Version Description
Download this release
Release Info
| Developer | digitalchild |
| Plugin |  WC Vendors |
| Version | 2.0.5 |
| Comparing to | |
| See all releases | |
Code changes from version 2.0.3 to 2.0.5
- changelog.txt +28 -0
- class-wc-vendors.php +3 -3
- classes/admin/class-admin-users.php +11 -11
- classes/admin/class-setup-wizard.php +5 -5
- classes/admin/class-vendor-admin-dashboard.php +43 -9
- classes/admin/class-wcv-admin-setup.php +6 -6
- classes/admin/emails/class-emails.php +50 -19
- classes/admin/emails/class-wc-notify-vendor.php +5 -5
- classes/admin/emails/class-wcv-admin-notify-application.php +1 -0
- classes/admin/emails/class-wcv-admin-notify-product.php +1 -1
- classes/admin/emails/class-wcv-vendor-notify-order.php +18 -4
- classes/admin/settings/class-wcv-settings-capabilities.php +1 -1
- classes/admin/settings/class-wcv-settings-payments.php +1 -1
- classes/admin/views/notices/html-notice-updating.php +1 -1
- classes/class-commission.php +1 -1
- classes/class-install.php +7 -6
- classes/class-shipping.php +1 -1
- classes/class-vendors.php +1 -1
- classes/front/class-vendor-shop.php +9 -29
- classes/front/dashboard/class-vendor-dashboard.php +7 -8
- classes/front/orders/class-orders.php +28 -3
- classes/front/signup/class-vendor-signup.php +4 -3
- classes/gateways/PayPal_AdvPayments/paypal_ap.php +4 -4
- classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php +2 -7
- classes/includes/class-functions.php +1 -7
- classes/includes/wcv-template-functions.php +5 -5
- classes/includes/wcv-update-functions.php +5 -8
- languages/wc-vendors.pot +73 -61
- package-lock.json +5 -5
- readme.txt +29 -1
- templates/dashboard/date-picker.php +1 -1
- templates/dashboard/denied.php +1 -1
- templates/dashboard/links.php +1 -1
- templates/dashboard/orders.php +9 -6
- templates/dashboard/reports.php +1 -1
- templates/emails/plain/vendor-notify-order.php +2 -2
- templates/emails/plain/vendor-order-addresses.php +50 -0
- templates/emails/vendor-new-order.php +13 -27
- templates/emails/vendor-notify-order.php +3 -3
- templates/emails/vendor-order-addresses.php +56 -0
- templates/orders/orders.php +1 -1
- templates/orders/table-body.php +1 -1
- trunk/assets/banner-1544x500.png +0 -0
- trunk/assets/banner-772x250.png +0 -0
- trunk/assets/css/_variables.scss +0 -23
- trunk/assets/css/admin-orders.css +0 -7
- trunk/assets/css/select2.min.css +0 -1
- trunk/assets/css/wcv-activation.css +0 -21
- trunk/assets/css/wcv-activation.min.css +0 -1
- trunk/assets/css/wcv-activation.scss +0 -68
- trunk/assets/css/wcv-admin.css +0 -162
- trunk/assets/css/wcv-admin.min.css +0 -1
- trunk/assets/css/wcv-admin.scss +0 -474
- trunk/assets/css/wcv-frontend.css +0 -547
- trunk/assets/css/wcv-setup.css +0 -185
- trunk/assets/css/wcv-setup.min.css +0 -1
- trunk/assets/css/wcv-setup.scss +0 -540
- trunk/assets/icon-128x128.png +0 -0
- trunk/assets/icon-256x256.png +0 -0
- trunk/assets/icon.svg +0 -115
- trunk/assets/images/extensions/screenshot-1.png +0 -0
- trunk/assets/images/extensions/screenshot-2.png +0 -0
- trunk/assets/images/extensions/screenshot-3.png +0 -0
- trunk/assets/images/icons/truck.png +0 -0
- trunk/assets/images/wcvendors_logo.png +0 -0
- trunk/assets/js/admin/settings.js +0 -40
- trunk/assets/js/admin/wcv-setup.js +0 -0
- trunk/assets/js/front-orders.js +0 -8
- trunk/assets/js/select2.min.js +0 -3
- trunk/assets/js/wcv-admin-login.js +0 -9
- trunk/assets/js/wcv-admin-quick-edit.js +0 -34
- trunk/assets/js/wcv-commissions.js +0 -11
- trunk/assets/screenshot-1.png +0 -0
- trunk/assets/screenshot-2.png +0 -0
- trunk/assets/screenshot-3.png +0 -0
- trunk/assets/screenshot-4.png +0 -0
- trunk/assets/screenshot-5.png +0 -0
- trunk/assets/screenshot-6.png +0 -0
- trunk/assets/screenshot-7.png +0 -0
- trunk/changelog.txt +0 -700
- trunk/class-wc-vendors.php +0 -425
- trunk/classes/admin/class-admin-menus.php +0 -185
- trunk/classes/admin/class-admin-page.php +0 -882
- trunk/classes/admin/class-admin-reports.php +0 -544
- trunk/classes/admin/class-admin-users.php +0 -425
- trunk/classes/admin/class-product-meta.php +0 -268
- trunk/classes/admin/class-setup-wizard.php +0 -348
- trunk/classes/admin/class-vendor-admin-dashboard.php +0 -724
- trunk/classes/admin/class-vendor-applicants.php +0 -104
- trunk/classes/admin/class-vendor-reports.php +0 -121
- trunk/classes/admin/class-wcv-admin-extensions.php +0 -25
- trunk/classes/admin/class-wcv-admin-help.php +0 -120
- trunk/classes/admin/class-wcv-admin-notices.php +0 -249
- trunk/classes/admin/class-wcv-admin-settings.php +0 -668
- trunk/classes/admin/class-wcv-admin-setup.php +0 -304
- trunk/classes/admin/class-wcv-commissions-csv-exporter.php +0 -175
- trunk/classes/admin/class-wcv-commissions-page.php +0 -554
- trunk/classes/admin/class-wcv-commissions-sum-csv-exporter.php +0 -85
- trunk/classes/admin/emails/class-emails.php +0 -244
- trunk/classes/admin/emails/class-wc-approve-vendor.php +0 -165
- trunk/classes/admin/emails/class-wc-notify-admin.php +0 -176
- trunk/classes/admin/emails/class-wc-notify-shipped.php +0 -201
- trunk/classes/admin/emails/class-wc-notify-vendor.php +0 -355
- trunk/classes/admin/emails/class-wcv-admin-notify-application.php +0 -185
- trunk/classes/admin/emails/class-wcv-admin-notify-product.php +0 -192
- trunk/classes/admin/emails/class-wcv-admin-notify-shipped.php +0 -181
- trunk/classes/admin/emails/class-wcv-customer-notify-shipped.php +0 -235
- trunk/classes/admin/emails/class-wcv-vendor-notify-application.php +0 -167
- trunk/classes/admin/emails/class-wcv-vendor-notify-approved.php +0 -185
- trunk/classes/admin/emails/class-wcv-vendor-notify-denied.php +0 -203
- trunk/classes/admin/emails/class-wcv-vendor-notify-order.php +0 -213
- trunk/classes/admin/settings/README.md +0 -126
- trunk/classes/admin/settings/assets/css/sf-styles.css +0 -167
- trunk/classes/admin/settings/assets/img/tip.png +0 -0
- trunk/classes/admin/settings/assets/js/bootstrap-tooltip.js +0 -126
- trunk/classes/admin/settings/assets/js/js.iml +0 -10
- trunk/classes/admin/settings/assets/js/select2/select2-bootstrap.css +0 -87
- trunk/classes/admin/settings/assets/js/select2/select2-spinner.gif +0 -0
- trunk/classes/admin/settings/assets/js/select2/select2.css +0 -704
- trunk/classes/admin/settings/assets/js/select2/select2.js +0 -3541
- trunk/classes/admin/settings/assets/js/select2/select2.min.js +0 -23
- trunk/classes/admin/settings/assets/js/select2/select2.png +0 -0
- trunk/classes/admin/settings/assets/js/select2/select2x2.png +0 -0
- trunk/classes/admin/settings/assets/js/sf-jquery.js +0 -23
- trunk/classes/admin/settings/assets/js/wcvendors-media.js +0 -52
- trunk/classes/admin/settings/class-wcv-settings-capabilities.php +0 -316
- trunk/classes/admin/settings/class-wcv-settings-commission.php +0 -88
- trunk/classes/admin/settings/class-wcv-settings-display.php +0 -271
- trunk/classes/admin/settings/class-wcv-settings-general.php +0 -109
- trunk/classes/admin/settings/class-wcv-settings-page.php +0 -144
- trunk/classes/admin/settings/class-wcv-settings-payments.php +0 -143
- trunk/classes/admin/settings/classes/sf-class-format-options.php +0 -347
- trunk/classes/admin/settings/classes/sf-class-sanitize.php +0 -199
- trunk/classes/admin/settings/classes/sf-class-settings.php +0 -978
- trunk/classes/admin/settings/sf-options.php +0 -363
- trunk/classes/admin/views/html-admin-commission-page.php +0 -39
- trunk/classes/admin/views/html-admin-page-extensions.php +0 -92
- trunk/classes/admin/views/html-admin-settings.php +0 -46
- trunk/classes/admin/views/html-vendor-meta.php +0 -153
- trunk/classes/admin/views/html-vendor-settings-page.php +0 -114
- trunk/classes/admin/views/notices/html-notice-custom.php +0 -14
- trunk/classes/admin/views/notices/html-notice-install.php +0 -14
- trunk/classes/admin/views/notices/html-notice-template-check.php +0 -17
- trunk/classes/admin/views/notices/html-notice-theme-support.php +0 -0
- trunk/classes/admin/views/notices/html-notice-update.php +0 -19
- trunk/classes/admin/views/notices/html-notice-updated.php +0 -14
- trunk/classes/admin/views/notices/html-notice-updating.php +0 -13
- trunk/classes/admin/views/setup/capabilities.php +0 -134
- trunk/classes/admin/views/setup/footer.php +0 -20
- trunk/classes/admin/views/setup/general.php +0 -99
- trunk/classes/admin/views/setup/header.php +0 -22
- trunk/classes/admin/views/setup/pages.php +0 -87
- trunk/classes/admin/views/setup/ready.php +0 -78
- trunk/classes/admin/views/setup/steps.php +0 -24
- trunk/classes/class-commission.php +0 -620
- trunk/classes/class-cron.php +0 -171
- trunk/classes/class-install.php +0 -451
- trunk/classes/class-queries.php +0 -284
- trunk/classes/class-shipping.php +0 -334
- trunk/classes/class-vendor-order.php +0 -9
changelog.txt
CHANGED
|
@@ -1,5 +1,33 @@
|
|
| 1 |
Changelog for WC Vendors
|
| 2 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3 |
Version 2.0.3
|
| 4 |
|
| 5 |
* Added: Export Commission Sum Totals
|
| 1 |
Changelog for WC Vendors
|
| 2 |
|
| 3 |
+
Version 2.0.5
|
| 4 |
+
|
| 5 |
+
* Updated: Legacy WooCommerce calls
|
| 6 |
+
* Updated: Changed how options are retrieved from the database
|
| 7 |
+
* Fixed: Customer details not filtered on WP Admin orders screen #413
|
| 8 |
+
* Fixed: Customer details not filtered on emails #411
|
| 9 |
+
* Fixed: Totals display in vendor order notification emails
|
| 10 |
+
* Fixed: Duplicate new product admin notification emails
|
| 11 |
+
* Fixed: New product admin notification email trigger not working
|
| 12 |
+
* Fixed: Username placeholder in vendor application email
|
| 13 |
+
* Fixed: Vendor Sold By name is not appearing on customer order #412
|
| 14 |
+
* Fixed: Update dialog is stuck #409
|
| 15 |
+
* Fixed: Order capabilities not working #410
|
| 16 |
+
* Fixed: Incorrect label in emails
|
| 17 |
+
|
| 18 |
+
Templates Added:
|
| 19 |
+
templates/emails/plain/vendor-order-addresses.php
|
| 20 |
+
templates/emails/vendor-order-addresses.php
|
| 21 |
+
|
| 22 |
+
Templates Updated:
|
| 23 |
+
templates/dashboard/dashboard/orders.php
|
| 24 |
+
templates/emails/plain/vendor-order-details.php
|
| 25 |
+
templates/emails/vendor-order-details.php
|
| 26 |
+
|
| 27 |
+
Version 2.0.4
|
| 28 |
+
|
| 29 |
+
* Fixed: Critical commission calculation error
|
| 30 |
+
|
| 31 |
Version 2.0.3
|
| 32 |
|
| 33 |
* Added: Export Commission Sum Totals
|
class-wc-vendors.php
CHANGED
|
@@ -7,7 +7,7 @@
|
|
| 7 |
* Author URI: https://www.wcvendors.com
|
| 8 |
* GitHub Plugin URI: https://github.com/wcvendors/wcvendors
|
| 9 |
*
|
| 10 |
-
* Version: 2.0.
|
| 11 |
* Requires at least: 4.4.0
|
| 12 |
* Tested up to: 4.9.5
|
| 13 |
* WC requires at least: 3.0.0
|
|
@@ -80,7 +80,7 @@ if ( wcv_is_woocommerce_activated() ) {
|
|
| 80 |
class WC_Vendors
|
| 81 |
{
|
| 82 |
|
| 83 |
-
public $version = '2.0.
|
| 84 |
|
| 85 |
/**
|
| 86 |
* @var
|
|
@@ -324,7 +324,7 @@ if ( wcv_is_woocommerce_activated() ) {
|
|
| 324 |
*
|
| 325 |
*/
|
| 326 |
public function maybe_flush_permalinks() {
|
| 327 |
-
if (
|
| 328 |
$this->flush_rewrite_rules();
|
| 329 |
update_option( 'wcvendors_queue_flush_rewrite_rules', 'no' );
|
| 330 |
}
|
| 7 |
* Author URI: https://www.wcvendors.com
|
| 8 |
* GitHub Plugin URI: https://github.com/wcvendors/wcvendors
|
| 9 |
*
|
| 10 |
+
* Version: 2.0.5
|
| 11 |
* Requires at least: 4.4.0
|
| 12 |
* Tested up to: 4.9.5
|
| 13 |
* WC requires at least: 3.0.0
|
| 80 |
class WC_Vendors
|
| 81 |
{
|
| 82 |
|
| 83 |
+
public $version = '2.0.5';
|
| 84 |
|
| 85 |
/**
|
| 86 |
* @var
|
| 324 |
*
|
| 325 |
*/
|
| 326 |
public function maybe_flush_permalinks() {
|
| 327 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_queue_flush_rewrite_rules', 'no' ) ) ) {
|
| 328 |
$this->flush_rewrite_rules();
|
| 329 |
update_option( 'wcvendors_queue_flush_rewrite_rules', 'no' );
|
| 330 |
}
|
classes/admin/class-admin-users.php
CHANGED
|
@@ -67,7 +67,7 @@ class WCV_Admin_Users
|
|
| 67 |
return;
|
| 68 |
}
|
| 69 |
|
| 70 |
-
$can_submit =
|
| 71 |
|
| 72 |
if ( ! $can_submit ) {
|
| 73 |
wp_die( sprintf( __( 'You are not allowed to submit products. <a href="%s">Go Back</a>', 'wc-vendors' ), admin_url( 'edit.php?post_type=product' ) ) );
|
|
@@ -90,7 +90,7 @@ class WCV_Admin_Users
|
|
| 90 |
* Enable/disable duplicate product
|
| 91 |
*/
|
| 92 |
public function add_duplicate_capability( $capability ){
|
| 93 |
-
if (
|
| 94 |
return 'manage_product';
|
| 95 |
}
|
| 96 |
return $capability;
|
|
@@ -143,13 +143,13 @@ class WCV_Admin_Users
|
|
| 143 |
*/
|
| 144 |
function filter_product_types( $types ) {
|
| 145 |
|
| 146 |
-
$product_types = get_option( 'wcvendors_capability_product_types' );
|
| 147 |
$product_misc = array(
|
| 148 |
-
'taxes' =>
|
| 149 |
-
'sku' =>
|
| 150 |
-
'duplicate' =>
|
| 151 |
-
'delete' =>
|
| 152 |
-
'featured' =>
|
| 153 |
);
|
| 154 |
|
| 155 |
// Add any custom css
|
|
@@ -185,7 +185,7 @@ class WCV_Admin_Users
|
|
| 185 |
*/
|
| 186 |
function filter_product_data_tabs( $tabs ){
|
| 187 |
|
| 188 |
-
$product_panel = get_option( 'wcvendors_capability_product_data_tabs' );
|
| 189 |
|
| 190 |
if ( !$product_panel ) return $tabs;
|
| 191 |
|
|
@@ -209,7 +209,7 @@ class WCV_Admin_Users
|
|
| 209 |
*/
|
| 210 |
function filter_product_type_options( $types )
|
| 211 |
{
|
| 212 |
-
$product_options = get_option( 'wcvendors_capability_product_type_options' );
|
| 213 |
|
| 214 |
if ( !$product_options ) return $types;
|
| 215 |
|
|
@@ -414,7 +414,7 @@ class WCV_Admin_Users
|
|
| 414 |
}
|
| 415 |
|
| 416 |
// SKU
|
| 417 |
-
if (
|
| 418 |
unset($columns['sku']);
|
| 419 |
}
|
| 420 |
|
| 67 |
return;
|
| 68 |
}
|
| 69 |
|
| 70 |
+
$can_submit = wc_string_to_bool( get_option( 'wcvendors_capability_products_enabled', 'no' ) );
|
| 71 |
|
| 72 |
if ( ! $can_submit ) {
|
| 73 |
wp_die( sprintf( __( 'You are not allowed to submit products. <a href="%s">Go Back</a>', 'wc-vendors' ), admin_url( 'edit.php?post_type=product' ) ) );
|
| 90 |
* Enable/disable duplicate product
|
| 91 |
*/
|
| 92 |
public function add_duplicate_capability( $capability ){
|
| 93 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_capability_product_duplicate', 'no' ) ) ) {
|
| 94 |
return 'manage_product';
|
| 95 |
}
|
| 96 |
return $capability;
|
| 143 |
*/
|
| 144 |
function filter_product_types( $types ) {
|
| 145 |
|
| 146 |
+
$product_types = get_option( 'wcvendors_capability_product_types', array() );
|
| 147 |
$product_misc = array(
|
| 148 |
+
'taxes' => wc_string_to_bool( get_option( 'wcvendors_capability_product_taxes', 'no' ) ) ,
|
| 149 |
+
'sku' => wc_string_to_bool( get_option( 'wcvendors_capability_product_sku', 'no' ) ) ,
|
| 150 |
+
'duplicate' => wc_string_to_bool( get_option( 'wcvendors_capability_product_duplicate', 'no' ) ) ,
|
| 151 |
+
'delete' => wc_string_to_bool( get_option( 'wcvendors_capability_product_delete', 'no' ) ) ,
|
| 152 |
+
'featured' => wc_string_to_bool( get_option( 'wcvendors_capability_product_featured', 'no' ) ) ,
|
| 153 |
);
|
| 154 |
|
| 155 |
// Add any custom css
|
| 185 |
*/
|
| 186 |
function filter_product_data_tabs( $tabs ){
|
| 187 |
|
| 188 |
+
$product_panel = get_option( 'wcvendors_capability_product_data_tabs', array() );
|
| 189 |
|
| 190 |
if ( !$product_panel ) return $tabs;
|
| 191 |
|
| 209 |
*/
|
| 210 |
function filter_product_type_options( $types )
|
| 211 |
{
|
| 212 |
+
$product_options = get_option( 'wcvendors_capability_product_type_options', array() );
|
| 213 |
|
| 214 |
if ( !$product_options ) return $types;
|
| 215 |
|
| 414 |
}
|
| 415 |
|
| 416 |
// SKU
|
| 417 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_capability_product_sku', 'no' ) ) ){
|
| 418 |
unset($columns['sku']);
|
| 419 |
}
|
| 420 |
|
classes/admin/class-setup-wizard.php
CHANGED
|
@@ -206,11 +206,11 @@ class WCVendors_Admin_Setup_Wizard {
|
|
| 206 |
*/
|
| 207 |
public function wcv_setup_general() {
|
| 208 |
|
| 209 |
-
$allow_registration = get_option( 'wcvendors_vendor_allow_registration', 'yes' );
|
| 210 |
-
$manual_approval = get_option( 'wcvendors_vendor_approve_registration', 'yes' );
|
| 211 |
-
$vendor_taxes = get_option( 'wcvendors_vendor_give_taxes', 'yes' );
|
| 212 |
-
$vendor_shipping = get_option( 'wcvendors_vendor_give_shipping', 'yes' );
|
| 213 |
-
$commission_rate = get_option( 'wcvendors_vendor_commission_rate' );
|
| 214 |
|
| 215 |
include( WCV_ABSPATH_ADMIN . 'views/setup/general.php' );
|
| 216 |
}
|
| 206 |
*/
|
| 207 |
public function wcv_setup_general() {
|
| 208 |
|
| 209 |
+
$allow_registration = wc_string_to_bool( get_option( 'wcvendors_vendor_allow_registration', 'yes' ) );
|
| 210 |
+
$manual_approval = wc_string_to_bool( get_option( 'wcvendors_vendor_approve_registration', 'yes' ) );
|
| 211 |
+
$vendor_taxes = wc_string_to_bool( get_option( 'wcvendors_vendor_give_taxes', 'yes' ) );
|
| 212 |
+
$vendor_shipping = wc_string_to_bool( get_option( 'wcvendors_vendor_give_shipping', 'yes' ) );
|
| 213 |
+
$commission_rate = wc_string_to_bool( get_option( 'wcvendors_vendor_commission_rate', '' ) );
|
| 214 |
|
| 215 |
include( WCV_ABSPATH_ADMIN . 'views/setup/general.php' );
|
| 216 |
}
|
classes/admin/class-vendor-admin-dashboard.php
CHANGED
|
@@ -32,7 +32,7 @@ Class WCV_Vendor_Admin_Dashboard {
|
|
| 32 |
$seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
|
| 33 |
$has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
|
| 34 |
$shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
|
| 35 |
-
$global_html =
|
| 36 |
include('views/html-vendor-settings-page.php');
|
| 37 |
}
|
| 38 |
|
|
@@ -274,8 +274,8 @@ class WCV_Vendor_Order_Page extends WP_List_Table
|
|
| 274 |
'ajax' => false
|
| 275 |
) );
|
| 276 |
|
| 277 |
-
$this->can_view_comments =
|
| 278 |
-
$this->can_add_comments =
|
| 279 |
}
|
| 280 |
|
| 281 |
|
|
@@ -503,7 +503,7 @@ class WCV_Vendor_Order_Page extends WP_List_Table
|
|
| 503 |
foreach ( $_orders as $order ) {
|
| 504 |
|
| 505 |
$order = wc_get_order( $order->order_id );
|
| 506 |
-
$order_id =
|
| 507 |
$valid_items = WCV_Queries::get_products_for_order( $order_id );
|
| 508 |
$valid = array();
|
| 509 |
|
|
@@ -568,7 +568,7 @@ class WCV_Vendor_Order_Page extends WP_List_Table
|
|
| 568 |
|
| 569 |
}
|
| 570 |
|
| 571 |
-
$order_id =
|
| 572 |
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 573 |
$shipped = in_array($user_id, $shippers) ? __( 'Yes', 'wc-vendors' ) : __( 'No', 'wc-vendors' ) ;
|
| 574 |
|
|
@@ -579,14 +579,48 @@ class WCV_Vendor_Order_Page extends WP_List_Table
|
|
| 579 |
|
| 580 |
$comment_output = '';
|
| 581 |
|
| 582 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 583 |
|
| 584 |
-
// Make sure the correct address is shown based on the WooCommerce options
|
| 585 |
-
$customer = $order->get_formatted_billing_address();
|
| 586 |
if ( ( get_option( 'woocommerce_ship_to_billing_address_only' ) === 'no' ) && ( $order->get_formatted_shipping_address() ) ) {
|
| 587 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 588 |
}
|
| 589 |
|
|
|
|
|
|
|
| 590 |
$order_items = array();
|
| 591 |
$order_items[ 'order_id' ] = $order_id;
|
| 592 |
$order_items[ 'customer' ] = $customer;
|
| 32 |
$seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
|
| 33 |
$has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
|
| 34 |
$shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
|
| 35 |
+
$global_html = wc_string_to_bool( get_option( 'wcvendors_display_shop_description_html', 'no' ) );
|
| 36 |
include('views/html-vendor-settings-page.php');
|
| 37 |
}
|
| 38 |
|
| 274 |
'ajax' => false
|
| 275 |
) );
|
| 276 |
|
| 277 |
+
$this->can_view_comments = wc_string_to_bool( get_option( 'wcvendors_capability_order_read_notes', 'no' ) );
|
| 278 |
+
$this->can_add_comments = wc_string_to_bool( get_option( 'wcvendors_capability_order_update_notes', 'no' ) );
|
| 279 |
}
|
| 280 |
|
| 281 |
|
| 503 |
foreach ( $_orders as $order ) {
|
| 504 |
|
| 505 |
$order = wc_get_order( $order->order_id );
|
| 506 |
+
$order_id = $order->get_id();
|
| 507 |
$valid_items = WCV_Queries::get_products_for_order( $order_id );
|
| 508 |
$valid = array();
|
| 509 |
|
| 568 |
|
| 569 |
}
|
| 570 |
|
| 571 |
+
$order_id = $order->get_id();
|
| 572 |
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 573 |
$shipped = in_array($user_id, $shippers) ? __( 'Yes', 'wc-vendors' ) : __( 'No', 'wc-vendors' ) ;
|
| 574 |
|
| 579 |
|
| 580 |
$comment_output = '';
|
| 581 |
|
| 582 |
+
$show_name = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_name', 'no' ) );
|
| 583 |
+
$show_billing_address = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_billing', 'no' ) );
|
| 584 |
+
$show_shipping_address = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_shipping', 'no' ) );
|
| 585 |
+
$order_date = $order->get_date_created();
|
| 586 |
+
|
| 587 |
+
$address = $order->get_address( 'billing' );
|
| 588 |
+
if ( ! $show_name ) {
|
| 589 |
+
unset( $address['first_name'] );
|
| 590 |
+
unset( $address['last_name'] );
|
| 591 |
+
}
|
| 592 |
+
|
| 593 |
+
if ( ! $show_billing_address ) {
|
| 594 |
+
unset( $address[ 'company' ] );
|
| 595 |
+
unset( $address[ 'address_1' ] );
|
| 596 |
+
unset( $address[ 'address_2' ] );
|
| 597 |
+
unset( $address[ 'city' ] );
|
| 598 |
+
unset( $address[ 'state' ] );
|
| 599 |
+
unset( $address[ 'postcode' ] );
|
| 600 |
+
unset( $address[ 'country' ] );
|
| 601 |
+
}
|
| 602 |
|
|
|
|
|
|
|
| 603 |
if ( ( get_option( 'woocommerce_ship_to_billing_address_only' ) === 'no' ) && ( $order->get_formatted_shipping_address() ) ) {
|
| 604 |
+
|
| 605 |
+
$address = $order->get_address( 'shipping' );
|
| 606 |
+
if ( ! $show_name ) {
|
| 607 |
+
unset( $address['first_name'] );
|
| 608 |
+
unset( $address['last_name'] );
|
| 609 |
+
}
|
| 610 |
+
|
| 611 |
+
if ( ! $show_shipping_address ) {
|
| 612 |
+
unset( $address[ 'company' ] );
|
| 613 |
+
unset( $address[ 'address_1' ] );
|
| 614 |
+
unset( $address[ 'address_2' ] );
|
| 615 |
+
unset( $address[ 'city' ] );
|
| 616 |
+
unset( $address[ 'state' ] );
|
| 617 |
+
unset( $address[ 'postcode' ] );
|
| 618 |
+
unset( $address[ 'country' ] );
|
| 619 |
+
}
|
| 620 |
}
|
| 621 |
|
| 622 |
+
$customer = WC()->countries->get_formatted_address( $address );
|
| 623 |
+
|
| 624 |
$order_items = array();
|
| 625 |
$order_items[ 'order_id' ] = $order_id;
|
| 626 |
$order_items[ 'customer' ] = $customer;
|
classes/admin/class-wcv-admin-setup.php
CHANGED
|
@@ -116,9 +116,9 @@ class WCV_Admin_Setup {
|
|
| 116 |
*/
|
| 117 |
public static function reset_vendor_roles(){
|
| 118 |
|
| 119 |
-
$can_add =
|
| 120 |
-
$can_edit =
|
| 121 |
-
$can_submit_live =
|
| 122 |
|
| 123 |
$args = array(
|
| 124 |
'assign_product_terms' => $can_add,
|
|
@@ -275,9 +275,9 @@ class WCV_Admin_Setup {
|
|
| 275 |
*/
|
| 276 |
public function update_vendor_role( ){
|
| 277 |
|
| 278 |
-
$can_add =
|
| 279 |
-
$can_edit =
|
| 280 |
-
$can_submit_live =
|
| 281 |
|
| 282 |
$args = array(
|
| 283 |
'assign_product_terms' => $can_add,
|
| 116 |
*/
|
| 117 |
public static function reset_vendor_roles(){
|
| 118 |
|
| 119 |
+
$can_add = wc_string_to_bool( get_option( 'wcvendors_capability_products_enabled', 'no' ) );
|
| 120 |
+
$can_edit = wc_string_to_bool( get_option( 'wcvendors_capability_products_edit', 'no' ) );
|
| 121 |
+
$can_submit_live = wc_string_to_bool( get_option( 'wcvendors_capability_products_live', 'no' ) );
|
| 122 |
|
| 123 |
$args = array(
|
| 124 |
'assign_product_terms' => $can_add,
|
| 275 |
*/
|
| 276 |
public function update_vendor_role( ){
|
| 277 |
|
| 278 |
+
$can_add = wc_string_to_bool( get_option( 'wcvendors_capability_products_enabled', 'no' ) );
|
| 279 |
+
$can_edit = wc_string_to_bool( get_option( 'wcvendors_capability_products_edit', 'no' ) );
|
| 280 |
+
$can_submit_live = wc_string_to_bool( get_option( 'wcvendors_capability_products_live', 'no' ) );
|
| 281 |
|
| 282 |
$args = array(
|
| 283 |
'assign_product_terms' => $can_add,
|
classes/admin/emails/class-emails.php
CHANGED
|
@@ -21,7 +21,7 @@ class WCV_Emails
|
|
| 21 |
|
| 22 |
add_filter( 'woocommerce_email_classes', array( $this, 'email_classes' ) );
|
| 23 |
add_filter( 'woocommerce_order_actions', array( $this, 'order_actions' ) );
|
| 24 |
-
add_action( '
|
| 25 |
// Deprecaited
|
| 26 |
|
| 27 |
add_action( 'set_user_role', array( $this, 'application_status_email' ), 10, 2 );
|
|
@@ -35,10 +35,10 @@ class WCV_Emails
|
|
| 35 |
|
| 36 |
// New emails
|
| 37 |
// Triggers
|
| 38 |
-
add_action( 'wcvendors_vendor_ship',
|
| 39 |
-
add_action( 'wcvendors_email_order_details',array( $this, 'vendor_order_details'), 10, 8 );
|
| 40 |
-
add_action( '
|
| 41 |
-
add_action( 'set_user_role',
|
| 42 |
|
| 43 |
}
|
| 44 |
|
|
@@ -144,7 +144,7 @@ class WCV_Emails
|
|
| 144 |
*
|
| 145 |
*/
|
| 146 |
public function order_actions( $order_actions ){
|
| 147 |
-
$order_actions[ '
|
| 148 |
return $order_actions;
|
| 149 |
}
|
| 150 |
|
|
@@ -171,19 +171,6 @@ class WCV_Emails
|
|
| 171 |
}
|
| 172 |
|
| 173 |
|
| 174 |
-
/**
|
| 175 |
-
* Trigger the notify admin new vendor product
|
| 176 |
-
*
|
| 177 |
-
* @since 2.0.0
|
| 178 |
-
*/
|
| 179 |
-
public function new_vendor_product( $from, $to, $post ){
|
| 180 |
-
|
| 181 |
-
if ( $from != $to && $post->post_status == 'pending' && WCV_Vendors::is_vendor( $post->post_author ) && $post->post_type == 'product' ) {
|
| 182 |
-
|
| 183 |
-
WC()->mailer()->emails[ 'WCVendors_Admin_Notify_Product' ]->trigger( $post->post_id, $post );
|
| 184 |
-
}
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
/**
|
| 188 |
* Trigger the vendor application emails
|
| 189 |
*
|
|
@@ -241,4 +228,48 @@ class WCV_Emails
|
|
| 241 |
'woocommerce', WCV_TEMPLATE_BASE );
|
| 242 |
}
|
| 243 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 244 |
}
|
| 21 |
|
| 22 |
add_filter( 'woocommerce_email_classes', array( $this, 'email_classes' ) );
|
| 23 |
add_filter( 'woocommerce_order_actions', array( $this, 'order_actions' ) );
|
| 24 |
+
add_action( 'woocommerce_order_action_send_vendor_new_order', array( $this, 'order_actions_save') );
|
| 25 |
// Deprecaited
|
| 26 |
|
| 27 |
add_action( 'set_user_role', array( $this, 'application_status_email' ), 10, 2 );
|
| 35 |
|
| 36 |
// New emails
|
| 37 |
// Triggers
|
| 38 |
+
add_action( 'wcvendors_vendor_ship', array( $this, 'vendor_shipped' ), 10, 3 );
|
| 39 |
+
add_action( 'wcvendors_email_order_details', array( $this, 'vendor_order_details'), 10, 8 );
|
| 40 |
+
add_action( 'wcvendors_email_customer_details', array( $this, 'vendor_customer_details'), 10, 4 );
|
| 41 |
+
add_action( 'set_user_role', array( $this, 'vendor_application' ), 10, 2 );
|
| 42 |
|
| 43 |
}
|
| 44 |
|
| 144 |
*
|
| 145 |
*/
|
| 146 |
public function order_actions( $order_actions ){
|
| 147 |
+
$order_actions[ 'send_vendor_new_order' ] = sprintf( __( 'Resend %s new order notification', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 148 |
return $order_actions;
|
| 149 |
}
|
| 150 |
|
| 171 |
}
|
| 172 |
|
| 173 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 174 |
/**
|
| 175 |
* Trigger the vendor application emails
|
| 176 |
*
|
| 228 |
'woocommerce', WCV_TEMPLATE_BASE );
|
| 229 |
}
|
| 230 |
}
|
| 231 |
+
|
| 232 |
+
/**
|
| 233 |
+
* Show the customer address details based on the capabilities for the vendor
|
| 234 |
+
*/
|
| 235 |
+
public function vendor_customer_details( $order, $sent_to_admin, $plain_text, $email ){
|
| 236 |
+
|
| 237 |
+
$show_customer_name = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_name', 'no' ) );
|
| 238 |
+
$show_customer_email = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_email', 'no' ) );
|
| 239 |
+
$show_customer_phone = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_phone', 'no' ) );
|
| 240 |
+
$show_billing_address = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_shipping', 'no' ) );
|
| 241 |
+
$show_shipping_address = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_shipping', 'no' ) );
|
| 242 |
+
$customer_name = $show_customer_name ? $order->get_formatted_billing_full_name() : '';
|
| 243 |
+
|
| 244 |
+
if ( $plain_text ) {
|
| 245 |
+
wc_get_template(
|
| 246 |
+
'emails/plain/vendor-order-addresses.php', array(
|
| 247 |
+
'show_customer_email' => $show_customer_email,
|
| 248 |
+
'show_customer_phone' => $show_customer_phone,
|
| 249 |
+
'show_billing_address' => $show_billing_address,
|
| 250 |
+
'show_shipping_address' => $show_shipping_address,
|
| 251 |
+
'show_customer_name' => $show_customer_name,
|
| 252 |
+
'customer_name' => $customer_name,
|
| 253 |
+
'order' => $order,
|
| 254 |
+
'sent_to_admin' => $sent_to_admin,
|
| 255 |
+
),
|
| 256 |
+
'woocommerce', WCV_TEMPLATE_BASE );
|
| 257 |
+
} else {
|
| 258 |
+
wc_get_template(
|
| 259 |
+
'emails/vendor-order-addresses.php', array(
|
| 260 |
+
'show_customer_email' => $show_customer_email,
|
| 261 |
+
'show_customer_phone' => $show_customer_phone,
|
| 262 |
+
'show_billing_address' => $show_billing_address,
|
| 263 |
+
'show_shipping_address' => $show_shipping_address,
|
| 264 |
+
'show_customer_name' => $show_customer_name,
|
| 265 |
+
'customer_name' => $customer_name,
|
| 266 |
+
'order' => $order,
|
| 267 |
+
'sent_to_admin' => $sent_to_admin,
|
| 268 |
+
),
|
| 269 |
+
'woocommerce', WCV_TEMPLATE_BASE );
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
|
| 273 |
+
}
|
| 274 |
+
|
| 275 |
}
|
classes/admin/emails/class-wc-notify-vendor.php
CHANGED
|
@@ -62,7 +62,7 @@ class WC_Email_Notify_Vendor extends WC_Email
|
|
| 62 |
if ( $order_id ) {
|
| 63 |
$this->object = wc_get_order( $order_id );
|
| 64 |
|
| 65 |
-
$order_date =
|
| 66 |
|
| 67 |
$this->find[ ] = '{order_date}';
|
| 68 |
$this->replace[ ] = date_i18n( wc_date_format(), strtotime( $order_date ) );
|
|
@@ -108,7 +108,7 @@ class WC_Email_Notify_Vendor extends WC_Email
|
|
| 108 |
$return[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
|
| 109 |
$return[ 'cart_subtotal' ][ 'label' ] = $commission_label;
|
| 110 |
|
| 111 |
-
if (
|
| 112 |
$return[ 'tax_subtotal'] = array( 'label' => '', 'value' => '');
|
| 113 |
$return[ 'tax_subtotal']['label'] = apply_filters('wcv_notify_vendor_tax_label', __( 'Tax Subtotal:', 'wc-vendors' ) ) ;
|
| 114 |
}
|
|
@@ -127,7 +127,7 @@ class WC_Email_Notify_Vendor extends WC_Email
|
|
| 127 |
}
|
| 128 |
}
|
| 129 |
// Format tax price
|
| 130 |
-
if (
|
| 131 |
$return[ 'tax_subtotal']['value'] = wc_price( $return[ 'tax_subtotal'] ['value'] );
|
| 132 |
}
|
| 133 |
|
|
@@ -194,7 +194,7 @@ class WC_Email_Notify_Vendor extends WC_Email
|
|
| 194 |
// If display commission is ticked show this otherwise show the full price.
|
| 195 |
if ( 'yes' == $settings[ 'commission_display' ] ){
|
| 196 |
|
| 197 |
-
$order_id =
|
| 198 |
|
| 199 |
// Get correct product_id depending on which product type
|
| 200 |
$product_id = !empty( $product['variation_id'] ) ? $product['variation_id'] : $product['product_id'];
|
|
@@ -311,7 +311,7 @@ class WC_Email_Notify_Vendor extends WC_Email
|
|
| 311 |
*/
|
| 312 |
function check_order_formatted_line_subtotal( $subtotal, $item, $order ){
|
| 313 |
|
| 314 |
-
$order_currency =
|
| 315 |
|
| 316 |
$subtotal = wc_price( $order->get_line_subtotal( $item ), array( 'currency' => $order_currency ) );
|
| 317 |
|
| 62 |
if ( $order_id ) {
|
| 63 |
$this->object = wc_get_order( $order_id );
|
| 64 |
|
| 65 |
+
$order_date = $this->object->get_date_created();
|
| 66 |
|
| 67 |
$this->find[ ] = '{order_date}';
|
| 68 |
$this->replace[ ] = date_i18n( wc_date_format(), strtotime( $order_date ) );
|
| 108 |
$return[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
|
| 109 |
$return[ 'cart_subtotal' ][ 'label' ] = $commission_label;
|
| 110 |
|
| 111 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_vendor_give_taxes', 'no' ) ) ) {
|
| 112 |
$return[ 'tax_subtotal'] = array( 'label' => '', 'value' => '');
|
| 113 |
$return[ 'tax_subtotal']['label'] = apply_filters('wcv_notify_vendor_tax_label', __( 'Tax Subtotal:', 'wc-vendors' ) ) ;
|
| 114 |
}
|
| 127 |
}
|
| 128 |
}
|
| 129 |
// Format tax price
|
| 130 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_vendor_give_taxes', 'no' ) ) ){
|
| 131 |
$return[ 'tax_subtotal']['value'] = wc_price( $return[ 'tax_subtotal'] ['value'] );
|
| 132 |
}
|
| 133 |
|
| 194 |
// If display commission is ticked show this otherwise show the full price.
|
| 195 |
if ( 'yes' == $settings[ 'commission_display' ] ){
|
| 196 |
|
| 197 |
+
$order_id = $order->get_id();
|
| 198 |
|
| 199 |
// Get correct product_id depending on which product type
|
| 200 |
$product_id = !empty( $product['variation_id'] ) ? $product['variation_id'] : $product['product_id'];
|
| 311 |
*/
|
| 312 |
function check_order_formatted_line_subtotal( $subtotal, $item, $order ){
|
| 313 |
|
| 314 |
+
$order_currency = $order->get_currency();
|
| 315 |
|
| 316 |
$subtotal = wc_price( $order->get_line_subtotal( $item ), array( 'currency' => $order_currency ) );
|
| 317 |
|
classes/admin/emails/class-wcv-admin-notify-application.php
CHANGED
|
@@ -73,6 +73,7 @@ class WCVendors_Admin_Notify_Application extends WC_Email {
|
|
| 73 |
|
| 74 |
$this->user = get_userdata( $vendor_id );
|
| 75 |
$this->status = $status;
|
|
|
|
| 76 |
|
| 77 |
if ( $this->is_enabled() && $this->get_recipient() && $status === $this->get_option( 'notification' ) ) {
|
| 78 |
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 73 |
|
| 74 |
$this->user = get_userdata( $vendor_id );
|
| 75 |
$this->status = $status;
|
| 76 |
+
$this->placeholders['{user_name}'] = $this->user->user_name;
|
| 77 |
|
| 78 |
if ( $this->is_enabled() && $this->get_recipient() && $status === $this->get_option( 'notification' ) ) {
|
| 79 |
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
classes/admin/emails/class-wcv-admin-notify-product.php
CHANGED
|
@@ -84,7 +84,7 @@ class WCVendors_Admin_Notify_Product extends WC_Email {
|
|
| 84 |
$this->product = wc_get_product( $post_id );
|
| 85 |
$this->vendor_name = WCV_Vendors::get_vendor_shop_name( $post->post_author );
|
| 86 |
|
| 87 |
-
if (
|
| 88 |
$this->placeholders['{product_name}'] = $this->product->get_title();
|
| 89 |
$this->placeholders['{vendor_name}'] = $this->vendor_name;
|
| 90 |
|
| 84 |
$this->product = wc_get_product( $post_id );
|
| 85 |
$this->vendor_name = WCV_Vendors::get_vendor_shop_name( $post->post_author );
|
| 86 |
|
| 87 |
+
if ( is_object( $this->product ) ){
|
| 88 |
$this->placeholders['{product_name}'] = $this->product->get_title();
|
| 89 |
$this->placeholders['{vendor_name}'] = $this->vendor_name;
|
| 90 |
|
classes/admin/emails/class-wcv-vendor-notify-order.php
CHANGED
|
@@ -35,7 +35,7 @@ class WCVendors_Vendor_Notify_Order extends WC_Email {
|
|
| 35 |
'{order_number}' => '',
|
| 36 |
);
|
| 37 |
|
| 38 |
-
//
|
| 39 |
add_action( 'woocommerce_order_status_pending_to_processing_notification', array( $this, 'trigger' ), 10, 2 );
|
| 40 |
add_action( 'woocommerce_order_status_pending_to_completed_notification', array( $this, 'trigger' ), 10, 2 );
|
| 41 |
add_action( 'woocommerce_order_status_failed_to_processing_notification', array( $this, 'trigger' ), 10, 2 );
|
|
@@ -81,7 +81,7 @@ class WCVendors_Vendor_Notify_Order extends WC_Email {
|
|
| 81 |
$order = wc_get_order( $order_id );
|
| 82 |
}
|
| 83 |
|
| 84 |
-
$this->vendors
|
| 85 |
|
| 86 |
if ( is_a( $order, 'WC_Order' ) ) {
|
| 87 |
$this->object = $order;
|
|
@@ -97,8 +97,13 @@ class WCVendors_Vendor_Notify_Order extends WC_Email {
|
|
| 97 |
$this->order_items = $vendor_details[ 'line_items' ];
|
| 98 |
$this->vendor_id = $vendor_id;
|
| 99 |
$this->totals_display = $this->get_option( 'totals_display' );
|
| 100 |
-
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 101 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 102 |
}
|
| 103 |
}
|
| 104 |
|
|
@@ -183,7 +188,7 @@ class WCVendors_Vendor_Notify_Order extends WC_Email {
|
|
| 183 |
'class' => 'wc-enhanced-select',
|
| 184 |
'options' => array(
|
| 185 |
'both' => __( 'Both', 'wc-vendors'),
|
| 186 |
-
'
|
| 187 |
'product' => __( 'Product', 'wc-vendors' ),
|
| 188 |
'none' => __( 'None', 'wc-vendors' ),
|
| 189 |
),
|
|
@@ -206,6 +211,15 @@ class WCVendors_Vendor_Notify_Order extends WC_Email {
|
|
| 206 |
),
|
| 207 |
);
|
| 208 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 209 |
}
|
| 210 |
|
| 211 |
endif;
|
| 35 |
'{order_number}' => '',
|
| 36 |
);
|
| 37 |
|
| 38 |
+
// Triggers
|
| 39 |
add_action( 'woocommerce_order_status_pending_to_processing_notification', array( $this, 'trigger' ), 10, 2 );
|
| 40 |
add_action( 'woocommerce_order_status_pending_to_completed_notification', array( $this, 'trigger' ), 10, 2 );
|
| 41 |
add_action( 'woocommerce_order_status_failed_to_processing_notification', array( $this, 'trigger' ), 10, 2 );
|
| 81 |
$order = wc_get_order( $order_id );
|
| 82 |
}
|
| 83 |
|
| 84 |
+
$this->vendors = WCV_Vendors::get_vendors_from_order( $order );
|
| 85 |
|
| 86 |
if ( is_a( $order, 'WC_Order' ) ) {
|
| 87 |
$this->object = $order;
|
| 97 |
$this->order_items = $vendor_details[ 'line_items' ];
|
| 98 |
$this->vendor_id = $vendor_id;
|
| 99 |
$this->totals_display = $this->get_option( 'totals_display' );
|
|
|
|
| 100 |
|
| 101 |
+
// Remove the customer name from the addresses
|
| 102 |
+
add_filter( 'woocommerce_order_formatted_billing_address', array( $this, 'filter_customer_name' ) );
|
| 103 |
+
add_filter( 'woocommerce_order_formatted_shipping_address', array( $this, 'filter_customer_name' ) );
|
| 104 |
+
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 105 |
+
remove_filter( 'woocommerce_order_formatted_billing_address', array( $this, 'filter_customer_name' ) );
|
| 106 |
+
remove_filter( 'woocommerce_order_formatted_shipping_address', array( $this, 'filter_customer_name' ) );
|
| 107 |
}
|
| 108 |
}
|
| 109 |
|
| 188 |
'class' => 'wc-enhanced-select',
|
| 189 |
'options' => array(
|
| 190 |
'both' => __( 'Both', 'wc-vendors'),
|
| 191 |
+
'commission'=> __( 'Commission', 'wc-vendors' ),
|
| 192 |
'product' => __( 'Product', 'wc-vendors' ),
|
| 193 |
'none' => __( 'None', 'wc-vendors' ),
|
| 194 |
),
|
| 211 |
),
|
| 212 |
);
|
| 213 |
}
|
| 214 |
+
|
| 215 |
+
public function filter_customer_name( $address ){
|
| 216 |
+
|
| 217 |
+
unset( $address['first_name'] );
|
| 218 |
+
unset( $address['last_name'] );
|
| 219 |
+
|
| 220 |
+
return $address;
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
}
|
| 224 |
|
| 225 |
endif;
|
classes/admin/settings/class-wcv-settings-capabilities.php
CHANGED
|
@@ -187,7 +187,7 @@ class WCVendors_Settings_Capabilities extends WCVendors_Settings_Page {
|
|
| 187 |
array(
|
| 188 |
'title' => __( 'Customer Billing Address', 'wc-vendors' ),
|
| 189 |
'desc' => sprintf( __( 'Allow %s to view customer billing address fields', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 190 |
-
'id' => '
|
| 191 |
'default' => 'yes',
|
| 192 |
'type' => 'checkbox',
|
| 193 |
),
|
| 187 |
array(
|
| 188 |
'title' => __( 'Customer Billing Address', 'wc-vendors' ),
|
| 189 |
'desc' => sprintf( __( 'Allow %s to view customer billing address fields', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 190 |
+
'id' => 'wcvendors_capability_order_customer_billing',
|
| 191 |
'default' => 'yes',
|
| 192 |
'type' => 'checkbox',
|
| 193 |
),
|
classes/admin/settings/class-wcv-settings-payments.php
CHANGED
|
@@ -79,7 +79,7 @@ class WCVendors_Settings_Payments extends WCVendors_Settings_Page {
|
|
| 79 |
array(
|
| 80 |
'title' => __( 'Instant Pay', 'wc-vendors' ),
|
| 81 |
'desc' => __( 'Enable instantpay', 'wc-vendors' ),
|
| 82 |
-
'desc_tip' => sprintf( __( 'Instantly pay %
|
| 83 |
'id' => 'wcvendors_payments_paypal_instantpay_enable',
|
| 84 |
'default' => 'no',
|
| 85 |
'type' => 'checkbox',
|
| 79 |
array(
|
| 80 |
'title' => __( 'Instant Pay', 'wc-vendors' ),
|
| 81 |
'desc' => __( 'Enable instantpay', 'wc-vendors' ),
|
| 82 |
+
'desc_tip' => sprintf( __( 'Instantly pay %1$s their commission when an order is made, and if a %1$s has a valid PayPal email added on their Shop Settings page.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 83 |
'id' => 'wcvendors_payments_paypal_instantpay_enable',
|
| 84 |
'default' => 'no',
|
| 85 |
'type' => 'checkbox',
|
classes/admin/views/notices/html-notice-updating.php
CHANGED
|
@@ -9,5 +9,5 @@ if ( ! defined( 'ABSPATH' ) ) {
|
|
| 9 |
|
| 10 |
?>
|
| 11 |
<div id="message" class="updated wcvendors-message wc-connect">
|
| 12 |
-
<p><strong><?php _e( 'WC Vendors data update', 'wc-vendors' ); ?></strong> – <?php _e( 'Your database is being updated in the background.', 'wc-vendors' ); ?> <a href="<?php echo esc_url( add_query_arg( 'force_update_wcvendors', 'true', admin_url( 'admin.php?page=wcv-settings' ) ) ); ?>"><?php _e( 'Taking a while? Click here to run it now.', 'wc-vendors' ); ?></a></p>
|
| 13 |
</div>
|
| 9 |
|
| 10 |
?>
|
| 11 |
<div id="message" class="updated wcvendors-message wc-connect">
|
| 12 |
+
<p><strong><?php _e( 'WC Vendors data update', 'wc-vendors' ); ?></strong> – <?php _e( 'Your database is being updated in the background. ', 'wc-vendors' ); ?> <a href="<?php echo esc_url( add_query_arg( 'force_update_wcvendors', 'true', admin_url( 'admin.php?page=wcv-settings' ) ) ); ?>"><?php _e( 'Taking a while? Click here to run it now.', 'wc-vendors' ); ?></a></p>
|
| 13 |
</div>
|
classes/class-commission.php
CHANGED
|
@@ -300,7 +300,7 @@ class WCV_Commission
|
|
| 300 |
|
| 301 |
$product_commission = get_post_meta( $product_id, 'pv_commission_rate', true );
|
| 302 |
$vendor_commission = WCV_Vendors::get_default_commission( $vendor_id );
|
| 303 |
-
$default_commission = get_option( '
|
| 304 |
|
| 305 |
if ( $product_commission != '' && $product_commission !== false ) {
|
| 306 |
$commission = $product_commission;
|
| 300 |
|
| 301 |
$product_commission = get_post_meta( $product_id, 'pv_commission_rate', true );
|
| 302 |
$vendor_commission = WCV_Vendors::get_default_commission( $vendor_id );
|
| 303 |
+
$default_commission = get_option( 'wcvendors_vendor_commission_rate' );
|
| 304 |
|
| 305 |
if ( $product_commission != '' && $product_commission !== false ) {
|
| 306 |
$commission = $product_commission;
|
classes/class-install.php
CHANGED
|
@@ -13,12 +13,12 @@ class WCVendors_Install {
|
|
| 13 |
private static $db_updates = array(
|
| 14 |
'2.0.0' => array(
|
| 15 |
'wcv_migrate_settings',
|
|
|
|
| 16 |
'wcv_update_200_db_version',
|
| 17 |
-
'wcv_enable_legacy_emails'
|
| 18 |
),
|
| 19 |
-
'2.0.
|
| 20 |
-
'
|
| 21 |
-
|
| 22 |
);
|
| 23 |
|
| 24 |
|
|
@@ -103,7 +103,7 @@ class WCVendors_Install {
|
|
| 103 |
public static function install() {
|
| 104 |
|
| 105 |
// Check if we are not already running this routine.
|
| 106 |
-
if (
|
| 107 |
return;
|
| 108 |
}
|
| 109 |
|
|
@@ -378,6 +378,7 @@ class WCVendors_Install {
|
|
| 378 |
$update_queued = false;
|
| 379 |
|
| 380 |
foreach ( self::get_db_update_callbacks() as $version => $update_callbacks ) {
|
|
|
|
| 381 |
if ( version_compare( $current_db_version, $version, '<' ) ) {
|
| 382 |
foreach ( $update_callbacks as $update_callback ) {
|
| 383 |
$logger->info(
|
|
@@ -440,7 +441,7 @@ class WCVendors_Install {
|
|
| 440 |
* @since 2.0.0
|
| 441 |
*/
|
| 442 |
public static function maybe_flush_rewrite_rules() {
|
| 443 |
-
if (
|
| 444 |
update_option( 'wcvendors_queue_flush_rewrite_rules', 'no' );
|
| 445 |
flush_rewrite_rules();
|
| 446 |
}
|
| 13 |
private static $db_updates = array(
|
| 14 |
'2.0.0' => array(
|
| 15 |
'wcv_migrate_settings',
|
| 16 |
+
'wcv_enable_legacy_emails',
|
| 17 |
'wcv_update_200_db_version',
|
|
|
|
| 18 |
),
|
| 19 |
+
'2.0.5' => array(
|
| 20 |
+
'wcv_update_db_version',
|
| 21 |
+
),
|
| 22 |
);
|
| 23 |
|
| 24 |
|
| 103 |
public static function install() {
|
| 104 |
|
| 105 |
// Check if we are not already running this routine.
|
| 106 |
+
if ( wc_string_to_bool( get_transient( 'wcvendors_installing' ) ) ) {
|
| 107 |
return;
|
| 108 |
}
|
| 109 |
|
| 378 |
$update_queued = false;
|
| 379 |
|
| 380 |
foreach ( self::get_db_update_callbacks() as $version => $update_callbacks ) {
|
| 381 |
+
|
| 382 |
if ( version_compare( $current_db_version, $version, '<' ) ) {
|
| 383 |
foreach ( $update_callbacks as $update_callback ) {
|
| 384 |
$logger->info(
|
| 441 |
* @since 2.0.0
|
| 442 |
*/
|
| 443 |
public static function maybe_flush_rewrite_rules() {
|
| 444 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_queue_flush_rewrite_rules', 'no' ) ) ) {
|
| 445 |
update_option( 'wcvendors_queue_flush_rewrite_rules', 'no' );
|
| 446 |
flush_rewrite_rules();
|
| 447 |
}
|
classes/class-shipping.php
CHANGED
|
@@ -208,7 +208,7 @@ class WCV_Shipping
|
|
| 208 |
|
| 209 |
if ( $tax_rates ) {
|
| 210 |
foreach ( $tax_rates as $key => $rate ) {
|
| 211 |
-
if ( isset( $rate['shipping'] ) &&
|
| 212 |
$matched_tax_rates[ $key ] = $rate;
|
| 213 |
}
|
| 214 |
}
|
| 208 |
|
| 209 |
if ( $tax_rates ) {
|
| 210 |
foreach ( $tax_rates as $key => $rate ) {
|
| 211 |
+
if ( isset( $rate['shipping'] ) && wc_string_to_bool( $rate['shipping'] ) ) {
|
| 212 |
$matched_tax_rates[ $key ] = $rate;
|
| 213 |
}
|
| 214 |
}
|
classes/class-vendors.php
CHANGED
|
@@ -588,7 +588,7 @@ class WCV_Vendors
|
|
| 588 |
$vendor_order = wc_get_order( $vendor_order_id );
|
| 589 |
$order = wc_get_order( $args['order_id'] );
|
| 590 |
|
| 591 |
-
$order_currency =
|
| 592 |
|
| 593 |
// Order currency is the same used for the parent order
|
| 594 |
update_post_meta( $vendor_order_id, '_order_currency', $order_currency );
|
| 588 |
$vendor_order = wc_get_order( $vendor_order_id );
|
| 589 |
$order = wc_get_order( $args['order_id'] );
|
| 590 |
|
| 591 |
+
$order_currency = $order->get_currency();
|
| 592 |
|
| 593 |
// Order currency is the same used for the parent order
|
| 594 |
update_post_meta( $vendor_order_id, '_order_currency', $order_currency );
|
classes/front/class-vendor-shop.php
CHANGED
|
@@ -29,7 +29,7 @@ class WCV_Vendor_Shop
|
|
| 29 |
add_filter( 'post_type_archive_link', array( 'WCV_Vendor_Shop', 'change_archive_link' ) );
|
| 30 |
|
| 31 |
// Add sold by to product loop before add to cart
|
| 32 |
-
if ( apply_filters( 'wcvendors_disable_sold_by_labels',
|
| 33 |
add_action( 'woocommerce_after_shop_loop_item', array('WCV_Vendor_Shop', 'template_loop_sold_by'), 9 );
|
| 34 |
}
|
| 35 |
|
|
@@ -37,7 +37,7 @@ class WCV_Vendor_Shop
|
|
| 37 |
add_filter ( 'woocommerce_show_page_title', array( 'WCV_Vendor_Shop', 'remove_vendor_title' ) );
|
| 38 |
|
| 39 |
// Show vendor on all sales related invoices
|
| 40 |
-
add_action( 'woocommerce_checkout_create_order_line_item', array( $this, 'add_vendor_to_order_item_meta' ),
|
| 41 |
|
| 42 |
// Add a vendor header
|
| 43 |
if ( apply_filters( 'wcvendors_disable_shop_headers', get_option( 'wcvendors_display_shop_headers' ) ) ) {
|
|
@@ -277,10 +277,10 @@ class WCV_Vendor_Shop
|
|
| 277 |
|
| 278 |
$vendor = get_userdata( $post->post_author );
|
| 279 |
$vendor_id = $post->post_author;
|
| 280 |
-
$vendor_shop_link =
|
| 281 |
$shop_name = get_user_meta( $vendor_id, 'pv_shop_name', true );
|
| 282 |
$has_html = $vendor->pv_shop_html_enabled;
|
| 283 |
-
$global_html =
|
| 284 |
$description = do_shortcode( $vendor->pv_shop_description );
|
| 285 |
$shop_description = ( $global_html || $has_html ) ? wpautop( wptexturize( wp_kses_post( $description ) ) ) : sanitize_text_field( $description );
|
| 286 |
$seller_info = ( $global_html || $has_html ) ? wpautop( get_user_meta( $vendor_id, 'pv_seller_info', true ) ) : sanitize_text_field( get_user_meta( $vendor_id, 'pv_seller_info', true ) );
|
|
@@ -306,44 +306,24 @@ class WCV_Vendor_Shop
|
|
| 306 |
}
|
| 307 |
}
|
| 308 |
|
| 309 |
-
/*
|
| 310 |
-
* Add Vendor to Order item Meta legacy
|
| 311 |
-
* Thanks to Asbjoern Andersen for the code
|
| 312 |
-
*
|
| 313 |
-
* @depreciated
|
| 314 |
-
*/
|
| 315 |
-
public static function add_vendor_to_order_item_meta_legacy( $item_id, $cart_item) {
|
| 316 |
-
|
| 317 |
-
if ( 'yes' === get_option( 'wcvendors_display_label_sold_by_enable' ) ) {
|
| 318 |
-
|
| 319 |
-
$vendor_id = $cart_item[ 'data' ]->post->post_author;
|
| 320 |
-
$sold_by_label = get_option( 'wcvendors_label_sold_by' );
|
| 321 |
-
$sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ): get_bloginfo( 'name' );
|
| 322 |
-
|
| 323 |
-
wc_add_order_item_meta( $item_id, apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by );
|
| 324 |
-
}
|
| 325 |
-
}
|
| 326 |
-
|
| 327 |
-
|
| 328 |
/**
|
| 329 |
-
* Add vendor to order item meta
|
| 330 |
*
|
| 331 |
* @since 1.9.9
|
| 332 |
* @access public
|
| 333 |
*/
|
| 334 |
-
public function add_vendor_to_order_item_meta( $item, $cart_item_key, $values ) {
|
| 335 |
|
| 336 |
-
if (
|
| 337 |
|
| 338 |
$cart = WC()->cart->get_cart();
|
| 339 |
$cart_item = $cart[ $cart_item_key ];
|
| 340 |
$product_id = $cart_item[ 'product_id'];
|
| 341 |
-
$
|
| 342 |
-
$vendor_id = $post->post_author;
|
| 343 |
$sold_by_label = get_option( 'wcvendors_label_sold_by' );
|
| 344 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ): get_bloginfo( 'name' );
|
| 345 |
|
| 346 |
-
$item->add_meta_data( apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by );
|
| 347 |
}
|
| 348 |
|
| 349 |
|
| 29 |
add_filter( 'post_type_archive_link', array( 'WCV_Vendor_Shop', 'change_archive_link' ) );
|
| 30 |
|
| 31 |
// Add sold by to product loop before add to cart
|
| 32 |
+
if ( apply_filters( 'wcvendors_disable_sold_by_labels', wc_string_to_bool( get_option( 'wcvendors_display_label_sold_by_enable', 'no' ) ) ) ) {
|
| 33 |
add_action( 'woocommerce_after_shop_loop_item', array('WCV_Vendor_Shop', 'template_loop_sold_by'), 9 );
|
| 34 |
}
|
| 35 |
|
| 37 |
add_filter ( 'woocommerce_show_page_title', array( 'WCV_Vendor_Shop', 'remove_vendor_title' ) );
|
| 38 |
|
| 39 |
// Show vendor on all sales related invoices
|
| 40 |
+
add_action( 'woocommerce_checkout_create_order_line_item', array( $this, 'add_vendor_to_order_item_meta' ), 10, 4 );
|
| 41 |
|
| 42 |
// Add a vendor header
|
| 43 |
if ( apply_filters( 'wcvendors_disable_shop_headers', get_option( 'wcvendors_display_shop_headers' ) ) ) {
|
| 277 |
|
| 278 |
$vendor = get_userdata( $post->post_author );
|
| 279 |
$vendor_id = $post->post_author;
|
| 280 |
+
$vendor_shop_link = WCV_Vendors::get_vendor_shop_page( $vendor_id );
|
| 281 |
$shop_name = get_user_meta( $vendor_id, 'pv_shop_name', true );
|
| 282 |
$has_html = $vendor->pv_shop_html_enabled;
|
| 283 |
+
$global_html = wc_string_to_bool( get_option( 'wcvendors_display_shop_description_html', 'no' ) );
|
| 284 |
$description = do_shortcode( $vendor->pv_shop_description );
|
| 285 |
$shop_description = ( $global_html || $has_html ) ? wpautop( wptexturize( wp_kses_post( $description ) ) ) : sanitize_text_field( $description );
|
| 286 |
$seller_info = ( $global_html || $has_html ) ? wpautop( get_user_meta( $vendor_id, 'pv_seller_info', true ) ) : sanitize_text_field( get_user_meta( $vendor_id, 'pv_seller_info', true ) );
|
| 306 |
}
|
| 307 |
}
|
| 308 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 309 |
/**
|
| 310 |
+
* Add vendor to order item meta
|
| 311 |
*
|
| 312 |
* @since 1.9.9
|
| 313 |
* @access public
|
| 314 |
*/
|
| 315 |
+
public function add_vendor_to_order_item_meta( $item, $cart_item_key, $values, $order ) {
|
| 316 |
|
| 317 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_display_label_sold_by_enable', 'no' ) ) ) {
|
| 318 |
|
| 319 |
$cart = WC()->cart->get_cart();
|
| 320 |
$cart_item = $cart[ $cart_item_key ];
|
| 321 |
$product_id = $cart_item[ 'product_id'];
|
| 322 |
+
$vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
|
|
|
|
| 323 |
$sold_by_label = get_option( 'wcvendors_label_sold_by' );
|
| 324 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ): get_bloginfo( 'name' );
|
| 325 |
|
| 326 |
+
$item->add_meta_data( apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by, true );
|
| 327 |
}
|
| 328 |
|
| 329 |
|
classes/front/dashboard/class-vendor-dashboard.php
CHANGED
|
@@ -204,9 +204,9 @@ class WCV_Vendor_Dashboard
|
|
| 204 |
$start_date = !empty( $_SESSION[ 'PV_Session' ][ 'start_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 205 |
$end_date = !empty( $_SESSION[ 'PV_Session' ][ 'end_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 206 |
|
| 207 |
-
$can_view_orders =
|
| 208 |
$settings_page = get_permalink(get_option( 'wcvendors_shop_settings_page_id' ) );
|
| 209 |
-
$can_submit =
|
| 210 |
$submit_link = ( $can_submit ) ? admin_url( 'post-new.php?post_type=product' ) : '';
|
| 211 |
$edit_link = ( $can_submit ) ? admin_url( 'edit.php?post_type=product' ) : '';
|
| 212 |
|
|
@@ -260,6 +260,8 @@ class WCV_Vendor_Dashboard
|
|
| 260 |
|
| 261 |
if ( $can_view_sales = get_option( 'wcvendors_capability_frontend_reports' ) ) {
|
| 262 |
|
|
|
|
|
|
|
| 263 |
wc_get_template( 'reports.php', array(
|
| 264 |
'start_date' => $start_date,
|
| 265 |
'end_date' => $end_date,
|
|
@@ -279,15 +281,12 @@ class WCV_Vendor_Dashboard
|
|
| 279 |
'providers' => $providers,
|
| 280 |
'provider_array' => $provider_array,
|
| 281 |
'can_view_orders' => $can_view_orders,
|
|
|
|
| 282 |
), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
|
| 283 |
do_action( 'wcvendors_after_dashboard' );
|
| 284 |
|
| 285 |
|
| 286 |
-
|
| 287 |
-
wc_enqueue_js( WCV_Vendor_dashboard::wc_st_js( $provider_array ) );
|
| 288 |
-
} else {
|
| 289 |
-
$woocommerce->add_inline_js( $js );
|
| 290 |
-
}
|
| 291 |
|
| 292 |
return ob_get_clean();
|
| 293 |
}
|
|
@@ -318,7 +317,7 @@ class WCV_Vendor_Dashboard
|
|
| 318 |
$seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
|
| 319 |
$has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
|
| 320 |
$shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
|
| 321 |
-
$global_html =
|
| 322 |
|
| 323 |
ob_start();
|
| 324 |
wc_get_template( 'settings.php', array(
|
| 204 |
$start_date = !empty( $_SESSION[ 'PV_Session' ][ 'start_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 205 |
$end_date = !empty( $_SESSION[ 'PV_Session' ][ 'end_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 206 |
|
| 207 |
+
$can_view_orders = wc_string_to_bool( get_option( 'wcvendors_capability_orders_enabled', 'no' ) );
|
| 208 |
$settings_page = get_permalink(get_option( 'wcvendors_shop_settings_page_id' ) );
|
| 209 |
+
$can_submit = wc_string_to_bool( get_option( 'wcvendors_capability_products_enabled', 'no' ) );
|
| 210 |
$submit_link = ( $can_submit ) ? admin_url( 'post-new.php?post_type=product' ) : '';
|
| 211 |
$edit_link = ( $can_submit ) ? admin_url( 'edit.php?post_type=product' ) : '';
|
| 212 |
|
| 260 |
|
| 261 |
if ( $can_view_sales = get_option( 'wcvendors_capability_frontend_reports' ) ) {
|
| 262 |
|
| 263 |
+
$can_view_address = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_shipping' ) );
|
| 264 |
+
|
| 265 |
wc_get_template( 'reports.php', array(
|
| 266 |
'start_date' => $start_date,
|
| 267 |
'end_date' => $end_date,
|
| 281 |
'providers' => $providers,
|
| 282 |
'provider_array' => $provider_array,
|
| 283 |
'can_view_orders' => $can_view_orders,
|
| 284 |
+
'can_view_address' => $can_view_address,
|
| 285 |
), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
|
| 286 |
do_action( 'wcvendors_after_dashboard' );
|
| 287 |
|
| 288 |
|
| 289 |
+
wc_enqueue_js( WCV_Vendor_dashboard::wc_st_js( $provider_array ) );
|
|
|
|
|
|
|
|
|
|
|
|
|
| 290 |
|
| 291 |
return ob_get_clean();
|
| 292 |
}
|
| 317 |
$seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
|
| 318 |
$has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
|
| 319 |
$shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
|
| 320 |
+
$global_html = wc_string_to_bool( get_option( 'wcvendors_display_shop_description_html', 'no' ) );
|
| 321 |
|
| 322 |
ob_start();
|
| 323 |
wc_get_template( 'settings.php', array(
|
classes/front/orders/class-orders.php
CHANGED
|
@@ -17,9 +17,11 @@ class WCV_Orders
|
|
| 17 |
*/
|
| 18 |
function __construct()
|
| 19 |
{
|
| 20 |
-
$this->can_view_orders
|
| 21 |
-
$this->can_export_csv
|
| 22 |
-
$this->can_view_emails
|
|
|
|
|
|
|
| 23 |
|
| 24 |
add_action( 'template_redirect', array( $this, 'check_access' ) );
|
| 25 |
add_action( 'template_redirect', array( $this, 'process_export_orders' ) );
|
|
@@ -216,6 +218,18 @@ class WCV_Orders
|
|
| 216 |
unset( $headers[ 'email' ] );
|
| 217 |
}
|
| 218 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 219 |
return $headers;
|
| 220 |
}
|
| 221 |
|
|
@@ -265,6 +279,17 @@ class WCV_Orders
|
|
| 265 |
unset( $body[ $i ][ 'email' ] );
|
| 266 |
}
|
| 267 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 268 |
$items[ $i ][ 'total_qty' ] = 0;
|
| 269 |
foreach ( $order->get_items() as $line_id => $item ) {
|
| 270 |
|
| 17 |
*/
|
| 18 |
function __construct()
|
| 19 |
{
|
| 20 |
+
$this->can_view_orders = wc_string_to_bool( get_option( 'wcvendors_capability_orders_enabled', 'no' ) );
|
| 21 |
+
$this->can_export_csv = wc_string_to_bool( get_option( 'wcvendors_capability_orders_export', 'no' ) );
|
| 22 |
+
$this->can_view_emails = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_email', 'no' ) );
|
| 23 |
+
$this->can_view_name = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_name', 'no' ) );
|
| 24 |
+
$this->can_view_address = wc_string_to_bool( get_option( 'wcvendors_capability_order_customer_shipping' ) );
|
| 25 |
|
| 26 |
add_action( 'template_redirect', array( $this, 'check_access' ) );
|
| 27 |
add_action( 'template_redirect', array( $this, 'process_export_orders' ) );
|
| 218 |
unset( $headers[ 'email' ] );
|
| 219 |
}
|
| 220 |
|
| 221 |
+
if ( !$this->can_view_name ) {
|
| 222 |
+
unset( $headers[ 'name' ] );
|
| 223 |
+
}
|
| 224 |
+
|
| 225 |
+
if ( !$this->can_view_address ) {
|
| 226 |
+
unset( $headers[ 'address' ] );
|
| 227 |
+
unset( $headers[ 'city' ] );
|
| 228 |
+
unset( $headers[ 'state' ] );
|
| 229 |
+
unset( $headers[ 'zip' ] );
|
| 230 |
+
}
|
| 231 |
+
|
| 232 |
+
|
| 233 |
return $headers;
|
| 234 |
}
|
| 235 |
|
| 279 |
unset( $body[ $i ][ 'email' ] );
|
| 280 |
}
|
| 281 |
|
| 282 |
+
if ( !$this->can_view_name ) {
|
| 283 |
+
unset( $body[ $i ][ 'name' ] );
|
| 284 |
+
}
|
| 285 |
+
|
| 286 |
+
if ( !$this->can_view_address ) {
|
| 287 |
+
unset( $body[ $i ][ 'address' ] );
|
| 288 |
+
unset( $body[ $i ][ 'city' ] );
|
| 289 |
+
unset( $body[ $i ][ 'state' ] );
|
| 290 |
+
unset( $body[ $i ][ 'zip' ] );
|
| 291 |
+
}
|
| 292 |
+
|
| 293 |
$items[ $i ][ 'total_qty' ] = 0;
|
| 294 |
foreach ( $order->get_items() as $line_id => $item ) {
|
| 295 |
|
classes/front/signup/class-vendor-signup.php
CHANGED
|
@@ -17,7 +17,8 @@ class WCV_Vendor_Signup
|
|
| 17 |
*/
|
| 18 |
function __construct()
|
| 19 |
{
|
| 20 |
-
|
|
|
|
| 21 |
|
| 22 |
$this->terms_page = get_option( 'wcvendors_vendor_terms_page_id' );
|
| 23 |
|
|
@@ -101,7 +102,7 @@ class WCV_Vendor_Signup
|
|
| 101 |
} else {
|
| 102 |
wc_add_notice( apply_filters( 'wcvendors_application_submitted_msg', __( 'Your application has been submitted.', 'wc-vendors' ) ), 'notice' );
|
| 103 |
|
| 104 |
-
$manual =
|
| 105 |
$role = apply_filters( 'wcvendors_pending_role', ( $manual ? 'pending_vendor' : 'vendor' ) );
|
| 106 |
|
| 107 |
$wp_user_object = new WP_User( $user_id );
|
|
@@ -125,7 +126,7 @@ class WCV_Vendor_Signup
|
|
| 125 |
|
| 126 |
if ( isset( $_POST[ 'apply_for_vendor' ] ) ) {
|
| 127 |
|
| 128 |
-
$manual = get_option( 'wcvendors_vendor_approve_registration' );
|
| 129 |
$role = apply_filters( 'wcvendors_pending_role', ( $manual ? 'pending_vendor' : 'vendor' ) );
|
| 130 |
|
| 131 |
$wp_user_object = new WP_User( $user_id );
|
| 17 |
*/
|
| 18 |
function __construct()
|
| 19 |
{
|
| 20 |
+
|
| 21 |
+
if ( ! wc_string_to_bool( get_option( 'wcvendors_vendor_allow_registration', 'no' ) ) ) return;
|
| 22 |
|
| 23 |
$this->terms_page = get_option( 'wcvendors_vendor_terms_page_id' );
|
| 24 |
|
| 102 |
} else {
|
| 103 |
wc_add_notice( apply_filters( 'wcvendors_application_submitted_msg', __( 'Your application has been submitted.', 'wc-vendors' ) ), 'notice' );
|
| 104 |
|
| 105 |
+
$manual = wc_string_to_bool( get_option( 'wcvendors_vendor_approve_registration', 'no' ) );
|
| 106 |
$role = apply_filters( 'wcvendors_pending_role', ( $manual ? 'pending_vendor' : 'vendor' ) );
|
| 107 |
|
| 108 |
$wp_user_object = new WP_User( $user_id );
|
| 126 |
|
| 127 |
if ( isset( $_POST[ 'apply_for_vendor' ] ) ) {
|
| 128 |
|
| 129 |
+
$manual = wc_string_to_bool( get_option( 'wcvendors_vendor_approve_registration', 'no' ) );
|
| 130 |
$role = apply_filters( 'wcvendors_pending_role', ( $manual ? 'pending_vendor' : 'vendor' ) );
|
| 131 |
|
| 132 |
$wp_user_object = new WP_User( $user_id );
|
classes/gateways/PayPal_AdvPayments/paypal_ap.php
CHANGED
|
@@ -305,7 +305,7 @@ class WC_PaypalAP extends WC_Payment_Gateway
|
|
| 305 |
$receivers = WCV_Vendors::get_vendor_dues_from_order( $order );
|
| 306 |
$i = 0;
|
| 307 |
|
| 308 |
-
$order_id =
|
| 309 |
|
| 310 |
foreach ( $receivers as $author => $values ) {
|
| 311 |
if ( empty( $values[ 'total' ] ) ) continue;
|
|
@@ -351,9 +351,9 @@ class WC_PaypalAP extends WC_Payment_Gateway
|
|
| 351 |
$this->include_paypal_sdk();
|
| 352 |
$this->logger = new PPLoggingManager( 'Pay' );
|
| 353 |
$order = wc_get_order( $order_id );
|
| 354 |
-
$order_id =
|
| 355 |
-
$order_key =
|
| 356 |
-
$customer_note =
|
| 357 |
|
| 358 |
$receivers = $this->get_receivers( $order );
|
| 359 |
$receiverList = new ReceiverList( $receivers );
|
| 305 |
$receivers = WCV_Vendors::get_vendor_dues_from_order( $order );
|
| 306 |
$i = 0;
|
| 307 |
|
| 308 |
+
$order_id = $order->get_id();
|
| 309 |
|
| 310 |
foreach ( $receivers as $author => $values ) {
|
| 311 |
if ( empty( $values[ 'total' ] ) ) continue;
|
| 351 |
$this->include_paypal_sdk();
|
| 352 |
$this->logger = new PPLoggingManager( 'Pay' );
|
| 353 |
$order = wc_get_order( $order_id );
|
| 354 |
+
$order_id = $order->get_id();
|
| 355 |
+
$order_key = $order->get_order_key();
|
| 356 |
+
$customer_note = $order->get_customer_note();
|
| 357 |
|
| 358 |
$receivers = $this->get_receivers( $order );
|
| 359 |
$receiverList = new ReceiverList( $receivers );
|
classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php
CHANGED
|
@@ -106,7 +106,7 @@ class WC_Gateway_WCV_Gateway_Test extends WC_Payment_Gateway {
|
|
| 106 |
*/
|
| 107 |
public function email_instructions( $order, $sent_to_admin, $plain_text = false ) {
|
| 108 |
|
| 109 |
-
$payment_method =
|
| 110 |
|
| 111 |
if ( $this->instructions && ! $sent_to_admin && 'wcvendors_test_gateway' === $payment_method && $order->has_status( 'processing' ) ) {
|
| 112 |
echo wpautop( wptexturize( $this->instructions ) ) . PHP_EOL;
|
|
@@ -127,12 +127,7 @@ class WC_Gateway_WCV_Gateway_Test extends WC_Payment_Gateway {
|
|
| 127 |
$order->update_status( 'processing', __( 'Test gateway transation complete. Order processing.', 'wc-vendors' ) );
|
| 128 |
|
| 129 |
// Reduce stock levels
|
| 130 |
-
|
| 131 |
-
$order->reduce_order_stock();
|
| 132 |
-
} else {
|
| 133 |
-
wc_reduce_stock_levels( $order_id );
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
|
| 137 |
// Remove cart
|
| 138 |
WC()->cart->empty_cart();
|
| 106 |
*/
|
| 107 |
public function email_instructions( $order, $sent_to_admin, $plain_text = false ) {
|
| 108 |
|
| 109 |
+
$payment_method = $order->get_payment_method();
|
| 110 |
|
| 111 |
if ( $this->instructions && ! $sent_to_admin && 'wcvendors_test_gateway' === $payment_method && $order->has_status( 'processing' ) ) {
|
| 112 |
echo wpautop( wptexturize( $this->instructions ) ) . PHP_EOL;
|
| 127 |
$order->update_status( 'processing', __( 'Test gateway transation complete. Order processing.', 'wc-vendors' ) );
|
| 128 |
|
| 129 |
// Reduce stock levels
|
| 130 |
+
wc_reduce_stock_levels( $order_id );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 131 |
|
| 132 |
// Remove cart
|
| 133 |
WC()->cart->empty_cart();
|
classes/includes/class-functions.php
CHANGED
|
@@ -40,11 +40,6 @@ function wcv_get_vendor_name( $singluar = true, $upper_case = true ){
|
|
| 40 |
|
| 41 |
return apply_filters( 'wcv_vendor_display_name', $vendor_label, $vendor_singular, $vendor_plural, $singluar, $upper_case );
|
| 42 |
|
| 43 |
-
// if ( $singluar ){
|
| 44 |
-
// return apply_filters( 'wcv_vendor_display_name_singluar', $vendor_singular );
|
| 45 |
-
// } else {
|
| 46 |
-
// return apply_filters( 'wcv_vendor_display_name_plural', $vendor_plural );
|
| 47 |
-
// }
|
| 48 |
}
|
| 49 |
|
| 50 |
// Output a single select page drop down
|
|
@@ -64,6 +59,7 @@ function wcv_single_select_page( $id, $value, $class = '', $css = '' ){
|
|
| 64 |
echo str_replace( ' id=', " data-placeholder='" . esc_attr__( 'Select a page…', 'wc-vendors' ) . "' style='" . $css . "' class='" . $class . "' id=", wp_dropdown_pages( $dropdown_args ) );
|
| 65 |
}
|
| 66 |
|
|
|
|
| 67 |
function wcv_get_screen_ids(){
|
| 68 |
return apply_filters( 'wcv_get_screen_ids', array(
|
| 69 |
'wc-vendors_page_wcv-settings',
|
|
@@ -71,6 +67,4 @@ function wcv_get_screen_ids(){
|
|
| 71 |
'wc-vendors_page_wcv-extensions',
|
| 72 |
) );
|
| 73 |
}
|
| 74 |
-
|
| 75 |
-
|
| 76 |
?>
|
| 40 |
|
| 41 |
return apply_filters( 'wcv_vendor_display_name', $vendor_label, $vendor_singular, $vendor_plural, $singluar, $upper_case );
|
| 42 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 43 |
}
|
| 44 |
|
| 45 |
// Output a single select page drop down
|
| 59 |
echo str_replace( ' id=', " data-placeholder='" . esc_attr__( 'Select a page…', 'wc-vendors' ) . "' style='" . $css . "' class='" . $class . "' id=", wp_dropdown_pages( $dropdown_args ) );
|
| 60 |
}
|
| 61 |
|
| 62 |
+
// Get the WC Vendors Screen ids
|
| 63 |
function wcv_get_screen_ids(){
|
| 64 |
return apply_filters( 'wcv_get_screen_ids', array(
|
| 65 |
'wc-vendors_page_wcv-settings',
|
| 67 |
'wc-vendors_page_wcv-extensions',
|
| 68 |
) );
|
| 69 |
}
|
|
|
|
|
|
|
| 70 |
?>
|
classes/includes/wcv-template-functions.php
CHANGED
|
@@ -87,10 +87,10 @@ if ( ! function_exists( 'wcv_get_vendor_item_totals' ) ) {
|
|
| 87 |
|
| 88 |
if ( $vendor_id == $commission[ 'vendor_id' ] ){
|
| 89 |
|
| 90 |
-
$commission_subtotal
|
| 91 |
$shipping = $commission[ 'shipping' ];
|
| 92 |
$tax = $commission[ 'tax' ];
|
| 93 |
-
$commission_total
|
| 94 |
}
|
| 95 |
|
| 96 |
}
|
|
@@ -118,7 +118,7 @@ if ( ! function_exists( 'wcv_get_vendor_item_totals' ) ) {
|
|
| 118 |
}
|
| 119 |
|
| 120 |
// Shipping
|
| 121 |
-
if (
|
| 122 |
$total_rows[ 'shipping' ] = array(
|
| 123 |
'label' => __( 'Shipping:', 'wc-vendors' ),
|
| 124 |
'value' => wc_price( $shipping, array( 'currency' => $order->get_currency() ) ),
|
|
@@ -126,9 +126,9 @@ if ( ! function_exists( 'wcv_get_vendor_item_totals' ) ) {
|
|
| 126 |
}
|
| 127 |
|
| 128 |
// Tax
|
| 129 |
-
if (
|
| 130 |
$total_rows[ 'tax' ] = array(
|
| 131 |
-
'label' => __( '
|
| 132 |
'value' => wc_price( $tax, array( 'currency' => $order->get_currency() ) ),
|
| 133 |
);
|
| 134 |
}
|
| 87 |
|
| 88 |
if ( $vendor_id == $commission[ 'vendor_id' ] ){
|
| 89 |
|
| 90 |
+
$commission_subtotal += $commission[ 'commission' ];
|
| 91 |
$shipping = $commission[ 'shipping' ];
|
| 92 |
$tax = $commission[ 'tax' ];
|
| 93 |
+
$commission_total += $commission[ 'total' ];
|
| 94 |
}
|
| 95 |
|
| 96 |
}
|
| 118 |
}
|
| 119 |
|
| 120 |
// Shipping
|
| 121 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_vendor_give_shipping', 'no' ) ) ) {
|
| 122 |
$total_rows[ 'shipping' ] = array(
|
| 123 |
'label' => __( 'Shipping:', 'wc-vendors' ),
|
| 124 |
'value' => wc_price( $shipping, array( 'currency' => $order->get_currency() ) ),
|
| 126 |
}
|
| 127 |
|
| 128 |
// Tax
|
| 129 |
+
if ( wc_string_to_bool( get_option( 'wcvendors_vendor_give_taxes', 'no' ) ) ) {
|
| 130 |
$total_rows[ 'tax' ] = array(
|
| 131 |
+
'label' => __( 'Tax:', 'wc-vendors' ),
|
| 132 |
'value' => wc_price( $tax, array( 'currency' => $order->get_currency() ) ),
|
| 133 |
);
|
| 134 |
}
|
classes/includes/wcv-update-functions.php
CHANGED
|
@@ -70,7 +70,7 @@ function wcv_get_settings_mapping(){
|
|
| 70 |
'can_view_order_comments' => 'wcvendors_capability_order_read_notes',
|
| 71 |
'can_submit_order_comments' => 'wcvendors_capability_order_update_notes',
|
| 72 |
'can_view_frontend_reports' => 'wcvendors_capability_frontend_reports',
|
| 73 |
-
'default_commission' => '
|
| 74 |
'sold_by' => 'wcvendors_display_label_sold_by_enable',
|
| 75 |
'sold_by_label' => 'wcvendors_label_sold_by',
|
| 76 |
'seller_info_label' => 'wcvendors_display_label_store_info',
|
|
@@ -111,15 +111,12 @@ function wcv_enable_legacy_emails(){
|
|
| 111 |
* @since 2.0.0
|
| 112 |
*/
|
| 113 |
function wcv_update_200_db_version(){
|
| 114 |
-
WCVendors_Install::update_db_version(
|
| 115 |
}
|
| 116 |
|
| 117 |
-
|
| 118 |
/**
|
| 119 |
-
*
|
| 120 |
-
*
|
| 121 |
-
* @since 2.0.3
|
| 122 |
*/
|
| 123 |
-
function
|
| 124 |
-
WCVendors_Install::update_db_version(
|
| 125 |
}
|
| 70 |
'can_view_order_comments' => 'wcvendors_capability_order_read_notes',
|
| 71 |
'can_submit_order_comments' => 'wcvendors_capability_order_update_notes',
|
| 72 |
'can_view_frontend_reports' => 'wcvendors_capability_frontend_reports',
|
| 73 |
+
'default_commission' => 'wcvendors_vendor_commission_rate',
|
| 74 |
'sold_by' => 'wcvendors_display_label_sold_by_enable',
|
| 75 |
'sold_by_label' => 'wcvendors_label_sold_by',
|
| 76 |
'seller_info_label' => 'wcvendors_display_label_store_info',
|
| 111 |
* @since 2.0.0
|
| 112 |
*/
|
| 113 |
function wcv_update_200_db_version(){
|
| 114 |
+
WCVendors_Install::update_db_version();
|
| 115 |
}
|
| 116 |
|
|
|
|
| 117 |
/**
|
| 118 |
+
* Manually push the database version to fix update dialog.
|
|
|
|
|
|
|
| 119 |
*/
|
| 120 |
+
function wcv_update_db_version(){
|
| 121 |
+
WCVendors_Install::update_db_version();
|
| 122 |
}
|
languages/wc-vendors.pot
CHANGED
|
@@ -100,35 +100,35 @@ msgctxt "Page title"
|
|
| 100 |
msgid "Orders"
|
| 101 |
msgstr ""
|
| 102 |
|
| 103 |
-
#: classes/class-install.php:
|
| 104 |
msgid "View WC Vendors settings"
|
| 105 |
msgstr ""
|
| 106 |
|
| 107 |
-
#: classes/class-install.php:
|
| 108 |
msgid "Settings"
|
| 109 |
msgstr ""
|
| 110 |
|
| 111 |
-
#: classes/class-install.php:
|
| 112 |
msgid "View WC Vendors documentation"
|
| 113 |
msgstr ""
|
| 114 |
|
| 115 |
-
#: classes/class-install.php:
|
| 116 |
msgid "Docs"
|
| 117 |
msgstr ""
|
| 118 |
|
| 119 |
-
#: classes/class-install.php:
|
| 120 |
msgid "Visit community forums"
|
| 121 |
msgstr ""
|
| 122 |
|
| 123 |
-
#: classes/class-install.php:
|
| 124 |
msgid "Free support"
|
| 125 |
msgstr ""
|
| 126 |
|
| 127 |
-
#: classes/class-install.php:
|
| 128 |
msgid "Visit premium customer support"
|
| 129 |
msgstr ""
|
| 130 |
|
| 131 |
-
#: classes/class-install.php:
|
| 132 |
msgid "Premium support"
|
| 133 |
msgstr ""
|
| 134 |
|
|
@@ -209,15 +209,15 @@ msgstr ""
|
|
| 209 |
msgid "Recent Commission"
|
| 210 |
msgstr ""
|
| 211 |
|
| 212 |
-
#: classes/admin/class-admin-reports.php:171, templates/dashboard/orders.php:
|
| 213 |
msgid "Order"
|
| 214 |
msgstr ""
|
| 215 |
|
| 216 |
-
#: classes/admin/class-admin-reports.php:172, classes/admin/class-wcv-commissions-csv-exporter.php:41, classes/admin/class-wcv-commissions-page.php:116, templates/dashboard/reports.php:35, templates/emails/notify-vendor-shipped.php:27, templates/emails/vendor-new-order.php:31, templates/emails/vendor-order-details.php:36, classes/admin/emails/class-wcv-vendor-notify-order.php:
|
| 217 |
msgid "Product"
|
| 218 |
msgstr ""
|
| 219 |
|
| 220 |
-
#: classes/admin/class-admin-reports.php:174, classes/admin/class-admin-reports.php:372, classes/admin/class-vendor-admin-dashboard.php:351, classes/admin/class-wcv-commissions-csv-exporter.php:47, classes/admin/class-wcv-commissions-page.php:122, classes/admin/class-wcv-commissions-sum-csv-exporter.php:42, templates/dashboard/orders.php:
|
| 221 |
msgid "Total"
|
| 222 |
msgstr ""
|
| 223 |
|
|
@@ -229,7 +229,7 @@ msgstr ""
|
|
| 229 |
msgid "Status"
|
| 230 |
msgstr ""
|
| 231 |
|
| 232 |
-
#: classes/admin/class-admin-reports.php:184
|
| 233 |
msgid "N/A"
|
| 234 |
msgstr ""
|
| 235 |
|
|
@@ -285,7 +285,7 @@ msgstr ""
|
|
| 285 |
msgid "You are not allowed to submit products. <a href=\"%s\">Go Back</a>"
|
| 286 |
msgstr ""
|
| 287 |
|
| 288 |
-
#: classes/admin/class-product-meta.php:151, classes/admin/class-product-meta.php:167, classes/admin/class-wcv-commissions-csv-exporter.php:44, classes/admin/class-wcv-commissions-page.php:119, templates/dashboard/reports.php:37, templates/emails/vendor-order-details.php:39, classes/admin/emails/class-wcv-vendor-notify-order.php:
|
| 289 |
msgid "Commission"
|
| 290 |
msgstr ""
|
| 291 |
|
|
@@ -354,15 +354,15 @@ msgstr ""
|
|
| 354 |
msgid "Products"
|
| 355 |
msgstr ""
|
| 356 |
|
| 357 |
-
#: classes/admin/class-vendor-admin-dashboard.php:353, classes/admin/class-wcv-commissions-csv-exporter.php:49, classes/admin/class-wcv-commissions-page.php:124, templates/dashboard/orders.php:
|
| 358 |
msgid "Date"
|
| 359 |
msgstr ""
|
| 360 |
|
| 361 |
-
#: classes/admin/class-vendor-admin-dashboard.php:354, templates/dashboard/orders.php:
|
| 362 |
msgid "Shipped"
|
| 363 |
msgstr ""
|
| 364 |
|
| 365 |
-
#: classes/admin/class-vendor-admin-dashboard.php:390, templates/dashboard/orders.php:
|
| 366 |
msgid "Mark shipped"
|
| 367 |
msgstr ""
|
| 368 |
|
|
@@ -509,7 +509,7 @@ msgstr ""
|
|
| 509 |
msgid "The changes you made will be lost if you navigate away from this page."
|
| 510 |
msgstr ""
|
| 511 |
|
| 512 |
-
#: classes/admin/class-wcv-admin-settings.php:432, classes/includes/class-functions.php:
|
| 513 |
msgid "Select a page…"
|
| 514 |
msgstr ""
|
| 515 |
|
|
@@ -662,10 +662,14 @@ msgstr ""
|
|
| 662 |
msgid "Product subtotal:"
|
| 663 |
msgstr ""
|
| 664 |
|
| 665 |
-
#: classes/includes/wcv-template-functions.php:123
|
| 666 |
msgid "Shipping:"
|
| 667 |
msgstr ""
|
| 668 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 669 |
#: classes/includes/wcv-template-functions.php:139
|
| 670 |
msgid "Payment method:"
|
| 671 |
msgstr ""
|
|
@@ -722,19 +726,19 @@ msgstr ""
|
|
| 722 |
msgid "Hide items"
|
| 723 |
msgstr ""
|
| 724 |
|
| 725 |
-
#: templates/dashboard/orders.php:25, templates/dashboard/orders.php:
|
| 726 |
msgid "View items"
|
| 727 |
msgstr ""
|
| 728 |
|
| 729 |
-
#: templates/dashboard/orders.php:
|
| 730 |
msgid "Links"
|
| 731 |
msgstr ""
|
| 732 |
|
| 733 |
-
#: templates/dashboard/orders.php:
|
| 734 |
msgid "Tracking"
|
| 735 |
msgstr ""
|
| 736 |
|
| 737 |
-
#: templates/dashboard/orders.php:
|
| 738 |
msgid "You have no orders during this period."
|
| 739 |
msgstr ""
|
| 740 |
|
|
@@ -818,15 +822,15 @@ msgstr ""
|
|
| 818 |
msgid "Price"
|
| 819 |
msgstr ""
|
| 820 |
|
| 821 |
-
#: templates/emails/notify-vendor-shipped.php:61, templates/emails/vendor-new-order.php:
|
| 822 |
msgid "Customer details"
|
| 823 |
msgstr ""
|
| 824 |
|
| 825 |
-
#: templates/emails/notify-vendor-shipped.php:64, templates/emails/vendor-new-order.php:
|
| 826 |
msgid "Email:"
|
| 827 |
msgstr ""
|
| 828 |
|
| 829 |
-
#: templates/emails/notify-vendor-shipped.php:67, templates/emails/vendor-new-order.php:
|
| 830 |
msgid "Tel:"
|
| 831 |
msgstr ""
|
| 832 |
|
|
@@ -839,7 +843,15 @@ msgid "Your application is currently: %s"
|
|
| 839 |
msgstr ""
|
| 840 |
|
| 841 |
#: templates/emails/vendor-notify-order.php:22
|
| 842 |
-
msgid "You have received an order
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 843 |
msgstr ""
|
| 844 |
|
| 845 |
#. translators: %s: Order ID.
|
|
@@ -867,7 +879,7 @@ msgstr ""
|
|
| 867 |
msgid "Quantity: %d"
|
| 868 |
msgstr ""
|
| 869 |
|
| 870 |
-
#: classes/admin/emails/class-emails.php:73, classes/admin/emails/class-emails.php:
|
| 871 |
msgid "pending"
|
| 872 |
msgstr ""
|
| 873 |
|
|
@@ -899,11 +911,11 @@ msgstr ""
|
|
| 899 |
msgid "[{blogname}] Your vendor application has been {status}"
|
| 900 |
msgstr ""
|
| 901 |
|
| 902 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:123, classes/admin/emails/class-wc-notify-admin.php:134, classes/admin/emails/class-wc-notify-shipped.php:166, classes/admin/emails/class-wc-notify-vendor.php:268, classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 903 |
msgid "Enable/Disable"
|
| 904 |
msgstr ""
|
| 905 |
|
| 906 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:125, classes/admin/emails/class-wc-notify-admin.php:136, classes/admin/emails/class-wc-notify-shipped.php:168, classes/admin/emails/class-wc-notify-vendor.php:270, classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 907 |
msgid "Enable this email notification"
|
| 908 |
msgstr ""
|
| 909 |
|
|
@@ -911,7 +923,7 @@ msgstr ""
|
|
| 911 |
msgid "Enter recipients (comma separated) for this email. Defaults to <code>%s</code>."
|
| 912 |
msgstr ""
|
| 913 |
|
| 914 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:136, classes/admin/emails/class-wc-notify-admin.php:147, classes/admin/emails/class-wc-notify-shipped.php:172, classes/admin/emails/class-wc-notify-vendor.php:274, classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 915 |
msgid "Subject"
|
| 916 |
msgstr ""
|
| 917 |
|
|
@@ -927,11 +939,11 @@ msgstr ""
|
|
| 927 |
msgid "This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>."
|
| 928 |
msgstr ""
|
| 929 |
|
| 930 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:150, classes/admin/emails/class-wc-notify-admin.php:161, classes/admin/emails/class-wc-notify-shipped.php:186, classes/admin/emails/class-wc-notify-vendor.php:294, classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 931 |
msgid "Email type"
|
| 932 |
msgstr ""
|
| 933 |
|
| 934 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:152, classes/admin/emails/class-wc-notify-admin.php:163, classes/admin/emails/class-wc-notify-shipped.php:188, classes/admin/emails/class-wc-notify-vendor.php:296, classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 935 |
msgid "Choose which format of email to send."
|
| 936 |
msgstr ""
|
| 937 |
|
|
@@ -1035,11 +1047,11 @@ msgstr ""
|
|
| 1035 |
msgid "%s application received"
|
| 1036 |
msgstr ""
|
| 1037 |
|
| 1038 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 1039 |
msgid "Recipient(s)"
|
| 1040 |
msgstr ""
|
| 1041 |
|
| 1042 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 1043 |
msgid "Enter recipients (comma separated) for this email. Defaults to %s."
|
| 1044 |
msgstr ""
|
| 1045 |
|
|
@@ -1060,27 +1072,27 @@ msgstr ""
|
|
| 1060 |
#. translators: %s: list of placeholders
|
| 1061 |
#. translators: %s: list of placeholders
|
| 1062 |
#. translators: %s: list of placeholders
|
| 1063 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 1064 |
msgid "Available placeholders: %s"
|
| 1065 |
msgstr ""
|
| 1066 |
|
| 1067 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 1068 |
msgid "Email heading"
|
| 1069 |
msgstr ""
|
| 1070 |
|
| 1071 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 1072 |
msgid "Notification"
|
| 1073 |
msgstr ""
|
| 1074 |
|
| 1075 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 1076 |
msgid "Choose when to be notified of an application."
|
| 1077 |
msgstr ""
|
| 1078 |
|
| 1079 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 1080 |
msgid "All Applications"
|
| 1081 |
msgstr ""
|
| 1082 |
|
| 1083 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:
|
| 1084 |
msgid "Pending Applications"
|
| 1085 |
msgstr ""
|
| 1086 |
|
|
@@ -1212,27 +1224,27 @@ msgstr ""
|
|
| 1212 |
msgid "New Customer Order"
|
| 1213 |
msgstr ""
|
| 1214 |
|
| 1215 |
-
#: classes/admin/emails/class-wcv-vendor-notify-order.php:
|
| 1216 |
msgid "Totals Display"
|
| 1217 |
msgstr ""
|
| 1218 |
|
| 1219 |
-
#: classes/admin/emails/class-wcv-vendor-notify-order.php:
|
| 1220 |
msgid "Choose how to display the product totals. Including commission or without or no totals at all."
|
| 1221 |
msgstr ""
|
| 1222 |
|
| 1223 |
-
#: classes/admin/emails/class-wcv-vendor-notify-order.php:
|
| 1224 |
msgid "Both"
|
| 1225 |
msgstr ""
|
| 1226 |
|
| 1227 |
-
#: classes/admin/emails/class-wcv-vendor-notify-order.php:
|
| 1228 |
msgid "None"
|
| 1229 |
msgstr ""
|
| 1230 |
|
| 1231 |
-
#: classes/admin/emails/class-wcv-vendor-notify-order.php:
|
| 1232 |
msgid "Payment method"
|
| 1233 |
msgstr ""
|
| 1234 |
|
| 1235 |
-
#: classes/admin/emails/class-wcv-vendor-notify-order.php:
|
| 1236 |
msgid "Include the payment method in the email"
|
| 1237 |
msgstr ""
|
| 1238 |
|
|
@@ -1708,7 +1720,7 @@ msgid "Enable instantpay"
|
|
| 1708 |
msgstr ""
|
| 1709 |
|
| 1710 |
#: classes/admin/settings/class-wcv-settings-payments.php:82
|
| 1711 |
-
msgid "Instantly pay %
|
| 1712 |
msgstr ""
|
| 1713 |
|
| 1714 |
#: classes/admin/settings/class-wcv-settings-payments.php:89
|
|
@@ -1995,39 +2007,39 @@ msgstr ""
|
|
| 1995 |
msgid "Item Meta"
|
| 1996 |
msgstr ""
|
| 1997 |
|
| 1998 |
-
#: classes/front/orders/class-orders.php:
|
| 1999 |
msgid "You haven't selected a product's orders to view! Please go back to the %s Dashboard and click Show Orders on the product you'd like to view."
|
| 2000 |
msgstr ""
|
| 2001 |
|
| 2002 |
-
#: classes/front/orders/class-orders.php:
|
| 2003 |
msgid "No orders."
|
| 2004 |
msgstr ""
|
| 2005 |
|
| 2006 |
-
#: classes/front/orders/class-orders.php:
|
| 2007 |
msgid "Product Title"
|
| 2008 |
msgstr ""
|
| 2009 |
|
| 2010 |
-
#: classes/front/orders/class-orders.php:
|
| 2011 |
msgid "Full name"
|
| 2012 |
msgstr ""
|
| 2013 |
|
| 2014 |
-
#: classes/front/orders/class-orders.php:
|
| 2015 |
msgid "Address"
|
| 2016 |
msgstr ""
|
| 2017 |
|
| 2018 |
-
#: classes/front/orders/class-orders.php:
|
| 2019 |
msgid "City"
|
| 2020 |
msgstr ""
|
| 2021 |
|
| 2022 |
-
#: classes/front/orders/class-orders.php:
|
| 2023 |
msgid "State"
|
| 2024 |
msgstr ""
|
| 2025 |
|
| 2026 |
-
#: classes/front/orders/class-orders.php:
|
| 2027 |
msgid "Zip"
|
| 2028 |
msgstr ""
|
| 2029 |
|
| 2030 |
-
#: classes/front/orders/class-orders.php:
|
| 2031 |
msgid "Email address"
|
| 2032 |
msgstr ""
|
| 2033 |
|
|
@@ -2039,19 +2051,19 @@ msgstr ""
|
|
| 2039 |
msgid "Success. The customer has been notified of your comment."
|
| 2040 |
msgstr ""
|
| 2041 |
|
| 2042 |
-
#: classes/front/signup/class-vendor-signup.php:
|
| 2043 |
msgid "ERROR"
|
| 2044 |
msgstr ""
|
| 2045 |
|
| 2046 |
-
#: classes/front/signup/class-vendor-signup.php:
|
| 2047 |
msgid "Application denied. You are an administrator."
|
| 2048 |
msgstr ""
|
| 2049 |
|
| 2050 |
-
#: classes/front/signup/class-vendor-signup.php:
|
| 2051 |
msgid "Your application has been submitted."
|
| 2052 |
msgstr ""
|
| 2053 |
|
| 2054 |
-
#: classes/front/signup/class-vendor-signup.php:
|
| 2055 |
msgid "You must accept the terms and conditions to become a vendor."
|
| 2056 |
msgstr ""
|
| 2057 |
|
|
@@ -2345,7 +2357,7 @@ msgid "WC Vendors data update"
|
|
| 2345 |
msgstr ""
|
| 2346 |
|
| 2347 |
#: classes/admin/views/notices/html-notice-updating.php:12
|
| 2348 |
-
msgid "Your database is being updated in the background."
|
| 2349 |
msgstr ""
|
| 2350 |
|
| 2351 |
#: classes/admin/views/notices/html-notice-updating.php:12
|
| 100 |
msgid "Orders"
|
| 101 |
msgstr ""
|
| 102 |
|
| 103 |
+
#: classes/class-install.php:409
|
| 104 |
msgid "View WC Vendors settings"
|
| 105 |
msgstr ""
|
| 106 |
|
| 107 |
+
#: classes/class-install.php:409, templates/dashboard/settings/settings.php:18
|
| 108 |
msgid "Settings"
|
| 109 |
msgstr ""
|
| 110 |
|
| 111 |
+
#: classes/class-install.php:426
|
| 112 |
msgid "View WC Vendors documentation"
|
| 113 |
msgstr ""
|
| 114 |
|
| 115 |
+
#: classes/class-install.php:426
|
| 116 |
msgid "Docs"
|
| 117 |
msgstr ""
|
| 118 |
|
| 119 |
+
#: classes/class-install.php:427
|
| 120 |
msgid "Visit community forums"
|
| 121 |
msgstr ""
|
| 122 |
|
| 123 |
+
#: classes/class-install.php:427
|
| 124 |
msgid "Free support"
|
| 125 |
msgstr ""
|
| 126 |
|
| 127 |
+
#: classes/class-install.php:428
|
| 128 |
msgid "Visit premium customer support"
|
| 129 |
msgstr ""
|
| 130 |
|
| 131 |
+
#: classes/class-install.php:428
|
| 132 |
msgid "Premium support"
|
| 133 |
msgstr ""
|
| 134 |
|
| 209 |
msgid "Recent Commission"
|
| 210 |
msgstr ""
|
| 211 |
|
| 212 |
+
#: classes/admin/class-admin-reports.php:171, templates/dashboard/orders.php:49, classes/front/orders/class-orders.php:206
|
| 213 |
msgid "Order"
|
| 214 |
msgstr ""
|
| 215 |
|
| 216 |
+
#: classes/admin/class-admin-reports.php:172, classes/admin/class-wcv-commissions-csv-exporter.php:41, classes/admin/class-wcv-commissions-page.php:116, templates/dashboard/reports.php:35, templates/emails/notify-vendor-shipped.php:27, templates/emails/vendor-new-order.php:31, templates/emails/vendor-order-details.php:36, classes/admin/emails/class-wcv-vendor-notify-order.php:192
|
| 217 |
msgid "Product"
|
| 218 |
msgstr ""
|
| 219 |
|
| 220 |
+
#: classes/admin/class-admin-reports.php:174, classes/admin/class-admin-reports.php:372, classes/admin/class-vendor-admin-dashboard.php:351, classes/admin/class-wcv-commissions-csv-exporter.php:47, classes/admin/class-wcv-commissions-page.php:122, classes/admin/class-wcv-commissions-sum-csv-exporter.php:42, templates/dashboard/orders.php:53
|
| 221 |
msgid "Total"
|
| 222 |
msgstr ""
|
| 223 |
|
| 229 |
msgid "Status"
|
| 230 |
msgstr ""
|
| 231 |
|
| 232 |
+
#: classes/admin/class-admin-reports.php:184, templates/emails/vendor-order-addresses.php:29
|
| 233 |
msgid "N/A"
|
| 234 |
msgstr ""
|
| 235 |
|
| 285 |
msgid "You are not allowed to submit products. <a href=\"%s\">Go Back</a>"
|
| 286 |
msgstr ""
|
| 287 |
|
| 288 |
+
#: classes/admin/class-product-meta.php:151, classes/admin/class-product-meta.php:167, classes/admin/class-wcv-commissions-csv-exporter.php:44, classes/admin/class-wcv-commissions-page.php:119, templates/dashboard/reports.php:37, templates/emails/vendor-order-details.php:39, classes/admin/emails/class-wcv-vendor-notify-order.php:191, classes/admin/settings/class-wcv-settings-commission.php:31, classes/admin/views/html-admin-commission-page.php:23, classes/admin/views/setup/general.php:79
|
| 289 |
msgid "Commission"
|
| 290 |
msgstr ""
|
| 291 |
|
| 354 |
msgid "Products"
|
| 355 |
msgstr ""
|
| 356 |
|
| 357 |
+
#: classes/admin/class-vendor-admin-dashboard.php:353, classes/admin/class-wcv-commissions-csv-exporter.php:49, classes/admin/class-wcv-commissions-page.php:124, templates/dashboard/orders.php:54, classes/front/orders/class-orders.php:214
|
| 358 |
msgid "Date"
|
| 359 |
msgstr ""
|
| 360 |
|
| 361 |
+
#: classes/admin/class-vendor-admin-dashboard.php:354, templates/dashboard/orders.php:115
|
| 362 |
msgid "Shipped"
|
| 363 |
msgstr ""
|
| 364 |
|
| 365 |
+
#: classes/admin/class-vendor-admin-dashboard.php:390, templates/dashboard/orders.php:108
|
| 366 |
msgid "Mark shipped"
|
| 367 |
msgstr ""
|
| 368 |
|
| 509 |
msgid "The changes you made will be lost if you navigate away from this page."
|
| 510 |
msgstr ""
|
| 511 |
|
| 512 |
+
#: classes/admin/class-wcv-admin-settings.php:432, classes/includes/class-functions.php:59
|
| 513 |
msgid "Select a page…"
|
| 514 |
msgstr ""
|
| 515 |
|
| 662 |
msgid "Product subtotal:"
|
| 663 |
msgstr ""
|
| 664 |
|
| 665 |
+
#: classes/includes/wcv-template-functions.php:123
|
| 666 |
msgid "Shipping:"
|
| 667 |
msgstr ""
|
| 668 |
|
| 669 |
+
#: classes/includes/wcv-template-functions.php:131
|
| 670 |
+
msgid "Tax:"
|
| 671 |
+
msgstr ""
|
| 672 |
+
|
| 673 |
#: classes/includes/wcv-template-functions.php:139
|
| 674 |
msgid "Payment method:"
|
| 675 |
msgstr ""
|
| 726 |
msgid "Hide items"
|
| 727 |
msgstr ""
|
| 728 |
|
| 729 |
+
#: templates/dashboard/orders.php:25, templates/dashboard/orders.php:102
|
| 730 |
msgid "View items"
|
| 731 |
msgstr ""
|
| 732 |
|
| 733 |
+
#: templates/dashboard/orders.php:55
|
| 734 |
msgid "Links"
|
| 735 |
msgstr ""
|
| 736 |
|
| 737 |
+
#: templates/dashboard/orders.php:123
|
| 738 |
msgid "Tracking"
|
| 739 |
msgstr ""
|
| 740 |
|
| 741 |
+
#: templates/dashboard/orders.php:197
|
| 742 |
msgid "You have no orders during this period."
|
| 743 |
msgstr ""
|
| 744 |
|
| 822 |
msgid "Price"
|
| 823 |
msgstr ""
|
| 824 |
|
| 825 |
+
#: templates/emails/notify-vendor-shipped.php:61, templates/emails/vendor-new-order.php:67
|
| 826 |
msgid "Customer details"
|
| 827 |
msgstr ""
|
| 828 |
|
| 829 |
+
#: templates/emails/notify-vendor-shipped.php:64, templates/emails/vendor-new-order.php:70
|
| 830 |
msgid "Email:"
|
| 831 |
msgstr ""
|
| 832 |
|
| 833 |
+
#: templates/emails/notify-vendor-shipped.php:67, templates/emails/vendor-new-order.php:73
|
| 834 |
msgid "Tel:"
|
| 835 |
msgstr ""
|
| 836 |
|
| 843 |
msgstr ""
|
| 844 |
|
| 845 |
#: templates/emails/vendor-notify-order.php:22
|
| 846 |
+
msgid "You have received an order. The order is as follows:"
|
| 847 |
+
msgstr ""
|
| 848 |
+
|
| 849 |
+
#: templates/emails/vendor-order-addresses.php:23, templates/emails/plain/vendor-order-addresses.php:22
|
| 850 |
+
msgid "Billing address"
|
| 851 |
+
msgstr ""
|
| 852 |
+
|
| 853 |
+
#: templates/emails/vendor-order-addresses.php:46, templates/emails/plain/vendor-order-addresses.php:46
|
| 854 |
+
msgid "Shipping address"
|
| 855 |
msgstr ""
|
| 856 |
|
| 857 |
#. translators: %s: Order ID.
|
| 879 |
msgid "Quantity: %d"
|
| 880 |
msgstr ""
|
| 881 |
|
| 882 |
+
#: classes/admin/emails/class-emails.php:73, classes/admin/emails/class-emails.php:184, classes/admin/emails/class-wc-approve-vendor.php:70
|
| 883 |
msgid "pending"
|
| 884 |
msgstr ""
|
| 885 |
|
| 911 |
msgid "[{blogname}] Your vendor application has been {status}"
|
| 912 |
msgstr ""
|
| 913 |
|
| 914 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:123, classes/admin/emails/class-wc-notify-admin.php:134, classes/admin/emails/class-wc-notify-shipped.php:166, classes/admin/emails/class-wc-notify-vendor.php:268, classes/admin/emails/class-wcv-admin-notify-application.php:128, classes/admin/emails/class-wcv-admin-notify-product.php:146, classes/admin/emails/class-wcv-admin-notify-shipped.php:135, classes/admin/emails/class-wcv-customer-notify-shipped.php:142, classes/admin/emails/class-wcv-vendor-notify-application.php:129, classes/admin/emails/class-wcv-vendor-notify-approved.php:138, classes/admin/emails/class-wcv-vendor-notify-denied.php:148, classes/admin/emails/class-wcv-vendor-notify-order.php:160, classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
|
| 915 |
msgid "Enable/Disable"
|
| 916 |
msgstr ""
|
| 917 |
|
| 918 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:125, classes/admin/emails/class-wc-notify-admin.php:136, classes/admin/emails/class-wc-notify-shipped.php:168, classes/admin/emails/class-wc-notify-vendor.php:270, classes/admin/emails/class-wcv-admin-notify-application.php:130, classes/admin/emails/class-wcv-admin-notify-product.php:148, classes/admin/emails/class-wcv-admin-notify-shipped.php:137, classes/admin/emails/class-wcv-customer-notify-shipped.php:144, classes/admin/emails/class-wcv-vendor-notify-application.php:131, classes/admin/emails/class-wcv-vendor-notify-approved.php:140, classes/admin/emails/class-wcv-vendor-notify-denied.php:150, classes/admin/emails/class-wcv-vendor-notify-order.php:162
|
| 919 |
msgid "Enable this email notification"
|
| 920 |
msgstr ""
|
| 921 |
|
| 923 |
msgid "Enter recipients (comma separated) for this email. Defaults to <code>%s</code>."
|
| 924 |
msgstr ""
|
| 925 |
|
| 926 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:136, classes/admin/emails/class-wc-notify-admin.php:147, classes/admin/emails/class-wc-notify-shipped.php:172, classes/admin/emails/class-wc-notify-vendor.php:274, classes/admin/emails/class-wcv-admin-notify-application.php:142, classes/admin/emails/class-wcv-admin-notify-product.php:160, classes/admin/emails/class-wcv-admin-notify-shipped.php:149, classes/admin/emails/class-wcv-customer-notify-shipped.php:148, classes/admin/emails/class-wcv-vendor-notify-application.php:135, classes/admin/emails/class-wcv-vendor-notify-approved.php:144, classes/admin/emails/class-wcv-vendor-notify-denied.php:154, classes/admin/emails/class-wcv-vendor-notify-order.php:166
|
| 927 |
msgid "Subject"
|
| 928 |
msgstr ""
|
| 929 |
|
| 939 |
msgid "This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>."
|
| 940 |
msgstr ""
|
| 941 |
|
| 942 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:150, classes/admin/emails/class-wc-notify-admin.php:161, classes/admin/emails/class-wc-notify-shipped.php:186, classes/admin/emails/class-wc-notify-vendor.php:294, classes/admin/emails/class-wcv-admin-notify-application.php:172, classes/admin/emails/class-wcv-admin-notify-product.php:178, classes/admin/emails/class-wcv-admin-notify-shipped.php:167, classes/admin/emails/class-wcv-customer-notify-shipped.php:166, classes/admin/emails/class-wcv-vendor-notify-application.php:153, classes/admin/emails/class-wcv-vendor-notify-approved.php:171, classes/admin/emails/class-wcv-vendor-notify-denied.php:189, classes/admin/emails/class-wcv-vendor-notify-order.php:204
|
| 943 |
msgid "Email type"
|
| 944 |
msgstr ""
|
| 945 |
|
| 946 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:152, classes/admin/emails/class-wc-notify-admin.php:163, classes/admin/emails/class-wc-notify-shipped.php:188, classes/admin/emails/class-wc-notify-vendor.php:296, classes/admin/emails/class-wcv-admin-notify-application.php:174, classes/admin/emails/class-wcv-admin-notify-product.php:180, classes/admin/emails/class-wcv-admin-notify-shipped.php:169, classes/admin/emails/class-wcv-customer-notify-shipped.php:168, classes/admin/emails/class-wcv-vendor-notify-application.php:155, classes/admin/emails/class-wcv-vendor-notify-approved.php:173, classes/admin/emails/class-wcv-vendor-notify-denied.php:191, classes/admin/emails/class-wcv-vendor-notify-order.php:206
|
| 947 |
msgid "Choose which format of email to send."
|
| 948 |
msgstr ""
|
| 949 |
|
| 1047 |
msgid "%s application received"
|
| 1048 |
msgstr ""
|
| 1049 |
|
| 1050 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:134, classes/admin/emails/class-wcv-admin-notify-product.php:152, classes/admin/emails/class-wcv-admin-notify-shipped.php:141
|
| 1051 |
msgid "Recipient(s)"
|
| 1052 |
msgstr ""
|
| 1053 |
|
| 1054 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:136, classes/admin/emails/class-wcv-admin-notify-product.php:154, classes/admin/emails/class-wcv-admin-notify-shipped.php:143
|
| 1055 |
msgid "Enter recipients (comma separated) for this email. Defaults to %s."
|
| 1056 |
msgstr ""
|
| 1057 |
|
| 1072 |
#. translators: %s: list of placeholders
|
| 1073 |
#. translators: %s: list of placeholders
|
| 1074 |
#. translators: %s: list of placeholders
|
| 1075 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:146, classes/admin/emails/class-wcv-admin-notify-application.php:155, classes/admin/emails/class-wcv-admin-notify-product.php:164, classes/admin/emails/class-wcv-admin-notify-product.php:173, classes/admin/emails/class-wcv-admin-notify-shipped.php:153, classes/admin/emails/class-wcv-admin-notify-shipped.php:162, classes/admin/emails/class-wcv-customer-notify-shipped.php:152, classes/admin/emails/class-wcv-customer-notify-shipped.php:161, classes/admin/emails/class-wcv-vendor-notify-application.php:139, classes/admin/emails/class-wcv-vendor-notify-application.php:148, classes/admin/emails/class-wcv-vendor-notify-approved.php:148, classes/admin/emails/class-wcv-vendor-notify-approved.php:166, classes/admin/emails/class-wcv-vendor-notify-denied.php:158, classes/admin/emails/class-wcv-vendor-notify-denied.php:167, classes/admin/emails/class-wcv-vendor-notify-denied.php:184, classes/admin/emails/class-wcv-vendor-notify-order.php:170, classes/admin/emails/class-wcv-vendor-notify-order.php:179
|
| 1076 |
msgid "Available placeholders: %s"
|
| 1077 |
msgstr ""
|
| 1078 |
|
| 1079 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:151, classes/admin/emails/class-wcv-admin-notify-product.php:169, classes/admin/emails/class-wcv-admin-notify-shipped.php:158, classes/admin/emails/class-wcv-customer-notify-shipped.php:157, classes/admin/emails/class-wcv-vendor-notify-application.php:144, classes/admin/emails/class-wcv-vendor-notify-approved.php:162, classes/admin/emails/class-wcv-vendor-notify-denied.php:180, classes/admin/emails/class-wcv-vendor-notify-order.php:175
|
| 1080 |
msgid "Email heading"
|
| 1081 |
msgstr ""
|
| 1082 |
|
| 1083 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:160
|
| 1084 |
msgid "Notification"
|
| 1085 |
msgstr ""
|
| 1086 |
|
| 1087 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:162
|
| 1088 |
msgid "Choose when to be notified of an application."
|
| 1089 |
msgstr ""
|
| 1090 |
|
| 1091 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:166
|
| 1092 |
msgid "All Applications"
|
| 1093 |
msgstr ""
|
| 1094 |
|
| 1095 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:167
|
| 1096 |
msgid "Pending Applications"
|
| 1097 |
msgstr ""
|
| 1098 |
|
| 1224 |
msgid "New Customer Order"
|
| 1225 |
msgstr ""
|
| 1226 |
|
| 1227 |
+
#: classes/admin/emails/class-wcv-vendor-notify-order.php:184
|
| 1228 |
msgid "Totals Display"
|
| 1229 |
msgstr ""
|
| 1230 |
|
| 1231 |
+
#: classes/admin/emails/class-wcv-vendor-notify-order.php:186
|
| 1232 |
msgid "Choose how to display the product totals. Including commission or without or no totals at all."
|
| 1233 |
msgstr ""
|
| 1234 |
|
| 1235 |
+
#: classes/admin/emails/class-wcv-vendor-notify-order.php:190
|
| 1236 |
msgid "Both"
|
| 1237 |
msgstr ""
|
| 1238 |
|
| 1239 |
+
#: classes/admin/emails/class-wcv-vendor-notify-order.php:193
|
| 1240 |
msgid "None"
|
| 1241 |
msgstr ""
|
| 1242 |
|
| 1243 |
+
#: classes/admin/emails/class-wcv-vendor-notify-order.php:198
|
| 1244 |
msgid "Payment method"
|
| 1245 |
msgstr ""
|
| 1246 |
|
| 1247 |
+
#: classes/admin/emails/class-wcv-vendor-notify-order.php:200
|
| 1248 |
msgid "Include the payment method in the email"
|
| 1249 |
msgstr ""
|
| 1250 |
|
| 1720 |
msgstr ""
|
| 1721 |
|
| 1722 |
#: classes/admin/settings/class-wcv-settings-payments.php:82
|
| 1723 |
+
msgid "Instantly pay %1$s their commission when an order is made, and if a %1$s has a valid PayPal email added on their Shop Settings page."
|
| 1724 |
msgstr ""
|
| 1725 |
|
| 1726 |
#: classes/admin/settings/class-wcv-settings-payments.php:89
|
| 2007 |
msgid "Item Meta"
|
| 2008 |
msgstr ""
|
| 2009 |
|
| 2010 |
+
#: classes/front/orders/class-orders.php:57, classes/front/orders/class-orders.php:123
|
| 2011 |
msgid "You haven't selected a product's orders to view! Please go back to the %s Dashboard and click Show Orders on the product you'd like to view."
|
| 2012 |
msgstr ""
|
| 2013 |
|
| 2014 |
+
#: classes/front/orders/class-orders.php:80, classes/front/orders/class-orders.php:146
|
| 2015 |
msgid "No orders."
|
| 2016 |
msgstr ""
|
| 2017 |
|
| 2018 |
+
#: classes/front/orders/class-orders.php:207
|
| 2019 |
msgid "Product Title"
|
| 2020 |
msgstr ""
|
| 2021 |
|
| 2022 |
+
#: classes/front/orders/class-orders.php:208
|
| 2023 |
msgid "Full name"
|
| 2024 |
msgstr ""
|
| 2025 |
|
| 2026 |
+
#: classes/front/orders/class-orders.php:209
|
| 2027 |
msgid "Address"
|
| 2028 |
msgstr ""
|
| 2029 |
|
| 2030 |
+
#: classes/front/orders/class-orders.php:210
|
| 2031 |
msgid "City"
|
| 2032 |
msgstr ""
|
| 2033 |
|
| 2034 |
+
#: classes/front/orders/class-orders.php:211
|
| 2035 |
msgid "State"
|
| 2036 |
msgstr ""
|
| 2037 |
|
| 2038 |
+
#: classes/front/orders/class-orders.php:212
|
| 2039 |
msgid "Zip"
|
| 2040 |
msgstr ""
|
| 2041 |
|
| 2042 |
+
#: classes/front/orders/class-orders.php:213, classes/admin/views/setup/ready.php:23
|
| 2043 |
msgid "Email address"
|
| 2044 |
msgstr ""
|
| 2045 |
|
| 2051 |
msgid "Success. The customer has been notified of your comment."
|
| 2052 |
msgstr ""
|
| 2053 |
|
| 2054 |
+
#: classes/front/signup/class-vendor-signup.php:82
|
| 2055 |
msgid "ERROR"
|
| 2056 |
msgstr ""
|
| 2057 |
|
| 2058 |
+
#: classes/front/signup/class-vendor-signup.php:101
|
| 2059 |
msgid "Application denied. You are an administrator."
|
| 2060 |
msgstr ""
|
| 2061 |
|
| 2062 |
+
#: classes/front/signup/class-vendor-signup.php:103
|
| 2063 |
msgid "Your application has been submitted."
|
| 2064 |
msgstr ""
|
| 2065 |
|
| 2066 |
+
#: classes/front/signup/class-vendor-signup.php:150, classes/front/signup/class-vendor-signup.php:187, classes/front/signup/class-vendor-signup.php:199
|
| 2067 |
msgid "You must accept the terms and conditions to become a vendor."
|
| 2068 |
msgstr ""
|
| 2069 |
|
| 2357 |
msgstr ""
|
| 2358 |
|
| 2359 |
#: classes/admin/views/notices/html-notice-updating.php:12
|
| 2360 |
+
msgid "Your database is being updated in the background. "
|
| 2361 |
msgstr ""
|
| 2362 |
|
| 2363 |
#: classes/admin/views/notices/html-notice-updating.php:12
|
package-lock.json
CHANGED
|
@@ -422,7 +422,7 @@
|
|
| 422 |
"integrity": "sha1-OciRjO/1eZ+D+UkqhI9iWt0Mdm8=",
|
| 423 |
"dev": true,
|
| 424 |
"requires": {
|
| 425 |
-
"hoek": "2.
|
| 426 |
}
|
| 427 |
},
|
| 428 |
"brace-expansion": {
|
|
@@ -2932,13 +2932,13 @@
|
|
| 2932 |
"requires": {
|
| 2933 |
"boom": "2.10.1",
|
| 2934 |
"cryptiles": "2.0.5",
|
| 2935 |
-
"hoek": "2.
|
| 2936 |
"sntp": "1.0.9"
|
| 2937 |
}
|
| 2938 |
},
|
| 2939 |
"hoek": {
|
| 2940 |
-
"version": "2.
|
| 2941 |
-
"resolved": "https://registry.npmjs.org/hoek/-/hoek-2.
|
| 2942 |
"integrity": "sha1-ILt0A9POo5jpHcRxCo/xuCdKJe0=",
|
| 2943 |
"dev": true
|
| 2944 |
},
|
|
@@ -5181,7 +5181,7 @@
|
|
| 5181 |
"integrity": "sha1-ZUEYTMkK7qbG57NeJlkIJEPGYZg=",
|
| 5182 |
"dev": true,
|
| 5183 |
"requires": {
|
| 5184 |
-
"hoek": "2.
|
| 5185 |
}
|
| 5186 |
},
|
| 5187 |
"source-map": {
|
| 422 |
"integrity": "sha1-OciRjO/1eZ+D+UkqhI9iWt0Mdm8=",
|
| 423 |
"dev": true,
|
| 424 |
"requires": {
|
| 425 |
+
"hoek": "4.2.1"
|
| 426 |
}
|
| 427 |
},
|
| 428 |
"brace-expansion": {
|
| 2932 |
"requires": {
|
| 2933 |
"boom": "2.10.1",
|
| 2934 |
"cryptiles": "2.0.5",
|
| 2935 |
+
"hoek": "4.2.1",
|
| 2936 |
"sntp": "1.0.9"
|
| 2937 |
}
|
| 2938 |
},
|
| 2939 |
"hoek": {
|
| 2940 |
+
"version": "4.2.1",
|
| 2941 |
+
"resolved": "https://registry.npmjs.org/hoek/-/hoek-4.2.1.tgz",
|
| 2942 |
"integrity": "sha1-ILt0A9POo5jpHcRxCo/xuCdKJe0=",
|
| 2943 |
"dev": true
|
| 2944 |
},
|
| 5181 |
"integrity": "sha1-ZUEYTMkK7qbG57NeJlkIJEPGYZg=",
|
| 5182 |
"dev": true,
|
| 5183 |
"requires": {
|
| 5184 |
+
"hoek": "4.2.1"
|
| 5185 |
}
|
| 5186 |
},
|
| 5187 |
"source-map": {
|
readme.txt
CHANGED
|
@@ -7,7 +7,7 @@ Plugin URI: https://www.wcvendors.com/
|
|
| 7 |
Requires at least: 4.4.0
|
| 8 |
Requires PHP: 5.6
|
| 9 |
Tested up to: 4.9.5
|
| 10 |
-
Stable tag: 2.0.
|
| 11 |
License: GPLv2 or later
|
| 12 |
|
| 13 |
The free marketplace plugin for WooCommerce. Now you can allow anyone to open a store on your WooCommerce site!
|
|
@@ -142,6 +142,34 @@ WC Vendors does not work with multisite WordPress. There are no plans to support
|
|
| 142 |
|
| 143 |
== Changelog ==
|
| 144 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 145 |
= Version 2.0.3 - 18th May 2018 =
|
| 146 |
|
| 147 |
* Added: Export Commission Sum Totals
|
| 7 |
Requires at least: 4.4.0
|
| 8 |
Requires PHP: 5.6
|
| 9 |
Tested up to: 4.9.5
|
| 10 |
+
Stable tag: 2.0.5
|
| 11 |
License: GPLv2 or later
|
| 12 |
|
| 13 |
The free marketplace plugin for WooCommerce. Now you can allow anyone to open a store on your WooCommerce site!
|
| 142 |
|
| 143 |
== Changelog ==
|
| 144 |
|
| 145 |
+
= Version 2.0.5 - 21 May 2018 =
|
| 146 |
+
|
| 147 |
+
* Updated: Legacy WooCommerce calls
|
| 148 |
+
* Updated: Changed how options are retrieved from the database
|
| 149 |
+
* Fixed: Customer details not filtered on WP Admin orders screen #413
|
| 150 |
+
* Fixed: Customer details not filtered on emails #411
|
| 151 |
+
* Fixed: Totals display in vendor order notification emails
|
| 152 |
+
* Fixed: Duplicate new product admin notification emails
|
| 153 |
+
* Fixed: New product admin notification email trigger not working
|
| 154 |
+
* Fixed: Username placeholder in vendor application email
|
| 155 |
+
* Fixed: Vendor Sold By name is not appearing on customer order #412
|
| 156 |
+
* Fixed: Update dialog is stuck #409
|
| 157 |
+
* Fixed: Order capabilities not working #410
|
| 158 |
+
* Fixed: Incorrect label in emails
|
| 159 |
+
|
| 160 |
+
Templates Added:
|
| 161 |
+
templates/emails/plain/vendor-order-addresses.php
|
| 162 |
+
templates/emails/vendor-order-addresses.php
|
| 163 |
+
|
| 164 |
+
Templates Updated:
|
| 165 |
+
templates/dashboard/dashboard/orders.php
|
| 166 |
+
templates/emails/plain/vendor-order-details.php
|
| 167 |
+
templates/emails/vendor-order-details.php
|
| 168 |
+
|
| 169 |
+
= Version 2.0.4 - 18th May 2018 =
|
| 170 |
+
|
| 171 |
+
* Fixed: Critical commission calculation error
|
| 172 |
+
|
| 173 |
= Version 2.0.3 - 18th May 2018 =
|
| 174 |
|
| 175 |
* Added: Export Commission Sum Totals
|
templates/dashboard/date-picker.php
CHANGED
|
@@ -5,7 +5,7 @@
|
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/date-picker.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
-
* @package WCVendors/Templates/
|
| 9 |
* @version 2.0.0
|
| 10 |
|
| 11 |
*/
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/date-picker.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
+
* @package WCVendors/Templates/dashboard
|
| 9 |
* @version 2.0.0
|
| 10 |
|
| 11 |
*/
|
templates/dashboard/denied.php
CHANGED
|
@@ -5,7 +5,7 @@
|
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/denied.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
-
* @package WCVendors/Templates/
|
| 9 |
* @version 2.0.0
|
| 10 |
|
| 11 |
*/
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/denied.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
+
* @package WCVendors/Templates/dashboard
|
| 9 |
* @version 2.0.0
|
| 10 |
|
| 11 |
*/
|
templates/dashboard/links.php
CHANGED
|
@@ -5,7 +5,7 @@
|
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/links.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
-
* @package WCVendors/Templates/
|
| 9 |
* @version 2.0.0
|
| 10 |
|
| 11 |
*/
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/links.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
+
* @package WCVendors/Templates/dashboard
|
| 9 |
* @version 2.0.0
|
| 10 |
|
| 11 |
*/
|
templates/dashboard/orders.php
CHANGED
|
@@ -5,8 +5,8 @@
|
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/orders.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
-
* @package WCVendors/Templates/
|
| 9 |
-
* @version 2.0.
|
| 10 |
|
| 11 |
*/
|
| 12 |
|
|
@@ -40,7 +40,6 @@ jQuery(function () {
|
|
| 40 |
|
| 41 |
<h2><?php _e( 'Orders', 'wc-vendors' ); ?></h2>
|
| 42 |
|
| 43 |
-
<?php global $woocommerce; ?>
|
| 44 |
|
| 45 |
<?php if ( function_exists( 'wc_print_notices' ) ) { wc_print_notices(); } ?>
|
| 46 |
|
|
@@ -48,7 +47,9 @@ jQuery(function () {
|
|
| 48 |
<thead>
|
| 49 |
<tr>
|
| 50 |
<th class="product-header"><?php _e( 'Order', 'wc-vendors' ); ?></th>
|
|
|
|
| 51 |
<th class="quantity-header"><?php _e( 'Shipping', 'wc-vendors' ) ?></th>
|
|
|
|
| 52 |
<th class="commission-header"><?php _e( 'Total', 'wc-vendors' ) ?></th>
|
| 53 |
<th class="rate-header"><?php _e( 'Date', 'wc-vendors' ) ?></th>
|
| 54 |
<th class="rate-header"><?php _e( 'Links', 'wc-vendors' ) ?></th>
|
|
@@ -62,7 +63,7 @@ jQuery(function () {
|
|
| 62 |
<?php foreach ( $order_summary as $order ) :
|
| 63 |
|
| 64 |
$order = wc_get_order( $order->order_id );
|
| 65 |
-
$order_id =
|
| 66 |
$valid_items = WCV_Queries::get_products_for_order( $order_id );
|
| 67 |
$valid = array();
|
| 68 |
$needs_shipping = false;
|
|
@@ -82,13 +83,15 @@ jQuery(function () {
|
|
| 82 |
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 83 |
$shipped = in_array($user_id, $shippers);
|
| 84 |
|
| 85 |
-
$order_date =
|
| 86 |
|
| 87 |
?>
|
| 88 |
|
| 89 |
<tr id="order-<?php echo $order_id; ?>" data-order-id="<?php echo $order_id; ?>">
|
| 90 |
<td><?php echo $order->get_order_number(); ?></td>
|
| 91 |
-
|
|
|
|
|
|
|
| 92 |
<td><?php $sum = WCV_Queries::sum_for_orders( array( $order_id ), array('vendor_id'=>get_current_user_id()) ); $total = $sum[0]->line_total; $totals += $total; echo wc_price( $total ); ?></td>
|
| 93 |
<td><?php echo date_i18n( wc_date_format(), strtotime( $order_date ) ); ?></td>
|
| 94 |
<td>
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/orders.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
+
* @package WCVendors/Templates/dashboard/
|
| 9 |
+
* @version 2.0.5
|
| 10 |
|
| 11 |
*/
|
| 12 |
|
| 40 |
|
| 41 |
<h2><?php _e( 'Orders', 'wc-vendors' ); ?></h2>
|
| 42 |
|
|
|
|
| 43 |
|
| 44 |
<?php if ( function_exists( 'wc_print_notices' ) ) { wc_print_notices(); } ?>
|
| 45 |
|
| 47 |
<thead>
|
| 48 |
<tr>
|
| 49 |
<th class="product-header"><?php _e( 'Order', 'wc-vendors' ); ?></th>
|
| 50 |
+
<?php if ( $can_view_address ) : ?>
|
| 51 |
<th class="quantity-header"><?php _e( 'Shipping', 'wc-vendors' ) ?></th>
|
| 52 |
+
<?php endif; ?>
|
| 53 |
<th class="commission-header"><?php _e( 'Total', 'wc-vendors' ) ?></th>
|
| 54 |
<th class="rate-header"><?php _e( 'Date', 'wc-vendors' ) ?></th>
|
| 55 |
<th class="rate-header"><?php _e( 'Links', 'wc-vendors' ) ?></th>
|
| 63 |
<?php foreach ( $order_summary as $order ) :
|
| 64 |
|
| 65 |
$order = wc_get_order( $order->order_id );
|
| 66 |
+
$order_id = $order->get_id();
|
| 67 |
$valid_items = WCV_Queries::get_products_for_order( $order_id );
|
| 68 |
$valid = array();
|
| 69 |
$needs_shipping = false;
|
| 83 |
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 84 |
$shipped = in_array($user_id, $shippers);
|
| 85 |
|
| 86 |
+
$order_date = $order->get_date_created();
|
| 87 |
|
| 88 |
?>
|
| 89 |
|
| 90 |
<tr id="order-<?php echo $order_id; ?>" data-order-id="<?php echo $order_id; ?>">
|
| 91 |
<td><?php echo $order->get_order_number(); ?></td>
|
| 92 |
+
<?php if ( $can_view_address ) : ?>
|
| 93 |
+
<td><?php echo apply_filters( 'wcvendors_dashboard_google_maps_link', '<a target="_blank" href="' . esc_url( 'http://maps.google.com/maps?&q=' . urlencode( esc_html( preg_replace( '#<br\s*/?>#i', ', ', $order->get_formatted_shipping_address() ) ) ) . '&z=16' ) . '">'. esc_html( preg_replace( '#<br\s*/?>#i', ', ', $order->get_formatted_shipping_address() ) ) .'</a>' ); ?></td>
|
| 94 |
+
<?php endif; ?>
|
| 95 |
<td><?php $sum = WCV_Queries::sum_for_orders( array( $order_id ), array('vendor_id'=>get_current_user_id()) ); $total = $sum[0]->line_total; $totals += $total; echo wc_price( $total ); ?></td>
|
| 96 |
<td><?php echo date_i18n( wc_date_format(), strtotime( $order_date ) ); ?></td>
|
| 97 |
<td>
|
templates/dashboard/reports.php
CHANGED
|
@@ -5,7 +5,7 @@
|
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/reports.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
-
* @package WCVendors/Templates/
|
| 9 |
* @version 2.0.0
|
| 10 |
|
| 11 |
*/
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/dashboard/reports.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
+
* @package WCVendors/Templates/dashboard
|
| 9 |
* @version 2.0.0
|
| 10 |
|
| 11 |
*/
|
templates/emails/plain/vendor-notify-order.php
CHANGED
|
@@ -16,7 +16,7 @@ if ( ! defined( 'ABSPATH' ) ) {
|
|
| 16 |
|
| 17 |
echo "= " . $email_heading . " =\n\n";
|
| 18 |
|
| 19 |
-
echo sprintf( __( 'You have received an order from %s.', 'wc-vendors' ), $
|
| 20 |
|
| 21 |
echo "=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=\n\n";
|
| 22 |
|
|
@@ -25,7 +25,7 @@ do_action( 'wcvendors_email_order_details', $order, $sent_to_admin, $plain_text,
|
|
| 25 |
|
| 26 |
echo "\n=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=\n\n";
|
| 27 |
|
| 28 |
-
do_action( '
|
| 29 |
|
| 30 |
echo "\n=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=\n\n";
|
| 31 |
|
| 16 |
|
| 17 |
echo "= " . $email_heading . " =\n\n";
|
| 18 |
|
| 19 |
+
echo sprintf( __( 'You have received an order from %s.', 'wc-vendors' ), $customer_name ) . "\n\n";
|
| 20 |
|
| 21 |
echo "=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=\n\n";
|
| 22 |
|
| 25 |
|
| 26 |
echo "\n=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=\n\n";
|
| 27 |
|
| 28 |
+
do_action( 'wcvendors_email_customer_details', $order, $sent_to_admin, $plain_text, $email );
|
| 29 |
|
| 30 |
echo "\n=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=\n\n";
|
| 31 |
|
templates/emails/plain/vendor-order-addresses.php
ADDED
|
@@ -0,0 +1,50 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Vendor Order Customer Details
|
| 4 |
+
*
|
| 5 |
+
* This template can be overridden by copying it to yourtheme/woocommerce/emails/plain/vendor-order-addresses.php.
|
| 6 |
+
*
|
| 7 |
+
*
|
| 8 |
+
* @author Jamie Madden, WC Vendors
|
| 9 |
+
* @package WCVendors/Templates/Emails/Plain
|
| 10 |
+
* @version 2.0.5
|
| 11 |
+
*/
|
| 12 |
+
|
| 13 |
+
if ( ! defined( 'ABSPATH' ) ) {
|
| 14 |
+
exit;
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
if ( $show_customer_name ){
|
| 18 |
+
echo esc_html( $customer_name ). "\n";
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
if ( $show_shipping_address ) {
|
| 22 |
+
echo "\n" . esc_html( wc_strtoupper( __( 'Billing address', 'wc-vendors' ) ) ) . "\n\n";
|
| 23 |
+
echo preg_replace( '#<br\s*/?>#i', "\n", $order->get_formatted_billing_address() ) . "\n"; // WPCS: XSS ok.
|
| 24 |
+
}
|
| 25 |
+
if ( $show_customer_phone ) {
|
| 26 |
+
if ( $order->get_billing_phone() ) {
|
| 27 |
+
echo $order->get_billing_phone() . "\n"; // WPCS: XSS ok.
|
| 28 |
+
}
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
if ( $show_customer_email ) {
|
| 32 |
+
if ( $order->get_billing_email() ) {
|
| 33 |
+
echo $order->get_billing_email() . "\n"; // WPCS: XSS ok.
|
| 34 |
+
}
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
if ( $show_shipping_address ) {
|
| 38 |
+
if ( $show_customer_name ){
|
| 39 |
+
echo esc_html( $customer_name ). "\n";
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
if ( ! wc_ship_to_billing_address_only() && $order->needs_shipping_address() ) {
|
| 43 |
+
$shipping = $order->get_formatted_shipping_address();
|
| 44 |
+
|
| 45 |
+
if ( $shipping ) {
|
| 46 |
+
echo "\n" . esc_html( wc_strtoupper( __( 'Shipping address', 'wc-vendors' ) ) ) . "\n\n";
|
| 47 |
+
echo preg_replace( '#<br\s*/?>#i', "\n", $shipping ) . "\n"; // WPCS: XSS ok.
|
| 48 |
+
}
|
| 49 |
+
}
|
| 50 |
+
}
|
templates/emails/vendor-new-order.php
CHANGED
|
@@ -1,6 +1,6 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
-
* DEPRECATED
|
| 4 |
* Vendor new order email
|
| 5 |
*
|
| 6 |
* @author WC Vendors
|
|
@@ -9,11 +9,11 @@
|
|
| 9 |
*/
|
| 10 |
if ( ! defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 11 |
|
| 12 |
-
$billing_first_name =
|
| 13 |
-
$billing_last_name =
|
| 14 |
-
$billing_email =
|
| 15 |
-
$billing_phone =
|
| 16 |
-
$order_date =
|
| 17 |
|
| 18 |
?>
|
| 19 |
|
|
@@ -35,27 +35,13 @@ $order_date = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->order_da
|
|
| 35 |
</thead>
|
| 36 |
<tbody>
|
| 37 |
<?php
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
'plain_text' => false,
|
| 46 |
-
'sent_to_admin' => false
|
| 47 |
-
) );
|
| 48 |
-
|
| 49 |
-
} else {
|
| 50 |
-
echo wc_get_email_order_items( $order, array(
|
| 51 |
-
'show_sku' => true,
|
| 52 |
-
'show_image' => false,
|
| 53 |
-
'image_size' => array( 32, 32 ),
|
| 54 |
-
'plain_text' => false,
|
| 55 |
-
'sent_to_admin' => false,
|
| 56 |
-
) );
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
?>
|
| 60 |
</tbody>
|
| 61 |
<tfoot>
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
+
* DEPRECATED
|
| 4 |
* Vendor new order email
|
| 5 |
*
|
| 6 |
* @author WC Vendors
|
| 9 |
*/
|
| 10 |
if ( ! defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 11 |
|
| 12 |
+
$billing_first_name = $order->get_billing_first_name();
|
| 13 |
+
$billing_last_name = $order->get_billing_last_name();
|
| 14 |
+
$billing_email = $order->get_billing_email();
|
| 15 |
+
$billing_phone = $order->get_billing_phone();
|
| 16 |
+
$order_date = $order->get_date_created();
|
| 17 |
|
| 18 |
?>
|
| 19 |
|
| 35 |
</thead>
|
| 36 |
<tbody>
|
| 37 |
<?php
|
| 38 |
+
echo wc_get_email_order_items( $order, array(
|
| 39 |
+
'show_sku' => true,
|
| 40 |
+
'show_image' => false,
|
| 41 |
+
'image_size' => array( 32, 32 ),
|
| 42 |
+
'plain_text' => false,
|
| 43 |
+
'sent_to_admin' => false,
|
| 44 |
+
) );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 45 |
?>
|
| 46 |
</tbody>
|
| 47 |
<tfoot>
|
templates/emails/vendor-notify-order.php
CHANGED
|
@@ -7,7 +7,7 @@
|
|
| 7 |
*
|
| 8 |
* @author Jamie Madden, WC Vendors
|
| 9 |
* @package WCVendors/Templates/Emails
|
| 10 |
-
* @version 2.0.
|
| 11 |
*/
|
| 12 |
|
| 13 |
if ( ! defined( 'ABSPATH' ) ) {
|
|
@@ -19,12 +19,12 @@
|
|
| 19 |
*/
|
| 20 |
do_action( 'woocommerce_email_header', $email_heading, $email ); ?>
|
| 21 |
|
| 22 |
-
<p><?php
|
| 23 |
|
| 24 |
<?php
|
| 25 |
|
| 26 |
do_action( 'wcvendors_email_order_details', $order, $vendor_items, $totals_display, $vendor_id, $sent_to_vendor, $sent_to_admin, $plain_text, $email );
|
| 27 |
|
| 28 |
-
do_action( '
|
| 29 |
|
| 30 |
do_action( 'woocommerce_email_footer', $email );
|
| 7 |
*
|
| 8 |
* @author Jamie Madden, WC Vendors
|
| 9 |
* @package WCVendors/Templates/Emails
|
| 10 |
+
* @version 2.0.5
|
| 11 |
*/
|
| 12 |
|
| 13 |
if ( ! defined( 'ABSPATH' ) ) {
|
| 19 |
*/
|
| 20 |
do_action( 'woocommerce_email_header', $email_heading, $email ); ?>
|
| 21 |
|
| 22 |
+
<p><?php _e( 'You have received an order. The order is as follows:', 'wc-vendors' ); ?></p>
|
| 23 |
|
| 24 |
<?php
|
| 25 |
|
| 26 |
do_action( 'wcvendors_email_order_details', $order, $vendor_items, $totals_display, $vendor_id, $sent_to_vendor, $sent_to_admin, $plain_text, $email );
|
| 27 |
|
| 28 |
+
do_action( 'wcvendors_email_customer_details', $order, $sent_to_admin, $plain_text, $email );
|
| 29 |
|
| 30 |
do_action( 'woocommerce_email_footer', $email );
|
templates/emails/vendor-order-addresses.php
ADDED
|
@@ -0,0 +1,56 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Vendor Order Customer Details
|
| 4 |
+
*
|
| 5 |
+
* This template can be overridden by copying it to yourtheme/woocommerce/emails/vendor-order-addresses.php.
|
| 6 |
+
*
|
| 7 |
+
*
|
| 8 |
+
* @author Jamie Madden, WC Vendors
|
| 9 |
+
* @package WCVendors/Templates/Emails
|
| 10 |
+
* @version 2.0.5
|
| 11 |
+
*/
|
| 12 |
+
|
| 13 |
+
if ( ! defined( 'ABSPATH' ) ) {
|
| 14 |
+
exit;
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
$text_align = is_rtl() ? 'right' : 'left';
|
| 18 |
+
|
| 19 |
+
?><table id="addresses" cellspacing="0" cellpadding="0" style="width: 100%; vertical-align: top; margin-bottom: 40px; padding:0;" border="0">
|
| 20 |
+
<tr>
|
| 21 |
+
<td style="text-align:<?php echo $text_align; ?>; font-family: 'Helvetica Neue', Helvetica, Roboto, Arial, sans-serif; border:0; padding:0;" valign="top" width="50%">
|
| 22 |
+
<?php if ( $show_billing_address ) : ?>
|
| 23 |
+
<h2><?php _e( 'Billing address', 'wc-vendors' ); ?></h2>
|
| 24 |
+
|
| 25 |
+
<address class="address">
|
| 26 |
+
<?php if ( $show_customer_name ) : ?>
|
| 27 |
+
<?php echo esc_html( $customer_name ); ?><br/>
|
| 28 |
+
<?php endif; ?>
|
| 29 |
+
<?php echo ( $address = $order->get_formatted_billing_address() ) ? $address : __( 'N/A', 'wc-vendors' ); ?>
|
| 30 |
+
<?php if ( $show_customer_phone ) : ?>
|
| 31 |
+
<?php if ( $order->get_billing_phone() ) : ?>
|
| 32 |
+
<br/><?php echo esc_html( $order->get_billing_phone() ); ?>
|
| 33 |
+
<?php endif; ?>
|
| 34 |
+
<?php endif; ?>
|
| 35 |
+
<?php if ( $show_customer_email ) : ?>
|
| 36 |
+
<?php if ( $order->get_billing_email() ) : ?>
|
| 37 |
+
<p><?php echo esc_html( $order->get_billing_email() ); ?></p>
|
| 38 |
+
<?php endif; ?>
|
| 39 |
+
<?php endif; ?>
|
| 40 |
+
</address>
|
| 41 |
+
<?php endif; ?>
|
| 42 |
+
</td>
|
| 43 |
+
<?php if ( $show_shipping_address ) : ?>
|
| 44 |
+
<?php if ( ! wc_ship_to_billing_address_only() && $order->needs_shipping_address() && ( $shipping = $order->get_formatted_shipping_address() ) ) : ?>
|
| 45 |
+
<td style="text-align:<?php echo $text_align; ?>; font-family: 'Helvetica Neue', Helvetica, Roboto, Arial, sans-serif; padding:0;" valign="top" width="50%">
|
| 46 |
+
<h2><?php _e( 'Shipping address', 'wc-vendors' ); ?></h2>
|
| 47 |
+
<?php if ( $show_customer_name ) : ?>
|
| 48 |
+
<?php echo esc_html( $customer_name ); ?>
|
| 49 |
+
<?php endif; ?>
|
| 50 |
+
|
| 51 |
+
<address class="address"><?php echo $shipping; ?></address>
|
| 52 |
+
</td>
|
| 53 |
+
<?php endif; ?>
|
| 54 |
+
<?php endif; ?>
|
| 55 |
+
</tr>
|
| 56 |
+
</table>
|
templates/orders/orders.php
CHANGED
|
@@ -5,7 +5,7 @@
|
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/orders/orders.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
-
* @package WCVendors/Templates/
|
| 9 |
* @version 2.0.0
|
| 10 |
*/
|
| 11 |
|
| 5 |
* This template can be overridden by copying it to yourtheme/wc-vendors/orders/orders.php
|
| 6 |
*
|
| 7 |
* @author Jamie Madden, WC Vendors
|
| 8 |
+
* @package WCVendors/Templates/Orders
|
| 9 |
* @version 2.0.0
|
| 10 |
*/
|
| 11 |
|
templates/orders/table-body.php
CHANGED
|
@@ -6,7 +6,7 @@
|
|
| 6 |
*
|
| 7 |
*
|
| 8 |
* @author WC Vendors
|
| 9 |
-
* @package WCVendors/Templates/
|
| 10 |
* @version 2.0.0
|
| 11 |
*/
|
| 12 |
|
| 6 |
*
|
| 7 |
*
|
| 8 |
* @author WC Vendors
|
| 9 |
+
* @package WCVendors/Templates/Orders/
|
| 10 |
* @version 2.0.0
|
| 11 |
*/
|
| 12 |
|
trunk/assets/banner-1544x500.png
DELETED
|
Binary file
|
trunk/assets/banner-772x250.png
DELETED
|
Binary file
|
trunk/assets/css/_variables.scss
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* WooCommerce CSS Variables
|
| 3 |
-
*/
|
| 4 |
-
|
| 5 |
-
$wcvendors: #005580;
|
| 6 |
-
$wcvendors-light: #5897b6;
|
| 7 |
-
$green: #7ad03a;
|
| 8 |
-
$red: #a00;
|
| 9 |
-
$orange: #ffba00;
|
| 10 |
-
$blue: #2ea2cc;
|
| 11 |
-
|
| 12 |
-
$primary: #a46497; // Primary color for buttons (alt)
|
| 13 |
-
$primarytext: desaturate(lighten($primary, 50%), 18%); // Text on primary color bg
|
| 14 |
-
|
| 15 |
-
$secondary: desaturate(lighten($primary, 40%), 21%); // Secondary buttons
|
| 16 |
-
$secondarytext: desaturate(darken($secondary, 60%), 21%); // Text on secondary color bg
|
| 17 |
-
|
| 18 |
-
$highlight: adjust-hue($primary, 150deg); // Prices, In stock labels, sales flash
|
| 19 |
-
$highlightext: desaturate(lighten($highlight, 50%), 18%); // Text on highlight color bg
|
| 20 |
-
|
| 21 |
-
$contentbg: #fff; // Content BG - Tabs (active state)
|
| 22 |
-
$subtext: #777; // small, breadcrumbs etc
|
| 23 |
-
$white: #fff;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/css/admin-orders.css
DELETED
|
@@ -1,7 +0,0 @@
|
|
| 1 |
-
.wp-list-table .column-order_id { width: 10%; }
|
| 2 |
-
.wp-list-table .column-customer { width: 15%; }
|
| 3 |
-
.wp-list-table .column-product { width: 35%; }
|
| 4 |
-
.wp-list-table .column-total { width: 10%;}
|
| 5 |
-
/*.wp-list-table .column-comments { width: 27.5%;}*/
|
| 6 |
-
.wp-list-table .column-date { width: 15%;}
|
| 7 |
-
.wp-list-table .column-status { width: 15%;}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/css/select2.min.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.select2-container{box-sizing:border-box;display:inline-block;margin:0;position:relative;vertical-align:middle}.select2-container .select2-selection--single{box-sizing:border-box;cursor:pointer;display:block;height:28px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--single .select2-selection__rendered{display:block;padding-left:8px;padding-right:20px;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-selection--single .select2-selection__clear{position:relative}.select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered{padding-right:8px;padding-left:20px}.select2-container .select2-selection--multiple{box-sizing:border-box;cursor:pointer;display:block;min-height:32px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--multiple .select2-selection__rendered{display:inline-block;overflow:hidden;padding-left:8px;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-search--inline{float:left}.select2-container .select2-search--inline .select2-search__field{box-sizing:border-box;border:none;font-size:100%;margin-top:5px;padding:0}.select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-dropdown{background-color:white;border:1px solid #aaa;border-radius:4px;box-sizing:border-box;display:block;position:absolute;left:-100000px;width:100%;z-index:1051}.select2-results{display:block}.select2-results__options{list-style:none;margin:0;padding:0}.select2-results__option{padding:6px;user-select:none;-webkit-user-select:none}.select2-results__option[aria-selected]{cursor:pointer}.select2-container--open .select2-dropdown{left:0}.select2-container--open .select2-dropdown--above{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--open .select2-dropdown--below{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-search--dropdown{display:block;padding:4px}.select2-search--dropdown .select2-search__field{padding:4px;width:100%;box-sizing:border-box}.select2-search--dropdown .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-search--dropdown.select2-search--hide{display:none}.select2-close-mask{border:0;margin:0;padding:0;display:block;position:fixed;left:0;top:0;min-height:100%;min-width:100%;height:auto;width:auto;opacity:0;z-index:99;background-color:#fff;filter:alpha(opacity=0)}.select2-hidden-accessible{border:0 !important;clip:rect(0 0 0 0) !important;height:1px !important;margin:-1px !important;overflow:hidden !important;padding:0 !important;position:absolute !important;width:1px !important}.select2-container--default .select2-selection--single{background-color:#fff;border:1px solid #aaa;border-radius:4px}.select2-container--default .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--default .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold}.select2-container--default .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--default .select2-selection--single .select2-selection__arrow{height:26px;position:absolute;top:1px;right:1px;width:20px}.select2-container--default .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow{left:1px;right:auto}.select2-container--default.select2-container--disabled .select2-selection--single{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear{display:none}.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--default .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text}.select2-container--default .select2-selection--multiple .select2-selection__rendered{box-sizing:border-box;list-style:none;margin:0;padding:0 5px;width:100%}.select2-container--default .select2-selection--multiple .select2-selection__rendered li{list-style:none}.select2-container--default .select2-selection--multiple .select2-selection__placeholder{color:#999;margin-top:5px;float:left}.select2-container--default .select2-selection--multiple .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-top:5px;margin-right:10px}.select2-container--default .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove{color:#999;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover{color:#333}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__placeholder,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline{float:right}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--default.select2-container--focus .select2-selection--multiple{border:solid black 1px;outline:0}.select2-container--default.select2-container--disabled .select2-selection--multiple{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection__choice__remove{display:none}.select2-container--default.select2-container--open.select2-container--above .select2-selection--single,.select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple{border-top-left-radius:0;border-top-right-radius:0}.select2-container--default.select2-container--open.select2-container--below .select2-selection--single,.select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--default .select2-search--dropdown .select2-search__field{border:1px solid #aaa}.select2-container--default .select2-search--inline .select2-search__field{background:transparent;border:none;outline:0;box-shadow:none;-webkit-appearance:textfield}.select2-container--default .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--default .select2-results__option[role=group]{padding:0}.select2-container--default .select2-results__option[aria-disabled=true]{color:#999}.select2-container--default .select2-results__option[aria-selected=true]{background-color:#ddd}.select2-container--default .select2-results__option .select2-results__option{padding-left:1em}.select2-container--default .select2-results__option .select2-results__option .select2-results__group{padding-left:0}.select2-container--default .select2-results__option .select2-results__option .select2-results__option{margin-left:-1em;padding-left:2em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-2em;padding-left:3em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-3em;padding-left:4em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-4em;padding-left:5em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-5em;padding-left:6em}.select2-container--default .select2-results__option--highlighted[aria-selected]{background-color:#5897fb;color:white}.select2-container--default .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic .select2-selection--single{background-color:#f7f7f7;border:1px solid #aaa;border-radius:4px;outline:0;background-image:-webkit-linear-gradient(top, #fff 50%, #eee 100%);background-image:-o-linear-gradient(top, #fff 50%, #eee 100%);background-image:linear-gradient(to bottom, #fff 50%, #eee 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic .select2-selection--single:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--classic .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-right:10px}.select2-container--classic .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--classic .select2-selection--single .select2-selection__arrow{background-color:#ddd;border:none;border-left:1px solid #aaa;border-top-right-radius:4px;border-bottom-right-radius:4px;height:26px;position:absolute;top:1px;right:1px;width:20px;background-image:-webkit-linear-gradient(top, #eee 50%, #ccc 100%);background-image:-o-linear-gradient(top, #eee 50%, #ccc 100%);background-image:linear-gradient(to bottom, #eee 50%, #ccc 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0)}.select2-container--classic .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow{border:none;border-right:1px solid #aaa;border-radius:0;border-top-left-radius:4px;border-bottom-left-radius:4px;left:1px;right:auto}.select2-container--classic.select2-container--open .select2-selection--single{border:1px solid #5897fb}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow{background:transparent;border:none}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single{border-top:none;border-top-left-radius:0;border-top-right-radius:0;background-image:-webkit-linear-gradient(top, #fff 0%, #eee 50%);background-image:-o-linear-gradient(top, #fff 0%, #eee 50%);background-image:linear-gradient(to bottom, #fff 0%, #eee 50%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0;background-image:-webkit-linear-gradient(top, #eee 50%, #fff 100%);background-image:-o-linear-gradient(top, #eee 50%, #fff 100%);background-image:linear-gradient(to bottom, #eee 50%, #fff 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0)}.select2-container--classic .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text;outline:0}.select2-container--classic .select2-selection--multiple:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--multiple .select2-selection__rendered{list-style:none;margin:0;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__clear{display:none}.select2-container--classic .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove{color:#888;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover{color:#555}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{float:right}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--classic.select2-container--open .select2-selection--multiple{border:1px solid #5897fb}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--classic .select2-search--dropdown .select2-search__field{border:1px solid #aaa;outline:0}.select2-container--classic .select2-search--inline .select2-search__field{outline:0;box-shadow:none}.select2-container--classic .select2-dropdown{background-color:#fff;border:1px solid transparent}.select2-container--classic .select2-dropdown--above{border-bottom:none}.select2-container--classic .select2-dropdown--below{border-top:none}.select2-container--classic .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--classic .select2-results__option[role=group]{padding:0}.select2-container--classic .select2-results__option[aria-disabled=true]{color:grey}.select2-container--classic .select2-results__option--highlighted[aria-selected]{background-color:#3875d7;color:#fff}.select2-container--classic .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic.select2-container--open .select2-dropdown{border-color:#5897fb}
|
|
|
trunk/assets/css/wcv-activation.css
DELETED
|
@@ -1,21 +0,0 @@
|
|
| 1 |
-
/** activation.scss Styles applied to elements displayed on activation */
|
| 2 |
-
/** Styling begins */
|
| 3 |
-
div.wcvendors-message { overflow: hidden; position: relative; border-left-color: #005580 !important; }
|
| 4 |
-
|
| 5 |
-
div.wcvendors-message p { max-width: 700px; }
|
| 6 |
-
|
| 7 |
-
div.wcvendors-message p:last-child { max-width: inherit; }
|
| 8 |
-
|
| 9 |
-
p.wcvendors-actions .button-primary, .wcvendors-message .button-primary { background: #005580; border-color: #005580; -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #a36597; box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #a36597; color: #fff; text-shadow: 0 -1px 1px #005580, 1px 0 1px #005580, 0 1px 1px #005580, -1px 0 1px #005580; }
|
| 10 |
-
|
| 11 |
-
p.wcvendors-actions .button-primary:hover, p.wcvendors-actions .button-primary:focus, p.wcvendors-actions .button-primary:active, .wcvendors-message .button-primary:hover, .wcvendors-message .button-primary:focus, .wcvendors-message .button-primary:active { background: #005580; border-color: #005580; -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #005580; box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #005580; }
|
| 12 |
-
|
| 13 |
-
p.wcvendors-actions a.wcvendors-message-close, .wcvendors-message a.wcvendors-message-close { position: absolute; top: 0; right: 0; padding: 10px 15px 10px 21px; font-size: 13px; line-height: 1.23076923; text-decoration: none; }
|
| 14 |
-
|
| 15 |
-
p.wcvendors-actions a.wcvendors-message-close::before, .wcvendors-message a.wcvendors-message-close::before { position: absolute; top: 8px; left: 0; -webkit-transition: all 0.1s ease-in-out; transition: all 0.1s ease-in-out; }
|
| 16 |
-
|
| 17 |
-
p.wcvendors-actions .button-primary, p.wcvendors-actions .button-secondary, .wcvendors-message .button-primary, .wcvendors-message .button-secondary { text-decoration: none !important; }
|
| 18 |
-
|
| 19 |
-
p.wcvendors-actions .twitter-share-button, .wcvendors-message .twitter-share-button { margin-top: -3px; margin-left: 3px; vertical-align: middle; }
|
| 20 |
-
|
| 21 |
-
p.wcvendors-actions, .wcvendors-about-text { margin-bottom: 1em !important; }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/css/wcv-activation.min.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
div.wcvendors-message{overflow:hidden;position:relative;border-left-color:#005580!important}div.wcvendors-message p{max-width:700px}div.wcvendors-message p:last-child{max-width:inherit}.wcvendors-message .button-primary,p.wcvendors-actions .button-primary{background:#005580;border-color:#005580;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #a36597;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #a36597;color:#fff;text-shadow:0 -1px 1px #005580,1px 0 1px #005580,0 1px 1px #005580,-1px 0 1px #005580}.wcvendors-message .button-primary:active,.wcvendors-message .button-primary:focus,.wcvendors-message .button-primary:hover,p.wcvendors-actions .button-primary:active,p.wcvendors-actions .button-primary:focus,p.wcvendors-actions .button-primary:hover{background:#005580;border-color:#005580;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #005580;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #005580}.wcvendors-message a.wcvendors-message-close,p.wcvendors-actions a.wcvendors-message-close{position:absolute;top:0;right:0;padding:10px 15px 10px 21px;font-size:13px;line-height:1.23076923;text-decoration:none}.wcvendors-message a.wcvendors-message-close::before,p.wcvendors-actions a.wcvendors-message-close::before{position:absolute;top:8px;left:0;-webkit-transition:all .1s ease-in-out;transition:all .1s ease-in-out}.wcvendors-message .button-primary,.wcvendors-message .button-secondary,p.wcvendors-actions .button-primary,p.wcvendors-actions .button-secondary{text-decoration:none!important}.wcvendors-message .twitter-share-button,p.wcvendors-actions .twitter-share-button{margin-top:-3px;margin-left:3px;vertical-align:middle}.wcvendors-about-text,p.wcvendors-actions{margin-bottom:1em!important}
|
|
|
trunk/assets/css/wcv-activation.scss
DELETED
|
@@ -1,68 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* activation.scss
|
| 3 |
-
* Styles applied to elements displayed on activation
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* Styling begins
|
| 8 |
-
*/
|
| 9 |
-
div.wcvendors-message {
|
| 10 |
-
overflow: hidden;
|
| 11 |
-
position: relative;
|
| 12 |
-
border-left-color: #005580 !important;
|
| 13 |
-
p {
|
| 14 |
-
max-width: 700px;
|
| 15 |
-
}
|
| 16 |
-
p:last-child {
|
| 17 |
-
max-width: inherit;
|
| 18 |
-
}
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
p.wcvendors-actions,
|
| 22 |
-
.wcvendors-message {
|
| 23 |
-
.button-primary {
|
| 24 |
-
background: #005580;
|
| 25 |
-
border-color: #005580;
|
| 26 |
-
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #a36597;
|
| 27 |
-
color: #fff;
|
| 28 |
-
text-shadow: 0 -1px 1px #005580, 1px 0 1px #005580, 0 1px 1px #005580, -1px 0 1px #005580;
|
| 29 |
-
|
| 30 |
-
&:hover, &:focus, &:active {
|
| 31 |
-
background: #005580;
|
| 32 |
-
border-color: #005580;
|
| 33 |
-
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #005580;
|
| 34 |
-
}
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
a.wcvendors-message-close {
|
| 38 |
-
position: absolute;
|
| 39 |
-
top: 0;
|
| 40 |
-
right: 0;
|
| 41 |
-
padding: 10px 15px 10px 21px;
|
| 42 |
-
font-size: 13px;
|
| 43 |
-
line-height: 1.23076923;
|
| 44 |
-
text-decoration: none;
|
| 45 |
-
&::before {
|
| 46 |
-
position: absolute;
|
| 47 |
-
top: 8px;
|
| 48 |
-
left: 0;
|
| 49 |
-
transition: all 0.1s ease-in-out;
|
| 50 |
-
}
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
.button-primary,
|
| 54 |
-
.button-secondary {
|
| 55 |
-
text-decoration: none !important;
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
.twitter-share-button {
|
| 59 |
-
margin-top: -3px;
|
| 60 |
-
margin-left: 3px;
|
| 61 |
-
vertical-align: middle;
|
| 62 |
-
}
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
p.wcvendors-actions,
|
| 66 |
-
.wcvendors-about-text {
|
| 67 |
-
margin-bottom: 1em !important;
|
| 68 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/css/wcv-admin.css
DELETED
|
@@ -1,162 +0,0 @@
|
|
| 1 |
-
.wcv_addons_wrap { max-width: 1200px; }
|
| 2 |
-
|
| 3 |
-
.wcv_addons_wrap h1.search-form-title { clear: left; padding: 0; }
|
| 4 |
-
|
| 5 |
-
.wcv_addons_wrap .update-plugins .update-count { background-color: #d54e21; border-radius: 10px; color: #fff; display: inline-block; font-size: 9px; font-weight: 600; line-height: 17px; margin: 1px 0 0 2px; padding: 0 6px; vertical-align: text-top; }
|
| 6 |
-
|
| 7 |
-
.wcv_addons_wrap .addons-featured { margin: 0; }
|
| 8 |
-
|
| 9 |
-
.wcv_addons_wrap ul.feature-list { list-style: inherit; }
|
| 10 |
-
|
| 11 |
-
.wcv_addons_wrap ul.feature-list li { margin-left: 20px; }
|
| 12 |
-
|
| 13 |
-
.wcv_addons_wrap ul.subsubsub.subsubsub { margin: -2px 0 12px; }
|
| 14 |
-
|
| 15 |
-
.wcv_addons_wrap .subsubsub li::after { content: '|'; }
|
| 16 |
-
|
| 17 |
-
.wcv_addons_wrap .subsubsub li:last-child::after { content: ''; }
|
| 18 |
-
|
| 19 |
-
.wcv_addons_wrap .addons-banner-block-item-icon, .wcv_addons_wrap .addons-column-block-item-icon { -webkit-box-align: center; -ms-flex-align: center; align-items: center; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; }
|
| 20 |
-
|
| 21 |
-
.wcv_addons_wrap .addons-banner-block, .wcv_addons_wrap .addons-wcs-banner-block { background: #ffffff; border: 1px solid #ddd; margin: 0 0 1em 0; padding: 2em 2em 1em; }
|
| 22 |
-
|
| 23 |
-
.wcv_addons_wrap .addons-banner-block img { height: 62px; }
|
| 24 |
-
|
| 25 |
-
.wcv_addons_wrap .addons-banner-block p { margin: 0 0 20px; }
|
| 26 |
-
|
| 27 |
-
.wcv_addons_wrap .addons-banner-block-items { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-pack: distribute; justify-content: space-around; margin: 0 -10px 0 -10px; }
|
| 28 |
-
|
| 29 |
-
.wcv_addons_wrap .addons-banner-block-item { border: 1px solid #e6e6e6; border-radius: 3px; -webkit-box-flex: 1; -ms-flex: 1; flex: 1; margin: 1em; min-width: 200px; width: 30%; }
|
| 30 |
-
|
| 31 |
-
.wcv_addons_wrap .addons-banner-block-item-icon { background: #f7f7f7; height: 143px; }
|
| 32 |
-
|
| 33 |
-
.wcv_addons_wrap .addons-banner-block-item-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; height: 184px; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; padding: 24px; }
|
| 34 |
-
|
| 35 |
-
.wcv_addons_wrap .addons-banner-block-item-content h3 { margin-top: 0; }
|
| 36 |
-
|
| 37 |
-
.wcv_addons_wrap .addons-banner-block-item-content p { margin: 0 0 auto; }
|
| 38 |
-
|
| 39 |
-
.wcv_addons_wrap .addons-wcs-banner-block { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; }
|
| 40 |
-
|
| 41 |
-
.wcv_addons_wrap .addons-wcs-banner-block-image { background: #f7f7f7; border: 1px solid #e6e6e6; margin-right: 2em; width: 400px; padding: 1em; text-align: center; }
|
| 42 |
-
|
| 43 |
-
.wcv_addons_wrap .addons-wcs-banner-block-image .addons-img { margin: auto 0; max-height: 350px; max-width: 350px; }
|
| 44 |
-
|
| 45 |
-
.wcv_addons_wrap .addons-shipping-methods .addons-wcs-banner-block { margin-left: 0; margin-right: 0; margin-top: 1em; }
|
| 46 |
-
|
| 47 |
-
.wcv_addons_wrap .addons-wcs-banner-block-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -ms-flex-pack: distribute; justify-content: space-around; -ms-flex-item-align: stretch; align-self: stretch; padding: 1em 0; }
|
| 48 |
-
|
| 49 |
-
.wcv_addons_wrap .addons-wcs-banner-block-content h1 { padding-bottom: 0; }
|
| 50 |
-
|
| 51 |
-
.wcv_addons_wrap .addons-wcs-banner-block-content p { margin-bottom: 0; }
|
| 52 |
-
|
| 53 |
-
.wcv_addons_wrap .addons-wcs-banner-block-content .wcs-service-logo { max-width: 40px; }
|
| 54 |
-
|
| 55 |
-
.wcv_addons_wrap .addons-column-section { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-pack: distribute; justify-content: space-around; }
|
| 56 |
-
|
| 57 |
-
.wcv_addons_wrap .addons-column { -webkit-box-flex: 1; -ms-flex: 1; flex: 1; width: 50%; padding: 0 .5em; }
|
| 58 |
-
|
| 59 |
-
.wcv_addons_wrap .addons-column:nth-child(2) { margin-right: 0; }
|
| 60 |
-
|
| 61 |
-
.wcv_addons_wrap .addons-small-light-block, .wcv_addons_wrap .addons-small-dark-block, .wcv_addons_wrap .addons-column-block { -webkit-box-sizing: border-box; box-sizing: border-box; border: 1px solid #ddd; margin: 0 0 1em; padding: 20px; }
|
| 62 |
-
|
| 63 |
-
.wcv_addons_wrap .addons-column-block img { max-height: 50px; max-width: 50px; }
|
| 64 |
-
|
| 65 |
-
.wcv_addons_wrap .addons-small-light-block, .wcv_addons_wrap .addons-column-block { background: #ffffff; }
|
| 66 |
-
|
| 67 |
-
.wcv_addons_wrap .addons-column-block-left { float: left; }
|
| 68 |
-
|
| 69 |
-
.wcv_addons_wrap .addons-column-block-right { float: right; }
|
| 70 |
-
|
| 71 |
-
.wcv_addons_wrap .addons-column-block-item { border-top: 2px solid #f9f9f9; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; margin: 0 -20px; padding: 20px; }
|
| 72 |
-
|
| 73 |
-
.wcv_addons_wrap .addons-column-block-item-icon { background: #f7f7f7; border: 1px solid #e6e6e6; height: 100px; margin: 0 10px 10px 0; width: 100px; }
|
| 74 |
-
|
| 75 |
-
.wcv_addons_wrap .addons-column-block-item-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-flex: 1; -ms-flex: 1; flex: 1; -ms-flex-wrap: wrap; flex-wrap: wrap; height: 20%; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; min-width: 200px; }
|
| 76 |
-
|
| 77 |
-
.wcv_addons_wrap .addons-column-block-item-content h2 { float: left; margin-top: 8px; }
|
| 78 |
-
|
| 79 |
-
.wcv_addons_wrap .addons-column-block-item-content a { float: right; }
|
| 80 |
-
|
| 81 |
-
.wcv_addons_wrap .addons-column-block-item-content p { float: left; }
|
| 82 |
-
|
| 83 |
-
.wcv_addons_wrap .addons-banner-block-item, .wcv_addons_wrap .addons-column-block-item { display: none; }
|
| 84 |
-
|
| 85 |
-
.wcv_addons_wrap .addons-banner-block-item:nth-child(-n+3) { display: block; }
|
| 86 |
-
|
| 87 |
-
.wcv_addons_wrap .addons-column-block-item:nth-of-type(-n+3) { display: -webkit-box; display: -ms-flexbox; display: flex; }
|
| 88 |
-
|
| 89 |
-
.wcv_addons_wrap .addons-small-dark-block { background-color: #54687d; text-align: center; }
|
| 90 |
-
|
| 91 |
-
.wcv_addons_wrap .addons-small-dark-items { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-pack: distribute; justify-content: space-around; }
|
| 92 |
-
|
| 93 |
-
.wcv_addons_wrap .addons-small-dark-item { margin: 0 0 20px; }
|
| 94 |
-
|
| 95 |
-
.wcv_addons_wrap .addons-small-dark-block h1 { color: #ffffff; }
|
| 96 |
-
|
| 97 |
-
.wcv_addons_wrap .addons-small-dark-block p { color: #fafafa; }
|
| 98 |
-
|
| 99 |
-
.wcv_addons_wrap .addons-small-dark-item-icon img { height: 30px; }
|
| 100 |
-
|
| 101 |
-
.wcv_addons_wrap .addons-small-dark-item a { margin: 28px auto 0; }
|
| 102 |
-
|
| 103 |
-
.wcv_addons_wrap .addons-small-light-block { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; }
|
| 104 |
-
|
| 105 |
-
.wcv_addons_wrap .addons-small-light-block h1 { margin-top: -12px; }
|
| 106 |
-
|
| 107 |
-
.wcv_addons_wrap .addons-small-light-block p { margin-top: 0; }
|
| 108 |
-
|
| 109 |
-
.wcv_addons_wrap .addons-small-light-block img { height: 225px; margin: 0 0 0 -20px; }
|
| 110 |
-
|
| 111 |
-
.wcv_addons_wrap .addons-small-light-block-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-flex: 1; -ms-flex: 1 1 100px; flex: 1 1 100px; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -ms-flex-pack: distribute; justify-content: space-around; }
|
| 112 |
-
|
| 113 |
-
.wcv_addons_wrap .addons-small-light-block-buttons { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; }
|
| 114 |
-
|
| 115 |
-
.wcv_addons_wrap .addons-small-light-block-content a { width: 48%; }
|
| 116 |
-
|
| 117 |
-
.wcv_addons_wrap .product-addons-button { cursor: pointer; display: block; height: 37px; line-height: 37px; text-align: center; text-decoration: none; width: 124px; }
|
| 118 |
-
|
| 119 |
-
.wcv_addons_wrap .product-addons-button-solid { background-color: #005580; color: #ffffff; }
|
| 120 |
-
|
| 121 |
-
.wcv_addons_wrap .addons-button { border-radius: 3px; cursor: pointer; display: block; height: 37px; line-height: 37px; text-align: center; text-decoration: none; width: 124px; }
|
| 122 |
-
|
| 123 |
-
.wcv_addons_wrap .addons-button-solid { background-color: #005580; color: #ffffff; }
|
| 124 |
-
|
| 125 |
-
.wcv_addons_wrap .addons-button-solid:hover { color: #ffffff; opacity: 0.8; }
|
| 126 |
-
|
| 127 |
-
.wcv_addons_wrap .addons-button-outline-green { border: 1px solid #73ae39; color: #73ae39; }
|
| 128 |
-
|
| 129 |
-
.wcv_addons_wrap .addons-button-outline-green:hover { color: #73ae39; opacity: 0.8; }
|
| 130 |
-
|
| 131 |
-
.wcv_addons_wrap .addons-button-outline-white { border: 1px solid #ffffff; color: #ffffff; }
|
| 132 |
-
|
| 133 |
-
.wcv_addons_wrap .addons-button-outline-white:hover { color: #ffffff; opacity: 0.8; }
|
| 134 |
-
|
| 135 |
-
.wcv_addons_wrap .addons-button-installed { background: #e6e6e6; color: #3c3c3c; }
|
| 136 |
-
|
| 137 |
-
.wcv_addons_wrap .addons-button-installed:hover { color: #3c3c3c; opacity: 0.8; }
|
| 138 |
-
|
| 139 |
-
@media only screen and (max-width: 400px) { .wcv_addons_wrap .addons-featured { margin: -1% -5%; }
|
| 140 |
-
.wcv_addons_wrap .addons-button { width: 100%; }
|
| 141 |
-
.wcv_addons_wrap .addons-small-dark-item { width: 100%; }
|
| 142 |
-
.wcv_addons_wrap .addons-column-block-item-icon { background: none; border: none; height: 75px; margin: 0 10px 10px 0; width: 75px; } }
|
| 143 |
-
|
| 144 |
-
.wcv_addons_wrap .products { overflow: hidden; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row; flex-flow: row; -ms-flex-wrap: wrap; flex-wrap: wrap; margin: 0 -.5em; }
|
| 145 |
-
|
| 146 |
-
.wcv_addons_wrap .products li { float: left; border: 1px solid #ddd; margin: 0 .5em 1em !important; padding: 0; vertical-align: top; width: 25%; min-width: 280px; min-height: 220px; -webkit-box-flex: 1; -ms-flex: 1; flex: 1; overflow: hidden; background: #f5f5f5; -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), inset 0 -1px 0 rgba(0, 0, 0, 0.1); box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), inset 0 -1px 0 rgba(0, 0, 0, 0.1); }
|
| 147 |
-
|
| 148 |
-
.wcv_addons_wrap .products li a { text-decoration: none; color: inherit; display: block; height: 100%; }
|
| 149 |
-
|
| 150 |
-
.wcv_addons_wrap .products li a .product-img-wrap { background: #fff; display: block; }
|
| 151 |
-
|
| 152 |
-
.wcv_addons_wrap .products li a img { max-width: 258px; max-height: 24px; padding: 17px 20px; display: block; margin: 0; background: #fff; border-right: 260px solid #fff; }
|
| 153 |
-
|
| 154 |
-
.wcv_addons_wrap .products li a img.extension-thumb + h3 { display: none; }
|
| 155 |
-
|
| 156 |
-
.wcv_addons_wrap .products li a .price { display: none; }
|
| 157 |
-
|
| 158 |
-
.wcv_addons_wrap .products li a h2, .wcv_addons_wrap .products li a h3 { margin: 0 !important; padding: 20px !important; background: #fff; }
|
| 159 |
-
|
| 160 |
-
.wcv_addons_wrap .products li a p { padding: 20px !important; margin: 0 !important; border-top: 1px solid #f1f1f1; }
|
| 161 |
-
|
| 162 |
-
.wcv_addons_wrap .products li a:hover, .wcv_addons_wrap .products li a:focus { background-color: #fff; }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/css/wcv-admin.min.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wcv_addons_wrap{max-width:1200px}.wcv_addons_wrap h1.search-form-title{clear:left;padding:0}.wcv_addons_wrap .update-plugins .update-count{background-color:#d54e21;border-radius:10px;color:#fff;display:inline-block;font-size:9px;font-weight:600;line-height:17px;margin:1px 0 0 2px;padding:0 6px;vertical-align:text-top}.wcv_addons_wrap .addons-featured{margin:0}.wcv_addons_wrap ul.feature-list{list-style:inherit}.wcv_addons_wrap ul.feature-list li{margin-left:20px}.wcv_addons_wrap ul.subsubsub.subsubsub{margin:-2px 0 12px}.wcv_addons_wrap .subsubsub li::after{content:'|'}.wcv_addons_wrap .subsubsub li:last-child::after{content:''}.wcv_addons_wrap .addons-banner-block-item-icon,.wcv_addons_wrap .addons-column-block-item-icon{-webkit-box-align:center;-ms-flex-align:center;align-items:center;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center}.wcv_addons_wrap .addons-banner-block,.wcv_addons_wrap .addons-wcs-banner-block{background:#fff;border:1px solid #ddd;margin:0 0 1em 0;padding:2em 2em 1em}.wcv_addons_wrap .addons-banner-block img{height:62px}.wcv_addons_wrap .addons-banner-block p{margin:0 0 20px}.wcv_addons_wrap .addons-banner-block-items{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-pack:distribute;justify-content:space-around;margin:0 -10px 0 -10px}.wcv_addons_wrap .addons-banner-block-item{border:1px solid #e6e6e6;border-radius:3px;-webkit-box-flex:1;-ms-flex:1;flex:1;margin:1em;min-width:200px;width:30%}.wcv_addons_wrap .addons-banner-block-item-icon{background:#f7f7f7;height:143px}.wcv_addons_wrap .addons-banner-block-item-content{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;height:184px;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;padding:24px}.wcv_addons_wrap .addons-banner-block-item-content h3{margin-top:0}.wcv_addons_wrap .addons-banner-block-item-content p{margin:0 0 auto}.wcv_addons_wrap .addons-wcs-banner-block{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.wcv_addons_wrap .addons-wcs-banner-block-image{background:#f7f7f7;border:1px solid #e6e6e6;margin-right:2em;width:400px;padding:1em;text-align:center}.wcv_addons_wrap .addons-wcs-banner-block-image .addons-img{margin:auto 0;max-height:350px;max-width:350px}.wcv_addons_wrap .addons-shipping-methods .addons-wcs-banner-block{margin-left:0;margin-right:0;margin-top:1em}.wcv_addons_wrap .addons-wcs-banner-block-content{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:distribute;justify-content:space-around;-ms-flex-item-align:stretch;align-self:stretch;padding:1em 0}.wcv_addons_wrap .addons-wcs-banner-block-content h1{padding-bottom:0}.wcv_addons_wrap .addons-wcs-banner-block-content p{margin-bottom:0}.wcv_addons_wrap .addons-wcs-banner-block-content .wcs-service-logo{max-width:40px}.wcv_addons_wrap .addons-column-section{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-pack:distribute;justify-content:space-around}.wcv_addons_wrap .addons-column{-webkit-box-flex:1;-ms-flex:1;flex:1;width:50%;padding:0 .5em}.wcv_addons_wrap .addons-column:nth-child(2){margin-right:0}.wcv_addons_wrap .addons-column-block,.wcv_addons_wrap .addons-small-dark-block,.wcv_addons_wrap .addons-small-light-block{-webkit-box-sizing:border-box;box-sizing:border-box;border:1px solid #ddd;margin:0 0 1em;padding:20px}.wcv_addons_wrap .addons-column-block img{max-height:50px;max-width:50px}.wcv_addons_wrap .addons-column-block,.wcv_addons_wrap .addons-small-light-block{background:#fff}.wcv_addons_wrap .addons-column-block-left{float:left}.wcv_addons_wrap .addons-column-block-right{float:right}.wcv_addons_wrap .addons-column-block-item{border-top:2px solid #f9f9f9;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;margin:0 -20px;padding:20px}.wcv_addons_wrap .addons-column-block-item-icon{background:#f7f7f7;border:1px solid #e6e6e6;height:100px;margin:0 10px 10px 0;width:100px}.wcv_addons_wrap .addons-column-block-item-content{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-flex:1;-ms-flex:1;flex:1;-ms-flex-wrap:wrap;flex-wrap:wrap;height:20%;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;min-width:200px}.wcv_addons_wrap .addons-column-block-item-content h2{float:left;margin-top:8px}.wcv_addons_wrap .addons-column-block-item-content a{float:right}.wcv_addons_wrap .addons-column-block-item-content p{float:left}.wcv_addons_wrap .addons-banner-block-item,.wcv_addons_wrap .addons-column-block-item{display:none}.wcv_addons_wrap .addons-banner-block-item:nth-child(-n+3){display:block}.wcv_addons_wrap .addons-column-block-item:nth-of-type(-n+3){display:-webkit-box;display:-ms-flexbox;display:flex}.wcv_addons_wrap .addons-small-dark-block{background-color:#54687d;text-align:center}.wcv_addons_wrap .addons-small-dark-items{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-pack:distribute;justify-content:space-around}.wcv_addons_wrap .addons-small-dark-item{margin:0 0 20px}.wcv_addons_wrap .addons-small-dark-block h1{color:#fff}.wcv_addons_wrap .addons-small-dark-block p{color:#fafafa}.wcv_addons_wrap .addons-small-dark-item-icon img{height:30px}.wcv_addons_wrap .addons-small-dark-item a{margin:28px auto 0}.wcv_addons_wrap .addons-small-light-block{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap}.wcv_addons_wrap .addons-small-light-block h1{margin-top:-12px}.wcv_addons_wrap .addons-small-light-block p{margin-top:0}.wcv_addons_wrap .addons-small-light-block img{height:225px;margin:0 0 0 -20px}.wcv_addons_wrap .addons-small-light-block-content{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-flex:1;-ms-flex:1 1 100px;flex:1 1 100px;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:distribute;justify-content:space-around}.wcv_addons_wrap .addons-small-light-block-buttons{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between}.wcv_addons_wrap .addons-small-light-block-content a{width:48%}.wcv_addons_wrap .product-addons-button{cursor:pointer;display:block;height:37px;line-height:37px;text-align:center;text-decoration:none;width:124px}.wcv_addons_wrap .product-addons-button-solid{background-color:#005580;color:#fff}.wcv_addons_wrap .addons-button{border-radius:3px;cursor:pointer;display:block;height:37px;line-height:37px;text-align:center;text-decoration:none;width:124px}.wcv_addons_wrap .addons-button-solid{background-color:#005580;color:#fff}.wcv_addons_wrap .addons-button-solid:hover{color:#fff;opacity:.8}.wcv_addons_wrap .addons-button-outline-green{border:1px solid #73ae39;color:#73ae39}.wcv_addons_wrap .addons-button-outline-green:hover{color:#73ae39;opacity:.8}.wcv_addons_wrap .addons-button-outline-white{border:1px solid #fff;color:#fff}.wcv_addons_wrap .addons-button-outline-white:hover{color:#fff;opacity:.8}.wcv_addons_wrap .addons-button-installed{background:#e6e6e6;color:#3c3c3c}.wcv_addons_wrap .addons-button-installed:hover{color:#3c3c3c;opacity:.8}@media only screen and (max-width:400px){.wcv_addons_wrap .addons-featured{margin:-1% -5%}.wcv_addons_wrap .addons-button{width:100%}.wcv_addons_wrap .addons-small-dark-item{width:100%}.wcv_addons_wrap .addons-column-block-item-icon{background:0 0;border:none;height:75px;margin:0 10px 10px 0;width:75px}}.wcv_addons_wrap .products{overflow:hidden;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row;flex-flow:row;-ms-flex-wrap:wrap;flex-wrap:wrap;margin:0 -.5em}.wcv_addons_wrap .products li{float:left;border:1px solid #ddd;margin:0 .5em 1em!important;padding:0;vertical-align:top;width:25%;min-width:280px;min-height:220px;-webkit-box-flex:1;-ms-flex:1;flex:1;overflow:hidden;background:#f5f5f5;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.2),inset 0 -1px 0 rgba(0,0,0,.1);box-shadow:inset 0 1px 0 rgba(255,255,255,.2),inset 0 -1px 0 rgba(0,0,0,.1)}.wcv_addons_wrap .products li a{text-decoration:none;color:inherit;display:block;height:100%}.wcv_addons_wrap .products li a .product-img-wrap{background:#fff;display:block}.wcv_addons_wrap .products li a img{max-width:258px;max-height:24px;padding:17px 20px;display:block;margin:0;background:#fff;border-right:260px solid #fff}.wcv_addons_wrap .products li a img.extension-thumb+h3{display:none}.wcv_addons_wrap .products li a .price{display:none}.wcv_addons_wrap .products li a h2,.wcv_addons_wrap .products li a h3{margin:0!important;padding:20px!important;background:#fff}.wcv_addons_wrap .products li a p{padding:20px!important;margin:0!important;border-top:1px solid #f1f1f1}.wcv_addons_wrap .products li a:focus,.wcv_addons_wrap .products li a:hover{background-color:#fff}
|
|
|
trunk/assets/css/wcv-admin.scss
DELETED
|
@@ -1,474 +0,0 @@
|
|
| 1 |
-
.wcv_addons_wrap {
|
| 2 |
-
max-width: 1200px;
|
| 3 |
-
|
| 4 |
-
h1.search-form-title {
|
| 5 |
-
clear: left;
|
| 6 |
-
padding: 0;
|
| 7 |
-
}
|
| 8 |
-
|
| 9 |
-
.update-plugins .update-count {
|
| 10 |
-
background-color: #d54e21;
|
| 11 |
-
border-radius: 10px;
|
| 12 |
-
color: #fff;
|
| 13 |
-
display: inline-block;
|
| 14 |
-
font-size: 9px;
|
| 15 |
-
font-weight: 600;
|
| 16 |
-
line-height: 17px;
|
| 17 |
-
margin: 1px 0 0 2px;
|
| 18 |
-
padding: 0 6px;
|
| 19 |
-
vertical-align: text-top;
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
.addons-featured {
|
| 23 |
-
margin: 0;
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
ul.feature-list {
|
| 27 |
-
list-style: inherit;
|
| 28 |
-
|
| 29 |
-
li {
|
| 30 |
-
margin-left: 20px;
|
| 31 |
-
}
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
ul.subsubsub.subsubsub {
|
| 35 |
-
margin: -2px 0 12px;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
.subsubsub li::after {
|
| 39 |
-
content: '|';
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
.subsubsub li:last-child::after {
|
| 43 |
-
content: '';
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
.addons-banner-block-item-icon,
|
| 47 |
-
.addons-column-block-item-icon {
|
| 48 |
-
align-items: center;
|
| 49 |
-
display: flex;
|
| 50 |
-
justify-content: center;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
.addons-banner-block,
|
| 54 |
-
.addons-wcs-banner-block {
|
| 55 |
-
background: #ffffff;
|
| 56 |
-
border: 1px solid #ddd;
|
| 57 |
-
margin: 0 0 1em 0;
|
| 58 |
-
padding: 2em 2em 1em;
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
.addons-banner-block img {
|
| 62 |
-
height: 62px;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
.addons-banner-block p {
|
| 66 |
-
margin: 0 0 20px;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
.addons-banner-block-items {
|
| 70 |
-
display: flex;
|
| 71 |
-
flex-direction: row;
|
| 72 |
-
flex-wrap: wrap;
|
| 73 |
-
justify-content: space-around;
|
| 74 |
-
margin: 0 -10px 0 -10px;
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
.addons-banner-block-item {
|
| 78 |
-
border: 1px solid #e6e6e6;
|
| 79 |
-
border-radius: 3px;
|
| 80 |
-
flex: 1;
|
| 81 |
-
margin: 1em;
|
| 82 |
-
min-width: 200px;
|
| 83 |
-
width: 30%;
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
.addons-banner-block-item-icon {
|
| 87 |
-
background: #f7f7f7;
|
| 88 |
-
height: 143px;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
.addons-banner-block-item-content {
|
| 92 |
-
display: flex;
|
| 93 |
-
flex-direction: column;
|
| 94 |
-
height: 184px;
|
| 95 |
-
justify-content: space-between;
|
| 96 |
-
padding: 24px;
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
.addons-banner-block-item-content h3 {
|
| 100 |
-
margin-top: 0;
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
.addons-banner-block-item-content p {
|
| 104 |
-
margin: 0 0 auto;
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
.addons-wcs-banner-block {
|
| 108 |
-
display: flex;
|
| 109 |
-
align-items: center;
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
.addons-wcs-banner-block-image {
|
| 113 |
-
background: #f7f7f7;
|
| 114 |
-
border: 1px solid #e6e6e6;
|
| 115 |
-
margin-right: 2em;
|
| 116 |
-
width: 400px;
|
| 117 |
-
padding: 1em;
|
| 118 |
-
text-align: center;
|
| 119 |
-
|
| 120 |
-
.addons-img {
|
| 121 |
-
margin: auto 0;
|
| 122 |
-
max-height: 350px;
|
| 123 |
-
max-width: 350px;
|
| 124 |
-
}
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
.addons-shipping-methods .addons-wcs-banner-block {
|
| 128 |
-
margin-left: 0;
|
| 129 |
-
margin-right: 0;
|
| 130 |
-
margin-top: 1em;
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
.addons-wcs-banner-block-content {
|
| 134 |
-
display: flex;
|
| 135 |
-
flex-direction: column;
|
| 136 |
-
justify-content: space-around;
|
| 137 |
-
align-self: stretch;
|
| 138 |
-
padding: 1em 0;
|
| 139 |
-
|
| 140 |
-
h1 {
|
| 141 |
-
padding-bottom: 0;
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
p {
|
| 145 |
-
margin-bottom: 0;
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
.wcs-service-logo {
|
| 149 |
-
max-width: 40px;
|
| 150 |
-
}
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
-
.addons-column-section {
|
| 154 |
-
display: flex;
|
| 155 |
-
flex-direction: row;
|
| 156 |
-
flex-wrap: wrap;
|
| 157 |
-
justify-content: space-around;
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
.addons-column {
|
| 161 |
-
flex: 1;
|
| 162 |
-
width: 50%;
|
| 163 |
-
padding: 0 .5em;
|
| 164 |
-
}
|
| 165 |
-
|
| 166 |
-
.addons-column:nth-child(2) {
|
| 167 |
-
margin-right: 0;
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
.addons-small-light-block,
|
| 171 |
-
.addons-small-dark-block,
|
| 172 |
-
.addons-column-block {
|
| 173 |
-
box-sizing: border-box;
|
| 174 |
-
border: 1px solid #ddd;
|
| 175 |
-
margin: 0 0 1em;
|
| 176 |
-
padding: 20px;
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
.addons-column-block img {
|
| 180 |
-
max-height: 50px;
|
| 181 |
-
max-width: 50px;
|
| 182 |
-
}
|
| 183 |
-
|
| 184 |
-
.addons-small-light-block,
|
| 185 |
-
.addons-column-block {
|
| 186 |
-
background: #ffffff;
|
| 187 |
-
}
|
| 188 |
-
|
| 189 |
-
.addons-column-block-left {
|
| 190 |
-
float: left;
|
| 191 |
-
}
|
| 192 |
-
|
| 193 |
-
.addons-column-block-right {
|
| 194 |
-
float: right;
|
| 195 |
-
}
|
| 196 |
-
|
| 197 |
-
.addons-column-block-item {
|
| 198 |
-
border-top: 2px solid #f9f9f9;
|
| 199 |
-
flex-direction: row;
|
| 200 |
-
flex-wrap: wrap;
|
| 201 |
-
justify-content: space-between;
|
| 202 |
-
margin: 0 -20px;
|
| 203 |
-
padding: 20px;
|
| 204 |
-
}
|
| 205 |
-
|
| 206 |
-
.addons-column-block-item-icon {
|
| 207 |
-
background: #f7f7f7;
|
| 208 |
-
border: 1px solid #e6e6e6;
|
| 209 |
-
height: 100px;
|
| 210 |
-
margin: 0 10px 10px 0;
|
| 211 |
-
width: 100px;
|
| 212 |
-
}
|
| 213 |
-
|
| 214 |
-
.addons-column-block-item-content {
|
| 215 |
-
display: flex;
|
| 216 |
-
flex: 1;
|
| 217 |
-
flex-wrap: wrap;
|
| 218 |
-
height: 20%;
|
| 219 |
-
justify-content: space-between;
|
| 220 |
-
min-width: 200px;
|
| 221 |
-
}
|
| 222 |
-
|
| 223 |
-
.addons-column-block-item-content h2 {
|
| 224 |
-
float: left;
|
| 225 |
-
margin-top: 8px;
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
.addons-column-block-item-content a {
|
| 229 |
-
float: right;
|
| 230 |
-
}
|
| 231 |
-
|
| 232 |
-
.addons-column-block-item-content p {
|
| 233 |
-
float: left;
|
| 234 |
-
}
|
| 235 |
-
|
| 236 |
-
.addons-banner-block-item,
|
| 237 |
-
.addons-column-block-item {
|
| 238 |
-
display: none;
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
.addons-banner-block-item:nth-child(-n+3) {
|
| 242 |
-
display: block;
|
| 243 |
-
}
|
| 244 |
-
.addons-column-block-item:nth-of-type(-n+3) {
|
| 245 |
-
display: flex;
|
| 246 |
-
}
|
| 247 |
-
|
| 248 |
-
.addons-small-dark-block {
|
| 249 |
-
background-color: #54687d;
|
| 250 |
-
text-align: center;
|
| 251 |
-
}
|
| 252 |
-
|
| 253 |
-
.addons-small-dark-items {
|
| 254 |
-
display: flex;
|
| 255 |
-
flex-wrap: wrap;
|
| 256 |
-
justify-content: space-around;
|
| 257 |
-
}
|
| 258 |
-
|
| 259 |
-
.addons-small-dark-item {
|
| 260 |
-
margin: 0 0 20px;
|
| 261 |
-
}
|
| 262 |
-
|
| 263 |
-
.addons-small-dark-block h1 {
|
| 264 |
-
color: #ffffff;
|
| 265 |
-
}
|
| 266 |
-
|
| 267 |
-
.addons-small-dark-block p {
|
| 268 |
-
color: #fafafa;
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
.addons-small-dark-item-icon img {
|
| 272 |
-
height: 30px;
|
| 273 |
-
}
|
| 274 |
-
|
| 275 |
-
.addons-small-dark-item a {
|
| 276 |
-
margin: 28px auto 0;
|
| 277 |
-
}
|
| 278 |
-
|
| 279 |
-
.addons-small-light-block {
|
| 280 |
-
display: flex;
|
| 281 |
-
flex-wrap: wrap;
|
| 282 |
-
}
|
| 283 |
-
|
| 284 |
-
.addons-small-light-block h1 {
|
| 285 |
-
margin-top: -12px;
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
.addons-small-light-block p {
|
| 289 |
-
margin-top: 0;
|
| 290 |
-
}
|
| 291 |
-
|
| 292 |
-
.addons-small-light-block img {
|
| 293 |
-
height: 225px;
|
| 294 |
-
margin: 0 0 0 -20px;
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
.addons-small-light-block-content {
|
| 298 |
-
display: flex;
|
| 299 |
-
flex: 1 1 100px;
|
| 300 |
-
flex-direction: column;
|
| 301 |
-
justify-content: space-around;
|
| 302 |
-
}
|
| 303 |
-
|
| 304 |
-
.addons-small-light-block-buttons {
|
| 305 |
-
display: flex;
|
| 306 |
-
justify-content: space-between;
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
.addons-small-light-block-content a {
|
| 310 |
-
width: 48%;
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
.product-addons-button {
|
| 314 |
-
// border-radius: 3px;
|
| 315 |
-
cursor: pointer;
|
| 316 |
-
display: block;
|
| 317 |
-
height: 37px;
|
| 318 |
-
line-height: 37px;
|
| 319 |
-
text-align: center;
|
| 320 |
-
text-decoration: none;
|
| 321 |
-
width: 124px;
|
| 322 |
-
}
|
| 323 |
-
|
| 324 |
-
.product-addons-button-solid {
|
| 325 |
-
background-color: #005580;
|
| 326 |
-
color: #ffffff;
|
| 327 |
-
}
|
| 328 |
-
|
| 329 |
-
.addons-button {
|
| 330 |
-
border-radius: 3px;
|
| 331 |
-
cursor: pointer;
|
| 332 |
-
display: block;
|
| 333 |
-
height: 37px;
|
| 334 |
-
line-height: 37px;
|
| 335 |
-
text-align: center;
|
| 336 |
-
text-decoration: none;
|
| 337 |
-
width: 124px;
|
| 338 |
-
}
|
| 339 |
-
|
| 340 |
-
.addons-button-solid {
|
| 341 |
-
background-color: #005580;
|
| 342 |
-
color: #ffffff;
|
| 343 |
-
}
|
| 344 |
-
|
| 345 |
-
.addons-button-solid:hover {
|
| 346 |
-
color: #ffffff;
|
| 347 |
-
opacity: 0.8;
|
| 348 |
-
}
|
| 349 |
-
|
| 350 |
-
.addons-button-outline-green {
|
| 351 |
-
border: 1px solid #73ae39;
|
| 352 |
-
color: #73ae39;
|
| 353 |
-
}
|
| 354 |
-
|
| 355 |
-
.addons-button-outline-green:hover {
|
| 356 |
-
color: #73ae39;
|
| 357 |
-
opacity: 0.8;
|
| 358 |
-
}
|
| 359 |
-
|
| 360 |
-
.addons-button-outline-white {
|
| 361 |
-
border: 1px solid #ffffff;
|
| 362 |
-
color: #ffffff;
|
| 363 |
-
}
|
| 364 |
-
|
| 365 |
-
.addons-button-outline-white:hover {
|
| 366 |
-
color: #ffffff;
|
| 367 |
-
opacity: 0.8;
|
| 368 |
-
}
|
| 369 |
-
|
| 370 |
-
.addons-button-installed {
|
| 371 |
-
background: #e6e6e6;
|
| 372 |
-
color: #3c3c3c;
|
| 373 |
-
}
|
| 374 |
-
|
| 375 |
-
.addons-button-installed:hover {
|
| 376 |
-
color: #3c3c3c;
|
| 377 |
-
opacity: 0.8;
|
| 378 |
-
}
|
| 379 |
-
|
| 380 |
-
@media only screen and (max-width : 400px) {
|
| 381 |
-
.addons-featured {
|
| 382 |
-
margin: -1% -5%;
|
| 383 |
-
}
|
| 384 |
-
|
| 385 |
-
.addons-button {
|
| 386 |
-
width: 100%;
|
| 387 |
-
}
|
| 388 |
-
|
| 389 |
-
.addons-small-dark-item {
|
| 390 |
-
width: 100%;
|
| 391 |
-
}
|
| 392 |
-
|
| 393 |
-
.addons-column-block-item-icon {
|
| 394 |
-
background: none;
|
| 395 |
-
border: none;
|
| 396 |
-
height: 75px;
|
| 397 |
-
margin: 0 10px 10px 0;
|
| 398 |
-
width: 75px;
|
| 399 |
-
}
|
| 400 |
-
}
|
| 401 |
-
|
| 402 |
-
.products {
|
| 403 |
-
overflow: hidden;
|
| 404 |
-
display: flex;
|
| 405 |
-
flex-flow: row;
|
| 406 |
-
flex-wrap: wrap;
|
| 407 |
-
margin: 0 -.5em;
|
| 408 |
-
|
| 409 |
-
li {
|
| 410 |
-
float: left;
|
| 411 |
-
border: 1px solid #ddd;
|
| 412 |
-
margin: 0 .5em 1em !important;
|
| 413 |
-
padding: 0;
|
| 414 |
-
vertical-align: top;
|
| 415 |
-
width: 25%;
|
| 416 |
-
min-width: 280px;
|
| 417 |
-
min-height: 220px;
|
| 418 |
-
flex: 1;
|
| 419 |
-
overflow: hidden;
|
| 420 |
-
background: #f5f5f5;
|
| 421 |
-
box-shadow:
|
| 422 |
-
inset 0 1px 0 rgba(255, 255, 255, 0.2),
|
| 423 |
-
inset 0 -1px 0 rgba(0, 0, 0, 0.1);
|
| 424 |
-
|
| 425 |
-
a {
|
| 426 |
-
text-decoration: none;
|
| 427 |
-
color: inherit;
|
| 428 |
-
display: block;
|
| 429 |
-
height: 100%;
|
| 430 |
-
|
| 431 |
-
.product-img-wrap {
|
| 432 |
-
background: #fff;
|
| 433 |
-
display: block;
|
| 434 |
-
}
|
| 435 |
-
|
| 436 |
-
img {
|
| 437 |
-
max-width: 258px;
|
| 438 |
-
max-height: 24px;
|
| 439 |
-
padding: 17px 20px;
|
| 440 |
-
display: block;
|
| 441 |
-
margin: 0;
|
| 442 |
-
background: #fff;
|
| 443 |
-
border-right: 260px solid #fff;
|
| 444 |
-
}
|
| 445 |
-
|
| 446 |
-
img.extension-thumb + h3 {
|
| 447 |
-
display: none;
|
| 448 |
-
}
|
| 449 |
-
|
| 450 |
-
.price {
|
| 451 |
-
display: none;
|
| 452 |
-
}
|
| 453 |
-
|
| 454 |
-
h2, h3 {
|
| 455 |
-
margin: 0 !important;
|
| 456 |
-
padding: 20px !important;
|
| 457 |
-
background: #fff;
|
| 458 |
-
}
|
| 459 |
-
|
| 460 |
-
p {
|
| 461 |
-
padding: 20px !important;
|
| 462 |
-
margin: 0 !important;
|
| 463 |
-
border-top: 1px solid #f1f1f1;
|
| 464 |
-
}
|
| 465 |
-
|
| 466 |
-
&:hover,
|
| 467 |
-
&:focus {
|
| 468 |
-
background-color: #fff;
|
| 469 |
-
}
|
| 470 |
-
}
|
| 471 |
-
}
|
| 472 |
-
}
|
| 473 |
-
|
| 474 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/css/wcv-frontend.css
DELETED
|
@@ -1,547 +0,0 @@
|
|
| 1 |
-
/*!
|
| 2 |
-
* Bootstrap v2.1.1
|
| 3 |
-
*
|
| 4 |
-
* Copyright 2012 Twitter, Inc
|
| 5 |
-
* Licensed under the Apache License v2.0
|
| 6 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 7 |
-
*
|
| 8 |
-
* Designed and built with all the love in the world @twitter by @mdo and @fat.
|
| 9 |
-
*/
|
| 10 |
-
clearfix {
|
| 11 |
-
*zoom: 1;
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
.clearfix:before, .clearfix:after {
|
| 15 |
-
display: table;
|
| 16 |
-
content: "";
|
| 17 |
-
line-height: 0;
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
.clearfix:after {
|
| 21 |
-
clear: both;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.hide-text {
|
| 25 |
-
font: 0/0 a;
|
| 26 |
-
color: transparent;
|
| 27 |
-
text-shadow: none;
|
| 28 |
-
background-color: transparent;
|
| 29 |
-
border: 0;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
.input-block-level {
|
| 33 |
-
display: block;
|
| 34 |
-
width: 100%;
|
| 35 |
-
min-height: 30px;
|
| 36 |
-
-webkit-box-sizing: border-box;
|
| 37 |
-
-moz-box-sizing: border-box;
|
| 38 |
-
box-sizing: border-box;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
.wcv-btn {
|
| 42 |
-
display: inline-block;
|
| 43 |
-
*display: inline;
|
| 44 |
-
*zoom: 1;
|
| 45 |
-
padding: 4px 14px;
|
| 46 |
-
margin-bottom: 0;
|
| 47 |
-
font-size: 14px;
|
| 48 |
-
line-height: 20px;
|
| 49 |
-
*line-height: 20px;
|
| 50 |
-
text-align: center;
|
| 51 |
-
vertical-align: middle;
|
| 52 |
-
cursor: pointer;
|
| 53 |
-
color: #333333;
|
| 54 |
-
text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75);
|
| 55 |
-
background-color: #f5f5f5;
|
| 56 |
-
background-image: -moz-linear-gradient(top, #ffffff, #e6e6e6);
|
| 57 |
-
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#e6e6e6));
|
| 58 |
-
background-image: -webkit-linear-gradient(top, #ffffff, #e6e6e6);
|
| 59 |
-
background-image: -o-linear-gradient(top, #ffffff, #e6e6e6);
|
| 60 |
-
background-image: linear-gradient(to bottom, #ffffff, #e6e6e6);
|
| 61 |
-
background-repeat: repeat-x;
|
| 62 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffe6e6e6', GradientType=0);
|
| 63 |
-
border-color: #e6e6e6 #e6e6e6 #bfbfbf;
|
| 64 |
-
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 65 |
-
*background-color: #e6e6e6;
|
| 66 |
-
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 67 |
-
border: 1px solid #bbbbbb;
|
| 68 |
-
*border: 0;
|
| 69 |
-
border-bottom-color: #a2a2a2;
|
| 70 |
-
-webkit-border-radius: 4px;
|
| 71 |
-
-moz-border-radius: 4px;
|
| 72 |
-
border-radius: 4px;
|
| 73 |
-
*margin-left: .3em;
|
| 74 |
-
-webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 75 |
-
-moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 76 |
-
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
.wcv-btn:hover, .wcv-btn:active, .wcv-btn.active, .wcv-btn.disabled, .wcv-btn[disabled] {
|
| 80 |
-
color: #333333;
|
| 81 |
-
background-color: #e6e6e6;
|
| 82 |
-
*background-color: #d9d9d9;
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
.wcv-btn:active, .wcv-btn.active {
|
| 86 |
-
background-color: #cccccc \9;
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
.wcv-btn:first-child {
|
| 90 |
-
*margin-left: 0;
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
.wcv-btn:hover {
|
| 94 |
-
color: #333333;
|
| 95 |
-
text-decoration: none;
|
| 96 |
-
background-color: #e6e6e6;
|
| 97 |
-
*background-color: #d9d9d9;
|
| 98 |
-
background-position: 0 -15px;
|
| 99 |
-
-webkit-transition: background-position 0.1s linear;
|
| 100 |
-
-moz-transition: background-position 0.1s linear;
|
| 101 |
-
-o-transition: background-position 0.1s linear;
|
| 102 |
-
transition: background-position 0.1s linear;
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
.wcv-btn:focus {
|
| 106 |
-
outline: thin dotted #333;
|
| 107 |
-
outline: 5px auto -webkit-focus-ring-color;
|
| 108 |
-
outline-offset: -2px;
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
.wcv-btn.active, .wcv-btn:active {
|
| 112 |
-
background-color: #e6e6e6;
|
| 113 |
-
background-color: #d9d9d9 \9;
|
| 114 |
-
background-image: none;
|
| 115 |
-
outline: 0;
|
| 116 |
-
-webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 117 |
-
-moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 118 |
-
box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
.wcv-btn.disabled, .wcv-btn[disabled] {
|
| 122 |
-
cursor: default;
|
| 123 |
-
background-color: #e6e6e6;
|
| 124 |
-
background-image: none;
|
| 125 |
-
opacity: 0.65;
|
| 126 |
-
filter: alpha(opacity=65);
|
| 127 |
-
-webkit-box-shadow: none;
|
| 128 |
-
-moz-box-shadow: none;
|
| 129 |
-
box-shadow: none;
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
.wcv-btn-large {
|
| 133 |
-
padding: 9px 14px;
|
| 134 |
-
font-size: 16px;
|
| 135 |
-
line-height: normal;
|
| 136 |
-
-webkit-border-radius: 5px;
|
| 137 |
-
-moz-border-radius: 5px;
|
| 138 |
-
border-radius: 5px;
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
.wcv-btn-large [class^="icon-"] {
|
| 142 |
-
margin-top: 2px;
|
| 143 |
-
}
|
| 144 |
-
|
| 145 |
-
.wcv-btn-small {
|
| 146 |
-
padding: 3px 9px;
|
| 147 |
-
font-size: 12px;
|
| 148 |
-
line-height: 18px;
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
.wcv-btn-small [class^="icon-"] {
|
| 152 |
-
margin-top: 0;
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
.wcv-btn-mini {
|
| 156 |
-
padding: 2px 6px;
|
| 157 |
-
font-size: 11px;
|
| 158 |
-
line-height: 17px;
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
.wcv-btn-block {
|
| 162 |
-
display: block;
|
| 163 |
-
width: 100%;
|
| 164 |
-
padding-left: 0;
|
| 165 |
-
padding-right: 0;
|
| 166 |
-
-webkit-box-sizing: border-box;
|
| 167 |
-
-moz-box-sizing: border-box;
|
| 168 |
-
box-sizing: border-box;
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
.wcv-btn-block + .wcv-btn-block {
|
| 172 |
-
margin-top: 5px;
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
input[type="submit"].wcv-btn-block, input[type="reset"].wcv-btn-block, input[type="button"].wcv-btn-block {
|
| 176 |
-
width: 100%;
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
.wcv-btn-primary.active, .wcv-btn-warning.active, .wcv-btn-danger.active, .wcv-btn-success.active, .wcv-btn-info.active, .wcv-btn-inverse.active {
|
| 180 |
-
color: rgba(255, 255, 255, 0.75);
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
.wcv-btn {
|
| 184 |
-
border-color: #c5c5c5;
|
| 185 |
-
border-color: rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.25);
|
| 186 |
-
}
|
| 187 |
-
|
| 188 |
-
.wcv-btn-primary {
|
| 189 |
-
color: #ffffff;
|
| 190 |
-
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 191 |
-
background-color: #006dcc;
|
| 192 |
-
background-image: -moz-linear-gradient(top, #0088cc, #0044cc);
|
| 193 |
-
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0044cc));
|
| 194 |
-
background-image: -webkit-linear-gradient(top, #0088cc, #0044cc);
|
| 195 |
-
background-image: -o-linear-gradient(top, #0088cc, #0044cc);
|
| 196 |
-
background-image: linear-gradient(to bottom, #0088cc, #0044cc);
|
| 197 |
-
background-repeat: repeat-x;
|
| 198 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0044cc', GradientType=0);
|
| 199 |
-
border-color: #0044cc #0044cc #002a80;
|
| 200 |
-
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 201 |
-
*background-color: #0044cc;
|
| 202 |
-
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 203 |
-
}
|
| 204 |
-
|
| 205 |
-
.wcv-btn-primary:hover, .wcv-btn-primary:active, .wcv-btn-primary.active, .wcv-btn-primary.disabled, .wcv-btn-primary[disabled] {
|
| 206 |
-
color: #ffffff;
|
| 207 |
-
background-color: #0044cc;
|
| 208 |
-
*background-color: #003bb3;
|
| 209 |
-
}
|
| 210 |
-
|
| 211 |
-
.wcv-btn-primary:active, .wcv-btn-primary.active {
|
| 212 |
-
background-color: #003399 \9;
|
| 213 |
-
}
|
| 214 |
-
|
| 215 |
-
.wcv-btn-warning {
|
| 216 |
-
color: #ffffff;
|
| 217 |
-
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 218 |
-
background-color: #faa732;
|
| 219 |
-
background-image: -moz-linear-gradient(top, #fbb450, #f89406);
|
| 220 |
-
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406));
|
| 221 |
-
background-image: -webkit-linear-gradient(top, #fbb450, #f89406);
|
| 222 |
-
background-image: -o-linear-gradient(top, #fbb450, #f89406);
|
| 223 |
-
background-image: linear-gradient(to bottom, #fbb450, #f89406);
|
| 224 |
-
background-repeat: repeat-x;
|
| 225 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffbb450', endColorstr='#fff89406', GradientType=0);
|
| 226 |
-
border-color: #f89406 #f89406 #ad6704;
|
| 227 |
-
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 228 |
-
*background-color: #f89406;
|
| 229 |
-
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 230 |
-
}
|
| 231 |
-
|
| 232 |
-
.wcv-btn-warning:hover, .wcv-btn-warning:active, .wcv-btn-warning.active, .wcv-btn-warning.disabled, .wcv-btn-warning[disabled] {
|
| 233 |
-
color: #ffffff;
|
| 234 |
-
background-color: #f89406;
|
| 235 |
-
*background-color: #df8505;
|
| 236 |
-
}
|
| 237 |
-
|
| 238 |
-
.wcv-btn-warning:active, .wcv-btn-warning.active {
|
| 239 |
-
background-color: #c67605 \9;
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
.wcv-btn-danger {
|
| 243 |
-
color: #ffffff;
|
| 244 |
-
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 245 |
-
background-color: #da4f49;
|
| 246 |
-
background-image: -moz-linear-gradient(top, #ee5f5b, #bd362f);
|
| 247 |
-
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#bd362f));
|
| 248 |
-
background-image: -webkit-linear-gradient(top, #ee5f5b, #bd362f);
|
| 249 |
-
background-image: -o-linear-gradient(top, #ee5f5b, #bd362f);
|
| 250 |
-
background-image: linear-gradient(to bottom, #ee5f5b, #bd362f);
|
| 251 |
-
background-repeat: repeat-x;
|
| 252 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffee5f5b', endColorstr='#ffbd362f', GradientType=0);
|
| 253 |
-
border-color: #bd362f #bd362f #802420;
|
| 254 |
-
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 255 |
-
*background-color: #bd362f;
|
| 256 |
-
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 257 |
-
}
|
| 258 |
-
|
| 259 |
-
.wcv-btn-danger:hover, .wcv-btn-danger:active, .wcv-btn-danger.active, .wcv-btn-danger.disabled, .wcv-btn-danger[disabled] {
|
| 260 |
-
color: #ffffff;
|
| 261 |
-
background-color: #bd362f;
|
| 262 |
-
*background-color: #a9302a;
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
.wcv-btn-danger:active, .wcv-btn-danger.active {
|
| 266 |
-
background-color: #942a25 \9;
|
| 267 |
-
}
|
| 268 |
-
|
| 269 |
-
.wcv-btn-success {
|
| 270 |
-
color: #ffffff;
|
| 271 |
-
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 272 |
-
background-color: #5bb75b;
|
| 273 |
-
background-image: -moz-linear-gradient(top, #62c462, #51a351);
|
| 274 |
-
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#51a351));
|
| 275 |
-
background-image: -webkit-linear-gradient(top, #62c462, #51a351);
|
| 276 |
-
background-image: -o-linear-gradient(top, #62c462, #51a351);
|
| 277 |
-
background-image: linear-gradient(to bottom, #62c462, #51a351);
|
| 278 |
-
background-repeat: repeat-x;
|
| 279 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff62c462', endColorstr='#ff51a351', GradientType=0);
|
| 280 |
-
border-color: #51a351 #51a351 #387038;
|
| 281 |
-
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 282 |
-
*background-color: #51a351;
|
| 283 |
-
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 284 |
-
}
|
| 285 |
-
|
| 286 |
-
.wcv-btn-success:hover, .wcv-btn-success:active, .wcv-btn-success.active, .wcv-btn-success.disabled, .wcv-btn-success[disabled] {
|
| 287 |
-
color: #ffffff;
|
| 288 |
-
background-color: #51a351;
|
| 289 |
-
*background-color: #499249;
|
| 290 |
-
}
|
| 291 |
-
|
| 292 |
-
.wcv-btn-success:active, .wcv-btn-success.active {
|
| 293 |
-
background-color: #408140 \9;
|
| 294 |
-
}
|
| 295 |
-
|
| 296 |
-
.wcv-btn-info {
|
| 297 |
-
color: #ffffff;
|
| 298 |
-
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 299 |
-
background-color: #49afcd;
|
| 300 |
-
background-image: -moz-linear-gradient(top, #5bc0de, #2f96b4);
|
| 301 |
-
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#2f96b4));
|
| 302 |
-
background-image: -webkit-linear-gradient(top, #5bc0de, #2f96b4);
|
| 303 |
-
background-image: -o-linear-gradient(top, #5bc0de, #2f96b4);
|
| 304 |
-
background-image: linear-gradient(to bottom, #5bc0de, #2f96b4);
|
| 305 |
-
background-repeat: repeat-x;
|
| 306 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff2f96b4', GradientType=0);
|
| 307 |
-
border-color: #2f96b4 #2f96b4 #1f6377;
|
| 308 |
-
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 309 |
-
*background-color: #2f96b4;
|
| 310 |
-
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
.wcv-btn-info:hover, .wcv-btn-info:active, .wcv-btn-info.active, .wcv-btn-info.disabled, .wcv-btn-info[disabled] {
|
| 314 |
-
color: #ffffff;
|
| 315 |
-
background-color: #2f96b4;
|
| 316 |
-
*background-color: #2a85a0;
|
| 317 |
-
}
|
| 318 |
-
|
| 319 |
-
.wcv-btn-info:active, .wcv-btn-info.active {
|
| 320 |
-
background-color: #24748c \9;
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
.wcv-btn-inverse {
|
| 324 |
-
color: #ffffff;
|
| 325 |
-
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 326 |
-
background-color: #363636;
|
| 327 |
-
background-image: -moz-linear-gradient(top, #444444, #222222);
|
| 328 |
-
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#444444), to(#222222));
|
| 329 |
-
background-image: -webkit-linear-gradient(top, #444444, #222222);
|
| 330 |
-
background-image: -o-linear-gradient(top, #444444, #222222);
|
| 331 |
-
background-image: linear-gradient(to bottom, #444444, #222222);
|
| 332 |
-
background-repeat: repeat-x;
|
| 333 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff444444', endColorstr='#ff222222', GradientType=0);
|
| 334 |
-
border-color: #222222 #222222 #000000;
|
| 335 |
-
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 336 |
-
*background-color: #222222;
|
| 337 |
-
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 338 |
-
}
|
| 339 |
-
|
| 340 |
-
.wcv-btn-inverse:hover, .wcv-btn-inverse:active, .wcv-btn-inverse.active, .wcv-btn-inverse.disabled, .wcv-btn-inverse[disabled] {
|
| 341 |
-
color: #ffffff;
|
| 342 |
-
background-color: #222222;
|
| 343 |
-
*background-color: #151515;
|
| 344 |
-
}
|
| 345 |
-
|
| 346 |
-
.wcv-btn-inverse:active, .wcv-btn-inverse.active {
|
| 347 |
-
background-color: #080808 \9;
|
| 348 |
-
}
|
| 349 |
-
|
| 350 |
-
button.wcv-btn, input[type="submit"].wcv-btn {
|
| 351 |
-
*padding-top: 3px;
|
| 352 |
-
*padding-bottom: 3px;
|
| 353 |
-
}
|
| 354 |
-
|
| 355 |
-
button.wcv-btn::-moz-focus-inner, input[type="submit"].wcv-btn::-moz-focus-inner {
|
| 356 |
-
padding: 0;
|
| 357 |
-
border: 0;
|
| 358 |
-
}
|
| 359 |
-
|
| 360 |
-
button.wcv-btn.wcv-btn-large, input[type="submit"].wcv-btn.wcv-btn-large {
|
| 361 |
-
*padding-top: 7px;
|
| 362 |
-
*padding-bottom: 7px;
|
| 363 |
-
}
|
| 364 |
-
|
| 365 |
-
button.wcv-btn.wcv-btn-small, input[type="submit"].wcv-btn.wcv-btn-small {
|
| 366 |
-
*padding-top: 3px;
|
| 367 |
-
*padding-bottom: 3px;
|
| 368 |
-
}
|
| 369 |
-
|
| 370 |
-
button.wcv-btn.wcv-btn-mini, input[type="submit"].wcv-btn.wcv-btn-mini {
|
| 371 |
-
*padding-top: 1px;
|
| 372 |
-
*padding-bottom: 1px;
|
| 373 |
-
}
|
| 374 |
-
|
| 375 |
-
.wcv-btn-link, .wcv-btn-link:active, .wcv-btn-link[disabled] {
|
| 376 |
-
background-color: transparent;
|
| 377 |
-
background-image: none;
|
| 378 |
-
-webkit-box-shadow: none;
|
| 379 |
-
-moz-box-shadow: none;
|
| 380 |
-
box-shadow: none;
|
| 381 |
-
}
|
| 382 |
-
|
| 383 |
-
.wcv-btn-link {
|
| 384 |
-
border-color: transparent;
|
| 385 |
-
cursor: pointer;
|
| 386 |
-
color: #0088cc;
|
| 387 |
-
-webkit-border-radius: 0;
|
| 388 |
-
-moz-border-radius: 0;
|
| 389 |
-
border-radius: 0;
|
| 390 |
-
}
|
| 391 |
-
|
| 392 |
-
.wcv-btn-link:hover {
|
| 393 |
-
color: #005580;
|
| 394 |
-
text-decoration: underline;
|
| 395 |
-
background-color: transparent;
|
| 396 |
-
}
|
| 397 |
-
|
| 398 |
-
.wcv-btn-link[disabled]:hover {
|
| 399 |
-
color: #333333;
|
| 400 |
-
text-decoration: none;
|
| 401 |
-
}
|
| 402 |
-
|
| 403 |
-
table {
|
| 404 |
-
max-width: 100%;
|
| 405 |
-
background-color: transparent;
|
| 406 |
-
border-collapse: collapse;
|
| 407 |
-
border-spacing: 0;
|
| 408 |
-
}
|
| 409 |
-
|
| 410 |
-
.table {
|
| 411 |
-
width: 100%;
|
| 412 |
-
margin-bottom: 20px;
|
| 413 |
-
}
|
| 414 |
-
|
| 415 |
-
.table th, .table td {
|
| 416 |
-
padding: 8px;
|
| 417 |
-
line-height: 20px;
|
| 418 |
-
text-align: left;
|
| 419 |
-
vertical-align: top;
|
| 420 |
-
border-top: 1px solid #dddddd;
|
| 421 |
-
}
|
| 422 |
-
|
| 423 |
-
.table th {
|
| 424 |
-
font-weight: bold;
|
| 425 |
-
}
|
| 426 |
-
|
| 427 |
-
.table thead th {
|
| 428 |
-
vertical-align: bottom;
|
| 429 |
-
}
|
| 430 |
-
|
| 431 |
-
.table caption + thead tr:first-child th, .table caption + thead tr:first-child td, .table colgroup + thead tr:first-child th, .table colgroup + thead tr:first-child td, .table thead:first-child tr:first-child th, .table thead:first-child tr:first-child td {
|
| 432 |
-
border-top: 0;
|
| 433 |
-
}
|
| 434 |
-
|
| 435 |
-
.table tbody + tbody {
|
| 436 |
-
border-top: 2px solid #dddddd;
|
| 437 |
-
}
|
| 438 |
-
|
| 439 |
-
.table-condensed th, .table-condensed td {
|
| 440 |
-
padding: 4px 5px;
|
| 441 |
-
}
|
| 442 |
-
|
| 443 |
-
.table-bordered {
|
| 444 |
-
border: 1px solid #dddddd;
|
| 445 |
-
border-collapse: separate;
|
| 446 |
-
*border-collapse: collapse;
|
| 447 |
-
border-left: 0;
|
| 448 |
-
-webkit-border-radius: 4px;
|
| 449 |
-
-moz-border-radius: 4px;
|
| 450 |
-
border-radius: 4px;
|
| 451 |
-
}
|
| 452 |
-
|
| 453 |
-
.table-bordered th, .table-bordered td {
|
| 454 |
-
border-left: 1px solid #dddddd;
|
| 455 |
-
}
|
| 456 |
-
|
| 457 |
-
.table-bordered caption + thead tr:first-child th, .table-bordered caption + tbody tr:first-child th, .table-bordered caption + tbody tr:first-child td, .table-bordered colgroup + thead tr:first-child th, .table-bordered colgroup + tbody tr:first-child th, .table-bordered colgroup + tbody tr:first-child td, .table-bordered thead:first-child tr:first-child th, .table-bordered tbody:first-child tr:first-child th, .table-bordered tbody:first-child tr:first-child td {
|
| 458 |
-
border-top: 0;
|
| 459 |
-
}
|
| 460 |
-
|
| 461 |
-
.table-bordered thead:first-child tr:first-child th:first-child, .table-bordered tbody:first-child tr:first-child td:first-child {
|
| 462 |
-
-webkit-border-top-left-radius: 4px;
|
| 463 |
-
border-top-left-radius: 4px;
|
| 464 |
-
-moz-border-radius-topleft: 4px;
|
| 465 |
-
}
|
| 466 |
-
|
| 467 |
-
.table-bordered thead:first-child tr:first-child th:last-child, .table-bordered tbody:first-child tr:first-child td:last-child {
|
| 468 |
-
-webkit-border-top-right-radius: 4px;
|
| 469 |
-
border-top-right-radius: 4px;
|
| 470 |
-
-moz-border-radius-topright: 4px;
|
| 471 |
-
}
|
| 472 |
-
|
| 473 |
-
.table-bordered thead:last-child tr:last-child th:first-child, .table-bordered tbody:last-child tr:last-child td:first-child, .table-bordered tfoot:last-child tr:last-child td:first-child {
|
| 474 |
-
-webkit-border-radius: 0 0 0 4px;
|
| 475 |
-
-moz-border-radius: 0 0 0 4px;
|
| 476 |
-
border-radius: 0 0 0 4px;
|
| 477 |
-
-webkit-border-bottom-left-radius: 4px;
|
| 478 |
-
border-bottom-left-radius: 4px;
|
| 479 |
-
-moz-border-radius-bottomleft: 4px;
|
| 480 |
-
}
|
| 481 |
-
|
| 482 |
-
.table-bordered thead:last-child tr:last-child th:last-child, .table-bordered tbody:last-child tr:last-child td:last-child, .table-bordered tfoot:last-child tr:last-child td:last-child {
|
| 483 |
-
-webkit-border-bottom-right-radius: 4px;
|
| 484 |
-
border-bottom-right-radius: 4px;
|
| 485 |
-
-moz-border-radius-bottomright: 4px;
|
| 486 |
-
}
|
| 487 |
-
|
| 488 |
-
.table-bordered caption + thead tr:first-child th:first-child, .table-bordered caption + tbody tr:first-child td:first-child, .table-bordered colgroup + thead tr:first-child th:first-child, .table-bordered colgroup + tbody tr:first-child td:first-child {
|
| 489 |
-
-webkit-border-top-left-radius: 4px;
|
| 490 |
-
border-top-left-radius: 4px;
|
| 491 |
-
-moz-border-radius-topleft: 4px;
|
| 492 |
-
}
|
| 493 |
-
|
| 494 |
-
.table-bordered caption + thead tr:first-child th:last-child, .table-bordered caption + tbody tr:first-child td:last-child, .table-bordered colgroup + thead tr:first-child th:last-child, .table-bordered colgroup + tbody tr:first-child td:last-child {
|
| 495 |
-
-webkit-border-top-right-radius: 4px;
|
| 496 |
-
border-top-right-radius: 4px;
|
| 497 |
-
-moz-border-radius-topleft: 4px;
|
| 498 |
-
}
|
| 499 |
-
|
| 500 |
-
.table-striped tbody tr:nth-child(odd) td, .table-striped tbody tr:nth-child(odd) th {
|
| 501 |
-
background-color: #f9f9f9;
|
| 502 |
-
}
|
| 503 |
-
|
| 504 |
-
.table-hover tbody tr:hover td, .table-hover tbody tr:hover th {
|
| 505 |
-
background-color: #f5f5f5;
|
| 506 |
-
}
|
| 507 |
-
|
| 508 |
-
table [class*=span], .row-fluid table [class*=span] {
|
| 509 |
-
display: table-cell;
|
| 510 |
-
float: none;
|
| 511 |
-
margin-left: 0;
|
| 512 |
-
}
|
| 513 |
-
|
| 514 |
-
.table tbody tr.success td {
|
| 515 |
-
background-color: #dff0d8;
|
| 516 |
-
}
|
| 517 |
-
|
| 518 |
-
.table tbody tr.error td {
|
| 519 |
-
background-color: #f2dede;
|
| 520 |
-
}
|
| 521 |
-
|
| 522 |
-
.table tbody tr.warning td {
|
| 523 |
-
background-color: #fcf8e3;
|
| 524 |
-
}
|
| 525 |
-
|
| 526 |
-
.table tbody tr.info td {
|
| 527 |
-
background-color: #d9edf7;
|
| 528 |
-
}
|
| 529 |
-
|
| 530 |
-
.table-hover tbody tr.success:hover td {
|
| 531 |
-
background-color: #d0e9c6;
|
| 532 |
-
}
|
| 533 |
-
|
| 534 |
-
.table-hover tbody tr.error:hover td {
|
| 535 |
-
background-color: #ebcccc;
|
| 536 |
-
}
|
| 537 |
-
|
| 538 |
-
.table-hover tbody tr.warning:hover td {
|
| 539 |
-
background-color: #faf2cc;
|
| 540 |
-
}
|
| 541 |
-
|
| 542 |
-
.table-hover tbody tr.info:hover td {
|
| 543 |
-
background-color: #c4e3f3;
|
| 544 |
-
}
|
| 545 |
-
.hidden { display: none; }
|
| 546 |
-
|
| 547 |
-
.vendor_list .button { width: 100%; }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/css/wcv-setup.css
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/** WC Vendors setup wizard styles */
|
| 2 |
-
/** WooCommerce CSS Variables */
|
| 3 |
-
body { margin: 65px auto 24px; -webkit-box-shadow: none; box-shadow: none; background: #f1f1f1; padding: 0; }
|
| 4 |
-
|
| 5 |
-
#wcv-logo { border: 0; margin: 0 0 24px; padding: 0; text-align: center; }
|
| 6 |
-
|
| 7 |
-
#wcv-logo img { max-width: 30%; }
|
| 8 |
-
|
| 9 |
-
.wcv-setup-content { -webkit-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.13); box-shadow: 0 1px 3px rgba(0, 0, 0, 0.13); padding: 2em; margin: 0 0 20px; background: #fff; overflow: hidden; zoom: 1; }
|
| 10 |
-
|
| 11 |
-
.wcv-setup-content h1, .wcv-setup-content h2, .wcv-setup-content h3, .wcv-setup-content table { margin: 0 0 20px; border: 0; padding: 0; color: #666; clear: none; font-weight: 500; }
|
| 12 |
-
|
| 13 |
-
.wcv-setup-content p { margin: 20px 0; font-size: 1em; line-height: 1.75em; color: #666; }
|
| 14 |
-
|
| 15 |
-
.wcv-setup-content table { font-size: 1em; line-height: 1.75em; color: #666; }
|
| 16 |
-
|
| 17 |
-
.wcv-setup-content a { color: #005580; }
|
| 18 |
-
|
| 19 |
-
.wcv-setup-content a:hover, .wcv-setup-content a:focus { color: #111; }
|
| 20 |
-
|
| 21 |
-
.wcv-setup-content h4.help-title { text-align: center; }
|
| 22 |
-
|
| 23 |
-
.wcv-setup-content .wcv-setup-input input { padding: 5px 10px; font-size: 1em; }
|
| 24 |
-
|
| 25 |
-
.wcv-setup-content .wcv-setup-next-steps { overflow: hidden; margin: 0 0 24px; padding-bottom: 2px; }
|
| 26 |
-
|
| 27 |
-
.wcv-setup-content .wcv-setup-next-steps h2 { margin-bottom: 12px; }
|
| 28 |
-
|
| 29 |
-
.wcv-setup-content .wcv-setup-next-steps .wcv-setup-next-steps-first { float: left; width: 50%; -webkit-box-sizing: border-box; box-sizing: border-box; }
|
| 30 |
-
|
| 31 |
-
.wcv-setup-content .wcv-setup-next-steps .wcv-setup-next-steps-last { float: right; width: 50%; -webkit-box-sizing: border-box; box-sizing: border-box; }
|
| 32 |
-
|
| 33 |
-
.wcv-setup-content .wcv-setup-next-steps ul { padding: 0 2em 0 0; list-style: none outside; margin: 0; }
|
| 34 |
-
|
| 35 |
-
.wcv-setup-content .wcv-setup-next-steps ul li a { display: block; padding: 0 0 0.75em; }
|
| 36 |
-
|
| 37 |
-
.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button { background-color: #f7f7f7; border-color: #ccc; color: #23282d; -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #ccc; box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #ccc; text-shadow: 1px 0 1px #eee, 0 1px 1px #eee; font-size: 1em; height: auto; line-height: 1.75em; margin: 0 0 0.75em; opacity: 1; padding: 1em; text-align: center; }
|
| 38 |
-
|
| 39 |
-
.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button:hover, .wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button:focus, .wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button:active { background: #5897b6; border-color: #aaa; }
|
| 40 |
-
|
| 41 |
-
.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button-primary { color: #fff; background-color: #bb77ae; border-color: #5897b6; -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #5897b6; box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #5897b6; text-shadow: 0 -1px 1px #5897b6, 1px 0 1px #5897b6, 0 1px 1px #5897b6, -1px 0 1px #5897b6; }
|
| 42 |
-
|
| 43 |
-
.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button-primary:hover, .wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button-primary:focus, .wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button-primary:active { color: #fff; background: #5897b6; border-color: #5897b6; -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #5897b6; box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #5897b6; }
|
| 44 |
-
|
| 45 |
-
.wcv-setup-content .wcv-setup-next-steps ul li a::before { color: #82878c; font: normal 20px/1 'dashicons'; speak: none; display: inline-block; padding: 0 10px 0 0; top: 1px; position: relative; -webkit-font-smoothing: antialiased; -moz-osx-font-smoothing: grayscale; text-decoration: none !important; vertical-align: top; }
|
| 46 |
-
|
| 47 |
-
.wcv-setup-content .wcv-setup-next-steps ul .learn-more a::before { content: '\f105'; }
|
| 48 |
-
|
| 49 |
-
.wcv-setup-content .wcv-setup-next-steps ul .video-walkthrough a::before { content: '\f126'; }
|
| 50 |
-
|
| 51 |
-
.wcv-setup-content .wcv-setup-next-steps ul .newsletter a::before { content: '\f465'; }
|
| 52 |
-
|
| 53 |
-
.wcv-setup-content .wcvendors-newsletter, .wcv-setup-content .wcvendors-tracker, .wcv-setup-content .updated { padding: 24px 24px 0; margin: 0 0 24px; overflow: hidden; background: #f5f5f5; }
|
| 54 |
-
|
| 55 |
-
.wcv-setup-content .wcvendors-newsletter p, .wcv-setup-content .wcvendors-tracker p, .wcv-setup-content .updated p { padding: 0; margin: 0 0 12px; }
|
| 56 |
-
|
| 57 |
-
.wcv-setup-content .wcvendors-newsletter form, .wcv-setup-content .wcvendors-newsletter p:last-child, .wcv-setup-content .wcvendors-tracker form, .wcv-setup-content .wcvendors-tracker p:last-child, .wcv-setup-content .updated form, .wcv-setup-content .updated p:last-child { margin: 0 0 24px; }
|
| 58 |
-
|
| 59 |
-
.wcv-setup-content .wcvendors-tracker + .wcvendors-newsletter { margin-top: -24px; border-top: 2px dashed #ddd; }
|
| 60 |
-
|
| 61 |
-
.wcv-setup-steps { padding: 0 0 24px; margin: 0; list-style: none outside; overflow: hidden; color: #ccc; width: 100%; display: -webkit-inline-box; display: -ms-inline-flexbox; display: inline-flex; }
|
| 62 |
-
|
| 63 |
-
.wcv-setup-steps li { width: 25%; float: left; padding: 0 0 0.8em; margin: 0; text-align: center; position: relative; border-bottom: 4px solid #ccc; line-height: 1.4em; }
|
| 64 |
-
|
| 65 |
-
.wcv-setup-steps li::before { content: ''; border: 4px solid #ccc; border-radius: 100%; width: 4px; height: 4px; position: absolute; bottom: 0; left: 50%; margin-left: -6px; margin-bottom: -8px; background: #fff; }
|
| 66 |
-
|
| 67 |
-
.wcv-setup-steps li.active { border-color: #5897b6; color: #005580; }
|
| 68 |
-
|
| 69 |
-
.wcv-setup-steps li.active::before { border-color: #005580; }
|
| 70 |
-
|
| 71 |
-
.wcv-setup-steps li.done { border-color: #5897b6; color: #005580; }
|
| 72 |
-
|
| 73 |
-
.wcv-setup-steps li.done::before { border-color: #5897b6; background: #5897b6; }
|
| 74 |
-
|
| 75 |
-
.wcv-setup .wcv-setup-actions { overflow: hidden; margin: 20px 0 0; }
|
| 76 |
-
|
| 77 |
-
.wcv-setup .wcv-setup-actions .button { font-size: 1.25em; line-height: 1em; margin-right: 0.5em; margin-bottom: 2px; height: auto; border-radius: 4px; }
|
| 78 |
-
|
| 79 |
-
.wcv-setup .wcv-setup-actions .button-primary { background-color: #005580; border-color: #5897b6; -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #5897b6; box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #5897b6; text-shadow: 0 -1px 1px #5897b6, 1px 0 1px #5897b6, 0 1px 1px #5897b6, -1px 0 1px #5897b6; margin: 0; opacity: 1; }
|
| 80 |
-
|
| 81 |
-
.wcv-setup .wcv-setup-actions .button-primary:hover, .wcv-setup .wcv-setup-actions .button-primary:focus, .wcv-setup .wcv-setup-actions .button-primary:active { background: #5897b6; border-color: #5897b6; -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #5897b6; box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #5897b6; }
|
| 82 |
-
|
| 83 |
-
.wcv-setup-content p:last-child { margin-bottom: 0; }
|
| 84 |
-
|
| 85 |
-
.wcv-setup-content p.store-setup { margin-top: 0; }
|
| 86 |
-
|
| 87 |
-
.wcv-return-to-dashboard { font-size: 0.85em; color: #b5b5b5; margin: 1.18em 0; display: block; text-align: center; }
|
| 88 |
-
|
| 89 |
-
.wcv-wizard-storefront .wcv-wizard-storefront-intro { padding: 40px 40px 0; background: #F5F5F5; text-align: center; }
|
| 90 |
-
|
| 91 |
-
.wcv-wizard-storefront .wcv-wizard-storefront-intro img { margin: 40px 0 0 0; width: 100%; display: block; }
|
| 92 |
-
|
| 93 |
-
.wcv-wizard-storefront .wcv-wizard-storefront-features { list-style: none outside; margin: 0 0 20px; padding: 0 0 0 30px; overflow: hidden; }
|
| 94 |
-
|
| 95 |
-
.wcv-wizard-storefront .wcv-wizard-storefront-feature { margin: 0; padding: 20px 30px 20px 2em; width: 50%; -webkit-box-sizing: border-box; box-sizing: border-box; }
|
| 96 |
-
|
| 97 |
-
.wcv-wizard-storefront .wcv-wizard-storefront-feature::before { margin-left: -2em; position: absolute; }
|
| 98 |
-
|
| 99 |
-
.wcv-wizard-storefront .wcv-wizard-storefront-feature.first { clear: both; float: left; }
|
| 100 |
-
|
| 101 |
-
.wcv-wizard-storefront .wcv-wizard-storefront-feature.last { float: right; }
|
| 102 |
-
|
| 103 |
-
.hide { display: none; }
|
| 104 |
-
|
| 105 |
-
.wcv-wizard-features { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; list-style: none; padding: 0; }
|
| 106 |
-
|
| 107 |
-
.wcv-wizard-features .wcv-wizard-feature-item { -ms-flex-preferred-size: calc( 50% - 4em - 3px); flex-basis: calc( 50% - 4em - 3px); border: 1px solid #eee; padding: 2em; }
|
| 108 |
-
|
| 109 |
-
.wcv-wizard-features .wcv-wizard-feature-item:nth-child(1) { border-radius: 4px 0 0 0; }
|
| 110 |
-
|
| 111 |
-
.wcv-wizard-features .wcv-wizard-feature-item:nth-child(2) { border-left: 0; border-radius: 0 4px 0 0; }
|
| 112 |
-
|
| 113 |
-
.wcv-wizard-features .wcv-wizard-feature-item:nth-child(3) { border-top: 0; border-radius: 0 0 0 4px; }
|
| 114 |
-
|
| 115 |
-
.wcv-wizard-features .wcv-wizard-feature-item:nth-child(4) { border-top: 0; border-left: 0; border-radius: 0 0 4px 0; }
|
| 116 |
-
|
| 117 |
-
.wcv-wizard-features p.wcv-wizard-feature-name, .wcv-wizard-features p.wcv-wizard-feature-description { margin: 0; line-height: 1.5em; }
|
| 118 |
-
|
| 119 |
-
.step { text-align: center; }
|
| 120 |
-
|
| 121 |
-
.wcv-setup .wcv-setup-actions .button { font-weight: 300; font-size: 16px; padding: 0.5em 1em; -webkit-box-shadow: none; box-shadow: none; min-width: 12em; min-width: auto; margin-top: 10px; background-color: #005580; color: #fff; }
|
| 122 |
-
|
| 123 |
-
.wcv-setup .wcv-setup-actions .button:focus, .wcv-setup .wcv-setup-actions .button:hover, .wcv-setup .wcv-setup-actions .button:active { -webkit-box-shadow: none; box-shadow: none; background-color: #5897b6; }
|
| 124 |
-
|
| 125 |
-
.location-prompt { color: #666; font-size: 13px; font-weight: 500; margin-bottom: 0.5em; margin-top: 1em; display: inline-block; }
|
| 126 |
-
|
| 127 |
-
.address-step .select2 { min-width: 100%; }
|
| 128 |
-
|
| 129 |
-
.store-address-container { margin-bottom: 24px; }
|
| 130 |
-
|
| 131 |
-
.store-address-container .city-and-postcode { display: -webkit-box; display: -ms-flexbox; display: flex; }
|
| 132 |
-
|
| 133 |
-
.store-address-container .city-and-postcode div { -ms-flex-preferred-size: 50%; flex-basis: 50%; margin-right: 1em; }
|
| 134 |
-
|
| 135 |
-
.store-address-container .city-and-postcode div:last-of-type { margin-right: 0; }
|
| 136 |
-
|
| 137 |
-
.wcv-wizard-service-settings .payment-email-input { border: 1px solid #aaa; border-color: #ddd; border-radius: 4px; height: 30px; padding: 0 8px; font-size: 14px; color: #444; background-color: #fff; display: inline-block; }
|
| 138 |
-
|
| 139 |
-
.newsletter-form-container { display: -webkit-box; display: -ms-flexbox; display: flex; }
|
| 140 |
-
|
| 141 |
-
.newsletter-form-container .newsletter-form-email { border: 1px solid #aaa; border-color: #ddd; border-radius: 4px; height: 42px; padding: 0 8px; font-size: 16px; color: #666; background-color: #fff; display: inline-block; margin-right: 6px; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; }
|
| 142 |
-
|
| 143 |
-
.newsletter-form-container .newsletter-form-button-container { -webkit-box-flex: 0; -ms-flex-positive: 0; flex-grow: 0; }
|
| 144 |
-
|
| 145 |
-
.wcv-setup .wcv-setup-actions .button.newsletter-form-button { height: 42px; padding: 0 1em; margin: 0; }
|
| 146 |
-
|
| 147 |
-
.wcv-wizard-next-steps { border: 1px solid #eee; border-radius: 4px; list-style: none; padding: 0; }
|
| 148 |
-
|
| 149 |
-
.wcv-wizard-next-steps li { padding: 0; }
|
| 150 |
-
|
| 151 |
-
.wcv-wizard-next-steps .wcv-wizard-next-step-item { display: -webkit-box; display: -ms-flexbox; display: flex; border-top: 1px solid #eee; }
|
| 152 |
-
|
| 153 |
-
.wcv-wizard-next-steps .wcv-wizard-next-step-item:first-child { border-top: 0; }
|
| 154 |
-
|
| 155 |
-
.wcv-wizard-next-steps .wcv-wizard-next-step-description { -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; margin: 1.5em; }
|
| 156 |
-
|
| 157 |
-
.wcv-wizard-next-steps .wcv-wizard-next-step-action { -webkit-box-flex: 0; -ms-flex-positive: 0; flex-grow: 0; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; }
|
| 158 |
-
|
| 159 |
-
.wcv-wizard-next-steps .wcv-wizard-next-step-action .button { margin: 1em; }
|
| 160 |
-
|
| 161 |
-
.wcv-wizard-next-steps p.next-step-heading { margin: 0; font-size: 0.95em; font-weight: 400; font-variant: all-petite-caps; }
|
| 162 |
-
|
| 163 |
-
.wcv-wizard-next-steps p.next-step-extra-info { margin: 0; }
|
| 164 |
-
|
| 165 |
-
.wcv-wizard-next-steps h3.next-step-description { margin: 0; font-size: 16px; font-weight: 600; }
|
| 166 |
-
|
| 167 |
-
p.next-steps-help-text { color: #9f9f9f; padding: 0 2em; text-align: center; font-size: .9em; }
|
| 168 |
-
|
| 169 |
-
.wcv-setup-table { width: 100%; }
|
| 170 |
-
|
| 171 |
-
.wcv-setup-table .table-desc { width: 80%; }
|
| 172 |
-
|
| 173 |
-
.wcv-setup-table .table-check { width: 20%; text-align: right; }
|
| 174 |
-
|
| 175 |
-
.wcv-setup-table .table-check input.option_check { line-height: 4em; }
|
| 176 |
-
|
| 177 |
-
.wcv-setup-table-pages { width: 100%; }
|
| 178 |
-
|
| 179 |
-
.wcv-setup-table-pages .table-desc { width: 60%; }
|
| 180 |
-
|
| 181 |
-
.wcv-setup-table-pages .table-check { width: 40%; }
|
| 182 |
-
|
| 183 |
-
.wcv-setup-table-pages select { width: 100%; }
|
| 184 |
-
|
| 185 |
-
.wcv-setup-table-pages .tool-tip { font-size: 0.75em; }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/css/wcv-setup.min.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
body{margin:65px auto 24px;-webkit-box-shadow:none;box-shadow:none;background:#f1f1f1;padding:0}#wcv-logo{border:0;margin:0 0 24px;padding:0;text-align:center}#wcv-logo img{max-width:30%}.wcv-setup-content{-webkit-box-shadow:0 1px 3px rgba(0,0,0,.13);box-shadow:0 1px 3px rgba(0,0,0,.13);padding:2em;margin:0 0 20px;background:#fff;overflow:hidden;zoom:1}.wcv-setup-content h1,.wcv-setup-content h2,.wcv-setup-content h3,.wcv-setup-content table{margin:0 0 20px;border:0;padding:0;color:#666;clear:none;font-weight:500}.wcv-setup-content p{margin:20px 0;font-size:1em;line-height:1.75em;color:#666}.wcv-setup-content table{font-size:1em;line-height:1.75em;color:#666}.wcv-setup-content a{color:#005580}.wcv-setup-content a:focus,.wcv-setup-content a:hover{color:#111}.wcv-setup-content h4.help-title{text-align:center}.wcv-setup-content .wcv-setup-input input{padding:5px 10px;font-size:1em}.wcv-setup-content .wcv-setup-next-steps{overflow:hidden;margin:0 0 24px;padding-bottom:2px}.wcv-setup-content .wcv-setup-next-steps h2{margin-bottom:12px}.wcv-setup-content .wcv-setup-next-steps .wcv-setup-next-steps-first{float:left;width:50%;-webkit-box-sizing:border-box;box-sizing:border-box}.wcv-setup-content .wcv-setup-next-steps .wcv-setup-next-steps-last{float:right;width:50%;-webkit-box-sizing:border-box;box-sizing:border-box}.wcv-setup-content .wcv-setup-next-steps ul{padding:0 2em 0 0;list-style:none outside;margin:0}.wcv-setup-content .wcv-setup-next-steps ul li a{display:block;padding:0 0 .75em}.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button{background-color:#f7f7f7;border-color:#ccc;color:#23282d;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #ccc;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #ccc;text-shadow:1px 0 1px #eee,0 1px 1px #eee;font-size:1em;height:auto;line-height:1.75em;margin:0 0 .75em;opacity:1;padding:1em;text-align:center}.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button:active,.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button:focus,.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button:hover{background:#5897b6;border-color:#aaa}.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button-primary{color:#fff;background-color:#bb77ae;border-color:#5897b6;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #5897b6;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #5897b6;text-shadow:0 -1px 1px #5897b6,1px 0 1px #5897b6,0 1px 1px #5897b6,-1px 0 1px #5897b6}.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button-primary:active,.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button-primary:focus,.wcv-setup-content .wcv-setup-next-steps ul .setup-product a.button-primary:hover{color:#fff;background:#5897b6;border-color:#5897b6;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #5897b6;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #5897b6}.wcv-setup-content .wcv-setup-next-steps ul li a::before{color:#82878c;font:normal 20px/1 dashicons;speak:none;display:inline-block;padding:0 10px 0 0;top:1px;position:relative;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;text-decoration:none!important;vertical-align:top}.wcv-setup-content .wcv-setup-next-steps ul .learn-more a::before{content:'\f105'}.wcv-setup-content .wcv-setup-next-steps ul .video-walkthrough a::before{content:'\f126'}.wcv-setup-content .wcv-setup-next-steps ul .newsletter a::before{content:'\f465'}.wcv-setup-content .updated,.wcv-setup-content .wcvendors-newsletter,.wcv-setup-content .wcvendors-tracker{padding:24px 24px 0;margin:0 0 24px;overflow:hidden;background:#f5f5f5}.wcv-setup-content .updated p,.wcv-setup-content .wcvendors-newsletter p,.wcv-setup-content .wcvendors-tracker p{padding:0;margin:0 0 12px}.wcv-setup-content .updated form,.wcv-setup-content .updated p:last-child,.wcv-setup-content .wcvendors-newsletter form,.wcv-setup-content .wcvendors-newsletter p:last-child,.wcv-setup-content .wcvendors-tracker form,.wcv-setup-content .wcvendors-tracker p:last-child{margin:0 0 24px}.wcv-setup-content .wcvendors-tracker+.wcvendors-newsletter{margin-top:-24px;border-top:2px dashed #ddd}.wcv-setup-steps{padding:0 0 24px;margin:0;list-style:none outside;overflow:hidden;color:#ccc;width:100%;display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex}.wcv-setup-steps li{width:25%;float:left;padding:0 0 .8em;margin:0;text-align:center;position:relative;border-bottom:4px solid #ccc;line-height:1.4em}.wcv-setup-steps li::before{content:'';border:4px solid #ccc;border-radius:100%;width:4px;height:4px;position:absolute;bottom:0;left:50%;margin-left:-6px;margin-bottom:-8px;background:#fff}.wcv-setup-steps li.active{border-color:#5897b6;color:#005580}.wcv-setup-steps li.active::before{border-color:#005580}.wcv-setup-steps li.done{border-color:#5897b6;color:#005580}.wcv-setup-steps li.done::before{border-color:#5897b6;background:#5897b6}.wcv-setup .wcv-setup-actions{overflow:hidden;margin:20px 0 0}.wcv-setup .wcv-setup-actions .button{font-size:1.25em;line-height:1em;margin-right:.5em;margin-bottom:2px;height:auto;border-radius:4px}.wcv-setup .wcv-setup-actions .button-primary{background-color:#005580;border-color:#5897b6;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #5897b6;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #5897b6;text-shadow:0 -1px 1px #5897b6,1px 0 1px #5897b6,0 1px 1px #5897b6,-1px 0 1px #5897b6;margin:0;opacity:1}.wcv-setup .wcv-setup-actions .button-primary:active,.wcv-setup .wcv-setup-actions .button-primary:focus,.wcv-setup .wcv-setup-actions .button-primary:hover{background:#5897b6;border-color:#5897b6;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #5897b6;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #5897b6}.wcv-setup-content p:last-child{margin-bottom:0}.wcv-setup-content p.store-setup{margin-top:0}.wcv-return-to-dashboard{font-size:.85em;color:#b5b5b5;margin:1.18em 0;display:block;text-align:center}.wcv-wizard-storefront .wcv-wizard-storefront-intro{padding:40px 40px 0;background:#f5f5f5;text-align:center}.wcv-wizard-storefront .wcv-wizard-storefront-intro img{margin:40px 0 0 0;width:100%;display:block}.wcv-wizard-storefront .wcv-wizard-storefront-features{list-style:none outside;margin:0 0 20px;padding:0 0 0 30px;overflow:hidden}.wcv-wizard-storefront .wcv-wizard-storefront-feature{margin:0;padding:20px 30px 20px 2em;width:50%;-webkit-box-sizing:border-box;box-sizing:border-box}.wcv-wizard-storefront .wcv-wizard-storefront-feature::before{margin-left:-2em;position:absolute}.wcv-wizard-storefront .wcv-wizard-storefront-feature.first{clear:both;float:left}.wcv-wizard-storefront .wcv-wizard-storefront-feature.last{float:right}.hide{display:none}.wcv-wizard-features{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;list-style:none;padding:0}.wcv-wizard-features .wcv-wizard-feature-item{-ms-flex-preferred-size:calc(50% - 4em - 3px);flex-basis:calc(50% - 4em - 3px);border:1px solid #eee;padding:2em}.wcv-wizard-features .wcv-wizard-feature-item:nth-child(1){border-radius:4px 0 0 0}.wcv-wizard-features .wcv-wizard-feature-item:nth-child(2){border-left:0;border-radius:0 4px 0 0}.wcv-wizard-features .wcv-wizard-feature-item:nth-child(3){border-top:0;border-radius:0 0 0 4px}.wcv-wizard-features .wcv-wizard-feature-item:nth-child(4){border-top:0;border-left:0;border-radius:0 0 4px 0}.wcv-wizard-features p.wcv-wizard-feature-description,.wcv-wizard-features p.wcv-wizard-feature-name{margin:0;line-height:1.5em}.step{text-align:center}.wcv-setup .wcv-setup-actions .button{font-weight:300;font-size:16px;padding:.5em 1em;-webkit-box-shadow:none;box-shadow:none;min-width:12em;min-width:auto;margin-top:10px;background-color:#005580;color:#fff}.wcv-setup .wcv-setup-actions .button:active,.wcv-setup .wcv-setup-actions .button:focus,.wcv-setup .wcv-setup-actions .button:hover{-webkit-box-shadow:none;box-shadow:none;background-color:#5897b6}.location-prompt{color:#666;font-size:13px;font-weight:500;margin-bottom:.5em;margin-top:1em;display:inline-block}.address-step .select2{min-width:100%}.store-address-container{margin-bottom:24px}.store-address-container .city-and-postcode{display:-webkit-box;display:-ms-flexbox;display:flex}.store-address-container .city-and-postcode div{-ms-flex-preferred-size:50%;flex-basis:50%;margin-right:1em}.store-address-container .city-and-postcode div:last-of-type{margin-right:0}.wcv-wizard-service-settings .payment-email-input{border:1px solid #aaa;border-color:#ddd;border-radius:4px;height:30px;padding:0 8px;font-size:14px;color:#444;background-color:#fff;display:inline-block}.newsletter-form-container{display:-webkit-box;display:-ms-flexbox;display:flex}.newsletter-form-container .newsletter-form-email{border:1px solid #aaa;border-color:#ddd;border-radius:4px;height:42px;padding:0 8px;font-size:16px;color:#666;background-color:#fff;display:inline-block;margin-right:6px;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1}.newsletter-form-container .newsletter-form-button-container{-webkit-box-flex:0;-ms-flex-positive:0;flex-grow:0}.wcv-setup .wcv-setup-actions .button.newsletter-form-button{height:42px;padding:0 1em;margin:0}.wcv-wizard-next-steps{border:1px solid #eee;border-radius:4px;list-style:none;padding:0}.wcv-wizard-next-steps li{padding:0}.wcv-wizard-next-steps .wcv-wizard-next-step-item{display:-webkit-box;display:-ms-flexbox;display:flex;border-top:1px solid #eee}.wcv-wizard-next-steps .wcv-wizard-next-step-item:first-child{border-top:0}.wcv-wizard-next-steps .wcv-wizard-next-step-description{-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;margin:1.5em}.wcv-wizard-next-steps .wcv-wizard-next-step-action{-webkit-box-flex:0;-ms-flex-positive:0;flex-grow:0;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.wcv-wizard-next-steps .wcv-wizard-next-step-action .button{margin:1em}.wcv-wizard-next-steps p.next-step-heading{margin:0;font-size:.95em;font-weight:400;font-variant:all-petite-caps}.wcv-wizard-next-steps p.next-step-extra-info{margin:0}.wcv-wizard-next-steps h3.next-step-description{margin:0;font-size:16px;font-weight:600}p.next-steps-help-text{color:#9f9f9f;padding:0 2em;text-align:center;font-size:.9em}.wcv-setup-table{width:100%}.wcv-setup-table .table-desc{width:80%}.wcv-setup-table .table-check{width:20%;text-align:right}.wcv-setup-table .table-check input.option_check{line-height:4em}.wcv-setup-table-pages{width:100%}.wcv-setup-table-pages .table-desc{width:60%}.wcv-setup-table-pages .table-check{width:40%}.wcv-setup-table-pages select{width:100%}.wcv-setup-table-pages .tool-tip{font-size:.75em}
|
|
|
trunk/assets/css/wcv-setup.scss
DELETED
|
@@ -1,540 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* WC Vendors setup wizard styles
|
| 3 |
-
*/
|
| 4 |
-
|
| 5 |
-
@import 'variables';
|
| 6 |
-
|
| 7 |
-
body {
|
| 8 |
-
margin: 65px auto 24px;
|
| 9 |
-
box-shadow: none;
|
| 10 |
-
background: #f1f1f1;
|
| 11 |
-
padding: 0;
|
| 12 |
-
}
|
| 13 |
-
#wcv-logo {
|
| 14 |
-
border: 0;
|
| 15 |
-
margin: 0 0 24px;
|
| 16 |
-
padding: 0;
|
| 17 |
-
text-align: center;
|
| 18 |
-
img {
|
| 19 |
-
max-width: 30%;
|
| 20 |
-
}
|
| 21 |
-
}
|
| 22 |
-
.wcv-setup-content {
|
| 23 |
-
box-shadow: 0 1px 3px rgba(0, 0, 0, 0.13);
|
| 24 |
-
padding: 2em;
|
| 25 |
-
margin: 0 0 20px;
|
| 26 |
-
background: #fff;
|
| 27 |
-
overflow: hidden;
|
| 28 |
-
zoom: 1;
|
| 29 |
-
|
| 30 |
-
h1, h2, h3, table {
|
| 31 |
-
margin: 0 0 20px;
|
| 32 |
-
border: 0;
|
| 33 |
-
padding: 0;
|
| 34 |
-
color: #666;
|
| 35 |
-
clear: none;
|
| 36 |
-
font-weight: 500;
|
| 37 |
-
}
|
| 38 |
-
p {
|
| 39 |
-
margin: 20px 0;
|
| 40 |
-
font-size: 1em;
|
| 41 |
-
line-height: 1.75em;
|
| 42 |
-
color: #666;
|
| 43 |
-
}
|
| 44 |
-
table {
|
| 45 |
-
font-size: 1em;
|
| 46 |
-
line-height: 1.75em;
|
| 47 |
-
color: #666;
|
| 48 |
-
}
|
| 49 |
-
a {
|
| 50 |
-
color: $wcvendors;
|
| 51 |
-
&:hover, &:focus {
|
| 52 |
-
color: #111;
|
| 53 |
-
}
|
| 54 |
-
}
|
| 55 |
-
h4.help-title {
|
| 56 |
-
text-align: center;
|
| 57 |
-
}
|
| 58 |
-
.wcv-setup-input {
|
| 59 |
-
|
| 60 |
-
input {
|
| 61 |
-
padding: 5px 10px;
|
| 62 |
-
font-size: 1em;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
}
|
| 66 |
-
.wcv-setup-next-steps {
|
| 67 |
-
overflow: hidden;
|
| 68 |
-
margin: 0 0 24px;
|
| 69 |
-
padding-bottom: 2px;
|
| 70 |
-
h2 {
|
| 71 |
-
margin-bottom: 12px;
|
| 72 |
-
}
|
| 73 |
-
.wcv-setup-next-steps-first {
|
| 74 |
-
float: left;
|
| 75 |
-
width: 50%;
|
| 76 |
-
box-sizing: border-box;
|
| 77 |
-
}
|
| 78 |
-
.wcv-setup-next-steps-last {
|
| 79 |
-
float: right;
|
| 80 |
-
width: 50%;
|
| 81 |
-
box-sizing: border-box;
|
| 82 |
-
}
|
| 83 |
-
ul {
|
| 84 |
-
padding: 0 2em 0 0;
|
| 85 |
-
list-style: none outside;
|
| 86 |
-
margin: 0;
|
| 87 |
-
li a {
|
| 88 |
-
display: block;
|
| 89 |
-
padding: 0 0 0.75em;
|
| 90 |
-
}
|
| 91 |
-
.setup-product {
|
| 92 |
-
a.button {
|
| 93 |
-
background-color: #f7f7f7;
|
| 94 |
-
border-color: #ccc;
|
| 95 |
-
color: #23282d;
|
| 96 |
-
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 #ccc;
|
| 97 |
-
text-shadow: 1px 0 1px #eee, 0 1px 1px #eee;
|
| 98 |
-
font-size: 1em;
|
| 99 |
-
height: auto;
|
| 100 |
-
line-height: 1.75em;
|
| 101 |
-
margin: 0 0 0.75em;
|
| 102 |
-
opacity: 1;
|
| 103 |
-
padding: 1em;
|
| 104 |
-
text-align: center;
|
| 105 |
-
|
| 106 |
-
&:hover, &:focus, &:active {
|
| 107 |
-
background: $wcvendors-light;
|
| 108 |
-
border-color: #aaa;
|
| 109 |
-
}
|
| 110 |
-
}
|
| 111 |
-
a.button-primary {
|
| 112 |
-
color: #fff;
|
| 113 |
-
background-color: #bb77ae;
|
| 114 |
-
border-color: $wcvendors-light;
|
| 115 |
-
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 $wcvendors-light;
|
| 116 |
-
text-shadow: 0 -1px 1px $wcvendors-light, 1px 0 1px $wcvendors-light, 0 1px 1px $wcvendors-light, -1px 0 1px $wcvendors-light;
|
| 117 |
-
|
| 118 |
-
&:hover, &:focus, &:active {
|
| 119 |
-
color: #fff;
|
| 120 |
-
background: $wcvendors-light;
|
| 121 |
-
border-color: $wcvendors-light;
|
| 122 |
-
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 $wcvendors-light;
|
| 123 |
-
}
|
| 124 |
-
}
|
| 125 |
-
}
|
| 126 |
-
li a::before {
|
| 127 |
-
color: #82878c;
|
| 128 |
-
font: normal 20px/1 'dashicons';
|
| 129 |
-
speak: none;
|
| 130 |
-
display: inline-block;
|
| 131 |
-
padding: 0 10px 0 0;
|
| 132 |
-
top: 1px;
|
| 133 |
-
position: relative;
|
| 134 |
-
-webkit-font-smoothing: antialiased;
|
| 135 |
-
-moz-osx-font-smoothing: grayscale;
|
| 136 |
-
text-decoration: none !important;
|
| 137 |
-
vertical-align: top;
|
| 138 |
-
}
|
| 139 |
-
.learn-more a::before {
|
| 140 |
-
content: '\f105';
|
| 141 |
-
}
|
| 142 |
-
.video-walkthrough a::before {
|
| 143 |
-
content: '\f126';
|
| 144 |
-
}
|
| 145 |
-
.newsletter a::before {
|
| 146 |
-
content: '\f465';
|
| 147 |
-
}
|
| 148 |
-
}
|
| 149 |
-
}
|
| 150 |
-
.wcvendors-newsletter,
|
| 151 |
-
.wcvendors-tracker,
|
| 152 |
-
.updated {
|
| 153 |
-
padding: 24px 24px 0;
|
| 154 |
-
margin: 0 0 24px;
|
| 155 |
-
overflow: hidden;
|
| 156 |
-
background: #f5f5f5;
|
| 157 |
-
p {
|
| 158 |
-
padding: 0;
|
| 159 |
-
margin: 0 0 12px;
|
| 160 |
-
}
|
| 161 |
-
form,
|
| 162 |
-
p:last-child {
|
| 163 |
-
margin: 0 0 24px;
|
| 164 |
-
}
|
| 165 |
-
}
|
| 166 |
-
.wcvendors-tracker + .wcvendors-newsletter {
|
| 167 |
-
margin-top: -24px;
|
| 168 |
-
border-top: 2px dashed #ddd;
|
| 169 |
-
}
|
| 170 |
-
}
|
| 171 |
-
.wcv-setup-steps {
|
| 172 |
-
padding: 0 0 24px;
|
| 173 |
-
margin: 0;
|
| 174 |
-
list-style: none outside;
|
| 175 |
-
overflow: hidden;
|
| 176 |
-
color: #ccc;
|
| 177 |
-
width:100%;
|
| 178 |
-
display: inline-flex;
|
| 179 |
-
li {
|
| 180 |
-
width: 25%;
|
| 181 |
-
float: left;
|
| 182 |
-
padding: 0 0 0.8em;
|
| 183 |
-
margin: 0;
|
| 184 |
-
text-align: center;
|
| 185 |
-
position: relative;
|
| 186 |
-
border-bottom: 4px solid #ccc;
|
| 187 |
-
line-height: 1.4em;
|
| 188 |
-
}
|
| 189 |
-
li::before {
|
| 190 |
-
content: '';
|
| 191 |
-
border: 4px solid #ccc;
|
| 192 |
-
border-radius: 100%;
|
| 193 |
-
width: 4px;
|
| 194 |
-
height: 4px;
|
| 195 |
-
position: absolute;
|
| 196 |
-
bottom: 0;
|
| 197 |
-
left: 50%;
|
| 198 |
-
margin-left: -6px;
|
| 199 |
-
margin-bottom: -8px;
|
| 200 |
-
background: #fff;
|
| 201 |
-
}
|
| 202 |
-
li.active {
|
| 203 |
-
border-color: $wcvendors-light;
|
| 204 |
-
color: $wcvendors;
|
| 205 |
-
&::before {
|
| 206 |
-
border-color: #005580;
|
| 207 |
-
}
|
| 208 |
-
}
|
| 209 |
-
li.done {
|
| 210 |
-
border-color: $wcvendors-light;
|
| 211 |
-
color: $wcvendors;
|
| 212 |
-
&::before {
|
| 213 |
-
border-color: $wcvendors-light;
|
| 214 |
-
background: $wcvendors-light;
|
| 215 |
-
}
|
| 216 |
-
}
|
| 217 |
-
}
|
| 218 |
-
.wcv-setup .wcv-setup-actions {
|
| 219 |
-
overflow: hidden;
|
| 220 |
-
margin: 20px 0 0;
|
| 221 |
-
.button {
|
| 222 |
-
font-size: 1.25em;
|
| 223 |
-
line-height: 1em;
|
| 224 |
-
margin-right: 0.5em;
|
| 225 |
-
margin-bottom: 2px;
|
| 226 |
-
height: auto;
|
| 227 |
-
border-radius: 4px;
|
| 228 |
-
}
|
| 229 |
-
.button-primary {
|
| 230 |
-
background-color: $wcvendors;
|
| 231 |
-
border-color: $wcvendors-light;
|
| 232 |
-
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 $wcvendors-light;
|
| 233 |
-
text-shadow: 0 -1px 1px $wcvendors-light, 1px 0 1px $wcvendors-light, 0 1px 1px $wcvendors-light, -1px 0 1px $wcvendors-light;
|
| 234 |
-
margin: 0;
|
| 235 |
-
opacity: 1;
|
| 236 |
-
|
| 237 |
-
&:hover, &:focus, &:active {
|
| 238 |
-
background: $wcvendors-light;
|
| 239 |
-
border-color: $wcvendors-light;
|
| 240 |
-
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25), 0 1px 0 $wcvendors-light;
|
| 241 |
-
}
|
| 242 |
-
}
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
.wcv-setup-content p:last-child {
|
| 246 |
-
margin-bottom: 0;
|
| 247 |
-
}
|
| 248 |
-
|
| 249 |
-
.wcv-setup-content p.store-setup {
|
| 250 |
-
margin-top: 0;
|
| 251 |
-
}
|
| 252 |
-
|
| 253 |
-
.wcv-return-to-dashboard {
|
| 254 |
-
font-size: 0.85em;
|
| 255 |
-
color: #b5b5b5;
|
| 256 |
-
margin: 1.18em 0;
|
| 257 |
-
display: block;
|
| 258 |
-
text-align: center;
|
| 259 |
-
}
|
| 260 |
-
|
| 261 |
-
.wcv-wizard-storefront {
|
| 262 |
-
.wcv-wizard-storefront-intro {
|
| 263 |
-
padding: 40px 40px 0;
|
| 264 |
-
background: #F5F5F5;
|
| 265 |
-
text-align: center;
|
| 266 |
-
|
| 267 |
-
img {
|
| 268 |
-
margin: 40px 0 0 0;
|
| 269 |
-
width: 100%;
|
| 270 |
-
display: block;
|
| 271 |
-
}
|
| 272 |
-
}
|
| 273 |
-
.wcv-wizard-storefront-features {
|
| 274 |
-
list-style: none outside;
|
| 275 |
-
margin: 0 0 20px;
|
| 276 |
-
padding: 0 0 0 30px;
|
| 277 |
-
overflow: hidden;
|
| 278 |
-
}
|
| 279 |
-
.wcv-wizard-storefront-feature {
|
| 280 |
-
margin: 0;
|
| 281 |
-
padding: 20px 30px 20px 2em;
|
| 282 |
-
width: 50%;
|
| 283 |
-
box-sizing: border-box;
|
| 284 |
-
|
| 285 |
-
&::before {
|
| 286 |
-
margin-left: -2em;
|
| 287 |
-
position: absolute;
|
| 288 |
-
}
|
| 289 |
-
&.first {
|
| 290 |
-
clear: both;
|
| 291 |
-
float: left;
|
| 292 |
-
}
|
| 293 |
-
&.last {
|
| 294 |
-
float: right;
|
| 295 |
-
}
|
| 296 |
-
}
|
| 297 |
-
}
|
| 298 |
-
|
| 299 |
-
.hide {
|
| 300 |
-
display: none;
|
| 301 |
-
}
|
| 302 |
-
|
| 303 |
-
.wcv-wizard-features {
|
| 304 |
-
display: flex;
|
| 305 |
-
flex-wrap: wrap;
|
| 306 |
-
list-style: none;
|
| 307 |
-
padding: 0;
|
| 308 |
-
|
| 309 |
-
.wcv-wizard-feature-item {
|
| 310 |
-
flex-basis: calc( 50% - 4em - 3px); // two columns, account for padding and borders
|
| 311 |
-
border: 1px solid #eee;
|
| 312 |
-
padding: 2em;
|
| 313 |
-
}
|
| 314 |
-
|
| 315 |
-
.wcv-wizard-feature-item:nth-child(1) {
|
| 316 |
-
border-radius: 4px 0 0 0;
|
| 317 |
-
}
|
| 318 |
-
|
| 319 |
-
.wcv-wizard-feature-item:nth-child(2) {
|
| 320 |
-
border-left: 0;
|
| 321 |
-
border-radius: 0 4px 0 0;
|
| 322 |
-
}
|
| 323 |
-
|
| 324 |
-
.wcv-wizard-feature-item:nth-child(3) {
|
| 325 |
-
border-top: 0;
|
| 326 |
-
border-radius: 0 0 0 4px;
|
| 327 |
-
}
|
| 328 |
-
|
| 329 |
-
.wcv-wizard-feature-item:nth-child(4) {
|
| 330 |
-
border-top: 0;
|
| 331 |
-
border-left: 0;
|
| 332 |
-
border-radius: 0 0 4px 0;
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
p.wcv-wizard-feature-name,
|
| 336 |
-
p.wcv-wizard-feature-description {
|
| 337 |
-
margin: 0;
|
| 338 |
-
line-height: 1.5em;
|
| 339 |
-
}
|
| 340 |
-
}
|
| 341 |
-
|
| 342 |
-
.step {
|
| 343 |
-
text-align: center;
|
| 344 |
-
}
|
| 345 |
-
|
| 346 |
-
.wcv-setup .wcv-setup-actions .button {
|
| 347 |
-
font-weight: 300;
|
| 348 |
-
font-size: 16px;
|
| 349 |
-
padding: 0.5em 1em;
|
| 350 |
-
box-shadow: none;
|
| 351 |
-
min-width: 12em;
|
| 352 |
-
min-width: auto;
|
| 353 |
-
margin-top:10px;
|
| 354 |
-
background-color: $wcvendors;
|
| 355 |
-
color: $white;
|
| 356 |
-
|
| 357 |
-
&:focus,
|
| 358 |
-
&:hover,
|
| 359 |
-
&:active {
|
| 360 |
-
box-shadow: none;
|
| 361 |
-
background-color: $wcvendors-light;
|
| 362 |
-
}
|
| 363 |
-
}
|
| 364 |
-
|
| 365 |
-
.location-prompt {
|
| 366 |
-
color: #666;
|
| 367 |
-
font-size: 13px;
|
| 368 |
-
font-weight: 500;
|
| 369 |
-
margin-bottom: 0.5em;
|
| 370 |
-
margin-top: 1em;
|
| 371 |
-
display: inline-block;
|
| 372 |
-
}
|
| 373 |
-
|
| 374 |
-
.address-step {
|
| 375 |
-
.select2 {
|
| 376 |
-
min-width: 100%; // widen currency, product type dropdowns
|
| 377 |
-
}
|
| 378 |
-
}
|
| 379 |
-
|
| 380 |
-
.store-address-container {
|
| 381 |
-
margin-bottom: 24px; // match margin-bottom on top paragraph
|
| 382 |
-
|
| 383 |
-
.city-and-postcode {
|
| 384 |
-
display: flex;
|
| 385 |
-
|
| 386 |
-
div {
|
| 387 |
-
flex-basis: 50%;
|
| 388 |
-
margin-right: 1em;
|
| 389 |
-
|
| 390 |
-
&:last-of-type {
|
| 391 |
-
margin-right: 0;
|
| 392 |
-
}
|
| 393 |
-
}
|
| 394 |
-
}
|
| 395 |
-
}
|
| 396 |
-
|
| 397 |
-
.wcv-wizard-service-settings {
|
| 398 |
-
.payment-email-input {
|
| 399 |
-
border: 1px solid #aaa;
|
| 400 |
-
border-color: #ddd;
|
| 401 |
-
border-radius: 4px;
|
| 402 |
-
height: 30px;
|
| 403 |
-
padding: 0 8px;
|
| 404 |
-
font-size: 14px;
|
| 405 |
-
color: #444;
|
| 406 |
-
background-color: #fff;
|
| 407 |
-
display: inline-block;
|
| 408 |
-
}
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
.newsletter-form-container {
|
| 412 |
-
display: flex;
|
| 413 |
-
|
| 414 |
-
.newsletter-form-email {
|
| 415 |
-
border: 1px solid #aaa;
|
| 416 |
-
border-color: #ddd;
|
| 417 |
-
border-radius: 4px;
|
| 418 |
-
height: 42px;
|
| 419 |
-
padding: 0 8px;
|
| 420 |
-
font-size: 16px;
|
| 421 |
-
color: #666;
|
| 422 |
-
background-color: #fff;
|
| 423 |
-
display: inline-block;
|
| 424 |
-
margin-right: 6px;
|
| 425 |
-
flex-grow: 1;
|
| 426 |
-
}
|
| 427 |
-
|
| 428 |
-
.newsletter-form-button-container {
|
| 429 |
-
flex-grow: 0;
|
| 430 |
-
}
|
| 431 |
-
}
|
| 432 |
-
|
| 433 |
-
.wcv-setup .wcv-setup-actions .button.newsletter-form-button {
|
| 434 |
-
height: 42px;
|
| 435 |
-
padding: 0 1em;
|
| 436 |
-
margin: 0;
|
| 437 |
-
}
|
| 438 |
-
|
| 439 |
-
.wcv-wizard-next-steps {
|
| 440 |
-
border: 1px solid #eee;
|
| 441 |
-
border-radius: 4px;
|
| 442 |
-
list-style: none;
|
| 443 |
-
padding: 0;
|
| 444 |
-
|
| 445 |
-
li {
|
| 446 |
-
padding: 0;
|
| 447 |
-
}
|
| 448 |
-
|
| 449 |
-
.wcv-wizard-next-step-item {
|
| 450 |
-
display: flex;
|
| 451 |
-
border-top: 1px solid #eee;
|
| 452 |
-
|
| 453 |
-
&:first-child {
|
| 454 |
-
border-top: 0;
|
| 455 |
-
}
|
| 456 |
-
}
|
| 457 |
-
|
| 458 |
-
.wcv-wizard-next-step-description {
|
| 459 |
-
flex-grow: 1;
|
| 460 |
-
margin: 1.5em;
|
| 461 |
-
}
|
| 462 |
-
|
| 463 |
-
.wcv-wizard-next-step-action {
|
| 464 |
-
flex-grow: 0;
|
| 465 |
-
display: flex;
|
| 466 |
-
align-items: center;
|
| 467 |
-
|
| 468 |
-
.button {
|
| 469 |
-
margin: 1em;
|
| 470 |
-
}
|
| 471 |
-
}
|
| 472 |
-
|
| 473 |
-
p {
|
| 474 |
-
&.next-step-heading {
|
| 475 |
-
margin: 0;
|
| 476 |
-
font-size: 0.95em;
|
| 477 |
-
font-weight: 400;
|
| 478 |
-
font-variant: all-petite-caps;
|
| 479 |
-
}
|
| 480 |
-
|
| 481 |
-
&.next-step-extra-info {
|
| 482 |
-
margin: 0;
|
| 483 |
-
}
|
| 484 |
-
}
|
| 485 |
-
|
| 486 |
-
h3 {
|
| 487 |
-
&.next-step-description {
|
| 488 |
-
margin: 0;
|
| 489 |
-
font-size: 16px;
|
| 490 |
-
font-weight: 600;
|
| 491 |
-
}
|
| 492 |
-
}
|
| 493 |
-
}
|
| 494 |
-
|
| 495 |
-
p.next-steps-help-text {
|
| 496 |
-
color: #9f9f9f;
|
| 497 |
-
padding: 0 2em;
|
| 498 |
-
text-align: center;
|
| 499 |
-
font-size: .9em;
|
| 500 |
-
}
|
| 501 |
-
|
| 502 |
-
.wcv-setup-table {
|
| 503 |
-
width: 100%;
|
| 504 |
-
|
| 505 |
-
.table-desc {
|
| 506 |
-
width: 80%;
|
| 507 |
-
}
|
| 508 |
-
|
| 509 |
-
.table-check {
|
| 510 |
-
width: 20%;
|
| 511 |
-
text-align: right;
|
| 512 |
-
|
| 513 |
-
input.option_check {
|
| 514 |
-
line-height: 4em;
|
| 515 |
-
}
|
| 516 |
-
}
|
| 517 |
-
}
|
| 518 |
-
|
| 519 |
-
.wcv-setup-table-pages {
|
| 520 |
-
|
| 521 |
-
width: 100%;
|
| 522 |
-
|
| 523 |
-
.table-desc {
|
| 524 |
-
width: 60%;
|
| 525 |
-
}
|
| 526 |
-
|
| 527 |
-
.table-check{
|
| 528 |
-
width: 40%;
|
| 529 |
-
|
| 530 |
-
}
|
| 531 |
-
|
| 532 |
-
select {
|
| 533 |
-
width: 100%;
|
| 534 |
-
}
|
| 535 |
-
|
| 536 |
-
.tool-tip {
|
| 537 |
-
font-size: 0.75em;
|
| 538 |
-
}
|
| 539 |
-
|
| 540 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/icon-128x128.png
DELETED
|
Binary file
|
trunk/assets/icon-256x256.png
DELETED
|
Binary file
|
trunk/assets/icon.svg
DELETED
|
@@ -1,115 +0,0 @@
|
|
| 1 |
-
<svg viewBox="0 0 500 500" xmlns:xlink="http://www.w3.org/1999/xlink" height="500pt" xmlns="http://www.w3.org/2000/svg" width="500pt" version="1.1"><defs>
|
| 2 |
-
<path d="M0.00 0.00 L500.00 0.00 L500.00 500.00 L0.00 500.00 L0.00 0.00" id="p1" />
|
| 3 |
-
<path d="M81.20 65.86 C86.56 60.77 91.79 55.56 97.38 50.72 C107.88 60.16 117.24 70.79 127.00 80.99 C128.97 82.95 130.73 85.43 133.41 86.45 C159.98 91.11 186.86 94.12 213.31 99.49 C210.33 110.00 209.66 121.01 210.56 131.87 C209.92 132.04 208.62 132.39 207.98 132.56 C202.01 127.72 197.14 121.68 191.11 116.90 C189.06 118.91 187.01 120.94 185.01 123.02 C190.35 131.20 200.26 135.94 203.39 145.57 C209.87 163.03 216.76 180.34 223.07 197.87 C224.22 201.13 225.75 204.40 225.73 207.92 C225.48 210.20 224.29 212.23 223.45 214.33 C218.99 214.61 213.97 215.23 210.88 218.83 C206.43 223.50 206.18 231.57 210.72 236.26 C214.45 240.56 221.21 241.88 226.19 239.01 C229.57 237.26 231.39 233.76 233.26 230.63 C245.84 230.66 258.41 230.60 270.99 230.62 C273.85 234.22 277.18 238.38 282.14 238.75 C290.33 239.91 298.02 231.30 296.09 223.30 C295.06 218.43 291.12 213.77 285.94 213.32 C283.08 213.15 279.97 212.97 277.41 214.48 C274.11 216.23 272.37 219.70 270.36 222.67 C257.45 222.43 244.54 222.73 231.63 222.60 C231.23 221.17 230.42 219.79 230.48 218.28 C232.02 214.41 234.51 211.00 236.64 207.44 C258.76 207.23 280.89 207.41 303.02 207.35 C306.26 207.36 309.47 206.89 312.68 206.51 C318.99 188.69 324.59 170.62 330.81 152.76 C335.01 141.26 338.42 129.35 338.50 117.01 C340.36 116.86 342.22 116.70 344.09 116.61 C361.99 119.04 379.93 121.68 397.83 124.32 C402.13 124.81 406.39 125.63 410.62 126.55 C403.27 145.65 395.55 164.62 387.85 183.58 C378.36 207.78 368.47 231.83 358.81 255.96 C358.00 257.55 357.28 260.14 354.98 259.62 C302.96 259.67 250.95 259.66 198.94 259.64 C192.82 268.77 187.99 278.69 182.23 288.04 C183.91 290.90 185.62 293.75 187.31 296.60 C219.72 296.40 252.14 296.83 284.55 296.58 C286.89 292.12 289.20 287.47 293.01 284.04 C299.46 278.23 308.31 274.89 317.02 275.69 C323.90 276.57 330.74 279.33 335.69 284.30 C344.03 292.07 347.71 304.76 344.07 315.67 C340.38 328.98 326.77 338.79 312.95 337.73 C305.62 337.97 298.61 334.62 293.18 329.88 C289.31 326.54 286.92 321.92 284.65 317.42 C252.37 317.52 220.08 317.37 187.79 317.40 C184.23 327.96 175.12 336.50 164.06 338.49 C157.93 338.96 151.44 339.27 145.74 336.56 C136.84 332.90 130.00 324.79 127.80 315.44 C123.88 301.38 131.94 285.22 145.36 279.60 C151.47 276.43 158.54 277.23 165.16 277.52 C168.19 272.67 171.14 267.76 173.92 262.75 C174.75 261.00 175.93 259.01 175.05 257.05 C156.08 206.34 137.13 155.61 118.35 104.82 C116.85 100.91 113.30 98.43 110.51 95.50 C100.78 85.58 90.84 75.87 81.20 65.86" id="p2" />
|
| 4 |
-
<path d="M253.24 60.18 C263.69 56.37 275.17 55.47 286.08 57.67 C306.03 61.43 323.82 75.24 332.41 93.63 C335.86 100.47 337.10 108.10 338.47 115.57 C340.34 115.90 342.21 116.25 344.09 116.61 C342.22 116.70 340.36 116.86 338.50 117.01 C338.42 129.35 335.01 141.26 330.81 152.76 C330.91 152.05 331.11 150.61 331.21 149.90 C327.89 149.46 324.57 149.03 321.26 148.54 C324.36 145.83 326.00 142.01 327.03 138.11 C322.06 139.30 317.29 141.18 312.62 143.23 C312.54 144.58 312.47 145.93 312.39 147.28 C304.65 146.22 296.88 145.38 289.15 144.31 C296.20 144.79 303.34 144.08 309.67 140.72 C309.16 130.99 307.96 121.15 304.13 112.11 C294.74 115.07 285.26 117.86 276.27 121.91 C278.45 129.10 280.84 136.23 283.68 143.20 C281.05 142.76 278.41 142.43 275.79 142.02 C277.11 142.05 278.44 142.07 279.76 142.06 C278.04 135.54 276.02 129.08 273.04 123.01 C263.51 125.91 254.10 129.22 244.90 133.05 C245.84 134.76 246.79 136.47 247.76 138.18 C246.23 137.96 244.70 137.73 243.18 137.48 C242.91 136.63 242.38 134.93 242.11 134.08 C240.17 134.82 238.24 135.58 236.29 136.25 C234.13 135.94 231.97 135.60 229.80 135.37 C233.53 133.99 237.13 132.29 240.76 130.67 C238.29 121.32 236.29 111.85 235.33 102.22 C230.57 103.65 225.55 104.63 221.26 107.25 C219.83 107.98 219.46 109.65 219.15 111.08 C217.74 118.45 218.42 126.01 219.67 133.35 C222.15 133.94 224.63 134.56 227.13 135.09 C220.73 134.36 214.33 133.60 207.98 132.56 C208.62 132.39 209.92 132.04 210.56 131.87 C209.66 121.01 210.33 110.00 213.31 99.49 C214.95 97.03 216.72 94.62 217.77 91.82 C224.02 76.61 237.71 65.12 253.24 60.18" id="p3" />
|
| 5 |
-
<path d="M275.16 65.49 C285.44 65.01 295.90 68.43 304.25 74.39 C299.93 76.02 295.68 78.09 291.08 78.77 C289.26 78.22 288.12 76.47 286.74 75.25 C283.30 71.52 279.12 68.62 275.16 65.49" id="p4" />
|
| 6 |
-
<path d="M257.29 67.74 C260.96 67.01 264.82 64.89 268.55 66.41 C275.87 69.13 281.83 74.53 286.98 80.25 C279.76 83.40 272.26 85.85 264.77 88.30 C261.91 81.58 259.74 74.61 257.29 67.74" id="p5" />
|
| 7 |
-
<path d="M244.73 74.69 C246.69 71.38 250.73 70.47 253.98 68.91 C256.43 75.78 259.22 82.55 261.07 89.62 C253.86 92.39 246.55 94.88 239.17 97.13 C239.01 89.33 240.64 81.39 244.73 74.69" id="p6" />
|
| 8 |
-
<path d="M293.00 81.94 C298.24 80.55 303.16 77.58 308.64 77.32 C316.48 83.22 322.52 91.57 326.03 100.72 C319.66 103.33 313.07 105.32 306.68 107.85 C304.99 104.32 303.45 100.72 301.81 97.17 C299.36 91.82 295.93 87.02 293.00 81.94" id="p7" />
|
| 9 |
-
<path d="M223.06 99.00 C226.54 90.81 231.87 83.26 238.92 77.77 C237.24 84.66 235.54 91.61 235.40 98.75 C231.38 100.03 227.16 99.59 223.06 99.00" id="p8" />
|
| 10 |
-
<path d="M265.96 91.87 C273.55 88.59 281.49 86.23 289.21 83.26 C295.39 91.04 300.24 99.97 303.07 109.51 C301.21 109.62 299.35 109.77 297.49 109.73 C289.68 109.23 282.02 107.44 274.21 106.86 C272.58 106.37 270.71 105.75 269.96 104.07 C268.00 100.24 267.22 95.95 265.96 91.87" id="p9" />
|
| 11 |
-
<path d="M244.65 98.80 C250.62 96.97 256.46 94.72 262.47 93.04 C264.07 97.12 265.59 101.23 266.82 105.43 C266.08 105.31 264.58 105.05 263.84 104.93 C255.85 103.73 247.89 102.15 239.82 101.67 C241.19 100.36 242.79 99.29 244.65 98.80" id="p10" />
|
| 12 |
-
<path d="M221.08 100.93 C223.47 100.26 225.92 99.94 228.40 99.93 C226.49 101.61 224.27 102.88 221.97 103.96 C221.68 102.94 221.38 101.93 221.08 100.93" id="p11" />
|
| 13 |
-
<path d="M221.26 107.25 C225.55 104.63 230.57 103.65 235.33 102.22 C236.29 111.85 238.29 121.32 240.76 130.67 C237.13 132.29 233.53 133.99 229.80 135.37 C229.13 135.30 227.79 135.16 227.13 135.09 C224.63 134.56 222.15 133.94 219.67 133.35 C218.42 126.01 217.74 118.45 219.15 111.08 C219.46 109.65 219.83 107.98 221.26 107.25" id="p12" />
|
| 14 |
-
<path d="M238.32 101.65 C238.69 101.65 239.44 101.67 239.82 101.67 C247.89 102.15 255.85 103.73 263.84 104.93 C269.90 107.04 270.01 114.59 271.94 119.75 C262.84 123.54 253.47 126.65 244.14 129.82 C240.28 120.92 239.46 111.16 238.32 101.65" id="p13" />
|
| 15 |
-
<path d="M309.15 110.27 C315.15 108.26 321.12 106.14 327.11 104.09 C328.26 107.44 328.98 110.92 329.43 114.43 C328.57 114.32 326.85 114.11 325.99 114.00 C320.71 113.11 315.39 112.32 310.02 112.23 C309.80 111.74 309.37 110.76 309.15 110.27" id="p14" />
|
| 16 |
-
<path d="M271.10 106.60 C271.88 106.67 273.43 106.80 274.21 106.86 C282.02 107.44 289.68 109.23 297.49 109.73 C291.10 114.55 282.87 115.54 275.71 118.80 C273.39 115.07 271.97 110.89 271.10 106.60" id="p15" />
|
| 17 |
-
<path d="M276.27 121.91 C285.26 117.86 294.74 115.07 304.13 112.11 C307.96 121.15 309.16 130.99 309.67 140.72 C303.34 144.08 296.20 144.79 289.15 144.31 C287.33 143.93 285.51 143.52 283.68 143.20 C280.84 136.23 278.45 129.10 276.27 121.91" id="p16" />
|
| 18 |
-
<path d="M308.08 112.16 C308.56 112.18 309.54 112.21 310.02 112.23 C315.39 112.32 320.71 113.11 325.99 114.00 C327.22 114.33 328.42 114.74 329.63 115.15 C329.71 120.23 330.06 125.37 329.19 130.41 C328.85 131.79 328.60 133.45 327.26 134.23 C322.80 136.90 317.60 137.90 312.62 139.17 C312.24 130.00 310.00 121.09 308.08 112.16" id="p17" />
|
| 19 |
-
<path d="M185.01 123.02 C187.01 120.94 189.06 118.91 191.11 116.90 C197.14 121.68 202.01 127.72 207.98 132.56 C214.33 133.60 220.73 134.36 227.13 135.09 C227.79 135.16 229.13 135.30 229.80 135.37 C231.97 135.60 234.13 135.94 236.29 136.25 C238.59 136.64 240.87 137.11 243.18 137.48 C244.70 137.73 246.23 137.96 247.76 138.18 C257.11 139.42 266.44 140.80 275.79 142.02 C278.41 142.43 281.05 142.76 283.68 143.20 C285.51 143.52 287.33 143.93 289.15 144.31 C296.88 145.38 304.65 146.22 312.39 147.28 C315.36 147.60 318.31 148.07 321.26 148.54 C324.57 149.03 327.89 149.46 331.21 149.90 C331.11 150.61 330.91 152.05 330.81 152.76 C324.59 170.62 318.99 188.69 312.68 206.51 C309.47 206.89 306.26 207.36 303.02 207.35 C280.89 207.41 258.76 207.23 236.64 207.44 C234.51 211.00 232.02 214.41 230.48 218.28 C230.42 219.79 231.23 221.17 231.63 222.60 C244.54 222.73 257.45 222.43 270.36 222.67 C272.37 219.70 274.11 216.23 277.41 214.48 C279.97 212.97 283.08 213.15 285.94 213.32 C291.12 213.77 295.06 218.43 296.09 223.30 C298.02 231.30 290.33 239.91 282.14 238.75 C277.18 238.38 273.85 234.22 270.99 230.62 C258.41 230.60 245.84 230.66 233.26 230.63 C231.39 233.76 229.57 237.26 226.19 239.01 C221.21 241.88 214.45 240.56 210.72 236.26 C206.18 231.57 206.43 223.50 210.88 218.83 C213.97 215.23 218.99 214.61 223.45 214.33 C224.29 212.23 225.48 210.20 225.73 207.92 C225.75 204.40 224.22 201.13 223.07 197.87 C216.76 180.34 209.87 163.03 203.39 145.57 C200.26 135.94 190.35 131.20 185.01 123.02" id="p18" />
|
| 20 |
-
<path d="M244.90 133.05 C254.10 129.22 263.51 125.91 273.04 123.01 C276.02 129.08 278.04 135.54 279.76 142.06 C278.44 142.07 277.11 142.05 275.79 142.02 C266.44 140.80 257.11 139.42 247.76 138.18 C246.79 136.47 245.84 134.76 244.90 133.05" id="p19" />
|
| 21 |
-
<path d="M236.29 136.25 C238.24 135.58 240.17 134.82 242.11 134.08 C242.38 134.93 242.91 136.63 243.18 137.48 C240.87 137.11 238.59 136.64 236.29 136.25" id="p20" />
|
| 22 |
-
<path d="M312.62 143.23 C317.29 141.18 322.06 139.30 327.03 138.11 C326.00 142.01 324.36 145.83 321.26 148.54 C318.31 148.07 315.36 147.60 312.39 147.28 C312.47 145.93 312.54 144.58 312.62 143.23" id="p21" />
|
| 23 |
-
<path d="M307.28 144.01 C308.89 142.91 310.81 145.58 308.86 146.46 C307.25 147.55 305.34 144.90 307.28 144.01" id="p22" />
|
| 24 |
-
<path d="M334.44 364.50 C337.13 364.56 339.83 364.56 342.52 364.53 C342.61 382.95 342.59 401.36 342.60 419.78 C340.72 419.54 338.71 419.77 336.95 418.99 C335.99 417.77 335.28 416.38 334.50 415.05 C331.13 417.51 327.44 420.24 323.01 419.85 C318.57 420.21 314.00 418.16 311.74 414.26 C308.30 408.88 308.10 402.15 308.80 395.99 C309.63 388.95 314.97 382.17 322.23 381.16 C326.53 380.09 330.61 382.39 334.44 384.02 C334.50 377.51 334.48 371.00 334.44 364.50" id="p23" />
|
| 25 |
-
<path d="M143.41 370.40 C153.35 363.44 167.47 364.52 176.74 372.15 C175.45 374.12 174.16 376.09 172.89 378.07 C168.25 375.68 163.45 372.78 157.99 373.35 C150.51 373.18 143.91 379.07 142.29 386.21 C140.36 394.04 141.45 403.57 147.86 409.11 C152.13 413.05 158.33 413.23 163.78 412.54 C167.33 411.93 170.22 409.61 173.11 407.64 C174.60 409.18 176.12 410.71 177.66 412.22 C171.73 419.80 161.09 421.64 152.09 419.87 C143.82 418.24 136.85 411.76 134.26 403.80 C130.24 392.30 133.04 377.63 143.41 370.40" id="p24" />
|
| 26 |
-
<path d="M178.93 366.41 C181.81 366.43 184.70 366.45 187.58 366.46 C191.15 373.80 193.75 381.54 196.85 389.06 C199.50 395.69 202.23 402.30 204.41 409.10 C207.00 401.05 210.22 393.23 213.47 385.43 C216.14 379.11 217.79 372.37 221.19 366.37 C224.12 366.38 227.06 366.39 229.99 366.39 C222.35 383.96 215.94 402.03 208.42 419.64 C205.73 419.62 203.05 419.62 200.37 419.66 C193.36 401.85 185.80 384.27 178.93 366.41" id="p25" />
|
| 27 |
-
<path d="M53.08 366.56 C54.07 366.56 56.03 366.57 57.02 366.58 C59.99 376.33 63.12 386.04 66.10 395.79 C68.45 403.67 71.43 411.37 73.07 419.45 C71.64 418.81 70.22 418.18 68.81 417.54 C63.90 400.45 58.20 383.59 53.08 366.56" id="p26" />
|
| 28 |
-
<path d="M57.02 366.58 C59.94 366.60 62.94 366.20 65.80 366.93 C67.30 368.09 67.56 370.16 68.20 371.83 C70.70 380.91 73.68 389.86 75.87 399.03 C76.58 398.07 77.29 397.11 78.00 396.17 C77.41 399.59 77.49 403.08 77.87 406.52 C80.78 400.52 82.51 394.06 84.63 387.77 C87.02 380.58 89.38 373.38 91.82 366.21 C93.85 366.39 95.88 366.47 97.89 366.82 C100.03 368.84 100.44 371.96 101.47 374.60 C104.30 382.72 106.30 391.18 110.29 398.85 C110.83 401.34 111.42 403.82 112.07 406.29 C116.25 393.06 119.43 379.54 123.93 366.41 C126.82 366.48 129.71 366.51 132.60 366.59 C127.46 384.35 121.60 401.89 116.44 419.64 C113.67 419.69 110.90 419.73 108.13 419.84 C104.06 406.35 99.53 393.00 95.02 379.66 C94.47 382.07 93.95 384.49 93.38 386.91 C92.32 388.69 91.14 390.43 90.50 392.42 C87.65 401.55 84.83 410.70 81.53 419.67 C77.67 420.08 73.80 420.33 69.92 420.43 C69.55 419.46 69.18 418.50 68.81 417.54 C70.22 418.18 71.64 418.81 73.07 419.45 C71.43 411.37 68.45 403.67 66.10 395.79 C63.12 386.04 59.99 376.33 57.02 366.58" id="p27" />
|
| 29 |
-
<path d="M87.64 367.66 C88.84 366.71 90.38 366.53 91.82 366.21 C89.38 373.38 87.02 380.58 84.63 387.77 C82.51 394.06 80.78 400.52 77.87 406.52 C77.49 403.08 77.41 399.59 78.00 396.17 C80.06 389.57 82.26 383.01 84.45 376.46 C85.45 373.51 86.05 370.38 87.64 367.66" id="p28" />
|
| 30 |
-
<path d="M110.29 398.85 C113.64 388.16 116.22 377.23 119.93 366.65 C121.26 366.56 122.60 366.48 123.93 366.41 C119.43 379.54 116.25 393.06 112.07 406.29 C111.42 403.82 110.83 401.34 110.29 398.85" id="p29" />
|
| 31 |
-
<path d="M93.38 386.91 C93.95 384.49 94.47 382.07 95.02 379.66 C99.53 393.00 104.06 406.35 108.13 419.84 C106.82 419.76 105.51 419.70 104.20 419.64 C100.73 408.69 97.31 397.70 93.38 386.91" id="p30" />
|
| 32 |
-
<path d="M240.45 381.73 C245.53 380.89 251.36 380.95 255.44 384.55 C260.47 388.46 261.75 395.23 261.36 401.26 C252.58 401.58 243.79 401.33 235.01 401.45 C235.52 405.78 236.64 410.89 241.00 412.92 C246.63 415.31 252.58 412.65 257.78 410.41 C258.80 411.69 259.83 412.96 260.85 414.24 C253.37 422.03 238.99 422.70 231.76 414.24 C227.04 408.88 226.65 401.18 227.77 394.46 C229.20 388.37 234.33 383.12 240.45 381.73" id="p31" />
|
| 33 |
-
<path d="M276.09 385.85 C279.07 383.74 282.21 381.30 286.05 381.30 C290.21 380.89 294.83 382.15 297.38 385.66 C300.32 389.80 300.32 395.13 300.31 400.00 C300.18 406.54 300.59 413.09 299.88 419.61 C297.38 419.58 294.88 419.57 292.39 419.59 C292.34 412.04 292.43 404.50 292.37 396.95 C292.22 394.02 292.11 390.37 289.38 388.58 C284.98 386.05 278.71 388.04 276.18 392.26 C275.20 401.33 276.03 410.54 275.84 419.66 C273.33 419.61 270.82 419.59 268.31 419.58 C268.03 411.39 268.50 403.19 267.93 395.01 C267.67 390.53 267.76 386.04 268.07 381.57 C269.65 381.63 271.24 381.63 272.82 381.86 C274.32 382.78 275.06 384.48 276.09 385.85" id="p32" />
|
| 34 |
-
<path d="M362.54 381.76 C368.44 380.79 375.43 380.52 380.15 384.84 C384.95 388.66 386.95 395.04 386.72 401.01 C386.89 407.38 383.97 414.05 378.42 417.45 C374.26 420.20 369.00 419.98 364.24 419.55 C356.95 418.56 351.03 412.20 350.37 404.91 C350.02 400.00 349.71 394.70 352.21 390.25 C354.24 386.12 358.06 382.91 362.54 381.76" id="p33" />
|
| 35 |
-
<path d="M409.50 381.26 C411.81 380.14 414.33 381.12 416.67 381.59 C416.48 383.91 416.32 386.23 416.15 388.55 C412.77 388.73 409.05 388.26 406.05 390.15 C403.52 392.27 402.42 395.71 402.52 398.94 C402.49 405.78 402.68 412.61 402.48 419.44 C399.86 419.42 397.24 419.41 394.63 419.41 C394.67 406.79 394.49 394.17 394.69 381.56 C396.87 381.58 399.04 381.63 401.23 381.69 C401.44 383.79 401.63 385.89 401.81 387.99 C404.06 385.44 406.14 382.42 409.50 381.26" id="p34" />
|
| 36 |
-
<path d="M426.86 382.05 C433.14 379.23 440.14 381.39 445.61 384.95 C444.77 386.46 443.94 387.97 443.10 389.48 C438.67 388.10 433.45 384.99 429.04 388.07 C427.05 389.20 427.51 391.75 427.18 393.66 C432.77 397.46 440.85 397.10 445.01 402.96 C448.54 408.99 444.44 417.02 438.03 418.97 C431.50 420.68 424.21 419.88 418.70 415.77 C419.50 414.12 420.32 412.50 421.17 410.88 C425.94 412.40 431.21 416.20 436.20 413.24 C439.21 411.93 439.70 406.96 436.60 405.45 C431.65 402.58 424.89 402.74 421.17 397.88 C417.30 392.40 420.67 384.08 426.86 382.05" id="p35" />
|
| 37 |
-
<path d="M241.60 387.61 C244.69 386.95 248.48 386.69 250.97 389.01 C253.20 390.77 253.61 393.74 254.33 396.31 C247.93 396.56 241.51 396.60 235.11 396.33 C236.00 392.73 237.71 388.76 241.60 387.61" id="p36" />
|
| 38 |
-
<path d="M323.47 387.57 C327.21 386.79 332.49 387.10 334.27 391.07 C334.79 395.71 334.47 400.40 334.54 405.06 C335.59 412.84 323.62 416.76 319.06 410.94 C316.44 406.87 316.21 401.71 316.83 397.05 C317.45 393.16 319.41 388.80 323.47 387.57" id="p37" />
|
| 39 |
-
<path d="M364.46 387.73 C368.51 386.76 373.52 387.21 376.12 390.88 C378.70 394.66 378.78 399.58 378.39 403.99 C377.91 407.70 376.28 412.02 372.35 413.21 C368.58 414.10 363.76 414.21 361.07 410.93 C357.83 407.06 358.04 401.71 358.41 396.99 C358.73 393.24 360.61 388.95 364.46 387.73" id="p38" /></defs><g stroke-width="10pt">
|
| 40 |
-
<use stroke="#fff" xlink:href="#p1" />
|
| 41 |
-
<use stroke="#005580" xlink:href="#p2" />
|
| 42 |
-
<use stroke="#5e9ab8" xlink:href="#p3" />
|
| 43 |
-
<use stroke="#fff" xlink:href="#p4" />
|
| 44 |
-
<use stroke="#fff" xlink:href="#p5" />
|
| 45 |
-
<use stroke="#fff" xlink:href="#p6" />
|
| 46 |
-
<use stroke="#fff" xlink:href="#p7" />
|
| 47 |
-
<use stroke="#fff" xlink:href="#p8" />
|
| 48 |
-
<use stroke="#fff" xlink:href="#p9" />
|
| 49 |
-
<use stroke="#fff" xlink:href="#p10" />
|
| 50 |
-
<use stroke="#005580" xlink:href="#p11" />
|
| 51 |
-
<use stroke="#005580" xlink:href="#p12" />
|
| 52 |
-
<use stroke="#005580" xlink:href="#p13" />
|
| 53 |
-
<use stroke="#fff" xlink:href="#p14" />
|
| 54 |
-
<use stroke="#005580" xlink:href="#p15" />
|
| 55 |
-
<use stroke="#005580" xlink:href="#p16" />
|
| 56 |
-
<use stroke="#005580" xlink:href="#p17" />
|
| 57 |
-
<use stroke="#fff" xlink:href="#p18" />
|
| 58 |
-
<use stroke="#005580" xlink:href="#p19" />
|
| 59 |
-
<use stroke="#005580" xlink:href="#p20" />
|
| 60 |
-
<use stroke="#005580" xlink:href="#p21" />
|
| 61 |
-
<use stroke="#005580" xlink:href="#p22" />
|
| 62 |
-
<use stroke="#5e9ab8" xlink:href="#p23" />
|
| 63 |
-
<use stroke="#5e9ab8" xlink:href="#p24" />
|
| 64 |
-
<use stroke="#5e9ab8" xlink:href="#p25" />
|
| 65 |
-
<use stroke="#005580" xlink:href="#p26" />
|
| 66 |
-
<use stroke="#5e9ab8" xlink:href="#p27" />
|
| 67 |
-
<use stroke="#005580" xlink:href="#p28" />
|
| 68 |
-
<use stroke="#005580" xlink:href="#p29" />
|
| 69 |
-
<use stroke="#005580" xlink:href="#p30" />
|
| 70 |
-
<use stroke="#5e9ab8" xlink:href="#p31" />
|
| 71 |
-
<use stroke="#5e9ab8" xlink:href="#p32" />
|
| 72 |
-
<use stroke="#5e9ab8" xlink:href="#p33" />
|
| 73 |
-
<use stroke="#5e9ab8" xlink:href="#p34" />
|
| 74 |
-
<use stroke="#5e9ab8" xlink:href="#p35" />
|
| 75 |
-
<use stroke="#fff" xlink:href="#p36" />
|
| 76 |
-
<use stroke="#fff" xlink:href="#p37" />
|
| 77 |
-
<use stroke="#fff" xlink:href="#p38" /></g><g>
|
| 78 |
-
<use xlink:href="#p1" fill="#fff" />
|
| 79 |
-
<use xlink:href="#p2" fill="#005580" />
|
| 80 |
-
<use xlink:href="#p3" fill="#5e9ab8" />
|
| 81 |
-
<use xlink:href="#p4" fill="#fff" />
|
| 82 |
-
<use xlink:href="#p5" fill="#fff" />
|
| 83 |
-
<use xlink:href="#p6" fill="#fff" />
|
| 84 |
-
<use xlink:href="#p7" fill="#fff" />
|
| 85 |
-
<use xlink:href="#p8" fill="#fff" />
|
| 86 |
-
<use xlink:href="#p9" fill="#fff" />
|
| 87 |
-
<use xlink:href="#p10" fill="#fff" />
|
| 88 |
-
<use xlink:href="#p11" fill="#005580" />
|
| 89 |
-
<use xlink:href="#p12" fill="#005580" />
|
| 90 |
-
<use xlink:href="#p13" fill="#005580" />
|
| 91 |
-
<use xlink:href="#p14" fill="#fff" />
|
| 92 |
-
<use xlink:href="#p15" fill="#005580" />
|
| 93 |
-
<use xlink:href="#p16" fill="#005580" />
|
| 94 |
-
<use xlink:href="#p17" fill="#005580" />
|
| 95 |
-
<use xlink:href="#p18" fill="#fff" />
|
| 96 |
-
<use xlink:href="#p19" fill="#005580" />
|
| 97 |
-
<use xlink:href="#p20" fill="#005580" />
|
| 98 |
-
<use xlink:href="#p21" fill="#005580" />
|
| 99 |
-
<use xlink:href="#p22" fill="#005580" />
|
| 100 |
-
<use xlink:href="#p23" fill="#5e9ab8" />
|
| 101 |
-
<use xlink:href="#p24" fill="#5e9ab8" />
|
| 102 |
-
<use xlink:href="#p25" fill="#5e9ab8" />
|
| 103 |
-
<use xlink:href="#p26" fill="#005580" />
|
| 104 |
-
<use xlink:href="#p27" fill="#5e9ab8" />
|
| 105 |
-
<use xlink:href="#p28" fill="#005580" />
|
| 106 |
-
<use xlink:href="#p29" fill="#005580" />
|
| 107 |
-
<use xlink:href="#p30" fill="#005580" />
|
| 108 |
-
<use xlink:href="#p31" fill="#5e9ab8" />
|
| 109 |
-
<use xlink:href="#p32" fill="#5e9ab8" />
|
| 110 |
-
<use xlink:href="#p33" fill="#5e9ab8" />
|
| 111 |
-
<use xlink:href="#p34" fill="#5e9ab8" />
|
| 112 |
-
<use xlink:href="#p35" fill="#5e9ab8" />
|
| 113 |
-
<use xlink:href="#p36" fill="#fff" />
|
| 114 |
-
<use xlink:href="#p37" fill="#fff" />
|
| 115 |
-
<use xlink:href="#p38" fill="#fff" /></g></svg>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/images/extensions/screenshot-1.png
DELETED
|
Binary file
|
trunk/assets/images/extensions/screenshot-2.png
DELETED
|
Binary file
|
trunk/assets/images/extensions/screenshot-3.png
DELETED
|
Binary file
|
trunk/assets/images/icons/truck.png
DELETED
|
Binary file
|
trunk/assets/images/wcvendors_logo.png
DELETED
|
Binary file
|
trunk/assets/js/admin/settings.js
DELETED
|
@@ -1,40 +0,0 @@
|
|
| 1 |
-
/* global wcvendors_settings_params */
|
| 2 |
-
( function( $ ) {
|
| 3 |
-
|
| 4 |
-
// Edit prompt
|
| 5 |
-
$( function() {
|
| 6 |
-
var changed = false;
|
| 7 |
-
|
| 8 |
-
$( 'input, textarea, select, checkbox' ).change( function() {
|
| 9 |
-
changed = true;
|
| 10 |
-
});
|
| 11 |
-
|
| 12 |
-
$( '.wcv-nav-tab-wrapper a' ).click( function() {
|
| 13 |
-
if ( changed ) {
|
| 14 |
-
window.onbeforeunload = function() {
|
| 15 |
-
return wcvendors_settings_params.i18n_nav_warning;
|
| 16 |
-
};
|
| 17 |
-
} else {
|
| 18 |
-
window.onbeforeunload = '';
|
| 19 |
-
}
|
| 20 |
-
});
|
| 21 |
-
|
| 22 |
-
$( '.submit input' ).click( function() {
|
| 23 |
-
window.onbeforeunload = '';
|
| 24 |
-
});
|
| 25 |
-
});
|
| 26 |
-
|
| 27 |
-
// Select all/none
|
| 28 |
-
$( '.wcvendors' ).on( 'click', '.select_all', function() {
|
| 29 |
-
$( this ).closest( 'td' ).find( 'select option' ).attr( 'selected', 'selected' );
|
| 30 |
-
$( this ).closest( 'td' ).find( 'select' ).trigger( 'change' );
|
| 31 |
-
return false;
|
| 32 |
-
});
|
| 33 |
-
|
| 34 |
-
$( '.wcvendors' ).on( 'click', '.select_none', function() {
|
| 35 |
-
$( this ).closest( 'td' ).find( 'select option' ).removeAttr( 'selected' );
|
| 36 |
-
$( this ).closest( 'td' ).find( 'select' ).trigger( 'change' );
|
| 37 |
-
return false;
|
| 38 |
-
});
|
| 39 |
-
|
| 40 |
-
})( jQuery );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/js/admin/wcv-setup.js
DELETED
|
File without changes
|
trunk/assets/js/front-orders.js
DELETED
|
@@ -1,8 +0,0 @@
|
|
| 1 |
-
jQuery(function () {
|
| 2 |
-
jQuery('div.order-comments, div.order-tracking').hide();
|
| 3 |
-
|
| 4 |
-
jQuery('a.order-comments-link, a.order-tracking-link').on('click', function (e) {
|
| 5 |
-
e.preventDefault();
|
| 6 |
-
jQuery(this).next('div').slideToggle();
|
| 7 |
-
});
|
| 8 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/js/select2.min.js
DELETED
|
@@ -1,3 +0,0 @@
|
|
| 1 |
-
/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */!function(a){"function"==typeof define&&define.amd?define(["jquery"],a):a("object"==typeof exports?require("jquery"):jQuery)}(function(a){var b=function(){if(a&&a.fn&&a.fn.select2&&a.fn.select2.amd)var b=a.fn.select2.amd;var b;return function(){if(!b||!b.requirejs){b?c=b:b={};var a,c,d;!function(b){function e(a,b){return u.call(a,b)}function f(a,b){var c,d,e,f,g,h,i,j,k,l,m,n=b&&b.split("/"),o=s.map,p=o&&o["*"]||{};if(a&&"."===a.charAt(0))if(b){for(a=a.split("/"),g=a.length-1,s.nodeIdCompat&&w.test(a[g])&&(a[g]=a[g].replace(w,"")),a=n.slice(0,n.length-1).concat(a),k=0;k<a.length;k+=1)if(m=a[k],"."===m)a.splice(k,1),k-=1;else if(".."===m){if(1===k&&(".."===a[2]||".."===a[0]))break;k>0&&(a.splice(k-1,2),k-=2)}a=a.join("/")}else 0===a.indexOf("./")&&(a=a.substring(2));if((n||p)&&o){for(c=a.split("/"),k=c.length;k>0;k-=1){if(d=c.slice(0,k).join("/"),n)for(l=n.length;l>0;l-=1)if(e=o[n.slice(0,l).join("/")],e&&(e=e[d])){f=e,h=k;break}if(f)break;!i&&p&&p[d]&&(i=p[d],j=k)}!f&&i&&(f=i,h=j),f&&(c.splice(0,h,f),a=c.join("/"))}return a}function g(a,c){return function(){var d=v.call(arguments,0);return"string"!=typeof d[0]&&1===d.length&&d.push(null),n.apply(b,d.concat([a,c]))}}function h(a){return function(b){return f(b,a)}}function i(a){return function(b){q[a]=b}}function j(a){if(e(r,a)){var c=r[a];delete r[a],t[a]=!0,m.apply(b,c)}if(!e(q,a)&&!e(t,a))throw new Error("No "+a);return q[a]}function k(a){var b,c=a?a.indexOf("!"):-1;return c>-1&&(b=a.substring(0,c),a=a.substring(c+1,a.length)),[b,a]}function l(a){return function(){return s&&s.config&&s.config[a]||{}}}var m,n,o,p,q={},r={},s={},t={},u=Object.prototype.hasOwnProperty,v=[].slice,w=/\.js$/;o=function(a,b){var c,d=k(a),e=d[0];return a=d[1],e&&(e=f(e,b),c=j(e)),e?a=c&&c.normalize?c.normalize(a,h(b)):f(a,b):(a=f(a,b),d=k(a),e=d[0],a=d[1],e&&(c=j(e))),{f:e?e+"!"+a:a,n:a,pr:e,p:c}},p={require:function(a){return g(a)},exports:function(a){var b=q[a];return"undefined"!=typeof b?b:q[a]={}},module:function(a){return{id:a,uri:"",exports:q[a],config:l(a)}}},m=function(a,c,d,f){var h,k,l,m,n,s,u=[],v=typeof d;if(f=f||a,"undefined"===v||"function"===v){for(c=!c.length&&d.length?["require","exports","module"]:c,n=0;n<c.length;n+=1)if(m=o(c[n],f),k=m.f,"require"===k)u[n]=p.require(a);else if("exports"===k)u[n]=p.exports(a),s=!0;else if("module"===k)h=u[n]=p.module(a);else if(e(q,k)||e(r,k)||e(t,k))u[n]=j(k);else{if(!m.p)throw new Error(a+" missing "+k);m.p.load(m.n,g(f,!0),i(k),{}),u[n]=q[k]}l=d?d.apply(q[a],u):void 0,a&&(h&&h.exports!==b&&h.exports!==q[a]?q[a]=h.exports:l===b&&s||(q[a]=l))}else a&&(q[a]=d)},a=c=n=function(a,c,d,e,f){if("string"==typeof a)return p[a]?p[a](c):j(o(a,c).f);if(!a.splice){if(s=a,s.deps&&n(s.deps,s.callback),!c)return;c.splice?(a=c,c=d,d=null):a=b}return c=c||function(){},"function"==typeof d&&(d=e,e=f),e?m(b,a,c,d):setTimeout(function(){m(b,a,c,d)},4),n},n.config=function(a){return n(a)},a._defined=q,d=function(a,b,c){if("string"!=typeof a)throw new Error("See almond README: incorrect module build, no module name");b.splice||(c=b,b=[]),e(q,a)||e(r,a)||(r[a]=[a,b,c])},d.amd={jQuery:!0}}(),b.requirejs=a,b.require=c,b.define=d}}(),b.define("almond",function(){}),b.define("jquery",[],function(){var b=a||$;return null==b&&console&&console.error&&console.error("Select2: An instance of jQuery or a jQuery-compatible library was not found. Make sure that you are including jQuery before Select2 on your web page."),b}),b.define("select2/utils",["jquery"],function(a){function b(a){var b=a.prototype,c=[];for(var d in b){var e=b[d];"function"==typeof e&&"constructor"!==d&&c.push(d)}return c}var c={};c.Extend=function(a,b){function c(){this.constructor=a}var d={}.hasOwnProperty;for(var e in b)d.call(b,e)&&(a[e]=b[e]);return c.prototype=b.prototype,a.prototype=new c,a.__super__=b.prototype,a},c.Decorate=function(a,c){function d(){var b=Array.prototype.unshift,d=c.prototype.constructor.length,e=a.prototype.constructor;d>0&&(b.call(arguments,a.prototype.constructor),e=c.prototype.constructor),e.apply(this,arguments)}function e(){this.constructor=d}var f=b(c),g=b(a);c.displayName=a.displayName,d.prototype=new e;for(var h=0;h<g.length;h++){var i=g[h];d.prototype[i]=a.prototype[i]}for(var j=(function(a){var b=function(){};a in d.prototype&&(b=d.prototype[a]);var e=c.prototype[a];return function(){var a=Array.prototype.unshift;return a.call(arguments,b),e.apply(this,arguments)}}),k=0;k<f.length;k++){var l=f[k];d.prototype[l]=j(l)}return d};var d=function(){this.listeners={}};return d.prototype.on=function(a,b){this.listeners=this.listeners||{},a in this.listeners?this.listeners[a].push(b):this.listeners[a]=[b]},d.prototype.trigger=function(a){var b=Array.prototype.slice,c=b.call(arguments,1);this.listeners=this.listeners||{},null==c&&(c=[]),0===c.length&&c.push({}),c[0]._type=a,a in this.listeners&&this.invoke(this.listeners[a],b.call(arguments,1)),"*"in this.listeners&&this.invoke(this.listeners["*"],arguments)},d.prototype.invoke=function(a,b){for(var c=0,d=a.length;d>c;c++)a[c].apply(this,b)},c.Observable=d,c.generateChars=function(a){for(var b="",c=0;a>c;c++){var d=Math.floor(36*Math.random());b+=d.toString(36)}return b},c.bind=function(a,b){return function(){a.apply(b,arguments)}},c._convertData=function(a){for(var b in a){var c=b.split("-"),d=a;if(1!==c.length){for(var e=0;e<c.length;e++){var f=c[e];f=f.substring(0,1).toLowerCase()+f.substring(1),f in d||(d[f]={}),e==c.length-1&&(d[f]=a[b]),d=d[f]}delete a[b]}}return a},c.hasScroll=function(b,c){var d=a(c),e=c.style.overflowX,f=c.style.overflowY;return e!==f||"hidden"!==f&&"visible"!==f?"scroll"===e||"scroll"===f?!0:d.innerHeight()<c.scrollHeight||d.innerWidth()<c.scrollWidth:!1},c.escapeMarkup=function(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return"string"!=typeof a?a:String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})},c.appendMany=function(b,c){if("1.7"===a.fn.jquery.substr(0,3)){var d=a();a.map(c,function(a){d=d.add(a)}),c=d}b.append(c)},c}),b.define("select2/results",["jquery","./utils"],function(a,b){function c(a,b,d){this.$element=a,this.data=d,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<ul class="select2-results__options" role="tree"></ul>');return this.options.get("multiple")&&b.attr("aria-multiselectable","true"),this.$results=b,b},c.prototype.clear=function(){this.$results.empty()},c.prototype.displayMessage=function(b){var c=this.options.get("escapeMarkup");this.clear(),this.hideLoading();var d=a('<li role="treeitem" aria-live="assertive" class="select2-results__option"></li>'),e=this.options.get("translations").get(b.message);d.append(c(e(b.args))),d[0].className+=" select2-results__message",this.$results.append(d)},c.prototype.hideMessages=function(){this.$results.find(".select2-results__message").remove()},c.prototype.append=function(a){this.hideLoading();var b=[];if(null==a.results||0===a.results.length)return void(0===this.$results.children().length&&this.trigger("results:message",{message:"noResults"}));a.results=this.sort(a.results);for(var c=0;c<a.results.length;c++){var d=a.results[c],e=this.option(d);b.push(e)}this.$results.append(b)},c.prototype.position=function(a,b){var c=b.find(".select2-results");c.append(a)},c.prototype.sort=function(a){var b=this.options.get("sorter");return b(a)},c.prototype.highlightFirstItem=function(){var a=this.$results.find(".select2-results__option[aria-selected]"),b=a.filter("[aria-selected=true]");b.length>0?b.first().trigger("mouseenter"):a.first().trigger("mouseenter"),this.ensureHighlightVisible()},c.prototype.setClasses=function(){var b=this;this.data.current(function(c){var d=a.map(c,function(a){return a.id.toString()}),e=b.$results.find(".select2-results__option[aria-selected]");e.each(function(){var b=a(this),c=a.data(this,"data"),e=""+c.id;null!=c.element&&c.element.selected||null==c.element&&a.inArray(e,d)>-1?b.attr("aria-selected","true"):b.attr("aria-selected","false")})})},c.prototype.showLoading=function(a){this.hideLoading();var b=this.options.get("translations").get("searching"),c={disabled:!0,loading:!0,text:b(a)},d=this.option(c);d.className+=" loading-results",this.$results.prepend(d)},c.prototype.hideLoading=function(){this.$results.find(".loading-results").remove()},c.prototype.option=function(b){var c=document.createElement("li");c.className="select2-results__option";var d={role:"treeitem","aria-selected":"false"};b.disabled&&(delete d["aria-selected"],d["aria-disabled"]="true"),null==b.id&&delete d["aria-selected"],null!=b._resultId&&(c.id=b._resultId),b.title&&(c.title=b.title),b.children&&(d.role="group",d["aria-label"]=b.text,delete d["aria-selected"]);for(var e in d){var f=d[e];c.setAttribute(e,f)}if(b.children){var g=a(c),h=document.createElement("strong");h.className="select2-results__group";a(h);this.template(b,h);for(var i=[],j=0;j<b.children.length;j++){var k=b.children[j],l=this.option(k);i.push(l)}var m=a("<ul></ul>",{"class":"select2-results__options select2-results__options--nested"});m.append(i),g.append(h),g.append(m)}else this.template(b,c);return a.data(c,"data",b),c},c.prototype.bind=function(b,c){var d=this,e=b.id+"-results";this.$results.attr("id",e),b.on("results:all",function(a){d.clear(),d.append(a.data),b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("results:append",function(a){d.append(a.data),b.isOpen()&&d.setClasses()}),b.on("query",function(a){d.hideMessages(),d.showLoading(a)}),b.on("select",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("unselect",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("open",function(){d.$results.attr("aria-expanded","true"),d.$results.attr("aria-hidden","false"),d.setClasses(),d.ensureHighlightVisible()}),b.on("close",function(){d.$results.attr("aria-expanded","false"),d.$results.attr("aria-hidden","true"),d.$results.removeAttr("aria-activedescendant")}),b.on("results:toggle",function(){var a=d.getHighlightedResults();0!==a.length&&a.trigger("mouseup")}),b.on("results:select",function(){var a=d.getHighlightedResults();if(0!==a.length){var b=a.data("data");"true"==a.attr("aria-selected")?d.trigger("close",{}):d.trigger("select",{data:b})}}),b.on("results:previous",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a);if(0!==c){var e=c-1;0===a.length&&(e=0);var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top,h=f.offset().top,i=d.$results.scrollTop()+(h-g);0===e?d.$results.scrollTop(0):0>h-g&&d.$results.scrollTop(i)}}),b.on("results:next",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a),e=c+1;if(!(e>=b.length)){var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top+d.$results.outerHeight(!1),h=f.offset().top+f.outerHeight(!1),i=d.$results.scrollTop()+h-g;0===e?d.$results.scrollTop(0):h>g&&d.$results.scrollTop(i)}}),b.on("results:focus",function(a){a.element.addClass("select2-results__option--highlighted")}),b.on("results:message",function(a){d.displayMessage(a)}),a.fn.mousewheel&&this.$results.on("mousewheel",function(a){var b=d.$results.scrollTop(),c=d.$results.get(0).scrollHeight-b+a.deltaY,e=a.deltaY>0&&b-a.deltaY<=0,f=a.deltaY<0&&c<=d.$results.height();e?(d.$results.scrollTop(0),a.preventDefault(),a.stopPropagation()):f&&(d.$results.scrollTop(d.$results.get(0).scrollHeight-d.$results.height()),a.preventDefault(),a.stopPropagation())}),this.$results.on("mouseup",".select2-results__option[aria-selected]",function(b){var c=a(this),e=c.data("data");return"true"===c.attr("aria-selected")?void(d.options.get("multiple")?d.trigger("unselect",{originalEvent:b,data:e}):d.trigger("close",{})):void d.trigger("select",{originalEvent:b,data:e})}),this.$results.on("mouseenter",".select2-results__option[aria-selected]",function(b){var c=a(this).data("data");d.getHighlightedResults().removeClass("select2-results__option--highlighted"),d.trigger("results:focus",{data:c,element:a(this)})})},c.prototype.getHighlightedResults=function(){var a=this.$results.find(".select2-results__option--highlighted");return a},c.prototype.destroy=function(){this.$results.remove()},c.prototype.ensureHighlightVisible=function(){var a=this.getHighlightedResults();if(0!==a.length){var b=this.$results.find("[aria-selected]"),c=b.index(a),d=this.$results.offset().top,e=a.offset().top,f=this.$results.scrollTop()+(e-d),g=e-d;f-=2*a.outerHeight(!1),2>=c?this.$results.scrollTop(0):(g>this.$results.outerHeight()||0>g)&&this.$results.scrollTop(f)}},c.prototype.template=function(b,c){var d=this.options.get("templateResult"),e=this.options.get("escapeMarkup"),f=d(b,c);null==f?c.style.display="none":"string"==typeof f?c.innerHTML=e(f):a(c).append(f)},c}),b.define("select2/keys",[],function(){var a={BACKSPACE:8,TAB:9,ENTER:13,SHIFT:16,CTRL:17,ALT:18,ESC:27,SPACE:32,PAGE_UP:33,PAGE_DOWN:34,END:35,HOME:36,LEFT:37,UP:38,RIGHT:39,DOWN:40,DELETE:46};return a}),b.define("select2/selection/base",["jquery","../utils","../keys"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,b.Observable),d.prototype.render=function(){var b=a('<span class="select2-selection" role="combobox" aria-haspopup="true" aria-expanded="false"></span>');return this._tabindex=0,null!=this.$element.data("old-tabindex")?this._tabindex=this.$element.data("old-tabindex"):null!=this.$element.attr("tabindex")&&(this._tabindex=this.$element.attr("tabindex")),b.attr("title",this.$element.attr("title")),b.attr("tabindex",this._tabindex),this.$selection=b,b},d.prototype.bind=function(a,b){var d=this,e=(a.id+"-container",a.id+"-results");this.container=a,this.$selection.on("focus",function(a){d.trigger("focus",a)}),this.$selection.on("blur",function(a){d._handleBlur(a)}),this.$selection.on("keydown",function(a){d.trigger("keypress",a),a.which===c.SPACE&&a.preventDefault()}),a.on("results:focus",function(a){d.$selection.attr("aria-activedescendant",a.data._resultId)}),a.on("selection:update",function(a){d.update(a.data)}),a.on("open",function(){d.$selection.attr("aria-expanded","true"),d.$selection.attr("aria-owns",e),d._attachCloseHandler(a)}),a.on("close",function(){d.$selection.attr("aria-expanded","false"),d.$selection.removeAttr("aria-activedescendant"),d.$selection.removeAttr("aria-owns"),d.$selection.focus(),d._detachCloseHandler(a)}),a.on("enable",function(){d.$selection.attr("tabindex",d._tabindex)}),a.on("disable",function(){d.$selection.attr("tabindex","-1")})},d.prototype._handleBlur=function(b){var c=this;window.setTimeout(function(){document.activeElement==c.$selection[0]||a.contains(c.$selection[0],document.activeElement)||c.trigger("blur",b)},1)},d.prototype._attachCloseHandler=function(b){a(document.body).on("mousedown.select2."+b.id,function(b){var c=a(b.target),d=c.closest(".select2"),e=a(".select2.select2-container--open");e.each(function(){var b=a(this);if(this!=d[0]){var c=b.data("element");c.select2("close")}})})},d.prototype._detachCloseHandler=function(b){a(document.body).off("mousedown.select2."+b.id)},d.prototype.position=function(a,b){var c=b.find(".selection");c.append(a)},d.prototype.destroy=function(){this._detachCloseHandler(this.container)},d.prototype.update=function(a){throw new Error("The `update` method must be defined in child classes.")},d}),b.define("select2/selection/single",["jquery","./base","../utils","../keys"],function(a,b,c,d){function e(){e.__super__.constructor.apply(this,arguments)}return c.Extend(e,b),e.prototype.render=function(){var a=e.__super__.render.call(this);return a.addClass("select2-selection--single"),a.html('<span class="select2-selection__rendered"></span><span class="select2-selection__arrow" role="presentation"><b role="presentation"></b></span>'),a},e.prototype.bind=function(a,b){var c=this;e.__super__.bind.apply(this,arguments);var d=a.id+"-container";this.$selection.find(".select2-selection__rendered").attr("id",d),this.$selection.attr("aria-labelledby",d),this.$selection.on("mousedown",function(a){1===a.which&&c.trigger("toggle",{originalEvent:a})}),this.$selection.on("focus",function(a){}),this.$selection.on("blur",function(a){}),a.on("focus",function(b){a.isOpen()||c.$selection.focus()}),a.on("selection:update",function(a){c.update(a.data)})},e.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},e.prototype.display=function(a,b){var c=this.options.get("templateSelection"),d=this.options.get("escapeMarkup");return d(c(a,b))},e.prototype.selectionContainer=function(){return a("<span></span>")},e.prototype.update=function(a){if(0===a.length)return void this.clear();var b=a[0],c=this.$selection.find(".select2-selection__rendered"),d=this.display(b,c);c.empty().append(d),c.prop("title",b.title||b.text)},e}),b.define("select2/selection/multiple",["jquery","./base","../utils"],function(a,b,c){function d(a,b){d.__super__.constructor.apply(this,arguments)}return c.Extend(d,b),d.prototype.render=function(){var a=d.__super__.render.call(this);return a.addClass("select2-selection--multiple"),a.html('<ul class="select2-selection__rendered"></ul>'),a},d.prototype.bind=function(b,c){var e=this;d.__super__.bind.apply(this,arguments),this.$selection.on("click",function(a){e.trigger("toggle",{originalEvent:a})}),this.$selection.on("click",".select2-selection__choice__remove",function(b){if(!e.options.get("disabled")){var c=a(this),d=c.parent(),f=d.data("data");e.trigger("unselect",{originalEvent:b,data:f})}})},d.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},d.prototype.display=function(a,b){var c=this.options.get("templateSelection"),d=this.options.get("escapeMarkup");return d(c(a,b))},d.prototype.selectionContainer=function(){var b=a('<li class="select2-selection__choice"><span class="select2-selection__choice__remove" role="presentation">×</span></li>');return b},d.prototype.update=function(a){if(this.clear(),0!==a.length){for(var b=[],d=0;d<a.length;d++){var e=a[d],f=this.selectionContainer(),g=this.display(e,f);f.append(g),f.prop("title",e.title||e.text),f.data("data",e),b.push(f)}var h=this.$selection.find(".select2-selection__rendered");c.appendMany(h,b)}},d}),b.define("select2/selection/placeholder",["../utils"],function(a){function b(a,b,c){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c)}return b.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},b.prototype.createPlaceholder=function(a,b){var c=this.selectionContainer();return c.html(this.display(b)),c.addClass("select2-selection__placeholder").removeClass("select2-selection__choice"),c},b.prototype.update=function(a,b){var c=1==b.length&&b[0].id!=this.placeholder.id,d=b.length>1;if(d||c)return a.call(this,b);this.clear();var e=this.createPlaceholder(this.placeholder);this.$selection.find(".select2-selection__rendered").append(e)},b}),b.define("select2/selection/allowClear",["jquery","../keys"],function(a,b){function c(){}return c.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),null==this.placeholder&&this.options.get("debug")&&window.console&&console.error&&console.error("Select2: The `allowClear` option should be used in combination with the `placeholder` option."),this.$selection.on("mousedown",".select2-selection__clear",function(a){d._handleClear(a)}),b.on("keypress",function(a){d._handleKeyboardClear(a,b)})},c.prototype._handleClear=function(a,b){if(!this.options.get("disabled")){var c=this.$selection.find(".select2-selection__clear");if(0!==c.length){b.stopPropagation();for(var d=c.data("data"),e=0;e<d.length;e++){var f={data:d[e]};if(this.trigger("unselect",f),f.prevented)return}this.$element.val(this.placeholder.id).trigger("change"),this.trigger("toggle",{})}}},c.prototype._handleKeyboardClear=function(a,c,d){d.isOpen()||(c.which==b.DELETE||c.which==b.BACKSPACE)&&this._handleClear(c)},c.prototype.update=function(b,c){if(b.call(this,c),!(this.$selection.find(".select2-selection__placeholder").length>0||0===c.length)){var d=a('<span class="select2-selection__clear">×</span>');d.data("data",c),this.$selection.find(".select2-selection__rendered").prepend(d)}},c}),b.define("select2/selection/search",["jquery","../utils","../keys"],function(a,b,c){function d(a,b,c){a.call(this,b,c)}return d.prototype.render=function(b){var c=a('<li class="select2-search select2-search--inline"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" aria-autocomplete="list" /></li>');this.$searchContainer=c,this.$search=c.find("input");var d=b.call(this);return this._transferTabIndex(),d},d.prototype.bind=function(a,b,d){var e=this;a.call(this,b,d),b.on("open",function(){e.$search.trigger("focus")}),b.on("close",function(){e.$search.val(""),e.$search.removeAttr("aria-activedescendant"),e.$search.trigger("focus")}),b.on("enable",function(){e.$search.prop("disabled",!1),e._transferTabIndex()}),b.on("disable",function(){e.$search.prop("disabled",!0)}),b.on("focus",function(a){e.$search.trigger("focus")}),b.on("results:focus",function(a){e.$search.attr("aria-activedescendant",a.id)}),this.$selection.on("focusin",".select2-search--inline",function(a){e.trigger("focus",a)}),this.$selection.on("focusout",".select2-search--inline",function(a){e._handleBlur(a)}),this.$selection.on("keydown",".select2-search--inline",function(a){a.stopPropagation(),e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented();var b=a.which;if(b===c.BACKSPACE&&""===e.$search.val()){var d=e.$searchContainer.prev(".select2-selection__choice");if(d.length>0){var f=d.data("data");e.searchRemoveChoice(f),a.preventDefault()}}});var f=document.documentMode,g=f&&11>=f;this.$selection.on("input.searchcheck",".select2-search--inline",function(a){return g?void e.$selection.off("input.search input.searchcheck"):void e.$selection.off("keyup.search")}),this.$selection.on("keyup.search input.search",".select2-search--inline",function(a){if(g&&"input"===a.type)return void e.$selection.off("input.search input.searchcheck");var b=a.which;b!=c.SHIFT&&b!=c.CTRL&&b!=c.ALT&&b!=c.TAB&&e.handleSearch(a)})},d.prototype._transferTabIndex=function(a){this.$search.attr("tabindex",this.$selection.attr("tabindex")),this.$selection.attr("tabindex","-1")},d.prototype.createPlaceholder=function(a,b){this.$search.attr("placeholder",b.text)},d.prototype.update=function(a,b){var c=this.$search[0]==document.activeElement;this.$search.attr("placeholder",""),a.call(this,b),this.$selection.find(".select2-selection__rendered").append(this.$searchContainer),this.resizeSearch(),c&&this.$search.focus()},d.prototype.handleSearch=function(){if(this.resizeSearch(),!this._keyUpPrevented){var a=this.$search.val();this.trigger("query",{term:a})}this._keyUpPrevented=!1},d.prototype.searchRemoveChoice=function(a,b){this.trigger("unselect",{data:b}),this.$search.val(b.text),this.handleSearch()},d.prototype.resizeSearch=function(){this.$search.css("width","25px");var a="";if(""!==this.$search.attr("placeholder"))a=this.$selection.find(".select2-selection__rendered").innerWidth();else{var b=this.$search.val().length+1;a=.75*b+"em"}this.$search.css("width",a)},d}),b.define("select2/selection/eventRelay",["jquery"],function(a){function b(){}return b.prototype.bind=function(b,c,d){var e=this,f=["open","opening","close","closing","select","selecting","unselect","unselecting"],g=["opening","closing","selecting","unselecting"];b.call(this,c,d),c.on("*",function(b,c){if(-1!==a.inArray(b,f)){c=c||{};var d=a.Event("select2:"+b,{params:c});e.$element.trigger(d),-1!==a.inArray(b,g)&&(c.prevented=d.isDefaultPrevented())}})},b}),b.define("select2/translation",["jquery","require"],function(a,b){function c(a){this.dict=a||{}}return c.prototype.all=function(){return this.dict},c.prototype.get=function(a){return this.dict[a]},c.prototype.extend=function(b){this.dict=a.extend({},b.all(),this.dict)},c._cache={},c.loadPath=function(a){if(!(a in c._cache)){var d=b(a);c._cache[a]=d}return new c(c._cache[a])},c}),b.define("select2/diacritics",[],function(){var a={"Ⓐ":"A","Ａ":"A","À":"A","Á":"A","Â":"A","Ầ":"A","Ấ":"A","Ẫ":"A","Ẩ":"A","Ã":"A","Ā":"A","Ă":"A","Ằ":"A","Ắ":"A","Ẵ":"A","Ẳ":"A","Ȧ":"A","Ǡ":"A","Ä":"A","Ǟ":"A","Ả":"A","Å":"A","Ǻ":"A","Ǎ":"A","Ȁ":"A","Ȃ":"A","Ạ":"A","Ậ":"A","Ặ":"A","Ḁ":"A","Ą":"A","Ⱥ":"A","Ɐ":"A","Ꜳ":"AA","Æ":"AE","Ǽ":"AE","Ǣ":"AE","Ꜵ":"AO","Ꜷ":"AU","Ꜹ":"AV","Ꜻ":"AV","Ꜽ":"AY","Ⓑ":"B","Ｂ":"B","Ḃ":"B","Ḅ":"B","Ḇ":"B","Ƀ":"B","Ƃ":"B","Ɓ":"B","Ⓒ":"C","Ｃ":"C","Ć":"C","Ĉ":"C","Ċ":"C","Č":"C","Ç":"C","Ḉ":"C","Ƈ":"C","Ȼ":"C","Ꜿ":"C","Ⓓ":"D","Ｄ":"D","Ḋ":"D","Ď":"D","Ḍ":"D","Ḑ":"D","Ḓ":"D","Ḏ":"D","Đ":"D","Ƌ":"D","Ɗ":"D","Ɖ":"D","Ꝺ":"D","DZ":"DZ","DŽ":"DZ","Dz":"Dz","Dž":"Dz","Ⓔ":"E","Ｅ":"E","È":"E","É":"E","Ê":"E","Ề":"E","Ế":"E","Ễ":"E","Ể":"E","Ẽ":"E","Ē":"E","Ḕ":"E","Ḗ":"E","Ĕ":"E","Ė":"E","Ë":"E","Ẻ":"E","Ě":"E","Ȅ":"E","Ȇ":"E","Ẹ":"E","Ệ":"E","Ȩ":"E","Ḝ":"E","Ę":"E","Ḙ":"E","Ḛ":"E","Ɛ":"E","Ǝ":"E","Ⓕ":"F","Ｆ":"F","Ḟ":"F","Ƒ":"F","Ꝼ":"F","Ⓖ":"G","Ｇ":"G","Ǵ":"G","Ĝ":"G","Ḡ":"G","Ğ":"G","Ġ":"G","Ǧ":"G","Ģ":"G","Ǥ":"G","Ɠ":"G","Ꞡ":"G","Ᵹ":"G","Ꝿ":"G","Ⓗ":"H","Ｈ":"H","Ĥ":"H","Ḣ":"H","Ḧ":"H","Ȟ":"H","Ḥ":"H","Ḩ":"H","Ḫ":"H","Ħ":"H","Ⱨ":"H","Ⱶ":"H","Ɥ":"H","Ⓘ":"I","Ｉ":"I","Ì":"I","Í":"I","Î":"I","Ĩ":"I","Ī":"I","Ĭ":"I","İ":"I","Ï":"I","Ḯ":"I","Ỉ":"I","Ǐ":"I","Ȉ":"I","Ȋ":"I","Ị":"I","Į":"I","Ḭ":"I","Ɨ":"I","Ⓙ":"J","Ｊ":"J","Ĵ":"J","Ɉ":"J","Ⓚ":"K","Ｋ":"K","Ḱ":"K","Ǩ":"K","Ḳ":"K","Ķ":"K","Ḵ":"K","Ƙ":"K","Ⱪ":"K","Ꝁ":"K","Ꝃ":"K","Ꝅ":"K","Ꞣ":"K","Ⓛ":"L","Ｌ":"L","Ŀ":"L","Ĺ":"L","Ľ":"L","Ḷ":"L","Ḹ":"L","Ļ":"L","Ḽ":"L","Ḻ":"L","Ł":"L","Ƚ":"L","Ɫ":"L","Ⱡ":"L","Ꝉ":"L","Ꝇ":"L","Ꞁ":"L","LJ":"LJ","Lj":"Lj","Ⓜ":"M","Ｍ":"M","Ḿ":"M","Ṁ":"M","Ṃ":"M","Ɱ":"M","Ɯ":"M","Ⓝ":"N","Ｎ":"N","Ǹ":"N","Ń":"N","Ñ":"N","Ṅ":"N","Ň":"N","Ṇ":"N","Ņ":"N","Ṋ":"N","Ṉ":"N","Ƞ":"N","Ɲ":"N","Ꞑ":"N","Ꞥ":"N","NJ":"NJ","Nj":"Nj","Ⓞ":"O","Ｏ":"O","Ò":"O","Ó":"O","Ô":"O","Ồ":"O","Ố":"O","Ỗ":"O","Ổ":"O","Õ":"O","Ṍ":"O","Ȭ":"O","Ṏ":"O","Ō":"O","Ṑ":"O","Ṓ":"O","Ŏ":"O","Ȯ":"O","Ȱ":"O","Ö":"O","Ȫ":"O","Ỏ":"O","Ő":"O","Ǒ":"O","Ȍ":"O","Ȏ":"O","Ơ":"O","Ờ":"O","Ớ":"O","Ỡ":"O","Ở":"O","Ợ":"O","Ọ":"O","Ộ":"O","Ǫ":"O","Ǭ":"O","Ø":"O","Ǿ":"O","Ɔ":"O","Ɵ":"O","Ꝋ":"O","Ꝍ":"O","Ƣ":"OI","Ꝏ":"OO","Ȣ":"OU","Ⓟ":"P","Ｐ":"P","Ṕ":"P","Ṗ":"P","Ƥ":"P","Ᵽ":"P","Ꝑ":"P","Ꝓ":"P","Ꝕ":"P","Ⓠ":"Q","Ｑ":"Q","Ꝗ":"Q","Ꝙ":"Q","Ɋ":"Q","Ⓡ":"R","Ｒ":"R","Ŕ":"R","Ṙ":"R","Ř":"R","Ȑ":"R","Ȓ":"R","Ṛ":"R","Ṝ":"R","Ŗ":"R","Ṟ":"R","Ɍ":"R","Ɽ":"R","Ꝛ":"R","Ꞧ":"R","Ꞃ":"R","Ⓢ":"S","Ｓ":"S","ẞ":"S","Ś":"S","Ṥ":"S","Ŝ":"S","Ṡ":"S","Š":"S","Ṧ":"S","Ṣ":"S","Ṩ":"S","Ș":"S","Ş":"S","Ȿ":"S","Ꞩ":"S","Ꞅ":"S","Ⓣ":"T","Ｔ":"T","Ṫ":"T","Ť":"T","Ṭ":"T","Ț":"T","Ţ":"T","Ṱ":"T","Ṯ":"T","Ŧ":"T","Ƭ":"T","Ʈ":"T","Ⱦ":"T","Ꞇ":"T","Ꜩ":"TZ","Ⓤ":"U","Ｕ":"U","Ù":"U","Ú":"U","Û":"U","Ũ":"U","Ṹ":"U","Ū":"U","Ṻ":"U","Ŭ":"U","Ü":"U","Ǜ":"U","Ǘ":"U","Ǖ":"U","Ǚ":"U","Ủ":"U","Ů":"U","Ű":"U","Ǔ":"U","Ȕ":"U","Ȗ":"U","Ư":"U","Ừ":"U","Ứ":"U","Ữ":"U","Ử":"U","Ự":"U","Ụ":"U","Ṳ":"U","Ų":"U","Ṷ":"U","Ṵ":"U","Ʉ":"U","Ⓥ":"V","Ｖ":"V","Ṽ":"V","Ṿ":"V","Ʋ":"V","Ꝟ":"V","Ʌ":"V","Ꝡ":"VY","Ⓦ":"W","Ｗ":"W","Ẁ":"W","Ẃ":"W","Ŵ":"W","Ẇ":"W","Ẅ":"W","Ẉ":"W","Ⱳ":"W","Ⓧ":"X","Ｘ":"X","Ẋ":"X","Ẍ":"X","Ⓨ":"Y","Ｙ":"Y","Ỳ":"Y","Ý":"Y","Ŷ":"Y","Ỹ":"Y","Ȳ":"Y","Ẏ":"Y","Ÿ":"Y","Ỷ":"Y","Ỵ":"Y","Ƴ":"Y","Ɏ":"Y","Ỿ":"Y","Ⓩ":"Z","Ｚ":"Z","Ź":"Z","Ẑ":"Z","Ż":"Z","Ž":"Z","Ẓ":"Z","Ẕ":"Z","Ƶ":"Z","Ȥ":"Z","Ɀ":"Z","Ⱬ":"Z","Ꝣ":"Z","ⓐ":"a","ａ":"a","ẚ":"a","à":"a","á":"a","â":"a","ầ":"a","ấ":"a","ẫ":"a","ẩ":"a","ã":"a","ā":"a","ă":"a","ằ":"a","ắ":"a","ẵ":"a","ẳ":"a","ȧ":"a","ǡ":"a","ä":"a","ǟ":"a","ả":"a","å":"a","ǻ":"a","ǎ":"a","ȁ":"a","ȃ":"a","ạ":"a","ậ":"a","ặ":"a","ḁ":"a","ą":"a","ⱥ":"a","ɐ":"a","ꜳ":"aa","æ":"ae","ǽ":"ae","ǣ":"ae","ꜵ":"ao","ꜷ":"au","ꜹ":"av","ꜻ":"av","ꜽ":"ay","ⓑ":"b","ｂ":"b","ḃ":"b","ḅ":"b","ḇ":"b","ƀ":"b","ƃ":"b","ɓ":"b","ⓒ":"c","ｃ":"c","ć":"c","ĉ":"c","ċ":"c","č":"c","ç":"c","ḉ":"c","ƈ":"c","ȼ":"c","ꜿ":"c","ↄ":"c","ⓓ":"d","ｄ":"d","ḋ":"d","ď":"d","ḍ":"d","ḑ":"d","ḓ":"d","ḏ":"d","đ":"d","ƌ":"d","ɖ":"d","ɗ":"d","ꝺ":"d","dz":"dz","dž":"dz","ⓔ":"e","ｅ":"e","è":"e","é":"e","ê":"e","ề":"e","ế":"e","ễ":"e","ể":"e","ẽ":"e","ē":"e","ḕ":"e","ḗ":"e","ĕ":"e","ė":"e","ë":"e","ẻ":"e","ě":"e","ȅ":"e","ȇ":"e","ẹ":"e","ệ":"e","ȩ":"e","ḝ":"e","ę":"e","ḙ":"e","ḛ":"e","ɇ":"e","ɛ":"e","ǝ":"e","ⓕ":"f","ｆ":"f","ḟ":"f","ƒ":"f","ꝼ":"f","ⓖ":"g","ｇ":"g","ǵ":"g","ĝ":"g","ḡ":"g","ğ":"g","ġ":"g","ǧ":"g","ģ":"g","ǥ":"g","ɠ":"g","ꞡ":"g","ᵹ":"g","ꝿ":"g","ⓗ":"h","ｈ":"h","ĥ":"h","ḣ":"h","ḧ":"h","ȟ":"h","ḥ":"h","ḩ":"h","ḫ":"h","ẖ":"h","ħ":"h","ⱨ":"h","ⱶ":"h","ɥ":"h","ƕ":"hv","ⓘ":"i","ｉ":"i","ì":"i","í":"i","î":"i","ĩ":"i","ī":"i","ĭ":"i","ï":"i","ḯ":"i","ỉ":"i","ǐ":"i","ȉ":"i","ȋ":"i","ị":"i","į":"i","ḭ":"i","ɨ":"i","ı":"i","ⓙ":"j","ｊ":"j","ĵ":"j","ǰ":"j","ɉ":"j","ⓚ":"k","ｋ":"k","ḱ":"k","ǩ":"k","ḳ":"k","ķ":"k","ḵ":"k","ƙ":"k","ⱪ":"k","ꝁ":"k","ꝃ":"k","ꝅ":"k","ꞣ":"k","ⓛ":"l","ｌ":"l","ŀ":"l","ĺ":"l","ľ":"l","ḷ":"l","ḹ":"l","ļ":"l","ḽ":"l","ḻ":"l","ſ":"l","ł":"l","ƚ":"l","ɫ":"l","ⱡ":"l","ꝉ":"l","ꞁ":"l","ꝇ":"l","lj":"lj","ⓜ":"m","ｍ":"m","ḿ":"m","ṁ":"m","ṃ":"m","ɱ":"m","ɯ":"m","ⓝ":"n","ｎ":"n","ǹ":"n","ń":"n","ñ":"n","ṅ":"n","ň":"n","ṇ":"n","ņ":"n","ṋ":"n","ṉ":"n","ƞ":"n","ɲ":"n","ʼn":"n","ꞑ":"n","ꞥ":"n","nj":"nj","ⓞ":"o","ｏ":"o","ò":"o","ó":"o","ô":"o","ồ":"o","ố":"o","ỗ":"o","ổ":"o","õ":"o","ṍ":"o","ȭ":"o","ṏ":"o","ō":"o","ṑ":"o","ṓ":"o","ŏ":"o","ȯ":"o","ȱ":"o","ö":"o","ȫ":"o","ỏ":"o","ő":"o","ǒ":"o","ȍ":"o","ȏ":"o","ơ":"o","ờ":"o","ớ":"o","ỡ":"o","ở":"o","ợ":"o","ọ":"o","ộ":"o","ǫ":"o","ǭ":"o","ø":"o","ǿ":"o","ɔ":"o","ꝋ":"o","ꝍ":"o","ɵ":"o","ƣ":"oi","ȣ":"ou","ꝏ":"oo","ⓟ":"p","ｐ":"p","ṕ":"p","ṗ":"p","ƥ":"p","ᵽ":"p","ꝑ":"p","ꝓ":"p","ꝕ":"p","ⓠ":"q","ｑ":"q","ɋ":"q","ꝗ":"q","ꝙ":"q","ⓡ":"r","ｒ":"r","ŕ":"r","ṙ":"r","ř":"r","ȑ":"r","ȓ":"r","ṛ":"r","ṝ":"r","ŗ":"r","ṟ":"r","ɍ":"r","ɽ":"r","ꝛ":"r","ꞧ":"r","ꞃ":"r","ⓢ":"s","ｓ":"s","ß":"s","ś":"s","ṥ":"s","ŝ":"s","ṡ":"s","š":"s","ṧ":"s","ṣ":"s","ṩ":"s","ș":"s","ş":"s","ȿ":"s","ꞩ":"s","ꞅ":"s","ẛ":"s","ⓣ":"t","ｔ":"t","ṫ":"t","ẗ":"t","ť":"t","ṭ":"t","ț":"t","ţ":"t","ṱ":"t","ṯ":"t","ŧ":"t","ƭ":"t","ʈ":"t","ⱦ":"t","ꞇ":"t","ꜩ":"tz","ⓤ":"u","ｕ":"u","ù":"u","ú":"u","û":"u","ũ":"u","ṹ":"u","ū":"u","ṻ":"u","ŭ":"u","ü":"u","ǜ":"u","ǘ":"u","ǖ":"u","ǚ":"u","ủ":"u","ů":"u","ű":"u","ǔ":"u","ȕ":"u","ȗ":"u","ư":"u","ừ":"u","ứ":"u","ữ":"u","ử":"u","ự":"u","ụ":"u","ṳ":"u","ų":"u","ṷ":"u","ṵ":"u","ʉ":"u","ⓥ":"v","ｖ":"v","ṽ":"v","ṿ":"v","ʋ":"v","ꝟ":"v","ʌ":"v","ꝡ":"vy","ⓦ":"w","ｗ":"w","ẁ":"w","ẃ":"w","ŵ":"w","ẇ":"w","ẅ":"w","ẘ":"w","ẉ":"w","ⱳ":"w","ⓧ":"x","ｘ":"x","ẋ":"x","ẍ":"x","ⓨ":"y","ｙ":"y","ỳ":"y","ý":"y","ŷ":"y","ỹ":"y","ȳ":"y","ẏ":"y","ÿ":"y","ỷ":"y","ẙ":"y","ỵ":"y","ƴ":"y","ɏ":"y","ỿ":"y","ⓩ":"z","ｚ":"z","ź":"z","ẑ":"z","ż":"z","ž":"z","ẓ":"z","ẕ":"z","ƶ":"z","ȥ":"z","ɀ":"z","ⱬ":"z","ꝣ":"z","Ά":"Α","Έ":"Ε","Ή":"Η","Ί":"Ι","Ϊ":"Ι","Ό":"Ο","Ύ":"Υ","Ϋ":"Υ","Ώ":"Ω","ά":"α","έ":"ε","ή":"η","ί":"ι","ϊ":"ι","ΐ":"ι","ό":"ο","ύ":"υ","ϋ":"υ","ΰ":"υ","ω":"ω","ς":"σ"};return a}),b.define("select2/data/base",["../utils"],function(a){function b(a,c){b.__super__.constructor.call(this)}return a.Extend(b,a.Observable),b.prototype.current=function(a){throw new Error("The `current` method must be defined in child classes.")},b.prototype.query=function(a,b){throw new Error("The `query` method must be defined in child classes.")},b.prototype.bind=function(a,b){},b.prototype.destroy=function(){},b.prototype.generateResultId=function(b,c){var d=b.id+"-result-";return d+=a.generateChars(4),d+=null!=c.id?"-"+c.id.toString():"-"+a.generateChars(4)},b}),b.define("select2/data/select",["./base","../utils","jquery"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,a),d.prototype.current=function(a){var b=[],d=this;this.$element.find(":selected").each(function(){var a=c(this),e=d.item(a);b.push(e)}),a(b)},d.prototype.select=function(a){var b=this;if(a.selected=!0,c(a.element).is("option"))return a.element.selected=!0,void this.$element.trigger("change");
|
| 2 |
-
if(this.$element.prop("multiple"))this.current(function(d){var e=[];a=[a],a.push.apply(a,d);for(var f=0;f<a.length;f++){var g=a[f].id;-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")});else{var d=a.id;this.$element.val(d),this.$element.trigger("change")}},d.prototype.unselect=function(a){var b=this;if(this.$element.prop("multiple"))return a.selected=!1,c(a.element).is("option")?(a.element.selected=!1,void this.$element.trigger("change")):void this.current(function(d){for(var e=[],f=0;f<d.length;f++){var g=d[f].id;g!==a.id&&-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")})},d.prototype.bind=function(a,b){var c=this;this.container=a,a.on("select",function(a){c.select(a.data)}),a.on("unselect",function(a){c.unselect(a.data)})},d.prototype.destroy=function(){this.$element.find("*").each(function(){c.removeData(this,"data")})},d.prototype.query=function(a,b){var d=[],e=this,f=this.$element.children();f.each(function(){var b=c(this);if(b.is("option")||b.is("optgroup")){var f=e.item(b),g=e.matches(a,f);null!==g&&d.push(g)}}),b({results:d})},d.prototype.addOptions=function(a){b.appendMany(this.$element,a)},d.prototype.option=function(a){var b;a.children?(b=document.createElement("optgroup"),b.label=a.text):(b=document.createElement("option"),void 0!==b.textContent?b.textContent=a.text:b.innerText=a.text),a.id&&(b.value=a.id),a.disabled&&(b.disabled=!0),a.selected&&(b.selected=!0),a.title&&(b.title=a.title);var d=c(b),e=this._normalizeItem(a);return e.element=b,c.data(b,"data",e),d},d.prototype.item=function(a){var b={};if(b=c.data(a[0],"data"),null!=b)return b;if(a.is("option"))b={id:a.val(),text:a.text(),disabled:a.prop("disabled"),selected:a.prop("selected"),title:a.prop("title")};else if(a.is("optgroup")){b={text:a.prop("label"),children:[],title:a.prop("title")};for(var d=a.children("option"),e=[],f=0;f<d.length;f++){var g=c(d[f]),h=this.item(g);e.push(h)}b.children=e}return b=this._normalizeItem(b),b.element=a[0],c.data(a[0],"data",b),b},d.prototype._normalizeItem=function(a){c.isPlainObject(a)||(a={id:a,text:a}),a=c.extend({},{text:""},a);var b={selected:!1,disabled:!1};return null!=a.id&&(a.id=a.id.toString()),null!=a.text&&(a.text=a.text.toString()),null==a._resultId&&a.id&&null!=this.container&&(a._resultId=this.generateResultId(this.container,a)),c.extend({},b,a)},d.prototype.matches=function(a,b){var c=this.options.get("matcher");return c(a,b)},d}),b.define("select2/data/array",["./select","../utils","jquery"],function(a,b,c){function d(a,b){var c=b.get("data")||[];d.__super__.constructor.call(this,a,b),this.addOptions(this.convertToOptions(c))}return b.Extend(d,a),d.prototype.select=function(a){var b=this.$element.find("option").filter(function(b,c){return c.value==a.id.toString()});0===b.length&&(b=this.option(a),this.addOptions(b)),d.__super__.select.call(this,a)},d.prototype.convertToOptions=function(a){function d(a){return function(){return c(this).val()==a.id}}for(var e=this,f=this.$element.find("option"),g=f.map(function(){return e.item(c(this)).id}).get(),h=[],i=0;i<a.length;i++){var j=this._normalizeItem(a[i]);if(c.inArray(j.id,g)>=0){var k=f.filter(d(j)),l=this.item(k),m=c.extend(!0,{},j,l),n=this.option(m);k.replaceWith(n)}else{var o=this.option(j);if(j.children){var p=this.convertToOptions(j.children);b.appendMany(o,p)}h.push(o)}}return h},d}),b.define("select2/data/ajax",["./array","../utils","jquery"],function(a,b,c){function d(a,b){this.ajaxOptions=this._applyDefaults(b.get("ajax")),null!=this.ajaxOptions.processResults&&(this.processResults=this.ajaxOptions.processResults),d.__super__.constructor.call(this,a,b)}return b.Extend(d,a),d.prototype._applyDefaults=function(a){var b={data:function(a){return c.extend({},a,{q:a.term})},transport:function(a,b,d){var e=c.ajax(a);return e.then(b),e.fail(d),e}};return c.extend({},b,a,!0)},d.prototype.processResults=function(a){return a},d.prototype.query=function(a,b){function d(){var d=f.transport(f,function(d){var f=e.processResults(d,a);e.options.get("debug")&&window.console&&console.error&&(f&&f.results&&c.isArray(f.results)||console.error("Select2: The AJAX results did not return an array in the `results` key of the response.")),b(f)},function(){d.status&&"0"===d.status||e.trigger("results:message",{message:"errorLoading"})});e._request=d}var e=this;null!=this._request&&(c.isFunction(this._request.abort)&&this._request.abort(),this._request=null);var f=c.extend({type:"GET"},this.ajaxOptions);"function"==typeof f.url&&(f.url=f.url.call(this.$element,a)),"function"==typeof f.data&&(f.data=f.data.call(this.$element,a)),this.ajaxOptions.delay&&null!=a.term?(this._queryTimeout&&window.clearTimeout(this._queryTimeout),this._queryTimeout=window.setTimeout(d,this.ajaxOptions.delay)):d()},d}),b.define("select2/data/tags",["jquery"],function(a){function b(b,c,d){var e=d.get("tags"),f=d.get("createTag");void 0!==f&&(this.createTag=f);var g=d.get("insertTag");if(void 0!==g&&(this.insertTag=g),b.call(this,c,d),a.isArray(e))for(var h=0;h<e.length;h++){var i=e[h],j=this._normalizeItem(i),k=this.option(j);this.$element.append(k)}}return b.prototype.query=function(a,b,c){function d(a,f){for(var g=a.results,h=0;h<g.length;h++){var i=g[h],j=null!=i.children&&!d({results:i.children},!0),k=i.text===b.term;if(k||j)return f?!1:(a.data=g,void c(a))}if(f)return!0;var l=e.createTag(b);if(null!=l){var m=e.option(l);m.attr("data-select2-tag",!0),e.addOptions([m]),e.insertTag(g,l)}a.results=g,c(a)}var e=this;return this._removeOldTags(),null==b.term||null!=b.page?void a.call(this,b,c):void a.call(this,b,d)},b.prototype.createTag=function(b,c){var d=a.trim(c.term);return""===d?null:{id:d,text:d}},b.prototype.insertTag=function(a,b,c){b.unshift(c)},b.prototype._removeOldTags=function(b){var c=(this._lastTag,this.$element.find("option[data-select2-tag]"));c.each(function(){this.selected||a(this).remove()})},b}),b.define("select2/data/tokenizer",["jquery"],function(a){function b(a,b,c){var d=c.get("tokenizer");void 0!==d&&(this.tokenizer=d),a.call(this,b,c)}return b.prototype.bind=function(a,b,c){a.call(this,b,c),this.$search=b.dropdown.$search||b.selection.$search||c.find(".select2-search__field")},b.prototype.query=function(b,c,d){function e(b){var c=g._normalizeItem(b),d=g.$element.find("option").filter(function(){return a(this).val()===c.id});if(!d.length){var e=g.option(c);e.attr("data-select2-tag",!0),g._removeOldTags(),g.addOptions([e])}f(c)}function f(a){g.trigger("select",{data:a})}var g=this;c.term=c.term||"";var h=this.tokenizer(c,this.options,e);h.term!==c.term&&(this.$search.length&&(this.$search.val(h.term),this.$search.focus()),c.term=h.term),b.call(this,c,d)},b.prototype.tokenizer=function(b,c,d,e){for(var f=d.get("tokenSeparators")||[],g=c.term,h=0,i=this.createTag||function(a){return{id:a.term,text:a.term}};h<g.length;){var j=g[h];if(-1!==a.inArray(j,f)){var k=g.substr(0,h),l=a.extend({},c,{term:k}),m=i(l);null!=m?(e(m),g=g.substr(h+1)||"",h=0):h++}else h++}return{term:g}},b}),b.define("select2/data/minimumInputLength",[],function(){function a(a,b,c){this.minimumInputLength=c.get("minimumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){return b.term=b.term||"",b.term.length<this.minimumInputLength?void this.trigger("results:message",{message:"inputTooShort",args:{minimum:this.minimumInputLength,input:b.term,params:b}}):void a.call(this,b,c)},a}),b.define("select2/data/maximumInputLength",[],function(){function a(a,b,c){this.maximumInputLength=c.get("maximumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){return b.term=b.term||"",this.maximumInputLength>0&&b.term.length>this.maximumInputLength?void this.trigger("results:message",{message:"inputTooLong",args:{maximum:this.maximumInputLength,input:b.term,params:b}}):void a.call(this,b,c)},a}),b.define("select2/data/maximumSelectionLength",[],function(){function a(a,b,c){this.maximumSelectionLength=c.get("maximumSelectionLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){var d=this;this.current(function(e){var f=null!=e?e.length:0;return d.maximumSelectionLength>0&&f>=d.maximumSelectionLength?void d.trigger("results:message",{message:"maximumSelected",args:{maximum:d.maximumSelectionLength}}):void a.call(d,b,c)})},a}),b.define("select2/dropdown",["jquery","./utils"],function(a,b){function c(a,b){this.$element=a,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<span class="select2-dropdown"><span class="select2-results"></span></span>');return b.attr("dir",this.options.get("dir")),this.$dropdown=b,b},c.prototype.bind=function(){},c.prototype.position=function(a,b){},c.prototype.destroy=function(){this.$dropdown.remove()},c}),b.define("select2/dropdown/search",["jquery","../utils"],function(a,b){function c(){}return c.prototype.render=function(b){var c=b.call(this),d=a('<span class="select2-search select2-search--dropdown"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" /></span>');return this.$searchContainer=d,this.$search=d.find("input"),c.prepend(d),c},c.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),this.$search.on("keydown",function(a){e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented()}),this.$search.on("input",function(b){a(this).off("keyup")}),this.$search.on("keyup input",function(a){e.handleSearch(a)}),c.on("open",function(){e.$search.attr("tabindex",0),e.$search.focus(),window.setTimeout(function(){e.$search.focus()},0)}),c.on("close",function(){e.$search.attr("tabindex",-1),e.$search.val("")}),c.on("focus",function(){c.isOpen()&&e.$search.focus()}),c.on("results:all",function(a){if(null==a.query.term||""===a.query.term){var b=e.showSearch(a);b?e.$searchContainer.removeClass("select2-search--hide"):e.$searchContainer.addClass("select2-search--hide")}})},c.prototype.handleSearch=function(a){if(!this._keyUpPrevented){var b=this.$search.val();this.trigger("query",{term:b})}this._keyUpPrevented=!1},c.prototype.showSearch=function(a,b){return!0},c}),b.define("select2/dropdown/hidePlaceholder",[],function(){function a(a,b,c,d){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c,d)}return a.prototype.append=function(a,b){b.results=this.removePlaceholder(b.results),a.call(this,b)},a.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},a.prototype.removePlaceholder=function(a,b){for(var c=b.slice(0),d=b.length-1;d>=0;d--){var e=b[d];this.placeholder.id===e.id&&c.splice(d,1)}return c},a}),b.define("select2/dropdown/infiniteScroll",["jquery"],function(a){function b(a,b,c,d){this.lastParams={},a.call(this,b,c,d),this.$loadingMore=this.createLoadingMore(),this.loading=!1}return b.prototype.append=function(a,b){this.$loadingMore.remove(),this.loading=!1,a.call(this,b),this.showLoadingMore(b)&&this.$results.append(this.$loadingMore)},b.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),c.on("query",function(a){e.lastParams=a,e.loading=!0}),c.on("query:append",function(a){e.lastParams=a,e.loading=!0}),this.$results.on("scroll",function(){var b=a.contains(document.documentElement,e.$loadingMore[0]);if(!e.loading&&b){var c=e.$results.offset().top+e.$results.outerHeight(!1),d=e.$loadingMore.offset().top+e.$loadingMore.outerHeight(!1);c+50>=d&&e.loadMore()}})},b.prototype.loadMore=function(){this.loading=!0;var b=a.extend({},{page:1},this.lastParams);b.page++,this.trigger("query:append",b)},b.prototype.showLoadingMore=function(a,b){return b.pagination&&b.pagination.more},b.prototype.createLoadingMore=function(){var b=a('<li class="select2-results__option select2-results__option--load-more"role="treeitem" aria-disabled="true"></li>'),c=this.options.get("translations").get("loadingMore");return b.html(c(this.lastParams)),b},b}),b.define("select2/dropdown/attachBody",["jquery","../utils"],function(a,b){function c(b,c,d){this.$dropdownParent=d.get("dropdownParent")||a(document.body),b.call(this,c,d)}return c.prototype.bind=function(a,b,c){var d=this,e=!1;a.call(this,b,c),b.on("open",function(){d._showDropdown(),d._attachPositioningHandler(b),e||(e=!0,b.on("results:all",function(){d._positionDropdown(),d._resizeDropdown()}),b.on("results:append",function(){d._positionDropdown(),d._resizeDropdown()}))}),b.on("close",function(){d._hideDropdown(),d._detachPositioningHandler(b)}),this.$dropdownContainer.on("mousedown",function(a){a.stopPropagation()})},c.prototype.destroy=function(a){a.call(this),this.$dropdownContainer.remove()},c.prototype.position=function(a,b,c){b.attr("class",c.attr("class")),b.removeClass("select2"),b.addClass("select2-container--open"),b.css({position:"absolute",top:-999999}),this.$container=c},c.prototype.render=function(b){var c=a("<span></span>"),d=b.call(this);return c.append(d),this.$dropdownContainer=c,c},c.prototype._hideDropdown=function(a){this.$dropdownContainer.detach()},c.prototype._attachPositioningHandler=function(c,d){var e=this,f="scroll.select2."+d.id,g="resize.select2."+d.id,h="orientationchange.select2."+d.id,i=this.$container.parents().filter(b.hasScroll);i.each(function(){a(this).data("select2-scroll-position",{x:a(this).scrollLeft(),y:a(this).scrollTop()})}),i.on(f,function(b){var c=a(this).data("select2-scroll-position");a(this).scrollTop(c.y)}),a(window).on(f+" "+g+" "+h,function(a){e._positionDropdown(),e._resizeDropdown()})},c.prototype._detachPositioningHandler=function(c,d){var e="scroll.select2."+d.id,f="resize.select2."+d.id,g="orientationchange.select2."+d.id,h=this.$container.parents().filter(b.hasScroll);h.off(e),a(window).off(e+" "+f+" "+g)},c.prototype._positionDropdown=function(){var b=a(window),c=this.$dropdown.hasClass("select2-dropdown--above"),d=this.$dropdown.hasClass("select2-dropdown--below"),e=null,f=this.$container.offset();f.bottom=f.top+this.$container.outerHeight(!1);var g={height:this.$container.outerHeight(!1)};g.top=f.top,g.bottom=f.top+g.height;var h={height:this.$dropdown.outerHeight(!1)},i={top:b.scrollTop(),bottom:b.scrollTop()+b.height()},j=i.top<f.top-h.height,k=i.bottom>f.bottom+h.height,l={left:f.left,top:g.bottom},m=this.$dropdownParent;"static"===m.css("position")&&(m=m.offsetParent());var n=m.offset();l.top-=n.top,l.left-=n.left,c||d||(e="below"),k||!j||c?!j&&k&&c&&(e="below"):e="above",("above"==e||c&&"below"!==e)&&(l.top=g.top-n.top-h.height),null!=e&&(this.$dropdown.removeClass("select2-dropdown--below select2-dropdown--above").addClass("select2-dropdown--"+e),this.$container.removeClass("select2-container--below select2-container--above").addClass("select2-container--"+e)),this.$dropdownContainer.css(l)},c.prototype._resizeDropdown=function(){var a={width:this.$container.outerWidth(!1)+"px"};this.options.get("dropdownAutoWidth")&&(a.minWidth=a.width,a.position="relative",a.width="auto"),this.$dropdown.css(a)},c.prototype._showDropdown=function(a){this.$dropdownContainer.appendTo(this.$dropdownParent),this._positionDropdown(),this._resizeDropdown()},c}),b.define("select2/dropdown/minimumResultsForSearch",[],function(){function a(b){for(var c=0,d=0;d<b.length;d++){var e=b[d];e.children?c+=a(e.children):c++}return c}function b(a,b,c,d){this.minimumResultsForSearch=c.get("minimumResultsForSearch"),this.minimumResultsForSearch<0&&(this.minimumResultsForSearch=1/0),a.call(this,b,c,d)}return b.prototype.showSearch=function(b,c){return a(c.data.results)<this.minimumResultsForSearch?!1:b.call(this,c)},b}),b.define("select2/dropdown/selectOnClose",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("close",function(a){d._handleSelectOnClose(a)})},a.prototype._handleSelectOnClose=function(a,b){if(b&&null!=b.originalSelect2Event){var c=b.originalSelect2Event;if("select"===c._type||"unselect"===c._type)return}var d=this.getHighlightedResults();if(!(d.length<1)){var e=d.data("data");null!=e.element&&e.element.selected||null==e.element&&e.selected||this.trigger("select",{data:e})}},a}),b.define("select2/dropdown/closeOnSelect",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("select",function(a){d._selectTriggered(a)}),b.on("unselect",function(a){d._selectTriggered(a)})},a.prototype._selectTriggered=function(a,b){var c=b.originalEvent;c&&c.ctrlKey||this.trigger("close",{originalEvent:c,originalSelect2Event:b})},a}),b.define("select2/i18n/en",[],function(){return{errorLoading:function(){return"The results could not be loaded."},inputTooLong:function(a){var b=a.input.length-a.maximum,c="Please delete "+b+" character";return 1!=b&&(c+="s"),c},inputTooShort:function(a){var b=a.minimum-a.input.length,c="Please enter "+b+" or more characters";return c},loadingMore:function(){return"Loading more results…"},maximumSelected:function(a){var b="You can only select "+a.maximum+" item";return 1!=a.maximum&&(b+="s"),b},noResults:function(){return"No results found"},searching:function(){return"Searching…"}}}),b.define("select2/defaults",["jquery","require","./results","./selection/single","./selection/multiple","./selection/placeholder","./selection/allowClear","./selection/search","./selection/eventRelay","./utils","./translation","./diacritics","./data/select","./data/array","./data/ajax","./data/tags","./data/tokenizer","./data/minimumInputLength","./data/maximumInputLength","./data/maximumSelectionLength","./dropdown","./dropdown/search","./dropdown/hidePlaceholder","./dropdown/infiniteScroll","./dropdown/attachBody","./dropdown/minimumResultsForSearch","./dropdown/selectOnClose","./dropdown/closeOnSelect","./i18n/en"],function(a,b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u,v,w,x,y,z,A,B,C){function D(){this.reset()}D.prototype.apply=function(l){if(l=a.extend(!0,{},this.defaults,l),null==l.dataAdapter){if(null!=l.ajax?l.dataAdapter=o:null!=l.data?l.dataAdapter=n:l.dataAdapter=m,l.minimumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,r)),l.maximumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,s)),l.maximumSelectionLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,t)),l.tags&&(l.dataAdapter=j.Decorate(l.dataAdapter,p)),(null!=l.tokenSeparators||null!=l.tokenizer)&&(l.dataAdapter=j.Decorate(l.dataAdapter,q)),null!=l.query){var C=b(l.amdBase+"compat/query");l.dataAdapter=j.Decorate(l.dataAdapter,C)}if(null!=l.initSelection){var D=b(l.amdBase+"compat/initSelection");l.dataAdapter=j.Decorate(l.dataAdapter,D)}}if(null==l.resultsAdapter&&(l.resultsAdapter=c,null!=l.ajax&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,x)),null!=l.placeholder&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,w)),l.selectOnClose&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,A))),null==l.dropdownAdapter){if(l.multiple)l.dropdownAdapter=u;else{var E=j.Decorate(u,v);l.dropdownAdapter=E}if(0!==l.minimumResultsForSearch&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,z)),l.closeOnSelect&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,B)),null!=l.dropdownCssClass||null!=l.dropdownCss||null!=l.adaptDropdownCssClass){var F=b(l.amdBase+"compat/dropdownCss");l.dropdownAdapter=j.Decorate(l.dropdownAdapter,F)}l.dropdownAdapter=j.Decorate(l.dropdownAdapter,y)}if(null==l.selectionAdapter){if(l.multiple?l.selectionAdapter=e:l.selectionAdapter=d,null!=l.placeholder&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,f)),l.allowClear&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,g)),l.multiple&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,h)),null!=l.containerCssClass||null!=l.containerCss||null!=l.adaptContainerCssClass){var G=b(l.amdBase+"compat/containerCss");l.selectionAdapter=j.Decorate(l.selectionAdapter,G)}l.selectionAdapter=j.Decorate(l.selectionAdapter,i)}if("string"==typeof l.language)if(l.language.indexOf("-")>0){var H=l.language.split("-"),I=H[0];l.language=[l.language,I]}else l.language=[l.language];if(a.isArray(l.language)){var J=new k;l.language.push("en");for(var K=l.language,L=0;L<K.length;L++){var M=K[L],N={};try{N=k.loadPath(M)}catch(O){try{M=this.defaults.amdLanguageBase+M,N=k.loadPath(M)}catch(P){l.debug&&window.console&&console.warn&&console.warn('Select2: The language file for "'+M+'" could not be automatically loaded. A fallback will be used instead.');continue}}J.extend(N)}l.translations=J}else{var Q=k.loadPath(this.defaults.amdLanguageBase+"en"),R=new k(l.language);R.extend(Q),l.translations=R}return l},D.prototype.reset=function(){function b(a){function b(a){return l[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function c(d,e){if(""===a.trim(d.term))return e;if(e.children&&e.children.length>0){for(var f=a.extend(!0,{},e),g=e.children.length-1;g>=0;g--){var h=e.children[g],i=c(d,h);null==i&&f.children.splice(g,1)}return f.children.length>0?f:c(d,f)}var j=b(e.text).toUpperCase(),k=b(d.term).toUpperCase();return j.indexOf(k)>-1?e:null}this.defaults={amdBase:"./",amdLanguageBase:"./i18n/",closeOnSelect:!0,debug:!1,dropdownAutoWidth:!1,escapeMarkup:j.escapeMarkup,language:C,matcher:c,minimumInputLength:0,maximumInputLength:0,maximumSelectionLength:0,minimumResultsForSearch:0,selectOnClose:!1,sorter:function(a){return a},templateResult:function(a){return a.text},templateSelection:function(a){return a.text},theme:"default",width:"resolve"}},D.prototype.set=function(b,c){var d=a.camelCase(b),e={};e[d]=c;var f=j._convertData(e);a.extend(this.defaults,f)};var E=new D;return E}),b.define("select2/options",["require","jquery","./defaults","./utils"],function(a,b,c,d){function e(b,e){if(this.options=b,null!=e&&this.fromElement(e),this.options=c.apply(this.options),e&&e.is("input")){var f=a(this.get("amdBase")+"compat/inputData");this.options.dataAdapter=d.Decorate(this.options.dataAdapter,f)}}return e.prototype.fromElement=function(a){var c=["select2"];null==this.options.multiple&&(this.options.multiple=a.prop("multiple")),null==this.options.disabled&&(this.options.disabled=a.prop("disabled")),null==this.options.language&&(a.prop("lang")?this.options.language=a.prop("lang").toLowerCase():a.closest("[lang]").prop("lang")&&(this.options.language=a.closest("[lang]").prop("lang"))),null==this.options.dir&&(a.prop("dir")?this.options.dir=a.prop("dir"):a.closest("[dir]").prop("dir")?this.options.dir=a.closest("[dir]").prop("dir"):this.options.dir="ltr"),a.prop("disabled",this.options.disabled),a.prop("multiple",this.options.multiple),a.data("select2Tags")&&(this.options.debug&&window.console&&console.warn&&console.warn('Select2: The `data-select2-tags` attribute has been changed to use the `data-data` and `data-tags="true"` attributes and will be removed in future versions of Select2.'),a.data("data",a.data("select2Tags")),a.data("tags",!0)),a.data("ajaxUrl")&&(this.options.debug&&window.console&&console.warn&&console.warn("Select2: The `data-ajax-url` attribute has been changed to `data-ajax--url` and support for the old attribute will be removed in future versions of Select2."),a.attr("ajax--url",a.data("ajaxUrl")),a.data("ajax--url",a.data("ajaxUrl")));var e={};e=b.fn.jquery&&"1."==b.fn.jquery.substr(0,2)&&a[0].dataset?b.extend(!0,{},a[0].dataset,a.data()):a.data();var f=b.extend(!0,{},e);f=d._convertData(f);for(var g in f)b.inArray(g,c)>-1||(b.isPlainObject(this.options[g])?b.extend(this.options[g],f[g]):this.options[g]=f[g]);return this},e.prototype.get=function(a){return this.options[a]},e.prototype.set=function(a,b){this.options[a]=b},e}),b.define("select2/core",["jquery","./options","./utils","./keys"],function(a,b,c,d){var e=function(a,c){null!=a.data("select2")&&a.data("select2").destroy(),this.$element=a,this.id=this._generateId(a),c=c||{},this.options=new b(c,a),e.__super__.constructor.call(this);var d=a.attr("tabindex")||0;a.data("old-tabindex",d),a.attr("tabindex","-1");var f=this.options.get("dataAdapter");this.dataAdapter=new f(a,this.options);var g=this.render();this._placeContainer(g);var h=this.options.get("selectionAdapter");this.selection=new h(a,this.options),this.$selection=this.selection.render(),this.selection.position(this.$selection,g);var i=this.options.get("dropdownAdapter");this.dropdown=new i(a,this.options),this.$dropdown=this.dropdown.render(),this.dropdown.position(this.$dropdown,g);var j=this.options.get("resultsAdapter");this.results=new j(a,this.options,this.dataAdapter),this.$results=this.results.render(),this.results.position(this.$results,this.$dropdown);var k=this;this._bindAdapters(),this._registerDomEvents(),this._registerDataEvents(),this._registerSelectionEvents(),this._registerDropdownEvents(),this._registerResultsEvents(),this._registerEvents(),this.dataAdapter.current(function(a){k.trigger("selection:update",{data:a})}),a.addClass("select2-hidden-accessible"),a.attr("aria-hidden","true"),this._syncAttributes(),a.data("select2",this)};return c.Extend(e,c.Observable),e.prototype._generateId=function(a){var b="";return b=null!=a.attr("id")?a.attr("id"):null!=a.attr("name")?a.attr("name")+"-"+c.generateChars(2):c.generateChars(4),b=b.replace(/(:|\.|\[|\]|,)/g,""),b="select2-"+b},e.prototype._placeContainer=function(a){a.insertAfter(this.$element);var b=this._resolveWidth(this.$element,this.options.get("width"));null!=b&&a.css("width",b)},e.prototype._resolveWidth=function(a,b){var c=/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;if("resolve"==b){var d=this._resolveWidth(a,"style");return null!=d?d:this._resolveWidth(a,"element")}if("element"==b){var e=a.outerWidth(!1);return 0>=e?"auto":e+"px"}if("style"==b){var f=a.attr("style");if("string"!=typeof f)return null;for(var g=f.split(";"),h=0,i=g.length;i>h;h+=1){var j=g[h].replace(/\s/g,""),k=j.match(c);if(null!==k&&k.length>=1)return k[1]}return null}return b},e.prototype._bindAdapters=function(){this.dataAdapter.bind(this,this.$container),this.selection.bind(this,this.$container),this.dropdown.bind(this,this.$container),this.results.bind(this,this.$container)},e.prototype._registerDomEvents=function(){var b=this;this.$element.on("change.select2",function(){b.dataAdapter.current(function(a){b.trigger("selection:update",{data:a})})}),this.$element.on("focus.select2",function(a){b.trigger("focus",a)}),this._syncA=c.bind(this._syncAttributes,this),this._syncS=c.bind(this._syncSubtree,this),this.$element[0].attachEvent&&this.$element[0].attachEvent("onpropertychange",this._syncA);var d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver;null!=d?(this._observer=new d(function(c){a.each(c,b._syncA),a.each(c,b._syncS)}),this._observer.observe(this.$element[0],{attributes:!0,childList:!0,subtree:!1})):this.$element[0].addEventListener&&(this.$element[0].addEventListener("DOMAttrModified",b._syncA,!1),this.$element[0].addEventListener("DOMNodeInserted",b._syncS,!1),this.$element[0].addEventListener("DOMNodeRemoved",b._syncS,!1))},e.prototype._registerDataEvents=function(){var a=this;this.dataAdapter.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerSelectionEvents=function(){var b=this,c=["toggle","focus"];this.selection.on("toggle",function(){b.toggleDropdown()}),this.selection.on("focus",function(a){b.focus(a)}),this.selection.on("*",function(d,e){-1===a.inArray(d,c)&&b.trigger(d,e)})},e.prototype._registerDropdownEvents=function(){var a=this;this.dropdown.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerResultsEvents=function(){var a=this;this.results.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerEvents=function(){var a=this;this.on("open",function(){a.$container.addClass("select2-container--open")}),this.on("close",function(){a.$container.removeClass("select2-container--open")}),this.on("enable",function(){a.$container.removeClass("select2-container--disabled")}),this.on("disable",function(){a.$container.addClass("select2-container--disabled")}),this.on("blur",function(){a.$container.removeClass("select2-container--focus")}),this.on("query",function(b){a.isOpen()||a.trigger("open",{}),this.dataAdapter.query(b,function(c){a.trigger("results:all",{data:c,query:b})})}),this.on("query:append",function(b){this.dataAdapter.query(b,function(c){a.trigger("results:append",{data:c,query:b})})}),this.on("keypress",function(b){var c=b.which;a.isOpen()?c===d.ESC||c===d.TAB||c===d.UP&&b.altKey?(a.close(),b.preventDefault()):c===d.ENTER?(a.trigger("results:select",{}),b.preventDefault()):c===d.SPACE&&b.ctrlKey?(a.trigger("results:toggle",{}),b.preventDefault()):c===d.UP?(a.trigger("results:previous",{}),b.preventDefault()):c===d.DOWN&&(a.trigger("results:next",{}),b.preventDefault()):(c===d.ENTER||c===d.SPACE||c===d.DOWN&&b.altKey)&&(a.open(),b.preventDefault())})},e.prototype._syncAttributes=function(){this.options.set("disabled",this.$element.prop("disabled")),this.options.get("disabled")?(this.isOpen()&&this.close(),this.trigger("disable",{})):this.trigger("enable",{})},e.prototype._syncSubtree=function(a,b){var c=!1,d=this;if(!a||!a.target||"OPTION"===a.target.nodeName||"OPTGROUP"===a.target.nodeName){if(b)if(b.addedNodes&&b.addedNodes.length>0)for(var e=0;e<b.addedNodes.length;e++){var f=b.addedNodes[e];f.selected&&(c=!0)}else b.removedNodes&&b.removedNodes.length>0&&(c=!0);else c=!0;c&&this.dataAdapter.current(function(a){d.trigger("selection:update",{data:a})})}},e.prototype.trigger=function(a,b){var c=e.__super__.trigger,d={open:"opening",close:"closing",select:"selecting",unselect:"unselecting"};if(void 0===b&&(b={}),a in d){var f=d[a],g={prevented:!1,name:a,args:b};if(c.call(this,f,g),g.prevented)return void(b.prevented=!0)}c.call(this,a,b)},e.prototype.toggleDropdown=function(){this.options.get("disabled")||(this.isOpen()?this.close():this.open())},e.prototype.open=function(){this.isOpen()||this.trigger("query",{})},e.prototype.close=function(){this.isOpen()&&this.trigger("close",{})},e.prototype.isOpen=function(){return this.$container.hasClass("select2-container--open")},e.prototype.hasFocus=function(){return this.$container.hasClass("select2-container--focus")},e.prototype.focus=function(a){this.hasFocus()||(this.$container.addClass("select2-container--focus"),this.trigger("focus",{}))},e.prototype.enable=function(a){this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("enable")` method has been deprecated and will be removed in later Select2 versions. Use $element.prop("disabled") instead.'),(null==a||0===a.length)&&(a=[!0]);var b=!a[0];this.$element.prop("disabled",b)},e.prototype.data=function(){this.options.get("debug")&&arguments.length>0&&window.console&&console.warn&&console.warn('Select2: Data can no longer be set using `select2("data")`. You should consider setting the value instead using `$element.val()`.');var a=[];return this.dataAdapter.current(function(b){a=b}),a},e.prototype.val=function(b){if(this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("val")` method has been deprecated and will be removed in later Select2 versions. Use $element.val() instead.'),null==b||0===b.length)return this.$element.val();var c=b[0];a.isArray(c)&&(c=a.map(c,function(a){return a.toString()})),this.$element.val(c).trigger("change")},e.prototype.destroy=function(){this.$container.remove(),this.$element[0].detachEvent&&this.$element[0].detachEvent("onpropertychange",this._syncA),null!=this._observer?(this._observer.disconnect(),this._observer=null):this.$element[0].removeEventListener&&(this.$element[0].removeEventListener("DOMAttrModified",this._syncA,!1),this.$element[0].removeEventListener("DOMNodeInserted",this._syncS,!1),this.$element[0].removeEventListener("DOMNodeRemoved",this._syncS,!1)),this._syncA=null,this._syncS=null,this.$element.off(".select2"),this.$element.attr("tabindex",this.$element.data("old-tabindex")),this.$element.removeClass("select2-hidden-accessible"),this.$element.attr("aria-hidden","false"),this.$element.removeData("select2"),this.dataAdapter.destroy(),this.selection.destroy(),this.dropdown.destroy(),this.results.destroy(),this.dataAdapter=null,this.selection=null,this.dropdown=null,this.results=null;
|
| 3 |
-
},e.prototype.render=function(){var b=a('<span class="select2 select2-container"><span class="selection"></span><span class="dropdown-wrapper" aria-hidden="true"></span></span>');return b.attr("dir",this.options.get("dir")),this.$container=b,this.$container.addClass("select2-container--"+this.options.get("theme")),b.data("element",this.$element),b},e}),b.define("jquery-mousewheel",["jquery"],function(a){return a}),b.define("jquery.select2",["jquery","jquery-mousewheel","./select2/core","./select2/defaults"],function(a,b,c,d){if(null==a.fn.select2){var e=["open","close","destroy"];a.fn.select2=function(b){if(b=b||{},"object"==typeof b)return this.each(function(){var d=a.extend(!0,{},b);new c(a(this),d)}),this;if("string"==typeof b){var d,f=Array.prototype.slice.call(arguments,1);return this.each(function(){var c=a(this).data("select2");null==c&&window.console&&console.error&&console.error("The select2('"+b+"') method was called on an element that is not using Select2."),d=c[b].apply(c,f)}),a.inArray(b,e)>-1?this:d}throw new Error("Invalid arguments for Select2: "+b)}}return null==a.fn.select2.defaults&&(a.fn.select2.defaults=d),c}),{define:b.define,require:b.require}}(),c=b.require("jquery.select2");return a.fn.select2.amd=b,c});
|
|
|
|
|
|
|
|
|
trunk/assets/js/wcv-admin-login.js
DELETED
|
@@ -1,9 +0,0 @@
|
|
| 1 |
-
jQuery( function () {
|
| 2 |
-
if (jQuery('#apply_for_vendor').is(':checked')) {
|
| 3 |
-
jQuery('.agree-to-terms-container').show();
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
jQuery('#apply_for_vendor').on('click', function () {
|
| 7 |
-
jQuery('.agree-to-terms-container').slideToggle();
|
| 8 |
-
});
|
| 9 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/js/wcv-admin-quick-edit.js
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
jQuery(function(){
|
| 2 |
-
jQuery('#the-list').on('click', '.editinline', function(){
|
| 3 |
-
|
| 4 |
-
if (jQuery('.inline-edit-author').length && jQuery('.inline-edit-author-new').length) {
|
| 5 |
-
jQuery('.inline-edit-author').hide();
|
| 6 |
-
jQuery('.inline-edit-author').attr('class', 'inline-edit-author-old');
|
| 7 |
-
jQuery('select[name=post_author]').attr('name', 'post_author-old');
|
| 8 |
-
jQuery('.inline-edit-author-new').attr('class', 'inline-edit-author');
|
| 9 |
-
jQuery('select[name=post_author-new]').attr('name', 'post_author');
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
inlineEditPost.revert();
|
| 13 |
-
|
| 14 |
-
var post_id = jQuery(this).closest('tr').attr('id');
|
| 15 |
-
|
| 16 |
-
post_id = post_id.replace("post-", "");
|
| 17 |
-
|
| 18 |
-
var wcv_inline_data = jQuery('#vendor_' + post_id),
|
| 19 |
-
wc_inline_data = jQuery('#woocommerce_inline_' + post_id );
|
| 20 |
-
|
| 21 |
-
var vendor = wcv_inline_data.find("#_vendor").text();
|
| 22 |
-
|
| 23 |
-
jQuery('select[name="post_author"] option[value="' + vendor + '"]', '.inline-edit-row').attr('selected', 'selected');
|
| 24 |
-
|
| 25 |
-
var product_type = wc_inline_data.find('.product_type').val();
|
| 26 |
-
|
| 27 |
-
if (product_type=='simple' || product_type=='external') {
|
| 28 |
-
jQuery('.vendor', '.inline-edit-row').show();
|
| 29 |
-
} else {
|
| 30 |
-
jQuery('.vendor', '.inline-edit-row').hide();
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
});
|
| 34 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/js/wcv-commissions.js
DELETED
|
@@ -1,11 +0,0 @@
|
|
| 1 |
-
// global variable
|
| 2 |
-
jQuery(function(){
|
| 3 |
-
|
| 4 |
-
jQuery('.select2').select2(
|
| 5 |
-
{
|
| 6 |
-
placeholder: wcv_commissions_select.placeholder,
|
| 7 |
-
allowClear: wcv_commissions_select.allowclear
|
| 8 |
-
}
|
| 9 |
-
);
|
| 10 |
-
|
| 11 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/assets/screenshot-1.png
DELETED
|
Binary file
|
trunk/assets/screenshot-2.png
DELETED
|
Binary file
|
trunk/assets/screenshot-3.png
DELETED
|
Binary file
|
trunk/assets/screenshot-4.png
DELETED
|
Binary file
|
trunk/assets/screenshot-5.png
DELETED
|
Binary file
|
trunk/assets/screenshot-6.png
DELETED
|
Binary file
|
trunk/assets/screenshot-7.png
DELETED
|
Binary file
|
trunk/changelog.txt
DELETED
|
@@ -1,700 +0,0 @@
|
|
| 1 |
-
Changelog for WC Vendors
|
| 2 |
-
|
| 3 |
-
Version 2.0.3
|
| 4 |
-
|
| 5 |
-
* Added: Export Commission Sum Totals
|
| 6 |
-
* Added: New setting to rename vendors store wide
|
| 7 |
-
* Fixed: Update Dialog is stuck #409
|
| 8 |
-
* Updated: Langage file
|
| 9 |
-
|
| 10 |
-
Version 2.0.2
|
| 11 |
-
|
| 12 |
-
* Fixed: Corrected settings conditional checks across classes
|
| 13 |
-
* Fixed: Vendor Capabilities
|
| 14 |
-
* Fixed: Reset vendor roles
|
| 15 |
-
* Fixed: Incorrect get_option calls
|
| 16 |
-
* Fixed: Permission check for product submit and order view
|
| 17 |
-
* Updated: Templates to make tracking changes possible
|
| 18 |
-
* Updated: Disable add new product completely if disabled
|
| 19 |
-
* Updated: Make denied product message translateable.
|
| 20 |
-
|
| 21 |
-
Version 2.0.1
|
| 22 |
-
|
| 23 |
-
* Fixed: Update notice won't complete
|
| 24 |
-
* Fixed: Legacy settings options loading
|
| 25 |
-
* Fixed: Errors on activation when unsupported plugin is detected
|
| 26 |
-
* Fixed: Display sold_by option not working
|
| 27 |
-
|
| 28 |
-
Version 2.0.0
|
| 29 |
-
|
| 30 |
-
* Added: New WC Vendors Admin menu
|
| 31 |
-
* Added: Bank details fields for vendors
|
| 32 |
-
* Added: New all new email system and templates
|
| 33 |
-
* Added: New contextual help menus on settings pages
|
| 34 |
-
* Added: New settings system and admin notice system
|
| 35 |
-
* Added: Setup Wizard
|
| 36 |
-
* Added: Support for PHP 7.1+
|
| 37 |
-
* Updated: styles and script build script
|
| 38 |
-
* Updated: language file cleanup
|
| 39 |
-
* Updated: Brazilian Portuguese translation thanks CasperBraske
|
| 40 |
-
* Fixed: Permalinks not flushing on settings save
|
| 41 |
-
* Fixed: Terms & Conditions Checkbox for Vendor Registration does not show #392
|
| 42 |
-
* Fixed: Depreciated calls on orders screen
|
| 43 |
-
* Fixed: Vendor role capabilities updated when new settings updated.
|
| 44 |
-
* Fixed: Vendors can delete media they uploaded
|
| 45 |
-
* Fixed: Added check for woocommerce shipping tax class setting
|
| 46 |
-
* Fixed: Tax classes not being used in shipping tax calculations
|
| 47 |
-
* Fixed: Make compatible with translate.wordpress.org #396
|
| 48 |
-
* Fixed: undefined index notice for reports that have been removed
|
| 49 |
-
* Fixed: Removed focus from select on vendor drop down on product edit screen
|
| 50 |
-
|
| 51 |
-
Templates Added:
|
| 52 |
-
templates/emails/plain/admin-notify-product.php
|
| 53 |
-
templates/emails/plain/admin-notify-shipped.php
|
| 54 |
-
templates/emails/plain/admin-notify-application.php
|
| 55 |
-
templates/emails/plain/customer-notify-shipped.php
|
| 56 |
-
templates/emails/plain/vendor-notify-application.php
|
| 57 |
-
templates/emails/plain/vendor-notify-approved.php
|
| 58 |
-
templates/emails/plain/vendor-notify-denied.php
|
| 59 |
-
templates/emails/plain/vendor-notify-order.php
|
| 60 |
-
templates/emails/plain/vendor-order-details.php
|
| 61 |
-
templates/emails/plain/vendor-order-items.php
|
| 62 |
-
templates/emails/admin-notify-product.php
|
| 63 |
-
templates/emails/admin-notify-shipped.php
|
| 64 |
-
templates/emails/admin-notify-application.php
|
| 65 |
-
templates/emails/customer-notify-shipped.php
|
| 66 |
-
templates/emails/vendor-notify-application.php
|
| 67 |
-
templates/emails/vendor-notify-approved.php
|
| 68 |
-
templates/emails/vendor-notify-denied.php
|
| 69 |
-
templates/emails/vendor-notify-order.php
|
| 70 |
-
templates/emails/vendor-order-details.php
|
| 71 |
-
templates/emails/vendor-order-items.php
|
| 72 |
-
|
| 73 |
-
Templates Updated:
|
| 74 |
-
templates/dashboard/settings/settings.php
|
| 75 |
-
templates/order/table-body.php
|
| 76 |
-
|
| 77 |
-
Version 1.9.14
|
| 78 |
-
|
| 79 |
-
* Added: Export commissions via CSV
|
| 80 |
-
* Added: Commission Table Links #166
|
| 81 |
-
* Added: Apply to become a vendor on wp-login registration page #245
|
| 82 |
-
* Added: Apply filter to get_vendor_dues_from_order()
|
| 83 |
-
* Fixed: wp-admin Commissions Page sorted by status & vendor #374
|
| 84 |
-
* Fixed: Commission filters loading too early so they cannot be applied.
|
| 85 |
-
* Fixed: WooCommerce Reports are showing 2X accurate sales #388
|
| 86 |
-
* Fixed: Shortcodes do not work for products assigned to vendor by admin #385
|
| 87 |
-
* Fixed: Text domain in read me for glotpress translations
|
| 88 |
-
* Fixed: "sold by" is showing in several areas despite deselected admin setting #386
|
| 89 |
-
|
| 90 |
-
Version 1.9.13
|
| 91 |
-
|
| 92 |
-
* Added: Notice for depreciated gateway
|
| 93 |
-
* Added: A filter for role change: Denied Vendor #351
|
| 94 |
-
* Added: WooCommerce tested header for new WooCommerce Status page
|
| 95 |
-
* Added: Filter for vendor signup form so it can be overriden
|
| 96 |
-
* Added: "Approve" Vendor action on Pending Vendors Page #372
|
| 97 |
-
* Updated: Brazillian Port wcvendors-pt_BR.pot
|
| 98 |
-
* Fixed: Moved sprintf must be outside #381 thanks CasperBraske
|
| 99 |
-
* Fixed: Re-Send email options in admin/orders are not available after WooCommerce update #383
|
| 100 |
-
* Fixed: depreciated screen_icon method call
|
| 101 |
-
* Fixed: Use wc_get_order instead of new WC_Order #382
|
| 102 |
-
* Fixed: Post called incorrectly #378
|
| 103 |
-
* Fixed: Get correct product name in commission table if variation deleted
|
| 104 |
-
* Fixed: Commissions reversed when order deleted
|
| 105 |
-
* Fixed: mistake in vendor_shop_query
|
| 106 |
-
* Fixed: Return 404 if vendor doesn't exist
|
| 107 |
-
* Fixed: The shop name background doesn’t scale with shop image #366
|
| 108 |
-
* Fixed: Depreciated functions #368 thanks @stodorovic
|
| 109 |
-
* Fixed: Changed how customer address is displayed based on Woo Options. Thanks @debain
|
| 110 |
-
|
| 111 |
-
Version 1.9.12
|
| 112 |
-
|
| 113 |
-
* Added: For hook for vendor order content
|
| 114 |
-
* Updated: Portuguese translations thanks Elsa
|
| 115 |
-
* Updated: Show SKU in emails as per pre WC3.0 updates
|
| 116 |
-
* Fixed: Static reference calls in commision class
|
| 117 |
-
* Fixed: Shipping tax bug in vendor calculations
|
| 118 |
-
* Fixed: Variations showing $0 price in emails thanks damanmehta
|
| 119 |
-
* Fixed: Prevent PHP notice for getting non-existing vendor name from JeroenSormani/master
|
| 120 |
-
|
| 121 |
-
Version 1.9.11
|
| 122 |
-
|
| 123 |
-
* Fixed: Correct product id being parsed to shipping function
|
| 124 |
-
* Fixed: Payment method notice due to direct access to object property
|
| 125 |
-
* Fixed: Sold by incorrectly showing in cart for variations
|
| 126 |
-
|
| 127 |
-
Version 1.9.10
|
| 128 |
-
|
| 129 |
-
* Fixed: Terms & Conditions Checkbox is not functioning normally #348
|
| 130 |
-
* Fixed: Apply to Become a Vendor Checkbox is Missing with WC 3.0 + WC Vendors 1.9.9 #349
|
| 131 |
-
* Fixed: New product title formatting is showing product #350
|
| 132 |
-
* Fixed: Incorrect use of wpdb->prepare
|
| 133 |
-
* Fixed: Mark shipped filter not providing parameters correctly
|
| 134 |
-
* Fixed: Incorrect reference to billing email in notification email
|
| 135 |
-
* Updated: Removed Sales reports from backend
|
| 136 |
-
|
| 137 |
-
Version 1.9.9
|
| 138 |
-
|
| 139 |
-
* Added: Filters to vendor admin dashboard class for custom columns #339
|
| 140 |
-
* Added: Vendor shop name to the <title> tag on products archive page
|
| 141 |
-
* Updated Woocommerce 2.7 compatibility
|
| 142 |
-
* Updated: i18n text domain loading for proper translations #341
|
| 143 |
-
* Fixed: Class logger when called via includes files
|
| 144 |
-
* Fixed: Bug in how admin notices are displayed when saving shop settings
|
| 145 |
-
* Fixed: 2.7 compatibility bugs
|
| 146 |
-
* Fixed: Commissions Subtotal showing Full Product Price in vendor email #330
|
| 147 |
-
* Fixed: Capabilities Fix for Resetting Roles #329
|
| 148 |
-
* Fixed: HTML title attribute doesn't change for store pages #328
|
| 149 |
-
* Fixed: Login form not displayed if get variable set
|
| 150 |
-
* Fixed: Depreciated action in product edit screen
|
| 151 |
-
|
| 152 |
-
Templates Updated:
|
| 153 |
-
templates/emails/vendor-new-order.php
|
| 154 |
-
templates/emails/notify-vendor-shipped.php
|
| 155 |
-
templates/order/orders.php
|
| 156 |
-
|
| 157 |
-
Version 1.9.8
|
| 158 |
-
|
| 159 |
-
* Fixed: Paypal adaptive payments url changes
|
| 160 |
-
* Added: Store Vendor ID in vendor child order #326
|
| 161 |
-
* Added: 100% Japanese translations thanks to Shohei Tanaka
|
| 162 |
-
|
| 163 |
-
Version 1.9.7
|
| 164 |
-
|
| 165 |
-
* Fixed: Capabilities Fix for Resetting Roles #329
|
| 166 |
-
|
| 167 |
-
Version 1.9.6
|
| 168 |
-
|
| 169 |
-
* Added: Commission Query Functions #321
|
| 170 |
-
* Added: Template for sold by in shop loop #324
|
| 171 |
-
* Merged: Extended commissions management #319 from MounirHamani
|
| 172 |
-
* Updated: Brazilian Portuguese translation
|
| 173 |
-
* Template Added:
|
| 174 |
-
templates/front/vendor-sold-by.php
|
| 175 |
-
|
| 176 |
-
Version 1.9.5
|
| 177 |
-
|
| 178 |
-
* Added: Automated language file builds
|
| 179 |
-
* Added: Vendors can now delete media in the media uploader
|
| 180 |
-
* Updated: Commissions table in backend now shows cost breakdowns
|
| 181 |
-
* Fixed: Removed legacy code for unsupported shipping methods
|
| 182 |
-
* Fixed: Rounding issue with 100% commission and coupons in pro
|
| 183 |
-
|
| 184 |
-
Version 1.9.4
|
| 185 |
-
|
| 186 |
-
* Added: Filter to add delayed payment possibility #309
|
| 187 |
-
* Added: WPML support configuration file
|
| 188 |
-
* Updated: Brazilian translation files thanks Luis!
|
| 189 |
-
* Fixed: Using "date_i18n" instead of just "date" #316 from CasperBraske
|
| 190 |
-
* Fixed: Geczy text domain in the settings file #314
|
| 191 |
-
* Fixed: Commissions lock on one vendor after some actions are made #311
|
| 192 |
-
* Fixed: Vendor dashboard Orders Export link is dead #306
|
| 193 |
-
* Fixed: Vendor sorting in commissions - no option to NOT choose a vendor #305
|
| 194 |
-
* Fixed: vendor order admin product metadata loading #298 from mikko-niemikorpi
|
| 195 |
-
* Fixed: Commission status translatable in reports thanks CasperBraske
|
| 196 |
-
* Fixed: Translatable strings thanks CasperBraske
|
| 197 |
-
* Fixed: Issues with translation strings
|
| 198 |
-
* Fixed: Incorrect variable reference
|
| 199 |
-
* Fixed: bp_setup_current_user was called incorrectly
|
| 200 |
-
* Fixed: Display of variations on main dashboard
|
| 201 |
-
* Fixed: Trying to get property of non-object
|
| 202 |
-
* Fixed: Variation data styles in order display in wp-admin
|
| 203 |
-
* Fixed: Save user meta fields when pending vendor
|
| 204 |
-
* Fixed: Incorrect url string format in french translation
|
| 205 |
-
* Templates Updated:
|
| 206 |
-
templates/dashboard/orders.php
|
| 207 |
-
|
| 208 |
-
Version 1.9.3
|
| 209 |
-
|
| 210 |
-
* Fixed: Only load asset on orders page in admin
|
| 211 |
-
* Fixed: Not showing orders on vendor dashboard for new installations
|
| 212 |
-
* Updated: Persian translations thanks to Alireza
|
| 213 |
-
|
| 214 |
-
Version 1.9.2
|
| 215 |
-
|
| 216 |
-
* Added: Reverse commission when order emptied from trash #277
|
| 217 |
-
* Added: Daily Payout option for PayPal Cron #297
|
| 218 |
-
* Added: Vendor select2 on the commissions page #284
|
| 219 |
-
* Added: Button to reset vendor roles & WC Vendors settings to WooCoomerce system status tools page #230
|
| 220 |
-
* Added: Dutch Translation, thanks @jjclinton
|
| 221 |
-
* Added: Date filter for order queries
|
| 222 |
-
* Added: Turkish translations thanks Hakan
|
| 223 |
-
* Added: $wc_vendors object variable
|
| 224 |
-
* Added: Action to fire after dashboard links (wcvendors_after_links)
|
| 225 |
-
* Added: Body css classes to set pages
|
| 226 |
-
* Updated: Support for woo commerce minimum and readme
|
| 227 |
-
* Fixed: Mark commission reversed bulk action on commissions table
|
| 228 |
-
* Fixed: No longer have to save permalink settings when updating WC Vendors options
|
| 229 |
-
* Fixed: Orders page not set on fresh install
|
| 230 |
-
* Fixed: Property of non object #300
|
| 231 |
-
* Fixed: Translation for Mark Shipped #296
|
| 232 |
-
* Fixed: Too many redirect loops if pages not set #290
|
| 233 |
-
* Fixed: Non-Object Notice in install #289
|
| 234 |
-
* Fixed: Rounding error with 100% commission thanks Brett!
|
| 235 |
-
* Fixed: text domain for email templates
|
| 236 |
-
* Fixed: Don't start session if user isn't logged
|
| 237 |
-
* Fixed: Session error on log out if session doesn't exist
|
| 238 |
-
* Fixed: Settings image selector bug
|
| 239 |
-
* Merged pull request #302 from NicolasBernier - Completed French Translations, Thanks!
|
| 240 |
-
* Merged: pull request #293 from stodorovic/fix_init_sessions
|
| 241 |
-
|
| 242 |
-
Version 1.9.1
|
| 243 |
-
|
| 244 |
-
* Added: GitHub Plugin URI for afragen/github-updater #282 thanks Agoruh
|
| 245 |
-
* Added: Edit and View page settings options
|
| 246 |
-
* Fixed: Missing Argument WCV_Admin_Users::filter_product_types() #288
|
| 247 |
-
* Fixed: Critical: PHP Fatal error: Call to a member function get_children() #287
|
| 248 |
-
* Fixed: Date range session data is not working #285
|
| 249 |
-
* Fixed HTML escaped characters in PaypalAP Cancel and Return URLs: #286 thanks Nicolas
|
| 250 |
-
* Fixed: Post type check to trigger_new_product() function #276
|
| 251 |
-
* Fixed: Updated to notices instead of wordpress errors
|
| 252 |
-
* Fixed: Product attribute fetch and returning HTML #283 thanks Mikko
|
| 253 |
-
* Fixed: Vendor Mark Shipped Security Fix #280 thanks Agoruh
|
| 254 |
-
* Fixed: Missing argument in Vendors Class
|
| 255 |
-
* Fixed: Rounded product commission to avoid error 589023 when submitting to PayPal #275 thanks Nicolas
|
| 256 |
-
|
| 257 |
-
Version 1.9.0
|
| 258 |
-
|
| 259 |
-
* Added: Support for WooCommerce 2.6
|
| 260 |
-
* Added: Vendor roles filter wcvendors_vendor_roles
|
| 261 |
-
* Added: Product and Vendor id's to sold_by filters
|
| 262 |
-
* Added: Vendor Signup Filters #269
|
| 263 |
-
* Added: Notify Vendors Email - Add Product SKU, if set #263
|
| 264 |
-
* Added: New Option: Notify Vendors show Purchase Price or Commissions #253
|
| 265 |
-
* Added: Option to disable sold by #236
|
| 266 |
-
* Added: Initial sub order management code #196 thanks Spreeuw
|
| 267 |
-
* Fixed: Sold by meta removal
|
| 268 |
-
* Fixed: Sequential Orders Support Commissions table #270
|
| 269 |
-
* Fixed: Notify Vendors Email Customizer Not Working #240
|
| 270 |
-
* Fixed: Commissions Total Report a-z sorting #239
|
| 271 |
-
* Fixed: need to agree to terms for this to process correctly
|
| 272 |
-
* Fixed: save pending vendor for login screen
|
| 273 |
-
* Fixed: Notify Vendors Email in WC 2.5+ #265
|
| 274 |
-
* Fixed: Order table layout
|
| 275 |
-
* Fixed: Orders screen for vendors in admin #231
|
| 276 |
-
* Fixed: product management in WC 2.6
|
| 277 |
-
* Fixed: Duplicate application emails firing in free and pro
|
| 278 |
-
* Fixed: Commission display issue in notify vendor email
|
| 279 |
-
* Fixed: New ítem meta compatability with WC 2.5 and above
|
| 280 |
-
|
| 281 |
-
Version 1.8.9
|
| 282 |
-
|
| 283 |
-
* Fixed: Commission Totals Report Inaccurate #267
|
| 284 |
-
* Added: Swedish Translation Thanks Arvid!
|
| 285 |
-
|
| 286 |
-
Version 1.8.8
|
| 287 |
-
|
| 288 |
-
* Fixed: Undefined variable error in commission class
|
| 289 |
-
* Fixed: Pagination bug in wcv_vendorslist shortcode
|
| 290 |
-
|
| 291 |
-
Version 1.8.7
|
| 292 |
-
|
| 293 |
-
* Added: New qty argument to commission calculations
|
| 294 |
-
* Added: Image uploader settings type
|
| 295 |
-
* Added: New commission function for payment gateways
|
| 296 |
-
* Fixed: Prefixed all btn css classes to stop theme collision
|
| 297 |
-
* Fixed: Sold By:Name spaces issue #256
|
| 298 |
-
* Fixed: Show extended fields for vendor and pending vendor roles
|
| 299 |
-
* Fixed: Check if product is taxable
|
| 300 |
-
* Fixed: Depreciated function calls in email templates
|
| 301 |
-
* Fixed: Commission giving tax on none taxable items #251
|
| 302 |
-
* Fixed: Sold by label issues with WC 2.5 #250
|
| 303 |
-
|
| 304 |
-
Version 1.8.6
|
| 305 |
-
|
| 306 |
-
* Fixed: Critical issue with paypal loading classes incorrectly
|
| 307 |
-
|
| 308 |
-
Version 1.8.5
|
| 309 |
-
|
| 310 |
-
* Fixed: Issue with PayPal on some sites - Rolled back issue #247
|
| 311 |
-
* Fixed: Reverted ticket #216 for email conflicts
|
| 312 |
-
* Added: New KnowledgeBase URL
|
| 313 |
-
|
| 314 |
-
Version 1.8.4
|
| 315 |
-
|
| 316 |
-
* Added: Removed fields from users that aren't vendors
|
| 317 |
-
* Added: actions to hook into approve/deny vendor
|
| 318 |
-
* Added: Ability to integrate with any order status for emails #216
|
| 319 |
-
* Added: Terms & Conditions Opens in New Tab #246
|
| 320 |
-
* Updated: Added trigger for on-hold to processing/completed for Notify Vendor Email #238
|
| 321 |
-
* Updated: Settings page helper text and clarifications
|
| 322 |
-
* Fixed: Sold by formatting issue #248
|
| 323 |
-
* Fixed: wp_redirect caches with W3 Total Cache #237
|
| 324 |
-
* Fixed: Bug in single page settings generator
|
| 325 |
-
* Fixed: Category title missing bug #213
|
| 326 |
-
* Fixed: Undefined index for non vendor users
|
| 327 |
-
* Merge: pull request #247 from archonic/hotfix/oauth-class-exists
|
| 328 |
-
|
| 329 |
-
|
| 330 |
-
Version 1.8.3
|
| 331 |
-
|
| 332 |
-
* Fixed: Fatal Error on activation Merge pull request #235 from oleggen/patch-1
|
| 333 |
-
* Added: Seller info label option
|
| 334 |
-
|
| 335 |
-
Version 1.8.2
|
| 336 |
-
|
| 337 |
-
* Added: Sold By label option
|
| 338 |
-
* Added: New Vendor Commission Totals Report #234
|
| 339 |
-
* Fixed: Added 'Shipped' if marked as shipped #233 can be found on WooCommerce > Reports > WC Vendors > Commission Totals
|
| 340 |
-
* Fixed: Renamed internal function to stop theme and plugin clash
|
| 341 |
-
|
| 342 |
-
Version 1.8.1
|
| 343 |
-
|
| 344 |
-
* Added: New options updated action for settings
|
| 345 |
-
* Added: New plugin activation hook for testing woocommerce active
|
| 346 |
-
* Added: vendor id to get shipping due filter
|
| 347 |
-
* Added: Warning on settings page if user registration in WooCommerce is not enabled
|
| 348 |
-
* Added: Russian Translations thanks Natalia
|
| 349 |
-
|
| 350 |
-
Version 1.8.0
|
| 351 |
-
|
| 352 |
-
* Fixed: Mark $0.00 commissions as paid instead of due #205
|
| 353 |
-
* Fixed: Email trigger should be filter not action - Thanks ontiuk #215
|
| 354 |
-
* Updated: Read me with link to Pro and Updated Language List
|
| 355 |
-
* Added: Portuguese Language (Thanks Renato) #212
|
| 356 |
-
* Remove Forced HTTP Protocol on Sent IPN URL #207 from GoTeamScotch
|
| 357 |
-
|
| 358 |
-
Version 1.7.9
|
| 359 |
-
|
| 360 |
-
* Fixed: woocommerce filter and action issues on product edit page
|
| 361 |
-
|
| 362 |
-
Version 1.7.8
|
| 363 |
-
|
| 364 |
-
* Fixed: Vendors can not register #193
|
| 365 |
-
* Fixed: Variation product image upload #194
|
| 366 |
-
* Added: Order actions thanks GoTeamScotch
|
| 367 |
-
* Updated: New item meta in WC 2.4+
|
| 368 |
-
* Updated: WooCommerce Shipment Tracking v1.2.7+
|
| 369 |
-
* Fixed: Paypal Logging thanks to GoTeamScotch
|
| 370 |
-
* Updated: Templates now fully translatable #195
|
| 371 |
-
* Fixed: Translations not loading bug
|
| 372 |
-
* Fixed: vendors not defined error
|
| 373 |
-
* Updated: Base translation files
|
| 374 |
-
|
| 375 |
-
Version 1.7.7
|
| 376 |
-
|
| 377 |
-
* Fixed: Terms and conditions processing #182
|
| 378 |
-
* Added: filter to order note for overrides
|
| 379 |
-
* Added: Order note for marked shipped #187
|
| 380 |
-
* Fixed: order retrieval for wp-admin orders table for vendors
|
| 381 |
-
* Fixed: pagination bug #179
|
| 382 |
-
* Updated: styles for orders table in admin for vendors
|
| 383 |
-
* Fixed: Vendor displaying issue #180
|
| 384 |
-
* Updated: Admin Commission Report Column Names #183
|
| 385 |
-
* Updated: Admin Commissions Page now shows times a product has sold in total #184
|
| 386 |
-
|
| 387 |
-
Version 1.7.6
|
| 388 |
-
|
| 389 |
-
* Added: Stock notifications go to vendors #114
|
| 390 |
-
* Fixed: Instant Pay bug #174
|
| 391 |
-
* Fixed: wcv_vendorslist paging #178
|
| 392 |
-
* Added: Vendor display name now translatable
|
| 393 |
-
* Depreciated: Dashboard vendor reports
|
| 394 |
-
* Added: Chinese Language files thanks to SundayLau
|
| 395 |
-
* Fixed: Added support for WPML #177
|
| 396 |
-
* Update: default pot language file
|
| 397 |
-
|
| 398 |
-
Version 1.7.5
|
| 399 |
-
|
| 400 |
-
* Merged: Check product post type in vendor dashboard thanks simplementNat
|
| 401 |
-
* Updated: Base language file
|
| 402 |
-
* Updated: Compatibility for Shipment Tracking for v1.3.5 #167
|
| 403 |
-
* Fixed: Shipping taxes
|
| 404 |
-
* Fixed: Pending Products for Vendors #168
|
| 405 |
-
* Added: Vendor shipping override #171
|
| 406 |
-
* Added: Give Tax Per Vendor Override #56
|
| 407 |
-
* Added: Hide duplicate product option
|
| 408 |
-
* Fixed: Email firing for pending status only
|
| 409 |
-
* Updated: Unified vendor-main/mini-header variables
|
| 410 |
-
* Fixed: Email template paths to woocommerce paths
|
| 411 |
-
* Merged: Updated Brazilian Portuguese thanks carlosramosweb
|
| 412 |
-
* Added: Seller Info to header #161
|
| 413 |
-
* Updated: Spanish Translations #160
|
| 414 |
-
* Updated: Brazilian Portuguese Language #156
|
| 415 |
-
|
| 416 |
-
Version 1.7.4
|
| 417 |
-
|
| 418 |
-
* Added: Mark shipped filter #157
|
| 419 |
-
* Fixed: Added Tax total to vendor email #146
|
| 420 |
-
* Updated: Location of email templates in theme to wc-vendors/emails
|
| 421 |
-
* Added: User email to Vendor Display Options #158
|
| 422 |
-
* Fixed: Mass Pay Now Bug #159
|
| 423 |
-
* Fixed: Mark as shipped for downloadable product #40
|
| 424 |
-
* Added: Brazilian Portuguese language #156
|
| 425 |
-
* Updated: Default Language file
|
| 426 |
-
* Fixed: Translation issue for query test #155
|
| 427 |
-
* Updated: Template base for emails
|
| 428 |
-
* Fixed: Vendor email and renamed template #135
|
| 429 |
-
* Fixed: Better CSV Output #63
|
| 430 |
-
* Fixed: Made PayPal optional on Vendor Dashboard Shop Settings #144
|
| 431 |
-
* Update: fixed return query var
|
| 432 |
-
* Fixed: Test for product post types #149
|
| 433 |
-
* Fixed: 2.1 Depreciated return call
|
| 434 |
-
* Fixed: PHP Strict static call in commissions class
|
| 435 |
-
* Merged: Is Vendor checks all user roles #147 thanks crabilld
|
| 436 |
-
|
| 437 |
-
Version 1.7.3
|
| 438 |
-
|
| 439 |
-
* Fixed: Paypal AP IPN url issue
|
| 440 |
-
|
| 441 |
-
Version 1.7.2
|
| 442 |
-
|
| 443 |
-
* Added: Filters for seller tab #141
|
| 444 |
-
* Fixed: URI Too Large Error #143
|
| 445 |
-
* Fixed: Give tax to vendors #142
|
| 446 |
-
* Updated: Spanish Translations #140
|
| 447 |
-
* Added: Persian Translation #139
|
| 448 |
-
|
| 449 |
-
Version 1.7.1
|
| 450 |
-
|
| 451 |
-
* Fixed: Invalid argument on new orders dashboard page #138
|
| 452 |
-
* Updated: Base translation file
|
| 453 |
-
|
| 454 |
-
Version 1.7.0
|
| 455 |
-
|
| 456 |
-
* Fixed: add_query_arg/remove_query_arg XSS issue
|
| 457 |
-
* Fixed: Hide Notice not working for admin settings
|
| 458 |
-
* Added: Shop Settings page in WordPress dashboard
|
| 459 |
-
* Added: Orders page in WordPress dashboard
|
| 460 |
-
|
| 461 |
-
Version 1.6.2
|
| 462 |
-
|
| 463 |
-
* Added: Option to change sold by vendor name #106
|
| 464 |
-
* Fixed: Error notice in vendor dashboard #133
|
| 465 |
-
* Fixed: Pagination in commissions admin screen #68
|
| 466 |
-
* Added: Support for WooCommerce Order Status Manager
|
| 467 |
-
* Fixed: Updated media filter method for vendors #132
|
| 468 |
-
* Fixed: Commission not logged for variations #131
|
| 469 |
-
|
| 470 |
-
Version 1.6.1
|
| 471 |
-
|
| 472 |
-
* Fixed: Support for Per Product Shipping 2.2.x #126
|
| 473 |
-
* Added: Filter to change commission label in vendor email #127
|
| 474 |
-
|
| 475 |
-
Version 1.6.0
|
| 476 |
-
|
| 477 |
-
* Added: Admin notices for vendor page slug & permalinks
|
| 478 |
-
* Fixed: Plugin row meta links
|
| 479 |
-
* Added: Upgrade notice
|
| 480 |
-
* Fixed: Rounding issue #120
|
| 481 |
-
* Fixed: Paypal https host check depreciated call
|
| 482 |
-
* Added: show_products attribute #107
|
| 483 |
-
* Updated: Text in denied template to make more sense when registration disabled #123
|
| 484 |
-
* Updated: wcv_vendorslist shortcode now shows 3 column output #123
|
| 485 |
-
* Fixed: Index issue #122
|
| 486 |
-
* Updated: New plugin and template directory structure - IMPORTANT READ KB
|
| 487 |
-
|
| 488 |
-
Version 1.5.0
|
| 489 |
-
|
| 490 |
-
* Added: Spanish translation thanks Mauricio
|
| 491 |
-
* Added: French translation thanks JP
|
| 492 |
-
* Added: CSS class for sold by (classes same as filters in those files)
|
| 493 |
-
* Fixed: Paypal return URL
|
| 494 |
-
* Added: Vendor Dashboard UI Improvements
|
| 495 |
-
* Added: WC Vendors Test Gateway
|
| 496 |
-
* Updated: ToolTips to be more helpful
|
| 497 |
-
* Added: Admin option for not giving shipping cost to vendor
|
| 498 |
-
* Fixed: Disable notify admin
|
| 499 |
-
* Fixed: Mark as shipped/unshipped
|
| 500 |
-
* Fixed: Duplicate column name
|
| 501 |
-
|
| 502 |
-
Version 1.4.5
|
| 503 |
-
|
| 504 |
-
* Updated: select2 3.5.2 for settings api
|
| 505 |
-
* Fixed: Replaced Chosen with Select2 #102
|
| 506 |
-
* Fixed: Table Rate Shipping issue #103
|
| 507 |
-
* Fixed: Featured column issue #100
|
| 508 |
-
* Updated: Filter call for report
|
| 509 |
-
* Fixed: Call to depreciated function #98
|
| 510 |
-
|
| 511 |
-
Version 1.4.4
|
| 512 |
-
|
| 513 |
-
* Fixed: Hardcoded table in wcv_vendorslist shortcode
|
| 514 |
-
|
| 515 |
-
Version 1.4.3
|
| 516 |
-
|
| 517 |
-
* Fixed: Placeholder on Product Reports
|
| 518 |
-
|
| 519 |
-
Version 1.4.2
|
| 520 |
-
|
| 521 |
-
* Added: Commission status sort to commissions page
|
| 522 |
-
* Fixed: Recent Commissions limit of 20 now works on selected date range
|
| 523 |
-
* Fixed: Report By product in WC2.3
|
| 524 |
-
* Fixed: Vendor Report date selector in wp-admin
|
| 525 |
-
* Fixed: Tracking plugin Order Meta
|
| 526 |
-
* Added: New filter wcvendors_dashboard_google_maps_link
|
| 527 |
-
* Fixed: Formatting error for Google maps link
|
| 528 |
-
* Added: New actions in vendor-dashboard wcvendors_vendor_unship, wcvendors_vendor_ship (thanks Nathan H)
|
| 529 |
-
|
| 530 |
-
Version 1.4.1
|
| 531 |
-
|
| 532 |
-
* Fixed: Language file loading issue
|
| 533 |
-
* Fixed: Static function calls in commision class for php 5.6
|
| 534 |
-
* Fixed: Static call in Vendor Cart
|
| 535 |
-
* Added: New language files for de_AT, de_DE (thanks to theHubi), it_IT (thanks to Nicole)
|
| 536 |
-
* Added: New actions for main and mini headers (before and after see KB)
|
| 537 |
-
|
| 538 |
-
Version 1.4.0
|
| 539 |
-
|
| 540 |
-
* Added: product category + vendor shortcode [wcv_product_category category="category" vendor="vendorname"]
|
| 541 |
-
* Added: Tracking number support via WooThemes Shipment Tracking plugin
|
| 542 |
-
* Added: Google Maps for delivery address on front end
|
| 543 |
-
* Fixed: woocommerce_wp_text_input via merged pull request from svenl77
|
| 544 |
-
* Added: Vendor List shortcode [wcv_vendorlist] + template for styling see KB for full details
|
| 545 |
-
* Fixed: Report not showing Commission by Product
|
| 546 |
-
* Fixed: Paths in language files
|
| 547 |
-
|
| 548 |
-
Version 1.3.1
|
| 549 |
-
|
| 550 |
-
* Fixed: Sold by in invoices
|
| 551 |
-
|
| 552 |
-
Version 1.3.0
|
| 553 |
-
|
| 554 |
-
* Added: show vendor on all emails #29
|
| 555 |
-
* Fixed: Critical issue #58
|
| 556 |
-
* Added: Vendor header templates #65
|
| 557 |
-
* Added: Vendor to QuickEdit #12
|
| 558 |
-
* Fixed: Updating notices to use 2.1 Notice API #62
|
| 559 |
-
* Added: wcvendors_registration_checkbox filter to denied.php template view
|
| 560 |
-
* Added: wcvendors_vendor_registration_checkbox filter to filter "Apply to become a vendor?" at registration.
|
| 561 |
-
* Added: wcvendors_vendor_registration_checkbox to filter "Apply to become a vendor?"
|
| 562 |
-
|
| 563 |
-
Version 1.2.0
|
| 564 |
-
|
| 565 |
-
* Added new filters to change sold by text see Knowledge base for details
|
| 566 |
-
* Added sold by to product loop for archive-product.php, see knowledge base on how to disable or change this
|
| 567 |
-
* Added new option to hide "Featured product" from vendors
|
| 568 |
-
* Added Sold By Filter as per #3
|
| 569 |
-
* Removing unused tag filter
|
| 570 |
-
* Updated default.pot
|
| 571 |
-
* Fixing attribute bug #48 - Thanks to gcskye
|
| 572 |
-
* Removing legacy translations
|
| 573 |
-
* Fixed Orders view errors
|
| 574 |
-
* Fixing call to incorrect method #45
|
| 575 |
-
|
| 576 |
-
Version 1.1.5
|
| 577 |
-
|
| 578 |
-
* Fixed orders view to remove incorrect call to woocommerce print messages
|
| 579 |
-
|
| 580 |
-
Version 1.1.4
|
| 581 |
-
|
| 582 |
-
* Fixed called to incorrect notice method
|
| 583 |
-
* Moved methods into parent class See #41
|
| 584 |
-
* PHP Strict updates
|
| 585 |
-
* Deprecated Class due to PHP strict issues
|
| 586 |
-
* fixing static call
|
| 587 |
-
* Tidying up and comments.
|
| 588 |
-
* Renaming class to new standard
|
| 589 |
-
* Removing deprecated wc methods.
|
| 590 |
-
* Fixing incorrect method call
|
| 591 |
-
* Problem with undefined variable.
|
| 592 |
-
* fixing static call issues
|
| 593 |
-
* fixing static call problems
|
| 594 |
-
* Fixing more strict issues
|
| 595 |
-
* fixing encoding issue
|
| 596 |
-
* Fixing tax rounding issue #37
|
| 597 |
-
* Fixing deprecated calls #42
|
| 598 |
-
* Fixing strict standards
|
| 599 |
-
* Fixing constant reference #36
|
| 600 |
-
* Fixed reference to old plugin name
|
| 601 |
-
* Fixing strict errors #27
|
| 602 |
-
* New Default POT translations #26
|
| 603 |
-
* Fixing translation strings #26
|
| 604 |
-
* Updated description
|
| 605 |
-
* Fix link to paypal adaptive payments #25
|
| 606 |
-
* Fixing issue #22
|
| 607 |
-
* Remove support for woo commerce 2.1 and below
|
| 608 |
-
* Class rename
|
| 609 |
-
* Fixed incorrect table name see #35
|
| 610 |
-
* Fixed Class description
|
| 611 |
-
* Added label on vendor email shipping line see #22
|
| 612 |
-
* Fix issue #23 Notify vendor email problem
|
| 613 |
-
* Fixing Issue #28 & removing WC2.0 support
|
| 614 |
-
* Strict Standards in WCV_Vendors #32
|
| 615 |
-
* Fixing Issue #31 PHP Strict Issues
|
| 616 |
-
* Fixing Issue #30 PHP Strict Standards
|
| 617 |
-
* Change Log added for release changes
|
| 618 |
-
* WC Version Requirement changed
|
| 619 |
-
* Updating author to include wc after modifications
|
| 620 |
-
* Rename class
|
| 621 |
-
* Fixing up link to documentation
|
| 622 |
-
* Updated Readme
|
| 623 |
-
|
| 624 |
-
Version 1.1.3
|
| 625 |
-
|
| 626 |
-
* Fixing table names for compatibility
|
| 627 |
-
* Rename class
|
| 628 |
-
* Fixing Fatal error #18
|
| 629 |
-
* Fatal error fixed, version bump
|
| 630 |
-
* Fixing Class call
|
| 631 |
-
* Fixing all references to incorrect class name
|
| 632 |
-
* Commission and report fixes
|
| 633 |
-
* Fixing spelling
|
| 634 |
-
* Update readme.txt
|
| 635 |
-
* Fixing author
|
| 636 |
-
* Version bump
|
| 637 |
-
* Check if shipping is enabled
|
| 638 |
-
* Comment for future reference
|
| 639 |
-
|
| 640 |
-
Version 1.1.1
|
| 641 |
-
|
| 642 |
-
* Start of adding woocomerce short codes enhanced
|
| 643 |
-
* Shortcodes class
|
| 644 |
-
* Removing temp file
|
| 645 |
-
* Adding short code support
|
| 646 |
-
* Version Bump
|
| 647 |
-
* PHP Strict Issue #5
|
| 648 |
-
* Fatal Error: Class 'PV_Commission' #14
|
| 649 |
-
* Fixing references to PV_Vendors
|
| 650 |
-
* Renamed filters and actions
|
| 651 |
-
* Rename Reports Submenu #15
|
| 652 |
-
* "Mark Shipped" Icon #16
|
| 653 |
-
* Version increased after bug fixes
|
| 654 |
-
|
| 655 |
-
Version 1.0.2
|
| 656 |
-
|
| 657 |
-
* Fix up admin settings notices
|
| 658 |
-
* Renamed shortcodes
|
| 659 |
-
* Version bump for short code rename
|
| 660 |
-
|
| 661 |
-
|
| 662 |
-
Version 1.0.1
|
| 663 |
-
|
| 664 |
-
* Initial Commit
|
| 665 |
-
* First commit - no modifications to existing plugin
|
| 666 |
-
* Updating README
|
| 667 |
-
* Update README.md
|
| 668 |
-
* Features added
|
| 669 |
-
* Updated Details of plugin
|
| 670 |
-
* Fixing up formatting
|
| 671 |
-
* More fixes.
|
| 672 |
-
* Updating readme
|
| 673 |
-
* Updating more details
|
| 674 |
-
* Update denied.php
|
| 675 |
-
* Added mac file ignore
|
| 676 |
-
* updated read me
|
| 677 |
-
* Plugin Rename
|
| 678 |
-
* Plugin rename
|
| 679 |
-
* Rename plugin
|
| 680 |
-
* Rename plugin
|
| 681 |
-
* more updates
|
| 682 |
-
* Plugin Updater removed
|
| 683 |
-
* Updating text domain
|
| 684 |
-
* Basic rename complete
|
| 685 |
-
* Replacement includes classes
|
| 686 |
-
* text domain updates
|
| 687 |
-
* text domain updates
|
| 688 |
-
* new change log for new fork
|
| 689 |
-
* Rename main class
|
| 690 |
-
* renaming constants
|
| 691 |
-
* updated constants
|
| 692 |
-
* plugin constant
|
| 693 |
-
* Renaming queries class
|
| 694 |
-
* constants updated
|
| 695 |
-
* rename vendor shop class
|
| 696 |
-
* rename vendor cart class
|
| 697 |
-
* Renaming classes
|
| 698 |
-
* Author updates
|
| 699 |
-
* Class renaming
|
| 700 |
-
* Version bump
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/class-wc-vendors.php
DELETED
|
@@ -1,425 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Plugin Name: WC Vendors
|
| 4 |
-
* Plugin URI: https://www.wcvendors.com
|
| 5 |
-
* Description: Allow vendors to sell their own products and receive a commission for each sale.
|
| 6 |
-
* Author: WC Vendors
|
| 7 |
-
* Author URI: https://www.wcvendors.com
|
| 8 |
-
* GitHub Plugin URI: https://github.com/wcvendors/wcvendors
|
| 9 |
-
*
|
| 10 |
-
* Version: 2.0.3
|
| 11 |
-
* Requires at least: 4.4.0
|
| 12 |
-
* Tested up to: 4.9.5
|
| 13 |
-
* WC requires at least: 3.0.0
|
| 14 |
-
* WC tested up to: 3.3.5
|
| 15 |
-
*
|
| 16 |
-
* Text Domain: wc-vendors
|
| 17 |
-
* Domain Path: /languages/
|
| 18 |
-
*
|
| 19 |
-
* @category Plugin
|
| 20 |
-
* @copyright Copyright © 2012 Matt Gates
|
| 21 |
-
* @copyright Copyright © 2018 WC Vendors
|
| 22 |
-
* @author Matt Gates, WC Vendors
|
| 23 |
-
* @package WCVendors
|
| 24 |
-
* @license GPL2
|
| 25 |
-
|
| 26 |
-
WC Vendors is free software: you can redistribute it and/or modify
|
| 27 |
-
it under the terms of the GNU General Public License as published by
|
| 28 |
-
the Free Software Foundation, either version 2 of the License, or
|
| 29 |
-
any later version.
|
| 30 |
-
|
| 31 |
-
WC Vendors is distributed in the hope that it will be useful,
|
| 32 |
-
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 33 |
-
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 34 |
-
GNU General Public License for more details.
|
| 35 |
-
|
| 36 |
-
You should have received a copy of the GNU General Public License
|
| 37 |
-
along with WC Vendors. If not, see http://www.gnu.org/licenses/gpl-2.0.txt.
|
| 38 |
-
|
| 39 |
-
*/
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
/**
|
| 43 |
-
* Plugin activation hook
|
| 44 |
-
*/
|
| 45 |
-
function wcvendors_activate() {
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* Requires woocommerce to be installed and active
|
| 49 |
-
*/
|
| 50 |
-
if ( !class_exists( 'WooCommerce' ) ) {
|
| 51 |
-
deactivate_plugins( plugin_basename( __FILE__ ) );
|
| 52 |
-
wp_die( __( 'WC Vendors requires WooCommerce to run. Please install WooCommerce and activate before attempting to activate again.', 'wc-vendors' ) );
|
| 53 |
-
}
|
| 54 |
-
} // wcvendors_activate()
|
| 55 |
-
|
| 56 |
-
register_activation_hook( __FILE__, 'wcvendors_activate' );
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* Required functions
|
| 61 |
-
*/
|
| 62 |
-
require_once trailingslashit( dirname( __FILE__ ) ) . 'classes/includes/class-functions.php';
|
| 63 |
-
|
| 64 |
-
/**
|
| 65 |
-
* Check if WooCommerce is active
|
| 66 |
-
*/
|
| 67 |
-
if ( wcv_is_woocommerce_activated() ) {
|
| 68 |
-
|
| 69 |
-
/* Define an absolute path to our plugin directory. */
|
| 70 |
-
if ( !defined( 'wcv_plugin_dir' ) ) define( 'wcv_plugin_dir', trailingslashit( dirname( __FILE__ ) ) );
|
| 71 |
-
if ( !defined( 'wcv_assets_url' ) ) define( 'wcv_assets_url', trailingslashit( plugins_url( 'assets', __FILE__ ) ) );
|
| 72 |
-
if ( !defined( 'wcv_plugin_base' ) ) define( 'wcv_plugin_base', plugin_basename( __FILE__ ) );
|
| 73 |
-
if ( !defined( 'wcv_plugin_dir_path' ) ) define( 'wcv_plugin_dir_path', untrailingslashit( plugin_dir_path( __FILE__ ) ) );
|
| 74 |
-
|
| 75 |
-
/**
|
| 76 |
-
* Main Product Vendor class
|
| 77 |
-
*
|
| 78 |
-
* @package WCVendors
|
| 79 |
-
*/
|
| 80 |
-
class WC_Vendors
|
| 81 |
-
{
|
| 82 |
-
|
| 83 |
-
public $version = '2.0.3';
|
| 84 |
-
|
| 85 |
-
/**
|
| 86 |
-
* @var
|
| 87 |
-
*/
|
| 88 |
-
public static $pv_options;
|
| 89 |
-
public static $id = 'wc_prd_vendor';
|
| 90 |
-
|
| 91 |
-
/**
|
| 92 |
-
* Constructor.
|
| 93 |
-
*/
|
| 94 |
-
public function __construct()
|
| 95 |
-
{
|
| 96 |
-
|
| 97 |
-
// Load text domain
|
| 98 |
-
add_action( 'plugins_loaded', array( $this, 'load_il8n' ) );
|
| 99 |
-
|
| 100 |
-
$this->title = __( 'WC Vendors', 'wc-vendors' );
|
| 101 |
-
|
| 102 |
-
$this->define_constants();
|
| 103 |
-
|
| 104 |
-
// Install & upgrade
|
| 105 |
-
add_action( 'admin_init', array( $this, 'check_install' ) );
|
| 106 |
-
add_action( 'init', array( $this, 'maybe_flush_permalinks' ), 99 );
|
| 107 |
-
add_action( 'wcvendors_flush_rewrite_rules', array( $this, 'flush_rewrite_rules' ) );
|
| 108 |
-
add_action( 'admin_init', array( $this, 'wcv_required_ignore_notices' ) );
|
| 109 |
-
|
| 110 |
-
add_action( 'plugins_loaded', array( $this, 'include_gateways' ) );
|
| 111 |
-
add_action( 'plugins_loaded', array( $this, 'include_core' ) );
|
| 112 |
-
add_action( 'init', array( $this, 'include_init' ) );
|
| 113 |
-
add_action( 'current_screen', array( $this, 'include_assets' ) );
|
| 114 |
-
|
| 115 |
-
// Start a PHP session, if not yet started then destroy if logged in or out
|
| 116 |
-
add_action( 'init', array( $this, 'init_session'), 1 );
|
| 117 |
-
add_action( 'wp_logout', array( $this, 'destroy_session') );
|
| 118 |
-
add_action( 'wp_login', array( $this, 'destroy_session') );
|
| 119 |
-
|
| 120 |
-
// Legacy settings
|
| 121 |
-
add_action( 'admin_init', array( 'WCVendors_Install', 'check_pro_version' ) );
|
| 122 |
-
add_action( 'plugins_loaded', array( $this, 'load_legacy_settings' ) );
|
| 123 |
-
|
| 124 |
-
// Show update notices
|
| 125 |
-
$file = basename( __FILE__ );
|
| 126 |
-
$folder = basename( dirname( __FILE__ ) );
|
| 127 |
-
$hook = "in_plugin_update_message-{$folder}/{$file}";
|
| 128 |
-
add_action( $hook, array( $this, 'show_upgrade_notification') , 10, 2);
|
| 129 |
-
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
/**
|
| 134 |
-
*
|
| 135 |
-
*/
|
| 136 |
-
public function invalid_wc_version() {
|
| 137 |
-
echo '<div class="error"><p>' . __( '<b>WC Vendors is inactive</b>. WC Vendors requires a minimum of WooCommerce 3.0.0 to operate.', 'wc-vendors' ) . '</p></div>';
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
/**
|
| 141 |
-
* Define WC Constants.
|
| 142 |
-
*/
|
| 143 |
-
private function define_constants() {
|
| 144 |
-
|
| 145 |
-
$this->define( 'WCV_VERSION', $this->version );
|
| 146 |
-
$this->define( 'WCV_TEMPLATE_BASE', untrailingslashit( plugin_dir_path( __FILE__ ) ) . '/templates/' );
|
| 147 |
-
$this->define( 'WCV_ABSPATH_ADMIN', dirname( __FILE__ ) . '/classes/admin/');
|
| 148 |
-
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
/**
|
| 152 |
-
* Define constant if not already set.
|
| 153 |
-
*
|
| 154 |
-
* @param string $name Constant name.
|
| 155 |
-
* @param string|bool $value Constant value.
|
| 156 |
-
*/
|
| 157 |
-
private function define( $name, $value ) {
|
| 158 |
-
if ( ! defined( $name ) ) {
|
| 159 |
-
define( $name, $value );
|
| 160 |
-
}
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
|
| 164 |
-
/**
|
| 165 |
-
* Start the session
|
| 166 |
-
*/
|
| 167 |
-
public function init_session(){
|
| 168 |
-
|
| 169 |
-
if ( !session_id() && is_user_logged_in() ) {
|
| 170 |
-
session_start();
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
} //init_session()
|
| 174 |
-
|
| 175 |
-
public function destroy_session(){
|
| 176 |
-
|
| 177 |
-
if ( session_id() ) {
|
| 178 |
-
session_destroy();
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
} // destroy_session()
|
| 182 |
-
|
| 183 |
-
|
| 184 |
-
/**
|
| 185 |
-
* Check whether install has ran before or not
|
| 186 |
-
*
|
| 187 |
-
* Run install if it hasn't.
|
| 188 |
-
*
|
| 189 |
-
* @return unknown
|
| 190 |
-
*/
|
| 191 |
-
public function check_install() {
|
| 192 |
-
|
| 193 |
-
if ( version_compare( WC_VERSION, '3.0.0', '<' ) ) {
|
| 194 |
-
add_action( 'admin_notices', array( $this, 'invalid_wc_version' ) );
|
| 195 |
-
deactivate_plugins( plugin_basename( __FILE__ ) );
|
| 196 |
-
return false;
|
| 197 |
-
}
|
| 198 |
-
|
| 199 |
-
}
|
| 200 |
-
|
| 201 |
-
|
| 202 |
-
/**
|
| 203 |
-
* Set static $pv_options to hold options class
|
| 204 |
-
*/
|
| 205 |
-
public function load_legacy_settings() {
|
| 206 |
-
if ( empty( self::$pv_options ) ) {
|
| 207 |
-
include_once( wcv_plugin_dir . 'classes/includes/class-sf-settings.php' );
|
| 208 |
-
self::$pv_options = new SF_Settings_API();
|
| 209 |
-
}
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
public function load_il8n() {
|
| 213 |
-
$locale = apply_filters( 'plugin_locale', get_locale(), 'wc-vendors' );
|
| 214 |
-
load_textdomain( 'wc-vendors', WP_LANG_DIR.'/wc-vendors/wc-vendors-'.$locale.'.mo');
|
| 215 |
-
load_plugin_textdomain( 'wc-vendors', false, plugin_basename( dirname( __FILE__ ) ) . '/languages/' );
|
| 216 |
-
|
| 217 |
-
}
|
| 218 |
-
|
| 219 |
-
/**
|
| 220 |
-
* Include core files
|
| 221 |
-
*/
|
| 222 |
-
public function include_core() {
|
| 223 |
-
|
| 224 |
-
include_once( wcv_plugin_dir . 'classes/class-install.php' );
|
| 225 |
-
include_once( wcv_plugin_dir . 'classes/class-queries.php');
|
| 226 |
-
include_once( wcv_plugin_dir . 'classes/class-vendors.php');
|
| 227 |
-
include_once( wcv_plugin_dir . 'classes/class-cron.php');
|
| 228 |
-
include_once( wcv_plugin_dir . 'classes/class-commission.php');
|
| 229 |
-
include_once( wcv_plugin_dir . 'classes/class-shipping.php');
|
| 230 |
-
include_once( wcv_plugin_dir . 'classes/class-vendor-order.php');
|
| 231 |
-
include_once( wcv_plugin_dir . 'classes/class-vendor-post-types.php');
|
| 232 |
-
include_once( wcv_plugin_dir . 'classes/front/class-vendor-cart.php');
|
| 233 |
-
include_once( wcv_plugin_dir . 'classes/front/dashboard/class-vendor-dashboard.php');
|
| 234 |
-
include_once( wcv_plugin_dir . 'classes/front/class-vendor-shop.php');
|
| 235 |
-
include_once( wcv_plugin_dir . 'classes/front/signup/class-vendor-signup.php');
|
| 236 |
-
include_once( wcv_plugin_dir . 'classes/front/orders/class-orders.php');
|
| 237 |
-
include_once( wcv_plugin_dir . 'classes/admin/emails/class-emails.php');
|
| 238 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-vendor-applicants.php');
|
| 239 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-admin-reports.php');
|
| 240 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-wcv-commissions-page.php');
|
| 241 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-wcv-admin-setup.php');
|
| 242 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-wcv-admin-notices.php');
|
| 243 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-wcv-admin-settings.php');
|
| 244 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-admin-menus.php');
|
| 245 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-wcv-admin-extensions.php');
|
| 246 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-wcv-admin-help.php');
|
| 247 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-setup-wizard.php');
|
| 248 |
-
include_once( wcv_plugin_dir . 'classes/admin/class-vendor-admin-dashboard.php');
|
| 249 |
-
include_once( wcv_plugin_dir . 'classes/includes/class-wcv-shortcodes.php');
|
| 250 |
-
include_once( wcv_plugin_dir . 'classes/includes/wcv-update-functions.php');
|
| 251 |
-
include_once( wcv_plugin_dir . 'classes/includes/wcv-template-functions.php');
|
| 252 |
-
|
| 253 |
-
// Include
|
| 254 |
-
|
| 255 |
-
|
| 256 |
-
if ( !function_exists( 'woocommerce_wp_text_input' ) && !is_admin() ) {
|
| 257 |
-
include_once( WC()->plugin_path() . '/includes/admin/wc-meta-box-functions.php' );
|
| 258 |
-
}
|
| 259 |
-
|
| 260 |
-
new WCV_Vendors;
|
| 261 |
-
new WCV_Vendor_Shop;
|
| 262 |
-
new WCV_Vendor_Cart;
|
| 263 |
-
new WCV_Commission;
|
| 264 |
-
new WCV_Shipping;
|
| 265 |
-
new WCV_Cron;
|
| 266 |
-
new WCV_Orders;
|
| 267 |
-
new WCV_Vendor_Dashboard;
|
| 268 |
-
new WCV_Admin_Setup;
|
| 269 |
-
new WCV_Vendor_Admin_Dashboard;
|
| 270 |
-
new WCV_Admin_Reports;
|
| 271 |
-
new WCV_Vendor_Applicants;
|
| 272 |
-
new WCV_Emails;
|
| 273 |
-
new WCV_Vendor_Signup;
|
| 274 |
-
new WCV_Shortcodes;
|
| 275 |
-
}
|
| 276 |
-
|
| 277 |
-
|
| 278 |
-
/**
|
| 279 |
-
* These need to be initlized later in loading to fix interaction with other plugins that call current_user_can at the right time.
|
| 280 |
-
*
|
| 281 |
-
* @since 1.9.4
|
| 282 |
-
* @access public
|
| 283 |
-
*/
|
| 284 |
-
public function include_init(){
|
| 285 |
-
|
| 286 |
-
require_once wcv_plugin_dir . 'classes/admin/class-vendor-reports.php';
|
| 287 |
-
require_once wcv_plugin_dir . 'classes/admin/class-product-meta.php';
|
| 288 |
-
require_once wcv_plugin_dir . 'classes/admin/class-admin-users.php';
|
| 289 |
-
|
| 290 |
-
|
| 291 |
-
new WCV_Vendor_Reports;
|
| 292 |
-
new WCV_Product_Meta;
|
| 293 |
-
new WCV_Admin_Users;
|
| 294 |
-
|
| 295 |
-
} // include_init()
|
| 296 |
-
|
| 297 |
-
/**
|
| 298 |
-
* Load plugin assets
|
| 299 |
-
*/
|
| 300 |
-
public function include_assets(){
|
| 301 |
-
|
| 302 |
-
$screen = get_current_screen();
|
| 303 |
-
|
| 304 |
-
if ( in_array( $screen->id, array( 'edit-product' ) ) ) {
|
| 305 |
-
wp_enqueue_script( 'wcv_quick-edit', wcv_assets_url. 'js/wcv-admin-quick-edit.js', array('jquery') );
|
| 306 |
-
}
|
| 307 |
-
|
| 308 |
-
}
|
| 309 |
-
|
| 310 |
-
|
| 311 |
-
/**
|
| 312 |
-
* Include payment gateways
|
| 313 |
-
*/
|
| 314 |
-
public function include_gateways()
|
| 315 |
-
{
|
| 316 |
-
require_once wcv_plugin_dir . 'classes/gateways/PayPal_AdvPayments/paypal_ap.php';
|
| 317 |
-
require_once wcv_plugin_dir . 'classes/gateways/PayPal_Masspay/class-paypal-masspay.php';
|
| 318 |
-
require_once wcv_plugin_dir . 'classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php';
|
| 319 |
-
}
|
| 320 |
-
|
| 321 |
-
/**
|
| 322 |
-
* If the settings are updated and the vendor page link has changed update permalinks
|
| 323 |
-
* @access public
|
| 324 |
-
*
|
| 325 |
-
*/
|
| 326 |
-
public function maybe_flush_permalinks() {
|
| 327 |
-
if ( 'yes' === get_option( 'wcvendors_queue_flush_rewrite_rules' ) ) {
|
| 328 |
-
$this->flush_rewrite_rules();
|
| 329 |
-
update_option( 'wcvendors_queue_flush_rewrite_rules', 'no' );
|
| 330 |
-
}
|
| 331 |
-
}
|
| 332 |
-
|
| 333 |
-
public function flush_rewrite_rules(){
|
| 334 |
-
flush_rewrite_rules();
|
| 335 |
-
}
|
| 336 |
-
|
| 337 |
-
|
| 338 |
-
/**
|
| 339 |
-
* Add user meta to remember ignore notices
|
| 340 |
-
* @access public
|
| 341 |
-
*
|
| 342 |
-
*/
|
| 343 |
-
public function wcv_required_ignore_notices(){
|
| 344 |
-
global $current_user;
|
| 345 |
-
$current_user_id = $current_user->ID;
|
| 346 |
-
|
| 347 |
-
/* If user clicks to ignore the notice, add that to their user meta */
|
| 348 |
-
if ( isset( $_GET[ 'wcv_shop_ignore_notice' ] ) && '0' == $_GET[ 'wcv_shop_ignore_notice' ] ) {
|
| 349 |
-
add_user_meta( $current_user_id, 'wcv_shop_ignore_notice', 'true', true);
|
| 350 |
-
}
|
| 351 |
-
if ( isset($_GET['wcv_pl_ignore_notice']) && '0' == $_GET['wcv_pl_ignore_notice'] ) {
|
| 352 |
-
add_user_meta( $current_user_id, 'wcv_pl_ignore_notice', 'true' , true);
|
| 353 |
-
}
|
| 354 |
-
|
| 355 |
-
}
|
| 356 |
-
|
| 357 |
-
/**
|
| 358 |
-
* Class logger so that we can keep our debug and logging information cleaner
|
| 359 |
-
*
|
| 360 |
-
* @since 2.0.0
|
| 361 |
-
* @version 2.0.0
|
| 362 |
-
* @access public
|
| 363 |
-
*
|
| 364 |
-
* @param mixed - $data the data to go to the error log could be string, array or object
|
| 365 |
-
*/
|
| 366 |
-
public static function log( $data = '', $prefix = '' ){
|
| 367 |
-
|
| 368 |
-
$trace = debug_backtrace( false, 2 );
|
| 369 |
-
$caller = ( isset( $trace[ 1 ]['class'] ) ) ? $trace[ 1 ]['class'] : basename( $trace[ 1 ][ 'file' ] );
|
| 370 |
-
|
| 371 |
-
if ( is_array( $data ) || is_object( $data ) ) {
|
| 372 |
-
if ( $prefix ){
|
| 373 |
-
error_log( '===========================' );
|
| 374 |
-
error_log( $prefix );
|
| 375 |
-
error_log( '===========================' );
|
| 376 |
-
}
|
| 377 |
-
error_log( $caller . ' : ' . print_r( $data, true ) );
|
| 378 |
-
} else {
|
| 379 |
-
if ( $prefix ){
|
| 380 |
-
error_log( '===========================' );
|
| 381 |
-
error_log( $prefix );
|
| 382 |
-
error_log( '===========================' );
|
| 383 |
-
}
|
| 384 |
-
error_log( $caller . ' : ' . $data );
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
} // log()
|
| 388 |
-
|
| 389 |
-
|
| 390 |
-
/*
|
| 391 |
-
* Upgrade notice displayed on the plugin screen
|
| 392 |
-
*
|
| 393 |
-
*/
|
| 394 |
-
public function show_upgrade_notification( $args, $response ) {
|
| 395 |
-
|
| 396 |
-
$new_version = $response->new_version;
|
| 397 |
-
$upgrade_notice = sprintf( __( 'WC Vendors 2.0 is a major update. This is not compatible with any of our existing extensions. You should test this update on a staging server before updating. Backup your site and update your theme and extensions, and <a href="%s">review update details here</a> before upgrading.', 'wc-vendors' ), 'https://docs.wcvendors.com/knowledge-base/upgrading-to-wc-vendors-2-0/');
|
| 398 |
-
|
| 399 |
-
if ( version_compare( WCV_VERSION, $new_version, '<' ) && version_compare( $new_version, '2.0.0', '>=') ){
|
| 400 |
-
echo '<h3>Important Upgrade Notice:</h3>';
|
| 401 |
-
echo '<p style="background-color: #d54e21; padding: 10px; color: #f9f9f9; margin-top: 10px">';
|
| 402 |
-
echo $upgrade_notice;
|
| 403 |
-
if ( !class_exists( 'WCVendors_Pro' ) ) echo '</p>';
|
| 404 |
-
|
| 405 |
-
if ( class_exists( 'WCVendors_Pro' ) ){
|
| 406 |
-
|
| 407 |
-
if ( version_compare( WCV_PRO_VERSION, '1.5.0', '<' ) ){
|
| 408 |
-
echo '<h3>WC Vendors Pro Notice</h3>';
|
| 409 |
-
echo '<p style="background-color: #d54e21; padding: 10px; color: #f9f9f9; margin-top: 10px">';
|
| 410 |
-
$pro_upgrade = sprintf( __( 'WC Vendors Pro 1.5.0 is required to run WC Vendors 2.0.0. Your current version %s will be deactivated. Please upgrade to the latest version.', 'wc-vendors' ), WCV_PRO_VERSION );
|
| 411 |
-
|
| 412 |
-
echo $pro_upgrade;
|
| 413 |
-
// echo '</p>';
|
| 414 |
-
}
|
| 415 |
-
|
| 416 |
-
}
|
| 417 |
-
|
| 418 |
-
}
|
| 419 |
-
} // show_upgrade_notification()
|
| 420 |
-
|
| 421 |
-
}
|
| 422 |
-
|
| 423 |
-
$wc_vendors = new WC_Vendors;
|
| 424 |
-
|
| 425 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-admin-menus.php
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* The admin class handles all admin custom page functions for admin view
|
| 8 |
-
*
|
| 9 |
-
* @author Jamie Madden, WC Vendors
|
| 10 |
-
* @category Admin
|
| 11 |
-
* @package WCVendors/Admin
|
| 12 |
-
* @version 2.0.0
|
| 13 |
-
*/
|
| 14 |
-
class WCVendors_Admin_Menus {
|
| 15 |
-
|
| 16 |
-
public $commissions_table;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructor
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(){
|
| 22 |
-
|
| 23 |
-
// Add menus
|
| 24 |
-
add_action( 'admin_menu', array( $this, 'admin_menu' ) );
|
| 25 |
-
add_action( 'admin_menu', array( $this, 'commissions_menu' ), 50 );
|
| 26 |
-
add_action( 'admin_menu', array( $this, 'settings_menu' ), 70 );
|
| 27 |
-
add_action( 'admin_menu', array( $this, 'extensions_menu'), 80 );
|
| 28 |
-
add_action( 'admin_head', array( $this, 'commission_table_header_styles' ) );
|
| 29 |
-
|
| 30 |
-
add_filter( 'set-screen-option', array( __CLASS__, 'set_commissions_screen' ), 10, 3 );
|
| 31 |
-
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
/**
|
| 35 |
-
* WC Vendors menu
|
| 36 |
-
*/
|
| 37 |
-
public function admin_menu() {
|
| 38 |
-
|
| 39 |
-
global $menu;
|
| 40 |
-
|
| 41 |
-
if ( current_user_can( 'manage_woocommerce' ) ) {
|
| 42 |
-
$menu[] = array( '', 'read', 'separator-woocommerce', '', 'wp-menu-separator wcvendors' );
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
add_menu_page( __( 'WC Vendors', 'wc-vendors' ), __( 'WC Vendors', 'wc-vendors' ), 'manage_woocommerce', 'wc-vendors', array( $this, 'extensions_page' ), 'dashicons-cart', '50' );
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
/**
|
| 49 |
-
* Addons menu item.
|
| 50 |
-
*/
|
| 51 |
-
public function extensions_menu() {
|
| 52 |
-
add_submenu_page( 'wc-vendors', __( 'WC Vendors Extensions', 'wc-vendors' ), __( 'Extensions', 'wc-vendors' ), 'manage_woocommerce', 'wcv-extensions', array( $this, 'extensions_page' ) );
|
| 53 |
-
remove_submenu_page( 'wc-vendors', 'wc-vendors' );
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* Addons Page
|
| 58 |
-
*/
|
| 59 |
-
public function extensions_page(){
|
| 60 |
-
WCVendors_Admin_Extensions::output();
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/**
|
| 64 |
-
* Add the commissions sub menu
|
| 65 |
-
*
|
| 66 |
-
* @since 1.0.0
|
| 67 |
-
* @access public
|
| 68 |
-
*
|
| 69 |
-
*/
|
| 70 |
-
public function commissions_menu() {
|
| 71 |
-
|
| 72 |
-
$commissions_page = add_submenu_page( 'wc-vendors', __( 'Commissions', 'wc-vendors' ), __( 'Commissions', 'wc-vendors' ), 'manage_woocommerce', 'wcv-commissions', array( $this, 'commissions_page' ) );\
|
| 73 |
-
add_action( "load-$commissions_page", array( $this, 'commission_screen_options' ) );
|
| 74 |
-
|
| 75 |
-
} // commissions_menu()
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
/**
|
| 79 |
-
* Settings menu item
|
| 80 |
-
*/
|
| 81 |
-
public function settings_menu(){
|
| 82 |
-
$settings_page = add_submenu_page( 'wc-vendors', __( 'WC Vendors Settings', 'wcvendors' ), __( 'Settings', 'wcvendors' ), 'manage_woocommerce', 'wcv-settings', array( $this, 'settings_page' ) );
|
| 83 |
-
add_action( 'load-' . $settings_page, array( $this, 'settings_page_init') );
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
/**
|
| 88 |
-
* Loads required objects into memory for use within settings
|
| 89 |
-
*/
|
| 90 |
-
public function settings_page_init() {
|
| 91 |
-
|
| 92 |
-
global $current_tab, $current_section;
|
| 93 |
-
|
| 94 |
-
// Include settings pages
|
| 95 |
-
WCVendors_Admin_Settings::get_settings_pages();
|
| 96 |
-
|
| 97 |
-
// Get current tab/section
|
| 98 |
-
$current_tab = empty( $_GET['tab'] ) ? 'general' : sanitize_title( $_GET['tab'] );
|
| 99 |
-
$current_section = empty( $_REQUEST['section'] ) ? '' : sanitize_title( $_REQUEST['section'] );
|
| 100 |
-
|
| 101 |
-
// Save settings if data has been posted
|
| 102 |
-
if ( ! empty( $_POST ) ) {
|
| 103 |
-
WCVendors_Admin_Settings::save();
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
// Add any posted messages
|
| 107 |
-
if ( ! empty( $_GET['wcv_error'] ) ) {
|
| 108 |
-
WCVendors_Admin_Settings::add_error( stripslashes( $_GET['wcv_error'] ) );
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
if ( ! empty( $_GET['wcv_message'] ) ) {
|
| 112 |
-
WCVendors_Admin_Settings::add_message( stripslashes( $_GET['wcv_message'] ) );
|
| 113 |
-
}
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
/**
|
| 117 |
-
* Settings Page
|
| 118 |
-
*/
|
| 119 |
-
public function settings_page(){
|
| 120 |
-
WCVendors_Admin_Settings::output();
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
/**
|
| 124 |
-
* Commission page output
|
| 125 |
-
*
|
| 126 |
-
* @since 2.0.0
|
| 127 |
-
*/
|
| 128 |
-
public function commissions_page(){
|
| 129 |
-
include( WCV_ABSPATH_ADMIN . 'views/html-admin-commission-page.php' );
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
/**
|
| 134 |
-
* Screen options
|
| 135 |
-
*/
|
| 136 |
-
public function commission_screen_options() {
|
| 137 |
-
|
| 138 |
-
$option = 'per_page';
|
| 139 |
-
$args = [
|
| 140 |
-
'label' => 'Commissions',
|
| 141 |
-
'default' => 10,
|
| 142 |
-
'option' => 'commissions_per_page'
|
| 143 |
-
];
|
| 144 |
-
|
| 145 |
-
add_screen_option( $option, $args );
|
| 146 |
-
|
| 147 |
-
$this->commissions_table = new WCVendors_Commissions_Page();
|
| 148 |
-
}
|
| 149 |
-
|
| 150 |
-
public static function set_commissions_screen( $status, $option, $value ) {
|
| 151 |
-
return $value;
|
| 152 |
-
}
|
| 153 |
-
|
| 154 |
-
/**
|
| 155 |
-
* Load styles for the commissions table page
|
| 156 |
-
*/
|
| 157 |
-
public function commission_table_header_styles() {
|
| 158 |
-
|
| 159 |
-
$page = ( isset( $_GET[ 'page' ] ) ) ? esc_attr( $_GET[ 'page' ] ) : false;
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
wp_enqueue_style( 'wcv-admin-styles', wcv_assets_url . 'css/wcv-admin.css', array(), WCV_VERSION );
|
| 163 |
-
|
| 164 |
-
// Only load the styles on the license table page
|
| 165 |
-
|
| 166 |
-
if ( 'wcv_admin_commissions' !== $page ) return;
|
| 167 |
-
|
| 168 |
-
echo '<style type="text/css">';
|
| 169 |
-
echo '.wp-list-table .column-product_id { width: 20%; }';
|
| 170 |
-
echo '.wp-list-table .column-vendor_id { width: 15%; }';
|
| 171 |
-
echo '.wp-list-table .column-order_id { width: 8%; }';
|
| 172 |
-
echo '.wp-list-table .column-total_due { width: 10%;}';
|
| 173 |
-
echo '.wp-list-table .column-total_shipping { width: 10%;}';
|
| 174 |
-
echo '.wp-list-table .column-tax { width: 10%;}';
|
| 175 |
-
echo '.wp-list-table .column-totals { width: 10%;}';
|
| 176 |
-
echo '.wp-list-table .column-status { width: 5%;}';
|
| 177 |
-
echo '.wp-list-table .column-time { width: 10%;}';
|
| 178 |
-
echo '</style>';
|
| 179 |
-
|
| 180 |
-
} //table_header_styles()
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
}
|
| 184 |
-
|
| 185 |
-
new WCVendors_Admin_Menus();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-admin-page.php
DELETED
|
@@ -1,882 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
class WCV_Admin_Setup
|
| 4 |
-
{
|
| 5 |
-
/**
|
| 6 |
-
* WC > Referrals menu
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
public function __construct()
|
| 10 |
-
{
|
| 11 |
-
add_filter( 'set-screen-option', array( 'WCV_Admin_Setup', 'set_table_option' ), 10, 3 );
|
| 12 |
-
add_action( 'admin_menu', array( 'WCV_Admin_Setup', 'menu' ) );
|
| 13 |
-
|
| 14 |
-
add_action( 'woocommerce_admin_order_data_after_shipping_address', array( $this, 'add_vendor_details' ), 10, 2 );
|
| 15 |
-
add_action( 'woocommerce_admin_order_actions_end', array( $this, 'append_actions' ), 10, 1 );
|
| 16 |
-
|
| 17 |
-
add_filter( 'woocommerce_debug_tools', array( $this, 'wcvendors_tools' ) );
|
| 18 |
-
|
| 19 |
-
add_action( 'admin_head', array( $this, 'commission_table_header_styles' ) );
|
| 20 |
-
|
| 21 |
-
add_action( 'admin_init', array( $this, 'export_commissions' ) );
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
public function add_vendor_details( $order )
|
| 26 |
-
{
|
| 27 |
-
$actions = $this->append_actions( $order, true );
|
| 28 |
-
|
| 29 |
-
if (empty( $actions['wc_pv_shipped']['name'] )) {
|
| 30 |
-
return;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
echo '<h4>' . __('Vendors shipped', 'wcvendors') . '</h4><br/>';
|
| 34 |
-
echo $actions['wc_pv_shipped']['name'];
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function append_actions( $order, $order_page = false )
|
| 38 |
-
{
|
| 39 |
-
global $woocommerce;
|
| 40 |
-
|
| 41 |
-
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 42 |
-
|
| 43 |
-
$authors = WCV_Vendors::get_vendors_from_order( $order );
|
| 44 |
-
$authors = $authors ? array_keys( $authors ) : array();
|
| 45 |
-
if ( empty( $authors ) ) return false;
|
| 46 |
-
|
| 47 |
-
$shipped = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 48 |
-
$string = '</br></br>';
|
| 49 |
-
|
| 50 |
-
foreach ($authors as $author ) {
|
| 51 |
-
$string .= in_array( $author, $shipped ) ? '✔ ' : '✕ ';
|
| 52 |
-
$string .= WCV_Vendors::get_vendor_shop_name( $author );
|
| 53 |
-
$string .= '</br>';
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
$response = array(
|
| 57 |
-
'url' => '#',
|
| 58 |
-
'name' => __('Vendors Shipped', 'wcvendors') . $string,
|
| 59 |
-
'action' => 'wc_pv_shipped',
|
| 60 |
-
'image_url' => wcv_assets_url . '/images/icons/truck.png',
|
| 61 |
-
);
|
| 62 |
-
|
| 63 |
-
if ( ! $order_page ) {
|
| 64 |
-
printf( '<a class="button tips %s" href="%s" data-tip="%s"><img style="width:16px;height:16px;" src="%s"></a>', $response['action'], $response['url'], $response['name'], $response['image_url'] );
|
| 65 |
-
} else {
|
| 66 |
-
echo $response['name'];
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
return $response;
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Add the commissions sub menu
|
| 75 |
-
*
|
| 76 |
-
* @since 1.0.0
|
| 77 |
-
* @access public
|
| 78 |
-
*
|
| 79 |
-
*/
|
| 80 |
-
public static function menu()
|
| 81 |
-
{
|
| 82 |
-
$hook = add_submenu_page(
|
| 83 |
-
'woocommerce',
|
| 84 |
-
__( 'Commission', 'wcvendors' ), __( 'Commission', 'wcvendors' ),
|
| 85 |
-
'manage_woocommerce',
|
| 86 |
-
'pv_admin_commissions',
|
| 87 |
-
array( 'WCV_Admin_Setup', 'commissions_page' )
|
| 88 |
-
);
|
| 89 |
-
|
| 90 |
-
add_action( "load-$hook", array( 'WCV_Admin_Setup', 'add_options' ) );
|
| 91 |
-
|
| 92 |
-
add_action( "admin_print_styles-$hook", array( 'WCV_Admin_Setup', 'commission_enqueue_style' ) );
|
| 93 |
-
add_action( "admin_print_scripts-$hook", array( 'WCV_Admin_Setup', 'commission_my_enqueue_script' ) );
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
} // menu()
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
/**
|
| 101 |
-
* Add tools to the woocommerce status tools page
|
| 102 |
-
*
|
| 103 |
-
* @since 1.9.2
|
| 104 |
-
* @access public
|
| 105 |
-
*/
|
| 106 |
-
public function wcvendors_tools( $tools ){
|
| 107 |
-
|
| 108 |
-
$tools[ 'reset_wcvendor_roles' ] = array(
|
| 109 |
-
'name' => __( 'Reset WC Vendors roles ', 'wcvendors' ),
|
| 110 |
-
'button' => __( 'Reset WC Vendor Roles', 'wcvendors' ),
|
| 111 |
-
'desc' => __( 'This will reset the wcvendors roles ( vendor & pending_vendor ), back to the default capabilities.', 'wcvendors' ),
|
| 112 |
-
'callback' => array( 'WCV_Admin_Setup', 'reset_vendor_roles' )
|
| 113 |
-
);
|
| 114 |
-
|
| 115 |
-
$tools[ 'reset_wcvendors' ] = array(
|
| 116 |
-
'name' => __( 'Reset WC Vendors ', 'wcvendors' ),
|
| 117 |
-
'button' => __( 'Reset WC Vendors Settings', 'wcvendors' ),
|
| 118 |
-
'desc' => __( 'This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings.', 'wcvendors' ),
|
| 119 |
-
'callback' => array( 'WCV_Admin_Setup', 'reset_wcvendors' )
|
| 120 |
-
);
|
| 121 |
-
|
| 122 |
-
return $tools;
|
| 123 |
-
|
| 124 |
-
} // wcvendors_tools()
|
| 125 |
-
|
| 126 |
-
/**
|
| 127 |
-
* Reset the vendor roles
|
| 128 |
-
*
|
| 129 |
-
* @since 1.9.2
|
| 130 |
-
* @access public
|
| 131 |
-
*/
|
| 132 |
-
public static function reset_vendor_roles(){
|
| 133 |
-
|
| 134 |
-
$can_add = WC_Vendors::$pv_options->get_option( 'can_submit_products' );
|
| 135 |
-
$can_edit = WC_Vendors::$pv_options->get_option( 'can_edit_published_products' );
|
| 136 |
-
$can_submit_live = WC_Vendors::$pv_options->get_option( 'can_submit_live_products' );
|
| 137 |
-
$can_view_reports = WC_Vendors::$pv_options->get_option( 'can_view_backend_reports' );
|
| 138 |
-
|
| 139 |
-
$args = array(
|
| 140 |
-
'assign_product_terms' => $can_add,
|
| 141 |
-
'edit_products' => $can_add || $can_edit,
|
| 142 |
-
'edit_published_products' => $can_edit,
|
| 143 |
-
'delete_published_products' => $can_edit,
|
| 144 |
-
'delete_products' => $can_edit,
|
| 145 |
-
'manage_product' => $can_add,
|
| 146 |
-
'publish_products' => $can_submit_live,
|
| 147 |
-
'read' => true,
|
| 148 |
-
'read_products' => $can_edit || $can_add,
|
| 149 |
-
'upload_files' => true,
|
| 150 |
-
'import' => true,
|
| 151 |
-
'view_woocommerce_reports' => false,
|
| 152 |
-
);
|
| 153 |
-
|
| 154 |
-
remove_role( 'vendor' );
|
| 155 |
-
add_role( 'vendor', __('Vendor', 'wcvendors'), $args );
|
| 156 |
-
|
| 157 |
-
remove_role( 'pending_vendor');
|
| 158 |
-
add_role( 'pending_vendor', __( 'Pending Vendor', 'wcvendors' ), array(
|
| 159 |
-
'read' => true,
|
| 160 |
-
'edit_posts' => false,
|
| 161 |
-
'delete_posts' => true
|
| 162 |
-
) );
|
| 163 |
-
|
| 164 |
-
echo '<div class="updated inline"><p>' . __( 'WC Vendor roles successfully reset.', 'wcvendors' ) . '</p></div>';
|
| 165 |
-
|
| 166 |
-
} // reset_vendor_roles()
|
| 167 |
-
|
| 168 |
-
|
| 169 |
-
/**
|
| 170 |
-
* Reset wcvendors
|
| 171 |
-
*
|
| 172 |
-
* @since 1.9.2
|
| 173 |
-
* @access public
|
| 174 |
-
*/
|
| 175 |
-
public static function reset_wcvendors(){
|
| 176 |
-
|
| 177 |
-
delete_option( WC_Vendors::$id . '_options' );
|
| 178 |
-
echo '<div class="updated inline"><p>' . __( 'WC Vendors was successfully reset. All settings have been reset.', 'wcvendors' ) . '</p></div>';
|
| 179 |
-
|
| 180 |
-
} // reset_wcvendors()
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
public static function commission_enqueue_style(){
|
| 184 |
-
|
| 185 |
-
wp_enqueue_style( 'commissions_select2_css', wcv_assets_url . 'css/select2.min.css' );
|
| 186 |
-
|
| 187 |
-
} //commission_enqueue_style()
|
| 188 |
-
|
| 189 |
-
public static function commission_my_enqueue_script(){
|
| 190 |
-
|
| 191 |
-
$select2_args = apply_filters( 'wcvendors_select2_commission_args', array(
|
| 192 |
-
'placeholder' => __( 'Select a Vendor', 'wcvendors' ),
|
| 193 |
-
'allowclear' => true,
|
| 194 |
-
) );
|
| 195 |
-
|
| 196 |
-
wp_enqueue_script( 'commissions_select2_styles_js', wcv_assets_url. 'js/select2.min.js', array('jquery') );
|
| 197 |
-
|
| 198 |
-
wp_register_script( 'commissions_select2_load_js', wcv_assets_url. 'js/wcv-commissions.js', array('jquery') );
|
| 199 |
-
wp_localize_script( 'commissions_select2_load_js', 'wcv_commissions_select', $select2_args );
|
| 200 |
-
wp_enqueue_script( 'commissions_select2_load_js' );
|
| 201 |
-
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
-
/**
|
| 205 |
-
* Load styles for the commissions table page
|
| 206 |
-
*/
|
| 207 |
-
public function commission_table_header_styles() {
|
| 208 |
-
|
| 209 |
-
$page = ( isset( $_GET[ 'page' ] ) ) ? esc_attr( $_GET[ 'page' ] ) : false;
|
| 210 |
-
|
| 211 |
-
// Only load the styles on the license table page
|
| 212 |
-
|
| 213 |
-
if ( 'pv_admin_commissions' !== $page ) return;
|
| 214 |
-
|
| 215 |
-
echo '<style type="text/css">';
|
| 216 |
-
echo '.wp-list-table .column-product_id { width: 20%; }';
|
| 217 |
-
echo '.wp-list-table .column-vendor_id { width: 15%; }';
|
| 218 |
-
echo '.wp-list-table .column-order_id { width: 8%; }';
|
| 219 |
-
echo '.wp-list-table .column-total_due { width: 10%;}';
|
| 220 |
-
echo '.wp-list-table .column-total_shipping { width: 10%;}';
|
| 221 |
-
echo '.wp-list-table .column-tax { width: 10%;}';
|
| 222 |
-
echo '.wp-list-table .column-totals { width: 10%;}';
|
| 223 |
-
echo '.wp-list-table .column-status { width: 5%;}';
|
| 224 |
-
echo '.wp-list-table .column-time { width: 10%;}';
|
| 225 |
-
echo '</style>';
|
| 226 |
-
|
| 227 |
-
} //table_header_styles()
|
| 228 |
-
|
| 229 |
-
/**
|
| 230 |
-
*
|
| 231 |
-
*
|
| 232 |
-
* @param unknown $status
|
| 233 |
-
* @param unknown $option
|
| 234 |
-
* @param unknown $value
|
| 235 |
-
*
|
| 236 |
-
* @return unknown
|
| 237 |
-
*/
|
| 238 |
-
public static function set_table_option( $status, $option, $value )
|
| 239 |
-
{
|
| 240 |
-
if ( $option == 'commission_per_page' ) {
|
| 241 |
-
return $value;
|
| 242 |
-
}
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
/**
|
| 247 |
-
*
|
| 248 |
-
*/
|
| 249 |
-
public static function add_options()
|
| 250 |
-
{
|
| 251 |
-
global $PV_Admin_Page;
|
| 252 |
-
|
| 253 |
-
$args = array(
|
| 254 |
-
'label' => 'Rows',
|
| 255 |
-
'default' => 10,
|
| 256 |
-
'option' => 'commission_per_page'
|
| 257 |
-
);
|
| 258 |
-
add_screen_option( 'per_page', $args );
|
| 259 |
-
|
| 260 |
-
$PV_Admin_Page = new WCV_Admin_Page();
|
| 261 |
-
|
| 262 |
-
}
|
| 263 |
-
|
| 264 |
-
|
| 265 |
-
/**
|
| 266 |
-
* HTML setup for the WC > Commission page
|
| 267 |
-
*/
|
| 268 |
-
public static function commissions_page()
|
| 269 |
-
{
|
| 270 |
-
global $woocommerce, $PV_Admin_Page;
|
| 271 |
-
?>
|
| 272 |
-
|
| 273 |
-
<div class="wrap">
|
| 274 |
-
|
| 275 |
-
<div id="icon-woocommerce" class="icon32 icon32-woocommerce-reports"><br/></div>
|
| 276 |
-
<h2><?php _e( 'Commission', 'wcvendors' ); ?></h2>
|
| 277 |
-
|
| 278 |
-
<form id="posts-filter" method="get">
|
| 279 |
-
|
| 280 |
-
<?php
|
| 281 |
-
$page = filter_input( INPUT_GET, 'page', FILTER_SANITIZE_STRIPPED );
|
| 282 |
-
$paged = filter_input( INPUT_GET, 'paged', FILTER_SANITIZE_NUMBER_INT );
|
| 283 |
-
|
| 284 |
-
printf( '<input type="hidden" name="page" value="%s" />', $page );
|
| 285 |
-
printf( '<input type="hidden" name="paged" value="%d" />', $paged );
|
| 286 |
-
?>
|
| 287 |
-
|
| 288 |
-
<input type="hidden" name="page" value="pv_admin_commissions"/>
|
| 289 |
-
|
| 290 |
-
<?php $PV_Admin_Page->prepare_items(); ?>
|
| 291 |
-
<?php $PV_Admin_Page->views() ?>
|
| 292 |
-
<?php $PV_Admin_Page->display() ?>
|
| 293 |
-
|
| 294 |
-
</form>
|
| 295 |
-
<div id="ajax-response"></div>
|
| 296 |
-
<br class="clear"/>
|
| 297 |
-
</div>
|
| 298 |
-
<?php
|
| 299 |
-
}
|
| 300 |
-
|
| 301 |
-
/*
|
| 302 |
-
* Export commissions via csv
|
| 303 |
-
*/
|
| 304 |
-
public function export_commissions(){
|
| 305 |
-
|
| 306 |
-
// prepare the items to export
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
if ( isset( $_GET['action'], $_GET['nonce'] ) && wp_verify_nonce( wp_unslash( $_GET['nonce'] ), 'export_commissions' ) && 'export_commissions' === wp_unslash( $_GET['action'] ) ) {
|
| 310 |
-
|
| 311 |
-
include_once( 'class-wcv-commissions-csv-exporter.php' );
|
| 312 |
-
|
| 313 |
-
$exporter = new WCV_Commissions_CSV_Export();
|
| 314 |
-
|
| 315 |
-
$date = date( 'Y-M-d' );
|
| 316 |
-
|
| 317 |
-
if ( ! empty( $_GET['com_status'] ) ) { // WPCS: input var ok.
|
| 318 |
-
$exporter->set_filename( 'wcv_commissions_'. wp_unslash( $_GET['com_status'] ) . '-' . $date . '.csv' ); // WPCS: input var ok, sanitization ok.
|
| 319 |
-
} else {
|
| 320 |
-
$exporter->set_filename( 'wcv_commissions-' . $date . '.csv' ); // WPCS: input var ok, sanitization ok.
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
$exporter->export();
|
| 324 |
-
}
|
| 325 |
-
|
| 326 |
-
}
|
| 327 |
-
|
| 328 |
-
|
| 329 |
-
}
|
| 330 |
-
|
| 331 |
-
|
| 332 |
-
if ( !class_exists( 'WP_List_Table' ) ) require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php';
|
| 333 |
-
|
| 334 |
-
/**
|
| 335 |
-
* WC_Simple_Referral_Admin class.
|
| 336 |
-
*
|
| 337 |
-
* @extends WP_List_Table
|
| 338 |
-
*/
|
| 339 |
-
class WCV_Admin_Page extends WP_List_Table
|
| 340 |
-
{
|
| 341 |
-
|
| 342 |
-
public $index;
|
| 343 |
-
|
| 344 |
-
|
| 345 |
-
/**
|
| 346 |
-
* __construct function.
|
| 347 |
-
*
|
| 348 |
-
* @access public
|
| 349 |
-
*/
|
| 350 |
-
function __construct()
|
| 351 |
-
{
|
| 352 |
-
global $status, $page;
|
| 353 |
-
|
| 354 |
-
$this->index = 0;
|
| 355 |
-
|
| 356 |
-
//Set parent defaults
|
| 357 |
-
parent::__construct( array(
|
| 358 |
-
'singular' => 'commission',
|
| 359 |
-
'plural' => 'commissions',
|
| 360 |
-
'ajax' => false
|
| 361 |
-
) );
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
|
| 365 |
-
/**
|
| 366 |
-
* column_default function.
|
| 367 |
-
*
|
| 368 |
-
* @access public
|
| 369 |
-
*
|
| 370 |
-
* @param unknown $item
|
| 371 |
-
* @param mixed $column_name
|
| 372 |
-
*
|
| 373 |
-
* @return unknown
|
| 374 |
-
*/
|
| 375 |
-
function column_default( $item, $column_name )
|
| 376 |
-
{
|
| 377 |
-
global $wpdb;
|
| 378 |
-
|
| 379 |
-
switch ( $column_name ) {
|
| 380 |
-
case 'id' :
|
| 381 |
-
return $item->id;
|
| 382 |
-
case 'vendor_id' :
|
| 383 |
-
$user = get_userdata( $item->vendor_id );
|
| 384 |
-
return '<a href="' . admin_url( 'user-edit.php?user_id=' . $item->vendor_id ) . '">' . WCV_Vendors::get_vendor_shop_name( $item->vendor_id ) . '</a>';
|
| 385 |
-
case 'total_due' :
|
| 386 |
-
return wc_price( $item->total_due );
|
| 387 |
-
case 'total_shipping':
|
| 388 |
-
return wc_price($item->total_shipping );
|
| 389 |
-
case 'tax':
|
| 390 |
-
return wc_price( $item->tax );
|
| 391 |
-
case 'totals' :
|
| 392 |
-
$totals = ( wc_tax_enabled() ) ? $item->total_due + $item->total_shipping + $item->tax : $item->total_due + $item->total_shipping;
|
| 393 |
-
return wc_price( $totals );
|
| 394 |
-
case 'product_id' :
|
| 395 |
-
$parent = get_post_ancestors( $item->product_id );
|
| 396 |
-
$product_id = $parent ? $parent[ 0 ] : $item->product_id;
|
| 397 |
-
$wcv_total_sales = get_post_meta( $product_id, 'total_sales', true );
|
| 398 |
-
if ( ! get_post_status( $product_id ) ) {
|
| 399 |
-
$product_id = WCV_Vendors::find_parent_id_from_order( $item->order_id, $product_id );
|
| 400 |
-
}
|
| 401 |
-
return '<a href="' . admin_url( 'post.php?post=' . $product_id . '&action=edit' ) . '">' . get_the_title( $product_id ) . '</a> (<span title="' . get_the_title( $product_id ) .' has sold ' . $wcv_total_sales . ' times total.">' . $wcv_total_sales . '</span>)';
|
| 402 |
-
case 'order_id' :
|
| 403 |
-
$order = wc_get_order( $item->order_id );
|
| 404 |
-
if ( $order ) {
|
| 405 |
-
return '<a href="' . admin_url( 'post.php?post=' . $item->order_id . '&action=edit' ) . '">' . $order->get_order_number() . '</a>';
|
| 406 |
-
} else {
|
| 407 |
-
return $item->order_id;
|
| 408 |
-
}
|
| 409 |
-
case 'status' :
|
| 410 |
-
return $item->status;
|
| 411 |
-
case 'time' :
|
| 412 |
-
return date_i18n( get_option( 'date_format' ), strtotime( $item->time ) );
|
| 413 |
-
}
|
| 414 |
-
}
|
| 415 |
-
|
| 416 |
-
|
| 417 |
-
/**
|
| 418 |
-
* column_cb function.
|
| 419 |
-
*
|
| 420 |
-
* @access public
|
| 421 |
-
*
|
| 422 |
-
* @param mixed $item
|
| 423 |
-
*
|
| 424 |
-
* @return unknown
|
| 425 |
-
*/
|
| 426 |
-
function column_cb( $item )
|
| 427 |
-
{
|
| 428 |
-
return sprintf(
|
| 429 |
-
'<input type="checkbox" name="%1$s[]" value="%2$s" />',
|
| 430 |
-
/*$1%s*/
|
| 431 |
-
'id',
|
| 432 |
-
/*$2%s*/
|
| 433 |
-
$item->id
|
| 434 |
-
);
|
| 435 |
-
}
|
| 436 |
-
|
| 437 |
-
|
| 438 |
-
/**
|
| 439 |
-
* get_columns function.
|
| 440 |
-
*
|
| 441 |
-
* @access public
|
| 442 |
-
* @return unknown
|
| 443 |
-
*/
|
| 444 |
-
function get_columns()
|
| 445 |
-
{
|
| 446 |
-
$columns = array(
|
| 447 |
-
'cb' => '<input type="checkbox" />',
|
| 448 |
-
'product_id' => __( 'Product', 'wcvendors' ),
|
| 449 |
-
'order_id' => __( 'Order ID', 'wcvendors' ),
|
| 450 |
-
'vendor_id' => __( 'Vendor', 'wcvendors' ),
|
| 451 |
-
'total_due' => __( 'Commission', 'wcvendors' ),
|
| 452 |
-
'total_shipping' => __( 'Shipping', 'wcvendors' ),
|
| 453 |
-
'tax' => __( 'Tax', 'wcvendors' ),
|
| 454 |
-
'totals' => __( 'Total', 'wcvendors' ),
|
| 455 |
-
'status' => __( 'Status', 'wcvendors' ),
|
| 456 |
-
'time' => __( 'Date', 'wcvendors' ),
|
| 457 |
-
);
|
| 458 |
-
|
| 459 |
-
if ( ! wc_tax_enabled() ) unset( $columns[ 'tax'] );
|
| 460 |
-
|
| 461 |
-
return $columns;
|
| 462 |
-
}
|
| 463 |
-
|
| 464 |
-
|
| 465 |
-
/**
|
| 466 |
-
* get_sortable_columns function.
|
| 467 |
-
*
|
| 468 |
-
* @access public
|
| 469 |
-
* @return unknown
|
| 470 |
-
*/
|
| 471 |
-
function get_sortable_columns()
|
| 472 |
-
{
|
| 473 |
-
$sortable_columns = array(
|
| 474 |
-
'time' => array( 'time', true ),
|
| 475 |
-
'product_id' => array( 'product_id', false ),
|
| 476 |
-
'order_id' => array( 'order_id', false ),
|
| 477 |
-
'total_due' => array( 'total_due', false ),
|
| 478 |
-
'total_shipping' => array( 'total_shipping', false ),
|
| 479 |
-
'tax' => array( 'tax', false ),
|
| 480 |
-
'totals' => array( 'totals', false ),
|
| 481 |
-
'status' => array( 'status', false ),
|
| 482 |
-
'vendor_id' => array( 'vendor_id', false ),
|
| 483 |
-
'status' => array( 'status', false ),
|
| 484 |
-
);
|
| 485 |
-
|
| 486 |
-
if ( ! wc_tax_enabled() ) unset( $sortable_columns[ 'tax'] );
|
| 487 |
-
|
| 488 |
-
return $sortable_columns;
|
| 489 |
-
}
|
| 490 |
-
|
| 491 |
-
|
| 492 |
-
/**
|
| 493 |
-
* Get bulk actions
|
| 494 |
-
*
|
| 495 |
-
* @return unknown
|
| 496 |
-
*/
|
| 497 |
-
function get_bulk_actions()
|
| 498 |
-
{
|
| 499 |
-
$actions = array(
|
| 500 |
-
'mark_paid' => __( 'Mark paid', 'wcvendors' ),
|
| 501 |
-
'mark_due' => __( 'Mark due', 'wcvendors' ),
|
| 502 |
-
'mark_reversed' => __( 'Mark reversed', 'wcvendors' ),
|
| 503 |
-
// 'delete' => __('Delete', 'wcvendors'),
|
| 504 |
-
);
|
| 505 |
-
|
| 506 |
-
$actions = apply_filters('wcv_edit_bulk_actions', $actions);
|
| 507 |
-
|
| 508 |
-
return $actions;
|
| 509 |
-
}
|
| 510 |
-
|
| 511 |
-
|
| 512 |
-
/**
|
| 513 |
-
*
|
| 514 |
-
*/
|
| 515 |
-
function extra_tablenav( $which )
|
| 516 |
-
{
|
| 517 |
-
$m = isset( $_GET[ 'm' ] ) ? (int) $_GET[ 'm' ] : 0;
|
| 518 |
-
$com_status = isset( $_GET[ 'com_status' ] ) ? $_GET[ 'com_status' ] : '';
|
| 519 |
-
$vendor_id = isset( $_GET[ 'vendor_id' ] ) ? $_GET[ 'vendor_id' ] : '';
|
| 520 |
-
$args_url = '';
|
| 521 |
-
|
| 522 |
-
if ( $m ) $args_url .= '&m='. $m;
|
| 523 |
-
if ( $com_status ) $args_url .= '&com_status='. $com_status;
|
| 524 |
-
if ( $vendor_id ) $args_url .= '&vendor_id='. $vendor_id;
|
| 525 |
-
|
| 526 |
-
if ( $which == 'top' ) {
|
| 527 |
-
echo '<div class="alignleft actions" style="width: 70%;">';
|
| 528 |
-
|
| 529 |
-
// Months drop down
|
| 530 |
-
$this->months_dropdown( 'commission' );
|
| 531 |
-
|
| 532 |
-
// commission status drop down
|
| 533 |
-
$this->status_dropdown( 'commission' );
|
| 534 |
-
|
| 535 |
-
// Vendor drop down
|
| 536 |
-
$this->vendor_dropdown( 'commission' );
|
| 537 |
-
|
| 538 |
-
submit_button( __( 'Filter' ), false, false, false, array( 'id' => "post-query-submit", 'name' => 'do-filter' ) );
|
| 539 |
-
|
| 540 |
-
echo '<a class="button" style="width: 110px; float: left;" href="' . wp_nonce_url( admin_url( 'admin.php?page=pv_admin_commissions&action=export_commissions'. $args_url ), 'export_commissions', 'nonce' ) . '">' . __('Export to CSV') . '</a>';
|
| 541 |
-
echo '</div>';
|
| 542 |
-
|
| 543 |
-
}
|
| 544 |
-
}
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
/**
|
| 548 |
-
* Display a monthly dropdown for filtering items
|
| 549 |
-
*
|
| 550 |
-
* @since 3.1.0
|
| 551 |
-
* @access protected
|
| 552 |
-
*
|
| 553 |
-
* @param unknown $post_type
|
| 554 |
-
*/
|
| 555 |
-
function months_dropdown( $post_type )
|
| 556 |
-
{
|
| 557 |
-
global $wpdb, $wp_locale;
|
| 558 |
-
|
| 559 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 560 |
-
|
| 561 |
-
$months = $wpdb->get_results( "
|
| 562 |
-
SELECT DISTINCT YEAR( time ) AS year, MONTH( time ) AS month
|
| 563 |
-
FROM $table_name
|
| 564 |
-
ORDER BY time DESC
|
| 565 |
-
" );
|
| 566 |
-
|
| 567 |
-
$month_count = count( $months );
|
| 568 |
-
|
| 569 |
-
if ( !$month_count || ( 1 == $month_count && 0 == $months[ 0 ]->month ) )
|
| 570 |
-
return;
|
| 571 |
-
|
| 572 |
-
$m = isset( $_GET[ 'm' ] ) ? (int) $_GET[ 'm' ] : 0;
|
| 573 |
-
?>
|
| 574 |
-
<select name="m" id="filter-by-date">
|
| 575 |
-
<option<?php selected( $m, 0 ); ?> value='0'><?php _e( 'Show all dates', 'wcvendors' ); ?></option>
|
| 576 |
-
<?php
|
| 577 |
-
foreach ( $months as $arc_row ) {
|
| 578 |
-
if ( 0 == $arc_row->year )
|
| 579 |
-
continue;
|
| 580 |
-
|
| 581 |
-
$month = zeroise( $arc_row->month, 2 );
|
| 582 |
-
$year = $arc_row->year;
|
| 583 |
-
|
| 584 |
-
printf( "<option %s value='%s'>%s</option>\n",
|
| 585 |
-
selected( $m, $year . $month, false ),
|
| 586 |
-
esc_attr( $arc_row->year . $month ),
|
| 587 |
-
/* translators: 1: month name, 2: 4-digit year */
|
| 588 |
-
sprintf( __( '%1$s %2$d' ), $wp_locale->get_month( $month ), $year )
|
| 589 |
-
);
|
| 590 |
-
}
|
| 591 |
-
?>
|
| 592 |
-
</select>
|
| 593 |
-
|
| 594 |
-
<?php
|
| 595 |
-
}
|
| 596 |
-
|
| 597 |
-
/**
|
| 598 |
-
* Display a status dropdown for filtering items
|
| 599 |
-
*
|
| 600 |
-
* @since 3.1.0
|
| 601 |
-
* @access protected
|
| 602 |
-
*
|
| 603 |
-
* @param unknown $post_type
|
| 604 |
-
*/
|
| 605 |
-
function status_dropdown( $post_type )
|
| 606 |
-
{
|
| 607 |
-
$com_status = isset( $_GET[ 'com_status' ] ) ? $_GET[ 'com_status' ] : '';
|
| 608 |
-
?>
|
| 609 |
-
<select name="com_status">
|
| 610 |
-
<option<?php selected( $com_status, '' ); ?> value=''><?php _e( 'Show all Statuses', 'wcvendors' ); ?></option>
|
| 611 |
-
<option<?php selected( $com_status, 'due' ); ?> value="due"><?php _e( 'Due', 'wcvendors' ); ?></option>
|
| 612 |
-
<option<?php selected( $com_status, 'paid' ); ?> value="paid"><?php _e( 'Paid', 'wcvendors' ); ?></option>
|
| 613 |
-
<option<?php selected( $com_status, 'reversed' ); ?> value="reversed"><?php _e( 'Reversed', 'wcvendors' ); ?></option>
|
| 614 |
-
</select>
|
| 615 |
-
<?php
|
| 616 |
-
}
|
| 617 |
-
|
| 618 |
-
/**
|
| 619 |
-
* Display a vendor dropdown for filtering commissions
|
| 620 |
-
*
|
| 621 |
-
* @since 1.9.2
|
| 622 |
-
* @access public
|
| 623 |
-
*
|
| 624 |
-
* @param unknown $post_type
|
| 625 |
-
*/
|
| 626 |
-
public function vendor_dropdown( $post_type ){
|
| 627 |
-
|
| 628 |
-
$user_args = array( 'fields' => array( 'ID', 'display_name' ) );
|
| 629 |
-
$vendor_id = isset( $_GET[ 'vendor_id' ] ) ? $_GET[ 'vendor_id' ] : '';
|
| 630 |
-
$new_args = $user_args;
|
| 631 |
-
$new_args[ 'role' ] = 'vendor';
|
| 632 |
-
$users = get_users( $new_args );
|
| 633 |
-
|
| 634 |
-
// Generate the drop down
|
| 635 |
-
$output = '<select style="width: 30%;" name="vendor_id" id="vendor_id" class="select2">';
|
| 636 |
-
$output .= "<option></option>";
|
| 637 |
-
foreach ( (array) $users as $user ) {
|
| 638 |
-
$select = selected( $user->ID, $vendor_id, false );
|
| 639 |
-
$output .= "<option value='$user->ID' $select>$user->display_name</option>";
|
| 640 |
-
}
|
| 641 |
-
$output .= '</select>';
|
| 642 |
-
|
| 643 |
-
echo $output;
|
| 644 |
-
|
| 645 |
-
} // vendor_dropdown()
|
| 646 |
-
|
| 647 |
-
|
| 648 |
-
|
| 649 |
-
/**
|
| 650 |
-
* Process bulk actions
|
| 651 |
-
*
|
| 652 |
-
* @return unknown
|
| 653 |
-
*/
|
| 654 |
-
function process_bulk_action()
|
| 655 |
-
{
|
| 656 |
-
if ( !isset( $_GET[ 'id' ] ) ) return;
|
| 657 |
-
|
| 658 |
-
$items = array_map( 'intval', $_GET[ 'id' ] );
|
| 659 |
-
$ids = implode( ',', $items );
|
| 660 |
-
|
| 661 |
-
switch ( $this->current_action() ) {
|
| 662 |
-
case 'mark_paid':
|
| 663 |
-
$result = $this->mark_paid( $ids );
|
| 664 |
-
|
| 665 |
-
if ( $result )
|
| 666 |
-
echo '<div class="updated"><p>' . __( 'Commission marked paid.', 'wcvendors' ) . '</p></div>';
|
| 667 |
-
break;
|
| 668 |
-
|
| 669 |
-
case 'mark_due':
|
| 670 |
-
$result = $this->mark_due( $ids );
|
| 671 |
-
|
| 672 |
-
if ( $result )
|
| 673 |
-
echo '<div class="updated"><p>' . __( 'Commission marked due.', 'wcvendors' ) . '</p></div>';
|
| 674 |
-
break;
|
| 675 |
-
|
| 676 |
-
case 'mark_reversed':
|
| 677 |
-
$result = $this->mark_reversed( $ids );
|
| 678 |
-
|
| 679 |
-
if ( $result )
|
| 680 |
-
echo '<div class="updated"><p>' . __( 'Commission marked reversed.', 'wcvendors' ) . '</p></div>';
|
| 681 |
-
break;
|
| 682 |
-
|
| 683 |
-
default:
|
| 684 |
-
// code...
|
| 685 |
-
do_action('wcv_edit_process_bulk_actions', $this->current_action(), $ids);
|
| 686 |
-
break;
|
| 687 |
-
}
|
| 688 |
-
|
| 689 |
-
}
|
| 690 |
-
|
| 691 |
-
|
| 692 |
-
/**
|
| 693 |
-
*
|
| 694 |
-
*
|
| 695 |
-
* @param unknown $ids (optional)
|
| 696 |
-
*
|
| 697 |
-
* @return unknown
|
| 698 |
-
*/
|
| 699 |
-
public function mark_paid( $ids = array() )
|
| 700 |
-
{
|
| 701 |
-
global $wpdb;
|
| 702 |
-
|
| 703 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 704 |
-
|
| 705 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE id IN ($ids) AND `status` = 'due'";
|
| 706 |
-
$result = $wpdb->query( $query );
|
| 707 |
-
|
| 708 |
-
return $result;
|
| 709 |
-
}
|
| 710 |
-
|
| 711 |
-
|
| 712 |
-
/**
|
| 713 |
-
*
|
| 714 |
-
*
|
| 715 |
-
* @param unknown $ids (optional)
|
| 716 |
-
*
|
| 717 |
-
* @return unknown
|
| 718 |
-
*/
|
| 719 |
-
public function mark_reversed( $ids = array() )
|
| 720 |
-
{
|
| 721 |
-
global $wpdb;
|
| 722 |
-
|
| 723 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 724 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'reversed' WHERE id IN ($ids)";
|
| 725 |
-
$result = $wpdb->query( $query );
|
| 726 |
-
|
| 727 |
-
return $result;
|
| 728 |
-
|
| 729 |
-
}
|
| 730 |
-
|
| 731 |
-
|
| 732 |
-
/**
|
| 733 |
-
*
|
| 734 |
-
*
|
| 735 |
-
* @param unknown $ids (optional)
|
| 736 |
-
*
|
| 737 |
-
* @return unknown
|
| 738 |
-
*/
|
| 739 |
-
public function mark_due( $ids = array() )
|
| 740 |
-
{
|
| 741 |
-
global $wpdb;
|
| 742 |
-
|
| 743 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 744 |
-
|
| 745 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'due' WHERE id IN ($ids)";
|
| 746 |
-
$result = $wpdb->query( $query );
|
| 747 |
-
|
| 748 |
-
return $result;
|
| 749 |
-
}
|
| 750 |
-
|
| 751 |
-
|
| 752 |
-
/**
|
| 753 |
-
* cubrid_prepare(conn_identifier, prepare_stmt)_items function.
|
| 754 |
-
*
|
| 755 |
-
* @access public
|
| 756 |
-
*/
|
| 757 |
-
function prepare_items()
|
| 758 |
-
{
|
| 759 |
-
global $wpdb;
|
| 760 |
-
|
| 761 |
-
$_SERVER['REQUEST_URI'] = remove_query_arg( '_wp_http_referer', $_SERVER['REQUEST_URI'] );
|
| 762 |
-
|
| 763 |
-
$per_page = $this->get_items_per_page( 'commission_per_page', 10 );
|
| 764 |
-
$current_page = $this->get_pagenum();
|
| 765 |
-
|
| 766 |
-
$orderby = !empty( $_REQUEST[ 'orderby' ] ) ? esc_attr( $_REQUEST[ 'orderby' ] ) : 'time';
|
| 767 |
-
$order = ( !empty( $_REQUEST[ 'order' ] ) && $_REQUEST[ 'order' ] == 'asc' ) ? 'ASC' : 'DESC';
|
| 768 |
-
$com_status = !empty( $_REQUEST[ 'com_status' ] ) ? esc_attr( $_REQUEST[ 'com_status' ] ) : '';
|
| 769 |
-
$vendor_id = !empty( $_REQUEST[ 'vendor_id' ] ) ? esc_attr( $_REQUEST[ 'vendor_id' ] ) : '';
|
| 770 |
-
$status_sql = '';
|
| 771 |
-
$time_sql = '';
|
| 772 |
-
|
| 773 |
-
/**
|
| 774 |
-
* Init column headers
|
| 775 |
-
*/
|
| 776 |
-
$this->_column_headers = $this->get_column_info();
|
| 777 |
-
|
| 778 |
-
/**
|
| 779 |
-
* Process bulk actions
|
| 780 |
-
*/
|
| 781 |
-
$this->process_bulk_action();
|
| 782 |
-
|
| 783 |
-
/**
|
| 784 |
-
* Get items
|
| 785 |
-
*/
|
| 786 |
-
$sql = "SELECT COUNT(id) FROM {$wpdb->prefix}pv_commission";
|
| 787 |
-
|
| 788 |
-
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 789 |
-
|
| 790 |
-
$year = substr( $_GET[ 'm' ], 0, 4 );
|
| 791 |
-
$month = substr( $_GET[ 'm' ], 4, 2 );
|
| 792 |
-
|
| 793 |
-
$time_sql = "
|
| 794 |
-
WHERE MONTH(`time`) = '$month'
|
| 795 |
-
AND YEAR(`time`) = '$year'
|
| 796 |
-
";
|
| 797 |
-
|
| 798 |
-
$sql .= $time_sql;
|
| 799 |
-
}
|
| 800 |
-
|
| 801 |
-
if ( !empty( $_GET[ 'com_status' ] ) ) {
|
| 802 |
-
|
| 803 |
-
if ( $time_sql == '' ) {
|
| 804 |
-
$status_sql = "
|
| 805 |
-
WHERE status = '$com_status'
|
| 806 |
-
";
|
| 807 |
-
} else {
|
| 808 |
-
$status_sql = "
|
| 809 |
-
AND status = '$com_status'
|
| 810 |
-
";
|
| 811 |
-
}
|
| 812 |
-
|
| 813 |
-
$sql .= $status_sql;
|
| 814 |
-
}
|
| 815 |
-
|
| 816 |
-
|
| 817 |
-
if ( !empty( $_GET[ 'vendor_id' ] ) ) {
|
| 818 |
-
|
| 819 |
-
if ( $time_sql == '' && $status_sql == '' ) {
|
| 820 |
-
$vendor_sql = "
|
| 821 |
-
WHERE vendor_id = '$vendor_id'
|
| 822 |
-
";
|
| 823 |
-
} else {
|
| 824 |
-
$vendor_sql = "
|
| 825 |
-
AND vendor_id = '$vendor_id'
|
| 826 |
-
";
|
| 827 |
-
}
|
| 828 |
-
|
| 829 |
-
$sql .= $vendor_sql;
|
| 830 |
-
}
|
| 831 |
-
|
| 832 |
-
$max = $wpdb->get_var( $sql );
|
| 833 |
-
|
| 834 |
-
$sql = "
|
| 835 |
-
SELECT * FROM {$wpdb->prefix}pv_commission
|
| 836 |
-
";
|
| 837 |
-
|
| 838 |
-
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 839 |
-
$sql .= $time_sql;
|
| 840 |
-
}
|
| 841 |
-
|
| 842 |
-
if ( !empty( $_GET['com_status'] ) ) {
|
| 843 |
-
$sql .= $status_sql;
|
| 844 |
-
}
|
| 845 |
-
|
| 846 |
-
if ( !empty( $_GET['vendor_id'] ) ) {
|
| 847 |
-
$sql .= $vendor_sql;
|
| 848 |
-
}
|
| 849 |
-
|
| 850 |
-
$offset = ( $current_page - 1 ) * $per_page;
|
| 851 |
-
|
| 852 |
-
$sql .= "
|
| 853 |
-
ORDER BY `{$orderby}` {$order}
|
| 854 |
-
LIMIT {$offset}, {$per_page}
|
| 855 |
-
";
|
| 856 |
-
|
| 857 |
-
// $this->items = $wpdb->get_results( $wpdb->prepare( $sql, ( $current_page - 1 ) * $per_page, $per_page ) );
|
| 858 |
-
$this->items = $wpdb->get_results( $sql );
|
| 859 |
-
|
| 860 |
-
/**
|
| 861 |
-
* Pagination
|
| 862 |
-
*/
|
| 863 |
-
$this->set_pagination_args( array(
|
| 864 |
-
'total_items' => $max,
|
| 865 |
-
'per_page' => $per_page,
|
| 866 |
-
'total_pages' => ceil( $max / $per_page )
|
| 867 |
-
) );
|
| 868 |
-
}
|
| 869 |
-
|
| 870 |
-
public function get_views() {
|
| 871 |
-
$views = array(
|
| 872 |
-
'all' => '<li class="all"><a href="' . admin_url( 'admin.php?page=pv_admin_commissions' ) . '">' . __( 'All', 'wcvendors' ) . '</a></li>',
|
| 873 |
-
'due' => '<li class="all"><a href="' . admin_url( 'admin.php?page=pv_admin_commissions&com_status=due' ) . '">' . __( 'Due', 'wcvendors' ) . '</a></li>',
|
| 874 |
-
'paid' => '<li class="all"><a href="' . admin_url( 'admin.php?page=pv_admin_commissions&com_status=paid' ) . '">' . __( 'Paid', 'wcvendors' ) . '</a></li>',
|
| 875 |
-
'void' => '<li class="all"><a href="' . admin_url( 'admin.php?page=pv_admin_commissions&com_status=void' ) . '">' . __( 'Void', 'wcvendors' ) . '</a></li>',
|
| 876 |
-
);
|
| 877 |
-
|
| 878 |
-
return $views;
|
| 879 |
-
}
|
| 880 |
-
|
| 881 |
-
|
| 882 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-admin-reports.php
DELETED
|
@@ -1,544 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* WCV_Admin_Reports class.
|
| 4 |
-
*
|
| 5 |
-
* Shows reports related to software in the woocommerce backend
|
| 6 |
-
*
|
| 7 |
-
* @author Matt Gates <http://mgates.me>
|
| 8 |
-
* @package
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
class WCV_Admin_Reports
|
| 13 |
-
{
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* __construct function.
|
| 18 |
-
*
|
| 19 |
-
* @access public
|
| 20 |
-
* @return void
|
| 21 |
-
*
|
| 22 |
-
* @param bool $debug (optional) (default: false)
|
| 23 |
-
*/
|
| 24 |
-
function __construct( $debug = false )
|
| 25 |
-
{
|
| 26 |
-
add_filter( 'woocommerce_admin_reports', array( $this, 'reports_tab' ) );
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* reports_tab function.
|
| 31 |
-
*
|
| 32 |
-
* @access public
|
| 33 |
-
*
|
| 34 |
-
* @param unknown $reports
|
| 35 |
-
*
|
| 36 |
-
* @return void
|
| 37 |
-
*/
|
| 38 |
-
function reports_tab( $reports )
|
| 39 |
-
{
|
| 40 |
-
$reports[ 'vendors' ] = array(
|
| 41 |
-
'title' => __( 'WC Vendors', 'wc-vendors' ),
|
| 42 |
-
'charts' => array(
|
| 43 |
-
array(
|
| 44 |
-
'title' => __( 'Overview', 'wc-vendors' ),
|
| 45 |
-
'description' => '',
|
| 46 |
-
'hide_title' => true,
|
| 47 |
-
'function' => array( $this, 'sales' ),
|
| 48 |
-
),
|
| 49 |
-
array(
|
| 50 |
-
'title' => __( 'Commission by vendor', 'wc-vendors' ),
|
| 51 |
-
'description' => '',
|
| 52 |
-
'hide_title' => true,
|
| 53 |
-
'function' => array( $this, 'commission' ),
|
| 54 |
-
),
|
| 55 |
-
array(
|
| 56 |
-
'title' => __( 'Commission by product', 'wc-vendors' ),
|
| 57 |
-
'description' => '',
|
| 58 |
-
'hide_title' => true,
|
| 59 |
-
'function' => array( $this, 'commission' ),
|
| 60 |
-
),
|
| 61 |
-
array(
|
| 62 |
-
'title' => __( 'Commission Totals', 'wc-vendors' ),
|
| 63 |
-
'description' => __( 'Commission totals for all vendors includes shipping and taxes. By default no date range is used and all due commissions are returned. Use the date range to filter.', 'wc-vendors' ),
|
| 64 |
-
'hide_title' => true,
|
| 65 |
-
'function' => array( $this, 'commission_totals' ),
|
| 66 |
-
),
|
| 67 |
-
),
|
| 68 |
-
);
|
| 69 |
-
|
| 70 |
-
return apply_filters( 'wcvendors_admin_reports_tab', $reports );
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
/**
|
| 75 |
-
*
|
| 76 |
-
*/
|
| 77 |
-
function sales()
|
| 78 |
-
{
|
| 79 |
-
|
| 80 |
-
global $start_date, $end_date, $woocommerce, $wpdb;
|
| 81 |
-
|
| 82 |
-
$commission_status_labels = WCV_Commission::commission_status();
|
| 83 |
-
|
| 84 |
-
$start_date = !empty( $_POST[ 'start_date' ] ) ? $_POST[ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 85 |
-
$end_date = !empty( $_POST[ 'end_date' ] ) ? $_POST[ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 86 |
-
|
| 87 |
-
if ( !empty( $_POST[ 'start_date' ] ) ) {
|
| 88 |
-
$start_date = strtotime( $_POST[ 'start_date' ] );
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
if ( !empty( $_POST[ 'end_date' ] ) ) {
|
| 92 |
-
$end_date = strtotime( $_POST[ 'end_date' ] );
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
$after = date( 'Y-m-d', $start_date );
|
| 96 |
-
$before = date( 'Y-m-d', strtotime( '+1 day', $end_date ) );
|
| 97 |
-
|
| 98 |
-
$commission_due = $wpdb->get_var( "
|
| 99 |
-
SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'due'
|
| 100 |
-
AND time >= '" . $after . "'
|
| 101 |
-
AND time <= '" . $before . "'
|
| 102 |
-
" );
|
| 103 |
-
|
| 104 |
-
$reversed = $wpdb->get_var( "
|
| 105 |
-
SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'reversed'
|
| 106 |
-
AND time >= '" . $after . "'
|
| 107 |
-
AND time <= '" . $before . "'
|
| 108 |
-
" );
|
| 109 |
-
|
| 110 |
-
$paid = $wpdb->get_var( "
|
| 111 |
-
SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'paid'
|
| 112 |
-
AND time >= '" . $after . "'
|
| 113 |
-
AND time <= '" . $before . "'
|
| 114 |
-
" );
|
| 115 |
-
|
| 116 |
-
?>
|
| 117 |
-
|
| 118 |
-
<form method="post" action="">
|
| 119 |
-
<p><label for="from"><?php _e( 'From:', 'wc-vendors' ); ?></label>
|
| 120 |
-
<input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $start_date ) ); ?>" name="start_date" class="range_datepicker from" id="from" />
|
| 121 |
-
<label for="to"><?php _e( 'To:', 'wc-vendors' ); ?></label>
|
| 122 |
-
<input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $end_date ) ); ?>" name="end_date" class="range_datepicker to" id="to" />
|
| 123 |
-
<input type="submit" class="button" value="<?php _e( 'Show', 'wc-vendors' ); ?>"/></p>
|
| 124 |
-
</form>
|
| 125 |
-
|
| 126 |
-
<div id="poststuff" class="woocommerce-reports-wrap">
|
| 127 |
-
<div class="woocommerce-reports-sidebar">
|
| 128 |
-
<div class="postbox">
|
| 129 |
-
<h3><span><?php _e( 'Total paid in range', 'wc-vendors' ); ?></span></h3>
|
| 130 |
-
|
| 131 |
-
<div class="inside">
|
| 132 |
-
<p class="stat"><?php if ( $paid > 0 ) echo wc_price( $paid ); else _e( 'n/a', 'wc-vendors' ); ?></p>
|
| 133 |
-
</div>
|
| 134 |
-
</div>
|
| 135 |
-
<div class="postbox">
|
| 136 |
-
<h3><span><?php _e( 'Total due in range', 'wc-vendors' ); ?></span></h3>
|
| 137 |
-
|
| 138 |
-
<div class="inside">
|
| 139 |
-
<p class="stat"><?php if ( $commission_due > 0 ) echo wc_price( $commission_due ); else _e( 'n/a', 'wc-vendors' ); ?></p>
|
| 140 |
-
</div>
|
| 141 |
-
</div>
|
| 142 |
-
<div class="postbox">
|
| 143 |
-
<h3><span><?php _e( 'Total reversed in range', 'wc-vendors' ); ?></span></h3>
|
| 144 |
-
|
| 145 |
-
<div class="inside">
|
| 146 |
-
<p class="stat"><?php if ( $reversed > 0 ) echo wc_price( $reversed ); else _e( 'n/a', 'wc-vendors' ); ?></p>
|
| 147 |
-
</div>
|
| 148 |
-
</div>
|
| 149 |
-
</div>
|
| 150 |
-
|
| 151 |
-
<div class="woocommerce-reports-main">
|
| 152 |
-
<div class="postbox">
|
| 153 |
-
<h3><span><?php _e( 'Recent Commission', 'wc-vendors' ); ?></span></h3>
|
| 154 |
-
|
| 155 |
-
<div>
|
| 156 |
-
<?php
|
| 157 |
-
$commission = $wpdb->get_results( "
|
| 158 |
-
SELECT * FROM {$wpdb->prefix}pv_commission
|
| 159 |
-
WHERE time >= '" . $after . "'
|
| 160 |
-
AND time <= '" . $before . "'
|
| 161 |
-
ORDER BY time DESC
|
| 162 |
-
" );
|
| 163 |
-
|
| 164 |
-
if ( sizeof( $commission ) > 0 ) {
|
| 165 |
-
|
| 166 |
-
?>
|
| 167 |
-
<div class="woocommerce_order_items_wrapper">
|
| 168 |
-
<table id="commission-table" class="woocommerce_order_items" cellspacing="0">
|
| 169 |
-
<thead>
|
| 170 |
-
<tr>
|
| 171 |
-
<th><?php _e( 'Order', 'wc-vendors' ) ?></th>
|
| 172 |
-
<th><?php _e( 'Product', 'wc-vendors' ) ?></th>
|
| 173 |
-
<th><?php _e( 'Vendor', 'wc-vendors' ) ?></th>
|
| 174 |
-
<th><?php _e( 'Total', 'wc-vendors' ) ?></th>
|
| 175 |
-
<th><?php _e( 'Date & Time', 'wc-vendors' ) ?></th>
|
| 176 |
-
<th><?php _e( 'Status', 'wc-vendors' ) ?></th>
|
| 177 |
-
</tr>
|
| 178 |
-
</thead>
|
| 179 |
-
<tbody>
|
| 180 |
-
<?php $i = 1;
|
| 181 |
-
foreach ( $commission as $row ) : $i++ ?>
|
| 182 |
-
<tr<?php if ( $i % 2 == 1 ) echo ' class="alternate"' ?>>
|
| 183 |
-
<td><?php if ( $row->order_id ) : ?><a
|
| 184 |
-
href="<?php echo admin_url( 'post.php?post=' . $row->order_id . '&action=edit' ); ?>"><?php echo $row->order_id; ?></a><?php else : _e( 'N/A', 'wc-vendors' ); endif; ?>
|
| 185 |
-
</td>
|
| 186 |
-
<td><?php echo get_the_title( $row->product_id ); ?></td>
|
| 187 |
-
<td><?php echo WCV_Vendors::get_vendor_shop_name( $row->vendor_id ); ?></td>
|
| 188 |
-
<td><?php echo wc_price( $row->total_due + $row->total_shipping + $row->tax ) ?></td>
|
| 189 |
-
<td><?php echo date_i18n( __( 'D j M Y \a\t h:ia', 'wc-vendors' ), strtotime( $row->time ) ) ?></td>
|
| 190 |
-
<td><?php echo $commission_status_labels[ $row->status ]; ?></td>
|
| 191 |
-
</tr>
|
| 192 |
-
<?php endforeach; ?>
|
| 193 |
-
</tbody>
|
| 194 |
-
</table>
|
| 195 |
-
</div>
|
| 196 |
-
<?php
|
| 197 |
-
} else {
|
| 198 |
-
?><p><?php _e( 'No commission yet', 'wc-vendors' ) ?></p><?php
|
| 199 |
-
}
|
| 200 |
-
?>
|
| 201 |
-
</div>
|
| 202 |
-
</div>
|
| 203 |
-
</div>
|
| 204 |
-
</div>
|
| 205 |
-
<?php
|
| 206 |
-
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
/**
|
| 211 |
-
*
|
| 212 |
-
*/
|
| 213 |
-
function commission()
|
| 214 |
-
{
|
| 215 |
-
global $start_date, $end_date, $woocommerce, $wpdb;
|
| 216 |
-
|
| 217 |
-
$latest_woo = version_compare( $woocommerce->version, '2.3', '>' );
|
| 218 |
-
|
| 219 |
-
$first_year = $wpdb->get_var( "SELECT time FROM {$wpdb->prefix}pv_commission ORDER BY time ASC LIMIT 1;" );
|
| 220 |
-
$first_year = $first_year ? date( 'Y', strtotime( $first_year ) ) : date( 'Y' );
|
| 221 |
-
$current_year = isset( $_POST[ 'show_year' ] ) ? $_POST[ 'show_year' ] : date( 'Y', current_time( 'timestamp' ) );
|
| 222 |
-
$start_date = strtotime( $current_year . '0101' );
|
| 223 |
-
|
| 224 |
-
$vendors = get_users( array( 'role' => 'vendor' ) );
|
| 225 |
-
$vendors = apply_filters( 'pv_commission_vendors_list', $vendors );
|
| 226 |
-
$selected_vendor = !empty( $_POST[ 'show_vendor' ] ) ? (int) $_POST[ 'show_vendor' ] : false;
|
| 227 |
-
$products = !empty( $_POST[ 'product_ids' ] ) ? (array) $_POST[ 'product_ids' ] : array();
|
| 228 |
-
|
| 229 |
-
?>
|
| 230 |
-
|
| 231 |
-
<form method="post" action="" class="report_filters">
|
| 232 |
-
<label for="show_year"><?php _e( 'Show:', 'wc-vendors' ); ?></label>
|
| 233 |
-
<select name="show_year" id="show_year">
|
| 234 |
-
<?php
|
| 235 |
-
for ( $i = $first_year; $i <= date( 'Y' ); $i++ )
|
| 236 |
-
printf( '<option value="%s" %s>%s</option>', $i, selected( $current_year, $i, false ), $i );
|
| 237 |
-
?>
|
| 238 |
-
</select>
|
| 239 |
-
<?php if ( $_GET[ 'report' ] == 2 ) {
|
| 240 |
-
if ($latest_woo) { ?>
|
| 241 |
-
<input type="hidden" class="wc-product-search" style="width:203px;" name="product_ids[]" data-placeholder="<?php _e( 'Search for a product…', 'woocommerce' ); ?>" data-action="woocommerce_json_search_products_and_variations" />
|
| 242 |
-
<?php } else { ?>
|
| 243 |
-
<select id="product_ids" name="product_ids[]" class="ajax_chosen_select_products" multiple="multiple"
|
| 244 |
-
data-placeholder="<?php _e( 'Type in a product name to start searching...', 'wc-vendors' ); ?>"
|
| 245 |
-
style="width: 400px;"></select>
|
| 246 |
-
<script type="text/javascript">
|
| 247 |
-
jQuery(function () {
|
| 248 |
-
|
| 249 |
-
// Ajax Chosen Product Selectors
|
| 250 |
-
jQuery("select.ajax_chosen_select_products").ajaxChosen({
|
| 251 |
-
method: 'GET',
|
| 252 |
-
url: '<?php echo admin_url('admin-ajax.php'); ?>',
|
| 253 |
-
dataType: 'json',
|
| 254 |
-
afterTypeDelay: 100,
|
| 255 |
-
data: {
|
| 256 |
-
action: 'woocommerce_json_search_products',
|
| 257 |
-
security: '<?php echo wp_create_nonce("search-products"); ?>'
|
| 258 |
-
}
|
| 259 |
-
}, function (data) {
|
| 260 |
-
|
| 261 |
-
var terms = {};
|
| 262 |
-
|
| 263 |
-
jQuery.each(data, function (i, val) {
|
| 264 |
-
terms[i] = val;
|
| 265 |
-
});
|
| 266 |
-
|
| 267 |
-
return terms;
|
| 268 |
-
});
|
| 269 |
-
|
| 270 |
-
});
|
| 271 |
-
</script>
|
| 272 |
-
|
| 273 |
-
<?php }
|
| 274 |
-
} else { ?>
|
| 275 |
-
<select class="chosen_select" id="show_vendor" name="show_vendor" style="width: 300px;"
|
| 276 |
-
data-placeholder="<?php _e( 'Select a vendor…', 'wc-vendors' ); ?>">
|
| 277 |
-
<option></option>
|
| 278 |
-
<?php foreach ( $vendors as $key => $vendor ) printf( '<option value="%s" %s>%s</option>', $vendor->ID, selected( $selected_vendor, $vendor->ID, false ), $vendor->display_name ); ?>
|
| 279 |
-
</select>
|
| 280 |
-
<?php } ?>
|
| 281 |
-
<input type="submit" class="button" value="<?php _e( 'Show', 'wc-vendors' ); ?>"/>
|
| 282 |
-
</form>
|
| 283 |
-
|
| 284 |
-
<?php
|
| 285 |
-
|
| 286 |
-
if ( !empty( $selected_vendor ) || !empty( $products ) ) {
|
| 287 |
-
|
| 288 |
-
foreach ($products as $key => $product_id) {
|
| 289 |
-
$_product = wc_get_product($product_id);
|
| 290 |
-
$childs = $_product->get_children();
|
| 291 |
-
$products = array_merge($childs, $products);
|
| 292 |
-
}
|
| 293 |
-
|
| 294 |
-
$commissions = array();
|
| 295 |
-
$filter = !empty( $selected_vendor ) ? (" WHERE vendor_id = " . $selected_vendor) : (" WHERE product_id IN ( " . implode( ', ', $products ) ." )");
|
| 296 |
-
|
| 297 |
-
$sql = "SELECT
|
| 298 |
-
SUM(total_due + total_shipping + tax) as total,
|
| 299 |
-
SUM(total_due) as commission,
|
| 300 |
-
SUM(total_shipping) as shipping,
|
| 301 |
-
SUM(tax) as tax
|
| 302 |
-
FROM {$wpdb->prefix}pv_commission
|
| 303 |
-
";
|
| 304 |
-
|
| 305 |
-
$paid_sql = "SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission " . $filter . " AND status = 'paid'";
|
| 306 |
-
$reversed_sql = "SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission" . $filter . " AND status = 'reversed'";
|
| 307 |
-
$date_sql = " AND date_format(`time`,'%%Y%%m') = %d";
|
| 308 |
-
|
| 309 |
-
for ( $count = 0; $count < 12; $count++ ) {
|
| 310 |
-
$time = strtotime( date( 'Ym', strtotime( '+ ' . $count . ' MONTH', $start_date ) ) . '01' );
|
| 311 |
-
if ( $time > current_time( 'timestamp' ) ) continue;
|
| 312 |
-
|
| 313 |
-
$month = date( 'Ym', strtotime( date( 'Ym', strtotime( '+ ' . $count . ' MONTH', $start_date ) ) . '01' ) );
|
| 314 |
-
|
| 315 |
-
$fetch_results = $wpdb->prepare( $sql . $filter . $date_sql, $month );
|
| 316 |
-
|
| 317 |
-
$results = $wpdb->get_results( $fetch_results );
|
| 318 |
-
if ( !empty( $results[ 0 ] ) ) {
|
| 319 |
-
extract( get_object_vars( $results[ 0 ] ) );
|
| 320 |
-
}
|
| 321 |
-
|
| 322 |
-
$paid = $wpdb->get_var( $wpdb->prepare( $paid_sql . $date_sql, $month ) );
|
| 323 |
-
$reversed = $wpdb->get_var( $wpdb->prepare( $reversed_sql . $date_sql, $month ) );
|
| 324 |
-
|
| 325 |
-
$commissions[ date( 'M', strtotime( $month . '01' ) ) ] = array(
|
| 326 |
-
'commission' => $commission,
|
| 327 |
-
'tax' => $tax,
|
| 328 |
-
'shipping' => $shipping,
|
| 329 |
-
'reversed' => $reversed,
|
| 330 |
-
'paid' => $paid,
|
| 331 |
-
'total' => $total - $reversed - $paid,
|
| 332 |
-
);
|
| 333 |
-
|
| 334 |
-
}
|
| 335 |
-
|
| 336 |
-
?>
|
| 337 |
-
|
| 338 |
-
<div class="woocommerce-reports-main">
|
| 339 |
-
<table class="widefat">
|
| 340 |
-
<thead>
|
| 341 |
-
<tr>
|
| 342 |
-
<th><?php _e( 'Month', 'wc-vendors' ); ?></th>
|
| 343 |
-
<th class="total_row"><?php _e( 'Commission Totals', 'wc-vendors' ); ?></th>
|
| 344 |
-
<th class="total_row"><?php _e( 'Tax', 'wc-vendors' ); ?></th>
|
| 345 |
-
<th class="total_row"><?php _e( 'Shipping', 'wc-vendors' ); ?></th>
|
| 346 |
-
<th class="total_row"><?php _e( 'Reversed', 'wc-vendors' ); ?></th>
|
| 347 |
-
<th class="total_row"><?php _e( 'Paid', 'wc-vendors' ); ?></th>
|
| 348 |
-
<th class="total_row"><?php _e( 'Due', 'wc-vendors' ); ?></th>
|
| 349 |
-
</tr>
|
| 350 |
-
</thead>
|
| 351 |
-
<tfoot>
|
| 352 |
-
<tr>
|
| 353 |
-
<?php
|
| 354 |
-
$total = array(
|
| 355 |
-
'commission' => 0,
|
| 356 |
-
'tax' => 0,
|
| 357 |
-
'shipping' => 0,
|
| 358 |
-
'reversed' => 0,
|
| 359 |
-
'paid' => 0,
|
| 360 |
-
'total' => 0,
|
| 361 |
-
);
|
| 362 |
-
|
| 363 |
-
foreach ( $commissions as $month => $commission ) {
|
| 364 |
-
$total[ 'commission' ] += $commission[ 'commission' ];
|
| 365 |
-
$total[ 'tax' ] += $commission[ 'tax' ];
|
| 366 |
-
$total[ 'shipping' ] += $commission[ 'shipping' ];
|
| 367 |
-
$total[ 'reversed' ] += $commission[ 'reversed' ];
|
| 368 |
-
$total[ 'paid' ] += $commission[ 'paid' ];
|
| 369 |
-
$total[ 'total' ] += $commission[ 'total' ];
|
| 370 |
-
}
|
| 371 |
-
|
| 372 |
-
echo '<td>' . __( 'Total', 'wc-vendors' ) . '</td>';
|
| 373 |
-
|
| 374 |
-
foreach ( $total as $value ) {
|
| 375 |
-
echo '<td class="total_row">' . wc_price( $value ) . '</td>';
|
| 376 |
-
}
|
| 377 |
-
?>
|
| 378 |
-
</tr>
|
| 379 |
-
</tfoot>
|
| 380 |
-
<tbody>
|
| 381 |
-
<?php
|
| 382 |
-
foreach ( $commissions as $month => $commission ) {
|
| 383 |
-
$alt = ( isset( $alt ) && $alt == 'alt' ) ? '' : 'alt';
|
| 384 |
-
|
| 385 |
-
echo '<tr class="' . $alt . '"><td>' . $month . '</td>';
|
| 386 |
-
|
| 387 |
-
foreach ( $commission as $value ) {
|
| 388 |
-
echo '<td class="total_row">' . wc_price( $value ) . '</td>';
|
| 389 |
-
}
|
| 390 |
-
|
| 391 |
-
echo '</tr>';
|
| 392 |
-
}
|
| 393 |
-
?>
|
| 394 |
-
</tbody>
|
| 395 |
-
</table>
|
| 396 |
-
</div>
|
| 397 |
-
|
| 398 |
-
<?php } ?>
|
| 399 |
-
<?php
|
| 400 |
-
|
| 401 |
-
}
|
| 402 |
-
|
| 403 |
-
|
| 404 |
-
/**
|
| 405 |
-
* Commission Totals for vendors reports
|
| 406 |
-
*
|
| 407 |
-
* @since 1.8.4
|
| 408 |
-
*/
|
| 409 |
-
function commission_totals(){
|
| 410 |
-
|
| 411 |
-
global $wpdb;
|
| 412 |
-
|
| 413 |
-
$total_start_date = !empty( $_POST[ 'total_start_date' ] ) ? $_POST[ 'total_start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 414 |
-
$total_end_date = !empty( $_POST[ 'total_end_date' ] ) ? $_POST[ 'total_end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 415 |
-
$commission_status = !empty( $_POST[ 'commission_status' ] ) ? $_POST[ 'commission_status' ] : 'due';
|
| 416 |
-
$date_sql = ( !empty( $_POST[ 'total_start_date' ] ) && !empty( $_POST[ 'total_end_date' ] ) ) ? " time BETWEEN '$total_start_date 00:00:00' AND '$total_end_date 23:59:59' AND" : "";
|
| 417 |
-
|
| 418 |
-
$status_sql = " status='$commission_status'";
|
| 419 |
-
|
| 420 |
-
$sql = "SELECT vendor_id, total_due, total_shipping, tax, status FROM {$wpdb->prefix}pv_commission WHERE";
|
| 421 |
-
|
| 422 |
-
$commissions = $wpdb->get_results( $sql . $date_sql . $status_sql );
|
| 423 |
-
|
| 424 |
-
if ( !empty( $_POST[ 'total_start_date' ] ) ) {
|
| 425 |
-
$total_start_date = strtotime( $_POST[ 'total_start_date' ] );
|
| 426 |
-
}
|
| 427 |
-
|
| 428 |
-
if ( !empty( $_POST[ 'total_end_date' ] ) ) {
|
| 429 |
-
$total_end_date = strtotime( $_POST[ 'total_end_date' ] );
|
| 430 |
-
}
|
| 431 |
-
|
| 432 |
-
$totals = $this->calculate_totals( $commissions );
|
| 433 |
-
|
| 434 |
-
?><form method="post" action="">
|
| 435 |
-
<p><label for="from"><?php _e( 'From:', 'wc-vendors' ); ?></label>
|
| 436 |
-
<input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $total_start_date ) ); ?>" name="total_start_date" class="range_datepicker from" id="from" />
|
| 437 |
-
<label for="to"><?php _e( 'To:', 'wc-vendors' ); ?></label>
|
| 438 |
-
<input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $total_end_date ) ); ?>" name="total_end_date" class="range_datepicker to" id="to" />
|
| 439 |
-
|
| 440 |
-
<select name="commission_status">
|
| 441 |
-
<option value="due"><?php _e( 'Due', 'wc-vendors' ); ?></option>
|
| 442 |
-
<option value="paid"><?php _e( 'Paid', 'wc-vendors' ); ?></option>
|
| 443 |
-
<option value="reversed"><?php _e( 'Reversed', 'wc-vendors' ); ?></option>
|
| 444 |
-
</select>
|
| 445 |
-
|
| 446 |
-
<input type="submit" class="button" value="<?php _e( 'Show', 'wc-vendors' ); ?>"/>
|
| 447 |
-
|
| 448 |
-
<?php do_action( 'wcvendors_after_commission_reports', $commissions ); ?>
|
| 449 |
-
</p>
|
| 450 |
-
</form>
|
| 451 |
-
|
| 452 |
-
<div class="woocommerce-reports-main">
|
| 453 |
-
<table class="widefat">
|
| 454 |
-
<thead>
|
| 455 |
-
<tr>
|
| 456 |
-
<th class="total_row"><?php _e( 'Vendor', 'wc-vendors' ); ?></th>
|
| 457 |
-
<th class="total_row"><?php _e( 'Tax Total', 'wc-vendors' ); ?></th>
|
| 458 |
-
<th class="total_row"><?php _e( 'Shipping Total', 'wc-vendors' ); ?></th>
|
| 459 |
-
<th class="total_row"><?php _e( 'Status', 'wc-vendors' ); ?></th>
|
| 460 |
-
<th class="total_row"><?php _e( 'Commission Total', 'wc-vendors' ); ?></th>
|
| 461 |
-
</tr>
|
| 462 |
-
</thead>
|
| 463 |
-
<tbody>
|
| 464 |
-
<?php
|
| 465 |
-
|
| 466 |
-
if ( !empty( $commissions ) ){
|
| 467 |
-
|
| 468 |
-
foreach ( $totals as $totals ) {
|
| 469 |
-
|
| 470 |
-
echo '<tr>';
|
| 471 |
-
echo '<td>' . $totals[ 'user_login' ]. '</td>';
|
| 472 |
-
echo '<td>' . wc_price( $totals[ 'tax' ] ). '</td>';
|
| 473 |
-
echo '<td>' . wc_price( $totals[ 'total_shipping' ] ). '</td>';
|
| 474 |
-
echo '<td>' . $totals[ 'status' ] . '</td>';
|
| 475 |
-
echo '<td>' . wc_price( $totals[ 'total_due' ] ). '</td>';
|
| 476 |
-
echo '</tr>';
|
| 477 |
-
|
| 478 |
-
}
|
| 479 |
-
|
| 480 |
-
} else {
|
| 481 |
-
echo '<tr>';
|
| 482 |
-
echo '<td colspan="5">'. __( 'No commissions found.', 'wc-vendors' ) . '</td>';
|
| 483 |
-
echo '</tr>';
|
| 484 |
-
|
| 485 |
-
}
|
| 486 |
-
?>
|
| 487 |
-
</tbody>
|
| 488 |
-
</table>
|
| 489 |
-
|
| 490 |
-
<?php
|
| 491 |
-
|
| 492 |
-
|
| 493 |
-
} // commission_totals()
|
| 494 |
-
|
| 495 |
-
/**
|
| 496 |
-
* Calculate the totals of the commissions return an array with vendor id as the key with the totals
|
| 497 |
-
*
|
| 498 |
-
* @param array $commissions total commissions array
|
| 499 |
-
* @return array $totals calculated totals
|
| 500 |
-
*/
|
| 501 |
-
function calculate_totals( $commissions ){
|
| 502 |
-
|
| 503 |
-
$totals = array();
|
| 504 |
-
|
| 505 |
-
$vendors = get_users( array( 'role' => 'vendor', 'fields' => array( 'ID', 'user_login' ) ) );
|
| 506 |
-
$vendor_names = wp_list_pluck( $vendors, 'user_login', 'ID' );
|
| 507 |
-
|
| 508 |
-
foreach ($commissions as $commission ) {
|
| 509 |
-
|
| 510 |
-
if ( array_key_exists( $commission->vendor_id, $totals ) ){
|
| 511 |
-
|
| 512 |
-
$totals[ $commission->vendor_id ][ 'total_due' ] += $commission->total_due + $commission->tax + $commission->total_shipping;
|
| 513 |
-
$totals[ $commission->vendor_id ][ 'tax' ] += $commission->tax;
|
| 514 |
-
$totals[ $commission->vendor_id ][ 'total_shipping' ] += $commission->total_shipping;
|
| 515 |
-
|
| 516 |
-
} else {
|
| 517 |
-
|
| 518 |
-
if ( array_key_exists( $commission->vendor_id, $vendor_names) ){
|
| 519 |
-
|
| 520 |
-
$temp_array = array(
|
| 521 |
-
'user_login' => $vendor_names[ $commission->vendor_id ],
|
| 522 |
-
'total_due' => $commission->total_due,
|
| 523 |
-
'tax' => $commission->tax,
|
| 524 |
-
'total_shipping' => $commission->total_shipping,
|
| 525 |
-
'status' => $commission->status,
|
| 526 |
-
);
|
| 527 |
-
|
| 528 |
-
$totals[ $commission->vendor_id ] = $temp_array ;
|
| 529 |
-
|
| 530 |
-
}
|
| 531 |
-
|
| 532 |
-
}
|
| 533 |
-
|
| 534 |
-
}
|
| 535 |
-
|
| 536 |
-
usort( $totals, function( $a, $b ) {
|
| 537 |
-
return strcmp( strtolower( $a[ 'user_login' ] ), strtolower( $b[ 'user_login' ] ) );
|
| 538 |
-
});
|
| 539 |
-
|
| 540 |
-
return $totals;
|
| 541 |
-
|
| 542 |
-
} // calculate_totals()
|
| 543 |
-
|
| 544 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-admin-users.php
DELETED
|
@@ -1,425 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* WP-Admin users page
|
| 5 |
-
*
|
| 6 |
-
* @author Matt Gates <http://mgates.me>
|
| 7 |
-
* @package WC_Vendors
|
| 8 |
-
*/
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
class WCV_Admin_Users
|
| 12 |
-
{
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructor
|
| 17 |
-
*/
|
| 18 |
-
function __construct()
|
| 19 |
-
{
|
| 20 |
-
if ( !is_admin() ) return;
|
| 21 |
-
|
| 22 |
-
add_action( 'edit_user_profile', array( $this, 'show_extra_profile_fields' ) );
|
| 23 |
-
add_action( 'edit_user_profile_update', array( $this, 'save_extra_profile_fields' ) );
|
| 24 |
-
|
| 25 |
-
add_filter( 'add_menu_classes', array( $this, 'show_pending_number' ) );
|
| 26 |
-
|
| 27 |
-
// Disabling non-vendor related items on the admin screens
|
| 28 |
-
if ( WCV_Vendors::is_vendor( get_current_user_id() ) ) {
|
| 29 |
-
add_filter( 'woocommerce_csv_product_role', array( $this, 'csv_import_suite_compatibility' ) );
|
| 30 |
-
add_filter( 'woocommerce_csv_product_export_args', array( $this, 'csv_import_suite_compatibility_export' ) );
|
| 31 |
-
|
| 32 |
-
// Admin page lockdown
|
| 33 |
-
remove_action( 'admin_init', 'woocommerce_prevent_admin_access' );
|
| 34 |
-
add_action( 'admin_init', array( $this, 'prevent_admin_access' ) );
|
| 35 |
-
|
| 36 |
-
add_filter( 'woocommerce_prevent_admin_access', array( $this, 'deny_admin_access' ) );
|
| 37 |
-
|
| 38 |
-
// WC > Product page fixes
|
| 39 |
-
add_action( 'load-post-new.php', array( $this, 'confirm_access_to_add' ) );
|
| 40 |
-
add_action( 'load-edit.php', array( $this, 'edit_nonvendors' ) );
|
| 41 |
-
add_filter( 'views_edit-product', array( $this, 'hide_nonvendor_links' ) );
|
| 42 |
-
|
| 43 |
-
// Filter user attachments so they only see their own attachements
|
| 44 |
-
add_action( 'ajax_query_attachments_args', array( $this, 'show_user_attachment_ajax' ) );
|
| 45 |
-
add_filter( 'parse_query', array( $this, 'show_user_attachment_page' ) );
|
| 46 |
-
|
| 47 |
-
add_action( 'admin_menu', array( $this, 'remove_menu_page' ), 99 );
|
| 48 |
-
add_action( 'add_meta_boxes', array( $this, 'remove_meta_boxes' ), 99 );
|
| 49 |
-
add_filter( 'product_type_selector', array( $this, 'filter_product_types' ), 99 );
|
| 50 |
-
add_filter( 'product_type_options', array( $this, 'filter_product_type_options' ), 99 );
|
| 51 |
-
add_filter( 'woocommerce_product_data_tabs', array( $this, 'filter_product_data_tabs' ), 99, 2 );
|
| 52 |
-
|
| 53 |
-
// Vendor Capabilities
|
| 54 |
-
// Duplicate product
|
| 55 |
-
add_filter( 'woocommerce_duplicate_product_capability', array( $this, 'add_duplicate_capability' ) );
|
| 56 |
-
|
| 57 |
-
// WC > Product featured
|
| 58 |
-
add_filter( 'manage_product_posts_columns', array( $this, 'manage_product_columns'), 99);
|
| 59 |
-
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
public function confirm_access_to_add()
|
| 65 |
-
{
|
| 66 |
-
if ( empty( $_GET['post_type'] ) || $_GET['post_type'] != 'product' ) {
|
| 67 |
-
return;
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
$can_submit = 'yes' == get_option( 'wcvendors_capability_products_enabled', 'no' ) ? true : false;
|
| 71 |
-
|
| 72 |
-
if ( ! $can_submit ) {
|
| 73 |
-
wp_die( sprintf( __( 'You are not allowed to submit products. <a href="%s">Go Back</a>', 'wc-vendors' ), admin_url( 'edit.php?post_type=product' ) ) );
|
| 74 |
-
}
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
public function csv_import_suite_compatibility( $capability )
|
| 78 |
-
{
|
| 79 |
-
return 'manage_product';
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
public function csv_import_suite_compatibility_export( $args )
|
| 83 |
-
{
|
| 84 |
-
$args[ 'author' ] = get_current_user_id();
|
| 85 |
-
|
| 86 |
-
return $args;
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
/*
|
| 90 |
-
* Enable/disable duplicate product
|
| 91 |
-
*/
|
| 92 |
-
public function add_duplicate_capability( $capability ){
|
| 93 |
-
if ( 'yes' === get_option( 'wcvendors_capability_product_duplicate', 'no' ) ) {
|
| 94 |
-
return 'manage_product';
|
| 95 |
-
}
|
| 96 |
-
return $capability;
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
/**
|
| 101 |
-
*
|
| 102 |
-
*
|
| 103 |
-
* @param unknown $menu
|
| 104 |
-
*
|
| 105 |
-
* @return unknown
|
| 106 |
-
*/
|
| 107 |
-
public function show_pending_number( $menu )
|
| 108 |
-
{
|
| 109 |
-
|
| 110 |
-
$args = array(
|
| 111 |
-
'post_type' => 'product',
|
| 112 |
-
'author' => get_current_user_id(),
|
| 113 |
-
'post_status' => 'pending'
|
| 114 |
-
);
|
| 115 |
-
|
| 116 |
-
if (!WCV_Vendors::is_vendor( get_current_user_id() ) ) unset( $args['author'] );
|
| 117 |
-
|
| 118 |
-
$pending_posts = get_posts( $args );
|
| 119 |
-
|
| 120 |
-
$pending_count = is_array( $pending_posts ) ? count( $pending_posts ) : 0;
|
| 121 |
-
|
| 122 |
-
$menu_str = 'edit.php?post_type=product';
|
| 123 |
-
|
| 124 |
-
foreach ( $menu as $menu_key => $menu_data ) {
|
| 125 |
-
|
| 126 |
-
if ( $menu_str != $menu_data[ 2 ] ) continue;
|
| 127 |
-
|
| 128 |
-
if ($pending_count > 0 ) {
|
| 129 |
-
$menu[ $menu_key ][ 0 ] .= " <span class='update-plugins counting-$pending_count'><span class='plugin-count'>" . number_format_i18n( $pending_count ) . '</span></span>';
|
| 130 |
-
}
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
return $menu;
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
-
/**
|
| 137 |
-
*
|
| 138 |
-
*
|
| 139 |
-
* @param unknown $types
|
| 140 |
-
* @param unknown $product_type
|
| 141 |
-
*
|
| 142 |
-
* @return unknown
|
| 143 |
-
*/
|
| 144 |
-
function filter_product_types( $types ) {
|
| 145 |
-
|
| 146 |
-
$product_types = get_option( 'wcvendors_capability_product_types' );
|
| 147 |
-
$product_misc = array(
|
| 148 |
-
'taxes' => 'yes' === get_option( 'wcvendors_capability_product_taxes', 'no' ) ? true: false,
|
| 149 |
-
'sku' => 'yes' === get_option( 'wcvendors_capability_product_sku', 'no' ) ? true: false,
|
| 150 |
-
'duplicate' => 'yes' === get_option( 'wcvendors_capability_product_duplicate', 'no' ) ? true: false,
|
| 151 |
-
'delete' => 'yes' === get_option( 'wcvendors_capability_product_delete', 'no' ) ? true: false,
|
| 152 |
-
'featured' => 'yes' === get_option( 'wcvendors_capability_product_featured', 'no' ? true: false)
|
| 153 |
-
);
|
| 154 |
-
|
| 155 |
-
// Add any custom css
|
| 156 |
-
$css = get_option( 'wcvendors_display_advanced_stylesheet' );
|
| 157 |
-
// Filter taxes
|
| 158 |
-
if ( !empty( $product_misc[ 'taxes' ] ) ) {
|
| 159 |
-
$css .= '.form-field._tax_status_field, .form-field._tax_class_field{display:none !important;}';
|
| 160 |
-
}
|
| 161 |
-
unset( $product_misc[ 'taxes' ] );
|
| 162 |
-
|
| 163 |
-
// Filter the rest of the fields
|
| 164 |
-
foreach ( $product_misc as $key => $value ) {
|
| 165 |
-
if ( $value ) $css .= sprintf( '._%s_field{display:none !important;}', $key );
|
| 166 |
-
}
|
| 167 |
-
|
| 168 |
-
echo '<style>';
|
| 169 |
-
echo $css;
|
| 170 |
-
echo '</style>';
|
| 171 |
-
|
| 172 |
-
// Filter product type drop down
|
| 173 |
-
foreach ( $types as $key => $value ) {
|
| 174 |
-
if ( in_array( $key, $product_types ) ){
|
| 175 |
-
unset( $types[ $key ] );
|
| 176 |
-
}
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
return $types;
|
| 180 |
-
}
|
| 181 |
-
|
| 182 |
-
/**
|
| 183 |
-
* Filter the product meta tabs in wp-admin
|
| 184 |
-
* @since 1.9.0
|
| 185 |
-
*/
|
| 186 |
-
function filter_product_data_tabs( $tabs ){
|
| 187 |
-
|
| 188 |
-
$product_panel = get_option( 'wcvendors_capability_product_data_tabs' );
|
| 189 |
-
|
| 190 |
-
if ( !$product_panel ) return $tabs;
|
| 191 |
-
|
| 192 |
-
foreach ( $tabs as $key => $value ){
|
| 193 |
-
if ( in_array($key, $product_panel ) ){
|
| 194 |
-
unset( $tabs[ $key ] );
|
| 195 |
-
}
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
return $tabs;
|
| 199 |
-
|
| 200 |
-
} // filter_product_data_tabs()
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
/**
|
| 204 |
-
*
|
| 205 |
-
*
|
| 206 |
-
* @param unknown $types
|
| 207 |
-
*
|
| 208 |
-
* @return unknown
|
| 209 |
-
*/
|
| 210 |
-
function filter_product_type_options( $types )
|
| 211 |
-
{
|
| 212 |
-
$product_options = get_option( 'wcvendors_capability_product_type_options' );
|
| 213 |
-
|
| 214 |
-
if ( !$product_options ) return $types;
|
| 215 |
-
|
| 216 |
-
foreach ( $types as $key => $value ) {
|
| 217 |
-
if ( !empty( $product_options[ $key ] ) ) {
|
| 218 |
-
unset( $types[ $key ] );
|
| 219 |
-
}
|
| 220 |
-
}
|
| 221 |
-
|
| 222 |
-
return $types;
|
| 223 |
-
}
|
| 224 |
-
|
| 225 |
-
|
| 226 |
-
/**
|
| 227 |
-
* Show attachments only belonging to vendor
|
| 228 |
-
*
|
| 229 |
-
* @param object $query
|
| 230 |
-
*/
|
| 231 |
-
function show_user_attachment_ajax ( $query ) {
|
| 232 |
-
|
| 233 |
-
$user_id = get_current_user_id();
|
| 234 |
-
if ( $user_id ) {
|
| 235 |
-
$query['author'] = $user_id;
|
| 236 |
-
}
|
| 237 |
-
return $query;
|
| 238 |
-
}
|
| 239 |
-
|
| 240 |
-
/**
|
| 241 |
-
* Show attachments only belonging to vendor
|
| 242 |
-
*
|
| 243 |
-
* @param object $query
|
| 244 |
-
*/
|
| 245 |
-
function show_user_attachment_page ( $query ) {
|
| 246 |
-
|
| 247 |
-
global $current_user, $pagenow;
|
| 248 |
-
|
| 249 |
-
if ( !is_a( $current_user, 'WP_User') )
|
| 250 |
-
return;
|
| 251 |
-
|
| 252 |
-
if ( 'upload.php' != $pagenow && 'media-upload.php' != $pagenow)
|
| 253 |
-
return;
|
| 254 |
-
|
| 255 |
-
if ( !current_user_can('delete_pages') )
|
| 256 |
-
$query->set('author', $current_user->ID );
|
| 257 |
-
|
| 258 |
-
return;
|
| 259 |
-
}
|
| 260 |
-
|
| 261 |
-
/**
|
| 262 |
-
* Allow vendors to access admin when disabled
|
| 263 |
-
*/
|
| 264 |
-
public function prevent_admin_access()
|
| 265 |
-
{
|
| 266 |
-
$permitted_user = ( current_user_can( 'edit_posts' ) || current_user_can( 'manage_woocommerce' ) || current_user_can( 'vendor' ) );
|
| 267 |
-
|
| 268 |
-
if ( get_option( 'woocommerce_lock_down_admin' ) == 'yes' && !is_ajax() && !$permitted_user ) {
|
| 269 |
-
wp_safe_redirect( get_permalink( woocommerce_get_page_id( 'myaccount' ) ) );
|
| 270 |
-
exit;
|
| 271 |
-
}
|
| 272 |
-
}
|
| 273 |
-
|
| 274 |
-
public function deny_admin_access()
|
| 275 |
-
{
|
| 276 |
-
return false;
|
| 277 |
-
}
|
| 278 |
-
|
| 279 |
-
|
| 280 |
-
/**
|
| 281 |
-
* Request when load-edit.php
|
| 282 |
-
*/
|
| 283 |
-
public function edit_nonvendors()
|
| 284 |
-
{
|
| 285 |
-
add_action( 'request', array( $this, 'hide_nonvendor_products' ) );
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
|
| 289 |
-
/**
|
| 290 |
-
* Hide links that don't matter anymore from vendors
|
| 291 |
-
*
|
| 292 |
-
* @param array $views
|
| 293 |
-
*
|
| 294 |
-
* @return array
|
| 295 |
-
*/
|
| 296 |
-
public function hide_nonvendor_links( $views )
|
| 297 |
-
{
|
| 298 |
-
return array();
|
| 299 |
-
}
|
| 300 |
-
|
| 301 |
-
|
| 302 |
-
/**
|
| 303 |
-
* Hide products that don't belong to the vendor
|
| 304 |
-
*
|
| 305 |
-
* @param array $query_vars
|
| 306 |
-
*
|
| 307 |
-
* @return array
|
| 308 |
-
*/
|
| 309 |
-
public function hide_nonvendor_products( $query_vars )
|
| 310 |
-
{
|
| 311 |
-
if (array_key_exists('post_type', $query_vars) && ($query_vars['post_type'] == 'product')) {
|
| 312 |
-
$query_vars[ 'author' ] = get_current_user_id();
|
| 313 |
-
}
|
| 314 |
-
|
| 315 |
-
return $query_vars;
|
| 316 |
-
}
|
| 317 |
-
|
| 318 |
-
|
| 319 |
-
/**
|
| 320 |
-
* Remove the media library menu
|
| 321 |
-
*/
|
| 322 |
-
public function remove_menu_page(){
|
| 323 |
-
global $pagenow;
|
| 324 |
-
|
| 325 |
-
remove_menu_page( 'index.php' ); /* Hides Dashboard menu */
|
| 326 |
-
remove_menu_page( 'separator1' ); /* Hides separator under Dashboard menu*/
|
| 327 |
-
remove_all_actions( 'admin_notices' );
|
| 328 |
-
|
| 329 |
-
$can_submit = 'yes' == get_option( 'wcvendors_capability_products_enabled' ) ? true : false;
|
| 330 |
-
|
| 331 |
-
if ( ! $can_submit ) {
|
| 332 |
-
global $submenu;
|
| 333 |
-
unset($submenu['edit.php?post_type=product'][10]);
|
| 334 |
-
}
|
| 335 |
-
|
| 336 |
-
if ( $pagenow == 'index.php' ) {
|
| 337 |
-
wp_redirect( admin_url( 'profile.php' ) );
|
| 338 |
-
}
|
| 339 |
-
}
|
| 340 |
-
|
| 341 |
-
|
| 342 |
-
/**
|
| 343 |
-
*
|
| 344 |
-
*/
|
| 345 |
-
public function remove_meta_boxes()
|
| 346 |
-
{
|
| 347 |
-
remove_meta_box( 'postcustom', 'product', 'normal' );
|
| 348 |
-
remove_meta_box( 'wpseo_meta', 'product', 'normal' );
|
| 349 |
-
remove_meta_box( 'expirationdatediv', 'product', 'side' );
|
| 350 |
-
}
|
| 351 |
-
|
| 352 |
-
|
| 353 |
-
/**
|
| 354 |
-
* Update the vendor PayPal email
|
| 355 |
-
*
|
| 356 |
-
* @param int $vendor_id
|
| 357 |
-
*
|
| 358 |
-
* @return bool
|
| 359 |
-
*/
|
| 360 |
-
public function save_extra_profile_fields( $vendor_id )
|
| 361 |
-
{
|
| 362 |
-
if ( !current_user_can( 'edit_user', $vendor_id ) ) return false;
|
| 363 |
-
|
| 364 |
-
if ( ! WCV_Vendors::is_pending( $vendor_id ) && ! WCV_Vendors::is_vendor( $vendor_id ) ) { return; }
|
| 365 |
-
|
| 366 |
-
$users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $_POST[ 'pv_shop_name' ] ) ) );
|
| 367 |
-
if ( empty( $users ) || $users[ 0 ]->ID == $vendor_id ) {
|
| 368 |
-
update_user_meta( $vendor_id, 'pv_shop_name', $_POST[ 'pv_shop_name' ] );
|
| 369 |
-
update_user_meta( $vendor_id, 'pv_shop_slug', sanitize_title( $_POST[ 'pv_shop_name' ] ) );
|
| 370 |
-
}
|
| 371 |
-
|
| 372 |
-
update_user_meta( $vendor_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
|
| 373 |
-
update_user_meta( $vendor_id, 'pv_shop_html_enabled', isset( $_POST[ 'pv_shop_html_enabled' ] ) );
|
| 374 |
-
update_user_meta( $vendor_id, 'pv_custom_commission_rate', $_POST[ 'pv_custom_commission_rate' ] );
|
| 375 |
-
update_user_meta( $vendor_id, 'pv_shop_description', $_POST[ 'pv_shop_description' ] );
|
| 376 |
-
update_user_meta( $vendor_id, 'pv_seller_info', $_POST[ 'pv_seller_info' ] );
|
| 377 |
-
update_user_meta( $vendor_id, 'wcv_give_vendor_tax', isset( $_POST[ 'wcv_give_vendor_tax' ] ) );
|
| 378 |
-
update_user_meta( $vendor_id, 'wcv_give_vendor_shipping', isset( $_POST[ 'wcv_give_vendor_shipping' ] ) );
|
| 379 |
-
|
| 380 |
-
// Bank details
|
| 381 |
-
update_user_meta( $vendor_id, 'wcv_bank_account_name', $_POST['wcv_bank_account_name'] );
|
| 382 |
-
update_user_meta( $vendor_id, 'wcv_bank_account_number', $_POST['wcv_bank_account_number'] );
|
| 383 |
-
update_user_meta( $vendor_id, 'wcv_bank_name', $_POST['wcv_bank_name'] );
|
| 384 |
-
update_user_meta( $vendor_id, 'wcv_bank_routing_number', $_POST['wcv_bank_routing_number'] );
|
| 385 |
-
update_user_meta( $vendor_id, 'wcv_bank_iban', $_POST['wcv_bank_iban'] );
|
| 386 |
-
update_user_meta( $vendor_id, 'wcv_bank_bic_swift', $_POST['wcv_bank_bic_swift'] );
|
| 387 |
-
|
| 388 |
-
do_action( 'wcvendors_update_admin_user', $vendor_id );
|
| 389 |
-
}
|
| 390 |
-
|
| 391 |
-
|
| 392 |
-
/**
|
| 393 |
-
* Show the PayPal field and commision due table
|
| 394 |
-
*
|
| 395 |
-
* @param unknown $user
|
| 396 |
-
*/
|
| 397 |
-
public function show_extra_profile_fields( $user ) {
|
| 398 |
-
|
| 399 |
-
if ( ! WCV_Vendors::is_vendor( $user->ID ) && ! WCV_Vendors::is_pending( $user->ID ) ) {
|
| 400 |
-
return;
|
| 401 |
-
}
|
| 402 |
-
|
| 403 |
-
include( apply_filters( 'wcvendors_vendor_meta_partial', WCV_ABSPATH_ADMIN . 'views/html-vendor-meta.php' ) );
|
| 404 |
-
}
|
| 405 |
-
|
| 406 |
-
/*
|
| 407 |
-
Manage product columns on product page
|
| 408 |
-
*/
|
| 409 |
-
public function manage_product_columns( $columns ){
|
| 410 |
-
|
| 411 |
-
// Featured Product
|
| 412 |
-
if ( 'yes' !== get_option( 'wcvendors_capability_product_featured', 'no' ) ) {
|
| 413 |
-
unset($columns['featured']);
|
| 414 |
-
}
|
| 415 |
-
|
| 416 |
-
// SKU
|
| 417 |
-
if ( 'yes' === get_option( 'wcvendors_capability_product_sku', 'no' ) ) {
|
| 418 |
-
unset($columns['sku']);
|
| 419 |
-
}
|
| 420 |
-
|
| 421 |
-
|
| 422 |
-
return $columns;
|
| 423 |
-
}
|
| 424 |
-
|
| 425 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-product-meta.php
DELETED
|
@@ -1,268 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Product meta configurations
|
| 5 |
-
*
|
| 6 |
-
* @package ProductVendor
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
class WCV_Product_Meta
|
| 11 |
-
{
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructor
|
| 16 |
-
*/
|
| 17 |
-
function __construct()
|
| 18 |
-
{
|
| 19 |
-
if ( !current_user_can( 'manage_woocommerce' ) ) return;
|
| 20 |
-
|
| 21 |
-
// Allow products to have authors
|
| 22 |
-
add_post_type_support( 'product', 'author' );
|
| 23 |
-
|
| 24 |
-
add_action( 'add_meta_boxes', array( $this, 'change_author_meta_box_title' ) );
|
| 25 |
-
add_action( 'wp_dropdown_users', array( $this, 'author_vendor_roles' ), 0, 1 );
|
| 26 |
-
if ( apply_filters( 'wcv_product_commission_tab', true ) ) {
|
| 27 |
-
add_action( 'woocommerce_product_write_panel_tabs', array( $this, 'add_tab' ) );
|
| 28 |
-
add_action( 'woocommerce_product_data_panels', array( $this, 'add_panel' ) );
|
| 29 |
-
add_action( 'woocommerce_process_product_meta', array( $this, 'save_panel' ) );
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
add_action( 'woocommerce_product_quick_edit_end', array($this, 'display_vendor_dd_quick_edit') );
|
| 33 |
-
add_action( 'woocommerce_product_quick_edit_save', array($this, 'save_vendor_quick_edit'), 2, 99 );
|
| 34 |
-
add_action( 'manage_product_posts_custom_column', array($this, 'display_vendor_column'), 2, 99 );
|
| 35 |
-
add_filter( 'manage_product_posts_columns', array($this, 'vendor_column_quickedit') );
|
| 36 |
-
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
/**
|
| 41 |
-
* Change the "Author" metabox to "Vendor"
|
| 42 |
-
*/
|
| 43 |
-
public function change_author_meta_box_title()
|
| 44 |
-
{
|
| 45 |
-
global $wp_meta_boxes;
|
| 46 |
-
$wp_meta_boxes[ 'product' ][ 'normal' ][ 'core' ][ 'authordiv' ][ 'title' ] = wcv_get_vendor_name();
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* Override the authors selectbox with +vendor roles
|
| 52 |
-
*
|
| 53 |
-
* @param html $output
|
| 54 |
-
*
|
| 55 |
-
* @return html
|
| 56 |
-
*/
|
| 57 |
-
public function author_vendor_roles( $output )
|
| 58 |
-
{
|
| 59 |
-
global $post;
|
| 60 |
-
|
| 61 |
-
if ( empty( $post ) ) return $output;
|
| 62 |
-
|
| 63 |
-
// Return if this isn't a WooCommerce product post type
|
| 64 |
-
if ( $post->post_type != 'product' ) return $output;
|
| 65 |
-
|
| 66 |
-
// Return if this isn't the vendor author override dropdown
|
| 67 |
-
if ( !strpos( $output, 'post_author_override' ) ) return $output;
|
| 68 |
-
|
| 69 |
-
$args = array(
|
| 70 |
-
'selected' => $post->post_author,
|
| 71 |
-
'id' => 'post_author_override',
|
| 72 |
-
);
|
| 73 |
-
|
| 74 |
-
$output = $this->vendor_selectbox( $args );
|
| 75 |
-
|
| 76 |
-
return $output;
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
/**
|
| 81 |
-
* Create a selectbox to display vendor & administrator roles
|
| 82 |
-
*
|
| 83 |
-
* @param array $args
|
| 84 |
-
*
|
| 85 |
-
* @return html
|
| 86 |
-
*/
|
| 87 |
-
public function vendor_selectbox( $args )
|
| 88 |
-
{
|
| 89 |
-
$default_args = array(
|
| 90 |
-
'placeholder',
|
| 91 |
-
'id',
|
| 92 |
-
'class',
|
| 93 |
-
);
|
| 94 |
-
|
| 95 |
-
foreach ( $default_args as $key ) {
|
| 96 |
-
if ( !is_array( $key ) && empty( $args[ $key ] ) ) $args[ $key ] = '';
|
| 97 |
-
else if ( is_array( $key ) ) foreach ( $key as $val ) $args[ $key ][ $val ] = esc_attr( $args[ $key ][ $val ] );
|
| 98 |
-
}
|
| 99 |
-
extract( $args );
|
| 100 |
-
|
| 101 |
-
$roles = array( 'vendor', 'administrator' );
|
| 102 |
-
$user_args = array( 'fields' => array( 'ID', 'user_login' ) );
|
| 103 |
-
|
| 104 |
-
$output = "<select style='width:200px;' name='$id' id='$id' class='$class' data-placeholder='$placeholder'>\n";
|
| 105 |
-
$output .= "\t<option value=''></option>\n";
|
| 106 |
-
|
| 107 |
-
foreach ( $roles as $role ) {
|
| 108 |
-
|
| 109 |
-
$new_args = $user_args;
|
| 110 |
-
$new_args[ 'role' ] = $role;
|
| 111 |
-
$users = get_users( $new_args );
|
| 112 |
-
|
| 113 |
-
if ( empty( $users ) ) continue;
|
| 114 |
-
foreach ( (array) $users as $user ) {
|
| 115 |
-
$select = selected( $user->ID, $selected, false );
|
| 116 |
-
$output .= "\t<option value='$user->ID' $select>$user->user_login</option>\n";
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
}
|
| 120 |
-
$output .= "</select>";
|
| 121 |
-
|
| 122 |
-
// Convert this selectbox with select2
|
| 123 |
-
$output .= '
|
| 124 |
-
<script type="text/javascript">jQuery(function() { jQuery("#' . $id . '").select2(); } );</script>';
|
| 125 |
-
|
| 126 |
-
return $output;
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
|
| 130 |
-
/**
|
| 131 |
-
* Save commission rate of a product
|
| 132 |
-
*
|
| 133 |
-
* @param int $post_id
|
| 134 |
-
*/
|
| 135 |
-
public function save_panel( $post_id )
|
| 136 |
-
{
|
| 137 |
-
if ( isset( $_POST[ 'pv_commission_rate' ] ) ) {
|
| 138 |
-
update_post_meta( $post_id, 'pv_commission_rate', is_numeric( $_POST[ 'pv_commission_rate' ] ) ? (float) $_POST[ 'pv_commission_rate' ] : false );
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
/**
|
| 145 |
-
* Add the Commission tab to a product
|
| 146 |
-
*/
|
| 147 |
-
public function add_tab()
|
| 148 |
-
{
|
| 149 |
-
?>
|
| 150 |
-
<li class="commission_tab">
|
| 151 |
-
<a href="#commission"><?php _e( 'Commission', 'wc-vendors' ) ?></a>
|
| 152 |
-
</li> <?php
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
|
| 156 |
-
/**
|
| 157 |
-
* Add the Commission panel to a product
|
| 158 |
-
*/
|
| 159 |
-
public function add_panel()
|
| 160 |
-
{
|
| 161 |
-
global $post; ?>
|
| 162 |
-
|
| 163 |
-
<div id="commission" class="panel woocommerce_options_panel">
|
| 164 |
-
<fieldset>
|
| 165 |
-
|
| 166 |
-
<p class='form-field commission_rate_field'>
|
| 167 |
-
<label for='pv_commission_rate'><?php _e( 'Commission', 'wc-vendors' ); ?> (%)</label>
|
| 168 |
-
<input type='number' id='pv_commission_rate'
|
| 169 |
-
name='pv_commission_rate'
|
| 170 |
-
class='short'
|
| 171 |
-
max="100"
|
| 172 |
-
min="0"
|
| 173 |
-
step='any'
|
| 174 |
-
placeholder='<?php _e( 'Leave blank for default', 'wc-vendors' ); ?>'
|
| 175 |
-
value="<?php echo get_post_meta( $post->ID, 'pv_commission_rate', true ); ?>"/>
|
| 176 |
-
</p>
|
| 177 |
-
|
| 178 |
-
</fieldset>
|
| 179 |
-
</div> <?php
|
| 180 |
-
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
/*
|
| 184 |
-
* Rename the Authors column to Vendor on products page
|
| 185 |
-
*/
|
| 186 |
-
public function vendor_column_quickedit($posts_columns) {
|
| 187 |
-
$posts_columns['author'] = wcv_get_vendor_name();
|
| 188 |
-
|
| 189 |
-
return $posts_columns;
|
| 190 |
-
}
|
| 191 |
-
|
| 192 |
-
/*
|
| 193 |
-
* Display the vendor drop down on the quick edit screen
|
| 194 |
-
*/
|
| 195 |
-
public function display_vendor_dd_quick_edit() {
|
| 196 |
-
|
| 197 |
-
global $post;
|
| 198 |
-
$selected = $post->post_author;
|
| 199 |
-
|
| 200 |
-
$roles = array( 'vendor', 'administrator' );
|
| 201 |
-
$user_args = array( 'fields' => array( 'ID', 'display_name' ) );
|
| 202 |
-
|
| 203 |
-
$output = "<select style='width:200px;' name='post_author-new' class='select'>\n";
|
| 204 |
-
|
| 205 |
-
foreach ( $roles as $role ) {
|
| 206 |
-
|
| 207 |
-
$new_args = $user_args;
|
| 208 |
-
$new_args[ 'role' ] = $role;
|
| 209 |
-
$users = get_users( $new_args );
|
| 210 |
-
|
| 211 |
-
if ( empty( $users ) ) continue;
|
| 212 |
-
foreach ( (array) $users as $user ) {
|
| 213 |
-
$select = selected( $user->ID, $selected, false );
|
| 214 |
-
$output .= "\t<option value='$user->ID' $select>$user->display_name</option>\n";
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
}
|
| 218 |
-
$output .= "</select>";
|
| 219 |
-
|
| 220 |
-
?>
|
| 221 |
-
<br class="clear" />
|
| 222 |
-
<label class="inline-edit-author-new">
|
| 223 |
-
<span class="title"><?php _e('Vendor', 'wc-vendors' ); ?></span>
|
| 224 |
-
<?php echo $output; ?>
|
| 225 |
-
</label>
|
| 226 |
-
<?php
|
| 227 |
-
}
|
| 228 |
-
|
| 229 |
-
|
| 230 |
-
/*
|
| 231 |
-
* Save the vendor on the quick edit screen
|
| 232 |
-
*/
|
| 233 |
-
public function save_vendor_quick_edit( $product ) {
|
| 234 |
-
|
| 235 |
-
if ( $product->is_type('simple') || $product->is_type('external') ) {
|
| 236 |
-
if ( isset( $_REQUEST['_vendor'] ) ) {
|
| 237 |
-
$vendor = wc_clean($_REQUEST['_vendor']);
|
| 238 |
-
$post = get_post( $product->get_id() );
|
| 239 |
-
$post->post_author = $vendor;
|
| 240 |
-
}
|
| 241 |
-
}
|
| 242 |
-
return $product;
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
/*
|
| 246 |
-
* Display hidden column data for js
|
| 247 |
-
*/
|
| 248 |
-
public function display_vendor_column( $column, $post_id ){
|
| 249 |
-
|
| 250 |
-
$vendor = get_post_field( 'post_author', $post_id );
|
| 251 |
-
|
| 252 |
-
switch ( $column ) {
|
| 253 |
-
case 'name' :
|
| 254 |
-
|
| 255 |
-
?>
|
| 256 |
-
<div class="hidden vendor" id="vendor_<?php echo $post_id; ?>">
|
| 257 |
-
<div id="post_author"><?php echo $vendor; ?></div>
|
| 258 |
-
</div>
|
| 259 |
-
<?php
|
| 260 |
-
|
| 261 |
-
break;
|
| 262 |
-
|
| 263 |
-
default :
|
| 264 |
-
break;
|
| 265 |
-
}
|
| 266 |
-
|
| 267 |
-
}
|
| 268 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-setup-wizard.php
DELETED
|
@@ -1,348 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin setup wziard
|
| 4 |
-
*
|
| 5 |
-
* @author WooCommerce, Jamie Madden, WC Vendors
|
| 6 |
-
* @category Admin
|
| 7 |
-
* @package WCVendors/Admin
|
| 8 |
-
* @version 2.0.0
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 12 |
-
exit;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* WCVendors_Admin_Setup_Wizard class.
|
| 17 |
-
*/
|
| 18 |
-
class WCVendors_Admin_Setup_Wizard {
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Current step
|
| 22 |
-
*
|
| 23 |
-
* @var string
|
| 24 |
-
*/
|
| 25 |
-
private $step = '';
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Steps for the setup wizard
|
| 29 |
-
*
|
| 30 |
-
* @var array
|
| 31 |
-
*/
|
| 32 |
-
private $steps = array();
|
| 33 |
-
|
| 34 |
-
/**
|
| 35 |
-
* Actions to be executed after the HTTP response has completed
|
| 36 |
-
*
|
| 37 |
-
* @var array
|
| 38 |
-
*/
|
| 39 |
-
private $deferred_actions = array();
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* Hook in tabs.
|
| 43 |
-
*/
|
| 44 |
-
public function __construct() {
|
| 45 |
-
|
| 46 |
-
if ( apply_filters( 'wcv_enable_setup_wizard', true ) && current_user_can( 'manage_woocommerce' ) ) {
|
| 47 |
-
add_action( 'admin_menu', array( $this, 'admin_menus' ) );
|
| 48 |
-
add_action( 'admin_init', array( $this, 'setup_wizard' ) );
|
| 49 |
-
}
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
/**
|
| 53 |
-
* Add admin menus/screens.
|
| 54 |
-
*/
|
| 55 |
-
public function admin_menus() {
|
| 56 |
-
add_dashboard_page( '', '', 'manage_options', 'wcv-setup', '' );
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* Show the setup wizard.
|
| 61 |
-
*/
|
| 62 |
-
public function setup_wizard() {
|
| 63 |
-
|
| 64 |
-
if ( empty( $_GET['page'] ) || 'wcv-setup' !== $_GET['page'] ) {
|
| 65 |
-
return;
|
| 66 |
-
}
|
| 67 |
-
$default_steps = array(
|
| 68 |
-
'store_setup' => array(
|
| 69 |
-
'name' => __( 'Start', 'wc-vendors' ),
|
| 70 |
-
'view' => array( $this, 'wcv_setup_general' ),
|
| 71 |
-
'handler' => array( $this, 'wcv_setup_general_save' ),
|
| 72 |
-
),
|
| 73 |
-
'capabilities' => array(
|
| 74 |
-
'name' => __( 'Capabilities', 'wc-vendors' ),
|
| 75 |
-
'view' => array( $this, 'wcv_setup_capabilities' ),
|
| 76 |
-
'handler' => array( $this, 'wcv_setup_capabilities_save' ),
|
| 77 |
-
),
|
| 78 |
-
'shipping' => array(
|
| 79 |
-
'name' => __( 'Pages', 'wc-vendors' ),
|
| 80 |
-
'view' => array( $this, 'wcv_setup_pages' ),
|
| 81 |
-
'handler' => array( $this, 'wcv_setup_pages_save' ),
|
| 82 |
-
),
|
| 83 |
-
'ready' => array(
|
| 84 |
-
'name' => __( 'Ready!', 'wc-vendors' ),
|
| 85 |
-
'view' => array( $this, 'wcv_setup_ready' ),
|
| 86 |
-
'handler' => '',
|
| 87 |
-
),
|
| 88 |
-
);
|
| 89 |
-
|
| 90 |
-
$this->steps = apply_filters( 'wcv_setup_wizard_steps', $default_steps );
|
| 91 |
-
$this->step = isset( $_GET['step'] ) ? sanitize_key( $_GET['step'] ) : current( array_keys( $this->steps ) );
|
| 92 |
-
$suffix = defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG ? '' : '.min';
|
| 93 |
-
|
| 94 |
-
wp_register_script( 'jquery-blockui', WC()->plugin_url() . '/assets/js/jquery-blockui/jquery.blockUI' . $suffix . '.js', array( 'jquery' ), '2.70', true );
|
| 95 |
-
wp_register_script( 'selectWoo', WC()->plugin_url() . '/assets/js/selectWoo/selectWoo.full' . $suffix . '.js', array( 'jquery' ), '1.0.0' );
|
| 96 |
-
wp_register_script( 'wc-enhanced-select', WC()->plugin_url() . '/assets/js/admin/wc-enhanced-select' . $suffix . '.js', array( 'jquery', 'selectWoo' ), WC_VERSION );
|
| 97 |
-
wp_localize_script( 'wc-enhanced-select', 'wc_enhanced_select_params', array(
|
| 98 |
-
'i18n_no_matches' => _x( 'No matches found', 'enhanced select', 'wcvendors' ),
|
| 99 |
-
'i18n_ajax_error' => _x( 'Loading failed', 'enhanced select', 'wcvendors' ),
|
| 100 |
-
'i18n_input_too_short_1' => _x( 'Please enter 1 or more characters', 'enhanced select', 'wcvendors' ),
|
| 101 |
-
'i18n_input_too_short_n' => _x( 'Please enter %qty% or more characters', 'enhanced select', 'wcvendors' ),
|
| 102 |
-
'i18n_input_too_long_1' => _x( 'Please delete 1 character', 'enhanced select', 'wcvendors' ),
|
| 103 |
-
'i18n_input_too_long_n' => _x( 'Please delete %qty% characters', 'enhanced select', 'wcvendors' ),
|
| 104 |
-
'i18n_selection_too_long_1' => _x( 'You can only select 1 item', 'enhanced select', 'wcvendors' ),
|
| 105 |
-
'i18n_selection_too_long_n' => _x( 'You can only select %qty% items', 'enhanced select', 'wcvendors' ),
|
| 106 |
-
'i18n_load_more' => _x( 'Loading more results…', 'enhanced select', 'wcvendors' ),
|
| 107 |
-
'i18n_searching' => _x( 'Searching…', 'enhanced select', 'wcvendors' ),
|
| 108 |
-
'ajax_url' => admin_url( 'admin-ajax.php' ),
|
| 109 |
-
'search_products_nonce' => wp_create_nonce( 'search-products' ),
|
| 110 |
-
'search_customers_nonce' => wp_create_nonce( 'search-customers' ),
|
| 111 |
-
) );
|
| 112 |
-
// @todo fix the select2 styles in our admin.css
|
| 113 |
-
wp_enqueue_style( 'woocommerce_admin_styles', WC()->plugin_url() . '/assets/css/admin.css', array(), WC_VERSION );
|
| 114 |
-
|
| 115 |
-
wp_enqueue_style( 'wcv-setup', wcv_assets_url . 'css/wcv-setup.css', array( 'dashicons', 'install' ), WCV_VERSION );
|
| 116 |
-
wp_register_script( 'wcv-setup', wcv_assets_url . 'js/admin/wcv-setup.js', array( 'jquery', 'wc-enhanced-select', 'jquery-blockui', 'wp-util' ), WCV_VERSION );
|
| 117 |
-
|
| 118 |
-
if ( ! empty( $_POST['save_step'] ) && isset( $this->steps[ $this->step ]['handler'] ) ) {
|
| 119 |
-
call_user_func( $this->steps[ $this->step ]['handler'], $this );
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
ob_start();
|
| 123 |
-
$this->setup_wizard_header();
|
| 124 |
-
$this->setup_wizard_steps();
|
| 125 |
-
$this->setup_wizard_content();
|
| 126 |
-
$this->setup_wizard_footer();
|
| 127 |
-
exit;
|
| 128 |
-
}
|
| 129 |
-
|
| 130 |
-
/**
|
| 131 |
-
* Get the URL for the next step's screen.
|
| 132 |
-
*
|
| 133 |
-
* @param string $step slug (default: current step).
|
| 134 |
-
* @return string URL for next step if a next step exists.
|
| 135 |
-
* Admin URL if it's the last step.
|
| 136 |
-
* Empty string on failure.
|
| 137 |
-
* @since 2.0.0
|
| 138 |
-
*/
|
| 139 |
-
public function get_next_step_link( $step = '' ) {
|
| 140 |
-
if ( ! $step ) {
|
| 141 |
-
$step = $this->step;
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
$keys = array_keys( $this->steps );
|
| 145 |
-
if ( end( $keys ) === $step ) {
|
| 146 |
-
return admin_url();
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
$step_index = array_search( $step, $keys );
|
| 150 |
-
if ( false === $step_index ) {
|
| 151 |
-
return '';
|
| 152 |
-
}
|
| 153 |
-
|
| 154 |
-
return add_query_arg( 'step', $keys[ $step_index + 1 ], remove_query_arg( 'activate_error' ) );
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
/**
|
| 158 |
-
* Setup Wizard Header.
|
| 159 |
-
*/
|
| 160 |
-
public function setup_wizard_header() {
|
| 161 |
-
|
| 162 |
-
include( WCV_ABSPATH_ADMIN . 'views/setup/header.php' );
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
/**
|
| 166 |
-
* Setup Wizard Footer.
|
| 167 |
-
*/
|
| 168 |
-
public function setup_wizard_footer() {
|
| 169 |
-
include( WCV_ABSPATH_ADMIN . 'views/setup/footer.php' );
|
| 170 |
-
}
|
| 171 |
-
|
| 172 |
-
/**
|
| 173 |
-
* Output the steps.
|
| 174 |
-
*/
|
| 175 |
-
public function setup_wizard_steps() {
|
| 176 |
-
$output_steps = $this->steps;
|
| 177 |
-
include( WCV_ABSPATH_ADMIN . 'views/setup/steps.php' );
|
| 178 |
-
}
|
| 179 |
-
|
| 180 |
-
/**
|
| 181 |
-
* Output the content for the current step.
|
| 182 |
-
*/
|
| 183 |
-
public function setup_wizard_content() {
|
| 184 |
-
echo '<div class="wcv-setup-content">';
|
| 185 |
-
if ( ! empty( $this->steps[ $this->step ]['view'] ) ) {
|
| 186 |
-
call_user_func( $this->steps[ $this->step ]['view'], $this );
|
| 187 |
-
}
|
| 188 |
-
echo '</div>';
|
| 189 |
-
}
|
| 190 |
-
|
| 191 |
-
/**
|
| 192 |
-
* Helper method to retrieve the current user's email address.
|
| 193 |
-
*
|
| 194 |
-
* @return string Email address
|
| 195 |
-
*/
|
| 196 |
-
protected function get_current_user_email() {
|
| 197 |
-
$current_user = wp_get_current_user();
|
| 198 |
-
$user_email = $current_user->user_email;
|
| 199 |
-
|
| 200 |
-
return $user_email;
|
| 201 |
-
}
|
| 202 |
-
|
| 203 |
-
/**
|
| 204 |
-
* Initial "marketplace setup" step.
|
| 205 |
-
* Vendor registration, taxes and shipping
|
| 206 |
-
*/
|
| 207 |
-
public function wcv_setup_general() {
|
| 208 |
-
|
| 209 |
-
$allow_registration = get_option( 'wcvendors_vendor_allow_registration', 'yes' );
|
| 210 |
-
$manual_approval = get_option( 'wcvendors_vendor_approve_registration', 'yes' );
|
| 211 |
-
$vendor_taxes = get_option( 'wcvendors_vendor_give_taxes', 'yes' );
|
| 212 |
-
$vendor_shipping = get_option( 'wcvendors_vendor_give_shipping', 'yes' );
|
| 213 |
-
$commission_rate = get_option( 'wcvendors_vendor_commission_rate' );
|
| 214 |
-
|
| 215 |
-
include( WCV_ABSPATH_ADMIN . 'views/setup/general.php' );
|
| 216 |
-
}
|
| 217 |
-
|
| 218 |
-
/**
|
| 219 |
-
* Save initial marketplace settings.
|
| 220 |
-
*/
|
| 221 |
-
public function wcv_setup_general_save() {
|
| 222 |
-
|
| 223 |
-
check_admin_referer( 'wcv-setup' );
|
| 224 |
-
|
| 225 |
-
$allow_registration = isset( $_POST[ 'wcv_vendor_allow_registration' ] ) ? sanitize_text_field( $_POST[ 'wcv_vendor_allow_registration' ] ) : '';
|
| 226 |
-
$manual_approval = isset( $_POST[ 'wcv_vendor_approve_registration'] ) ? sanitize_text_field( $_POST[ 'wcv_vendor_approve_registration' ] ) : '';
|
| 227 |
-
$vendor_taxes = isset( $_POST[ 'wcv_vendor_give_taxes' ] ) ? sanitize_text_field( $_POST[ 'wcv_vendor_give_taxes' ] ) : '';
|
| 228 |
-
$vendor_shipping = isset( $_POST[ 'wcv_vendor_give_shipping' ] ) ? sanitize_text_field( $_POST[ 'wcv_vendor_give_shipping' ] ) : '';
|
| 229 |
-
$commission_rate = sanitize_text_field( $_POST[ 'wcv_vendor_commission_rate' ] );
|
| 230 |
-
|
| 231 |
-
update_option( 'wcvendors_vendor_allow_registration', $allow_registration );
|
| 232 |
-
update_option( 'wcvendors_vendor_approve_registration', $manual_approval );
|
| 233 |
-
update_option( 'wcvendors_vendor_give_taxes', $vendor_taxes );
|
| 234 |
-
update_option( 'wcvendors_vendor_give_shipping', $vendor_shipping );
|
| 235 |
-
update_option( 'wcvendors_vendor_commission_rate', $commission_rate );
|
| 236 |
-
|
| 237 |
-
WCVendors_Install::create_pages();
|
| 238 |
-
wp_redirect( esc_url_raw( $this->get_next_step_link() ) );
|
| 239 |
-
exit;
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
/**
|
| 243 |
-
* General setup
|
| 244 |
-
* Vendor registration, taxes and shipping
|
| 245 |
-
*/
|
| 246 |
-
public function wcv_setup_capabilities() {
|
| 247 |
-
|
| 248 |
-
$products_enabled = get_option( 'wcvendors_capability_products_enabled', 'yes' );
|
| 249 |
-
$live_products = get_option( 'wcvendors_capability_products_edit', 'yes' );
|
| 250 |
-
$products_approval = get_option( 'wcvendors_capability_products_live', 'yes' );
|
| 251 |
-
$orders_enabled = get_option( 'wcvendors_capability_orders_enabled', 'yes' );
|
| 252 |
-
$export_orders = get_option( 'wcvendors_capability_orders_export', 'yes' );
|
| 253 |
-
$view_order_notes = get_option( 'wcvendors_capability_order_read_notes', 'yes' );
|
| 254 |
-
$add_order_notes = get_option( 'wcvendors_capability_order_update_notes', 'yes' );
|
| 255 |
-
|
| 256 |
-
include( WCV_ABSPATH_ADMIN . 'views/setup/capabilities.php' );
|
| 257 |
-
}
|
| 258 |
-
|
| 259 |
-
/**
|
| 260 |
-
* Save capabilities settings.
|
| 261 |
-
*/
|
| 262 |
-
public function wcv_setup_capabilities_save() {
|
| 263 |
-
|
| 264 |
-
check_admin_referer( 'wcv-setup' );
|
| 265 |
-
|
| 266 |
-
$products_enabled = isset( $_POST[ 'wcv_capability_products_enabled' ] ) ? sanitize_text_field( $_POST[ 'wcv_capability_products_enabled' ] ) : '';
|
| 267 |
-
$live_products = isset( $_POST[ 'wcv_capability_products_edit' ] ) ? sanitize_text_field( $_POST[ 'wcv_capability_products_edit' ] ) : '';
|
| 268 |
-
$products_approval = isset( $_POST[ 'wcv_capability_products_live' ] ) ? sanitize_text_field( $_POST[ 'wcv_capability_products_live' ] ) : '';
|
| 269 |
-
$orders_enabled = isset( $_POST[ 'wcv_capability_orders_enabled' ] ) ? sanitize_text_field( $_POST[ 'wcv_capability_orders_enabled' ] ) : '';
|
| 270 |
-
$export_orders = isset( $_POST[ 'wcv_capability_orders_export' ] ) ? sanitize_text_field( $_POST[ 'wcv_capability_orders_export' ] ) : '';
|
| 271 |
-
$view_order_notes = isset( $_POST[ 'wcv_capability_order_read_notes' ] ) ? sanitize_text_field( $_POST[ 'wcv_capability_order_read_notes' ] ) : '';
|
| 272 |
-
$add_order_notes = isset( $_POST[ 'wcv_capability_order_update_notes' ] ) ? sanitize_text_field( $_POST[ 'wcv_capability_order_update_notes' ] ) : '';
|
| 273 |
-
|
| 274 |
-
update_option( 'wcvendors_capability_products_enabled', $products_enabled );
|
| 275 |
-
update_option( 'wcvendors_capability_products_edit', $live_products );
|
| 276 |
-
update_option( 'wcvendors_capability_products_live', $products_approval );
|
| 277 |
-
update_option( 'wcvendors_capability_orders_enabled', $orders_enabled );
|
| 278 |
-
update_option( 'wcvendors_capability_orders_export', $export_orders );
|
| 279 |
-
update_option( 'wcvendors_capability_order_read_notes', $view_order_notes );
|
| 280 |
-
update_option( 'wcvendors_capability_order_update_notes', $add_order_notes );
|
| 281 |
-
|
| 282 |
-
wp_redirect( esc_url_raw( $this->get_next_step_link() ) );
|
| 283 |
-
exit;
|
| 284 |
-
}
|
| 285 |
-
|
| 286 |
-
/**
|
| 287 |
-
* Initial "marketplace setup" step.
|
| 288 |
-
* Vendor registration, taxes and shipping
|
| 289 |
-
*/
|
| 290 |
-
public function wcv_setup_pages() {
|
| 291 |
-
|
| 292 |
-
$vendor_dashboard_page_id = get_option( 'wcvendors_vendor_dashboard_page_id' );
|
| 293 |
-
$shop_settings_page_id = get_option( 'wcvendors_shop_settings_page_id' );
|
| 294 |
-
$product_orders_page_id = get_option( 'wcvendors_product_orders_page_id' );
|
| 295 |
-
$vendors_page_id = get_option( 'wcvendors_vendors_page_id' );
|
| 296 |
-
$terms_page_id = get_option( 'wcvendors_vendor_terms_page_id' );
|
| 297 |
-
|
| 298 |
-
include( WCV_ABSPATH_ADMIN . 'views/setup/pages.php' );
|
| 299 |
-
}
|
| 300 |
-
|
| 301 |
-
/**
|
| 302 |
-
* Initial "marketplace setup" step.
|
| 303 |
-
* Vendor registration, taxes and shipping
|
| 304 |
-
*/
|
| 305 |
-
public function wcv_setup_pages_save() {
|
| 306 |
-
|
| 307 |
-
|
| 308 |
-
$vendor_dashboard_page_id = sanitize_text_field( $_POST[ 'wcvendors_vendor_dashboard_page_id' ] );
|
| 309 |
-
$shop_settings_page_id = sanitize_text_field( $_POST[ 'wcvendors_shop_settings_page_id' ] );
|
| 310 |
-
$product_orders_page_id = sanitize_text_field( $_POST[ 'wcvendors_product_orders_page_id' ] );
|
| 311 |
-
$vendors_page_id = sanitize_text_field( $_POST[ 'wcvendors_vendors_page_id' ] );
|
| 312 |
-
$terms_page_id = sanitize_text_field( $_POST[ 'wcvendors_vendor_terms_page_id' ] );
|
| 313 |
-
|
| 314 |
-
update_option( 'wcvendors_vendor_dashboard_page_id', $vendor_dashboard_page_id );
|
| 315 |
-
update_option( 'wcvendors_shop_settings_page_id', $shop_settings_page_id );
|
| 316 |
-
update_option( 'wcvendors_product_orders_page_id', $product_orders_page_id );
|
| 317 |
-
update_option( 'wcvendors_vendors_page_id', $vendors_page_id );
|
| 318 |
-
update_option( 'wcvendors_vendor_terms_page_id', $terms_page_id );
|
| 319 |
-
|
| 320 |
-
wp_redirect( esc_url_raw( $this->get_next_step_link() ) );
|
| 321 |
-
exit;
|
| 322 |
-
|
| 323 |
-
}
|
| 324 |
-
|
| 325 |
-
/**
|
| 326 |
-
* Final step.
|
| 327 |
-
*/
|
| 328 |
-
public function wcv_setup_ready() {
|
| 329 |
-
|
| 330 |
-
WCVendors_Admin_Notices::remove_notice( 'install' );
|
| 331 |
-
WCVendors_Install::update_db_version();
|
| 332 |
-
flush_rewrite_rules();
|
| 333 |
-
|
| 334 |
-
$user_email = $this->get_current_user_email();
|
| 335 |
-
$forums = 'https://wordpress.org/support/plugin/wc-vendors';
|
| 336 |
-
$docs_url = 'https://docs.wcvendors.com/?utm_source=setup_wizard&utm_medium=plugin&utm_campaign=setup_complete';
|
| 337 |
-
$help_text = sprintf(
|
| 338 |
-
/* translators: %1$s: link to videos, %2$s: link to docs */
|
| 339 |
-
__( 'Don\'t forget to check our <a href="%1$s" target="_blank">documentation</a> to learn more about setting up WC Vendors and if you need help, be sure to visit our <a href="%2$s" target="_blank">free support forums</a>.', 'wc-vendors' ),
|
| 340 |
-
$docs_url,
|
| 341 |
-
$forums
|
| 342 |
-
);
|
| 343 |
-
|
| 344 |
-
include( WCV_ABSPATH_ADMIN . 'views/setup/ready.php' );
|
| 345 |
-
}
|
| 346 |
-
}
|
| 347 |
-
|
| 348 |
-
new WCVendors_Admin_Setup_Wizard();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-vendor-admin-dashboard.php
DELETED
|
@@ -1,724 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* WC Vendor Admin Dashboard - Vendor WP-Admin Dashboard Pages
|
| 4 |
-
*
|
| 5 |
-
* @author Jamie Madden <http://wcvendors.com / https://github.com/digitalchild>
|
| 6 |
-
* @package WCVendors
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
Class WCV_Vendor_Admin_Dashboard {
|
| 10 |
-
|
| 11 |
-
public $dashboard_error_msg;
|
| 12 |
-
|
| 13 |
-
function __construct(){
|
| 14 |
-
// Add Shop Settings page
|
| 15 |
-
add_action( 'admin_menu', array( $this, 'vendor_dashboard_pages') );
|
| 16 |
-
// Hook into init for form processing
|
| 17 |
-
add_action( 'admin_init', array( $this, 'save_shop_settings' ) );
|
| 18 |
-
add_action( 'admin_head', array( $this, 'admin_enqueue_order_style') );
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
function vendor_dashboard_pages(){
|
| 22 |
-
add_menu_page( __('Shop Settings', 'wc-vendors'), __('Shop Settings', 'wc-vendors'), 'manage_product', 'wcv-vendor-shopsettings', array( $this, 'settings_page' ) );
|
| 23 |
-
$hook = add_menu_page( __( 'Orders', 'wc-vendors' ), __( 'Orders', 'wc-vendors' ), 'manage_product', 'wcv-vendor-orders', array( 'WCV_Vendor_Admin_Dashboard', 'orders_page' ) );
|
| 24 |
-
add_action( "load-$hook", array( 'WCV_Vendor_Admin_Dashboard', 'add_options' ) );
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
function settings_page() {
|
| 28 |
-
$user_id = get_current_user_id();
|
| 29 |
-
$paypal_address = true;
|
| 30 |
-
$shop_description = true;
|
| 31 |
-
$description = get_user_meta( $user_id, 'pv_shop_description', true );
|
| 32 |
-
$seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
|
| 33 |
-
$has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
|
| 34 |
-
$shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
|
| 35 |
-
$global_html = 'yes' === get_option( 'wcvendors_display_shop_description_html', 'no' ) ? true : false;
|
| 36 |
-
include('views/html-vendor-settings-page.php');
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
function admin_enqueue_order_style() {
|
| 40 |
-
|
| 41 |
-
$screen = get_current_screen();
|
| 42 |
-
|
| 43 |
-
if ( ! $screen ) return;
|
| 44 |
-
|
| 45 |
-
$screen_id = $screen->id;
|
| 46 |
-
|
| 47 |
-
if ( 'wcv-vendor-orders' === $screen_id ){
|
| 48 |
-
|
| 49 |
-
add_thickbox();
|
| 50 |
-
wp_enqueue_style( 'admin_order_styles', wcv_assets_url . 'css/admin-orders.css' );
|
| 51 |
-
}
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
/**
|
| 55 |
-
* Save shop settings
|
| 56 |
-
*/
|
| 57 |
-
public function save_shop_settings()
|
| 58 |
-
{
|
| 59 |
-
$user_id = get_current_user_id();
|
| 60 |
-
$error = false;
|
| 61 |
-
$error_msg = '';
|
| 62 |
-
|
| 63 |
-
if (isset ( $_POST[ 'wc-vendors-nonce' ] ) ) {
|
| 64 |
-
|
| 65 |
-
if ( !wp_verify_nonce( $_POST[ 'wc-vendors-nonce' ], 'save-shop-settings-admin' ) ) {
|
| 66 |
-
return false;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
if ( isset( $_POST[ 'pv_paypal' ] ) && '' !== $_POST[ 'pv_paypal' ] ) {
|
| 70 |
-
if ( !is_email( $_POST[ 'pv_paypal' ] ) ) {
|
| 71 |
-
$error_msg .= __( 'Your PayPal address is not a valid email address.', 'wc-vendors' );
|
| 72 |
-
$error = true;
|
| 73 |
-
} else {
|
| 74 |
-
update_user_meta( $user_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
|
| 75 |
-
}
|
| 76 |
-
} else {
|
| 77 |
-
update_user_meta( $user_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
if ( !empty( $_POST[ 'pv_shop_name' ] ) ) {
|
| 81 |
-
$users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $_POST[ 'pv_shop_name' ] ) ) );
|
| 82 |
-
if ( !empty( $users ) && $users[ 0 ]->ID != $user_id ) {
|
| 83 |
-
$error_msg .= __( 'That shop name is already taken. Your shop name must be unique.', 'wc-vendors' );
|
| 84 |
-
$error = true;
|
| 85 |
-
} else {
|
| 86 |
-
update_user_meta( $user_id, 'pv_shop_name', $_POST[ 'pv_shop_name' ] );
|
| 87 |
-
update_user_meta( $user_id, 'pv_shop_slug', sanitize_title( $_POST[ 'pv_shop_name' ] ) );
|
| 88 |
-
}
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
if ( isset( $_POST[ 'pv_shop_description' ] ) ) {
|
| 92 |
-
update_user_meta( $user_id, 'pv_shop_description', $_POST[ 'pv_shop_description' ] );
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
if ( isset( $_POST[ 'pv_seller_info' ] ) ) {
|
| 96 |
-
update_user_meta( $user_id, 'pv_seller_info', $_POST[ 'pv_seller_info' ] );
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
// Bank details
|
| 100 |
-
if ( isset( $_POST[ 'wcv_bank_account_name' ] ) ){
|
| 101 |
-
update_user_meta( $user_id, 'wcv_bank_account_name', $_POST['wcv_bank_account_name'] );
|
| 102 |
-
}
|
| 103 |
-
if ( isset( $_POST[ 'wcv_bank_account_number' ] ) ){
|
| 104 |
-
update_user_meta( $user_id, 'wcv_bank_account_name', $_POST['wcv_bank_account_name'] );
|
| 105 |
-
}
|
| 106 |
-
if ( isset( $_POST[ 'wcv_bank_name' ] ) ){
|
| 107 |
-
update_user_meta( $user_id, 'wcv_bank_name', $_POST['wcv_bank_name'] );
|
| 108 |
-
}
|
| 109 |
-
if ( isset( $_POST[ 'wcv_bank_routing_number' ] ) ){
|
| 110 |
-
update_user_meta( $user_id, 'wcv_bank_routing_number', $_POST['wcv_bank_routing_number'] );
|
| 111 |
-
}
|
| 112 |
-
if ( isset( $_POST[ 'wcv_bank_iban' ] ) ){
|
| 113 |
-
update_user_meta( $user_id, 'wcv_bank_iban', $_POST['wcv_bank_iban'] );
|
| 114 |
-
}
|
| 115 |
-
if ( isset( $_POST[ 'wcv_bank_bic_swift' ] ) ){
|
| 116 |
-
update_user_meta( $user_id, 'wcv_bank_bic_swift', $_POST['wcv_bank_bic_swift'] );
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
do_action( 'wcvendors_shop_settings_admin_saved', $user_id );
|
| 122 |
-
|
| 123 |
-
if ( ! $error ) {
|
| 124 |
-
add_action( 'admin_notices', array( $this, 'add_admin_notice_success' ) );
|
| 125 |
-
} else {
|
| 126 |
-
$this->dashboard_error_msg = $error_msg;
|
| 127 |
-
add_action( 'admin_notices', array( $this, 'add_admin_notice_error' ) );
|
| 128 |
-
}
|
| 129 |
-
}
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
/**
|
| 133 |
-
* Output a sucessful message after saving the shop settings
|
| 134 |
-
*
|
| 135 |
-
* @since 1.9.9
|
| 136 |
-
* @access public
|
| 137 |
-
*/
|
| 138 |
-
public function add_admin_notice_success( ){
|
| 139 |
-
|
| 140 |
-
echo '<div class="updated"><p>';
|
| 141 |
-
echo __( 'Settings saved.', 'wc-vendors' );
|
| 142 |
-
echo '</p></div>';
|
| 143 |
-
|
| 144 |
-
} // add_admin_notice_success()
|
| 145 |
-
|
| 146 |
-
/**
|
| 147 |
-
* Output an error message
|
| 148 |
-
*
|
| 149 |
-
* @since 1.9.9
|
| 150 |
-
* @access public
|
| 151 |
-
*/
|
| 152 |
-
public function add_admin_notice_error( ){
|
| 153 |
-
|
| 154 |
-
echo '<div class="error"><p>';
|
| 155 |
-
echo $this->dashboard_error_msg;
|
| 156 |
-
echo '</p></div>';
|
| 157 |
-
|
| 158 |
-
} // add_admin_notice_error()
|
| 159 |
-
|
| 160 |
-
/**
|
| 161 |
-
*
|
| 162 |
-
*
|
| 163 |
-
* @param unknown $status
|
| 164 |
-
* @param unknown $option
|
| 165 |
-
* @param unknown $value
|
| 166 |
-
*
|
| 167 |
-
* @return unknown
|
| 168 |
-
*/
|
| 169 |
-
public static function set_table_option( $status, $option, $value )
|
| 170 |
-
{
|
| 171 |
-
if ( $option == 'orders_per_page' ) {
|
| 172 |
-
return $value;
|
| 173 |
-
}
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
/**
|
| 178 |
-
*
|
| 179 |
-
*/
|
| 180 |
-
public static function add_options()
|
| 181 |
-
{
|
| 182 |
-
global $WCV_Vendor_Order_Page;
|
| 183 |
-
|
| 184 |
-
$args = array(
|
| 185 |
-
'label' => 'Rows',
|
| 186 |
-
'default' => 10,
|
| 187 |
-
'option' => 'orders_per_page'
|
| 188 |
-
);
|
| 189 |
-
add_screen_option( 'per_page', $args );
|
| 190 |
-
|
| 191 |
-
$WCV_Vendor_Order_Page = new WCV_Vendor_Order_Page();
|
| 192 |
-
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
/**
|
| 197 |
-
* HTML setup for the Orders Page
|
| 198 |
-
*/
|
| 199 |
-
public static function orders_page()
|
| 200 |
-
{
|
| 201 |
-
global $woocommerce, $WCV_Vendor_Order_Page;
|
| 202 |
-
|
| 203 |
-
$WCV_Vendor_Order_Page->prepare_items();
|
| 204 |
-
|
| 205 |
-
?>
|
| 206 |
-
<div class="wrap">
|
| 207 |
-
|
| 208 |
-
<div id="icon-woocommerce" class="icon32 icon32-woocommerce-reports"><br/></div>
|
| 209 |
-
<h2><?php _e( 'Orders', 'wc-vendors' ); ?></h2>
|
| 210 |
-
|
| 211 |
-
<form id="posts-filter" method="get">
|
| 212 |
-
|
| 213 |
-
<input type="hidden" name="page" value="wcv-vendor-orders"/>
|
| 214 |
-
<?php $WCV_Vendor_Order_Page->display() ?>
|
| 215 |
-
|
| 216 |
-
</form>
|
| 217 |
-
<div id="ajax-response"></div>
|
| 218 |
-
<br class="clear"/>
|
| 219 |
-
</div>
|
| 220 |
-
|
| 221 |
-
<?php }
|
| 222 |
-
|
| 223 |
-
} // End WCV_Vendor_Admin_Dashboard
|
| 224 |
-
|
| 225 |
-
if ( !class_exists( 'WP_List_Table' ) ) require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php';
|
| 226 |
-
|
| 227 |
-
/**
|
| 228 |
-
* WCV Vendor Order Page
|
| 229 |
-
*
|
| 230 |
-
* @author Jamie Madden <http://wcvendors.com / https://github.com/digitalchild>
|
| 231 |
-
* @package WCVendors
|
| 232 |
-
* @extends WP_List_Table
|
| 233 |
-
*/
|
| 234 |
-
class WCV_Vendor_Order_Page extends WP_List_Table
|
| 235 |
-
{
|
| 236 |
-
|
| 237 |
-
public $index;
|
| 238 |
-
|
| 239 |
-
/**
|
| 240 |
-
* can_view_comments
|
| 241 |
-
*
|
| 242 |
-
* @since 1.0.0
|
| 243 |
-
* @access public
|
| 244 |
-
* @var string $can_view_comments permission check for view comments
|
| 245 |
-
*/
|
| 246 |
-
public $can_view_comments;
|
| 247 |
-
|
| 248 |
-
|
| 249 |
-
/**
|
| 250 |
-
* can_add_comments
|
| 251 |
-
*
|
| 252 |
-
* @since 1.0.0
|
| 253 |
-
* @access public
|
| 254 |
-
* @var string $can_add_comments permission check for add comments
|
| 255 |
-
*/
|
| 256 |
-
public $can_add_comments;
|
| 257 |
-
|
| 258 |
-
|
| 259 |
-
/**
|
| 260 |
-
* __construct function.
|
| 261 |
-
*
|
| 262 |
-
* @access public
|
| 263 |
-
*/
|
| 264 |
-
function __construct()
|
| 265 |
-
{
|
| 266 |
-
global $status, $page;
|
| 267 |
-
|
| 268 |
-
$this->index = 0;
|
| 269 |
-
|
| 270 |
-
//Set parent defaults
|
| 271 |
-
parent::__construct( array(
|
| 272 |
-
'singular' => __( 'order', 'wc-vendors' ),
|
| 273 |
-
'plural' => __( 'orders', 'wc-vendors' ),
|
| 274 |
-
'ajax' => false
|
| 275 |
-
) );
|
| 276 |
-
|
| 277 |
-
$this->can_view_comments = 'yes' === get_option( 'wcvendors_capability_order_read_notes', 'no' ) ? true : false;
|
| 278 |
-
$this->can_add_comments = 'yes' === get_option( 'wcvendors_capability_order_update_notes', 'no' ) ? true : false;
|
| 279 |
-
}
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
/**
|
| 283 |
-
* column_default function.
|
| 284 |
-
*
|
| 285 |
-
* @access public
|
| 286 |
-
*
|
| 287 |
-
* @param unknown $item
|
| 288 |
-
* @param mixed $column_name
|
| 289 |
-
*
|
| 290 |
-
* @return unknown
|
| 291 |
-
*/
|
| 292 |
-
function column_default( $item, $column_name )
|
| 293 |
-
{
|
| 294 |
-
global $wpdb;
|
| 295 |
-
|
| 296 |
-
switch ( $column_name ) {
|
| 297 |
-
case 'order_id' :
|
| 298 |
-
return $item->order_id;
|
| 299 |
-
case 'customer' :
|
| 300 |
-
return $item->customer;
|
| 301 |
-
case 'products' :
|
| 302 |
-
return $item->products;
|
| 303 |
-
case 'total' :
|
| 304 |
-
return $item->total;
|
| 305 |
-
// case 'comments' :
|
| 306 |
-
// return $item->comments;
|
| 307 |
-
case 'date' :
|
| 308 |
-
return $item->date;
|
| 309 |
-
case 'status' :
|
| 310 |
-
return $item->status;
|
| 311 |
-
default:
|
| 312 |
-
return apply_filters( 'wcvendors_vendor_order_page_column_default', '', $item, $column_name );
|
| 313 |
-
}
|
| 314 |
-
}
|
| 315 |
-
|
| 316 |
-
|
| 317 |
-
/**
|
| 318 |
-
* column_cb function.
|
| 319 |
-
*
|
| 320 |
-
* @access public
|
| 321 |
-
*
|
| 322 |
-
* @param mixed $item
|
| 323 |
-
*
|
| 324 |
-
* @return unknown
|
| 325 |
-
*/
|
| 326 |
-
function column_cb( $item )
|
| 327 |
-
{
|
| 328 |
-
return sprintf(
|
| 329 |
-
'<input type="checkbox" name="%1$s[]" value="%2$s" />',
|
| 330 |
-
/*$1%s*/
|
| 331 |
-
'order_id',
|
| 332 |
-
/*$2%s*/
|
| 333 |
-
$item->order_id
|
| 334 |
-
);
|
| 335 |
-
}
|
| 336 |
-
|
| 337 |
-
|
| 338 |
-
/**
|
| 339 |
-
* get_columns function.
|
| 340 |
-
*
|
| 341 |
-
* @access public
|
| 342 |
-
* @return unknown
|
| 343 |
-
*/
|
| 344 |
-
function get_columns()
|
| 345 |
-
{
|
| 346 |
-
$columns = array(
|
| 347 |
-
'cb' => '<input type="checkbox" />',
|
| 348 |
-
'order_id' => __( 'Order ID', 'wc-vendors' ),
|
| 349 |
-
'customer' => __( 'Customer', 'wc-vendors' ),
|
| 350 |
-
'products' => __( 'Products', 'wc-vendors' ),
|
| 351 |
-
'total' => __( 'Total', 'wc-vendors' ),
|
| 352 |
-
// 'comments' => __( 'Comments to Customer', 'wc-vendors' ),
|
| 353 |
-
'date' => __( 'Date', 'wc-vendors' ),
|
| 354 |
-
'status' => __( 'Shipped', 'wc-vendors' ),
|
| 355 |
-
);
|
| 356 |
-
|
| 357 |
-
if ( !$this->can_view_comments ) unset( $columns['comments'] );
|
| 358 |
-
|
| 359 |
-
return apply_filters( 'wcvendors_vendor_order_page_get_columns', $columns );
|
| 360 |
-
|
| 361 |
-
}
|
| 362 |
-
|
| 363 |
-
|
| 364 |
-
/**
|
| 365 |
-
* get_sortable_columns function.
|
| 366 |
-
*
|
| 367 |
-
* @access public
|
| 368 |
-
* @return unknown
|
| 369 |
-
*/
|
| 370 |
-
function get_sortable_columns()
|
| 371 |
-
{
|
| 372 |
-
$sortable_columns = array(
|
| 373 |
-
'order_id' => array( 'order_id', false ),
|
| 374 |
-
'total' => array( 'total', false ),
|
| 375 |
-
'status' => array( 'status', false ),
|
| 376 |
-
);
|
| 377 |
-
|
| 378 |
-
return $sortable_columns;
|
| 379 |
-
}
|
| 380 |
-
|
| 381 |
-
|
| 382 |
-
/**
|
| 383 |
-
* Get bulk actions
|
| 384 |
-
*
|
| 385 |
-
* @return unknown
|
| 386 |
-
*/
|
| 387 |
-
function get_bulk_actions()
|
| 388 |
-
{
|
| 389 |
-
$actions = array(
|
| 390 |
-
'mark_shipped' => apply_filters( 'wcvendors_mark_shipped_label', __( 'Mark shipped', 'wc-vendors' ) ),
|
| 391 |
-
);
|
| 392 |
-
|
| 393 |
-
return $actions;
|
| 394 |
-
}
|
| 395 |
-
|
| 396 |
-
|
| 397 |
-
/**
|
| 398 |
-
* Process bulk actions
|
| 399 |
-
*
|
| 400 |
-
* @return unknown
|
| 401 |
-
*/
|
| 402 |
-
function process_bulk_action()
|
| 403 |
-
{
|
| 404 |
-
if ( !isset( $_GET[ 'order_id' ] ) ) return;
|
| 405 |
-
|
| 406 |
-
if (is_array( $_GET[ 'order_id' ] ) ) {
|
| 407 |
-
|
| 408 |
-
$items = array_map( 'intval', $_GET[ 'order_id' ] );
|
| 409 |
-
|
| 410 |
-
switch ( $this->current_action() ) {
|
| 411 |
-
case 'mark_shipped':
|
| 412 |
-
|
| 413 |
-
$result = $this->mark_shipped( $items );
|
| 414 |
-
|
| 415 |
-
if ( $result )
|
| 416 |
-
echo '<div class="updated"><p>' . __( 'Orders marked shipped.', 'wc-vendors' ) . '</p></div>';
|
| 417 |
-
break;
|
| 418 |
-
|
| 419 |
-
default:
|
| 420 |
-
// code...
|
| 421 |
-
break;
|
| 422 |
-
}
|
| 423 |
-
|
| 424 |
-
} else {
|
| 425 |
-
|
| 426 |
-
if ( !isset( $_GET[ 'action' ] ) ) return;
|
| 427 |
-
}
|
| 428 |
-
|
| 429 |
-
|
| 430 |
-
}
|
| 431 |
-
|
| 432 |
-
|
| 433 |
-
/**
|
| 434 |
-
* Mark orders as shipped
|
| 435 |
-
*
|
| 436 |
-
* @param unknown $ids (optional)
|
| 437 |
-
*
|
| 438 |
-
* @version 2.0.0
|
| 439 |
-
* @return unknown
|
| 440 |
-
*/
|
| 441 |
-
public function mark_shipped( $ids = array() ){
|
| 442 |
-
|
| 443 |
-
$user_id = get_current_user_id();
|
| 444 |
-
|
| 445 |
-
if ( !empty( $ids ) ) {
|
| 446 |
-
|
| 447 |
-
foreach ($ids as $order_id ) {
|
| 448 |
-
$order = wc_get_order( $order_id );
|
| 449 |
-
$vendors = WCV_Vendors::get_vendors_from_order( $order );
|
| 450 |
-
$vendor_ids = array_keys( $vendors );
|
| 451 |
-
|
| 452 |
-
if ( !in_array( $user_id, $vendor_ids ) ) {
|
| 453 |
-
return;
|
| 454 |
-
}
|
| 455 |
-
|
| 456 |
-
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 457 |
-
|
| 458 |
-
if( !in_array($user_id, $shippers ) ) {
|
| 459 |
-
|
| 460 |
-
$shippers[] = $user_id;
|
| 461 |
-
|
| 462 |
-
if ( !empty( $mails ) ) {
|
| 463 |
-
WC()->mailer()->emails[ 'WC_Email_Notify_Shipped' ]->trigger( $order_id, $user_id );
|
| 464 |
-
}
|
| 465 |
-
do_action( 'wcvendors_vendor_ship', $order_id, $user_id, $order );
|
| 466 |
-
}
|
| 467 |
-
|
| 468 |
-
update_post_meta( $order_id, 'wc_pv_shipped', $shippers );
|
| 469 |
-
}
|
| 470 |
-
return true;
|
| 471 |
-
}
|
| 472 |
-
return false;
|
| 473 |
-
}
|
| 474 |
-
|
| 475 |
-
|
| 476 |
-
|
| 477 |
-
/**
|
| 478 |
-
* Get Orders to display in admin
|
| 479 |
-
*
|
| 480 |
-
* @return $orders
|
| 481 |
-
*/
|
| 482 |
-
function get_orders() {
|
| 483 |
-
|
| 484 |
-
$user_id = get_current_user_id();
|
| 485 |
-
|
| 486 |
-
$orders = array();
|
| 487 |
-
|
| 488 |
-
$vendor_products = $this->get_vendor_products( $user_id );
|
| 489 |
-
|
| 490 |
-
$products = array();
|
| 491 |
-
|
| 492 |
-
foreach ( $vendor_products as $_product ) {
|
| 493 |
-
|
| 494 |
-
$products[] = $_product->ID;
|
| 495 |
-
}
|
| 496 |
-
|
| 497 |
-
$_orders = $this->get_orders_for_vendor_products( $products );
|
| 498 |
-
|
| 499 |
-
$model_id = 0;
|
| 500 |
-
|
| 501 |
-
if ( !empty( $_orders ) ) {
|
| 502 |
-
|
| 503 |
-
foreach ( $_orders as $order ) {
|
| 504 |
-
|
| 505 |
-
$order = wc_get_order( $order->order_id );
|
| 506 |
-
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 507 |
-
$valid_items = WCV_Queries::get_products_for_order( $order_id );
|
| 508 |
-
$valid = array();
|
| 509 |
-
|
| 510 |
-
$items = $order->get_items();
|
| 511 |
-
|
| 512 |
-
foreach ( $items as $order_item_id => $item) {
|
| 513 |
-
if ( in_array( $item[ 'variation_id' ], $valid_items) || in_array( $item[ 'product_id' ], $valid_items ) ) {
|
| 514 |
-
$valid[ $order_item_id ] = $item;
|
| 515 |
-
}
|
| 516 |
-
}
|
| 517 |
-
|
| 518 |
-
$products = '';
|
| 519 |
-
|
| 520 |
-
foreach ( $valid as $order_item_id => $item ) {
|
| 521 |
-
|
| 522 |
-
$wc_product = new WC_Product( $item['product_id'] );
|
| 523 |
-
$products .= '<strong>'. $item['qty'] . ' x ' . $item['name'] . '</strong><br />';
|
| 524 |
-
$_item = $order->get_item( $order_item_id );
|
| 525 |
-
$meta_data = $_item->get_meta_data();
|
| 526 |
-
|
| 527 |
-
if ( !empty( $metadata ) ) {
|
| 528 |
-
|
| 529 |
-
$products .= '<table cellspacing="0" class="wcv_display_meta">';
|
| 530 |
-
|
| 531 |
-
foreach ( $metadata as $meta ) {
|
| 532 |
-
|
| 533 |
-
// Skip hidden core fields
|
| 534 |
-
if ( in_array( $meta['meta_key'], apply_filters( 'woocommerce_hidden_order_itemmeta', array(
|
| 535 |
-
'_qty',
|
| 536 |
-
'_tax_class',
|
| 537 |
-
'_product_id',
|
| 538 |
-
'_variation_id',
|
| 539 |
-
'_line_subtotal',
|
| 540 |
-
'_line_subtotal_tax',
|
| 541 |
-
'_line_total',
|
| 542 |
-
'_line_tax',
|
| 543 |
-
'_vendor_order_item_id',
|
| 544 |
-
'_vendor_commission',
|
| 545 |
-
get_option( 'wcvendors_label_sold_by' ),
|
| 546 |
-
) ) ) ) {
|
| 547 |
-
continue;
|
| 548 |
-
}
|
| 549 |
-
|
| 550 |
-
// Skip serialised meta
|
| 551 |
-
if ( is_serialized( $meta['meta_value'] ) ) {
|
| 552 |
-
continue;
|
| 553 |
-
}
|
| 554 |
-
|
| 555 |
-
// Get attribute data
|
| 556 |
-
if ( taxonomy_exists( wc_sanitize_taxonomy_name( $meta['meta_key'] ) ) ) {
|
| 557 |
-
$term = get_term_by( 'slug', $meta['meta_value'], wc_sanitize_taxonomy_name( $meta['meta_key'] ) );
|
| 558 |
-
$meta['meta_key'] = wc_attribute_label( wc_sanitize_taxonomy_name( $meta['meta_key'] ) );
|
| 559 |
-
$meta['meta_value'] = isset( $term->name ) ? $term->name : $meta['meta_value'];
|
| 560 |
-
} else {
|
| 561 |
-
$meta['meta_key'] = apply_filters( 'woocommerce_attribute_label', wc_attribute_label( $meta['meta_key'], $wc_product ), $meta['meta_key'] );
|
| 562 |
-
}
|
| 563 |
-
|
| 564 |
-
$products .= '<tr><th>' . wp_kses_post( rawurldecode( $meta['meta_key'] ) ) . ':</th><td>' . rawurldecode( $meta['meta_value'] ) . '</td></tr>';
|
| 565 |
-
}
|
| 566 |
-
$products .= '</table>';
|
| 567 |
-
}
|
| 568 |
-
|
| 569 |
-
}
|
| 570 |
-
|
| 571 |
-
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 572 |
-
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 573 |
-
$shipped = in_array($user_id, $shippers) ? __( 'Yes', 'wc-vendors' ) : __( 'No', 'wc-vendors' ) ;
|
| 574 |
-
|
| 575 |
-
$sum = WCV_Queries::sum_for_orders( array( $order_id ), array('vendor_id' =>get_current_user_id() ), false );
|
| 576 |
-
$sum = reset( $sum );
|
| 577 |
-
|
| 578 |
-
$total = $sum->line_total;
|
| 579 |
-
|
| 580 |
-
$comment_output = '';
|
| 581 |
-
|
| 582 |
-
$order_date = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->order_date : $order->get_date_created();
|
| 583 |
-
|
| 584 |
-
// Make sure the correct address is shown based on the WooCommerce options
|
| 585 |
-
$customer = $order->get_formatted_billing_address();
|
| 586 |
-
if ( ( get_option( 'woocommerce_ship_to_billing_address_only' ) === 'no' ) && ( $order->get_formatted_shipping_address() ) ) {
|
| 587 |
-
$customer = $order->get_formatted_shipping_address();
|
| 588 |
-
}
|
| 589 |
-
|
| 590 |
-
$order_items = array();
|
| 591 |
-
$order_items[ 'order_id' ] = $order_id;
|
| 592 |
-
$order_items[ 'customer' ] = $customer;
|
| 593 |
-
$order_items[ 'products' ] = $products;
|
| 594 |
-
$order_items[ 'total' ] = wc_price( $total );
|
| 595 |
-
$order_items[ 'date' ] = date_i18n( wc_date_format(), strtotime( $order_date ) );
|
| 596 |
-
$order_items[ 'status' ] = $shipped;
|
| 597 |
-
|
| 598 |
-
$orders[] = (object) $order_items;
|
| 599 |
-
|
| 600 |
-
$model_id++;
|
| 601 |
-
}
|
| 602 |
-
}
|
| 603 |
-
return $orders;
|
| 604 |
-
|
| 605 |
-
}
|
| 606 |
-
|
| 607 |
-
|
| 608 |
-
/**
|
| 609 |
-
* Get the vendor products sold
|
| 610 |
-
*
|
| 611 |
-
* @param $user_id - the user_id to get the products of
|
| 612 |
-
*
|
| 613 |
-
* @return unknown
|
| 614 |
-
*/
|
| 615 |
-
public function get_vendor_products( $user_id )
|
| 616 |
-
{
|
| 617 |
-
global $wpdb;
|
| 618 |
-
|
| 619 |
-
$vendor_products = array();
|
| 620 |
-
$sql = '';
|
| 621 |
-
|
| 622 |
-
$sql .= "SELECT product_id FROM {$wpdb->prefix}pv_commission WHERE vendor_id = {$user_id} AND status != 'reversed' GROUP BY product_id";
|
| 623 |
-
|
| 624 |
-
$results = $wpdb->get_results( $sql );
|
| 625 |
-
|
| 626 |
-
foreach ( $results as $value ) {
|
| 627 |
-
$ids[ ] = $value->product_id;
|
| 628 |
-
}
|
| 629 |
-
|
| 630 |
-
if ( !empty( $ids ) ) {
|
| 631 |
-
$vendor_products = get_posts(
|
| 632 |
-
array(
|
| 633 |
-
'numberposts' => -1,
|
| 634 |
-
'orderby' => 'post_date',
|
| 635 |
-
'post_type' => array( 'product', 'product_variation' ),
|
| 636 |
-
'order' => 'DESC',
|
| 637 |
-
'include' => $ids
|
| 638 |
-
)
|
| 639 |
-
);
|
| 640 |
-
}
|
| 641 |
-
|
| 642 |
-
return $vendor_products;
|
| 643 |
-
}
|
| 644 |
-
|
| 645 |
-
|
| 646 |
-
/**
|
| 647 |
-
* All orders for a specific product
|
| 648 |
-
*
|
| 649 |
-
* @param array $product_ids
|
| 650 |
-
* @param array $args (optional)
|
| 651 |
-
*
|
| 652 |
-
* @return object
|
| 653 |
-
*/
|
| 654 |
-
public function get_orders_for_vendor_products( array $product_ids, array $args = array() )
|
| 655 |
-
{
|
| 656 |
-
global $wpdb;
|
| 657 |
-
|
| 658 |
-
if ( empty( $product_ids ) ) return false;
|
| 659 |
-
|
| 660 |
-
$defaults = array(
|
| 661 |
-
'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
|
| 662 |
-
);
|
| 663 |
-
|
| 664 |
-
$args = wp_parse_args( $args, $defaults );
|
| 665 |
-
|
| 666 |
-
|
| 667 |
-
$sql = "
|
| 668 |
-
SELECT order_id
|
| 669 |
-
FROM {$wpdb->prefix}pv_commission as order_items
|
| 670 |
-
WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
|
| 671 |
-
AND status != 'reversed'
|
| 672 |
-
";
|
| 673 |
-
|
| 674 |
-
if ( !empty( $args[ 'vendor_id' ] ) ) {
|
| 675 |
-
$sql .= "
|
| 676 |
-
AND vendor_id = {$args['vendor_id']}
|
| 677 |
-
";
|
| 678 |
-
}
|
| 679 |
-
|
| 680 |
-
$sql .= "
|
| 681 |
-
GROUP BY order_id
|
| 682 |
-
ORDER BY time DESC
|
| 683 |
-
";
|
| 684 |
-
|
| 685 |
-
$orders = $wpdb->get_results( $sql );
|
| 686 |
-
|
| 687 |
-
return $orders;
|
| 688 |
-
}
|
| 689 |
-
|
| 690 |
-
|
| 691 |
-
|
| 692 |
-
/**
|
| 693 |
-
* prepare_items function.
|
| 694 |
-
*
|
| 695 |
-
* @access public
|
| 696 |
-
*/
|
| 697 |
-
function prepare_items()
|
| 698 |
-
{
|
| 699 |
-
|
| 700 |
-
|
| 701 |
-
/**
|
| 702 |
-
* Init column headers
|
| 703 |
-
*/
|
| 704 |
-
$this->_column_headers = $this->get_column_info();
|
| 705 |
-
|
| 706 |
-
|
| 707 |
-
/**
|
| 708 |
-
* Process bulk actions
|
| 709 |
-
*/
|
| 710 |
-
$this->process_bulk_action();
|
| 711 |
-
|
| 712 |
-
/**
|
| 713 |
-
* Get items
|
| 714 |
-
*/
|
| 715 |
-
|
| 716 |
-
$this->items = $this->get_orders();
|
| 717 |
-
|
| 718 |
-
/**
|
| 719 |
-
* Pagination
|
| 720 |
-
*/
|
| 721 |
-
}
|
| 722 |
-
|
| 723 |
-
|
| 724 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-vendor-applicants.php
DELETED
|
@@ -1,104 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
*
|
| 5 |
-
*/
|
| 6 |
-
class WCV_Vendor_Applicants
|
| 7 |
-
{
|
| 8 |
-
|
| 9 |
-
function __construct()
|
| 10 |
-
{
|
| 11 |
-
add_filter( 'user_row_actions', array( $this, 'user_row_actions' ), 10, 2 );
|
| 12 |
-
add_filter( 'load-users.php', array( $this, 'user_row_actions_commit' ) );
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
*
|
| 17 |
-
*
|
| 18 |
-
* @param unknown $actions
|
| 19 |
-
* @param unknown $user_object
|
| 20 |
-
*
|
| 21 |
-
* @return unknown
|
| 22 |
-
*/
|
| 23 |
-
function user_row_actions( $actions, $user_object )
|
| 24 |
-
{
|
| 25 |
-
|
| 26 |
-
if ( in_array( 'pending_vendor', $user_object->roles ) ){
|
| 27 |
-
$actions[ 'approve_vendor' ] = "<a href='?role=pending_vendor&action=approve_vendor&user_id=" . $user_object->ID . "'>" . __( 'Approve', 'cgc_ub' ) . "</a>";
|
| 28 |
-
$actions[ 'deny_vendor' ] = "<a href='?role=pending_vendor&action=deny_vendor&user_id=" . $user_object->ID . "'>" . __( 'Deny', 'cgc_ub' ) . "</a>";
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
return $actions;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
/**
|
| 36 |
-
*
|
| 37 |
-
*/
|
| 38 |
-
public function user_row_actions_commit()
|
| 39 |
-
{
|
| 40 |
-
if ( !empty( $_GET[ 'action' ] ) && !empty( $_GET[ 'user_id' ] ) ) {
|
| 41 |
-
|
| 42 |
-
$wp_user_object = new WP_User( (int) $_GET[ 'user_id' ] );
|
| 43 |
-
|
| 44 |
-
switch ( $_GET[ 'action' ] ) {
|
| 45 |
-
case 'approve_vendor':
|
| 46 |
-
$role = 'vendor';
|
| 47 |
-
add_action( 'admin_notices', array( $this, 'approved' ) );
|
| 48 |
-
do_action( 'wcvendors_approve_vendor', $wp_user_object );
|
| 49 |
-
break;
|
| 50 |
-
|
| 51 |
-
case 'deny_vendor':
|
| 52 |
-
$role = apply_filters( 'wcvendors_denied_vendor_role', 'subscriber' );
|
| 53 |
-
add_action( 'admin_notices', array( $this, 'denied' ) );
|
| 54 |
-
do_action( 'wcvendors_deny_vendor', $wp_user_object );
|
| 55 |
-
break;
|
| 56 |
-
|
| 57 |
-
default:
|
| 58 |
-
// code...
|
| 59 |
-
break;
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
$wp_user_object->set_role( $role );
|
| 63 |
-
|
| 64 |
-
}
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
/**
|
| 69 |
-
*
|
| 70 |
-
*/
|
| 71 |
-
public function denied()
|
| 72 |
-
{
|
| 73 |
-
echo '<div class="updated">';
|
| 74 |
-
echo '<p>' . sprintf( __( '%s has been <b>denied</b>.', 'wc-vendors' ), wcv_get_vendor_name( ) ) . '</p>';
|
| 75 |
-
echo '</div>';
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
/**
|
| 80 |
-
*
|
| 81 |
-
*/
|
| 82 |
-
public function approved()
|
| 83 |
-
{
|
| 84 |
-
echo '<div class="updated">';
|
| 85 |
-
echo '<p>' . __( 'Vendor has been <b>approved</b>.', 'wc-vendors' ) . '</p>';
|
| 86 |
-
echo '</div>';
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
/**
|
| 91 |
-
*
|
| 92 |
-
*
|
| 93 |
-
* @param unknown $values
|
| 94 |
-
*
|
| 95 |
-
* @return unknown
|
| 96 |
-
*/
|
| 97 |
-
public function show_pending_vendors_link( $values )
|
| 98 |
-
{
|
| 99 |
-
$values[ 'pending_vendors' ] = '<a href="?role=asd">' . __( 'Pending Vendors', 'wc-vendors' ) . ' <span class="count">(3)</span></a>';
|
| 100 |
-
|
| 101 |
-
return $values;
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-vendor-reports.php
DELETED
|
@@ -1,121 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Report views
|
| 5 |
-
*
|
| 6 |
-
* @author Matt Gates <http://mgates.me>
|
| 7 |
-
* @package ProductVendor
|
| 8 |
-
*/
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
class WCV_Vendor_Reports
|
| 12 |
-
{
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructor
|
| 17 |
-
*/
|
| 18 |
-
function __construct()
|
| 19 |
-
{
|
| 20 |
-
$this->vendor_id = !current_user_can( 'manage_woocommerce' ) ? wp_get_current_user()->ID : '';
|
| 21 |
-
if ( !empty ( $this->vendor_id ) ) {
|
| 22 |
-
add_filter( 'woocommerce_reports_charts', array( $this, 'filter_tabs' ), 99 );
|
| 23 |
-
add_filter( 'woocommerce_json_search_found_products', array( $this, 'filter_products_json' ) );
|
| 24 |
-
add_filter( 'woocommerce_reports_product_sales_order_items', array( $this, 'filter_products' ) );
|
| 25 |
-
add_filter( 'woocommerce_reports_top_sellers_order_items', array( $this, 'filter_products' ) );
|
| 26 |
-
add_filter( 'woocommerce_reports_top_earners_order_items', array( $this, 'filter_products' ) );
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* Show only reports that are useful to a vendor
|
| 33 |
-
*
|
| 34 |
-
* @param array $tabs
|
| 35 |
-
*
|
| 36 |
-
* @return array
|
| 37 |
-
*/
|
| 38 |
-
public function filter_tabs( $tabs )
|
| 39 |
-
{
|
| 40 |
-
global $woocommerce;
|
| 41 |
-
|
| 42 |
-
$remove = array(
|
| 43 |
-
'woocommerce_sales_overview',
|
| 44 |
-
'woocommerce_daily_sales',
|
| 45 |
-
'woocommerce_monthly_sales',
|
| 46 |
-
'woocommerce_monthly_taxes',
|
| 47 |
-
'woocommerce_category_sales',
|
| 48 |
-
'woocommerce_coupon_sales',
|
| 49 |
-
);
|
| 50 |
-
|
| 51 |
-
$reports = $tabs[ 'orders' ][ 'reports' ];
|
| 52 |
-
|
| 53 |
-
foreach ( $reports as $key => $chart ) {
|
| 54 |
-
if ( $key == 'coupon_usage' ) {
|
| 55 |
-
unset( $tabs[ 'orders' ][ 'reports' ][ $key ] );
|
| 56 |
-
}
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
// These are admin tabs
|
| 60 |
-
$return = array(
|
| 61 |
-
'orders' => $tabs[ 'orders' ]
|
| 62 |
-
);
|
| 63 |
-
|
| 64 |
-
return $return;
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
/**
|
| 69 |
-
* Filter products based on current vendor
|
| 70 |
-
*
|
| 71 |
-
* @param unknown $orders
|
| 72 |
-
*
|
| 73 |
-
* @return unknown
|
| 74 |
-
*/
|
| 75 |
-
public function filter_products( $orders )
|
| 76 |
-
{
|
| 77 |
-
$products = WCV_Vendors::get_vendor_products( $this->vendor_id );
|
| 78 |
-
|
| 79 |
-
$ids = array();
|
| 80 |
-
foreach ( $products as $product ) {
|
| 81 |
-
$ids[ ] = ( $product->ID );
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
foreach ( $orders as $key => $order ) {
|
| 85 |
-
|
| 86 |
-
if ( !in_array( $order->product_id, $ids ) ) {
|
| 87 |
-
unset( $orders[ $key ] );
|
| 88 |
-
continue;
|
| 89 |
-
} else {
|
| 90 |
-
if ( !empty( $order->line_total ) ) {
|
| 91 |
-
$orders[ $key ]->line_total = WCV_Commission::calculate_commission( $order->line_total, $order->product_id, $order, $order->qty );
|
| 92 |
-
}
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
return $orders;
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
/**
|
| 102 |
-
*
|
| 103 |
-
*
|
| 104 |
-
* @param unknown $products
|
| 105 |
-
*
|
| 106 |
-
* @return unknown
|
| 107 |
-
*/
|
| 108 |
-
public function filter_products_json( $products )
|
| 109 |
-
{
|
| 110 |
-
$vendor_products = WCV_Vendors::get_vendor_products( $this->vendor_id );
|
| 111 |
-
|
| 112 |
-
$ids = array();
|
| 113 |
-
foreach ( $vendor_products as $vendor_product ) {
|
| 114 |
-
$ids[ $vendor_product->ID ] = $vendor_product->post_title;
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
return array_intersect_key( $products, $ids );
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-wcv-admin-extensions.php
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* WC Vendors Extensions Page
|
| 4 |
-
*
|
| 5 |
-
* @author WooThemes
|
| 6 |
-
* @category Admin
|
| 7 |
-
* @package WooCommerce/Admin
|
| 8 |
-
* @version 2.5.0
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 12 |
-
exit;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* WC_Admin_Addons Class.
|
| 17 |
-
*/
|
| 18 |
-
class WCVendors_Admin_Extensions {
|
| 19 |
-
|
| 20 |
-
public static function output(){
|
| 21 |
-
|
| 22 |
-
include_once dirname( __FILE__ ) . '/views/html-admin-page-extensions.php';
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-wcv-admin-help.php
DELETED
|
@@ -1,120 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Add some content to the help tab
|
| 4 |
-
*
|
| 5 |
-
* @package WC Vendors/Admin
|
| 6 |
-
* @version 2.0.0
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
-
exit;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
if ( class_exists( 'WCVendors_Admin_Help', false ) ) {
|
| 14 |
-
return new WCVendors_Admin_Help();
|
| 15 |
-
}
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* WCVendors_Admin_Help Class.
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Admin_Help {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Hook in tabs.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
add_action( 'current_screen', array( $this, 'add_tabs' ), 60 );
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* Add help tabs.
|
| 31 |
-
*/
|
| 32 |
-
public function add_tabs() {
|
| 33 |
-
|
| 34 |
-
$screen = get_current_screen();
|
| 35 |
-
|
| 36 |
-
if ( ! $screen || ! in_array( $screen->id, wcv_get_screen_ids() ) ) {
|
| 37 |
-
return;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
// Rquired to unhook woocommerce tabs on these pages due to adding wc vendors pages into the wc_get_screen_ids to load woocommerce assets
|
| 41 |
-
$screen->remove_help_tab( 'woocommerce_support_tab' );
|
| 42 |
-
$screen->remove_help_tab( 'woocommerce_bugs_tab' );
|
| 43 |
-
$screen->remove_help_tab( 'woocommerce_education_tab' );
|
| 44 |
-
$screen->remove_help_tab( 'woocommerce_onboard_tab' );
|
| 45 |
-
|
| 46 |
-
$screen->add_help_tab( array(
|
| 47 |
-
'id' => 'wcv_support_tab',
|
| 48 |
-
'title' => __( 'Help & Support', 'wc-vendors' ),
|
| 49 |
-
'content' =>
|
| 50 |
-
'<h2>' . __( 'Welcome to WC Vendors Help & Support', 'wc-vendors' ) . '</h2>' .
|
| 51 |
-
'<p>' . sprintf(
|
| 52 |
-
/* translators: %s: Documentation URL */
|
| 53 |
-
__( 'Should you need any help with using or extending WC Vendors, <a href="%s">please read our documentation</a>. You will find all kinds of resources including code snippets, guides and much more.', 'wc-vendors' ),
|
| 54 |
-
'https://docs.wcvendors.com/?utm_source=plugin&utm_medium=help&utm_campaign=settings'
|
| 55 |
-
) . '</p>' .
|
| 56 |
-
'<p>' . sprintf(
|
| 57 |
-
/* translators: %s: Forum URL */
|
| 58 |
-
__( 'Do you have a question about WC Vendors? For assistance please see our <a href="%1$s">community forum</a>. If you need help with premium extensions sold by WC Vendors, please <a href="%2$s">submit a ticket</a>.', 'wc-vendors' ),
|
| 59 |
-
'https://wordpress.org/support/plugin/wc-vendors',
|
| 60 |
-
'https://www.wcvendors.com/submit-ticket/?utm_source=plugin&utm_medium=help&utm_campaign=pluginsettings'
|
| 61 |
-
) . '</p>' .
|
| 62 |
-
'<p>' . __( 'Before asking for help we recommend checking the system status page to identify any problems with your configuration. <strong>Anything showing red should be fixed before contacting us.</strong>', 'wc-vendors' ) . '</p>' .
|
| 63 |
-
'<p>' . sprintf( __( 'Please follow our <a href="%s">debuggin guide</a> to ensure that you have narrowed down the issue. ', 'wc-vendors' ), 'https://docs.wcvendors.com/knowledge-base/the-debugging-guide/?utm_source=plugin&utm_medium=help&utm_campaign=settings' ) .
|
| 64 |
-
'<p><a href="' . admin_url( 'admin.php?page=wc-status' ) . '" class="button button-primary">' . __( 'System status', 'wc-vendors' ) . '</a> <a href="https://wordpress.org/support/plugin/wc-vendors" class="button">' . __( 'Community forum', 'wc-vendors' ) . '</a> <a href="https://www.wcvendors.com/submit-ticket/?utm_source=plugin&utm_medium=help&utm_campaign=pluginsettings" class="button">' . __( 'WC Vendors Premium Support', 'wc-vendors' ) . '</a></p>',
|
| 65 |
-
) );
|
| 66 |
-
|
| 67 |
-
$screen->add_help_tab( array(
|
| 68 |
-
'id' => 'wcvendors_getting_started_tab',
|
| 69 |
-
'title' => __( 'Getting Started', 'wc-vendors' ),
|
| 70 |
-
'content' =>
|
| 71 |
-
'<h2>' . __( 'Getting Started', 'wc-vendors' ) . '</h2>' .
|
| 72 |
-
'<p>' . sprintf( __( 'If you are new to WC Vendors then we highly recommend that you go through our <a href="%s">getting started guides</a>.', 'wc-vendors' ), 'https://docs.wcvendors.com/article-categories/getting-started/' ). '</p>'
|
| 73 |
-
) );
|
| 74 |
-
|
| 75 |
-
$screen->add_help_tab( array(
|
| 76 |
-
'id' => 'wcvendors_bugs_tab',
|
| 77 |
-
'title' => __( 'Found a bug?', 'wc-vendors' ),
|
| 78 |
-
'content' =>
|
| 79 |
-
'<h2>' . __( 'Found a bug?', 'wc-vendors' ) . '</h2>' .
|
| 80 |
-
/* translators: 1: GitHub issues URL 2: System status report URL */
|
| 81 |
-
'<p>' . sprintf( __( 'If you think you have found a bug in WC Vendors you can create a ticket via <a href="%1$s">Github issues</a>. To help us solve your issue, please be as descriptive as possible and include your <a href="%2$s">system status report</a>.', 'wc-vendors' ), 'https://github.com/wcvendors/wcvendors/issues?state=open', admin_url( 'admin.php?page=wc-status' ) ) . '</p>' .
|
| 82 |
-
'<p><a href="https://github.com/wcvendors/wcvendors/issues?state=open" class="button button-primary">' . __( 'Report a bug', 'wc-vendors' ) . '</a> <a href="' . admin_url( 'admin.php?page=wc-status' ) . '" class="button">' . __( 'System status', 'wc-vendors' ) . '</a></p>',
|
| 83 |
-
|
| 84 |
-
) );
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
$screen->add_help_tab( array(
|
| 89 |
-
'id' => 'wcvendors_onboard_tab',
|
| 90 |
-
'title' => __( 'Setup wizard', 'wc-vendors' ),
|
| 91 |
-
'content' =>
|
| 92 |
-
'<h2>' . __( 'Setup wizard', 'wc-vendors' ) . '</h2>' .
|
| 93 |
-
'<p>' . __( 'If you need to access the setup wizard again, please click on the button below.', 'wc-vendors' ) . '</p>' .
|
| 94 |
-
'<p><a href="' . admin_url( 'index.php?page=wcv-setup' ) . '" class="button button-primary">' . __( 'Setup wizard', 'wc-vendors' ) . '</a></p>',
|
| 95 |
-
|
| 96 |
-
) );
|
| 97 |
-
|
| 98 |
-
$screen->add_help_tab( array(
|
| 99 |
-
'id' => 'wcvendors_upgrade_tab',
|
| 100 |
-
'title' => __( 'Update', 'wc-vendors' ),
|
| 101 |
-
'content' =>
|
| 102 |
-
'<h2>' . __( 'Upgrade', 'wc-vendors' ) . '</h2>' .
|
| 103 |
-
'<p>' . __( 'If you need to manually run the updates, please click on the button below.', 'wc-vendors' ) . '</p>' .
|
| 104 |
-
'<p><a href="' . esc_url( add_query_arg( 'do_update_wcvendors', 'true', admin_url( 'admin.php?page=wcv-settings' ) ) ). '" class="button button-primary">' . __( 'Run the updater', 'wc-vendors' ) . '</a></p>',
|
| 105 |
-
|
| 106 |
-
) );
|
| 107 |
-
|
| 108 |
-
$screen->set_help_sidebar(
|
| 109 |
-
'<p><strong>' . __( 'For more information:', 'wc-vendors' ) . '</strong></p>' .
|
| 110 |
-
'<p><a href="https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_medium=help&utm_campaign=settings" target="_blank">' . __( 'Upgrade to Pro', 'wc-vendors' ) . '</a></p>' .
|
| 111 |
-
'<p><a href="https://www.wcvendors.com/extensions/?utm_source=plugin&utm_medium=help&utm_campaign=settings" target="_blank">' . __( 'Buy extensions', 'wc-vendors' ) . '</a></p>' .
|
| 112 |
-
'<p><a href="https://woocommerce.com/?utm_source=helptab&utm_medium=product&utm_content=about&utm_campaign=woocommerceplugin" target="_blank">' . __( 'About WC Vendors', 'wc-vendors' ) . '</a></p>' .
|
| 113 |
-
'<p><a href="https://wordpress.org/plugins/wc-vendors/" target="_blank">' . __( 'WC Vendors on WordPress.org', 'wc-vendors' ) . '</a></p>' .
|
| 114 |
-
'<p><a href="https://github.com/wcvendors/wcvendors" target="_blank">' . __( 'WC Vendors Github', 'wc-vendors' ) . '</a></p>'
|
| 115 |
-
|
| 116 |
-
);
|
| 117 |
-
}
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
return new WCVendors_Admin_Help();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-wcv-admin-notices.php
DELETED
|
@@ -1,249 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Display notices in admin
|
| 4 |
-
*
|
| 5 |
-
* @author Jamie Madden, WC Vendors
|
| 6 |
-
* @category Admin
|
| 7 |
-
* @package WCVendors/Admin
|
| 8 |
-
* @version 2.0.0
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 12 |
-
exit;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* WC_Admin_Notices Class.
|
| 17 |
-
*/
|
| 18 |
-
class WCVendors_Admin_Notices {
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Stores notices.
|
| 22 |
-
* @var array
|
| 23 |
-
*/
|
| 24 |
-
private static $notices = array();
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Array of notices - name => callback.
|
| 28 |
-
* @var array
|
| 29 |
-
*/
|
| 30 |
-
private static $core_notices = array(
|
| 31 |
-
'install' => 'install_notice',
|
| 32 |
-
'update' => 'update_notice',
|
| 33 |
-
'template_files' => 'template_file_check_notice',
|
| 34 |
-
'theme_support' => 'theme_check_notice',
|
| 35 |
-
);
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* Constructor.
|
| 39 |
-
*/
|
| 40 |
-
public static function init() {
|
| 41 |
-
self::$notices = get_option( 'wcvendors_admin_notices', array() );
|
| 42 |
-
|
| 43 |
-
add_action( 'switch_theme', array( __CLASS__, 'reset_admin_notices' ) );
|
| 44 |
-
add_action( 'wcvendors_installed', array( __CLASS__, 'reset_admin_notices' ) );
|
| 45 |
-
add_action( 'wp_loaded', array( __CLASS__, 'hide_notices' ) );
|
| 46 |
-
add_action( 'shutdown', array( __CLASS__, 'store_notices' ) );
|
| 47 |
-
|
| 48 |
-
if ( current_user_can( 'manage_woocommerce' ) ) {
|
| 49 |
-
add_action( 'admin_print_styles', array( __CLASS__, 'add_notices' ) );
|
| 50 |
-
}
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
/**
|
| 54 |
-
* Store notices to DB
|
| 55 |
-
*/
|
| 56 |
-
public static function store_notices() {
|
| 57 |
-
update_option( 'wcvendors_admin_notices', self::get_notices() );
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Get notices
|
| 62 |
-
* @return array
|
| 63 |
-
*/
|
| 64 |
-
public static function get_notices() {
|
| 65 |
-
return self::$notices;
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
/**
|
| 69 |
-
* Remove all notices.
|
| 70 |
-
*/
|
| 71 |
-
public static function remove_all_notices() {
|
| 72 |
-
self::$notices = array();
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
/**
|
| 76 |
-
* Reset notices for themes when switched or a new version of WC is installed.
|
| 77 |
-
*/
|
| 78 |
-
public static function reset_admin_notices() {
|
| 79 |
-
self::add_notice( 'template_files' );
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
/**
|
| 83 |
-
* Show a notice.
|
| 84 |
-
* @param string $name
|
| 85 |
-
*/
|
| 86 |
-
public static function add_notice( $name ) {
|
| 87 |
-
self::$notices = array_unique( array_merge( self::get_notices(), array( $name ) ) );
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
/**
|
| 91 |
-
* Remove a notice from being displayed.
|
| 92 |
-
* @param string $name
|
| 93 |
-
*/
|
| 94 |
-
public static function remove_notice( $name ) {
|
| 95 |
-
self::$notices = array_diff( self::get_notices(), array( $name ) );
|
| 96 |
-
delete_option( 'wcvendors_admin_notice_' . $name );
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
/**
|
| 100 |
-
* See if a notice is being shown.
|
| 101 |
-
* @param string $name
|
| 102 |
-
* @return boolean
|
| 103 |
-
*/
|
| 104 |
-
public static function has_notice( $name ) {
|
| 105 |
-
return in_array( $name, self::get_notices() );
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
/**
|
| 109 |
-
* Hide a notice if the GET variable is set.
|
| 110 |
-
*/
|
| 111 |
-
public static function hide_notices() {
|
| 112 |
-
if ( isset( $_GET['wcv-hide-notice'] ) && isset( $_GET['_wcv_notice_nonce'] ) ) {
|
| 113 |
-
if ( ! wp_verify_nonce( $_GET['_wcv_notice_nonce'], 'wcvendors_hide_notices_nonce' ) ) {
|
| 114 |
-
wp_die( __( 'Action failed. Please refresh the page and retry.', 'wcvendors' ) );
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
if ( ! current_user_can( 'manage_woocommerce' ) ) {
|
| 118 |
-
wp_die( __( 'Cheatin’ huh?', 'wcvendors' ) );
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
$hide_notice = sanitize_text_field( $_GET['wcv-hide-notice'] );
|
| 122 |
-
self::remove_notice( $hide_notice );
|
| 123 |
-
do_action( 'wcvendors_hide_' . $hide_notice . '_notice' );
|
| 124 |
-
}
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
/**
|
| 128 |
-
* Add notices + styles if needed.
|
| 129 |
-
*/
|
| 130 |
-
public static function add_notices() {
|
| 131 |
-
$notices = self::get_notices();
|
| 132 |
-
|
| 133 |
-
if ( ! empty( $notices ) ) {
|
| 134 |
-
$suffix = defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG ? '' : '.min';
|
| 135 |
-
wp_enqueue_style( 'wcv-setup', wcv_assets_url . 'css/wcv-activation' . $suffix .'.css', WCV_VERSION );
|
| 136 |
-
foreach ( $notices as $notice ) {
|
| 137 |
-
if ( ! empty( self::$core_notices[ $notice ] ) && apply_filters( 'wcvendors_show_admin_notice', true, $notice ) ) {
|
| 138 |
-
add_action( 'admin_notices', array( __CLASS__, self::$core_notices[ $notice ] ) );
|
| 139 |
-
} else {
|
| 140 |
-
add_action( 'admin_notices', array( __CLASS__, 'output_custom_notices' ) );
|
| 141 |
-
}
|
| 142 |
-
}
|
| 143 |
-
}
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
/**
|
| 147 |
-
* Add a custom notice.
|
| 148 |
-
* @param string $name
|
| 149 |
-
* @param string $notice_html
|
| 150 |
-
*/
|
| 151 |
-
public static function add_custom_notice( $name, $notice_html ) {
|
| 152 |
-
self::add_notice( $name );
|
| 153 |
-
update_option( 'wcvendors_admin_notice_' . $name, wp_kses_post( $notice_html ) );
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
/**
|
| 157 |
-
* Output any stored custom notices.
|
| 158 |
-
*/
|
| 159 |
-
public static function output_custom_notices() {
|
| 160 |
-
$notices = self::get_notices();
|
| 161 |
-
|
| 162 |
-
if ( ! empty( $notices ) ) {
|
| 163 |
-
foreach ( $notices as $notice ) {
|
| 164 |
-
if ( empty( self::$core_notices[ $notice ] ) ) {
|
| 165 |
-
$notice_html = get_option( 'wcvendors_admin_notice_' . $notice );
|
| 166 |
-
|
| 167 |
-
if ( $notice_html ) {
|
| 168 |
-
include( 'views/notices/html-notice-custom.php' );
|
| 169 |
-
}
|
| 170 |
-
}
|
| 171 |
-
}
|
| 172 |
-
}
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
/**
|
| 176 |
-
* If we need to update, include a message with the update button.
|
| 177 |
-
*/
|
| 178 |
-
public static function update_notice() {
|
| 179 |
-
if ( version_compare( get_option( 'wcvendors_db_version' ), WCV_VERSION, '<' ) ) {
|
| 180 |
-
$updater = new WC_Background_Updater();
|
| 181 |
-
if ( $updater->is_updating() || ! empty( $_GET['do_update_wcvendors'] ) ) {
|
| 182 |
-
include( 'views/notices/html-notice-updating.php' );
|
| 183 |
-
} else {
|
| 184 |
-
include( 'views/notices/html-notice-update.php' );
|
| 185 |
-
}
|
| 186 |
-
} else {
|
| 187 |
-
include( 'views/notices/html-notice-updated.php' );
|
| 188 |
-
}
|
| 189 |
-
}
|
| 190 |
-
|
| 191 |
-
/**
|
| 192 |
-
* If we have just installed, show a message with the install pages button.
|
| 193 |
-
*/
|
| 194 |
-
public static function install_notice() {
|
| 195 |
-
include( 'views/notices/html-notice-install.php' );
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
/**
|
| 199 |
-
* Show the Theme Check notice.
|
| 200 |
-
*/
|
| 201 |
-
public static function theme_check_notice() {
|
| 202 |
-
if ( ! current_theme_supports( 'wcvendors' ) && ! in_array( get_option( 'template' ), wc_get_core_supported_themes() ) ) {
|
| 203 |
-
include( 'views/notices/html-notice-theme-support.php' );
|
| 204 |
-
} else {
|
| 205 |
-
self::remove_notice( 'theme_support' );
|
| 206 |
-
}
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
/**
|
| 210 |
-
* Show a notice highlighting bad template files.
|
| 211 |
-
*/
|
| 212 |
-
public static function template_file_check_notice() {
|
| 213 |
-
|
| 214 |
-
$core_templates = WC_Admin_Status::scan_template_files( wcv_plugin_dir_path . '/templates' );
|
| 215 |
-
$outdated = false;
|
| 216 |
-
|
| 217 |
-
foreach ( $core_templates as $file ) {
|
| 218 |
-
|
| 219 |
-
$theme_file = false;
|
| 220 |
-
if ( file_exists( get_stylesheet_directory() . '/' . $file ) ) {
|
| 221 |
-
$theme_file = get_stylesheet_directory() . '/' . $file;
|
| 222 |
-
} elseif ( file_exists( get_stylesheet_directory() . '/wc-vendors/' . $file ) ) {
|
| 223 |
-
$theme_file = get_stylesheet_directory() . '/wc-vendors/' . $file;
|
| 224 |
-
} elseif ( file_exists( get_template_directory() . '/' . $file ) ) {
|
| 225 |
-
$theme_file = get_template_directory() . '/' . $file;
|
| 226 |
-
} elseif ( file_exists( get_template_directory() . '/wc-vendors/' . $file ) ) {
|
| 227 |
-
$theme_file = get_template_directory() . '/wc-vendors/' . $file;
|
| 228 |
-
}
|
| 229 |
-
|
| 230 |
-
if ( false !== $theme_file ) {
|
| 231 |
-
$core_version = WC_Admin_Status::get_file_version( wcv_plugin_dir_path . '/templates/' . $file );
|
| 232 |
-
$theme_version = WC_Admin_Status::get_file_version( $theme_file );
|
| 233 |
-
|
| 234 |
-
if ( $core_version && $theme_version && version_compare( $theme_version, $core_version, '<' ) ) {
|
| 235 |
-
$outdated = true;
|
| 236 |
-
break;
|
| 237 |
-
}
|
| 238 |
-
}
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
if ( $outdated ) {
|
| 242 |
-
include( 'views/notices/html-notice-template-check.php' );
|
| 243 |
-
} else {
|
| 244 |
-
self::remove_notice( 'template_files' );
|
| 245 |
-
}
|
| 246 |
-
}
|
| 247 |
-
}
|
| 248 |
-
|
| 249 |
-
WCVendors_Admin_Notices::init();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-wcv-admin-settings.php
DELETED
|
@@ -1,668 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* The admin settings class handles all settings in the admin area. This is a modified version of the WooCommerce Admin Settings class
|
| 8 |
-
*
|
| 9 |
-
* @author WooCommerce, Jamie Madden, WC Vendors
|
| 10 |
-
* @category Admin
|
| 11 |
-
* @package WCVendors/Admin
|
| 12 |
-
* @version 2.0.0
|
| 13 |
-
*/
|
| 14 |
-
|
| 15 |
-
class WCVendors_Admin_Settings extends WC_Admin_Settings {
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Setting pages.
|
| 19 |
-
*
|
| 20 |
-
* @var array
|
| 21 |
-
*/
|
| 22 |
-
private static $settings = array();
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Error messages.
|
| 26 |
-
*
|
| 27 |
-
* @var array
|
| 28 |
-
*/
|
| 29 |
-
private static $errors = array();
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* Update messages.
|
| 33 |
-
*
|
| 34 |
-
* @var array
|
| 35 |
-
*/
|
| 36 |
-
private static $messages = array();
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* Include the settings page classes.
|
| 40 |
-
*/
|
| 41 |
-
public static function get_settings_pages() {
|
| 42 |
-
|
| 43 |
-
if ( empty( self::$settings ) ) {
|
| 44 |
-
$settings = array();
|
| 45 |
-
|
| 46 |
-
// Include the setings page.
|
| 47 |
-
include_once( WCV_ABSPATH_ADMIN . 'settings/class-wcv-settings-page.php' );
|
| 48 |
-
|
| 49 |
-
$settings[] = include( WCV_ABSPATH_ADMIN . 'settings/class-wcv-settings-general.php' );
|
| 50 |
-
$settings[] = include( WCV_ABSPATH_ADMIN . 'settings/class-wcv-settings-commission.php' );
|
| 51 |
-
$settings[] = include( WCV_ABSPATH_ADMIN . 'settings/class-wcv-settings-capabilities.php' );
|
| 52 |
-
$settings[] = include( WCV_ABSPATH_ADMIN . 'settings/class-wcv-settings-display.php' );
|
| 53 |
-
$settings[] = include( WCV_ABSPATH_ADMIN . 'settings/class-wcv-settings-payments.php' );
|
| 54 |
-
|
| 55 |
-
self::$settings = apply_filters( 'wcvendors_get_settings_pages', $settings );
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
return self::$settings;
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* Save the settings.
|
| 63 |
-
*/
|
| 64 |
-
public static function save() {
|
| 65 |
-
global $current_tab;
|
| 66 |
-
|
| 67 |
-
if ( empty( $_REQUEST['_wpnonce'] ) || ! wp_verify_nonce( $_REQUEST['_wpnonce'], 'wcvendors-settings' ) ) {
|
| 68 |
-
die( __( 'Action failed. Please refresh the page and retry.', 'wc-vendors' ) );
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
// Trigger actions
|
| 72 |
-
do_action( 'wcvendors_settings_save_' . $current_tab );
|
| 73 |
-
do_action( 'wcvendors_update_options_' . $current_tab );
|
| 74 |
-
do_action( 'wcvendors_update_options' );
|
| 75 |
-
|
| 76 |
-
self::add_message( __( 'Your settings have been saved.', 'wc-vendors' ) );
|
| 77 |
-
|
| 78 |
-
update_option( 'wcvendors_queue_flush_rewrite_rules', 'yes' );
|
| 79 |
-
do_action( 'wcvendors_settings_saved' );
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
/**
|
| 83 |
-
* Settings page.
|
| 84 |
-
*
|
| 85 |
-
* Handles the display of the main woocommerce settings page in admin.
|
| 86 |
-
*/
|
| 87 |
-
public static function output() {
|
| 88 |
-
global $current_section, $current_tab;
|
| 89 |
-
|
| 90 |
-
// $suffix = defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG ? '' : '.min';
|
| 91 |
-
$suffix = '';
|
| 92 |
-
|
| 93 |
-
do_action( 'wcvendors_settings_start' );
|
| 94 |
-
wp_enqueue_script( 'wcvendors_settings', wcv_assets_url . '/js/admin/settings' . $suffix . '.js', array( 'jquery', 'jquery-ui-datepicker', 'jquery-ui-sortable', 'iris', 'selectWoo' ), WCV_VERSION, true );
|
| 95 |
-
wp_localize_script( 'wcvendors_settings', 'wcvendors_settings_params', array(
|
| 96 |
-
'i18n_nav_warning' => __( 'The changes you made will be lost if you navigate away from this page.', 'wc-vendors' ),
|
| 97 |
-
) );
|
| 98 |
-
|
| 99 |
-
// Get tabs for the settings page
|
| 100 |
-
$tabs = apply_filters( 'wcvendors_settings_tabs_array', array() );
|
| 101 |
-
|
| 102 |
-
include( WCV_ABSPATH_ADMIN . 'views/html-admin-settings.php' );
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
/**
|
| 106 |
-
* Output admin fields.
|
| 107 |
-
*
|
| 108 |
-
* Loops though the wcvendors options array and outputs each field.
|
| 109 |
-
*
|
| 110 |
-
* @param array[] $options Opens array to output
|
| 111 |
-
*/
|
| 112 |
-
public static function output_fields( $options ) {
|
| 113 |
-
|
| 114 |
-
foreach ( $options as $value ) {
|
| 115 |
-
if ( ! isset( $value['type'] ) ) {
|
| 116 |
-
continue;
|
| 117 |
-
}
|
| 118 |
-
if ( ! isset( $value['id'] ) ) {
|
| 119 |
-
$value['id'] = '';
|
| 120 |
-
}
|
| 121 |
-
if ( ! isset( $value['title'] ) ) {
|
| 122 |
-
$value['title'] = isset( $value['name'] ) ? $value['name'] : '';
|
| 123 |
-
}
|
| 124 |
-
if ( ! isset( $value['class'] ) ) {
|
| 125 |
-
$value['class'] = '';
|
| 126 |
-
}
|
| 127 |
-
if ( ! isset( $value['css'] ) ) {
|
| 128 |
-
$value['css'] = '';
|
| 129 |
-
}
|
| 130 |
-
if ( ! isset( $value['default'] ) ) {
|
| 131 |
-
$value['default'] = '';
|
| 132 |
-
}
|
| 133 |
-
if ( ! isset( $value['desc'] ) ) {
|
| 134 |
-
$value['desc'] = '';
|
| 135 |
-
}
|
| 136 |
-
if ( ! isset( $value['desc_tip'] ) ) {
|
| 137 |
-
$value['desc_tip'] = false;
|
| 138 |
-
}
|
| 139 |
-
if ( ! isset( $value['placeholder'] ) ) {
|
| 140 |
-
$value['placeholder'] = '';
|
| 141 |
-
}
|
| 142 |
-
if ( ! isset( $value['suffix'] ) ) {
|
| 143 |
-
$value['suffix'] = '';
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
// Custom attribute handling
|
| 147 |
-
$custom_attributes = array();
|
| 148 |
-
|
| 149 |
-
if ( ! empty( $value['custom_attributes'] ) && is_array( $value['custom_attributes'] ) ) {
|
| 150 |
-
foreach ( $value['custom_attributes'] as $attribute => $attribute_value ) {
|
| 151 |
-
$custom_attributes[] = esc_attr( $attribute ) . '="' . esc_attr( $attribute_value ) . '"';
|
| 152 |
-
}
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
// Description handling
|
| 156 |
-
$field_description = self::get_field_description( $value );
|
| 157 |
-
extract( $field_description );
|
| 158 |
-
|
| 159 |
-
// Switch based on type
|
| 160 |
-
switch ( $value['type'] ) {
|
| 161 |
-
|
| 162 |
-
// Section Titles
|
| 163 |
-
case 'title':
|
| 164 |
-
if ( ! empty( $value['title'] ) ) {
|
| 165 |
-
echo '<h2>' . esc_html( $value['title'] ) . '</h2>';
|
| 166 |
-
}
|
| 167 |
-
if ( ! empty( $value['desc'] ) ) {
|
| 168 |
-
echo wpautop( wptexturize( wp_kses_post( $value['desc'] ) ) );
|
| 169 |
-
}
|
| 170 |
-
echo '<table class="form-table">' . "\n\n";
|
| 171 |
-
if ( ! empty( $value['id'] ) ) {
|
| 172 |
-
do_action( 'wcvendors_settings_' . sanitize_title( $value['id'] ) );
|
| 173 |
-
}
|
| 174 |
-
break;
|
| 175 |
-
|
| 176 |
-
// Section Ends
|
| 177 |
-
case 'sectionend':
|
| 178 |
-
if ( ! empty( $value['id'] ) ) {
|
| 179 |
-
do_action( 'wcvendors_settings_' . sanitize_title( $value['id'] ) . '_end' );
|
| 180 |
-
}
|
| 181 |
-
echo '</table>';
|
| 182 |
-
if ( ! empty( $value['id'] ) ) {
|
| 183 |
-
do_action( 'wcvendors_settings_' . sanitize_title( $value['id'] ) . '_after' );
|
| 184 |
-
}
|
| 185 |
-
break;
|
| 186 |
-
|
| 187 |
-
// Standard text inputs and subtypes like 'number'
|
| 188 |
-
case 'text':
|
| 189 |
-
case 'email':
|
| 190 |
-
case 'number':
|
| 191 |
-
case 'password' :
|
| 192 |
-
$option_value = self::get_option( $value['id'], $value['default'] );
|
| 193 |
-
|
| 194 |
-
?><tr valign="top">
|
| 195 |
-
<th scope="row" class="titledesc">
|
| 196 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 197 |
-
<?php echo $tooltip_html; ?>
|
| 198 |
-
</th>
|
| 199 |
-
<td class="forminp forminp-<?php echo sanitize_title( $value['type'] ) ?>">
|
| 200 |
-
<input
|
| 201 |
-
name="<?php echo esc_attr( $value['id'] ); ?>"
|
| 202 |
-
id="<?php echo esc_attr( $value['id'] ); ?>"
|
| 203 |
-
type="<?php echo esc_attr( $value['type'] ); ?>"
|
| 204 |
-
style="<?php echo esc_attr( $value['css'] ); ?>"
|
| 205 |
-
value="<?php echo esc_attr( $option_value ); ?>"
|
| 206 |
-
class="<?php echo esc_attr( $value['class'] ); ?>"
|
| 207 |
-
placeholder="<?php echo esc_attr( $value['placeholder'] ); ?>"
|
| 208 |
-
<?php echo implode( ' ', $custom_attributes ); ?>
|
| 209 |
-
/><?php echo esc_html( $value['suffix'] ); ?> <?php echo $description; ?>
|
| 210 |
-
</td>
|
| 211 |
-
</tr><?php
|
| 212 |
-
break;
|
| 213 |
-
|
| 214 |
-
// Color picker.
|
| 215 |
-
case 'color' :
|
| 216 |
-
$option_value = self::get_option( $value['id'], $value['default'] );
|
| 217 |
-
|
| 218 |
-
?><tr valign="top">
|
| 219 |
-
<th scope="row" class="titledesc">
|
| 220 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 221 |
-
<?php echo $tooltip_html; ?>
|
| 222 |
-
</th>
|
| 223 |
-
<td class="forminp forminp-<?php echo sanitize_title( $value['type'] ) ?>">‎
|
| 224 |
-
<span class="colorpickpreview" style="background: <?php echo esc_attr( $option_value ); ?>"></span>
|
| 225 |
-
<input
|
| 226 |
-
name="<?php echo esc_attr( $value['id'] ); ?>"
|
| 227 |
-
id="<?php echo esc_attr( $value['id'] ); ?>"
|
| 228 |
-
type="text"
|
| 229 |
-
dir="ltr"
|
| 230 |
-
style="<?php echo esc_attr( $value['css'] ); ?>"
|
| 231 |
-
value="<?php echo esc_attr( $option_value ); ?>"
|
| 232 |
-
class="<?php echo esc_attr( $value['class'] ); ?>colorpick"
|
| 233 |
-
placeholder="<?php echo esc_attr( $value['placeholder'] ); ?>"
|
| 234 |
-
<?php echo implode( ' ', $custom_attributes ); ?>
|
| 235 |
-
/>‎ <?php echo $description; ?>
|
| 236 |
-
<div id="colorPickerDiv_<?php echo esc_attr( $value['id'] ); ?>" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>
|
| 237 |
-
</td>
|
| 238 |
-
</tr><?php
|
| 239 |
-
break;
|
| 240 |
-
|
| 241 |
-
// Textarea
|
| 242 |
-
case 'textarea':
|
| 243 |
-
|
| 244 |
-
$option_value = self::get_option( $value['id'], $value['default'] );
|
| 245 |
-
|
| 246 |
-
?><tr valign="top">
|
| 247 |
-
<th scope="row" class="titledesc">
|
| 248 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 249 |
-
<?php echo $tooltip_html; ?>
|
| 250 |
-
</th>
|
| 251 |
-
<td class="forminp forminp-<?php echo sanitize_title( $value['type'] ) ?>">
|
| 252 |
-
<?php echo $description; ?>
|
| 253 |
-
|
| 254 |
-
<textarea
|
| 255 |
-
name="<?php echo esc_attr( $value['id'] ); ?>"
|
| 256 |
-
id="<?php echo esc_attr( $value['id'] ); ?>"
|
| 257 |
-
style="<?php echo esc_attr( $value['css'] ); ?>"
|
| 258 |
-
class="<?php echo esc_attr( $value['class'] ); ?>"
|
| 259 |
-
placeholder="<?php echo esc_attr( $value['placeholder'] ); ?>"
|
| 260 |
-
<?php echo implode( ' ', $custom_attributes ); ?>
|
| 261 |
-
><?php echo esc_textarea( $option_value ); ?></textarea>
|
| 262 |
-
</td>
|
| 263 |
-
</tr><?php
|
| 264 |
-
break;
|
| 265 |
-
|
| 266 |
-
// Select boxes
|
| 267 |
-
case 'select' :
|
| 268 |
-
case 'multiselect' :
|
| 269 |
-
|
| 270 |
-
$option_value = self::get_option( $value['id'], $value['default'] );
|
| 271 |
-
|
| 272 |
-
?><tr valign="top">
|
| 273 |
-
<th scope="row" class="titledesc">
|
| 274 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 275 |
-
<?php echo $tooltip_html; ?>
|
| 276 |
-
</th>
|
| 277 |
-
<td class="forminp forminp-<?php echo sanitize_title( $value['type'] ) ?>">
|
| 278 |
-
<select
|
| 279 |
-
name="<?php echo esc_attr( $value['id'] ); ?><?php echo ( 'multiselect' === $value['type'] ) ? '[]' : ''; ?>"
|
| 280 |
-
id="<?php echo esc_attr( $value['id'] ); ?>"
|
| 281 |
-
style="<?php echo esc_attr( $value['css'] ); ?>"
|
| 282 |
-
class="<?php echo esc_attr( $value['class'] ); ?>"
|
| 283 |
-
<?php echo implode( ' ', $custom_attributes ); ?>
|
| 284 |
-
<?php echo ( 'multiselect' == $value['type'] ) ? 'multiple="multiple"' : ''; ?>
|
| 285 |
-
>
|
| 286 |
-
<?php
|
| 287 |
-
foreach ( $value['options'] as $key => $val ) {
|
| 288 |
-
?>
|
| 289 |
-
<option value="<?php echo esc_attr( $key ); ?>" <?php
|
| 290 |
-
|
| 291 |
-
if ( is_array( $option_value ) ) {
|
| 292 |
-
selected( in_array( $key, $option_value ), true );
|
| 293 |
-
} else {
|
| 294 |
-
selected( $option_value, $key );
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
?>><?php echo $val ?></option>
|
| 298 |
-
<?php
|
| 299 |
-
}
|
| 300 |
-
?>
|
| 301 |
-
</select> <?php echo $description; ?>
|
| 302 |
-
</td>
|
| 303 |
-
</tr><?php
|
| 304 |
-
break;
|
| 305 |
-
|
| 306 |
-
// Radio inputs
|
| 307 |
-
case 'radio' :
|
| 308 |
-
|
| 309 |
-
$option_value = self::get_option( $value['id'], $value['default'] );
|
| 310 |
-
|
| 311 |
-
?><tr valign="top">
|
| 312 |
-
<th scope="row" class="titledesc">
|
| 313 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 314 |
-
<?php echo $tooltip_html; ?>
|
| 315 |
-
</th>
|
| 316 |
-
<td class="forminp forminp-<?php echo sanitize_title( $value['type'] ) ?>">
|
| 317 |
-
<fieldset>
|
| 318 |
-
<?php echo $description; ?>
|
| 319 |
-
<ul>
|
| 320 |
-
<?php
|
| 321 |
-
foreach ( $value['options'] as $key => $val ) {
|
| 322 |
-
?>
|
| 323 |
-
<li>
|
| 324 |
-
<label><input
|
| 325 |
-
name="<?php echo esc_attr( $value['id'] ); ?>"
|
| 326 |
-
value="<?php echo $key; ?>"
|
| 327 |
-
type="radio"
|
| 328 |
-
style="<?php echo esc_attr( $value['css'] ); ?>"
|
| 329 |
-
class="<?php echo esc_attr( $value['class'] ); ?>"
|
| 330 |
-
<?php echo implode( ' ', $custom_attributes ); ?>
|
| 331 |
-
<?php checked( $key, $option_value ); ?>
|
| 332 |
-
/> <?php echo $val ?></label>
|
| 333 |
-
</li>
|
| 334 |
-
<?php
|
| 335 |
-
}
|
| 336 |
-
?>
|
| 337 |
-
</ul>
|
| 338 |
-
</fieldset>
|
| 339 |
-
</td>
|
| 340 |
-
</tr><?php
|
| 341 |
-
break;
|
| 342 |
-
|
| 343 |
-
// Checkbox input
|
| 344 |
-
case 'checkbox' :
|
| 345 |
-
|
| 346 |
-
$option_value = self::get_option( $value['id'], $value['default'] );
|
| 347 |
-
$visibility_class = array();
|
| 348 |
-
|
| 349 |
-
if ( ! isset( $value['hide_if_checked'] ) ) {
|
| 350 |
-
$value['hide_if_checked'] = false;
|
| 351 |
-
}
|
| 352 |
-
if ( ! isset( $value['show_if_checked'] ) ) {
|
| 353 |
-
$value['show_if_checked'] = false;
|
| 354 |
-
}
|
| 355 |
-
if ( 'yes' == $value['hide_if_checked'] || 'yes' == $value['show_if_checked'] ) {
|
| 356 |
-
$visibility_class[] = 'hidden_option';
|
| 357 |
-
}
|
| 358 |
-
if ( 'option' == $value['hide_if_checked'] ) {
|
| 359 |
-
$visibility_class[] = 'hide_options_if_checked';
|
| 360 |
-
}
|
| 361 |
-
if ( 'option' == $value['show_if_checked'] ) {
|
| 362 |
-
$visibility_class[] = 'show_options_if_checked';
|
| 363 |
-
}
|
| 364 |
-
|
| 365 |
-
if ( ! isset( $value['checkboxgroup'] ) || 'start' == $value['checkboxgroup'] ) {
|
| 366 |
-
?>
|
| 367 |
-
<tr valign="top" class="<?php echo esc_attr( implode( ' ', $visibility_class ) ); ?>">
|
| 368 |
-
<th scope="row" class="titledesc"><?php echo esc_html( $value['title'] ) ?></th>
|
| 369 |
-
<td class="forminp forminp-checkbox">
|
| 370 |
-
<fieldset>
|
| 371 |
-
<?php
|
| 372 |
-
} else {
|
| 373 |
-
?>
|
| 374 |
-
<fieldset class="<?php echo esc_attr( implode( ' ', $visibility_class ) ); ?>">
|
| 375 |
-
<?php
|
| 376 |
-
}
|
| 377 |
-
|
| 378 |
-
if ( ! empty( $value['title'] ) ) {
|
| 379 |
-
?>
|
| 380 |
-
<legend class="screen-reader-text"><span><?php echo esc_html( $value['title'] ) ?></span></legend>
|
| 381 |
-
<?php
|
| 382 |
-
}
|
| 383 |
-
|
| 384 |
-
?>
|
| 385 |
-
<label for="<?php echo $value['id'] ?>">
|
| 386 |
-
<input
|
| 387 |
-
name="<?php echo esc_attr( $value['id'] ); ?>"
|
| 388 |
-
id="<?php echo esc_attr( $value['id'] ); ?>"
|
| 389 |
-
type="checkbox"
|
| 390 |
-
class="<?php echo esc_attr( isset( $value['class'] ) ? $value['class'] : '' ); ?>"
|
| 391 |
-
value="1"
|
| 392 |
-
<?php checked( $option_value, 'yes' ); ?>
|
| 393 |
-
<?php echo implode( ' ', $custom_attributes ); ?>
|
| 394 |
-
/> <?php echo $description ?>
|
| 395 |
-
</label> <?php echo $tooltip_html; ?>
|
| 396 |
-
<?php
|
| 397 |
-
|
| 398 |
-
if ( ! isset( $value['checkboxgroup'] ) || 'end' == $value['checkboxgroup'] ) {
|
| 399 |
-
?>
|
| 400 |
-
</fieldset>
|
| 401 |
-
</td>
|
| 402 |
-
</tr>
|
| 403 |
-
<?php
|
| 404 |
-
} else {
|
| 405 |
-
?>
|
| 406 |
-
</fieldset>
|
| 407 |
-
<?php
|
| 408 |
-
}
|
| 409 |
-
break;
|
| 410 |
-
|
| 411 |
-
// Single page selects
|
| 412 |
-
case 'single_select_page' :
|
| 413 |
-
|
| 414 |
-
$args = array(
|
| 415 |
-
'name' => $value['id'],
|
| 416 |
-
'id' => $value['id'],
|
| 417 |
-
'sort_column' => 'menu_order',
|
| 418 |
-
'sort_order' => 'ASC',
|
| 419 |
-
'show_option_none' => ' ',
|
| 420 |
-
'class' => $value['class'],
|
| 421 |
-
'echo' => false,
|
| 422 |
-
'selected' => absint( self::get_option( $value['id'] ) ),
|
| 423 |
-
);
|
| 424 |
-
|
| 425 |
-
if ( isset( $value['args'] ) ) {
|
| 426 |
-
$args = wp_parse_args( $value['args'], $args );
|
| 427 |
-
}
|
| 428 |
-
|
| 429 |
-
?><tr valign="top" class="single_select_page">
|
| 430 |
-
<th scope="row" class="titledesc"><?php echo esc_html( $value['title'] ) ?> <?php echo $tooltip_html; ?></th>
|
| 431 |
-
<td class="forminp">
|
| 432 |
-
<?php echo str_replace( ' id=', " data-placeholder='" . esc_attr__( 'Select a page…', 'wc-vendors' ) . "' style='" . $value['css'] . "' class='" . $value['class'] . "' id=", wp_dropdown_pages( $args ) ); ?> <?php echo $description; ?>
|
| 433 |
-
</td>
|
| 434 |
-
</tr><?php
|
| 435 |
-
break;
|
| 436 |
-
|
| 437 |
-
// Single country selects
|
| 438 |
-
case 'single_select_country' :
|
| 439 |
-
$country_setting = (string) self::get_option( $value['id'] );
|
| 440 |
-
|
| 441 |
-
if ( strstr( $country_setting, ':' ) ) {
|
| 442 |
-
$country_setting = explode( ':', $country_setting );
|
| 443 |
-
$country = current( $country_setting );
|
| 444 |
-
$state = end( $country_setting );
|
| 445 |
-
} else {
|
| 446 |
-
$country = $country_setting;
|
| 447 |
-
$state = '*';
|
| 448 |
-
}
|
| 449 |
-
?><tr valign="top">
|
| 450 |
-
<th scope="row" class="titledesc">
|
| 451 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 452 |
-
<?php echo $tooltip_html; ?>
|
| 453 |
-
</th>
|
| 454 |
-
<td class="forminp"><select name="<?php echo esc_attr( $value['id'] ); ?>" style="<?php echo esc_attr( $value['css'] ); ?>" data-placeholder="<?php esc_attr_e( 'Choose a country…', 'wc-vendors' ); ?>" aria-label="<?php esc_attr_e( 'Country', 'wc-vendors' ) ?>" class="wc-enhanced-select">
|
| 455 |
-
<?php WC()->countries->country_dropdown_options( $country, $state ); ?>
|
| 456 |
-
</select> <?php echo $description; ?>
|
| 457 |
-
</td>
|
| 458 |
-
</tr><?php
|
| 459 |
-
break;
|
| 460 |
-
|
| 461 |
-
// Country multiselects
|
| 462 |
-
case 'multi_select_countries' :
|
| 463 |
-
|
| 464 |
-
$selections = (array) self::get_option( $value['id'] );
|
| 465 |
-
|
| 466 |
-
if ( ! empty( $value['options'] ) ) {
|
| 467 |
-
$countries = $value['options'];
|
| 468 |
-
} else {
|
| 469 |
-
$countries = WC()->countries->countries;
|
| 470 |
-
}
|
| 471 |
-
|
| 472 |
-
asort( $countries );
|
| 473 |
-
?><tr valign="top">
|
| 474 |
-
<th scope="row" class="titledesc">
|
| 475 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 476 |
-
<?php echo $tooltip_html; ?>
|
| 477 |
-
</th>
|
| 478 |
-
<td class="forminp">
|
| 479 |
-
<select multiple="multiple" name="<?php echo esc_attr( $value['id'] ); ?>[]" style="width:350px" data-placeholder="<?php esc_attr_e( 'Choose countries…', 'wc-vendors' ); ?>" aria-label="<?php esc_attr_e( 'Country', 'wc-vendors' ) ?>" class="wc-enhanced-select">
|
| 480 |
-
<?php
|
| 481 |
-
if ( ! empty( $countries ) ) {
|
| 482 |
-
foreach ( $countries as $key => $val ) {
|
| 483 |
-
echo '<option value="' . esc_attr( $key ) . '" ' . selected( in_array( $key, $selections ), true, false ) . '>' . $val . '</option>';
|
| 484 |
-
}
|
| 485 |
-
}
|
| 486 |
-
?>
|
| 487 |
-
</select> <?php echo ( $description ) ? $description : ''; ?> <br /><a class="select_all button" href="#"><?php _e( 'Select all', 'wc-vendors' ); ?></a> <a class="select_none button" href="#"><?php _e( 'Select none', 'wc-vendors' ); ?></a>
|
| 488 |
-
</td>
|
| 489 |
-
</tr><?php
|
| 490 |
-
break;
|
| 491 |
-
|
| 492 |
-
case 'image':
|
| 493 |
-
|
| 494 |
-
$option_value = self::get_option( $value['id'], $value['default'] );
|
| 495 |
-
|
| 496 |
-
?><tr valign="top">
|
| 497 |
-
<th scope="row" class="titledesc">
|
| 498 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 499 |
-
<?php echo $tooltip_html; ?>
|
| 500 |
-
</th>
|
| 501 |
-
<td class="forminp">
|
| 502 |
-
<img class="wcv-image-container-<?php echo $value['id']; ?>" src="<?php echo $option_value; ?>" alt="" style="max-width:100%;" />
|
| 503 |
-
<br />
|
| 504 |
-
<input id="wcv-add-<?php echo $value['id']; ?>" type="button" class="<?php echo $value['css']; ?>" value="<?php echo sprintf( __( 'Update %s', 'wc-vendors' ), strtolower( $value['title'] ) ); ?>" data-id="<?php echo $value['id']; ?>" data-save_button="<?php echo sprintf( __( 'Add %s', 'wc-vendors' ), $value['title'] ); ?>" data-window_title="<?php echo sprintf( __( 'Add %s', 'wc-vendors' ), strtolower( $value['title'] ) ); ?>" data-upload_notice="<?php echo sprintf( __( 'Upload an image for the %s', 'wc-vendors' ), strtolower( $value['title'] ) ); ?>" />
|
| 505 |
-
<input type="hidden" name="<?php echo $value['id']; ?>" id="<?php echo $value['id']; ?>" value="<?php echo $option_value; ?>">
|
| 506 |
-
</td>
|
| 507 |
-
</tr><?php
|
| 508 |
-
|
| 509 |
-
break;
|
| 510 |
-
|
| 511 |
-
case 'wysiwyg':
|
| 512 |
-
|
| 513 |
-
$option_value = self::get_option( $value['id'], $value['default'] );
|
| 514 |
-
|
| 515 |
-
?>
|
| 516 |
-
<tr valign="top">
|
| 517 |
-
<th scope="row" class="titledesc">
|
| 518 |
-
<label for="<?php echo esc_attr( $value['id'] ); ?>"><?php echo esc_html( $value['title'] ); ?></label>
|
| 519 |
-
<?php echo $tooltip_html; ?>
|
| 520 |
-
</th>
|
| 521 |
-
<td class="forminp">
|
| 522 |
-
<?php wp_editor( $option_value, $value[ 'id' ], array( 'textarea_name' => $value['id'] ) ); ?>
|
| 523 |
-
<?php echo $description;?>
|
| 524 |
-
</td>
|
| 525 |
-
</tr>
|
| 526 |
-
<?php
|
| 527 |
-
|
| 528 |
-
|
| 529 |
-
break;
|
| 530 |
-
|
| 531 |
-
// Default: run an action
|
| 532 |
-
default:
|
| 533 |
-
do_action( 'wcvendors_admin_field_' . $value['type'], $value );
|
| 534 |
-
break;
|
| 535 |
-
}
|
| 536 |
-
}
|
| 537 |
-
}
|
| 538 |
-
|
| 539 |
-
/**
|
| 540 |
-
* Save admin fields.
|
| 541 |
-
*
|
| 542 |
-
* Loops though the options array and saves each field.
|
| 543 |
-
*
|
| 544 |
-
* @param array $options Options array to output
|
| 545 |
-
* @param array $data Optional. Data to use for saving. Defaults to $_POST.
|
| 546 |
-
* @return bool
|
| 547 |
-
*/
|
| 548 |
-
public static function save_fields( $options, $data = null ) {
|
| 549 |
-
if ( is_null( $data ) ) {
|
| 550 |
-
$data = $_POST;
|
| 551 |
-
}
|
| 552 |
-
if ( empty( $data ) ) {
|
| 553 |
-
return false;
|
| 554 |
-
}
|
| 555 |
-
|
| 556 |
-
// Options to update will be stored here and saved later.
|
| 557 |
-
$update_options = array();
|
| 558 |
-
|
| 559 |
-
// Loop options and get values to save.
|
| 560 |
-
foreach ( $options as $option ) {
|
| 561 |
-
if ( ! isset( $option['id'] ) || ! isset( $option['type'] ) ) {
|
| 562 |
-
continue;
|
| 563 |
-
}
|
| 564 |
-
|
| 565 |
-
// Get posted value.
|
| 566 |
-
if ( strstr( $option['id'], '[' ) ) {
|
| 567 |
-
parse_str( $option['id'], $option_name_array );
|
| 568 |
-
$option_name = current( array_keys( $option_name_array ) );
|
| 569 |
-
$setting_name = key( $option_name_array[ $option_name ] );
|
| 570 |
-
$raw_value = isset( $data[ $option_name ][ $setting_name ] ) ? wp_unslash( $data[ $option_name ][ $setting_name ] ) : null;
|
| 571 |
-
} else {
|
| 572 |
-
$option_name = $option['id'];
|
| 573 |
-
$setting_name = '';
|
| 574 |
-
$raw_value = isset( $data[ $option['id'] ] ) ? wp_unslash( $data[ $option['id'] ] ) : null;
|
| 575 |
-
}
|
| 576 |
-
|
| 577 |
-
// Format the value based on option type.
|
| 578 |
-
switch ( $option['type'] ) {
|
| 579 |
-
case 'checkbox' :
|
| 580 |
-
$value = '1' === $raw_value || 'yes' === $raw_value ? 'yes' : 'no';
|
| 581 |
-
break;
|
| 582 |
-
case 'textarea' :
|
| 583 |
-
$value = wp_kses_post( trim( $raw_value ) );
|
| 584 |
-
break;
|
| 585 |
-
case 'multiselect' :
|
| 586 |
-
case 'multi_select_countries' :
|
| 587 |
-
$value = array_filter( array_map( 'wc_clean', (array) $raw_value ) );
|
| 588 |
-
break;
|
| 589 |
-
case 'image_width' :
|
| 590 |
-
$value = array();
|
| 591 |
-
if ( isset( $raw_value['width'] ) ) {
|
| 592 |
-
$value['width'] = wc_clean( $raw_value['width'] );
|
| 593 |
-
$value['height'] = wc_clean( $raw_value['height'] );
|
| 594 |
-
$value['crop'] = isset( $raw_value['crop'] ) ? 1 : 0;
|
| 595 |
-
} else {
|
| 596 |
-
$value['width'] = $option['default']['width'];
|
| 597 |
-
$value['height'] = $option['default']['height'];
|
| 598 |
-
$value['crop'] = $option['default']['crop'];
|
| 599 |
-
}
|
| 600 |
-
break;
|
| 601 |
-
case 'thumbnail_cropping' :
|
| 602 |
-
$value = wc_clean( $raw_value );
|
| 603 |
-
|
| 604 |
-
if ( 'custom' === $value ) {
|
| 605 |
-
$width_ratio = wc_clean( wp_unslash( $_POST['thumbnail_cropping_aspect_ratio_width'] ) );
|
| 606 |
-
$height_ratio = wc_clean( wp_unslash( $_POST['thumbnail_cropping_aspect_ratio_height'] ) );
|
| 607 |
-
$value = $width_ratio . ':' . $height_ratio;
|
| 608 |
-
}
|
| 609 |
-
break;
|
| 610 |
-
case 'select':
|
| 611 |
-
$allowed_values = empty( $option['options'] ) ? array() : array_keys( $option['options'] );
|
| 612 |
-
if ( empty( $option['default'] ) && empty( $allowed_values ) ) {
|
| 613 |
-
$value = null;
|
| 614 |
-
break;
|
| 615 |
-
}
|
| 616 |
-
$default = ( empty( $option['default'] ) ? $allowed_values[0] : $option['default'] );
|
| 617 |
-
$value = in_array( $raw_value, $allowed_values ) ? $raw_value : $default;
|
| 618 |
-
break;
|
| 619 |
-
default :
|
| 620 |
-
$value = wc_clean( $raw_value );
|
| 621 |
-
break;
|
| 622 |
-
}
|
| 623 |
-
|
| 624 |
-
/**
|
| 625 |
-
* Sanitize the value of an option.
|
| 626 |
-
* @since 2.4.0
|
| 627 |
-
*/
|
| 628 |
-
$value = apply_filters( 'wcvendors_admin_settings_sanitize_option', $value, $option, $raw_value );
|
| 629 |
-
|
| 630 |
-
/**
|
| 631 |
-
* Sanitize the value of an option by option name.
|
| 632 |
-
* @since 2.4.0
|
| 633 |
-
*/
|
| 634 |
-
$value = apply_filters( "wcvendors_admin_settings_sanitize_option_$option_name", $value, $option, $raw_value );
|
| 635 |
-
|
| 636 |
-
if ( is_null( $value ) ) {
|
| 637 |
-
continue;
|
| 638 |
-
}
|
| 639 |
-
|
| 640 |
-
// Check if option is an array and handle that differently to single values.
|
| 641 |
-
if ( $option_name && $setting_name ) {
|
| 642 |
-
if ( ! isset( $update_options[ $option_name ] ) ) {
|
| 643 |
-
$update_options[ $option_name ] = get_option( $option_name, array() );
|
| 644 |
-
}
|
| 645 |
-
if ( ! is_array( $update_options[ $option_name ] ) ) {
|
| 646 |
-
$update_options[ $option_name ] = array();
|
| 647 |
-
}
|
| 648 |
-
$update_options[ $option_name ][ $setting_name ] = $value;
|
| 649 |
-
} else {
|
| 650 |
-
$update_options[ $option_name ] = $value;
|
| 651 |
-
}
|
| 652 |
-
|
| 653 |
-
/**
|
| 654 |
-
* Fire an action before saved.
|
| 655 |
-
* @deprecated 2.4.0 - doesn't allow manipulation of values!
|
| 656 |
-
*/
|
| 657 |
-
do_action( 'wcvendors_update_option', $option );
|
| 658 |
-
}
|
| 659 |
-
|
| 660 |
-
// Save all options in our array.
|
| 661 |
-
foreach ( $update_options as $name => $value ) {
|
| 662 |
-
update_option( $name, $value );
|
| 663 |
-
}
|
| 664 |
-
|
| 665 |
-
return true;
|
| 666 |
-
}
|
| 667 |
-
|
| 668 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-wcv-admin-setup.php
DELETED
|
@@ -1,304 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Admin setup
|
| 5 |
-
*
|
| 6 |
-
* @author Jamie Madden, WC Vendors
|
| 7 |
-
* @category Admin
|
| 8 |
-
* @package WCVendors/Admin
|
| 9 |
-
* @version 2.0.0
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 13 |
-
exit;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
class WCV_Admin_Setup {
|
| 18 |
-
|
| 19 |
-
public function __construct() {
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
// add_action( 'admin_menu', array( 'WCV_Admin_Setup', 'menu' ), 10 );
|
| 23 |
-
add_action( 'woocommerce_admin_order_data_after_shipping_address', array( $this, 'add_vendor_details' ), 10, 2 );
|
| 24 |
-
add_action( 'woocommerce_admin_order_actions_end', array( $this, 'append_actions' ), 10, 1 );
|
| 25 |
-
add_filter( 'woocommerce_debug_tools', array( $this, 'wcvendors_tools' ) );
|
| 26 |
-
|
| 27 |
-
add_filter( 'admin_footer_text', array( $this, 'admin_footer_text' ), 1 );
|
| 28 |
-
add_action( 'admin_init', array( $this, 'export_commissions' ) );
|
| 29 |
-
add_action( 'admin_init', array( $this, 'export_sum_commissions' ) );
|
| 30 |
-
add_filter( 'woocommerce_screen_ids', array( $this, 'wcv_screen_ids' ) );
|
| 31 |
-
add_action( 'wcvendors_update_options_capabilities', array( $this, 'update_vendor_role' ) );
|
| 32 |
-
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function add_vendor_details( $order )
|
| 36 |
-
{
|
| 37 |
-
$actions = $this->append_actions( $order, true );
|
| 38 |
-
|
| 39 |
-
if (empty( $actions['wc_pv_shipped']['name'] )) {
|
| 40 |
-
return;
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
echo '<h4>' . __('Vendors shipped', 'wc-vendors') . '</h4><br/>';
|
| 44 |
-
echo $actions['wc_pv_shipped']['name'];
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function append_actions( $order, $order_page = false )
|
| 48 |
-
{
|
| 49 |
-
global $woocommerce;
|
| 50 |
-
|
| 51 |
-
$order_id = $order->get_id();
|
| 52 |
-
|
| 53 |
-
$authors = WCV_Vendors::get_vendors_from_order( $order );
|
| 54 |
-
$authors = $authors ? array_keys( $authors ) : array();
|
| 55 |
-
if ( empty( $authors ) ) return false;
|
| 56 |
-
|
| 57 |
-
$shipped = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 58 |
-
$string = '</br></br>';
|
| 59 |
-
|
| 60 |
-
foreach ($authors as $author ) {
|
| 61 |
-
$string .= in_array( $author, $shipped ) ? '✔ ' : '✕ ';
|
| 62 |
-
$string .= WCV_Vendors::get_vendor_shop_name( $author );
|
| 63 |
-
$string .= '</br>';
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
$response = array(
|
| 67 |
-
'url' => '#',
|
| 68 |
-
'name' => __('Vendors Shipped', 'wc-vendors') . $string,
|
| 69 |
-
'action' => 'wc_pv_shipped',
|
| 70 |
-
'image_url' => wcv_assets_url . '/images/icons/truck.png',
|
| 71 |
-
);
|
| 72 |
-
|
| 73 |
-
if ( ! $order_page ) {
|
| 74 |
-
printf( '<a class="button tips %s" href="%s" data-tip="%s"><img style="width:16px;height:16px;" src="%s"></a>', $response['action'], $response['url'], $response['name'], $response['image_url'] );
|
| 75 |
-
} else {
|
| 76 |
-
echo $response['name'];
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
return $response;
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
/**
|
| 86 |
-
* Add tools to the woocommerce status tools page
|
| 87 |
-
*
|
| 88 |
-
* @since 1.9.2
|
| 89 |
-
* @access public
|
| 90 |
-
*/
|
| 91 |
-
public function wcvendors_tools( $tools ){
|
| 92 |
-
|
| 93 |
-
$tools[ 'reset_wcvendor_roles' ] = array(
|
| 94 |
-
'name' => __( 'Reset WC Vendors roles ', 'wc-vendors' ),
|
| 95 |
-
'button' => __( 'Reset WC Vendor Roles', 'wc-vendors' ),
|
| 96 |
-
'desc' => __( 'This will reset the wcvendors roles ( vendor & pending_vendor ), back to the default capabilities.', 'wc-vendors' ),
|
| 97 |
-
'callback' => array( 'WCV_Admin_Setup', 'reset_vendor_roles' )
|
| 98 |
-
);
|
| 99 |
-
|
| 100 |
-
$tools[ 'reset_wcvendors' ] = array(
|
| 101 |
-
'name' => __( 'Reset WC Vendors ', 'wc-vendors' ),
|
| 102 |
-
'button' => __( 'Reset WC Vendors Settings', 'wc-vendors' ),
|
| 103 |
-
'desc' => __( 'This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings.', 'wc-vendors' ),
|
| 104 |
-
'callback' => array( 'WCV_Admin_Setup', 'reset_wcvendors' )
|
| 105 |
-
);
|
| 106 |
-
|
| 107 |
-
return $tools;
|
| 108 |
-
|
| 109 |
-
} // wcvendors_tools()
|
| 110 |
-
|
| 111 |
-
/**
|
| 112 |
-
* Reset the vendor roles
|
| 113 |
-
*
|
| 114 |
-
* @since 1.9.2
|
| 115 |
-
* @access public
|
| 116 |
-
*/
|
| 117 |
-
public static function reset_vendor_roles(){
|
| 118 |
-
|
| 119 |
-
$can_add = 'yes' === get_option( 'wcvendors_capability_products_enabled', 'no' ) ? true : false;
|
| 120 |
-
$can_edit = 'yes' === get_option( 'wcvendors_capability_products_edit', 'no' ) ? true : false;
|
| 121 |
-
$can_submit_live = 'yes' === get_option( 'wcvendors_capability_products_live', 'no' ) ? true : false;
|
| 122 |
-
|
| 123 |
-
$args = array(
|
| 124 |
-
'assign_product_terms' => $can_add,
|
| 125 |
-
'edit_products' => $can_add || $can_edit,
|
| 126 |
-
'edit_published_products' => $can_edit,
|
| 127 |
-
'delete_published_products' => $can_edit,
|
| 128 |
-
'delete_products' => $can_edit,
|
| 129 |
-
'manage_product' => $can_add,
|
| 130 |
-
'publish_products' => $can_submit_live,
|
| 131 |
-
'delete_posts' => true,
|
| 132 |
-
'read' => true,
|
| 133 |
-
'read_products' => $can_edit || $can_add,
|
| 134 |
-
'upload_files' => true,
|
| 135 |
-
'import' => true,
|
| 136 |
-
'view_woocommerce_reports' => false,
|
| 137 |
-
);
|
| 138 |
-
|
| 139 |
-
remove_role( 'vendor' );
|
| 140 |
-
add_role( 'vendor', __('Vendor', 'wc-vendors'), $args );
|
| 141 |
-
|
| 142 |
-
remove_role( 'pending_vendor');
|
| 143 |
-
add_role( 'pending_vendor', __( 'Pending Vendor', 'wc-vendors' ), array(
|
| 144 |
-
'read' => true,
|
| 145 |
-
'edit_posts' => false,
|
| 146 |
-
'delete_posts' => false
|
| 147 |
-
) );
|
| 148 |
-
|
| 149 |
-
echo '<div class="updated inline"><p>' . __( 'WC Vendor roles successfully reset.', 'wc-vendors' ) . '</p></div>';
|
| 150 |
-
|
| 151 |
-
} // reset_vendor_roles()
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
/**
|
| 155 |
-
* Reset wcvendors
|
| 156 |
-
*
|
| 157 |
-
* @since 1.9.2
|
| 158 |
-
* @access public
|
| 159 |
-
*/
|
| 160 |
-
public static function reset_wcvendors(){
|
| 161 |
-
|
| 162 |
-
delete_option( WC_Vendors::$id . '_options' );
|
| 163 |
-
echo '<div class="updated inline"><p>' . __( 'WC Vendors was successfully reset. All settings have been reset.', 'wc-vendors' ) . '</p></div>';
|
| 164 |
-
|
| 165 |
-
} // reset_wcvendors()
|
| 166 |
-
|
| 167 |
-
|
| 168 |
-
|
| 169 |
-
/*
|
| 170 |
-
* Export commissions via csv
|
| 171 |
-
*/
|
| 172 |
-
public function export_commissions(){
|
| 173 |
-
|
| 174 |
-
// prepare the items to export
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
if ( isset( $_GET['action'], $_GET['nonce'] ) && wp_verify_nonce( wp_unslash( $_GET['nonce'] ), 'export_commissions' ) && 'export_commissions' === wp_unslash( $_GET['action'] ) ) {
|
| 178 |
-
|
| 179 |
-
include_once( 'class-wcv-commissions-csv-exporter.php' );
|
| 180 |
-
|
| 181 |
-
$exporter = new WCV_Commissions_CSV_Export();
|
| 182 |
-
|
| 183 |
-
$date = date( 'Y-M-d' );
|
| 184 |
-
|
| 185 |
-
if ( ! empty( $_GET['com_status'] ) ) { // WPCS: input var ok.
|
| 186 |
-
$exporter->set_filename( 'wcv_commissions_'. wp_unslash( $_GET['com_status'] ) . '-' . $date . '.csv' ); // WPCS: input var ok, sanitization ok.
|
| 187 |
-
} else {
|
| 188 |
-
$exporter->set_filename( 'wcv_commissions-' . $date . '.csv' ); // WPCS: input var ok, sanitization ok.
|
| 189 |
-
}
|
| 190 |
-
|
| 191 |
-
$exporter->export();
|
| 192 |
-
}
|
| 193 |
-
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
/*
|
| 197 |
-
* Export sum commissions via csv
|
| 198 |
-
*/
|
| 199 |
-
public function export_sum_commissions(){
|
| 200 |
-
|
| 201 |
-
// prepare the items to export
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
if ( isset( $_GET['action'], $_GET['nonce'] ) && wp_verify_nonce( wp_unslash( $_GET['nonce'] ), 'export_commission_totals' ) && 'export_commission_totals' === wp_unslash( $_GET['action'] ) ) {
|
| 205 |
-
|
| 206 |
-
include_once( 'class-wcv-commissions-sum-csv-exporter.php' );
|
| 207 |
-
|
| 208 |
-
$exporter = new WCV_Commissions_Sum_CSV_Export();
|
| 209 |
-
|
| 210 |
-
$date = date( 'Y-M-d' );
|
| 211 |
-
|
| 212 |
-
if ( ! empty( $_GET['com_status'] ) ) { // WPCS: input var ok.
|
| 213 |
-
$exporter->set_filename( 'wcv_commissions_sum_'. wp_unslash( $_GET['com_status'] ) . '-' . $date . '.csv' ); // WPCS: input var ok, sanitization ok.
|
| 214 |
-
} else {
|
| 215 |
-
$exporter->set_filename( 'wcv_commissions_sum-' . $date . '.csv' ); // WPCS: input var ok, sanitization ok.
|
| 216 |
-
}
|
| 217 |
-
|
| 218 |
-
$exporter->export();
|
| 219 |
-
}
|
| 220 |
-
|
| 221 |
-
}
|
| 222 |
-
|
| 223 |
-
|
| 224 |
-
/**
|
| 225 |
-
* Add wc vendors screens to woocommerce screen ids to utilise js and css assets from woocommerce.
|
| 226 |
-
*
|
| 227 |
-
* @since 2.0.0
|
| 228 |
-
*/
|
| 229 |
-
public function wcv_screen_ids( $screen_ids ) {
|
| 230 |
-
|
| 231 |
-
$screen = get_current_screen();
|
| 232 |
-
|
| 233 |
-
$wcv_screen_ids = wcv_get_screen_ids();
|
| 234 |
-
$screen_ids = array_merge( $wcv_screen_ids, $screen_ids );
|
| 235 |
-
|
| 236 |
-
return $screen_ids;
|
| 237 |
-
}
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
/**
|
| 241 |
-
* Change the admin footer text on WooCommerce admin pages.
|
| 242 |
-
*
|
| 243 |
-
* @since 2.0.0
|
| 244 |
-
* @param string $footer_text
|
| 245 |
-
* @return string
|
| 246 |
-
*/
|
| 247 |
-
public function admin_footer_text( $footer_text ) {
|
| 248 |
-
|
| 249 |
-
if ( ! current_user_can( 'manage_woocommerce' ) || ! function_exists( 'wcv_get_screen_ids' ) ) {
|
| 250 |
-
return $footer_text;
|
| 251 |
-
}
|
| 252 |
-
$current_screen = get_current_screen();
|
| 253 |
-
$wcv_pages = wcv_get_screen_ids();
|
| 254 |
-
|
| 255 |
-
// Set only WC pages.
|
| 256 |
-
// $wcv_pages = array_diff( $wcv_pages, array( 'profile', 'user-edit' ) );
|
| 257 |
-
|
| 258 |
-
// Check to make sure we're on a WooCommerce admin page.
|
| 259 |
-
if ( isset( $current_screen->id ) && apply_filters( 'wcvendors_display_admin_footer_text', in_array( $current_screen->id, $wcv_pages ) ) ) {
|
| 260 |
-
// Change the footer text
|
| 261 |
-
$footer_text = sprintf(
|
| 262 |
-
/* translators: 1: WooCommerce 2:: five stars */
|
| 263 |
-
__( 'If you like %1$s please leave us a %2$s rating. A huge thanks in advance!', 'wc-vendors' ),
|
| 264 |
-
sprintf( '<strong>%s</strong>', esc_html__( 'WC Vendors', 'wc-vendors' ) ),
|
| 265 |
-
'<a href="https://wordpress.org/support/plugin/wc-vendors/reviews?rate=5#new-post" target="_blank" class="wcv-rating-link" data-rated="' . esc_attr__( 'Thanks :)', 'wc-vendors' ) . '">★★★★★</a>'
|
| 266 |
-
);
|
| 267 |
-
}
|
| 268 |
-
|
| 269 |
-
return $footer_text;
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
/**
|
| 273 |
-
* Update the vendor role based on the capabilities saved.
|
| 274 |
-
*
|
| 275 |
-
*/
|
| 276 |
-
public function update_vendor_role( ){
|
| 277 |
-
|
| 278 |
-
$can_add = 'yes' === get_option( 'wcvendors_capability_products_enabled', 'no' ) ? true : false;
|
| 279 |
-
$can_edit = 'yes' === get_option( 'wcvendors_capability_products_edit', 'no' ) ? true : false;
|
| 280 |
-
$can_submit_live = 'yes' === get_option( 'wcvendors_capability_products_live', 'no' ) ? true : false;
|
| 281 |
-
|
| 282 |
-
$args = array(
|
| 283 |
-
'assign_product_terms' => $can_add,
|
| 284 |
-
'edit_products' => $can_add || $can_edit,
|
| 285 |
-
'edit_published_products' => $can_edit,
|
| 286 |
-
'delete_published_products' => $can_edit,
|
| 287 |
-
'delete_products' => $can_edit,
|
| 288 |
-
'delete_posts' => true,
|
| 289 |
-
'manage_product' => $can_add,
|
| 290 |
-
'publish_products' => $can_submit_live,
|
| 291 |
-
'read' => true,
|
| 292 |
-
'read_products' => $can_edit || $can_add,
|
| 293 |
-
'upload_files' => true,
|
| 294 |
-
'import' => true,
|
| 295 |
-
'view_woocommerce_reports' => false,
|
| 296 |
-
);
|
| 297 |
-
|
| 298 |
-
remove_role( 'vendor' );
|
| 299 |
-
add_role( 'vendor', __('Vendor', 'wc-vendors'), $args );
|
| 300 |
-
|
| 301 |
-
}
|
| 302 |
-
|
| 303 |
-
|
| 304 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-wcv-commissions-csv-exporter.php
DELETED
|
@@ -1,175 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Handles commission CSV export.
|
| 4 |
-
*
|
| 5 |
-
* @version 1.9.14
|
| 6 |
-
*/
|
| 7 |
-
|
| 8 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 9 |
-
exit;
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Include dependencies.
|
| 14 |
-
*/
|
| 15 |
-
if ( ! class_exists( 'WC_CSV_Exporter', false ) ) {
|
| 16 |
-
include_once WC_ABSPATH . 'includes/export/abstract-wc-csv-exporter.php';
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
/**
|
| 20 |
-
* WCV_Commissions_CSV_Export Class.
|
| 21 |
-
*/
|
| 22 |
-
class WCV_Commissions_CSV_Export extends WC_CSV_Exporter {
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Constructor.
|
| 26 |
-
*/
|
| 27 |
-
public function __construct() {
|
| 28 |
-
$this->column_names = $this->get_default_column_names();
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Return an array of columns to export.
|
| 34 |
-
*
|
| 35 |
-
* @since 1.9.14
|
| 36 |
-
* @return array
|
| 37 |
-
*/
|
| 38 |
-
public function get_default_column_names() {
|
| 39 |
-
|
| 40 |
-
return apply_filters( 'wcv_commissions_export_columns', array(
|
| 41 |
-
'product_id' => __( 'Product', 'wc-vendors' ),
|
| 42 |
-
'order_id' => __( 'Order ID', 'wc-vendors' ),
|
| 43 |
-
'vendor_id' => __( 'Vendor', 'wc-vendors' ),
|
| 44 |
-
'total_due' => __( 'Commission', 'wc-vendors' ),
|
| 45 |
-
'total_shipping' => __( 'Shipping', 'wc-vendors' ),
|
| 46 |
-
'tax' => __( 'Tax', 'wc-vendors' ),
|
| 47 |
-
'totals' => __( 'Total', 'wc-vendors' ),
|
| 48 |
-
'status' => __( 'Status', 'wc-vendors' ),
|
| 49 |
-
'time' => __( 'Date', 'wc-vendors' ),
|
| 50 |
-
) );
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
/**
|
| 54 |
-
* Prepare data for export.
|
| 55 |
-
*
|
| 56 |
-
* @since 1.9.14
|
| 57 |
-
*/
|
| 58 |
-
public function prepare_data_to_export() {
|
| 59 |
-
|
| 60 |
-
global $wpdb;
|
| 61 |
-
|
| 62 |
-
$columns = $this->get_column_names();
|
| 63 |
-
|
| 64 |
-
if ( ! current_user_can( 'manage_options' ) ) return;
|
| 65 |
-
|
| 66 |
-
$orderby = !empty( $_REQUEST[ 'orderby' ] ) ? esc_attr( $_REQUEST[ 'orderby' ] ) : 'time';
|
| 67 |
-
$order = ( !empty( $_REQUEST[ 'order' ] ) && $_REQUEST[ 'order' ] == 'asc' ) ? 'ASC' : 'DESC';
|
| 68 |
-
$com_status = !empty( $_REQUEST[ 'com_status' ] ) ? esc_attr( $_REQUEST[ 'com_status' ] ) : '';
|
| 69 |
-
$vendor_id = !empty( $_REQUEST[ 'vendor_id' ] ) ? esc_attr( $_REQUEST[ 'vendor_id' ] ) : '';
|
| 70 |
-
$status_sql = '';
|
| 71 |
-
$time_sql = '';
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Get items
|
| 75 |
-
*/
|
| 76 |
-
$sql = "SELECT COUNT(id) FROM {$wpdb->prefix}pv_commission";
|
| 77 |
-
|
| 78 |
-
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 79 |
-
|
| 80 |
-
$year = substr( $_GET[ 'm' ], 0, 4 );
|
| 81 |
-
$month = substr( $_GET[ 'm' ], 4, 2 );
|
| 82 |
-
|
| 83 |
-
$time_sql = "
|
| 84 |
-
WHERE MONTH(`time`) = '$month'
|
| 85 |
-
AND YEAR(`time`) = '$year'
|
| 86 |
-
";
|
| 87 |
-
|
| 88 |
-
$sql .= $time_sql;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
if ( !empty( $_GET[ 'com_status' ] ) ) {
|
| 92 |
-
|
| 93 |
-
if ( $time_sql == '' ) {
|
| 94 |
-
$status_sql = "
|
| 95 |
-
WHERE status = '$com_status'
|
| 96 |
-
";
|
| 97 |
-
} else {
|
| 98 |
-
$status_sql = "
|
| 99 |
-
AND status = '$com_status'
|
| 100 |
-
";
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
$sql .= $status_sql;
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
if ( !empty( $_GET[ 'vendor_id' ] ) ) {
|
| 108 |
-
|
| 109 |
-
if ( $time_sql == '' && $status_sql == '' ) {
|
| 110 |
-
$vendor_sql = "
|
| 111 |
-
WHERE vendor_id = '$vendor_id'
|
| 112 |
-
";
|
| 113 |
-
} else {
|
| 114 |
-
$vendor_sql = "
|
| 115 |
-
AND vendor_id = '$vendor_id'
|
| 116 |
-
";
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
$sql .= $vendor_sql;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
$max = $wpdb->get_var( $sql );
|
| 123 |
-
|
| 124 |
-
$sql = "
|
| 125 |
-
SELECT * FROM {$wpdb->prefix}pv_commission
|
| 126 |
-
";
|
| 127 |
-
|
| 128 |
-
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 129 |
-
$sql .= $time_sql;
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
if ( !empty( $_GET['com_status'] ) ) {
|
| 133 |
-
$sql .= $status_sql;
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
-
if ( !empty( $_GET['vendor_id'] ) ) {
|
| 137 |
-
$sql .= $vendor_sql;
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
// $offset = ( $current_page - 1 ) * $per_page;
|
| 141 |
-
|
| 142 |
-
$sql .= "
|
| 143 |
-
ORDER BY `{$orderby}` {$order}
|
| 144 |
-
";
|
| 145 |
-
|
| 146 |
-
$commissions = $wpdb->get_results( $sql );
|
| 147 |
-
|
| 148 |
-
$this->total_rows = count( $commissions );
|
| 149 |
-
$this->row_data = array();
|
| 150 |
-
|
| 151 |
-
foreach ( $commissions as $commission ) {
|
| 152 |
-
|
| 153 |
-
$row = array();
|
| 154 |
-
|
| 155 |
-
foreach ( $columns as $column_id => $column_name ) {
|
| 156 |
-
|
| 157 |
-
if ( $column_id == 'vendor_id' ) {
|
| 158 |
-
$value = WCV_Vendors::get_vendor_shop_name( $commission->vendor_id );
|
| 159 |
-
} elseif ( $column_id == 'totals' ){
|
| 160 |
-
$totals = ( wc_tax_enabled() ) ? $commission->total_due + $commission->total_shipping + $commission->tax : $commission->total_due + $commission->total_shipping;
|
| 161 |
-
$value = wc_format_localized_price( $totals );
|
| 162 |
-
} else {
|
| 163 |
-
$value = $commission->$column_id;
|
| 164 |
-
}
|
| 165 |
-
|
| 166 |
-
|
| 167 |
-
|
| 168 |
-
$row[ $column_id ] = $value;
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
$this->row_data[] = apply_filters( 'wcv_commissions_export_row_data', $row, $commission );
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
}
|
| 175 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-wcv-commissions-page.php
DELETED
|
@@ -1,554 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( !class_exists( 'WP_List_Table' ) ) require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php';
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* WCVendors_Commissions_Page class.
|
| 7 |
-
*
|
| 8 |
-
* @category Admin
|
| 9 |
-
* @package WCVendors/Admin
|
| 10 |
-
* @version 2.0.0
|
| 11 |
-
* @extends WP_List_Table
|
| 12 |
-
*/
|
| 13 |
-
class WCVendors_Commissions_Page extends WP_List_Table {
|
| 14 |
-
|
| 15 |
-
public $index;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* __construct function.
|
| 19 |
-
*
|
| 20 |
-
* @access public
|
| 21 |
-
*/
|
| 22 |
-
public function __construct() {
|
| 23 |
-
global $status, $page;
|
| 24 |
-
|
| 25 |
-
$this->index = 0;
|
| 26 |
-
|
| 27 |
-
//Set parent defaults
|
| 28 |
-
parent::__construct( array(
|
| 29 |
-
'singular' => 'commission',
|
| 30 |
-
'plural' => 'commissions',
|
| 31 |
-
'ajax' => false
|
| 32 |
-
) );
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* column_default function.
|
| 38 |
-
*
|
| 39 |
-
* @access public
|
| 40 |
-
*
|
| 41 |
-
* @param unknown $item
|
| 42 |
-
* @param mixed $column_name
|
| 43 |
-
*
|
| 44 |
-
* @return unknown
|
| 45 |
-
*/
|
| 46 |
-
public function column_default( $item, $column_name ) {
|
| 47 |
-
global $wpdb;
|
| 48 |
-
|
| 49 |
-
switch ( $column_name ) {
|
| 50 |
-
case 'id' :
|
| 51 |
-
return $item->id;
|
| 52 |
-
case 'vendor_id' :
|
| 53 |
-
$user = get_userdata( $item->vendor_id );
|
| 54 |
-
return '<a href="' . admin_url( 'user-edit.php?user_id=' . $item->vendor_id ) . '">' . WCV_Vendors::get_vendor_shop_name( $item->vendor_id ) . '</a>';
|
| 55 |
-
case 'total_due' :
|
| 56 |
-
return wc_price( $item->total_due );
|
| 57 |
-
case 'total_shipping':
|
| 58 |
-
return wc_price($item->total_shipping );
|
| 59 |
-
case 'tax':
|
| 60 |
-
return wc_price( $item->tax );
|
| 61 |
-
case 'totals' :
|
| 62 |
-
$totals = ( wc_tax_enabled() ) ? $item->total_due + $item->total_shipping + $item->tax : $item->total_due + $item->total_shipping;
|
| 63 |
-
return wc_price( $totals );
|
| 64 |
-
case 'product_id' :
|
| 65 |
-
$parent = get_post_ancestors( $item->product_id );
|
| 66 |
-
$product_id = $parent ? $parent[ 0 ] : $item->product_id;
|
| 67 |
-
$wcv_total_sales = get_post_meta( $product_id, 'total_sales', true );
|
| 68 |
-
if ( ! get_post_status( $product_id ) ) {
|
| 69 |
-
$product_id = WCV_Vendors::find_parent_id_from_order( $item->order_id, $product_id );
|
| 70 |
-
}
|
| 71 |
-
return '<a href="' . admin_url( 'post.php?post=' . $product_id . '&action=edit' ) . '">' . get_the_title( $product_id ) . '</a> (<span title="' . get_the_title( $product_id ) .' has sold ' . $wcv_total_sales . ' times total.">' . $wcv_total_sales . '</span>)';
|
| 72 |
-
case 'order_id' :
|
| 73 |
-
$order = wc_get_order( $item->order_id );
|
| 74 |
-
if ( $order ) {
|
| 75 |
-
return '<a href="' . admin_url( 'post.php?post=' . $item->order_id . '&action=edit' ) . '">' . $order->get_order_number() . '</a>';
|
| 76 |
-
} else {
|
| 77 |
-
return $item->order_id;
|
| 78 |
-
}
|
| 79 |
-
case 'status' :
|
| 80 |
-
return $item->status;
|
| 81 |
-
case 'time' :
|
| 82 |
-
return date_i18n( get_option( 'date_format' ), strtotime( $item->time ) );
|
| 83 |
-
}
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
/**
|
| 88 |
-
* column_cb function.
|
| 89 |
-
*
|
| 90 |
-
* @access public
|
| 91 |
-
*
|
| 92 |
-
* @param mixed $item
|
| 93 |
-
*
|
| 94 |
-
* @return unknown
|
| 95 |
-
*/
|
| 96 |
-
public function column_cb( $item ) {
|
| 97 |
-
return sprintf(
|
| 98 |
-
'<input type="checkbox" name="%1$s[]" value="%2$s" />',
|
| 99 |
-
/*$1%s*/
|
| 100 |
-
'id',
|
| 101 |
-
/*$2%s*/
|
| 102 |
-
$item->id
|
| 103 |
-
);
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
/**
|
| 108 |
-
* get_columns function.
|
| 109 |
-
*
|
| 110 |
-
* @access public
|
| 111 |
-
* @return unknown
|
| 112 |
-
*/
|
| 113 |
-
public function get_columns() {
|
| 114 |
-
$columns = array(
|
| 115 |
-
'cb' => '<input type="checkbox" />',
|
| 116 |
-
'product_id' => __( 'Product', 'wc-vendors' ),
|
| 117 |
-
'order_id' => __( 'Order ID', 'wc-vendors' ),
|
| 118 |
-
'vendor_id' => __( 'Vendor', 'wc-vendors' ),
|
| 119 |
-
'total_due' => __( 'Commission', 'wc-vendors' ),
|
| 120 |
-
'total_shipping' => __( 'Shipping', 'wc-vendors' ),
|
| 121 |
-
'tax' => __( 'Tax', 'wc-vendors' ),
|
| 122 |
-
'totals' => __( 'Total', 'wc-vendors' ),
|
| 123 |
-
'status' => __( 'Status', 'wc-vendors' ),
|
| 124 |
-
'time' => __( 'Date', 'wc-vendors' ),
|
| 125 |
-
);
|
| 126 |
-
|
| 127 |
-
if ( ! wc_tax_enabled() ) unset( $columns[ 'tax'] );
|
| 128 |
-
|
| 129 |
-
return $columns;
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
/**
|
| 134 |
-
* get_sortable_columns function.
|
| 135 |
-
*
|
| 136 |
-
* @access public
|
| 137 |
-
* @return unknown
|
| 138 |
-
*/
|
| 139 |
-
public function get_sortable_columns() {
|
| 140 |
-
$sortable_columns = array(
|
| 141 |
-
'time' => array( 'time', true ),
|
| 142 |
-
'product_id' => array( 'product_id', false ),
|
| 143 |
-
'order_id' => array( 'order_id', false ),
|
| 144 |
-
'total_due' => array( 'total_due', false ),
|
| 145 |
-
'total_shipping' => array( 'total_shipping', false ),
|
| 146 |
-
'tax' => array( 'tax', false ),
|
| 147 |
-
'totals' => array( 'totals', false ),
|
| 148 |
-
'status' => array( 'status', false ),
|
| 149 |
-
'vendor_id' => array( 'vendor_id', false ),
|
| 150 |
-
'status' => array( 'status', false ),
|
| 151 |
-
);
|
| 152 |
-
|
| 153 |
-
if ( ! wc_tax_enabled() ) unset( $sortable_columns[ 'tax'] );
|
| 154 |
-
|
| 155 |
-
return $sortable_columns;
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
|
| 159 |
-
/**
|
| 160 |
-
* Get bulk actions
|
| 161 |
-
*
|
| 162 |
-
* @return unknown
|
| 163 |
-
*/
|
| 164 |
-
public function get_bulk_actions() {
|
| 165 |
-
$actions = array(
|
| 166 |
-
'mark_paid' => __( 'Mark paid', 'wc-vendors' ),
|
| 167 |
-
'mark_due' => __( 'Mark due', 'wc-vendors' ),
|
| 168 |
-
'mark_reversed' => __( 'Mark reversed', 'wc-vendors' ),
|
| 169 |
-
// 'delete' => __('Delete', 'wc-vendors'),
|
| 170 |
-
);
|
| 171 |
-
|
| 172 |
-
$actions = apply_filters('wcv_edit_bulk_actions', $actions);
|
| 173 |
-
|
| 174 |
-
return $actions;
|
| 175 |
-
}
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
/**
|
| 179 |
-
*
|
| 180 |
-
*/
|
| 181 |
-
public function extra_tablenav( $which ) {
|
| 182 |
-
$m = isset( $_GET[ 'm' ] ) ? (int) $_GET[ 'm' ] : 0;
|
| 183 |
-
$com_status = isset( $_GET[ 'com_status' ] ) ? $_GET[ 'com_status' ] : '';
|
| 184 |
-
$vendor_id = isset( $_GET[ 'vendor_id' ] ) ? $_GET[ 'vendor_id' ] : '';
|
| 185 |
-
$args_url = '';
|
| 186 |
-
|
| 187 |
-
if ( $m ) $args_url .= '&m='. $m;
|
| 188 |
-
if ( $com_status ) $args_url .= '&com_status='. $com_status;
|
| 189 |
-
if ( $vendor_id ) $args_url .= '&vendor_id='. $vendor_id;
|
| 190 |
-
|
| 191 |
-
if ( $which == 'top' ) {
|
| 192 |
-
echo '<div class="alignleft actions" style="width: 70%;">';
|
| 193 |
-
|
| 194 |
-
// Months drop down
|
| 195 |
-
$this->months_dropdown( 'commission' );
|
| 196 |
-
|
| 197 |
-
// commission status drop down
|
| 198 |
-
$this->status_dropdown( 'commission' );
|
| 199 |
-
|
| 200 |
-
// Vendor drop down
|
| 201 |
-
$this->vendor_dropdown( 'commission' );
|
| 202 |
-
|
| 203 |
-
submit_button( __( 'Filter', 'wc-vendors' ), false, false, false, array( 'id' => "post-query-submit", 'name' => 'do-filter' ) );
|
| 204 |
-
submit_button( __( 'Clear', 'wc-vendors' ), 'secondary', 'reset', false, array( 'type' => 'reset' ) );
|
| 205 |
-
|
| 206 |
-
echo '<a class="button" style="width: 110px; float: left;" href="' . wp_nonce_url( admin_url( 'admin.php?page=wcv-commissions&action=export_commissions'. $args_url ), 'export_commissions', 'nonce' ) . '">' . __('Export to CSV', 'wc-vendors' ) . '</a>';
|
| 207 |
-
echo '<a class="button" style="width: 150px; float: left;" href="' . wp_nonce_url( admin_url( 'admin.php?page=wcv-commissions&action=export_commission_totals'. $args_url ), 'export_commission_totals', 'nonce' ) . '">' . __('Export Totals to CSV', 'wc-vendors' ) . '</a>';
|
| 208 |
-
echo '</div>';
|
| 209 |
-
|
| 210 |
-
}
|
| 211 |
-
}
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
/**
|
| 215 |
-
* Display a monthly dropdown for filtering items
|
| 216 |
-
*
|
| 217 |
-
* @since 3.1.0
|
| 218 |
-
* @access protected
|
| 219 |
-
*
|
| 220 |
-
* @param unknown $post_type
|
| 221 |
-
*/
|
| 222 |
-
public function months_dropdown( $post_type )
|
| 223 |
-
{
|
| 224 |
-
global $wpdb, $wp_locale;
|
| 225 |
-
|
| 226 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 227 |
-
|
| 228 |
-
$months = $wpdb->get_results( "
|
| 229 |
-
SELECT DISTINCT YEAR( time ) AS year, MONTH( time ) AS month
|
| 230 |
-
FROM $table_name
|
| 231 |
-
ORDER BY time DESC
|
| 232 |
-
" );
|
| 233 |
-
|
| 234 |
-
$month_count = count( $months );
|
| 235 |
-
|
| 236 |
-
if ( !$month_count || ( 1 == $month_count && 0 == $months[ 0 ]->month ) )
|
| 237 |
-
return;
|
| 238 |
-
|
| 239 |
-
$m = isset( $_GET[ 'm' ] ) ? (int) $_GET[ 'm' ] : 0;
|
| 240 |
-
?>
|
| 241 |
-
<select name="m" id="filter-by-date" class="wc-enhanced-select-nostd" style="min-width:150px;">
|
| 242 |
-
<option<?php selected( $m, 0 ); ?> value='0'><?php _e( 'Show all dates', 'wc-vendors' ); ?></option>
|
| 243 |
-
<?php
|
| 244 |
-
foreach ( $months as $arc_row ) {
|
| 245 |
-
if ( 0 == $arc_row->year )
|
| 246 |
-
continue;
|
| 247 |
-
|
| 248 |
-
$month = zeroise( $arc_row->month, 2 );
|
| 249 |
-
$year = $arc_row->year;
|
| 250 |
-
|
| 251 |
-
printf( "<option %s value='%s'>%s</option>\n",
|
| 252 |
-
selected( $m, $year . $month, false ),
|
| 253 |
-
esc_attr( $arc_row->year . $month ),
|
| 254 |
-
/* translators: 1: month name, 2: 4-digit year */
|
| 255 |
-
sprintf( __( '%1$s %2$d' ), $wp_locale->get_month( $month ), $year )
|
| 256 |
-
);
|
| 257 |
-
}
|
| 258 |
-
?>
|
| 259 |
-
</select>
|
| 260 |
-
|
| 261 |
-
<?php
|
| 262 |
-
}
|
| 263 |
-
|
| 264 |
-
/**
|
| 265 |
-
* Display a status dropdown for filtering items
|
| 266 |
-
*
|
| 267 |
-
* @since 3.1.0
|
| 268 |
-
* @access protected
|
| 269 |
-
*
|
| 270 |
-
* @param unknown $post_type
|
| 271 |
-
*/
|
| 272 |
-
public function status_dropdown( $post_type )
|
| 273 |
-
{
|
| 274 |
-
$com_status = isset( $_GET[ 'com_status' ] ) ? $_GET[ 'com_status' ] : '';
|
| 275 |
-
?>
|
| 276 |
-
<select name="com_status" class="wc-enhanced-select">
|
| 277 |
-
<option<?php selected( $com_status, '' ); ?> value=''><?php _e( 'Show all Statuses', 'wc-vendors' ); ?></option>
|
| 278 |
-
<option<?php selected( $com_status, 'due' ); ?> value="due"><?php _e( 'Due', 'wc-vendors' ); ?></option>
|
| 279 |
-
<option<?php selected( $com_status, 'paid' ); ?> value="paid"><?php _e( 'Paid', 'wc-vendors' ); ?></option>
|
| 280 |
-
<option<?php selected( $com_status, 'reversed' ); ?> value="reversed"><?php _e( 'Reversed', 'wc-vendors' ); ?></option>
|
| 281 |
-
</select>
|
| 282 |
-
<?php
|
| 283 |
-
}
|
| 284 |
-
|
| 285 |
-
/**
|
| 286 |
-
* Display a vendor dropdown for filtering commissions
|
| 287 |
-
*
|
| 288 |
-
* @since 1.9.2
|
| 289 |
-
* @access public
|
| 290 |
-
*
|
| 291 |
-
* @param unknown $post_type
|
| 292 |
-
*/
|
| 293 |
-
public function vendor_dropdown( $post_type ){
|
| 294 |
-
|
| 295 |
-
$user_args = array( 'fields' => array( 'ID', 'display_name' ) );
|
| 296 |
-
$vendor_id = isset( $_GET[ 'vendor_id' ] ) ? $_GET[ 'vendor_id' ] : '';
|
| 297 |
-
$new_args = $user_args;
|
| 298 |
-
$new_args[ 'role' ] = 'vendor';
|
| 299 |
-
$users = get_users( $new_args );
|
| 300 |
-
|
| 301 |
-
// Generate the drop down
|
| 302 |
-
$output = '<select style="width:250px;" name="vendor_id" id="vendor_id" class="wc-enhanced-select">';
|
| 303 |
-
$output .= "<option></option>";
|
| 304 |
-
foreach ( (array) $users as $user ) {
|
| 305 |
-
$select = selected( $user->ID, $vendor_id, false );
|
| 306 |
-
$output .= "<option value='$user->ID' $select>$user->display_name</option>";
|
| 307 |
-
}
|
| 308 |
-
$output .= '</select>';
|
| 309 |
-
|
| 310 |
-
echo $output;
|
| 311 |
-
|
| 312 |
-
} // vendor_dropdown()
|
| 313 |
-
|
| 314 |
-
|
| 315 |
-
|
| 316 |
-
/**
|
| 317 |
-
* Process bulk actions
|
| 318 |
-
*
|
| 319 |
-
* @return unknown
|
| 320 |
-
*/
|
| 321 |
-
public function process_bulk_action()
|
| 322 |
-
{
|
| 323 |
-
if ( !isset( $_GET[ 'id' ] ) ) return;
|
| 324 |
-
|
| 325 |
-
$items = array_map( 'intval', $_GET[ 'id' ] );
|
| 326 |
-
$ids = implode( ',', $items );
|
| 327 |
-
|
| 328 |
-
switch ( $this->current_action() ) {
|
| 329 |
-
case 'mark_paid':
|
| 330 |
-
$result = $this->mark_paid( $ids );
|
| 331 |
-
|
| 332 |
-
if ( $result )
|
| 333 |
-
echo '<div class="updated"><p>' . __( 'Commission marked paid.', 'wc-vendors' ) . '</p></div>';
|
| 334 |
-
break;
|
| 335 |
-
|
| 336 |
-
case 'mark_due':
|
| 337 |
-
$result = $this->mark_due( $ids );
|
| 338 |
-
|
| 339 |
-
if ( $result )
|
| 340 |
-
echo '<div class="updated"><p>' . __( 'Commission marked due.', 'wc-vendors' ) . '</p></div>';
|
| 341 |
-
break;
|
| 342 |
-
|
| 343 |
-
case 'mark_reversed':
|
| 344 |
-
$result = $this->mark_reversed( $ids );
|
| 345 |
-
|
| 346 |
-
if ( $result )
|
| 347 |
-
echo '<div class="updated"><p>' . __( 'Commission marked reversed.', 'wc-vendors' ) . '</p></div>';
|
| 348 |
-
break;
|
| 349 |
-
|
| 350 |
-
default:
|
| 351 |
-
// code...
|
| 352 |
-
do_action('wcv_edit_process_bulk_actions', $this->current_action(), $ids);
|
| 353 |
-
break;
|
| 354 |
-
}
|
| 355 |
-
|
| 356 |
-
}
|
| 357 |
-
|
| 358 |
-
|
| 359 |
-
/**
|
| 360 |
-
*
|
| 361 |
-
*
|
| 362 |
-
* @param unknown $ids (optional)
|
| 363 |
-
*
|
| 364 |
-
* @return unknown
|
| 365 |
-
*/
|
| 366 |
-
public function mark_paid( $ids = array() )
|
| 367 |
-
{
|
| 368 |
-
global $wpdb;
|
| 369 |
-
|
| 370 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 371 |
-
|
| 372 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE id IN ($ids) AND `status` = 'due'";
|
| 373 |
-
$result = $wpdb->query( $query );
|
| 374 |
-
|
| 375 |
-
return $result;
|
| 376 |
-
}
|
| 377 |
-
|
| 378 |
-
|
| 379 |
-
/**
|
| 380 |
-
*
|
| 381 |
-
*
|
| 382 |
-
* @param unknown $ids (optional)
|
| 383 |
-
*
|
| 384 |
-
* @return unknown
|
| 385 |
-
*/
|
| 386 |
-
public function mark_reversed( $ids = array() )
|
| 387 |
-
{
|
| 388 |
-
global $wpdb;
|
| 389 |
-
|
| 390 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 391 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'reversed' WHERE id IN ($ids)";
|
| 392 |
-
$result = $wpdb->query( $query );
|
| 393 |
-
|
| 394 |
-
return $result;
|
| 395 |
-
|
| 396 |
-
}
|
| 397 |
-
|
| 398 |
-
|
| 399 |
-
/**
|
| 400 |
-
*
|
| 401 |
-
*
|
| 402 |
-
* @param unknown $ids (optional)
|
| 403 |
-
*
|
| 404 |
-
* @return unknown
|
| 405 |
-
*/
|
| 406 |
-
public function mark_due( $ids = array() )
|
| 407 |
-
{
|
| 408 |
-
global $wpdb;
|
| 409 |
-
|
| 410 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 411 |
-
|
| 412 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'due' WHERE id IN ($ids)";
|
| 413 |
-
$result = $wpdb->query( $query );
|
| 414 |
-
|
| 415 |
-
return $result;
|
| 416 |
-
}
|
| 417 |
-
|
| 418 |
-
|
| 419 |
-
/**
|
| 420 |
-
* cubrid_prepare(conn_identifier, prepare_stmt)_items function.
|
| 421 |
-
*
|
| 422 |
-
* @access public
|
| 423 |
-
*/
|
| 424 |
-
public function prepare_items() {
|
| 425 |
-
global $wpdb;
|
| 426 |
-
|
| 427 |
-
|
| 428 |
-
$_SERVER['REQUEST_URI'] = remove_query_arg( '_wp_http_referer', $_SERVER['REQUEST_URI'] );
|
| 429 |
-
|
| 430 |
-
$per_page = $this->get_items_per_page( 'commissions_per_page', 10 );
|
| 431 |
-
$current_page = $this->get_pagenum();
|
| 432 |
-
|
| 433 |
-
$orderby = !empty( $_REQUEST[ 'orderby' ] ) ? esc_attr( $_REQUEST[ 'orderby' ] ) : 'time';
|
| 434 |
-
$order = ( !empty( $_REQUEST[ 'order' ] ) && $_REQUEST[ 'order' ] == 'asc' ) ? 'ASC' : 'DESC';
|
| 435 |
-
$com_status = !empty( $_REQUEST[ 'com_status' ] ) ? esc_attr( $_REQUEST[ 'com_status' ] ) : '';
|
| 436 |
-
$vendor_id = !empty( $_REQUEST[ 'vendor_id' ] ) ? esc_attr( $_REQUEST[ 'vendor_id' ] ) : '';
|
| 437 |
-
$status_sql = '';
|
| 438 |
-
$time_sql = '';
|
| 439 |
-
|
| 440 |
-
/**
|
| 441 |
-
* Init column headers
|
| 442 |
-
*/
|
| 443 |
-
$this->_column_headers = $this->get_column_info();
|
| 444 |
-
|
| 445 |
-
/**
|
| 446 |
-
* Process bulk actions
|
| 447 |
-
*/
|
| 448 |
-
$this->process_bulk_action();
|
| 449 |
-
|
| 450 |
-
/**
|
| 451 |
-
* Get items
|
| 452 |
-
*/
|
| 453 |
-
$sql = "SELECT COUNT(id) FROM {$wpdb->prefix}pv_commission";
|
| 454 |
-
|
| 455 |
-
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 456 |
-
|
| 457 |
-
$year = substr( $_GET[ 'm' ], 0, 4 );
|
| 458 |
-
$month = substr( $_GET[ 'm' ], 4, 2 );
|
| 459 |
-
|
| 460 |
-
$time_sql = "
|
| 461 |
-
WHERE MONTH(`time`) = '$month'
|
| 462 |
-
AND YEAR(`time`) = '$year'
|
| 463 |
-
";
|
| 464 |
-
|
| 465 |
-
$sql .= $time_sql;
|
| 466 |
-
}
|
| 467 |
-
|
| 468 |
-
if ( !empty( $_GET[ 'com_status' ] ) ) {
|
| 469 |
-
|
| 470 |
-
if ( $time_sql == '' ) {
|
| 471 |
-
$status_sql = "
|
| 472 |
-
WHERE status = '$com_status'
|
| 473 |
-
";
|
| 474 |
-
} else {
|
| 475 |
-
$status_sql = "
|
| 476 |
-
AND status = '$com_status'
|
| 477 |
-
";
|
| 478 |
-
}
|
| 479 |
-
|
| 480 |
-
$sql .= $status_sql;
|
| 481 |
-
}
|
| 482 |
-
|
| 483 |
-
|
| 484 |
-
if ( !empty( $_GET[ 'vendor_id' ] ) ) {
|
| 485 |
-
|
| 486 |
-
if ( $time_sql == '' && $status_sql == '' ) {
|
| 487 |
-
$vendor_sql = "
|
| 488 |
-
WHERE vendor_id = '$vendor_id'
|
| 489 |
-
";
|
| 490 |
-
} else {
|
| 491 |
-
$vendor_sql = "
|
| 492 |
-
AND vendor_id = '$vendor_id'
|
| 493 |
-
";
|
| 494 |
-
}
|
| 495 |
-
|
| 496 |
-
$sql .= $vendor_sql;
|
| 497 |
-
}
|
| 498 |
-
|
| 499 |
-
$max = $wpdb->get_var( $sql );
|
| 500 |
-
|
| 501 |
-
$sql = "
|
| 502 |
-
SELECT * FROM {$wpdb->prefix}pv_commission
|
| 503 |
-
";
|
| 504 |
-
|
| 505 |
-
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 506 |
-
$sql .= $time_sql;
|
| 507 |
-
}
|
| 508 |
-
|
| 509 |
-
if ( !empty( $_GET['com_status'] ) ) {
|
| 510 |
-
$sql .= $status_sql;
|
| 511 |
-
}
|
| 512 |
-
|
| 513 |
-
if ( !empty( $_GET['vendor_id'] ) ) {
|
| 514 |
-
$sql .= $vendor_sql;
|
| 515 |
-
}
|
| 516 |
-
|
| 517 |
-
$offset = ( $current_page - 1 ) * $per_page;
|
| 518 |
-
|
| 519 |
-
$sql .= "
|
| 520 |
-
ORDER BY `{$orderby}` {$order}
|
| 521 |
-
LIMIT {$offset}, {$per_page}
|
| 522 |
-
";
|
| 523 |
-
|
| 524 |
-
// $this->items = $wpdb->get_results( $wpdb->prepare( $sql, ( $current_page - 1 ) * $per_page, $per_page ) );
|
| 525 |
-
$this->items = $wpdb->get_results( $sql );
|
| 526 |
-
|
| 527 |
-
/**
|
| 528 |
-
* Pagination
|
| 529 |
-
*/
|
| 530 |
-
$this->set_pagination_args( array(
|
| 531 |
-
'total_items' => $max,
|
| 532 |
-
'per_page' => $per_page,
|
| 533 |
-
'total_pages' => ceil( $max / $per_page )
|
| 534 |
-
) );
|
| 535 |
-
}
|
| 536 |
-
|
| 537 |
-
/**
|
| 538 |
-
* Get Views for commissions page
|
| 539 |
-
*
|
| 540 |
-
*/
|
| 541 |
-
public function get_views() {
|
| 542 |
-
$views = array(
|
| 543 |
-
'all' => '<li class="all"><a href="' . admin_url( 'admin.php?page=wcv-commissions' ) . '">' . __( 'All', 'wc-vendors' ) . '</a></li>',
|
| 544 |
-
'due' => '<li class="all"><a href="' . admin_url( 'admin.php?page=wcv-commissions&com_status=due' ) . '">' . __( 'Due', 'wc-vendors' ) . '</a></li>',
|
| 545 |
-
'paid' => '<li class="all"><a href="' . admin_url( 'admin.php?page=wcv-commissions&com_status=paid' ) . '">' . __( 'Paid', 'wc-vendors' ) . '</a></li>',
|
| 546 |
-
'void' => '<li class="all"><a href="' . admin_url( 'admin.php?page=wcv-commissions&com_status=reversed' ) . '">' . __( 'Reversed', 'wc-vendors' ) . '</a></li>',
|
| 547 |
-
);
|
| 548 |
-
|
| 549 |
-
return $views;
|
| 550 |
-
}
|
| 551 |
-
|
| 552 |
-
|
| 553 |
-
|
| 554 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/class-wcv-commissions-sum-csv-exporter.php
DELETED
|
@@ -1,85 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Handles commission CSV export.
|
| 4 |
-
*
|
| 5 |
-
* @version 1.9.14
|
| 6 |
-
*/
|
| 7 |
-
|
| 8 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 9 |
-
exit;
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Include dependencies.
|
| 14 |
-
*/
|
| 15 |
-
if ( ! class_exists( 'WC_CSV_Exporter', false ) ) {
|
| 16 |
-
include_once WC_ABSPATH . 'includes/export/abstract-wc-csv-exporter.php';
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
/**
|
| 20 |
-
* WCV_Commissions_CSV_Export Class.
|
| 21 |
-
*/
|
| 22 |
-
class WCV_Commissions_Sum_CSV_Export extends WC_CSV_Exporter {
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Constructor.
|
| 26 |
-
*/
|
| 27 |
-
public function __construct() {
|
| 28 |
-
$this->column_names = $this->get_default_column_names();
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Return an array of columns to export.
|
| 34 |
-
*
|
| 35 |
-
* @since 1.9.14
|
| 36 |
-
* @return array
|
| 37 |
-
*/
|
| 38 |
-
public function get_default_column_names() {
|
| 39 |
-
|
| 40 |
-
return apply_filters( 'wcv_commissions_sum_export_columns', array(
|
| 41 |
-
'vendor_id' => __( 'Vendor', 'wc-vendors' ),
|
| 42 |
-
'total_due' => __( 'Total', 'wc-vendors' ),
|
| 43 |
-
'status' => __( 'Commission Status', 'wc-vendors' ),
|
| 44 |
-
) );
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* Prepare data for export.
|
| 49 |
-
*
|
| 50 |
-
* @since 1.9.14
|
| 51 |
-
*/
|
| 52 |
-
public function prepare_data_to_export() {
|
| 53 |
-
|
| 54 |
-
global $wpdb;
|
| 55 |
-
|
| 56 |
-
$columns = $this->get_column_names();
|
| 57 |
-
|
| 58 |
-
if ( ! current_user_can( 'manage_options' ) ) return;
|
| 59 |
-
|
| 60 |
-
$sum_totals = WCV_Commission::get_sum_vendor_totals();
|
| 61 |
-
$this->total_rows = count( $sum_totals );
|
| 62 |
-
$this->row_data = array();
|
| 63 |
-
|
| 64 |
-
foreach ( $sum_totals as $status => $totals ) {
|
| 65 |
-
$row = array();
|
| 66 |
-
foreach ( $totals as $vendor_id => $total ) {
|
| 67 |
-
|
| 68 |
-
foreach ( $columns as $column_id => $column_name ) {
|
| 69 |
-
if ( $column_id == 'vendor_id' ) {
|
| 70 |
-
$value = WCV_Vendors::get_vendor_shop_name( $vendor_id );
|
| 71 |
-
} elseif ( $column_id == 'total_due' ){
|
| 72 |
-
$value = wc_format_localized_price( $total );
|
| 73 |
-
} else {
|
| 74 |
-
$value = $status;
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
$row[ $column_id ] = $value;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
$this->row_data[] = apply_filters( 'wcv_sum_commissions_export_row_data', $row, $vendor_id, $total, $status );
|
| 81 |
-
}
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
}
|
| 85 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-emails.php
DELETED
|
@@ -1,244 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
*
|
| 7 |
-
*
|
| 8 |
-
* @author Matt Gates <http://mgates.me>
|
| 9 |
-
* @package
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
class WCV_Emails
|
| 14 |
-
{
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
*
|
| 19 |
-
*/
|
| 20 |
-
public function __construct() {
|
| 21 |
-
|
| 22 |
-
add_filter( 'woocommerce_email_classes', array( $this, 'email_classes' ) );
|
| 23 |
-
add_filter( 'woocommerce_order_actions', array( $this, 'order_actions' ) );
|
| 24 |
-
add_action( 'woocommerce_order_action_send_vvendor_new_order', array( $this, 'order_actions_save') );
|
| 25 |
-
// Deprecaited
|
| 26 |
-
|
| 27 |
-
add_action( 'set_user_role', array( $this, 'application_status_email' ), 10, 2 );
|
| 28 |
-
add_action( 'transition_post_status', array( $this, 'trigger_new_product' ), 10, 3 );
|
| 29 |
-
|
| 30 |
-
// Low stock
|
| 31 |
-
// These fatal error in WC3.3.3 @todo fix !
|
| 32 |
-
add_filter( 'woocommerce_email_recipient_low_stock', array( $this, 'vendor_stock_email'), 10, 2 );
|
| 33 |
-
add_filter( 'woocommerce_email_recipient_no_stock', array( $this, 'vendor_stock_email'), 10, 2 );
|
| 34 |
-
add_filter( 'woocommerce_email_recipient_backorder', array( $this, 'vendor_stock_email'), 10, 2 );
|
| 35 |
-
|
| 36 |
-
// New emails
|
| 37 |
-
// Triggers
|
| 38 |
-
add_action( 'wcvendors_vendor_ship', array( $this, 'vendor_shipped' ), 10, 3 );
|
| 39 |
-
add_action( 'wcvendors_email_order_details',array( $this, 'vendor_order_details'), 10, 8 );
|
| 40 |
-
add_action( 'transition_post_status', array( $this, 'new_vendor_product' ), 10, 3 );
|
| 41 |
-
add_action( 'set_user_role', array( $this, 'vendor_application' ), 10, 2 );
|
| 42 |
-
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
// Depreciated
|
| 47 |
-
public function trigger_new_product( $from, $to, $post )
|
| 48 |
-
{
|
| 49 |
-
global $woocommerce;
|
| 50 |
-
|
| 51 |
-
if ( $from != $to && $post->post_status == 'pending' && WCV_Vendors::is_vendor( $post->post_author ) && $post->post_type == 'product' ) {
|
| 52 |
-
$mails = $woocommerce->mailer()->get_emails();
|
| 53 |
-
if ( !empty( $mails ) ) {
|
| 54 |
-
$mails[ 'WC_Email_Notify_Admin' ]->trigger( $post->post_id, $post );
|
| 55 |
-
}
|
| 56 |
-
}
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* @depreciated
|
| 62 |
-
*
|
| 63 |
-
* @param unknown $user_id
|
| 64 |
-
* @param unknown $role
|
| 65 |
-
*/
|
| 66 |
-
public function application_status_email( $user_id, $role ) {
|
| 67 |
-
|
| 68 |
-
global $woocommerce;
|
| 69 |
-
|
| 70 |
-
if ( !empty( $_POST[ 'apply_for_vendor' ] ) || ( !empty( $_GET[ 'action' ] ) && ( $_GET[ 'action' ] == 'approve_vendor' || $_GET[ 'action' ] == 'deny_vendor' ) ) ) {
|
| 71 |
-
|
| 72 |
-
if ( $role == 'pending_vendor' ) {
|
| 73 |
-
$status = __( 'pending', 'wc-vendors' );
|
| 74 |
-
} else if ( $role == 'vendor' ) {
|
| 75 |
-
$status = __( 'approved', 'wc-vendors' );
|
| 76 |
-
} else if ( !empty( $_GET[ 'action' ] ) && $_GET[ 'action' ] == 'deny_vendor' ) {
|
| 77 |
-
$status = __( 'denied', 'wc-vendors' );
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
$mails = $woocommerce->mailer()->get_emails();
|
| 81 |
-
|
| 82 |
-
if ( isset( $status ) && !empty( $mails ) ) {
|
| 83 |
-
$mails[ 'WC_Email_Approve_Vendor' ]->trigger( $user_id, $status );
|
| 84 |
-
}
|
| 85 |
-
}
|
| 86 |
-
}
|
| 87 |
-
|
| 88 |
-
/**
|
| 89 |
-
*
|
| 90 |
-
*
|
| 91 |
-
* @param unknown $emails
|
| 92 |
-
*
|
| 93 |
-
* @return unknown
|
| 94 |
-
*/
|
| 95 |
-
public function email_classes( $emails ){
|
| 96 |
-
|
| 97 |
-
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-admin.php';
|
| 98 |
-
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-vendor.php';
|
| 99 |
-
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-approve-vendor.php';
|
| 100 |
-
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-shipped.php';
|
| 101 |
-
|
| 102 |
-
// Emails to depreciate
|
| 103 |
-
$emails[ 'WC_Email_Notify_Vendor' ] = new WC_Email_Notify_Vendor();
|
| 104 |
-
$emails[ 'WC_Email_Approve_Vendor' ] = new WC_Email_Approve_Vendor();
|
| 105 |
-
$emails[ 'WC_Email_Notify_Admin' ] = new WC_Email_Notify_Admin();
|
| 106 |
-
$emails[ 'WC_Email_Notify_Shipped' ] = new WC_Email_Notify_Shipped();
|
| 107 |
-
|
| 108 |
-
// New emails introduced in @since 2.0.0
|
| 109 |
-
$emails[ 'WCVendors_Customer_Notify_Shipped'] = include( wcv_plugin_dir . 'classes/admin/emails/class-wcv-customer-notify-shipped.php' );
|
| 110 |
-
$emails[ 'WCVendors_Admin_Notify_Shipped'] = include( wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-shipped.php' );
|
| 111 |
-
$emails[ 'WCVendors_Admin_Notify_Product'] = include( wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-product.php' );
|
| 112 |
-
$emails[ 'WCVendors_Admin_Notify_Application'] = include( wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-application.php' );
|
| 113 |
-
$emails[ 'WCVendors_Vendor_Notify_Application'] = include( wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-application.php' );
|
| 114 |
-
$emails[ 'WCVendors_Vendor_Notify_Approved'] = include( wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-approved.php' );
|
| 115 |
-
$emails[ 'WCVendors_Vendor_Notify_Denied'] = include( wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-denied.php' );
|
| 116 |
-
$emails[ 'WCVendors_Vendor_Notify_Order'] = include( wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-order.php' );
|
| 117 |
-
|
| 118 |
-
return $emails;
|
| 119 |
-
|
| 120 |
-
} // email_classes()
|
| 121 |
-
|
| 122 |
-
/**
|
| 123 |
-
* Add the vendor email to the low stock emails.
|
| 124 |
-
*
|
| 125 |
-
*/
|
| 126 |
-
public function vendor_stock_email( $emails, $product ) {
|
| 127 |
-
|
| 128 |
-
if ( ! is_a( $product, 'WC_Product' ) ) return;
|
| 129 |
-
|
| 130 |
-
$post = get_post( $product->get_id() );
|
| 131 |
-
|
| 132 |
-
if ( WCV_Vendors::is_vendor( $post->post_author ) ) {
|
| 133 |
-
$vendor_data = get_userdata( $post->post_author );
|
| 134 |
-
$vendor_email = $vendor_data->user_email;
|
| 135 |
-
$emails .= ','.$vendor_email;
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
return $emails;
|
| 139 |
-
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
/**
|
| 143 |
-
* Filter hook for order actions meta box
|
| 144 |
-
*
|
| 145 |
-
*/
|
| 146 |
-
public function order_actions( $order_actions ){
|
| 147 |
-
$order_actions[ 'send_vvendor_new_order' ] = sprintf( __( 'Resend %s new order notification', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 148 |
-
return $order_actions;
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
/**
|
| 152 |
-
* Action hook : trigger the notify vendor email
|
| 153 |
-
*
|
| 154 |
-
*/
|
| 155 |
-
public function order_actions_save( $order ){
|
| 156 |
-
|
| 157 |
-
WC()->mailer()->emails[ 'WC_Email_Notify_Vendor' ]->trigger( $order->get_id(), $order );
|
| 158 |
-
WC()->mailer()->emails[ 'WCVendors_Vendor_Notify_Order' ]->trigger( $order->get_id(), $order );
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
/**
|
| 162 |
-
* Trigger the notify vendor shipped emails
|
| 163 |
-
*
|
| 164 |
-
* @since 2.0.0
|
| 165 |
-
*/
|
| 166 |
-
public function vendor_shipped( $order_id, $user_id, $order ){
|
| 167 |
-
// Notify the admin
|
| 168 |
-
WC()->mailer()->emails[ 'WCVendors_Admin_Notify_Shipped' ]->trigger( $order->get_id(), $user_id, $order );
|
| 169 |
-
// Notify the customer
|
| 170 |
-
WC()->mailer()->emails[ 'WCVendors_Customer_Notify_Shipped' ]->trigger( $order->get_id(), $user_id, $order );
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
/**
|
| 175 |
-
* Trigger the notify admin new vendor product
|
| 176 |
-
*
|
| 177 |
-
* @since 2.0.0
|
| 178 |
-
*/
|
| 179 |
-
public function new_vendor_product( $from, $to, $post ){
|
| 180 |
-
|
| 181 |
-
if ( $from != $to && $post->post_status == 'pending' && WCV_Vendors::is_vendor( $post->post_author ) && $post->post_type == 'product' ) {
|
| 182 |
-
|
| 183 |
-
WC()->mailer()->emails[ 'WCVendors_Admin_Notify_Product' ]->trigger( $post->post_id, $post );
|
| 184 |
-
}
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
-
/**
|
| 188 |
-
* Trigger the vendor application emails
|
| 189 |
-
*
|
| 190 |
-
* @since 2.0.0
|
| 191 |
-
*/
|
| 192 |
-
public function vendor_application( $user_id, $role ){
|
| 193 |
-
|
| 194 |
-
if ( !empty( $_POST[ 'apply_for_vendor' ] ) || ( !empty( $_GET[ 'action' ] ) && ( $_GET[ 'action' ] == 'approve_vendor' || $_GET[ 'action' ] == 'deny_vendor' ) ) ) {
|
| 195 |
-
|
| 196 |
-
if ( $role == 'pending_vendor' ) {
|
| 197 |
-
WC()->mailer()->emails[ 'WCVendors_Vendor_Notify_Application' ]->trigger( $user_id, __( 'pending', 'wc-vendors' ) );
|
| 198 |
-
} else if ( $role == 'vendor' ) {
|
| 199 |
-
WC()->mailer()->emails[ 'WCVendors_Vendor_Notify_Approved' ]->trigger( $user_id );
|
| 200 |
-
} else if ( !empty( $_GET[ 'action' ] ) && $_GET[ 'action' ] == 'deny_vendor' ) {
|
| 201 |
-
$reason = isset( $_GET[ 'reason' ] ) ? $_GET[ 'reason' ] : '';
|
| 202 |
-
WC()->mailer()->emails[ 'WCVendors_Vendor_Notify_Denied' ]->trigger( $user_id, $reason );
|
| 203 |
-
}
|
| 204 |
-
|
| 205 |
-
WC()->mailer()->emails[ 'WCVendors_Admin_Notify_Application' ]->trigger( $user_id, $role );
|
| 206 |
-
|
| 207 |
-
}
|
| 208 |
-
}
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
/*
|
| 212 |
-
* Show the order details table filtered for each vendor
|
| 213 |
-
*/
|
| 214 |
-
public function vendor_order_details( $order, $vendor_items, $totals_display, $vendor_id, $sent_to_vendor = false, $sent_to_admin = false, $plain_text = false, $email = '' ) {
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
if ( $plain_text ) {
|
| 218 |
-
|
| 219 |
-
wc_get_template( 'emails/plain/vendor-order-details.php', array(
|
| 220 |
-
'order' => $order,
|
| 221 |
-
'vendor_id' => $vendor_id,
|
| 222 |
-
'vendor_items' => $vendor_items,
|
| 223 |
-
'sent_to_admin' => $sent_to_admin,
|
| 224 |
-
'sent_to_vendor' => $sent_to_vendor,
|
| 225 |
-
'totals_display' => $totals_display,
|
| 226 |
-
'plain_text' => $plain_text,
|
| 227 |
-
'email' => $email ),
|
| 228 |
-
'woocommerce', WCV_TEMPLATE_BASE );
|
| 229 |
-
|
| 230 |
-
} else {
|
| 231 |
-
|
| 232 |
-
wc_get_template( 'emails/vendor-order-details.php', array(
|
| 233 |
-
'order' => $order,
|
| 234 |
-
'vendor_id' => $vendor_id,
|
| 235 |
-
'vendor_items' => $vendor_items,
|
| 236 |
-
'sent_to_admin' => $sent_to_admin,
|
| 237 |
-
'sent_to_vendor' => $sent_to_vendor,
|
| 238 |
-
'totals_display' => $totals_display,
|
| 239 |
-
'plain_text' => $plain_text,
|
| 240 |
-
'email' => $email ),
|
| 241 |
-
'woocommerce', WCV_TEMPLATE_BASE );
|
| 242 |
-
}
|
| 243 |
-
}
|
| 244 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wc-approve-vendor.php
DELETED
|
@@ -1,165 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* New Order Email
|
| 7 |
-
*
|
| 8 |
-
* An email sent to the admin when a new order is received/paid for.
|
| 9 |
-
*
|
| 10 |
-
* @class WC_Email_Approve_Vendor
|
| 11 |
-
* @version 2.0.0
|
| 12 |
-
* @extends WC_Email
|
| 13 |
-
* @author WooThemes
|
| 14 |
-
* @package WooCommerce/Classes/Emails
|
| 15 |
-
*/
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
class WC_Email_Approve_Vendor extends WC_Email
|
| 19 |
-
{
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor
|
| 24 |
-
*/
|
| 25 |
-
function __construct()
|
| 26 |
-
{
|
| 27 |
-
$this->id = 'vendor_application';
|
| 28 |
-
$this->title = __( 'Vendor Application', 'wc-vendors' );
|
| 29 |
-
$this->description = __( 'Vendor application will either be approved, denied, or pending. <strong>This email has been depreciated.</strong>', 'wc-vendors' );
|
| 30 |
-
|
| 31 |
-
$this->heading = __( 'Application {status}', 'wc-vendors' );
|
| 32 |
-
$this->subject = __( '[{blogname}] Your vendor application has been {status}', 'wc-vendors' );
|
| 33 |
-
|
| 34 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
|
| 35 |
-
$this->template_html = 'application-status.php';
|
| 36 |
-
$this->template_plain = 'application-status.php';
|
| 37 |
-
|
| 38 |
-
// Call parent constuctor
|
| 39 |
-
parent::__construct();
|
| 40 |
-
|
| 41 |
-
// Other settings
|
| 42 |
-
$this->recipient = $this->get_option( 'recipient' );
|
| 43 |
-
|
| 44 |
-
if ( !$this->recipient )
|
| 45 |
-
$this->recipient = get_option( 'admin_email' );
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
/**
|
| 49 |
-
* trigger function.
|
| 50 |
-
*
|
| 51 |
-
* @access public
|
| 52 |
-
* @return void
|
| 53 |
-
*
|
| 54 |
-
* @param unknown $order_id
|
| 55 |
-
*/
|
| 56 |
-
function trigger( $user_id, $status )
|
| 57 |
-
{
|
| 58 |
-
if ( !$this->is_enabled() ) return;
|
| 59 |
-
|
| 60 |
-
$this->find[ ] = '{status}';
|
| 61 |
-
$this->replace[ ] = $status;
|
| 62 |
-
|
| 63 |
-
$this->status = $status;
|
| 64 |
-
|
| 65 |
-
$this->user = get_userdata( $user_id );
|
| 66 |
-
$user_email = $this->user->user_email;
|
| 67 |
-
|
| 68 |
-
$this->send( $user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 69 |
-
|
| 70 |
-
if ( $status == __( 'pending', 'wc-vendors' ) ) {
|
| 71 |
-
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 72 |
-
}
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
/**
|
| 76 |
-
* get_content_html function.
|
| 77 |
-
*
|
| 78 |
-
* @access public
|
| 79 |
-
* @return string
|
| 80 |
-
*/
|
| 81 |
-
function get_content_html()
|
| 82 |
-
{
|
| 83 |
-
ob_start();
|
| 84 |
-
wc_get_template( $this->template_html, array(
|
| 85 |
-
'status' => $this->status,
|
| 86 |
-
'user' => $this->user,
|
| 87 |
-
'email_heading' => $this->get_heading()
|
| 88 |
-
), 'woocommerce', $this->template_base );
|
| 89 |
-
|
| 90 |
-
return ob_get_clean();
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
/**
|
| 95 |
-
* get_content_plain function.
|
| 96 |
-
*
|
| 97 |
-
* @access public
|
| 98 |
-
* @return string
|
| 99 |
-
*/
|
| 100 |
-
function get_content_plain()
|
| 101 |
-
{
|
| 102 |
-
ob_start();
|
| 103 |
-
wc_get_template( $this->template_plain, array(
|
| 104 |
-
'status' => $this->status,
|
| 105 |
-
'user' => $this->user,
|
| 106 |
-
'email_heading' => $this->get_heading()
|
| 107 |
-
), 'woocommerce', $this->template_base );
|
| 108 |
-
|
| 109 |
-
return ob_get_clean();
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
/**
|
| 114 |
-
* Initialise Settings Form Fields
|
| 115 |
-
*
|
| 116 |
-
* @access public
|
| 117 |
-
* @return void
|
| 118 |
-
*/
|
| 119 |
-
function init_form_fields()
|
| 120 |
-
{
|
| 121 |
-
$this->form_fields = array(
|
| 122 |
-
'enabled' => array(
|
| 123 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 124 |
-
'type' => 'checkbox',
|
| 125 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 126 |
-
'default' => 'no'
|
| 127 |
-
),
|
| 128 |
-
'recipient' => array(
|
| 129 |
-
'title' => __( 'Recipient(s)', 'woocommerce' ),
|
| 130 |
-
'type' => 'text',
|
| 131 |
-
'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to <code>%s</code>.', 'wc-vendors' ), esc_attr( get_option( 'admin_email' ) ) ),
|
| 132 |
-
'placeholder' => '',
|
| 133 |
-
'default' => ''
|
| 134 |
-
),
|
| 135 |
-
'subject' => array(
|
| 136 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 137 |
-
'type' => 'text',
|
| 138 |
-
'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wc-vendors' ), $this->subject ),
|
| 139 |
-
'placeholder' => '',
|
| 140 |
-
'default' => ''
|
| 141 |
-
),
|
| 142 |
-
'heading' => array(
|
| 143 |
-
'title' => __( 'Email Heading', 'wc-vendors' ),
|
| 144 |
-
'type' => 'text',
|
| 145 |
-
'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wc-vendors' ), $this->heading ),
|
| 146 |
-
'placeholder' => '',
|
| 147 |
-
'default' => ''
|
| 148 |
-
),
|
| 149 |
-
'email_type' => array(
|
| 150 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 151 |
-
'type' => 'select',
|
| 152 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 153 |
-
'default' => 'html',
|
| 154 |
-
'class' => 'email_type',
|
| 155 |
-
'options' => array(
|
| 156 |
-
'plain' => __( 'Plain text', 'wc-vendors' ),
|
| 157 |
-
'html' => __( 'HTML', 'wc-vendors' ),
|
| 158 |
-
'multipart' => __( 'Multipart', 'wc-vendors' ),
|
| 159 |
-
)
|
| 160 |
-
)
|
| 161 |
-
);
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
|
| 165 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wc-notify-admin.php
DELETED
|
@@ -1,176 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* New Order Email
|
| 7 |
-
*
|
| 8 |
-
* An email sent to the admin when a new product is created.
|
| 9 |
-
*
|
| 10 |
-
* @class WC_Email_Notify_Admin
|
| 11 |
-
* @version 2.0.0
|
| 12 |
-
* @extends WC_Email
|
| 13 |
-
* @author WooThemes
|
| 14 |
-
* @package WooCommerce/Classes/Emails
|
| 15 |
-
*/
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
class WC_Email_Notify_Admin extends WC_Email
|
| 19 |
-
{
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor
|
| 24 |
-
*/
|
| 25 |
-
function __construct()
|
| 26 |
-
{
|
| 27 |
-
$this->id = 'admin_new_vendor_product';
|
| 28 |
-
$this->title = __( 'New Vendor Product', 'wc-vendors' );
|
| 29 |
-
$this->description = __( 'New order emails are sent when a new product is submitted by a vendor. <strong>This email has been depreciated.</strong>', 'wc-vendors' );
|
| 30 |
-
|
| 31 |
-
$this->heading = __( 'New product submitted: {product_name}', 'wc-vendors' );
|
| 32 |
-
$this->subject = __( '[{blogname}] New product submitted by {vendor_name} - {product_name}', 'wc-vendors' );
|
| 33 |
-
|
| 34 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
|
| 35 |
-
$this->template_html = 'new-product.php';
|
| 36 |
-
$this->template_plain = 'new-product.php';
|
| 37 |
-
|
| 38 |
-
// Triggers for this email
|
| 39 |
-
add_action( 'pending_product', array( $this, 'trigger' ), 10, 2 );
|
| 40 |
-
add_action( 'pending_product_variation', array( $this, 'trigger' ), 10, 2 );
|
| 41 |
-
|
| 42 |
-
// Call parent constuctor
|
| 43 |
-
parent::__construct();
|
| 44 |
-
|
| 45 |
-
// Other settings
|
| 46 |
-
$this->recipient = $this->get_option( 'recipient' );
|
| 47 |
-
|
| 48 |
-
if ( !$this->recipient )
|
| 49 |
-
$this->recipient = get_option( 'admin_email' );
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
/**
|
| 54 |
-
* trigger function.
|
| 55 |
-
*
|
| 56 |
-
* @access public
|
| 57 |
-
* @return void
|
| 58 |
-
*
|
| 59 |
-
* @param unknown $order_id
|
| 60 |
-
*/
|
| 61 |
-
function trigger( $id, $post )
|
| 62 |
-
{
|
| 63 |
-
|
| 64 |
-
// Ensure that the post author is a vendor
|
| 65 |
-
if ( !WCV_Vendors::is_vendor( $post->post_author ) ) {
|
| 66 |
-
return;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
if ( !$this->is_enabled() ) return;
|
| 70 |
-
|
| 71 |
-
$this->find[ ] = '{product_name}';
|
| 72 |
-
$this->product_name = $post->post_title;
|
| 73 |
-
$this->replace[ ] = $this->product_name;
|
| 74 |
-
|
| 75 |
-
$this->find[ ] = '{vendor_name}';
|
| 76 |
-
$this->vendor_name = WCV_Vendors::get_vendor_shop_name( $post->post_author );
|
| 77 |
-
$this->replace[ ] = $this->vendor_name;
|
| 78 |
-
|
| 79 |
-
$this->post_id = $post->ID;
|
| 80 |
-
|
| 81 |
-
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
/**
|
| 85 |
-
* get_content_html function.
|
| 86 |
-
*
|
| 87 |
-
* @access public
|
| 88 |
-
* @return string
|
| 89 |
-
*/
|
| 90 |
-
function get_content_html()
|
| 91 |
-
{
|
| 92 |
-
ob_start();
|
| 93 |
-
wc_get_template( $this->template_html, array(
|
| 94 |
-
'product_name' => $this->product_name,
|
| 95 |
-
'vendor_name' => $this->vendor_name,
|
| 96 |
-
'post_id' => $this->post_id,
|
| 97 |
-
'email_heading' => $this->get_heading()
|
| 98 |
-
), 'woocommerce', $this->template_base );
|
| 99 |
-
|
| 100 |
-
return ob_get_clean();
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
/**
|
| 105 |
-
* get_content_plain function.
|
| 106 |
-
*
|
| 107 |
-
* @access public
|
| 108 |
-
* @return string
|
| 109 |
-
*/
|
| 110 |
-
function get_content_plain()
|
| 111 |
-
{
|
| 112 |
-
ob_start();
|
| 113 |
-
wc_get_template( $this->template_plain, array(
|
| 114 |
-
'product_name' => $this->product_name,
|
| 115 |
-
'vendor_name' => $this->vendor_name,
|
| 116 |
-
'post_id' => $this->post_id,
|
| 117 |
-
'email_heading' => $this->get_heading()
|
| 118 |
-
), 'woocommerce', $this->template_base );
|
| 119 |
-
|
| 120 |
-
return ob_get_clean();
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
|
| 124 |
-
/**
|
| 125 |
-
* Initialise Settings Form Fields
|
| 126 |
-
*
|
| 127 |
-
* @access public
|
| 128 |
-
* @return void
|
| 129 |
-
*/
|
| 130 |
-
function init_form_fields()
|
| 131 |
-
{
|
| 132 |
-
$this->form_fields = array(
|
| 133 |
-
'enabled' => array(
|
| 134 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 135 |
-
'type' => 'checkbox',
|
| 136 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 137 |
-
'default' => 'no'
|
| 138 |
-
),
|
| 139 |
-
'recipient' => array(
|
| 140 |
-
'title' => __( 'Recipient(s)', 'woocommerce' ),
|
| 141 |
-
'type' => 'text',
|
| 142 |
-
'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to <code>%s</code>.', 'wc-vendors' ), esc_attr( get_option( 'admin_email' ) ) ),
|
| 143 |
-
'placeholder' => '',
|
| 144 |
-
'default' => ''
|
| 145 |
-
),
|
| 146 |
-
'subject' => array(
|
| 147 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 148 |
-
'type' => 'text',
|
| 149 |
-
'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wc-vendors' ), $this->subject ),
|
| 150 |
-
'placeholder' => '',
|
| 151 |
-
'default' => ''
|
| 152 |
-
),
|
| 153 |
-
'heading' => array(
|
| 154 |
-
'title' => __( 'Email Heading', 'wc-vendors' ),
|
| 155 |
-
'type' => 'text',
|
| 156 |
-
'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wc-vendors' ), $this->heading ),
|
| 157 |
-
'placeholder' => '',
|
| 158 |
-
'default' => ''
|
| 159 |
-
),
|
| 160 |
-
'email_type' => array(
|
| 161 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 162 |
-
'type' => 'select',
|
| 163 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 164 |
-
'default' => 'html',
|
| 165 |
-
'class' => 'email_type',
|
| 166 |
-
'options' => array(
|
| 167 |
-
'plain' => __( 'Plain text', 'wc-vendors' ),
|
| 168 |
-
'html' => __( 'HTML', 'wc-vendors' ),
|
| 169 |
-
'multipart' => __( 'Multipart', 'wc-vendors' ),
|
| 170 |
-
)
|
| 171 |
-
)
|
| 172 |
-
);
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wc-notify-shipped.php
DELETED
|
@@ -1,201 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* New Order Email
|
| 7 |
-
*
|
| 8 |
-
* An email sent to the admin when a new product is created.
|
| 9 |
-
*
|
| 10 |
-
* @class WC_Email_Notify_Shipped
|
| 11 |
-
* @version 2.0.0
|
| 12 |
-
* @extends WC_Email
|
| 13 |
-
* @author WooThemes
|
| 14 |
-
* @package WooCommerce/Classes/Emails
|
| 15 |
-
*/
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
class WC_Email_Notify_Shipped extends WC_Email
|
| 19 |
-
{
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor
|
| 24 |
-
*/
|
| 25 |
-
function __construct()
|
| 26 |
-
{
|
| 27 |
-
$this->id = 'vendor_notify_shipped';
|
| 28 |
-
$this->title = __( 'Vendor has shipped', 'wc-vendors' );
|
| 29 |
-
$this->description = __( 'An email is sent when a vendor has marked one of their orders as shipped. <strong>This email has been depreciated.</strong>', 'wc-vendors' );
|
| 30 |
-
|
| 31 |
-
$this->heading = __( 'Your order has been shipped', 'wc-vendors' );
|
| 32 |
-
$this->subject = __( '[{blogname}] Your order has been shipped ({order_number}) - {order_date}', 'wc-vendors' );
|
| 33 |
-
|
| 34 |
-
$this->template_html = 'notify-vendor-shipped.php';
|
| 35 |
-
$this->template_plain = 'notify-vendor-shipped.php';
|
| 36 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
|
| 37 |
-
|
| 38 |
-
// Call parent constuctor
|
| 39 |
-
parent::__construct();
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
/**
|
| 44 |
-
* trigger function.
|
| 45 |
-
*
|
| 46 |
-
* @access public
|
| 47 |
-
* @return void
|
| 48 |
-
*
|
| 49 |
-
* @param unknown $order_id
|
| 50 |
-
*/
|
| 51 |
-
function trigger( $order_id, $vendor_id )
|
| 52 |
-
{
|
| 53 |
-
$this->object = wc_get_order( $order_id );
|
| 54 |
-
$this->current_vendor = $vendor_id;
|
| 55 |
-
$order_date = $this->object->get_date_created();
|
| 56 |
-
|
| 57 |
-
$this->find[ ] = '{order_date}';
|
| 58 |
-
$this->replace[ ] = date_i18n( wc_date_format(), strtotime( $order_date ) );
|
| 59 |
-
|
| 60 |
-
$this->find[ ] = '{order_number}';
|
| 61 |
-
$this->replace[ ] = $this->object->get_order_number();
|
| 62 |
-
|
| 63 |
-
$billing_email = $this->object->get_billing_email();
|
| 64 |
-
|
| 65 |
-
if ( !$this->is_enabled() ) return;
|
| 66 |
-
|
| 67 |
-
add_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
|
| 68 |
-
add_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
|
| 69 |
-
$this->send( $billing_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 70 |
-
remove_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
|
| 71 |
-
remove_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
/**
|
| 76 |
-
*
|
| 77 |
-
*
|
| 78 |
-
* @param unknown $items
|
| 79 |
-
* @param unknown $order
|
| 80 |
-
*
|
| 81 |
-
* @return unknown
|
| 82 |
-
*/
|
| 83 |
-
public function check_items( $items, $order )
|
| 84 |
-
{
|
| 85 |
-
foreach ( $items as $key => $product ) {
|
| 86 |
-
|
| 87 |
-
if ( empty( $product[ 'product_id' ] ) ) {
|
| 88 |
-
unset( $items[ $key ] );
|
| 89 |
-
continue;
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
$author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
|
| 93 |
-
|
| 94 |
-
if ( $this->current_vendor != $author ) {
|
| 95 |
-
unset( $items[ $key ] );
|
| 96 |
-
continue;
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
return $items;
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
/**
|
| 105 |
-
*
|
| 106 |
-
*
|
| 107 |
-
* @param unknown $total_rows
|
| 108 |
-
* @param unknown $order
|
| 109 |
-
*
|
| 110 |
-
* @return unknown
|
| 111 |
-
*/
|
| 112 |
-
public function check_order_totals( $total_rows, $order )
|
| 113 |
-
{
|
| 114 |
-
$return[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
|
| 115 |
-
$return[ 'cart_subtotal' ][ 'label' ] = __( 'Subtotal:', 'wc-vendors' );
|
| 116 |
-
|
| 117 |
-
return $return;
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
/**
|
| 121 |
-
* get_content_html function.
|
| 122 |
-
*
|
| 123 |
-
* @access public
|
| 124 |
-
* @return string
|
| 125 |
-
*/
|
| 126 |
-
function get_content_html()
|
| 127 |
-
{
|
| 128 |
-
ob_start();
|
| 129 |
-
wc_get_template( $this->template_html, array(
|
| 130 |
-
'order' => $this->object,
|
| 131 |
-
'email_heading' => $this->get_heading()
|
| 132 |
-
), 'woocommerce/emails', $this->template_base );
|
| 133 |
-
|
| 134 |
-
return ob_get_clean();
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
/**
|
| 139 |
-
* get_content_plain function.
|
| 140 |
-
*
|
| 141 |
-
* @access public
|
| 142 |
-
* @return string
|
| 143 |
-
*/
|
| 144 |
-
function get_content_plain()
|
| 145 |
-
{
|
| 146 |
-
ob_start();
|
| 147 |
-
wc_get_template( $this->template_plain, array(
|
| 148 |
-
'order' => $this->object,
|
| 149 |
-
'email_heading' => $this->get_heading()
|
| 150 |
-
), 'woocommerce/emails', $this->template_base );
|
| 151 |
-
|
| 152 |
-
return ob_get_clean();
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
|
| 156 |
-
/**
|
| 157 |
-
* Initialise Settings Form Fields
|
| 158 |
-
*
|
| 159 |
-
* @access public
|
| 160 |
-
* @return void
|
| 161 |
-
*/
|
| 162 |
-
function init_form_fields()
|
| 163 |
-
{
|
| 164 |
-
$this->form_fields = array(
|
| 165 |
-
'enabled' => array(
|
| 166 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 167 |
-
'type' => 'checkbox',
|
| 168 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 169 |
-
'default' => 'no'
|
| 170 |
-
),
|
| 171 |
-
'subject' => array(
|
| 172 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 173 |
-
'type' => 'text',
|
| 174 |
-
'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wc-vendors' ), $this->subject ),
|
| 175 |
-
'placeholder' => '',
|
| 176 |
-
'default' => ''
|
| 177 |
-
),
|
| 178 |
-
'heading' => array(
|
| 179 |
-
'title' => __( 'Email Heading', 'wc-vendors' ),
|
| 180 |
-
'type' => 'text',
|
| 181 |
-
'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wc-vendors' ), $this->heading ),
|
| 182 |
-
'placeholder' => '',
|
| 183 |
-
'default' => ''
|
| 184 |
-
),
|
| 185 |
-
'email_type' => array(
|
| 186 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 187 |
-
'type' => 'select',
|
| 188 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 189 |
-
'default' => 'html',
|
| 190 |
-
'class' => 'email_type',
|
| 191 |
-
'options' => array(
|
| 192 |
-
'plain' => __( 'Plain text', 'wc-vendors' ),
|
| 193 |
-
'html' => __( 'HTML', 'wc-vendors' ),
|
| 194 |
-
'multipart' => __( 'Multipart', 'wc-vendors' ),
|
| 195 |
-
)
|
| 196 |
-
)
|
| 197 |
-
);
|
| 198 |
-
}
|
| 199 |
-
|
| 200 |
-
|
| 201 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wc-notify-vendor.php
DELETED
|
@@ -1,355 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* New Order Email
|
| 7 |
-
*
|
| 8 |
-
* An email sent to the vendor when a new order is received/paid for.
|
| 9 |
-
*
|
| 10 |
-
* @class WC_Email_Notify_Vendor
|
| 11 |
-
* @version 2.0.0
|
| 12 |
-
* @extends WC_Email
|
| 13 |
-
* @author WooThemes
|
| 14 |
-
* @package WooCommerce/Classes/Emails
|
| 15 |
-
*/
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
class WC_Email_Notify_Vendor extends WC_Email
|
| 19 |
-
{
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* Constructor
|
| 23 |
-
*/
|
| 24 |
-
function __construct()
|
| 25 |
-
{
|
| 26 |
-
$this->id = 'vendor_new_order';
|
| 27 |
-
$this->title = __( 'Notify vendors', 'wc-vendors' );
|
| 28 |
-
$this->description = __( 'New order emails are sent when an order is received/paid by a customer. <strong>This email has been depreciated.</strong>', 'wc-vendors' );
|
| 29 |
-
|
| 30 |
-
$this->heading = __( 'New customer order', 'wc-vendors' );
|
| 31 |
-
$this->subject = __( '[{blogname}] New customer order ({order_number}) - {order_date}', 'wc-vendors' );
|
| 32 |
-
|
| 33 |
-
$this->template_html = 'vendor-new-order.php';
|
| 34 |
-
$this->template_plain = 'vendor-new-order.php';
|
| 35 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
|
| 36 |
-
|
| 37 |
-
// Triggers for this email
|
| 38 |
-
add_action( 'woocommerce_order_status_pending_to_processing_notification', array( $this, 'trigger' ) );
|
| 39 |
-
add_action( 'woocommerce_order_status_pending_to_completed_notification', array( $this, 'trigger' ) );
|
| 40 |
-
add_action( 'woocommerce_order_status_failed_to_processing_notification', array( $this, 'trigger' ) );
|
| 41 |
-
add_action( 'woocommerce_order_status_failed_to_completed_notification', array( $this, 'trigger' ) );
|
| 42 |
-
add_action( 'woocommerce_order_status_on-hold_to_processing_notification', array( $this, 'trigger' ) ); // Added in 1.8.4
|
| 43 |
-
add_action( 'woocommerce_order_status_on-hold_to_completed_notification', array( $this, 'trigger' ) ); // Added in 1.8.4
|
| 44 |
-
|
| 45 |
-
// Call parent constuctor
|
| 46 |
-
parent::__construct();
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* trigger function.
|
| 52 |
-
*
|
| 53 |
-
* @access public
|
| 54 |
-
* @return void
|
| 55 |
-
*
|
| 56 |
-
* @param unknown $order_id
|
| 57 |
-
*/
|
| 58 |
-
function trigger( $order_id )
|
| 59 |
-
{
|
| 60 |
-
global $woocommerce;
|
| 61 |
-
|
| 62 |
-
if ( $order_id ) {
|
| 63 |
-
$this->object = wc_get_order( $order_id );
|
| 64 |
-
|
| 65 |
-
$order_date = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $this->object->order_date : $this->object->get_date_created();
|
| 66 |
-
|
| 67 |
-
$this->find[ ] = '{order_date}';
|
| 68 |
-
$this->replace[ ] = date_i18n( wc_date_format(), strtotime( $order_date ) );
|
| 69 |
-
|
| 70 |
-
$this->find[ ] = '{order_number}';
|
| 71 |
-
$this->replace[ ] = $this->object->get_order_number();
|
| 72 |
-
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
if ( !$this->is_enabled() ) return;
|
| 76 |
-
|
| 77 |
-
$vendors = $this->get_vendors( $this->object );
|
| 78 |
-
|
| 79 |
-
if ( empty( $vendors ) ) return;
|
| 80 |
-
|
| 81 |
-
add_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
|
| 82 |
-
add_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
|
| 83 |
-
add_filter( 'woocommerce_order_formatted_line_subtotal', array( $this, 'check_order_formatted_line_subtotal' ), 10, 3 );
|
| 84 |
-
add_filter( 'woocommerce_order_subtotal_to_display', array( $this, 'check_order_subtotal_to_display'), 10, 3 );
|
| 85 |
-
foreach ( $vendors as $user_id => $user_email ) {
|
| 86 |
-
$this->current_vendor = $user_id;
|
| 87 |
-
$this->send( $user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 88 |
-
}
|
| 89 |
-
remove_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
|
| 90 |
-
remove_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
|
| 91 |
-
remove_filter( 'woocommerce_order_formatted_line_subtotal', array( $this, 'check_order_formatted_line_subtotal' ), 10, 3 );
|
| 92 |
-
remove_filter( 'woocommerce_order_subtotal_to_display', array( $this, 'check_order_subtotal_to_display'), 10, 3 );
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
/**
|
| 97 |
-
*
|
| 98 |
-
*
|
| 99 |
-
* @param unknown $total_rows
|
| 100 |
-
* @param unknown $order
|
| 101 |
-
*
|
| 102 |
-
* @return unknown
|
| 103 |
-
*/
|
| 104 |
-
function check_order_totals( $total_rows, $order )
|
| 105 |
-
{
|
| 106 |
-
|
| 107 |
-
$commission_label = apply_filters('wcv_notify_vendor_commission_label', __( 'Commission Subtotal:', 'wc-vendors' ) ) ;
|
| 108 |
-
$return[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
|
| 109 |
-
$return[ 'cart_subtotal' ][ 'label' ] = $commission_label;
|
| 110 |
-
|
| 111 |
-
if ( 'yes' === get_option( 'wcvendors_vendor_give_taxes', 'no' ) ) {
|
| 112 |
-
$return[ 'tax_subtotal'] = array( 'label' => '', 'value' => '');
|
| 113 |
-
$return[ 'tax_subtotal']['label'] = apply_filters('wcv_notify_vendor_tax_label', __( 'Tax Subtotal:', 'wc-vendors' ) ) ;
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
$dues = WCV_Vendors::get_vendor_dues_from_order( $order );
|
| 117 |
-
|
| 118 |
-
foreach ( $dues as $due ) {
|
| 119 |
-
if ( $this->current_vendor == $due['vendor_id'] ) {
|
| 120 |
-
if (!empty($return[ 'shipping' ])) $return[ 'shipping' ] = $total_rows[ 'shipping' ];
|
| 121 |
-
$return[ 'shipping' ]['label'] = __( 'Shipping Subtotal:', 'wc-vendors' );
|
| 122 |
-
$return[ 'shipping' ][ 'value' ] = wc_price( $due['shipping'] );
|
| 123 |
-
if ( get_option( 'wcvendors_vendor_give_taxes' ) ) {
|
| 124 |
-
$return[ 'tax_subtotal']['value'] += (float) $due['tax'];
|
| 125 |
-
}
|
| 126 |
-
break;
|
| 127 |
-
}
|
| 128 |
-
}
|
| 129 |
-
// Format tax price
|
| 130 |
-
if ( 'yes' === get_option( 'wcvendors_vendor_give_taxes', 'no' ) ) {
|
| 131 |
-
$return[ 'tax_subtotal']['value'] = wc_price( $return[ 'tax_subtotal'] ['value'] );
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
return $return;
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
/**
|
| 139 |
-
*
|
| 140 |
-
*
|
| 141 |
-
* @param unknown $order
|
| 142 |
-
*
|
| 143 |
-
* @return unknown
|
| 144 |
-
*/
|
| 145 |
-
public function get_vendors( $order )
|
| 146 |
-
{
|
| 147 |
-
$items = $order->get_items();
|
| 148 |
-
$vendors = array();
|
| 149 |
-
|
| 150 |
-
foreach ( $items as $key => $product ) {
|
| 151 |
-
|
| 152 |
-
if ( empty( $product[ 'product_id' ] ) ) continue;
|
| 153 |
-
$author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
|
| 154 |
-
|
| 155 |
-
// Only store the vendor authors
|
| 156 |
-
if ( !WCV_Vendors::is_vendor( $author ) ) {
|
| 157 |
-
unset( $items[ $key ] );
|
| 158 |
-
continue;
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
$vendors[ $author ] = get_userdata( $author )->user_email;
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
return $vendors;
|
| 165 |
-
}
|
| 166 |
-
|
| 167 |
-
/**
|
| 168 |
-
*
|
| 169 |
-
*
|
| 170 |
-
* @param unknown $items
|
| 171 |
-
* @param unknown $order
|
| 172 |
-
*
|
| 173 |
-
* @return unknown
|
| 174 |
-
*/
|
| 175 |
-
function check_items( $items, $order )
|
| 176 |
-
{
|
| 177 |
-
|
| 178 |
-
$settings = get_option( 'woocommerce_vendor_new_order_settings' );
|
| 179 |
-
|
| 180 |
-
if ( empty( $settings ) ) $settings = $this->get_default_settings();
|
| 181 |
-
|
| 182 |
-
foreach ( $items as $key => $product ) {
|
| 183 |
-
|
| 184 |
-
// If this is a line item
|
| 185 |
-
if ( $product['type'] == 'line_item' ) {
|
| 186 |
-
|
| 187 |
-
$author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
|
| 188 |
-
|
| 189 |
-
if ( $this->current_vendor != $author) {
|
| 190 |
-
unset( $items[ $key ] );
|
| 191 |
-
continue;
|
| 192 |
-
} else {
|
| 193 |
-
|
| 194 |
-
// If display commission is ticked show this otherwise show the full price.
|
| 195 |
-
if ( 'yes' == $settings[ 'commission_display' ] ){
|
| 196 |
-
|
| 197 |
-
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 198 |
-
|
| 199 |
-
// Get correct product_id depending on which product type
|
| 200 |
-
$product_id = !empty( $product['variation_id'] ) ? $product['variation_id'] : $product['product_id'];
|
| 201 |
-
|
| 202 |
-
$commission_due = WCV_Commission::get_commission_due( $order_id, $product_id, $author );
|
| 203 |
-
|
| 204 |
-
$items[ $key ][ 'line_subtotal' ] = $commission_due;
|
| 205 |
-
$items[ $key ][ 'line_total' ] = $commission_due;
|
| 206 |
-
|
| 207 |
-
// Don't display tax if give tax is not enabled.
|
| 208 |
-
if ( !get_option( 'wcvendors_vendor_give_taxes' ) ) {
|
| 209 |
-
unset($items[ $key ][ 'line_tax' ]) ;
|
| 210 |
-
}
|
| 211 |
-
}
|
| 212 |
-
}
|
| 213 |
-
}
|
| 214 |
-
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
return $items;
|
| 218 |
-
|
| 219 |
-
} // check_items()
|
| 220 |
-
|
| 221 |
-
|
| 222 |
-
/**
|
| 223 |
-
* get_content_html function.
|
| 224 |
-
*
|
| 225 |
-
* @access public
|
| 226 |
-
* @return string
|
| 227 |
-
*/
|
| 228 |
-
function get_content_html()
|
| 229 |
-
{
|
| 230 |
-
ob_start();
|
| 231 |
-
wc_get_template( $this->template_html, array(
|
| 232 |
-
'order' => $this->object,
|
| 233 |
-
'email_heading' => $this->get_heading()
|
| 234 |
-
), 'woocommerce', $this->template_base );
|
| 235 |
-
|
| 236 |
-
return ob_get_clean();
|
| 237 |
-
}
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
/**
|
| 241 |
-
* get_content_plain function.
|
| 242 |
-
*
|
| 243 |
-
* @access public
|
| 244 |
-
* @return string
|
| 245 |
-
*/
|
| 246 |
-
function get_content_plain()
|
| 247 |
-
{
|
| 248 |
-
ob_start();
|
| 249 |
-
wc_get_template( $this->template_plain, array(
|
| 250 |
-
'order' => $this->object,
|
| 251 |
-
'email_heading' => $this->get_heading()
|
| 252 |
-
), 'woocommerce', $this->template_base );
|
| 253 |
-
|
| 254 |
-
return ob_get_clean();
|
| 255 |
-
}
|
| 256 |
-
|
| 257 |
-
|
| 258 |
-
/**
|
| 259 |
-
* Initialise Settings Form Fields
|
| 260 |
-
*
|
| 261 |
-
* @access public
|
| 262 |
-
* @return void
|
| 263 |
-
*/
|
| 264 |
-
function init_form_fields()
|
| 265 |
-
{
|
| 266 |
-
$this->form_fields = array(
|
| 267 |
-
'enabled' => array(
|
| 268 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 269 |
-
'type' => 'checkbox',
|
| 270 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 271 |
-
'default' => 'no'
|
| 272 |
-
),
|
| 273 |
-
'subject' => array(
|
| 274 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 275 |
-
'type' => 'text',
|
| 276 |
-
'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wc-vendors' ), $this->subject ),
|
| 277 |
-
'placeholder' => '',
|
| 278 |
-
'default' => ''
|
| 279 |
-
),
|
| 280 |
-
'heading' => array(
|
| 281 |
-
'title' => __( 'Email Heading', 'wc-vendors' ),
|
| 282 |
-
'type' => 'text',
|
| 283 |
-
'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wc-vendors' ), $this->heading ),
|
| 284 |
-
'placeholder' => '',
|
| 285 |
-
'default' => ''
|
| 286 |
-
),
|
| 287 |
-
'commission_display' => array(
|
| 288 |
-
'title' => __( 'Product Totals', 'wc-vendors' ),
|
| 289 |
-
'type' => 'checkbox',
|
| 290 |
-
'label' => __( 'Show the commission due/paid as the product totals instead of the product prices.', 'wc-vendors' ),
|
| 291 |
-
'default' => 'yes'
|
| 292 |
-
),
|
| 293 |
-
'email_type' => array(
|
| 294 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 295 |
-
'type' => 'select',
|
| 296 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 297 |
-
'default' => 'html',
|
| 298 |
-
'class' => 'email_type',
|
| 299 |
-
'options' => array(
|
| 300 |
-
'plain' => __( 'Plain text', 'wc-vendors' ),
|
| 301 |
-
'html' => __( 'HTML', 'wc-vendors' ),
|
| 302 |
-
'multipart' => __( 'Multipart', 'wc-vendors' ),
|
| 303 |
-
)
|
| 304 |
-
)
|
| 305 |
-
);
|
| 306 |
-
}
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
/**
|
| 310 |
-
* check the order line item sub total to ensure that the tax is shown correctly on the vendor emails
|
| 311 |
-
*/
|
| 312 |
-
function check_order_formatted_line_subtotal( $subtotal, $item, $order ){
|
| 313 |
-
|
| 314 |
-
$order_currency = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->get_order_currency() : $order->get_currency();
|
| 315 |
-
|
| 316 |
-
$subtotal = wc_price( $order->get_line_subtotal( $item ), array( 'currency' => $order_currency ) );
|
| 317 |
-
|
| 318 |
-
return $subtotal;
|
| 319 |
-
|
| 320 |
-
} // check_order_formatted_line_subtotal()
|
| 321 |
-
|
| 322 |
-
|
| 323 |
-
function check_order_subtotal_to_display( $subtotal, $compound, $order ){
|
| 324 |
-
|
| 325 |
-
$new_subtotal = 0;
|
| 326 |
-
|
| 327 |
-
foreach ( $order->get_items() as $key => $product ) {
|
| 328 |
-
$new_subtotal += $product[ 'line_subtotal' ];
|
| 329 |
-
}
|
| 330 |
-
|
| 331 |
-
return wc_price( $new_subtotal );
|
| 332 |
-
|
| 333 |
-
|
| 334 |
-
} // check_order_subtotal_to_display()
|
| 335 |
-
|
| 336 |
-
/**
|
| 337 |
-
* Get the default settings for this email if not already set.
|
| 338 |
-
*
|
| 339 |
-
* @since 1.9.9
|
| 340 |
-
*
|
| 341 |
-
*/
|
| 342 |
-
public function get_default_settings(){
|
| 343 |
-
|
| 344 |
-
$settings = array();
|
| 345 |
-
|
| 346 |
-
foreach ( $this->form_fields as $key => $field ) {
|
| 347 |
-
$settings[ $key ] = $field[ 'default' ];
|
| 348 |
-
}
|
| 349 |
-
|
| 350 |
-
return $settings;
|
| 351 |
-
|
| 352 |
-
} // get_default_settings()
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wcv-admin-notify-application.php
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 4 |
-
exit;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
if ( ! class_exists( 'WCVendors_Admin_Notify_Application' ) ) :
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Notify Admin Shipped
|
| 11 |
-
*
|
| 12 |
-
* An email sent to the admin when the vendor marks the order shipped.
|
| 13 |
-
*
|
| 14 |
-
* @class WCVendors_Admin_Notify_Shipped
|
| 15 |
-
* @version 2.0.0
|
| 16 |
-
* @package Classes/Admin/Emails
|
| 17 |
-
* @author WC Vendors
|
| 18 |
-
* @extends WC_Email
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Admin_Notify_Application extends WC_Email {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
$this->id = 'admin_notify_application';
|
| 27 |
-
$this->title = sprintf( __( 'Admin notify %s application', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 28 |
-
$this->description = sprintf( __( 'Notification is sent to chosen recipient(s) when a user applies to be a %s', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 29 |
-
$this->template_html = 'emails/admin-notify-application.php';
|
| 30 |
-
$this->template_plain = 'emails/plain/admin-notify-application.php';
|
| 31 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 32 |
-
$this->placeholders = array(
|
| 33 |
-
'{site_title}' => $this->get_blogname(),
|
| 34 |
-
'{user_name}' => '',
|
| 35 |
-
);
|
| 36 |
-
|
| 37 |
-
// Call parent constructor
|
| 38 |
-
parent::__construct();
|
| 39 |
-
|
| 40 |
-
// Other settings
|
| 41 |
-
$this->recipient = $this->get_option( 'recipient', get_option( 'admin_email' ) );
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
/**
|
| 45 |
-
* Get email subject.
|
| 46 |
-
*
|
| 47 |
-
* @since 2.0.0
|
| 48 |
-
* @return string
|
| 49 |
-
*/
|
| 50 |
-
public function get_default_subject() {
|
| 51 |
-
return sprintf( __( '[{site_title}] {user_name} has applied to be a %s', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
/**
|
| 55 |
-
* Get email heading.
|
| 56 |
-
*
|
| 57 |
-
* @since 2.0.0
|
| 58 |
-
* @return string
|
| 59 |
-
*/
|
| 60 |
-
public function get_default_heading() {
|
| 61 |
-
return sprintf( __( '%s application received', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
/**
|
| 65 |
-
* Trigger the sending of this email.
|
| 66 |
-
*
|
| 67 |
-
* @param int $order_id The order ID.
|
| 68 |
-
* @param WC_Order $order Order object.
|
| 69 |
-
*/
|
| 70 |
-
public function trigger( $vendor_id, $status ) {
|
| 71 |
-
|
| 72 |
-
$this->setup_locale();
|
| 73 |
-
|
| 74 |
-
$this->user = get_userdata( $vendor_id );
|
| 75 |
-
$this->status = $status;
|
| 76 |
-
|
| 77 |
-
if ( $this->is_enabled() && $this->get_recipient() && $status === $this->get_option( 'notification' ) ) {
|
| 78 |
-
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
$this->restore_locale();
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
/**
|
| 85 |
-
* Get content html.
|
| 86 |
-
*
|
| 87 |
-
* @access public
|
| 88 |
-
* @return string
|
| 89 |
-
*/
|
| 90 |
-
public function get_content_html() {
|
| 91 |
-
|
| 92 |
-
return wc_get_template_html( $this->template_html, array(
|
| 93 |
-
'order' => $this->object,
|
| 94 |
-
'email_heading' => $this->get_heading(),
|
| 95 |
-
'sent_to_admin' => true,
|
| 96 |
-
'plain_text' => false,
|
| 97 |
-
'email' => $this,
|
| 98 |
-
'user' => $this->user,
|
| 99 |
-
'status' => $this->status,
|
| 100 |
-
), 'woocommerce', $this->template_base );
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
/**
|
| 104 |
-
* Get content plain.
|
| 105 |
-
*
|
| 106 |
-
* @access public
|
| 107 |
-
* @return string
|
| 108 |
-
*/
|
| 109 |
-
public function get_content_plain() {
|
| 110 |
-
return wc_get_template_html( $this->template_plain, array(
|
| 111 |
-
'order' => $this->object,
|
| 112 |
-
'email_heading' => $this->get_heading(),
|
| 113 |
-
'sent_to_admin' => true,
|
| 114 |
-
'plain_text' => true,
|
| 115 |
-
'email' => $this,
|
| 116 |
-
'user' => $this->user,
|
| 117 |
-
'status' => $this->status,
|
| 118 |
-
), 'woocommerce', $this->template_base );
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
/**
|
| 122 |
-
* Initialise settings form fields.
|
| 123 |
-
*/
|
| 124 |
-
public function init_form_fields() {
|
| 125 |
-
$this->form_fields = array(
|
| 126 |
-
'enabled' => array(
|
| 127 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 128 |
-
'type' => 'checkbox',
|
| 129 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 130 |
-
'default' => 'no',
|
| 131 |
-
),
|
| 132 |
-
'recipient' => array(
|
| 133 |
-
'title' => __( 'Recipient(s)', 'wc-vendors' ),
|
| 134 |
-
'type' => 'text',
|
| 135 |
-
'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to %s.', 'wc-vendors' ), '<code>' . esc_attr( get_option( 'admin_email' ) ) . '</code>' ),
|
| 136 |
-
'placeholder' => '',
|
| 137 |
-
'default' => '',
|
| 138 |
-
'desc_tip' => true,
|
| 139 |
-
),
|
| 140 |
-
'subject' => array(
|
| 141 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 142 |
-
'type' => 'text',
|
| 143 |
-
'desc_tip' => true,
|
| 144 |
-
/* translators: %s: list of placeholders */
|
| 145 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{user_name}</code>' ),
|
| 146 |
-
'placeholder' => $this->get_default_subject(),
|
| 147 |
-
'default' => '',
|
| 148 |
-
),
|
| 149 |
-
'heading' => array(
|
| 150 |
-
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 151 |
-
'type' => 'text',
|
| 152 |
-
'desc_tip' => true,
|
| 153 |
-
/* translators: %s: list of placeholders */
|
| 154 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{user_name}</code>' ),
|
| 155 |
-
'placeholder' => $this->get_default_heading(),
|
| 156 |
-
'default' => '',
|
| 157 |
-
),
|
| 158 |
-
'notification' => array(
|
| 159 |
-
'title' => __( 'Notification', 'wc-vendors' ),
|
| 160 |
-
'type' => 'select',
|
| 161 |
-
'description' => __( 'Choose when to be notified of an application.', 'wc-vendors' ),
|
| 162 |
-
'default' => 'pending',
|
| 163 |
-
'class' => 'wc-enhanced-select',
|
| 164 |
-
'options' => array(
|
| 165 |
-
'vendor' => __( 'All Applications', 'wc-vendors'),
|
| 166 |
-
'pending_vendor' => __( 'Pending Applications', 'wc-vendors' ),
|
| 167 |
-
),
|
| 168 |
-
'desc_tip' => true,
|
| 169 |
-
),
|
| 170 |
-
'email_type' => array(
|
| 171 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 172 |
-
'type' => 'select',
|
| 173 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 174 |
-
'default' => 'html',
|
| 175 |
-
'class' => 'email_type wc-enhanced-select',
|
| 176 |
-
'options' => $this->get_email_type_options(),
|
| 177 |
-
'desc_tip' => true,
|
| 178 |
-
),
|
| 179 |
-
);
|
| 180 |
-
}
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
endif;
|
| 184 |
-
|
| 185 |
-
return new WCVendors_Admin_Notify_Application();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wcv-admin-notify-product.php
DELETED
|
@@ -1,192 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 4 |
-
exit;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
if ( ! class_exists( 'WCVendors_Admin_Notify_Product' ) ) :
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Notify Admin of new vendor product
|
| 11 |
-
*
|
| 12 |
-
* An email sent to the admin when a vendor adds a new product for approval
|
| 13 |
-
*
|
| 14 |
-
* @class WCVendors_Admin_Notify_Product
|
| 15 |
-
* @version 2.0.0
|
| 16 |
-
* @package Classes/Admin/Emails
|
| 17 |
-
* @author WC Vendors
|
| 18 |
-
* @extends WC_Email
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Admin_Notify_Product extends WC_Email {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
$this->id = 'admin_notify_product';
|
| 27 |
-
$this->title = sprintf( __( 'Admin new %s product', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 28 |
-
$this->description = sprintf( __( 'Notification is sent to chosen recipient(s) when a %s submits a product for approval.', 'wc-vendors' ), wcv_get_vendor_name() );
|
| 29 |
-
$this->template_html = 'emails/admin-notify-product.php';
|
| 30 |
-
$this->template_plain = 'emails/plain/admin-notify-product.php';
|
| 31 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 32 |
-
$this->placeholders = array(
|
| 33 |
-
'{site_title}' => $this->get_blogname(),
|
| 34 |
-
'{product_name}' => '',
|
| 35 |
-
'{vendor_name}' => '',
|
| 36 |
-
);
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
// Triggers for this email
|
| 40 |
-
add_action( 'pending_product', array( $this, 'trigger' ), 10, 2 );
|
| 41 |
-
add_action( 'pending_product_variation', array( $this, 'trigger' ), 10, 2 );
|
| 42 |
-
|
| 43 |
-
// Call parent constructor
|
| 44 |
-
parent::__construct();
|
| 45 |
-
|
| 46 |
-
// Other settings
|
| 47 |
-
$this->recipient = $this->get_option( 'recipient', get_option( 'admin_email' ) );
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* Get email subject.
|
| 52 |
-
*
|
| 53 |
-
* @since 2.0.0
|
| 54 |
-
* @return string
|
| 55 |
-
*/
|
| 56 |
-
public function get_default_subject() {
|
| 57 |
-
return sprintf( __( '[{site_title}] New %s product submitted by {vendor_name} - {product_name}', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Get email heading.
|
| 62 |
-
*
|
| 63 |
-
* @since 2.0.0
|
| 64 |
-
* @return string
|
| 65 |
-
*/
|
| 66 |
-
public function get_default_heading() {
|
| 67 |
-
return sprintf( __( 'New %s product submitted: {product_name}', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
/**
|
| 71 |
-
* Trigger the sending of this email.
|
| 72 |
-
*
|
| 73 |
-
* @param int $order_id The order ID.
|
| 74 |
-
* @param WC_Order $order Order object.
|
| 75 |
-
*/
|
| 76 |
-
public function trigger( $post_id, $post ) {
|
| 77 |
-
|
| 78 |
-
$this->setup_locale();
|
| 79 |
-
|
| 80 |
-
if ( ! WCV_Vendors::is_vendor( $post->post_author ) ) return;
|
| 81 |
-
|
| 82 |
-
$this->post_id = $post_id;
|
| 83 |
-
$this->vendor_id = $post->post_author;
|
| 84 |
-
$this->product = wc_get_product( $post_id );
|
| 85 |
-
$this->vendor_name = WCV_Vendors::get_vendor_shop_name( $post->post_author );
|
| 86 |
-
|
| 87 |
-
if ( is_a( 'WC_Product', $this->product ) ){
|
| 88 |
-
$this->placeholders['{product_name}'] = $this->product->get_title();
|
| 89 |
-
$this->placeholders['{vendor_name}'] = $this->vendor_name;
|
| 90 |
-
|
| 91 |
-
if ( $this->is_enabled() && $this->get_recipient() ) {
|
| 92 |
-
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
$this->restore_locale();
|
| 96 |
-
}
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
/**
|
| 100 |
-
* Get content html.
|
| 101 |
-
*
|
| 102 |
-
* @access public
|
| 103 |
-
* @return string
|
| 104 |
-
*/
|
| 105 |
-
public function get_content_html() {
|
| 106 |
-
|
| 107 |
-
return wc_get_template_html( $this->template_html, array(
|
| 108 |
-
'order' => $this->object,
|
| 109 |
-
'email_heading' => $this->get_heading(),
|
| 110 |
-
'sent_to_admin' => true,
|
| 111 |
-
'plain_text' => false,
|
| 112 |
-
'email' => $this,
|
| 113 |
-
'post_id' => $this->post_id,
|
| 114 |
-
'vendor_id' => $this->vendor_id,
|
| 115 |
-
'vendor_name' => $this->vendor_name,
|
| 116 |
-
'product' => $this->product,
|
| 117 |
-
), 'woocommerce', $this->template_base );
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
/**
|
| 121 |
-
* Get content plain.
|
| 122 |
-
*
|
| 123 |
-
* @access public
|
| 124 |
-
* @return string
|
| 125 |
-
*/
|
| 126 |
-
public function get_content_plain() {
|
| 127 |
-
return wc_get_template_html( $this->template_plain, array(
|
| 128 |
-
'order' => $this->object,
|
| 129 |
-
'email_heading' => $this->get_heading(),
|
| 130 |
-
'sent_to_admin' => true,
|
| 131 |
-
'plain_text' => true,
|
| 132 |
-
'email' => $this,
|
| 133 |
-
'post_id' => $this->post_id,
|
| 134 |
-
'vendor_id' => $this->vendor_id,
|
| 135 |
-
'vendor_name' => $this->vendor_name,
|
| 136 |
-
'product' => $this->product,
|
| 137 |
-
), 'woocommerce', $this->template_base );
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
/**
|
| 141 |
-
* Initialise settings form fields.
|
| 142 |
-
*/
|
| 143 |
-
public function init_form_fields() {
|
| 144 |
-
$this->form_fields = array(
|
| 145 |
-
'enabled' => array(
|
| 146 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 147 |
-
'type' => 'checkbox',
|
| 148 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 149 |
-
'default' => 'yes',
|
| 150 |
-
),
|
| 151 |
-
'recipient' => array(
|
| 152 |
-
'title' => __( 'Recipient(s)', 'wc-vendors' ),
|
| 153 |
-
'type' => 'text',
|
| 154 |
-
'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to %s.', 'wc-vendors' ), '<code>' . esc_attr( get_option( 'admin_email' ) ) . '</code>' ),
|
| 155 |
-
'placeholder' => '',
|
| 156 |
-
'default' => '',
|
| 157 |
-
'desc_tip' => true,
|
| 158 |
-
),
|
| 159 |
-
'subject' => array(
|
| 160 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 161 |
-
'type' => 'text',
|
| 162 |
-
'desc_tip' => true,
|
| 163 |
-
/* translators: %s: list of placeholders */
|
| 164 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}, {order_date}, {order_number}</code>' ),
|
| 165 |
-
'placeholder' => $this->get_default_subject(),
|
| 166 |
-
'default' => '',
|
| 167 |
-
),
|
| 168 |
-
'heading' => array(
|
| 169 |
-
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 170 |
-
'type' => 'text',
|
| 171 |
-
'desc_tip' => true,
|
| 172 |
-
/* translators: %s: list of placeholders */
|
| 173 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}, {order_date}, {order_number}</code>' ),
|
| 174 |
-
'placeholder' => $this->get_default_heading(),
|
| 175 |
-
'default' => '',
|
| 176 |
-
),
|
| 177 |
-
'email_type' => array(
|
| 178 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 179 |
-
'type' => 'select',
|
| 180 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 181 |
-
'default' => 'html',
|
| 182 |
-
'class' => 'email_type wc-enhanced-select',
|
| 183 |
-
'options' => $this->get_email_type_options(),
|
| 184 |
-
'desc_tip' => true,
|
| 185 |
-
),
|
| 186 |
-
);
|
| 187 |
-
}
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
endif;
|
| 191 |
-
|
| 192 |
-
return new WCVendors_Admin_Notify_Product();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wcv-admin-notify-shipped.php
DELETED
|
@@ -1,181 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 4 |
-
exit;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
if ( ! class_exists( 'WCVendors_Admin_Notify_Shipped' ) ) :
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Notify Admin Shipped
|
| 11 |
-
*
|
| 12 |
-
* An email sent to the admin when the vendor marks the order shipped.
|
| 13 |
-
*
|
| 14 |
-
* @class WCVendors_Admin_Notify_Shipped
|
| 15 |
-
* @version 2.0.0
|
| 16 |
-
* @package Classes/Admin/Emails
|
| 17 |
-
* @author WC Vendors
|
| 18 |
-
* @extends WC_Email
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Admin_Notify_Shipped extends WC_Email {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
$this->id = 'admin_notify_shipped';
|
| 27 |
-
$this->title = sprintf( __( 'Admin notify %s shipped', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 28 |
-
$this->description = sprintf( __( 'Notification is sent to chosen recipient(s) when a %s marks an order shipped.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 29 |
-
$this->template_html = 'emails/admin-notify-shipped.php';
|
| 30 |
-
$this->template_plain = 'emails/plain/admin-notify-shipped.php';
|
| 31 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 32 |
-
$this->placeholders = array(
|
| 33 |
-
'{site_title}' => $this->get_blogname(),
|
| 34 |
-
'{order_date}' => '',
|
| 35 |
-
'{order_number}' => '',
|
| 36 |
-
);
|
| 37 |
-
|
| 38 |
-
// Call parent constructor
|
| 39 |
-
parent::__construct();
|
| 40 |
-
|
| 41 |
-
// Other settings
|
| 42 |
-
$this->recipient = $this->get_option( 'recipient', get_option( 'admin_email' ) );
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* Get email subject.
|
| 47 |
-
*
|
| 48 |
-
* @since 2.0.0
|
| 49 |
-
* @return string
|
| 50 |
-
*/
|
| 51 |
-
public function get_default_subject() {
|
| 52 |
-
return sprintf( __( '[{site_title}] %s has marked shipped ({order_number}) - {order_date}', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
/**
|
| 56 |
-
* Get email heading.
|
| 57 |
-
*
|
| 58 |
-
* @since 2.0.0
|
| 59 |
-
* @return string
|
| 60 |
-
*/
|
| 61 |
-
public function get_default_heading() {
|
| 62 |
-
return sprintf( __( '%s has shipped', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/**
|
| 66 |
-
* Trigger the sending of this email.
|
| 67 |
-
*
|
| 68 |
-
* @param int $order_id The order ID.
|
| 69 |
-
* @param WC_Order $order Order object.
|
| 70 |
-
*/
|
| 71 |
-
public function trigger( $order_id, $user_id, $order = false ) {
|
| 72 |
-
|
| 73 |
-
$this->setup_locale();
|
| 74 |
-
|
| 75 |
-
$this->vendor_id = $user_id;
|
| 76 |
-
|
| 77 |
-
if ( $order_id && ! is_a( $order, 'WC_Order' ) ) {
|
| 78 |
-
$order = wc_get_order( $order_id );
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
if ( is_a( $order, 'WC_Order' ) ) {
|
| 82 |
-
$this->object = $order;
|
| 83 |
-
$this->placeholders['{order_date}'] = wc_format_datetime( $this->object->get_date_created() );
|
| 84 |
-
$this->placeholders['{order_number}'] = $this->object->get_order_number();
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
if ( $this->is_enabled() && $this->get_recipient() ) {
|
| 88 |
-
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
$this->restore_locale();
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
/**
|
| 95 |
-
* Get content html.
|
| 96 |
-
*
|
| 97 |
-
* @access public
|
| 98 |
-
* @return string
|
| 99 |
-
*/
|
| 100 |
-
public function get_content_html() {
|
| 101 |
-
|
| 102 |
-
return wc_get_template_html( $this->template_html, array(
|
| 103 |
-
'order' => $this->object,
|
| 104 |
-
'email_heading' => $this->get_heading(),
|
| 105 |
-
'sent_to_admin' => true,
|
| 106 |
-
'plain_text' => false,
|
| 107 |
-
'email' => $this,
|
| 108 |
-
'vendor_id' => $this->vendor_id,
|
| 109 |
-
), 'woocommerce', $this->template_base );
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
/**
|
| 113 |
-
* Get content plain.
|
| 114 |
-
*
|
| 115 |
-
* @access public
|
| 116 |
-
* @return string
|
| 117 |
-
*/
|
| 118 |
-
public function get_content_plain() {
|
| 119 |
-
return wc_get_template_html( $this->template_plain, array(
|
| 120 |
-
'order' => $this->object,
|
| 121 |
-
'email_heading' => $this->get_heading(),
|
| 122 |
-
'sent_to_admin' => true,
|
| 123 |
-
'plain_text' => true,
|
| 124 |
-
'email' => $this,
|
| 125 |
-
'vendor_id' => $this->vendor_id,
|
| 126 |
-
), 'woocommerce', $this->template_base );
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
/**
|
| 130 |
-
* Initialise settings form fields.
|
| 131 |
-
*/
|
| 132 |
-
public function init_form_fields() {
|
| 133 |
-
$this->form_fields = array(
|
| 134 |
-
'enabled' => array(
|
| 135 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 136 |
-
'type' => 'checkbox',
|
| 137 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 138 |
-
'default' => 'yes',
|
| 139 |
-
),
|
| 140 |
-
'recipient' => array(
|
| 141 |
-
'title' => __( 'Recipient(s)', 'wc-vendors' ),
|
| 142 |
-
'type' => 'text',
|
| 143 |
-
'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to %s.', 'wc-vendors' ), '<code>' . esc_attr( get_option( 'admin_email' ) ) . '</code>' ),
|
| 144 |
-
'placeholder' => '',
|
| 145 |
-
'default' => '',
|
| 146 |
-
'desc_tip' => true,
|
| 147 |
-
),
|
| 148 |
-
'subject' => array(
|
| 149 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 150 |
-
'type' => 'text',
|
| 151 |
-
'desc_tip' => true,
|
| 152 |
-
/* translators: %s: list of placeholders */
|
| 153 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}, {order_date}, {order_number}</code>' ),
|
| 154 |
-
'placeholder' => $this->get_default_subject(),
|
| 155 |
-
'default' => '',
|
| 156 |
-
),
|
| 157 |
-
'heading' => array(
|
| 158 |
-
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 159 |
-
'type' => 'text',
|
| 160 |
-
'desc_tip' => true,
|
| 161 |
-
/* translators: %s: list of placeholders */
|
| 162 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}, {order_date}, {order_number}</code>' ),
|
| 163 |
-
'placeholder' => $this->get_default_heading(),
|
| 164 |
-
'default' => '',
|
| 165 |
-
),
|
| 166 |
-
'email_type' => array(
|
| 167 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 168 |
-
'type' => 'select',
|
| 169 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 170 |
-
'default' => 'html',
|
| 171 |
-
'class' => 'email_type wc-enhanced-select',
|
| 172 |
-
'options' => $this->get_email_type_options(),
|
| 173 |
-
'desc_tip' => true,
|
| 174 |
-
),
|
| 175 |
-
);
|
| 176 |
-
}
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
endif;
|
| 180 |
-
|
| 181 |
-
return new WCVendors_Admin_Notify_Shipped();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wcv-customer-notify-shipped.php
DELETED
|
@@ -1,235 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 4 |
-
exit;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
if ( ! class_exists( 'WCVendors_Customer_Notify_Shipped' ) ) :
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Notify Admin Shipped
|
| 11 |
-
*
|
| 12 |
-
* An email sent to the admin when the vendor marks the order shipped.
|
| 13 |
-
*
|
| 14 |
-
* @class WCVendors_Customer_Notify_Shipped
|
| 15 |
-
* @version 2.0.0
|
| 16 |
-
* @package Classes/Admin/Emails
|
| 17 |
-
* @author WC Vendors
|
| 18 |
-
* @extends WC_Email
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Customer_Notify_Shipped extends WC_Email {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
$this->id = 'customer_notify_shipped';
|
| 27 |
-
$this->customer_email = true;
|
| 28 |
-
$this->title = sprintf( __( 'Customer %s shipped', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 29 |
-
$this->description = sprintf( __( 'Email is sent to the customer when a %s marks an order received/paid by a customer.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 30 |
-
$this->template_html = 'emails/customer-notify-shipped.php';
|
| 31 |
-
$this->template_plain = 'emails/plain/customer-notify-shipped.php';
|
| 32 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 33 |
-
$this->placeholders = array(
|
| 34 |
-
'{site_title}' => $this->get_blogname(),
|
| 35 |
-
'{order_date}' => '',
|
| 36 |
-
'{order_number}' => '',
|
| 37 |
-
);
|
| 38 |
-
|
| 39 |
-
// Call parent constructor
|
| 40 |
-
parent::__construct();
|
| 41 |
-
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
/**
|
| 45 |
-
* Get email subject.
|
| 46 |
-
*
|
| 47 |
-
* @since 2.0.0
|
| 48 |
-
* @return string
|
| 49 |
-
*/
|
| 50 |
-
public function get_default_subject() {
|
| 51 |
-
return sprintf( __( '[{site_title}] %s has marked shipped ({order_number}) - {order_date}', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
/**
|
| 55 |
-
* Get email heading.
|
| 56 |
-
*
|
| 57 |
-
* @since 2.0.0
|
| 58 |
-
* @return string
|
| 59 |
-
*/
|
| 60 |
-
public function get_default_heading() {
|
| 61 |
-
return sprintf( __( '%s has shipped', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
/**
|
| 65 |
-
* Trigger the sending of this email.
|
| 66 |
-
*
|
| 67 |
-
* @param int $order_id The order ID.
|
| 68 |
-
* @param WC_Order $order Order object.
|
| 69 |
-
*/
|
| 70 |
-
public function trigger( $order_id, $user_id, $order = false ) {
|
| 71 |
-
|
| 72 |
-
$this->setup_locale();
|
| 73 |
-
$this->vendor_id = $user_id;
|
| 74 |
-
|
| 75 |
-
if ( $order_id && ! is_a( $order, 'WC_Order' ) ) {
|
| 76 |
-
$order = wc_get_order( $order_id );
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
if ( is_a( $order, 'WC_Order' ) ) {
|
| 80 |
-
$this->object = $order;
|
| 81 |
-
$this->recipient = $this->object->get_billing_email();
|
| 82 |
-
$this->placeholders['{order_date}'] = wc_format_datetime( $this->object->get_date_created() );
|
| 83 |
-
$this->placeholders['{order_number}'] = $this->object->get_order_number();
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
if ( $this->is_enabled() && $this->get_recipient() ) {
|
| 87 |
-
// Filter the order items to only show the products owned by the vendor that marked shipped.
|
| 88 |
-
add_filter( 'woocommerce_order_get_items', array( $this, 'filter_vendor_items' ), 10, 3 );
|
| 89 |
-
add_filter( 'woocommerce_get_order_item_totals', array( $this, 'udpate_order_totals' ), 10, 3 );
|
| 90 |
-
|
| 91 |
-
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 92 |
-
|
| 93 |
-
// Remove filters
|
| 94 |
-
remove_filter( 'woocommerce_get_order_item_totals', array( $this, 'udpate_order_totals' ), 10, 3 );
|
| 95 |
-
remove_filter( 'woocommerce_order_get_items', array( $this, 'filter_vendor_items' ), 10, 3 );
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
$this->restore_locale();
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
/**
|
| 102 |
-
* Get content html.
|
| 103 |
-
*
|
| 104 |
-
* @access public
|
| 105 |
-
* @return string
|
| 106 |
-
*/
|
| 107 |
-
public function get_content_html() {
|
| 108 |
-
|
| 109 |
-
return wc_get_template_html( $this->template_html, array(
|
| 110 |
-
'order' => $this->object,
|
| 111 |
-
'email_heading' => $this->get_heading(),
|
| 112 |
-
'sent_to_admin' => true,
|
| 113 |
-
'plain_text' => false,
|
| 114 |
-
'email' => $this,
|
| 115 |
-
'vendor_id' => $this->vendor_id,
|
| 116 |
-
), 'woocommerce', $this->template_base );
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
/**
|
| 120 |
-
* Get content plain.
|
| 121 |
-
*
|
| 122 |
-
* @access public
|
| 123 |
-
* @return string
|
| 124 |
-
*/
|
| 125 |
-
public function get_content_plain() {
|
| 126 |
-
return wc_get_template_html( $this->template_plain, array(
|
| 127 |
-
'order' => $this->object,
|
| 128 |
-
'email_heading' => $this->get_heading(),
|
| 129 |
-
'sent_to_admin' => true,
|
| 130 |
-
'plain_text' => true,
|
| 131 |
-
'email' => $this,
|
| 132 |
-
'vendor_id' => $this->vendor_id,
|
| 133 |
-
), 'woocommerce', $this->template_base );
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
-
/**
|
| 137 |
-
* Initialise settings form fields.
|
| 138 |
-
*/
|
| 139 |
-
public function init_form_fields() {
|
| 140 |
-
$this->form_fields = array(
|
| 141 |
-
'enabled' => array(
|
| 142 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 143 |
-
'type' => 'checkbox',
|
| 144 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 145 |
-
'default' => 'yes',
|
| 146 |
-
),
|
| 147 |
-
'subject' => array(
|
| 148 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 149 |
-
'type' => 'text',
|
| 150 |
-
'desc_tip' => true,
|
| 151 |
-
/* translators: %s: list of placeholders */
|
| 152 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}, {order_date}, {order_number}</code>' ),
|
| 153 |
-
'placeholder' => $this->get_default_subject(),
|
| 154 |
-
'default' => '',
|
| 155 |
-
),
|
| 156 |
-
'heading' => array(
|
| 157 |
-
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 158 |
-
'type' => 'text',
|
| 159 |
-
'desc_tip' => true,
|
| 160 |
-
/* translators: %s: list of placeholders */
|
| 161 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}, {order_date}, {order_number}</code>' ),
|
| 162 |
-
'placeholder' => $this->get_default_heading(),
|
| 163 |
-
'default' => '',
|
| 164 |
-
),
|
| 165 |
-
'email_type' => array(
|
| 166 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 167 |
-
'type' => 'select',
|
| 168 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 169 |
-
'default' => 'html',
|
| 170 |
-
'class' => 'email_type wc-enhanced-select',
|
| 171 |
-
'options' => $this->get_email_type_options(),
|
| 172 |
-
'desc_tip' => true,
|
| 173 |
-
),
|
| 174 |
-
);
|
| 175 |
-
}
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
/**
|
| 179 |
-
* Filter the order to only show vendor products
|
| 180 |
-
*
|
| 181 |
-
* @param array $items
|
| 182 |
-
* @param WC_Order $order
|
| 183 |
-
* @param array $types
|
| 184 |
-
*
|
| 185 |
-
* @return array
|
| 186 |
-
*/
|
| 187 |
-
public function filter_vendor_items( $items, $order, $types ) {
|
| 188 |
-
|
| 189 |
-
foreach ( $items as $item_id => $order_item ) {
|
| 190 |
-
|
| 191 |
-
if ( 'line_item' === $order_item->get_type() ){
|
| 192 |
-
|
| 193 |
-
$product_id = ( $order_item->get_variation_id() ) ? $order_item->get_variation_id() : $order_item->get_product_id();
|
| 194 |
-
|
| 195 |
-
if ( empty( $product_id ) ) {
|
| 196 |
-
unset( $items[ $item_id ] );
|
| 197 |
-
continue;
|
| 198 |
-
}
|
| 199 |
-
|
| 200 |
-
$product_vendor = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 201 |
-
|
| 202 |
-
if ( $this->vendor_id != $product_vendor ) {
|
| 203 |
-
unset( $items[ $item_id ] );
|
| 204 |
-
continue;
|
| 205 |
-
}
|
| 206 |
-
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
}
|
| 210 |
-
|
| 211 |
-
return $items;
|
| 212 |
-
|
| 213 |
-
} // filter_vendor_items
|
| 214 |
-
|
| 215 |
-
/**
|
| 216 |
-
* Update the order totals to only show the items for the product(s)
|
| 217 |
-
*
|
| 218 |
-
* @param array $total_rows
|
| 219 |
-
* @param WC_Order $order
|
| 220 |
-
* @param string $tax_display
|
| 221 |
-
*
|
| 222 |
-
* @return array
|
| 223 |
-
*/
|
| 224 |
-
public function udpate_order_totals( $total_rows, $order, $tax_display ) {
|
| 225 |
-
|
| 226 |
-
$new_total_rows = array();
|
| 227 |
-
$new_total_rows[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
|
| 228 |
-
|
| 229 |
-
return $new_total_rows;
|
| 230 |
-
}
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
endif;
|
| 234 |
-
|
| 235 |
-
return new WCVendors_Customer_Notify_Shipped();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wcv-vendor-notify-application.php
DELETED
|
@@ -1,167 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 4 |
-
exit;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
if ( ! class_exists( 'WCVendors_Vendor_Notify_Application' ) ) :
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Notify vendor application has started
|
| 11 |
-
*
|
| 12 |
-
* An email sent to the admin when the vendor marks the order shipped.
|
| 13 |
-
*
|
| 14 |
-
* @class WCVendors_Vendor_Notify_Application
|
| 15 |
-
* @version 2.0.0
|
| 16 |
-
* @package Classes/Admin/Emails
|
| 17 |
-
* @author WC Vendors
|
| 18 |
-
* @extends WC_Email
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Vendor_Notify_Application extends WC_Email {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
$this->id = 'vendor_notify_application';
|
| 27 |
-
$this->title = sprintf( __( '%s notify application', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 28 |
-
$this->description = sprintf( __( 'Notification is sent to the %s that their application has been received', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 29 |
-
$this->template_html = 'emails/vendor-notify-application.php';
|
| 30 |
-
$this->template_plain = 'emails/plain/vendor-notify-application.php';
|
| 31 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 32 |
-
$this->placeholders = array(
|
| 33 |
-
'{site_title}' => $this->get_blogname()
|
| 34 |
-
);
|
| 35 |
-
|
| 36 |
-
// Call parent constructor
|
| 37 |
-
parent::__construct();
|
| 38 |
-
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* Get email subject.
|
| 43 |
-
*
|
| 44 |
-
* @since 2.0.0
|
| 45 |
-
* @return string
|
| 46 |
-
*/
|
| 47 |
-
public function get_default_subject() {
|
| 48 |
-
return sprintf( __( '[{site_title}] Your %s application has been received', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Get email heading.
|
| 53 |
-
*
|
| 54 |
-
* @since 2.0.0
|
| 55 |
-
* @return string
|
| 56 |
-
*/
|
| 57 |
-
public function get_default_heading() {
|
| 58 |
-
return sprintf( __( '%s application received', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
public function get_default_content() {
|
| 62 |
-
return sprintf( __( 'Hi there. This is a notification about a %s application on %s.', 'wc-vendors' ), wcv_get_vendor_name( true, false ), get_option( 'blogname' ) );
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/**
|
| 66 |
-
* Trigger the sending of this email.
|
| 67 |
-
*
|
| 68 |
-
* @param int $order_id The order ID.
|
| 69 |
-
* @param WC_Order $order Order object.
|
| 70 |
-
*/
|
| 71 |
-
public function trigger( $vendor_id, $status = '' ) {
|
| 72 |
-
|
| 73 |
-
$this->setup_locale();
|
| 74 |
-
|
| 75 |
-
$this->user = get_userdata( $vendor_id );
|
| 76 |
-
$this->user_email = $this->user->user_email;
|
| 77 |
-
$this->status = $status;
|
| 78 |
-
|
| 79 |
-
if ( $this->is_enabled() ) {
|
| 80 |
-
$this->send( $this->user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
$this->restore_locale();
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
/**
|
| 87 |
-
* Get content html.
|
| 88 |
-
*
|
| 89 |
-
* @access public
|
| 90 |
-
* @return string
|
| 91 |
-
*/
|
| 92 |
-
public function get_content_html() {
|
| 93 |
-
|
| 94 |
-
return wc_get_template_html( $this->template_html, array(
|
| 95 |
-
'order' => $this->object,
|
| 96 |
-
'email_heading' => $this->get_heading(),
|
| 97 |
-
'sent_to_admin' => true,
|
| 98 |
-
'plain_text' => false,
|
| 99 |
-
'email' => $this,
|
| 100 |
-
'user' => $this->user,
|
| 101 |
-
'status' => $this->status,
|
| 102 |
-
), 'woocommerce', $this->template_base );
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
/**
|
| 106 |
-
* Get content plain.
|
| 107 |
-
*
|
| 108 |
-
* @access public
|
| 109 |
-
* @return string
|
| 110 |
-
*/
|
| 111 |
-
public function get_content_plain() {
|
| 112 |
-
return wc_get_template_html( $this->template_plain, array(
|
| 113 |
-
'order' => $this->object,
|
| 114 |
-
'email_heading' => $this->get_heading(),
|
| 115 |
-
'sent_to_admin' => true,
|
| 116 |
-
'plain_text' => true,
|
| 117 |
-
'email' => $this,
|
| 118 |
-
'user' => $this->user,
|
| 119 |
-
'status' => $this->status,
|
| 120 |
-
), 'woocommerce', $this->template_base );
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
/**
|
| 124 |
-
* Initialise settings form fields.
|
| 125 |
-
*/
|
| 126 |
-
public function init_form_fields() {
|
| 127 |
-
$this->form_fields = array(
|
| 128 |
-
'enabled' => array(
|
| 129 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 130 |
-
'type' => 'checkbox',
|
| 131 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 132 |
-
'default' => 'yes',
|
| 133 |
-
),
|
| 134 |
-
'subject' => array(
|
| 135 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 136 |
-
'type' => 'text',
|
| 137 |
-
'desc_tip' => true,
|
| 138 |
-
/* translators: %s: list of placeholders */
|
| 139 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}</code>' ),
|
| 140 |
-
'placeholder' => $this->get_default_subject(),
|
| 141 |
-
'default' => '',
|
| 142 |
-
),
|
| 143 |
-
'heading' => array(
|
| 144 |
-
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 145 |
-
'type' => 'text',
|
| 146 |
-
'desc_tip' => true,
|
| 147 |
-
/* translators: %s: list of placeholders */
|
| 148 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}</code>' ),
|
| 149 |
-
'placeholder' => $this->get_default_heading(),
|
| 150 |
-
'default' => '',
|
| 151 |
-
),
|
| 152 |
-
'email_type' => array(
|
| 153 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 154 |
-
'type' => 'select',
|
| 155 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 156 |
-
'default' => 'html',
|
| 157 |
-
'class' => 'email_type wc-enhanced-select',
|
| 158 |
-
'options' => $this->get_email_type_options(),
|
| 159 |
-
'desc_tip' => true,
|
| 160 |
-
),
|
| 161 |
-
);
|
| 162 |
-
}
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
endif;
|
| 166 |
-
|
| 167 |
-
return new WCVendors_Vendor_Notify_Application();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wcv-vendor-notify-approved.php
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 4 |
-
exit;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
if ( ! class_exists( 'WCVendors_Notify_Vendor_Approved' ) ) :
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Notify vendor application has started
|
| 11 |
-
*
|
| 12 |
-
* An email sent to the admin when the vendor marks the order shipped.
|
| 13 |
-
*
|
| 14 |
-
* @class WCV_Notify_Vendor_Application
|
| 15 |
-
* @version 2.0.0
|
| 16 |
-
* @package Classes/Admin/Emails
|
| 17 |
-
* @author WC Vendors
|
| 18 |
-
* @extends WC_Email
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Notify_Vendor_Approved extends WC_Email {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
$this->id = 'vendor_notify_approved';
|
| 27 |
-
$this->title = sprintf( __( '%s notify approved', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 28 |
-
$this->description = sprintf( __( 'Notification is sent to the %s that their application has been approved', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 29 |
-
$this->template_html = 'emails/vendor-notify-approved.php';
|
| 30 |
-
$this->template_plain = 'emails/plain/vendor-notify-approved.php';
|
| 31 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 32 |
-
$this->placeholders = array(
|
| 33 |
-
'{site_title}' => $this->get_blogname(),
|
| 34 |
-
);
|
| 35 |
-
|
| 36 |
-
// Call parent constructor
|
| 37 |
-
parent::__construct();
|
| 38 |
-
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* Get email subject.
|
| 43 |
-
*
|
| 44 |
-
* @since 2.0.0
|
| 45 |
-
* @return string
|
| 46 |
-
*/
|
| 47 |
-
public function get_default_subject() {
|
| 48 |
-
return __( '[{site_title}] Your vendor application has been approved', 'wc-vendors' );
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Get email heading.
|
| 53 |
-
*
|
| 54 |
-
* @since 2.0.0
|
| 55 |
-
* @return string
|
| 56 |
-
*/
|
| 57 |
-
public function get_default_heading() {
|
| 58 |
-
return sprintf( __( '%s Application Approved', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* Get email content
|
| 63 |
-
*
|
| 64 |
-
* @since 2.0.0
|
| 65 |
-
* @return string
|
| 66 |
-
*/
|
| 67 |
-
public function get_default_content(){
|
| 68 |
-
return sprintf( __( 'Your application to become a %s has been approved.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
/**
|
| 72 |
-
* Trigger the sending of this email.
|
| 73 |
-
*
|
| 74 |
-
* @param int $order_id The order ID.
|
| 75 |
-
* @param WC_Order $order Order object.
|
| 76 |
-
*/
|
| 77 |
-
public function trigger( $vendor_id, $status = '' ) {
|
| 78 |
-
|
| 79 |
-
$this->setup_locale();
|
| 80 |
-
|
| 81 |
-
$this->user = get_userdata( $vendor_id );
|
| 82 |
-
$this->user_email = $this->user->user_email;
|
| 83 |
-
$this->content = $this->get_option( 'content', $this->get_default_content() );
|
| 84 |
-
$this->status = $status;
|
| 85 |
-
|
| 86 |
-
if ( $this->is_enabled() ) {
|
| 87 |
-
$this->send( $this->user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
$this->restore_locale();
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
/**
|
| 94 |
-
* Get content html.
|
| 95 |
-
*
|
| 96 |
-
* @access public
|
| 97 |
-
* @return string
|
| 98 |
-
*/
|
| 99 |
-
public function get_content_html() {
|
| 100 |
-
|
| 101 |
-
return wc_get_template_html( $this->template_html, array(
|
| 102 |
-
'order' => $this->object,
|
| 103 |
-
'email_heading' => $this->get_heading(),
|
| 104 |
-
'sent_to_admin' => true,
|
| 105 |
-
'plain_text' => false,
|
| 106 |
-
'email' => $this,
|
| 107 |
-
'user' => $this->user,
|
| 108 |
-
'content' => $this->content,
|
| 109 |
-
'status' => $this->status,
|
| 110 |
-
), 'woocommerce', $this->template_base );
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
/**
|
| 114 |
-
* Get content plain.
|
| 115 |
-
*
|
| 116 |
-
* @access public
|
| 117 |
-
* @return string
|
| 118 |
-
*/
|
| 119 |
-
public function get_content_plain() {
|
| 120 |
-
return wc_get_template_html( $this->template_plain, array(
|
| 121 |
-
'order' => $this->object,
|
| 122 |
-
'email_heading' => $this->get_heading(),
|
| 123 |
-
'sent_to_admin' => true,
|
| 124 |
-
'plain_text' => true,
|
| 125 |
-
'email' => $this,
|
| 126 |
-
'user' => $this->user,
|
| 127 |
-
'content' => $this->content,
|
| 128 |
-
'status' => $this->status,
|
| 129 |
-
) );
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
/**
|
| 133 |
-
* Initialise settings form fields.
|
| 134 |
-
*/
|
| 135 |
-
public function init_form_fields() {
|
| 136 |
-
$this->form_fields = array(
|
| 137 |
-
'enabled' => array(
|
| 138 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 139 |
-
'type' => 'checkbox',
|
| 140 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 141 |
-
'default' => 'yes',
|
| 142 |
-
),
|
| 143 |
-
'subject' => array(
|
| 144 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 145 |
-
'type' => 'text',
|
| 146 |
-
'desc_tip' => true,
|
| 147 |
-
/* translators: %s: list of placeholders */
|
| 148 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}</code>' ),
|
| 149 |
-
'placeholder' => $this->get_default_subject(),
|
| 150 |
-
'default' => '',
|
| 151 |
-
),
|
| 152 |
-
'content' => array(
|
| 153 |
-
'title' => __( 'Content', 'wc-vendors' ),
|
| 154 |
-
'type' => 'textarea',
|
| 155 |
-
'desc_tip' => true,
|
| 156 |
-
/* translators: %s: list of placeholders */
|
| 157 |
-
'description' => sprintf( __( 'Email body to be included when sent to the %s.', '' ), wcv_get_vendor_name( true, false ) ),
|
| 158 |
-
'placeholder' => $this->get_default_content(),
|
| 159 |
-
'default' => '',
|
| 160 |
-
),
|
| 161 |
-
'heading' => array(
|
| 162 |
-
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 163 |
-
'type' => 'text',
|
| 164 |
-
'desc_tip' => true,
|
| 165 |
-
/* translators: %s: list of placeholders */
|
| 166 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}</code>' ),
|
| 167 |
-
'placeholder' => $this->get_default_heading(),
|
| 168 |
-
'default' => '',
|
| 169 |
-
),
|
| 170 |
-
'email_type' => array(
|
| 171 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 172 |
-
'type' => 'select',
|
| 173 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 174 |
-
'default' => 'html',
|
| 175 |
-
'class' => 'email_type wc-enhanced-select',
|
| 176 |
-
'options' => $this->get_email_type_options(),
|
| 177 |
-
'desc_tip' => true,
|
| 178 |
-
),
|
| 179 |
-
);
|
| 180 |
-
}
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
endif;
|
| 184 |
-
|
| 185 |
-
return new WCVendors_Notify_Vendor_Approved();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wcv-vendor-notify-denied.php
DELETED
|
@@ -1,203 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 4 |
-
exit;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
if ( ! class_exists( 'WCVendors_Vendor_Notify_Denied' ) ) :
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Notify vendor application has been denied
|
| 11 |
-
*
|
| 12 |
-
* An email sent to the vendor when the admin denies their application
|
| 13 |
-
*
|
| 14 |
-
* @class WCVendors_Vendor_Notify_Denied
|
| 15 |
-
* @version 2.0.0
|
| 16 |
-
* @package Classes/Admin/Emails
|
| 17 |
-
* @author WC Vendors
|
| 18 |
-
* @extends WC_Email
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Vendor_Notify_Denied extends WC_Email {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
$this->id = 'vendor_notify_denied';
|
| 27 |
-
$this->title = sprintf( __( '%s notify denied', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 28 |
-
$this->description = sprintf( __( 'Notification is sent to the %s that their application has been denied', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 29 |
-
$this->template_html = 'emails/vendor-notify-denied.php';
|
| 30 |
-
$this->template_plain = 'emails/plain/vendor-notify-denied.php';
|
| 31 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 32 |
-
$this->placeholders = array(
|
| 33 |
-
'{site_title}' => $this->get_blogname(),
|
| 34 |
-
);
|
| 35 |
-
|
| 36 |
-
// Call parent constructor
|
| 37 |
-
parent::__construct();
|
| 38 |
-
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* Get email subject.
|
| 43 |
-
*
|
| 44 |
-
* @since 2.0.0
|
| 45 |
-
* @return string
|
| 46 |
-
*/
|
| 47 |
-
public function get_default_subject() {
|
| 48 |
-
return sprintf( __( '[{site_title}] Your %s application has been denied', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Get email heading.
|
| 53 |
-
*
|
| 54 |
-
* @since 2.0.0
|
| 55 |
-
* @return string
|
| 56 |
-
*/
|
| 57 |
-
public function get_default_heading() {
|
| 58 |
-
return sprintf( __( '%s Application Denied', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* Get email content
|
| 63 |
-
*
|
| 64 |
-
* @since 2.0.0
|
| 65 |
-
* @return string
|
| 66 |
-
*/
|
| 67 |
-
public function get_default_content(){
|
| 68 |
-
return sprintf( __( 'Your application to become a %s has been denied.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
/**
|
| 72 |
-
* Get email reason
|
| 73 |
-
*
|
| 74 |
-
* @since 2.0.0
|
| 75 |
-
* @return string
|
| 76 |
-
*/
|
| 77 |
-
public function get_default_reason(){
|
| 78 |
-
return __( 'We are not taking any new applications at this time.', 'wc-vendors' );
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
/**
|
| 82 |
-
* Trigger the sending of this email.
|
| 83 |
-
*
|
| 84 |
-
* @param int $order_id The order ID.
|
| 85 |
-
* @param WC_Order $order Order object.
|
| 86 |
-
*/
|
| 87 |
-
public function trigger( $vendor_id, $reason = '' ) {
|
| 88 |
-
|
| 89 |
-
$this->setup_locale();
|
| 90 |
-
|
| 91 |
-
$this->user = get_userdata( $vendor_id );
|
| 92 |
-
$this->user_email = $this->user->user_email;
|
| 93 |
-
$this->content = $this->get_option( 'content', $this->get_default_content() );
|
| 94 |
-
$this->reason = ( $reason ) ? $reason : $this->get_option( 'reason', $this->get_default_reason() );
|
| 95 |
-
|
| 96 |
-
if ( $this->is_enabled() ) {
|
| 97 |
-
$this->send( $this->user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
$this->restore_locale();
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
/**
|
| 104 |
-
* Get content html.
|
| 105 |
-
*
|
| 106 |
-
* @access public
|
| 107 |
-
* @return string
|
| 108 |
-
*/
|
| 109 |
-
public function get_content_html() {
|
| 110 |
-
|
| 111 |
-
return wc_get_template_html( $this->template_html, array(
|
| 112 |
-
'order' => $this->object,
|
| 113 |
-
'email_heading' => $this->get_heading(),
|
| 114 |
-
'sent_to_admin' => true,
|
| 115 |
-
'plain_text' => false,
|
| 116 |
-
'email' => $this,
|
| 117 |
-
'user' => $this->user,
|
| 118 |
-
'reason' => $this->reason,
|
| 119 |
-
'content' => $this->content,
|
| 120 |
-
), 'woocommerce', $this->template_base );
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
/**
|
| 124 |
-
* Get content plain.
|
| 125 |
-
*
|
| 126 |
-
* @access public
|
| 127 |
-
* @return string
|
| 128 |
-
*/
|
| 129 |
-
public function get_content_plain() {
|
| 130 |
-
return wc_get_template_html( $this->template_plain, array(
|
| 131 |
-
'order' => $this->object,
|
| 132 |
-
'email_heading' => $this->get_heading(),
|
| 133 |
-
'sent_to_admin' => true,
|
| 134 |
-
'plain_text' => true,
|
| 135 |
-
'email' => $this,
|
| 136 |
-
'reason' => $this->reason,
|
| 137 |
-
'content' => $this->content,
|
| 138 |
-
'user' => $this->user,
|
| 139 |
-
) );
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
/**
|
| 143 |
-
* Initialise settings form fields.
|
| 144 |
-
*/
|
| 145 |
-
public function init_form_fields() {
|
| 146 |
-
$this->form_fields = array(
|
| 147 |
-
'enabled' => array(
|
| 148 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 149 |
-
'type' => 'checkbox',
|
| 150 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 151 |
-
'default' => 'yes',
|
| 152 |
-
),
|
| 153 |
-
'subject' => array(
|
| 154 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 155 |
-
'type' => 'text',
|
| 156 |
-
'desc_tip' => true,
|
| 157 |
-
/* translators: %s: list of placeholders */
|
| 158 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}</code>' ),
|
| 159 |
-
'placeholder' => $this->get_default_subject(),
|
| 160 |
-
'default' => '',
|
| 161 |
-
),
|
| 162 |
-
'content' => array(
|
| 163 |
-
'title' => __( 'Content', 'wc-vendors' ),
|
| 164 |
-
'type' => 'textarea',
|
| 165 |
-
'desc_tip' => true,
|
| 166 |
-
/* translators: %s: list of placeholders */
|
| 167 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}</code>' ),
|
| 168 |
-
'placeholder' => $this->get_default_content(),
|
| 169 |
-
'default' => $this->get_default_content(),
|
| 170 |
-
),
|
| 171 |
-
'reason' => array(
|
| 172 |
-
'title' => __( 'Reason', 'wc-vendors' ),
|
| 173 |
-
'type' => 'textarea',
|
| 174 |
-
'desc_tip' => true,
|
| 175 |
-
'description' => sprintf( __( 'Provide a reason for denying the %s application', 'wc-vendors'), wcv_get_vendor_name( true, false ) ),
|
| 176 |
-
'placeholder' => $this->get_default_reason(),
|
| 177 |
-
'default' => $this->get_default_reason(),
|
| 178 |
-
),
|
| 179 |
-
'heading' => array(
|
| 180 |
-
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 181 |
-
'type' => 'text',
|
| 182 |
-
'desc_tip' => true,
|
| 183 |
-
/* translators: %s: list of placeholders */
|
| 184 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}</code>' ),
|
| 185 |
-
'placeholder' => $this->get_default_heading(),
|
| 186 |
-
'default' => '',
|
| 187 |
-
),
|
| 188 |
-
'email_type' => array(
|
| 189 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 190 |
-
'type' => 'select',
|
| 191 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 192 |
-
'default' => 'html',
|
| 193 |
-
'class' => 'email_type wc-enhanced-select',
|
| 194 |
-
'options' => $this->get_email_type_options(),
|
| 195 |
-
'desc_tip' => true,
|
| 196 |
-
),
|
| 197 |
-
);
|
| 198 |
-
}
|
| 199 |
-
}
|
| 200 |
-
|
| 201 |
-
endif;
|
| 202 |
-
|
| 203 |
-
return new WCVendors_Vendor_Notify_Denied();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/emails/class-wcv-vendor-notify-order.php
DELETED
|
@@ -1,213 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 4 |
-
exit;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
if ( ! class_exists( 'WCVendors_Vendor_Notify_Order' ) ) :
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Notify Admin Shipped
|
| 11 |
-
*
|
| 12 |
-
* An email sent to the admin when the vendor marks the order shipped.
|
| 13 |
-
*
|
| 14 |
-
* @class WCVendors_Vendor_Notify_Order
|
| 15 |
-
* @version 2.0.0
|
| 16 |
-
* @package Classes/Admin/Emails
|
| 17 |
-
* @author WC Vendors
|
| 18 |
-
* @extends WC_Email
|
| 19 |
-
*/
|
| 20 |
-
class WCVendors_Vendor_Notify_Order extends WC_Email {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Constructor.
|
| 24 |
-
*/
|
| 25 |
-
public function __construct() {
|
| 26 |
-
$this->id = 'vendor_notify_order';
|
| 27 |
-
$this->title = sprintf( __( '%s notify order', 'wc-vendors' ), wcv_get_vendor_name( ) );
|
| 28 |
-
$this->description = sprintf( __( 'Notification is sent to %s when an order is paid.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 29 |
-
$this->template_html = 'emails/vendor-notify-order.php';
|
| 30 |
-
$this->template_plain = 'emails/plain/vendor-notify-order.php';
|
| 31 |
-
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 32 |
-
$this->placeholders = array(
|
| 33 |
-
'{site_title}' => $this->get_blogname(),
|
| 34 |
-
'{order_date}' => '',
|
| 35 |
-
'{order_number}' => '',
|
| 36 |
-
);
|
| 37 |
-
|
| 38 |
-
// Other settings
|
| 39 |
-
add_action( 'woocommerce_order_status_pending_to_processing_notification', array( $this, 'trigger' ), 10, 2 );
|
| 40 |
-
add_action( 'woocommerce_order_status_pending_to_completed_notification', array( $this, 'trigger' ), 10, 2 );
|
| 41 |
-
add_action( 'woocommerce_order_status_failed_to_processing_notification', array( $this, 'trigger' ), 10, 2 );
|
| 42 |
-
add_action( 'woocommerce_order_status_failed_to_completed_notification', array( $this, 'trigger' ), 10, 2 );
|
| 43 |
-
add_action( 'woocommerce_order_status_on-hold_to_processing_notification', array( $this, 'trigger' ), 10, 2 );
|
| 44 |
-
add_action( 'woocommerce_order_status_on-hold_to_completed_notification', array( $this, 'trigger' ), 10, 2 );
|
| 45 |
-
|
| 46 |
-
// Call parent constructor
|
| 47 |
-
parent::__construct();
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* Get email subject.
|
| 52 |
-
*
|
| 53 |
-
* @since 2.0.0
|
| 54 |
-
* @return string
|
| 55 |
-
*/
|
| 56 |
-
public function get_default_subject() {
|
| 57 |
-
return __( '[{site_title}] New Customer Order ({order_number}) - {order_date}', 'wc-vendors' );
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Get email heading.
|
| 62 |
-
*
|
| 63 |
-
* @since 2.0.0
|
| 64 |
-
* @return string
|
| 65 |
-
*/
|
| 66 |
-
public function get_default_heading() {
|
| 67 |
-
return __( 'New Customer Order', 'wc-vendors' );
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
/**
|
| 71 |
-
* Trigger the sending of this email.
|
| 72 |
-
*
|
| 73 |
-
* @param int $order_id The order ID.
|
| 74 |
-
* @param WC_Order $order Order object.
|
| 75 |
-
*/
|
| 76 |
-
public function trigger( $order_id, $order = false ) {
|
| 77 |
-
|
| 78 |
-
$this->setup_locale();
|
| 79 |
-
|
| 80 |
-
if ( $order_id && ! is_a( $order, 'WC_Order' ) ) {
|
| 81 |
-
$order = wc_get_order( $order_id );
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
$this->vendors = WCV_Vendors::get_vendors_from_order( $order );
|
| 85 |
-
|
| 86 |
-
if ( is_a( $order, 'WC_Order' ) ) {
|
| 87 |
-
$this->object = $order;
|
| 88 |
-
$this->placeholders['{order_date}'] = wc_format_datetime( $this->object->get_date_created() );
|
| 89 |
-
$this->placeholders['{order_number}'] = $this->object->get_order_number();
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
if ( $this->is_enabled() && !empty( $this->vendors )) {
|
| 93 |
-
|
| 94 |
-
foreach ( $this->vendors as $vendor_id => $vendor_details ) {
|
| 95 |
-
|
| 96 |
-
$this->recipient = $vendor_details[ 'vendor' ]->user_email;
|
| 97 |
-
$this->order_items = $vendor_details[ 'line_items' ];
|
| 98 |
-
$this->vendor_id = $vendor_id;
|
| 99 |
-
$this->totals_display = $this->get_option( 'totals_display' );
|
| 100 |
-
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 101 |
-
|
| 102 |
-
}
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
$this->restore_locale();
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
/**
|
| 109 |
-
* Get content html.
|
| 110 |
-
*
|
| 111 |
-
* @access public
|
| 112 |
-
* @return string
|
| 113 |
-
*/
|
| 114 |
-
public function get_content_html() {
|
| 115 |
-
|
| 116 |
-
return wc_get_template_html( $this->template_html, array(
|
| 117 |
-
'order' => $this->object,
|
| 118 |
-
'vendor_id' => $this->vendor_id,
|
| 119 |
-
'vendor_items' => $this->order_items,
|
| 120 |
-
'email_heading' => $this->get_heading(),
|
| 121 |
-
'totals_display' => $this->totals_display,
|
| 122 |
-
'sent_to_admin' => false,
|
| 123 |
-
'sent_to_vendor' => true,
|
| 124 |
-
'plain_text' => false,
|
| 125 |
-
'email' => $this,
|
| 126 |
-
), 'woocommerce', $this->template_base );
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
/**
|
| 130 |
-
* Get content plain.
|
| 131 |
-
*
|
| 132 |
-
* @access public
|
| 133 |
-
* @return string
|
| 134 |
-
*/
|
| 135 |
-
public function get_content_plain() {
|
| 136 |
-
return wc_get_template_html( $this->template_plain, array(
|
| 137 |
-
'order' => $this->object,
|
| 138 |
-
'vendor_id' => $this->vendor_id,
|
| 139 |
-
'vendor_items' => $this->order_items,
|
| 140 |
-
'email_heading' => $this->get_heading(),
|
| 141 |
-
'sent_to_admin' => false,
|
| 142 |
-
'sent_to_vendor' => true,
|
| 143 |
-
'totals_display' => $this->totals_display,
|
| 144 |
-
'plain_text' => true,
|
| 145 |
-
'email' => $this,
|
| 146 |
-
), 'woocommerce', $this->template_base );
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
/**
|
| 150 |
-
* Initialise settings form fields.
|
| 151 |
-
*/
|
| 152 |
-
public function init_form_fields() {
|
| 153 |
-
$this->form_fields = array(
|
| 154 |
-
'enabled' => array(
|
| 155 |
-
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 156 |
-
'type' => 'checkbox',
|
| 157 |
-
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 158 |
-
'default' => 'yes',
|
| 159 |
-
),
|
| 160 |
-
'subject' => array(
|
| 161 |
-
'title' => __( 'Subject', 'wc-vendors' ),
|
| 162 |
-
'type' => 'text',
|
| 163 |
-
'desc_tip' => true,
|
| 164 |
-
/* translators: %s: list of placeholders */
|
| 165 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}, {order_date}, {order_number}</code>' ),
|
| 166 |
-
'placeholder' => $this->get_default_subject(),
|
| 167 |
-
'default' => '',
|
| 168 |
-
),
|
| 169 |
-
'heading' => array(
|
| 170 |
-
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 171 |
-
'type' => 'text',
|
| 172 |
-
'desc_tip' => true,
|
| 173 |
-
/* translators: %s: list of placeholders */
|
| 174 |
-
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{site_title}, {order_date}, {order_number}</code>' ),
|
| 175 |
-
'placeholder' => $this->get_default_heading(),
|
| 176 |
-
'default' => '',
|
| 177 |
-
),
|
| 178 |
-
'totals_display' => array(
|
| 179 |
-
'title' => __( 'Totals Display', 'wc-vendors' ),
|
| 180 |
-
'type' => 'select',
|
| 181 |
-
'description' => __( 'Choose how to display the product totals. Including commission or without or no totals at all.', 'wc-vendors' ),
|
| 182 |
-
'default' => 'both',
|
| 183 |
-
'class' => 'wc-enhanced-select',
|
| 184 |
-
'options' => array(
|
| 185 |
-
'both' => __( 'Both', 'wc-vendors'),
|
| 186 |
-
'comission' => __( 'Commission', 'wc-vendors' ),
|
| 187 |
-
'product' => __( 'Product', 'wc-vendors' ),
|
| 188 |
-
'none' => __( 'None', 'wc-vendors' ),
|
| 189 |
-
),
|
| 190 |
-
'desc_tip' => true,
|
| 191 |
-
),
|
| 192 |
-
'payment_method' => array(
|
| 193 |
-
'title' => __( 'Payment method', 'wc-vendors' ),
|
| 194 |
-
'type' => 'checkbox',
|
| 195 |
-
'label' => __( 'Include the payment method in the email', 'wc-vendors' ),
|
| 196 |
-
'default' => 'no',
|
| 197 |
-
),
|
| 198 |
-
'email_type' => array(
|
| 199 |
-
'title' => __( 'Email type', 'wc-vendors' ),
|
| 200 |
-
'type' => 'select',
|
| 201 |
-
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 202 |
-
'default' => 'html',
|
| 203 |
-
'class' => 'email_type wc-enhanced-select',
|
| 204 |
-
'options' => $this->get_email_type_options(),
|
| 205 |
-
'desc_tip' => true,
|
| 206 |
-
),
|
| 207 |
-
);
|
| 208 |
-
}
|
| 209 |
-
}
|
| 210 |
-
|
| 211 |
-
endif;
|
| 212 |
-
|
| 213 |
-
return new WCVendors_Vendor_Notify_Order();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/README.md
DELETED
|
@@ -1,126 +0,0 @@
|
|
| 1 |
-
WP Simple Settings Framework
|
| 2 |
-
================================
|
| 3 |
-
|
| 4 |
-
A minimalistic framework for Wordpress Settings API.
|
| 5 |
-
|
| 6 |
-
Quick start
|
| 7 |
-
------------
|
| 8 |
-
|
| 9 |
-
* [Download the latest release](https://github.com/Geczy/WP-Simple-Settings-Framework/zipball/master) (zip)
|
| 10 |
-
|
| 11 |
-
* Or, clone the repo, `git clone git://github.com/Geczy/WP-Simple-Settings-Framework.git`
|
| 12 |
-
|
| 13 |
-
Installation
|
| 14 |
-
------------
|
| 15 |
-
1. Include the framework in your Wordpress plugin by using:
|
| 16 |
-
|
| 17 |
-
```php
|
| 18 |
-
<?php
|
| 19 |
-
add_action( 'init', 'sf_load_settings' );
|
| 20 |
-
function sf_load_settings() {
|
| 21 |
-
require 'classes/sf-class-settings.php';
|
| 22 |
-
$settings_framework = new SF_Settings_API($id = 'my_plugin_name', $title = 'My Plugin Title', $menu = 'plugins.php', __FILE__);
|
| 23 |
-
}
|
| 24 |
-
```
|
| 25 |
-
|
| 26 |
-
Optionally, you might want to make `$settings_framework` a global variable so that you can use the [helper functions](#helpers).
|
| 27 |
-
|
| 28 |
-
2. Open `sf-options.php` to begin configuring your options.
|
| 29 |
-
|
| 30 |
-
Features
|
| 31 |
-
------------
|
| 32 |
-
|
| 33 |
-
### Automatic settings page
|
| 34 |
-
Don't want it under the Plugins tab like in the screenshot? No problem, you can choose where you want it!
|
| 35 |
-
|
| 36 |
-
You can also change "Simple Settings" submenu to be anything you'd like.
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
---
|
| 41 |
-
|
| 42 |
-
### Tooltips
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
Optional tooltips using [Twitter Bootstrap](http://twitter.github.com/bootstrap/javascript.html#tooltips)!
|
| 46 |
-
|
| 47 |
-
---
|
| 48 |
-
|
| 49 |
-
### Select box replacement
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
Utilizing [Select2](http://ivaynberg.github.com/select2/) to display select boxes. It's pretty cool!
|
| 53 |
-
|
| 54 |
-
---
|
| 55 |
-
|
| 56 |
-
### Multiple tabs
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
Create multiple tabs for your options.
|
| 60 |
-
|
| 61 |
-
---
|
| 62 |
-
|
| 63 |
-
### Input types
|
| 64 |
-
|
| 65 |
-
* Text
|
| 66 |
-
* Number
|
| 67 |
-
* Textarea
|
| 68 |
-
* Checkbox
|
| 69 |
-
* Radio
|
| 70 |
-
* Select
|
| 71 |
-
* WP Pages
|
| 72 |
-
|
| 73 |
-
Helpers
|
| 74 |
-
------------
|
| 75 |
-
|
| 76 |
-
Update or add a new option
|
| 77 |
-
|
| 78 |
-
```php
|
| 79 |
-
<?php
|
| 80 |
-
$settings_framework->update_option('your_option', 'new_value');
|
| 81 |
-
```
|
| 82 |
-
|
| 83 |
-
Get an existing option's value
|
| 84 |
-
|
| 85 |
-
```php
|
| 86 |
-
<?php
|
| 87 |
-
$settings_framework->get_option('your_option');
|
| 88 |
-
```
|
| 89 |
-
|
| 90 |
-
Example configuration
|
| 91 |
-
------------
|
| 92 |
-
|
| 93 |
-
Check out the [example config](https://github.com/Geczy/WP-Simple-Settings-Framework/blob/master/sf-options.php) for an idea of how to use every input type.
|
| 94 |
-
|
| 95 |
-
Here's an example of one type, though:
|
| 96 |
-
|
| 97 |
-
```php
|
| 98 |
-
<?php
|
| 99 |
-
$options[] = array(
|
| 100 |
-
'name' => __( 'Name', 'geczy' ),
|
| 101 |
-
'desc' => __( 'Please tell me who you are.', 'geczy' ),
|
| 102 |
-
'id' => 'text_sample',
|
| 103 |
-
'type' => 'text',
|
| 104 |
-
);
|
| 105 |
-
```
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
Bug tracker
|
| 109 |
-
-----------
|
| 110 |
-
|
| 111 |
-
Have a bug? Please create an issue here on GitHub!
|
| 112 |
-
|
| 113 |
-
https://github.com/Geczy/WP-Simple-Settings-Framework/issues/
|
| 114 |
-
|
| 115 |
-
Copyright and License
|
| 116 |
-
---------------------
|
| 117 |
-
|
| 118 |
-
Copyright 2012 Matthew Gates
|
| 119 |
-
|
| 120 |
-
Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:
|
| 121 |
-
|
| 122 |
-
* Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.
|
| 123 |
-
* Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.
|
| 124 |
-
* Neither the names of the copyright holders nor the names of the contributors may be used to endorse or promote products derived from this software without specific prior written permission.
|
| 125 |
-
|
| 126 |
-
http://www.opensource.org/licenses/bsd-license.php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/css/sf-styles.css
DELETED
|
@@ -1,167 +0,0 @@
|
|
| 1 |
-
a.sf-tips {
|
| 2 |
-
height: 16px;
|
| 3 |
-
width: 16px;
|
| 4 |
-
margin-top: 0.2em;
|
| 5 |
-
float: right;
|
| 6 |
-
background: url(../img/tip.png) no-repeat top left;
|
| 7 |
-
}
|
| 8 |
-
|
| 9 |
-
/*!
|
| 10 |
-
* Bootstrap v2.3.1 [Styles for Tooltips]
|
| 11 |
-
*
|
| 12 |
-
* Copyright 2012 Twitter, Inc
|
| 13 |
-
* Licensed under the Apache License v2.0
|
| 14 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 15 |
-
*
|
| 16 |
-
* Designed and built with all the love in the world @twitter by @mdo and @fat.
|
| 17 |
-
*/
|
| 18 |
-
.clearfix {
|
| 19 |
-
*zoom: 1;
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
.clearfix:before, .clearfix:after {
|
| 23 |
-
display: table;
|
| 24 |
-
content: "";
|
| 25 |
-
line-height: 0;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
.clearfix:after {
|
| 29 |
-
clear: both;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
.hide-text {
|
| 33 |
-
font: 0/0 a;
|
| 34 |
-
color: transparent;
|
| 35 |
-
text-shadow: none;
|
| 36 |
-
background-color: transparent;
|
| 37 |
-
border: 0;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
.input-block-level {
|
| 41 |
-
display: block;
|
| 42 |
-
width: 100%;
|
| 43 |
-
min-height: 30px;
|
| 44 |
-
-webkit-box-sizing: border-box;
|
| 45 |
-
-moz-box-sizing: border-box;
|
| 46 |
-
box-sizing: border-box;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/* Tooltips */
|
| 50 |
-
.tooltip {
|
| 51 |
-
text-shadow: none;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
.tooltip {
|
| 55 |
-
position: absolute;
|
| 56 |
-
z-index: 1030;
|
| 57 |
-
display: block;
|
| 58 |
-
visibility: visible;
|
| 59 |
-
font-size: 11px;
|
| 60 |
-
line-height: 1.4;
|
| 61 |
-
opacity: 0;
|
| 62 |
-
filter: alpha(opacity=0);
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
.tooltip.in {
|
| 66 |
-
opacity: 0.8;
|
| 67 |
-
filter: alpha(opacity=80);
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
.tooltip.top {
|
| 71 |
-
margin-top: -3px;
|
| 72 |
-
padding: 5px 0;
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
.tooltip.right {
|
| 76 |
-
margin-left: 3px;
|
| 77 |
-
padding: 0 5px;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
.tooltip.bottom {
|
| 81 |
-
margin-top: 3px;
|
| 82 |
-
padding: 5px 0;
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
.tooltip.left {
|
| 86 |
-
margin-left: -3px;
|
| 87 |
-
padding: 0 5px;
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
.tooltip-inner {
|
| 91 |
-
max-width: 200px;
|
| 92 |
-
padding: 8px;
|
| 93 |
-
color: #ffffff;
|
| 94 |
-
text-align: center;
|
| 95 |
-
text-decoration: none;
|
| 96 |
-
background-color: #000000;
|
| 97 |
-
-webkit-border-radius: 4px;
|
| 98 |
-
-moz-border-radius: 4px;
|
| 99 |
-
border-radius: 4px;
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
.tooltip-arrow {
|
| 103 |
-
position: absolute;
|
| 104 |
-
width: 0;
|
| 105 |
-
height: 0;
|
| 106 |
-
border-color: transparent;
|
| 107 |
-
border-style: solid;
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
.tooltip.top .tooltip-arrow {
|
| 111 |
-
bottom: 0;
|
| 112 |
-
left: 50%;
|
| 113 |
-
margin-left: -5px;
|
| 114 |
-
border-width: 5px 5px 0;
|
| 115 |
-
border-top-color: #000000;
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
.tooltip.right .tooltip-arrow {
|
| 119 |
-
top: 50%;
|
| 120 |
-
left: 0;
|
| 121 |
-
margin-top: -5px;
|
| 122 |
-
border-width: 5px 5px 5px 0;
|
| 123 |
-
border-right-color: #000000;
|
| 124 |
-
}
|
| 125 |
-
|
| 126 |
-
.tooltip.left .tooltip-arrow {
|
| 127 |
-
top: 50%;
|
| 128 |
-
right: 0;
|
| 129 |
-
margin-top: -5px;
|
| 130 |
-
border-width: 5px 0 5px 5px;
|
| 131 |
-
border-left-color: #000000;
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
.tooltip.bottom .tooltip-arrow {
|
| 135 |
-
top: 0;
|
| 136 |
-
left: 50%;
|
| 137 |
-
margin-left: -5px;
|
| 138 |
-
border-width: 0 5px 5px;
|
| 139 |
-
border-bottom-color: #000000;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
/* Animation */
|
| 143 |
-
.fade {
|
| 144 |
-
opacity: 0;
|
| 145 |
-
-webkit-transition: opacity 0.15s linear;
|
| 146 |
-
-moz-transition: opacity 0.15s linear;
|
| 147 |
-
-o-transition: opacity 0.15s linear;
|
| 148 |
-
transition: opacity 0.15s linear;
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
.fade.in {
|
| 152 |
-
opacity: 1;
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
.collapse {
|
| 156 |
-
position: relative;
|
| 157 |
-
height: 0;
|
| 158 |
-
overflow: hidden;
|
| 159 |
-
-webkit-transition: height 0.35s ease;
|
| 160 |
-
-moz-transition: height 0.35s ease;
|
| 161 |
-
-o-transition: height 0.35s ease;
|
| 162 |
-
transition: height 0.35s ease;
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
.collapse.in {
|
| 166 |
-
height: auto;
|
| 167 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/img/tip.png
DELETED
|
Binary file
|
trunk/classes/admin/settings/assets/js/bootstrap-tooltip.js
DELETED
|
@@ -1,126 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Bootstrap.js by @fat & @mdo
|
| 3 |
-
* plugins: bootstrap-transition.js, bootstrap-tooltip.js
|
| 4 |
-
* 2.3.1
|
| 5 |
-
* Copyright 2012 Twitter, Inc.
|
| 6 |
-
* http://www.apache.org/licenses/LICENSE-2.0.txt
|
| 7 |
-
*/
|
| 8 |
-
!function (a) {
|
| 9 |
-
a(function () {
|
| 10 |
-
a.support.transition = function () {
|
| 11 |
-
var a = function () {
|
| 12 |
-
var a = document.createElement("bootstrap"), b = {WebkitTransition: "webkitTransitionEnd", MozTransition: "transitionend", OTransition: "oTransitionEnd otransitionend", transition: "transitionend"}, c;
|
| 13 |
-
for (c in b)if (a.style[c] !== undefined)return b[c]
|
| 14 |
-
}();
|
| 15 |
-
return a && {end: a}
|
| 16 |
-
}()
|
| 17 |
-
})
|
| 18 |
-
}(window.jQuery), !function (a) {
|
| 19 |
-
var b = function (a, b) {
|
| 20 |
-
this.init("tooltip", a, b)
|
| 21 |
-
};
|
| 22 |
-
b.prototype = {constructor: b, init: function (b, c, d) {
|
| 23 |
-
var e, f, g, h, i;
|
| 24 |
-
this.type = b, this.$element = a(c), this.options = this.getOptions(d), this.enabled = !0, g = this.options.trigger.split(" ");
|
| 25 |
-
for (i = g.length; i--;)h = g[i], h == "click" ? this.$element.on("click." + this.type, this.options.selector, a.proxy(this.toggle, this)) : h != "manual" && (e = h == "hover" ? "mouseenter" : "focus", f = h == "hover" ? "mouseleave" : "blur", this.$element.on(e + "." + this.type, this.options.selector, a.proxy(this.enter, this)), this.$element.on(f + "." + this.type, this.options.selector, a.proxy(this.leave, this)));
|
| 26 |
-
this.options.selector ? this._options = a.extend({}, this.options, {trigger: "manual", selector: ""}) : this.fixTitle()
|
| 27 |
-
}, getOptions: function (b) {
|
| 28 |
-
return b = a.extend({}, a.fn[this.type].defaults, this.$element.data(), b), b.delay && typeof b.delay == "number" && (b.delay = {show: b.delay, hide: b.delay}), b
|
| 29 |
-
}, enter: function (b) {
|
| 30 |
-
var c = a.fn[this.type].defaults, d = {}, e;
|
| 31 |
-
this._options && a.each(this._options, function (a, b) {
|
| 32 |
-
c[a] != b && (d[a] = b)
|
| 33 |
-
}, this), e = a(b.currentTarget)[this.type](d).data(this.type);
|
| 34 |
-
if (!e.options.delay || !e.options.delay.show)return e.show();
|
| 35 |
-
clearTimeout(this.timeout), e.hoverState = "in", this.timeout = setTimeout(function () {
|
| 36 |
-
e.hoverState == "in" && e.show()
|
| 37 |
-
}, e.options.delay.show)
|
| 38 |
-
}, leave: function (b) {
|
| 39 |
-
var c = a(b.currentTarget)[this.type](this._options).data(this.type);
|
| 40 |
-
this.timeout && clearTimeout(this.timeout);
|
| 41 |
-
if (!c.options.delay || !c.options.delay.hide)return c.hide();
|
| 42 |
-
c.hoverState = "out", this.timeout = setTimeout(function () {
|
| 43 |
-
c.hoverState == "out" && c.hide()
|
| 44 |
-
}, c.options.delay.hide)
|
| 45 |
-
}, show: function () {
|
| 46 |
-
var b, c, d, e, f, g, h = a.Event("show");
|
| 47 |
-
if (this.hasContent() && this.enabled) {
|
| 48 |
-
this.$element.trigger(h);
|
| 49 |
-
if (h.isDefaultPrevented())return;
|
| 50 |
-
b = this.tip(), this.setContent(), this.options.animation && b.addClass("fade"), f = typeof this.options.placement == "function" ? this.options.placement.call(this, b[0], this.$element[0]) : this.options.placement, b.detach().css({top: 0, left: 0, display: "block"}), this.options.container ? b.appendTo(this.options.container) : b.insertAfter(this.$element), c = this.getPosition(), d = b[0].offsetWidth, e = b[0].offsetHeight;
|
| 51 |
-
switch (f) {
|
| 52 |
-
case"bottom":
|
| 53 |
-
g = {top: c.top + c.height, left: c.left + c.width / 2 - d / 2};
|
| 54 |
-
break;
|
| 55 |
-
case"top":
|
| 56 |
-
g = {top: c.top - e, left: c.left + c.width / 2 - d / 2};
|
| 57 |
-
break;
|
| 58 |
-
case"left":
|
| 59 |
-
g = {top: c.top + c.height / 2 - e / 2, left: c.left - d};
|
| 60 |
-
break;
|
| 61 |
-
case"right":
|
| 62 |
-
g = {top: c.top + c.height / 2 - e / 2, left: c.left + c.width}
|
| 63 |
-
}
|
| 64 |
-
this.applyPlacement(g, f), this.$element.trigger("shown")
|
| 65 |
-
}
|
| 66 |
-
}, applyPlacement: function (a, b) {
|
| 67 |
-
var c = this.tip(), d = c[0].offsetWidth, e = c[0].offsetHeight, f, g, h, i;
|
| 68 |
-
c.offset(a).addClass(b).addClass("in"), f = c[0].offsetWidth, g = c[0].offsetHeight, b == "top" && g != e && (a.top = a.top + e - g, i = !0), b == "bottom" || b == "top" ? (h = 0, a.left < 0 && (h = a.left * -2, a.left = 0, c.offset(a), f = c[0].offsetWidth, g = c[0].offsetHeight), this.replaceArrow(h - d + f, f, "left")) : this.replaceArrow(g - e, g, "top"), i && c.offset(a)
|
| 69 |
-
}, replaceArrow: function (a, b, c) {
|
| 70 |
-
this.arrow().css(c, a ? 50 * (1 - a / b) + "%" : "")
|
| 71 |
-
}, setContent: function () {
|
| 72 |
-
var a = this.tip(), b = this.getTitle();
|
| 73 |
-
a.find(".tooltip-inner")[this.options.html ? "html" : "text"](b), a.removeClass("fade in top bottom left right")
|
| 74 |
-
}, hide: function () {
|
| 75 |
-
function e() {
|
| 76 |
-
var b = setTimeout(function () {
|
| 77 |
-
c.off(a.support.transition.end).detach()
|
| 78 |
-
}, 500);
|
| 79 |
-
c.one(a.support.transition.end, function () {
|
| 80 |
-
clearTimeout(b), c.detach()
|
| 81 |
-
})
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
var b = this, c = this.tip(), d = a.Event("hide");
|
| 85 |
-
this.$element.trigger(d);
|
| 86 |
-
if (d.isDefaultPrevented())return;
|
| 87 |
-
return c.removeClass("in"), a.support.transition && this.$tip.hasClass("fade") ? e() : c.detach(), this.$element.trigger("hidden"), this
|
| 88 |
-
}, fixTitle: function () {
|
| 89 |
-
var a = this.$element;
|
| 90 |
-
(a.attr("title") || typeof a.attr("data-original-title") != "string") && a.attr("data-original-title", a.attr("title") || "").attr("title", "")
|
| 91 |
-
}, hasContent: function () {
|
| 92 |
-
return this.getTitle()
|
| 93 |
-
}, getPosition: function () {
|
| 94 |
-
var b = this.$element[0];
|
| 95 |
-
return a.extend({}, typeof b.getBoundingClientRect == "function" ? b.getBoundingClientRect() : {width: b.offsetWidth, height: b.offsetHeight}, this.$element.offset())
|
| 96 |
-
}, getTitle: function () {
|
| 97 |
-
var a, b = this.$element, c = this.options;
|
| 98 |
-
return a = b.attr("data-original-title") || (typeof c.title == "function" ? c.title.call(b[0]) : c.title), a
|
| 99 |
-
}, tip: function () {
|
| 100 |
-
return this.$tip = this.$tip || a(this.options.template)
|
| 101 |
-
}, arrow: function () {
|
| 102 |
-
return this.$arrow = this.$arrow || this.tip().find(".tooltip-arrow")
|
| 103 |
-
}, validate: function () {
|
| 104 |
-
this.$element[0].parentNode || (this.hide(), this.$element = null, this.options = null)
|
| 105 |
-
}, enable: function () {
|
| 106 |
-
this.enabled = !0
|
| 107 |
-
}, disable: function () {
|
| 108 |
-
this.enabled = !1
|
| 109 |
-
}, toggleEnabled: function () {
|
| 110 |
-
this.enabled = !this.enabled
|
| 111 |
-
}, toggle: function (b) {
|
| 112 |
-
var c = b ? a(b.currentTarget)[this.type](this._options).data(this.type) : this;
|
| 113 |
-
c.tip().hasClass("in") ? c.hide() : c.show()
|
| 114 |
-
}, destroy: function () {
|
| 115 |
-
this.hide().$element.off("." + this.type).removeData(this.type)
|
| 116 |
-
}};
|
| 117 |
-
var c = a.fn.tooltip;
|
| 118 |
-
a.fn.tooltip = function (c) {
|
| 119 |
-
return this.each(function () {
|
| 120 |
-
var d = a(this), e = d.data("tooltip"), f = typeof c == "object" && c;
|
| 121 |
-
e || d.data("tooltip", e = new b(this, f)), typeof c == "string" && e[c]()
|
| 122 |
-
})
|
| 123 |
-
}, a.fn.tooltip.Constructor = b, a.fn.tooltip.defaults = {animation: !0, placement: "top", selector: !1, template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>', trigger: "hover focus", title: "", delay: 0, html: !1, container: !1}, a.fn.tooltip.noConflict = function () {
|
| 124 |
-
return a.fn.tooltip = c, this
|
| 125 |
-
}
|
| 126 |
-
}(window.jQuery)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/js/js.iml
DELETED
|
@@ -1,10 +0,0 @@
|
|
| 1 |
-
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
-
<module type="WEB_MODULE" version="4">
|
| 3 |
-
<component name="NewModuleRootManager" inherit-compiler-output="true">
|
| 4 |
-
<exclude-output />
|
| 5 |
-
<content url="file://$MODULE_DIR$" />
|
| 6 |
-
<orderEntry type="inheritedJdk" />
|
| 7 |
-
<orderEntry type="sourceFolder" forTests="false" />
|
| 8 |
-
</component>
|
| 9 |
-
</module>
|
| 10 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/js/select2/select2-bootstrap.css
DELETED
|
@@ -1,87 +0,0 @@
|
|
| 1 |
-
.form-control .select2-choice {
|
| 2 |
-
border: 0;
|
| 3 |
-
border-radius: 2px;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
.form-control .select2-choice .select2-arrow {
|
| 7 |
-
border-radius: 0 2px 2px 0;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
.form-control.select2-container {
|
| 11 |
-
height: auto !important;
|
| 12 |
-
padding: 0;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
.form-control.select2-container.select2-dropdown-open {
|
| 16 |
-
border-color: #5897FB;
|
| 17 |
-
border-radius: 3px 3px 0 0;
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
| 21 |
-
border-radius: 3px 3px 0 0;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.form-control.select2-container .select2-choices {
|
| 25 |
-
border: 0 !important;
|
| 26 |
-
border-radius: 3px;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
.control-group.warning .select2-container .select2-choice,
|
| 30 |
-
.control-group.warning .select2-container .select2-choices,
|
| 31 |
-
.control-group.warning .select2-container-active .select2-choice,
|
| 32 |
-
.control-group.warning .select2-container-active .select2-choices,
|
| 33 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 34 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 35 |
-
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
| 36 |
-
border: 1px solid #C09853 !important;
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
.control-group.warning .select2-container .select2-choice div {
|
| 40 |
-
border-left: 1px solid #C09853 !important;
|
| 41 |
-
background: #FCF8E3 !important;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
.control-group.error .select2-container .select2-choice,
|
| 45 |
-
.control-group.error .select2-container .select2-choices,
|
| 46 |
-
.control-group.error .select2-container-active .select2-choice,
|
| 47 |
-
.control-group.error .select2-container-active .select2-choices,
|
| 48 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 49 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 50 |
-
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
| 51 |
-
border: 1px solid #B94A48 !important;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
.control-group.error .select2-container .select2-choice div {
|
| 55 |
-
border-left: 1px solid #B94A48 !important;
|
| 56 |
-
background: #F2DEDE !important;
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
.control-group.info .select2-container .select2-choice,
|
| 60 |
-
.control-group.info .select2-container .select2-choices,
|
| 61 |
-
.control-group.info .select2-container-active .select2-choice,
|
| 62 |
-
.control-group.info .select2-container-active .select2-choices,
|
| 63 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 64 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 65 |
-
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
| 66 |
-
border: 1px solid #3A87AD !important;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
.control-group.info .select2-container .select2-choice div {
|
| 70 |
-
border-left: 1px solid #3A87AD !important;
|
| 71 |
-
background: #D9EDF7 !important;
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
.control-group.success .select2-container .select2-choice,
|
| 75 |
-
.control-group.success .select2-container .select2-choices,
|
| 76 |
-
.control-group.success .select2-container-active .select2-choice,
|
| 77 |
-
.control-group.success .select2-container-active .select2-choices,
|
| 78 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 79 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 80 |
-
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
| 81 |
-
border: 1px solid #468847 !important;
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
.control-group.success .select2-container .select2-choice div {
|
| 85 |
-
border-left: 1px solid #468847 !important;
|
| 86 |
-
background: #DFF0D8 !important;
|
| 87 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/js/select2/select2-spinner.gif
DELETED
|
Binary file
|
trunk/classes/admin/settings/assets/js/select2/select2.css
DELETED
|
@@ -1,704 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 3 |
-
*/
|
| 4 |
-
.select2-container {
|
| 5 |
-
margin: 0;
|
| 6 |
-
position: relative;
|
| 7 |
-
display: inline-block;
|
| 8 |
-
/* inline-block for ie7 */
|
| 9 |
-
zoom: 1;
|
| 10 |
-
*display: inline;
|
| 11 |
-
vertical-align: middle;
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
.select2-container,
|
| 15 |
-
.select2-drop,
|
| 16 |
-
.select2-search,
|
| 17 |
-
.select2-search input {
|
| 18 |
-
/*
|
| 19 |
-
Force border-box so that % widths fit the parent
|
| 20 |
-
container without overlap because of margin/padding.
|
| 21 |
-
More Info : http://www.quirksmode.org/css/box.html
|
| 22 |
-
*/
|
| 23 |
-
-webkit-box-sizing: border-box; /* webkit */
|
| 24 |
-
-moz-box-sizing: border-box; /* firefox */
|
| 25 |
-
box-sizing: border-box; /* css3 */
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
.select2-container .select2-choice {
|
| 29 |
-
display: block;
|
| 30 |
-
height: 26px;
|
| 31 |
-
padding: 0 0 0 8px;
|
| 32 |
-
overflow: hidden;
|
| 33 |
-
position: relative;
|
| 34 |
-
|
| 35 |
-
border: 1px solid #aaa;
|
| 36 |
-
white-space: nowrap;
|
| 37 |
-
line-height: 26px;
|
| 38 |
-
color: #444;
|
| 39 |
-
text-decoration: none;
|
| 40 |
-
|
| 41 |
-
border-radius: 4px;
|
| 42 |
-
|
| 43 |
-
background-clip: padding-box;
|
| 44 |
-
|
| 45 |
-
-webkit-touch-callout: none;
|
| 46 |
-
-webkit-user-select: none;
|
| 47 |
-
-moz-user-select: none;
|
| 48 |
-
-ms-user-select: none;
|
| 49 |
-
user-select: none;
|
| 50 |
-
|
| 51 |
-
background-color: #fff;
|
| 52 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 53 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 55 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 56 |
-
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
html[dir="rtl"] .select2-container .select2-choice {
|
| 60 |
-
padding: 0 8px 0 0;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
.select2-container.select2-drop-above .select2-choice {
|
| 64 |
-
border-bottom-color: #aaa;
|
| 65 |
-
|
| 66 |
-
border-radius: 0 0 4px 4px;
|
| 67 |
-
|
| 68 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
| 69 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 70 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 71 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 72 |
-
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
| 76 |
-
margin-right: 42px;
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
.select2-container .select2-choice > .select2-chosen {
|
| 80 |
-
margin-right: 26px;
|
| 81 |
-
display: block;
|
| 82 |
-
overflow: hidden;
|
| 83 |
-
|
| 84 |
-
white-space: nowrap;
|
| 85 |
-
|
| 86 |
-
text-overflow: ellipsis;
|
| 87 |
-
float: none;
|
| 88 |
-
width: auto;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
| 92 |
-
margin-left: 26px;
|
| 93 |
-
margin-right: 0;
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
.select2-container .select2-choice abbr {
|
| 97 |
-
display: none;
|
| 98 |
-
width: 12px;
|
| 99 |
-
height: 12px;
|
| 100 |
-
position: absolute;
|
| 101 |
-
right: 24px;
|
| 102 |
-
top: 8px;
|
| 103 |
-
|
| 104 |
-
font-size: 1px;
|
| 105 |
-
text-decoration: none;
|
| 106 |
-
|
| 107 |
-
border: 0;
|
| 108 |
-
background: url('select2.png') right top no-repeat;
|
| 109 |
-
cursor: pointer;
|
| 110 |
-
outline: 0;
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
.select2-container.select2-allowclear .select2-choice abbr {
|
| 114 |
-
display: inline-block;
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
.select2-container .select2-choice abbr:hover {
|
| 118 |
-
background-position: right -11px;
|
| 119 |
-
cursor: pointer;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
.select2-drop-mask {
|
| 123 |
-
border: 0;
|
| 124 |
-
margin: 0;
|
| 125 |
-
padding: 0;
|
| 126 |
-
position: fixed;
|
| 127 |
-
left: 0;
|
| 128 |
-
top: 0;
|
| 129 |
-
min-height: 100%;
|
| 130 |
-
min-width: 100%;
|
| 131 |
-
height: auto;
|
| 132 |
-
width: auto;
|
| 133 |
-
opacity: 0;
|
| 134 |
-
z-index: 9998;
|
| 135 |
-
/* styles required for IE to work */
|
| 136 |
-
background-color: #fff;
|
| 137 |
-
filter: alpha(opacity=0);
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
.select2-drop {
|
| 141 |
-
width: 100%;
|
| 142 |
-
margin-top: -1px;
|
| 143 |
-
position: absolute;
|
| 144 |
-
z-index: 9999;
|
| 145 |
-
top: 100%;
|
| 146 |
-
|
| 147 |
-
background: #fff;
|
| 148 |
-
color: #000;
|
| 149 |
-
border: 1px solid #aaa;
|
| 150 |
-
border-top: 0;
|
| 151 |
-
|
| 152 |
-
border-radius: 0 0 4px 4px;
|
| 153 |
-
|
| 154 |
-
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 155 |
-
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
.select2-drop.select2-drop-above {
|
| 159 |
-
margin-top: 1px;
|
| 160 |
-
border-top: 1px solid #aaa;
|
| 161 |
-
border-bottom: 0;
|
| 162 |
-
|
| 163 |
-
border-radius: 4px 4px 0 0;
|
| 164 |
-
|
| 165 |
-
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 166 |
-
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 167 |
-
}
|
| 168 |
-
|
| 169 |
-
.select2-drop-active {
|
| 170 |
-
border: 1px solid #5897fb;
|
| 171 |
-
border-top: none;
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
.select2-drop.select2-drop-above.select2-drop-active {
|
| 175 |
-
border-top: 1px solid #5897fb;
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
.select2-drop-auto-width {
|
| 179 |
-
border-top: 1px solid #aaa;
|
| 180 |
-
width: auto;
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
.select2-drop-auto-width .select2-search {
|
| 184 |
-
padding-top: 4px;
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
-
.select2-container .select2-choice .select2-arrow {
|
| 188 |
-
display: inline-block;
|
| 189 |
-
width: 18px;
|
| 190 |
-
height: 100%;
|
| 191 |
-
position: absolute;
|
| 192 |
-
right: 0;
|
| 193 |
-
top: 0;
|
| 194 |
-
|
| 195 |
-
border-left: 1px solid #aaa;
|
| 196 |
-
border-radius: 0 4px 4px 0;
|
| 197 |
-
|
| 198 |
-
background-clip: padding-box;
|
| 199 |
-
|
| 200 |
-
background: #ccc;
|
| 201 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
| 202 |
-
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 203 |
-
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 204 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 205 |
-
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
| 209 |
-
left: 0;
|
| 210 |
-
right: auto;
|
| 211 |
-
|
| 212 |
-
border-left: none;
|
| 213 |
-
border-right: 1px solid #aaa;
|
| 214 |
-
border-radius: 4px 0 0 4px;
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
.select2-container .select2-choice .select2-arrow b {
|
| 218 |
-
display: block;
|
| 219 |
-
width: 100%;
|
| 220 |
-
height: 100%;
|
| 221 |
-
background: url('select2.png') no-repeat 0 1px;
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
| 225 |
-
background-position: 2px 1px;
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
.select2-search {
|
| 229 |
-
display: inline-block;
|
| 230 |
-
width: 100%;
|
| 231 |
-
min-height: 26px;
|
| 232 |
-
margin: 0;
|
| 233 |
-
padding-left: 4px;
|
| 234 |
-
padding-right: 4px;
|
| 235 |
-
|
| 236 |
-
position: relative;
|
| 237 |
-
z-index: 10000;
|
| 238 |
-
|
| 239 |
-
white-space: nowrap;
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
.select2-search input {
|
| 243 |
-
width: 100%;
|
| 244 |
-
height: auto !important;
|
| 245 |
-
min-height: 26px;
|
| 246 |
-
padding: 4px 20px 4px 5px;
|
| 247 |
-
margin: 0;
|
| 248 |
-
|
| 249 |
-
outline: 0;
|
| 250 |
-
font-family: sans-serif;
|
| 251 |
-
font-size: 1em;
|
| 252 |
-
|
| 253 |
-
border: 1px solid #aaa;
|
| 254 |
-
border-radius: 0;
|
| 255 |
-
|
| 256 |
-
-webkit-box-shadow: none;
|
| 257 |
-
box-shadow: none;
|
| 258 |
-
|
| 259 |
-
background: #fff url('select2.png') no-repeat 100% -22px;
|
| 260 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 261 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 262 |
-
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 263 |
-
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
html[dir="rtl"] .select2-search input {
|
| 267 |
-
padding: 4px 5px 4px 20px;
|
| 268 |
-
|
| 269 |
-
background: #fff url('select2.png') no-repeat -37px -22px;
|
| 270 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 271 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 272 |
-
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 273 |
-
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 274 |
-
}
|
| 275 |
-
|
| 276 |
-
.select2-drop.select2-drop-above .select2-search input {
|
| 277 |
-
margin-top: 4px;
|
| 278 |
-
}
|
| 279 |
-
|
| 280 |
-
.select2-search input.select2-active {
|
| 281 |
-
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
| 282 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 283 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 284 |
-
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 285 |
-
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
.select2-container-active .select2-choice,
|
| 289 |
-
.select2-container-active .select2-choices {
|
| 290 |
-
border: 1px solid #5897fb;
|
| 291 |
-
outline: none;
|
| 292 |
-
|
| 293 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 294 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
.select2-dropdown-open .select2-choice {
|
| 298 |
-
border-bottom-color: transparent;
|
| 299 |
-
-webkit-box-shadow: 0 1px 0 #fff inset;
|
| 300 |
-
box-shadow: 0 1px 0 #fff inset;
|
| 301 |
-
|
| 302 |
-
border-bottom-left-radius: 0;
|
| 303 |
-
border-bottom-right-radius: 0;
|
| 304 |
-
|
| 305 |
-
background-color: #eee;
|
| 306 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 307 |
-
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 308 |
-
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 309 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 310 |
-
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
.select2-dropdown-open.select2-drop-above .select2-choice,
|
| 314 |
-
.select2-dropdown-open.select2-drop-above .select2-choices {
|
| 315 |
-
border: 1px solid #5897fb;
|
| 316 |
-
border-top-color: transparent;
|
| 317 |
-
|
| 318 |
-
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 319 |
-
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 320 |
-
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 321 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 322 |
-
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
| 323 |
-
}
|
| 324 |
-
|
| 325 |
-
.select2-dropdown-open .select2-choice .select2-arrow {
|
| 326 |
-
background: transparent;
|
| 327 |
-
border-left: none;
|
| 328 |
-
filter: none;
|
| 329 |
-
}
|
| 330 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
| 331 |
-
border-right: none;
|
| 332 |
-
}
|
| 333 |
-
|
| 334 |
-
.select2-dropdown-open .select2-choice .select2-arrow b {
|
| 335 |
-
background-position: -18px 1px;
|
| 336 |
-
}
|
| 337 |
-
|
| 338 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
| 339 |
-
background-position: -16px 1px;
|
| 340 |
-
}
|
| 341 |
-
|
| 342 |
-
.select2-hidden-accessible {
|
| 343 |
-
border: 0;
|
| 344 |
-
clip: rect(0 0 0 0);
|
| 345 |
-
height: 1px;
|
| 346 |
-
margin: -1px;
|
| 347 |
-
overflow: hidden;
|
| 348 |
-
padding: 0;
|
| 349 |
-
position: absolute;
|
| 350 |
-
width: 1px;
|
| 351 |
-
}
|
| 352 |
-
|
| 353 |
-
/* results */
|
| 354 |
-
.select2-results {
|
| 355 |
-
max-height: 200px;
|
| 356 |
-
padding: 0 0 0 4px;
|
| 357 |
-
margin: 4px 4px 4px 0;
|
| 358 |
-
position: relative;
|
| 359 |
-
overflow-x: hidden;
|
| 360 |
-
overflow-y: auto;
|
| 361 |
-
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
html[dir="rtl"] .select2-results {
|
| 365 |
-
padding: 0 4px 0 0;
|
| 366 |
-
margin: 4px 0 4px 4px;
|
| 367 |
-
}
|
| 368 |
-
|
| 369 |
-
.select2-results ul.select2-result-sub {
|
| 370 |
-
margin: 0;
|
| 371 |
-
padding-left: 0;
|
| 372 |
-
}
|
| 373 |
-
|
| 374 |
-
.select2-results li {
|
| 375 |
-
list-style: none;
|
| 376 |
-
display: list-item;
|
| 377 |
-
background-image: none;
|
| 378 |
-
}
|
| 379 |
-
|
| 380 |
-
.select2-results li.select2-result-with-children > .select2-result-label {
|
| 381 |
-
font-weight: bold;
|
| 382 |
-
}
|
| 383 |
-
|
| 384 |
-
.select2-results .select2-result-label {
|
| 385 |
-
padding: 3px 7px 4px;
|
| 386 |
-
margin: 0;
|
| 387 |
-
cursor: pointer;
|
| 388 |
-
|
| 389 |
-
min-height: 1em;
|
| 390 |
-
|
| 391 |
-
-webkit-touch-callout: none;
|
| 392 |
-
-webkit-user-select: none;
|
| 393 |
-
-moz-user-select: none;
|
| 394 |
-
-ms-user-select: none;
|
| 395 |
-
user-select: none;
|
| 396 |
-
}
|
| 397 |
-
|
| 398 |
-
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
| 399 |
-
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
| 400 |
-
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
| 401 |
-
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
| 402 |
-
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
| 403 |
-
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
| 404 |
-
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
| 405 |
-
|
| 406 |
-
.select2-results .select2-highlighted {
|
| 407 |
-
background: #3875d7;
|
| 408 |
-
color: #fff;
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
.select2-results li em {
|
| 412 |
-
background: #feffde;
|
| 413 |
-
font-style: normal;
|
| 414 |
-
}
|
| 415 |
-
|
| 416 |
-
.select2-results .select2-highlighted em {
|
| 417 |
-
background: transparent;
|
| 418 |
-
}
|
| 419 |
-
|
| 420 |
-
.select2-results .select2-highlighted ul {
|
| 421 |
-
background: #fff;
|
| 422 |
-
color: #000;
|
| 423 |
-
}
|
| 424 |
-
|
| 425 |
-
.select2-results .select2-no-results,
|
| 426 |
-
.select2-results .select2-searching,
|
| 427 |
-
.select2-results .select2-ajax-error,
|
| 428 |
-
.select2-results .select2-selection-limit {
|
| 429 |
-
background: #f4f4f4;
|
| 430 |
-
display: list-item;
|
| 431 |
-
padding-left: 5px;
|
| 432 |
-
}
|
| 433 |
-
|
| 434 |
-
/*
|
| 435 |
-
disabled look for disabled choices in the results dropdown
|
| 436 |
-
*/
|
| 437 |
-
.select2-results .select2-disabled.select2-highlighted {
|
| 438 |
-
color: #666;
|
| 439 |
-
background: #f4f4f4;
|
| 440 |
-
display: list-item;
|
| 441 |
-
cursor: default;
|
| 442 |
-
}
|
| 443 |
-
.select2-results .select2-disabled {
|
| 444 |
-
background: #f4f4f4;
|
| 445 |
-
display: list-item;
|
| 446 |
-
cursor: default;
|
| 447 |
-
}
|
| 448 |
-
|
| 449 |
-
.select2-results .select2-selected {
|
| 450 |
-
display: none;
|
| 451 |
-
}
|
| 452 |
-
|
| 453 |
-
.select2-more-results.select2-active {
|
| 454 |
-
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
| 455 |
-
}
|
| 456 |
-
|
| 457 |
-
.select2-results .select2-ajax-error {
|
| 458 |
-
background: rgba(255, 50, 50, .2);
|
| 459 |
-
}
|
| 460 |
-
|
| 461 |
-
.select2-more-results {
|
| 462 |
-
background: #f4f4f4;
|
| 463 |
-
display: list-item;
|
| 464 |
-
}
|
| 465 |
-
|
| 466 |
-
/* disabled styles */
|
| 467 |
-
|
| 468 |
-
.select2-container.select2-container-disabled .select2-choice {
|
| 469 |
-
background-color: #f4f4f4;
|
| 470 |
-
background-image: none;
|
| 471 |
-
border: 1px solid #ddd;
|
| 472 |
-
cursor: default;
|
| 473 |
-
}
|
| 474 |
-
|
| 475 |
-
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
| 476 |
-
background-color: #f4f4f4;
|
| 477 |
-
background-image: none;
|
| 478 |
-
border-left: 0;
|
| 479 |
-
}
|
| 480 |
-
|
| 481 |
-
.select2-container.select2-container-disabled .select2-choice abbr {
|
| 482 |
-
display: none;
|
| 483 |
-
}
|
| 484 |
-
|
| 485 |
-
|
| 486 |
-
/* multiselect */
|
| 487 |
-
|
| 488 |
-
.select2-container-multi .select2-choices {
|
| 489 |
-
height: auto !important;
|
| 490 |
-
height: 1%;
|
| 491 |
-
margin: 0;
|
| 492 |
-
padding: 0 5px 0 0;
|
| 493 |
-
position: relative;
|
| 494 |
-
|
| 495 |
-
border: 1px solid #aaa;
|
| 496 |
-
cursor: text;
|
| 497 |
-
overflow: hidden;
|
| 498 |
-
|
| 499 |
-
background-color: #fff;
|
| 500 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
| 501 |
-
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
| 502 |
-
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
| 503 |
-
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
| 504 |
-
}
|
| 505 |
-
|
| 506 |
-
html[dir="rtl"] .select2-container-multi .select2-choices {
|
| 507 |
-
padding: 0 0 0 5px;
|
| 508 |
-
}
|
| 509 |
-
|
| 510 |
-
.select2-locked {
|
| 511 |
-
padding: 3px 5px 3px 5px !important;
|
| 512 |
-
}
|
| 513 |
-
|
| 514 |
-
.select2-container-multi .select2-choices {
|
| 515 |
-
min-height: 26px;
|
| 516 |
-
}
|
| 517 |
-
|
| 518 |
-
.select2-container-multi.select2-container-active .select2-choices {
|
| 519 |
-
border: 1px solid #5897fb;
|
| 520 |
-
outline: none;
|
| 521 |
-
|
| 522 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 523 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 524 |
-
}
|
| 525 |
-
.select2-container-multi .select2-choices li {
|
| 526 |
-
float: left;
|
| 527 |
-
list-style: none;
|
| 528 |
-
}
|
| 529 |
-
html[dir="rtl"] .select2-container-multi .select2-choices li
|
| 530 |
-
{
|
| 531 |
-
float: right;
|
| 532 |
-
}
|
| 533 |
-
.select2-container-multi .select2-choices .select2-search-field {
|
| 534 |
-
margin: 0;
|
| 535 |
-
padding: 0;
|
| 536 |
-
white-space: nowrap;
|
| 537 |
-
}
|
| 538 |
-
|
| 539 |
-
.select2-container-multi .select2-choices .select2-search-field input {
|
| 540 |
-
padding: 5px;
|
| 541 |
-
margin: 1px 0;
|
| 542 |
-
|
| 543 |
-
font-family: sans-serif;
|
| 544 |
-
font-size: 100%;
|
| 545 |
-
color: #666;
|
| 546 |
-
outline: 0;
|
| 547 |
-
border: 0;
|
| 548 |
-
-webkit-box-shadow: none;
|
| 549 |
-
box-shadow: none;
|
| 550 |
-
background: transparent !important;
|
| 551 |
-
}
|
| 552 |
-
|
| 553 |
-
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
| 554 |
-
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
| 555 |
-
}
|
| 556 |
-
|
| 557 |
-
.select2-default {
|
| 558 |
-
color: #999 !important;
|
| 559 |
-
}
|
| 560 |
-
|
| 561 |
-
.select2-container-multi .select2-choices .select2-search-choice {
|
| 562 |
-
padding: 3px 5px 3px 18px;
|
| 563 |
-
margin: 3px 0 3px 5px;
|
| 564 |
-
position: relative;
|
| 565 |
-
|
| 566 |
-
line-height: 13px;
|
| 567 |
-
color: #333;
|
| 568 |
-
cursor: default;
|
| 569 |
-
border: 1px solid #aaaaaa;
|
| 570 |
-
|
| 571 |
-
border-radius: 3px;
|
| 572 |
-
|
| 573 |
-
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 574 |
-
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 575 |
-
|
| 576 |
-
background-clip: padding-box;
|
| 577 |
-
|
| 578 |
-
-webkit-touch-callout: none;
|
| 579 |
-
-webkit-user-select: none;
|
| 580 |
-
-moz-user-select: none;
|
| 581 |
-
-ms-user-select: none;
|
| 582 |
-
user-select: none;
|
| 583 |
-
|
| 584 |
-
background-color: #e4e4e4;
|
| 585 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
| 586 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
| 587 |
-
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 588 |
-
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 589 |
-
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 590 |
-
}
|
| 591 |
-
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
| 592 |
-
{
|
| 593 |
-
margin: 3px 5px 3px 0;
|
| 594 |
-
padding: 3px 18px 3px 5px;
|
| 595 |
-
}
|
| 596 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
| 597 |
-
cursor: default;
|
| 598 |
-
}
|
| 599 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
| 600 |
-
background: #d4d4d4;
|
| 601 |
-
}
|
| 602 |
-
|
| 603 |
-
.select2-search-choice-close {
|
| 604 |
-
display: block;
|
| 605 |
-
width: 12px;
|
| 606 |
-
height: 13px;
|
| 607 |
-
position: absolute;
|
| 608 |
-
right: 3px;
|
| 609 |
-
top: 4px;
|
| 610 |
-
|
| 611 |
-
font-size: 1px;
|
| 612 |
-
outline: none;
|
| 613 |
-
background: url('select2.png') right top no-repeat;
|
| 614 |
-
}
|
| 615 |
-
html[dir="rtl"] .select2-search-choice-close {
|
| 616 |
-
right: auto;
|
| 617 |
-
left: 3px;
|
| 618 |
-
}
|
| 619 |
-
|
| 620 |
-
.select2-container-multi .select2-search-choice-close {
|
| 621 |
-
left: 3px;
|
| 622 |
-
}
|
| 623 |
-
|
| 624 |
-
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
| 625 |
-
left: auto;
|
| 626 |
-
right: 2px;
|
| 627 |
-
}
|
| 628 |
-
|
| 629 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
| 630 |
-
background-position: right -11px;
|
| 631 |
-
}
|
| 632 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
| 633 |
-
background-position: right -11px;
|
| 634 |
-
}
|
| 635 |
-
|
| 636 |
-
/* disabled styles */
|
| 637 |
-
.select2-container-multi.select2-container-disabled .select2-choices {
|
| 638 |
-
background-color: #f4f4f4;
|
| 639 |
-
background-image: none;
|
| 640 |
-
border: 1px solid #ddd;
|
| 641 |
-
cursor: default;
|
| 642 |
-
}
|
| 643 |
-
|
| 644 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
| 645 |
-
padding: 3px 5px 3px 5px;
|
| 646 |
-
border: 1px solid #ddd;
|
| 647 |
-
background-image: none;
|
| 648 |
-
background-color: #f4f4f4;
|
| 649 |
-
}
|
| 650 |
-
|
| 651 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
| 652 |
-
background: none;
|
| 653 |
-
}
|
| 654 |
-
/* end multiselect */
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
.select2-result-selectable .select2-match,
|
| 658 |
-
.select2-result-unselectable .select2-match {
|
| 659 |
-
text-decoration: underline;
|
| 660 |
-
}
|
| 661 |
-
|
| 662 |
-
.select2-offscreen, .select2-offscreen:focus {
|
| 663 |
-
clip: rect(0 0 0 0) !important;
|
| 664 |
-
width: 1px !important;
|
| 665 |
-
height: 1px !important;
|
| 666 |
-
border: 0 !important;
|
| 667 |
-
margin: 0 !important;
|
| 668 |
-
padding: 0 !important;
|
| 669 |
-
overflow: hidden !important;
|
| 670 |
-
position: absolute !important;
|
| 671 |
-
outline: 0 !important;
|
| 672 |
-
left: 0px !important;
|
| 673 |
-
top: 0px !important;
|
| 674 |
-
}
|
| 675 |
-
|
| 676 |
-
.select2-display-none {
|
| 677 |
-
display: none;
|
| 678 |
-
}
|
| 679 |
-
|
| 680 |
-
.select2-measure-scrollbar {
|
| 681 |
-
position: absolute;
|
| 682 |
-
top: -10000px;
|
| 683 |
-
left: -10000px;
|
| 684 |
-
width: 100px;
|
| 685 |
-
height: 100px;
|
| 686 |
-
overflow: scroll;
|
| 687 |
-
}
|
| 688 |
-
|
| 689 |
-
/* Retina-ize icons */
|
| 690 |
-
|
| 691 |
-
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
| 692 |
-
.select2-search input,
|
| 693 |
-
.select2-search-choice-close,
|
| 694 |
-
.select2-container .select2-choice abbr,
|
| 695 |
-
.select2-container .select2-choice .select2-arrow b {
|
| 696 |
-
background-image: url('select2x2.png') !important;
|
| 697 |
-
background-repeat: no-repeat !important;
|
| 698 |
-
background-size: 60px 40px !important;
|
| 699 |
-
}
|
| 700 |
-
|
| 701 |
-
.select2-search input {
|
| 702 |
-
background-position: 100% -21px !important;
|
| 703 |
-
}
|
| 704 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/js/select2/select2.js
DELETED
|
@@ -1,3541 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Copyright 2012 Igor Vaynberg
|
| 3 |
-
|
| 4 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
-
|
| 6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
-
License or the GPL License.
|
| 10 |
-
|
| 11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
-
|
| 13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
-
|
| 16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the
|
| 17 |
-
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
| 18 |
-
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
| 19 |
-
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
| 20 |
-
*/
|
| 21 |
-
(function ($) {
|
| 22 |
-
if(typeof $.fn.each2 == "undefined") {
|
| 23 |
-
$.extend($.fn, {
|
| 24 |
-
/*
|
| 25 |
-
* 4-10 times faster .each replacement
|
| 26 |
-
* use it carefully, as it overrides jQuery context of element on each iteration
|
| 27 |
-
*/
|
| 28 |
-
each2 : function (c) {
|
| 29 |
-
var j = $([0]), i = -1, l = this.length;
|
| 30 |
-
while (
|
| 31 |
-
++i < l
|
| 32 |
-
&& (j.context = j[0] = this[i])
|
| 33 |
-
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
| 34 |
-
);
|
| 35 |
-
return this;
|
| 36 |
-
}
|
| 37 |
-
});
|
| 38 |
-
}
|
| 39 |
-
})(jQuery);
|
| 40 |
-
|
| 41 |
-
(function ($, undefined) {
|
| 42 |
-
"use strict";
|
| 43 |
-
/*global document, window, jQuery, console */
|
| 44 |
-
|
| 45 |
-
if (window.Select2 !== undefined) {
|
| 46 |
-
return;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
| 50 |
-
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
| 51 |
-
|
| 52 |
-
KEY = {
|
| 53 |
-
TAB: 9,
|
| 54 |
-
ENTER: 13,
|
| 55 |
-
ESC: 27,
|
| 56 |
-
SPACE: 32,
|
| 57 |
-
LEFT: 37,
|
| 58 |
-
UP: 38,
|
| 59 |
-
RIGHT: 39,
|
| 60 |
-
DOWN: 40,
|
| 61 |
-
SHIFT: 16,
|
| 62 |
-
CTRL: 17,
|
| 63 |
-
ALT: 18,
|
| 64 |
-
PAGE_UP: 33,
|
| 65 |
-
PAGE_DOWN: 34,
|
| 66 |
-
HOME: 36,
|
| 67 |
-
END: 35,
|
| 68 |
-
BACKSPACE: 8,
|
| 69 |
-
DELETE: 46,
|
| 70 |
-
isArrow: function (k) {
|
| 71 |
-
k = k.which ? k.which : k;
|
| 72 |
-
switch (k) {
|
| 73 |
-
case KEY.LEFT:
|
| 74 |
-
case KEY.RIGHT:
|
| 75 |
-
case KEY.UP:
|
| 76 |
-
case KEY.DOWN:
|
| 77 |
-
return true;
|
| 78 |
-
}
|
| 79 |
-
return false;
|
| 80 |
-
},
|
| 81 |
-
isControl: function (e) {
|
| 82 |
-
var k = e.which;
|
| 83 |
-
switch (k) {
|
| 84 |
-
case KEY.SHIFT:
|
| 85 |
-
case KEY.CTRL:
|
| 86 |
-
case KEY.ALT:
|
| 87 |
-
return true;
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
if (e.metaKey) return true;
|
| 91 |
-
|
| 92 |
-
return false;
|
| 93 |
-
},
|
| 94 |
-
isFunctionKey: function (k) {
|
| 95 |
-
k = k.which ? k.which : k;
|
| 96 |
-
return k >= 112 && k <= 123;
|
| 97 |
-
}
|
| 98 |
-
},
|
| 99 |
-
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
| 100 |
-
|
| 101 |
-
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
| 102 |
-
|
| 103 |
-
$document = $(document);
|
| 104 |
-
|
| 105 |
-
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
function reinsertElement(element) {
|
| 109 |
-
var placeholder = $(document.createTextNode(''));
|
| 110 |
-
|
| 111 |
-
element.before(placeholder);
|
| 112 |
-
placeholder.before(element);
|
| 113 |
-
placeholder.remove();
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
function stripDiacritics(str) {
|
| 117 |
-
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
| 118 |
-
function match(a) {
|
| 119 |
-
return DIACRITICS[a] || a;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
return str.replace(/[^\u0000-\u007E]/g, match);
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
function indexOf(value, array) {
|
| 126 |
-
var i = 0, l = array.length;
|
| 127 |
-
for (; i < l; i = i + 1) {
|
| 128 |
-
if (equal(value, array[i])) return i;
|
| 129 |
-
}
|
| 130 |
-
return -1;
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
function measureScrollbar () {
|
| 134 |
-
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
| 135 |
-
$template.appendTo(document.body);
|
| 136 |
-
|
| 137 |
-
var dim = {
|
| 138 |
-
width: $template.width() - $template[0].clientWidth,
|
| 139 |
-
height: $template.height() - $template[0].clientHeight
|
| 140 |
-
};
|
| 141 |
-
$template.remove();
|
| 142 |
-
|
| 143 |
-
return dim;
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
/**
|
| 147 |
-
* Compares equality of a and b
|
| 148 |
-
* @param a
|
| 149 |
-
* @param b
|
| 150 |
-
*/
|
| 151 |
-
function equal(a, b) {
|
| 152 |
-
if (a === b) return true;
|
| 153 |
-
if (a === undefined || b === undefined) return false;
|
| 154 |
-
if (a === null || b === null) return false;
|
| 155 |
-
// Check whether 'a' or 'b' is a string (primitive or object).
|
| 156 |
-
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
| 157 |
-
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
| 158 |
-
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
| 159 |
-
return false;
|
| 160 |
-
}
|
| 161 |
-
|
| 162 |
-
/**
|
| 163 |
-
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
| 164 |
-
* strings
|
| 165 |
-
* @param string
|
| 166 |
-
* @param separator
|
| 167 |
-
*/
|
| 168 |
-
function splitVal(string, separator, transform) {
|
| 169 |
-
var val, i, l;
|
| 170 |
-
if (string === null || string.length < 1) return [];
|
| 171 |
-
val = string.split(separator);
|
| 172 |
-
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
| 173 |
-
return val;
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
function getSideBorderPadding(element) {
|
| 177 |
-
return element.outerWidth(false) - element.width();
|
| 178 |
-
}
|
| 179 |
-
|
| 180 |
-
function installKeyUpChangeEvent(element) {
|
| 181 |
-
var key="keyup-change-value";
|
| 182 |
-
element.on("keydown", function () {
|
| 183 |
-
if ($.data(element, key) === undefined) {
|
| 184 |
-
$.data(element, key, element.val());
|
| 185 |
-
}
|
| 186 |
-
});
|
| 187 |
-
element.on("keyup", function () {
|
| 188 |
-
var val= $.data(element, key);
|
| 189 |
-
if (val !== undefined && element.val() !== val) {
|
| 190 |
-
$.removeData(element, key);
|
| 191 |
-
element.trigger("keyup-change");
|
| 192 |
-
}
|
| 193 |
-
});
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
/**
|
| 198 |
-
* filters mouse events so an event is fired only if the mouse moved.
|
| 199 |
-
*
|
| 200 |
-
* filters out mouse events that occur when mouse is stationary but
|
| 201 |
-
* the elements under the pointer are scrolled.
|
| 202 |
-
*/
|
| 203 |
-
function installFilteredMouseMove(element) {
|
| 204 |
-
element.on("mousemove", function (e) {
|
| 205 |
-
var lastpos = lastMousePosition;
|
| 206 |
-
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
| 207 |
-
$(e.target).trigger("mousemove-filtered", e);
|
| 208 |
-
}
|
| 209 |
-
});
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
/**
|
| 213 |
-
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
| 214 |
-
* within the last quietMillis milliseconds.
|
| 215 |
-
*
|
| 216 |
-
* @param quietMillis number of milliseconds to wait before invoking fn
|
| 217 |
-
* @param fn function to be debounced
|
| 218 |
-
* @param ctx object to be used as this reference within fn
|
| 219 |
-
* @return debounced version of fn
|
| 220 |
-
*/
|
| 221 |
-
function debounce(quietMillis, fn, ctx) {
|
| 222 |
-
ctx = ctx || undefined;
|
| 223 |
-
var timeout;
|
| 224 |
-
return function () {
|
| 225 |
-
var args = arguments;
|
| 226 |
-
window.clearTimeout(timeout);
|
| 227 |
-
timeout = window.setTimeout(function() {
|
| 228 |
-
fn.apply(ctx, args);
|
| 229 |
-
}, quietMillis);
|
| 230 |
-
};
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
function installDebouncedScroll(threshold, element) {
|
| 234 |
-
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
| 235 |
-
element.on("scroll", function (e) {
|
| 236 |
-
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
| 237 |
-
});
|
| 238 |
-
}
|
| 239 |
-
|
| 240 |
-
function focus($el) {
|
| 241 |
-
if ($el[0] === document.activeElement) return;
|
| 242 |
-
|
| 243 |
-
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
| 244 |
-
of the current event has finished - which seems like the only reliable way
|
| 245 |
-
to set focus */
|
| 246 |
-
window.setTimeout(function() {
|
| 247 |
-
var el=$el[0], pos=$el.val().length, range;
|
| 248 |
-
|
| 249 |
-
$el.focus();
|
| 250 |
-
|
| 251 |
-
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
| 252 |
-
sometimes modals or others listeners may steal it after its set */
|
| 253 |
-
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
| 254 |
-
if (isVisible && el === document.activeElement) {
|
| 255 |
-
|
| 256 |
-
/* after the focus is set move the caret to the end, necessary when we val()
|
| 257 |
-
just before setting focus */
|
| 258 |
-
if(el.setSelectionRange)
|
| 259 |
-
{
|
| 260 |
-
el.setSelectionRange(pos, pos);
|
| 261 |
-
}
|
| 262 |
-
else if (el.createTextRange) {
|
| 263 |
-
range = el.createTextRange();
|
| 264 |
-
range.collapse(false);
|
| 265 |
-
range.select();
|
| 266 |
-
}
|
| 267 |
-
}
|
| 268 |
-
}, 0);
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
function getCursorInfo(el) {
|
| 272 |
-
el = $(el)[0];
|
| 273 |
-
var offset = 0;
|
| 274 |
-
var length = 0;
|
| 275 |
-
if ('selectionStart' in el) {
|
| 276 |
-
offset = el.selectionStart;
|
| 277 |
-
length = el.selectionEnd - offset;
|
| 278 |
-
} else if ('selection' in document) {
|
| 279 |
-
el.focus();
|
| 280 |
-
var sel = document.selection.createRange();
|
| 281 |
-
length = document.selection.createRange().text.length;
|
| 282 |
-
sel.moveStart('character', -el.value.length);
|
| 283 |
-
offset = sel.text.length - length;
|
| 284 |
-
}
|
| 285 |
-
return { offset: offset, length: length };
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
function killEvent(event) {
|
| 289 |
-
event.preventDefault();
|
| 290 |
-
event.stopPropagation();
|
| 291 |
-
}
|
| 292 |
-
function killEventImmediately(event) {
|
| 293 |
-
event.preventDefault();
|
| 294 |
-
event.stopImmediatePropagation();
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
function measureTextWidth(e) {
|
| 298 |
-
if (!sizer){
|
| 299 |
-
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
| 300 |
-
sizer = $(document.createElement("div")).css({
|
| 301 |
-
position: "absolute",
|
| 302 |
-
left: "-10000px",
|
| 303 |
-
top: "-10000px",
|
| 304 |
-
display: "none",
|
| 305 |
-
fontSize: style.fontSize,
|
| 306 |
-
fontFamily: style.fontFamily,
|
| 307 |
-
fontStyle: style.fontStyle,
|
| 308 |
-
fontWeight: style.fontWeight,
|
| 309 |
-
letterSpacing: style.letterSpacing,
|
| 310 |
-
textTransform: style.textTransform,
|
| 311 |
-
whiteSpace: "nowrap"
|
| 312 |
-
});
|
| 313 |
-
sizer.attr("class","select2-sizer");
|
| 314 |
-
$(document.body).append(sizer);
|
| 315 |
-
}
|
| 316 |
-
sizer.text(e.val());
|
| 317 |
-
return sizer.width();
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
function syncCssClasses(dest, src, adapter) {
|
| 321 |
-
var classes, replacements = [], adapted;
|
| 322 |
-
|
| 323 |
-
classes = $.trim(dest.attr("class"));
|
| 324 |
-
|
| 325 |
-
if (classes) {
|
| 326 |
-
classes = '' + classes; // for IE which returns object
|
| 327 |
-
|
| 328 |
-
$(classes.split(/\s+/)).each2(function() {
|
| 329 |
-
if (this.indexOf("select2-") === 0) {
|
| 330 |
-
replacements.push(this);
|
| 331 |
-
}
|
| 332 |
-
});
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
classes = $.trim(src.attr("class"));
|
| 336 |
-
|
| 337 |
-
if (classes) {
|
| 338 |
-
classes = '' + classes; // for IE which returns object
|
| 339 |
-
|
| 340 |
-
$(classes.split(/\s+/)).each2(function() {
|
| 341 |
-
if (this.indexOf("select2-") !== 0) {
|
| 342 |
-
adapted = adapter(this);
|
| 343 |
-
|
| 344 |
-
if (adapted) {
|
| 345 |
-
replacements.push(adapted);
|
| 346 |
-
}
|
| 347 |
-
}
|
| 348 |
-
});
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
dest.attr("class", replacements.join(" "));
|
| 352 |
-
}
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
function markMatch(text, term, markup, escapeMarkup) {
|
| 356 |
-
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
| 357 |
-
tl=term.length;
|
| 358 |
-
|
| 359 |
-
if (match<0) {
|
| 360 |
-
markup.push(escapeMarkup(text));
|
| 361 |
-
return;
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
markup.push(escapeMarkup(text.substring(0, match)));
|
| 365 |
-
markup.push("<span class='select2-match'>");
|
| 366 |
-
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
| 367 |
-
markup.push("</span>");
|
| 368 |
-
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
| 369 |
-
}
|
| 370 |
-
|
| 371 |
-
function defaultEscapeMarkup(markup) {
|
| 372 |
-
var replace_map = {
|
| 373 |
-
'\\': '\',
|
| 374 |
-
'&': '&',
|
| 375 |
-
'<': '<',
|
| 376 |
-
'>': '>',
|
| 377 |
-
'"': '"',
|
| 378 |
-
"'": ''',
|
| 379 |
-
"/": '/'
|
| 380 |
-
};
|
| 381 |
-
|
| 382 |
-
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
| 383 |
-
return replace_map[match];
|
| 384 |
-
});
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
/**
|
| 388 |
-
* Produces an ajax-based query function
|
| 389 |
-
*
|
| 390 |
-
* @param options object containing configuration parameters
|
| 391 |
-
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
| 392 |
-
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
| 393 |
-
* @param options.url url for the data
|
| 394 |
-
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
| 395 |
-
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
| 396 |
-
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
| 397 |
-
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
| 398 |
-
* The expected format is an object containing the following keys:
|
| 399 |
-
* results array of objects that will be used as choices
|
| 400 |
-
* more (optional) boolean indicating whether there are more results available
|
| 401 |
-
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
| 402 |
-
*/
|
| 403 |
-
function ajax(options) {
|
| 404 |
-
var timeout, // current scheduled but not yet executed request
|
| 405 |
-
handler = null,
|
| 406 |
-
quietMillis = options.quietMillis || 100,
|
| 407 |
-
ajaxUrl = options.url,
|
| 408 |
-
self = this;
|
| 409 |
-
|
| 410 |
-
return function (query) {
|
| 411 |
-
window.clearTimeout(timeout);
|
| 412 |
-
timeout = window.setTimeout(function () {
|
| 413 |
-
var data = options.data, // ajax data function
|
| 414 |
-
url = ajaxUrl, // ajax url string or function
|
| 415 |
-
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
| 416 |
-
// deprecated - to be removed in 4.0 - use params instead
|
| 417 |
-
deprecated = {
|
| 418 |
-
type: options.type || 'GET', // set type of request (GET or POST)
|
| 419 |
-
cache: options.cache || false,
|
| 420 |
-
jsonpCallback: options.jsonpCallback||undefined,
|
| 421 |
-
dataType: options.dataType||"json"
|
| 422 |
-
},
|
| 423 |
-
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
| 424 |
-
|
| 425 |
-
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
| 426 |
-
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
| 427 |
-
|
| 428 |
-
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
| 429 |
-
|
| 430 |
-
if (options.params) {
|
| 431 |
-
if ($.isFunction(options.params)) {
|
| 432 |
-
$.extend(params, options.params.call(self));
|
| 433 |
-
} else {
|
| 434 |
-
$.extend(params, options.params);
|
| 435 |
-
}
|
| 436 |
-
}
|
| 437 |
-
|
| 438 |
-
$.extend(params, {
|
| 439 |
-
url: url,
|
| 440 |
-
dataType: options.dataType,
|
| 441 |
-
data: data,
|
| 442 |
-
success: function (data) {
|
| 443 |
-
// TODO - replace query.page with query so users have access to term, page, etc.
|
| 444 |
-
// added query as third paramter to keep backwards compatibility
|
| 445 |
-
var results = options.results(data, query.page, query);
|
| 446 |
-
query.callback(results);
|
| 447 |
-
},
|
| 448 |
-
error: function(jqXHR, textStatus, errorThrown){
|
| 449 |
-
var results = {
|
| 450 |
-
hasError: true,
|
| 451 |
-
jqXHR: jqXHR,
|
| 452 |
-
textStatus: textStatus,
|
| 453 |
-
errorThrown: errorThrown
|
| 454 |
-
};
|
| 455 |
-
|
| 456 |
-
query.callback(results);
|
| 457 |
-
}
|
| 458 |
-
});
|
| 459 |
-
handler = transport.call(self, params);
|
| 460 |
-
}, quietMillis);
|
| 461 |
-
};
|
| 462 |
-
}
|
| 463 |
-
|
| 464 |
-
/**
|
| 465 |
-
* Produces a query function that works with a local array
|
| 466 |
-
*
|
| 467 |
-
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
| 468 |
-
* object.
|
| 469 |
-
*
|
| 470 |
-
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
| 471 |
-
*
|
| 472 |
-
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
| 473 |
-
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
| 474 |
-
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
| 475 |
-
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
| 476 |
-
* the text.
|
| 477 |
-
*/
|
| 478 |
-
function local(options) {
|
| 479 |
-
var data = options, // data elements
|
| 480 |
-
dataText,
|
| 481 |
-
tmp,
|
| 482 |
-
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
| 483 |
-
|
| 484 |
-
if ($.isArray(data)) {
|
| 485 |
-
tmp = data;
|
| 486 |
-
data = { results: tmp };
|
| 487 |
-
}
|
| 488 |
-
|
| 489 |
-
if ($.isFunction(data) === false) {
|
| 490 |
-
tmp = data;
|
| 491 |
-
data = function() { return tmp; };
|
| 492 |
-
}
|
| 493 |
-
|
| 494 |
-
var dataItem = data();
|
| 495 |
-
if (dataItem.text) {
|
| 496 |
-
text = dataItem.text;
|
| 497 |
-
// if text is not a function we assume it to be a key name
|
| 498 |
-
if (!$.isFunction(text)) {
|
| 499 |
-
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
| 500 |
-
text = function (item) { return item[dataText]; };
|
| 501 |
-
}
|
| 502 |
-
}
|
| 503 |
-
|
| 504 |
-
return function (query) {
|
| 505 |
-
var t = query.term, filtered = { results: [] }, process;
|
| 506 |
-
if (t === "") {
|
| 507 |
-
query.callback(data());
|
| 508 |
-
return;
|
| 509 |
-
}
|
| 510 |
-
|
| 511 |
-
process = function(datum, collection) {
|
| 512 |
-
var group, attr;
|
| 513 |
-
datum = datum[0];
|
| 514 |
-
if (datum.children) {
|
| 515 |
-
group = {};
|
| 516 |
-
for (attr in datum) {
|
| 517 |
-
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
| 518 |
-
}
|
| 519 |
-
group.children=[];
|
| 520 |
-
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
| 521 |
-
if (group.children.length || query.matcher(t, text(group), datum)) {
|
| 522 |
-
collection.push(group);
|
| 523 |
-
}
|
| 524 |
-
} else {
|
| 525 |
-
if (query.matcher(t, text(datum), datum)) {
|
| 526 |
-
collection.push(datum);
|
| 527 |
-
}
|
| 528 |
-
}
|
| 529 |
-
};
|
| 530 |
-
|
| 531 |
-
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
| 532 |
-
query.callback(filtered);
|
| 533 |
-
};
|
| 534 |
-
}
|
| 535 |
-
|
| 536 |
-
// TODO javadoc
|
| 537 |
-
function tags(data) {
|
| 538 |
-
var isFunc = $.isFunction(data);
|
| 539 |
-
return function (query) {
|
| 540 |
-
var t = query.term, filtered = {results: []};
|
| 541 |
-
var result = isFunc ? data(query) : data;
|
| 542 |
-
if ($.isArray(result)) {
|
| 543 |
-
$(result).each(function () {
|
| 544 |
-
var isObject = this.text !== undefined,
|
| 545 |
-
text = isObject ? this.text : this;
|
| 546 |
-
if (t === "" || query.matcher(t, text)) {
|
| 547 |
-
filtered.results.push(isObject ? this : {id: this, text: this});
|
| 548 |
-
}
|
| 549 |
-
});
|
| 550 |
-
query.callback(filtered);
|
| 551 |
-
}
|
| 552 |
-
};
|
| 553 |
-
}
|
| 554 |
-
|
| 555 |
-
/**
|
| 556 |
-
* Checks if the formatter function should be used.
|
| 557 |
-
*
|
| 558 |
-
* Throws an error if it is not a function. Returns true if it should be used,
|
| 559 |
-
* false if no formatting should be performed.
|
| 560 |
-
*
|
| 561 |
-
* @param formatter
|
| 562 |
-
*/
|
| 563 |
-
function checkFormatter(formatter, formatterName) {
|
| 564 |
-
if ($.isFunction(formatter)) return true;
|
| 565 |
-
if (!formatter) return false;
|
| 566 |
-
if (typeof(formatter) === 'string') return true;
|
| 567 |
-
throw new Error(formatterName +" must be a string, function, or falsy value");
|
| 568 |
-
}
|
| 569 |
-
|
| 570 |
-
/**
|
| 571 |
-
* Returns a given value
|
| 572 |
-
* If given a function, returns its output
|
| 573 |
-
*
|
| 574 |
-
* @param val string|function
|
| 575 |
-
* @param context value of "this" to be passed to function
|
| 576 |
-
* @returns {*}
|
| 577 |
-
*/
|
| 578 |
-
function evaluate(val, context) {
|
| 579 |
-
if ($.isFunction(val)) {
|
| 580 |
-
var args = Array.prototype.slice.call(arguments, 2);
|
| 581 |
-
return val.apply(context, args);
|
| 582 |
-
}
|
| 583 |
-
return val;
|
| 584 |
-
}
|
| 585 |
-
|
| 586 |
-
function countResults(results) {
|
| 587 |
-
var count = 0;
|
| 588 |
-
$.each(results, function(i, item) {
|
| 589 |
-
if (item.children) {
|
| 590 |
-
count += countResults(item.children);
|
| 591 |
-
} else {
|
| 592 |
-
count++;
|
| 593 |
-
}
|
| 594 |
-
});
|
| 595 |
-
return count;
|
| 596 |
-
}
|
| 597 |
-
|
| 598 |
-
/**
|
| 599 |
-
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
| 600 |
-
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
| 601 |
-
* two options have to be defined in order for the tokenizer to work.
|
| 602 |
-
*
|
| 603 |
-
* @param input text user has typed so far or pasted into the search field
|
| 604 |
-
* @param selection currently selected choices
|
| 605 |
-
* @param selectCallback function(choice) callback tho add the choice to selection
|
| 606 |
-
* @param opts select2's opts
|
| 607 |
-
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
| 608 |
-
*/
|
| 609 |
-
function defaultTokenizer(input, selection, selectCallback, opts) {
|
| 610 |
-
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
| 611 |
-
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
| 612 |
-
token, // token
|
| 613 |
-
index, // position at which the separator was found
|
| 614 |
-
i, l, // looping variables
|
| 615 |
-
separator; // the matched separator
|
| 616 |
-
|
| 617 |
-
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
| 618 |
-
|
| 619 |
-
while (true) {
|
| 620 |
-
index = -1;
|
| 621 |
-
|
| 622 |
-
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
| 623 |
-
separator = opts.tokenSeparators[i];
|
| 624 |
-
index = input.indexOf(separator);
|
| 625 |
-
if (index >= 0) break;
|
| 626 |
-
}
|
| 627 |
-
|
| 628 |
-
if (index < 0) break; // did not find any token separator in the input string, bail
|
| 629 |
-
|
| 630 |
-
token = input.substring(0, index);
|
| 631 |
-
input = input.substring(index + separator.length);
|
| 632 |
-
|
| 633 |
-
if (token.length > 0) {
|
| 634 |
-
token = opts.createSearchChoice.call(this, token, selection);
|
| 635 |
-
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
| 636 |
-
dupe = false;
|
| 637 |
-
for (i = 0, l = selection.length; i < l; i++) {
|
| 638 |
-
if (equal(opts.id(token), opts.id(selection[i]))) {
|
| 639 |
-
dupe = true; break;
|
| 640 |
-
}
|
| 641 |
-
}
|
| 642 |
-
|
| 643 |
-
if (!dupe) selectCallback(token);
|
| 644 |
-
}
|
| 645 |
-
}
|
| 646 |
-
}
|
| 647 |
-
|
| 648 |
-
if (original!==input) return input;
|
| 649 |
-
}
|
| 650 |
-
|
| 651 |
-
function cleanupJQueryElements() {
|
| 652 |
-
var self = this;
|
| 653 |
-
|
| 654 |
-
$.each(arguments, function (i, element) {
|
| 655 |
-
self[element].remove();
|
| 656 |
-
self[element] = null;
|
| 657 |
-
});
|
| 658 |
-
}
|
| 659 |
-
|
| 660 |
-
/**
|
| 661 |
-
* Creates a new class
|
| 662 |
-
*
|
| 663 |
-
* @param superClass
|
| 664 |
-
* @param methods
|
| 665 |
-
*/
|
| 666 |
-
function clazz(SuperClass, methods) {
|
| 667 |
-
var constructor = function () {};
|
| 668 |
-
constructor.prototype = new SuperClass;
|
| 669 |
-
constructor.prototype.constructor = constructor;
|
| 670 |
-
constructor.prototype.parent = SuperClass.prototype;
|
| 671 |
-
constructor.prototype = $.extend(constructor.prototype, methods);
|
| 672 |
-
return constructor;
|
| 673 |
-
}
|
| 674 |
-
|
| 675 |
-
AbstractSelect2 = clazz(Object, {
|
| 676 |
-
|
| 677 |
-
// abstract
|
| 678 |
-
bind: function (func) {
|
| 679 |
-
var self = this;
|
| 680 |
-
return function () {
|
| 681 |
-
func.apply(self, arguments);
|
| 682 |
-
};
|
| 683 |
-
},
|
| 684 |
-
|
| 685 |
-
// abstract
|
| 686 |
-
init: function (opts) {
|
| 687 |
-
var results, search, resultsSelector = ".select2-results";
|
| 688 |
-
|
| 689 |
-
// prepare options
|
| 690 |
-
this.opts = opts = this.prepareOpts(opts);
|
| 691 |
-
|
| 692 |
-
this.id=opts.id;
|
| 693 |
-
|
| 694 |
-
// destroy if called on an existing component
|
| 695 |
-
if (opts.element.data("select2") !== undefined &&
|
| 696 |
-
opts.element.data("select2") !== null) {
|
| 697 |
-
opts.element.data("select2").destroy();
|
| 698 |
-
}
|
| 699 |
-
|
| 700 |
-
this.container = this.createContainer();
|
| 701 |
-
|
| 702 |
-
this.liveRegion = $('.select2-hidden-accessible');
|
| 703 |
-
if (this.liveRegion.length == 0) {
|
| 704 |
-
this.liveRegion = $("<span>", {
|
| 705 |
-
role: "status",
|
| 706 |
-
"aria-live": "polite"
|
| 707 |
-
})
|
| 708 |
-
.addClass("select2-hidden-accessible")
|
| 709 |
-
.appendTo(document.body);
|
| 710 |
-
}
|
| 711 |
-
|
| 712 |
-
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
| 713 |
-
this.containerEventName= this.containerId
|
| 714 |
-
.replace(/([.])/g, '_')
|
| 715 |
-
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
| 716 |
-
this.container.attr("id", this.containerId);
|
| 717 |
-
|
| 718 |
-
this.container.attr("title", opts.element.attr("title"));
|
| 719 |
-
|
| 720 |
-
this.body = $(document.body);
|
| 721 |
-
|
| 722 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 723 |
-
|
| 724 |
-
this.container.attr("style", opts.element.attr("style"));
|
| 725 |
-
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
| 726 |
-
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
| 727 |
-
|
| 728 |
-
this.elementTabIndex = this.opts.element.attr("tabindex");
|
| 729 |
-
|
| 730 |
-
// swap container for the element
|
| 731 |
-
this.opts.element
|
| 732 |
-
.data("select2", this)
|
| 733 |
-
.attr("tabindex", "-1")
|
| 734 |
-
.before(this.container)
|
| 735 |
-
.on("click.select2", killEvent); // do not leak click events
|
| 736 |
-
|
| 737 |
-
this.container.data("select2", this);
|
| 738 |
-
|
| 739 |
-
this.dropdown = this.container.find(".select2-drop");
|
| 740 |
-
|
| 741 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 742 |
-
|
| 743 |
-
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
| 744 |
-
this.dropdown.data("select2", this);
|
| 745 |
-
this.dropdown.on("click", killEvent);
|
| 746 |
-
|
| 747 |
-
this.results = results = this.container.find(resultsSelector);
|
| 748 |
-
this.search = search = this.container.find("input.select2-input");
|
| 749 |
-
|
| 750 |
-
this.queryCount = 0;
|
| 751 |
-
this.resultsPage = 0;
|
| 752 |
-
this.context = null;
|
| 753 |
-
|
| 754 |
-
// initialize the container
|
| 755 |
-
this.initContainer();
|
| 756 |
-
|
| 757 |
-
this.container.on("click", killEvent);
|
| 758 |
-
|
| 759 |
-
installFilteredMouseMove(this.results);
|
| 760 |
-
|
| 761 |
-
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
| 762 |
-
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
| 763 |
-
this._touchEvent = true;
|
| 764 |
-
this.highlightUnderEvent(event);
|
| 765 |
-
}));
|
| 766 |
-
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
| 767 |
-
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
| 768 |
-
|
| 769 |
-
// Waiting for a click event on touch devices to select option and hide dropdown
|
| 770 |
-
// otherwise click will be triggered on an underlying element
|
| 771 |
-
this.dropdown.on('click', this.bind(function (event) {
|
| 772 |
-
if (this._touchEvent) {
|
| 773 |
-
this._touchEvent = false;
|
| 774 |
-
this.selectHighlighted();
|
| 775 |
-
}
|
| 776 |
-
}));
|
| 777 |
-
|
| 778 |
-
installDebouncedScroll(80, this.results);
|
| 779 |
-
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
| 780 |
-
|
| 781 |
-
// do not propagate change event from the search field out of the component
|
| 782 |
-
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 783 |
-
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 784 |
-
|
| 785 |
-
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
| 786 |
-
if ($.fn.mousewheel) {
|
| 787 |
-
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
| 788 |
-
var top = results.scrollTop();
|
| 789 |
-
if (deltaY > 0 && top - deltaY <= 0) {
|
| 790 |
-
results.scrollTop(0);
|
| 791 |
-
killEvent(e);
|
| 792 |
-
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
| 793 |
-
results.scrollTop(results.get(0).scrollHeight - results.height());
|
| 794 |
-
killEvent(e);
|
| 795 |
-
}
|
| 796 |
-
});
|
| 797 |
-
}
|
| 798 |
-
|
| 799 |
-
installKeyUpChangeEvent(search);
|
| 800 |
-
search.on("keyup-change input paste", this.bind(this.updateResults));
|
| 801 |
-
search.on("focus", function () { search.addClass("select2-focused"); });
|
| 802 |
-
search.on("blur", function () { search.removeClass("select2-focused");});
|
| 803 |
-
|
| 804 |
-
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
| 805 |
-
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
| 806 |
-
this.highlightUnderEvent(e);
|
| 807 |
-
this.selectHighlighted(e);
|
| 808 |
-
}
|
| 809 |
-
}));
|
| 810 |
-
|
| 811 |
-
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
| 812 |
-
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
| 813 |
-
// dom it will trigger the popup close, which is not what we want
|
| 814 |
-
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
| 815 |
-
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
| 816 |
-
|
| 817 |
-
this.nextSearchTerm = undefined;
|
| 818 |
-
|
| 819 |
-
if ($.isFunction(this.opts.initSelection)) {
|
| 820 |
-
// initialize selection based on the current value of the source element
|
| 821 |
-
this.initSelection();
|
| 822 |
-
|
| 823 |
-
// if the user has provided a function that can set selection based on the value of the source element
|
| 824 |
-
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
| 825 |
-
this.monitorSource();
|
| 826 |
-
}
|
| 827 |
-
|
| 828 |
-
if (opts.maximumInputLength !== null) {
|
| 829 |
-
this.search.attr("maxlength", opts.maximumInputLength);
|
| 830 |
-
}
|
| 831 |
-
|
| 832 |
-
var disabled = opts.element.prop("disabled");
|
| 833 |
-
if (disabled === undefined) disabled = false;
|
| 834 |
-
this.enable(!disabled);
|
| 835 |
-
|
| 836 |
-
var readonly = opts.element.prop("readonly");
|
| 837 |
-
if (readonly === undefined) readonly = false;
|
| 838 |
-
this.readonly(readonly);
|
| 839 |
-
|
| 840 |
-
// Calculate size of scrollbar
|
| 841 |
-
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
| 842 |
-
|
| 843 |
-
this.autofocus = opts.element.prop("autofocus");
|
| 844 |
-
opts.element.prop("autofocus", false);
|
| 845 |
-
if (this.autofocus) this.focus();
|
| 846 |
-
|
| 847 |
-
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
| 848 |
-
},
|
| 849 |
-
|
| 850 |
-
// abstract
|
| 851 |
-
destroy: function () {
|
| 852 |
-
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
| 853 |
-
|
| 854 |
-
this.close();
|
| 855 |
-
|
| 856 |
-
if (element.length && element[0].detachEvent && self._sync) {
|
| 857 |
-
element.each(function () {
|
| 858 |
-
if (self._sync) {
|
| 859 |
-
this.detachEvent("onpropertychange", self._sync);
|
| 860 |
-
}
|
| 861 |
-
});
|
| 862 |
-
}
|
| 863 |
-
if (this.propertyObserver) {
|
| 864 |
-
this.propertyObserver.disconnect();
|
| 865 |
-
this.propertyObserver = null;
|
| 866 |
-
}
|
| 867 |
-
this._sync = null;
|
| 868 |
-
|
| 869 |
-
if (select2 !== undefined) {
|
| 870 |
-
select2.container.remove();
|
| 871 |
-
select2.liveRegion.remove();
|
| 872 |
-
select2.dropdown.remove();
|
| 873 |
-
element
|
| 874 |
-
.show()
|
| 875 |
-
.removeData("select2")
|
| 876 |
-
.off(".select2")
|
| 877 |
-
.prop("autofocus", this.autofocus || false);
|
| 878 |
-
if (this.elementTabIndex) {
|
| 879 |
-
element.attr({tabindex: this.elementTabIndex});
|
| 880 |
-
} else {
|
| 881 |
-
element.removeAttr("tabindex");
|
| 882 |
-
}
|
| 883 |
-
element.show();
|
| 884 |
-
}
|
| 885 |
-
|
| 886 |
-
cleanupJQueryElements.call(this,
|
| 887 |
-
"container",
|
| 888 |
-
"liveRegion",
|
| 889 |
-
"dropdown",
|
| 890 |
-
"results",
|
| 891 |
-
"search"
|
| 892 |
-
);
|
| 893 |
-
},
|
| 894 |
-
|
| 895 |
-
// abstract
|
| 896 |
-
optionToData: function(element) {
|
| 897 |
-
if (element.is("option")) {
|
| 898 |
-
return {
|
| 899 |
-
id:element.prop("value"),
|
| 900 |
-
text:element.text(),
|
| 901 |
-
element: element.get(),
|
| 902 |
-
css: element.attr("class"),
|
| 903 |
-
disabled: element.prop("disabled"),
|
| 904 |
-
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
| 905 |
-
};
|
| 906 |
-
} else if (element.is("optgroup")) {
|
| 907 |
-
return {
|
| 908 |
-
text:element.attr("label"),
|
| 909 |
-
children:[],
|
| 910 |
-
element: element.get(),
|
| 911 |
-
css: element.attr("class")
|
| 912 |
-
};
|
| 913 |
-
}
|
| 914 |
-
},
|
| 915 |
-
|
| 916 |
-
// abstract
|
| 917 |
-
prepareOpts: function (opts) {
|
| 918 |
-
var element, select, idKey, ajaxUrl, self = this;
|
| 919 |
-
|
| 920 |
-
element = opts.element;
|
| 921 |
-
|
| 922 |
-
if (element.get(0).tagName.toLowerCase() === "select") {
|
| 923 |
-
this.select = select = opts.element;
|
| 924 |
-
}
|
| 925 |
-
|
| 926 |
-
if (select) {
|
| 927 |
-
// these options are not allowed when attached to a select because they are picked up off the element itself
|
| 928 |
-
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
| 929 |
-
if (this in opts) {
|
| 930 |
-
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
| 931 |
-
}
|
| 932 |
-
});
|
| 933 |
-
}
|
| 934 |
-
|
| 935 |
-
opts = $.extend({}, {
|
| 936 |
-
populateResults: function(container, results, query) {
|
| 937 |
-
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
| 938 |
-
|
| 939 |
-
populate=function(results, container, depth) {
|
| 940 |
-
|
| 941 |
-
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
| 942 |
-
|
| 943 |
-
results = opts.sortResults(results, container, query);
|
| 944 |
-
|
| 945 |
-
// collect the created nodes for bulk append
|
| 946 |
-
var nodes = [];
|
| 947 |
-
for (i = 0, l = results.length; i < l; i = i + 1) {
|
| 948 |
-
|
| 949 |
-
result=results[i];
|
| 950 |
-
|
| 951 |
-
disabled = (result.disabled === true);
|
| 952 |
-
selectable = (!disabled) && (id(result) !== undefined);
|
| 953 |
-
|
| 954 |
-
compound=result.children && result.children.length > 0;
|
| 955 |
-
|
| 956 |
-
node=$("<li></li>");
|
| 957 |
-
node.addClass("select2-results-dept-"+depth);
|
| 958 |
-
node.addClass("select2-result");
|
| 959 |
-
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
| 960 |
-
if (disabled) { node.addClass("select2-disabled"); }
|
| 961 |
-
if (compound) { node.addClass("select2-result-with-children"); }
|
| 962 |
-
node.addClass(self.opts.formatResultCssClass(result));
|
| 963 |
-
node.attr("role", "presentation");
|
| 964 |
-
|
| 965 |
-
label=$(document.createElement("div"));
|
| 966 |
-
label.addClass("select2-result-label");
|
| 967 |
-
label.attr("id", "select2-result-label-" + nextUid());
|
| 968 |
-
label.attr("role", "option");
|
| 969 |
-
|
| 970 |
-
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
| 971 |
-
if (formatted!==undefined) {
|
| 972 |
-
label.html(formatted);
|
| 973 |
-
node.append(label);
|
| 974 |
-
}
|
| 975 |
-
|
| 976 |
-
|
| 977 |
-
if (compound) {
|
| 978 |
-
|
| 979 |
-
innerContainer=$("<ul></ul>");
|
| 980 |
-
innerContainer.addClass("select2-result-sub");
|
| 981 |
-
populate(result.children, innerContainer, depth+1);
|
| 982 |
-
node.append(innerContainer);
|
| 983 |
-
}
|
| 984 |
-
|
| 985 |
-
node.data("select2-data", result);
|
| 986 |
-
nodes.push(node[0]);
|
| 987 |
-
}
|
| 988 |
-
|
| 989 |
-
// bulk append the created nodes
|
| 990 |
-
container.append(nodes);
|
| 991 |
-
liveRegion.text(opts.formatMatches(results.length));
|
| 992 |
-
};
|
| 993 |
-
|
| 994 |
-
populate(results, container, 0);
|
| 995 |
-
}
|
| 996 |
-
}, $.fn.select2.defaults, opts);
|
| 997 |
-
|
| 998 |
-
if (typeof(opts.id) !== "function") {
|
| 999 |
-
idKey = opts.id;
|
| 1000 |
-
opts.id = function (e) { return e[idKey]; };
|
| 1001 |
-
}
|
| 1002 |
-
|
| 1003 |
-
if ($.isArray(opts.element.data("select2Tags"))) {
|
| 1004 |
-
if ("tags" in opts) {
|
| 1005 |
-
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
| 1006 |
-
}
|
| 1007 |
-
opts.tags=opts.element.data("select2Tags");
|
| 1008 |
-
}
|
| 1009 |
-
|
| 1010 |
-
if (select) {
|
| 1011 |
-
opts.query = this.bind(function (query) {
|
| 1012 |
-
var data = { results: [], more: false },
|
| 1013 |
-
term = query.term,
|
| 1014 |
-
children, placeholderOption, process;
|
| 1015 |
-
|
| 1016 |
-
process=function(element, collection) {
|
| 1017 |
-
var group;
|
| 1018 |
-
if (element.is("option")) {
|
| 1019 |
-
if (query.matcher(term, element.text(), element)) {
|
| 1020 |
-
collection.push(self.optionToData(element));
|
| 1021 |
-
}
|
| 1022 |
-
} else if (element.is("optgroup")) {
|
| 1023 |
-
group=self.optionToData(element);
|
| 1024 |
-
element.children().each2(function(i, elm) { process(elm, group.children); });
|
| 1025 |
-
if (group.children.length>0) {
|
| 1026 |
-
collection.push(group);
|
| 1027 |
-
}
|
| 1028 |
-
}
|
| 1029 |
-
};
|
| 1030 |
-
|
| 1031 |
-
children=element.children();
|
| 1032 |
-
|
| 1033 |
-
// ignore the placeholder option if there is one
|
| 1034 |
-
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
| 1035 |
-
placeholderOption = this.getPlaceholderOption();
|
| 1036 |
-
if (placeholderOption) {
|
| 1037 |
-
children=children.not(placeholderOption);
|
| 1038 |
-
}
|
| 1039 |
-
}
|
| 1040 |
-
|
| 1041 |
-
children.each2(function(i, elm) { process(elm, data.results); });
|
| 1042 |
-
|
| 1043 |
-
query.callback(data);
|
| 1044 |
-
});
|
| 1045 |
-
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
| 1046 |
-
opts.id=function(e) { return e.id; };
|
| 1047 |
-
} else {
|
| 1048 |
-
if (!("query" in opts)) {
|
| 1049 |
-
|
| 1050 |
-
if ("ajax" in opts) {
|
| 1051 |
-
ajaxUrl = opts.element.data("ajax-url");
|
| 1052 |
-
if (ajaxUrl && ajaxUrl.length > 0) {
|
| 1053 |
-
opts.ajax.url = ajaxUrl;
|
| 1054 |
-
}
|
| 1055 |
-
opts.query = ajax.call(opts.element, opts.ajax);
|
| 1056 |
-
} else if ("data" in opts) {
|
| 1057 |
-
opts.query = local(opts.data);
|
| 1058 |
-
} else if ("tags" in opts) {
|
| 1059 |
-
opts.query = tags(opts.tags);
|
| 1060 |
-
if (opts.createSearchChoice === undefined) {
|
| 1061 |
-
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
| 1062 |
-
}
|
| 1063 |
-
if (opts.initSelection === undefined) {
|
| 1064 |
-
opts.initSelection = function (element, callback) {
|
| 1065 |
-
var data = [];
|
| 1066 |
-
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
| 1067 |
-
var obj = { id: this, text: this },
|
| 1068 |
-
tags = opts.tags;
|
| 1069 |
-
if ($.isFunction(tags)) tags=tags();
|
| 1070 |
-
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
| 1071 |
-
data.push(obj);
|
| 1072 |
-
});
|
| 1073 |
-
|
| 1074 |
-
callback(data);
|
| 1075 |
-
};
|
| 1076 |
-
}
|
| 1077 |
-
}
|
| 1078 |
-
}
|
| 1079 |
-
}
|
| 1080 |
-
if (typeof(opts.query) !== "function") {
|
| 1081 |
-
throw "query function not defined for Select2 " + opts.element.attr("id");
|
| 1082 |
-
}
|
| 1083 |
-
|
| 1084 |
-
if (opts.createSearchChoicePosition === 'top') {
|
| 1085 |
-
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
| 1086 |
-
}
|
| 1087 |
-
else if (opts.createSearchChoicePosition === 'bottom') {
|
| 1088 |
-
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
| 1089 |
-
}
|
| 1090 |
-
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
| 1091 |
-
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
| 1092 |
-
}
|
| 1093 |
-
|
| 1094 |
-
return opts;
|
| 1095 |
-
},
|
| 1096 |
-
|
| 1097 |
-
/**
|
| 1098 |
-
* Monitor the original element for changes and update select2 accordingly
|
| 1099 |
-
*/
|
| 1100 |
-
// abstract
|
| 1101 |
-
monitorSource: function () {
|
| 1102 |
-
var el = this.opts.element, observer, self = this;
|
| 1103 |
-
|
| 1104 |
-
el.on("change.select2", this.bind(function (e) {
|
| 1105 |
-
if (this.opts.element.data("select2-change-triggered") !== true) {
|
| 1106 |
-
this.initSelection();
|
| 1107 |
-
}
|
| 1108 |
-
}));
|
| 1109 |
-
|
| 1110 |
-
this._sync = this.bind(function () {
|
| 1111 |
-
|
| 1112 |
-
// sync enabled state
|
| 1113 |
-
var disabled = el.prop("disabled");
|
| 1114 |
-
if (disabled === undefined) disabled = false;
|
| 1115 |
-
this.enable(!disabled);
|
| 1116 |
-
|
| 1117 |
-
var readonly = el.prop("readonly");
|
| 1118 |
-
if (readonly === undefined) readonly = false;
|
| 1119 |
-
this.readonly(readonly);
|
| 1120 |
-
|
| 1121 |
-
if (this.container) {
|
| 1122 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 1123 |
-
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
| 1124 |
-
}
|
| 1125 |
-
|
| 1126 |
-
if (this.dropdown) {
|
| 1127 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 1128 |
-
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
| 1129 |
-
}
|
| 1130 |
-
|
| 1131 |
-
});
|
| 1132 |
-
|
| 1133 |
-
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
| 1134 |
-
if (el.length && el[0].attachEvent) {
|
| 1135 |
-
el.each(function() {
|
| 1136 |
-
this.attachEvent("onpropertychange", self._sync);
|
| 1137 |
-
});
|
| 1138 |
-
}
|
| 1139 |
-
|
| 1140 |
-
// safari, chrome, firefox, IE11
|
| 1141 |
-
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
| 1142 |
-
if (observer !== undefined) {
|
| 1143 |
-
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
| 1144 |
-
this.propertyObserver = new observer(function (mutations) {
|
| 1145 |
-
$.each(mutations, self._sync);
|
| 1146 |
-
});
|
| 1147 |
-
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
| 1148 |
-
}
|
| 1149 |
-
},
|
| 1150 |
-
|
| 1151 |
-
// abstract
|
| 1152 |
-
triggerSelect: function(data) {
|
| 1153 |
-
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
| 1154 |
-
this.opts.element.trigger(evt);
|
| 1155 |
-
return !evt.isDefaultPrevented();
|
| 1156 |
-
},
|
| 1157 |
-
|
| 1158 |
-
/**
|
| 1159 |
-
* Triggers the change event on the source element
|
| 1160 |
-
*/
|
| 1161 |
-
// abstract
|
| 1162 |
-
triggerChange: function (details) {
|
| 1163 |
-
|
| 1164 |
-
details = details || {};
|
| 1165 |
-
details= $.extend({}, details, { type: "change", val: this.val() });
|
| 1166 |
-
// prevents recursive triggering
|
| 1167 |
-
this.opts.element.data("select2-change-triggered", true);
|
| 1168 |
-
this.opts.element.trigger(details);
|
| 1169 |
-
this.opts.element.data("select2-change-triggered", false);
|
| 1170 |
-
|
| 1171 |
-
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
| 1172 |
-
// so here we trigger the click event manually
|
| 1173 |
-
this.opts.element.click();
|
| 1174 |
-
|
| 1175 |
-
// ValidationEngine ignores the change event and listens instead to blur
|
| 1176 |
-
// so here we trigger the blur event manually if so desired
|
| 1177 |
-
if (this.opts.blurOnChange)
|
| 1178 |
-
this.opts.element.blur();
|
| 1179 |
-
},
|
| 1180 |
-
|
| 1181 |
-
//abstract
|
| 1182 |
-
isInterfaceEnabled: function()
|
| 1183 |
-
{
|
| 1184 |
-
return this.enabledInterface === true;
|
| 1185 |
-
},
|
| 1186 |
-
|
| 1187 |
-
// abstract
|
| 1188 |
-
enableInterface: function() {
|
| 1189 |
-
var enabled = this._enabled && !this._readonly,
|
| 1190 |
-
disabled = !enabled;
|
| 1191 |
-
|
| 1192 |
-
if (enabled === this.enabledInterface) return false;
|
| 1193 |
-
|
| 1194 |
-
this.container.toggleClass("select2-container-disabled", disabled);
|
| 1195 |
-
this.close();
|
| 1196 |
-
this.enabledInterface = enabled;
|
| 1197 |
-
|
| 1198 |
-
return true;
|
| 1199 |
-
},
|
| 1200 |
-
|
| 1201 |
-
// abstract
|
| 1202 |
-
enable: function(enabled) {
|
| 1203 |
-
if (enabled === undefined) enabled = true;
|
| 1204 |
-
if (this._enabled === enabled) return;
|
| 1205 |
-
this._enabled = enabled;
|
| 1206 |
-
|
| 1207 |
-
this.opts.element.prop("disabled", !enabled);
|
| 1208 |
-
this.enableInterface();
|
| 1209 |
-
},
|
| 1210 |
-
|
| 1211 |
-
// abstract
|
| 1212 |
-
disable: function() {
|
| 1213 |
-
this.enable(false);
|
| 1214 |
-
},
|
| 1215 |
-
|
| 1216 |
-
// abstract
|
| 1217 |
-
readonly: function(enabled) {
|
| 1218 |
-
if (enabled === undefined) enabled = false;
|
| 1219 |
-
if (this._readonly === enabled) return;
|
| 1220 |
-
this._readonly = enabled;
|
| 1221 |
-
|
| 1222 |
-
this.opts.element.prop("readonly", enabled);
|
| 1223 |
-
this.enableInterface();
|
| 1224 |
-
},
|
| 1225 |
-
|
| 1226 |
-
// abstract
|
| 1227 |
-
opened: function () {
|
| 1228 |
-
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
| 1229 |
-
},
|
| 1230 |
-
|
| 1231 |
-
// abstract
|
| 1232 |
-
positionDropdown: function() {
|
| 1233 |
-
var $dropdown = this.dropdown,
|
| 1234 |
-
container = this.container,
|
| 1235 |
-
offset = container.offset(),
|
| 1236 |
-
height = container.outerHeight(false),
|
| 1237 |
-
width = container.outerWidth(false),
|
| 1238 |
-
dropHeight = $dropdown.outerHeight(false),
|
| 1239 |
-
$window = $(window),
|
| 1240 |
-
windowWidth = $window.width(),
|
| 1241 |
-
windowHeight = $window.height(),
|
| 1242 |
-
viewPortRight = $window.scrollLeft() + windowWidth,
|
| 1243 |
-
viewportBottom = $window.scrollTop() + windowHeight,
|
| 1244 |
-
dropTop = offset.top + height,
|
| 1245 |
-
dropLeft = offset.left,
|
| 1246 |
-
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
| 1247 |
-
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
| 1248 |
-
dropWidth = $dropdown.outerWidth(false),
|
| 1249 |
-
enoughRoomOnRight = function() {
|
| 1250 |
-
return dropLeft + dropWidth <= viewPortRight;
|
| 1251 |
-
},
|
| 1252 |
-
enoughRoomOnLeft = function() {
|
| 1253 |
-
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
| 1254 |
-
},
|
| 1255 |
-
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
| 1256 |
-
bodyOffset,
|
| 1257 |
-
above,
|
| 1258 |
-
changeDirection,
|
| 1259 |
-
css,
|
| 1260 |
-
resultsListNode;
|
| 1261 |
-
|
| 1262 |
-
// always prefer the current above/below alignment, unless there is not enough room
|
| 1263 |
-
if (aboveNow) {
|
| 1264 |
-
above = true;
|
| 1265 |
-
if (!enoughRoomAbove && enoughRoomBelow) {
|
| 1266 |
-
changeDirection = true;
|
| 1267 |
-
above = false;
|
| 1268 |
-
}
|
| 1269 |
-
} else {
|
| 1270 |
-
above = false;
|
| 1271 |
-
if (!enoughRoomBelow && enoughRoomAbove) {
|
| 1272 |
-
changeDirection = true;
|
| 1273 |
-
above = true;
|
| 1274 |
-
}
|
| 1275 |
-
}
|
| 1276 |
-
|
| 1277 |
-
//if we are changing direction we need to get positions when dropdown is hidden;
|
| 1278 |
-
if (changeDirection) {
|
| 1279 |
-
$dropdown.hide();
|
| 1280 |
-
offset = this.container.offset();
|
| 1281 |
-
height = this.container.outerHeight(false);
|
| 1282 |
-
width = this.container.outerWidth(false);
|
| 1283 |
-
dropHeight = $dropdown.outerHeight(false);
|
| 1284 |
-
viewPortRight = $window.scrollLeft() + windowWidth;
|
| 1285 |
-
viewportBottom = $window.scrollTop() + windowHeight;
|
| 1286 |
-
dropTop = offset.top + height;
|
| 1287 |
-
dropLeft = offset.left;
|
| 1288 |
-
dropWidth = $dropdown.outerWidth(false);
|
| 1289 |
-
$dropdown.show();
|
| 1290 |
-
|
| 1291 |
-
// fix so the cursor does not move to the left within the search-textbox in IE
|
| 1292 |
-
this.focusSearch();
|
| 1293 |
-
}
|
| 1294 |
-
|
| 1295 |
-
if (this.opts.dropdownAutoWidth) {
|
| 1296 |
-
resultsListNode = $('.select2-results', $dropdown)[0];
|
| 1297 |
-
$dropdown.addClass('select2-drop-auto-width');
|
| 1298 |
-
$dropdown.css('width', '');
|
| 1299 |
-
// Add scrollbar width to dropdown if vertical scrollbar is present
|
| 1300 |
-
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
| 1301 |
-
dropWidth > width ? width = dropWidth : dropWidth = width;
|
| 1302 |
-
dropHeight = $dropdown.outerHeight(false);
|
| 1303 |
-
}
|
| 1304 |
-
else {
|
| 1305 |
-
this.container.removeClass('select2-drop-auto-width');
|
| 1306 |
-
}
|
| 1307 |
-
|
| 1308 |
-
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
| 1309 |
-
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
| 1310 |
-
|
| 1311 |
-
// fix positioning when body has an offset and is not position: static
|
| 1312 |
-
if (this.body.css('position') !== 'static') {
|
| 1313 |
-
bodyOffset = this.body.offset();
|
| 1314 |
-
dropTop -= bodyOffset.top;
|
| 1315 |
-
dropLeft -= bodyOffset.left;
|
| 1316 |
-
}
|
| 1317 |
-
|
| 1318 |
-
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
| 1319 |
-
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
| 1320 |
-
}
|
| 1321 |
-
|
| 1322 |
-
css = {
|
| 1323 |
-
left: dropLeft,
|
| 1324 |
-
width: width
|
| 1325 |
-
};
|
| 1326 |
-
|
| 1327 |
-
if (above) {
|
| 1328 |
-
css.top = offset.top - dropHeight;
|
| 1329 |
-
css.bottom = 'auto';
|
| 1330 |
-
this.container.addClass("select2-drop-above");
|
| 1331 |
-
$dropdown.addClass("select2-drop-above");
|
| 1332 |
-
}
|
| 1333 |
-
else {
|
| 1334 |
-
css.top = dropTop;
|
| 1335 |
-
css.bottom = 'auto';
|
| 1336 |
-
this.container.removeClass("select2-drop-above");
|
| 1337 |
-
$dropdown.removeClass("select2-drop-above");
|
| 1338 |
-
}
|
| 1339 |
-
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
| 1340 |
-
|
| 1341 |
-
$dropdown.css(css);
|
| 1342 |
-
},
|
| 1343 |
-
|
| 1344 |
-
// abstract
|
| 1345 |
-
shouldOpen: function() {
|
| 1346 |
-
var event;
|
| 1347 |
-
|
| 1348 |
-
if (this.opened()) return false;
|
| 1349 |
-
|
| 1350 |
-
if (this._enabled === false || this._readonly === true) return false;
|
| 1351 |
-
|
| 1352 |
-
event = $.Event("select2-opening");
|
| 1353 |
-
this.opts.element.trigger(event);
|
| 1354 |
-
return !event.isDefaultPrevented();
|
| 1355 |
-
},
|
| 1356 |
-
|
| 1357 |
-
// abstract
|
| 1358 |
-
clearDropdownAlignmentPreference: function() {
|
| 1359 |
-
// clear the classes used to figure out the preference of where the dropdown should be opened
|
| 1360 |
-
this.container.removeClass("select2-drop-above");
|
| 1361 |
-
this.dropdown.removeClass("select2-drop-above");
|
| 1362 |
-
},
|
| 1363 |
-
|
| 1364 |
-
/**
|
| 1365 |
-
* Opens the dropdown
|
| 1366 |
-
*
|
| 1367 |
-
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
| 1368 |
-
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
| 1369 |
-
*/
|
| 1370 |
-
// abstract
|
| 1371 |
-
open: function () {
|
| 1372 |
-
|
| 1373 |
-
if (!this.shouldOpen()) return false;
|
| 1374 |
-
|
| 1375 |
-
this.opening();
|
| 1376 |
-
|
| 1377 |
-
// Only bind the document mousemove when the dropdown is visible
|
| 1378 |
-
$document.on("mousemove.select2Event", function (e) {
|
| 1379 |
-
lastMousePosition.x = e.pageX;
|
| 1380 |
-
lastMousePosition.y = e.pageY;
|
| 1381 |
-
});
|
| 1382 |
-
|
| 1383 |
-
return true;
|
| 1384 |
-
},
|
| 1385 |
-
|
| 1386 |
-
/**
|
| 1387 |
-
* Performs the opening of the dropdown
|
| 1388 |
-
*/
|
| 1389 |
-
// abstract
|
| 1390 |
-
opening: function() {
|
| 1391 |
-
var cid = this.containerEventName,
|
| 1392 |
-
scroll = "scroll." + cid,
|
| 1393 |
-
resize = "resize."+cid,
|
| 1394 |
-
orient = "orientationchange."+cid,
|
| 1395 |
-
mask;
|
| 1396 |
-
|
| 1397 |
-
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
| 1398 |
-
|
| 1399 |
-
this.clearDropdownAlignmentPreference();
|
| 1400 |
-
|
| 1401 |
-
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
| 1402 |
-
this.dropdown.detach().appendTo(this.body);
|
| 1403 |
-
}
|
| 1404 |
-
|
| 1405 |
-
// create the dropdown mask if doesn't already exist
|
| 1406 |
-
mask = $("#select2-drop-mask");
|
| 1407 |
-
if (mask.length === 0) {
|
| 1408 |
-
mask = $(document.createElement("div"));
|
| 1409 |
-
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
| 1410 |
-
mask.hide();
|
| 1411 |
-
mask.appendTo(this.body);
|
| 1412 |
-
mask.on("mousedown touchstart click", function (e) {
|
| 1413 |
-
// Prevent IE from generating a click event on the body
|
| 1414 |
-
reinsertElement(mask);
|
| 1415 |
-
|
| 1416 |
-
var dropdown = $("#select2-drop"), self;
|
| 1417 |
-
if (dropdown.length > 0) {
|
| 1418 |
-
self=dropdown.data("select2");
|
| 1419 |
-
if (self.opts.selectOnBlur) {
|
| 1420 |
-
self.selectHighlighted({noFocus: true});
|
| 1421 |
-
}
|
| 1422 |
-
self.close();
|
| 1423 |
-
e.preventDefault();
|
| 1424 |
-
e.stopPropagation();
|
| 1425 |
-
}
|
| 1426 |
-
});
|
| 1427 |
-
}
|
| 1428 |
-
|
| 1429 |
-
// ensure the mask is always right before the dropdown
|
| 1430 |
-
if (this.dropdown.prev()[0] !== mask[0]) {
|
| 1431 |
-
this.dropdown.before(mask);
|
| 1432 |
-
}
|
| 1433 |
-
|
| 1434 |
-
// move the global id to the correct dropdown
|
| 1435 |
-
$("#select2-drop").removeAttr("id");
|
| 1436 |
-
this.dropdown.attr("id", "select2-drop");
|
| 1437 |
-
|
| 1438 |
-
// show the elements
|
| 1439 |
-
mask.show();
|
| 1440 |
-
|
| 1441 |
-
this.positionDropdown();
|
| 1442 |
-
this.dropdown.show();
|
| 1443 |
-
this.positionDropdown();
|
| 1444 |
-
|
| 1445 |
-
this.dropdown.addClass("select2-drop-active");
|
| 1446 |
-
|
| 1447 |
-
// attach listeners to events that can change the position of the container and thus require
|
| 1448 |
-
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
| 1449 |
-
var that = this;
|
| 1450 |
-
this.container.parents().add(window).each(function () {
|
| 1451 |
-
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
| 1452 |
-
if (that.opened()) that.positionDropdown();
|
| 1453 |
-
});
|
| 1454 |
-
});
|
| 1455 |
-
|
| 1456 |
-
|
| 1457 |
-
},
|
| 1458 |
-
|
| 1459 |
-
// abstract
|
| 1460 |
-
close: function () {
|
| 1461 |
-
if (!this.opened()) return;
|
| 1462 |
-
|
| 1463 |
-
var cid = this.containerEventName,
|
| 1464 |
-
scroll = "scroll." + cid,
|
| 1465 |
-
resize = "resize."+cid,
|
| 1466 |
-
orient = "orientationchange."+cid;
|
| 1467 |
-
|
| 1468 |
-
// unbind event listeners
|
| 1469 |
-
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
| 1470 |
-
|
| 1471 |
-
this.clearDropdownAlignmentPreference();
|
| 1472 |
-
|
| 1473 |
-
$("#select2-drop-mask").hide();
|
| 1474 |
-
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
| 1475 |
-
this.dropdown.hide();
|
| 1476 |
-
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
| 1477 |
-
this.results.empty();
|
| 1478 |
-
|
| 1479 |
-
// Now that the dropdown is closed, unbind the global document mousemove event
|
| 1480 |
-
$document.off("mousemove.select2Event");
|
| 1481 |
-
|
| 1482 |
-
this.clearSearch();
|
| 1483 |
-
this.search.removeClass("select2-active");
|
| 1484 |
-
this.opts.element.trigger($.Event("select2-close"));
|
| 1485 |
-
},
|
| 1486 |
-
|
| 1487 |
-
/**
|
| 1488 |
-
* Opens control, sets input value, and updates results.
|
| 1489 |
-
*/
|
| 1490 |
-
// abstract
|
| 1491 |
-
externalSearch: function (term) {
|
| 1492 |
-
this.open();
|
| 1493 |
-
this.search.val(term);
|
| 1494 |
-
this.updateResults(false);
|
| 1495 |
-
},
|
| 1496 |
-
|
| 1497 |
-
// abstract
|
| 1498 |
-
clearSearch: function () {
|
| 1499 |
-
|
| 1500 |
-
},
|
| 1501 |
-
|
| 1502 |
-
//abstract
|
| 1503 |
-
getMaximumSelectionSize: function() {
|
| 1504 |
-
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
| 1505 |
-
},
|
| 1506 |
-
|
| 1507 |
-
// abstract
|
| 1508 |
-
ensureHighlightVisible: function () {
|
| 1509 |
-
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
| 1510 |
-
|
| 1511 |
-
index = this.highlight();
|
| 1512 |
-
|
| 1513 |
-
if (index < 0) return;
|
| 1514 |
-
|
| 1515 |
-
if (index == 0) {
|
| 1516 |
-
|
| 1517 |
-
// if the first element is highlighted scroll all the way to the top,
|
| 1518 |
-
// that way any unselectable headers above it will also be scrolled
|
| 1519 |
-
// into view
|
| 1520 |
-
|
| 1521 |
-
results.scrollTop(0);
|
| 1522 |
-
return;
|
| 1523 |
-
}
|
| 1524 |
-
|
| 1525 |
-
children = this.findHighlightableChoices().find('.select2-result-label');
|
| 1526 |
-
|
| 1527 |
-
child = $(children[index]);
|
| 1528 |
-
|
| 1529 |
-
topOffset = (child.offset() || {}).top || 0;
|
| 1530 |
-
|
| 1531 |
-
hb = topOffset + child.outerHeight(true);
|
| 1532 |
-
|
| 1533 |
-
// if this is the last child lets also make sure select2-more-results is visible
|
| 1534 |
-
if (index === children.length - 1) {
|
| 1535 |
-
more = results.find("li.select2-more-results");
|
| 1536 |
-
if (more.length > 0) {
|
| 1537 |
-
hb = more.offset().top + more.outerHeight(true);
|
| 1538 |
-
}
|
| 1539 |
-
}
|
| 1540 |
-
|
| 1541 |
-
rb = results.offset().top + results.outerHeight(false);
|
| 1542 |
-
if (hb > rb) {
|
| 1543 |
-
results.scrollTop(results.scrollTop() + (hb - rb));
|
| 1544 |
-
}
|
| 1545 |
-
y = topOffset - results.offset().top;
|
| 1546 |
-
|
| 1547 |
-
// make sure the top of the element is visible
|
| 1548 |
-
if (y < 0 && child.css('display') != 'none' ) {
|
| 1549 |
-
results.scrollTop(results.scrollTop() + y); // y is negative
|
| 1550 |
-
}
|
| 1551 |
-
},
|
| 1552 |
-
|
| 1553 |
-
// abstract
|
| 1554 |
-
findHighlightableChoices: function() {
|
| 1555 |
-
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
| 1556 |
-
},
|
| 1557 |
-
|
| 1558 |
-
// abstract
|
| 1559 |
-
moveHighlight: function (delta) {
|
| 1560 |
-
var choices = this.findHighlightableChoices(),
|
| 1561 |
-
index = this.highlight();
|
| 1562 |
-
|
| 1563 |
-
while (index > -1 && index < choices.length) {
|
| 1564 |
-
index += delta;
|
| 1565 |
-
var choice = $(choices[index]);
|
| 1566 |
-
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
| 1567 |
-
this.highlight(index);
|
| 1568 |
-
break;
|
| 1569 |
-
}
|
| 1570 |
-
}
|
| 1571 |
-
},
|
| 1572 |
-
|
| 1573 |
-
// abstract
|
| 1574 |
-
highlight: function (index) {
|
| 1575 |
-
var choices = this.findHighlightableChoices(),
|
| 1576 |
-
choice,
|
| 1577 |
-
data;
|
| 1578 |
-
|
| 1579 |
-
if (arguments.length === 0) {
|
| 1580 |
-
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
| 1581 |
-
}
|
| 1582 |
-
|
| 1583 |
-
if (index >= choices.length) index = choices.length - 1;
|
| 1584 |
-
if (index < 0) index = 0;
|
| 1585 |
-
|
| 1586 |
-
this.removeHighlight();
|
| 1587 |
-
|
| 1588 |
-
choice = $(choices[index]);
|
| 1589 |
-
choice.addClass("select2-highlighted");
|
| 1590 |
-
|
| 1591 |
-
// ensure assistive technology can determine the active choice
|
| 1592 |
-
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
| 1593 |
-
|
| 1594 |
-
this.ensureHighlightVisible();
|
| 1595 |
-
|
| 1596 |
-
this.liveRegion.text(choice.text());
|
| 1597 |
-
|
| 1598 |
-
data = choice.data("select2-data");
|
| 1599 |
-
if (data) {
|
| 1600 |
-
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
| 1601 |
-
}
|
| 1602 |
-
},
|
| 1603 |
-
|
| 1604 |
-
removeHighlight: function() {
|
| 1605 |
-
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
| 1606 |
-
},
|
| 1607 |
-
|
| 1608 |
-
touchMoved: function() {
|
| 1609 |
-
this._touchMoved = true;
|
| 1610 |
-
},
|
| 1611 |
-
|
| 1612 |
-
clearTouchMoved: function() {
|
| 1613 |
-
this._touchMoved = false;
|
| 1614 |
-
},
|
| 1615 |
-
|
| 1616 |
-
// abstract
|
| 1617 |
-
countSelectableResults: function() {
|
| 1618 |
-
return this.findHighlightableChoices().length;
|
| 1619 |
-
},
|
| 1620 |
-
|
| 1621 |
-
// abstract
|
| 1622 |
-
highlightUnderEvent: function (event) {
|
| 1623 |
-
var el = $(event.target).closest(".select2-result-selectable");
|
| 1624 |
-
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
| 1625 |
-
var choices = this.findHighlightableChoices();
|
| 1626 |
-
this.highlight(choices.index(el));
|
| 1627 |
-
} else if (el.length == 0) {
|
| 1628 |
-
// if we are over an unselectable item remove all highlights
|
| 1629 |
-
this.removeHighlight();
|
| 1630 |
-
}
|
| 1631 |
-
},
|
| 1632 |
-
|
| 1633 |
-
// abstract
|
| 1634 |
-
loadMoreIfNeeded: function () {
|
| 1635 |
-
var results = this.results,
|
| 1636 |
-
more = results.find("li.select2-more-results"),
|
| 1637 |
-
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
| 1638 |
-
page = this.resultsPage + 1,
|
| 1639 |
-
self=this,
|
| 1640 |
-
term=this.search.val(),
|
| 1641 |
-
context=this.context;
|
| 1642 |
-
|
| 1643 |
-
if (more.length === 0) return;
|
| 1644 |
-
below = more.offset().top - results.offset().top - results.height();
|
| 1645 |
-
|
| 1646 |
-
if (below <= this.opts.loadMorePadding) {
|
| 1647 |
-
more.addClass("select2-active");
|
| 1648 |
-
this.opts.query({
|
| 1649 |
-
element: this.opts.element,
|
| 1650 |
-
term: term,
|
| 1651 |
-
page: page,
|
| 1652 |
-
context: context,
|
| 1653 |
-
matcher: this.opts.matcher,
|
| 1654 |
-
callback: this.bind(function (data) {
|
| 1655 |
-
|
| 1656 |
-
// ignore a response if the select2 has been closed before it was received
|
| 1657 |
-
if (!self.opened()) return;
|
| 1658 |
-
|
| 1659 |
-
|
| 1660 |
-
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
| 1661 |
-
self.postprocessResults(data, false, false);
|
| 1662 |
-
|
| 1663 |
-
if (data.more===true) {
|
| 1664 |
-
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
| 1665 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1666 |
-
} else {
|
| 1667 |
-
more.remove();
|
| 1668 |
-
}
|
| 1669 |
-
self.positionDropdown();
|
| 1670 |
-
self.resultsPage = page;
|
| 1671 |
-
self.context = data.context;
|
| 1672 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1673 |
-
})});
|
| 1674 |
-
}
|
| 1675 |
-
},
|
| 1676 |
-
|
| 1677 |
-
/**
|
| 1678 |
-
* Default tokenizer function which does nothing
|
| 1679 |
-
*/
|
| 1680 |
-
tokenize: function() {
|
| 1681 |
-
|
| 1682 |
-
},
|
| 1683 |
-
|
| 1684 |
-
/**
|
| 1685 |
-
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
| 1686 |
-
*/
|
| 1687 |
-
// abstract
|
| 1688 |
-
updateResults: function (initial) {
|
| 1689 |
-
var search = this.search,
|
| 1690 |
-
results = this.results,
|
| 1691 |
-
opts = this.opts,
|
| 1692 |
-
data,
|
| 1693 |
-
self = this,
|
| 1694 |
-
input,
|
| 1695 |
-
term = search.val(),
|
| 1696 |
-
lastTerm = $.data(this.container, "select2-last-term"),
|
| 1697 |
-
// sequence number used to drop out-of-order responses
|
| 1698 |
-
queryNumber;
|
| 1699 |
-
|
| 1700 |
-
// prevent duplicate queries against the same term
|
| 1701 |
-
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
| 1702 |
-
|
| 1703 |
-
$.data(this.container, "select2-last-term", term);
|
| 1704 |
-
|
| 1705 |
-
// if the search is currently hidden we do not alter the results
|
| 1706 |
-
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
| 1707 |
-
return;
|
| 1708 |
-
}
|
| 1709 |
-
|
| 1710 |
-
function postRender() {
|
| 1711 |
-
search.removeClass("select2-active");
|
| 1712 |
-
self.positionDropdown();
|
| 1713 |
-
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
| 1714 |
-
self.liveRegion.text(results.text());
|
| 1715 |
-
}
|
| 1716 |
-
else {
|
| 1717 |
-
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
| 1718 |
-
}
|
| 1719 |
-
}
|
| 1720 |
-
|
| 1721 |
-
function render(html) {
|
| 1722 |
-
results.html(html);
|
| 1723 |
-
postRender();
|
| 1724 |
-
}
|
| 1725 |
-
|
| 1726 |
-
queryNumber = ++this.queryCount;
|
| 1727 |
-
|
| 1728 |
-
var maxSelSize = this.getMaximumSelectionSize();
|
| 1729 |
-
if (maxSelSize >=1) {
|
| 1730 |
-
data = this.data();
|
| 1731 |
-
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
| 1732 |
-
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
| 1733 |
-
return;
|
| 1734 |
-
}
|
| 1735 |
-
}
|
| 1736 |
-
|
| 1737 |
-
if (search.val().length < opts.minimumInputLength) {
|
| 1738 |
-
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
| 1739 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
| 1740 |
-
} else {
|
| 1741 |
-
render("");
|
| 1742 |
-
}
|
| 1743 |
-
if (initial && this.showSearch) this.showSearch(true);
|
| 1744 |
-
return;
|
| 1745 |
-
}
|
| 1746 |
-
|
| 1747 |
-
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
| 1748 |
-
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
| 1749 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
| 1750 |
-
} else {
|
| 1751 |
-
render("");
|
| 1752 |
-
}
|
| 1753 |
-
return;
|
| 1754 |
-
}
|
| 1755 |
-
|
| 1756 |
-
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
| 1757 |
-
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
| 1758 |
-
}
|
| 1759 |
-
|
| 1760 |
-
search.addClass("select2-active");
|
| 1761 |
-
|
| 1762 |
-
this.removeHighlight();
|
| 1763 |
-
|
| 1764 |
-
// give the tokenizer a chance to pre-process the input
|
| 1765 |
-
input = this.tokenize();
|
| 1766 |
-
if (input != undefined && input != null) {
|
| 1767 |
-
search.val(input);
|
| 1768 |
-
}
|
| 1769 |
-
|
| 1770 |
-
this.resultsPage = 1;
|
| 1771 |
-
|
| 1772 |
-
opts.query({
|
| 1773 |
-
element: opts.element,
|
| 1774 |
-
term: search.val(),
|
| 1775 |
-
page: this.resultsPage,
|
| 1776 |
-
context: null,
|
| 1777 |
-
matcher: opts.matcher,
|
| 1778 |
-
callback: this.bind(function (data) {
|
| 1779 |
-
var def; // default choice
|
| 1780 |
-
|
| 1781 |
-
// ignore old responses
|
| 1782 |
-
if (queryNumber != this.queryCount) {
|
| 1783 |
-
return;
|
| 1784 |
-
}
|
| 1785 |
-
|
| 1786 |
-
// ignore a response if the select2 has been closed before it was received
|
| 1787 |
-
if (!this.opened()) {
|
| 1788 |
-
this.search.removeClass("select2-active");
|
| 1789 |
-
return;
|
| 1790 |
-
}
|
| 1791 |
-
|
| 1792 |
-
// handle ajax error
|
| 1793 |
-
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
| 1794 |
-
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
| 1795 |
-
return;
|
| 1796 |
-
}
|
| 1797 |
-
|
| 1798 |
-
// save context, if any
|
| 1799 |
-
this.context = (data.context===undefined) ? null : data.context;
|
| 1800 |
-
// create a default choice and prepend it to the list
|
| 1801 |
-
if (this.opts.createSearchChoice && search.val() !== "") {
|
| 1802 |
-
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
| 1803 |
-
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
| 1804 |
-
if ($(data.results).filter(
|
| 1805 |
-
function () {
|
| 1806 |
-
return equal(self.id(this), self.id(def));
|
| 1807 |
-
}).length === 0) {
|
| 1808 |
-
this.opts.createSearchChoicePosition(data.results, def);
|
| 1809 |
-
}
|
| 1810 |
-
}
|
| 1811 |
-
}
|
| 1812 |
-
|
| 1813 |
-
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
| 1814 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
| 1815 |
-
return;
|
| 1816 |
-
}
|
| 1817 |
-
|
| 1818 |
-
results.empty();
|
| 1819 |
-
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
| 1820 |
-
|
| 1821 |
-
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
| 1822 |
-
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
| 1823 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1824 |
-
}
|
| 1825 |
-
|
| 1826 |
-
this.postprocessResults(data, initial);
|
| 1827 |
-
|
| 1828 |
-
postRender();
|
| 1829 |
-
|
| 1830 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1831 |
-
})});
|
| 1832 |
-
},
|
| 1833 |
-
|
| 1834 |
-
// abstract
|
| 1835 |
-
cancel: function () {
|
| 1836 |
-
this.close();
|
| 1837 |
-
},
|
| 1838 |
-
|
| 1839 |
-
// abstract
|
| 1840 |
-
blur: function () {
|
| 1841 |
-
// if selectOnBlur == true, select the currently highlighted option
|
| 1842 |
-
if (this.opts.selectOnBlur)
|
| 1843 |
-
this.selectHighlighted({noFocus: true});
|
| 1844 |
-
|
| 1845 |
-
this.close();
|
| 1846 |
-
this.container.removeClass("select2-container-active");
|
| 1847 |
-
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
| 1848 |
-
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
| 1849 |
-
this.clearSearch();
|
| 1850 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 1851 |
-
},
|
| 1852 |
-
|
| 1853 |
-
// abstract
|
| 1854 |
-
focusSearch: function () {
|
| 1855 |
-
focus(this.search);
|
| 1856 |
-
},
|
| 1857 |
-
|
| 1858 |
-
// abstract
|
| 1859 |
-
selectHighlighted: function (options) {
|
| 1860 |
-
if (this._touchMoved) {
|
| 1861 |
-
this.clearTouchMoved();
|
| 1862 |
-
return;
|
| 1863 |
-
}
|
| 1864 |
-
var index=this.highlight(),
|
| 1865 |
-
highlighted=this.results.find(".select2-highlighted"),
|
| 1866 |
-
data = highlighted.closest('.select2-result').data("select2-data");
|
| 1867 |
-
|
| 1868 |
-
if (data) {
|
| 1869 |
-
this.highlight(index);
|
| 1870 |
-
this.onSelect(data, options);
|
| 1871 |
-
} else if (options && options.noFocus) {
|
| 1872 |
-
this.close();
|
| 1873 |
-
}
|
| 1874 |
-
},
|
| 1875 |
-
|
| 1876 |
-
// abstract
|
| 1877 |
-
getPlaceholder: function () {
|
| 1878 |
-
var placeholderOption;
|
| 1879 |
-
return this.opts.element.attr("placeholder") ||
|
| 1880 |
-
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
| 1881 |
-
this.opts.element.data("placeholder") ||
|
| 1882 |
-
this.opts.placeholder ||
|
| 1883 |
-
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
| 1884 |
-
},
|
| 1885 |
-
|
| 1886 |
-
// abstract
|
| 1887 |
-
getPlaceholderOption: function() {
|
| 1888 |
-
if (this.select) {
|
| 1889 |
-
var firstOption = this.select.children('option').first();
|
| 1890 |
-
if (this.opts.placeholderOption !== undefined ) {
|
| 1891 |
-
//Determine the placeholder option based on the specified placeholderOption setting
|
| 1892 |
-
return (this.opts.placeholderOption === "first" && firstOption) ||
|
| 1893 |
-
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
| 1894 |
-
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
| 1895 |
-
//No explicit placeholder option specified, use the first if it's blank
|
| 1896 |
-
return firstOption;
|
| 1897 |
-
}
|
| 1898 |
-
}
|
| 1899 |
-
},
|
| 1900 |
-
|
| 1901 |
-
/**
|
| 1902 |
-
* Get the desired width for the container element. This is
|
| 1903 |
-
* derived first from option `width` passed to select2, then
|
| 1904 |
-
* the inline 'style' on the original element, and finally
|
| 1905 |
-
* falls back to the jQuery calculated element width.
|
| 1906 |
-
*/
|
| 1907 |
-
// abstract
|
| 1908 |
-
initContainerWidth: function () {
|
| 1909 |
-
function resolveContainerWidth() {
|
| 1910 |
-
var style, attrs, matches, i, l, attr;
|
| 1911 |
-
|
| 1912 |
-
if (this.opts.width === "off") {
|
| 1913 |
-
return null;
|
| 1914 |
-
} else if (this.opts.width === "element"){
|
| 1915 |
-
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
| 1916 |
-
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
| 1917 |
-
// check if there is inline style on the element that contains width
|
| 1918 |
-
style = this.opts.element.attr('style');
|
| 1919 |
-
if (style !== undefined) {
|
| 1920 |
-
attrs = style.split(';');
|
| 1921 |
-
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
| 1922 |
-
attr = attrs[i].replace(/\s/g, '');
|
| 1923 |
-
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
| 1924 |
-
if (matches !== null && matches.length >= 1)
|
| 1925 |
-
return matches[1];
|
| 1926 |
-
}
|
| 1927 |
-
}
|
| 1928 |
-
|
| 1929 |
-
if (this.opts.width === "resolve") {
|
| 1930 |
-
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
| 1931 |
-
// when attached to input type=hidden or elements hidden via css
|
| 1932 |
-
style = this.opts.element.css('width');
|
| 1933 |
-
if (style.indexOf("%") > 0) return style;
|
| 1934 |
-
|
| 1935 |
-
// finally, fallback on the calculated width of the element
|
| 1936 |
-
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
| 1937 |
-
}
|
| 1938 |
-
|
| 1939 |
-
return null;
|
| 1940 |
-
} else if ($.isFunction(this.opts.width)) {
|
| 1941 |
-
return this.opts.width();
|
| 1942 |
-
} else {
|
| 1943 |
-
return this.opts.width;
|
| 1944 |
-
}
|
| 1945 |
-
};
|
| 1946 |
-
|
| 1947 |
-
var width = resolveContainerWidth.call(this);
|
| 1948 |
-
if (width !== null) {
|
| 1949 |
-
this.container.css("width", width);
|
| 1950 |
-
}
|
| 1951 |
-
}
|
| 1952 |
-
});
|
| 1953 |
-
|
| 1954 |
-
SingleSelect2 = clazz(AbstractSelect2, {
|
| 1955 |
-
|
| 1956 |
-
// single
|
| 1957 |
-
|
| 1958 |
-
createContainer: function () {
|
| 1959 |
-
var container = $(document.createElement("div")).attr({
|
| 1960 |
-
"class": "select2-container"
|
| 1961 |
-
}).html([
|
| 1962 |
-
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
| 1963 |
-
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
| 1964 |
-
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
| 1965 |
-
"</a>",
|
| 1966 |
-
"<label for='' class='select2-offscreen'></label>",
|
| 1967 |
-
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
| 1968 |
-
"<div class='select2-drop select2-display-none'>",
|
| 1969 |
-
" <div class='select2-search'>",
|
| 1970 |
-
" <label for='' class='select2-offscreen'></label>",
|
| 1971 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
| 1972 |
-
" aria-autocomplete='list' />",
|
| 1973 |
-
" </div>",
|
| 1974 |
-
" <ul class='select2-results' role='listbox'>",
|
| 1975 |
-
" </ul>",
|
| 1976 |
-
"</div>"].join(""));
|
| 1977 |
-
return container;
|
| 1978 |
-
},
|
| 1979 |
-
|
| 1980 |
-
// single
|
| 1981 |
-
enableInterface: function() {
|
| 1982 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 1983 |
-
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
| 1984 |
-
}
|
| 1985 |
-
},
|
| 1986 |
-
|
| 1987 |
-
// single
|
| 1988 |
-
opening: function () {
|
| 1989 |
-
var el, range, len;
|
| 1990 |
-
|
| 1991 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
| 1992 |
-
this.showSearch(true);
|
| 1993 |
-
}
|
| 1994 |
-
|
| 1995 |
-
this.parent.opening.apply(this, arguments);
|
| 1996 |
-
|
| 1997 |
-
if (this.showSearchInput !== false) {
|
| 1998 |
-
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
| 1999 |
-
// all other browsers handle this just fine
|
| 2000 |
-
|
| 2001 |
-
this.search.val(this.focusser.val());
|
| 2002 |
-
}
|
| 2003 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2004 |
-
this.search.focus();
|
| 2005 |
-
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
| 2006 |
-
// new text will appear *before* focusser.val()
|
| 2007 |
-
el = this.search.get(0);
|
| 2008 |
-
if (el.createTextRange) {
|
| 2009 |
-
range = el.createTextRange();
|
| 2010 |
-
range.collapse(false);
|
| 2011 |
-
range.select();
|
| 2012 |
-
} else if (el.setSelectionRange) {
|
| 2013 |
-
len = this.search.val().length;
|
| 2014 |
-
el.setSelectionRange(len, len);
|
| 2015 |
-
}
|
| 2016 |
-
}
|
| 2017 |
-
|
| 2018 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2019 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2020 |
-
if(this.search.val() === "") {
|
| 2021 |
-
if(this.nextSearchTerm != undefined){
|
| 2022 |
-
this.search.val(this.nextSearchTerm);
|
| 2023 |
-
this.search.select();
|
| 2024 |
-
}
|
| 2025 |
-
}
|
| 2026 |
-
|
| 2027 |
-
this.focusser.prop("disabled", true).val("");
|
| 2028 |
-
this.updateResults(true);
|
| 2029 |
-
this.opts.element.trigger($.Event("select2-open"));
|
| 2030 |
-
},
|
| 2031 |
-
|
| 2032 |
-
// single
|
| 2033 |
-
close: function () {
|
| 2034 |
-
if (!this.opened()) return;
|
| 2035 |
-
this.parent.close.apply(this, arguments);
|
| 2036 |
-
|
| 2037 |
-
this.focusser.prop("disabled", false);
|
| 2038 |
-
|
| 2039 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2040 |
-
this.focusser.focus();
|
| 2041 |
-
}
|
| 2042 |
-
},
|
| 2043 |
-
|
| 2044 |
-
// single
|
| 2045 |
-
focus: function () {
|
| 2046 |
-
if (this.opened()) {
|
| 2047 |
-
this.close();
|
| 2048 |
-
} else {
|
| 2049 |
-
this.focusser.prop("disabled", false);
|
| 2050 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2051 |
-
this.focusser.focus();
|
| 2052 |
-
}
|
| 2053 |
-
}
|
| 2054 |
-
},
|
| 2055 |
-
|
| 2056 |
-
// single
|
| 2057 |
-
isFocused: function () {
|
| 2058 |
-
return this.container.hasClass("select2-container-active");
|
| 2059 |
-
},
|
| 2060 |
-
|
| 2061 |
-
// single
|
| 2062 |
-
cancel: function () {
|
| 2063 |
-
this.parent.cancel.apply(this, arguments);
|
| 2064 |
-
this.focusser.prop("disabled", false);
|
| 2065 |
-
|
| 2066 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2067 |
-
this.focusser.focus();
|
| 2068 |
-
}
|
| 2069 |
-
},
|
| 2070 |
-
|
| 2071 |
-
// single
|
| 2072 |
-
destroy: function() {
|
| 2073 |
-
$("label[for='" + this.focusser.attr('id') + "']")
|
| 2074 |
-
.attr('for', this.opts.element.attr("id"));
|
| 2075 |
-
this.parent.destroy.apply(this, arguments);
|
| 2076 |
-
|
| 2077 |
-
cleanupJQueryElements.call(this,
|
| 2078 |
-
"selection",
|
| 2079 |
-
"focusser"
|
| 2080 |
-
);
|
| 2081 |
-
},
|
| 2082 |
-
|
| 2083 |
-
// single
|
| 2084 |
-
initContainer: function () {
|
| 2085 |
-
|
| 2086 |
-
var selection,
|
| 2087 |
-
container = this.container,
|
| 2088 |
-
dropdown = this.dropdown,
|
| 2089 |
-
idSuffix = nextUid(),
|
| 2090 |
-
elementLabel;
|
| 2091 |
-
|
| 2092 |
-
if (this.opts.minimumResultsForSearch < 0) {
|
| 2093 |
-
this.showSearch(false);
|
| 2094 |
-
} else {
|
| 2095 |
-
this.showSearch(true);
|
| 2096 |
-
}
|
| 2097 |
-
|
| 2098 |
-
this.selection = selection = container.find(".select2-choice");
|
| 2099 |
-
|
| 2100 |
-
this.focusser = container.find(".select2-focusser");
|
| 2101 |
-
|
| 2102 |
-
// add aria associations
|
| 2103 |
-
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
| 2104 |
-
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
| 2105 |
-
this.results.attr("id", "select2-results-"+idSuffix);
|
| 2106 |
-
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
| 2107 |
-
|
| 2108 |
-
// rewrite labels from original element to focusser
|
| 2109 |
-
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
| 2110 |
-
|
| 2111 |
-
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
| 2112 |
-
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
| 2113 |
-
|
| 2114 |
-
this.focusser.prev()
|
| 2115 |
-
.text(elementLabel.text())
|
| 2116 |
-
.attr('for', this.focusser.attr('id'));
|
| 2117 |
-
|
| 2118 |
-
// Ensure the original element retains an accessible name
|
| 2119 |
-
var originalTitle = this.opts.element.attr("title");
|
| 2120 |
-
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
| 2121 |
-
|
| 2122 |
-
this.focusser.attr("tabindex", this.elementTabIndex);
|
| 2123 |
-
|
| 2124 |
-
// write label for search field using the label from the focusser element
|
| 2125 |
-
this.search.attr("id", this.focusser.attr('id') + '_search');
|
| 2126 |
-
|
| 2127 |
-
this.search.prev()
|
| 2128 |
-
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
| 2129 |
-
.attr('for', this.search.attr('id'));
|
| 2130 |
-
|
| 2131 |
-
this.search.on("keydown", this.bind(function (e) {
|
| 2132 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2133 |
-
|
| 2134 |
-
// filter 229 keyCodes (input method editor is processing key input)
|
| 2135 |
-
if (229 == e.keyCode) return;
|
| 2136 |
-
|
| 2137 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2138 |
-
// prevent the page from scrolling
|
| 2139 |
-
killEvent(e);
|
| 2140 |
-
return;
|
| 2141 |
-
}
|
| 2142 |
-
|
| 2143 |
-
switch (e.which) {
|
| 2144 |
-
case KEY.UP:
|
| 2145 |
-
case KEY.DOWN:
|
| 2146 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2147 |
-
killEvent(e);
|
| 2148 |
-
return;
|
| 2149 |
-
case KEY.ENTER:
|
| 2150 |
-
this.selectHighlighted();
|
| 2151 |
-
killEvent(e);
|
| 2152 |
-
return;
|
| 2153 |
-
case KEY.TAB:
|
| 2154 |
-
this.selectHighlighted({noFocus: true});
|
| 2155 |
-
return;
|
| 2156 |
-
case KEY.ESC:
|
| 2157 |
-
this.cancel(e);
|
| 2158 |
-
killEvent(e);
|
| 2159 |
-
return;
|
| 2160 |
-
}
|
| 2161 |
-
}));
|
| 2162 |
-
|
| 2163 |
-
this.search.on("blur", this.bind(function(e) {
|
| 2164 |
-
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
| 2165 |
-
// without this the search field loses focus which is annoying
|
| 2166 |
-
if (document.activeElement === this.body.get(0)) {
|
| 2167 |
-
window.setTimeout(this.bind(function() {
|
| 2168 |
-
if (this.opened()) {
|
| 2169 |
-
this.search.focus();
|
| 2170 |
-
}
|
| 2171 |
-
}), 0);
|
| 2172 |
-
}
|
| 2173 |
-
}));
|
| 2174 |
-
|
| 2175 |
-
this.focusser.on("keydown", this.bind(function (e) {
|
| 2176 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2177 |
-
|
| 2178 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
| 2179 |
-
return;
|
| 2180 |
-
}
|
| 2181 |
-
|
| 2182 |
-
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
| 2183 |
-
killEvent(e);
|
| 2184 |
-
return;
|
| 2185 |
-
}
|
| 2186 |
-
|
| 2187 |
-
if (e.which == KEY.DOWN || e.which == KEY.UP
|
| 2188 |
-
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
| 2189 |
-
|
| 2190 |
-
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
| 2191 |
-
|
| 2192 |
-
this.open();
|
| 2193 |
-
killEvent(e);
|
| 2194 |
-
return;
|
| 2195 |
-
}
|
| 2196 |
-
|
| 2197 |
-
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
| 2198 |
-
if (this.opts.allowClear) {
|
| 2199 |
-
this.clear();
|
| 2200 |
-
}
|
| 2201 |
-
killEvent(e);
|
| 2202 |
-
return;
|
| 2203 |
-
}
|
| 2204 |
-
}));
|
| 2205 |
-
|
| 2206 |
-
|
| 2207 |
-
installKeyUpChangeEvent(this.focusser);
|
| 2208 |
-
this.focusser.on("keyup-change input", this.bind(function(e) {
|
| 2209 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
| 2210 |
-
e.stopPropagation();
|
| 2211 |
-
if (this.opened()) return;
|
| 2212 |
-
this.open();
|
| 2213 |
-
}
|
| 2214 |
-
}));
|
| 2215 |
-
|
| 2216 |
-
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
| 2217 |
-
if (!this.isInterfaceEnabled()) {
|
| 2218 |
-
return;
|
| 2219 |
-
}
|
| 2220 |
-
|
| 2221 |
-
this.clear();
|
| 2222 |
-
killEventImmediately(e);
|
| 2223 |
-
this.close();
|
| 2224 |
-
|
| 2225 |
-
if (this.selection) {
|
| 2226 |
-
this.selection.focus();
|
| 2227 |
-
}
|
| 2228 |
-
}));
|
| 2229 |
-
|
| 2230 |
-
selection.on("mousedown touchstart", this.bind(function (e) {
|
| 2231 |
-
// Prevent IE from generating a click event on the body
|
| 2232 |
-
reinsertElement(selection);
|
| 2233 |
-
|
| 2234 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2235 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2236 |
-
}
|
| 2237 |
-
|
| 2238 |
-
if (this.opened()) {
|
| 2239 |
-
this.close();
|
| 2240 |
-
} else if (this.isInterfaceEnabled()) {
|
| 2241 |
-
this.open();
|
| 2242 |
-
}
|
| 2243 |
-
|
| 2244 |
-
killEvent(e);
|
| 2245 |
-
}));
|
| 2246 |
-
|
| 2247 |
-
dropdown.on("mousedown touchstart", this.bind(function() {
|
| 2248 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2249 |
-
this.search.focus();
|
| 2250 |
-
}
|
| 2251 |
-
}));
|
| 2252 |
-
|
| 2253 |
-
selection.on("focus", this.bind(function(e) {
|
| 2254 |
-
killEvent(e);
|
| 2255 |
-
}));
|
| 2256 |
-
|
| 2257 |
-
this.focusser.on("focus", this.bind(function(){
|
| 2258 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2259 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2260 |
-
}
|
| 2261 |
-
this.container.addClass("select2-container-active");
|
| 2262 |
-
})).on("blur", this.bind(function() {
|
| 2263 |
-
if (!this.opened()) {
|
| 2264 |
-
this.container.removeClass("select2-container-active");
|
| 2265 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
| 2266 |
-
}
|
| 2267 |
-
}));
|
| 2268 |
-
this.search.on("focus", this.bind(function(){
|
| 2269 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2270 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2271 |
-
}
|
| 2272 |
-
this.container.addClass("select2-container-active");
|
| 2273 |
-
}));
|
| 2274 |
-
|
| 2275 |
-
this.initContainerWidth();
|
| 2276 |
-
this.opts.element.hide();
|
| 2277 |
-
this.setPlaceholder();
|
| 2278 |
-
|
| 2279 |
-
},
|
| 2280 |
-
|
| 2281 |
-
// single
|
| 2282 |
-
clear: function(triggerChange) {
|
| 2283 |
-
var data=this.selection.data("select2-data");
|
| 2284 |
-
if (data) { // guard against queued quick consecutive clicks
|
| 2285 |
-
var evt = $.Event("select2-clearing");
|
| 2286 |
-
this.opts.element.trigger(evt);
|
| 2287 |
-
if (evt.isDefaultPrevented()) {
|
| 2288 |
-
return;
|
| 2289 |
-
}
|
| 2290 |
-
var placeholderOption = this.getPlaceholderOption();
|
| 2291 |
-
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
| 2292 |
-
this.selection.find(".select2-chosen").empty();
|
| 2293 |
-
this.selection.removeData("select2-data");
|
| 2294 |
-
this.setPlaceholder();
|
| 2295 |
-
|
| 2296 |
-
if (triggerChange !== false){
|
| 2297 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 2298 |
-
this.triggerChange({removed:data});
|
| 2299 |
-
}
|
| 2300 |
-
}
|
| 2301 |
-
},
|
| 2302 |
-
|
| 2303 |
-
/**
|
| 2304 |
-
* Sets selection based on source element's value
|
| 2305 |
-
*/
|
| 2306 |
-
// single
|
| 2307 |
-
initSelection: function () {
|
| 2308 |
-
var selected;
|
| 2309 |
-
if (this.isPlaceholderOptionSelected()) {
|
| 2310 |
-
this.updateSelection(null);
|
| 2311 |
-
this.close();
|
| 2312 |
-
this.setPlaceholder();
|
| 2313 |
-
} else {
|
| 2314 |
-
var self = this;
|
| 2315 |
-
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
| 2316 |
-
if (selected !== undefined && selected !== null) {
|
| 2317 |
-
self.updateSelection(selected);
|
| 2318 |
-
self.close();
|
| 2319 |
-
self.setPlaceholder();
|
| 2320 |
-
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
| 2321 |
-
}
|
| 2322 |
-
});
|
| 2323 |
-
}
|
| 2324 |
-
},
|
| 2325 |
-
|
| 2326 |
-
isPlaceholderOptionSelected: function() {
|
| 2327 |
-
var placeholderOption;
|
| 2328 |
-
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
| 2329 |
-
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
| 2330 |
-
|| (this.opts.element.val() === "")
|
| 2331 |
-
|| (this.opts.element.val() === undefined)
|
| 2332 |
-
|| (this.opts.element.val() === null);
|
| 2333 |
-
},
|
| 2334 |
-
|
| 2335 |
-
// single
|
| 2336 |
-
prepareOpts: function () {
|
| 2337 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2338 |
-
self=this;
|
| 2339 |
-
|
| 2340 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2341 |
-
// install the selection initializer
|
| 2342 |
-
opts.initSelection = function (element, callback) {
|
| 2343 |
-
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
| 2344 |
-
// a single select box always has a value, no need to null check 'selected'
|
| 2345 |
-
callback(self.optionToData(selected));
|
| 2346 |
-
};
|
| 2347 |
-
} else if ("data" in opts) {
|
| 2348 |
-
// install default initSelection when applied to hidden input and data is local
|
| 2349 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2350 |
-
var id = element.val();
|
| 2351 |
-
//search in data by id, storing the actual matching item
|
| 2352 |
-
var match = null;
|
| 2353 |
-
opts.query({
|
| 2354 |
-
matcher: function(term, text, el){
|
| 2355 |
-
var is_match = equal(id, opts.id(el));
|
| 2356 |
-
if (is_match) {
|
| 2357 |
-
match = el;
|
| 2358 |
-
}
|
| 2359 |
-
return is_match;
|
| 2360 |
-
},
|
| 2361 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2362 |
-
callback(match);
|
| 2363 |
-
}
|
| 2364 |
-
});
|
| 2365 |
-
};
|
| 2366 |
-
}
|
| 2367 |
-
|
| 2368 |
-
return opts;
|
| 2369 |
-
},
|
| 2370 |
-
|
| 2371 |
-
// single
|
| 2372 |
-
getPlaceholder: function() {
|
| 2373 |
-
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
| 2374 |
-
if (this.select) {
|
| 2375 |
-
if (this.getPlaceholderOption() === undefined) {
|
| 2376 |
-
return undefined;
|
| 2377 |
-
}
|
| 2378 |
-
}
|
| 2379 |
-
|
| 2380 |
-
return this.parent.getPlaceholder.apply(this, arguments);
|
| 2381 |
-
},
|
| 2382 |
-
|
| 2383 |
-
// single
|
| 2384 |
-
setPlaceholder: function () {
|
| 2385 |
-
var placeholder = this.getPlaceholder();
|
| 2386 |
-
|
| 2387 |
-
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
| 2388 |
-
|
| 2389 |
-
// check for a placeholder option if attached to a select
|
| 2390 |
-
if (this.select && this.getPlaceholderOption() === undefined) return;
|
| 2391 |
-
|
| 2392 |
-
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
| 2393 |
-
|
| 2394 |
-
this.selection.addClass("select2-default");
|
| 2395 |
-
|
| 2396 |
-
this.container.removeClass("select2-allowclear");
|
| 2397 |
-
}
|
| 2398 |
-
},
|
| 2399 |
-
|
| 2400 |
-
// single
|
| 2401 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 2402 |
-
var selected = 0, self = this, showSearchInput = true;
|
| 2403 |
-
|
| 2404 |
-
// find the selected element in the result list
|
| 2405 |
-
|
| 2406 |
-
this.findHighlightableChoices().each2(function (i, elm) {
|
| 2407 |
-
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
| 2408 |
-
selected = i;
|
| 2409 |
-
return false;
|
| 2410 |
-
}
|
| 2411 |
-
});
|
| 2412 |
-
|
| 2413 |
-
// and highlight it
|
| 2414 |
-
if (noHighlightUpdate !== false) {
|
| 2415 |
-
if (initial === true && selected >= 0) {
|
| 2416 |
-
this.highlight(selected);
|
| 2417 |
-
} else {
|
| 2418 |
-
this.highlight(0);
|
| 2419 |
-
}
|
| 2420 |
-
}
|
| 2421 |
-
|
| 2422 |
-
// hide the search box if this is the first we got the results and there are enough of them for search
|
| 2423 |
-
|
| 2424 |
-
if (initial === true) {
|
| 2425 |
-
var min = this.opts.minimumResultsForSearch;
|
| 2426 |
-
if (min >= 0) {
|
| 2427 |
-
this.showSearch(countResults(data.results) >= min);
|
| 2428 |
-
}
|
| 2429 |
-
}
|
| 2430 |
-
},
|
| 2431 |
-
|
| 2432 |
-
// single
|
| 2433 |
-
showSearch: function(showSearchInput) {
|
| 2434 |
-
if (this.showSearchInput === showSearchInput) return;
|
| 2435 |
-
|
| 2436 |
-
this.showSearchInput = showSearchInput;
|
| 2437 |
-
|
| 2438 |
-
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
| 2439 |
-
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
| 2440 |
-
//add "select2-with-searchbox" to the container if search box is shown
|
| 2441 |
-
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
| 2442 |
-
},
|
| 2443 |
-
|
| 2444 |
-
// single
|
| 2445 |
-
onSelect: function (data, options) {
|
| 2446 |
-
|
| 2447 |
-
if (!this.triggerSelect(data)) { return; }
|
| 2448 |
-
|
| 2449 |
-
var old = this.opts.element.val(),
|
| 2450 |
-
oldData = this.data();
|
| 2451 |
-
|
| 2452 |
-
this.opts.element.val(this.id(data));
|
| 2453 |
-
this.updateSelection(data);
|
| 2454 |
-
|
| 2455 |
-
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
| 2456 |
-
|
| 2457 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 2458 |
-
this.close();
|
| 2459 |
-
|
| 2460 |
-
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
| 2461 |
-
this.focusser.focus();
|
| 2462 |
-
}
|
| 2463 |
-
|
| 2464 |
-
if (!equal(old, this.id(data))) {
|
| 2465 |
-
this.triggerChange({ added: data, removed: oldData });
|
| 2466 |
-
}
|
| 2467 |
-
},
|
| 2468 |
-
|
| 2469 |
-
// single
|
| 2470 |
-
updateSelection: function (data) {
|
| 2471 |
-
|
| 2472 |
-
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
| 2473 |
-
|
| 2474 |
-
this.selection.data("select2-data", data);
|
| 2475 |
-
|
| 2476 |
-
container.empty();
|
| 2477 |
-
if (data !== null) {
|
| 2478 |
-
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
| 2479 |
-
}
|
| 2480 |
-
if (formatted !== undefined) {
|
| 2481 |
-
container.append(formatted);
|
| 2482 |
-
}
|
| 2483 |
-
cssClass=this.opts.formatSelectionCssClass(data, container);
|
| 2484 |
-
if (cssClass !== undefined) {
|
| 2485 |
-
container.addClass(cssClass);
|
| 2486 |
-
}
|
| 2487 |
-
|
| 2488 |
-
this.selection.removeClass("select2-default");
|
| 2489 |
-
|
| 2490 |
-
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
| 2491 |
-
this.container.addClass("select2-allowclear");
|
| 2492 |
-
}
|
| 2493 |
-
},
|
| 2494 |
-
|
| 2495 |
-
// single
|
| 2496 |
-
val: function () {
|
| 2497 |
-
var val,
|
| 2498 |
-
triggerChange = false,
|
| 2499 |
-
data = null,
|
| 2500 |
-
self = this,
|
| 2501 |
-
oldData = this.data();
|
| 2502 |
-
|
| 2503 |
-
if (arguments.length === 0) {
|
| 2504 |
-
return this.opts.element.val();
|
| 2505 |
-
}
|
| 2506 |
-
|
| 2507 |
-
val = arguments[0];
|
| 2508 |
-
|
| 2509 |
-
if (arguments.length > 1) {
|
| 2510 |
-
triggerChange = arguments[1];
|
| 2511 |
-
}
|
| 2512 |
-
|
| 2513 |
-
if (this.select) {
|
| 2514 |
-
this.select
|
| 2515 |
-
.val(val)
|
| 2516 |
-
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
| 2517 |
-
data = self.optionToData(elm);
|
| 2518 |
-
return false;
|
| 2519 |
-
});
|
| 2520 |
-
this.updateSelection(data);
|
| 2521 |
-
this.setPlaceholder();
|
| 2522 |
-
if (triggerChange) {
|
| 2523 |
-
this.triggerChange({added: data, removed:oldData});
|
| 2524 |
-
}
|
| 2525 |
-
} else {
|
| 2526 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 2527 |
-
if (!val && val !== 0) {
|
| 2528 |
-
this.clear(triggerChange);
|
| 2529 |
-
return;
|
| 2530 |
-
}
|
| 2531 |
-
if (this.opts.initSelection === undefined) {
|
| 2532 |
-
throw new Error("cannot call val() if initSelection() is not defined");
|
| 2533 |
-
}
|
| 2534 |
-
this.opts.element.val(val);
|
| 2535 |
-
this.opts.initSelection(this.opts.element, function(data){
|
| 2536 |
-
self.opts.element.val(!data ? "" : self.id(data));
|
| 2537 |
-
self.updateSelection(data);
|
| 2538 |
-
self.setPlaceholder();
|
| 2539 |
-
if (triggerChange) {
|
| 2540 |
-
self.triggerChange({added: data, removed:oldData});
|
| 2541 |
-
}
|
| 2542 |
-
});
|
| 2543 |
-
}
|
| 2544 |
-
},
|
| 2545 |
-
|
| 2546 |
-
// single
|
| 2547 |
-
clearSearch: function () {
|
| 2548 |
-
this.search.val("");
|
| 2549 |
-
this.focusser.val("");
|
| 2550 |
-
},
|
| 2551 |
-
|
| 2552 |
-
// single
|
| 2553 |
-
data: function(value) {
|
| 2554 |
-
var data,
|
| 2555 |
-
triggerChange = false;
|
| 2556 |
-
|
| 2557 |
-
if (arguments.length === 0) {
|
| 2558 |
-
data = this.selection.data("select2-data");
|
| 2559 |
-
if (data == undefined) data = null;
|
| 2560 |
-
return data;
|
| 2561 |
-
} else {
|
| 2562 |
-
if (arguments.length > 1) {
|
| 2563 |
-
triggerChange = arguments[1];
|
| 2564 |
-
}
|
| 2565 |
-
if (!value) {
|
| 2566 |
-
this.clear(triggerChange);
|
| 2567 |
-
} else {
|
| 2568 |
-
data = this.data();
|
| 2569 |
-
this.opts.element.val(!value ? "" : this.id(value));
|
| 2570 |
-
this.updateSelection(value);
|
| 2571 |
-
if (triggerChange) {
|
| 2572 |
-
this.triggerChange({added: value, removed:data});
|
| 2573 |
-
}
|
| 2574 |
-
}
|
| 2575 |
-
}
|
| 2576 |
-
}
|
| 2577 |
-
});
|
| 2578 |
-
|
| 2579 |
-
MultiSelect2 = clazz(AbstractSelect2, {
|
| 2580 |
-
|
| 2581 |
-
// multi
|
| 2582 |
-
createContainer: function () {
|
| 2583 |
-
var container = $(document.createElement("div")).attr({
|
| 2584 |
-
"class": "select2-container select2-container-multi"
|
| 2585 |
-
}).html([
|
| 2586 |
-
"<ul class='select2-choices'>",
|
| 2587 |
-
" <li class='select2-search-field'>",
|
| 2588 |
-
" <label for='' class='select2-offscreen'></label>",
|
| 2589 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
| 2590 |
-
" </li>",
|
| 2591 |
-
"</ul>",
|
| 2592 |
-
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
| 2593 |
-
" <ul class='select2-results'>",
|
| 2594 |
-
" </ul>",
|
| 2595 |
-
"</div>"].join(""));
|
| 2596 |
-
return container;
|
| 2597 |
-
},
|
| 2598 |
-
|
| 2599 |
-
// multi
|
| 2600 |
-
prepareOpts: function () {
|
| 2601 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2602 |
-
self=this;
|
| 2603 |
-
|
| 2604 |
-
// TODO validate placeholder is a string if specified
|
| 2605 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2606 |
-
// install the selection initializer
|
| 2607 |
-
opts.initSelection = function (element, callback) {
|
| 2608 |
-
|
| 2609 |
-
var data = [];
|
| 2610 |
-
|
| 2611 |
-
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
| 2612 |
-
data.push(self.optionToData(elm));
|
| 2613 |
-
});
|
| 2614 |
-
callback(data);
|
| 2615 |
-
};
|
| 2616 |
-
} else if ("data" in opts) {
|
| 2617 |
-
// install default initSelection when applied to hidden input and data is local
|
| 2618 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2619 |
-
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
| 2620 |
-
//search in data by array of ids, storing matching items in a list
|
| 2621 |
-
var matches = [];
|
| 2622 |
-
opts.query({
|
| 2623 |
-
matcher: function(term, text, el){
|
| 2624 |
-
var is_match = $.grep(ids, function(id) {
|
| 2625 |
-
return equal(id, opts.id(el));
|
| 2626 |
-
}).length;
|
| 2627 |
-
if (is_match) {
|
| 2628 |
-
matches.push(el);
|
| 2629 |
-
}
|
| 2630 |
-
return is_match;
|
| 2631 |
-
},
|
| 2632 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2633 |
-
// reorder matches based on the order they appear in the ids array because right now
|
| 2634 |
-
// they are in the order in which they appear in data array
|
| 2635 |
-
var ordered = [];
|
| 2636 |
-
for (var i = 0; i < ids.length; i++) {
|
| 2637 |
-
var id = ids[i];
|
| 2638 |
-
for (var j = 0; j < matches.length; j++) {
|
| 2639 |
-
var match = matches[j];
|
| 2640 |
-
if (equal(id, opts.id(match))) {
|
| 2641 |
-
ordered.push(match);
|
| 2642 |
-
matches.splice(j, 1);
|
| 2643 |
-
break;
|
| 2644 |
-
}
|
| 2645 |
-
}
|
| 2646 |
-
}
|
| 2647 |
-
callback(ordered);
|
| 2648 |
-
}
|
| 2649 |
-
});
|
| 2650 |
-
};
|
| 2651 |
-
}
|
| 2652 |
-
|
| 2653 |
-
return opts;
|
| 2654 |
-
},
|
| 2655 |
-
|
| 2656 |
-
// multi
|
| 2657 |
-
selectChoice: function (choice) {
|
| 2658 |
-
|
| 2659 |
-
var selected = this.container.find(".select2-search-choice-focus");
|
| 2660 |
-
if (selected.length && choice && choice[0] == selected[0]) {
|
| 2661 |
-
|
| 2662 |
-
} else {
|
| 2663 |
-
if (selected.length) {
|
| 2664 |
-
this.opts.element.trigger("choice-deselected", selected);
|
| 2665 |
-
}
|
| 2666 |
-
selected.removeClass("select2-search-choice-focus");
|
| 2667 |
-
if (choice && choice.length) {
|
| 2668 |
-
this.close();
|
| 2669 |
-
choice.addClass("select2-search-choice-focus");
|
| 2670 |
-
this.opts.element.trigger("choice-selected", choice);
|
| 2671 |
-
}
|
| 2672 |
-
}
|
| 2673 |
-
},
|
| 2674 |
-
|
| 2675 |
-
// multi
|
| 2676 |
-
destroy: function() {
|
| 2677 |
-
$("label[for='" + this.search.attr('id') + "']")
|
| 2678 |
-
.attr('for', this.opts.element.attr("id"));
|
| 2679 |
-
this.parent.destroy.apply(this, arguments);
|
| 2680 |
-
|
| 2681 |
-
cleanupJQueryElements.call(this,
|
| 2682 |
-
"searchContainer",
|
| 2683 |
-
"selection"
|
| 2684 |
-
);
|
| 2685 |
-
},
|
| 2686 |
-
|
| 2687 |
-
// multi
|
| 2688 |
-
initContainer: function () {
|
| 2689 |
-
|
| 2690 |
-
var selector = ".select2-choices", selection;
|
| 2691 |
-
|
| 2692 |
-
this.searchContainer = this.container.find(".select2-search-field");
|
| 2693 |
-
this.selection = selection = this.container.find(selector);
|
| 2694 |
-
|
| 2695 |
-
var _this = this;
|
| 2696 |
-
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
| 2697 |
-
_this.search[0].focus();
|
| 2698 |
-
_this.selectChoice($(this));
|
| 2699 |
-
});
|
| 2700 |
-
|
| 2701 |
-
// rewrite labels from original element to focusser
|
| 2702 |
-
this.search.attr("id", "s2id_autogen"+nextUid());
|
| 2703 |
-
|
| 2704 |
-
this.search.prev()
|
| 2705 |
-
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
| 2706 |
-
.attr('for', this.search.attr('id'));
|
| 2707 |
-
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
| 2708 |
-
|
| 2709 |
-
this.search.on("input paste", this.bind(function() {
|
| 2710 |
-
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
| 2711 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2712 |
-
if (!this.opened()) {
|
| 2713 |
-
this.open();
|
| 2714 |
-
}
|
| 2715 |
-
}));
|
| 2716 |
-
|
| 2717 |
-
this.search.attr("tabindex", this.elementTabIndex);
|
| 2718 |
-
|
| 2719 |
-
this.keydowns = 0;
|
| 2720 |
-
this.search.on("keydown", this.bind(function (e) {
|
| 2721 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2722 |
-
|
| 2723 |
-
++this.keydowns;
|
| 2724 |
-
var selected = selection.find(".select2-search-choice-focus");
|
| 2725 |
-
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
| 2726 |
-
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
| 2727 |
-
var pos = getCursorInfo(this.search);
|
| 2728 |
-
|
| 2729 |
-
if (selected.length &&
|
| 2730 |
-
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
| 2731 |
-
var selectedChoice = selected;
|
| 2732 |
-
if (e.which == KEY.LEFT && prev.length) {
|
| 2733 |
-
selectedChoice = prev;
|
| 2734 |
-
}
|
| 2735 |
-
else if (e.which == KEY.RIGHT) {
|
| 2736 |
-
selectedChoice = next.length ? next : null;
|
| 2737 |
-
}
|
| 2738 |
-
else if (e.which === KEY.BACKSPACE) {
|
| 2739 |
-
if (this.unselect(selected.first())) {
|
| 2740 |
-
this.search.width(10);
|
| 2741 |
-
selectedChoice = prev.length ? prev : next;
|
| 2742 |
-
}
|
| 2743 |
-
} else if (e.which == KEY.DELETE) {
|
| 2744 |
-
if (this.unselect(selected.first())) {
|
| 2745 |
-
this.search.width(10);
|
| 2746 |
-
selectedChoice = next.length ? next : null;
|
| 2747 |
-
}
|
| 2748 |
-
} else if (e.which == KEY.ENTER) {
|
| 2749 |
-
selectedChoice = null;
|
| 2750 |
-
}
|
| 2751 |
-
|
| 2752 |
-
this.selectChoice(selectedChoice);
|
| 2753 |
-
killEvent(e);
|
| 2754 |
-
if (!selectedChoice || !selectedChoice.length) {
|
| 2755 |
-
this.open();
|
| 2756 |
-
}
|
| 2757 |
-
return;
|
| 2758 |
-
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
| 2759 |
-
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
| 2760 |
-
|
| 2761 |
-
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
| 2762 |
-
killEvent(e);
|
| 2763 |
-
return;
|
| 2764 |
-
} else {
|
| 2765 |
-
this.selectChoice(null);
|
| 2766 |
-
}
|
| 2767 |
-
|
| 2768 |
-
if (this.opened()) {
|
| 2769 |
-
switch (e.which) {
|
| 2770 |
-
case KEY.UP:
|
| 2771 |
-
case KEY.DOWN:
|
| 2772 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2773 |
-
killEvent(e);
|
| 2774 |
-
return;
|
| 2775 |
-
case KEY.ENTER:
|
| 2776 |
-
this.selectHighlighted();
|
| 2777 |
-
killEvent(e);
|
| 2778 |
-
return;
|
| 2779 |
-
case KEY.TAB:
|
| 2780 |
-
this.selectHighlighted({noFocus:true});
|
| 2781 |
-
this.close();
|
| 2782 |
-
return;
|
| 2783 |
-
case KEY.ESC:
|
| 2784 |
-
this.cancel(e);
|
| 2785 |
-
killEvent(e);
|
| 2786 |
-
return;
|
| 2787 |
-
}
|
| 2788 |
-
}
|
| 2789 |
-
|
| 2790 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
| 2791 |
-
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
| 2792 |
-
return;
|
| 2793 |
-
}
|
| 2794 |
-
|
| 2795 |
-
if (e.which === KEY.ENTER) {
|
| 2796 |
-
if (this.opts.openOnEnter === false) {
|
| 2797 |
-
return;
|
| 2798 |
-
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
| 2799 |
-
return;
|
| 2800 |
-
}
|
| 2801 |
-
}
|
| 2802 |
-
|
| 2803 |
-
this.open();
|
| 2804 |
-
|
| 2805 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2806 |
-
// prevent the page from scrolling
|
| 2807 |
-
killEvent(e);
|
| 2808 |
-
}
|
| 2809 |
-
|
| 2810 |
-
if (e.which === KEY.ENTER) {
|
| 2811 |
-
// prevent form from being submitted
|
| 2812 |
-
killEvent(e);
|
| 2813 |
-
}
|
| 2814 |
-
|
| 2815 |
-
}));
|
| 2816 |
-
|
| 2817 |
-
this.search.on("keyup", this.bind(function (e) {
|
| 2818 |
-
this.keydowns = 0;
|
| 2819 |
-
this.resizeSearch();
|
| 2820 |
-
})
|
| 2821 |
-
);
|
| 2822 |
-
|
| 2823 |
-
this.search.on("blur", this.bind(function(e) {
|
| 2824 |
-
this.container.removeClass("select2-container-active");
|
| 2825 |
-
this.search.removeClass("select2-focused");
|
| 2826 |
-
this.selectChoice(null);
|
| 2827 |
-
if (!this.opened()) this.clearSearch();
|
| 2828 |
-
e.stopImmediatePropagation();
|
| 2829 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
| 2830 |
-
}));
|
| 2831 |
-
|
| 2832 |
-
this.container.on("click", selector, this.bind(function (e) {
|
| 2833 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2834 |
-
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
| 2835 |
-
// clicked inside a select2 search choice, do not open
|
| 2836 |
-
return;
|
| 2837 |
-
}
|
| 2838 |
-
this.selectChoice(null);
|
| 2839 |
-
this.clearPlaceholder();
|
| 2840 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2841 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2842 |
-
}
|
| 2843 |
-
this.open();
|
| 2844 |
-
this.focusSearch();
|
| 2845 |
-
e.preventDefault();
|
| 2846 |
-
}));
|
| 2847 |
-
|
| 2848 |
-
this.container.on("focus", selector, this.bind(function () {
|
| 2849 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2850 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2851 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2852 |
-
}
|
| 2853 |
-
this.container.addClass("select2-container-active");
|
| 2854 |
-
this.dropdown.addClass("select2-drop-active");
|
| 2855 |
-
this.clearPlaceholder();
|
| 2856 |
-
}));
|
| 2857 |
-
|
| 2858 |
-
this.initContainerWidth();
|
| 2859 |
-
this.opts.element.hide();
|
| 2860 |
-
|
| 2861 |
-
// set the placeholder if necessary
|
| 2862 |
-
this.clearSearch();
|
| 2863 |
-
},
|
| 2864 |
-
|
| 2865 |
-
// multi
|
| 2866 |
-
enableInterface: function() {
|
| 2867 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 2868 |
-
this.search.prop("disabled", !this.isInterfaceEnabled());
|
| 2869 |
-
}
|
| 2870 |
-
},
|
| 2871 |
-
|
| 2872 |
-
// multi
|
| 2873 |
-
initSelection: function () {
|
| 2874 |
-
var data;
|
| 2875 |
-
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
| 2876 |
-
this.updateSelection([]);
|
| 2877 |
-
this.close();
|
| 2878 |
-
// set the placeholder if necessary
|
| 2879 |
-
this.clearSearch();
|
| 2880 |
-
}
|
| 2881 |
-
if (this.select || this.opts.element.val() !== "") {
|
| 2882 |
-
var self = this;
|
| 2883 |
-
this.opts.initSelection.call(null, this.opts.element, function(data){
|
| 2884 |
-
if (data !== undefined && data !== null) {
|
| 2885 |
-
self.updateSelection(data);
|
| 2886 |
-
self.close();
|
| 2887 |
-
// set the placeholder if necessary
|
| 2888 |
-
self.clearSearch();
|
| 2889 |
-
}
|
| 2890 |
-
});
|
| 2891 |
-
}
|
| 2892 |
-
},
|
| 2893 |
-
|
| 2894 |
-
// multi
|
| 2895 |
-
clearSearch: function () {
|
| 2896 |
-
var placeholder = this.getPlaceholder(),
|
| 2897 |
-
maxWidth = this.getMaxSearchWidth();
|
| 2898 |
-
|
| 2899 |
-
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
| 2900 |
-
this.search.val(placeholder).addClass("select2-default");
|
| 2901 |
-
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
| 2902 |
-
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
| 2903 |
-
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
| 2904 |
-
} else {
|
| 2905 |
-
this.search.val("").width(10);
|
| 2906 |
-
}
|
| 2907 |
-
},
|
| 2908 |
-
|
| 2909 |
-
// multi
|
| 2910 |
-
clearPlaceholder: function () {
|
| 2911 |
-
if (this.search.hasClass("select2-default")) {
|
| 2912 |
-
this.search.val("").removeClass("select2-default");
|
| 2913 |
-
}
|
| 2914 |
-
},
|
| 2915 |
-
|
| 2916 |
-
// multi
|
| 2917 |
-
opening: function () {
|
| 2918 |
-
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
| 2919 |
-
this.resizeSearch();
|
| 2920 |
-
|
| 2921 |
-
this.parent.opening.apply(this, arguments);
|
| 2922 |
-
|
| 2923 |
-
this.focusSearch();
|
| 2924 |
-
|
| 2925 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2926 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2927 |
-
if(this.search.val() === "") {
|
| 2928 |
-
if(this.nextSearchTerm != undefined){
|
| 2929 |
-
this.search.val(this.nextSearchTerm);
|
| 2930 |
-
this.search.select();
|
| 2931 |
-
}
|
| 2932 |
-
}
|
| 2933 |
-
|
| 2934 |
-
this.updateResults(true);
|
| 2935 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2936 |
-
this.search.focus();
|
| 2937 |
-
}
|
| 2938 |
-
this.opts.element.trigger($.Event("select2-open"));
|
| 2939 |
-
},
|
| 2940 |
-
|
| 2941 |
-
// multi
|
| 2942 |
-
close: function () {
|
| 2943 |
-
if (!this.opened()) return;
|
| 2944 |
-
this.parent.close.apply(this, arguments);
|
| 2945 |
-
},
|
| 2946 |
-
|
| 2947 |
-
// multi
|
| 2948 |
-
focus: function () {
|
| 2949 |
-
this.close();
|
| 2950 |
-
this.search.focus();
|
| 2951 |
-
},
|
| 2952 |
-
|
| 2953 |
-
// multi
|
| 2954 |
-
isFocused: function () {
|
| 2955 |
-
return this.search.hasClass("select2-focused");
|
| 2956 |
-
},
|
| 2957 |
-
|
| 2958 |
-
// multi
|
| 2959 |
-
updateSelection: function (data) {
|
| 2960 |
-
var ids = [], filtered = [], self = this;
|
| 2961 |
-
|
| 2962 |
-
// filter out duplicates
|
| 2963 |
-
$(data).each(function () {
|
| 2964 |
-
if (indexOf(self.id(this), ids) < 0) {
|
| 2965 |
-
ids.push(self.id(this));
|
| 2966 |
-
filtered.push(this);
|
| 2967 |
-
}
|
| 2968 |
-
});
|
| 2969 |
-
data = filtered;
|
| 2970 |
-
|
| 2971 |
-
this.selection.find(".select2-search-choice").remove();
|
| 2972 |
-
$(data).each(function () {
|
| 2973 |
-
self.addSelectedChoice(this);
|
| 2974 |
-
});
|
| 2975 |
-
self.postprocessResults();
|
| 2976 |
-
},
|
| 2977 |
-
|
| 2978 |
-
// multi
|
| 2979 |
-
tokenize: function() {
|
| 2980 |
-
var input = this.search.val();
|
| 2981 |
-
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
| 2982 |
-
if (input != null && input != undefined) {
|
| 2983 |
-
this.search.val(input);
|
| 2984 |
-
if (input.length > 0) {
|
| 2985 |
-
this.open();
|
| 2986 |
-
}
|
| 2987 |
-
}
|
| 2988 |
-
|
| 2989 |
-
},
|
| 2990 |
-
|
| 2991 |
-
// multi
|
| 2992 |
-
onSelect: function (data, options) {
|
| 2993 |
-
|
| 2994 |
-
if (!this.triggerSelect(data) || data.text === "") { return; }
|
| 2995 |
-
|
| 2996 |
-
this.addSelectedChoice(data);
|
| 2997 |
-
|
| 2998 |
-
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
| 2999 |
-
|
| 3000 |
-
// keep track of the search's value before it gets cleared
|
| 3001 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 3002 |
-
|
| 3003 |
-
this.clearSearch();
|
| 3004 |
-
this.updateResults();
|
| 3005 |
-
|
| 3006 |
-
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
| 3007 |
-
|
| 3008 |
-
if (this.opts.closeOnSelect) {
|
| 3009 |
-
this.close();
|
| 3010 |
-
this.search.width(10);
|
| 3011 |
-
} else {
|
| 3012 |
-
if (this.countSelectableResults()>0) {
|
| 3013 |
-
this.search.width(10);
|
| 3014 |
-
this.resizeSearch();
|
| 3015 |
-
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
| 3016 |
-
// if we reached max selection size repaint the results so choices
|
| 3017 |
-
// are replaced with the max selection reached message
|
| 3018 |
-
this.updateResults(true);
|
| 3019 |
-
} else {
|
| 3020 |
-
// initializes search's value with nextSearchTerm and update search result
|
| 3021 |
-
if(this.nextSearchTerm != undefined){
|
| 3022 |
-
this.search.val(this.nextSearchTerm);
|
| 3023 |
-
this.updateResults();
|
| 3024 |
-
this.search.select();
|
| 3025 |
-
}
|
| 3026 |
-
}
|
| 3027 |
-
this.positionDropdown();
|
| 3028 |
-
} else {
|
| 3029 |
-
// if nothing left to select close
|
| 3030 |
-
this.close();
|
| 3031 |
-
this.search.width(10);
|
| 3032 |
-
}
|
| 3033 |
-
}
|
| 3034 |
-
|
| 3035 |
-
// since its not possible to select an element that has already been
|
| 3036 |
-
// added we do not need to check if this is a new element before firing change
|
| 3037 |
-
this.triggerChange({ added: data });
|
| 3038 |
-
|
| 3039 |
-
if (!options || !options.noFocus)
|
| 3040 |
-
this.focusSearch();
|
| 3041 |
-
},
|
| 3042 |
-
|
| 3043 |
-
// multi
|
| 3044 |
-
cancel: function () {
|
| 3045 |
-
this.close();
|
| 3046 |
-
this.focusSearch();
|
| 3047 |
-
},
|
| 3048 |
-
|
| 3049 |
-
addSelectedChoice: function (data) {
|
| 3050 |
-
var enableChoice = !data.locked,
|
| 3051 |
-
enabledItem = $(
|
| 3052 |
-
"<li class='select2-search-choice'>" +
|
| 3053 |
-
" <div></div>" +
|
| 3054 |
-
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
| 3055 |
-
"</li>"),
|
| 3056 |
-
disabledItem = $(
|
| 3057 |
-
"<li class='select2-search-choice select2-locked'>" +
|
| 3058 |
-
"<div></div>" +
|
| 3059 |
-
"</li>");
|
| 3060 |
-
var choice = enableChoice ? enabledItem : disabledItem,
|
| 3061 |
-
id = this.id(data),
|
| 3062 |
-
val = this.getVal(),
|
| 3063 |
-
formatted,
|
| 3064 |
-
cssClass;
|
| 3065 |
-
|
| 3066 |
-
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
| 3067 |
-
if (formatted != undefined) {
|
| 3068 |
-
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
| 3069 |
-
}
|
| 3070 |
-
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
| 3071 |
-
if (cssClass != undefined) {
|
| 3072 |
-
choice.addClass(cssClass);
|
| 3073 |
-
}
|
| 3074 |
-
|
| 3075 |
-
if(enableChoice){
|
| 3076 |
-
choice.find(".select2-search-choice-close")
|
| 3077 |
-
.on("mousedown", killEvent)
|
| 3078 |
-
.on("click dblclick", this.bind(function (e) {
|
| 3079 |
-
if (!this.isInterfaceEnabled()) return;
|
| 3080 |
-
|
| 3081 |
-
this.unselect($(e.target));
|
| 3082 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 3083 |
-
killEvent(e);
|
| 3084 |
-
this.close();
|
| 3085 |
-
this.focusSearch();
|
| 3086 |
-
})).on("focus", this.bind(function () {
|
| 3087 |
-
if (!this.isInterfaceEnabled()) return;
|
| 3088 |
-
this.container.addClass("select2-container-active");
|
| 3089 |
-
this.dropdown.addClass("select2-drop-active");
|
| 3090 |
-
}));
|
| 3091 |
-
}
|
| 3092 |
-
|
| 3093 |
-
choice.data("select2-data", data);
|
| 3094 |
-
choice.insertBefore(this.searchContainer);
|
| 3095 |
-
|
| 3096 |
-
val.push(id);
|
| 3097 |
-
this.setVal(val);
|
| 3098 |
-
},
|
| 3099 |
-
|
| 3100 |
-
// multi
|
| 3101 |
-
unselect: function (selected) {
|
| 3102 |
-
var val = this.getVal(),
|
| 3103 |
-
data,
|
| 3104 |
-
index;
|
| 3105 |
-
selected = selected.closest(".select2-search-choice");
|
| 3106 |
-
|
| 3107 |
-
if (selected.length === 0) {
|
| 3108 |
-
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
| 3109 |
-
}
|
| 3110 |
-
|
| 3111 |
-
data = selected.data("select2-data");
|
| 3112 |
-
|
| 3113 |
-
if (!data) {
|
| 3114 |
-
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
| 3115 |
-
// and invoked on an element already removed
|
| 3116 |
-
return;
|
| 3117 |
-
}
|
| 3118 |
-
|
| 3119 |
-
var evt = $.Event("select2-removing");
|
| 3120 |
-
evt.val = this.id(data);
|
| 3121 |
-
evt.choice = data;
|
| 3122 |
-
this.opts.element.trigger(evt);
|
| 3123 |
-
|
| 3124 |
-
if (evt.isDefaultPrevented()) {
|
| 3125 |
-
return false;
|
| 3126 |
-
}
|
| 3127 |
-
|
| 3128 |
-
while((index = indexOf(this.id(data), val)) >= 0) {
|
| 3129 |
-
val.splice(index, 1);
|
| 3130 |
-
this.setVal(val);
|
| 3131 |
-
if (this.select) this.postprocessResults();
|
| 3132 |
-
}
|
| 3133 |
-
|
| 3134 |
-
selected.remove();
|
| 3135 |
-
|
| 3136 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 3137 |
-
this.triggerChange({ removed: data });
|
| 3138 |
-
|
| 3139 |
-
return true;
|
| 3140 |
-
},
|
| 3141 |
-
|
| 3142 |
-
// multi
|
| 3143 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 3144 |
-
var val = this.getVal(),
|
| 3145 |
-
choices = this.results.find(".select2-result"),
|
| 3146 |
-
compound = this.results.find(".select2-result-with-children"),
|
| 3147 |
-
self = this;
|
| 3148 |
-
|
| 3149 |
-
choices.each2(function (i, choice) {
|
| 3150 |
-
var id = self.id(choice.data("select2-data"));
|
| 3151 |
-
if (indexOf(id, val) >= 0) {
|
| 3152 |
-
choice.addClass("select2-selected");
|
| 3153 |
-
// mark all children of the selected parent as selected
|
| 3154 |
-
choice.find(".select2-result-selectable").addClass("select2-selected");
|
| 3155 |
-
}
|
| 3156 |
-
});
|
| 3157 |
-
|
| 3158 |
-
compound.each2(function(i, choice) {
|
| 3159 |
-
// hide an optgroup if it doesn't have any selectable children
|
| 3160 |
-
if (!choice.is('.select2-result-selectable')
|
| 3161 |
-
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
| 3162 |
-
choice.addClass("select2-selected");
|
| 3163 |
-
}
|
| 3164 |
-
});
|
| 3165 |
-
|
| 3166 |
-
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
| 3167 |
-
self.highlight(0);
|
| 3168 |
-
}
|
| 3169 |
-
|
| 3170 |
-
//If all results are chosen render formatNoMatches
|
| 3171 |
-
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
| 3172 |
-
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
| 3173 |
-
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
| 3174 |
-
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
| 3175 |
-
}
|
| 3176 |
-
}
|
| 3177 |
-
}
|
| 3178 |
-
|
| 3179 |
-
},
|
| 3180 |
-
|
| 3181 |
-
// multi
|
| 3182 |
-
getMaxSearchWidth: function() {
|
| 3183 |
-
return this.selection.width() - getSideBorderPadding(this.search);
|
| 3184 |
-
},
|
| 3185 |
-
|
| 3186 |
-
// multi
|
| 3187 |
-
resizeSearch: function () {
|
| 3188 |
-
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
| 3189 |
-
sideBorderPadding = getSideBorderPadding(this.search);
|
| 3190 |
-
|
| 3191 |
-
minimumWidth = measureTextWidth(this.search) + 10;
|
| 3192 |
-
|
| 3193 |
-
left = this.search.offset().left;
|
| 3194 |
-
|
| 3195 |
-
maxWidth = this.selection.width();
|
| 3196 |
-
containerLeft = this.selection.offset().left;
|
| 3197 |
-
|
| 3198 |
-
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
| 3199 |
-
|
| 3200 |
-
if (searchWidth < minimumWidth) {
|
| 3201 |
-
searchWidth = maxWidth - sideBorderPadding;
|
| 3202 |
-
}
|
| 3203 |
-
|
| 3204 |
-
if (searchWidth < 40) {
|
| 3205 |
-
searchWidth = maxWidth - sideBorderPadding;
|
| 3206 |
-
}
|
| 3207 |
-
|
| 3208 |
-
if (searchWidth <= 0) {
|
| 3209 |
-
searchWidth = minimumWidth;
|
| 3210 |
-
}
|
| 3211 |
-
|
| 3212 |
-
this.search.width(Math.floor(searchWidth));
|
| 3213 |
-
},
|
| 3214 |
-
|
| 3215 |
-
// multi
|
| 3216 |
-
getVal: function () {
|
| 3217 |
-
var val;
|
| 3218 |
-
if (this.select) {
|
| 3219 |
-
val = this.select.val();
|
| 3220 |
-
return val === null ? [] : val;
|
| 3221 |
-
} else {
|
| 3222 |
-
val = this.opts.element.val();
|
| 3223 |
-
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
| 3224 |
-
}
|
| 3225 |
-
},
|
| 3226 |
-
|
| 3227 |
-
// multi
|
| 3228 |
-
setVal: function (val) {
|
| 3229 |
-
var unique;
|
| 3230 |
-
if (this.select) {
|
| 3231 |
-
this.select.val(val);
|
| 3232 |
-
} else {
|
| 3233 |
-
unique = [];
|
| 3234 |
-
// filter out duplicates
|
| 3235 |
-
$(val).each(function () {
|
| 3236 |
-
if (indexOf(this, unique) < 0) unique.push(this);
|
| 3237 |
-
});
|
| 3238 |
-
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
| 3239 |
-
}
|
| 3240 |
-
},
|
| 3241 |
-
|
| 3242 |
-
// multi
|
| 3243 |
-
buildChangeDetails: function (old, current) {
|
| 3244 |
-
var current = current.slice(0),
|
| 3245 |
-
old = old.slice(0);
|
| 3246 |
-
|
| 3247 |
-
// remove intersection from each array
|
| 3248 |
-
for (var i = 0; i < current.length; i++) {
|
| 3249 |
-
for (var j = 0; j < old.length; j++) {
|
| 3250 |
-
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
| 3251 |
-
current.splice(i, 1);
|
| 3252 |
-
if(i>0){
|
| 3253 |
-
i--;
|
| 3254 |
-
}
|
| 3255 |
-
old.splice(j, 1);
|
| 3256 |
-
j--;
|
| 3257 |
-
}
|
| 3258 |
-
}
|
| 3259 |
-
}
|
| 3260 |
-
|
| 3261 |
-
return {added: current, removed: old};
|
| 3262 |
-
},
|
| 3263 |
-
|
| 3264 |
-
|
| 3265 |
-
// multi
|
| 3266 |
-
val: function (val, triggerChange) {
|
| 3267 |
-
var oldData, self=this;
|
| 3268 |
-
|
| 3269 |
-
if (arguments.length === 0) {
|
| 3270 |
-
return this.getVal();
|
| 3271 |
-
}
|
| 3272 |
-
|
| 3273 |
-
oldData=this.data();
|
| 3274 |
-
if (!oldData.length) oldData=[];
|
| 3275 |
-
|
| 3276 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 3277 |
-
if (!val && val !== 0) {
|
| 3278 |
-
this.opts.element.val("");
|
| 3279 |
-
this.updateSelection([]);
|
| 3280 |
-
this.clearSearch();
|
| 3281 |
-
if (triggerChange) {
|
| 3282 |
-
this.triggerChange({added: this.data(), removed: oldData});
|
| 3283 |
-
}
|
| 3284 |
-
return;
|
| 3285 |
-
}
|
| 3286 |
-
|
| 3287 |
-
// val is a list of ids
|
| 3288 |
-
this.setVal(val);
|
| 3289 |
-
|
| 3290 |
-
if (this.select) {
|
| 3291 |
-
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
| 3292 |
-
if (triggerChange) {
|
| 3293 |
-
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
| 3294 |
-
}
|
| 3295 |
-
} else {
|
| 3296 |
-
if (this.opts.initSelection === undefined) {
|
| 3297 |
-
throw new Error("val() cannot be called if initSelection() is not defined");
|
| 3298 |
-
}
|
| 3299 |
-
|
| 3300 |
-
this.opts.initSelection(this.opts.element, function(data){
|
| 3301 |
-
var ids=$.map(data, self.id);
|
| 3302 |
-
self.setVal(ids);
|
| 3303 |
-
self.updateSelection(data);
|
| 3304 |
-
self.clearSearch();
|
| 3305 |
-
if (triggerChange) {
|
| 3306 |
-
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
| 3307 |
-
}
|
| 3308 |
-
});
|
| 3309 |
-
}
|
| 3310 |
-
this.clearSearch();
|
| 3311 |
-
},
|
| 3312 |
-
|
| 3313 |
-
// multi
|
| 3314 |
-
onSortStart: function() {
|
| 3315 |
-
if (this.select) {
|
| 3316 |
-
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
| 3317 |
-
}
|
| 3318 |
-
|
| 3319 |
-
// collapse search field into 0 width so its container can be collapsed as well
|
| 3320 |
-
this.search.width(0);
|
| 3321 |
-
// hide the container
|
| 3322 |
-
this.searchContainer.hide();
|
| 3323 |
-
},
|
| 3324 |
-
|
| 3325 |
-
// multi
|
| 3326 |
-
onSortEnd:function() {
|
| 3327 |
-
|
| 3328 |
-
var val=[], self=this;
|
| 3329 |
-
|
| 3330 |
-
// show search and move it to the end of the list
|
| 3331 |
-
this.searchContainer.show();
|
| 3332 |
-
// make sure the search container is the last item in the list
|
| 3333 |
-
this.searchContainer.appendTo(this.searchContainer.parent());
|
| 3334 |
-
// since we collapsed the width in dragStarted, we resize it here
|
| 3335 |
-
this.resizeSearch();
|
| 3336 |
-
|
| 3337 |
-
// update selection
|
| 3338 |
-
this.selection.find(".select2-search-choice").each(function() {
|
| 3339 |
-
val.push(self.opts.id($(this).data("select2-data")));
|
| 3340 |
-
});
|
| 3341 |
-
this.setVal(val);
|
| 3342 |
-
this.triggerChange();
|
| 3343 |
-
},
|
| 3344 |
-
|
| 3345 |
-
// multi
|
| 3346 |
-
data: function(values, triggerChange) {
|
| 3347 |
-
var self=this, ids, old;
|
| 3348 |
-
if (arguments.length === 0) {
|
| 3349 |
-
return this.selection
|
| 3350 |
-
.children(".select2-search-choice")
|
| 3351 |
-
.map(function() { return $(this).data("select2-data"); })
|
| 3352 |
-
.get();
|
| 3353 |
-
} else {
|
| 3354 |
-
old = this.data();
|
| 3355 |
-
if (!values) { values = []; }
|
| 3356 |
-
ids = $.map(values, function(e) { return self.opts.id(e); });
|
| 3357 |
-
this.setVal(ids);
|
| 3358 |
-
this.updateSelection(values);
|
| 3359 |
-
this.clearSearch();
|
| 3360 |
-
if (triggerChange) {
|
| 3361 |
-
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
| 3362 |
-
}
|
| 3363 |
-
}
|
| 3364 |
-
}
|
| 3365 |
-
});
|
| 3366 |
-
|
| 3367 |
-
$.fn.select2 = function () {
|
| 3368 |
-
|
| 3369 |
-
var args = Array.prototype.slice.call(arguments, 0),
|
| 3370 |
-
opts,
|
| 3371 |
-
select2,
|
| 3372 |
-
method, value, multiple,
|
| 3373 |
-
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
| 3374 |
-
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
| 3375 |
-
propertyMethods = ["val", "data"],
|
| 3376 |
-
methodsMap = { search: "externalSearch" };
|
| 3377 |
-
|
| 3378 |
-
this.each(function () {
|
| 3379 |
-
if (args.length === 0 || typeof(args[0]) === "object") {
|
| 3380 |
-
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
| 3381 |
-
opts.element = $(this);
|
| 3382 |
-
|
| 3383 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 3384 |
-
multiple = opts.element.prop("multiple");
|
| 3385 |
-
} else {
|
| 3386 |
-
multiple = opts.multiple || false;
|
| 3387 |
-
if ("tags" in opts) {opts.multiple = multiple = true;}
|
| 3388 |
-
}
|
| 3389 |
-
|
| 3390 |
-
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
| 3391 |
-
select2.init(opts);
|
| 3392 |
-
} else if (typeof(args[0]) === "string") {
|
| 3393 |
-
|
| 3394 |
-
if (indexOf(args[0], allowedMethods) < 0) {
|
| 3395 |
-
throw "Unknown method: " + args[0];
|
| 3396 |
-
}
|
| 3397 |
-
|
| 3398 |
-
value = undefined;
|
| 3399 |
-
select2 = $(this).data("select2");
|
| 3400 |
-
if (select2 === undefined) return;
|
| 3401 |
-
|
| 3402 |
-
method=args[0];
|
| 3403 |
-
|
| 3404 |
-
if (method === "container") {
|
| 3405 |
-
value = select2.container;
|
| 3406 |
-
} else if (method === "dropdown") {
|
| 3407 |
-
value = select2.dropdown;
|
| 3408 |
-
} else {
|
| 3409 |
-
if (methodsMap[method]) method = methodsMap[method];
|
| 3410 |
-
|
| 3411 |
-
value = select2[method].apply(select2, args.slice(1));
|
| 3412 |
-
}
|
| 3413 |
-
if (indexOf(args[0], valueMethods) >= 0
|
| 3414 |
-
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
| 3415 |
-
return false; // abort the iteration, ready to return first matched value
|
| 3416 |
-
}
|
| 3417 |
-
} else {
|
| 3418 |
-
throw "Invalid arguments to select2 plugin: " + args;
|
| 3419 |
-
}
|
| 3420 |
-
});
|
| 3421 |
-
return (value === undefined) ? this : value;
|
| 3422 |
-
};
|
| 3423 |
-
|
| 3424 |
-
// plugin defaults, accessible to users
|
| 3425 |
-
$.fn.select2.defaults = {
|
| 3426 |
-
width: "copy",
|
| 3427 |
-
loadMorePadding: 0,
|
| 3428 |
-
closeOnSelect: true,
|
| 3429 |
-
openOnEnter: true,
|
| 3430 |
-
containerCss: {},
|
| 3431 |
-
dropdownCss: {},
|
| 3432 |
-
containerCssClass: "",
|
| 3433 |
-
dropdownCssClass: "",
|
| 3434 |
-
formatResult: function(result, container, query, escapeMarkup) {
|
| 3435 |
-
var markup=[];
|
| 3436 |
-
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
| 3437 |
-
return markup.join("");
|
| 3438 |
-
},
|
| 3439 |
-
transformVal: function(val) {
|
| 3440 |
-
return $.trim(val);
|
| 3441 |
-
},
|
| 3442 |
-
formatSelection: function (data, container, escapeMarkup) {
|
| 3443 |
-
return data ? escapeMarkup(this.text(data)) : undefined;
|
| 3444 |
-
},
|
| 3445 |
-
sortResults: function (results, container, query) {
|
| 3446 |
-
return results;
|
| 3447 |
-
},
|
| 3448 |
-
formatResultCssClass: function(data) {return data.css;},
|
| 3449 |
-
formatSelectionCssClass: function(data, container) {return undefined;},
|
| 3450 |
-
minimumResultsForSearch: 0,
|
| 3451 |
-
minimumInputLength: 0,
|
| 3452 |
-
maximumInputLength: null,
|
| 3453 |
-
maximumSelectionSize: 0,
|
| 3454 |
-
id: function (e) { return e == undefined ? null : e.id; },
|
| 3455 |
-
text: function (e) {
|
| 3456 |
-
if (e && this.data && this.data.text) {
|
| 3457 |
-
if ($.isFunction(this.data.text)) {
|
| 3458 |
-
return this.data.text(e);
|
| 3459 |
-
} else {
|
| 3460 |
-
return e[this.data.text];
|
| 3461 |
-
}
|
| 3462 |
-
} else {
|
| 3463 |
-
return e.text;
|
| 3464 |
-
}
|
| 3465 |
-
},
|
| 3466 |
-
matcher: function(term, text) {
|
| 3467 |
-
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
| 3468 |
-
},
|
| 3469 |
-
separator: ",",
|
| 3470 |
-
tokenSeparators: [],
|
| 3471 |
-
tokenizer: defaultTokenizer,
|
| 3472 |
-
escapeMarkup: defaultEscapeMarkup,
|
| 3473 |
-
blurOnChange: false,
|
| 3474 |
-
selectOnBlur: false,
|
| 3475 |
-
adaptContainerCssClass: function(c) { return c; },
|
| 3476 |
-
adaptDropdownCssClass: function(c) { return null; },
|
| 3477 |
-
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
| 3478 |
-
searchInputPlaceholder: '',
|
| 3479 |
-
createSearchChoicePosition: 'top',
|
| 3480 |
-
shouldFocusInput: function (instance) {
|
| 3481 |
-
// Attempt to detect touch devices
|
| 3482 |
-
var supportsTouchEvents = (('ontouchstart' in window) ||
|
| 3483 |
-
(navigator.msMaxTouchPoints > 0));
|
| 3484 |
-
|
| 3485 |
-
// Only devices which support touch events should be special cased
|
| 3486 |
-
if (!supportsTouchEvents) {
|
| 3487 |
-
return true;
|
| 3488 |
-
}
|
| 3489 |
-
|
| 3490 |
-
// Never focus the input if search is disabled
|
| 3491 |
-
if (instance.opts.minimumResultsForSearch < 0) {
|
| 3492 |
-
return false;
|
| 3493 |
-
}
|
| 3494 |
-
|
| 3495 |
-
return true;
|
| 3496 |
-
}
|
| 3497 |
-
};
|
| 3498 |
-
|
| 3499 |
-
$.fn.select2.locales = [];
|
| 3500 |
-
|
| 3501 |
-
$.fn.select2.locales['en'] = {
|
| 3502 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 3503 |
-
formatNoMatches: function () { return "No matches found"; },
|
| 3504 |
-
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
| 3505 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 3506 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 3507 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 3508 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 3509 |
-
formatSearching: function () { return "Searching…"; }
|
| 3510 |
-
};
|
| 3511 |
-
|
| 3512 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 3513 |
-
|
| 3514 |
-
$.fn.select2.ajaxDefaults = {
|
| 3515 |
-
transport: $.ajax,
|
| 3516 |
-
params: {
|
| 3517 |
-
type: "GET",
|
| 3518 |
-
cache: false,
|
| 3519 |
-
dataType: "json"
|
| 3520 |
-
}
|
| 3521 |
-
};
|
| 3522 |
-
|
| 3523 |
-
// exports
|
| 3524 |
-
window.Select2 = {
|
| 3525 |
-
query: {
|
| 3526 |
-
ajax: ajax,
|
| 3527 |
-
local: local,
|
| 3528 |
-
tags: tags
|
| 3529 |
-
}, util: {
|
| 3530 |
-
debounce: debounce,
|
| 3531 |
-
markMatch: markMatch,
|
| 3532 |
-
escapeMarkup: defaultEscapeMarkup,
|
| 3533 |
-
stripDiacritics: stripDiacritics
|
| 3534 |
-
}, "class": {
|
| 3535 |
-
"abstract": AbstractSelect2,
|
| 3536 |
-
"single": SingleSelect2,
|
| 3537 |
-
"multi": MultiSelect2
|
| 3538 |
-
}
|
| 3539 |
-
};
|
| 3540 |
-
|
| 3541 |
-
}(jQuery));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/js/select2/select2.min.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Copyright 2014 Igor Vaynberg
|
| 3 |
-
|
| 4 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
-
|
| 6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
-
License or the GPL License.
|
| 10 |
-
|
| 11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
-
|
| 13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
-
|
| 16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 17 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 18 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
-
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
-
*/
|
| 21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
| 22 |
-
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
| 23 |
-
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/js/select2/select2.png
DELETED
|
Binary file
|
trunk/classes/admin/settings/assets/js/select2/select2x2.png
DELETED
|
Binary file
|
trunk/classes/admin/settings/assets/js/sf-jquery.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
jQuery(document).ready(function () {
|
| 2 |
-
|
| 3 |
-
jQuery(".sf-tips").tooltip({ animation: true, html: true, delay: { show: 300, hide: 100 } });
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
//This if statement checks if the color picker widget exists within jQuery UI
|
| 7 |
-
//If it does exist then we initialize the WordPress color picker on our text input field
|
| 8 |
-
if (typeof jQuery.wp === 'object' && typeof jQuery.wp.wpColorPicker === 'function') {
|
| 9 |
-
jQuery('.colorpick').wpColorPicker();
|
| 10 |
-
} else {
|
| 11 |
-
// Color picker
|
| 12 |
-
jQuery('.colorpick').each(function () {
|
| 13 |
-
jQuery('.colorpickdiv', jQuery(this).parent()).farbtastic(this);
|
| 14 |
-
jQuery(this).click(function () {
|
| 15 |
-
if (jQuery(this).val() == "") jQuery(this).val('#');
|
| 16 |
-
jQuery('.colorpickdiv', jQuery(this).parent()).show();
|
| 17 |
-
});
|
| 18 |
-
});
|
| 19 |
-
jQuery(document).mousedown(function () {
|
| 20 |
-
jQuery('.colorpickdiv').hide();
|
| 21 |
-
});
|
| 22 |
-
}
|
| 23 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/assets/js/wcvendors-media.js
DELETED
|
@@ -1,52 +0,0 @@
|
|
| 1 |
-
jQuery( function( $ ){
|
| 2 |
-
|
| 3 |
-
var id;
|
| 4 |
-
|
| 5 |
-
// Iterate over all instances of the uploader on the page
|
| 6 |
-
$('.wcv-img-id').each( function () {
|
| 7 |
-
|
| 8 |
-
id = $( this ).data( 'id' );
|
| 9 |
-
|
| 10 |
-
// Handle Add banner
|
| 11 |
-
$( '#wcv-add-' + id ).on( 'click', function(e) {
|
| 12 |
-
e.preventDefault();
|
| 13 |
-
file_uploader( id );
|
| 14 |
-
return false;
|
| 15 |
-
});
|
| 16 |
-
|
| 17 |
-
});
|
| 18 |
-
|
| 19 |
-
function file_uploader( id )
|
| 20 |
-
{
|
| 21 |
-
|
| 22 |
-
var media_uploader, json;
|
| 23 |
-
|
| 24 |
-
if (undefined !== media_uploader ) {
|
| 25 |
-
media_uploader.open();
|
| 26 |
-
return;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
media_uploader = wp.media({
|
| 30 |
-
title: $( '#wcv-add-' + id ).data('window_title'),
|
| 31 |
-
button: {
|
| 32 |
-
text: $( '#wcv-add-' + id ).data('save_button'),
|
| 33 |
-
},
|
| 34 |
-
multiple: false // Set to true to allow multiple files to be selected
|
| 35 |
-
});
|
| 36 |
-
|
| 37 |
-
media_uploader.on( 'select' , function(){
|
| 38 |
-
|
| 39 |
-
json = media_uploader.state().get('selection').first().toJSON();
|
| 40 |
-
|
| 41 |
-
if ( 0 > $.trim( json.url.length ) ) {
|
| 42 |
-
return;
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
$( '.wcv-image-container-' + id ).prop( 'src', json.sizes.full.url );
|
| 46 |
-
$( '#' + id ).val( json.sizes.full.url );
|
| 47 |
-
|
| 48 |
-
});
|
| 49 |
-
|
| 50 |
-
media_uploader.open();
|
| 51 |
-
}
|
| 52 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/class-wcv-settings-capabilities.php
DELETED
|
@@ -1,316 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* The capabilities settings class
|
| 8 |
-
*
|
| 9 |
-
* @author Jamie Madden, WC Vendors
|
| 10 |
-
* @category Settings
|
| 11 |
-
* @package WCVendors/Admin/Settings
|
| 12 |
-
* @version 2.0.0
|
| 13 |
-
*/
|
| 14 |
-
|
| 15 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 16 |
-
exit; // Exit if accessed directly
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
if ( ! class_exists( 'WCVendors_Settings_Capabilities', false ) ) :
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* WC_Admin_Settings_General.
|
| 23 |
-
*/
|
| 24 |
-
class WCVendors_Settings_Capabilities extends WCVendors_Settings_Page {
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Constructor.
|
| 28 |
-
*/
|
| 29 |
-
public function __construct() {
|
| 30 |
-
$this->id = 'capabilities';
|
| 31 |
-
$this->label = __( 'Capabilities', 'wc-vendors' );
|
| 32 |
-
|
| 33 |
-
parent::__construct();
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Get sections.
|
| 38 |
-
*
|
| 39 |
-
* @return array
|
| 40 |
-
*/
|
| 41 |
-
public function get_sections() {
|
| 42 |
-
$sections = array(
|
| 43 |
-
'' => __( 'General', 'wc-vendors' ),
|
| 44 |
-
'product' => __( 'Products', 'wc-vendors' ),
|
| 45 |
-
'order' => __( 'Orders', 'wc-vendors' ),
|
| 46 |
-
);
|
| 47 |
-
|
| 48 |
-
return apply_filters( 'wcvendors_get_sections_' . $this->id, $sections );
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Get settings array.
|
| 53 |
-
*
|
| 54 |
-
* @return array
|
| 55 |
-
*/
|
| 56 |
-
public function get_settings( $current_section = '' ) {
|
| 57 |
-
|
| 58 |
-
if ( 'product' === $current_section ){
|
| 59 |
-
|
| 60 |
-
$settings = apply_filters( 'wcvendors_settings_capabilities_product', array(
|
| 61 |
-
|
| 62 |
-
array(
|
| 63 |
-
'title' => __( 'Add / Edit Product', 'wc-vendors' ),
|
| 64 |
-
'type' => 'title',
|
| 65 |
-
'desc' => sprintf( __( 'Configure what product information to hide from the %s when creating or editing a product', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 66 |
-
'id' => 'product_add_options',
|
| 67 |
-
),
|
| 68 |
-
|
| 69 |
-
array(
|
| 70 |
-
'title' => __( 'Product Types', 'wc-vendors' ),
|
| 71 |
-
'desc' => sprintf( __( 'This controls what product types the %s can create', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 72 |
-
'id' => 'wcvendors_capability_product_types',
|
| 73 |
-
'class' => 'wc-enhanced-select',
|
| 74 |
-
'css' => 'min-width:300px;',
|
| 75 |
-
'default' => 'simple',
|
| 76 |
-
'type' => 'multiselect',
|
| 77 |
-
'options' => wc_get_product_types(),
|
| 78 |
-
'desc_tip' => true,
|
| 79 |
-
),
|
| 80 |
-
|
| 81 |
-
array(
|
| 82 |
-
'title' => __( 'Product Type Options', 'wc-vendors' ),
|
| 83 |
-
'desc' => sprintf( __( 'This controls what product type options the %s can use', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 84 |
-
'id' => 'wcvendors_capability_product_type_options',
|
| 85 |
-
'class' => 'wc-enhanced-select',
|
| 86 |
-
'css' => 'min-width:300px;',
|
| 87 |
-
'default' => 'simple',
|
| 88 |
-
'type' => 'multiselect',
|
| 89 |
-
'options' => array(
|
| 90 |
-
'virtual' => __( 'Virtual', 'wc-vendors' ),
|
| 91 |
-
'downloadable' => __( 'Downloadable', 'wc-vendors' ),
|
| 92 |
-
),
|
| 93 |
-
'desc_tip' => true,
|
| 94 |
-
),
|
| 95 |
-
|
| 96 |
-
array(
|
| 97 |
-
'title' => __( 'Product Data Tabs', 'wc-vendors' ),
|
| 98 |
-
'desc' => sprintf( __( 'This controls what product data tabs the %s can use', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 99 |
-
'id' => 'wcvendors_capability_product_data_tabs',
|
| 100 |
-
'class' => 'wc-enhanced-select',
|
| 101 |
-
'css' => 'min-width:300px;',
|
| 102 |
-
'default' => 'simple',
|
| 103 |
-
'type' => 'multiselect',
|
| 104 |
-
'options' => array(
|
| 105 |
-
'general' => __( 'General', 'wc-vendors' ),
|
| 106 |
-
'inventory' => __( 'Inventory', 'wc-vendors' ),
|
| 107 |
-
'shipping' => __( 'Shipping', 'wc-vendors' ),
|
| 108 |
-
'linked_product' => __( 'Linked Products', 'wc-vendors' ),
|
| 109 |
-
'attribute' => __( 'Attributes', 'wc-vendors' ),
|
| 110 |
-
'variations' => __( 'Variations', 'wc-vendors' ),
|
| 111 |
-
'advanced' => __( 'Advanced', 'wc-vendors' ),
|
| 112 |
-
),
|
| 113 |
-
'desc_tip' => true,
|
| 114 |
-
),
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
array(
|
| 118 |
-
'title' => __( 'Featured Product', 'wc-vendors' ),
|
| 119 |
-
'desc' => sprintf( __( 'Allow %s to use the featured product option', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 120 |
-
'id' => 'wcvendors_capability_product_featured',
|
| 121 |
-
'default' => 'no',
|
| 122 |
-
'type' => 'checkbox',
|
| 123 |
-
),
|
| 124 |
-
|
| 125 |
-
array(
|
| 126 |
-
'title' => __( 'Duplicate Product', 'wc-vendors' ),
|
| 127 |
-
'desc' => sprintf( __( 'Allow %s to duplicate products', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 128 |
-
'id' => 'wcvendors_capability_product_duplicate',
|
| 129 |
-
'default' => 'no',
|
| 130 |
-
'type' => 'checkbox',
|
| 131 |
-
),
|
| 132 |
-
|
| 133 |
-
array(
|
| 134 |
-
'title' => __( 'SKU', 'wc-vendors' ),
|
| 135 |
-
'desc' => sprintf( __( 'Hide sku field from %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 136 |
-
'id' => 'wcvendors_capability_product_sku',
|
| 137 |
-
'default' => 'no',
|
| 138 |
-
'type' => 'checkbox',
|
| 139 |
-
),
|
| 140 |
-
|
| 141 |
-
array(
|
| 142 |
-
'title' => __( 'Taxes', 'wc-vendors' ),
|
| 143 |
-
'desc' => sprintf( __( 'Hide tax fields from %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 144 |
-
'id' => 'wcvendors_capability_product_taxes',
|
| 145 |
-
'default' => 'no',
|
| 146 |
-
'type' => 'checkbox',
|
| 147 |
-
),
|
| 148 |
-
|
| 149 |
-
array( 'type' => 'sectionend', 'id' => 'product_add_options' ),
|
| 150 |
-
|
| 151 |
-
) );
|
| 152 |
-
|
| 153 |
-
} elseif ( 'order' === $current_section ){
|
| 154 |
-
|
| 155 |
-
$settings = apply_filters( 'wcvendors_settings_capabilities_order', array(
|
| 156 |
-
|
| 157 |
-
array(
|
| 158 |
-
'type' => 'title',
|
| 159 |
-
'desc' => sprintf( __( 'Configure what order information a %s can view from an order', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 160 |
-
'id' => 'order_view_options',
|
| 161 |
-
),
|
| 162 |
-
|
| 163 |
-
array(
|
| 164 |
-
'title' => __( 'View Order Notes', 'wc-vendors' ),
|
| 165 |
-
'desc' => sprintf( __( 'Allow %s to view order notes', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 166 |
-
'id' => 'wcvendors_capability_order_read_notes',
|
| 167 |
-
'default' => 'yes',
|
| 168 |
-
'type' => 'checkbox',
|
| 169 |
-
),
|
| 170 |
-
|
| 171 |
-
array(
|
| 172 |
-
'title' => __( 'Add Order notes', 'wc-vendors' ),
|
| 173 |
-
'desc' => sprintf( __( 'Allow %s to add order notes.', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 174 |
-
'id' => 'wcvendors_capability_order_update_notes',
|
| 175 |
-
'default' => 'yes',
|
| 176 |
-
'type' => 'checkbox',
|
| 177 |
-
),
|
| 178 |
-
|
| 179 |
-
array(
|
| 180 |
-
'title' => __( 'Customer Name', 'wc-vendors' ),
|
| 181 |
-
'desc' => sprintf( __( 'Allow %s to view customer name fields', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 182 |
-
'id' => 'wcvendors_capability_order_customer_name',
|
| 183 |
-
'default' => 'yes',
|
| 184 |
-
'type' => 'checkbox',
|
| 185 |
-
),
|
| 186 |
-
|
| 187 |
-
array(
|
| 188 |
-
'title' => __( 'Customer Billing Address', 'wc-vendors' ),
|
| 189 |
-
'desc' => sprintf( __( 'Allow %s to view customer billing address fields', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 190 |
-
'id' => 'wcvendors_capability_order_customer_billling',
|
| 191 |
-
'default' => 'yes',
|
| 192 |
-
'type' => 'checkbox',
|
| 193 |
-
),
|
| 194 |
-
|
| 195 |
-
array(
|
| 196 |
-
'title' => __( 'Customer Shipping Address', 'wc-vendors' ),
|
| 197 |
-
'desc' => sprintf( __( 'Allow %s to view the customer shipping fields', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 198 |
-
'id' => 'wcvendors_capability_order_customer_shipping',
|
| 199 |
-
'default' => 'yes',
|
| 200 |
-
'type' => 'checkbox',
|
| 201 |
-
),
|
| 202 |
-
|
| 203 |
-
array(
|
| 204 |
-
'title' => __( 'Customer Email', 'wc-vendors' ),
|
| 205 |
-
'desc' => sprintf( __( 'Allow %s to view the customer email address', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 206 |
-
'id' => 'wcvendors_capability_order_customer_email',
|
| 207 |
-
'default' => 'yes',
|
| 208 |
-
'type' => 'checkbox',
|
| 209 |
-
),
|
| 210 |
-
|
| 211 |
-
array(
|
| 212 |
-
'title' => __( 'Customer Phone', 'wc-vendors' ),
|
| 213 |
-
'desc' => sprintf( __( 'Allow %s to view the customer phone number', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 214 |
-
'id' => 'wcvendors_capability_order_customer_phone',
|
| 215 |
-
'default' => 'yes',
|
| 216 |
-
'type' => 'checkbox',
|
| 217 |
-
),
|
| 218 |
-
|
| 219 |
-
array( 'type' => 'sectionend', 'id' => 'order_view_options' ),
|
| 220 |
-
|
| 221 |
-
) );
|
| 222 |
-
|
| 223 |
-
} else {
|
| 224 |
-
|
| 225 |
-
$settings = apply_filters( 'wcvendors_settings_capabilities_general', array(
|
| 226 |
-
|
| 227 |
-
array(
|
| 228 |
-
'title' => __( 'Permissions', 'wc-vendors' ),
|
| 229 |
-
'type' => 'title',
|
| 230 |
-
'desc' => sprintf( __( 'Enable or disable functionality for your %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 231 |
-
'id' => 'capabilities_options',
|
| 232 |
-
),
|
| 233 |
-
|
| 234 |
-
array( 'type' => 'sectionend', 'id' => 'capabilities_options' ),
|
| 235 |
-
|
| 236 |
-
// Products
|
| 237 |
-
array(
|
| 238 |
-
'title' => __( 'Products', 'wc-vendors' ),
|
| 239 |
-
'type' => 'title',
|
| 240 |
-
'id' => 'permissions_products_options',
|
| 241 |
-
),
|
| 242 |
-
|
| 243 |
-
array(
|
| 244 |
-
'title' => __( 'Submit Products', 'wc-vendors' ),
|
| 245 |
-
'desc' => sprintf( __( 'Allow %s to add/edit products', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 246 |
-
'id' => 'wcvendors_capability_products_enabled',
|
| 247 |
-
'default' => 'yes',
|
| 248 |
-
'type' => 'checkbox',
|
| 249 |
-
),
|
| 250 |
-
|
| 251 |
-
array(
|
| 252 |
-
'title' => __( 'Edit Live Products', 'wc-vendors' ),
|
| 253 |
-
'desc' => sprintf( __( 'Allow %s to edit published (live) products', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 254 |
-
'id' => 'wcvendors_capability_products_edit',
|
| 255 |
-
'default' => 'yes',
|
| 256 |
-
'type' => 'checkbox',
|
| 257 |
-
),
|
| 258 |
-
|
| 259 |
-
array(
|
| 260 |
-
'title' => __( 'Publish Approval', 'wc-vendors' ),
|
| 261 |
-
'desc' => sprintf( __( 'Allow %s to publish products directly to the marketplace without requiring approval.', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 262 |
-
'id' => 'wcvendors_capability_products_live',
|
| 263 |
-
'default' => 'yes',
|
| 264 |
-
'type' => 'checkbox',
|
| 265 |
-
),
|
| 266 |
-
|
| 267 |
-
array( 'type' => 'sectionend', 'id' => 'permissions_products_options' ),
|
| 268 |
-
|
| 269 |
-
// Orders
|
| 270 |
-
array(
|
| 271 |
-
'title' => __( 'Orders', 'wc-vendors' ),
|
| 272 |
-
'type' => 'title',
|
| 273 |
-
'id' => 'permissions_orders_options',
|
| 274 |
-
),
|
| 275 |
-
|
| 276 |
-
array(
|
| 277 |
-
'title' => __( 'View Orders', 'wc-vendors' ),
|
| 278 |
-
'desc' => sprintf( __( 'Allow %s to view orders', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 279 |
-
'id' => 'wcvendors_capability_orders_enabled',
|
| 280 |
-
'default' => 'yes',
|
| 281 |
-
'type' => 'checkbox',
|
| 282 |
-
),
|
| 283 |
-
|
| 284 |
-
array(
|
| 285 |
-
'title' => __( 'Export Orders', 'wc-vendors' ),
|
| 286 |
-
'desc' => sprintf( __( 'Allow %s to export their orders to a CSV file', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 287 |
-
'id' => 'wcvendors_capability_orders_export',
|
| 288 |
-
'default' => 'yes',
|
| 289 |
-
'type' => 'checkbox',
|
| 290 |
-
),
|
| 291 |
-
|
| 292 |
-
array(
|
| 293 |
-
'title' => __( 'Front End Sales Reports', 'wc-vendors' ),
|
| 294 |
-
'desc' => sprintf( __( 'Allow %s to view sales table on the frontend on the %s dashboard page.', 'wc-vendors' ), wcv_get_vendor_name( false, false ), wcv_get_vendor_name( false, false ) ),
|
| 295 |
-
'id' => 'wcvendors_capability_frontend_reports',
|
| 296 |
-
'default' => 'yes',
|
| 297 |
-
'type' => 'checkbox',
|
| 298 |
-
),
|
| 299 |
-
|
| 300 |
-
|
| 301 |
-
array( 'type' => 'sectionend', 'id' => 'permissions_orders_options' ),
|
| 302 |
-
|
| 303 |
-
) );
|
| 304 |
-
|
| 305 |
-
}
|
| 306 |
-
|
| 307 |
-
return apply_filters( 'wcvendors_get_settings_' . $this->id, $settings, $current_section );
|
| 308 |
-
|
| 309 |
-
}
|
| 310 |
-
|
| 311 |
-
|
| 312 |
-
}
|
| 313 |
-
|
| 314 |
-
endif;
|
| 315 |
-
|
| 316 |
-
return new WCVendors_Settings_Capabilities();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/class-wcv-settings-commission.php
DELETED
|
@@ -1,88 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* The commission admin settings
|
| 8 |
-
*
|
| 9 |
-
* @author Jamie Madden, WC Vendors
|
| 10 |
-
* @category Settings
|
| 11 |
-
* @package WCVendors/Admin/Settings
|
| 12 |
-
* @version 2.0.0
|
| 13 |
-
*/
|
| 14 |
-
|
| 15 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 16 |
-
exit; // Exit if accessed directly
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
if ( ! class_exists( 'WCVendors_Settings_Commission', false ) ) :
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* WC_Admin_Settings_General.
|
| 23 |
-
*/
|
| 24 |
-
class WCVendors_Settings_Commission extends WCVendors_Settings_Page {
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Constructor.
|
| 28 |
-
*/
|
| 29 |
-
public function __construct() {
|
| 30 |
-
$this->id = 'commission';
|
| 31 |
-
$this->label = __( 'Commission', 'wc-vendors' );
|
| 32 |
-
|
| 33 |
-
parent::__construct();
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Get sections.
|
| 38 |
-
*
|
| 39 |
-
* @return array
|
| 40 |
-
*/
|
| 41 |
-
public function get_sections() {
|
| 42 |
-
$sections = array(
|
| 43 |
-
'' => __( 'General', 'wc-vendors' ),
|
| 44 |
-
);
|
| 45 |
-
|
| 46 |
-
return apply_filters( 'wcvendors_get_sections_' . $this->id, $sections );
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/**
|
| 50 |
-
* Get settings array.
|
| 51 |
-
*
|
| 52 |
-
* @return array
|
| 53 |
-
*/
|
| 54 |
-
public function get_settings( $current_section = '' ) {
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
$settings = array();
|
| 58 |
-
|
| 59 |
-
if ( '' === $current_section ) {
|
| 60 |
-
$settings = apply_filters( 'wcvendors_settings_comission', array(
|
| 61 |
-
|
| 62 |
-
// General Options
|
| 63 |
-
array(
|
| 64 |
-
'type' => 'title',
|
| 65 |
-
'desc' => __( 'These are the commission settings for your marketplace', 'wc-vendors' ),
|
| 66 |
-
'id' => 'commission_options',
|
| 67 |
-
),
|
| 68 |
-
array(
|
| 69 |
-
'title' => sprintf( __( '%s Commission %%', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 70 |
-
'desc' => sprintf( __( 'The global commission rate for your %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ),
|
| 71 |
-
'id' => 'wcvendors_vendor_commission_rate',
|
| 72 |
-
'css' => 'width:50px;',
|
| 73 |
-
'default' => '50',
|
| 74 |
-
'type' => 'number',
|
| 75 |
-
),
|
| 76 |
-
array( 'type' => 'sectionend', 'id' => 'commission_options' ),
|
| 77 |
-
|
| 78 |
-
) );
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
return apply_filters( 'wcvendors_get_settings_' . $this->id, $settings, $current_section );
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
endif;
|
| 87 |
-
|
| 88 |
-
return new WCVendors_Settings_Commission();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/class-wcv-settings-display.php
DELETED
|
@@ -1,271 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* The display settings class
|
| 8 |
-
*
|
| 9 |
-
* @author Jamie Madden, WC Vendors
|
| 10 |
-
* @category Settings
|
| 11 |
-
* @package WCVendors/Admin/Settings
|
| 12 |
-
* @version 2.0.0
|
| 13 |
-
*/
|
| 14 |
-
|
| 15 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 16 |
-
exit; // Exit if accessed directly
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
if ( ! class_exists( 'WCVendors_Settings_Display', false ) ) :
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* WC_Admin_Settings_General.
|
| 23 |
-
*/
|
| 24 |
-
class WCVendors_Settings_Display extends WCVendors_Settings_Page {
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Constructor.
|
| 28 |
-
*/
|
| 29 |
-
public function __construct() {
|
| 30 |
-
$this->id = 'display';
|
| 31 |
-
$this->label = __( 'Display', 'wc-vendors' );
|
| 32 |
-
|
| 33 |
-
parent::__construct();
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Get sections.
|
| 38 |
-
*
|
| 39 |
-
* @return array
|
| 40 |
-
*/
|
| 41 |
-
public function get_sections() {
|
| 42 |
-
$sections = array(
|
| 43 |
-
'' => __( 'General', 'wc-vendors' ),
|
| 44 |
-
'labels' => __( 'Labels', 'wc-vendors' ),
|
| 45 |
-
'advanced' => __( 'Advanced', 'wc-vendors' ),
|
| 46 |
-
);
|
| 47 |
-
|
| 48 |
-
return apply_filters( 'wcvendors_get_sections_' . $this->id, $sections );
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Get settings array.
|
| 53 |
-
*
|
| 54 |
-
* @return array
|
| 55 |
-
*/
|
| 56 |
-
public function get_settings( $current_section = '' ) {
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
if ( 'advanced' === $current_section ){
|
| 60 |
-
|
| 61 |
-
$settings = apply_filters( 'wcvendors_settings_display_advanced', array(
|
| 62 |
-
// Shop Display Options
|
| 63 |
-
array(
|
| 64 |
-
'title' => __( '', 'wc-vendors' ),
|
| 65 |
-
'type' => 'title',
|
| 66 |
-
'desc' => sprintf( __( 'Advanced options provide extra display options', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 67 |
-
'id' => 'advanced_options',
|
| 68 |
-
),
|
| 69 |
-
array(
|
| 70 |
-
'title' => __( 'Product Page Stylesheet', 'wc-vendors' ),
|
| 71 |
-
'desc' => sprintf( __( 'You can add CSS in this textarea, which will be loaded on the product add/edit page for %s', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 72 |
-
'desc_tip' => sprintf( __( 'This enables the sold by labels used to show which %s shop the product belongs to', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 73 |
-
'id' => 'wcvendors_display_advanced_stylesheet',
|
| 74 |
-
'css' => 'width: 700px;min-height:100px',
|
| 75 |
-
'default' => '',
|
| 76 |
-
'type' => 'textarea',
|
| 77 |
-
),
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
array( 'type' => 'sectionend', 'id' => 'advanced_options' ),
|
| 81 |
-
) );
|
| 82 |
-
|
| 83 |
-
} elseif ( 'labels' === $current_section ){
|
| 84 |
-
|
| 85 |
-
$settings = apply_filters( 'wcvendors_settings_display_labels', array(
|
| 86 |
-
|
| 87 |
-
// Shop Display Options
|
| 88 |
-
array(
|
| 89 |
-
'title' => __( '', 'wc-vendors' ),
|
| 90 |
-
'type' => 'title',
|
| 91 |
-
'desc' => sprintf( __( 'Labels are shown on the front end, in orders or emails.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 92 |
-
'id' => 'label_options',
|
| 93 |
-
),
|
| 94 |
-
|
| 95 |
-
array(
|
| 96 |
-
'title' => __( 'Vendor singluar term', 'wc-vendors' ),
|
| 97 |
-
'desc_tip' => __( 'Change all references to vendor to this term', 'wc-vendors' ),
|
| 98 |
-
'id' => 'wcvendors_vendor_singular',
|
| 99 |
-
'type' => 'text',
|
| 100 |
-
'default' => __( 'Vendor', 'wc-vendors' ),
|
| 101 |
-
),
|
| 102 |
-
|
| 103 |
-
array(
|
| 104 |
-
'title' => __( 'Vendor plural term', 'wc-vendors' ),
|
| 105 |
-
'desc_tip' => __( 'Change all references to vendors to this term', 'wc-vendors' ),
|
| 106 |
-
'id' => 'wcvendors_vendor_plural',
|
| 107 |
-
'type' => 'text',
|
| 108 |
-
'default' => __( 'Vendors', 'wc-vendors' ),
|
| 109 |
-
),
|
| 110 |
-
|
| 111 |
-
array(
|
| 112 |
-
'title' => __( 'Sold by', 'wc-vendors' ),
|
| 113 |
-
'desc' => __( 'Enable sold by labels', 'wc-vendors' ),
|
| 114 |
-
'desc_tip' => sprintf( __( 'This enables the sold by labels used to show which %s shop the product belongs to', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 115 |
-
'id' => 'wcvendors_display_label_sold_by_enable',
|
| 116 |
-
'default' => 'yes',
|
| 117 |
-
'type' => 'checkbox',
|
| 118 |
-
),
|
| 119 |
-
|
| 120 |
-
array(
|
| 121 |
-
'title' => __( 'Sold by label', 'wc-vendors' ),
|
| 122 |
-
'desc_tip' => __( 'The sold by label', 'wc-vendors' ),
|
| 123 |
-
'id' => 'wcvendors_label_sold_by',
|
| 124 |
-
'type' => 'text',
|
| 125 |
-
'default' => __( 'Sold By', 'wc-vendors' ),
|
| 126 |
-
),
|
| 127 |
-
|
| 128 |
-
array(
|
| 129 |
-
'title' => sprintf( __( '%s Store Info', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 130 |
-
'desc' => sprintf( __( 'Enable %s store info tab on the single product page', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 131 |
-
'id' => 'wcvendors_label_store_info_enable',
|
| 132 |
-
'default' => 'yes',
|
| 133 |
-
'type' => 'checkbox',
|
| 134 |
-
),
|
| 135 |
-
|
| 136 |
-
array(
|
| 137 |
-
'title' => sprintf( __( '%s store Info label', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 138 |
-
'desc' => sprintf( __( 'The %s store info label', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 139 |
-
'id' => 'wcvendors_display_label_store_info',
|
| 140 |
-
'type' => 'text',
|
| 141 |
-
'default' => __( 'Store Info', 'wc-vendors' ),
|
| 142 |
-
),
|
| 143 |
-
|
| 144 |
-
array( 'type' => 'sectionend', 'id' => 'label_options' ),
|
| 145 |
-
|
| 146 |
-
) );
|
| 147 |
-
|
| 148 |
-
} else {
|
| 149 |
-
|
| 150 |
-
$settings = apply_filters( 'wcvendors_settings_display_general', array(
|
| 151 |
-
|
| 152 |
-
// General Options
|
| 153 |
-
array(
|
| 154 |
-
'title' => __( 'Pages', 'wc-vendors' ),
|
| 155 |
-
'type' => 'title',
|
| 156 |
-
'desc' => sprintf( __( 'These pages used on the front end by %s.', 'wc-vendors'), wcv_get_vendor_name( true, false ) ),
|
| 157 |
-
'id' => 'page_options',
|
| 158 |
-
),
|
| 159 |
-
array(
|
| 160 |
-
'title' => __( 'Dashboard', 'wc-vendors' ),
|
| 161 |
-
'id' => 'wcvendors_vendor_dashboard_page_id',
|
| 162 |
-
'type' => 'single_select_page',
|
| 163 |
-
'default' => '',
|
| 164 |
-
'class' => 'wc-enhanced-select-nostd',
|
| 165 |
-
'css' => 'min-width:300px;',
|
| 166 |
-
'desc' => sprintf( __( '<br />This sets the page used to display the front end %s dashboard. This page should contain the following shortcode. <code>[wcv_vendor_dashboard]</code>', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 167 |
-
),
|
| 168 |
-
array(
|
| 169 |
-
'title' => __( 'Shop Settings', 'wc-vendors' ),
|
| 170 |
-
'id' => 'wcvendors_shop_settings_page_id',
|
| 171 |
-
'type' => 'single_select_page',
|
| 172 |
-
'default' => '',
|
| 173 |
-
'class' => 'wc-enhanced-select-nostd',
|
| 174 |
-
'css' => 'min-width:300px;',
|
| 175 |
-
'desc' => sprintf( __( '<br />This sets the page used to display the %s shop settings page. This page should contain the following shortcode. <code>[wcv_shop_settings]</code>', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 176 |
-
),
|
| 177 |
-
array(
|
| 178 |
-
'title' => __( 'Orders', 'wc-vendors' ),
|
| 179 |
-
'id' => 'wcvendors_product_orders_page_id',
|
| 180 |
-
'type' => 'single_select_page',
|
| 181 |
-
'default' => '',
|
| 182 |
-
'class' => 'wc-enhanced-select-nostd',
|
| 183 |
-
'css' => 'min-width:300px;',
|
| 184 |
-
'desc' => sprintf( __( '<br />This sets the page used to display the %s orders page. This page should contain the following shortcode. <code>[wcv_orders]</code>', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 185 |
-
),
|
| 186 |
-
array(
|
| 187 |
-
'title' => sprintf( __( '%s', 'wc-vendors' ), wcv_get_vendor_name( false ) ),
|
| 188 |
-
'id' => 'wcvendors_vendors_page_id',
|
| 189 |
-
'type' => 'single_select_page',
|
| 190 |
-
'default' => '',
|
| 191 |
-
'class' => 'wc-enhanced-select-nostd',
|
| 192 |
-
'css' => 'min-width:300px;',
|
| 193 |
-
'desc' => sprintf( __( '<br />This sets the page used to display a paginated list of all %1$s stores. Your %1$s stores will be available at <code>%2$s/page-slug/store-name/</code><br />This page should contain the following shortcode. <code>[wcv_vendorslist]</code>', 'wc-vendors' ), wcv_get_vendor_name( true, false ), esc_html( home_url() ) ),
|
| 194 |
-
),
|
| 195 |
-
array(
|
| 196 |
-
'title' => __( 'Terms and Conditions', 'wc-vendors' ),
|
| 197 |
-
'id' => 'wcvendors_vendor_terms_page_id',
|
| 198 |
-
'type' => 'single_select_page',
|
| 199 |
-
'default' => '',
|
| 200 |
-
'class' => 'wc-enhanced-select-nostd',
|
| 201 |
-
'css' => 'min-width:300px;',
|
| 202 |
-
'desc' => sprintf( __( '<br />This sets the page used to display the terms and conditions when a %s signs up.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 203 |
-
),
|
| 204 |
-
|
| 205 |
-
array( 'type' => 'sectionend', 'id' => 'page_options' ),
|
| 206 |
-
|
| 207 |
-
// Shop Settings
|
| 208 |
-
array(
|
| 209 |
-
'title' => __( 'Store Settings', 'wc-vendors' ),
|
| 210 |
-
'type' => 'title',
|
| 211 |
-
'desc' => sprintf( __( 'These are the settings for the individual %s stores.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 212 |
-
'id' => 'shop_options',
|
| 213 |
-
),
|
| 214 |
-
|
| 215 |
-
array(
|
| 216 |
-
'title' => sprintf( __( '%s Store URL', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 217 |
-
'desc' => sprintf( __( 'If you enter "vendors" your %1$s store will be %1$s/vendors/store-name/', 'wc-vendors' ), wcv_get_vendor_name( true, false ), esc_html( home_url() ) ),
|
| 218 |
-
'id' => 'wcvendors_vendor_shop_permalink',
|
| 219 |
-
'default' => 'vendors',
|
| 220 |
-
'type' => 'text',
|
| 221 |
-
),
|
| 222 |
-
|
| 223 |
-
array(
|
| 224 |
-
'title' => __( 'Shop Header', 'wc-vendors' ),
|
| 225 |
-
'desc' => sprintf( __( 'Enable %s shop headers', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 226 |
-
'desc_tip' => sprintf( __( 'This enables the %s shop header template and disables the shop description text.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 227 |
-
'id' => 'wcvendors_display_shop_headers',
|
| 228 |
-
'default' => 'no',
|
| 229 |
-
'type' => 'checkbox',
|
| 230 |
-
),
|
| 231 |
-
|
| 232 |
-
array(
|
| 233 |
-
'title' => __( 'Shop HTML', 'wc-vendors' ),
|
| 234 |
-
'desc' => sprintf( __( 'Allow HTML in %s shop desription', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 235 |
-
'desc_tip' => sprintf( __( 'Enable HTML for the %1$s shop description. You can enable or disable this per %1$s by editing the %1$s user account.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 236 |
-
'id' => 'wcvendors_display_shop_description_html',
|
| 237 |
-
'default' => 'no',
|
| 238 |
-
'type' => 'checkbox',
|
| 239 |
-
),
|
| 240 |
-
|
| 241 |
-
array(
|
| 242 |
-
'title' => __( 'Display Name', 'wc-vendors' ),
|
| 243 |
-
'id' => 'wcvendors_display_shop_display_name',
|
| 244 |
-
'desc_tip' => sprintf( __( 'Select what will be used to display the %s name throughout the marketplace.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 245 |
-
'default' => 'shop_name',
|
| 246 |
-
'type' => 'select',
|
| 247 |
-
'class' => 'wc-enhanced-select',
|
| 248 |
-
'options' => array(
|
| 249 |
-
'display_name' => __( 'Display name', 'wc-vendors' ),
|
| 250 |
-
'shop_name' => __( 'Shop name', 'wc-vendors' ),
|
| 251 |
-
'user_login' => sprintf( __( '%s Username', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 252 |
-
'user_email' => sprintf( __( '%s Email', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 253 |
-
),
|
| 254 |
-
),
|
| 255 |
-
|
| 256 |
-
array( 'type' => 'sectionend', 'id' => 'shop_options' ),
|
| 257 |
-
|
| 258 |
-
) );
|
| 259 |
-
|
| 260 |
-
}
|
| 261 |
-
|
| 262 |
-
return apply_filters( 'wcvendors_get_settings_' . $this->id, $settings, $current_section );
|
| 263 |
-
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
}
|
| 268 |
-
|
| 269 |
-
endif;
|
| 270 |
-
|
| 271 |
-
return new WCVendors_Settings_Display();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/class-wcv-settings-general.php
DELETED
|
@@ -1,109 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* The general admin settings
|
| 8 |
-
*
|
| 9 |
-
* @author Jamie Madden, WC Vendors
|
| 10 |
-
* @category Settings
|
| 11 |
-
* @package WCVendors/Admin/Settings
|
| 12 |
-
* @version 2.0.0
|
| 13 |
-
*/
|
| 14 |
-
|
| 15 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 16 |
-
exit; // Exit if accessed directly
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
if ( ! class_exists( 'WCVendors_Settings_General', false ) ) :
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* WC_Admin_Settings_General.
|
| 23 |
-
*/
|
| 24 |
-
class WCVendors_Settings_General extends WCVendors_Settings_Page {
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Constructor.
|
| 28 |
-
*/
|
| 29 |
-
public function __construct() {
|
| 30 |
-
$this->id = 'general';
|
| 31 |
-
$this->label = __( 'General', 'wc-vendors' );
|
| 32 |
-
|
| 33 |
-
parent::__construct();
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Get sections.
|
| 38 |
-
*
|
| 39 |
-
* @return array
|
| 40 |
-
*/
|
| 41 |
-
public function get_sections() {
|
| 42 |
-
$sections = array(
|
| 43 |
-
'' => __( 'General', 'wc-vendors' ),
|
| 44 |
-
);
|
| 45 |
-
|
| 46 |
-
return apply_filters( 'wcvendors_get_sections_' . $this->id, $sections );
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/**
|
| 50 |
-
* Get settings array.
|
| 51 |
-
*
|
| 52 |
-
* @return array
|
| 53 |
-
*/
|
| 54 |
-
public function get_settings( $current_section = '' ) {
|
| 55 |
-
|
| 56 |
-
$settings = array();
|
| 57 |
-
|
| 58 |
-
if ( '' === $current_section ) {
|
| 59 |
-
|
| 60 |
-
$settings = apply_filters( 'wcvendors_settings', array(
|
| 61 |
-
|
| 62 |
-
// General Options
|
| 63 |
-
array(
|
| 64 |
-
'title' => __( 'Marketplace Options', 'wc-vendors' ),
|
| 65 |
-
'type' => 'title',
|
| 66 |
-
'desc' => __( 'These are the general settings for your marketplace', 'wc-vendors' ),
|
| 67 |
-
'id' => 'general_options',
|
| 68 |
-
),
|
| 69 |
-
array(
|
| 70 |
-
'title' => sprintf( __( '%s Registration', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 71 |
-
'desc' => sprintf( __( 'Allow users to apply to become a %s', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 72 |
-
'id' => 'wcvendors_vendor_allow_registration',
|
| 73 |
-
'default' => 'yes',
|
| 74 |
-
'type' => 'checkbox',
|
| 75 |
-
),
|
| 76 |
-
array(
|
| 77 |
-
'title' => sprintf( __( '%s Approval', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 78 |
-
'desc' => sprintf( __( 'Manually approve all %s applications', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 79 |
-
'id' => 'wcvendors_vendor_approve_registration',
|
| 80 |
-
'default' => 'no',
|
| 81 |
-
'type' => 'checkbox',
|
| 82 |
-
),
|
| 83 |
-
array(
|
| 84 |
-
'title' => sprintf( __( '%s Taxes', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 85 |
-
'desc' => sprintf( __( 'Give any taxes to the %s', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 86 |
-
'id' => 'wcvendors_vendor_give_taxes',
|
| 87 |
-
'default' => 'no',
|
| 88 |
-
'type' => 'checkbox',
|
| 89 |
-
),
|
| 90 |
-
array(
|
| 91 |
-
'title' => sprintf( __( '%s Shipping', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 92 |
-
'desc' => sprintf( __( 'Give any shipping to the %s', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 93 |
-
'id' => 'wcvendors_vendor_give_shipping',
|
| 94 |
-
'default' => 'no',
|
| 95 |
-
'type' => 'checkbox',
|
| 96 |
-
),
|
| 97 |
-
array( 'type' => 'sectionend', 'id' => 'general_options' ),
|
| 98 |
-
|
| 99 |
-
) );
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
return apply_filters( 'wcvendors_get_settings_' . $this->id, $settings, $current_section );
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
endif;
|
| 108 |
-
|
| 109 |
-
return new WCVendors_Settings_General();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/class-wcv-settings-page.php
DELETED
|
@@ -1,144 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* WC Vendors Settings Page/Tab - This is a copy of the WooCommerce Settings page
|
| 4 |
-
*
|
| 5 |
-
* @author WooThemes, Jamie Madden
|
| 6 |
-
* @category Admin
|
| 7 |
-
* @package WC Vendors/Admin
|
| 8 |
-
* @version 2.0.0
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 12 |
-
exit; // Exit if accessed directly
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
if ( ! class_exists( 'WCVendors_Settings_Page', false ) ) :
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* WCVendors_Settings_Page.
|
| 19 |
-
*/
|
| 20 |
-
abstract class WCVendors_Settings_Page {
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Setting page id.
|
| 24 |
-
*
|
| 25 |
-
* @var string
|
| 26 |
-
*/
|
| 27 |
-
protected $id = '';
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* Setting page label.
|
| 31 |
-
*
|
| 32 |
-
* @var string
|
| 33 |
-
*/
|
| 34 |
-
protected $label = '';
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Constructor.
|
| 38 |
-
*/
|
| 39 |
-
public function __construct() {
|
| 40 |
-
|
| 41 |
-
add_filter( 'wcvendors_settings_tabs_array', array( $this, 'add_settings_page' ), 20 );
|
| 42 |
-
add_action( 'wcvendors_sections_' . $this->id, array( $this, 'output_sections' ) );
|
| 43 |
-
add_action( 'wcvendors_settings_' . $this->id, array( $this, 'output' ) );
|
| 44 |
-
add_action( 'wcvendors_settings_save_' . $this->id, array( $this, 'save' ) );
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* Get settings page ID.
|
| 49 |
-
* @since 2.0.0
|
| 50 |
-
* @return string
|
| 51 |
-
*/
|
| 52 |
-
public function get_id() {
|
| 53 |
-
return $this->id;
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* Get settings page label.
|
| 58 |
-
* @since 2.0.0
|
| 59 |
-
* @return string
|
| 60 |
-
*/
|
| 61 |
-
public function get_label() {
|
| 62 |
-
return $this->label;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/**
|
| 66 |
-
* Add this page to settings.
|
| 67 |
-
*
|
| 68 |
-
* @param array $pages
|
| 69 |
-
*
|
| 70 |
-
* @return mixed
|
| 71 |
-
*/
|
| 72 |
-
public function add_settings_page( $pages ) {
|
| 73 |
-
$pages[ $this->id ] = $this->label;
|
| 74 |
-
|
| 75 |
-
return $pages;
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
/**
|
| 79 |
-
* Get settings array.
|
| 80 |
-
*
|
| 81 |
-
* @return array
|
| 82 |
-
*/
|
| 83 |
-
public function get_settings() {
|
| 84 |
-
return apply_filters( 'wcvendors_get_settings_' . $this->id, array() );
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
/**
|
| 88 |
-
* Get sections.
|
| 89 |
-
*
|
| 90 |
-
* @return array
|
| 91 |
-
*/
|
| 92 |
-
public function get_sections() {
|
| 93 |
-
return apply_filters( 'wcvendors_get_sections_' . $this->id, array() );
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
/**
|
| 97 |
-
* Output sections.
|
| 98 |
-
*/
|
| 99 |
-
public function output_sections() {
|
| 100 |
-
global $current_section;
|
| 101 |
-
|
| 102 |
-
$sections = $this->get_sections();
|
| 103 |
-
|
| 104 |
-
if ( empty( $sections ) || 1 === sizeof( $sections ) ) {
|
| 105 |
-
return;
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
echo '<ul class="subsubsub">';
|
| 109 |
-
|
| 110 |
-
$array_keys = array_keys( $sections );
|
| 111 |
-
|
| 112 |
-
foreach ( $sections as $id => $label ) {
|
| 113 |
-
echo '<li><a href="' . admin_url( 'admin.php?page=wcv-settings&tab=' . $this->id . '§ion=' . sanitize_title( $id ) ) . '" class="' . ( $current_section == $id ? 'current' : '' ) . '">' . $label . '</a> ' . ( end( $array_keys ) == $id ? '' : '|' ) . ' </li>';
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
echo '</ul><br class="clear" />';
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
/**
|
| 120 |
-
* Output the settings.
|
| 121 |
-
*/
|
| 122 |
-
public function output() {
|
| 123 |
-
global $current_section;
|
| 124 |
-
|
| 125 |
-
$settings = $this->get_settings( $current_section );
|
| 126 |
-
WCVendors_Admin_Settings::output_fields( $settings );
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
/**
|
| 130 |
-
* Save settings.
|
| 131 |
-
*/
|
| 132 |
-
public function save() {
|
| 133 |
-
global $current_section;
|
| 134 |
-
|
| 135 |
-
$settings = $this->get_settings( $current_section );
|
| 136 |
-
WCVendors_Admin_Settings::save_fields( $settings );
|
| 137 |
-
|
| 138 |
-
if ( $current_section ) {
|
| 139 |
-
do_action( 'wcvendors_update_options_' . $this->id . '_' . $current_section );
|
| 140 |
-
}
|
| 141 |
-
}
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
endif;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/class-wcv-settings-payments.php
DELETED
|
@@ -1,143 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* The display settings class
|
| 8 |
-
*
|
| 9 |
-
* @author Jamie Madden, WC Vendors
|
| 10 |
-
* @category Settings
|
| 11 |
-
* @package WCVendors/Admin/Settings
|
| 12 |
-
* @version 2.0.0
|
| 13 |
-
*/
|
| 14 |
-
|
| 15 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 16 |
-
exit; // Exit if accessed directly
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
if ( ! class_exists( 'WCVendors_Settings_Payments', false ) ) :
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* WC_Admin_Settings_General.
|
| 23 |
-
*/
|
| 24 |
-
class WCVendors_Settings_Payments extends WCVendors_Settings_Page {
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Constructor.
|
| 28 |
-
*/
|
| 29 |
-
public function __construct() {
|
| 30 |
-
$this->id = 'payments';
|
| 31 |
-
$this->label = __( 'Payments', 'wc-vendors' );
|
| 32 |
-
|
| 33 |
-
parent::__construct();
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* Get sections.
|
| 39 |
-
*
|
| 40 |
-
* @return array
|
| 41 |
-
*/
|
| 42 |
-
public function get_sections() {
|
| 43 |
-
$sections = array(
|
| 44 |
-
'' => __( 'General', 'wc-vendors' ),
|
| 45 |
-
'paypal' => __( 'PayPal Adaptive Payments', 'wc-vendors' ),
|
| 46 |
-
);
|
| 47 |
-
|
| 48 |
-
return apply_filters( 'wcvendors_get_sections_' . $this->id, $sections );
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Get settings array.
|
| 53 |
-
*
|
| 54 |
-
* @return array
|
| 55 |
-
*/
|
| 56 |
-
public function get_settings( $current_section = '' ) {
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
if ( 'paypal' === $current_section ){
|
| 60 |
-
|
| 61 |
-
$settings = apply_filters( 'wcvendors_settings_payments_paypal', array(
|
| 62 |
-
|
| 63 |
-
// Shop Display Options
|
| 64 |
-
array(
|
| 65 |
-
'title' => __( '', 'wc-vendors' ),
|
| 66 |
-
'type' => 'title',
|
| 67 |
-
'desc' => sprintf( __( '<h3>PayPal Adaptive Payments - Please Note: PayPal Adaptive Payments has been depreciated by PayPal as of September 2017. These options are for existing users only. This will be completely removed in a future version.</h3>', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 68 |
-
'id' => 'paypal_options',
|
| 69 |
-
),
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
array(
|
| 73 |
-
'title' => __( '', 'wc-vendors' ),
|
| 74 |
-
'type' => 'title',
|
| 75 |
-
'desc' => sprintf( __( 'Total Commission due: %s', 'wc-vendors' ), wc_price( WCV_Commission::get_totals( 'due' ) ) ),
|
| 76 |
-
'id' => 'paypal_options',
|
| 77 |
-
),
|
| 78 |
-
|
| 79 |
-
array(
|
| 80 |
-
'title' => __( 'Instant Pay', 'wc-vendors' ),
|
| 81 |
-
'desc' => __( 'Enable instantpay', 'wc-vendors' ),
|
| 82 |
-
'desc_tip' => sprintf( __( 'Instantly pay %1$s their commission when an order is made, and if a %1$s has a valid PayPal email added on their Shop Settings page.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 83 |
-
'id' => 'wcvendors_payments_paypal_instantpay_enable',
|
| 84 |
-
'default' => 'no',
|
| 85 |
-
'type' => 'checkbox',
|
| 86 |
-
),
|
| 87 |
-
|
| 88 |
-
array(
|
| 89 |
-
'title' => __( 'Payment schedule', 'wc-vendors' ),
|
| 90 |
-
'desc' => __( 'Note: Schedule will only work if instant pay is unchecked', 'wc-vendors' ),
|
| 91 |
-
'id' => 'wcvendors_payments_paypal_schedule',
|
| 92 |
-
'type' => 'radio',
|
| 93 |
-
'options' => array(
|
| 94 |
-
'daily' => __( 'Daily', 'wc-vendors' ),
|
| 95 |
-
'weekly' => __( 'Weekly', 'wc-vendors' ),
|
| 96 |
-
'biweekly' => __( 'Biweekly', 'wc-vendors' ),
|
| 97 |
-
'monthly' => __( 'Monthly', 'wc-vendors' ),
|
| 98 |
-
'manual' => __( 'Manual', 'wc-vendors' ),
|
| 99 |
-
'now' => '<span style="color:green;"><strong>' . __( 'Now', 'wc-vendors' ) . '</strong></span>',
|
| 100 |
-
)
|
| 101 |
-
),
|
| 102 |
-
|
| 103 |
-
array(
|
| 104 |
-
'title' => __( 'Email notification', 'wc-vendors' ),
|
| 105 |
-
'desc' => __( 'Enable notify the admin', 'wc-vendors' ),
|
| 106 |
-
'desc_tip' => __( 'Send the marketplace admin an email each time a payment has been made via the payment schedule options above', 'wc-vendors' ),
|
| 107 |
-
'id' => 'wcvendors_payments_paypal_email_enable',
|
| 108 |
-
'default' => 'no',
|
| 109 |
-
'type' => 'checkbox',
|
| 110 |
-
),
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
array( 'type' => 'sectionend', 'id' => 'paypal_options' ),
|
| 115 |
-
) );
|
| 116 |
-
|
| 117 |
-
} else {
|
| 118 |
-
|
| 119 |
-
$settings = apply_filters( 'wcvendors_settings_payments_general', array(
|
| 120 |
-
|
| 121 |
-
// Shop Display Options
|
| 122 |
-
array(
|
| 123 |
-
'title' => __( '', 'wc-vendors' ),
|
| 124 |
-
'type' => 'title',
|
| 125 |
-
'desc' => sprintf( __( '<strong>Payments controls how your %s commission is paid out. These settings only function if you are using a supported gateway.</strong> ', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 126 |
-
'id' => 'payment_general_options',
|
| 127 |
-
),
|
| 128 |
-
|
| 129 |
-
array( 'type' => 'sectionend', 'id' => 'payment_general_options' ),
|
| 130 |
-
|
| 131 |
-
) );
|
| 132 |
-
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
return apply_filters( 'wcvendors_get_settings_' . $this->id, $settings, $current_section );
|
| 136 |
-
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
endif;
|
| 142 |
-
|
| 143 |
-
return new WCVendors_Settings_Payments();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/classes/sf-class-format-options.php
DELETED
|
@@ -1,347 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Format an options array into HTML
|
| 5 |
-
* This class has been deprecated
|
| 6 |
-
*
|
| 7 |
-
* @author Matt Gates <http://mgates.me>
|
| 8 |
-
* @package WordPress
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
if ( !class_exists( 'SF_Format_Options' ) ) {
|
| 13 |
-
|
| 14 |
-
class SF_Format_Options extends SF_Settings_API
|
| 15 |
-
{
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Format an option array into HTML
|
| 19 |
-
*
|
| 20 |
-
*
|
| 21 |
-
* @access public
|
| 22 |
-
*
|
| 23 |
-
* @param unknown $setting
|
| 24 |
-
*
|
| 25 |
-
* @return string HTML.
|
| 26 |
-
*/
|
| 27 |
-
public function settings_options_format( $setting )
|
| 28 |
-
{
|
| 29 |
-
if ( empty( $setting ) ) return false;
|
| 30 |
-
|
| 31 |
-
$defaults = apply_filters( $this->id . '_options_defaults', array(
|
| 32 |
-
'name' => '',
|
| 33 |
-
'desc' => '',
|
| 34 |
-
'placeholder' => '',
|
| 35 |
-
'class' => '',
|
| 36 |
-
'tip' => '',
|
| 37 |
-
'id' => '',
|
| 38 |
-
'css' => '',
|
| 39 |
-
'type' => 'text',
|
| 40 |
-
'std' => '',
|
| 41 |
-
'select2' => false,
|
| 42 |
-
'multiple' => false,
|
| 43 |
-
'options' => array(),
|
| 44 |
-
'restrict' => array(),
|
| 45 |
-
'settings' => array()
|
| 46 |
-
) );
|
| 47 |
-
|
| 48 |
-
// Each to it's own variable for slim-ness' sakes.
|
| 49 |
-
$setting = shortcode_atts( $defaults, $setting );
|
| 50 |
-
|
| 51 |
-
$restrict_defaults = array(
|
| 52 |
-
'min' => 0,
|
| 53 |
-
'max' => '',
|
| 54 |
-
'step' => 'any',
|
| 55 |
-
);
|
| 56 |
-
|
| 57 |
-
$setting[ 'restrict' ] = shortcode_atts( $restrict_defaults, $setting[ 'restrict' ] );
|
| 58 |
-
|
| 59 |
-
$setting[ 'value' ] = $this->get_option( $setting[ 'id' ] );
|
| 60 |
-
$setting[ 'value' ] = $setting[ 'value' ] !== false ? maybe_unserialize( $setting[ 'value' ] ) : false;
|
| 61 |
-
$setting[ 'value' ] = SF_Format_Options::sanitize_value( $setting[ 'value' ], $setting );
|
| 62 |
-
|
| 63 |
-
$setting[ 'title' ] = $setting[ 'name' ];
|
| 64 |
-
$setting[ 'name' ] = $this->id . "_options[{$setting['id']}]";
|
| 65 |
-
|
| 66 |
-
$setting[ 'grouped' ] = !$setting[ 'title' ] ? ' style="padding-top:0px;"' : '';
|
| 67 |
-
$setting[ 'tip' ] = SF_Format_Options::get_formatted_tip( $setting[ 'tip' ] );
|
| 68 |
-
|
| 69 |
-
$header_types = apply_filters( $this->id . '_options_header_types', array( 'heading', 'title' ) );
|
| 70 |
-
|
| 71 |
-
extract( $setting );
|
| 72 |
-
|
| 73 |
-
$description = $desc && !$grouped && $type != 'checkbox'
|
| 74 |
-
? '<br /><small>' . $desc . '</small>'
|
| 75 |
-
: '<label for="' . $id . '"> ' . $desc . '</label>';
|
| 76 |
-
|
| 77 |
-
$description = ( ( in_array( $type, $header_types ) || $type == 'radio' ) && !empty( $desc ) )
|
| 78 |
-
? '<p>' . $desc . '</p>'
|
| 79 |
-
: $description;
|
| 80 |
-
|
| 81 |
-
?>
|
| 82 |
-
|
| 83 |
-
<?php if ( !in_array( $type, $header_types ) ) : ?>
|
| 84 |
-
<!-- Header of the option. -->
|
| 85 |
-
<tr valign="top">
|
| 86 |
-
<th scope="row"<?php echo $grouped; ?>>
|
| 87 |
-
|
| 88 |
-
<?php echo $tip; ?>
|
| 89 |
-
|
| 90 |
-
<?php if ( !$grouped ) : ?>
|
| 91 |
-
<label for="<?php echo $name; ?>" class="description"><?php echo $title; ?></label>
|
| 92 |
-
<?php endif; ?>
|
| 93 |
-
|
| 94 |
-
</th>
|
| 95 |
-
<td <?php echo $grouped; ?> >
|
| 96 |
-
<?php endif; ?>
|
| 97 |
-
|
| 98 |
-
<?php foreach ( $header_types as $header ) :
|
| 99 |
-
if ( $type != $header ) continue; ?>
|
| 100 |
-
<tr>
|
| 101 |
-
<th scope="col" colspan="2">
|
| 102 |
-
<h3 class="title"><?php echo $title; ?></h3>
|
| 103 |
-
<?php echo $description; ?>
|
| 104 |
-
</th>
|
| 105 |
-
</tr>
|
| 106 |
-
<?php endforeach; ?>
|
| 107 |
-
|
| 108 |
-
<?php switch ( $type ) :
|
| 109 |
-
|
| 110 |
-
case 'text' :
|
| 111 |
-
case 'color' :
|
| 112 |
-
case 'number' :
|
| 113 |
-
if ( $type == 'color' ) {
|
| 114 |
-
$type = 'text';
|
| 115 |
-
$class .= ' colorpick';
|
| 116 |
-
$description .= '<div id="colorPickerDiv_' . $id . '" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>';
|
| 117 |
-
}
|
| 118 |
-
?>
|
| 119 |
-
<input name="<?php echo $name; ?>"
|
| 120 |
-
id="<?php echo $id; ?>"
|
| 121 |
-
type="<?php echo $type; ?>"
|
| 122 |
-
|
| 123 |
-
<?php if ( $type == 'number' ): ?>
|
| 124 |
-
min="<?php echo $restrict[ 'min' ]; ?>"
|
| 125 |
-
max="<?php echo $restrict[ 'max' ]; ?>"
|
| 126 |
-
step="<?php echo $restrict[ 'step' ]; ?>"
|
| 127 |
-
<?php endif; ?>
|
| 128 |
-
|
| 129 |
-
class="regular-text <?php echo $class; ?>"
|
| 130 |
-
style="<?php echo $css; ?>"
|
| 131 |
-
placeholder="<?php echo $placeholder; ?>"
|
| 132 |
-
value="<?php echo $value !== false ? $value : $std; ?>"
|
| 133 |
-
/>
|
| 134 |
-
<?php echo $description;
|
| 135 |
-
break;
|
| 136 |
-
|
| 137 |
-
case 'checkbox':
|
| 138 |
-
|
| 139 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 140 |
-
|
| 141 |
-
if ( $multiple ) :
|
| 142 |
-
|
| 143 |
-
foreach ( $options as $key => $desc ) : ?>
|
| 144 |
-
|
| 145 |
-
<input name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 146 |
-
id="<?php echo $id . '_' . $key; ?>"
|
| 147 |
-
type="checkbox"
|
| 148 |
-
class="<?php echo $class; ?>"
|
| 149 |
-
style="<?php echo $css; ?>"
|
| 150 |
-
value="<?php echo $key; ?>"
|
| 151 |
-
<?php self::checked( $value, $key ); ?>
|
| 152 |
-
/>
|
| 153 |
-
<label for="<?php echo $id . '_' . $key; ?>">
|
| 154 |
-
<?php echo $desc; ?>
|
| 155 |
-
</label>
|
| 156 |
-
<br/>
|
| 157 |
-
<?php
|
| 158 |
-
|
| 159 |
-
endforeach;
|
| 160 |
-
|
| 161 |
-
else : ?>
|
| 162 |
-
|
| 163 |
-
<input name="<?php echo $name; ?>"
|
| 164 |
-
id="<?php echo $id ?>"
|
| 165 |
-
type="checkbox"
|
| 166 |
-
class="<?php echo $class; ?>"
|
| 167 |
-
style="<?php echo $css; ?>"
|
| 168 |
-
<?php checked( $selected, 1 ); ?>
|
| 169 |
-
/>
|
| 170 |
-
<?php echo $description;
|
| 171 |
-
endif;
|
| 172 |
-
break;
|
| 173 |
-
|
| 174 |
-
case 'radio':
|
| 175 |
-
|
| 176 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 177 |
-
|
| 178 |
-
foreach ( $options as $key => $val ) : ?>
|
| 179 |
-
<label class="radio">
|
| 180 |
-
<input type="radio"
|
| 181 |
-
name="<?php echo $name; ?>"
|
| 182 |
-
id="<?php echo $key; ?>"
|
| 183 |
-
value="<?php echo $key; ?>"
|
| 184 |
-
class="<?php echo $class; ?>"
|
| 185 |
-
<?php checked( $selected, $key ); ?>
|
| 186 |
-
/>
|
| 187 |
-
<?php echo $val; ?>
|
| 188 |
-
</label><br/>
|
| 189 |
-
<?php endforeach;
|
| 190 |
-
echo $description;
|
| 191 |
-
break;
|
| 192 |
-
|
| 193 |
-
case 'single_select_page':
|
| 194 |
-
|
| 195 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 196 |
-
|
| 197 |
-
$args = array(
|
| 198 |
-
'name' => $name,
|
| 199 |
-
'id' => $id,
|
| 200 |
-
'sort_order' => 'ASC',
|
| 201 |
-
'echo' => 0,
|
| 202 |
-
'selected' => $selected
|
| 203 |
-
);
|
| 204 |
-
|
| 205 |
-
echo str_replace( "'>", "'><option></option>", wp_dropdown_pages( $args ) );
|
| 206 |
-
|
| 207 |
-
echo $description;
|
| 208 |
-
|
| 209 |
-
if ( $select2 ) : ?>
|
| 210 |
-
<script type="text/javascript">jQuery(function () {
|
| 211 |
-
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px' });
|
| 212 |
-
});</script>
|
| 213 |
-
<?php endif;
|
| 214 |
-
|
| 215 |
-
break;
|
| 216 |
-
|
| 217 |
-
case 'select':
|
| 218 |
-
|
| 219 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 220 |
-
$options = apply_filters( $this->id . '_select_options', $options, $setting ); ?>
|
| 221 |
-
|
| 222 |
-
<select id="<?php echo $id; ?>"
|
| 223 |
-
class="<?php echo $class; ?>"
|
| 224 |
-
style="<?php echo $css; ?>"
|
| 225 |
-
name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 226 |
-
<?php echo $multiple ? 'multiple="multiple"' : ''; ?>>
|
| 227 |
-
|
| 228 |
-
<?php foreach ( $options as $key => $val ) : ?>
|
| 229 |
-
<option
|
| 230 |
-
value="<?php echo $key; ?>" <?php self::selected( $selected, $key ); ?>><?php echo $val; ?></option>
|
| 231 |
-
<?php endforeach; ?>
|
| 232 |
-
</select>
|
| 233 |
-
|
| 234 |
-
<?php echo $description;
|
| 235 |
-
|
| 236 |
-
if ( $select2 ) : ?>
|
| 237 |
-
<script type="text/javascript">jQuery(function () {
|
| 238 |
-
jQuery("#<?php echo $id; ?>").select2({ width: '350px' });
|
| 239 |
-
});</script>
|
| 240 |
-
<?php endif;
|
| 241 |
-
|
| 242 |
-
break;
|
| 243 |
-
|
| 244 |
-
case 'textarea':
|
| 245 |
-
?>
|
| 246 |
-
<textarea name="<?php echo $name; ?>"
|
| 247 |
-
id="<?php echo $id; ?>"
|
| 248 |
-
class="large-text <?php echo $class; ?>"
|
| 249 |
-
style="<?php if ( $css ) echo $css; else echo 'width:300px;'; ?>"
|
| 250 |
-
placeholder="<?php echo $placeholder; ?>"
|
| 251 |
-
rows="3"
|
| 252 |
-
><?php echo ( $value !== false ) ? $value : $std; ?></textarea>
|
| 253 |
-
<?php echo $description;
|
| 254 |
-
break;
|
| 255 |
-
|
| 256 |
-
case 'wysiwyg':
|
| 257 |
-
wp_editor( $value, $id, array( 'textarea_name' => $name ) );
|
| 258 |
-
echo $description;
|
| 259 |
-
break;
|
| 260 |
-
|
| 261 |
-
default :
|
| 262 |
-
do_action( $this->id . '_options_type_' . $type, $setting );
|
| 263 |
-
break;
|
| 264 |
-
|
| 265 |
-
endswitch;
|
| 266 |
-
|
| 267 |
-
/* Footer of the option. */
|
| 268 |
-
if ( !in_array( $type, $header_types ) ) echo '</td></tr>';
|
| 269 |
-
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
|
| 273 |
-
/**
|
| 274 |
-
*
|
| 275 |
-
*
|
| 276 |
-
* @param unknown $haystack
|
| 277 |
-
* @param unknown $current
|
| 278 |
-
*/
|
| 279 |
-
private function selected( $haystack, $current )
|
| 280 |
-
{
|
| 281 |
-
|
| 282 |
-
if ( is_array( $haystack ) && in_array( $current, $haystack ) ) {
|
| 283 |
-
$current = $haystack = 1;
|
| 284 |
-
}
|
| 285 |
-
|
| 286 |
-
selected( $haystack, $current );
|
| 287 |
-
}
|
| 288 |
-
|
| 289 |
-
|
| 290 |
-
/**
|
| 291 |
-
*
|
| 292 |
-
*
|
| 293 |
-
* @param unknown $haystack
|
| 294 |
-
* @param unknown $current
|
| 295 |
-
*/
|
| 296 |
-
private function checked( $haystack, $current )
|
| 297 |
-
{
|
| 298 |
-
|
| 299 |
-
if ( is_array( $haystack ) && !empty( $haystack[ $current ] ) ) {
|
| 300 |
-
$current = $haystack = 1;
|
| 301 |
-
}
|
| 302 |
-
|
| 303 |
-
checked( $haystack, $current );
|
| 304 |
-
}
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
/**
|
| 308 |
-
* Format a tooltip given a string
|
| 309 |
-
*
|
| 310 |
-
* @param string $tip
|
| 311 |
-
*
|
| 312 |
-
* @return string
|
| 313 |
-
*/
|
| 314 |
-
private function get_formatted_tip( $tip )
|
| 315 |
-
{
|
| 316 |
-
return $tip ? sprintf( '<a href="#" title="%s" class="sf-tips" tabindex="99"></a>', $tip ) : '';
|
| 317 |
-
}
|
| 318 |
-
|
| 319 |
-
|
| 320 |
-
/**
|
| 321 |
-
*
|
| 322 |
-
*
|
| 323 |
-
* @param unknown $value
|
| 324 |
-
* @param unknown $setting
|
| 325 |
-
*
|
| 326 |
-
* @return unknown
|
| 327 |
-
*/
|
| 328 |
-
private function sanitize_value( $value, $setting )
|
| 329 |
-
{
|
| 330 |
-
if ( $value !== false && $setting[ 'type' ] != 'wysiwyg' ) {
|
| 331 |
-
if ( is_array( $value ) ) {
|
| 332 |
-
foreach ( $value as $key => $output ) {
|
| 333 |
-
$value[ $key ] = esc_attr( $output );
|
| 334 |
-
}
|
| 335 |
-
} else {
|
| 336 |
-
$value = esc_attr( $value );
|
| 337 |
-
}
|
| 338 |
-
}
|
| 339 |
-
|
| 340 |
-
return apply_filters( $this->id . '_options_sanitize_value', $value, $setting );
|
| 341 |
-
}
|
| 342 |
-
|
| 343 |
-
|
| 344 |
-
}
|
| 345 |
-
|
| 346 |
-
|
| 347 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/classes/sf-class-sanitize.php
DELETED
|
@@ -1,199 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Sanitize filters
|
| 5 |
-
*
|
| 6 |
-
* @author Matt Gates <http://mgates.me>
|
| 7 |
-
* @package WordPress
|
| 8 |
-
*/
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
if ( !class_exists( 'SF_Sanitize' ) ) {
|
| 12 |
-
|
| 13 |
-
class SF_Sanitize
|
| 14 |
-
{
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Hooks
|
| 19 |
-
*/
|
| 20 |
-
function __construct()
|
| 21 |
-
{
|
| 22 |
-
add_filter( 'geczy_sanitize_color', 'sanitize_text_field' );
|
| 23 |
-
add_filter( 'geczy_sanitize_text', 'sanitize_text_field' );
|
| 24 |
-
add_filter( 'geczy_sanitize_number', array( 'SF_Sanitize', 'sanitize_number_field' ) );
|
| 25 |
-
add_filter( 'geczy_sanitize_textarea', array( 'SF_Sanitize', 'sanitize_textarea' ) );
|
| 26 |
-
add_filter( 'geczy_sanitize_wysiwyg', array( 'SF_Sanitize', 'sanitize_wysiwyg' ) );
|
| 27 |
-
add_filter( 'geczy_sanitize_checkbox', array( 'SF_Sanitize', 'sanitize_checkbox' ), 10, 2 );
|
| 28 |
-
add_filter( 'geczy_sanitize_radio', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
|
| 29 |
-
add_filter( 'geczy_sanitize_select', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
|
| 30 |
-
add_filter( 'geczy_sanitize_image', array( 'SF_Sanitize', 'sanitize_image_url' ), 10, 2 );
|
| 31 |
-
add_filter( 'geczy_sanitize_single_select_page', array( 'SF_Sanitize', 'sanitize_select_pages' ), 10, 2 );
|
| 32 |
-
add_filter( 'geczy_sanitize_multi_select_page', array( 'SF_Sanitize', 'sanitize_multi_pages' ), 10, 2 );
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Numeric sanitization
|
| 38 |
-
*
|
| 39 |
-
* @param int $input
|
| 40 |
-
*
|
| 41 |
-
* @return int
|
| 42 |
-
*/
|
| 43 |
-
public static function sanitize_number_field( $input )
|
| 44 |
-
{
|
| 45 |
-
$output = is_numeric( $input ) ? (float) $input : false;
|
| 46 |
-
|
| 47 |
-
return $input;
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Textarea sanitization
|
| 53 |
-
*
|
| 54 |
-
* @param string $input
|
| 55 |
-
*
|
| 56 |
-
* @return string
|
| 57 |
-
*/
|
| 58 |
-
public static function sanitize_textarea( $input )
|
| 59 |
-
{
|
| 60 |
-
global $allowedposttags;
|
| 61 |
-
$output = wp_kses( $input, $allowedposttags );
|
| 62 |
-
|
| 63 |
-
return $output;
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
/**
|
| 68 |
-
* WYSIWYG sanitization
|
| 69 |
-
*
|
| 70 |
-
* @param string $input
|
| 71 |
-
*
|
| 72 |
-
* @return string
|
| 73 |
-
*/
|
| 74 |
-
public static function sanitize_wysiwyg( $input )
|
| 75 |
-
{
|
| 76 |
-
return $input;
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
/**
|
| 81 |
-
* Checkbox sanitization
|
| 82 |
-
*
|
| 83 |
-
* @param int $input
|
| 84 |
-
* @param unknown $option
|
| 85 |
-
*
|
| 86 |
-
* @return int
|
| 87 |
-
*/
|
| 88 |
-
public static function sanitize_checkbox( $input, $option )
|
| 89 |
-
{
|
| 90 |
-
if ( !empty( $option[ 'multiple' ] ) ) {
|
| 91 |
-
|
| 92 |
-
$defaults = array_keys( $option[ 'options' ] );
|
| 93 |
-
|
| 94 |
-
foreach ( $defaults as $value ) {
|
| 95 |
-
|
| 96 |
-
if ( !is_array( $input ) ) {
|
| 97 |
-
$output[ $value ] = 0;
|
| 98 |
-
} else {
|
| 99 |
-
$output[ $value ] = in_array( $value, $input ) ? 1 : 0;
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
$output = serialize( $output );
|
| 105 |
-
} else {
|
| 106 |
-
$output = $input ? 1 : 0;
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
return $output;
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
/**
|
| 114 |
-
* Array sanitization
|
| 115 |
-
*
|
| 116 |
-
* @param unknown $input
|
| 117 |
-
* @param array $option
|
| 118 |
-
*
|
| 119 |
-
* @return bool
|
| 120 |
-
*/
|
| 121 |
-
public static function sanitize_enum( $input, $option )
|
| 122 |
-
{
|
| 123 |
-
$output = $input;
|
| 124 |
-
|
| 125 |
-
$sfs = new SF_Sanitize();
|
| 126 |
-
|
| 127 |
-
if ( is_array( $input ) ) {
|
| 128 |
-
foreach ( $input as $value ) {
|
| 129 |
-
if ( !$sfs->sanitize_enum( $value, $option ) ) {
|
| 130 |
-
$output = false;
|
| 131 |
-
break;
|
| 132 |
-
}
|
| 133 |
-
}
|
| 134 |
-
$output = $output ? serialize( $output ) : $output;
|
| 135 |
-
} else {
|
| 136 |
-
$output = array_key_exists( $input, $option[ 'options' ] ) ? $input : false;
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
return $output;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
/**
|
| 144 |
-
* Select box for pages sanitize
|
| 145 |
-
*
|
| 146 |
-
* @param int $input
|
| 147 |
-
* @param int $option
|
| 148 |
-
*
|
| 149 |
-
* @return int
|
| 150 |
-
*/
|
| 151 |
-
public static function sanitize_select_pages( $input, $option )
|
| 152 |
-
{
|
| 153 |
-
$output = get_page( $input ) ? (int) $input : 0;
|
| 154 |
-
|
| 155 |
-
return $output;
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
/**
|
| 159 |
-
* Select box for pages sanitize
|
| 160 |
-
*
|
| 161 |
-
* @param int $input
|
| 162 |
-
* @param int $option
|
| 163 |
-
*
|
| 164 |
-
* @return int
|
| 165 |
-
*/
|
| 166 |
-
public static function sanitize_multi_pages( $input, $option )
|
| 167 |
-
{
|
| 168 |
-
|
| 169 |
-
foreach ( $input as $value ){
|
| 170 |
-
$output[ $value ] = get_page( $value ) ? (int) $value : 0;
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
// $output = serialize( $output );
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
return $output;
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
|
| 180 |
-
|
| 181 |
-
/**
|
| 182 |
-
* Image uploader
|
| 183 |
-
*
|
| 184 |
-
* @param url $input
|
| 185 |
-
*
|
| 186 |
-
* @return int
|
| 187 |
-
*/
|
| 188 |
-
public static function sanitize_image_url( $input, $option ) {
|
| 189 |
-
|
| 190 |
-
$output = $input;
|
| 191 |
-
return $output;
|
| 192 |
-
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/classes/sf-class-settings.php
DELETED
|
@@ -1,978 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* WP-Simple-Settings-Framework
|
| 5 |
-
*
|
| 6 |
-
* Copyright (c) 2012 Matt Gates.
|
| 7 |
-
* All rights reserved.
|
| 8 |
-
*
|
| 9 |
-
* Redistribution and use in source and binary forms, with or without
|
| 10 |
-
* modification, are permitted provided that the following conditions
|
| 11 |
-
* are met:
|
| 12 |
-
*
|
| 13 |
-
* * Redistributions of source code must retain the above copyright
|
| 14 |
-
* notice, this list of conditions and the following disclaimer.
|
| 15 |
-
*
|
| 16 |
-
* * Redistributions in binary form must reproduce the above copyright
|
| 17 |
-
* notice, this list of conditions and the following disclaimer in
|
| 18 |
-
* the documentation and/or other materials provided with the
|
| 19 |
-
* distribution.
|
| 20 |
-
*
|
| 21 |
-
* * Neither the names of the copyright holders nor the names of the
|
| 22 |
-
* contributors may be used to endorse or promote products derived
|
| 23 |
-
* from this software without specific prior written permission.
|
| 24 |
-
*
|
| 25 |
-
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
|
| 26 |
-
* "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
|
| 27 |
-
* LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
|
| 28 |
-
* FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
| 29 |
-
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
|
| 30 |
-
* INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
|
| 31 |
-
* BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
|
| 32 |
-
* LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
|
| 33 |
-
* CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
|
| 34 |
-
* LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN
|
| 35 |
-
* ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
|
| 36 |
-
* POSSIBILITY OF SUCH DAMAGE.
|
| 37 |
-
*
|
| 38 |
-
* @subpackage WP-Simple-Settings-Framework
|
| 39 |
-
* @copyright 2012 Matt Gates.
|
| 40 |
-
* @license http://www.opensource.org/licenses/bsd-license.php BSD License
|
| 41 |
-
* @link http://mgates.me
|
| 42 |
-
* @version 1.1
|
| 43 |
-
* @author Matt Gates <info@mgates.me>
|
| 44 |
-
* @package WordPress
|
| 45 |
-
*/
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
if ( !class_exists( 'SF_Settings_API' ) ) {
|
| 49 |
-
|
| 50 |
-
class SF_Settings_API
|
| 51 |
-
{
|
| 52 |
-
|
| 53 |
-
private $data = array();
|
| 54 |
-
|
| 55 |
-
/**
|
| 56 |
-
* Init
|
| 57 |
-
*
|
| 58 |
-
* @param string $id
|
| 59 |
-
* @param string $title
|
| 60 |
-
* @param string $menu (optional)
|
| 61 |
-
* @param string $file
|
| 62 |
-
*/
|
| 63 |
-
public function __construct( $id, $title, $menu = '', $file )
|
| 64 |
-
{
|
| 65 |
-
$this->assets_url = trailingslashit( plugins_url( 'assets/', dirname( __FILE__ ) ) );
|
| 66 |
-
$this->id = $id;
|
| 67 |
-
$this->title = $title;
|
| 68 |
-
$this->menu = empty( $menu ) ? 'plugins.php' : $menu;
|
| 69 |
-
|
| 70 |
-
$this->file = $file;
|
| 71 |
-
|
| 72 |
-
$this->includes();
|
| 73 |
-
$this->actions();
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
// ==================================================================
|
| 78 |
-
//
|
| 79 |
-
// Getter and setter.
|
| 80 |
-
//
|
| 81 |
-
// ------------------------------------------------------------------
|
| 82 |
-
|
| 83 |
-
/**
|
| 84 |
-
* Setter
|
| 85 |
-
*
|
| 86 |
-
* @param unknown $name
|
| 87 |
-
* @param unknown $value
|
| 88 |
-
*/
|
| 89 |
-
public function __set( $name, $value )
|
| 90 |
-
{
|
| 91 |
-
if ( isset ( $this->data[ $name ] ) && is_array( $this->data[ $name ] ) ) {
|
| 92 |
-
$this->data[ $name ] = array_merge( $this->data[ $name ], $value );
|
| 93 |
-
} else {
|
| 94 |
-
$this->data[ $name ] = $value;
|
| 95 |
-
}
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
/**
|
| 100 |
-
* Getter
|
| 101 |
-
*
|
| 102 |
-
* @param unknown $name
|
| 103 |
-
*
|
| 104 |
-
* @return unknown
|
| 105 |
-
*/
|
| 106 |
-
public function __get( $name )
|
| 107 |
-
{
|
| 108 |
-
if ( array_key_exists( $name, $this->data ) ) {
|
| 109 |
-
return $this->data[ $name ];
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
return null;
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
/**
|
| 117 |
-
* Isset
|
| 118 |
-
*
|
| 119 |
-
* @param unknown $name
|
| 120 |
-
*
|
| 121 |
-
* @return unknown
|
| 122 |
-
*/
|
| 123 |
-
public function __isset( $name )
|
| 124 |
-
{
|
| 125 |
-
return isset( $this->data[ $name ] );
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
/**
|
| 130 |
-
* Unset
|
| 131 |
-
*
|
| 132 |
-
* @param unknown $name
|
| 133 |
-
*/
|
| 134 |
-
public function __unset( $name )
|
| 135 |
-
{
|
| 136 |
-
unset( $this->data[ $name ] );
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
|
| 140 |
-
/**
|
| 141 |
-
* Add a "Settings" link to the plugins.php page
|
| 142 |
-
*
|
| 143 |
-
* @param array $links
|
| 144 |
-
* @param array $file
|
| 145 |
-
*
|
| 146 |
-
* @return array
|
| 147 |
-
*/
|
| 148 |
-
public function add_settings_link( $links, $file )
|
| 149 |
-
{
|
| 150 |
-
$this_plugin = plugin_basename( $this->file );
|
| 151 |
-
$page = strpos( $this->menu, '.php' ) ? $this->menu : 'admin.php';
|
| 152 |
-
if ( $file == $this_plugin ) {
|
| 153 |
-
$settings_link = '<a href="' . $page . '?page=' . $this->id . '">' . __( 'Settings', 'wcvendors' ) . '</a>';
|
| 154 |
-
array_unshift( $links, $settings_link );
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
return $links;
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
|
| 161 |
-
// ==================================================================
|
| 162 |
-
//
|
| 163 |
-
// Begin initialization.
|
| 164 |
-
//
|
| 165 |
-
// ------------------------------------------------------------------
|
| 166 |
-
|
| 167 |
-
/**
|
| 168 |
-
* Core files
|
| 169 |
-
*/
|
| 170 |
-
private function includes()
|
| 171 |
-
{
|
| 172 |
-
require_once dirname( __FILE__ ) . '/sf-class-sanitize.php';
|
| 173 |
-
require_once dirname( __FILE__ ) . '/sf-class-format-options.php';
|
| 174 |
-
new SF_Sanitize;
|
| 175 |
-
}
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
/**
|
| 179 |
-
* Hooks
|
| 180 |
-
*/
|
| 181 |
-
private function actions()
|
| 182 |
-
{
|
| 183 |
-
add_action( 'admin_enqueue_scripts', array( &$this, 'admin_enqueue_scripts' ) );
|
| 184 |
-
add_action( 'admin_init', array( &$this, 'register_options' ) );
|
| 185 |
-
add_action( 'admin_menu', array( &$this, 'create_menu' ) );
|
| 186 |
-
add_filter( 'plugin_action_links', array( &$this, 'add_settings_link' ), 10, 2 );
|
| 187 |
-
}
|
| 188 |
-
|
| 189 |
-
|
| 190 |
-
/**
|
| 191 |
-
* Admin scripts and styles
|
| 192 |
-
*/
|
| 193 |
-
public function admin_enqueue_scripts()
|
| 194 |
-
{
|
| 195 |
-
|
| 196 |
-
$screen = get_current_screen();
|
| 197 |
-
$screen_id = $screen->id;
|
| 198 |
-
|
| 199 |
-
if ( $screen_id === 'woocommerce_page_wc_prd_vendor') {
|
| 200 |
-
wp_register_script( 'bootstrap-tooltip', $this->assets_url . 'js/bootstrap-tooltip.js', array( 'jquery' ), '1.0' );
|
| 201 |
-
wp_register_script( 'select2', $this->assets_url . 'js/select2/select2.min.js', array( 'jquery' ), '3.5.2' );
|
| 202 |
-
wp_register_script( 'wcvendors-media', $this->assets_url . 'js/wcvendors-media.js', array( 'jquery' ), '1.0' );
|
| 203 |
-
wp_register_script( 'sf-scripts', $this->assets_url . 'js/sf-jquery.js', array( 'jquery' ), '1.0' );
|
| 204 |
-
wp_register_style( 'select2', $this->assets_url . 'js/select2/select2.css' );
|
| 205 |
-
wp_register_style( 'sf-styles', $this->assets_url . 'css/sf-styles.css' );
|
| 206 |
-
}
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
/**
|
| 211 |
-
* Admin scripts and styles
|
| 212 |
-
*/
|
| 213 |
-
public function admin_print_scripts()
|
| 214 |
-
{
|
| 215 |
-
global $wp_version;
|
| 216 |
-
|
| 217 |
-
//Check wp version and load appropriate scripts for colorpicker.
|
| 218 |
-
if ( 3.5 <= $wp_version ) {
|
| 219 |
-
wp_enqueue_style( 'wp-color-picker' );
|
| 220 |
-
wp_enqueue_script( 'wp-color-picker' );
|
| 221 |
-
} else {
|
| 222 |
-
wp_enqueue_style( 'farbtastic' );
|
| 223 |
-
wp_enqueue_script( 'farbtastic' );
|
| 224 |
-
}
|
| 225 |
-
|
| 226 |
-
wp_enqueue_script( 'bootstrap-tooltip' );
|
| 227 |
-
wp_enqueue_script( 'select2' );
|
| 228 |
-
wp_enqueue_script( 'wcvendors-media' );
|
| 229 |
-
wp_enqueue_script( 'sf-scripts' );
|
| 230 |
-
|
| 231 |
-
wp_enqueue_style( 'wp-color-picker' );
|
| 232 |
-
wp_enqueue_style( 'select2' );
|
| 233 |
-
wp_enqueue_style( 'sf-styles' );
|
| 234 |
-
}
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
/**
|
| 238 |
-
* Register setting
|
| 239 |
-
*/
|
| 240 |
-
public function register_options()
|
| 241 |
-
{
|
| 242 |
-
register_setting( $this->id . '_options_nonce', $this->id . '_options', array( &$this, 'validate_options' ) );
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
/**
|
| 247 |
-
* Create menu
|
| 248 |
-
*/
|
| 249 |
-
public function create_menu()
|
| 250 |
-
{
|
| 251 |
-
$page = add_submenu_page( $this->menu, $this->title, $this->title, apply_filters( $this->id . '_manage_options', 'manage_options' ), $this->id, array( &$this, 'init_settings_page' ) );
|
| 252 |
-
add_action( 'admin_print_scripts-' . $page, array( &$this, 'admin_print_scripts' ) );
|
| 253 |
-
}
|
| 254 |
-
|
| 255 |
-
|
| 256 |
-
/**
|
| 257 |
-
* Parse options into tabbed organization
|
| 258 |
-
*
|
| 259 |
-
* @return array
|
| 260 |
-
*/
|
| 261 |
-
private function parse_options()
|
| 262 |
-
{
|
| 263 |
-
$options = $this->options;
|
| 264 |
-
|
| 265 |
-
foreach ( $options as $option ) {
|
| 266 |
-
|
| 267 |
-
if ( $option[ 'type' ] == 'heading' ) {
|
| 268 |
-
$tab_name = sanitize_title( $option[ 'name' ] );
|
| 269 |
-
$this->tab_headers = array( $tab_name => $option[ 'name' ] );
|
| 270 |
-
|
| 271 |
-
continue;
|
| 272 |
-
}
|
| 273 |
-
|
| 274 |
-
$option[ 'tab' ] = $tab_name;
|
| 275 |
-
$tabs[ $tab_name ][ ] = $option;
|
| 276 |
-
|
| 277 |
-
}
|
| 278 |
-
|
| 279 |
-
$this->tabs = $tabs;
|
| 280 |
-
|
| 281 |
-
return $tabs;
|
| 282 |
-
}
|
| 283 |
-
|
| 284 |
-
|
| 285 |
-
/**
|
| 286 |
-
* Load the options array from a file
|
| 287 |
-
*
|
| 288 |
-
* @param string $option_file
|
| 289 |
-
*/
|
| 290 |
-
public function load_options( $option_file )
|
| 291 |
-
{
|
| 292 |
-
if ( !empty( $this->options ) ) return;
|
| 293 |
-
|
| 294 |
-
if ( file_exists( $option_file ) ) {
|
| 295 |
-
require $option_file;
|
| 296 |
-
$this->options = apply_filters( $this->id . '_options', $options );
|
| 297 |
-
$this->parse_options();
|
| 298 |
-
|
| 299 |
-
$this->current_options = $this->get_current_options();
|
| 300 |
-
|
| 301 |
-
/* If the option has no saved data, load the defaults. */
|
| 302 |
-
/* @TODO: Can prob add this to the activation hook. */
|
| 303 |
-
$this->set_defaults( $this->current_options );
|
| 304 |
-
} else {
|
| 305 |
-
wp_die( __( 'Could not load settings at: ', 'wcvendors' ) . '<br/><code>' . $option_file . '</code>', __( 'Error - WP Settings Framework', 'wcvendors' ) );
|
| 306 |
-
}
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
|
| 310 |
-
/**
|
| 311 |
-
*
|
| 312 |
-
*
|
| 313 |
-
* @return unknown
|
| 314 |
-
*/
|
| 315 |
-
public function get_current_options()
|
| 316 |
-
{
|
| 317 |
-
if ( !empty( $this->current_options ) )
|
| 318 |
-
return $this->current_options;
|
| 319 |
-
|
| 320 |
-
$options = get_option( $this->id . '_options' );
|
| 321 |
-
|
| 322 |
-
if ( $options ) {
|
| 323 |
-
$options = array_map( 'maybe_unserialize', $options );
|
| 324 |
-
}
|
| 325 |
-
|
| 326 |
-
return $options;
|
| 327 |
-
}
|
| 328 |
-
|
| 329 |
-
|
| 330 |
-
/**
|
| 331 |
-
* Sanitize and validate post fields
|
| 332 |
-
*
|
| 333 |
-
* @param unknown $input
|
| 334 |
-
*
|
| 335 |
-
* @return unknown
|
| 336 |
-
*/
|
| 337 |
-
public function validate_options( $input )
|
| 338 |
-
{
|
| 339 |
-
if ( !isset( $_POST[ 'update' ] ) )
|
| 340 |
-
return $this->get_defaults();
|
| 341 |
-
|
| 342 |
-
$clean = $this->current_options;
|
| 343 |
-
$tabname = $_POST[ 'currentTab' ];
|
| 344 |
-
|
| 345 |
-
foreach ( $this->tabs[ $tabname ] as $option ) :
|
| 346 |
-
|
| 347 |
-
if ( !isset( $option[ 'id' ] ) )
|
| 348 |
-
continue;
|
| 349 |
-
|
| 350 |
-
if ( !isset( $option[ 'type' ] ) )
|
| 351 |
-
continue;
|
| 352 |
-
|
| 353 |
-
if ( $option[ 'type' ] == 'select' ) {
|
| 354 |
-
$option[ 'options' ] = apply_filters( $this->id . '_select_options', $option[ 'options' ], $option );
|
| 355 |
-
}
|
| 356 |
-
|
| 357 |
-
$id = sanitize_text_field( strtolower( $option[ 'id' ] ) );
|
| 358 |
-
|
| 359 |
-
// Set checkbox to false if it wasn't sent in the $_POST
|
| 360 |
-
if ( 'checkbox' == $option[ 'type' ] && !isset( $input[ $id ] ) )
|
| 361 |
-
$input[ $id ] = 0;
|
| 362 |
-
|
| 363 |
-
// For a value to be submitted to database it must pass through a sanitization filter
|
| 364 |
-
if ( has_filter( 'geczy_sanitize_' . $option[ 'type' ] ) ) {
|
| 365 |
-
$clean[ $id ] = apply_filters( 'geczy_sanitize_' . $option[ 'type' ], $input[ $id ], $option );
|
| 366 |
-
}
|
| 367 |
-
|
| 368 |
-
endforeach;
|
| 369 |
-
|
| 370 |
-
do_action( $this->id . '_options_updated', $clean, $tabname );
|
| 371 |
-
add_settings_error( $this->id, 'save_options', __( 'Settings saved.', 'wcvendors' ), 'updated' );
|
| 372 |
-
|
| 373 |
-
update_option( WC_Vendors::$id . '_flush_rules', true );
|
| 374 |
-
|
| 375 |
-
return apply_filters( $this->id . '_options_on_update', $clean, $tabname );
|
| 376 |
-
}
|
| 377 |
-
|
| 378 |
-
|
| 379 |
-
/**
|
| 380 |
-
* Create default options
|
| 381 |
-
*
|
| 382 |
-
* @param unknown $current_options (optional)
|
| 383 |
-
*/
|
| 384 |
-
private function set_defaults( $current_options = array() )
|
| 385 |
-
{
|
| 386 |
-
$options = $this->get_defaults( $current_options );
|
| 387 |
-
if ( $options ) {
|
| 388 |
-
update_option( $this->id . '_options', $options );
|
| 389 |
-
}
|
| 390 |
-
}
|
| 391 |
-
|
| 392 |
-
|
| 393 |
-
/**
|
| 394 |
-
* Retrieve default options
|
| 395 |
-
*
|
| 396 |
-
* @param unknown $currents (optional)
|
| 397 |
-
*
|
| 398 |
-
* @return array
|
| 399 |
-
*/
|
| 400 |
-
private function get_defaults( $currents = array() )
|
| 401 |
-
{
|
| 402 |
-
$output = array();
|
| 403 |
-
$config = $this->options;
|
| 404 |
-
$flag = false;
|
| 405 |
-
|
| 406 |
-
if ( $currents ) {
|
| 407 |
-
foreach ( $config as $value ) {
|
| 408 |
-
if ( !isset( $value[ 'id' ] ) || !isset( $value[ 'std' ] ) || !isset( $value[ 'type' ] ) )
|
| 409 |
-
continue;
|
| 410 |
-
|
| 411 |
-
if ( !isset( $currents[ $value[ 'id' ] ] ) ) {
|
| 412 |
-
$flag = true;
|
| 413 |
-
}
|
| 414 |
-
}
|
| 415 |
-
}
|
| 416 |
-
|
| 417 |
-
foreach ( $config as $option ) {
|
| 418 |
-
if ( !isset( $option[ 'id' ] ) || !isset( $option[ 'std' ] ) || !isset( $option[ 'type' ] ) )
|
| 419 |
-
continue;
|
| 420 |
-
|
| 421 |
-
if ( $currents && isset( $currents[ $option[ 'id' ] ] ) ) {
|
| 422 |
-
$output[ $option[ 'id' ] ] = $currents[ $option[ 'id' ] ];
|
| 423 |
-
} else if ( has_filter( 'geczy_sanitize_' . $option[ 'type' ] ) ) {
|
| 424 |
-
$output[ $option[ 'id' ] ] = apply_filters( 'geczy_sanitize_' . $option[ 'type' ], $option[ 'std' ], $option );
|
| 425 |
-
}
|
| 426 |
-
}
|
| 427 |
-
|
| 428 |
-
if ( $currents ) {
|
| 429 |
-
$output = array_merge( $currents, $output );
|
| 430 |
-
}
|
| 431 |
-
|
| 432 |
-
return !$flag && $currents ? array() : $output;
|
| 433 |
-
}
|
| 434 |
-
|
| 435 |
-
|
| 436 |
-
/**
|
| 437 |
-
* HTML header
|
| 438 |
-
*/
|
| 439 |
-
private function template_header()
|
| 440 |
-
{
|
| 441 |
-
?>
|
| 442 |
-
<div class="wrap">
|
| 443 |
-
<h2><?php echo $this->title; ?></h2>
|
| 444 |
-
|
| 445 |
-
<h2 class="nav-tab-wrapper">
|
| 446 |
-
<?php echo $this->display_tabs(); ?>
|
| 447 |
-
</h2><?php
|
| 448 |
-
|
| 449 |
-
if ( !empty ( $_REQUEST[ 'settings-updated' ] ) )
|
| 450 |
-
settings_errors();
|
| 451 |
-
|
| 452 |
-
}
|
| 453 |
-
|
| 454 |
-
|
| 455 |
-
/**
|
| 456 |
-
* HTML body
|
| 457 |
-
*
|
| 458 |
-
* @return unknown
|
| 459 |
-
*/
|
| 460 |
-
private function template_body()
|
| 461 |
-
{
|
| 462 |
-
|
| 463 |
-
if ( empty( $this->options ) ) return false;
|
| 464 |
-
|
| 465 |
-
|
| 466 |
-
$options = $this->options;
|
| 467 |
-
$tabs = $this->get_tabs();
|
| 468 |
-
$tabname = !empty ( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : $tabs[ 0 ][ 'slug' ];
|
| 469 |
-
|
| 470 |
-
$options = apply_filters( $this->id . '_options_tab-' . $tabname, $this->tabs[ $tabname ] ); ?>
|
| 471 |
-
|
| 472 |
-
<form method="post" action="options.php">
|
| 473 |
-
<?php settings_fields( $this->id . '_options_nonce' ); ?>
|
| 474 |
-
<table class="form-table">
|
| 475 |
-
|
| 476 |
-
<?php
|
| 477 |
-
foreach ( $options as $value ) :
|
| 478 |
-
$this->settings_options_format( $value );
|
| 479 |
-
endforeach;
|
| 480 |
-
|
| 481 |
-
do_action( $this->id . '_options_tab-' . $tabname );
|
| 482 |
-
?>
|
| 483 |
-
|
| 484 |
-
</table>
|
| 485 |
-
|
| 486 |
-
<p class="submit">
|
| 487 |
-
<input type="hidden" name="currentTab" value="<?php echo $tabname; ?>">
|
| 488 |
-
<input type="submit" name="update" class="button-primary"
|
| 489 |
-
value="<?php echo sprintf( __( 'Save %s changes', 'wcvendors' ), $this->tab_headers[ $tabname ] ); ?>"/>
|
| 490 |
-
</p>
|
| 491 |
-
</form> <?php
|
| 492 |
-
|
| 493 |
-
}
|
| 494 |
-
|
| 495 |
-
|
| 496 |
-
/**
|
| 497 |
-
* HTML footer
|
| 498 |
-
*/
|
| 499 |
-
private function template_footer()
|
| 500 |
-
{
|
| 501 |
-
|
| 502 |
-
$message = apply_filters( 'wcvendors_footer_msg', __( 'Please help with a <a href="https://wordpress.org/support/view/plugin-reviews/wc-vendors?rate=5#postform" target="top">High Five!</a> | <a href="https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_campaign=upgrade_promo" target="top">WC Vendors Pro</a> | <a href="https://www.wcvendors.com/product/stripe-commissions-gateway/?utm_source=plugin&utm_campaign=upgrade_promo" target="top">Stripe Commissions & Gateway</a> | <a href="https://docs.wcvendors.com/" target="top">Documentation</a> | <a href="https://wordpress.org/support/plugin/wc-vendors/" target="top">Free Support Forums</a>', 'wcvendors' ) );
|
| 503 |
-
|
| 504 |
-
echo '<div><p>' . $message . '</a></p>';
|
| 505 |
-
echo '</div>';
|
| 506 |
-
|
| 507 |
-
|
| 508 |
-
}
|
| 509 |
-
|
| 510 |
-
|
| 511 |
-
/**
|
| 512 |
-
* Create the settings page
|
| 513 |
-
*/
|
| 514 |
-
public function init_settings_page()
|
| 515 |
-
{
|
| 516 |
-
|
| 517 |
-
$this->template_header();
|
| 518 |
-
$this->template_body();
|
| 519 |
-
$this->template_footer();
|
| 520 |
-
|
| 521 |
-
}
|
| 522 |
-
|
| 523 |
-
|
| 524 |
-
/**
|
| 525 |
-
* Retrieve tabs
|
| 526 |
-
*
|
| 527 |
-
* @return array
|
| 528 |
-
*/
|
| 529 |
-
private function get_tabs()
|
| 530 |
-
{
|
| 531 |
-
$tabs = array();
|
| 532 |
-
foreach ( $this->options as $option ) {
|
| 533 |
-
|
| 534 |
-
if ( $option[ 'type' ] != 'heading' )
|
| 535 |
-
continue;
|
| 536 |
-
|
| 537 |
-
$option[ 'slug' ] = sanitize_title( $option[ 'name' ] );
|
| 538 |
-
unset( $option[ 'type' ] );
|
| 539 |
-
|
| 540 |
-
$tabs[ ] = $option;
|
| 541 |
-
}
|
| 542 |
-
|
| 543 |
-
return $tabs;
|
| 544 |
-
}
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
/**
|
| 548 |
-
* Heading for navigation
|
| 549 |
-
*
|
| 550 |
-
* @return string
|
| 551 |
-
*/
|
| 552 |
-
private function display_tabs()
|
| 553 |
-
{
|
| 554 |
-
$tabs = $this->get_tabs();
|
| 555 |
-
$tabname = !empty ( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : $tabs[ 0 ][ 'slug' ];
|
| 556 |
-
$menu = '';
|
| 557 |
-
|
| 558 |
-
foreach ( $tabs as $tab ) {
|
| 559 |
-
$class = $tabname == $tab[ 'slug' ] ? 'nav-tab-active' : '';
|
| 560 |
-
|
| 561 |
-
$fields = array(
|
| 562 |
-
'page' => $this->id,
|
| 563 |
-
'tab' => $tab[ 'slug' ],
|
| 564 |
-
);
|
| 565 |
-
|
| 566 |
-
$query = http_build_query( array_merge( $_GET, $fields ) );
|
| 567 |
-
$menu .= sprintf( '<a id="%s-tab" class="nav-tab %s" title="%s" href="?%s">%s</a>', $tab[ 'slug' ], $class, $tab[ 'name' ], $query, esc_html( $tab[ 'name' ] ) );
|
| 568 |
-
}
|
| 569 |
-
|
| 570 |
-
return $menu;
|
| 571 |
-
}
|
| 572 |
-
|
| 573 |
-
|
| 574 |
-
/**
|
| 575 |
-
* Update an option
|
| 576 |
-
*
|
| 577 |
-
* @param string $name
|
| 578 |
-
* @param string $value
|
| 579 |
-
*
|
| 580 |
-
* @return bool
|
| 581 |
-
*/
|
| 582 |
-
public function update_option( $name, $value )
|
| 583 |
-
{
|
| 584 |
-
// Overwrite the key/value pair
|
| 585 |
-
$this->current_options = array( $name => $value ) + (array) $this->current_options;
|
| 586 |
-
|
| 587 |
-
return update_option( $this->id . '_options', $this->current_options );
|
| 588 |
-
}
|
| 589 |
-
|
| 590 |
-
|
| 591 |
-
/**
|
| 592 |
-
* Get an option
|
| 593 |
-
*
|
| 594 |
-
* @param string $name
|
| 595 |
-
* @param string $default (optional)
|
| 596 |
-
*
|
| 597 |
-
* @return bool
|
| 598 |
-
*/
|
| 599 |
-
public function get_option( $name, $default = false )
|
| 600 |
-
{
|
| 601 |
-
return isset( $this->current_options[ $name ] ) ? maybe_unserialize( $this->current_options[ $name ] ) : $default;
|
| 602 |
-
}
|
| 603 |
-
|
| 604 |
-
|
| 605 |
-
public function settings_options_format( $setting )
|
| 606 |
-
{
|
| 607 |
-
if ( empty( $setting ) ) return false;
|
| 608 |
-
|
| 609 |
-
$defaults = apply_filters( $this->id . '_options_defaults', array(
|
| 610 |
-
'name' => '',
|
| 611 |
-
'desc' => '',
|
| 612 |
-
'placeholder' => '',
|
| 613 |
-
'class' => '',
|
| 614 |
-
'tip' => '',
|
| 615 |
-
'id' => '',
|
| 616 |
-
'css' => '',
|
| 617 |
-
'type' => 'text',
|
| 618 |
-
'std' => '',
|
| 619 |
-
'select2' => false,
|
| 620 |
-
'multiple' => false,
|
| 621 |
-
'options' => array(),
|
| 622 |
-
'restrict' => array(),
|
| 623 |
-
'settings' => array()
|
| 624 |
-
) );
|
| 625 |
-
|
| 626 |
-
// Each to it's own variable for slim-ness' sakes.
|
| 627 |
-
$setting = shortcode_atts( $defaults, $setting );
|
| 628 |
-
|
| 629 |
-
$restrict_defaults = array(
|
| 630 |
-
'min' => 0,
|
| 631 |
-
'max' => '',
|
| 632 |
-
'step' => 'any',
|
| 633 |
-
);
|
| 634 |
-
|
| 635 |
-
$setting[ 'restrict' ] = shortcode_atts( $restrict_defaults, $setting[ 'restrict' ] );
|
| 636 |
-
|
| 637 |
-
$setting[ 'value' ] = $this->get_option( $setting[ 'id' ] );
|
| 638 |
-
$setting[ 'value' ] = $setting[ 'value' ] !== false ? maybe_unserialize( $setting[ 'value' ] ) : false;
|
| 639 |
-
$setting[ 'value' ] = $this->sanitize_value( $setting[ 'value' ], $setting );
|
| 640 |
-
|
| 641 |
-
$setting[ 'title' ] = $setting[ 'name' ];
|
| 642 |
-
$setting[ 'name' ] = $this->id . "_options[{$setting['id']}]";
|
| 643 |
-
|
| 644 |
-
$setting[ 'grouped' ] = !$setting[ 'title' ] ? ' style="padding-top:0px;"' : '';
|
| 645 |
-
$setting[ 'tip' ] = $this->get_formatted_tip( $setting[ 'tip' ] );
|
| 646 |
-
|
| 647 |
-
$header_types = apply_filters( $this->id . '_options_header_types', array( 'heading', 'title' ) );
|
| 648 |
-
|
| 649 |
-
extract( $setting );
|
| 650 |
-
|
| 651 |
-
$description = $desc && !$grouped && $type != 'checkbox'
|
| 652 |
-
? '<br /><small>' . $desc . '</small>'
|
| 653 |
-
: '<label for="' . $id . '"> ' . $desc . '</label>';
|
| 654 |
-
|
| 655 |
-
$description = ( ( in_array( $type, $header_types ) || $type == 'radio' ) && !empty( $desc ) )
|
| 656 |
-
? '<p>' . $desc . '</p>'
|
| 657 |
-
: $description;
|
| 658 |
-
|
| 659 |
-
?>
|
| 660 |
-
|
| 661 |
-
<?php if ( !in_array( $type, $header_types ) ) : ?>
|
| 662 |
-
<!-- Header of the option. -->
|
| 663 |
-
<tr valign="top">
|
| 664 |
-
<th scope="row"<?php echo $grouped; ?>>
|
| 665 |
-
|
| 666 |
-
<?php echo $tip; ?>
|
| 667 |
-
|
| 668 |
-
<?php if ( !$grouped ) : ?>
|
| 669 |
-
<label for="<?php echo $name; ?>" class="description"><?php echo $title; ?></label>
|
| 670 |
-
<?php endif; ?>
|
| 671 |
-
|
| 672 |
-
</th>
|
| 673 |
-
<td <?php echo $grouped; ?> >
|
| 674 |
-
<?php endif; ?>
|
| 675 |
-
|
| 676 |
-
<?php foreach ( $header_types as $header ) :
|
| 677 |
-
if ( $type != $header ) continue; ?>
|
| 678 |
-
<tr>
|
| 679 |
-
<th scope="col" colspan="2">
|
| 680 |
-
<h3 class="title"><?php echo $title; ?></h3>
|
| 681 |
-
<?php echo $description; ?>
|
| 682 |
-
</th>
|
| 683 |
-
</tr>
|
| 684 |
-
<?php endforeach; ?>
|
| 685 |
-
|
| 686 |
-
<?php switch ( $type ) :
|
| 687 |
-
|
| 688 |
-
case 'text' :
|
| 689 |
-
case 'color' :
|
| 690 |
-
case 'number' :
|
| 691 |
-
if ( $type == 'color' ) {
|
| 692 |
-
$type = 'text';
|
| 693 |
-
$class .= ' colorpick';
|
| 694 |
-
$description .= '<div id="colorPickerDiv_' . $id . '" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>';
|
| 695 |
-
}
|
| 696 |
-
?>
|
| 697 |
-
<input name="<?php echo $name; ?>"
|
| 698 |
-
id="<?php echo $id; ?>"
|
| 699 |
-
type="<?php echo $type; ?>"
|
| 700 |
-
|
| 701 |
-
<?php if ( $type == 'number' ): ?>
|
| 702 |
-
min="<?php echo $restrict[ 'min' ]; ?>"
|
| 703 |
-
max="<?php echo $restrict[ 'max' ]; ?>"
|
| 704 |
-
step="<?php echo $restrict[ 'step' ]; ?>"
|
| 705 |
-
<?php endif; ?>
|
| 706 |
-
|
| 707 |
-
class="regular-text <?php echo $class; ?>"
|
| 708 |
-
style="<?php echo $css; ?>"
|
| 709 |
-
placeholder="<?php echo $placeholder; ?>"
|
| 710 |
-
value="<?php echo $value !== false ? $value : $std; ?>"
|
| 711 |
-
/>
|
| 712 |
-
<?php echo $description;
|
| 713 |
-
break;
|
| 714 |
-
|
| 715 |
-
case 'checkbox':
|
| 716 |
-
|
| 717 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 718 |
-
|
| 719 |
-
if ( $multiple ) :
|
| 720 |
-
|
| 721 |
-
foreach ( $options as $key => $desc ) : ?>
|
| 722 |
-
|
| 723 |
-
<input name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 724 |
-
id="<?php echo $id . '_' . $key; ?>"
|
| 725 |
-
type="checkbox"
|
| 726 |
-
class="<?php echo $class; ?>"
|
| 727 |
-
style="<?php echo $css; ?>"
|
| 728 |
-
value="<?php echo $key; ?>"
|
| 729 |
-
<?php @checked( $selected[$key], 1 ); ?>
|
| 730 |
-
/>
|
| 731 |
-
<label for="<?php echo $id . '_' . $key; ?>">
|
| 732 |
-
<?php echo $desc; ?>
|
| 733 |
-
</label>
|
| 734 |
-
<br/>
|
| 735 |
-
<?php
|
| 736 |
-
|
| 737 |
-
endforeach;
|
| 738 |
-
|
| 739 |
-
else : ?>
|
| 740 |
-
|
| 741 |
-
<input name="<?php echo $name; ?>"
|
| 742 |
-
id="<?php echo $id ?>"
|
| 743 |
-
type="checkbox"
|
| 744 |
-
class="<?php echo $class; ?>"
|
| 745 |
-
style="<?php echo $css; ?>"
|
| 746 |
-
<?php checked( $selected, 1 ); ?>
|
| 747 |
-
/>
|
| 748 |
-
<?php echo $description;
|
| 749 |
-
endif;
|
| 750 |
-
break;
|
| 751 |
-
|
| 752 |
-
case 'radio':
|
| 753 |
-
|
| 754 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 755 |
-
|
| 756 |
-
foreach ( $options as $key => $val ) : ?>
|
| 757 |
-
<label class="radio">
|
| 758 |
-
<input type="radio"
|
| 759 |
-
name="<?php echo $name; ?>"
|
| 760 |
-
id="<?php echo $key; ?>"
|
| 761 |
-
value="<?php echo $key; ?>"
|
| 762 |
-
class="<?php echo $class; ?>"
|
| 763 |
-
<?php checked( $selected, $key ); ?>
|
| 764 |
-
/>
|
| 765 |
-
<?php echo $val; ?>
|
| 766 |
-
</label><br/>
|
| 767 |
-
<?php endforeach;
|
| 768 |
-
echo $description;
|
| 769 |
-
break;
|
| 770 |
-
|
| 771 |
-
case 'single_select_page':
|
| 772 |
-
|
| 773 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 774 |
-
|
| 775 |
-
if ( $value == 0 ) $selected = $std;
|
| 776 |
-
|
| 777 |
-
$args = array(
|
| 778 |
-
'name' => $name,
|
| 779 |
-
'id' => $id,
|
| 780 |
-
'sort_order' => 'ASC',
|
| 781 |
-
'echo' => 0,
|
| 782 |
-
'selected' => $selected
|
| 783 |
-
);
|
| 784 |
-
|
| 785 |
-
echo str_replace( "'>", "'><option></option>", wp_dropdown_pages( $args ) );
|
| 786 |
-
|
| 787 |
-
echo '<a href="post.php?post='.$selected.'&action=edit" class="button">'.__( 'Edit Page', 'wcvendors' ).'</a>';
|
| 788 |
-
echo '<a href="'.get_permalink( $selected ). '" class="button">'.__( 'View Page', 'wcvendors' ).'</a>';
|
| 789 |
-
|
| 790 |
-
echo $description;
|
| 791 |
-
|
| 792 |
-
if ( $select2 ) : ?>
|
| 793 |
-
<script type="text/javascript">jQuery(function () {
|
| 794 |
-
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px', allowMultiple: true });
|
| 795 |
-
});</script>
|
| 796 |
-
<?php endif;
|
| 797 |
-
|
| 798 |
-
break;
|
| 799 |
-
|
| 800 |
-
case 'multi_select_page':
|
| 801 |
-
|
| 802 |
-
// TODO get this working with multiple page selection
|
| 803 |
-
|
| 804 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 805 |
-
$selected = implode( ',', array_keys( $selected ) );
|
| 806 |
-
|
| 807 |
-
if ( $value == 0 ) $selected = $std;
|
| 808 |
-
|
| 809 |
-
$name = $name . '[]';
|
| 810 |
-
|
| 811 |
-
$args = array(
|
| 812 |
-
'name' => $name,
|
| 813 |
-
'id' => $id,
|
| 814 |
-
'sort_order' => 'ASC',
|
| 815 |
-
'echo' => 0,
|
| 816 |
-
'selected' => $selected
|
| 817 |
-
);
|
| 818 |
-
|
| 819 |
-
echo str_replace( "'>", "' multiple=\"multiple\"><option></option>", wp_dropdown_pages( $args ) );
|
| 820 |
-
|
| 821 |
-
echo '<a href="post.php?post='.$selected.'&action=edit" class="button">'.__( 'Edit Page', 'wcvendors' ).'</a>';
|
| 822 |
-
echo '<a href="'.get_permalink( $selected ). '" class="button">'.__( 'View Page', 'wcvendors' ).'</a>';
|
| 823 |
-
|
| 824 |
-
echo $description;
|
| 825 |
-
|
| 826 |
-
if ( $select2 ) : ?>
|
| 827 |
-
<script type="text/javascript">jQuery(function () {
|
| 828 |
-
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px', allowMultiple: true });
|
| 829 |
-
});</script>
|
| 830 |
-
<?php endif;
|
| 831 |
-
|
| 832 |
-
break;
|
| 833 |
-
|
| 834 |
-
|
| 835 |
-
case 'select':
|
| 836 |
-
|
| 837 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 838 |
-
$options = apply_filters( $this->id . '_select_options', $options, $setting ); ?>
|
| 839 |
-
|
| 840 |
-
<select id="<?php echo $id; ?>"
|
| 841 |
-
class="<?php echo $class; ?>"
|
| 842 |
-
style="<?php echo $css; ?>"
|
| 843 |
-
name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 844 |
-
<?php echo $multiple ? 'multiple="multiple"' : ''; ?>>
|
| 845 |
-
|
| 846 |
-
<?php foreach ( $options as $key => $val ) : ?>
|
| 847 |
-
<option
|
| 848 |
-
value="<?php echo $key; ?>" <?php self::selected( $selected, $key ); ?>><?php echo $val; ?></option>
|
| 849 |
-
<?php endforeach; ?>
|
| 850 |
-
</select>
|
| 851 |
-
|
| 852 |
-
<?php echo $description;
|
| 853 |
-
|
| 854 |
-
if ( $select2 ) : ?>
|
| 855 |
-
<script type="text/javascript">jQuery(function () {
|
| 856 |
-
jQuery("#<?php echo $id; ?>").select2({ width: '350px' });
|
| 857 |
-
});</script>
|
| 858 |
-
<?php endif;
|
| 859 |
-
|
| 860 |
-
break;
|
| 861 |
-
|
| 862 |
-
case 'textarea':
|
| 863 |
-
?>
|
| 864 |
-
<textarea name="<?php echo $name; ?>"
|
| 865 |
-
id="<?php echo $id; ?>"
|
| 866 |
-
class="large-text <?php echo $class; ?>"
|
| 867 |
-
style="<?php if ( $css ) echo $css; else echo 'width:300px;'; ?>"
|
| 868 |
-
placeholder="<?php echo $placeholder; ?>"
|
| 869 |
-
rows="3"
|
| 870 |
-
><?php echo ( $value !== false ) ? $value : $std; ?></textarea>
|
| 871 |
-
<?php echo $description;
|
| 872 |
-
break;
|
| 873 |
-
|
| 874 |
-
case 'wysiwyg':
|
| 875 |
-
wp_editor( $value, $id, array( 'textarea_name' => $name ) );
|
| 876 |
-
echo $description;
|
| 877 |
-
break;
|
| 878 |
-
|
| 879 |
-
case 'image':
|
| 880 |
-
|
| 881 |
-
if ( empty ( $value ) ) $value = $std;
|
| 882 |
-
|
| 883 |
-
?>
|
| 884 |
-
<img class="wcv-image-container-<?php echo $id; ?>" src="<?php echo $value; ?>" alt="" style="max-width:100%;" />
|
| 885 |
-
<br />
|
| 886 |
-
<input id="wcv-add-<?php echo $id; ?>" type="button" class="<?php echo $class; ?>" value="<?php echo sprintf( __( 'Update %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-id="<?php echo $id; ?>" data-save_button="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), $title ); ?>" data-window_title="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-upload_notice="<?php echo sprintf( __( 'Upload an image for the %s', 'wcvendors' ), strtolower( $title ) ); ?>" />
|
| 887 |
-
<input type="hidden" name="<?php echo $name; ?>" id="<?php echo $id; ?>" value="<?php echo $value; ?>">
|
| 888 |
-
<?php
|
| 889 |
-
break;
|
| 890 |
-
|
| 891 |
-
default :
|
| 892 |
-
do_action( $this->id . '_options_type_' . $type, $setting );
|
| 893 |
-
break;
|
| 894 |
-
|
| 895 |
-
endswitch;
|
| 896 |
-
|
| 897 |
-
/* Footer of the option. */
|
| 898 |
-
if ( !in_array( $type, $header_types ) ) echo '</td></tr>';
|
| 899 |
-
|
| 900 |
-
}
|
| 901 |
-
|
| 902 |
-
|
| 903 |
-
/**
|
| 904 |
-
*
|
| 905 |
-
*
|
| 906 |
-
* @param unknown $haystack
|
| 907 |
-
* @param unknown $current
|
| 908 |
-
*/
|
| 909 |
-
private function selected( $haystack, $current )
|
| 910 |
-
{
|
| 911 |
-
|
| 912 |
-
if ( is_array( $haystack ) && in_array( $current, $haystack ) ) {
|
| 913 |
-
$current = $haystack = 1;
|
| 914 |
-
}
|
| 915 |
-
|
| 916 |
-
selected( $haystack, $current );
|
| 917 |
-
}
|
| 918 |
-
|
| 919 |
-
|
| 920 |
-
/**
|
| 921 |
-
*
|
| 922 |
-
*
|
| 923 |
-
* @param unknown $haystack
|
| 924 |
-
* @param unknown $current
|
| 925 |
-
*/
|
| 926 |
-
private function checked( $haystack, $current )
|
| 927 |
-
{
|
| 928 |
-
|
| 929 |
-
if ( is_array( $haystack ) && !empty( $haystack[ $current ] ) ) {
|
| 930 |
-
$current = $haystack = 1;
|
| 931 |
-
}
|
| 932 |
-
|
| 933 |
-
checked( $haystack, $current );
|
| 934 |
-
}
|
| 935 |
-
|
| 936 |
-
|
| 937 |
-
/**
|
| 938 |
-
* Format a tooltip given a string
|
| 939 |
-
*
|
| 940 |
-
* @param string $tip
|
| 941 |
-
*
|
| 942 |
-
* @return string
|
| 943 |
-
*/
|
| 944 |
-
private function get_formatted_tip( $tip )
|
| 945 |
-
{
|
| 946 |
-
return $tip ? sprintf( '<a href="#" title="%s" class="sf-tips" tabindex="99"></a>', $tip ) : '';
|
| 947 |
-
}
|
| 948 |
-
|
| 949 |
-
|
| 950 |
-
/**
|
| 951 |
-
*
|
| 952 |
-
*
|
| 953 |
-
* @param unknown $value
|
| 954 |
-
* @param unknown $setting
|
| 955 |
-
*
|
| 956 |
-
* @return unknown
|
| 957 |
-
*/
|
| 958 |
-
private function sanitize_value( $value, $setting )
|
| 959 |
-
{
|
| 960 |
-
if ( $value !== false && $setting[ 'type' ] != 'wysiwyg' ) {
|
| 961 |
-
if ( is_array( $value ) ) {
|
| 962 |
-
foreach ( $value as $key => $output ) {
|
| 963 |
-
$value[ $key ] = esc_attr( $output );
|
| 964 |
-
}
|
| 965 |
-
} else {
|
| 966 |
-
$value = esc_attr( $value );
|
| 967 |
-
}
|
| 968 |
-
}
|
| 969 |
-
|
| 970 |
-
return apply_filters( $this->id . '_options_sanitize_value', $value, $setting );
|
| 971 |
-
}
|
| 972 |
-
|
| 973 |
-
|
| 974 |
-
|
| 975 |
-
}
|
| 976 |
-
|
| 977 |
-
|
| 978 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/settings/sf-options.php
DELETED
|
@@ -1,363 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
$options = array();
|
| 3 |
-
|
| 4 |
-
$options[ ] = array( 'name' => __( 'General', 'wcvendors' ), 'type' => 'heading' );
|
| 5 |
-
$options[ ] = array( 'name' => __( 'General options', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 6 |
-
|
| 7 |
-
$options[ ] = array(
|
| 8 |
-
'name' => __( 'Default commission (%)', 'wcvendors' ),
|
| 9 |
-
'desc' => __( 'The default rate you pay each vendor for a product sale. <br>You can also give vendors their own individual commission rates by editing the vendors user account.<br>Also, you can edit an individual products commission to override both of these settings on a per product basis.', 'wcvendors' ),
|
| 10 |
-
'id' => 'default_commission',
|
| 11 |
-
'css' => 'width:70px;',
|
| 12 |
-
'type' => 'number',
|
| 13 |
-
'restrict' => array(
|
| 14 |
-
'min' => 0,
|
| 15 |
-
'max' => 100
|
| 16 |
-
)
|
| 17 |
-
);
|
| 18 |
-
|
| 19 |
-
/* Customize registration message depending on if they have registration enabled on the my account page */
|
| 20 |
-
$registration_message = __( 'Allow users or guests to apply to become a vendor', 'wcvendors' );
|
| 21 |
-
if ( get_option( 'woocommerce_enable_myaccount_registration' ) === 'no' ) {
|
| 22 |
-
$registration_message = __( 'Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:</strong> You MUST "<strong>Enable registration on the "My Account" page</strong>" in your <strong>WooCommerce > Settings > Accounts</strong> page for this option to work. Currently, you have registration disabled.', 'wcvendors' );
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
$options[ ] = array(
|
| 26 |
-
'name' => __( 'Registration', 'wcvendors' ),
|
| 27 |
-
'desc' => __( 'Allow users or guests to apply to become a vendor', 'wcvendors' ),
|
| 28 |
-
'tip' => __( 'This will show a checkbox on the My Account page\'s registration form asking if the user would like to apply to be a vendor. Also, on the Vendor Dashboard, users can still apply to become a vendor even if this is disabled.', 'wcvendors' ),
|
| 29 |
-
'id' => 'show_vendor_registration',
|
| 30 |
-
'type' => 'checkbox',
|
| 31 |
-
'std' => true,
|
| 32 |
-
);
|
| 33 |
-
|
| 34 |
-
$options[ ] = array(
|
| 35 |
-
'desc' => __( 'Approve vendor applications manually', 'wcvendors' ),
|
| 36 |
-
'tip' => __( 'With this unchecked, all vendor applications are automatically accepted. Otherwise, you must approve each manually.', 'wcvendors' ),
|
| 37 |
-
'id' => 'manual_vendor_registration',
|
| 38 |
-
'type' => 'checkbox',
|
| 39 |
-
'std' => true,
|
| 40 |
-
);
|
| 41 |
-
|
| 42 |
-
$options[ ] = array(
|
| 43 |
-
'name' => __( 'Taxes', 'wcvendors' ),
|
| 44 |
-
'desc' => __( 'Give vendors any tax collected per-product', 'wcvendors' ),
|
| 45 |
-
'tip' => __( 'The tax collected on a vendor\'s product will be given in its entirety', 'wcvendors' ),
|
| 46 |
-
'id' => 'give_tax',
|
| 47 |
-
'type' => 'checkbox',
|
| 48 |
-
'std' => false,
|
| 49 |
-
);
|
| 50 |
-
|
| 51 |
-
$options[ ] = array(
|
| 52 |
-
'name' => __( 'Shipping', 'wcvendors' ),
|
| 53 |
-
'desc' => __( 'Give vendors any shipping collected per-product', 'wcvendors' ),
|
| 54 |
-
'tip' => __( 'WC Vendors Free - Give vendors shipping if using Per Product Shipping gateway. WC Vendors Pro - Give vendors shipping when using Vendor Shipping. No other shipping module is compatible with this option.', 'wcvendors' ),
|
| 55 |
-
'id' => 'give_shipping',
|
| 56 |
-
'type' => 'checkbox',
|
| 57 |
-
'std' => true,
|
| 58 |
-
);
|
| 59 |
-
|
| 60 |
-
$options[ ] = array( 'name' => __( 'Shop options', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 61 |
-
|
| 62 |
-
$options[ ] = array(
|
| 63 |
-
'name' => __( 'Shop HTML', 'wcvendors' ),
|
| 64 |
-
'desc' => __( 'Enable HTML for a vendor\'s shop description by default. You can enable or disable this per vendor by editing the vendors user account.', 'wcvendors' ),
|
| 65 |
-
'id' => 'shop_html_enabled',
|
| 66 |
-
'type' => 'checkbox',
|
| 67 |
-
'std' => true,
|
| 68 |
-
);
|
| 69 |
-
|
| 70 |
-
$options[ ] = array(
|
| 71 |
-
'name' => __( 'Vendor Shop Page', 'wcvendors' ),
|
| 72 |
-
'desc' => __( 'Enter one word for the URI. If you enter "<strong>vendors</strong>" your vendors store will be <code>yourdomain.com/vendors/store-name/</code>', 'wcvendors' ),
|
| 73 |
-
'id' => 'vendor_shop_permalink',
|
| 74 |
-
'type' => 'text',
|
| 75 |
-
'std' => 'vendors/',
|
| 76 |
-
);
|
| 77 |
-
|
| 78 |
-
$options[ ] = array(
|
| 79 |
-
'name' => __( 'Shop Headers', 'wcvendors' ),
|
| 80 |
-
'desc' => __( 'Enable vendor shop headers', 'wcvendors' ),
|
| 81 |
-
'tip' => __( 'This will override the HTML Shop description output on product-archive pages. In order to customize the shop headers visit wcvendors.com and read the article in the Knowledgebase titled Changing the Vendor Templates.', 'wcvendors' ),
|
| 82 |
-
'id' => 'shop_headers_enabled',
|
| 83 |
-
'type' => 'checkbox',
|
| 84 |
-
'std' => false,
|
| 85 |
-
);
|
| 86 |
-
|
| 87 |
-
$options[ ] = array(
|
| 88 |
-
'name' => __( 'Vendor Display Name', 'wcvendors' ),
|
| 89 |
-
'desc' => __( 'Select what will be displayed for the sold by text throughout the store.', 'wcvendors' ),
|
| 90 |
-
'id' => 'vendor_display_name',
|
| 91 |
-
'type' => 'select',
|
| 92 |
-
'options' => array(
|
| 93 |
-
'display_name' => __( 'Display Name', 'wcvendors'),
|
| 94 |
-
'shop_name' => __( 'Shop Name', 'wcvendors'),
|
| 95 |
-
'user_login' => __( 'User Login', 'wcvendors'),
|
| 96 |
-
'user_email' => __( 'User Email', 'wcvendors'),
|
| 97 |
-
),
|
| 98 |
-
'std' => 'shop_name'
|
| 99 |
-
|
| 100 |
-
);
|
| 101 |
-
|
| 102 |
-
$options[ ] = array(
|
| 103 |
-
'name' => __( 'Sold By', 'wcvendors' ),
|
| 104 |
-
'desc' => __( 'Enable sold by labels', 'wcvendors' ),
|
| 105 |
-
'tip' => __( 'This will enable or disable the sold by labels.', 'wcvendors' ),
|
| 106 |
-
'id' => 'sold_by',
|
| 107 |
-
'type' => 'checkbox',
|
| 108 |
-
'std' => true,
|
| 109 |
-
);
|
| 110 |
-
|
| 111 |
-
$options[ ] = array(
|
| 112 |
-
'name' => __( 'Sold By Label', 'wcvendors' ),
|
| 113 |
-
'desc' => __( 'The sold by label used on the site and emails.', 'wcvendors' ),
|
| 114 |
-
'id' => 'sold_by_label',
|
| 115 |
-
'type' => 'text',
|
| 116 |
-
'std' => __( 'Sold By', 'wcvendors' ),
|
| 117 |
-
);
|
| 118 |
-
|
| 119 |
-
$options[ ] = array(
|
| 120 |
-
'name' => __( 'Seller Info Label', 'wcvendors' ),
|
| 121 |
-
'desc' => __( 'The seller info tab title on the single product page.', 'wcvendors' ),
|
| 122 |
-
'id' => 'seller_info_label',
|
| 123 |
-
'type' => 'text',
|
| 124 |
-
'std' => __( 'Seller Info', 'wcvendors' ),
|
| 125 |
-
);
|
| 126 |
-
|
| 127 |
-
$options[ ] = array( 'name' => __( 'Products', 'wcvendors' ), 'type' => 'heading' );
|
| 128 |
-
$options[ ] = array( 'name' => __( 'Product Add Page', 'wcvendors' ), 'type' => 'title', 'desc' => __( 'Configure what to hide from all vendors when adding a product', 'wcvendors' ) );
|
| 129 |
-
|
| 130 |
-
$options[ ] = array(
|
| 131 |
-
'name' => __( 'Left side panel', 'wcvendors' ),
|
| 132 |
-
'desc' => __( 'CHECKING these boxes will **HIDE** these areas of the add product page for vendors', 'wcvendors' ),
|
| 133 |
-
'id' => 'hide_product_panel',
|
| 134 |
-
'options' => array(
|
| 135 |
-
'inventory' => __( 'Inventory', 'wcvendors' ),
|
| 136 |
-
'shipping' => __( 'Shipping', 'wcvendors' ),
|
| 137 |
-
'linked_product' => __( 'Linked Products', 'wcvendors' ),
|
| 138 |
-
'attribute' => __( 'Attributes', 'wcvendors' ),
|
| 139 |
-
'advanced' => __( 'Advanced', 'wcvendors' ),
|
| 140 |
-
),
|
| 141 |
-
'type' => 'checkbox',
|
| 142 |
-
'multiple' => true,
|
| 143 |
-
);
|
| 144 |
-
|
| 145 |
-
$options[ ] = array(
|
| 146 |
-
'name' => __( 'Types', 'wcvendors' ),
|
| 147 |
-
'desc' => __( 'CHECKING these boxes will HIDE these product types from the vendor', 'wcvendors' ),
|
| 148 |
-
'id' => 'hide_product_types',
|
| 149 |
-
'options' => array(
|
| 150 |
-
'simple' => __( 'Simple', 'wcvendors' ),
|
| 151 |
-
'variable' => __( 'Variable', 'wcvendors' ),
|
| 152 |
-
'grouped' => __( 'Grouped', 'wcvendors' ),
|
| 153 |
-
'external' => __( 'External / affiliate', 'wcvendors' ),
|
| 154 |
-
),
|
| 155 |
-
'type' => 'checkbox',
|
| 156 |
-
'multiple' => true,
|
| 157 |
-
);
|
| 158 |
-
|
| 159 |
-
$options[ ] = array(
|
| 160 |
-
'name' => __( 'Type options', 'wcvendors' ),
|
| 161 |
-
'desc' => __( 'CHECKING these boxes will **HIDE** these product options from the vendor', 'wcvendors' ),
|
| 162 |
-
'id' => 'hide_product_type_options',
|
| 163 |
-
'options' => array(
|
| 164 |
-
'virtual' => __( 'Virtual', 'wcvendors' ),
|
| 165 |
-
'downloadable' => __( 'Downloadable', 'wcvendors' ),
|
| 166 |
-
),
|
| 167 |
-
'type' => 'checkbox',
|
| 168 |
-
'multiple' => true,
|
| 169 |
-
);
|
| 170 |
-
|
| 171 |
-
$options[ ] = array(
|
| 172 |
-
'name' => __( 'Miscellaneous', 'wcvendors' ),
|
| 173 |
-
'id' => 'hide_product_misc',
|
| 174 |
-
'options' => array(
|
| 175 |
-
'taxes' => __( 'Taxes', 'wcvendors' ),
|
| 176 |
-
'sku' => __( 'SKU', 'wcvendors' ),
|
| 177 |
-
'featured' => __( 'Featured', 'wcvendors' ),
|
| 178 |
-
'duplicate' => __( 'Duplicate Product', 'wcvendors' ),
|
| 179 |
-
),
|
| 180 |
-
'type' => 'checkbox',
|
| 181 |
-
'multiple' => true,
|
| 182 |
-
);
|
| 183 |
-
|
| 184 |
-
$options[ ] = array(
|
| 185 |
-
'name' => __( 'Stylesheet', 'wcvendors' ),
|
| 186 |
-
'desc' => __( 'You can add CSS in this textarea, which will be loaded on the product add/edit page for vendors.', 'wcvendors' ),
|
| 187 |
-
'id' => 'product_page_css',
|
| 188 |
-
'type' => 'textarea',
|
| 189 |
-
);
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
$options[ ] = array( 'name' => __( 'Capabilities', 'wcvendors' ), 'type' => 'heading', 'id' => 'capabilities' );
|
| 193 |
-
$options[ ] = array( 'name' => __( 'Permissions', 'wcvendors' ), 'id' => 'permissions', 'type' => 'title', 'desc' => __( 'General permissions used around the shop', 'wcvendors' ) );
|
| 194 |
-
|
| 195 |
-
$options[ ] = array(
|
| 196 |
-
'name' => __( 'Orders', 'wcvendors' ),
|
| 197 |
-
'desc' => __( 'View orders', 'wcvendors' ),
|
| 198 |
-
'tip' => __( 'Show customer details such as email, address, name, etc, for each order', 'wcvendors' ),
|
| 199 |
-
'id' => 'can_show_orders',
|
| 200 |
-
'type' => 'checkbox',
|
| 201 |
-
'std' => true,
|
| 202 |
-
);
|
| 203 |
-
|
| 204 |
-
$options[ ] = array(
|
| 205 |
-
'desc' => __( 'View comments', 'wcvendors' ),
|
| 206 |
-
'tip' => __( 'View all vendor comments for an order on the frontend', 'wcvendors' ),
|
| 207 |
-
'id' => 'can_view_order_comments',
|
| 208 |
-
'type' => 'checkbox',
|
| 209 |
-
'std' => true,
|
| 210 |
-
);
|
| 211 |
-
|
| 212 |
-
$options[ ] = array(
|
| 213 |
-
'desc' => __( 'Submit comments', 'wcvendors' ),
|
| 214 |
-
'tip' => __( 'Submit comments for an order on the frontend. Eg, tracking ID for a product', 'wcvendors' ),
|
| 215 |
-
'id' => 'can_submit_order_comments',
|
| 216 |
-
'type' => 'checkbox',
|
| 217 |
-
'std' => true,
|
| 218 |
-
);
|
| 219 |
-
|
| 220 |
-
$options[ ] = array(
|
| 221 |
-
'desc' => __( 'View email addresses', 'wcvendors' ),
|
| 222 |
-
'tip' => __( 'While viewing order details on the frontend, you can disable or enable email addresses', 'wcvendors' ),
|
| 223 |
-
'id' => 'can_view_order_emails',
|
| 224 |
-
'type' => 'checkbox',
|
| 225 |
-
'std' => true,
|
| 226 |
-
);
|
| 227 |
-
|
| 228 |
-
$options[ ] = array(
|
| 229 |
-
'desc' => __( 'Export a CSV file of orders for a product', 'wcvendors' ),
|
| 230 |
-
'tip' => __( 'Vendors could export orders for a product on the frontend', 'wcvendors' ),
|
| 231 |
-
'id' => 'can_export_csv',
|
| 232 |
-
'type' => 'checkbox',
|
| 233 |
-
'std' => true,
|
| 234 |
-
);
|
| 235 |
-
|
| 236 |
-
$options[ ] = array(
|
| 237 |
-
'name' => __( 'Reports', 'wcvendors' ),
|
| 238 |
-
'desc' => __( '<strike>View backend sales reports</strike>. <strong>Depreciated</strong>', 'wcvendors' ),
|
| 239 |
-
'tip' => __( 'This option has been removed and will no longer function. It will be completely removed in future versions. Vendors should use their Vendor Dashboard for reports as all identical functionality is already there. ', 'wcvendors' ),
|
| 240 |
-
'id' => 'can_view_backend_reports',
|
| 241 |
-
'type' => 'checkbox',
|
| 242 |
-
'std' => false,
|
| 243 |
-
);
|
| 244 |
-
|
| 245 |
-
$options[ ] = array(
|
| 246 |
-
'desc' => __( 'View Frontend sales reports', 'wcvendors' ),
|
| 247 |
-
'tip' => __( 'Sales table on the frontend on the Vendor Dashboard page. The table will only display sales data that pertain to their products, and only for orders that are processing or completed.', 'wcvendors' ),
|
| 248 |
-
'id' => 'can_view_frontend_reports',
|
| 249 |
-
'type' => 'checkbox',
|
| 250 |
-
'std' => true,
|
| 251 |
-
);
|
| 252 |
-
|
| 253 |
-
$options[ ] = array(
|
| 254 |
-
'name' => __( 'Products', 'wcvendors' ),
|
| 255 |
-
'desc' => __( 'Submit products', 'wcvendors' ),
|
| 256 |
-
'tip' => __( 'Check to allow vendors to list new products. Admin must approve new products by editing the product, and clicking Publish.', 'wcvendors' ),
|
| 257 |
-
'id' => 'can_submit_products',
|
| 258 |
-
'type' => 'checkbox',
|
| 259 |
-
'std' => true,
|
| 260 |
-
);
|
| 261 |
-
|
| 262 |
-
$options[ ] = array(
|
| 263 |
-
'desc' => __( 'Edit live products', 'wcvendors' ),
|
| 264 |
-
'tip' => __( 'Vendors could edit an approved product after it has already gone live. There is no approval or review after editing a live product. This could be dangerous with malicious vendors, so take caution.', 'wcvendors' ),
|
| 265 |
-
'id' => 'can_edit_published_products',
|
| 266 |
-
'type' => 'checkbox',
|
| 267 |
-
'std' => false,
|
| 268 |
-
);
|
| 269 |
-
|
| 270 |
-
$options[ ] = array(
|
| 271 |
-
'desc' => __( 'Submit products live without requiring approval', 'wcvendors' ),
|
| 272 |
-
'tip' => __( 'Vendors can submit products without review or approval from a shop admin. This could be dangerous with malicious vendors, so take caution.', 'wcvendors' ),
|
| 273 |
-
'id' => 'can_submit_live_products',
|
| 274 |
-
'type' => 'checkbox',
|
| 275 |
-
'std' => false,
|
| 276 |
-
);
|
| 277 |
-
|
| 278 |
-
$options[ ] = array( 'name' => __( 'Pages', 'wcvendors' ), 'type' => 'heading' );
|
| 279 |
-
$options[ ] = array( 'name' => __( 'Page configuration', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 280 |
-
|
| 281 |
-
$options[ ] = array(
|
| 282 |
-
'name' => __( 'Vendor dashboard', 'wcvendors' ),
|
| 283 |
-
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</code><br/>. If this page is not set, you will break your site. If you upgrade to Pro, keep this page unchanged as both Pro Dashboard and this Dashboard page must be set.', 'wcvendors' ),
|
| 284 |
-
'id' => 'vendor_dashboard_page',
|
| 285 |
-
'type' => 'single_select_page',
|
| 286 |
-
'select2' => true,
|
| 287 |
-
);
|
| 288 |
-
|
| 289 |
-
$options[ ] = array(
|
| 290 |
-
'name' => __( 'Shop settings', 'wcvendors' ),
|
| 291 |
-
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/>These are the shop settings a vendor can configure. By default, Vendor Dashboard > Shop Settings should have this shortcode.', 'wcvendors' ),
|
| 292 |
-
'id' => 'shop_settings_page',
|
| 293 |
-
'type' => 'single_select_page',
|
| 294 |
-
'select2' => true,
|
| 295 |
-
);
|
| 296 |
-
|
| 297 |
-
$options[ ] = array(
|
| 298 |
-
'name' => __( 'Orders page', 'wcvendors' ),
|
| 299 |
-
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By default, Vendor Dashboard > Orders should have the shortcode.', 'wcvendors' ),
|
| 300 |
-
'id' => 'product_orders_page',
|
| 301 |
-
'type' => 'single_select_page',
|
| 302 |
-
'select2' => true,
|
| 303 |
-
);
|
| 304 |
-
|
| 305 |
-
$options[ ] = array(
|
| 306 |
-
'name' => __( 'Vendor terms', 'wcvendors' ),
|
| 307 |
-
'desc' => __( 'These terms are shown to a user when submitting an application to become a vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor must accept terms in order to register, if set.', 'wcvendors' ),
|
| 308 |
-
'id' => 'terms_to_apply_page',
|
| 309 |
-
'type' => 'single_select_page',
|
| 310 |
-
'select2' => true,
|
| 311 |
-
);
|
| 312 |
-
|
| 313 |
-
$total_due = 0;
|
| 314 |
-
if ( !empty( $_GET[ 'tab' ] ) && $_GET[ 'tab' ] == __( 'payments', 'wcvendors' ) ) {
|
| 315 |
-
global $wpdb;
|
| 316 |
-
|
| 317 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 318 |
-
$query = "SELECT sum(total_due + total_shipping + tax) as total
|
| 319 |
-
FROM `{$table_name}`
|
| 320 |
-
WHERE status = %s";
|
| 321 |
-
$results = $wpdb->get_results( $wpdb->prepare( $query, 'due' ) );
|
| 322 |
-
|
| 323 |
-
$total_due = array_shift( $results )->total;
|
| 324 |
-
}
|
| 325 |
-
$options[ ] = array( 'name' => __( 'Payments', 'wcvendors' ), 'type' => 'heading' );
|
| 326 |
-
$options[ ] = array(
|
| 327 |
-
'name' => __( 'PayPal Adaptive Payments Scheduling - PayPal MassPay has been depreciated by PayPal as of September 2017', 'wcvendors' ), 'type' => 'title', 'desc' =>
|
| 328 |
-
sprintf( __( 'Total commission currently due: %s. <a href="%s">View details</a>.', 'wcvendors' ), !function_exists( 'wc_price' ) ? $total_due : wc_price( $total_due ), '?page=pv_admin_commissions' ) .
|
| 329 |
-
'<br/><br/>' . sprintf( __( 'Make sure you update your PayPal Adaptive Payments settings <a href="%s">here</a>. <br><br>To instantly pay with Adaptive Payments you must activate the PayPal AP gateway in your Checkout settings. <br><a href="https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/" target="top">PayPal AP Application Help</a>. <br><br>Another gateway that offers instant payments to vendors that also accepts credit cards directly on your checkout page is Stripe. <br><a href="https://www.wcvendors.com/product/stripe-commissions-gateway/" target="top">Stripe Commissions & Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a href="https://www.wcvendors.com/product/wc-vendors-pro/" target="top">WC Vendors Pro</a>.', 'wcvendors' ), 'admin.php?page=wc-settings&tab=checkout§ion=wc_paypalap' )
|
| 330 |
-
);
|
| 331 |
-
|
| 332 |
-
$options[ ] = array(
|
| 333 |
-
'name' => __( 'Instant pay', 'wcvendors' ),
|
| 334 |
-
'desc' => __( 'Instantly pay vendors their commission when an order is made, and if a vendor has a valid PayPal email added on their Shop Settings page.', 'wcvendors' ),
|
| 335 |
-
'tip' => __( 'For this to work, customers must checkout with the PayPal Adaptive Payments gateway. Using any other gateways will not pay vendors instantly', 'wcvendors' ),
|
| 336 |
-
'id' => 'instapay',
|
| 337 |
-
'type' => 'checkbox',
|
| 338 |
-
'std' => true,
|
| 339 |
-
);
|
| 340 |
-
|
| 341 |
-
$options[ ] = array(
|
| 342 |
-
'name' => __( 'Payment schedule', 'wcvendors' ),
|
| 343 |
-
'desc' => __( 'Note: Schedule will only work if instant pay is unchecked', 'wcvendors' ),
|
| 344 |
-
'id' => 'schedule',
|
| 345 |
-
'type' => 'radio',
|
| 346 |
-
'std' => 'manual',
|
| 347 |
-
'options' => array(
|
| 348 |
-
'daily' => __( 'Daily', 'wcvendors' ),
|
| 349 |
-
'weekly' => __( 'Weekly', 'wcvendors' ),
|
| 350 |
-
'biweekly' => __( 'Biweekly', 'wcvendors' ),
|
| 351 |
-
'monthly' => __( 'Monthly', 'wcvendors' ),
|
| 352 |
-
'manual' => __( 'Manual', 'wcvendors' ),
|
| 353 |
-
'now' => '<span style="color:green;"><strong>' . __( 'Now', 'wcvendors' ) . '</strong></span>',
|
| 354 |
-
)
|
| 355 |
-
);
|
| 356 |
-
|
| 357 |
-
$options[ ] = array(
|
| 358 |
-
'name' => __( 'Email notification', 'wcvendors' ),
|
| 359 |
-
'desc' => __( 'Send the WooCommerce admin an email each time a payment has been made via the payment schedule options above', 'wcvendors' ),
|
| 360 |
-
'id' => 'mail_mass_pay_results',
|
| 361 |
-
'type' => 'checkbox',
|
| 362 |
-
'std' => true,
|
| 363 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/html-admin-commission-page.php
DELETED
|
@@ -1,39 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Settings
|
| 4 |
-
*
|
| 5 |
-
* @author Jamie Madden, WC Vendors
|
| 6 |
-
* @category Admin
|
| 7 |
-
* @package WCVendors/Admin
|
| 8 |
-
* @version 2.0.0
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 12 |
-
exit;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
$page = filter_input( INPUT_GET, 'page', FILTER_SANITIZE_STRIPPED );
|
| 16 |
-
$paged = filter_input( INPUT_GET, 'paged', FILTER_SANITIZE_NUMBER_INT );
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
?>
|
| 20 |
-
<div class="wrap">
|
| 21 |
-
|
| 22 |
-
<div id="icon-woocommerce" class="icon32 icon32-woocommerce-reports"><br/></div>
|
| 23 |
-
<h2><?php _e( 'Commission', 'wc-vendors' ); ?></h2>
|
| 24 |
-
<form id="posts-filter" method="get">
|
| 25 |
-
|
| 26 |
-
<?php printf( '<input type="hidden" name="page" value="%s" />', $page ); ?>
|
| 27 |
-
<?php printf( '<input type="hidden" name="paged" value="%d" />', $paged ); ?>
|
| 28 |
-
|
| 29 |
-
<input type="hidden" name="page" value="wcv-commissions"/>
|
| 30 |
-
|
| 31 |
-
<?php $this->commissions_table->prepare_items(); ?>
|
| 32 |
-
<?php $this->commissions_table->views(); ?>
|
| 33 |
-
<?php $this->commissions_table->display(); ?>
|
| 34 |
-
|
| 35 |
-
</form>
|
| 36 |
-
<div id="ajax-response"></div>
|
| 37 |
-
|
| 38 |
-
<br class="clear"/>
|
| 39 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/html-admin-page-extensions.php
DELETED
|
@@ -1,92 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Page - Addons
|
| 4 |
-
*
|
| 5 |
-
* @var string $view
|
| 6 |
-
* @var object $addons
|
| 7 |
-
*/
|
| 8 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 9 |
-
exit;
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
?>
|
| 13 |
-
<div class="wrap woocommerce wcv_addons_wrap">
|
| 14 |
-
|
| 15 |
-
<h1><?php _e( 'Upgrade your marketplace today!', 'wc-vendors' ); ?></h1>
|
| 16 |
-
<br />
|
| 17 |
-
|
| 18 |
-
<div class="addons-wcs-banner-block">
|
| 19 |
-
<div class="addons-wcs-banner-block-image">
|
| 20 |
-
<img class="addons-img" src="<?php echo wcv_assets_url; ?>images/extensions/screenshot-1.png" alt="WC Vendors Pro">
|
| 21 |
-
<img class="addons-img" src="<?php echo wcv_assets_url; ?>images/extensions/screenshot-2.png" alt="WC Vendors Pro">
|
| 22 |
-
<img class="addons-img" src="<?php echo wcv_assets_url; ?>images/extensions/screenshot-3.png" alt="WC Vendors Pro">
|
| 23 |
-
</div>
|
| 24 |
-
<div class="addons-wcs-banner-block-content">
|
| 25 |
-
<h1><?php _e( 'WC Vendors Pro', 'wc-vendors'); ?></h1>
|
| 26 |
-
|
| 27 |
-
<p><?php _e( 'Enhanced your marketplace with pro features and capabilities. Move all your vendors tasks to the frontend. They no longer need or see the WordPress admin. Shipping system included.', 'wc-vendors' ); ?></p>
|
| 28 |
-
|
| 29 |
-
<h4>Features</h4>
|
| 30 |
-
|
| 31 |
-
<ul class="feature-list">
|
| 32 |
-
<li><?php _e( 'Vendors have a main dashboard showing sales reports and recent orders and products.', 'wc-vendors' ); ?></li>
|
| 33 |
-
<li><?php _e( 'Vendors have complete front end product management', 'wc-vendors' ); ?></li>
|
| 34 |
-
<li><?php _e( 'Vendors can add their own coupons that only apply to their products', 'wc-vendors' ); ?></li>
|
| 35 |
-
<li><?php _e( 'Vendors have advanced shipment tracking including shipping providers', 'wc-vendors' ); ?></li>
|
| 36 |
-
<li><?php _e( 'Vendors have the ability to print a shipping label with a picking list', 'wc-vendors' ); ?></li>
|
| 37 |
-
<li><?php _e( 'Vendors can add all their own social media profile links', 'wc-vendors' ); ?></li>
|
| 38 |
-
<li><?php _e( 'Vendors can add SEO to their store and products', 'wc-vendors' ); ?></li>
|
| 39 |
-
<li><?php _e( 'Vendors can add their own banner and store icon', 'wc-vendors' ); ?></li>
|
| 40 |
-
<li><?php _e( 'Vendors have a comprehensive shipping system available. Either flat rate or table rate based.', 'wc-vendors' ); ?></li>
|
| 41 |
-
<li><?php _e( 'Vendor stores templates are more advanced', 'wc-vendors' ); ?></li>
|
| 42 |
-
<li><?php _e( 'Vendors have more control over their order notes', 'wc-vendors' ); ?></li>
|
| 43 |
-
<li><?php _e( 'Vendors vacation module is included as part of pro not an extra addon', 'wc-vendors' ); ?></li>
|
| 44 |
-
<li><?php _e( 'Admins have multiple commission rate options including percentage, percentage + fee, fixed, fixed + fee.', 'wc-vendors' ); ?></li>
|
| 45 |
-
<li><?php _e( 'Admins can set global shipping rates as well as allow different shipping modules per vendor. Setting one as flat rate, while another can be table rate', 'wc-vendors' ); ?></li>
|
| 46 |
-
<li><?php _e( 'Ebay style feedback allows customers to rate the products from the vendors', 'wc-vendors' ); ?></li>
|
| 47 |
-
<li><?php _e( 'Premium ticket based support for all pro users. Annual and lifetime support licenses available.', 'wc-vendors' ); ?></li>
|
| 48 |
-
</ul>
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
<a class="product-addons-button product-addons-button-solid" href="https://www.wcvendors.com/product/wc-vendors-pro/">From $199</a>
|
| 52 |
-
</div>
|
| 53 |
-
</div>
|
| 54 |
-
|
| 55 |
-
<ul class="products">
|
| 56 |
-
<li class="product">
|
| 57 |
-
<a href="https://www.wcvendors.com/product/stripe-commissions-gateway/?utm_source=plugin&utm_medium=addons&utm_campaign=extensions">
|
| 58 |
-
<h2><?php _e( 'WC Vendors Stripe Commissions & Gateway', 'wc-vendors'); ?></h2>
|
| 59 |
-
<p><?php _e( 'Pay your vendors their commissions instantly when the customer purchases. No need to manually pay your vendors.', 'wc-vendors'); ?></p>
|
| 60 |
-
<span class="product-addons-button product-addons-button-solid"><?php _e( 'From $69', 'wc-vendors'); ?></span>
|
| 61 |
-
</a>
|
| 62 |
-
</li>
|
| 63 |
-
<li class="product">
|
| 64 |
-
<a href="https://www.wcvendors.com/product/woocommerce-bookings-integration/?utm_source=plugin&utm_medium=addons&utm_campaign=extensions">
|
| 65 |
-
<h2><?php _e( 'WooCommerce Bookings Integration<', 'wc-vendors'); ?>/h2>
|
| 66 |
-
<span class="price"><?php _e( 'From $69.00', 'wc-vendors'); ?></span>
|
| 67 |
-
<p><?php _e( 'Allow vendors to create bookings. Integrate WooCommerce bookings into the WC Vendors Pro Dashboard.', 'wc-vendors'); ?></p>
|
| 68 |
-
<span class="product-addons-button product-addons-button-solid"><?php _e( 'From $69', 'wc-vendors'); ?></span>
|
| 69 |
-
</a>
|
| 70 |
-
</li>
|
| 71 |
-
<li class="product">
|
| 72 |
-
<a href="https://www.wcvendors.com/product/woocommerce-simple-auctions-integration/?utm_source=plugin&utm_medium=addons&utm_campaign=extensions">
|
| 73 |
-
<h2><?php _e( 'WooCommerce Simple Auctions', 'wc-vendors'); ?></h2>
|
| 74 |
-
<p><?php _e( 'Integreate WooCommerce Simple Auctions into the WC Vendors Pro dashboard.', 'wc-vendors'); ?> </p>
|
| 75 |
-
<span class="product-addons-button product-addons-button-solid"><?php _e( 'From $69', 'wc-vendors'); ?></span>
|
| 76 |
-
</a>
|
| 77 |
-
</li>
|
| 78 |
-
<li class="product">
|
| 79 |
-
<a href="https://www.wcvendors.com/home/3rd-party-extensions/y/?utm_source=plugin&utm_medium=addons&utm_campaign=extensions">
|
| 80 |
-
<h2><?php _e( '3rd Party Extensions', 'wc-vendors'); ?></h2>
|
| 81 |
-
<p><?php _e( 'We have a list of 3rd party developer extensions that inetegrate with WC Vendors and WC Vendors Pro on our website.', 'wc-vendors'); ?></p>
|
| 82 |
-
<span class="product-addons-button product-addons-button-solid"><?php _e( 'View extensions', 'wc-vendors'); ?></span>
|
| 83 |
-
</a>
|
| 84 |
-
</li>
|
| 85 |
-
|
| 86 |
-
</ul>
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
<p><?php printf( __( 'Our list of extensions for WC Vendors can be found on our website. <a href="%s">Click here to view our extensions list.</a>', 'wc-vendors' ), 'https://www.wcvendors.com/extensions/' ); ?></p>
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/html-admin-settings.php
DELETED
|
@@ -1,46 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Settings
|
| 4 |
-
*
|
| 5 |
-
* @package WC Vendors
|
| 6 |
-
*/
|
| 7 |
-
|
| 8 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 9 |
-
exit;
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
$tab_exists = isset( $tabs[ $current_tab ] ) || has_action( 'wcvendors_sections_' . $current_tab ) || has_action( 'wcvendors_settings_' . $current_tab ) || has_action( 'wcvendors_settings_tabs_' . $current_tab );
|
| 13 |
-
$current_tab_label = isset( $tabs[ $current_tab ] ) ? $tabs[ $current_tab ] : '';
|
| 14 |
-
|
| 15 |
-
if ( ! $tab_exists ) {
|
| 16 |
-
wp_safe_redirect( admin_url( 'admin.php?page=wcv-settings' ) );
|
| 17 |
-
exit;
|
| 18 |
-
}
|
| 19 |
-
?>
|
| 20 |
-
<div class="wrap wcvendors">
|
| 21 |
-
<form method="<?php echo esc_attr( apply_filters( 'wcvendors_settings_form_method_tab_' . $current_tab, 'post' ) ); ?>" id="mainform" action="" enctype="multipart/form-data">
|
| 22 |
-
<nav class="nav-tab-wrapper wcv-nav-tab-wrapper">
|
| 23 |
-
<?php
|
| 24 |
-
|
| 25 |
-
foreach ( $tabs as $slug => $label ) {
|
| 26 |
-
echo '<a href="' . esc_html( admin_url( 'admin.php?page=wcv-settings&tab=' . esc_attr( $slug ) ) ) . '" class="nav-tab ' . ( $current_tab === $slug ? 'nav-tab-active' : '' ) . '">' . esc_html( $label ) . '</a>';
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
do_action( 'wcvendors_settings_tabs' );
|
| 30 |
-
|
| 31 |
-
?>
|
| 32 |
-
</nav>
|
| 33 |
-
<h1 class="screen-reader-text"><?php echo esc_html( $current_tab_label ); ?></h1>
|
| 34 |
-
<?php
|
| 35 |
-
do_action( 'wcvendors_sections_' . $current_tab );
|
| 36 |
-
self::show_messages();
|
| 37 |
-
do_action( 'wcvendors_settings_' . $current_tab );
|
| 38 |
-
?>
|
| 39 |
-
<p class="submit">
|
| 40 |
-
<?php if ( empty( $GLOBALS['hide_save_button'] ) ) : ?>
|
| 41 |
-
<button name="save" class="button-primary wcvendors-save-button" type="submit" value="<?php esc_attr_e( 'Save changes', 'wcvendors' ); ?>"><?php esc_html_e( 'Save changes', 'wcvendors' ); ?></button>
|
| 42 |
-
<?php endif; ?>
|
| 43 |
-
<?php wp_nonce_field( 'wcvendors-settings' ); ?>
|
| 44 |
-
</p>
|
| 45 |
-
</form>
|
| 46 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/html-vendor-meta.php
DELETED
|
@@ -1,153 +0,0 @@
|
|
| 1 |
-
<h3><?php _e( 'WC Vendors', 'wc-vendors' ); ?></h3>
|
| 2 |
-
|
| 3 |
-
<table class="form-table">
|
| 4 |
-
<tbody>
|
| 5 |
-
|
| 6 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_shop_html_enable', true ) ) : ?>
|
| 7 |
-
|
| 8 |
-
<?php do_action( 'wcvendors_admin_before_shop_html', $user ); ?>
|
| 9 |
-
<tr>
|
| 10 |
-
<th scope="row">Shop HTML</th>
|
| 11 |
-
<td>
|
| 12 |
-
<label for="pv_shop_html_enabled">
|
| 13 |
-
<input name="pv_shop_html_enabled" type="checkbox" id="pv_shop_html_enabled" <?php checked( true, get_user_meta( $user->ID, 'pv_shop_html_enabled', true ), $echo = true ) ?>/>
|
| 14 |
-
<?php _e( 'Enable HTML for the shop description', 'wc-vendors' ); ?>
|
| 15 |
-
</label>
|
| 16 |
-
</td>
|
| 17 |
-
</tr>
|
| 18 |
-
<?php do_action( 'wcvendors_admin_after_shop_html', $user ); ?>
|
| 19 |
-
|
| 20 |
-
<?php endif; ?>
|
| 21 |
-
|
| 22 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_shop_name_enable', true ) ) : ?>
|
| 23 |
-
|
| 24 |
-
<?php do_action( 'wcvendors_admin_before_shop_name', $user ); ?>
|
| 25 |
-
<tr>
|
| 26 |
-
<th><label for="pv_shop_name"><?php _e( 'Shop name', 'wc-vendors' ); ?></label></th>
|
| 27 |
-
<td><input type="text" name="pv_shop_name" id="pv_shop_name" value="<?php echo get_user_meta( $user->ID, 'pv_shop_name', true ); ?>" class="regular-text">
|
| 28 |
-
</td>
|
| 29 |
-
</tr>
|
| 30 |
-
<?php do_action( 'wcvendors_admin_after_shop_name', $user ); ?>
|
| 31 |
-
|
| 32 |
-
<?php endif; ?>
|
| 33 |
-
|
| 34 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_paypal_enable', true ) ) : ?>
|
| 35 |
-
|
| 36 |
-
<?php do_action( 'wcvendors_admin_before_paypal', $user ); ?>
|
| 37 |
-
<tr>
|
| 38 |
-
<th><label for="pv_paypal"><?php _e( 'PayPal E-mail', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 39 |
-
<td><input type="email" name="pv_paypal" id="pv_paypal" value="<?php echo get_user_meta( $user->ID, 'pv_paypal', true ); ?>" class="regular-text">
|
| 40 |
-
</td>
|
| 41 |
-
</tr>
|
| 42 |
-
<?php do_action( 'wcvendors_admin_after_paypal', $user ); ?>
|
| 43 |
-
|
| 44 |
-
<?php endif; ?>
|
| 45 |
-
|
| 46 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_bank_details_enable', true ) ) : ?>
|
| 47 |
-
|
| 48 |
-
<?php do_action( 'wcvendors_admin_before_bank_details', $user ); ?>
|
| 49 |
-
<tr>
|
| 50 |
-
<th><label for="wcv_bank_account_name"><?php _e( 'Bank Account Name', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 51 |
-
<td><input type="text" name="wcv_bank_account_name" id="wcv_bank_account_name" value="<?php echo get_user_meta( $user->ID, 'wcv_bank_account_name', true ); ?>" class="regular-text">
|
| 52 |
-
</td>
|
| 53 |
-
</tr>
|
| 54 |
-
<tr>
|
| 55 |
-
<th><label for="wcv_bank_account_number"><?php _e( 'Bank Account Number', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 56 |
-
<td><input type="text" name="wcv_bank_account_number" id="wcv_bank_account_number" value="<?php echo get_user_meta( $user->ID, 'wcv_bank_account_number', true ); ?>" class="regular-text">
|
| 57 |
-
</td>
|
| 58 |
-
</tr>
|
| 59 |
-
<tr>
|
| 60 |
-
<th><label for="wcv_bank_name"><?php _e( 'Bank Name', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 61 |
-
<td><input type="text" name="wcv_bank_name" id="wcv_bank_name" value="<?php echo get_user_meta( $user->ID, 'wcv_bank_name', true ); ?>" class="regular-text">
|
| 62 |
-
</td>
|
| 63 |
-
</tr>
|
| 64 |
-
<tr>
|
| 65 |
-
<th><label for="wcv_bank_routing_number"><?php _e( 'Routing Number', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 66 |
-
<td><input type="text" name="wcv_bank_routing_number" id="wcv_bank_routing_number" value="<?php echo get_user_meta( $user->ID, 'wcv_bank_routing_number', true ); ?>" class="regular-text">
|
| 67 |
-
</td>
|
| 68 |
-
</tr>
|
| 69 |
-
<tr>
|
| 70 |
-
<th><label for="wcv_bank_iban"><?php _e( 'IBAN', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 71 |
-
<td><input type="text" name="wcv_bank_iban" id="wcv_bank_iban" value="<?php echo get_user_meta( $user->ID, 'wcv_bank_iban', true ); ?>" class="regular-text">
|
| 72 |
-
</td>
|
| 73 |
-
</tr>
|
| 74 |
-
<tr>
|
| 75 |
-
<th><label for="wcv_bank_bic_swift"><?php _e( 'BIC/SWIFT', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 76 |
-
<td><input type="text" name="wcv_bank_bic_swift" id="wcv_bank_bic_swift" value="<?php echo get_user_meta( $user->ID, 'wcv_bank_bic_swift', true ); ?>" class="regular-text">
|
| 77 |
-
</td>
|
| 78 |
-
</tr>
|
| 79 |
-
<?php do_action( 'wcvendors_admin_after_bank_details', $user ); ?>
|
| 80 |
-
|
| 81 |
-
<?php endif; ?>
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_commission_rate_enable', true ) ) : ?>
|
| 85 |
-
|
| 86 |
-
<?php do_action( 'wcvendors_admin_before_commission_due', $user ); ?>
|
| 87 |
-
<tr>
|
| 88 |
-
<th><label for="pv_custom_commission_rate"><?php _e( 'Commission rate', 'wc-vendors' ); ?> (%)</label></th>
|
| 89 |
-
<td><input type="number" step="0.01" max="100" min="0" name="pv_custom_commission_rate" placeholder="<?php _e( 'Leave blank for default', 'wc-vendors' ); ?>" id="pv_custom_commission_rate"
|
| 90 |
-
value="<?php echo get_user_meta( $user->ID, 'pv_custom_commission_rate', true ); ?>" class="regular-text">
|
| 91 |
-
</td>
|
| 92 |
-
</tr>
|
| 93 |
-
<?php do_action( 'wcvendors_admin_after_commission_due', $user ); ?>
|
| 94 |
-
|
| 95 |
-
<?php endif; ?>
|
| 96 |
-
|
| 97 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_give_tax_enable', true ) ) : ?>
|
| 98 |
-
|
| 99 |
-
<?php do_action( 'wcvendors_admin_before_give_tax', $user ); ?>
|
| 100 |
-
<tr>
|
| 101 |
-
<th><label for="wcv_give_vendor_tax"><?php _e( 'Give Tax', 'wc-vendors' ); ?> (%)</label></th>
|
| 102 |
-
<td>
|
| 103 |
-
<label for="wcv_give_vendor_tax">
|
| 104 |
-
<input name="wcv_give_vendor_tax" type="checkbox" id="wcv_give_vendor_tax" <?php checked( true, get_user_meta( $user->ID, 'wcv_give_vendor_tax', true ), $echo = true ) ?>/>
|
| 105 |
-
<?php _e( 'Tax override for vendor', 'wc-vendors' ); ?>
|
| 106 |
-
</label>
|
| 107 |
-
</td>
|
| 108 |
-
</tr>
|
| 109 |
-
<?php do_action( 'wcvendors_admin_after_give_tax', $user ); ?>
|
| 110 |
-
|
| 111 |
-
<?php endif; ?>
|
| 112 |
-
|
| 113 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_give_shipping_enable', true ) ) : ?>
|
| 114 |
-
|
| 115 |
-
<?php do_action( 'wcvendors_admin_before_give_shipping', $user ); ?>
|
| 116 |
-
<tr>
|
| 117 |
-
<th><label for="wcv_give_vendor_shipping"><?php _e( 'Give Shipping', 'wc-vendors' ); ?> (%)</label></th>
|
| 118 |
-
<td>
|
| 119 |
-
<label for="wcv_give_vendor_shipping">
|
| 120 |
-
<input name="wcv_give_vendor_shipping" type="checkbox" id="wcv_give_vendor_shipping" <?php checked( true, get_user_meta( $user->ID, 'wcv_give_vendor_shipping', true ), $echo = true ) ?>/>
|
| 121 |
-
<?php _e( 'Shipping override for vendor', 'wc-vendors' ); ?>
|
| 122 |
-
</label>
|
| 123 |
-
</td>
|
| 124 |
-
</tr>
|
| 125 |
-
<?php do_action( 'wcvendors_admin_after_give_shipping', $user ); ?>
|
| 126 |
-
|
| 127 |
-
<?php endif; ?>
|
| 128 |
-
|
| 129 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_seller_info_enable', true ) ) : ?>
|
| 130 |
-
|
| 131 |
-
<?php do_action( 'wcvendors_admin_before_seller_info', $user ); ?>
|
| 132 |
-
<tr>
|
| 133 |
-
<th><label for="pv_seller_info"><?php _e( 'Seller info', 'wc-vendors' ); ?></label></th>
|
| 134 |
-
<td><?php wp_editor( get_user_meta( $user->ID, 'pv_seller_info', true ), 'pv_seller_info' ); ?></td>
|
| 135 |
-
</tr>
|
| 136 |
-
<?php do_action( 'wcvendors_admin_after_seller_info', $user ); ?>
|
| 137 |
-
|
| 138 |
-
<?php endif; ?>
|
| 139 |
-
|
| 140 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_shop_description_enable', true ) ) : ?>
|
| 141 |
-
|
| 142 |
-
<?php do_action( 'wcvendors_admin_before_shop_description', $user ); ?>
|
| 143 |
-
<tr>
|
| 144 |
-
<th><label for="pv_shop_description"><?php _e( 'Shop description', 'wc-vendors' ); ?></label>
|
| 145 |
-
</th>
|
| 146 |
-
<td><?php wp_editor( get_user_meta( $user->ID, 'pv_shop_description', true ), 'pv_shop_description' ); ?></td>
|
| 147 |
-
</tr>
|
| 148 |
-
<?php do_action( 'wcvendors_admin_after_shop_description', $user ); ?>
|
| 149 |
-
|
| 150 |
-
<?php endif; ?>
|
| 151 |
-
|
| 152 |
-
</tbody>
|
| 153 |
-
</table>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/html-vendor-settings-page.php
DELETED
|
@@ -1,114 +0,0 @@
|
|
| 1 |
-
<div class="wrap">
|
| 2 |
-
<h2>Shop Settings</h2>
|
| 3 |
-
<table class="form-table">
|
| 4 |
-
|
| 5 |
-
<form method="post">
|
| 6 |
-
<?php do_action( 'wcvendors_settings_before_paypal' );
|
| 7 |
-
|
| 8 |
-
if ( $paypal_address !== 'false' ) { ?>
|
| 9 |
-
|
| 10 |
-
<tr>
|
| 11 |
-
<th><?php _e( 'PayPal Address', 'wc-vendors' ); ?></th>
|
| 12 |
-
<td><input type="email" name="pv_paypal" class="regular-text" id="pv_paypal" placeholder="some@email.com" value="<?php echo get_user_meta( $user_id, 'pv_paypal', true ); ?>"/>
|
| 13 |
-
<p class="description">
|
| 14 |
-
<?php _e( 'Your PayPal address can be used to send you your commission.', 'wc-vendors' ); ?><br/>
|
| 15 |
-
</p>
|
| 16 |
-
</td>
|
| 17 |
-
</tr>
|
| 18 |
-
<?php } ?>
|
| 19 |
-
<?php do_action( 'wcvendors_settings_after_paypal' ); ?>
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
<?php if ( apply_filters( 'wcvendors_admin_user_meta_bank_details_enable', true ) ) : ?>
|
| 23 |
-
|
| 24 |
-
<?php do_action( 'wcvendors_settings_before_bank_details', $user_id ); ?>
|
| 25 |
-
<tr>
|
| 26 |
-
<th><label for="wcv_bank_account_name"><?php _e( 'Bank Account Name', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 27 |
-
<td><input type="text" name="wcv_bank_account_name" id="wcv_bank_account_name" value="<?php echo get_user_meta( $user_id, 'wcv_bank_account_name', true ); ?>" class="regular-text">
|
| 28 |
-
</td>
|
| 29 |
-
</tr>
|
| 30 |
-
<tr>
|
| 31 |
-
<th><label for="wcv_bank_account_number"><?php _e( 'Bank Account Number', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 32 |
-
<td><input type="text" name="wcv_bank_account_number" id="wcv_bank_account_number" value="<?php echo get_user_meta( $user_id, 'wcv_bank_account_number', true ); ?>" class="regular-text">
|
| 33 |
-
</td>
|
| 34 |
-
</tr>
|
| 35 |
-
<tr>
|
| 36 |
-
<th><label for="wcv_bank_name"><?php _e( 'Bank Name', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 37 |
-
<td><input type="text" name="wcv_bank_name" id="wcv_bank_name" value="<?php echo get_user_meta( $user_id, 'wcv_bank_name', true ); ?>" class="regular-text">
|
| 38 |
-
</td>
|
| 39 |
-
</tr>
|
| 40 |
-
<tr>
|
| 41 |
-
<th><label for="wcv_bank_routing_number"><?php _e( 'Routing Number', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 42 |
-
<td><input type="text" name="wcv_bank_routing_number" id="wcv_bank_routing_number" value="<?php echo get_user_meta( $user_id, 'wcv_bank_routing_number', true ); ?>" class="regular-text">
|
| 43 |
-
</td>
|
| 44 |
-
</tr>
|
| 45 |
-
<tr>
|
| 46 |
-
<th><label for="wcv_bank_iban"><?php _e( 'IBAN', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 47 |
-
<td><input type="text" name="wcv_bank_iban" id="wcv_bank_iban" value="<?php echo get_user_meta( $user_id, 'wcv_bank_iban', true ); ?>" class="regular-text">
|
| 48 |
-
</td>
|
| 49 |
-
</tr>
|
| 50 |
-
<tr>
|
| 51 |
-
<th><label for="wcv_bank_bic_swift"><?php _e( 'BIC/SWIFT', 'wc-vendors' ); ?> <span class="description"></span></label></th>
|
| 52 |
-
<td><input type="text" name="wcv_bank_bic_swift" id="wcv_bank_bic_swift" value="<?php echo get_user_meta( $user_id, 'wcv_bank_bic_swift', true ); ?>" class="regular-text">
|
| 53 |
-
</td>
|
| 54 |
-
</tr>
|
| 55 |
-
<?php do_action( 'wcvendors_settings_after_bank_details', $user_id ); ?>
|
| 56 |
-
|
| 57 |
-
<?php endif; ?>
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
<tr>
|
| 61 |
-
<th><?php _e( 'Shop Name', 'wc-vendors' ); ?></th>
|
| 62 |
-
<td><input type="text" name="pv_shop_name" id="pv_shop_name" placeholder="Your shop name" value="<?php echo get_user_meta( $user_id, 'pv_shop_name', true ); ?>"/>
|
| 63 |
-
<p class="description"><?php _e( 'Your shop name is public and must be unique.', 'wc-vendors' ); ?></p>
|
| 64 |
-
</td>
|
| 65 |
-
</tr>
|
| 66 |
-
<?php do_action( 'wcvendors_settings_after_shop_name' ); ?>
|
| 67 |
-
|
| 68 |
-
<tr>
|
| 69 |
-
<th><?php echo apply_filters( 'wcvendors_seller_info_label', __( 'Seller info', 'wc-vendors' ) ); ?></th>
|
| 70 |
-
<td><?php
|
| 71 |
-
|
| 72 |
-
if ( $global_html || $has_html ) {
|
| 73 |
-
$old_post = $GLOBALS[ 'post' ];
|
| 74 |
-
$GLOBALS[ 'post' ] = 0;
|
| 75 |
-
wp_editor( $seller_info, 'pv_seller_info' );
|
| 76 |
-
$GLOBALS[ 'post' ] = $old_post;
|
| 77 |
-
} else {
|
| 78 |
-
?><textarea class="large-text" rows="10" id="pv_seller_info_unhtml" style="width:95%"
|
| 79 |
-
name="pv_seller_info"><?php echo $seller_info; ?></textarea><?php
|
| 80 |
-
}
|
| 81 |
-
?>
|
| 82 |
-
<p class="description"><?php _e( 'This is displayed on each of your products.', 'wc-vendors' ); ?></p>
|
| 83 |
-
</td>
|
| 84 |
-
</tr>
|
| 85 |
-
<?php do_action( 'wcvendors_settings_after_seller_info' ); ?>
|
| 86 |
-
<?php if ( $shop_description !== 'false' ) { ?>
|
| 87 |
-
<tr>
|
| 88 |
-
<th><?php _e( 'Shop Description', 'wc-vendors' ); ?></th>
|
| 89 |
-
<td><?php
|
| 90 |
-
|
| 91 |
-
if ( $global_html || $has_html ) {
|
| 92 |
-
$old_post = $GLOBALS[ 'post' ];
|
| 93 |
-
$GLOBALS[ 'post' ] = 0;
|
| 94 |
-
wp_editor( $description, 'pv_shop_description' );
|
| 95 |
-
$GLOBALS[ 'post' ] = $old_post;
|
| 96 |
-
} else {
|
| 97 |
-
?><textarea class="large-text" rows="10" id="pv_shop_description_unhtml" style="width:95%" name="pv_shop_description"><?php echo $description; ?></textarea><?php
|
| 98 |
-
}
|
| 99 |
-
?>
|
| 100 |
-
<p class="description"><?php printf( __( 'This is displayed on your <a href="%s">shop page</a>.', 'wc-vendors' ), $shop_page ); ?></p>
|
| 101 |
-
</td>
|
| 102 |
-
</tr>
|
| 103 |
-
|
| 104 |
-
<?php do_action( 'wcvendors_settings_after_shop_description' ); ?>
|
| 105 |
-
<?php } ?>
|
| 106 |
-
<?php wp_nonce_field( 'save-shop-settings-admin', 'wc-vendors-nonce' ); ?>
|
| 107 |
-
<tr>
|
| 108 |
-
<td colspa="2">
|
| 109 |
-
<input type="submit" class="button button-primary" name="vendor_application_submit" value="<?php _e( 'Save Shop Settings', 'wc-vendors' ); ?>"/>
|
| 110 |
-
</td>
|
| 111 |
-
</tr>
|
| 112 |
-
</form>
|
| 113 |
-
</table>
|
| 114 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/notices/html-notice-custom.php
DELETED
|
@@ -1,14 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Custom Notices
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
<div id="message" class="updated wcvendors-message">
|
| 12 |
-
<a class="wcvendors-message-close notice-dismiss" href="<?php echo esc_url( wp_nonce_url( add_query_arg( 'wcv-hide-notice', $notice ), 'wcvendors_hide_notices_nonce', '_wcv_notice_nonce' ) ); ?>"><?php _e( 'Dismiss', 'wc-vendors' ); ?></a>
|
| 13 |
-
<?php echo wp_kses_post( wpautop( $notice_html ) ); ?>
|
| 14 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/notices/html-notice-install.php
DELETED
|
@@ -1,14 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Notice - Install
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
<div id="message" class="updated wcvendors-message wc-connect">
|
| 12 |
-
<p><?php _e( '<strong>Welcome to WC Vendors</strong> – You‘re almost ready to start your marketplace', 'wc-vendors' ); ?></p>
|
| 13 |
-
<p class="submit"><a href="<?php echo esc_url( admin_url( 'admin.php?page=wcv-setup' ) ); ?>" class="button-primary"><?php _e( 'Run the Setup Wizard', 'wc-vendors' ); ?></a> <a class="button-secondary skip" href="<?php echo esc_url( wp_nonce_url( add_query_arg( 'wcv-hide-notice', 'install' ), 'wcvendors_hide_notices_nonce', '_wcv_notice_nonce' ) ); ?>"><?php _e( 'Skip setup', 'wc-vendors' ); ?></a></p>
|
| 14 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/notices/html-notice-template-check.php
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Notice - Template Check
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
$theme = wp_get_theme();
|
| 11 |
-
?>
|
| 12 |
-
<div id="message" class="updated wcvendors-message">
|
| 13 |
-
<a class="wcvendors-message-close notice-dismiss" href="<?php echo esc_url( wp_nonce_url( add_query_arg( 'wcv-hide-notice', 'template_files' ), 'wcvendors_hide_notices_nonce', '_wcv_notice_nonce' ) ); ?>"><?php _e( 'Dismiss', 'wc-vendors' ); ?></a>
|
| 14 |
-
|
| 15 |
-
<p><?php printf( __( '<strong>Your theme (%1$s) contains outdated copies of some WC Vendors template files.</strong> These files may need updating to ensure they are compatible with the current version of WC Vendors. You can see which files are affected from the <a href="%2$s">system status page</a>. If in doubt, check with the author of the theme.', 'wc-vendors' ), esc_html( $theme[ 'Name' ] ), esc_url( admin_url( 'admin.php?page=wc-status' ) ) ); ?></p>
|
| 16 |
-
<p class="submit"><a class="button-primary" href="https://docs.wcvendors.com/article/templates" target="_blank"><?php _e( 'Learn more about templates', 'wc-vendors' ); ?></a></p>
|
| 17 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/notices/html-notice-theme-support.php
DELETED
|
File without changes
|
trunk/classes/admin/views/notices/html-notice-update.php
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Notice - Install
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
<div id="message" class="updated wcvendors-message wc-connect is-dismissible">
|
| 12 |
-
<p><?php _e( '<strong>WC Vendors Update Required.</strong> – We need to upgrade your configuration to the latest version.', 'wc-vendors' ); ?></p>
|
| 13 |
-
<p class="submit"><a class="wcv-update-now button-primary" href="<?php echo esc_url( add_query_arg( 'do_update_wcvendors', 'true', admin_url( 'admin.php?page=wcv-settings' ) ) ); ?>" class="button-primary"><?php _e( 'Run the update', 'wc-vendors' ); ?></a></p>
|
| 14 |
-
</div>
|
| 15 |
-
<script type="text/javascript">
|
| 16 |
-
jQuery( '.wcv-update-now' ).click( 'click', function() {
|
| 17 |
-
return window.confirm( '<?php echo esc_js( __( 'It is strongly recommended that you backup your database before proceeding. Are you sure you wish to run the updater now?', 'wc-vendors' ) ); ?>' ); // jshint ignore:line
|
| 18 |
-
});
|
| 19 |
-
</script>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/notices/html-notice-updated.php
DELETED
|
@@ -1,14 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Notice - Updated
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
<div id="message" class="updated wcvendors-message wc-connect wcvendors-message-success">
|
| 12 |
-
<a class="wcvendors-message-close notice-dismiss" href="<?php echo esc_url( wp_nonce_url( add_query_arg( 'wcv-hide-notice', 'update', remove_query_arg( 'do_update_wcvendors' ) ), 'wcvendors_hide_notices_nonce', '_wcv_notice_nonce' ) ); ?>"><?php _e( 'Dismiss', 'wc-vendors' ); ?></a>
|
| 13 |
-
<p><?php _e( 'WC Vendors data update complete. Thank you for updating to the latest version!', 'wc-vendors' ); ?></p>
|
| 14 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/notices/html-notice-updating.php
DELETED
|
@@ -1,13 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Notice - Update
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
<div id="message" class="updated wcvendors-message wc-connect">
|
| 12 |
-
<p><strong><?php _e( 'WC Vendors data update', 'wc-vendors' ); ?></strong> – <?php _e( 'Your database is being updated in the background.', 'wc-vendors' ); ?> <a href="<?php echo esc_url( add_query_arg( 'force_update_wcvendors', 'true', admin_url( 'admin.php?page=wcv-settings' ) ) ); ?>"><?php _e( 'Taking a while? Click here to run it now.', 'wc-vendors' ); ?></a></p>
|
| 13 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/setup/capabilities.php
DELETED
|
@@ -1,134 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Step Two
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit; // Exit if accessed directly
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
|
| 12 |
-
<form method="post">
|
| 13 |
-
<?php wp_nonce_field( 'wcv-setup' ); ?>
|
| 14 |
-
<p class="store-setup"><?php printf( __( 'Enable and disable capabilites of the %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></p>
|
| 15 |
-
|
| 16 |
-
<table class="wcv-setup-table">
|
| 17 |
-
<thead>
|
| 18 |
-
<tr>
|
| 19 |
-
<td class="table-desc"><strong><?php _e( 'Products', 'wc-vendors' ); ?></strong></td>
|
| 20 |
-
<td class="table-check"></td>
|
| 21 |
-
</tr>
|
| 22 |
-
</thead>
|
| 23 |
-
<tbody>
|
| 24 |
-
<tr>
|
| 25 |
-
<td class="table-desc"><?php printf( __( 'Allow %s to add/edit products', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td>
|
| 26 |
-
<td class="table-check">
|
| 27 |
-
<input
|
| 28 |
-
type="checkbox"
|
| 29 |
-
style="float: right; font-size: 4em;"
|
| 30 |
-
id="wcv_capability_products_enabled"
|
| 31 |
-
name="wcv_capability_products_enabled"
|
| 32 |
-
value="yes"
|
| 33 |
-
<?php checked( $products_enabled, 'yes' ); ?>
|
| 34 |
-
/>
|
| 35 |
-
</td>
|
| 36 |
-
</tr>
|
| 37 |
-
<tr>
|
| 38 |
-
<td class="table-desc"><?php printf( __( 'Allow %s to edit published (live) products', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td>
|
| 39 |
-
<td class="table-check">
|
| 40 |
-
<input
|
| 41 |
-
type="checkbox"
|
| 42 |
-
style="float: right; font-size: 4em;"
|
| 43 |
-
id="wcv_capability_products_edit"
|
| 44 |
-
name="wcv_capability_products_edit"
|
| 45 |
-
value="yes"
|
| 46 |
-
<?php checked( $live_products, 'yes' ); ?>
|
| 47 |
-
/>
|
| 48 |
-
</td>
|
| 49 |
-
</tr>
|
| 50 |
-
<tr>
|
| 51 |
-
<td class="table-desc"><?php printf( __( 'Allow %s to publish products without requiring approval.', 'wc-vendors' ), wcv_get_vendor_name( false, false ) )?></td>
|
| 52 |
-
<td class="table-check">
|
| 53 |
-
<input
|
| 54 |
-
type="checkbox"
|
| 55 |
-
style="float: right; font-size: 4em;"
|
| 56 |
-
id="wcv_capability_products_live"
|
| 57 |
-
name="wcv_capability_products_live"
|
| 58 |
-
value="yes"
|
| 59 |
-
<?php checked( $products_approval, 'yes' ); ?>
|
| 60 |
-
/>
|
| 61 |
-
</td>
|
| 62 |
-
</tr>
|
| 63 |
-
|
| 64 |
-
</tbody>
|
| 65 |
-
</table>
|
| 66 |
-
|
| 67 |
-
<table class="wcv-setup-table">
|
| 68 |
-
<thead>
|
| 69 |
-
<tr>
|
| 70 |
-
<td class="table-desc"><strong><?php _e( 'Orders', 'wc-vendors' ); ?></strong></td>
|
| 71 |
-
<td class="table-check"></td>
|
| 72 |
-
</tr>
|
| 73 |
-
</thead>
|
| 74 |
-
<tbody>
|
| 75 |
-
<tr>
|
| 76 |
-
<td class="table-desc"><?php printf( __( 'Allow %s to view orders', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td>
|
| 77 |
-
<td class="table-check">
|
| 78 |
-
<input
|
| 79 |
-
type="checkbox"
|
| 80 |
-
style="float: right; font-size: 4em;"
|
| 81 |
-
id="wcv_capability_orders_enabled"
|
| 82 |
-
name="wcv_capability_orders_enabled"
|
| 83 |
-
value="yes"
|
| 84 |
-
<?php checked( $orders_enabled, 'yes' ); ?>
|
| 85 |
-
/>
|
| 86 |
-
</td>
|
| 87 |
-
</tr>
|
| 88 |
-
<tr>
|
| 89 |
-
<td class="table-desc"><?php printf( __( 'Allow %s to export their orders to a CSV file', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td>
|
| 90 |
-
<td class="table-check">
|
| 91 |
-
<input
|
| 92 |
-
type="checkbox"
|
| 93 |
-
style="float: right; font-size: 4em;"
|
| 94 |
-
id="wcv_capability_orders_export"
|
| 95 |
-
name="wcv_capability_orders_export"
|
| 96 |
-
value="yes"
|
| 97 |
-
<?php checked( $export_orders, 'yes' ); ?>
|
| 98 |
-
/>
|
| 99 |
-
</td>
|
| 100 |
-
</tr>
|
| 101 |
-
<tr>
|
| 102 |
-
<td class="table-desc"><?php printf( __( 'Allow %s to view order notes', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td>
|
| 103 |
-
<td class="table-check">
|
| 104 |
-
<input
|
| 105 |
-
type="checkbox"
|
| 106 |
-
style="float: right; font-size: 4em;"
|
| 107 |
-
id="wcv_capability_order_read_notes"
|
| 108 |
-
name="wcv_capability_order_read_notes"
|
| 109 |
-
value="yes"
|
| 110 |
-
<?php checked( $view_order_notes, 'yes' ); ?>
|
| 111 |
-
/>
|
| 112 |
-
</td>
|
| 113 |
-
</tr>
|
| 114 |
-
<tr>
|
| 115 |
-
<td class="table-desc"><?php printf( __( 'Allow %s to add order notes.', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td>
|
| 116 |
-
<td class="table-check">
|
| 117 |
-
<input
|
| 118 |
-
type="checkbox"
|
| 119 |
-
style="float: right; font-size: 4em;"
|
| 120 |
-
id="wcv_capability_order_update_notes"
|
| 121 |
-
name="wcv_capability_order_update_notes"
|
| 122 |
-
value="yes"
|
| 123 |
-
<?php checked( $view_order_notes, 'yes' ); ?>
|
| 124 |
-
/>
|
| 125 |
-
</td>
|
| 126 |
-
</tr>
|
| 127 |
-
</tbody>
|
| 128 |
-
</table>
|
| 129 |
-
|
| 130 |
-
|
| 131 |
-
<p class="wcv-setup-actions step">
|
| 132 |
-
<button type="submit" class="button button-next" value="<?php esc_attr_e( "Next", 'wc-vendors' ); ?>" name="save_step"><?php esc_html_e( "Next", 'wc-vendors' ); ?></button>
|
| 133 |
-
</p>
|
| 134 |
-
</form>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/setup/footer.php
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Setup Footer
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit; // Exit if accessed directly
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
|
| 12 |
-
<?php if ( 'store_setup' === $this->step ) : ?>
|
| 13 |
-
<a class="wcv-return-to-dashboard" href="<?php echo esc_url( admin_url() ); ?>"><?php esc_html_e( 'Exit Wizard', 'wc-vendors' ); ?></a>
|
| 14 |
-
<?php elseif ( 'ready' === $this->step ) : ?>
|
| 15 |
-
<a class="wcv-return-to-dashboard" href="<?php echo esc_url( admin_url() .'admin.php?page=wcv-settings' ); ?>"><?php esc_html_e( 'Return to your dashboard', 'wc-vendors' ); ?></a>
|
| 16 |
-
<?php elseif ( 'activate' === $this->step ) : ?>
|
| 17 |
-
<a class="wcv-return-to-dashboard" href="<?php echo esc_url( $this->get_next_step_link() ); ?>"><?php esc_html_e( 'Skip this step', 'wc-vendors' ); ?></a>
|
| 18 |
-
<?php endif; ?>
|
| 19 |
-
</body>
|
| 20 |
-
</html>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/setup/general.php
DELETED
|
@@ -1,99 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Step One
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit; // Exit if accessed directly
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
|
| 12 |
-
<form method="post">
|
| 13 |
-
<?php wp_nonce_field( 'wcv-setup' ); ?>
|
| 14 |
-
<p class="store-setup"><?php esc_html_e( 'The following wizard will help you configure your marketplace and get your vendors onboard quickly.', 'wc-vendors' ); ?></p>
|
| 15 |
-
|
| 16 |
-
<table class="wcv-setup-table">
|
| 17 |
-
<thead>
|
| 18 |
-
<tr>
|
| 19 |
-
<td class="table-desc"><strong><?php _e( 'General', 'wc-vendors' ); ?></strong></td>
|
| 20 |
-
<td class="table-check"></td>
|
| 21 |
-
</tr>
|
| 22 |
-
</thead>
|
| 23 |
-
<tbody>
|
| 24 |
-
<tr>
|
| 25 |
-
<td class="table-desc"><?php printf( __( 'Allow users to apply to become a %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td>
|
| 26 |
-
<td class="table-check">
|
| 27 |
-
<input
|
| 28 |
-
type="checkbox"
|
| 29 |
-
class="option_checkbox"
|
| 30 |
-
id="wcv_vendor_allow_registration"
|
| 31 |
-
name="wcv_vendor_allow_registration"
|
| 32 |
-
value="yes"
|
| 33 |
-
<?php checked( $allow_registration, 'yes' ); ?>
|
| 34 |
-
/>
|
| 35 |
-
</td>
|
| 36 |
-
</tr>
|
| 37 |
-
<tr>
|
| 38 |
-
<td class="table-desc"><?php printf( __( 'Manually approve %s applications', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td>
|
| 39 |
-
<td class="table-check">
|
| 40 |
-
<input
|
| 41 |
-
type="checkbox"
|
| 42 |
-
class="option_checkbox"
|
| 43 |
-
id="wcv_vendor_approve_registration"
|
| 44 |
-
name="wcv_vendor_approve_registration"
|
| 45 |
-
value="yes"
|
| 46 |
-
<?php checked( $manual_approval, 'yes' ); ?>
|
| 47 |
-
/>
|
| 48 |
-
</td>
|
| 49 |
-
</tr>
|
| 50 |
-
<tr>
|
| 51 |
-
<td class="table-desc"><?php printf( __( 'Give any taxes to %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td></td>
|
| 52 |
-
<td class="table-check">
|
| 53 |
-
<input
|
| 54 |
-
type="checkbox"
|
| 55 |
-
class="option_checkbox"
|
| 56 |
-
id="wcv_vendor_give_taxes"
|
| 57 |
-
name="wcv_vendor_give_taxes"
|
| 58 |
-
value="yes"
|
| 59 |
-
<?php checked( $vendor_taxes, 'yes' ); ?>
|
| 60 |
-
/>
|
| 61 |
-
</td>
|
| 62 |
-
</tr>
|
| 63 |
-
<tr>
|
| 64 |
-
<td class="table-desc"><?php printf( __( 'Give any shipping to %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></td></td>
|
| 65 |
-
<td class="table-check">
|
| 66 |
-
<input
|
| 67 |
-
type="checkbox"
|
| 68 |
-
class="option_checkbox"
|
| 69 |
-
id="wcv_vendor_give_shipping"
|
| 70 |
-
name="wcv_vendor_give_shipping"
|
| 71 |
-
value="yes"
|
| 72 |
-
<?php checked( $vendor_shipping, 'yes' ); ?>
|
| 73 |
-
/>
|
| 74 |
-
</td>
|
| 75 |
-
</tr>
|
| 76 |
-
</tbody>
|
| 77 |
-
</table>
|
| 78 |
-
|
| 79 |
-
<strong><?php _e( 'Commission', 'wc-vendors' ); ?></strong>
|
| 80 |
-
|
| 81 |
-
<p class="store-setup"><?php _e( 'Commissions are calculated per product. The commission rate can be set globally, at a vendor level or at a product level.', 'wc-vendors' ); ?></p>
|
| 82 |
-
|
| 83 |
-
<!-- Vendor commission rate -->
|
| 84 |
-
<p class="store-setup wcv-setup-input">
|
| 85 |
-
<label class="" for="">
|
| 86 |
-
<?php esc_html_e( 'Global Commission Rate %', 'wc-vendors' ); ?>
|
| 87 |
-
</label>
|
| 88 |
-
<input
|
| 89 |
-
type="text"
|
| 90 |
-
id="wcv_vendor_commission_rate"
|
| 91 |
-
name="wcv_vendor_commission_rate"
|
| 92 |
-
placeholder="%"
|
| 93 |
-
value="<?php echo $commission_rate; ?>"
|
| 94 |
-
/>
|
| 95 |
-
</p>
|
| 96 |
-
<p class="wcv-setup-actions step">
|
| 97 |
-
<button type="submit" class="button button-next" value="<?php esc_attr_e( "Next", 'wc-vendors' ); ?>" name="save_step"><?php esc_html_e( "Next", 'wc-vendors' ); ?></button>
|
| 98 |
-
</p>
|
| 99 |
-
</form>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/setup/header.php
DELETED
|
@@ -1,22 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Setup Header
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit; // Exit if accessed directly
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
<!DOCTYPE html>
|
| 12 |
-
<html <?php language_attributes(); ?>>
|
| 13 |
-
<head>
|
| 14 |
-
<meta name="viewport" content="width=device-width" />
|
| 15 |
-
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
|
| 16 |
-
<title><?php esc_html_e( 'WC Vendors › Setup Wizard', 'wc-vendors' ); ?></title>
|
| 17 |
-
<?php wp_print_scripts( 'wcv-setup' ); ?>
|
| 18 |
-
<?php do_action( 'admin_print_styles' ); ?>
|
| 19 |
-
<?php do_action( 'admin_head' ); ?>
|
| 20 |
-
</head>
|
| 21 |
-
<body class="wcv-setup wp-core-ui">
|
| 22 |
-
<h1 id="wcv-logo"><a href="https://www.wcvendors.com/"><img src="<?php echo esc_url( wcv_assets_url ); ?>images/wcvendors_logo.png" alt="WC Vendors" /></a></h1>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/setup/pages.php
DELETED
|
@@ -1,87 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Step One
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit; // Exit if accessed directly
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
|
| 12 |
-
<form method="post">
|
| 13 |
-
<?php wp_nonce_field( 'wcv-setup' ); ?>
|
| 14 |
-
<p class="store-setup"><?php printf( __( 'Select the pages for relevant frontend features for %s', 'wc-vendors' ), wcv_get_vendor_name( false, false ) ); ?></p>
|
| 15 |
-
|
| 16 |
-
<table class="wcv-setup-table-pages">
|
| 17 |
-
<thead>
|
| 18 |
-
<tr>
|
| 19 |
-
<td class="table-desc"><strong><?php _e( 'Pages', 'wc-vendors' ); ?></strong></td>
|
| 20 |
-
<td class="table-check"></td>
|
| 21 |
-
</tr>
|
| 22 |
-
</thead>
|
| 23 |
-
<tbody>
|
| 24 |
-
<tr>
|
| 25 |
-
<td class="table-desc"><?php _e( 'Vendor Dashboard', 'wc-vendors' ); ?>
|
| 26 |
-
|
| 27 |
-
</td>
|
| 28 |
-
<td class="table-check">
|
| 29 |
-
<?php wcv_single_select_page( 'wcvendors_vendor_dashboard_page_id', $vendor_dashboard_page_id, 'wc-enhanced-select' ); ?>
|
| 30 |
-
</td>
|
| 31 |
-
</tr>
|
| 32 |
-
<tr>
|
| 33 |
-
<td colspan="3" class="tool-tip">
|
| 34 |
-
<?php _e( 'This page should contain the following shortcode. <code>[wcv_vendor_dashboard]</code>', 'wc-vendors' ); ?>
|
| 35 |
-
</td>
|
| 36 |
-
</tr>
|
| 37 |
-
<tr>
|
| 38 |
-
<td class="table-desc"><?php printf( __( '%s Shop Settings', 'wc-vendors' ), wcv_get_vendor_name( false ) ); ?></td>
|
| 39 |
-
<td class="table-check">
|
| 40 |
-
<?php wcv_single_select_page( 'wcvendors_shop_settings_page_id', $shop_settings_page_id, 'wc-enhanced-select' ); ?>
|
| 41 |
-
</td>
|
| 42 |
-
</tr>
|
| 43 |
-
<tr>
|
| 44 |
-
<td colspan="3" class="tool-tip">
|
| 45 |
-
<?php _e( 'This page should contain the following shortcode. <code>[wcv_shop_settings]</code>', 'wc-vendors' ); ?>
|
| 46 |
-
</td>
|
| 47 |
-
</tr>
|
| 48 |
-
<tr>
|
| 49 |
-
<td class="table-desc"><?php _e( 'Orders Page', 'wc-vendors' ); ?></td></td>
|
| 50 |
-
<td class="table-check">
|
| 51 |
-
<?php wcv_single_select_page( 'wcvendors_product_orders_page_id', $product_orders_page_id, 'wc-enhanced-select' ); ?>
|
| 52 |
-
</td>
|
| 53 |
-
</tr>
|
| 54 |
-
<tr>
|
| 55 |
-
<td colspan="3" class="tool-tip">
|
| 56 |
-
<?php _e( 'This page should contain the following shortcode. <code>[wcv_orders]</code>', 'wc-vendors' ); ?>
|
| 57 |
-
</td>
|
| 58 |
-
</tr>
|
| 59 |
-
<tr>
|
| 60 |
-
<td class="table-desc"><?php printf( __( '%s List Page', 'wc-vendors' ), wcv_get_vendor_name( false ) ); ?></td></td>
|
| 61 |
-
<td class="table-check">
|
| 62 |
-
<?php wcv_single_select_page( 'wcvendors_vendors_page_id', $vendors_page_id, 'wc-enhanced-select' ); ?>
|
| 63 |
-
</td>
|
| 64 |
-
</tr>
|
| 65 |
-
<tr>
|
| 66 |
-
<td colspan="3" class="tool-tip">
|
| 67 |
-
<?php _e( 'This page should contain the following shortcode. <code>[wcv_vendorslist]</code>', 'wc-vendors' ); ?>
|
| 68 |
-
</td>
|
| 69 |
-
</tr>
|
| 70 |
-
<tr>
|
| 71 |
-
<td class="table-desc"><?php printf( __( '%s Terms Page', 'wc-vendors' ), wcv_get_vendor_name() ); ?></td></td>
|
| 72 |
-
<td class="table-check">
|
| 73 |
-
<?php wcv_single_select_page( 'wcvendors_vendor_terms_page_id', $terms_page_id, 'wc-enhanced-select' ); ?>
|
| 74 |
-
</td>
|
| 75 |
-
</tr>
|
| 76 |
-
<tr>
|
| 77 |
-
<td colspan="3" class="tool-tip">
|
| 78 |
-
<?php printf( __( 'This optional page allows you to define terms and conidtions %s need to agree to before applying to your marketplace. ', 'wc-vendors' ), wcv_get_vendor_name( false ) ); ?>
|
| 79 |
-
</td>
|
| 80 |
-
</tr>
|
| 81 |
-
|
| 82 |
-
</tbody>
|
| 83 |
-
</table>
|
| 84 |
-
<p class="wcv-setup-actions step">
|
| 85 |
-
<button type="submit" class="button button-next" value="<?php esc_attr_e( "Next", 'wc-vendors' ); ?>" name="save_step"><?php esc_html_e( "Next", 'wc-vendors' ); ?></button>
|
| 86 |
-
</p>
|
| 87 |
-
</form>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/setup/ready.php
DELETED
|
@@ -1,78 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Step One
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit; // Exit if accessed directly
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
|
| 12 |
-
<h1><?php esc_html_e( "Your marketplace is ready!", 'wc-vendors' ); ?></h1>
|
| 13 |
-
|
| 14 |
-
<!-- <div class="wcvendors-message wcvendors-newsletter">
|
| 15 |
-
<p><?php esc_html_e( "Subscribe to our newsletter! Get product updates, marketplace tips, information and more.", 'wc-vendors' ); ?></p>
|
| 16 |
-
<form action="//wcvendors.us8.list-manage.com/subscribe/post?u=2c1434dc56f9506bf3c3ecd21&id=13860df971" method="post" target="_blank" novalidate>
|
| 17 |
-
<div class="newsletter-form-container">
|
| 18 |
-
<input
|
| 19 |
-
class="newsletter-form-email"
|
| 20 |
-
type="email"
|
| 21 |
-
value="<?php echo esc_attr( $user_email ); ?>"
|
| 22 |
-
name="EMAIL"
|
| 23 |
-
placeholder="<?php esc_attr_e( 'Email address', 'wc-vendors' ); ?>"
|
| 24 |
-
required
|
| 25 |
-
>
|
| 26 |
-
<p class="wcv-setup-actions step newsletter-form-button-container">
|
| 27 |
-
<button
|
| 28 |
-
type="submit"
|
| 29 |
-
value="<?php esc_html_e( 'Subscribe me', 'wc-vendors' ); ?>"
|
| 30 |
-
name="subscribe"
|
| 31 |
-
id="mc-embedded-subscribe"
|
| 32 |
-
class="button-primary button newsletter-form-button"
|
| 33 |
-
><?php esc_html_e( 'Subscribe me', 'wc-vendors' ); ?></button>
|
| 34 |
-
</p>
|
| 35 |
-
</div>
|
| 36 |
-
</form>
|
| 37 |
-
</div>
|
| 38 |
-
-->
|
| 39 |
-
<ul class="wcv-wizard-next-steps">
|
| 40 |
-
<li class="wcv-wizard-next-step-item">
|
| 41 |
-
<div class="wcv-wizard-next-step-description">
|
| 42 |
-
<p class="next-step-heading"><?php esc_html_e( 'Next step', 'wc-vendors' ); ?></p>
|
| 43 |
-
<h3 class="next-step-description"><?php esc_html_e( 'Upgrade to Pro!', 'wc-vendors' ); ?></h3>
|
| 44 |
-
<p class="next-step-extra-info"><?php esc_html_e( "Upgrade today to extend the features of your marketplace.", 'wc-vendors' ); ?></p>
|
| 45 |
-
<p class="next-step-heading"><?php esc_html_e( 'Features', 'wc-vendors' ); ?></p>
|
| 46 |
-
<ul>
|
| 47 |
-
<li><?php _e( 'Complete frontend dashboard for vendors', 'wc-vendors' ); ?></li>
|
| 48 |
-
<li><?php _e( 'Flat rate & table rate shipping module', 'wc-vendors' ); ?></li>
|
| 49 |
-
<li><?php _e( 'Coupons, ratings, reports, orders and more.', 'wc-vendors' ); ?></li>
|
| 50 |
-
<li><?php _e( 'Advanced commissions', 'wc-vendors' ); ?></li>
|
| 51 |
-
<li><?php _e( 'Premium support & updates', 'wc-vendors' ); ?></li>
|
| 52 |
-
</ul>
|
| 53 |
-
</div>
|
| 54 |
-
<div class="wcv-wizard-next-step-action">
|
| 55 |
-
<p class="wcv-setup-actions step">
|
| 56 |
-
<a class="button button-primary button-large" href="https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=setup_wizard&utm_medium=plugin&utm_campaign=setup_complete" target="_blank">
|
| 57 |
-
<?php _e( 'Upgrade Now', 'wc-vendors' ); ?>
|
| 58 |
-
</a>
|
| 59 |
-
</p>
|
| 60 |
-
</div>
|
| 61 |
-
</li>
|
| 62 |
-
<li class="wcv-wizard-next-step-item">
|
| 63 |
-
<div class="wcv-wizard-next-step-description">
|
| 64 |
-
<p class="next-step-heading"><?php _e( 'Extend your marketplace', 'wc-vendors' ); ?></p>
|
| 65 |
-
<h3 class="next-step-description"><?php _e( 'Extensions', 'wc-vendors' ); ?></h3>
|
| 66 |
-
<p class="next-step-extra-info"><?php _e( 'Extend your marketplace today with a variety of extensions from us and 3rd party developers.', 'wc-vendors' ); ?></p>
|
| 67 |
-
</div>
|
| 68 |
-
<div class="wcv-wizard-next-step-action">
|
| 69 |
-
<p class="wcv-setup-actions step">
|
| 70 |
-
<a class="button button-large" href="https://www.wcvendors.com/extensions/?utm_source=setup_wizard&utm_medium=plugin&utm_campaign=setup_complete" target="_blank">
|
| 71 |
-
<?php _e( 'View Extensions', 'wc-vendors' ); ?>
|
| 72 |
-
</a>
|
| 73 |
-
</p>
|
| 74 |
-
</div>
|
| 75 |
-
</li>
|
| 76 |
-
</ul>
|
| 77 |
-
<h4 class="help-title"><?php _e( 'Need Help?', 'wc-vendors' ); ?></h4>
|
| 78 |
-
<p class="next-steps-help-text"><?php echo wp_kses_post( $help_text ); ?></p>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/admin/views/setup/steps.php
DELETED
|
@@ -1,24 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin View: Setup Steps
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 7 |
-
exit; // Exit if accessed directly
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
?>
|
| 11 |
-
|
| 12 |
-
<ol class="wcv-setup-steps">
|
| 13 |
-
<?php foreach ( $output_steps as $step_key => $step ) : ?>
|
| 14 |
-
<li class="
|
| 15 |
-
<?php
|
| 16 |
-
if ( $step_key === $this->step ) {
|
| 17 |
-
echo 'active';
|
| 18 |
-
} elseif ( array_search( $this->step, array_keys( $this->steps ) ) > array_search( $step_key, array_keys( $this->steps ) ) ) {
|
| 19 |
-
echo 'done';
|
| 20 |
-
}
|
| 21 |
-
?>
|
| 22 |
-
"><?php echo esc_html( $step['name'] ); ?></li>
|
| 23 |
-
<?php endforeach; ?>
|
| 24 |
-
</ol>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/class-commission.php
DELETED
|
@@ -1,620 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Commission functions
|
| 5 |
-
*
|
| 6 |
-
* @author Matt Gates <http://mgates.me>
|
| 7 |
-
* @package ProductVendor
|
| 8 |
-
*/
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
class WCV_Commission
|
| 12 |
-
{
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructor
|
| 17 |
-
*/
|
| 18 |
-
function __construct() {
|
| 19 |
-
|
| 20 |
-
add_action( 'init', array( $this, 'check_order_complete' ) );
|
| 21 |
-
add_action( 'init', array( $this, 'check_order_reverse' ) );
|
| 22 |
-
|
| 23 |
-
// Reverse the commission if the order is deleted
|
| 24 |
-
add_action( 'delete_post', array( $this, 'commissions_table_sync' ), 10 );
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
/**
|
| 29 |
-
* Run actions when an order is reversed
|
| 30 |
-
*/
|
| 31 |
-
public function check_order_reverse()
|
| 32 |
-
{
|
| 33 |
-
foreach ( $this->get_completed_status() as $completed ) {
|
| 34 |
-
foreach ( $this->get_reversed_status() as $reversed ) {
|
| 35 |
-
add_action( "woocommerce_order_status_{$completed}_to_{$reversed}", array( 'WCV_Commission', 'reverse_due_commission' ) );
|
| 36 |
-
}
|
| 37 |
-
}
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* Runs only on a manual order update by a human
|
| 43 |
-
*/
|
| 44 |
-
public function check_order_complete()
|
| 45 |
-
{
|
| 46 |
-
foreach ( $this->get_completed_status() as $completed ) {
|
| 47 |
-
add_action( 'woocommerce_order_status_' . $completed, array( 'WCV_Commission', 'log_commission_due' ) );
|
| 48 |
-
}
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
// get commission status's
|
| 52 |
-
public static function commission_status(){
|
| 53 |
-
|
| 54 |
-
return apply_filters( 'wcvendors_commission_status', array(
|
| 55 |
-
'due' => __( 'Due', 'wc-vendors' ),
|
| 56 |
-
'paid' => __( 'Paid', 'wc-vendors' ),
|
| 57 |
-
'reversed' => __( 'Reversed', 'wc-vendors' )
|
| 58 |
-
)
|
| 59 |
-
);
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
/**
|
| 63 |
-
* return completed statuss
|
| 64 |
-
*/
|
| 65 |
-
public function get_completed_status(){
|
| 66 |
-
|
| 67 |
-
return $completed_statuses = apply_filters( 'wcvendors_completed_statuses',
|
| 68 |
-
array(
|
| 69 |
-
'completed',
|
| 70 |
-
'processing',
|
| 71 |
-
) );
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
/*
|
| 76 |
-
* Return reversed status's
|
| 77 |
-
*/
|
| 78 |
-
public function get_reversed_status(){
|
| 79 |
-
|
| 80 |
-
return $reverse_statuses = apply_filters( 'wcvendors_reversed_statuses',
|
| 81 |
-
array(
|
| 82 |
-
'pending',
|
| 83 |
-
'refunded',
|
| 84 |
-
'cancelled',
|
| 85 |
-
'failed',
|
| 86 |
-
) );
|
| 87 |
-
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
/**
|
| 92 |
-
* Reverse commission for an entire order
|
| 93 |
-
*
|
| 94 |
-
* Only runs if the order has been logged in pv_commission table
|
| 95 |
-
*
|
| 96 |
-
* @param int $order_id
|
| 97 |
-
*
|
| 98 |
-
* @return unknown
|
| 99 |
-
*/
|
| 100 |
-
public static function reverse_due_commission( $order_id )
|
| 101 |
-
{
|
| 102 |
-
global $wpdb;
|
| 103 |
-
|
| 104 |
-
// Check if this order exists
|
| 105 |
-
$count = WCV_Commission::count_commission_by_order( $order_id );
|
| 106 |
-
if ( !$count ) return false;
|
| 107 |
-
|
| 108 |
-
// Deduct this amount from the vendor's total due
|
| 109 |
-
$results = WCV_Commission::sum_total_due_for_order( $order_id );
|
| 110 |
-
$ids = implode( ',', $results[ 'ids' ] );
|
| 111 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 112 |
-
|
| 113 |
-
$query = "UPDATE `{$table_name}` SET `status` = '%s' WHERE id IN ({$ids})";
|
| 114 |
-
$results = $wpdb->query( $wpdb->prepare( $query, 'reversed' ) );
|
| 115 |
-
|
| 116 |
-
return $results;
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
/**
|
| 121 |
-
* Store all commission due for an order
|
| 122 |
-
*
|
| 123 |
-
* @return bool
|
| 124 |
-
*
|
| 125 |
-
* @param int $order_id
|
| 126 |
-
*/
|
| 127 |
-
public static function log_commission_due( $order_id )
|
| 128 |
-
{
|
| 129 |
-
global $woocommerce;
|
| 130 |
-
|
| 131 |
-
$order = wc_get_order( $order_id );
|
| 132 |
-
$dues = WCV_Vendors::get_vendor_dues_from_order( $order, false );
|
| 133 |
-
|
| 134 |
-
foreach ( $dues as $vendor_id => $details ) {
|
| 135 |
-
|
| 136 |
-
// Only process vendor commission
|
| 137 |
-
if ( !WCV_Vendors::is_vendor( $vendor_id ) ) continue;
|
| 138 |
-
|
| 139 |
-
// See if they currently have an amount due
|
| 140 |
-
$due = WCV_Vendors::count_due_by_vendor( $vendor_id, $order_id );
|
| 141 |
-
if ( $due > 0 ) continue;
|
| 142 |
-
|
| 143 |
-
// Get the dues in an easy format for inserting to our table
|
| 144 |
-
$insert_due = array();
|
| 145 |
-
|
| 146 |
-
foreach ( $details as $key => $detail ) {
|
| 147 |
-
|
| 148 |
-
$product_id = $detail['product_id'];
|
| 149 |
-
$order_date = $order->get_date_created();
|
| 150 |
-
|
| 151 |
-
$insert_due[ $product_id ] = array(
|
| 152 |
-
'order_id' => $order_id,
|
| 153 |
-
'vendor_id' => $vendor_id,
|
| 154 |
-
'product_id' => $product_id,
|
| 155 |
-
'total_due' => !empty( $insert_due[ $product_id ][ 'total_due' ] ) ? ( $detail[ 'commission' ] + $insert_due[ $product_id ][ 'total_due' ] ) : $detail[ 'commission' ],
|
| 156 |
-
'total_shipping' => !empty( $insert_due[ $product_id ][ 'total_shipping' ] ) ? ( $detail[ 'shipping' ] + $insert_due[ $product_id ][ 'total_shipping' ] ) : $detail[ 'shipping' ],
|
| 157 |
-
'tax' => !empty( $insert_due[ $product_id ][ 'tax' ] ) ? ( $detail[ 'tax' ] + $insert_due[ $product_id ][ 'tax' ] ) : $detail[ 'tax' ],
|
| 158 |
-
'qty' => !empty( $insert_due[ $product_id ][ 'qty' ] ) ? ( $detail[ 'qty' ] + $insert_due[ $product_id ][ 'qty' ] ) : $detail[ 'qty' ],
|
| 159 |
-
'time' => date( 'Y-m-d H:i:s', strtotime( $order_date ) ),
|
| 160 |
-
);
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
if ( !empty( $insert_due ) ) {
|
| 164 |
-
WCV_Commission::insert_new_commission( array_values( $insert_due ) );
|
| 165 |
-
}
|
| 166 |
-
}
|
| 167 |
-
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
|
| 171 |
-
/**
|
| 172 |
-
* Add up the totals for an order for each vendor
|
| 173 |
-
*
|
| 174 |
-
* @param int $order_id
|
| 175 |
-
*
|
| 176 |
-
* @return array
|
| 177 |
-
*/
|
| 178 |
-
public static function sum_total_due_for_order( $order_id, $status = 'due' )
|
| 179 |
-
{
|
| 180 |
-
global $wpdb;
|
| 181 |
-
|
| 182 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 183 |
-
$query = "SELECT `id`, `total_due`, `total_shipping`, `tax`, `vendor_id`
|
| 184 |
-
FROM `{$table_name}`
|
| 185 |
-
WHERE `order_id` = %d
|
| 186 |
-
AND `status` = %s";
|
| 187 |
-
|
| 188 |
-
$results = $wpdb->get_results( $wpdb->prepare( $query, $order_id, 'due' ) );
|
| 189 |
-
|
| 190 |
-
foreach ( $results as $commission ) {
|
| 191 |
-
$commission_ids[ ] = $commission->id;
|
| 192 |
-
|
| 193 |
-
$pay[ $commission->vendor_id ] = !empty( $pay[ $commission->vendor_id ] )
|
| 194 |
-
? ( $pay[ $commission->vendor_id ] + ( $commission->total_due + $commission->total_shipping + $commission->tax ) )
|
| 195 |
-
: ( $commission->total_due + $commission->total_shipping + $commission->tax );
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
$return = array(
|
| 199 |
-
'vendors' => $pay,
|
| 200 |
-
'ids' => $commission_ids,
|
| 201 |
-
);
|
| 202 |
-
|
| 203 |
-
return $return;
|
| 204 |
-
}
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
/**
|
| 208 |
-
* Return all commission outstanding with a 'due' status
|
| 209 |
-
*
|
| 210 |
-
* @return object
|
| 211 |
-
*/
|
| 212 |
-
public static function get_all_due()
|
| 213 |
-
{
|
| 214 |
-
global $wpdb;
|
| 215 |
-
|
| 216 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 217 |
-
$where = $wpdb->prepare( 'WHERE status = %s', 'due' );
|
| 218 |
-
$where = apply_filters( 'wcvendors_commission_all_due_where', $where );
|
| 219 |
-
$query = "SELECT id, vendor_id, total_due FROM `{$table_name}` $where";
|
| 220 |
-
$query = apply_filters( 'wcvendors_commission_all_due_sql', $query );
|
| 221 |
-
$results = $wpdb->get_results( $query );
|
| 222 |
-
|
| 223 |
-
return $results;
|
| 224 |
-
}
|
| 225 |
-
|
| 226 |
-
|
| 227 |
-
/**
|
| 228 |
-
* Check if this order has commission logged already
|
| 229 |
-
*
|
| 230 |
-
* @param int $order_id
|
| 231 |
-
*
|
| 232 |
-
* @return int
|
| 233 |
-
*/
|
| 234 |
-
public static function count_commission_by_order( $order_id )
|
| 235 |
-
{
|
| 236 |
-
global $wpdb;
|
| 237 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 238 |
-
|
| 239 |
-
if ( is_array( $order_id ) )
|
| 240 |
-
$order_id = implode( ',', $order_id );
|
| 241 |
-
|
| 242 |
-
$query = "SELECT COUNT(order_id) AS order_count
|
| 243 |
-
FROM {$table_name}
|
| 244 |
-
WHERE order_id IN ($order_id)
|
| 245 |
-
AND status <> %s";
|
| 246 |
-
$count = $wpdb->get_var( $wpdb->prepare( $query, 'reversed' ) );
|
| 247 |
-
|
| 248 |
-
return $count;
|
| 249 |
-
}
|
| 250 |
-
|
| 251 |
-
/**
|
| 252 |
-
* Check the commission status for the order
|
| 253 |
-
*
|
| 254 |
-
* @param array $order
|
| 255 |
-
* @param string $status
|
| 256 |
-
*
|
| 257 |
-
* @return int
|
| 258 |
-
*/
|
| 259 |
-
public static function check_commission_status( $order, $status ) {
|
| 260 |
-
|
| 261 |
-
global $wpdb;
|
| 262 |
-
|
| 263 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 264 |
-
|
| 265 |
-
$order_id = $order[ 'order_id' ];
|
| 266 |
-
$vendor_id = $order[ 'vendor_id' ];
|
| 267 |
-
$product_id = $order[ 'product_id' ];
|
| 268 |
-
|
| 269 |
-
$query = "SELECT count(order_id) AS order_count
|
| 270 |
-
FROM {$table_name}
|
| 271 |
-
WHERE order_id = {$order_id}
|
| 272 |
-
AND vendor_id = {$vendor_id}
|
| 273 |
-
AND product_id = {$product_id}
|
| 274 |
-
AND status = %s
|
| 275 |
-
";
|
| 276 |
-
|
| 277 |
-
return $wpdb->get_var( $wpdb->prepare( $query , $status ) );
|
| 278 |
-
|
| 279 |
-
}
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
/**
|
| 283 |
-
* Product's commission rate in percentage form
|
| 284 |
-
*
|
| 285 |
-
* Eg: 50 for 50%
|
| 286 |
-
*
|
| 287 |
-
* @param int $product_id
|
| 288 |
-
*
|
| 289 |
-
* @return float
|
| 290 |
-
*/
|
| 291 |
-
public static function get_commission_rate( $product_id )
|
| 292 |
-
{
|
| 293 |
-
|
| 294 |
-
$commission = 0;
|
| 295 |
-
|
| 296 |
-
$parent = get_post_ancestors( $product_id );
|
| 297 |
-
if ( $parent ) $product_id = $parent[ 0 ];
|
| 298 |
-
|
| 299 |
-
$vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 300 |
-
|
| 301 |
-
$product_commission = get_post_meta( $product_id, 'pv_commission_rate', true );
|
| 302 |
-
$vendor_commission = WCV_Vendors::get_default_commission( $vendor_id );
|
| 303 |
-
$default_commission = get_option( 'wcvendors_commission_percent' );
|
| 304 |
-
|
| 305 |
-
if ( $product_commission != '' && $product_commission !== false ) {
|
| 306 |
-
$commission = $product_commission;
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
else if ( $vendor_commission != '' && $vendor_commission !== false ) {
|
| 310 |
-
$commission = $vendor_commission;
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
else if ( $default_commission != '' && $default_commission !== false ) {
|
| 314 |
-
$commission = $default_commission;
|
| 315 |
-
}
|
| 316 |
-
|
| 317 |
-
return apply_filters( 'wcv_commission_rate_percent', $commission, $product_id );
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
|
| 321 |
-
/**
|
| 322 |
-
* Commission due for a product based on a rate and price
|
| 323 |
-
*
|
| 324 |
-
* @param float $product_price
|
| 325 |
-
* @param unknown $product_id
|
| 326 |
-
*
|
| 327 |
-
* @return float
|
| 328 |
-
*/
|
| 329 |
-
public static function calculate_commission( $product_price, $product_id, $order, $qty )
|
| 330 |
-
{
|
| 331 |
-
$commission_rate = WCV_Commission::get_commission_rate( $product_id );
|
| 332 |
-
$commission = $product_price * ( $commission_rate / 100 );
|
| 333 |
-
$commission = round( $commission, 2 );
|
| 334 |
-
|
| 335 |
-
return apply_filters( 'wcv_commission_rate', $commission, $product_id, $product_price, $order, $qty );
|
| 336 |
-
}
|
| 337 |
-
|
| 338 |
-
|
| 339 |
-
/**
|
| 340 |
-
* Log commission to the pv_commission table
|
| 341 |
-
*
|
| 342 |
-
* Will either update or insert to the database
|
| 343 |
-
*
|
| 344 |
-
* @param array $orders
|
| 345 |
-
*
|
| 346 |
-
* @return unknown
|
| 347 |
-
*/
|
| 348 |
-
public static function insert_new_commission( $orders = array() )
|
| 349 |
-
{
|
| 350 |
-
global $wpdb;
|
| 351 |
-
|
| 352 |
-
if ( empty( $orders ) ) return false;
|
| 353 |
-
|
| 354 |
-
$table = $wpdb->prefix . "pv_commission";
|
| 355 |
-
|
| 356 |
-
// Insert the time and default status 'due'
|
| 357 |
-
foreach ( $orders as $key => $order ) {
|
| 358 |
-
$orders[ $key ][ 'time' ] = $order['time'];
|
| 359 |
-
$orders[ $key ][ 'status' ] = ( $order['total_due'] == 0 ) ? 'paid' : 'due';
|
| 360 |
-
}
|
| 361 |
-
|
| 362 |
-
foreach ( $orders as $key => $order ) {
|
| 363 |
-
$where = array(
|
| 364 |
-
'order_id' => $order[ 'order_id' ],
|
| 365 |
-
'product_id' => $order[ 'product_id' ],
|
| 366 |
-
'vendor_id' => $order[ 'vendor_id' ],
|
| 367 |
-
'qty' => $order[ 'qty' ],
|
| 368 |
-
);
|
| 369 |
-
// Is the commission already paid?
|
| 370 |
-
$count = WCV_Commission::check_commission_status( $order, 'paid' );
|
| 371 |
-
|
| 372 |
-
if ( $count == 0 ) {
|
| 373 |
-
$update = $wpdb->update( $table, $order, $where );
|
| 374 |
-
if ( !$update ) $insert = $wpdb->insert( $table, $order );
|
| 375 |
-
}
|
| 376 |
-
|
| 377 |
-
}
|
| 378 |
-
|
| 379 |
-
do_action( 'wcv_commissions_inserted', $orders );
|
| 380 |
-
}
|
| 381 |
-
|
| 382 |
-
|
| 383 |
-
/**
|
| 384 |
-
* Set commission to 'paid' for an entire order
|
| 385 |
-
*
|
| 386 |
-
*
|
| 387 |
-
* @access public
|
| 388 |
-
*
|
| 389 |
-
* @param mixed $order_id An array of Order IDs or an int.
|
| 390 |
-
* @param unknown $column_ids (optional)
|
| 391 |
-
*
|
| 392 |
-
* @return bool.
|
| 393 |
-
*/
|
| 394 |
-
public static function set_order_commission_paid( $order_id, $column_ids = false )
|
| 395 |
-
{
|
| 396 |
-
global $wpdb;
|
| 397 |
-
|
| 398 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 399 |
-
|
| 400 |
-
if ( is_array( $order_id ) )
|
| 401 |
-
$order_id = implode( ',', $order_id );
|
| 402 |
-
|
| 403 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE order_id IN ($order_id)";
|
| 404 |
-
$result = $wpdb->query( $query );
|
| 405 |
-
|
| 406 |
-
return $result;
|
| 407 |
-
}
|
| 408 |
-
|
| 409 |
-
|
| 410 |
-
/**
|
| 411 |
-
* Set commission to 'paid' for an entire order
|
| 412 |
-
*
|
| 413 |
-
*
|
| 414 |
-
* @access public
|
| 415 |
-
*
|
| 416 |
-
* @param mixed $order_id An array of Order IDs or an int.
|
| 417 |
-
*
|
| 418 |
-
* @return bool.
|
| 419 |
-
*/
|
| 420 |
-
public static function set_vendor_commission_paid( $vendors )
|
| 421 |
-
{
|
| 422 |
-
global $wpdb;
|
| 423 |
-
|
| 424 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 425 |
-
|
| 426 |
-
if ( is_array( $vendors ) )
|
| 427 |
-
$vendors = implode( ',', $vendors );
|
| 428 |
-
|
| 429 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE vendor_id IN ($vendors)";
|
| 430 |
-
$result = $wpdb->query( $query );
|
| 431 |
-
|
| 432 |
-
return $result;
|
| 433 |
-
}
|
| 434 |
-
|
| 435 |
-
|
| 436 |
-
/**
|
| 437 |
-
* Set commission to 'paid' for a specifc vendor
|
| 438 |
-
*
|
| 439 |
-
*
|
| 440 |
-
* @access public
|
| 441 |
-
*
|
| 442 |
-
* @param int $vendor_id the vendor id
|
| 443 |
-
* @param int $product_id the product id
|
| 444 |
-
* @param int $order_id the order id
|
| 445 |
-
*
|
| 446 |
-
* @return bool.
|
| 447 |
-
*/
|
| 448 |
-
public static function set_vendor_product_commission_paid( $vendor_id, $product_id, $order_id )
|
| 449 |
-
{
|
| 450 |
-
global $wpdb;
|
| 451 |
-
|
| 452 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 453 |
-
|
| 454 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE vendor_id = $vendor_id AND order_id = $order_id AND product_id = $product_id";
|
| 455 |
-
$result = $wpdb->query( $query );
|
| 456 |
-
|
| 457 |
-
return $result;
|
| 458 |
-
}
|
| 459 |
-
|
| 460 |
-
/**
|
| 461 |
-
* If an order is deleted reverse the commissions rows
|
| 462 |
-
*
|
| 463 |
-
* @since 1.9.2
|
| 464 |
-
* @version 1.9.13
|
| 465 |
-
* @access public
|
| 466 |
-
* @param int $order_id the order id
|
| 467 |
-
*
|
| 468 |
-
* @return bool.
|
| 469 |
-
*/
|
| 470 |
-
public function commissions_table_sync( $order_id ){
|
| 471 |
-
|
| 472 |
-
global $wpdb;
|
| 473 |
-
|
| 474 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 475 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'reversed' WHERE `order_id` = %d";
|
| 476 |
-
$results = $wpdb->query( $wpdb->prepare( $query, $order_id ) );
|
| 477 |
-
|
| 478 |
-
} // commissions_table_sync()
|
| 479 |
-
|
| 480 |
-
|
| 481 |
-
/**
|
| 482 |
-
* Get the commission total for a specific vendor.
|
| 483 |
-
*
|
| 484 |
-
* @since 1.9.6
|
| 485 |
-
* @access public
|
| 486 |
-
* @param int $vendor_id the vendor id to search for
|
| 487 |
-
* @param string $status the status to look for
|
| 488 |
-
* @return object $totals as an object
|
| 489 |
-
*/
|
| 490 |
-
public static function commissions_now( $vendor_id, $status = 'due', $inc_shipping = false, $inc_tax = false ){
|
| 491 |
-
|
| 492 |
-
global $wpdb;
|
| 493 |
-
|
| 494 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 495 |
-
|
| 496 |
-
$sql = "SELECT sum( `total_due` ) as total_due";
|
| 497 |
-
|
| 498 |
-
if ( $inc_shipping ) $sql .= ", sum( `total_shipping` ) as total_shipping";
|
| 499 |
-
if ( $inc_tax ) $sql .= ", sum( `tax` ) as total_tax ";
|
| 500 |
-
|
| 501 |
-
$sql .= "
|
| 502 |
-
FROM `{$table_name}`
|
| 503 |
-
WHERE vendor_id = {$vendor_id}
|
| 504 |
-
AND status = '{$status}'
|
| 505 |
-
";
|
| 506 |
-
|
| 507 |
-
$results = $wpdb->get_row( $sql );
|
| 508 |
-
|
| 509 |
-
$commissions_now = array_filter( get_object_vars( $results ) );
|
| 510 |
-
|
| 511 |
-
if ( empty( $commissions_now ) ) $results = false;
|
| 512 |
-
|
| 513 |
-
return $results;
|
| 514 |
-
|
| 515 |
-
} // commissions_now()
|
| 516 |
-
|
| 517 |
-
|
| 518 |
-
/**
|
| 519 |
-
* Get the commission for a specific order, product and vendor
|
| 520 |
-
*
|
| 521 |
-
* @since 1.9.9
|
| 522 |
-
* @access public
|
| 523 |
-
* @param int $order_id the order id to search for
|
| 524 |
-
* @param int $product_id the product id to search for
|
| 525 |
-
* @param int $vendor_id the vendor id to search for
|
| 526 |
-
*/
|
| 527 |
-
public static function get_commission_due( $order_id, $product_id, $vendor_id ){
|
| 528 |
-
|
| 529 |
-
global $wpdb;
|
| 530 |
-
|
| 531 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 532 |
-
|
| 533 |
-
$sql = "SELECT total_due";
|
| 534 |
-
|
| 535 |
-
$sql .= "
|
| 536 |
-
FROM `{$table_name}`
|
| 537 |
-
WHERE vendor_id = {$vendor_id}
|
| 538 |
-
AND product_id = '{$product_id}'
|
| 539 |
-
AND order_id = '{$order_id}'
|
| 540 |
-
";
|
| 541 |
-
|
| 542 |
-
$commission_due = $wpdb->get_var( $sql );
|
| 543 |
-
|
| 544 |
-
return $commission_due;
|
| 545 |
-
|
| 546 |
-
} // get_commission_due()
|
| 547 |
-
|
| 548 |
-
|
| 549 |
-
/**
|
| 550 |
-
* Get the total due for all commissions
|
| 551 |
-
*
|
| 552 |
-
* @since 2.0.0
|
| 553 |
-
* @access public
|
| 554 |
-
*/
|
| 555 |
-
public static function get_totals( $status = 'due' ){
|
| 556 |
-
|
| 557 |
-
$total_due = 0;
|
| 558 |
-
|
| 559 |
-
global $wpdb;
|
| 560 |
-
|
| 561 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 562 |
-
$query = "SELECT sum(total_due + total_shipping + tax) as total
|
| 563 |
-
FROM `{$table_name}`
|
| 564 |
-
WHERE status = %s";
|
| 565 |
-
$results = $wpdb->get_results( $wpdb->prepare( $query, $status ) );
|
| 566 |
-
|
| 567 |
-
$totals = array_shift( $results )->total;
|
| 568 |
-
|
| 569 |
-
return $totals;
|
| 570 |
-
|
| 571 |
-
}
|
| 572 |
-
|
| 573 |
-
/*
|
| 574 |
-
* Get the summed total for each vendor based on the status
|
| 575 |
-
* @since 2.0.3
|
| 576 |
-
* @access public
|
| 577 |
-
*/
|
| 578 |
-
public static function get_sum_vendor_totals(){
|
| 579 |
-
|
| 580 |
-
global $wpdb;
|
| 581 |
-
|
| 582 |
-
$due = array();
|
| 583 |
-
$paid = array();
|
| 584 |
-
$reversed = array();
|
| 585 |
-
|
| 586 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 587 |
-
$query = "SELECT `id`, `total_due`, `total_shipping`, `tax`, `vendor_id`, `status`
|
| 588 |
-
FROM `{$table_name}`";
|
| 589 |
-
|
| 590 |
-
$results = $wpdb->get_results( $query );
|
| 591 |
-
|
| 592 |
-
foreach ( $results as $commission ) {
|
| 593 |
-
|
| 594 |
-
switch ( $commission->status ) {
|
| 595 |
-
case 'due':
|
| 596 |
-
$due[ $commission->vendor_id ] = !empty( $due[ $commission->vendor_id ] ) ? ( $due[ $commission->vendor_id ] + ( $commission->total_due + $commission->total_shipping + $commission->tax ) ) : ( $commission->total_due + $commission->total_shipping + $commission->tax );
|
| 597 |
-
break;
|
| 598 |
-
case 'paid':
|
| 599 |
-
$paid[ $commission->vendor_id ] = !empty( $paid[ $commission->vendor_id ] ) ? ( $paid[ $commission->vendor_id ] + ( $commission->total_due + $commission->total_shipping + $commission->tax ) ) : ( $commission->total_due + $commission->total_shipping + $commission->tax );
|
| 600 |
-
break;
|
| 601 |
-
case 'reversed':
|
| 602 |
-
$reversed[ $commission->vendor_id ] = !empty( $reversed[ $commission->vendor_id ] ) ? ( $reversed[ $commission->vendor_id ] + ( $commission->total_due + $commission->total_shipping + $commission->tax ) ) : ( $commission->total_due + $commission->total_shipping + $commission->tax );
|
| 603 |
-
break;
|
| 604 |
-
default:
|
| 605 |
-
# code...
|
| 606 |
-
break;
|
| 607 |
-
}
|
| 608 |
-
}
|
| 609 |
-
|
| 610 |
-
$sum_totals = array(
|
| 611 |
-
'due' => $due,
|
| 612 |
-
'paid' => $paid,
|
| 613 |
-
'reversed' => $reversed
|
| 614 |
-
);
|
| 615 |
-
|
| 616 |
-
return $sum_totals;
|
| 617 |
-
|
| 618 |
-
}
|
| 619 |
-
|
| 620 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/class-cron.php
DELETED
|
@@ -1,171 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Cron class
|
| 4 |
-
*
|
| 5 |
-
* @package WC_Vendors
|
| 6 |
-
*/
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
class WCV_Cron
|
| 10 |
-
{
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* Constructor
|
| 15 |
-
*/
|
| 16 |
-
function __construct()
|
| 17 |
-
{
|
| 18 |
-
add_filter( 'cron_schedules', array( 'WCV_Cron', 'custom_cron_intervals' ) );
|
| 19 |
-
add_action( WC_Vendors::$id . '_options_updated', array( 'WCV_Cron', 'check_schedule' ) );
|
| 20 |
-
add_filter( WC_Vendors::$id . '_options_on_update', array( 'WCV_Cron', 'check_schedule_now' ) );
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Re-add cron schedule when the settings have been updated
|
| 26 |
-
*
|
| 27 |
-
* @param array
|
| 28 |
-
* @param unknown $options
|
| 29 |
-
*/
|
| 30 |
-
public static function check_schedule( $options )
|
| 31 |
-
{
|
| 32 |
-
$old_interval = wp_get_schedule( 'pv_schedule_mass_payments' );
|
| 33 |
-
$new_interval = $options[ 'schedule' ];
|
| 34 |
-
$instapay = $options[ 'instapay' ];
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* 1. The user actually changed the schedule
|
| 38 |
-
* 2. Instapay is turned off
|
| 39 |
-
* 3. Manual was not selected
|
| 40 |
-
*/
|
| 41 |
-
if ( ( $old_interval != $new_interval ) && !$instapay && $new_interval != 'manual' ) {
|
| 42 |
-
WCV_Cron::remove_cron_schedule( $options );
|
| 43 |
-
WCV_Cron::schedule_cron( $new_interval );
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
if ( $new_interval == 'manual' || $instapay ) {
|
| 47 |
-
WCV_Cron::remove_cron_schedule( $options );
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
/**
|
| 54 |
-
* Check if the user chose "Now" on the Schedule settings
|
| 55 |
-
*
|
| 56 |
-
* @param array $options
|
| 57 |
-
*
|
| 58 |
-
* @return array
|
| 59 |
-
*/
|
| 60 |
-
public static function check_schedule_now( $options )
|
| 61 |
-
{
|
| 62 |
-
$old_schedule = get_option( 'wcvendors_payments_paypal_schedule' );
|
| 63 |
-
$new_schedule = $options[ 'schedule' ];
|
| 64 |
-
|
| 65 |
-
if ( $new_schedule == 'now' ) {
|
| 66 |
-
$return = WCV_Cron::pay_now();
|
| 67 |
-
$options[ 'schedule' ] = $old_schedule;
|
| 68 |
-
WCV_Cron::schedule_cron( $old_schedule );
|
| 69 |
-
add_settings_error( WC_Vendors::$pv_options->id, 'save_options', $return[ 'message' ], $return[ 'status' ] );
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
return $options;
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
/**
|
| 77 |
-
* Pay all outstanding commission using Paypal Mass Pay
|
| 78 |
-
*
|
| 79 |
-
* @return array
|
| 80 |
-
*/
|
| 81 |
-
public static function pay_now()
|
| 82 |
-
{
|
| 83 |
-
$mass_pay = new WCV_Mass_Pay;
|
| 84 |
-
$mass_pay = $mass_pay->do_payments();
|
| 85 |
-
|
| 86 |
-
$message = !empty( $mass_pay[ 'total' ] )
|
| 87 |
-
? $mass_pay[ 'msg' ] . '<br/>' . sprintf( __( 'Payment total: %s', 'wc-vendors' ), wc_price( $mass_pay[ 'total' ] ) )
|
| 88 |
-
: $mass_pay[ 'msg' ];
|
| 89 |
-
|
| 90 |
-
return array(
|
| 91 |
-
'message' => $message,
|
| 92 |
-
'status' => $mass_pay[ 'status' ]
|
| 93 |
-
);
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
/**
|
| 98 |
-
* Remove the mass payments schedule
|
| 99 |
-
*
|
| 100 |
-
* @return bool
|
| 101 |
-
*/
|
| 102 |
-
private static function remove_cron_schedule()
|
| 103 |
-
{
|
| 104 |
-
$timestamp = wp_next_scheduled( 'pv_schedule_mass_payments' );
|
| 105 |
-
|
| 106 |
-
return wp_unschedule_event( $timestamp, 'pv_schedule_mass_payments' );
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
/**
|
| 111 |
-
* Schedule a cron event on a specified interval
|
| 112 |
-
*
|
| 113 |
-
* @param string $interval
|
| 114 |
-
*
|
| 115 |
-
* @return bool
|
| 116 |
-
*/
|
| 117 |
-
public static function schedule_cron( $interval )
|
| 118 |
-
{
|
| 119 |
-
// Scheduled event
|
| 120 |
-
add_action( 'pv_schedule_mass_payments', array( 'WCV_Cron', 'pay_now' ) );
|
| 121 |
-
|
| 122 |
-
// Schedule the event
|
| 123 |
-
if ( !wp_next_scheduled( 'pv_schedule_mass_payments' ) ) {
|
| 124 |
-
wp_schedule_event( time(), $interval, 'pv_schedule_mass_payments' );
|
| 125 |
-
|
| 126 |
-
return true;
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
return false;
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
/**
|
| 134 |
-
* Add new schedule intervals to WP
|
| 135 |
-
*
|
| 136 |
-
* Weekly
|
| 137 |
-
* Biweekly
|
| 138 |
-
* Monthly
|
| 139 |
-
*
|
| 140 |
-
* @param array $schedules
|
| 141 |
-
*
|
| 142 |
-
* @return array
|
| 143 |
-
*/
|
| 144 |
-
public static function custom_cron_intervals( $schedules )
|
| 145 |
-
{
|
| 146 |
-
|
| 147 |
-
$schedules[ 'daily' ] = array(
|
| 148 |
-
'interval' => 86400,
|
| 149 |
-
'display' => __( 'Once Daily' )
|
| 150 |
-
);
|
| 151 |
-
|
| 152 |
-
$schedules[ 'weekly' ] = array(
|
| 153 |
-
'interval' => 604800,
|
| 154 |
-
'display' => __( 'Once Weekly' )
|
| 155 |
-
);
|
| 156 |
-
|
| 157 |
-
$schedules[ 'biweekly' ] = array(
|
| 158 |
-
'interval' => 1209600,
|
| 159 |
-
'display' => __( 'Once every two weeks' )
|
| 160 |
-
);
|
| 161 |
-
|
| 162 |
-
$schedules[ 'monthly' ] = array(
|
| 163 |
-
'interval' => 2635200,
|
| 164 |
-
'display' => __( 'Once a month' )
|
| 165 |
-
);
|
| 166 |
-
|
| 167 |
-
return $schedules;
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
|
| 171 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/class-install.php
DELETED
|
@@ -1,451 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Install class on activation.
|
| 4 |
-
*
|
| 5 |
-
* @author Jamie Madden
|
| 6 |
-
* @package WCVendors
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
class WCVendors_Install {
|
| 11 |
-
|
| 12 |
-
/** Updates to be run **/
|
| 13 |
-
private static $db_updates = array(
|
| 14 |
-
'2.0.0' => array(
|
| 15 |
-
'wcv_migrate_settings',
|
| 16 |
-
'wcv_update_200_db_version',
|
| 17 |
-
'wcv_enable_legacy_emails'
|
| 18 |
-
),
|
| 19 |
-
'2.0.3' => array(
|
| 20 |
-
'wcv_update_203_db_version',
|
| 21 |
-
)
|
| 22 |
-
);
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
/**
|
| 26 |
-
* Background update class.
|
| 27 |
-
*
|
| 28 |
-
* @var object
|
| 29 |
-
*/
|
| 30 |
-
private static $background_updater;
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Checks if install is requierd
|
| 34 |
-
*
|
| 35 |
-
* @return unknown
|
| 36 |
-
*/
|
| 37 |
-
public static function init() {
|
| 38 |
-
|
| 39 |
-
add_action( 'init', array( __CLASS__, 'check_version' ) );
|
| 40 |
-
add_action( 'admin_init', array( __CLASS__, 'check_pro_version' ) );
|
| 41 |
-
add_action( 'init', array( __CLASS__, 'init_background_updater' ), 5 );
|
| 42 |
-
add_action( 'admin_init', array( __CLASS__, 'install_actions' ) );
|
| 43 |
-
add_filter( 'plugin_row_meta', array( __CLASS__, 'plugin_row_meta' ), 10, 2 );
|
| 44 |
-
add_filter( 'plugin_action_links_' . wcv_plugin_base, array( __CLASS__, 'plugin_action_links' ) );
|
| 45 |
-
add_action( 'wcvendors_update_options_display', array( __CLASS__, 'maybe_flush_rewrite_rules' ) );
|
| 46 |
-
|
| 47 |
-
} // init()
|
| 48 |
-
|
| 49 |
-
/**
|
| 50 |
-
* Check WC Vendors version and run the updater if required.
|
| 51 |
-
*
|
| 52 |
-
* This check is done on all requests and runs if the versions do not match.
|
| 53 |
-
*/
|
| 54 |
-
public static function check_version() {
|
| 55 |
-
global $wc_vendors;
|
| 56 |
-
if ( ! defined( 'IFRAME_REQUEST' ) && get_option( 'wcvendors_version' ) !== $wc_vendors->version ) {
|
| 57 |
-
self::install();
|
| 58 |
-
do_action( 'wcvendors_updated' );
|
| 59 |
-
}
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
/**
|
| 63 |
-
* Check WC Vendors version and run the updater is required.
|
| 64 |
-
*
|
| 65 |
-
* This check is done on all requests and runs if the versions do not match.
|
| 66 |
-
*/
|
| 67 |
-
public static function check_pro_version() {
|
| 68 |
-
|
| 69 |
-
if ( class_exists( 'WCVendors_Pro' ) ){
|
| 70 |
-
|
| 71 |
-
if ( version_compare( WCV_PRO_VERSION, '1.5.0', '<' ) ){
|
| 72 |
-
|
| 73 |
-
if ( is_plugin_active( 'wc-vendors-pro/wcvendors-pro.php' ) ){
|
| 74 |
-
$notice = sprintf( __( 'WC Vendors Pro %s or below detected. WC Vendors Pro 1.5.0 is required for WC Vendors 2.0.0 and above. WC Vendors Pro has been deactivated.' ), WCV_PRO_VERSION );
|
| 75 |
-
WCVendors_Admin_Notices::add_custom_notice( 'pro_update', $notice );
|
| 76 |
-
deactivate_plugins( 'wc-vendors-pro/wcvendors-pro.php' );
|
| 77 |
-
}
|
| 78 |
-
}
|
| 79 |
-
}
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
/**
|
| 83 |
-
* Install actions when a update button is clicked within the admin area.
|
| 84 |
-
*
|
| 85 |
-
* This function is hooked into admin_init to affect admin only.
|
| 86 |
-
*/
|
| 87 |
-
public static function install_actions() {
|
| 88 |
-
if ( ! empty( $_GET['do_update_wcvendors'] ) ) {
|
| 89 |
-
self::update();
|
| 90 |
-
WCVendors_Admin_Notices::add_notice( 'update' );
|
| 91 |
-
}
|
| 92 |
-
if ( ! empty( $_GET['force_update_wcvendors'] ) ) {
|
| 93 |
-
self::update();
|
| 94 |
-
wp_safe_redirect( admin_url( 'admin.php?page=wcv-settings' ) );
|
| 95 |
-
exit;
|
| 96 |
-
}
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
/**
|
| 101 |
-
* Grouped functions for installing the WC Vendor plugin
|
| 102 |
-
*/
|
| 103 |
-
public static function install() {
|
| 104 |
-
|
| 105 |
-
// Check if we are not already running this routine.
|
| 106 |
-
if ( 'yes' === get_transient( 'wcvendors_installing' ) ) {
|
| 107 |
-
return;
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
// Ensure needed classes are loaded
|
| 111 |
-
include_once( dirname( __FILE__ ) . '/admin/class-wcv-admin-notices.php' );
|
| 112 |
-
|
| 113 |
-
// If we made it till here nothing is running yet, lets set the transient now.
|
| 114 |
-
set_transient( 'wcvendors_installing', 'yes', MINUTE_IN_SECONDS * 10 );
|
| 115 |
-
wc_maybe_define_constant( 'WCV_INSTALLING', true );
|
| 116 |
-
|
| 117 |
-
// Clear the cron
|
| 118 |
-
wp_clear_scheduled_hook( 'pv_schedule_mass_payments' );
|
| 119 |
-
|
| 120 |
-
self::remove_admin_notices();
|
| 121 |
-
self::create_roles();
|
| 122 |
-
self::create_tables();
|
| 123 |
-
self::create_options();
|
| 124 |
-
self::maybe_run_setup_wizard();
|
| 125 |
-
self::update_wcv_version();
|
| 126 |
-
self::maybe_update_db_version();
|
| 127 |
-
|
| 128 |
-
delete_transient( 'wcvendors_installing' );
|
| 129 |
-
|
| 130 |
-
do_action( 'wcvendors_flush_rewrite_rules' );
|
| 131 |
-
do_action( 'wcvendors_installed' );
|
| 132 |
-
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
/**
|
| 136 |
-
* Add the new Vendor role
|
| 137 |
-
*
|
| 138 |
-
* @return bool
|
| 139 |
-
*/
|
| 140 |
-
public static function create_roles() {
|
| 141 |
-
|
| 142 |
-
remove_role( 'pending_vendor' );
|
| 143 |
-
add_role( 'pending_vendor', __( 'Pending Vendor', 'wc-vendors' ), array(
|
| 144 |
-
'read' => true,
|
| 145 |
-
'edit_posts' => false,
|
| 146 |
-
'delete_posts' => false
|
| 147 |
-
) );
|
| 148 |
-
|
| 149 |
-
remove_role( 'vendor' );
|
| 150 |
-
add_role( 'vendor', __( 'Vendor', 'wc-vendors') , array(
|
| 151 |
-
'assign_product_terms' => true,
|
| 152 |
-
'edit_products' => true,
|
| 153 |
-
'edit_product' => true,
|
| 154 |
-
'edit_published_products' => false,
|
| 155 |
-
'manage_product' => true,
|
| 156 |
-
'publish_products' => false,
|
| 157 |
-
'delete_posts' => true,
|
| 158 |
-
'read' => true,
|
| 159 |
-
'import' => true,
|
| 160 |
-
'upload_files' => true,
|
| 161 |
-
'view_woocommerce_reports' => false,
|
| 162 |
-
) );
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
|
| 166 |
-
/**
|
| 167 |
-
* Create the pv_commission table
|
| 168 |
-
*/
|
| 169 |
-
public static function create_tables() {
|
| 170 |
-
global $wpdb;
|
| 171 |
-
|
| 172 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 173 |
-
require_once ABSPATH . 'wp-admin/includes/upgrade.php';
|
| 174 |
-
|
| 175 |
-
$sql = "CREATE TABLE $table_name (
|
| 176 |
-
id bigint(20) NOT NULL AUTO_INCREMENT,
|
| 177 |
-
product_id bigint(20) NOT NULL,
|
| 178 |
-
order_id bigint(20) NOT NULL,
|
| 179 |
-
vendor_id bigint(20) NOT NULL,
|
| 180 |
-
total_due decimal(20,2) NOT NULL,
|
| 181 |
-
qty BIGINT( 20 ) NOT NULL,
|
| 182 |
-
total_shipping decimal(20,2) NOT NULL,
|
| 183 |
-
tax decimal(20,2) NOT NULL,
|
| 184 |
-
status varchar(20) NOT NULL DEFAULT 'due',
|
| 185 |
-
time datetime DEFAULT '0000-00-00 00:00:00' NOT NULL,
|
| 186 |
-
UNIQUE KEY id (id)
|
| 187 |
-
);";
|
| 188 |
-
|
| 189 |
-
dbDelta( $sql );
|
| 190 |
-
}
|
| 191 |
-
|
| 192 |
-
/**
|
| 193 |
-
* Create pages that the plugin relies on, storing page IDs in variables.
|
| 194 |
-
*/
|
| 195 |
-
public static function create_pages() {
|
| 196 |
-
|
| 197 |
-
$vendor_dashboard_page_id = wc_create_page(
|
| 198 |
-
esc_sql( _x( 'vendor_dashboard', 'Page slug', 'wc-vendors' ) ),
|
| 199 |
-
'wcvendors_vendor_dashboard_page_id',
|
| 200 |
-
sprintf( _x( '%s Dashboard', 'Page title', 'wc-vendors' ), wcv_get_vendor_name( true ) ),
|
| 201 |
-
'[wcv_vendor_dashboard]',
|
| 202 |
-
''
|
| 203 |
-
);
|
| 204 |
-
|
| 205 |
-
$vendor_page_id = wc_create_page(
|
| 206 |
-
esc_sql( _x( 'vendors', 'Page slug', 'wc-vendors' ) ),
|
| 207 |
-
'wcvendors_vendors_page_id',
|
| 208 |
-
sprintf( _x( '%s', 'Page title', 'wc-vendors' ), wcv_get_vendor_name( false ) ),
|
| 209 |
-
'[wcv_vendorslist]',
|
| 210 |
-
''
|
| 211 |
-
);
|
| 212 |
-
|
| 213 |
-
$pages = apply_filters(
|
| 214 |
-
'wcvendors_create_pages', array(
|
| 215 |
-
'shop_settings' => array(
|
| 216 |
-
'name' => _x( 'shop_settings', 'Page slug', 'wc-vendors' ),
|
| 217 |
-
'title' => _x( 'Shop Settings', 'Page title', 'wc-vendors' ),
|
| 218 |
-
'parent' => $vendor_dashboard_page_id,
|
| 219 |
-
'content' => '[wcv_shop_settings]',
|
| 220 |
-
),
|
| 221 |
-
'product_orders' => array(
|
| 222 |
-
'name' => _x( 'product_orders', 'Page slug', 'wc-vendors' ),
|
| 223 |
-
'title' => _x( 'Orders', 'Page title', 'wc-vendors' ),
|
| 224 |
-
'parent' => $vendor_dashboard_page_id,
|
| 225 |
-
'content' => '[wcv_orders]',
|
| 226 |
-
),
|
| 227 |
-
)
|
| 228 |
-
);
|
| 229 |
-
|
| 230 |
-
foreach ( $pages as $key => $page ) {
|
| 231 |
-
wc_create_page( esc_sql( $page['name'] ), 'wcvendors_' . $key . '_page_id', $page['title'], $page['content'], ! empty( $page['parent'] ) ? $page['parent'] : '' );
|
| 232 |
-
}
|
| 233 |
-
}
|
| 234 |
-
|
| 235 |
-
/**
|
| 236 |
-
* Reset any notices added to admin.
|
| 237 |
-
*
|
| 238 |
-
* @since 2.0.0
|
| 239 |
-
*/
|
| 240 |
-
private static function remove_admin_notices() {
|
| 241 |
-
WCVendors_Admin_Notices::remove_all_notices();
|
| 242 |
-
}
|
| 243 |
-
|
| 244 |
-
|
| 245 |
-
/**
|
| 246 |
-
* Is this a brand new WC install?
|
| 247 |
-
*
|
| 248 |
-
* @since 2.0.0
|
| 249 |
-
* @return boolean
|
| 250 |
-
*/
|
| 251 |
-
public static function is_new_install() {
|
| 252 |
-
return is_null( get_option( 'wcvendors_version', null ) ) && is_null( get_option( 'wcvendors_db_version', null ) ) && is_null( get_option( 'wc_prd_vendor_options', null ) );
|
| 253 |
-
}
|
| 254 |
-
|
| 255 |
-
/**
|
| 256 |
-
* See if we need the wizard or not.
|
| 257 |
-
*
|
| 258 |
-
* @since 2.0.0
|
| 259 |
-
*/
|
| 260 |
-
public static function maybe_run_setup_wizard() {
|
| 261 |
-
if ( apply_filters( 'wcvendors_enable_setup_wizard', self::is_new_install() ) ) {
|
| 262 |
-
WCVendors_Admin_Notices::add_notice( 'install' );
|
| 263 |
-
}
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
/**
|
| 268 |
-
* Get list of DB update callbacks.
|
| 269 |
-
*
|
| 270 |
-
* @since 2.0.0
|
| 271 |
-
* @return array
|
| 272 |
-
*/
|
| 273 |
-
public static function get_db_update_callbacks() {
|
| 274 |
-
return self::$db_updates;
|
| 275 |
-
}
|
| 276 |
-
|
| 277 |
-
/**
|
| 278 |
-
* Is a DB update needed?
|
| 279 |
-
*
|
| 280 |
-
* @since 2.0.0
|
| 281 |
-
* @return boolean
|
| 282 |
-
*/
|
| 283 |
-
private static function needs_db_update() {
|
| 284 |
-
$current_db_version = get_option( 'wcvendors_db_version', null );
|
| 285 |
-
$version_one = get_option( 'wc_prd_vendor_options', null );
|
| 286 |
-
$updates = self::get_db_update_callbacks();
|
| 287 |
-
|
| 288 |
-
if ( ! is_null( $version_one ) && is_null( $current_db_version ) ){
|
| 289 |
-
return true;
|
| 290 |
-
} else {
|
| 291 |
-
return ! is_null( $current_db_version ) && version_compare( $current_db_version, max( array_keys( $updates ) ), '<' );
|
| 292 |
-
}
|
| 293 |
-
|
| 294 |
-
}
|
| 295 |
-
|
| 296 |
-
/**
|
| 297 |
-
* Init background updates
|
| 298 |
-
*/
|
| 299 |
-
public static function init_background_updater() {
|
| 300 |
-
self::$background_updater = new WC_Background_Updater();
|
| 301 |
-
}
|
| 302 |
-
|
| 303 |
-
|
| 304 |
-
|
| 305 |
-
/**
|
| 306 |
-
* See if we need to show or run database updates during install.
|
| 307 |
-
*
|
| 308 |
-
* @since 2.0.0
|
| 309 |
-
*/
|
| 310 |
-
private static function maybe_update_db_version() {
|
| 311 |
-
if ( self::needs_db_update() ) {
|
| 312 |
-
if ( apply_filters( 'wcvendors_enable_auto_update_db', false ) ) {
|
| 313 |
-
self::init_background_updater();
|
| 314 |
-
self::update();
|
| 315 |
-
} else {
|
| 316 |
-
WCVendors_Admin_Notices::add_notice( 'update' );
|
| 317 |
-
}
|
| 318 |
-
} else {
|
| 319 |
-
self::update_db_version();
|
| 320 |
-
}
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
/**
|
| 324 |
-
* Default options.
|
| 325 |
-
*
|
| 326 |
-
* Sets up the default options used on the settings page.
|
| 327 |
-
*/
|
| 328 |
-
private static function create_options() {
|
| 329 |
-
|
| 330 |
-
include_once( dirname( __FILE__ ) . '/admin/class-wcv-admin-settings.php' );
|
| 331 |
-
|
| 332 |
-
$settings = WCVendors_Admin_Settings::get_settings_pages();
|
| 333 |
-
|
| 334 |
-
foreach ( $settings as $section ) {
|
| 335 |
-
if ( ! method_exists( $section, 'get_settings' ) ) {
|
| 336 |
-
continue;
|
| 337 |
-
}
|
| 338 |
-
$subsections = array_unique( array_merge( array( '' ), array_keys( $section->get_sections() ) ) );
|
| 339 |
-
|
| 340 |
-
foreach ( $subsections as $subsection ) {
|
| 341 |
-
foreach ( $section->get_settings( $subsection ) as $value ) {
|
| 342 |
-
if ( isset( $value['default'] ) && isset( $value['id'] ) ) {
|
| 343 |
-
$autoload = isset( $value['autoload'] ) ? (bool) $value['autoload'] : true;
|
| 344 |
-
add_option( $value['id'], $value['default'], '', ( $autoload ? 'yes' : 'no' ) );
|
| 345 |
-
}
|
| 346 |
-
}
|
| 347 |
-
}
|
| 348 |
-
}
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
/**
|
| 352 |
-
* Update DB version to current.
|
| 353 |
-
* @param string $version
|
| 354 |
-
*/
|
| 355 |
-
public static function update_db_version( $version = null ) {
|
| 356 |
-
global $wc_vendors;
|
| 357 |
-
delete_option( 'wcvendors_db_version' );
|
| 358 |
-
add_option( 'wcvendors_db_version', is_null( $version ) ? $wc_vendors->version : $version );
|
| 359 |
-
}
|
| 360 |
-
|
| 361 |
-
|
| 362 |
-
/**
|
| 363 |
-
* Update WC version to current.
|
| 364 |
-
*/
|
| 365 |
-
private static function update_wcv_version() {
|
| 366 |
-
global $wc_vendors;
|
| 367 |
-
delete_option( 'wcvendors_version' );
|
| 368 |
-
add_option( 'wcvendors_version', $wc_vendors->version );
|
| 369 |
-
}
|
| 370 |
-
|
| 371 |
-
|
| 372 |
-
/**
|
| 373 |
-
* Push all needed DB updates to the queue for processing.
|
| 374 |
-
*/
|
| 375 |
-
private static function update() {
|
| 376 |
-
$current_db_version = get_option( 'wcvendors_db_version' );
|
| 377 |
-
$logger = wc_get_logger();
|
| 378 |
-
$update_queued = false;
|
| 379 |
-
|
| 380 |
-
foreach ( self::get_db_update_callbacks() as $version => $update_callbacks ) {
|
| 381 |
-
if ( version_compare( $current_db_version, $version, '<' ) ) {
|
| 382 |
-
foreach ( $update_callbacks as $update_callback ) {
|
| 383 |
-
$logger->info(
|
| 384 |
-
sprintf( 'Queuing %s - %s', $version, $update_callback ),
|
| 385 |
-
array( 'source' => 'wcvendors_db_updates' )
|
| 386 |
-
);
|
| 387 |
-
self::$background_updater->push_to_queue( $update_callback );
|
| 388 |
-
$update_queued = true;
|
| 389 |
-
}
|
| 390 |
-
}
|
| 391 |
-
}
|
| 392 |
-
|
| 393 |
-
if ( $update_queued ) {
|
| 394 |
-
self::$background_updater->save()->dispatch();
|
| 395 |
-
}
|
| 396 |
-
}
|
| 397 |
-
|
| 398 |
-
|
| 399 |
-
/**
|
| 400 |
-
* Show action links on the plugin screen.
|
| 401 |
-
*
|
| 402 |
-
* @param mixed $links Plugin Action links
|
| 403 |
-
* @return array
|
| 404 |
-
* @since 2.0.0
|
| 405 |
-
*/
|
| 406 |
-
public static function plugin_action_links( $links ) {
|
| 407 |
-
$action_links = array(
|
| 408 |
-
'settings' => '<a href="' . admin_url( 'admin.php?page=wcv-settings' ) . '" aria-label="' . esc_attr__( 'View WC Vendors settings', 'wc-vendors' ) . '">' . esc_html__( 'Settings', 'wc-vendors' ) . '</a>',
|
| 409 |
-
);
|
| 410 |
-
|
| 411 |
-
return array_merge( $action_links, $links );
|
| 412 |
-
}
|
| 413 |
-
|
| 414 |
-
/**
|
| 415 |
-
* Show row meta on the plugin screen.
|
| 416 |
-
*
|
| 417 |
-
* @param mixed $links Plugin Row Meta
|
| 418 |
-
* @param mixed $file Plugin Base file
|
| 419 |
-
* @return array
|
| 420 |
-
*/
|
| 421 |
-
public static function plugin_row_meta( $links, $file ) {
|
| 422 |
-
|
| 423 |
-
if ( wcv_plugin_base == $file ) {
|
| 424 |
-
$row_meta = array(
|
| 425 |
-
'docs' => '<a href="' . esc_url( apply_filters( 'wcvendors_docs_url', 'https://docs.wc-vendors.com/' ) ) . '" aria-label="' . esc_attr__( 'View WC Vendors documentation', 'wc-vendors' ) . '">' . esc_html__( 'Docs', 'wc-vendors' ) . '</a>',
|
| 426 |
-
'free-support' => '<a href="' . esc_url( apply_filters( 'wcvendors_free_support_url', 'https://wordpress.org/plugins/wc-vendors' ) ) . '" aria-label="' . esc_attr__( 'Visit community forums', 'wc-vendors' ) . '">' . esc_html__( 'Free support', 'wc-vendors' ) . '</a>',
|
| 427 |
-
'support' => '<a href="' . esc_url( apply_filters( 'wcvendors_support_url', 'https://wc-vendors.com/support/' ) ) . '" aria-label="' . esc_attr__( 'Visit premium customer support', 'wc-vendors' ) . '">' . esc_html__( 'Premium support', 'wc-vendors' ) . '</a>',
|
| 428 |
-
'pro' => '<strong><a href="https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_campaign=upgrade_promo" target="_blank">'.__( 'Upgrade to Pro', 'wcvendors').'</a></strong>',
|
| 429 |
-
);
|
| 430 |
-
|
| 431 |
-
return array_merge( $links, $row_meta );
|
| 432 |
-
}
|
| 433 |
-
|
| 434 |
-
return (array) $links;
|
| 435 |
-
}
|
| 436 |
-
|
| 437 |
-
/**
|
| 438 |
-
* Flush rules if the event is queued.
|
| 439 |
-
*
|
| 440 |
-
* @since 2.0.0
|
| 441 |
-
*/
|
| 442 |
-
public static function maybe_flush_rewrite_rules() {
|
| 443 |
-
if ( 'yes' === get_option( 'wcvendors_queue_flush_rewrite_rules' ) ) {
|
| 444 |
-
update_option( 'wcvendors_queue_flush_rewrite_rules', 'no' );
|
| 445 |
-
flush_rewrite_rules();
|
| 446 |
-
}
|
| 447 |
-
}
|
| 448 |
-
|
| 449 |
-
}
|
| 450 |
-
|
| 451 |
-
WCVendors_Install::init();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/class-queries.php
DELETED
|
@@ -1,284 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
class WCV_Queries
|
| 4 |
-
{
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
*
|
| 8 |
-
*
|
| 9 |
-
* @param unknown $user_id
|
| 10 |
-
*
|
| 11 |
-
* @return unknown
|
| 12 |
-
*/
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
public static function get_commission_products( $user_id )
|
| 16 |
-
{
|
| 17 |
-
global $wpdb;
|
| 18 |
-
|
| 19 |
-
$dates = WCV_Queries::orders_within_range();
|
| 20 |
-
$vendor_products = array();
|
| 21 |
-
$sql = '';
|
| 22 |
-
|
| 23 |
-
$sql .= "SELECT product_id FROM {$wpdb->prefix}pv_commission WHERE vendor_id = {$user_id} ";
|
| 24 |
-
|
| 25 |
-
if ( !empty( $dates ) ) {
|
| 26 |
-
$sql .= "AND time >= '" . $dates[ 'after' ] . "' AND time <= '" . $dates[ 'before' ] . "'";
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
$sql .= " AND status != 'reversed' GROUP BY product_id";
|
| 30 |
-
|
| 31 |
-
$results = $wpdb->get_results( $sql );
|
| 32 |
-
|
| 33 |
-
foreach ( $results as $value ) {
|
| 34 |
-
$ids[ ] = $value->product_id;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
if ( !empty( $ids ) ) {
|
| 38 |
-
$vendor_products = get_posts( array(
|
| 39 |
-
'numberposts' => -1,
|
| 40 |
-
'orderby' => 'post_date',
|
| 41 |
-
'post_type' => array( 'product', 'product_variation' ),
|
| 42 |
-
'order' => 'DESC',
|
| 43 |
-
'include' => $ids
|
| 44 |
-
)
|
| 45 |
-
);
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
return $vendor_products;
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
*
|
| 53 |
-
*
|
| 54 |
-
* @param unknown $order_id
|
| 55 |
-
*
|
| 56 |
-
* @return unknown
|
| 57 |
-
*/
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
public static function get_products_for_order( $order_id )
|
| 61 |
-
{
|
| 62 |
-
global $wpdb;
|
| 63 |
-
|
| 64 |
-
$vendor_products = array();
|
| 65 |
-
|
| 66 |
-
$results = $wpdb->get_results( "
|
| 67 |
-
SELECT product_id
|
| 68 |
-
FROM {$wpdb->prefix}pv_commission
|
| 69 |
-
WHERE order_id = {$order_id}
|
| 70 |
-
AND status != 'reversed'
|
| 71 |
-
AND vendor_id = " . get_current_user_id() . "
|
| 72 |
-
GROUP BY product_id" );
|
| 73 |
-
|
| 74 |
-
foreach ( $results as $value ) {
|
| 75 |
-
$ids[ ] = $value->product_id;
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
return $ids;
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
/**
|
| 83 |
-
* All orders for a specific product
|
| 84 |
-
*
|
| 85 |
-
* @param array $product_ids
|
| 86 |
-
* @param array $args (optional)
|
| 87 |
-
*
|
| 88 |
-
* @return object
|
| 89 |
-
*/
|
| 90 |
-
public static function get_orders_for_products( array $product_ids, array $args = array() )
|
| 91 |
-
{
|
| 92 |
-
global $wpdb;
|
| 93 |
-
|
| 94 |
-
if ( empty( $product_ids ) ) return false;
|
| 95 |
-
|
| 96 |
-
$dates = WCV_Queries::orders_within_range();
|
| 97 |
-
|
| 98 |
-
$defaults = array(
|
| 99 |
-
'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
|
| 100 |
-
'dates' => array( 'before' => $dates[ 'before' ], 'after' => $dates[ 'after' ] ),
|
| 101 |
-
);
|
| 102 |
-
|
| 103 |
-
$args = wp_parse_args( $args, $defaults );
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
$sql = "
|
| 107 |
-
SELECT order_id
|
| 108 |
-
FROM {$wpdb->prefix}pv_commission as order_items
|
| 109 |
-
WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
|
| 110 |
-
AND time >= '" . $args[ 'dates' ][ 'after' ] . "'
|
| 111 |
-
AND time <= '" . $args[ 'dates' ][ 'before' ] . "'
|
| 112 |
-
AND status != 'reversed'
|
| 113 |
-
";
|
| 114 |
-
|
| 115 |
-
if ( !empty( $args[ 'vendor_id' ] ) ) {
|
| 116 |
-
$sql .= "
|
| 117 |
-
AND vendor_id = {$args['vendor_id']}
|
| 118 |
-
";
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
$sql .= "
|
| 122 |
-
GROUP BY order_id
|
| 123 |
-
ORDER BY time DESC
|
| 124 |
-
";
|
| 125 |
-
|
| 126 |
-
$orders = $wpdb->get_results( $sql );
|
| 127 |
-
|
| 128 |
-
return $orders;
|
| 129 |
-
}
|
| 130 |
-
|
| 131 |
-
|
| 132 |
-
/**
|
| 133 |
-
* Sum of orders for a specific product
|
| 134 |
-
*
|
| 135 |
-
* @param array $product_ids
|
| 136 |
-
* @param array $args (optional)
|
| 137 |
-
*
|
| 138 |
-
* @return object
|
| 139 |
-
*/
|
| 140 |
-
public static function sum_orders_for_products( array $product_ids, array $args = array() )
|
| 141 |
-
{
|
| 142 |
-
global $wpdb;
|
| 143 |
-
|
| 144 |
-
$dates = WCV_Queries::orders_within_range();
|
| 145 |
-
|
| 146 |
-
$defaults = array(
|
| 147 |
-
'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
|
| 148 |
-
'dates' => array( 'before' => $dates[ 'before' ], 'after' => $dates[ 'after' ] ),
|
| 149 |
-
);
|
| 150 |
-
|
| 151 |
-
foreach ( $product_ids as $id ) {
|
| 152 |
-
$posts = get_posts( array(
|
| 153 |
-
'numberposts' => -1,
|
| 154 |
-
'post_type' => 'product_variation',
|
| 155 |
-
'post_parent' => $id,
|
| 156 |
-
)
|
| 157 |
-
);
|
| 158 |
-
|
| 159 |
-
if ( !empty( $posts ) ) {
|
| 160 |
-
foreach ( $posts as $post ) {
|
| 161 |
-
$product_ids[ ] = $post->ID;
|
| 162 |
-
}
|
| 163 |
-
}
|
| 164 |
-
}
|
| 165 |
-
|
| 166 |
-
$args = wp_parse_args( $args, $defaults );
|
| 167 |
-
|
| 168 |
-
$sql = "
|
| 169 |
-
SELECT COUNT(order_id) as total_orders,
|
| 170 |
-
SUM(total_due + total_shipping + tax) as line_total,
|
| 171 |
-
SUM(qty) as qty,
|
| 172 |
-
product_id
|
| 173 |
-
|
| 174 |
-
FROM {$wpdb->prefix}pv_commission
|
| 175 |
-
|
| 176 |
-
WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
|
| 177 |
-
AND time >= '" . $args[ 'dates' ][ 'after' ] . "'
|
| 178 |
-
AND time <= '" . $args[ 'dates' ][ 'before' ] . "'
|
| 179 |
-
AND status != 'reversed'
|
| 180 |
-
";
|
| 181 |
-
|
| 182 |
-
if ( !empty( $args[ 'vendor_id' ] ) ) {
|
| 183 |
-
$sql .= "
|
| 184 |
-
AND vendor_id = {$args['vendor_id']}
|
| 185 |
-
";
|
| 186 |
-
}
|
| 187 |
-
|
| 188 |
-
$sql .= "
|
| 189 |
-
GROUP BY product_id
|
| 190 |
-
ORDER BY time DESC;
|
| 191 |
-
";
|
| 192 |
-
|
| 193 |
-
$orders = $wpdb->get_results( $sql );
|
| 194 |
-
|
| 195 |
-
return $orders;
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
/**
|
| 200 |
-
* Sum of orders for a specific order
|
| 201 |
-
*
|
| 202 |
-
* @param array $order_ids
|
| 203 |
-
* @param array $args (optional)
|
| 204 |
-
*
|
| 205 |
-
* @return object
|
| 206 |
-
*/
|
| 207 |
-
public static function sum_for_orders( array $order_ids, array $args = array(), $date_range = true )
|
| 208 |
-
{
|
| 209 |
-
global $wpdb;
|
| 210 |
-
|
| 211 |
-
$dates = ( $date_range ) ? WCV_Queries::orders_within_range() : array();
|
| 212 |
-
|
| 213 |
-
$defaults = array(
|
| 214 |
-
'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
|
| 215 |
-
);
|
| 216 |
-
|
| 217 |
-
$args = wp_parse_args( $args, $defaults );
|
| 218 |
-
|
| 219 |
-
$sql = "
|
| 220 |
-
SELECT COUNT(order_id) as total_orders,
|
| 221 |
-
SUM(total_due + total_shipping + tax) as line_total,
|
| 222 |
-
SUM(qty) as qty,
|
| 223 |
-
product_id
|
| 224 |
-
|
| 225 |
-
FROM {$wpdb->prefix}pv_commission
|
| 226 |
-
|
| 227 |
-
WHERE order_id IN ('" . implode( "','", $order_ids ) . "')
|
| 228 |
-
AND status != 'reversed'
|
| 229 |
-
";
|
| 230 |
-
|
| 231 |
-
if ( !empty ( $dates ) ){
|
| 232 |
-
$sql .= "
|
| 233 |
-
AND time >= '" . $dates[ 'after' ] . "'
|
| 234 |
-
AND time <= '" . $dates[ 'before' ] . "'
|
| 235 |
-
";
|
| 236 |
-
}
|
| 237 |
-
|
| 238 |
-
if ( !empty( $args[ 'vendor_id' ] ) ) {
|
| 239 |
-
$sql .= "
|
| 240 |
-
AND vendor_id = {$args['vendor_id']}
|
| 241 |
-
";
|
| 242 |
-
}
|
| 243 |
-
|
| 244 |
-
$sql .= "
|
| 245 |
-
GROUP BY order_id
|
| 246 |
-
ORDER BY time DESC;
|
| 247 |
-
";
|
| 248 |
-
|
| 249 |
-
$orders = $wpdb->get_results( $sql );
|
| 250 |
-
|
| 251 |
-
return $orders;
|
| 252 |
-
}
|
| 253 |
-
|
| 254 |
-
|
| 255 |
-
/**
|
| 256 |
-
* Orders for range filter function
|
| 257 |
-
*
|
| 258 |
-
* @return array
|
| 259 |
-
*/
|
| 260 |
-
public static function orders_within_range()
|
| 261 |
-
{
|
| 262 |
-
global $start_date, $end_date;
|
| 263 |
-
|
| 264 |
-
$start_date = !empty( $_SESSION[ 'PV_Session' ][ 'start_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 265 |
-
$end_date = !empty( $_SESSION[ 'PV_Session' ][ 'end_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 266 |
-
|
| 267 |
-
if ( !empty( $_POST[ 'start_date' ] ) ) {
|
| 268 |
-
$start_date = strtotime( $_POST[ 'start_date' ] );
|
| 269 |
-
$_SESSION[ 'PV_Session' ][ 'start_date' ] = $start_date;
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
if ( !empty( $_POST[ 'end_date' ] ) ) {
|
| 273 |
-
$end_date = strtotime( $_POST[ 'end_date' ] );
|
| 274 |
-
$_SESSION[ 'PV_Session' ][ 'end_date' ] = $end_date;
|
| 275 |
-
}
|
| 276 |
-
|
| 277 |
-
$after = date( 'Y-m-d', $start_date );
|
| 278 |
-
$before = date( 'Y-m-d', strtotime( '+1 day', $end_date ) );
|
| 279 |
-
|
| 280 |
-
return apply_filters( 'wcvendors_orders_date_range', array( 'after' => $after, 'before' => $before ) );
|
| 281 |
-
}
|
| 282 |
-
|
| 283 |
-
|
| 284 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/class-shipping.php
DELETED
|
@@ -1,334 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Shipping functions
|
| 5 |
-
*
|
| 6 |
-
* @author Matt Gates <http://mgates.me>, WC Vendors <http://wcvendors.com>
|
| 7 |
-
* @package ProductVendor
|
| 8 |
-
*/
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
class WCV_Shipping
|
| 12 |
-
{
|
| 13 |
-
public static $trs2_shipping_rates;
|
| 14 |
-
public static $trs2_shipping_calc_type;
|
| 15 |
-
public static $pps_shipping_costs = array();
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructor
|
| 20 |
-
*/
|
| 21 |
-
function __construct()
|
| 22 |
-
{
|
| 23 |
-
// Table Rate Shipping 2 by WooThemes
|
| 24 |
-
if ( function_exists( 'woocommerce_get_shipping_method_table_rate' ) ) {
|
| 25 |
-
// add_action( 'wp', array( $this, 'trs2_clear_transients' ) );
|
| 26 |
-
add_action( 'woocommerce_checkout_update_order_meta', array( 'WCV_Shipping', 'trs2_add_shipping_data' ), 1, 2 );
|
| 27 |
-
add_action( 'wc_trs2_matched_rates', array( 'WCV_Shipping', 'trs2_store_shipping_data' ), 10, 3 );
|
| 28 |
-
}
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
*
|
| 33 |
-
*
|
| 34 |
-
* @param unknown $order_id
|
| 35 |
-
* @param unknown $product
|
| 36 |
-
* @param unknown $author
|
| 37 |
-
*
|
| 38 |
-
* @return unknown
|
| 39 |
-
*/
|
| 40 |
-
public static function get_shipping_due( $order_id, $order_item, $author, $product_id = 0 ){
|
| 41 |
-
|
| 42 |
-
$shipping_costs = array( 'amount' => 0, 'tax' => 0);
|
| 43 |
-
$shipping_due = 0;
|
| 44 |
-
$method = '';
|
| 45 |
-
$_product = wc_get_product( $order_item[ 'product_id' ] );
|
| 46 |
-
$order = wc_get_order( $order_id );
|
| 47 |
-
$tax_class = $order_item->get_tax_class();
|
| 48 |
-
|
| 49 |
-
if ( $_product && $_product->needs_shipping() && !$_product->is_downloadable() ) {
|
| 50 |
-
|
| 51 |
-
// Get Shipping methods.
|
| 52 |
-
$shipping_methods = $order->get_shipping_methods();
|
| 53 |
-
|
| 54 |
-
// TODO: Currently this only allows one shipping method per order, this definitely needs changing
|
| 55 |
-
foreach ($shipping_methods as $shipping_method) {
|
| 56 |
-
$method = $shipping_method['method_id'];
|
| 57 |
-
break;
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
// Per Product Shipping
|
| 61 |
-
if ( ( class_exists('WC_Shipping_Per_Product_Init') || function_exists( 'woocommerce_per_product_shipping' ) ) && $method == 'per_product' ) {
|
| 62 |
-
$shipping_costs = WCV_Shipping::pps_get_due( $order_id, $order_item );
|
| 63 |
-
|
| 64 |
-
// Local Delivery
|
| 65 |
-
} else if ( $method == 'local_delivery' ) {
|
| 66 |
-
$local_delivery = get_option( 'woocommerce_local_delivery_settings' );
|
| 67 |
-
|
| 68 |
-
if ( $local_delivery[ 'type' ] == 'product' ) {
|
| 69 |
-
|
| 70 |
-
$shipping_costs['amount'] = $order_item[ 'qty' ] * $local_delivery[ 'fee' ];
|
| 71 |
-
$shipping_costs['tax'] = WCV_Shipping::calculate_shipping_tax( $shipping_costs['amount'], $order );
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
// International Delivery
|
| 75 |
-
} else if ( $method == 'international_delivery' ) {
|
| 76 |
-
|
| 77 |
-
$int_delivery = get_option( 'woocommerce_international_delivery_settings' );
|
| 78 |
-
|
| 79 |
-
if ( $int_delivery[ 'type' ] == 'item' ) {
|
| 80 |
-
$WC_Shipping_International_Delivery = new WC_Shipping_International_Delivery();
|
| 81 |
-
$fee = $WC_Shipping_International_Delivery->get_fee( $int_delivery[ 'fee' ], $_product->get_price() );
|
| 82 |
-
$shipping_costs['amount'] = ( $int_delivery[ 'cost' ] + $fee ) * $order_item[ 'qty' ];
|
| 83 |
-
$shipping_costs['tax'] = ( 'taxable' === $int_delivery[ 'tax_status' ] ) ? WCV_Shipping::calculate_shipping_tax( $shipping_costs['amount'], $order, $tax_class ) : 0;
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
}
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
$shipping_costs = apply_filters( 'wcvendors_shipping_due', $shipping_costs, $order_id, $order_item, $author, $product_id );
|
| 90 |
-
|
| 91 |
-
return $shipping_costs;
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
/**
|
| 96 |
-
*
|
| 97 |
-
*
|
| 98 |
-
* @param unknown $order_id
|
| 99 |
-
* @param unknown $product
|
| 100 |
-
*
|
| 101 |
-
* @return array
|
| 102 |
-
*/
|
| 103 |
-
public static function pps_get_due( $order_id, $product ) {
|
| 104 |
-
|
| 105 |
-
$item_shipping_cost = 0;
|
| 106 |
-
$shipping_costs = array();
|
| 107 |
-
$settings = get_option( 'woocommerce_per_product_settings' );
|
| 108 |
-
$taxable = $settings['tax_status'];
|
| 109 |
-
$order = wc_get_order( $order_id );
|
| 110 |
-
$tax_class = $product->get_tax_glass();
|
| 111 |
-
|
| 112 |
-
$shipping_country = $order->get_shipping_country();
|
| 113 |
-
$shipping_state = $order->get_shipping_state();
|
| 114 |
-
$shipping_postcode = $order->get_shipping_postcode();
|
| 115 |
-
|
| 116 |
-
$package[ 'destination' ][ 'country' ] = $shipping_country;
|
| 117 |
-
$package[ 'destination' ][ 'state' ] = $shipping_state;
|
| 118 |
-
$package[ 'destination' ][ 'postcode' ] = $shipping_postcode;
|
| 119 |
-
$product_id = !empty( $product['variation_id'] ) ? $product['variation_id'] : $product['product_id'];
|
| 120 |
-
|
| 121 |
-
if ( !empty( $product['variation_id'] ) ) {
|
| 122 |
-
$rule = woocommerce_per_product_shipping_get_matching_rule( $product['variation_id'], $package );
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
if ( empty( $rule ) ) {
|
| 126 |
-
$rule = woocommerce_per_product_shipping_get_matching_rule( $product['product_id'], $package );
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
if ( !empty( $rule ) ) {
|
| 130 |
-
$item_shipping_cost += $rule->rule_item_cost * $product[ 'qty' ];
|
| 131 |
-
|
| 132 |
-
if ( !empty(self::$pps_shipping_costs[$order_id]) && ! in_array( $rule->rule_id, self::$pps_shipping_costs[$order_id] ) ) {
|
| 133 |
-
$item_shipping_cost += $rule->rule_cost;
|
| 134 |
-
} else if ( empty( self::$pps_shipping_costs[$order_id] ) ) {
|
| 135 |
-
$item_shipping_cost += $rule->rule_cost;
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
self::$pps_shipping_costs[$order_id][] = $rule->rule_id;
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
$shipping_costs['amount'] = $item_shipping_cost;
|
| 142 |
-
$shipping_costs['tax'] = ('taxable' === $taxable ) ? WCV_Shipping::calculate_shipping_tax( $item_shipping_cost, $order, $tax_class ) : 0;
|
| 143 |
-
|
| 144 |
-
// return $item_shipping_cost;
|
| 145 |
-
return $shipping_costs;
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
/**
|
| 150 |
-
* Calculate the shipping tax due for the product
|
| 151 |
-
*
|
| 152 |
-
*/
|
| 153 |
-
public static function calculate_shipping_tax( $shipping_amount, $order, $tax_class = '' ) {
|
| 154 |
-
|
| 155 |
-
$tax_based_on = get_option( 'woocommerce_tax_based_on' );
|
| 156 |
-
$wc_tax_enabled = get_option( 'woocommerce_calc_taxes' );
|
| 157 |
-
|
| 158 |
-
$shipping_city = $order->get_shipping_city();
|
| 159 |
-
$shipping_country = $order->get_shipping_country();
|
| 160 |
-
$shipping_state = $order->get_shipping_state();
|
| 161 |
-
$shipping_postcode = $order->get_shipping_postcode();
|
| 162 |
-
$billing_city = $order->get_billing_city();
|
| 163 |
-
$billing_country = $order->get_billing_country();
|
| 164 |
-
$billing_state = $order->get_billing_state();
|
| 165 |
-
$billing_postcode = $order->get_billing_postcode();
|
| 166 |
-
|
| 167 |
-
$woocommerce_shipping_tax_class = get_option( 'woocommerce_shipping_tax_class' );
|
| 168 |
-
$tax_class = ( 'inherit' === $woocommerce_shipping_tax_class ) ? $tax_class : $woocommerce_shipping_tax_class;
|
| 169 |
-
|
| 170 |
-
|
| 171 |
-
// if taxes aren't enabled don't calculate them
|
| 172 |
-
if ( 'no' === $wc_tax_enabled ) return 0;
|
| 173 |
-
|
| 174 |
-
if ( 'base' === $tax_based_on ) {
|
| 175 |
-
|
| 176 |
-
$default = wc_get_base_location();
|
| 177 |
-
$country = $default['country'];
|
| 178 |
-
$state = $default['state'];
|
| 179 |
-
$postcode = '';
|
| 180 |
-
$city = '';
|
| 181 |
-
|
| 182 |
-
} elseif ( 'billing' === $tax_based_on ) {
|
| 183 |
-
|
| 184 |
-
$country = $billing_country;
|
| 185 |
-
$state = $billing_state;
|
| 186 |
-
$postcode = $billing_postcode;
|
| 187 |
-
$city = $billing_city;
|
| 188 |
-
|
| 189 |
-
} else {
|
| 190 |
-
|
| 191 |
-
$country = $shipping_country;
|
| 192 |
-
$state = $shipping_state;
|
| 193 |
-
$postcode = $shipping_postcode;
|
| 194 |
-
$city = $shipping_city;
|
| 195 |
-
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
// Now calculate shipping tax
|
| 199 |
-
$matched_tax_rates = array();
|
| 200 |
-
|
| 201 |
-
$tax_rates = WC_Tax::find_rates( array(
|
| 202 |
-
'country' => $country,
|
| 203 |
-
'state' => $state,
|
| 204 |
-
'postcode' => $postcode,
|
| 205 |
-
'city' => $city,
|
| 206 |
-
'tax_class' => $tax_class
|
| 207 |
-
) );
|
| 208 |
-
|
| 209 |
-
if ( $tax_rates ) {
|
| 210 |
-
foreach ( $tax_rates as $key => $rate ) {
|
| 211 |
-
if ( isset( $rate['shipping'] ) && 'yes' === $rate['shipping'] ) {
|
| 212 |
-
$matched_tax_rates[ $key ] = $rate;
|
| 213 |
-
}
|
| 214 |
-
}
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
$shipping_taxes = WC_Tax::calc_shipping_tax( $shipping_amount, $matched_tax_rates );
|
| 218 |
-
$shipping_tax_total = WC_Tax::round( array_sum( $shipping_taxes ) );
|
| 219 |
-
|
| 220 |
-
return $shipping_tax_total;
|
| 221 |
-
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
/**
|
| 225 |
-
*
|
| 226 |
-
*/
|
| 227 |
-
public function trs2_clear_transients()
|
| 228 |
-
{
|
| 229 |
-
global $woocommerce;
|
| 230 |
-
|
| 231 |
-
if ( is_checkout() ) {
|
| 232 |
-
wc_delete_product_transients();
|
| 233 |
-
}
|
| 234 |
-
}
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
/**
|
| 238 |
-
*
|
| 239 |
-
*
|
| 240 |
-
* @param unknown $order_id
|
| 241 |
-
* @param unknown $product_id
|
| 242 |
-
*
|
| 243 |
-
* @return unknown
|
| 244 |
-
*/
|
| 245 |
-
public function trs2_get_due( $order_id, $product_id )
|
| 246 |
-
{
|
| 247 |
-
if ( !function_exists( 'woocommerce_get_shipping_method_table_rate' ) ) return;
|
| 248 |
-
|
| 249 |
-
$shipping_due = 0;
|
| 250 |
-
|
| 251 |
-
WCV_Shipping::trs2_retrieve_shipping_data( $order_id );
|
| 252 |
-
if ( !empty( WCV_Shipping::$trs2_shipping_calc_type ) ) {
|
| 253 |
-
|
| 254 |
-
$ship_id = ( WCV_Shipping::$trs2_shipping_calc_type == 'class' ) ? get_product( $product_id )->get_shipping_class_id() : $product_id;
|
| 255 |
-
|
| 256 |
-
if ( !empty( WCV_Shipping::$trs2_shipping_rates[ $ship_id ] ) ) {
|
| 257 |
-
$shipping_due = WCV_Shipping::$trs2_shipping_rates[ $ship_id ];
|
| 258 |
-
unset( WCV_Shipping::$trs2_shipping_rates[ $ship_id ] );
|
| 259 |
-
}
|
| 260 |
-
}
|
| 261 |
-
|
| 262 |
-
return $shipping_due;
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
|
| 266 |
-
/**
|
| 267 |
-
*
|
| 268 |
-
*
|
| 269 |
-
* @param unknown $order_id
|
| 270 |
-
*/
|
| 271 |
-
public function trs2_retrieve_shipping_data( $order_id )
|
| 272 |
-
{
|
| 273 |
-
global $woocommerce;
|
| 274 |
-
|
| 275 |
-
if ( !empty( WCV_Shipping::$trs2_shipping_rates ) ) return;
|
| 276 |
-
|
| 277 |
-
WCV_Shipping::$trs2_shipping_rates = array_filter( (array) get_post_meta( $order_id, '_wcvendors_trs2_shipping_rates', true ) );
|
| 278 |
-
WCV_Shipping::$trs2_shipping_calc_type = get_post_meta( $order_id, '_wcvendors_trs2_shipping_calc_type', true );
|
| 279 |
-
}
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
/**
|
| 283 |
-
*
|
| 284 |
-
*
|
| 285 |
-
* @param unknown $type
|
| 286 |
-
* @param unknown $rates
|
| 287 |
-
* @param unknown $per_item
|
| 288 |
-
*/
|
| 289 |
-
public function trs2_store_shipping_data( $type, $rates, $per_item )
|
| 290 |
-
{
|
| 291 |
-
global $woocommerce;
|
| 292 |
-
|
| 293 |
-
$types = (array) $woocommerce->session->trs2_shipping_class_type;
|
| 294 |
-
$types[ ] = $type;
|
| 295 |
-
$woocommerce->session->trs2_shipping_class_type = $types;
|
| 296 |
-
|
| 297 |
-
$items = (array) $woocommerce->session->trs2_shipping_rates;
|
| 298 |
-
$items[ ] = $per_item;
|
| 299 |
-
$woocommerce->session->trs2_shipping_rates = $items;
|
| 300 |
-
}
|
| 301 |
-
|
| 302 |
-
|
| 303 |
-
/**
|
| 304 |
-
*
|
| 305 |
-
*
|
| 306 |
-
* @param unknown $order_id
|
| 307 |
-
* @param unknown $post
|
| 308 |
-
*
|
| 309 |
-
* @return unknown
|
| 310 |
-
*/
|
| 311 |
-
public function trs2_add_shipping_data( $order_id, $post )
|
| 312 |
-
{
|
| 313 |
-
global $woocommerce;
|
| 314 |
-
|
| 315 |
-
if ( empty( $woocommerce->session->trs2_shipping_rates ) ) {
|
| 316 |
-
return false;
|
| 317 |
-
}
|
| 318 |
-
|
| 319 |
-
$order = wc_get_order( $order_id );
|
| 320 |
-
|
| 321 |
-
foreach ( $woocommerce->session->trs2_shipping_rates as $key => $shipping_rates ) {
|
| 322 |
-
|
| 323 |
-
if ( is_array( $shipping_rates ) && array_sum( $shipping_rates ) == $order->order_shipping ) {
|
| 324 |
-
$shipping_calc_type = $woocommerce->session->trs2_shipping_class_type[ $key ];
|
| 325 |
-
update_post_meta( $order_id, '_wcvendors_trs2_shipping_rates', $shipping_rates );
|
| 326 |
-
update_post_meta( $order_id, '_wcvendors_trs2_shipping_calc_type', $shipping_calc_type );
|
| 327 |
-
|
| 328 |
-
break;
|
| 329 |
-
}
|
| 330 |
-
}
|
| 331 |
-
|
| 332 |
-
unset( $woocommerce->session->trs2_shipping_rates, $woocommerce->session->trs2_shipping_class_type );
|
| 333 |
-
}
|
| 334 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
trunk/classes/class-vendor-order.php
DELETED
|
@@ -1,71 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Order vendor_order
|
| 4 |
-
*
|
| 5 |
-
* @class WC_Order_Vendor
|
| 6 |
-
*/
|
| 7 |
-
class WC_Order_Vendor extends WC_Order {
|
| 8 |
-
|
| 9 |
-
/** @public string Orde
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
