Version Description
Download this release
Release Info
| Developer | digitalchild |
| Plugin |  WC Vendors |
| Version | 2.1.13 |
| Comparing to | |
| See all releases | |
Code changes from version 2.1.12 to 2.1.13
- assets/banner-1544x500.png +0 -0
- assets/banner-772x250.png +0 -0
- assets/icon-128x128.png +0 -0
- assets/icon-256x256.png +0 -0
- assets/icon.svg +0 -115
- assets/js/wcv-admin-quick-edit.js +10 -0
- assets/screenshot-1.png +0 -0
- assets/screenshot-2.png +0 -0
- assets/screenshot-3.png +0 -0
- assets/screenshot-4.png +0 -0
- assets/screenshot-5.png +0 -0
- assets/screenshot-6.png +0 -0
- assets/screenshot-7.png +0 -0
- changelog.txt +13 -0
- class-wc-vendors.php +10 -4
- classes/admin/class-admin-page.php +0 -882
- classes/admin/class-vendor-admin-dashboard.php +1 -1
- classes/admin/class-wcv-admin-setup.php +35 -0
- classes/admin/emails/class-emails.php +11 -7
- classes/admin/emails/class-wcv-admin-notify-application.php +2 -2
- classes/admin/emails/class-wcv-admin-notify-approved.php +202 -0
- classes/admin/emails/class-wcv-vendor-notify-application.php +1 -1
- classes/admin/emails/class-wcv-vendor-notify-approved.php +1 -1
- classes/admin/settings/README.md +0 -126
- classes/admin/settings/assets/css/sf-styles.css +0 -167
- classes/admin/settings/assets/img/tip.png +0 -0
- classes/admin/settings/assets/js/bootstrap-tooltip.js +0 -126
- classes/admin/settings/assets/js/js.iml +0 -10
- classes/admin/settings/assets/js/select2/select2-bootstrap.css +0 -87
- classes/admin/settings/assets/js/select2/select2-spinner.gif +0 -0
- classes/admin/settings/assets/js/select2/select2.css +0 -704
- classes/admin/settings/assets/js/select2/select2.js +0 -3541
- classes/admin/settings/assets/js/select2/select2.min.js +0 -23
- classes/admin/settings/assets/js/select2/select2.png +0 -0
- classes/admin/settings/assets/js/select2/select2x2.png +0 -0
- classes/admin/settings/assets/js/sf-jquery.js +0 -23
- classes/admin/settings/assets/js/wcvendors-media.js +0 -52
- classes/admin/settings/class-wcv-settings-display.php +10 -1
- classes/admin/settings/classes/sf-class-format-options.php +0 -347
- classes/admin/settings/classes/sf-class-sanitize.php +0 -199
- classes/admin/settings/classes/sf-class-settings.php +0 -978
- classes/admin/settings/sf-options.php +0 -363
- classes/class-install.php +2 -2
- classes/class-vendors.php +27 -0
- classes/front/account/class-wc-account-links.php +6 -4
- classes/front/class-vendor-cart.php +4 -4
- classes/front/class-vendor-shop.php +5 -5
- classes/front/signup/class-vendor-signup.php +1 -1
- classes/includes/class-functions.php +1 -1
- classes/includes/class-wcv-shortcodes.php +2 -2
- gulpfile.js +0 -47
- languages/default.mo +0 -0
- languages/default.pot +0 -2434
- languages/wc-vendors.pot +105 -51
- languages/wcvendors-de_AT.mo +0 -0
- languages/wcvendors-de_AT.po +0 -1577
- languages/wcvendors-de_DE.mo +0 -0
- languages/wcvendors-de_DE.po +0 -1577
- languages/wcvendors-es_ES.mo +0 -0
- languages/wcvendors-es_ES.po +0 -2745
- languages/wcvendors-fa_IR.mo +0 -0
- languages/wcvendors-fa_IR.po +0 -2156
- languages/wcvendors-fr_FR.mo +0 -0
- languages/wcvendors-fr_FR.po +0 -2208
- languages/wcvendors-it_IT.mo +0 -0
- languages/wcvendors-it_IT.po +0 -1676
- languages/wcvendors-ja.mo +0 -0
- languages/wcvendors-ja.po +0 -1886
- languages/wcvendors-nl_NL.mo +0 -0
- languages/wcvendors-nl_NL.po +0 -1334
assets/banner-1544x500.png
DELETED
|
Binary file
|
assets/banner-772x250.png
DELETED
|
Binary file
|
assets/icon-128x128.png
DELETED
|
Binary file
|
assets/icon-256x256.png
DELETED
|
Binary file
|
assets/icon.svg
DELETED
|
@@ -1,115 +0,0 @@
|
|
| 1 |
-
<svg viewBox="0 0 500 500" xmlns:xlink="http://www.w3.org/1999/xlink" height="500pt" xmlns="http://www.w3.org/2000/svg" width="500pt" version="1.1"><defs>
|
| 2 |
-
<path d="M0.00 0.00 L500.00 0.00 L500.00 500.00 L0.00 500.00 L0.00 0.00" id="p1" />
|
| 3 |
-
<path d="M81.20 65.86 C86.56 60.77 91.79 55.56 97.38 50.72 C107.88 60.16 117.24 70.79 127.00 80.99 C128.97 82.95 130.73 85.43 133.41 86.45 C159.98 91.11 186.86 94.12 213.31 99.49 C210.33 110.00 209.66 121.01 210.56 131.87 C209.92 132.04 208.62 132.39 207.98 132.56 C202.01 127.72 197.14 121.68 191.11 116.90 C189.06 118.91 187.01 120.94 185.01 123.02 C190.35 131.20 200.26 135.94 203.39 145.57 C209.87 163.03 216.76 180.34 223.07 197.87 C224.22 201.13 225.75 204.40 225.73 207.92 C225.48 210.20 224.29 212.23 223.45 214.33 C218.99 214.61 213.97 215.23 210.88 218.83 C206.43 223.50 206.18 231.57 210.72 236.26 C214.45 240.56 221.21 241.88 226.19 239.01 C229.57 237.26 231.39 233.76 233.26 230.63 C245.84 230.66 258.41 230.60 270.99 230.62 C273.85 234.22 277.18 238.38 282.14 238.75 C290.33 239.91 298.02 231.30 296.09 223.30 C295.06 218.43 291.12 213.77 285.94 213.32 C283.08 213.15 279.97 212.97 277.41 214.48 C274.11 216.23 272.37 219.70 270.36 222.67 C257.45 222.43 244.54 222.73 231.63 222.60 C231.23 221.17 230.42 219.79 230.48 218.28 C232.02 214.41 234.51 211.00 236.64 207.44 C258.76 207.23 280.89 207.41 303.02 207.35 C306.26 207.36 309.47 206.89 312.68 206.51 C318.99 188.69 324.59 170.62 330.81 152.76 C335.01 141.26 338.42 129.35 338.50 117.01 C340.36 116.86 342.22 116.70 344.09 116.61 C361.99 119.04 379.93 121.68 397.83 124.32 C402.13 124.81 406.39 125.63 410.62 126.55 C403.27 145.65 395.55 164.62 387.85 183.58 C378.36 207.78 368.47 231.83 358.81 255.96 C358.00 257.55 357.28 260.14 354.98 259.62 C302.96 259.67 250.95 259.66 198.94 259.64 C192.82 268.77 187.99 278.69 182.23 288.04 C183.91 290.90 185.62 293.75 187.31 296.60 C219.72 296.40 252.14 296.83 284.55 296.58 C286.89 292.12 289.20 287.47 293.01 284.04 C299.46 278.23 308.31 274.89 317.02 275.69 C323.90 276.57 330.74 279.33 335.69 284.30 C344.03 292.07 347.71 304.76 344.07 315.67 C340.38 328.98 326.77 338.79 312.95 337.73 C305.62 337.97 298.61 334.62 293.18 329.88 C289.31 326.54 286.92 321.92 284.65 317.42 C252.37 317.52 220.08 317.37 187.79 317.40 C184.23 327.96 175.12 336.50 164.06 338.49 C157.93 338.96 151.44 339.27 145.74 336.56 C136.84 332.90 130.00 324.79 127.80 315.44 C123.88 301.38 131.94 285.22 145.36 279.60 C151.47 276.43 158.54 277.23 165.16 277.52 C168.19 272.67 171.14 267.76 173.92 262.75 C174.75 261.00 175.93 259.01 175.05 257.05 C156.08 206.34 137.13 155.61 118.35 104.82 C116.85 100.91 113.30 98.43 110.51 95.50 C100.78 85.58 90.84 75.87 81.20 65.86" id="p2" />
|
| 4 |
-
<path d="M253.24 60.18 C263.69 56.37 275.17 55.47 286.08 57.67 C306.03 61.43 323.82 75.24 332.41 93.63 C335.86 100.47 337.10 108.10 338.47 115.57 C340.34 115.90 342.21 116.25 344.09 116.61 C342.22 116.70 340.36 116.86 338.50 117.01 C338.42 129.35 335.01 141.26 330.81 152.76 C330.91 152.05 331.11 150.61 331.21 149.90 C327.89 149.46 324.57 149.03 321.26 148.54 C324.36 145.83 326.00 142.01 327.03 138.11 C322.06 139.30 317.29 141.18 312.62 143.23 C312.54 144.58 312.47 145.93 312.39 147.28 C304.65 146.22 296.88 145.38 289.15 144.31 C296.20 144.79 303.34 144.08 309.67 140.72 C309.16 130.99 307.96 121.15 304.13 112.11 C294.74 115.07 285.26 117.86 276.27 121.91 C278.45 129.10 280.84 136.23 283.68 143.20 C281.05 142.76 278.41 142.43 275.79 142.02 C277.11 142.05 278.44 142.07 279.76 142.06 C278.04 135.54 276.02 129.08 273.04 123.01 C263.51 125.91 254.10 129.22 244.90 133.05 C245.84 134.76 246.79 136.47 247.76 138.18 C246.23 137.96 244.70 137.73 243.18 137.48 C242.91 136.63 242.38 134.93 242.11 134.08 C240.17 134.82 238.24 135.58 236.29 136.25 C234.13 135.94 231.97 135.60 229.80 135.37 C233.53 133.99 237.13 132.29 240.76 130.67 C238.29 121.32 236.29 111.85 235.33 102.22 C230.57 103.65 225.55 104.63 221.26 107.25 C219.83 107.98 219.46 109.65 219.15 111.08 C217.74 118.45 218.42 126.01 219.67 133.35 C222.15 133.94 224.63 134.56 227.13 135.09 C220.73 134.36 214.33 133.60 207.98 132.56 C208.62 132.39 209.92 132.04 210.56 131.87 C209.66 121.01 210.33 110.00 213.31 99.49 C214.95 97.03 216.72 94.62 217.77 91.82 C224.02 76.61 237.71 65.12 253.24 60.18" id="p3" />
|
| 5 |
-
<path d="M275.16 65.49 C285.44 65.01 295.90 68.43 304.25 74.39 C299.93 76.02 295.68 78.09 291.08 78.77 C289.26 78.22 288.12 76.47 286.74 75.25 C283.30 71.52 279.12 68.62 275.16 65.49" id="p4" />
|
| 6 |
-
<path d="M257.29 67.74 C260.96 67.01 264.82 64.89 268.55 66.41 C275.87 69.13 281.83 74.53 286.98 80.25 C279.76 83.40 272.26 85.85 264.77 88.30 C261.91 81.58 259.74 74.61 257.29 67.74" id="p5" />
|
| 7 |
-
<path d="M244.73 74.69 C246.69 71.38 250.73 70.47 253.98 68.91 C256.43 75.78 259.22 82.55 261.07 89.62 C253.86 92.39 246.55 94.88 239.17 97.13 C239.01 89.33 240.64 81.39 244.73 74.69" id="p6" />
|
| 8 |
-
<path d="M293.00 81.94 C298.24 80.55 303.16 77.58 308.64 77.32 C316.48 83.22 322.52 91.57 326.03 100.72 C319.66 103.33 313.07 105.32 306.68 107.85 C304.99 104.32 303.45 100.72 301.81 97.17 C299.36 91.82 295.93 87.02 293.00 81.94" id="p7" />
|
| 9 |
-
<path d="M223.06 99.00 C226.54 90.81 231.87 83.26 238.92 77.77 C237.24 84.66 235.54 91.61 235.40 98.75 C231.38 100.03 227.16 99.59 223.06 99.00" id="p8" />
|
| 10 |
-
<path d="M265.96 91.87 C273.55 88.59 281.49 86.23 289.21 83.26 C295.39 91.04 300.24 99.97 303.07 109.51 C301.21 109.62 299.35 109.77 297.49 109.73 C289.68 109.23 282.02 107.44 274.21 106.86 C272.58 106.37 270.71 105.75 269.96 104.07 C268.00 100.24 267.22 95.95 265.96 91.87" id="p9" />
|
| 11 |
-
<path d="M244.65 98.80 C250.62 96.97 256.46 94.72 262.47 93.04 C264.07 97.12 265.59 101.23 266.82 105.43 C266.08 105.31 264.58 105.05 263.84 104.93 C255.85 103.73 247.89 102.15 239.82 101.67 C241.19 100.36 242.79 99.29 244.65 98.80" id="p10" />
|
| 12 |
-
<path d="M221.08 100.93 C223.47 100.26 225.92 99.94 228.40 99.93 C226.49 101.61 224.27 102.88 221.97 103.96 C221.68 102.94 221.38 101.93 221.08 100.93" id="p11" />
|
| 13 |
-
<path d="M221.26 107.25 C225.55 104.63 230.57 103.65 235.33 102.22 C236.29 111.85 238.29 121.32 240.76 130.67 C237.13 132.29 233.53 133.99 229.80 135.37 C229.13 135.30 227.79 135.16 227.13 135.09 C224.63 134.56 222.15 133.94 219.67 133.35 C218.42 126.01 217.74 118.45 219.15 111.08 C219.46 109.65 219.83 107.98 221.26 107.25" id="p12" />
|
| 14 |
-
<path d="M238.32 101.65 C238.69 101.65 239.44 101.67 239.82 101.67 C247.89 102.15 255.85 103.73 263.84 104.93 C269.90 107.04 270.01 114.59 271.94 119.75 C262.84 123.54 253.47 126.65 244.14 129.82 C240.28 120.92 239.46 111.16 238.32 101.65" id="p13" />
|
| 15 |
-
<path d="M309.15 110.27 C315.15 108.26 321.12 106.14 327.11 104.09 C328.26 107.44 328.98 110.92 329.43 114.43 C328.57 114.32 326.85 114.11 325.99 114.00 C320.71 113.11 315.39 112.32 310.02 112.23 C309.80 111.74 309.37 110.76 309.15 110.27" id="p14" />
|
| 16 |
-
<path d="M271.10 106.60 C271.88 106.67 273.43 106.80 274.21 106.86 C282.02 107.44 289.68 109.23 297.49 109.73 C291.10 114.55 282.87 115.54 275.71 118.80 C273.39 115.07 271.97 110.89 271.10 106.60" id="p15" />
|
| 17 |
-
<path d="M276.27 121.91 C285.26 117.86 294.74 115.07 304.13 112.11 C307.96 121.15 309.16 130.99 309.67 140.72 C303.34 144.08 296.20 144.79 289.15 144.31 C287.33 143.93 285.51 143.52 283.68 143.20 C280.84 136.23 278.45 129.10 276.27 121.91" id="p16" />
|
| 18 |
-
<path d="M308.08 112.16 C308.56 112.18 309.54 112.21 310.02 112.23 C315.39 112.32 320.71 113.11 325.99 114.00 C327.22 114.33 328.42 114.74 329.63 115.15 C329.71 120.23 330.06 125.37 329.19 130.41 C328.85 131.79 328.60 133.45 327.26 134.23 C322.80 136.90 317.60 137.90 312.62 139.17 C312.24 130.00 310.00 121.09 308.08 112.16" id="p17" />
|
| 19 |
-
<path d="M185.01 123.02 C187.01 120.94 189.06 118.91 191.11 116.90 C197.14 121.68 202.01 127.72 207.98 132.56 C214.33 133.60 220.73 134.36 227.13 135.09 C227.79 135.16 229.13 135.30 229.80 135.37 C231.97 135.60 234.13 135.94 236.29 136.25 C238.59 136.64 240.87 137.11 243.18 137.48 C244.70 137.73 246.23 137.96 247.76 138.18 C257.11 139.42 266.44 140.80 275.79 142.02 C278.41 142.43 281.05 142.76 283.68 143.20 C285.51 143.52 287.33 143.93 289.15 144.31 C296.88 145.38 304.65 146.22 312.39 147.28 C315.36 147.60 318.31 148.07 321.26 148.54 C324.57 149.03 327.89 149.46 331.21 149.90 C331.11 150.61 330.91 152.05 330.81 152.76 C324.59 170.62 318.99 188.69 312.68 206.51 C309.47 206.89 306.26 207.36 303.02 207.35 C280.89 207.41 258.76 207.23 236.64 207.44 C234.51 211.00 232.02 214.41 230.48 218.28 C230.42 219.79 231.23 221.17 231.63 222.60 C244.54 222.73 257.45 222.43 270.36 222.67 C272.37 219.70 274.11 216.23 277.41 214.48 C279.97 212.97 283.08 213.15 285.94 213.32 C291.12 213.77 295.06 218.43 296.09 223.30 C298.02 231.30 290.33 239.91 282.14 238.75 C277.18 238.38 273.85 234.22 270.99 230.62 C258.41 230.60 245.84 230.66 233.26 230.63 C231.39 233.76 229.57 237.26 226.19 239.01 C221.21 241.88 214.45 240.56 210.72 236.26 C206.18 231.57 206.43 223.50 210.88 218.83 C213.97 215.23 218.99 214.61 223.45 214.33 C224.29 212.23 225.48 210.20 225.73 207.92 C225.75 204.40 224.22 201.13 223.07 197.87 C216.76 180.34 209.87 163.03 203.39 145.57 C200.26 135.94 190.35 131.20 185.01 123.02" id="p18" />
|
| 20 |
-
<path d="M244.90 133.05 C254.10 129.22 263.51 125.91 273.04 123.01 C276.02 129.08 278.04 135.54 279.76 142.06 C278.44 142.07 277.11 142.05 275.79 142.02 C266.44 140.80 257.11 139.42 247.76 138.18 C246.79 136.47 245.84 134.76 244.90 133.05" id="p19" />
|
| 21 |
-
<path d="M236.29 136.25 C238.24 135.58 240.17 134.82 242.11 134.08 C242.38 134.93 242.91 136.63 243.18 137.48 C240.87 137.11 238.59 136.64 236.29 136.25" id="p20" />
|
| 22 |
-
<path d="M312.62 143.23 C317.29 141.18 322.06 139.30 327.03 138.11 C326.00 142.01 324.36 145.83 321.26 148.54 C318.31 148.07 315.36 147.60 312.39 147.28 C312.47 145.93 312.54 144.58 312.62 143.23" id="p21" />
|
| 23 |
-
<path d="M307.28 144.01 C308.89 142.91 310.81 145.58 308.86 146.46 C307.25 147.55 305.34 144.90 307.28 144.01" id="p22" />
|
| 24 |
-
<path d="M334.44 364.50 C337.13 364.56 339.83 364.56 342.52 364.53 C342.61 382.95 342.59 401.36 342.60 419.78 C340.72 419.54 338.71 419.77 336.95 418.99 C335.99 417.77 335.28 416.38 334.50 415.05 C331.13 417.51 327.44 420.24 323.01 419.85 C318.57 420.21 314.00 418.16 311.74 414.26 C308.30 408.88 308.10 402.15 308.80 395.99 C309.63 388.95 314.97 382.17 322.23 381.16 C326.53 380.09 330.61 382.39 334.44 384.02 C334.50 377.51 334.48 371.00 334.44 364.50" id="p23" />
|
| 25 |
-
<path d="M143.41 370.40 C153.35 363.44 167.47 364.52 176.74 372.15 C175.45 374.12 174.16 376.09 172.89 378.07 C168.25 375.68 163.45 372.78 157.99 373.35 C150.51 373.18 143.91 379.07 142.29 386.21 C140.36 394.04 141.45 403.57 147.86 409.11 C152.13 413.05 158.33 413.23 163.78 412.54 C167.33 411.93 170.22 409.61 173.11 407.64 C174.60 409.18 176.12 410.71 177.66 412.22 C171.73 419.80 161.09 421.64 152.09 419.87 C143.82 418.24 136.85 411.76 134.26 403.80 C130.24 392.30 133.04 377.63 143.41 370.40" id="p24" />
|
| 26 |
-
<path d="M178.93 366.41 C181.81 366.43 184.70 366.45 187.58 366.46 C191.15 373.80 193.75 381.54 196.85 389.06 C199.50 395.69 202.23 402.30 204.41 409.10 C207.00 401.05 210.22 393.23 213.47 385.43 C216.14 379.11 217.79 372.37 221.19 366.37 C224.12 366.38 227.06 366.39 229.99 366.39 C222.35 383.96 215.94 402.03 208.42 419.64 C205.73 419.62 203.05 419.62 200.37 419.66 C193.36 401.85 185.80 384.27 178.93 366.41" id="p25" />
|
| 27 |
-
<path d="M53.08 366.56 C54.07 366.56 56.03 366.57 57.02 366.58 C59.99 376.33 63.12 386.04 66.10 395.79 C68.45 403.67 71.43 411.37 73.07 419.45 C71.64 418.81 70.22 418.18 68.81 417.54 C63.90 400.45 58.20 383.59 53.08 366.56" id="p26" />
|
| 28 |
-
<path d="M57.02 366.58 C59.94 366.60 62.94 366.20 65.80 366.93 C67.30 368.09 67.56 370.16 68.20 371.83 C70.70 380.91 73.68 389.86 75.87 399.03 C76.58 398.07 77.29 397.11 78.00 396.17 C77.41 399.59 77.49 403.08 77.87 406.52 C80.78 400.52 82.51 394.06 84.63 387.77 C87.02 380.58 89.38 373.38 91.82 366.21 C93.85 366.39 95.88 366.47 97.89 366.82 C100.03 368.84 100.44 371.96 101.47 374.60 C104.30 382.72 106.30 391.18 110.29 398.85 C110.83 401.34 111.42 403.82 112.07 406.29 C116.25 393.06 119.43 379.54 123.93 366.41 C126.82 366.48 129.71 366.51 132.60 366.59 C127.46 384.35 121.60 401.89 116.44 419.64 C113.67 419.69 110.90 419.73 108.13 419.84 C104.06 406.35 99.53 393.00 95.02 379.66 C94.47 382.07 93.95 384.49 93.38 386.91 C92.32 388.69 91.14 390.43 90.50 392.42 C87.65 401.55 84.83 410.70 81.53 419.67 C77.67 420.08 73.80 420.33 69.92 420.43 C69.55 419.46 69.18 418.50 68.81 417.54 C70.22 418.18 71.64 418.81 73.07 419.45 C71.43 411.37 68.45 403.67 66.10 395.79 C63.12 386.04 59.99 376.33 57.02 366.58" id="p27" />
|
| 29 |
-
<path d="M87.64 367.66 C88.84 366.71 90.38 366.53 91.82 366.21 C89.38 373.38 87.02 380.58 84.63 387.77 C82.51 394.06 80.78 400.52 77.87 406.52 C77.49 403.08 77.41 399.59 78.00 396.17 C80.06 389.57 82.26 383.01 84.45 376.46 C85.45 373.51 86.05 370.38 87.64 367.66" id="p28" />
|
| 30 |
-
<path d="M110.29 398.85 C113.64 388.16 116.22 377.23 119.93 366.65 C121.26 366.56 122.60 366.48 123.93 366.41 C119.43 379.54 116.25 393.06 112.07 406.29 C111.42 403.82 110.83 401.34 110.29 398.85" id="p29" />
|
| 31 |
-
<path d="M93.38 386.91 C93.95 384.49 94.47 382.07 95.02 379.66 C99.53 393.00 104.06 406.35 108.13 419.84 C106.82 419.76 105.51 419.70 104.20 419.64 C100.73 408.69 97.31 397.70 93.38 386.91" id="p30" />
|
| 32 |
-
<path d="M240.45 381.73 C245.53 380.89 251.36 380.95 255.44 384.55 C260.47 388.46 261.75 395.23 261.36 401.26 C252.58 401.58 243.79 401.33 235.01 401.45 C235.52 405.78 236.64 410.89 241.00 412.92 C246.63 415.31 252.58 412.65 257.78 410.41 C258.80 411.69 259.83 412.96 260.85 414.24 C253.37 422.03 238.99 422.70 231.76 414.24 C227.04 408.88 226.65 401.18 227.77 394.46 C229.20 388.37 234.33 383.12 240.45 381.73" id="p31" />
|
| 33 |
-
<path d="M276.09 385.85 C279.07 383.74 282.21 381.30 286.05 381.30 C290.21 380.89 294.83 382.15 297.38 385.66 C300.32 389.80 300.32 395.13 300.31 400.00 C300.18 406.54 300.59 413.09 299.88 419.61 C297.38 419.58 294.88 419.57 292.39 419.59 C292.34 412.04 292.43 404.50 292.37 396.95 C292.22 394.02 292.11 390.37 289.38 388.58 C284.98 386.05 278.71 388.04 276.18 392.26 C275.20 401.33 276.03 410.54 275.84 419.66 C273.33 419.61 270.82 419.59 268.31 419.58 C268.03 411.39 268.50 403.19 267.93 395.01 C267.67 390.53 267.76 386.04 268.07 381.57 C269.65 381.63 271.24 381.63 272.82 381.86 C274.32 382.78 275.06 384.48 276.09 385.85" id="p32" />
|
| 34 |
-
<path d="M362.54 381.76 C368.44 380.79 375.43 380.52 380.15 384.84 C384.95 388.66 386.95 395.04 386.72 401.01 C386.89 407.38 383.97 414.05 378.42 417.45 C374.26 420.20 369.00 419.98 364.24 419.55 C356.95 418.56 351.03 412.20 350.37 404.91 C350.02 400.00 349.71 394.70 352.21 390.25 C354.24 386.12 358.06 382.91 362.54 381.76" id="p33" />
|
| 35 |
-
<path d="M409.50 381.26 C411.81 380.14 414.33 381.12 416.67 381.59 C416.48 383.91 416.32 386.23 416.15 388.55 C412.77 388.73 409.05 388.26 406.05 390.15 C403.52 392.27 402.42 395.71 402.52 398.94 C402.49 405.78 402.68 412.61 402.48 419.44 C399.86 419.42 397.24 419.41 394.63 419.41 C394.67 406.79 394.49 394.17 394.69 381.56 C396.87 381.58 399.04 381.63 401.23 381.69 C401.44 383.79 401.63 385.89 401.81 387.99 C404.06 385.44 406.14 382.42 409.50 381.26" id="p34" />
|
| 36 |
-
<path d="M426.86 382.05 C433.14 379.23 440.14 381.39 445.61 384.95 C444.77 386.46 443.94 387.97 443.10 389.48 C438.67 388.10 433.45 384.99 429.04 388.07 C427.05 389.20 427.51 391.75 427.18 393.66 C432.77 397.46 440.85 397.10 445.01 402.96 C448.54 408.99 444.44 417.02 438.03 418.97 C431.50 420.68 424.21 419.88 418.70 415.77 C419.50 414.12 420.32 412.50 421.17 410.88 C425.94 412.40 431.21 416.20 436.20 413.24 C439.21 411.93 439.70 406.96 436.60 405.45 C431.65 402.58 424.89 402.74 421.17 397.88 C417.30 392.40 420.67 384.08 426.86 382.05" id="p35" />
|
| 37 |
-
<path d="M241.60 387.61 C244.69 386.95 248.48 386.69 250.97 389.01 C253.20 390.77 253.61 393.74 254.33 396.31 C247.93 396.56 241.51 396.60 235.11 396.33 C236.00 392.73 237.71 388.76 241.60 387.61" id="p36" />
|
| 38 |
-
<path d="M323.47 387.57 C327.21 386.79 332.49 387.10 334.27 391.07 C334.79 395.71 334.47 400.40 334.54 405.06 C335.59 412.84 323.62 416.76 319.06 410.94 C316.44 406.87 316.21 401.71 316.83 397.05 C317.45 393.16 319.41 388.80 323.47 387.57" id="p37" />
|
| 39 |
-
<path d="M364.46 387.73 C368.51 386.76 373.52 387.21 376.12 390.88 C378.70 394.66 378.78 399.58 378.39 403.99 C377.91 407.70 376.28 412.02 372.35 413.21 C368.58 414.10 363.76 414.21 361.07 410.93 C357.83 407.06 358.04 401.71 358.41 396.99 C358.73 393.24 360.61 388.95 364.46 387.73" id="p38" /></defs><g stroke-width="10pt">
|
| 40 |
-
<use stroke="#fff" xlink:href="#p1" />
|
| 41 |
-
<use stroke="#005580" xlink:href="#p2" />
|
| 42 |
-
<use stroke="#5e9ab8" xlink:href="#p3" />
|
| 43 |
-
<use stroke="#fff" xlink:href="#p4" />
|
| 44 |
-
<use stroke="#fff" xlink:href="#p5" />
|
| 45 |
-
<use stroke="#fff" xlink:href="#p6" />
|
| 46 |
-
<use stroke="#fff" xlink:href="#p7" />
|
| 47 |
-
<use stroke="#fff" xlink:href="#p8" />
|
| 48 |
-
<use stroke="#fff" xlink:href="#p9" />
|
| 49 |
-
<use stroke="#fff" xlink:href="#p10" />
|
| 50 |
-
<use stroke="#005580" xlink:href="#p11" />
|
| 51 |
-
<use stroke="#005580" xlink:href="#p12" />
|
| 52 |
-
<use stroke="#005580" xlink:href="#p13" />
|
| 53 |
-
<use stroke="#fff" xlink:href="#p14" />
|
| 54 |
-
<use stroke="#005580" xlink:href="#p15" />
|
| 55 |
-
<use stroke="#005580" xlink:href="#p16" />
|
| 56 |
-
<use stroke="#005580" xlink:href="#p17" />
|
| 57 |
-
<use stroke="#fff" xlink:href="#p18" />
|
| 58 |
-
<use stroke="#005580" xlink:href="#p19" />
|
| 59 |
-
<use stroke="#005580" xlink:href="#p20" />
|
| 60 |
-
<use stroke="#005580" xlink:href="#p21" />
|
| 61 |
-
<use stroke="#005580" xlink:href="#p22" />
|
| 62 |
-
<use stroke="#5e9ab8" xlink:href="#p23" />
|
| 63 |
-
<use stroke="#5e9ab8" xlink:href="#p24" />
|
| 64 |
-
<use stroke="#5e9ab8" xlink:href="#p25" />
|
| 65 |
-
<use stroke="#005580" xlink:href="#p26" />
|
| 66 |
-
<use stroke="#5e9ab8" xlink:href="#p27" />
|
| 67 |
-
<use stroke="#005580" xlink:href="#p28" />
|
| 68 |
-
<use stroke="#005580" xlink:href="#p29" />
|
| 69 |
-
<use stroke="#005580" xlink:href="#p30" />
|
| 70 |
-
<use stroke="#5e9ab8" xlink:href="#p31" />
|
| 71 |
-
<use stroke="#5e9ab8" xlink:href="#p32" />
|
| 72 |
-
<use stroke="#5e9ab8" xlink:href="#p33" />
|
| 73 |
-
<use stroke="#5e9ab8" xlink:href="#p34" />
|
| 74 |
-
<use stroke="#5e9ab8" xlink:href="#p35" />
|
| 75 |
-
<use stroke="#fff" xlink:href="#p36" />
|
| 76 |
-
<use stroke="#fff" xlink:href="#p37" />
|
| 77 |
-
<use stroke="#fff" xlink:href="#p38" /></g><g>
|
| 78 |
-
<use xlink:href="#p1" fill="#fff" />
|
| 79 |
-
<use xlink:href="#p2" fill="#005580" />
|
| 80 |
-
<use xlink:href="#p3" fill="#5e9ab8" />
|
| 81 |
-
<use xlink:href="#p4" fill="#fff" />
|
| 82 |
-
<use xlink:href="#p5" fill="#fff" />
|
| 83 |
-
<use xlink:href="#p6" fill="#fff" />
|
| 84 |
-
<use xlink:href="#p7" fill="#fff" />
|
| 85 |
-
<use xlink:href="#p8" fill="#fff" />
|
| 86 |
-
<use xlink:href="#p9" fill="#fff" />
|
| 87 |
-
<use xlink:href="#p10" fill="#fff" />
|
| 88 |
-
<use xlink:href="#p11" fill="#005580" />
|
| 89 |
-
<use xlink:href="#p12" fill="#005580" />
|
| 90 |
-
<use xlink:href="#p13" fill="#005580" />
|
| 91 |
-
<use xlink:href="#p14" fill="#fff" />
|
| 92 |
-
<use xlink:href="#p15" fill="#005580" />
|
| 93 |
-
<use xlink:href="#p16" fill="#005580" />
|
| 94 |
-
<use xlink:href="#p17" fill="#005580" />
|
| 95 |
-
<use xlink:href="#p18" fill="#fff" />
|
| 96 |
-
<use xlink:href="#p19" fill="#005580" />
|
| 97 |
-
<use xlink:href="#p20" fill="#005580" />
|
| 98 |
-
<use xlink:href="#p21" fill="#005580" />
|
| 99 |
-
<use xlink:href="#p22" fill="#005580" />
|
| 100 |
-
<use xlink:href="#p23" fill="#5e9ab8" />
|
| 101 |
-
<use xlink:href="#p24" fill="#5e9ab8" />
|
| 102 |
-
<use xlink:href="#p25" fill="#5e9ab8" />
|
| 103 |
-
<use xlink:href="#p26" fill="#005580" />
|
| 104 |
-
<use xlink:href="#p27" fill="#5e9ab8" />
|
| 105 |
-
<use xlink:href="#p28" fill="#005580" />
|
| 106 |
-
<use xlink:href="#p29" fill="#005580" />
|
| 107 |
-
<use xlink:href="#p30" fill="#005580" />
|
| 108 |
-
<use xlink:href="#p31" fill="#5e9ab8" />
|
| 109 |
-
<use xlink:href="#p32" fill="#5e9ab8" />
|
| 110 |
-
<use xlink:href="#p33" fill="#5e9ab8" />
|
| 111 |
-
<use xlink:href="#p34" fill="#5e9ab8" />
|
| 112 |
-
<use xlink:href="#p35" fill="#5e9ab8" />
|
| 113 |
-
<use xlink:href="#p36" fill="#fff" />
|
| 114 |
-
<use xlink:href="#p37" fill="#fff" />
|
| 115 |
-
<use xlink:href="#p38" fill="#fff" /></g></svg>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/js/wcv-admin-quick-edit.js
CHANGED
|
@@ -31,4 +31,14 @@ jQuery(function(){
|
|
| 31 |
}
|
| 32 |
|
| 33 |
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 34 |
});
|
| 31 |
}
|
| 32 |
|
| 33 |
});
|
| 34 |
+
|
| 35 |
+
jQuery( document ).ready( function() {
|
| 36 |
+
var $inputFeatured = $( '.featured input[name="_featured"]' );
|
| 37 |
+
var $selectFetured = $( 'select.featured' ).closest( 'label' );
|
| 38 |
+
|
| 39 |
+
if ( wcv_quick_edit_params.allow_featured == 'no' ) {
|
| 40 |
+
$inputFeatured.parent().hide();
|
| 41 |
+
$selectFetured.hide();
|
| 42 |
+
}
|
| 43 |
+
});
|
| 44 |
});
|
assets/screenshot-1.png
DELETED
|
Binary file
|
assets/screenshot-2.png
DELETED
|
Binary file
|
assets/screenshot-3.png
DELETED
|
Binary file
|
assets/screenshot-4.png
DELETED
|
Binary file
|
assets/screenshot-5.png
DELETED
|
Binary file
|
assets/screenshot-6.png
DELETED
|
Binary file
|
assets/screenshot-7.png
DELETED
|
Binary file
|
changelog.txt
CHANGED
|
@@ -1,5 +1,18 @@
|
|
| 1 |
Changelog for WC Vendors Marketplace
|
| 2 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3 |
Version 2.1.12 - 26th June 2019
|
| 4 |
|
| 5 |
* Added: Become a vendor label
|
| 1 |
Changelog for WC Vendors Marketplace
|
| 2 |
|
| 3 |
+
Verison 2.1.13 - 26th August 2019
|
| 4 |
+
|
| 5 |
+
* Added: New shop description option for vendor store page
|
| 6 |
+
* Added: Check post type on delete for sub orders
|
| 7 |
+
* Added: Tool to remove orphaned vendor sub orders
|
| 8 |
+
* Updated: gulp and build language file. (#585)
|
| 9 |
+
* Updated: WooCommerce 3.7 compatibility testing
|
| 10 |
+
* Fixed: Translated strings saved to database aren't translated on output #579
|
| 11 |
+
* Fixed: Delete vendor sub orders when parent order is deteled #558
|
| 12 |
+
* Fixed: Approving a vendor sends an email to the admin #578 (#582)
|
| 13 |
+
* Fixed: Urls on settings page
|
| 14 |
+
* Fixed: Hide product featured input if capability disabled. (#587)
|
| 15 |
+
|
| 16 |
Version 2.1.12 - 26th June 2019
|
| 17 |
|
| 18 |
* Added: Become a vendor label
|
class-wc-vendors.php
CHANGED
|
@@ -7,11 +7,11 @@
|
|
| 7 |
* Author URI: https://www.wcvendors.com
|
| 8 |
* GitHub Plugin URI: https://github.com/wcvendors/wcvendors
|
| 9 |
*
|
| 10 |
-
* Version: 2.1.
|
| 11 |
* Requires at least: 5.0.0
|
| 12 |
* Tested up to: 5.2.2
|
| 13 |
* WC requires at least: 3.3.0
|
| 14 |
-
* WC tested up to: 3.
|
| 15 |
*
|
| 16 |
* Text Domain: wc-vendors
|
| 17 |
* Domain Path: /languages/
|
|
@@ -97,7 +97,7 @@ if ( wcv_is_woocommerce_activated() ) {
|
|
| 97 |
*/
|
| 98 |
class WC_Vendors {
|
| 99 |
|
| 100 |
-
public $version = '2.1.
|
| 101 |
|
| 102 |
/**
|
| 103 |
* @var
|
|
@@ -207,7 +207,6 @@ if ( wcv_is_woocommerce_activated() ) {
|
|
| 207 |
$locale = apply_filters( 'plugin_locale', $locale, 'wc-vendors' );
|
| 208 |
load_textdomain( 'wc-vendors', WP_LANG_DIR . '/wc-vendors/wc-vendors-' . $locale . '.mo' );
|
| 209 |
load_plugin_textdomain( 'wc-vendors', false, plugin_basename( dirname( __FILE__ ) ) . '/languages/' );
|
| 210 |
-
|
| 211 |
}
|
| 212 |
|
| 213 |
/**
|
|
@@ -308,6 +307,13 @@ if ( wcv_is_woocommerce_activated() ) {
|
|
| 308 |
switch ( $screen->id ) {
|
| 309 |
case 'edit-product':
|
| 310 |
wp_enqueue_script( 'wcv_quick-edit', wcv_assets_url . 'js/wcv-admin-quick-edit.js', array( 'jquery' ), WCV_VERSION );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 311 |
break;
|
| 312 |
case 'wc-vendors_page_wcv-commissions':
|
| 313 |
wp_register_script( 'wcv_admin_commissions', wcv_assets_url . 'js/admin/wcv-admin-commissions.js', array( 'jquery' ), WCV_VERSION , true );
|
| 7 |
* Author URI: https://www.wcvendors.com
|
| 8 |
* GitHub Plugin URI: https://github.com/wcvendors/wcvendors
|
| 9 |
*
|
| 10 |
+
* Version: 2.1.13
|
| 11 |
* Requires at least: 5.0.0
|
| 12 |
* Tested up to: 5.2.2
|
| 13 |
* WC requires at least: 3.3.0
|
| 14 |
+
* WC tested up to: 3.7.0
|
| 15 |
*
|
| 16 |
* Text Domain: wc-vendors
|
| 17 |
* Domain Path: /languages/
|
| 97 |
*/
|
| 98 |
class WC_Vendors {
|
| 99 |
|
| 100 |
+
public $version = '2.1.13';
|
| 101 |
|
| 102 |
/**
|
| 103 |
* @var
|
| 207 |
$locale = apply_filters( 'plugin_locale', $locale, 'wc-vendors' );
|
| 208 |
load_textdomain( 'wc-vendors', WP_LANG_DIR . '/wc-vendors/wc-vendors-' . $locale . '.mo' );
|
| 209 |
load_plugin_textdomain( 'wc-vendors', false, plugin_basename( dirname( __FILE__ ) ) . '/languages/' );
|
|
|
|
| 210 |
}
|
| 211 |
|
| 212 |
/**
|
| 307 |
switch ( $screen->id ) {
|
| 308 |
case 'edit-product':
|
| 309 |
wp_enqueue_script( 'wcv_quick-edit', wcv_assets_url . 'js/wcv-admin-quick-edit.js', array( 'jquery' ), WCV_VERSION );
|
| 310 |
+
wp_localize_script(
|
| 311 |
+
'wcv_quick-edit',
|
| 312 |
+
'wcv_quick_edit_params',
|
| 313 |
+
array(
|
| 314 |
+
'allow_featured' => apply_filters( 'wcvendors_capability_allow_product_featured', get_option( 'wcvendors_capability_product_featured', 'no' ) ),
|
| 315 |
+
)
|
| 316 |
+
);
|
| 317 |
break;
|
| 318 |
case 'wc-vendors_page_wcv-commissions':
|
| 319 |
wp_register_script( 'wcv_admin_commissions', wcv_assets_url . 'js/admin/wcv-admin-commissions.js', array( 'jquery' ), WCV_VERSION , true );
|
classes/admin/class-admin-page.php
DELETED
|
@@ -1,882 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
class WCV_Admin_Setup
|
| 4 |
-
{
|
| 5 |
-
/**
|
| 6 |
-
* WC > Referrals menu
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
public function __construct()
|
| 10 |
-
{
|
| 11 |
-
add_filter( 'set-screen-option', array( 'WCV_Admin_Setup', 'set_table_option' ), 10, 3 );
|
| 12 |
-
add_action( 'admin_menu', array( 'WCV_Admin_Setup', 'menu' ) );
|
| 13 |
-
|
| 14 |
-
add_action( 'woocommerce_admin_order_data_after_shipping_address', array( $this, 'add_vendor_details' ), 10, 2 );
|
| 15 |
-
add_action( 'woocommerce_admin_order_actions_end', array( $this, 'append_actions' ), 10, 1 );
|
| 16 |
-
|
| 17 |
-
add_filter( 'woocommerce_debug_tools', array( $this, 'wcvendors_tools' ) );
|
| 18 |
-
|
| 19 |
-
add_action( 'admin_head', array( $this, 'commission_table_header_styles' ) );
|
| 20 |
-
|
| 21 |
-
add_action( 'admin_init', array( $this, 'export_commissions' ) );
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
public function add_vendor_details( $order )
|
| 26 |
-
{
|
| 27 |
-
$actions = $this->append_actions( $order, true );
|
| 28 |
-
|
| 29 |
-
if (empty( $actions['wc_pv_shipped']['name'] )) {
|
| 30 |
-
return;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
echo '<h4>' . __('Vendors shipped', 'wcvendors') . '</h4><br/>';
|
| 34 |
-
echo $actions['wc_pv_shipped']['name'];
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function append_actions( $order, $order_page = false )
|
| 38 |
-
{
|
| 39 |
-
global $woocommerce;
|
| 40 |
-
|
| 41 |
-
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 42 |
-
|
| 43 |
-
$authors = WCV_Vendors::get_vendors_from_order( $order );
|
| 44 |
-
$authors = $authors ? array_keys( $authors ) : array();
|
| 45 |
-
if ( empty( $authors ) ) return false;
|
| 46 |
-
|
| 47 |
-
$shipped = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 48 |
-
$string = '</br></br>';
|
| 49 |
-
|
| 50 |
-
foreach ($authors as $author ) {
|
| 51 |
-
$string .= in_array( $author, $shipped ) ? '✔ ' : '✕ ';
|
| 52 |
-
$string .= WCV_Vendors::get_vendor_shop_name( $author );
|
| 53 |
-
$string .= '</br>';
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
$response = array(
|
| 57 |
-
'url' => '#',
|
| 58 |
-
'name' => __('Vendors Shipped', 'wcvendors') . $string,
|
| 59 |
-
'action' => 'wc_pv_shipped',
|
| 60 |
-
'image_url' => wcv_assets_url . '/images/icons/truck.png',
|
| 61 |
-
);
|
| 62 |
-
|
| 63 |
-
if ( ! $order_page ) {
|
| 64 |
-
printf( '<a class="button tips %s" href="%s" data-tip="%s"><img style="width:16px;height:16px;" src="%s"></a>', $response['action'], $response['url'], $response['name'], $response['image_url'] );
|
| 65 |
-
} else {
|
| 66 |
-
echo $response['name'];
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
return $response;
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Add the commissions sub menu
|
| 75 |
-
*
|
| 76 |
-
* @since 1.0.0
|
| 77 |
-
* @access public
|
| 78 |
-
*
|
| 79 |
-
*/
|
| 80 |
-
public static function menu()
|
| 81 |
-
{
|
| 82 |
-
$hook = add_submenu_page(
|
| 83 |
-
'woocommerce',
|
| 84 |
-
__( 'Commission', 'wcvendors' ), __( 'Commission', 'wcvendors' ),
|
| 85 |
-
'manage_woocommerce',
|
| 86 |
-
'pv_admin_commissions',
|
| 87 |
-
array( 'WCV_Admin_Setup', 'commissions_page' )
|
| 88 |
-
);
|
| 89 |
-
|
| 90 |
-
add_action( "load-$hook", array( 'WCV_Admin_Setup', 'add_options' ) );
|
| 91 |
-
|
| 92 |
-
add_action( "admin_print_styles-$hook", array( 'WCV_Admin_Setup', 'commission_enqueue_style' ) );
|
| 93 |
-
add_action( "admin_print_scripts-$hook", array( 'WCV_Admin_Setup', 'commission_my_enqueue_script' ) );
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
} // menu()
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
/**
|
| 101 |
-
* Add tools to the woocommerce status tools page
|
| 102 |
-
*
|
| 103 |
-
* @since 1.9.2
|
| 104 |
-
* @access public
|
| 105 |
-
*/
|
| 106 |
-
public function wcvendors_tools( $tools ){
|
| 107 |
-
|
| 108 |
-
$tools[ 'reset_wcvendor_roles' ] = array(
|
| 109 |
-
'name' => __( 'Reset WC Vendors roles ', 'wcvendors' ),
|
| 110 |
-
'button' => __( 'Reset WC Vendor Roles', 'wcvendors' ),
|
| 111 |
-
'desc' => __( 'This will reset the wcvendors roles ( vendor & pending_vendor ), back to the default capabilities.', 'wcvendors' ),
|
| 112 |
-
'callback' => array( 'WCV_Admin_Setup', 'reset_vendor_roles' )
|
| 113 |
-
);
|
| 114 |
-
|
| 115 |
-
$tools[ 'reset_wcvendors' ] = array(
|
| 116 |
-
'name' => __( 'Reset WC Vendors ', 'wcvendors' ),
|
| 117 |
-
'button' => __( 'Reset WC Vendors Settings', 'wcvendors' ),
|
| 118 |
-
'desc' => __( 'This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings.', 'wcvendors' ),
|
| 119 |
-
'callback' => array( 'WCV_Admin_Setup', 'reset_wcvendors' )
|
| 120 |
-
);
|
| 121 |
-
|
| 122 |
-
return $tools;
|
| 123 |
-
|
| 124 |
-
} // wcvendors_tools()
|
| 125 |
-
|
| 126 |
-
/**
|
| 127 |
-
* Reset the vendor roles
|
| 128 |
-
*
|
| 129 |
-
* @since 1.9.2
|
| 130 |
-
* @access public
|
| 131 |
-
*/
|
| 132 |
-
public static function reset_vendor_roles(){
|
| 133 |
-
|
| 134 |
-
$can_add = WC_Vendors::$pv_options->get_option( 'can_submit_products' );
|
| 135 |
-
$can_edit = WC_Vendors::$pv_options->get_option( 'can_edit_published_products' );
|
| 136 |
-
$can_submit_live = WC_Vendors::$pv_options->get_option( 'can_submit_live_products' );
|
| 137 |
-
$can_view_reports = WC_Vendors::$pv_options->get_option( 'can_view_backend_reports' );
|
| 138 |
-
|
| 139 |
-
$args = array(
|
| 140 |
-
'assign_product_terms' => $can_add,
|
| 141 |
-
'edit_products' => $can_add || $can_edit,
|
| 142 |
-
'edit_published_products' => $can_edit,
|
| 143 |
-
'delete_published_products' => $can_edit,
|
| 144 |
-
'delete_products' => $can_edit,
|
| 145 |
-
'manage_product' => $can_add,
|
| 146 |
-
'publish_products' => $can_submit_live,
|
| 147 |
-
'read' => true,
|
| 148 |
-
'read_products' => $can_edit || $can_add,
|
| 149 |
-
'upload_files' => true,
|
| 150 |
-
'import' => true,
|
| 151 |
-
'view_woocommerce_reports' => false,
|
| 152 |
-
);
|
| 153 |
-
|
| 154 |
-
remove_role( 'vendor' );
|
| 155 |
-
add_role( 'vendor', __('Vendor', 'wcvendors'), $args );
|
| 156 |
-
|
| 157 |
-
remove_role( 'pending_vendor');
|
| 158 |
-
add_role( 'pending_vendor', __( 'Pending Vendor', 'wcvendors' ), array(
|
| 159 |
-
'read' => true,
|
| 160 |
-
'edit_posts' => false,
|
| 161 |
-
'delete_posts' => true
|
| 162 |
-
) );
|
| 163 |
-
|
| 164 |
-
echo '<div class="updated inline"><p>' . __( 'WC Vendor roles successfully reset.', 'wcvendors' ) . '</p></div>';
|
| 165 |
-
|
| 166 |
-
} // reset_vendor_roles()
|
| 167 |
-
|
| 168 |
-
|
| 169 |
-
/**
|
| 170 |
-
* Reset wcvendors
|
| 171 |
-
*
|
| 172 |
-
* @since 1.9.2
|
| 173 |
-
* @access public
|
| 174 |
-
*/
|
| 175 |
-
public static function reset_wcvendors(){
|
| 176 |
-
|
| 177 |
-
delete_option( WC_Vendors::$id . '_options' );
|
| 178 |
-
echo '<div class="updated inline"><p>' . __( 'WC Vendors was successfully reset. All settings have been reset.', 'wcvendors' ) . '</p></div>';
|
| 179 |
-
|
| 180 |
-
} // reset_wcvendors()
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
public static function commission_enqueue_style(){
|
| 184 |
-
|
| 185 |
-
wp_enqueue_style( 'commissions_select2_css', wcv_assets_url . 'css/select2.min.css' );
|
| 186 |
-
|
| 187 |
-
} //commission_enqueue_style()
|
| 188 |
-
|
| 189 |
-
public static function commission_my_enqueue_script(){
|
| 190 |
-
|
| 191 |
-
$select2_args = apply_filters( 'wcvendors_select2_commission_args', array(
|
| 192 |
-
'placeholder' => __( 'Select a Vendor', 'wcvendors' ),
|
| 193 |
-
'allowclear' => true,
|
| 194 |
-
) );
|
| 195 |
-
|
| 196 |
-
wp_enqueue_script( 'commissions_select2_styles_js', wcv_assets_url. 'js/select2.min.js', array('jquery') );
|
| 197 |
-
|
| 198 |
-
wp_register_script( 'commissions_select2_load_js', wcv_assets_url. 'js/wcv-commissions.js', array('jquery') );
|
| 199 |
-
wp_localize_script( 'commissions_select2_load_js', 'wcv_commissions_select', $select2_args );
|
| 200 |
-
wp_enqueue_script( 'commissions_select2_load_js' );
|
| 201 |
-
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
-
/**
|
| 205 |
-
* Load styles for the commissions table page
|
| 206 |
-
*/
|
| 207 |
-
public function commission_table_header_styles() {
|
| 208 |
-
|
| 209 |
-
$page = ( isset( $_GET[ 'page' ] ) ) ? esc_attr( $_GET[ 'page' ] ) : false;
|
| 210 |
-
|
| 211 |
-
// Only load the styles on the license table page
|
| 212 |
-
|
| 213 |
-
if ( 'pv_admin_commissions' !== $page ) return;
|
| 214 |
-
|
| 215 |
-
echo '<style type="text/css">';
|
| 216 |
-
echo '.wp-list-table .column-product_id { width: 20%; }';
|
| 217 |
-
echo '.wp-list-table .column-vendor_id { width: 15%; }';
|
| 218 |
-
echo '.wp-list-table .column-order_id { width: 8%; }';
|
| 219 |
-
echo '.wp-list-table .column-total_due { width: 10%;}';
|
| 220 |
-
echo '.wp-list-table .column-total_shipping { width: 10%;}';
|
| 221 |
-
echo '.wp-list-table .column-tax { width: 10%;}';
|
| 222 |
-
echo '.wp-list-table .column-totals { width: 10%;}';
|
| 223 |
-
echo '.wp-list-table .column-status { width: 5%;}';
|
| 224 |
-
echo '.wp-list-table .column-time { width: 10%;}';
|
| 225 |
-
echo '</style>';
|
| 226 |
-
|
| 227 |
-
} //table_header_styles()
|
| 228 |
-
|
| 229 |
-
/**
|
| 230 |
-
*
|
| 231 |
-
*
|
| 232 |
-
* @param unknown $status
|
| 233 |
-
* @param unknown $option
|
| 234 |
-
* @param unknown $value
|
| 235 |
-
*
|
| 236 |
-
* @return unknown
|
| 237 |
-
*/
|
| 238 |
-
public static function set_table_option( $status, $option, $value )
|
| 239 |
-
{
|
| 240 |
-
if ( $option == 'commission_per_page' ) {
|
| 241 |
-
return $value;
|
| 242 |
-
}
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
/**
|
| 247 |
-
*
|
| 248 |
-
*/
|
| 249 |
-
public static function add_options()
|
| 250 |
-
{
|
| 251 |
-
global $PV_Admin_Page;
|
| 252 |
-
|
| 253 |
-
$args = array(
|
| 254 |
-
'label' => 'Rows',
|
| 255 |
-
'default' => 10,
|
| 256 |
-
'option' => 'commission_per_page'
|
| 257 |
-
);
|
| 258 |
-
add_screen_option( 'per_page', $args );
|
| 259 |
-
|
| 260 |
-
$PV_Admin_Page = new WCV_Admin_Page();
|
| 261 |
-
|
| 262 |
-
}
|
| 263 |
-
|
| 264 |
-
|
| 265 |
-
/**
|
| 266 |
-
* HTML setup for the WC > Commission page
|
| 267 |
-
*/
|
| 268 |
-
public static function commissions_page()
|
| 269 |
-
{
|
| 270 |
-
global $woocommerce, $PV_Admin_Page;
|
| 271 |
-
?>
|
| 272 |
-
|
| 273 |
-
<div class="wrap">
|
| 274 |
-
|
| 275 |
-
<div id="icon-woocommerce" class="icon32 icon32-woocommerce-reports"><br/></div>
|
| 276 |
-
<h2><?php _e( 'Commission', 'wcvendors' ); ?></h2>
|
| 277 |
-
|
| 278 |
-
<form id="posts-filter" method="get">
|
| 279 |
-
|
| 280 |
-
<?php
|
| 281 |
-
$page = filter_input( INPUT_GET, 'page', FILTER_SANITIZE_STRIPPED );
|
| 282 |
-
$paged = filter_input( INPUT_GET, 'paged', FILTER_SANITIZE_NUMBER_INT );
|
| 283 |
-
|
| 284 |
-
printf( '<input type="hidden" name="page" value="%s" />', $page );
|
| 285 |
-
printf( '<input type="hidden" name="paged" value="%d" />', $paged );
|
| 286 |
-
?>
|
| 287 |
-
|
| 288 |
-
<input type="hidden" name="page" value="pv_admin_commissions"/>
|
| 289 |
-
|
| 290 |
-
<?php $PV_Admin_Page->prepare_items(); ?>
|
| 291 |
-
<?php $PV_Admin_Page->views() ?>
|
| 292 |
-
<?php $PV_Admin_Page->display() ?>
|
| 293 |
-
|
| 294 |
-
</form>
|
| 295 |
-
<div id="ajax-response"></div>
|
| 296 |
-
<br class="clear"/>
|
| 297 |
-
</div>
|
| 298 |
-
<?php
|
| 299 |
-
}
|
| 300 |
-
|
| 301 |
-
/*
|
| 302 |
-
* Export commissions via csv
|
| 303 |
-
*/
|
| 304 |
-
public function export_commissions(){
|
| 305 |
-
|
| 306 |
-
// prepare the items to export
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
if ( isset( $_GET['action'], $_GET['nonce'] ) && wp_verify_nonce( wp_unslash( $_GET['nonce'] ), 'export_commissions' ) && 'export_commissions' === wp_unslash( $_GET['action'] ) ) {
|
| 310 |
-
|
| 311 |
-
include_once( 'class-wcv-commissions-csv-exporter.php' );
|
| 312 |
-
|
| 313 |
-
$exporter = new WCV_Commissions_CSV_Export();
|
| 314 |
-
|
| 315 |
-
$date = date( 'Y-M-d' );
|
| 316 |
-
|
| 317 |
-
if ( ! empty( $_GET['com_status'] ) ) { // WPCS: input var ok.
|
| 318 |
-
$exporter->set_filename( 'wcv_commissions_'. wp_unslash( $_GET['com_status'] ) . '-' . $date . '.csv' ); // WPCS: input var ok, sanitization ok.
|
| 319 |
-
} else {
|
| 320 |
-
$exporter->set_filename( 'wcv_commissions-' . $date . '.csv' ); // WPCS: input var ok, sanitization ok.
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
$exporter->export();
|
| 324 |
-
}
|
| 325 |
-
|
| 326 |
-
}
|
| 327 |
-
|
| 328 |
-
|
| 329 |
-
}
|
| 330 |
-
|
| 331 |
-
|
| 332 |
-
if ( !class_exists( 'WP_List_Table' ) ) require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php';
|
| 333 |
-
|
| 334 |
-
/**
|
| 335 |
-
* WC_Simple_Referral_Admin class.
|
| 336 |
-
*
|
| 337 |
-
* @extends WP_List_Table
|
| 338 |
-
*/
|
| 339 |
-
class WCV_Admin_Page extends WP_List_Table
|
| 340 |
-
{
|
| 341 |
-
|
| 342 |
-
public $index;
|
| 343 |
-
|
| 344 |
-
|
| 345 |
-
/**
|
| 346 |
-
* __construct function.
|
| 347 |
-
*
|
| 348 |
-
* @access public
|
| 349 |
-
*/
|
| 350 |
-
function __construct()
|
| 351 |
-
{
|
| 352 |
-
global $status, $page;
|
| 353 |
-
|
| 354 |
-
$this->index = 0;
|
| 355 |
-
|
| 356 |
-
//Set parent defaults
|
| 357 |
-
parent::__construct( array(
|
| 358 |
-
'singular' => 'commission',
|
| 359 |
-
'plural' => 'commissions',
|
| 360 |
-
'ajax' => false
|
| 361 |
-
) );
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
|
| 365 |
-
/**
|
| 366 |
-
* column_default function.
|
| 367 |
-
*
|
| 368 |
-
* @access public
|
| 369 |
-
*
|
| 370 |
-
* @param unknown $item
|
| 371 |
-
* @param mixed $column_name
|
| 372 |
-
*
|
| 373 |
-
* @return unknown
|
| 374 |
-
*/
|
| 375 |
-
function column_default( $item, $column_name )
|
| 376 |
-
{
|
| 377 |
-
global $wpdb;
|
| 378 |
-
|
| 379 |
-
switch ( $column_name ) {
|
| 380 |
-
case 'id' :
|
| 381 |
-
return $item->id;
|
| 382 |
-
case 'vendor_id' :
|
| 383 |
-
$user = get_userdata( $item->vendor_id );
|
| 384 |
-
return '<a href="' . admin_url( 'user-edit.php?user_id=' . $item->vendor_id ) . '">' . WCV_Vendors::get_vendor_shop_name( $item->vendor_id ) . '</a>';
|
| 385 |
-
case 'total_due' :
|
| 386 |
-
return wc_price( $item->total_due );
|
| 387 |
-
case 'total_shipping':
|
| 388 |
-
return wc_price($item->total_shipping );
|
| 389 |
-
case 'tax':
|
| 390 |
-
return wc_price( $item->tax );
|
| 391 |
-
case 'totals' :
|
| 392 |
-
$totals = ( wc_tax_enabled() ) ? $item->total_due + $item->total_shipping + $item->tax : $item->total_due + $item->total_shipping;
|
| 393 |
-
return wc_price( $totals );
|
| 394 |
-
case 'product_id' :
|
| 395 |
-
$parent = get_post_ancestors( $item->product_id );
|
| 396 |
-
$product_id = $parent ? $parent[ 0 ] : $item->product_id;
|
| 397 |
-
$wcv_total_sales = get_post_meta( $product_id, 'total_sales', true );
|
| 398 |
-
if ( ! get_post_status( $product_id ) ) {
|
| 399 |
-
$product_id = WCV_Vendors::find_parent_id_from_order( $item->order_id, $product_id );
|
| 400 |
-
}
|
| 401 |
-
return '<a href="' . admin_url( 'post.php?post=' . $product_id . '&action=edit' ) . '">' . get_the_title( $product_id ) . '</a> (<span title="' . get_the_title( $product_id ) .' has sold ' . $wcv_total_sales . ' times total.">' . $wcv_total_sales . '</span>)';
|
| 402 |
-
case 'order_id' :
|
| 403 |
-
$order = wc_get_order( $item->order_id );
|
| 404 |
-
if ( $order ) {
|
| 405 |
-
return '<a href="' . admin_url( 'post.php?post=' . $item->order_id . '&action=edit' ) . '">' . $order->get_order_number() . '</a>';
|
| 406 |
-
} else {
|
| 407 |
-
return $item->order_id;
|
| 408 |
-
}
|
| 409 |
-
case 'status' :
|
| 410 |
-
return $item->status;
|
| 411 |
-
case 'time' :
|
| 412 |
-
return date_i18n( get_option( 'date_format' ), strtotime( $item->time ) );
|
| 413 |
-
}
|
| 414 |
-
}
|
| 415 |
-
|
| 416 |
-
|
| 417 |
-
/**
|
| 418 |
-
* column_cb function.
|
| 419 |
-
*
|
| 420 |
-
* @access public
|
| 421 |
-
*
|
| 422 |
-
* @param mixed $item
|
| 423 |
-
*
|
| 424 |
-
* @return unknown
|
| 425 |
-
*/
|
| 426 |
-
function column_cb( $item )
|
| 427 |
-
{
|
| 428 |
-
return sprintf(
|
| 429 |
-
'<input type="checkbox" name="%1$s[]" value="%2$s" />',
|
| 430 |
-
/*$1%s*/
|
| 431 |
-
'id',
|
| 432 |
-
/*$2%s*/
|
| 433 |
-
$item->id
|
| 434 |
-
);
|
| 435 |
-
}
|
| 436 |
-
|
| 437 |
-
|
| 438 |
-
/**
|
| 439 |
-
* get_columns function.
|
| 440 |
-
*
|
| 441 |
-
* @access public
|
| 442 |
-
* @return unknown
|
| 443 |
-
*/
|
| 444 |
-
function get_columns()
|
| 445 |
-
{
|
| 446 |
-
$columns = array(
|
| 447 |
-
'cb' => '<input type="checkbox" />',
|
| 448 |
-
'product_id' => __( 'Product', 'wcvendors' ),
|
| 449 |
-
'order_id' => __( 'Order ID', 'wcvendors' ),
|
| 450 |
-
'vendor_id' => __( 'Vendor', 'wcvendors' ),
|
| 451 |
-
'total_due' => __( 'Commission', 'wcvendors' ),
|
| 452 |
-
'total_shipping' => __( 'Shipping', 'wcvendors' ),
|
| 453 |
-
'tax' => __( 'Tax', 'wcvendors' ),
|
| 454 |
-
'totals' => __( 'Total', 'wcvendors' ),
|
| 455 |
-
'status' => __( 'Status', 'wcvendors' ),
|
| 456 |
-
'time' => __( 'Date', 'wcvendors' ),
|
| 457 |
-
);
|
| 458 |
-
|
| 459 |
-
if ( ! wc_tax_enabled() ) unset( $columns[ 'tax'] );
|
| 460 |
-
|
| 461 |
-
return $columns;
|
| 462 |
-
}
|
| 463 |
-
|
| 464 |
-
|
| 465 |
-
/**
|
| 466 |
-
* get_sortable_columns function.
|
| 467 |
-
*
|
| 468 |
-
* @access public
|
| 469 |
-
* @return unknown
|
| 470 |
-
*/
|
| 471 |
-
function get_sortable_columns()
|
| 472 |
-
{
|
| 473 |
-
$sortable_columns = array(
|
| 474 |
-
'time' => array( 'time', true ),
|
| 475 |
-
'product_id' => array( 'product_id', false ),
|
| 476 |
-
'order_id' => array( 'order_id', false ),
|
| 477 |
-
'total_due' => array( 'total_due', false ),
|
| 478 |
-
'total_shipping' => array( 'total_shipping', false ),
|
| 479 |
-
'tax' => array( 'tax', false ),
|
| 480 |
-
'totals' => array( 'totals', false ),
|
| 481 |
-
'status' => array( 'status', false ),
|
| 482 |
-
'vendor_id' => array( 'vendor_id', false ),
|
| 483 |
-
'status' => array( 'status', false ),
|
| 484 |
-
);
|
| 485 |
-
|
| 486 |
-
if ( ! wc_tax_enabled() ) unset( $sortable_columns[ 'tax'] );
|
| 487 |
-
|
| 488 |
-
return $sortable_columns;
|
| 489 |
-
}
|
| 490 |
-
|
| 491 |
-
|
| 492 |
-
/**
|
| 493 |
-
* Get bulk actions
|
| 494 |
-
*
|
| 495 |
-
* @return unknown
|
| 496 |
-
*/
|
| 497 |
-
function get_bulk_actions()
|
| 498 |
-
{
|
| 499 |
-
$actions = array(
|
| 500 |
-
'mark_paid' => __( 'Mark paid', 'wcvendors' ),
|
| 501 |
-
'mark_due' => __( 'Mark due', 'wcvendors' ),
|
| 502 |
-
'mark_reversed' => __( 'Mark reversed', 'wcvendors' ),
|
| 503 |
-
// 'delete' => __('Delete', 'wcvendors'),
|
| 504 |
-
);
|
| 505 |
-
|
| 506 |
-
$actions = apply_filters('wcv_edit_bulk_actions', $actions);
|
| 507 |
-
|
| 508 |
-
return $actions;
|
| 509 |
-
}
|
| 510 |
-
|
| 511 |
-
|
| 512 |
-
/**
|
| 513 |
-
*
|
| 514 |
-
*/
|
| 515 |
-
function extra_tablenav( $which )
|
| 516 |
-
{
|
| 517 |
-
$m = isset( $_GET[ 'm' ] ) ? (int) $_GET[ 'm' ] : 0;
|
| 518 |
-
$com_status = isset( $_GET[ 'com_status' ] ) ? $_GET[ 'com_status' ] : '';
|
| 519 |
-
$vendor_id = isset( $_GET[ 'vendor_id' ] ) ? $_GET[ 'vendor_id' ] : '';
|
| 520 |
-
$args_url = '';
|
| 521 |
-
|
| 522 |
-
if ( $m ) $args_url .= '&m='. $m;
|
| 523 |
-
if ( $com_status ) $args_url .= '&com_status='. $com_status;
|
| 524 |
-
if ( $vendor_id ) $args_url .= '&vendor_id='. $vendor_id;
|
| 525 |
-
|
| 526 |
-
if ( $which == 'top' ) {
|
| 527 |
-
echo '<div class="alignleft actions" style="width: 70%;">';
|
| 528 |
-
|
| 529 |
-
// Months drop down
|
| 530 |
-
$this->months_dropdown( 'commission' );
|
| 531 |
-
|
| 532 |
-
// commission status drop down
|
| 533 |
-
$this->status_dropdown( 'commission' );
|
| 534 |
-
|
| 535 |
-
// Vendor drop down
|
| 536 |
-
$this->vendor_dropdown( 'commission' );
|
| 537 |
-
|
| 538 |
-
submit_button( __( 'Filter' ), false, false, false, array( 'id' => "post-query-submit", 'name' => 'do-filter' ) );
|
| 539 |
-
|
| 540 |
-
echo '<a class="button" style="width: 110px; float: left;" href="' . wp_nonce_url( admin_url( 'admin.php?page=pv_admin_commissions&action=export_commissions'. $args_url ), 'export_commissions', 'nonce' ) . '">' . __('Export to CSV') . '</a>';
|
| 541 |
-
echo '</div>';
|
| 542 |
-
|
| 543 |
-
}
|
| 544 |
-
}
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
/**
|
| 548 |
-
* Display a monthly dropdown for filtering items
|
| 549 |
-
*
|
| 550 |
-
* @since 3.1.0
|
| 551 |
-
* @access protected
|
| 552 |
-
*
|
| 553 |
-
* @param unknown $post_type
|
| 554 |
-
*/
|
| 555 |
-
function months_dropdown( $post_type )
|
| 556 |
-
{
|
| 557 |
-
global $wpdb, $wp_locale;
|
| 558 |
-
|
| 559 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 560 |
-
|
| 561 |
-
$months = $wpdb->get_results( "
|
| 562 |
-
SELECT DISTINCT YEAR( time ) AS year, MONTH( time ) AS month
|
| 563 |
-
FROM $table_name
|
| 564 |
-
ORDER BY time DESC
|
| 565 |
-
" );
|
| 566 |
-
|
| 567 |
-
$month_count = count( $months );
|
| 568 |
-
|
| 569 |
-
if ( !$month_count || ( 1 == $month_count && 0 == $months[ 0 ]->month ) )
|
| 570 |
-
return;
|
| 571 |
-
|
| 572 |
-
$m = isset( $_GET[ 'm' ] ) ? (int) $_GET[ 'm' ] : 0;
|
| 573 |
-
?>
|
| 574 |
-
<select name="m" id="filter-by-date">
|
| 575 |
-
<option<?php selected( $m, 0 ); ?> value='0'><?php _e( 'Show all dates', 'wcvendors' ); ?></option>
|
| 576 |
-
<?php
|
| 577 |
-
foreach ( $months as $arc_row ) {
|
| 578 |
-
if ( 0 == $arc_row->year )
|
| 579 |
-
continue;
|
| 580 |
-
|
| 581 |
-
$month = zeroise( $arc_row->month, 2 );
|
| 582 |
-
$year = $arc_row->year;
|
| 583 |
-
|
| 584 |
-
printf( "<option %s value='%s'>%s</option>\n",
|
| 585 |
-
selected( $m, $year . $month, false ),
|
| 586 |
-
esc_attr( $arc_row->year . $month ),
|
| 587 |
-
/* translators: 1: month name, 2: 4-digit year */
|
| 588 |
-
sprintf( __( '%1$s %2$d' ), $wp_locale->get_month( $month ), $year )
|
| 589 |
-
);
|
| 590 |
-
}
|
| 591 |
-
?>
|
| 592 |
-
</select>
|
| 593 |
-
|
| 594 |
-
<?php
|
| 595 |
-
}
|
| 596 |
-
|
| 597 |
-
/**
|
| 598 |
-
* Display a status dropdown for filtering items
|
| 599 |
-
*
|
| 600 |
-
* @since 3.1.0
|
| 601 |
-
* @access protected
|
| 602 |
-
*
|
| 603 |
-
* @param unknown $post_type
|
| 604 |
-
*/
|
| 605 |
-
function status_dropdown( $post_type )
|
| 606 |
-
{
|
| 607 |
-
$com_status = isset( $_GET[ 'com_status' ] ) ? $_GET[ 'com_status' ] : '';
|
| 608 |
-
?>
|
| 609 |
-
<select name="com_status">
|
| 610 |
-
<option<?php selected( $com_status, '' ); ?> value=''><?php _e( 'Show all Statuses', 'wcvendors' ); ?></option>
|
| 611 |
-
<option<?php selected( $com_status, 'due' ); ?> value="due"><?php _e( 'Due', 'wcvendors' ); ?></option>
|
| 612 |
-
<option<?php selected( $com_status, 'paid' ); ?> value="paid"><?php _e( 'Paid', 'wcvendors' ); ?></option>
|
| 613 |
-
<option<?php selected( $com_status, 'reversed' ); ?> value="reversed"><?php _e( 'Reversed', 'wcvendors' ); ?></option>
|
| 614 |
-
</select>
|
| 615 |
-
<?php
|
| 616 |
-
}
|
| 617 |
-
|
| 618 |
-
/**
|
| 619 |
-
* Display a vendor dropdown for filtering commissions
|
| 620 |
-
*
|
| 621 |
-
* @since 1.9.2
|
| 622 |
-
* @access public
|
| 623 |
-
*
|
| 624 |
-
* @param unknown $post_type
|
| 625 |
-
*/
|
| 626 |
-
public function vendor_dropdown( $post_type ){
|
| 627 |
-
|
| 628 |
-
$user_args = array( 'fields' => array( 'ID', 'display_name' ) );
|
| 629 |
-
$vendor_id = isset( $_GET[ 'vendor_id' ] ) ? $_GET[ 'vendor_id' ] : '';
|
| 630 |
-
$new_args = $user_args;
|
| 631 |
-
$new_args[ 'role' ] = 'vendor';
|
| 632 |
-
$users = get_users( $new_args );
|
| 633 |
-
|
| 634 |
-
// Generate the drop down
|
| 635 |
-
$output = '<select style="width: 30%;" name="vendor_id" id="vendor_id" class="select2">';
|
| 636 |
-
$output .= "<option></option>";
|
| 637 |
-
foreach ( (array) $users as $user ) {
|
| 638 |
-
$select = selected( $user->ID, $vendor_id, false );
|
| 639 |
-
$output .= "<option value='$user->ID' $select>$user->display_name</option>";
|
| 640 |
-
}
|
| 641 |
-
$output .= '</select>';
|
| 642 |
-
|
| 643 |
-
echo $output;
|
| 644 |
-
|
| 645 |
-
} // vendor_dropdown()
|
| 646 |
-
|
| 647 |
-
|
| 648 |
-
|
| 649 |
-
/**
|
| 650 |
-
* Process bulk actions
|
| 651 |
-
*
|
| 652 |
-
* @return unknown
|
| 653 |
-
*/
|
| 654 |
-
function process_bulk_action()
|
| 655 |
-
{
|
| 656 |
-
if ( !isset( $_GET[ 'id' ] ) ) return;
|
| 657 |
-
|
| 658 |
-
$items = array_map( 'intval', $_GET[ 'id' ] );
|
| 659 |
-
$ids = implode( ',', $items );
|
| 660 |
-
|
| 661 |
-
switch ( $this->current_action() ) {
|
| 662 |
-
case 'mark_paid':
|
| 663 |
-
$result = $this->mark_paid( $ids );
|
| 664 |
-
|
| 665 |
-
if ( $result )
|
| 666 |
-
echo '<div class="updated"><p>' . __( 'Commission marked paid.', 'wcvendors' ) . '</p></div>';
|
| 667 |
-
break;
|
| 668 |
-
|
| 669 |
-
case 'mark_due':
|
| 670 |
-
$result = $this->mark_due( $ids );
|
| 671 |
-
|
| 672 |
-
if ( $result )
|
| 673 |
-
echo '<div class="updated"><p>' . __( 'Commission marked due.', 'wcvendors' ) . '</p></div>';
|
| 674 |
-
break;
|
| 675 |
-
|
| 676 |
-
case 'mark_reversed':
|
| 677 |
-
$result = $this->mark_reversed( $ids );
|
| 678 |
-
|
| 679 |
-
if ( $result )
|
| 680 |
-
echo '<div class="updated"><p>' . __( 'Commission marked reversed.', 'wcvendors' ) . '</p></div>';
|
| 681 |
-
break;
|
| 682 |
-
|
| 683 |
-
default:
|
| 684 |
-
// code...
|
| 685 |
-
do_action('wcv_edit_process_bulk_actions', $this->current_action(), $ids);
|
| 686 |
-
break;
|
| 687 |
-
}
|
| 688 |
-
|
| 689 |
-
}
|
| 690 |
-
|
| 691 |
-
|
| 692 |
-
/**
|
| 693 |
-
*
|
| 694 |
-
*
|
| 695 |
-
* @param unknown $ids (optional)
|
| 696 |
-
*
|
| 697 |
-
* @return unknown
|
| 698 |
-
*/
|
| 699 |
-
public function mark_paid( $ids = array() )
|
| 700 |
-
{
|
| 701 |
-
global $wpdb;
|
| 702 |
-
|
| 703 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 704 |
-
|
| 705 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE id IN ($ids) AND `status` = 'due'";
|
| 706 |
-
$result = $wpdb->query( $query );
|
| 707 |
-
|
| 708 |
-
return $result;
|
| 709 |
-
}
|
| 710 |
-
|
| 711 |
-
|
| 712 |
-
/**
|
| 713 |
-
*
|
| 714 |
-
*
|
| 715 |
-
* @param unknown $ids (optional)
|
| 716 |
-
*
|
| 717 |
-
* @return unknown
|
| 718 |
-
*/
|
| 719 |
-
public function mark_reversed( $ids = array() )
|
| 720 |
-
{
|
| 721 |
-
global $wpdb;
|
| 722 |
-
|
| 723 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 724 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'reversed' WHERE id IN ($ids)";
|
| 725 |
-
$result = $wpdb->query( $query );
|
| 726 |
-
|
| 727 |
-
return $result;
|
| 728 |
-
|
| 729 |
-
}
|
| 730 |
-
|
| 731 |
-
|
| 732 |
-
/**
|
| 733 |
-
*
|
| 734 |
-
*
|
| 735 |
-
* @param unknown $ids (optional)
|
| 736 |
-
*
|
| 737 |
-
* @return unknown
|
| 738 |
-
*/
|
| 739 |
-
public function mark_due( $ids = array() )
|
| 740 |
-
{
|
| 741 |
-
global $wpdb;
|
| 742 |
-
|
| 743 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 744 |
-
|
| 745 |
-
$query = "UPDATE `{$table_name}` SET `status` = 'due' WHERE id IN ($ids)";
|
| 746 |
-
$result = $wpdb->query( $query );
|
| 747 |
-
|
| 748 |
-
return $result;
|
| 749 |
-
}
|
| 750 |
-
|
| 751 |
-
|
| 752 |
-
/**
|
| 753 |
-
* cubrid_prepare(conn_identifier, prepare_stmt)_items function.
|
| 754 |
-
*
|
| 755 |
-
* @access public
|
| 756 |
-
*/
|
| 757 |
-
function prepare_items()
|
| 758 |
-
{
|
| 759 |
-
global $wpdb;
|
| 760 |
-
|
| 761 |
-
$_SERVER['REQUEST_URI'] = remove_query_arg( '_wp_http_referer', $_SERVER['REQUEST_URI'] );
|
| 762 |
-
|
| 763 |
-
$per_page = $this->get_items_per_page( 'commission_per_page', 10 );
|
| 764 |
-
$current_page = $this->get_pagenum();
|
| 765 |
-
|
| 766 |
-
$orderby = !empty( $_REQUEST[ 'orderby' ] ) ? esc_attr( $_REQUEST[ 'orderby' ] ) : 'time';
|
| 767 |
-
$order = ( !empty( $_REQUEST[ 'order' ] ) && $_REQUEST[ 'order' ] == 'asc' ) ? 'ASC' : 'DESC';
|
| 768 |
-
$com_status = !empty( $_REQUEST[ 'com_status' ] ) ? esc_attr( $_REQUEST[ 'com_status' ] ) : '';
|
| 769 |
-
$vendor_id = !empty( $_REQUEST[ 'vendor_id' ] ) ? esc_attr( $_REQUEST[ 'vendor_id' ] ) : '';
|
| 770 |
-
$status_sql = '';
|
| 771 |
-
$time_sql = '';
|
| 772 |
-
|
| 773 |
-
/**
|
| 774 |
-
* Init column headers
|
| 775 |
-
*/
|
| 776 |
-
$this->_column_headers = $this->get_column_info();
|
| 777 |
-
|
| 778 |
-
/**
|
| 779 |
-
* Process bulk actions
|
| 780 |
-
*/
|
| 781 |
-
$this->process_bulk_action();
|
| 782 |
-
|
| 783 |
-
/**
|
| 784 |
-
* Get items
|
| 785 |
-
*/
|
| 786 |
-
$sql = "SELECT COUNT(id) FROM {$wpdb->prefix}pv_commission";
|
| 787 |
-
|
| 788 |
-
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 789 |
-
|
| 790 |
-
$year = substr( $_GET[ 'm' ], 0, 4 );
|
| 791 |
-
$month = substr( $_GET[ 'm' ], 4, 2 );
|
| 792 |
-
|
| 793 |
-
$time_sql = "
|
| 794 |
-
WHERE MONTH(`time`) = '$month'
|
| 795 |
-
AND YEAR(`time`) = '$year'
|
| 796 |
-
";
|
| 797 |
-
|
| 798 |
-
$sql .= $time_sql;
|
| 799 |
-
}
|
| 800 |
-
|
| 801 |
-
if ( !empty( $_GET[ 'com_status' ] ) ) {
|
| 802 |
-
|
| 803 |
-
if ( $time_sql == '' ) {
|
| 804 |
-
$status_sql = "
|
| 805 |
-
WHERE status = '$com_status'
|
| 806 |
-
";
|
| 807 |
-
} else {
|
| 808 |
-
$status_sql = "
|
| 809 |
-
AND status = '$com_status'
|
| 810 |
-
";
|
| 811 |
-
}
|
| 812 |
-
|
| 813 |
-
$sql .= $status_sql;
|
| 814 |
-
}
|
| 815 |
-
|
| 816 |
-
|
| 817 |
-
if ( !empty( $_GET[ 'vendor_id' ] ) ) {
|
| 818 |
-
|
| 819 |
-
if ( $time_sql == '' && $status_sql == '' ) {
|
| 820 |
-
$vendor_sql = "
|
| 821 |
-
WHERE vendor_id = '$vendor_id'
|
| 822 |
-
";
|
| 823 |
-
} else {
|
| 824 |
-
$vendor_sql = "
|
| 825 |
-
AND vendor_id = '$vendor_id'
|
| 826 |
-
";
|
| 827 |
-
}
|
| 828 |
-
|
| 829 |
-
$sql .= $vendor_sql;
|
| 830 |
-
}
|
| 831 |
-
|
| 832 |
-
$max = $wpdb->get_var( $sql );
|
| 833 |
-
|
| 834 |
-
$sql = "
|
| 835 |
-
SELECT * FROM {$wpdb->prefix}pv_commission
|
| 836 |
-
";
|
| 837 |
-
|
| 838 |
-
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 839 |
-
$sql .= $time_sql;
|
| 840 |
-
}
|
| 841 |
-
|
| 842 |
-
if ( !empty( $_GET['com_status'] ) ) {
|
| 843 |
-
$sql .= $status_sql;
|
| 844 |
-
}
|
| 845 |
-
|
| 846 |
-
if ( !empty( $_GET['vendor_id'] ) ) {
|
| 847 |
-
$sql .= $vendor_sql;
|
| 848 |
-
}
|
| 849 |
-
|
| 850 |
-
$offset = ( $current_page - 1 ) * $per_page;
|
| 851 |
-
|
| 852 |
-
$sql .= "
|
| 853 |
-
ORDER BY `{$orderby}` {$order}
|
| 854 |
-
LIMIT {$offset}, {$per_page}
|
| 855 |
-
";
|
| 856 |
-
|
| 857 |
-
// $this->items = $wpdb->get_results( $wpdb->prepare( $sql, ( $current_page - 1 ) * $per_page, $per_page ) );
|
| 858 |
-
$this->items = $wpdb->get_results( $sql );
|
| 859 |
-
|
| 860 |
-
/**
|
| 861 |
-
* Pagination
|
| 862 |
-
*/
|
| 863 |
-
$this->set_pagination_args( array(
|
| 864 |
-
'total_items' => $max,
|
| 865 |
-
'per_page' => $per_page,
|
| 866 |
-
'total_pages' => ceil( $max / $per_page )
|
| 867 |
-
) );
|
| 868 |
-
}
|
| 869 |
-
|
| 870 |
-
public function get_views() {
|
| 871 |
-
$views = array(
|
| 872 |
-
'all' => '<li class="all"><a href="' . admin_url( 'admin.php?page=pv_admin_commissions' ) . '">' . __( 'All', 'wcvendors' ) . '</a></li>',
|
| 873 |
-
'due' => '<li class="all"><a href="' . admin_url( 'admin.php?page=pv_admin_commissions&com_status=due' ) . '">' . __( 'Due', 'wcvendors' ) . '</a></li>',
|
| 874 |
-
'paid' => '<li class="all"><a href="' . admin_url( 'admin.php?page=pv_admin_commissions&com_status=paid' ) . '">' . __( 'Paid', 'wcvendors' ) . '</a></li>',
|
| 875 |
-
'void' => '<li class="all"><a href="' . admin_url( 'admin.php?page=pv_admin_commissions&com_status=void' ) . '">' . __( 'Void', 'wcvendors' ) . '</a></li>',
|
| 876 |
-
);
|
| 877 |
-
|
| 878 |
-
return $views;
|
| 879 |
-
}
|
| 880 |
-
|
| 881 |
-
|
| 882 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/class-vendor-admin-dashboard.php
CHANGED
|
@@ -578,7 +578,7 @@ class WCV_Vendor_Order_Page extends WP_List_Table {
|
|
| 578 |
'_line_tax',
|
| 579 |
'_vendor_order_item_id',
|
| 580 |
'_vendor_commission',
|
| 581 |
-
get_option( 'wcvendors_label_sold_by' ),
|
| 582 |
)
|
| 583 |
)
|
| 584 |
) ) {
|
| 578 |
'_line_tax',
|
| 579 |
'_vendor_order_item_id',
|
| 580 |
'_vendor_commission',
|
| 581 |
+
__( get_option( 'wcvendors_label_sold_by' ), 'wc-vendors' ),
|
| 582 |
)
|
| 583 |
)
|
| 584 |
) ) {
|
classes/admin/class-wcv-admin-setup.php
CHANGED
|
@@ -104,6 +104,13 @@ class WCV_Admin_Setup {
|
|
| 104 |
'callback' => array( 'WCV_Admin_Setup', 'reset_wcvendors' ),
|
| 105 |
);
|
| 106 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 107 |
return $tools;
|
| 108 |
|
| 109 |
} // wcvendors_tools()
|
|
@@ -173,6 +180,34 @@ class WCV_Admin_Setup {
|
|
| 173 |
} // reset_wcvendors()
|
| 174 |
|
| 175 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 176 |
/*
|
| 177 |
* Export commissions via csv
|
| 178 |
*/
|
| 104 |
'callback' => array( 'WCV_Admin_Setup', 'reset_wcvendors' ),
|
| 105 |
);
|
| 106 |
|
| 107 |
+
$tools['remove_suborders'] = array(
|
| 108 |
+
'name' => __( 'Remove orphaned sub orders', 'wc-vendors' ),
|
| 109 |
+
'button' => __( 'Remove orphaned sub orders', 'wc-vendors' ),
|
| 110 |
+
'desc' => __( 'This will remove all orphaned sub orders ', 'wc-vendors' ),
|
| 111 |
+
'callback' => array( 'WCV_Admin_Setup', 'remove_orphaned_orders' ),
|
| 112 |
+
);
|
| 113 |
+
|
| 114 |
return $tools;
|
| 115 |
|
| 116 |
} // wcvendors_tools()
|
| 180 |
} // reset_wcvendors()
|
| 181 |
|
| 182 |
|
| 183 |
+
/**
|
| 184 |
+
* Clean up orphaned Vendor sub orders that do not have parent posts
|
| 185 |
+
*
|
| 186 |
+
* @since 2.1.13
|
| 187 |
+
*/
|
| 188 |
+
public static function remove_orphaned_orders(){
|
| 189 |
+
|
| 190 |
+
$args = array(
|
| 191 |
+
'post_status' => 'any',
|
| 192 |
+
'numberposts' => -1,
|
| 193 |
+
'post_type' => 'shop_order_vendor',
|
| 194 |
+
'fields' => array( 'ID', 'post_parent' ),
|
| 195 |
+
);
|
| 196 |
+
|
| 197 |
+
$vendor_sub_orders = get_posts( $args );
|
| 198 |
+
|
| 199 |
+
if ( empty( $vendor_sub_orders ) ) return;
|
| 200 |
+
|
| 201 |
+
foreach ( $vendor_sub_orders as $vendor_sub_order ) {
|
| 202 |
+
if ( ! get_post_status( $vendor_sub_order->post_parent ) ){
|
| 203 |
+
wp_delete_post( $vendor_sub_order->ID, true );
|
| 204 |
+
}
|
| 205 |
+
}
|
| 206 |
+
|
| 207 |
+
echo '<div class="updated inline"><p>' . __( 'Orphaned sub orders have been removed.', 'wc-vendors' ) . '</p></div>';
|
| 208 |
+
}
|
| 209 |
+
|
| 210 |
+
|
| 211 |
/*
|
| 212 |
* Export commissions via csv
|
| 213 |
*/
|
classes/admin/emails/class-emails.php
CHANGED
|
@@ -87,11 +87,13 @@ class WCV_Emails {
|
|
| 87 |
}
|
| 88 |
|
| 89 |
/**
|
|
|
|
| 90 |
*
|
|
|
|
|
|
|
|
|
|
| 91 |
*
|
| 92 |
-
* @
|
| 93 |
-
*
|
| 94 |
-
* @return unknown
|
| 95 |
*/
|
| 96 |
public function email_classes( $emails ) {
|
| 97 |
|
|
@@ -100,17 +102,18 @@ class WCV_Emails {
|
|
| 100 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-approve-vendor.php';
|
| 101 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-shipped.php';
|
| 102 |
|
| 103 |
-
// Emails to depreciate
|
| 104 |
$emails['WC_Email_Notify_Vendor'] = new WC_Email_Notify_Vendor();
|
| 105 |
$emails['WC_Email_Approve_Vendor'] = new WC_Email_Approve_Vendor();
|
| 106 |
$emails['WC_Email_Notify_Admin'] = new WC_Email_Notify_Admin();
|
| 107 |
$emails['WC_Email_Notify_Shipped'] = new WC_Email_Notify_Shipped();
|
| 108 |
|
| 109 |
-
// New emails introduced in @since 2.0.0
|
| 110 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-customer-notify-shipped.php';
|
| 111 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-shipped.php';
|
| 112 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-product.php';
|
| 113 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-application.php';
|
|
|
|
| 114 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-application.php';
|
| 115 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-approved.php';
|
| 116 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-denied.php';
|
|
@@ -121,6 +124,7 @@ class WCV_Emails {
|
|
| 121 |
$emails['WCVendors_Admin_Notify_Shipped'] = new WCVendors_Admin_Notify_Shipped();
|
| 122 |
$emails['WCVendors_Admin_Notify_Product'] = new WCVendors_Admin_Notify_Product();
|
| 123 |
$emails['WCVendors_Admin_Notify_Application'] = new WCVendors_Admin_Notify_Application();
|
|
|
|
| 124 |
$emails['WCVendors_Vendor_Notify_Application'] = new WCVendors_Vendor_Notify_Application();
|
| 125 |
$emails['WCVendors_Vendor_Notify_Approved'] = new WCVendors_Vendor_Notify_Approved();
|
| 126 |
$emails['WCVendors_Vendor_Notify_Denied'] = new WCVendors_Vendor_Notify_Denied();
|
|
@@ -129,7 +133,7 @@ class WCV_Emails {
|
|
| 129 |
|
| 130 |
return $emails;
|
| 131 |
|
| 132 |
-
} // email_classes
|
| 133 |
|
| 134 |
/**
|
| 135 |
* Add the vendor email to the low stock emails.
|
|
@@ -250,7 +254,7 @@ class WCV_Emails {
|
|
| 250 |
} elseif ( $role == 'vendor' ) {
|
| 251 |
$status = __( 'approved', 'wc-vendors' );
|
| 252 |
WC()->mailer()->emails['WCVendors_Vendor_Notify_Approved']->trigger( $user_id, $status );
|
| 253 |
-
WC()->mailer()->emails['
|
| 254 |
}
|
| 255 |
|
| 256 |
}
|
| 87 |
}
|
| 88 |
|
| 89 |
/**
|
| 90 |
+
* Load WooCommerce email classes.
|
| 91 |
*
|
| 92 |
+
* @param array $emails Current list of WooCommerce emails.
|
| 93 |
+
* @version 2.0.13
|
| 94 |
+
* @since 1.0.0
|
| 95 |
*
|
| 96 |
+
* @return array
|
|
|
|
|
|
|
| 97 |
*/
|
| 98 |
public function email_classes( $emails ) {
|
| 99 |
|
| 102 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-approve-vendor.php';
|
| 103 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-shipped.php';
|
| 104 |
|
| 105 |
+
// Emails to depreciate.
|
| 106 |
$emails['WC_Email_Notify_Vendor'] = new WC_Email_Notify_Vendor();
|
| 107 |
$emails['WC_Email_Approve_Vendor'] = new WC_Email_Approve_Vendor();
|
| 108 |
$emails['WC_Email_Notify_Admin'] = new WC_Email_Notify_Admin();
|
| 109 |
$emails['WC_Email_Notify_Shipped'] = new WC_Email_Notify_Shipped();
|
| 110 |
|
| 111 |
+
// New emails introduced in @since 2.0.0.
|
| 112 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-customer-notify-shipped.php';
|
| 113 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-shipped.php';
|
| 114 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-product.php';
|
| 115 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-application.php';
|
| 116 |
+
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-admin-notify-approved.php';
|
| 117 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-application.php';
|
| 118 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-approved.php';
|
| 119 |
require_once wcv_plugin_dir . 'classes/admin/emails/class-wcv-vendor-notify-denied.php';
|
| 124 |
$emails['WCVendors_Admin_Notify_Shipped'] = new WCVendors_Admin_Notify_Shipped();
|
| 125 |
$emails['WCVendors_Admin_Notify_Product'] = new WCVendors_Admin_Notify_Product();
|
| 126 |
$emails['WCVendors_Admin_Notify_Application'] = new WCVendors_Admin_Notify_Application();
|
| 127 |
+
$emails['WCVendors_Admin_Notify_Approved'] = new WCVendors_Admin_Notify_Approved();
|
| 128 |
$emails['WCVendors_Vendor_Notify_Application'] = new WCVendors_Vendor_Notify_Application();
|
| 129 |
$emails['WCVendors_Vendor_Notify_Approved'] = new WCVendors_Vendor_Notify_Approved();
|
| 130 |
$emails['WCVendors_Vendor_Notify_Denied'] = new WCVendors_Vendor_Notify_Denied();
|
| 133 |
|
| 134 |
return $emails;
|
| 135 |
|
| 136 |
+
} // email_classes
|
| 137 |
|
| 138 |
/**
|
| 139 |
* Add the vendor email to the low stock emails.
|
| 254 |
} elseif ( $role == 'vendor' ) {
|
| 255 |
$status = __( 'approved', 'wc-vendors' );
|
| 256 |
WC()->mailer()->emails['WCVendors_Vendor_Notify_Approved']->trigger( $user_id, $status );
|
| 257 |
+
WC()->mailer()->emails['WCVendors_Admin_Notify_Approved']->trigger( $user_id, $status );
|
| 258 |
}
|
| 259 |
|
| 260 |
}
|
classes/admin/emails/class-wcv-admin-notify-application.php
CHANGED
|
@@ -34,10 +34,10 @@ if ( ! class_exists( 'WCVendors_Admin_Notify_Application' ) ) :
|
|
| 34 |
'{user_name}' => '',
|
| 35 |
);
|
| 36 |
|
| 37 |
-
// Call parent constructor
|
| 38 |
parent::__construct();
|
| 39 |
|
| 40 |
-
// Other settings
|
| 41 |
$this->recipient = $this->get_option( 'recipient', get_option( 'admin_email' ) );
|
| 42 |
}
|
| 43 |
|
| 34 |
'{user_name}' => '',
|
| 35 |
);
|
| 36 |
|
| 37 |
+
// Call parent constructor.
|
| 38 |
parent::__construct();
|
| 39 |
|
| 40 |
+
// Other settings.
|
| 41 |
$this->recipient = $this->get_option( 'recipient', get_option( 'admin_email' ) );
|
| 42 |
}
|
| 43 |
|
classes/admin/emails/class-wcv-admin-notify-approved.php
ADDED
|
@@ -0,0 +1,202 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Defines the class to send admin notification for approved vendors.
|
| 4 |
+
*
|
| 5 |
+
* @version 2.0.13
|
| 6 |
+
* @package Classes/Admin/Emails
|
| 7 |
+
* @author WC Vendors
|
| 8 |
+
*/
|
| 9 |
+
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
+
exit;
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
if ( ! class_exists( 'WCVendors_Admin_Notify_Approved' ) ) :
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* Notify Admin Approved
|
| 17 |
+
*
|
| 18 |
+
* An email sent to the admin when admin approves a user to be a vendor
|
| 19 |
+
*
|
| 20 |
+
* @since 2.0.
|
| 21 |
+
* @version 2.0.
|
| 22 |
+
* @class WCVendors_Admin_Notify_Approved
|
| 23 |
+
* @extends WC_Email
|
| 24 |
+
*/
|
| 25 |
+
class WCVendors_Admin_Notify_Approved extends WC_Email {
|
| 26 |
+
|
| 27 |
+
/**
|
| 28 |
+
* Constructor.
|
| 29 |
+
*/
|
| 30 |
+
public function __construct() {
|
| 31 |
+
$this->id = 'admin_notify_application';
|
| 32 |
+
$this->title = sprintf( __( 'Admin notify %s approved', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 33 |
+
$this->description = sprintf( __( 'Notification is sent to chosen recipient(s) when admin approves a user to be a %s', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 34 |
+
$this->template_html = 'emails/admin-notify-approved.php';
|
| 35 |
+
$this->template_plain = 'emails/plain/admin-notify-approved.php';
|
| 36 |
+
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/';
|
| 37 |
+
$this->placeholders = array(
|
| 38 |
+
'{site_title}' => $this->get_blogname(),
|
| 39 |
+
'{user_name}' => '',
|
| 40 |
+
);
|
| 41 |
+
|
| 42 |
+
// Call parent constructor.
|
| 43 |
+
parent::__construct();
|
| 44 |
+
|
| 45 |
+
// Other settings.
|
| 46 |
+
$this->recipient = $this->get_option( 'recipient', get_option( 'admin_email' ) );
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
/**
|
| 50 |
+
* Get email subject.
|
| 51 |
+
*
|
| 52 |
+
* @since 2.0.0
|
| 53 |
+
* @return string
|
| 54 |
+
*/
|
| 55 |
+
public function get_default_subject() {
|
| 56 |
+
return sprintf( __( '[{site_title}] {user_name} has been approved to be a %s', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
/**
|
| 60 |
+
* Get email heading.
|
| 61 |
+
*
|
| 62 |
+
* @since 2.0.0
|
| 63 |
+
* @return string
|
| 64 |
+
*/
|
| 65 |
+
public function get_default_heading() {
|
| 66 |
+
return sprintf( __( '%s application approved', 'wc-vendors' ), wcv_get_vendor_name() );
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
/**
|
| 70 |
+
* Trigger the sending of this email.
|
| 71 |
+
*
|
| 72 |
+
* @param int $vendor_id The order ID.
|
| 73 |
+
* @param string $status vendor role.
|
| 74 |
+
*/
|
| 75 |
+
public function trigger( $vendor_id, $status ) {
|
| 76 |
+
|
| 77 |
+
$this->setup_locale();
|
| 78 |
+
|
| 79 |
+
$this->user = get_userdata( $vendor_id );
|
| 80 |
+
$this->status = $status;
|
| 81 |
+
$this->placeholders['{user_name}'] = $this->user->user_login;
|
| 82 |
+
|
| 83 |
+
$send_if = $this->get_option( 'notification' );
|
| 84 |
+
$should_send = $send_if == 'vendor' ? true : ( $send_if == 'vendor' && $status == 'approved' ? true : false );
|
| 85 |
+
|
| 86 |
+
if ( $this->is_enabled() && $this->get_recipient() && $should_send ) {
|
| 87 |
+
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
$this->restore_locale();
|
| 91 |
+
}
|
| 92 |
+
|
| 93 |
+
/**
|
| 94 |
+
* Get content html.
|
| 95 |
+
*
|
| 96 |
+
* @access public
|
| 97 |
+
* @return string
|
| 98 |
+
*/
|
| 99 |
+
public function get_content_html() {
|
| 100 |
+
|
| 101 |
+
return wc_get_template_html(
|
| 102 |
+
$this->template_html,
|
| 103 |
+
array(
|
| 104 |
+
'order' => $this->object,
|
| 105 |
+
'email_heading' => $this->get_heading(),
|
| 106 |
+
'sent_to_admin' => true,
|
| 107 |
+
'plain_text' => false,
|
| 108 |
+
'email' => $this,
|
| 109 |
+
'user' => $this->user,
|
| 110 |
+
'status' => $this->status,
|
| 111 |
+
),
|
| 112 |
+
'woocommerce',
|
| 113 |
+
$this->template_base
|
| 114 |
+
);
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
/**
|
| 118 |
+
* Get content plain.
|
| 119 |
+
*
|
| 120 |
+
* @access public
|
| 121 |
+
* @return string
|
| 122 |
+
*/
|
| 123 |
+
public function get_content_plain() {
|
| 124 |
+
return wc_get_template_html(
|
| 125 |
+
$this->template_plain,
|
| 126 |
+
array(
|
| 127 |
+
'order' => $this->object,
|
| 128 |
+
'email_heading' => $this->get_heading(),
|
| 129 |
+
'sent_to_admin' => true,
|
| 130 |
+
'plain_text' => true,
|
| 131 |
+
'email' => $this,
|
| 132 |
+
'user' => $this->user,
|
| 133 |
+
'status' => $this->status,
|
| 134 |
+
),
|
| 135 |
+
'woocommerce',
|
| 136 |
+
$this->template_base
|
| 137 |
+
);
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
/**
|
| 141 |
+
* Initialise settings form fields.
|
| 142 |
+
*/
|
| 143 |
+
public function init_form_fields() {
|
| 144 |
+
$this->form_fields = array(
|
| 145 |
+
'enabled' => array(
|
| 146 |
+
'title' => __( 'Enable/Disable', 'wc-vendors' ),
|
| 147 |
+
'type' => 'checkbox',
|
| 148 |
+
'label' => __( 'Enable this email notification', 'wc-vendors' ),
|
| 149 |
+
'default' => 'yes',
|
| 150 |
+
),
|
| 151 |
+
'recipient' => array(
|
| 152 |
+
'title' => __( 'Recipient(s)', 'wc-vendors' ),
|
| 153 |
+
'type' => 'text',
|
| 154 |
+
'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to %s.', 'wc-vendors' ), '<code>' . esc_attr( get_option( 'admin_email' ) ) . '</code>' ),
|
| 155 |
+
'placeholder' => '',
|
| 156 |
+
'default' => '',
|
| 157 |
+
'desc_tip' => true,
|
| 158 |
+
),
|
| 159 |
+
'subject' => array(
|
| 160 |
+
'title' => __( 'Subject', 'wc-vendors' ),
|
| 161 |
+
'type' => 'text',
|
| 162 |
+
'desc_tip' => true,
|
| 163 |
+
/* translators: %s: list of placeholders */
|
| 164 |
+
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{user_name}</code>' ),
|
| 165 |
+
'placeholder' => $this->get_default_subject(),
|
| 166 |
+
'default' => '',
|
| 167 |
+
),
|
| 168 |
+
'heading' => array(
|
| 169 |
+
'title' => __( 'Email heading', 'wc-vendors' ),
|
| 170 |
+
'type' => 'text',
|
| 171 |
+
'desc_tip' => true,
|
| 172 |
+
/* translators: %s: list of placeholders */
|
| 173 |
+
'description' => sprintf( __( 'Available placeholders: %s', 'wc-vendors' ), '<code>{user_name}</code>' ),
|
| 174 |
+
'placeholder' => $this->get_default_heading(),
|
| 175 |
+
'default' => '',
|
| 176 |
+
),
|
| 177 |
+
'notification' => array(
|
| 178 |
+
'title' => __( 'Notification', 'wc-vendors' ),
|
| 179 |
+
'type' => 'select',
|
| 180 |
+
'description' => __( 'Choose when to be notified of an application.', 'wc-vendors' ),
|
| 181 |
+
'default' => 'vendor',
|
| 182 |
+
'class' => 'wc-enhanced-select',
|
| 183 |
+
'options' => array(
|
| 184 |
+
'vendor' => __( 'All Applications', 'wc-vendors' ),
|
| 185 |
+
'pending_vendor' => __( 'Pending Applications', 'wc-vendors' ),
|
| 186 |
+
),
|
| 187 |
+
'desc_tip' => true,
|
| 188 |
+
),
|
| 189 |
+
'email_type' => array(
|
| 190 |
+
'title' => __( 'Email type', 'wc-vendors' ),
|
| 191 |
+
'type' => 'select',
|
| 192 |
+
'description' => __( 'Choose which format of email to send.', 'wc-vendors' ),
|
| 193 |
+
'default' => 'html',
|
| 194 |
+
'class' => 'email_type wc-enhanced-select',
|
| 195 |
+
'options' => $this->get_email_type_options(),
|
| 196 |
+
'desc_tip' => true,
|
| 197 |
+
),
|
| 198 |
+
);
|
| 199 |
+
}
|
| 200 |
+
}
|
| 201 |
+
|
| 202 |
+
endif;
|
classes/admin/emails/class-wcv-vendor-notify-application.php
CHANGED
|
@@ -63,7 +63,7 @@ if ( ! class_exists( 'WCVendors_Vendor_Notify_Application' ) ) :
|
|
| 63 |
|
| 64 |
public function get_default_content() {
|
| 65 |
|
| 66 |
-
return sprintf( __( 'Hi there. This is a notification about
|
| 67 |
}
|
| 68 |
|
| 69 |
/**
|
| 63 |
|
| 64 |
public function get_default_content() {
|
| 65 |
|
| 66 |
+
return sprintf( __( 'Hi there. This is a notification about your %1$s application on %2$s.', 'wc-vendors' ), wcv_get_vendor_name( true, false ), get_option( 'blogname' ) );
|
| 67 |
}
|
| 68 |
|
| 69 |
/**
|
classes/admin/emails/class-wcv-vendor-notify-approved.php
CHANGED
|
@@ -47,7 +47,7 @@ if ( ! class_exists( 'WCVendors_Vendor_Notify_Approved' ) ) :
|
|
| 47 |
*/
|
| 48 |
public function get_default_subject() {
|
| 49 |
|
| 50 |
-
return __( '[{site_title}] Your
|
| 51 |
}
|
| 52 |
|
| 53 |
/**
|
| 47 |
*/
|
| 48 |
public function get_default_subject() {
|
| 49 |
|
| 50 |
+
return sprintf( __( '[{site_title}] Your %s application has been approved', 'wc-vendors' ), wcv_get_vendor_name( true, false ) );
|
| 51 |
}
|
| 52 |
|
| 53 |
/**
|
classes/admin/settings/README.md
DELETED
|
@@ -1,126 +0,0 @@
|
|
| 1 |
-
WP Simple Settings Framework
|
| 2 |
-
================================
|
| 3 |
-
|
| 4 |
-
A minimalistic framework for Wordpress Settings API.
|
| 5 |
-
|
| 6 |
-
Quick start
|
| 7 |
-
------------
|
| 8 |
-
|
| 9 |
-
* [Download the latest release](https://github.com/Geczy/WP-Simple-Settings-Framework/zipball/master) (zip)
|
| 10 |
-
|
| 11 |
-
* Or, clone the repo, `git clone git://github.com/Geczy/WP-Simple-Settings-Framework.git`
|
| 12 |
-
|
| 13 |
-
Installation
|
| 14 |
-
------------
|
| 15 |
-
1. Include the framework in your Wordpress plugin by using:
|
| 16 |
-
|
| 17 |
-
```php
|
| 18 |
-
<?php
|
| 19 |
-
add_action( 'init', 'sf_load_settings' );
|
| 20 |
-
function sf_load_settings() {
|
| 21 |
-
require 'classes/sf-class-settings.php';
|
| 22 |
-
$settings_framework = new SF_Settings_API($id = 'my_plugin_name', $title = 'My Plugin Title', $menu = 'plugins.php', __FILE__);
|
| 23 |
-
}
|
| 24 |
-
```
|
| 25 |
-
|
| 26 |
-
Optionally, you might want to make `$settings_framework` a global variable so that you can use the [helper functions](#helpers).
|
| 27 |
-
|
| 28 |
-
2. Open `sf-options.php` to begin configuring your options.
|
| 29 |
-
|
| 30 |
-
Features
|
| 31 |
-
------------
|
| 32 |
-
|
| 33 |
-
### Automatic settings page
|
| 34 |
-
Don't want it under the Plugins tab like in the screenshot? No problem, you can choose where you want it!
|
| 35 |
-
|
| 36 |
-
You can also change "Simple Settings" submenu to be anything you'd like.
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
---
|
| 41 |
-
|
| 42 |
-
### Tooltips
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
Optional tooltips using [Twitter Bootstrap](http://twitter.github.com/bootstrap/javascript.html#tooltips)!
|
| 46 |
-
|
| 47 |
-
---
|
| 48 |
-
|
| 49 |
-
### Select box replacement
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
Utilizing [Select2](http://ivaynberg.github.com/select2/) to display select boxes. It's pretty cool!
|
| 53 |
-
|
| 54 |
-
---
|
| 55 |
-
|
| 56 |
-
### Multiple tabs
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
Create multiple tabs for your options.
|
| 60 |
-
|
| 61 |
-
---
|
| 62 |
-
|
| 63 |
-
### Input types
|
| 64 |
-
|
| 65 |
-
* Text
|
| 66 |
-
* Number
|
| 67 |
-
* Textarea
|
| 68 |
-
* Checkbox
|
| 69 |
-
* Radio
|
| 70 |
-
* Select
|
| 71 |
-
* WP Pages
|
| 72 |
-
|
| 73 |
-
Helpers
|
| 74 |
-
------------
|
| 75 |
-
|
| 76 |
-
Update or add a new option
|
| 77 |
-
|
| 78 |
-
```php
|
| 79 |
-
<?php
|
| 80 |
-
$settings_framework->update_option('your_option', 'new_value');
|
| 81 |
-
```
|
| 82 |
-
|
| 83 |
-
Get an existing option's value
|
| 84 |
-
|
| 85 |
-
```php
|
| 86 |
-
<?php
|
| 87 |
-
$settings_framework->get_option('your_option');
|
| 88 |
-
```
|
| 89 |
-
|
| 90 |
-
Example configuration
|
| 91 |
-
------------
|
| 92 |
-
|
| 93 |
-
Check out the [example config](https://github.com/Geczy/WP-Simple-Settings-Framework/blob/master/sf-options.php) for an idea of how to use every input type.
|
| 94 |
-
|
| 95 |
-
Here's an example of one type, though:
|
| 96 |
-
|
| 97 |
-
```php
|
| 98 |
-
<?php
|
| 99 |
-
$options[] = array(
|
| 100 |
-
'name' => __( 'Name', 'geczy' ),
|
| 101 |
-
'desc' => __( 'Please tell me who you are.', 'geczy' ),
|
| 102 |
-
'id' => 'text_sample',
|
| 103 |
-
'type' => 'text',
|
| 104 |
-
);
|
| 105 |
-
```
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
Bug tracker
|
| 109 |
-
-----------
|
| 110 |
-
|
| 111 |
-
Have a bug? Please create an issue here on GitHub!
|
| 112 |
-
|
| 113 |
-
https://github.com/Geczy/WP-Simple-Settings-Framework/issues/
|
| 114 |
-
|
| 115 |
-
Copyright and License
|
| 116 |
-
---------------------
|
| 117 |
-
|
| 118 |
-
Copyright 2012 Matthew Gates
|
| 119 |
-
|
| 120 |
-
Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:
|
| 121 |
-
|
| 122 |
-
* Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.
|
| 123 |
-
* Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.
|
| 124 |
-
* Neither the names of the copyright holders nor the names of the contributors may be used to endorse or promote products derived from this software without specific prior written permission.
|
| 125 |
-
|
| 126 |
-
http://www.opensource.org/licenses/bsd-license.php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/css/sf-styles.css
DELETED
|
@@ -1,167 +0,0 @@
|
|
| 1 |
-
a.sf-tips {
|
| 2 |
-
height: 16px;
|
| 3 |
-
width: 16px;
|
| 4 |
-
margin-top: 0.2em;
|
| 5 |
-
float: right;
|
| 6 |
-
background: url(../img/tip.png) no-repeat top left;
|
| 7 |
-
}
|
| 8 |
-
|
| 9 |
-
/*!
|
| 10 |
-
* Bootstrap v2.3.1 [Styles for Tooltips]
|
| 11 |
-
*
|
| 12 |
-
* Copyright 2012 Twitter, Inc
|
| 13 |
-
* Licensed under the Apache License v2.0
|
| 14 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 15 |
-
*
|
| 16 |
-
* Designed and built with all the love in the world @twitter by @mdo and @fat.
|
| 17 |
-
*/
|
| 18 |
-
.clearfix {
|
| 19 |
-
*zoom: 1;
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
.clearfix:before, .clearfix:after {
|
| 23 |
-
display: table;
|
| 24 |
-
content: "";
|
| 25 |
-
line-height: 0;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
.clearfix:after {
|
| 29 |
-
clear: both;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
.hide-text {
|
| 33 |
-
font: 0/0 a;
|
| 34 |
-
color: transparent;
|
| 35 |
-
text-shadow: none;
|
| 36 |
-
background-color: transparent;
|
| 37 |
-
border: 0;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
.input-block-level {
|
| 41 |
-
display: block;
|
| 42 |
-
width: 100%;
|
| 43 |
-
min-height: 30px;
|
| 44 |
-
-webkit-box-sizing: border-box;
|
| 45 |
-
-moz-box-sizing: border-box;
|
| 46 |
-
box-sizing: border-box;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/* Tooltips */
|
| 50 |
-
.tooltip {
|
| 51 |
-
text-shadow: none;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
.tooltip {
|
| 55 |
-
position: absolute;
|
| 56 |
-
z-index: 1030;
|
| 57 |
-
display: block;
|
| 58 |
-
visibility: visible;
|
| 59 |
-
font-size: 11px;
|
| 60 |
-
line-height: 1.4;
|
| 61 |
-
opacity: 0;
|
| 62 |
-
filter: alpha(opacity=0);
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
.tooltip.in {
|
| 66 |
-
opacity: 0.8;
|
| 67 |
-
filter: alpha(opacity=80);
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
.tooltip.top {
|
| 71 |
-
margin-top: -3px;
|
| 72 |
-
padding: 5px 0;
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
.tooltip.right {
|
| 76 |
-
margin-left: 3px;
|
| 77 |
-
padding: 0 5px;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
.tooltip.bottom {
|
| 81 |
-
margin-top: 3px;
|
| 82 |
-
padding: 5px 0;
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
.tooltip.left {
|
| 86 |
-
margin-left: -3px;
|
| 87 |
-
padding: 0 5px;
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
.tooltip-inner {
|
| 91 |
-
max-width: 200px;
|
| 92 |
-
padding: 8px;
|
| 93 |
-
color: #ffffff;
|
| 94 |
-
text-align: center;
|
| 95 |
-
text-decoration: none;
|
| 96 |
-
background-color: #000000;
|
| 97 |
-
-webkit-border-radius: 4px;
|
| 98 |
-
-moz-border-radius: 4px;
|
| 99 |
-
border-radius: 4px;
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
.tooltip-arrow {
|
| 103 |
-
position: absolute;
|
| 104 |
-
width: 0;
|
| 105 |
-
height: 0;
|
| 106 |
-
border-color: transparent;
|
| 107 |
-
border-style: solid;
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
.tooltip.top .tooltip-arrow {
|
| 111 |
-
bottom: 0;
|
| 112 |
-
left: 50%;
|
| 113 |
-
margin-left: -5px;
|
| 114 |
-
border-width: 5px 5px 0;
|
| 115 |
-
border-top-color: #000000;
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
.tooltip.right .tooltip-arrow {
|
| 119 |
-
top: 50%;
|
| 120 |
-
left: 0;
|
| 121 |
-
margin-top: -5px;
|
| 122 |
-
border-width: 5px 5px 5px 0;
|
| 123 |
-
border-right-color: #000000;
|
| 124 |
-
}
|
| 125 |
-
|
| 126 |
-
.tooltip.left .tooltip-arrow {
|
| 127 |
-
top: 50%;
|
| 128 |
-
right: 0;
|
| 129 |
-
margin-top: -5px;
|
| 130 |
-
border-width: 5px 0 5px 5px;
|
| 131 |
-
border-left-color: #000000;
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
.tooltip.bottom .tooltip-arrow {
|
| 135 |
-
top: 0;
|
| 136 |
-
left: 50%;
|
| 137 |
-
margin-left: -5px;
|
| 138 |
-
border-width: 0 5px 5px;
|
| 139 |
-
border-bottom-color: #000000;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
/* Animation */
|
| 143 |
-
.fade {
|
| 144 |
-
opacity: 0;
|
| 145 |
-
-webkit-transition: opacity 0.15s linear;
|
| 146 |
-
-moz-transition: opacity 0.15s linear;
|
| 147 |
-
-o-transition: opacity 0.15s linear;
|
| 148 |
-
transition: opacity 0.15s linear;
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
.fade.in {
|
| 152 |
-
opacity: 1;
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
.collapse {
|
| 156 |
-
position: relative;
|
| 157 |
-
height: 0;
|
| 158 |
-
overflow: hidden;
|
| 159 |
-
-webkit-transition: height 0.35s ease;
|
| 160 |
-
-moz-transition: height 0.35s ease;
|
| 161 |
-
-o-transition: height 0.35s ease;
|
| 162 |
-
transition: height 0.35s ease;
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
.collapse.in {
|
| 166 |
-
height: auto;
|
| 167 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/img/tip.png
DELETED
|
Binary file
|
classes/admin/settings/assets/js/bootstrap-tooltip.js
DELETED
|
@@ -1,126 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Bootstrap.js by @fat & @mdo
|
| 3 |
-
* plugins: bootstrap-transition.js, bootstrap-tooltip.js
|
| 4 |
-
* 2.3.1
|
| 5 |
-
* Copyright 2012 Twitter, Inc.
|
| 6 |
-
* http://www.apache.org/licenses/LICENSE-2.0.txt
|
| 7 |
-
*/
|
| 8 |
-
!function (a) {
|
| 9 |
-
a(function () {
|
| 10 |
-
a.support.transition = function () {
|
| 11 |
-
var a = function () {
|
| 12 |
-
var a = document.createElement("bootstrap"), b = {WebkitTransition: "webkitTransitionEnd", MozTransition: "transitionend", OTransition: "oTransitionEnd otransitionend", transition: "transitionend"}, c;
|
| 13 |
-
for (c in b)if (a.style[c] !== undefined)return b[c]
|
| 14 |
-
}();
|
| 15 |
-
return a && {end: a}
|
| 16 |
-
}()
|
| 17 |
-
})
|
| 18 |
-
}(window.jQuery), !function (a) {
|
| 19 |
-
var b = function (a, b) {
|
| 20 |
-
this.init("tooltip", a, b)
|
| 21 |
-
};
|
| 22 |
-
b.prototype = {constructor: b, init: function (b, c, d) {
|
| 23 |
-
var e, f, g, h, i;
|
| 24 |
-
this.type = b, this.$element = a(c), this.options = this.getOptions(d), this.enabled = !0, g = this.options.trigger.split(" ");
|
| 25 |
-
for (i = g.length; i--;)h = g[i], h == "click" ? this.$element.on("click." + this.type, this.options.selector, a.proxy(this.toggle, this)) : h != "manual" && (e = h == "hover" ? "mouseenter" : "focus", f = h == "hover" ? "mouseleave" : "blur", this.$element.on(e + "." + this.type, this.options.selector, a.proxy(this.enter, this)), this.$element.on(f + "." + this.type, this.options.selector, a.proxy(this.leave, this)));
|
| 26 |
-
this.options.selector ? this._options = a.extend({}, this.options, {trigger: "manual", selector: ""}) : this.fixTitle()
|
| 27 |
-
}, getOptions: function (b) {
|
| 28 |
-
return b = a.extend({}, a.fn[this.type].defaults, this.$element.data(), b), b.delay && typeof b.delay == "number" && (b.delay = {show: b.delay, hide: b.delay}), b
|
| 29 |
-
}, enter: function (b) {
|
| 30 |
-
var c = a.fn[this.type].defaults, d = {}, e;
|
| 31 |
-
this._options && a.each(this._options, function (a, b) {
|
| 32 |
-
c[a] != b && (d[a] = b)
|
| 33 |
-
}, this), e = a(b.currentTarget)[this.type](d).data(this.type);
|
| 34 |
-
if (!e.options.delay || !e.options.delay.show)return e.show();
|
| 35 |
-
clearTimeout(this.timeout), e.hoverState = "in", this.timeout = setTimeout(function () {
|
| 36 |
-
e.hoverState == "in" && e.show()
|
| 37 |
-
}, e.options.delay.show)
|
| 38 |
-
}, leave: function (b) {
|
| 39 |
-
var c = a(b.currentTarget)[this.type](this._options).data(this.type);
|
| 40 |
-
this.timeout && clearTimeout(this.timeout);
|
| 41 |
-
if (!c.options.delay || !c.options.delay.hide)return c.hide();
|
| 42 |
-
c.hoverState = "out", this.timeout = setTimeout(function () {
|
| 43 |
-
c.hoverState == "out" && c.hide()
|
| 44 |
-
}, c.options.delay.hide)
|
| 45 |
-
}, show: function () {
|
| 46 |
-
var b, c, d, e, f, g, h = a.Event("show");
|
| 47 |
-
if (this.hasContent() && this.enabled) {
|
| 48 |
-
this.$element.trigger(h);
|
| 49 |
-
if (h.isDefaultPrevented())return;
|
| 50 |
-
b = this.tip(), this.setContent(), this.options.animation && b.addClass("fade"), f = typeof this.options.placement == "function" ? this.options.placement.call(this, b[0], this.$element[0]) : this.options.placement, b.detach().css({top: 0, left: 0, display: "block"}), this.options.container ? b.appendTo(this.options.container) : b.insertAfter(this.$element), c = this.getPosition(), d = b[0].offsetWidth, e = b[0].offsetHeight;
|
| 51 |
-
switch (f) {
|
| 52 |
-
case"bottom":
|
| 53 |
-
g = {top: c.top + c.height, left: c.left + c.width / 2 - d / 2};
|
| 54 |
-
break;
|
| 55 |
-
case"top":
|
| 56 |
-
g = {top: c.top - e, left: c.left + c.width / 2 - d / 2};
|
| 57 |
-
break;
|
| 58 |
-
case"left":
|
| 59 |
-
g = {top: c.top + c.height / 2 - e / 2, left: c.left - d};
|
| 60 |
-
break;
|
| 61 |
-
case"right":
|
| 62 |
-
g = {top: c.top + c.height / 2 - e / 2, left: c.left + c.width}
|
| 63 |
-
}
|
| 64 |
-
this.applyPlacement(g, f), this.$element.trigger("shown")
|
| 65 |
-
}
|
| 66 |
-
}, applyPlacement: function (a, b) {
|
| 67 |
-
var c = this.tip(), d = c[0].offsetWidth, e = c[0].offsetHeight, f, g, h, i;
|
| 68 |
-
c.offset(a).addClass(b).addClass("in"), f = c[0].offsetWidth, g = c[0].offsetHeight, b == "top" && g != e && (a.top = a.top + e - g, i = !0), b == "bottom" || b == "top" ? (h = 0, a.left < 0 && (h = a.left * -2, a.left = 0, c.offset(a), f = c[0].offsetWidth, g = c[0].offsetHeight), this.replaceArrow(h - d + f, f, "left")) : this.replaceArrow(g - e, g, "top"), i && c.offset(a)
|
| 69 |
-
}, replaceArrow: function (a, b, c) {
|
| 70 |
-
this.arrow().css(c, a ? 50 * (1 - a / b) + "%" : "")
|
| 71 |
-
}, setContent: function () {
|
| 72 |
-
var a = this.tip(), b = this.getTitle();
|
| 73 |
-
a.find(".tooltip-inner")[this.options.html ? "html" : "text"](b), a.removeClass("fade in top bottom left right")
|
| 74 |
-
}, hide: function () {
|
| 75 |
-
function e() {
|
| 76 |
-
var b = setTimeout(function () {
|
| 77 |
-
c.off(a.support.transition.end).detach()
|
| 78 |
-
}, 500);
|
| 79 |
-
c.one(a.support.transition.end, function () {
|
| 80 |
-
clearTimeout(b), c.detach()
|
| 81 |
-
})
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
var b = this, c = this.tip(), d = a.Event("hide");
|
| 85 |
-
this.$element.trigger(d);
|
| 86 |
-
if (d.isDefaultPrevented())return;
|
| 87 |
-
return c.removeClass("in"), a.support.transition && this.$tip.hasClass("fade") ? e() : c.detach(), this.$element.trigger("hidden"), this
|
| 88 |
-
}, fixTitle: function () {
|
| 89 |
-
var a = this.$element;
|
| 90 |
-
(a.attr("title") || typeof a.attr("data-original-title") != "string") && a.attr("data-original-title", a.attr("title") || "").attr("title", "")
|
| 91 |
-
}, hasContent: function () {
|
| 92 |
-
return this.getTitle()
|
| 93 |
-
}, getPosition: function () {
|
| 94 |
-
var b = this.$element[0];
|
| 95 |
-
return a.extend({}, typeof b.getBoundingClientRect == "function" ? b.getBoundingClientRect() : {width: b.offsetWidth, height: b.offsetHeight}, this.$element.offset())
|
| 96 |
-
}, getTitle: function () {
|
| 97 |
-
var a, b = this.$element, c = this.options;
|
| 98 |
-
return a = b.attr("data-original-title") || (typeof c.title == "function" ? c.title.call(b[0]) : c.title), a
|
| 99 |
-
}, tip: function () {
|
| 100 |
-
return this.$tip = this.$tip || a(this.options.template)
|
| 101 |
-
}, arrow: function () {
|
| 102 |
-
return this.$arrow = this.$arrow || this.tip().find(".tooltip-arrow")
|
| 103 |
-
}, validate: function () {
|
| 104 |
-
this.$element[0].parentNode || (this.hide(), this.$element = null, this.options = null)
|
| 105 |
-
}, enable: function () {
|
| 106 |
-
this.enabled = !0
|
| 107 |
-
}, disable: function () {
|
| 108 |
-
this.enabled = !1
|
| 109 |
-
}, toggleEnabled: function () {
|
| 110 |
-
this.enabled = !this.enabled
|
| 111 |
-
}, toggle: function (b) {
|
| 112 |
-
var c = b ? a(b.currentTarget)[this.type](this._options).data(this.type) : this;
|
| 113 |
-
c.tip().hasClass("in") ? c.hide() : c.show()
|
| 114 |
-
}, destroy: function () {
|
| 115 |
-
this.hide().$element.off("." + this.type).removeData(this.type)
|
| 116 |
-
}};
|
| 117 |
-
var c = a.fn.tooltip;
|
| 118 |
-
a.fn.tooltip = function (c) {
|
| 119 |
-
return this.each(function () {
|
| 120 |
-
var d = a(this), e = d.data("tooltip"), f = typeof c == "object" && c;
|
| 121 |
-
e || d.data("tooltip", e = new b(this, f)), typeof c == "string" && e[c]()
|
| 122 |
-
})
|
| 123 |
-
}, a.fn.tooltip.Constructor = b, a.fn.tooltip.defaults = {animation: !0, placement: "top", selector: !1, template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>', trigger: "hover focus", title: "", delay: 0, html: !1, container: !1}, a.fn.tooltip.noConflict = function () {
|
| 124 |
-
return a.fn.tooltip = c, this
|
| 125 |
-
}
|
| 126 |
-
}(window.jQuery)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/js/js.iml
DELETED
|
@@ -1,10 +0,0 @@
|
|
| 1 |
-
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
-
<module type="WEB_MODULE" version="4">
|
| 3 |
-
<component name="NewModuleRootManager" inherit-compiler-output="true">
|
| 4 |
-
<exclude-output />
|
| 5 |
-
<content url="file://$MODULE_DIR$" />
|
| 6 |
-
<orderEntry type="inheritedJdk" />
|
| 7 |
-
<orderEntry type="sourceFolder" forTests="false" />
|
| 8 |
-
</component>
|
| 9 |
-
</module>
|
| 10 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/js/select2/select2-bootstrap.css
DELETED
|
@@ -1,87 +0,0 @@
|
|
| 1 |
-
.form-control .select2-choice {
|
| 2 |
-
border: 0;
|
| 3 |
-
border-radius: 2px;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
.form-control .select2-choice .select2-arrow {
|
| 7 |
-
border-radius: 0 2px 2px 0;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
.form-control.select2-container {
|
| 11 |
-
height: auto !important;
|
| 12 |
-
padding: 0;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
.form-control.select2-container.select2-dropdown-open {
|
| 16 |
-
border-color: #5897FB;
|
| 17 |
-
border-radius: 3px 3px 0 0;
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
| 21 |
-
border-radius: 3px 3px 0 0;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.form-control.select2-container .select2-choices {
|
| 25 |
-
border: 0 !important;
|
| 26 |
-
border-radius: 3px;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
.control-group.warning .select2-container .select2-choice,
|
| 30 |
-
.control-group.warning .select2-container .select2-choices,
|
| 31 |
-
.control-group.warning .select2-container-active .select2-choice,
|
| 32 |
-
.control-group.warning .select2-container-active .select2-choices,
|
| 33 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 34 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 35 |
-
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
| 36 |
-
border: 1px solid #C09853 !important;
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
.control-group.warning .select2-container .select2-choice div {
|
| 40 |
-
border-left: 1px solid #C09853 !important;
|
| 41 |
-
background: #FCF8E3 !important;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
.control-group.error .select2-container .select2-choice,
|
| 45 |
-
.control-group.error .select2-container .select2-choices,
|
| 46 |
-
.control-group.error .select2-container-active .select2-choice,
|
| 47 |
-
.control-group.error .select2-container-active .select2-choices,
|
| 48 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 49 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 50 |
-
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
| 51 |
-
border: 1px solid #B94A48 !important;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
.control-group.error .select2-container .select2-choice div {
|
| 55 |
-
border-left: 1px solid #B94A48 !important;
|
| 56 |
-
background: #F2DEDE !important;
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
.control-group.info .select2-container .select2-choice,
|
| 60 |
-
.control-group.info .select2-container .select2-choices,
|
| 61 |
-
.control-group.info .select2-container-active .select2-choice,
|
| 62 |
-
.control-group.info .select2-container-active .select2-choices,
|
| 63 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 64 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 65 |
-
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
| 66 |
-
border: 1px solid #3A87AD !important;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
.control-group.info .select2-container .select2-choice div {
|
| 70 |
-
border-left: 1px solid #3A87AD !important;
|
| 71 |
-
background: #D9EDF7 !important;
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
.control-group.success .select2-container .select2-choice,
|
| 75 |
-
.control-group.success .select2-container .select2-choices,
|
| 76 |
-
.control-group.success .select2-container-active .select2-choice,
|
| 77 |
-
.control-group.success .select2-container-active .select2-choices,
|
| 78 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 79 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 80 |
-
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
| 81 |
-
border: 1px solid #468847 !important;
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
.control-group.success .select2-container .select2-choice div {
|
| 85 |
-
border-left: 1px solid #468847 !important;
|
| 86 |
-
background: #DFF0D8 !important;
|
| 87 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/js/select2/select2-spinner.gif
DELETED
|
Binary file
|
classes/admin/settings/assets/js/select2/select2.css
DELETED
|
@@ -1,704 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 3 |
-
*/
|
| 4 |
-
.select2-container {
|
| 5 |
-
margin: 0;
|
| 6 |
-
position: relative;
|
| 7 |
-
display: inline-block;
|
| 8 |
-
/* inline-block for ie7 */
|
| 9 |
-
zoom: 1;
|
| 10 |
-
*display: inline;
|
| 11 |
-
vertical-align: middle;
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
.select2-container,
|
| 15 |
-
.select2-drop,
|
| 16 |
-
.select2-search,
|
| 17 |
-
.select2-search input {
|
| 18 |
-
/*
|
| 19 |
-
Force border-box so that % widths fit the parent
|
| 20 |
-
container without overlap because of margin/padding.
|
| 21 |
-
More Info : http://www.quirksmode.org/css/box.html
|
| 22 |
-
*/
|
| 23 |
-
-webkit-box-sizing: border-box; /* webkit */
|
| 24 |
-
-moz-box-sizing: border-box; /* firefox */
|
| 25 |
-
box-sizing: border-box; /* css3 */
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
.select2-container .select2-choice {
|
| 29 |
-
display: block;
|
| 30 |
-
height: 26px;
|
| 31 |
-
padding: 0 0 0 8px;
|
| 32 |
-
overflow: hidden;
|
| 33 |
-
position: relative;
|
| 34 |
-
|
| 35 |
-
border: 1px solid #aaa;
|
| 36 |
-
white-space: nowrap;
|
| 37 |
-
line-height: 26px;
|
| 38 |
-
color: #444;
|
| 39 |
-
text-decoration: none;
|
| 40 |
-
|
| 41 |
-
border-radius: 4px;
|
| 42 |
-
|
| 43 |
-
background-clip: padding-box;
|
| 44 |
-
|
| 45 |
-
-webkit-touch-callout: none;
|
| 46 |
-
-webkit-user-select: none;
|
| 47 |
-
-moz-user-select: none;
|
| 48 |
-
-ms-user-select: none;
|
| 49 |
-
user-select: none;
|
| 50 |
-
|
| 51 |
-
background-color: #fff;
|
| 52 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 53 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 55 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 56 |
-
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
html[dir="rtl"] .select2-container .select2-choice {
|
| 60 |
-
padding: 0 8px 0 0;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
.select2-container.select2-drop-above .select2-choice {
|
| 64 |
-
border-bottom-color: #aaa;
|
| 65 |
-
|
| 66 |
-
border-radius: 0 0 4px 4px;
|
| 67 |
-
|
| 68 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
| 69 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 70 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 71 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 72 |
-
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
| 76 |
-
margin-right: 42px;
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
.select2-container .select2-choice > .select2-chosen {
|
| 80 |
-
margin-right: 26px;
|
| 81 |
-
display: block;
|
| 82 |
-
overflow: hidden;
|
| 83 |
-
|
| 84 |
-
white-space: nowrap;
|
| 85 |
-
|
| 86 |
-
text-overflow: ellipsis;
|
| 87 |
-
float: none;
|
| 88 |
-
width: auto;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
| 92 |
-
margin-left: 26px;
|
| 93 |
-
margin-right: 0;
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
.select2-container .select2-choice abbr {
|
| 97 |
-
display: none;
|
| 98 |
-
width: 12px;
|
| 99 |
-
height: 12px;
|
| 100 |
-
position: absolute;
|
| 101 |
-
right: 24px;
|
| 102 |
-
top: 8px;
|
| 103 |
-
|
| 104 |
-
font-size: 1px;
|
| 105 |
-
text-decoration: none;
|
| 106 |
-
|
| 107 |
-
border: 0;
|
| 108 |
-
background: url('select2.png') right top no-repeat;
|
| 109 |
-
cursor: pointer;
|
| 110 |
-
outline: 0;
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
.select2-container.select2-allowclear .select2-choice abbr {
|
| 114 |
-
display: inline-block;
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
.select2-container .select2-choice abbr:hover {
|
| 118 |
-
background-position: right -11px;
|
| 119 |
-
cursor: pointer;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
.select2-drop-mask {
|
| 123 |
-
border: 0;
|
| 124 |
-
margin: 0;
|
| 125 |
-
padding: 0;
|
| 126 |
-
position: fixed;
|
| 127 |
-
left: 0;
|
| 128 |
-
top: 0;
|
| 129 |
-
min-height: 100%;
|
| 130 |
-
min-width: 100%;
|
| 131 |
-
height: auto;
|
| 132 |
-
width: auto;
|
| 133 |
-
opacity: 0;
|
| 134 |
-
z-index: 9998;
|
| 135 |
-
/* styles required for IE to work */
|
| 136 |
-
background-color: #fff;
|
| 137 |
-
filter: alpha(opacity=0);
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
.select2-drop {
|
| 141 |
-
width: 100%;
|
| 142 |
-
margin-top: -1px;
|
| 143 |
-
position: absolute;
|
| 144 |
-
z-index: 9999;
|
| 145 |
-
top: 100%;
|
| 146 |
-
|
| 147 |
-
background: #fff;
|
| 148 |
-
color: #000;
|
| 149 |
-
border: 1px solid #aaa;
|
| 150 |
-
border-top: 0;
|
| 151 |
-
|
| 152 |
-
border-radius: 0 0 4px 4px;
|
| 153 |
-
|
| 154 |
-
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 155 |
-
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
.select2-drop.select2-drop-above {
|
| 159 |
-
margin-top: 1px;
|
| 160 |
-
border-top: 1px solid #aaa;
|
| 161 |
-
border-bottom: 0;
|
| 162 |
-
|
| 163 |
-
border-radius: 4px 4px 0 0;
|
| 164 |
-
|
| 165 |
-
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 166 |
-
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 167 |
-
}
|
| 168 |
-
|
| 169 |
-
.select2-drop-active {
|
| 170 |
-
border: 1px solid #5897fb;
|
| 171 |
-
border-top: none;
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
.select2-drop.select2-drop-above.select2-drop-active {
|
| 175 |
-
border-top: 1px solid #5897fb;
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
.select2-drop-auto-width {
|
| 179 |
-
border-top: 1px solid #aaa;
|
| 180 |
-
width: auto;
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
.select2-drop-auto-width .select2-search {
|
| 184 |
-
padding-top: 4px;
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
-
.select2-container .select2-choice .select2-arrow {
|
| 188 |
-
display: inline-block;
|
| 189 |
-
width: 18px;
|
| 190 |
-
height: 100%;
|
| 191 |
-
position: absolute;
|
| 192 |
-
right: 0;
|
| 193 |
-
top: 0;
|
| 194 |
-
|
| 195 |
-
border-left: 1px solid #aaa;
|
| 196 |
-
border-radius: 0 4px 4px 0;
|
| 197 |
-
|
| 198 |
-
background-clip: padding-box;
|
| 199 |
-
|
| 200 |
-
background: #ccc;
|
| 201 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
| 202 |
-
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 203 |
-
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 204 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 205 |
-
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
| 209 |
-
left: 0;
|
| 210 |
-
right: auto;
|
| 211 |
-
|
| 212 |
-
border-left: none;
|
| 213 |
-
border-right: 1px solid #aaa;
|
| 214 |
-
border-radius: 4px 0 0 4px;
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
.select2-container .select2-choice .select2-arrow b {
|
| 218 |
-
display: block;
|
| 219 |
-
width: 100%;
|
| 220 |
-
height: 100%;
|
| 221 |
-
background: url('select2.png') no-repeat 0 1px;
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
| 225 |
-
background-position: 2px 1px;
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
.select2-search {
|
| 229 |
-
display: inline-block;
|
| 230 |
-
width: 100%;
|
| 231 |
-
min-height: 26px;
|
| 232 |
-
margin: 0;
|
| 233 |
-
padding-left: 4px;
|
| 234 |
-
padding-right: 4px;
|
| 235 |
-
|
| 236 |
-
position: relative;
|
| 237 |
-
z-index: 10000;
|
| 238 |
-
|
| 239 |
-
white-space: nowrap;
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
.select2-search input {
|
| 243 |
-
width: 100%;
|
| 244 |
-
height: auto !important;
|
| 245 |
-
min-height: 26px;
|
| 246 |
-
padding: 4px 20px 4px 5px;
|
| 247 |
-
margin: 0;
|
| 248 |
-
|
| 249 |
-
outline: 0;
|
| 250 |
-
font-family: sans-serif;
|
| 251 |
-
font-size: 1em;
|
| 252 |
-
|
| 253 |
-
border: 1px solid #aaa;
|
| 254 |
-
border-radius: 0;
|
| 255 |
-
|
| 256 |
-
-webkit-box-shadow: none;
|
| 257 |
-
box-shadow: none;
|
| 258 |
-
|
| 259 |
-
background: #fff url('select2.png') no-repeat 100% -22px;
|
| 260 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 261 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 262 |
-
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 263 |
-
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
html[dir="rtl"] .select2-search input {
|
| 267 |
-
padding: 4px 5px 4px 20px;
|
| 268 |
-
|
| 269 |
-
background: #fff url('select2.png') no-repeat -37px -22px;
|
| 270 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 271 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 272 |
-
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 273 |
-
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 274 |
-
}
|
| 275 |
-
|
| 276 |
-
.select2-drop.select2-drop-above .select2-search input {
|
| 277 |
-
margin-top: 4px;
|
| 278 |
-
}
|
| 279 |
-
|
| 280 |
-
.select2-search input.select2-active {
|
| 281 |
-
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
| 282 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 283 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 284 |
-
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 285 |
-
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
.select2-container-active .select2-choice,
|
| 289 |
-
.select2-container-active .select2-choices {
|
| 290 |
-
border: 1px solid #5897fb;
|
| 291 |
-
outline: none;
|
| 292 |
-
|
| 293 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 294 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
.select2-dropdown-open .select2-choice {
|
| 298 |
-
border-bottom-color: transparent;
|
| 299 |
-
-webkit-box-shadow: 0 1px 0 #fff inset;
|
| 300 |
-
box-shadow: 0 1px 0 #fff inset;
|
| 301 |
-
|
| 302 |
-
border-bottom-left-radius: 0;
|
| 303 |
-
border-bottom-right-radius: 0;
|
| 304 |
-
|
| 305 |
-
background-color: #eee;
|
| 306 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 307 |
-
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 308 |
-
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 309 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 310 |
-
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
.select2-dropdown-open.select2-drop-above .select2-choice,
|
| 314 |
-
.select2-dropdown-open.select2-drop-above .select2-choices {
|
| 315 |
-
border: 1px solid #5897fb;
|
| 316 |
-
border-top-color: transparent;
|
| 317 |
-
|
| 318 |
-
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 319 |
-
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 320 |
-
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 321 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 322 |
-
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
| 323 |
-
}
|
| 324 |
-
|
| 325 |
-
.select2-dropdown-open .select2-choice .select2-arrow {
|
| 326 |
-
background: transparent;
|
| 327 |
-
border-left: none;
|
| 328 |
-
filter: none;
|
| 329 |
-
}
|
| 330 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
| 331 |
-
border-right: none;
|
| 332 |
-
}
|
| 333 |
-
|
| 334 |
-
.select2-dropdown-open .select2-choice .select2-arrow b {
|
| 335 |
-
background-position: -18px 1px;
|
| 336 |
-
}
|
| 337 |
-
|
| 338 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
| 339 |
-
background-position: -16px 1px;
|
| 340 |
-
}
|
| 341 |
-
|
| 342 |
-
.select2-hidden-accessible {
|
| 343 |
-
border: 0;
|
| 344 |
-
clip: rect(0 0 0 0);
|
| 345 |
-
height: 1px;
|
| 346 |
-
margin: -1px;
|
| 347 |
-
overflow: hidden;
|
| 348 |
-
padding: 0;
|
| 349 |
-
position: absolute;
|
| 350 |
-
width: 1px;
|
| 351 |
-
}
|
| 352 |
-
|
| 353 |
-
/* results */
|
| 354 |
-
.select2-results {
|
| 355 |
-
max-height: 200px;
|
| 356 |
-
padding: 0 0 0 4px;
|
| 357 |
-
margin: 4px 4px 4px 0;
|
| 358 |
-
position: relative;
|
| 359 |
-
overflow-x: hidden;
|
| 360 |
-
overflow-y: auto;
|
| 361 |
-
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
html[dir="rtl"] .select2-results {
|
| 365 |
-
padding: 0 4px 0 0;
|
| 366 |
-
margin: 4px 0 4px 4px;
|
| 367 |
-
}
|
| 368 |
-
|
| 369 |
-
.select2-results ul.select2-result-sub {
|
| 370 |
-
margin: 0;
|
| 371 |
-
padding-left: 0;
|
| 372 |
-
}
|
| 373 |
-
|
| 374 |
-
.select2-results li {
|
| 375 |
-
list-style: none;
|
| 376 |
-
display: list-item;
|
| 377 |
-
background-image: none;
|
| 378 |
-
}
|
| 379 |
-
|
| 380 |
-
.select2-results li.select2-result-with-children > .select2-result-label {
|
| 381 |
-
font-weight: bold;
|
| 382 |
-
}
|
| 383 |
-
|
| 384 |
-
.select2-results .select2-result-label {
|
| 385 |
-
padding: 3px 7px 4px;
|
| 386 |
-
margin: 0;
|
| 387 |
-
cursor: pointer;
|
| 388 |
-
|
| 389 |
-
min-height: 1em;
|
| 390 |
-
|
| 391 |
-
-webkit-touch-callout: none;
|
| 392 |
-
-webkit-user-select: none;
|
| 393 |
-
-moz-user-select: none;
|
| 394 |
-
-ms-user-select: none;
|
| 395 |
-
user-select: none;
|
| 396 |
-
}
|
| 397 |
-
|
| 398 |
-
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
| 399 |
-
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
| 400 |
-
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
| 401 |
-
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
| 402 |
-
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
| 403 |
-
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
| 404 |
-
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
| 405 |
-
|
| 406 |
-
.select2-results .select2-highlighted {
|
| 407 |
-
background: #3875d7;
|
| 408 |
-
color: #fff;
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
.select2-results li em {
|
| 412 |
-
background: #feffde;
|
| 413 |
-
font-style: normal;
|
| 414 |
-
}
|
| 415 |
-
|
| 416 |
-
.select2-results .select2-highlighted em {
|
| 417 |
-
background: transparent;
|
| 418 |
-
}
|
| 419 |
-
|
| 420 |
-
.select2-results .select2-highlighted ul {
|
| 421 |
-
background: #fff;
|
| 422 |
-
color: #000;
|
| 423 |
-
}
|
| 424 |
-
|
| 425 |
-
.select2-results .select2-no-results,
|
| 426 |
-
.select2-results .select2-searching,
|
| 427 |
-
.select2-results .select2-ajax-error,
|
| 428 |
-
.select2-results .select2-selection-limit {
|
| 429 |
-
background: #f4f4f4;
|
| 430 |
-
display: list-item;
|
| 431 |
-
padding-left: 5px;
|
| 432 |
-
}
|
| 433 |
-
|
| 434 |
-
/*
|
| 435 |
-
disabled look for disabled choices in the results dropdown
|
| 436 |
-
*/
|
| 437 |
-
.select2-results .select2-disabled.select2-highlighted {
|
| 438 |
-
color: #666;
|
| 439 |
-
background: #f4f4f4;
|
| 440 |
-
display: list-item;
|
| 441 |
-
cursor: default;
|
| 442 |
-
}
|
| 443 |
-
.select2-results .select2-disabled {
|
| 444 |
-
background: #f4f4f4;
|
| 445 |
-
display: list-item;
|
| 446 |
-
cursor: default;
|
| 447 |
-
}
|
| 448 |
-
|
| 449 |
-
.select2-results .select2-selected {
|
| 450 |
-
display: none;
|
| 451 |
-
}
|
| 452 |
-
|
| 453 |
-
.select2-more-results.select2-active {
|
| 454 |
-
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
| 455 |
-
}
|
| 456 |
-
|
| 457 |
-
.select2-results .select2-ajax-error {
|
| 458 |
-
background: rgba(255, 50, 50, .2);
|
| 459 |
-
}
|
| 460 |
-
|
| 461 |
-
.select2-more-results {
|
| 462 |
-
background: #f4f4f4;
|
| 463 |
-
display: list-item;
|
| 464 |
-
}
|
| 465 |
-
|
| 466 |
-
/* disabled styles */
|
| 467 |
-
|
| 468 |
-
.select2-container.select2-container-disabled .select2-choice {
|
| 469 |
-
background-color: #f4f4f4;
|
| 470 |
-
background-image: none;
|
| 471 |
-
border: 1px solid #ddd;
|
| 472 |
-
cursor: default;
|
| 473 |
-
}
|
| 474 |
-
|
| 475 |
-
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
| 476 |
-
background-color: #f4f4f4;
|
| 477 |
-
background-image: none;
|
| 478 |
-
border-left: 0;
|
| 479 |
-
}
|
| 480 |
-
|
| 481 |
-
.select2-container.select2-container-disabled .select2-choice abbr {
|
| 482 |
-
display: none;
|
| 483 |
-
}
|
| 484 |
-
|
| 485 |
-
|
| 486 |
-
/* multiselect */
|
| 487 |
-
|
| 488 |
-
.select2-container-multi .select2-choices {
|
| 489 |
-
height: auto !important;
|
| 490 |
-
height: 1%;
|
| 491 |
-
margin: 0;
|
| 492 |
-
padding: 0 5px 0 0;
|
| 493 |
-
position: relative;
|
| 494 |
-
|
| 495 |
-
border: 1px solid #aaa;
|
| 496 |
-
cursor: text;
|
| 497 |
-
overflow: hidden;
|
| 498 |
-
|
| 499 |
-
background-color: #fff;
|
| 500 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
| 501 |
-
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
| 502 |
-
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
| 503 |
-
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
| 504 |
-
}
|
| 505 |
-
|
| 506 |
-
html[dir="rtl"] .select2-container-multi .select2-choices {
|
| 507 |
-
padding: 0 0 0 5px;
|
| 508 |
-
}
|
| 509 |
-
|
| 510 |
-
.select2-locked {
|
| 511 |
-
padding: 3px 5px 3px 5px !important;
|
| 512 |
-
}
|
| 513 |
-
|
| 514 |
-
.select2-container-multi .select2-choices {
|
| 515 |
-
min-height: 26px;
|
| 516 |
-
}
|
| 517 |
-
|
| 518 |
-
.select2-container-multi.select2-container-active .select2-choices {
|
| 519 |
-
border: 1px solid #5897fb;
|
| 520 |
-
outline: none;
|
| 521 |
-
|
| 522 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 523 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 524 |
-
}
|
| 525 |
-
.select2-container-multi .select2-choices li {
|
| 526 |
-
float: left;
|
| 527 |
-
list-style: none;
|
| 528 |
-
}
|
| 529 |
-
html[dir="rtl"] .select2-container-multi .select2-choices li
|
| 530 |
-
{
|
| 531 |
-
float: right;
|
| 532 |
-
}
|
| 533 |
-
.select2-container-multi .select2-choices .select2-search-field {
|
| 534 |
-
margin: 0;
|
| 535 |
-
padding: 0;
|
| 536 |
-
white-space: nowrap;
|
| 537 |
-
}
|
| 538 |
-
|
| 539 |
-
.select2-container-multi .select2-choices .select2-search-field input {
|
| 540 |
-
padding: 5px;
|
| 541 |
-
margin: 1px 0;
|
| 542 |
-
|
| 543 |
-
font-family: sans-serif;
|
| 544 |
-
font-size: 100%;
|
| 545 |
-
color: #666;
|
| 546 |
-
outline: 0;
|
| 547 |
-
border: 0;
|
| 548 |
-
-webkit-box-shadow: none;
|
| 549 |
-
box-shadow: none;
|
| 550 |
-
background: transparent !important;
|
| 551 |
-
}
|
| 552 |
-
|
| 553 |
-
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
| 554 |
-
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
| 555 |
-
}
|
| 556 |
-
|
| 557 |
-
.select2-default {
|
| 558 |
-
color: #999 !important;
|
| 559 |
-
}
|
| 560 |
-
|
| 561 |
-
.select2-container-multi .select2-choices .select2-search-choice {
|
| 562 |
-
padding: 3px 5px 3px 18px;
|
| 563 |
-
margin: 3px 0 3px 5px;
|
| 564 |
-
position: relative;
|
| 565 |
-
|
| 566 |
-
line-height: 13px;
|
| 567 |
-
color: #333;
|
| 568 |
-
cursor: default;
|
| 569 |
-
border: 1px solid #aaaaaa;
|
| 570 |
-
|
| 571 |
-
border-radius: 3px;
|
| 572 |
-
|
| 573 |
-
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 574 |
-
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 575 |
-
|
| 576 |
-
background-clip: padding-box;
|
| 577 |
-
|
| 578 |
-
-webkit-touch-callout: none;
|
| 579 |
-
-webkit-user-select: none;
|
| 580 |
-
-moz-user-select: none;
|
| 581 |
-
-ms-user-select: none;
|
| 582 |
-
user-select: none;
|
| 583 |
-
|
| 584 |
-
background-color: #e4e4e4;
|
| 585 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
| 586 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
| 587 |
-
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 588 |
-
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 589 |
-
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 590 |
-
}
|
| 591 |
-
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
| 592 |
-
{
|
| 593 |
-
margin: 3px 5px 3px 0;
|
| 594 |
-
padding: 3px 18px 3px 5px;
|
| 595 |
-
}
|
| 596 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
| 597 |
-
cursor: default;
|
| 598 |
-
}
|
| 599 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
| 600 |
-
background: #d4d4d4;
|
| 601 |
-
}
|
| 602 |
-
|
| 603 |
-
.select2-search-choice-close {
|
| 604 |
-
display: block;
|
| 605 |
-
width: 12px;
|
| 606 |
-
height: 13px;
|
| 607 |
-
position: absolute;
|
| 608 |
-
right: 3px;
|
| 609 |
-
top: 4px;
|
| 610 |
-
|
| 611 |
-
font-size: 1px;
|
| 612 |
-
outline: none;
|
| 613 |
-
background: url('select2.png') right top no-repeat;
|
| 614 |
-
}
|
| 615 |
-
html[dir="rtl"] .select2-search-choice-close {
|
| 616 |
-
right: auto;
|
| 617 |
-
left: 3px;
|
| 618 |
-
}
|
| 619 |
-
|
| 620 |
-
.select2-container-multi .select2-search-choice-close {
|
| 621 |
-
left: 3px;
|
| 622 |
-
}
|
| 623 |
-
|
| 624 |
-
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
| 625 |
-
left: auto;
|
| 626 |
-
right: 2px;
|
| 627 |
-
}
|
| 628 |
-
|
| 629 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
| 630 |
-
background-position: right -11px;
|
| 631 |
-
}
|
| 632 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
| 633 |
-
background-position: right -11px;
|
| 634 |
-
}
|
| 635 |
-
|
| 636 |
-
/* disabled styles */
|
| 637 |
-
.select2-container-multi.select2-container-disabled .select2-choices {
|
| 638 |
-
background-color: #f4f4f4;
|
| 639 |
-
background-image: none;
|
| 640 |
-
border: 1px solid #ddd;
|
| 641 |
-
cursor: default;
|
| 642 |
-
}
|
| 643 |
-
|
| 644 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
| 645 |
-
padding: 3px 5px 3px 5px;
|
| 646 |
-
border: 1px solid #ddd;
|
| 647 |
-
background-image: none;
|
| 648 |
-
background-color: #f4f4f4;
|
| 649 |
-
}
|
| 650 |
-
|
| 651 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
| 652 |
-
background: none;
|
| 653 |
-
}
|
| 654 |
-
/* end multiselect */
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
.select2-result-selectable .select2-match,
|
| 658 |
-
.select2-result-unselectable .select2-match {
|
| 659 |
-
text-decoration: underline;
|
| 660 |
-
}
|
| 661 |
-
|
| 662 |
-
.select2-offscreen, .select2-offscreen:focus {
|
| 663 |
-
clip: rect(0 0 0 0) !important;
|
| 664 |
-
width: 1px !important;
|
| 665 |
-
height: 1px !important;
|
| 666 |
-
border: 0 !important;
|
| 667 |
-
margin: 0 !important;
|
| 668 |
-
padding: 0 !important;
|
| 669 |
-
overflow: hidden !important;
|
| 670 |
-
position: absolute !important;
|
| 671 |
-
outline: 0 !important;
|
| 672 |
-
left: 0px !important;
|
| 673 |
-
top: 0px !important;
|
| 674 |
-
}
|
| 675 |
-
|
| 676 |
-
.select2-display-none {
|
| 677 |
-
display: none;
|
| 678 |
-
}
|
| 679 |
-
|
| 680 |
-
.select2-measure-scrollbar {
|
| 681 |
-
position: absolute;
|
| 682 |
-
top: -10000px;
|
| 683 |
-
left: -10000px;
|
| 684 |
-
width: 100px;
|
| 685 |
-
height: 100px;
|
| 686 |
-
overflow: scroll;
|
| 687 |
-
}
|
| 688 |
-
|
| 689 |
-
/* Retina-ize icons */
|
| 690 |
-
|
| 691 |
-
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
| 692 |
-
.select2-search input,
|
| 693 |
-
.select2-search-choice-close,
|
| 694 |
-
.select2-container .select2-choice abbr,
|
| 695 |
-
.select2-container .select2-choice .select2-arrow b {
|
| 696 |
-
background-image: url('select2x2.png') !important;
|
| 697 |
-
background-repeat: no-repeat !important;
|
| 698 |
-
background-size: 60px 40px !important;
|
| 699 |
-
}
|
| 700 |
-
|
| 701 |
-
.select2-search input {
|
| 702 |
-
background-position: 100% -21px !important;
|
| 703 |
-
}
|
| 704 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/js/select2/select2.js
DELETED
|
@@ -1,3541 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Copyright 2012 Igor Vaynberg
|
| 3 |
-
|
| 4 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
-
|
| 6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
-
License or the GPL License.
|
| 10 |
-
|
| 11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
-
|
| 13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
-
|
| 16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the
|
| 17 |
-
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
| 18 |
-
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
| 19 |
-
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
| 20 |
-
*/
|
| 21 |
-
(function ($) {
|
| 22 |
-
if(typeof $.fn.each2 == "undefined") {
|
| 23 |
-
$.extend($.fn, {
|
| 24 |
-
/*
|
| 25 |
-
* 4-10 times faster .each replacement
|
| 26 |
-
* use it carefully, as it overrides jQuery context of element on each iteration
|
| 27 |
-
*/
|
| 28 |
-
each2 : function (c) {
|
| 29 |
-
var j = $([0]), i = -1, l = this.length;
|
| 30 |
-
while (
|
| 31 |
-
++i < l
|
| 32 |
-
&& (j.context = j[0] = this[i])
|
| 33 |
-
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
| 34 |
-
);
|
| 35 |
-
return this;
|
| 36 |
-
}
|
| 37 |
-
});
|
| 38 |
-
}
|
| 39 |
-
})(jQuery);
|
| 40 |
-
|
| 41 |
-
(function ($, undefined) {
|
| 42 |
-
"use strict";
|
| 43 |
-
/*global document, window, jQuery, console */
|
| 44 |
-
|
| 45 |
-
if (window.Select2 !== undefined) {
|
| 46 |
-
return;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
| 50 |
-
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
| 51 |
-
|
| 52 |
-
KEY = {
|
| 53 |
-
TAB: 9,
|
| 54 |
-
ENTER: 13,
|
| 55 |
-
ESC: 27,
|
| 56 |
-
SPACE: 32,
|
| 57 |
-
LEFT: 37,
|
| 58 |
-
UP: 38,
|
| 59 |
-
RIGHT: 39,
|
| 60 |
-
DOWN: 40,
|
| 61 |
-
SHIFT: 16,
|
| 62 |
-
CTRL: 17,
|
| 63 |
-
ALT: 18,
|
| 64 |
-
PAGE_UP: 33,
|
| 65 |
-
PAGE_DOWN: 34,
|
| 66 |
-
HOME: 36,
|
| 67 |
-
END: 35,
|
| 68 |
-
BACKSPACE: 8,
|
| 69 |
-
DELETE: 46,
|
| 70 |
-
isArrow: function (k) {
|
| 71 |
-
k = k.which ? k.which : k;
|
| 72 |
-
switch (k) {
|
| 73 |
-
case KEY.LEFT:
|
| 74 |
-
case KEY.RIGHT:
|
| 75 |
-
case KEY.UP:
|
| 76 |
-
case KEY.DOWN:
|
| 77 |
-
return true;
|
| 78 |
-
}
|
| 79 |
-
return false;
|
| 80 |
-
},
|
| 81 |
-
isControl: function (e) {
|
| 82 |
-
var k = e.which;
|
| 83 |
-
switch (k) {
|
| 84 |
-
case KEY.SHIFT:
|
| 85 |
-
case KEY.CTRL:
|
| 86 |
-
case KEY.ALT:
|
| 87 |
-
return true;
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
if (e.metaKey) return true;
|
| 91 |
-
|
| 92 |
-
return false;
|
| 93 |
-
},
|
| 94 |
-
isFunctionKey: function (k) {
|
| 95 |
-
k = k.which ? k.which : k;
|
| 96 |
-
return k >= 112 && k <= 123;
|
| 97 |
-
}
|
| 98 |
-
},
|
| 99 |
-
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
| 100 |
-
|
| 101 |
-
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
| 102 |
-
|
| 103 |
-
$document = $(document);
|
| 104 |
-
|
| 105 |
-
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
function reinsertElement(element) {
|
| 109 |
-
var placeholder = $(document.createTextNode(''));
|
| 110 |
-
|
| 111 |
-
element.before(placeholder);
|
| 112 |
-
placeholder.before(element);
|
| 113 |
-
placeholder.remove();
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
function stripDiacritics(str) {
|
| 117 |
-
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
| 118 |
-
function match(a) {
|
| 119 |
-
return DIACRITICS[a] || a;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
return str.replace(/[^\u0000-\u007E]/g, match);
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
function indexOf(value, array) {
|
| 126 |
-
var i = 0, l = array.length;
|
| 127 |
-
for (; i < l; i = i + 1) {
|
| 128 |
-
if (equal(value, array[i])) return i;
|
| 129 |
-
}
|
| 130 |
-
return -1;
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
function measureScrollbar () {
|
| 134 |
-
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
| 135 |
-
$template.appendTo(document.body);
|
| 136 |
-
|
| 137 |
-
var dim = {
|
| 138 |
-
width: $template.width() - $template[0].clientWidth,
|
| 139 |
-
height: $template.height() - $template[0].clientHeight
|
| 140 |
-
};
|
| 141 |
-
$template.remove();
|
| 142 |
-
|
| 143 |
-
return dim;
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
/**
|
| 147 |
-
* Compares equality of a and b
|
| 148 |
-
* @param a
|
| 149 |
-
* @param b
|
| 150 |
-
*/
|
| 151 |
-
function equal(a, b) {
|
| 152 |
-
if (a === b) return true;
|
| 153 |
-
if (a === undefined || b === undefined) return false;
|
| 154 |
-
if (a === null || b === null) return false;
|
| 155 |
-
// Check whether 'a' or 'b' is a string (primitive or object).
|
| 156 |
-
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
| 157 |
-
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
| 158 |
-
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
| 159 |
-
return false;
|
| 160 |
-
}
|
| 161 |
-
|
| 162 |
-
/**
|
| 163 |
-
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
| 164 |
-
* strings
|
| 165 |
-
* @param string
|
| 166 |
-
* @param separator
|
| 167 |
-
*/
|
| 168 |
-
function splitVal(string, separator, transform) {
|
| 169 |
-
var val, i, l;
|
| 170 |
-
if (string === null || string.length < 1) return [];
|
| 171 |
-
val = string.split(separator);
|
| 172 |
-
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
| 173 |
-
return val;
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
function getSideBorderPadding(element) {
|
| 177 |
-
return element.outerWidth(false) - element.width();
|
| 178 |
-
}
|
| 179 |
-
|
| 180 |
-
function installKeyUpChangeEvent(element) {
|
| 181 |
-
var key="keyup-change-value";
|
| 182 |
-
element.on("keydown", function () {
|
| 183 |
-
if ($.data(element, key) === undefined) {
|
| 184 |
-
$.data(element, key, element.val());
|
| 185 |
-
}
|
| 186 |
-
});
|
| 187 |
-
element.on("keyup", function () {
|
| 188 |
-
var val= $.data(element, key);
|
| 189 |
-
if (val !== undefined && element.val() !== val) {
|
| 190 |
-
$.removeData(element, key);
|
| 191 |
-
element.trigger("keyup-change");
|
| 192 |
-
}
|
| 193 |
-
});
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
/**
|
| 198 |
-
* filters mouse events so an event is fired only if the mouse moved.
|
| 199 |
-
*
|
| 200 |
-
* filters out mouse events that occur when mouse is stationary but
|
| 201 |
-
* the elements under the pointer are scrolled.
|
| 202 |
-
*/
|
| 203 |
-
function installFilteredMouseMove(element) {
|
| 204 |
-
element.on("mousemove", function (e) {
|
| 205 |
-
var lastpos = lastMousePosition;
|
| 206 |
-
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
| 207 |
-
$(e.target).trigger("mousemove-filtered", e);
|
| 208 |
-
}
|
| 209 |
-
});
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
/**
|
| 213 |
-
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
| 214 |
-
* within the last quietMillis milliseconds.
|
| 215 |
-
*
|
| 216 |
-
* @param quietMillis number of milliseconds to wait before invoking fn
|
| 217 |
-
* @param fn function to be debounced
|
| 218 |
-
* @param ctx object to be used as this reference within fn
|
| 219 |
-
* @return debounced version of fn
|
| 220 |
-
*/
|
| 221 |
-
function debounce(quietMillis, fn, ctx) {
|
| 222 |
-
ctx = ctx || undefined;
|
| 223 |
-
var timeout;
|
| 224 |
-
return function () {
|
| 225 |
-
var args = arguments;
|
| 226 |
-
window.clearTimeout(timeout);
|
| 227 |
-
timeout = window.setTimeout(function() {
|
| 228 |
-
fn.apply(ctx, args);
|
| 229 |
-
}, quietMillis);
|
| 230 |
-
};
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
function installDebouncedScroll(threshold, element) {
|
| 234 |
-
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
| 235 |
-
element.on("scroll", function (e) {
|
| 236 |
-
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
| 237 |
-
});
|
| 238 |
-
}
|
| 239 |
-
|
| 240 |
-
function focus($el) {
|
| 241 |
-
if ($el[0] === document.activeElement) return;
|
| 242 |
-
|
| 243 |
-
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
| 244 |
-
of the current event has finished - which seems like the only reliable way
|
| 245 |
-
to set focus */
|
| 246 |
-
window.setTimeout(function() {
|
| 247 |
-
var el=$el[0], pos=$el.val().length, range;
|
| 248 |
-
|
| 249 |
-
$el.focus();
|
| 250 |
-
|
| 251 |
-
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
| 252 |
-
sometimes modals or others listeners may steal it after its set */
|
| 253 |
-
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
| 254 |
-
if (isVisible && el === document.activeElement) {
|
| 255 |
-
|
| 256 |
-
/* after the focus is set move the caret to the end, necessary when we val()
|
| 257 |
-
just before setting focus */
|
| 258 |
-
if(el.setSelectionRange)
|
| 259 |
-
{
|
| 260 |
-
el.setSelectionRange(pos, pos);
|
| 261 |
-
}
|
| 262 |
-
else if (el.createTextRange) {
|
| 263 |
-
range = el.createTextRange();
|
| 264 |
-
range.collapse(false);
|
| 265 |
-
range.select();
|
| 266 |
-
}
|
| 267 |
-
}
|
| 268 |
-
}, 0);
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
function getCursorInfo(el) {
|
| 272 |
-
el = $(el)[0];
|
| 273 |
-
var offset = 0;
|
| 274 |
-
var length = 0;
|
| 275 |
-
if ('selectionStart' in el) {
|
| 276 |
-
offset = el.selectionStart;
|
| 277 |
-
length = el.selectionEnd - offset;
|
| 278 |
-
} else if ('selection' in document) {
|
| 279 |
-
el.focus();
|
| 280 |
-
var sel = document.selection.createRange();
|
| 281 |
-
length = document.selection.createRange().text.length;
|
| 282 |
-
sel.moveStart('character', -el.value.length);
|
| 283 |
-
offset = sel.text.length - length;
|
| 284 |
-
}
|
| 285 |
-
return { offset: offset, length: length };
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
function killEvent(event) {
|
| 289 |
-
event.preventDefault();
|
| 290 |
-
event.stopPropagation();
|
| 291 |
-
}
|
| 292 |
-
function killEventImmediately(event) {
|
| 293 |
-
event.preventDefault();
|
| 294 |
-
event.stopImmediatePropagation();
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
function measureTextWidth(e) {
|
| 298 |
-
if (!sizer){
|
| 299 |
-
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
| 300 |
-
sizer = $(document.createElement("div")).css({
|
| 301 |
-
position: "absolute",
|
| 302 |
-
left: "-10000px",
|
| 303 |
-
top: "-10000px",
|
| 304 |
-
display: "none",
|
| 305 |
-
fontSize: style.fontSize,
|
| 306 |
-
fontFamily: style.fontFamily,
|
| 307 |
-
fontStyle: style.fontStyle,
|
| 308 |
-
fontWeight: style.fontWeight,
|
| 309 |
-
letterSpacing: style.letterSpacing,
|
| 310 |
-
textTransform: style.textTransform,
|
| 311 |
-
whiteSpace: "nowrap"
|
| 312 |
-
});
|
| 313 |
-
sizer.attr("class","select2-sizer");
|
| 314 |
-
$(document.body).append(sizer);
|
| 315 |
-
}
|
| 316 |
-
sizer.text(e.val());
|
| 317 |
-
return sizer.width();
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
function syncCssClasses(dest, src, adapter) {
|
| 321 |
-
var classes, replacements = [], adapted;
|
| 322 |
-
|
| 323 |
-
classes = $.trim(dest.attr("class"));
|
| 324 |
-
|
| 325 |
-
if (classes) {
|
| 326 |
-
classes = '' + classes; // for IE which returns object
|
| 327 |
-
|
| 328 |
-
$(classes.split(/\s+/)).each2(function() {
|
| 329 |
-
if (this.indexOf("select2-") === 0) {
|
| 330 |
-
replacements.push(this);
|
| 331 |
-
}
|
| 332 |
-
});
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
classes = $.trim(src.attr("class"));
|
| 336 |
-
|
| 337 |
-
if (classes) {
|
| 338 |
-
classes = '' + classes; // for IE which returns object
|
| 339 |
-
|
| 340 |
-
$(classes.split(/\s+/)).each2(function() {
|
| 341 |
-
if (this.indexOf("select2-") !== 0) {
|
| 342 |
-
adapted = adapter(this);
|
| 343 |
-
|
| 344 |
-
if (adapted) {
|
| 345 |
-
replacements.push(adapted);
|
| 346 |
-
}
|
| 347 |
-
}
|
| 348 |
-
});
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
dest.attr("class", replacements.join(" "));
|
| 352 |
-
}
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
function markMatch(text, term, markup, escapeMarkup) {
|
| 356 |
-
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
| 357 |
-
tl=term.length;
|
| 358 |
-
|
| 359 |
-
if (match<0) {
|
| 360 |
-
markup.push(escapeMarkup(text));
|
| 361 |
-
return;
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
markup.push(escapeMarkup(text.substring(0, match)));
|
| 365 |
-
markup.push("<span class='select2-match'>");
|
| 366 |
-
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
| 367 |
-
markup.push("</span>");
|
| 368 |
-
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
| 369 |
-
}
|
| 370 |
-
|
| 371 |
-
function defaultEscapeMarkup(markup) {
|
| 372 |
-
var replace_map = {
|
| 373 |
-
'\\': '\',
|
| 374 |
-
'&': '&',
|
| 375 |
-
'<': '<',
|
| 376 |
-
'>': '>',
|
| 377 |
-
'"': '"',
|
| 378 |
-
"'": ''',
|
| 379 |
-
"/": '/'
|
| 380 |
-
};
|
| 381 |
-
|
| 382 |
-
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
| 383 |
-
return replace_map[match];
|
| 384 |
-
});
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
/**
|
| 388 |
-
* Produces an ajax-based query function
|
| 389 |
-
*
|
| 390 |
-
* @param options object containing configuration parameters
|
| 391 |
-
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
| 392 |
-
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
| 393 |
-
* @param options.url url for the data
|
| 394 |
-
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
| 395 |
-
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
| 396 |
-
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
| 397 |
-
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
| 398 |
-
* The expected format is an object containing the following keys:
|
| 399 |
-
* results array of objects that will be used as choices
|
| 400 |
-
* more (optional) boolean indicating whether there are more results available
|
| 401 |
-
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
| 402 |
-
*/
|
| 403 |
-
function ajax(options) {
|
| 404 |
-
var timeout, // current scheduled but not yet executed request
|
| 405 |
-
handler = null,
|
| 406 |
-
quietMillis = options.quietMillis || 100,
|
| 407 |
-
ajaxUrl = options.url,
|
| 408 |
-
self = this;
|
| 409 |
-
|
| 410 |
-
return function (query) {
|
| 411 |
-
window.clearTimeout(timeout);
|
| 412 |
-
timeout = window.setTimeout(function () {
|
| 413 |
-
var data = options.data, // ajax data function
|
| 414 |
-
url = ajaxUrl, // ajax url string or function
|
| 415 |
-
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
| 416 |
-
// deprecated - to be removed in 4.0 - use params instead
|
| 417 |
-
deprecated = {
|
| 418 |
-
type: options.type || 'GET', // set type of request (GET or POST)
|
| 419 |
-
cache: options.cache || false,
|
| 420 |
-
jsonpCallback: options.jsonpCallback||undefined,
|
| 421 |
-
dataType: options.dataType||"json"
|
| 422 |
-
},
|
| 423 |
-
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
| 424 |
-
|
| 425 |
-
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
| 426 |
-
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
| 427 |
-
|
| 428 |
-
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
| 429 |
-
|
| 430 |
-
if (options.params) {
|
| 431 |
-
if ($.isFunction(options.params)) {
|
| 432 |
-
$.extend(params, options.params.call(self));
|
| 433 |
-
} else {
|
| 434 |
-
$.extend(params, options.params);
|
| 435 |
-
}
|
| 436 |
-
}
|
| 437 |
-
|
| 438 |
-
$.extend(params, {
|
| 439 |
-
url: url,
|
| 440 |
-
dataType: options.dataType,
|
| 441 |
-
data: data,
|
| 442 |
-
success: function (data) {
|
| 443 |
-
// TODO - replace query.page with query so users have access to term, page, etc.
|
| 444 |
-
// added query as third paramter to keep backwards compatibility
|
| 445 |
-
var results = options.results(data, query.page, query);
|
| 446 |
-
query.callback(results);
|
| 447 |
-
},
|
| 448 |
-
error: function(jqXHR, textStatus, errorThrown){
|
| 449 |
-
var results = {
|
| 450 |
-
hasError: true,
|
| 451 |
-
jqXHR: jqXHR,
|
| 452 |
-
textStatus: textStatus,
|
| 453 |
-
errorThrown: errorThrown
|
| 454 |
-
};
|
| 455 |
-
|
| 456 |
-
query.callback(results);
|
| 457 |
-
}
|
| 458 |
-
});
|
| 459 |
-
handler = transport.call(self, params);
|
| 460 |
-
}, quietMillis);
|
| 461 |
-
};
|
| 462 |
-
}
|
| 463 |
-
|
| 464 |
-
/**
|
| 465 |
-
* Produces a query function that works with a local array
|
| 466 |
-
*
|
| 467 |
-
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
| 468 |
-
* object.
|
| 469 |
-
*
|
| 470 |
-
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
| 471 |
-
*
|
| 472 |
-
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
| 473 |
-
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
| 474 |
-
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
| 475 |
-
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
| 476 |
-
* the text.
|
| 477 |
-
*/
|
| 478 |
-
function local(options) {
|
| 479 |
-
var data = options, // data elements
|
| 480 |
-
dataText,
|
| 481 |
-
tmp,
|
| 482 |
-
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
| 483 |
-
|
| 484 |
-
if ($.isArray(data)) {
|
| 485 |
-
tmp = data;
|
| 486 |
-
data = { results: tmp };
|
| 487 |
-
}
|
| 488 |
-
|
| 489 |
-
if ($.isFunction(data) === false) {
|
| 490 |
-
tmp = data;
|
| 491 |
-
data = function() { return tmp; };
|
| 492 |
-
}
|
| 493 |
-
|
| 494 |
-
var dataItem = data();
|
| 495 |
-
if (dataItem.text) {
|
| 496 |
-
text = dataItem.text;
|
| 497 |
-
// if text is not a function we assume it to be a key name
|
| 498 |
-
if (!$.isFunction(text)) {
|
| 499 |
-
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
| 500 |
-
text = function (item) { return item[dataText]; };
|
| 501 |
-
}
|
| 502 |
-
}
|
| 503 |
-
|
| 504 |
-
return function (query) {
|
| 505 |
-
var t = query.term, filtered = { results: [] }, process;
|
| 506 |
-
if (t === "") {
|
| 507 |
-
query.callback(data());
|
| 508 |
-
return;
|
| 509 |
-
}
|
| 510 |
-
|
| 511 |
-
process = function(datum, collection) {
|
| 512 |
-
var group, attr;
|
| 513 |
-
datum = datum[0];
|
| 514 |
-
if (datum.children) {
|
| 515 |
-
group = {};
|
| 516 |
-
for (attr in datum) {
|
| 517 |
-
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
| 518 |
-
}
|
| 519 |
-
group.children=[];
|
| 520 |
-
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
| 521 |
-
if (group.children.length || query.matcher(t, text(group), datum)) {
|
| 522 |
-
collection.push(group);
|
| 523 |
-
}
|
| 524 |
-
} else {
|
| 525 |
-
if (query.matcher(t, text(datum), datum)) {
|
| 526 |
-
collection.push(datum);
|
| 527 |
-
}
|
| 528 |
-
}
|
| 529 |
-
};
|
| 530 |
-
|
| 531 |
-
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
| 532 |
-
query.callback(filtered);
|
| 533 |
-
};
|
| 534 |
-
}
|
| 535 |
-
|
| 536 |
-
// TODO javadoc
|
| 537 |
-
function tags(data) {
|
| 538 |
-
var isFunc = $.isFunction(data);
|
| 539 |
-
return function (query) {
|
| 540 |
-
var t = query.term, filtered = {results: []};
|
| 541 |
-
var result = isFunc ? data(query) : data;
|
| 542 |
-
if ($.isArray(result)) {
|
| 543 |
-
$(result).each(function () {
|
| 544 |
-
var isObject = this.text !== undefined,
|
| 545 |
-
text = isObject ? this.text : this;
|
| 546 |
-
if (t === "" || query.matcher(t, text)) {
|
| 547 |
-
filtered.results.push(isObject ? this : {id: this, text: this});
|
| 548 |
-
}
|
| 549 |
-
});
|
| 550 |
-
query.callback(filtered);
|
| 551 |
-
}
|
| 552 |
-
};
|
| 553 |
-
}
|
| 554 |
-
|
| 555 |
-
/**
|
| 556 |
-
* Checks if the formatter function should be used.
|
| 557 |
-
*
|
| 558 |
-
* Throws an error if it is not a function. Returns true if it should be used,
|
| 559 |
-
* false if no formatting should be performed.
|
| 560 |
-
*
|
| 561 |
-
* @param formatter
|
| 562 |
-
*/
|
| 563 |
-
function checkFormatter(formatter, formatterName) {
|
| 564 |
-
if ($.isFunction(formatter)) return true;
|
| 565 |
-
if (!formatter) return false;
|
| 566 |
-
if (typeof(formatter) === 'string') return true;
|
| 567 |
-
throw new Error(formatterName +" must be a string, function, or falsy value");
|
| 568 |
-
}
|
| 569 |
-
|
| 570 |
-
/**
|
| 571 |
-
* Returns a given value
|
| 572 |
-
* If given a function, returns its output
|
| 573 |
-
*
|
| 574 |
-
* @param val string|function
|
| 575 |
-
* @param context value of "this" to be passed to function
|
| 576 |
-
* @returns {*}
|
| 577 |
-
*/
|
| 578 |
-
function evaluate(val, context) {
|
| 579 |
-
if ($.isFunction(val)) {
|
| 580 |
-
var args = Array.prototype.slice.call(arguments, 2);
|
| 581 |
-
return val.apply(context, args);
|
| 582 |
-
}
|
| 583 |
-
return val;
|
| 584 |
-
}
|
| 585 |
-
|
| 586 |
-
function countResults(results) {
|
| 587 |
-
var count = 0;
|
| 588 |
-
$.each(results, function(i, item) {
|
| 589 |
-
if (item.children) {
|
| 590 |
-
count += countResults(item.children);
|
| 591 |
-
} else {
|
| 592 |
-
count++;
|
| 593 |
-
}
|
| 594 |
-
});
|
| 595 |
-
return count;
|
| 596 |
-
}
|
| 597 |
-
|
| 598 |
-
/**
|
| 599 |
-
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
| 600 |
-
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
| 601 |
-
* two options have to be defined in order for the tokenizer to work.
|
| 602 |
-
*
|
| 603 |
-
* @param input text user has typed so far or pasted into the search field
|
| 604 |
-
* @param selection currently selected choices
|
| 605 |
-
* @param selectCallback function(choice) callback tho add the choice to selection
|
| 606 |
-
* @param opts select2's opts
|
| 607 |
-
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
| 608 |
-
*/
|
| 609 |
-
function defaultTokenizer(input, selection, selectCallback, opts) {
|
| 610 |
-
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
| 611 |
-
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
| 612 |
-
token, // token
|
| 613 |
-
index, // position at which the separator was found
|
| 614 |
-
i, l, // looping variables
|
| 615 |
-
separator; // the matched separator
|
| 616 |
-
|
| 617 |
-
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
| 618 |
-
|
| 619 |
-
while (true) {
|
| 620 |
-
index = -1;
|
| 621 |
-
|
| 622 |
-
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
| 623 |
-
separator = opts.tokenSeparators[i];
|
| 624 |
-
index = input.indexOf(separator);
|
| 625 |
-
if (index >= 0) break;
|
| 626 |
-
}
|
| 627 |
-
|
| 628 |
-
if (index < 0) break; // did not find any token separator in the input string, bail
|
| 629 |
-
|
| 630 |
-
token = input.substring(0, index);
|
| 631 |
-
input = input.substring(index + separator.length);
|
| 632 |
-
|
| 633 |
-
if (token.length > 0) {
|
| 634 |
-
token = opts.createSearchChoice.call(this, token, selection);
|
| 635 |
-
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
| 636 |
-
dupe = false;
|
| 637 |
-
for (i = 0, l = selection.length; i < l; i++) {
|
| 638 |
-
if (equal(opts.id(token), opts.id(selection[i]))) {
|
| 639 |
-
dupe = true; break;
|
| 640 |
-
}
|
| 641 |
-
}
|
| 642 |
-
|
| 643 |
-
if (!dupe) selectCallback(token);
|
| 644 |
-
}
|
| 645 |
-
}
|
| 646 |
-
}
|
| 647 |
-
|
| 648 |
-
if (original!==input) return input;
|
| 649 |
-
}
|
| 650 |
-
|
| 651 |
-
function cleanupJQueryElements() {
|
| 652 |
-
var self = this;
|
| 653 |
-
|
| 654 |
-
$.each(arguments, function (i, element) {
|
| 655 |
-
self[element].remove();
|
| 656 |
-
self[element] = null;
|
| 657 |
-
});
|
| 658 |
-
}
|
| 659 |
-
|
| 660 |
-
/**
|
| 661 |
-
* Creates a new class
|
| 662 |
-
*
|
| 663 |
-
* @param superClass
|
| 664 |
-
* @param methods
|
| 665 |
-
*/
|
| 666 |
-
function clazz(SuperClass, methods) {
|
| 667 |
-
var constructor = function () {};
|
| 668 |
-
constructor.prototype = new SuperClass;
|
| 669 |
-
constructor.prototype.constructor = constructor;
|
| 670 |
-
constructor.prototype.parent = SuperClass.prototype;
|
| 671 |
-
constructor.prototype = $.extend(constructor.prototype, methods);
|
| 672 |
-
return constructor;
|
| 673 |
-
}
|
| 674 |
-
|
| 675 |
-
AbstractSelect2 = clazz(Object, {
|
| 676 |
-
|
| 677 |
-
// abstract
|
| 678 |
-
bind: function (func) {
|
| 679 |
-
var self = this;
|
| 680 |
-
return function () {
|
| 681 |
-
func.apply(self, arguments);
|
| 682 |
-
};
|
| 683 |
-
},
|
| 684 |
-
|
| 685 |
-
// abstract
|
| 686 |
-
init: function (opts) {
|
| 687 |
-
var results, search, resultsSelector = ".select2-results";
|
| 688 |
-
|
| 689 |
-
// prepare options
|
| 690 |
-
this.opts = opts = this.prepareOpts(opts);
|
| 691 |
-
|
| 692 |
-
this.id=opts.id;
|
| 693 |
-
|
| 694 |
-
// destroy if called on an existing component
|
| 695 |
-
if (opts.element.data("select2") !== undefined &&
|
| 696 |
-
opts.element.data("select2") !== null) {
|
| 697 |
-
opts.element.data("select2").destroy();
|
| 698 |
-
}
|
| 699 |
-
|
| 700 |
-
this.container = this.createContainer();
|
| 701 |
-
|
| 702 |
-
this.liveRegion = $('.select2-hidden-accessible');
|
| 703 |
-
if (this.liveRegion.length == 0) {
|
| 704 |
-
this.liveRegion = $("<span>", {
|
| 705 |
-
role: "status",
|
| 706 |
-
"aria-live": "polite"
|
| 707 |
-
})
|
| 708 |
-
.addClass("select2-hidden-accessible")
|
| 709 |
-
.appendTo(document.body);
|
| 710 |
-
}
|
| 711 |
-
|
| 712 |
-
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
| 713 |
-
this.containerEventName= this.containerId
|
| 714 |
-
.replace(/([.])/g, '_')
|
| 715 |
-
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
| 716 |
-
this.container.attr("id", this.containerId);
|
| 717 |
-
|
| 718 |
-
this.container.attr("title", opts.element.attr("title"));
|
| 719 |
-
|
| 720 |
-
this.body = $(document.body);
|
| 721 |
-
|
| 722 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 723 |
-
|
| 724 |
-
this.container.attr("style", opts.element.attr("style"));
|
| 725 |
-
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
| 726 |
-
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
| 727 |
-
|
| 728 |
-
this.elementTabIndex = this.opts.element.attr("tabindex");
|
| 729 |
-
|
| 730 |
-
// swap container for the element
|
| 731 |
-
this.opts.element
|
| 732 |
-
.data("select2", this)
|
| 733 |
-
.attr("tabindex", "-1")
|
| 734 |
-
.before(this.container)
|
| 735 |
-
.on("click.select2", killEvent); // do not leak click events
|
| 736 |
-
|
| 737 |
-
this.container.data("select2", this);
|
| 738 |
-
|
| 739 |
-
this.dropdown = this.container.find(".select2-drop");
|
| 740 |
-
|
| 741 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 742 |
-
|
| 743 |
-
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
| 744 |
-
this.dropdown.data("select2", this);
|
| 745 |
-
this.dropdown.on("click", killEvent);
|
| 746 |
-
|
| 747 |
-
this.results = results = this.container.find(resultsSelector);
|
| 748 |
-
this.search = search = this.container.find("input.select2-input");
|
| 749 |
-
|
| 750 |
-
this.queryCount = 0;
|
| 751 |
-
this.resultsPage = 0;
|
| 752 |
-
this.context = null;
|
| 753 |
-
|
| 754 |
-
// initialize the container
|
| 755 |
-
this.initContainer();
|
| 756 |
-
|
| 757 |
-
this.container.on("click", killEvent);
|
| 758 |
-
|
| 759 |
-
installFilteredMouseMove(this.results);
|
| 760 |
-
|
| 761 |
-
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
| 762 |
-
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
| 763 |
-
this._touchEvent = true;
|
| 764 |
-
this.highlightUnderEvent(event);
|
| 765 |
-
}));
|
| 766 |
-
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
| 767 |
-
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
| 768 |
-
|
| 769 |
-
// Waiting for a click event on touch devices to select option and hide dropdown
|
| 770 |
-
// otherwise click will be triggered on an underlying element
|
| 771 |
-
this.dropdown.on('click', this.bind(function (event) {
|
| 772 |
-
if (this._touchEvent) {
|
| 773 |
-
this._touchEvent = false;
|
| 774 |
-
this.selectHighlighted();
|
| 775 |
-
}
|
| 776 |
-
}));
|
| 777 |
-
|
| 778 |
-
installDebouncedScroll(80, this.results);
|
| 779 |
-
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
| 780 |
-
|
| 781 |
-
// do not propagate change event from the search field out of the component
|
| 782 |
-
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 783 |
-
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 784 |
-
|
| 785 |
-
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
| 786 |
-
if ($.fn.mousewheel) {
|
| 787 |
-
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
| 788 |
-
var top = results.scrollTop();
|
| 789 |
-
if (deltaY > 0 && top - deltaY <= 0) {
|
| 790 |
-
results.scrollTop(0);
|
| 791 |
-
killEvent(e);
|
| 792 |
-
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
| 793 |
-
results.scrollTop(results.get(0).scrollHeight - results.height());
|
| 794 |
-
killEvent(e);
|
| 795 |
-
}
|
| 796 |
-
});
|
| 797 |
-
}
|
| 798 |
-
|
| 799 |
-
installKeyUpChangeEvent(search);
|
| 800 |
-
search.on("keyup-change input paste", this.bind(this.updateResults));
|
| 801 |
-
search.on("focus", function () { search.addClass("select2-focused"); });
|
| 802 |
-
search.on("blur", function () { search.removeClass("select2-focused");});
|
| 803 |
-
|
| 804 |
-
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
| 805 |
-
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
| 806 |
-
this.highlightUnderEvent(e);
|
| 807 |
-
this.selectHighlighted(e);
|
| 808 |
-
}
|
| 809 |
-
}));
|
| 810 |
-
|
| 811 |
-
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
| 812 |
-
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
| 813 |
-
// dom it will trigger the popup close, which is not what we want
|
| 814 |
-
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
| 815 |
-
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
| 816 |
-
|
| 817 |
-
this.nextSearchTerm = undefined;
|
| 818 |
-
|
| 819 |
-
if ($.isFunction(this.opts.initSelection)) {
|
| 820 |
-
// initialize selection based on the current value of the source element
|
| 821 |
-
this.initSelection();
|
| 822 |
-
|
| 823 |
-
// if the user has provided a function that can set selection based on the value of the source element
|
| 824 |
-
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
| 825 |
-
this.monitorSource();
|
| 826 |
-
}
|
| 827 |
-
|
| 828 |
-
if (opts.maximumInputLength !== null) {
|
| 829 |
-
this.search.attr("maxlength", opts.maximumInputLength);
|
| 830 |
-
}
|
| 831 |
-
|
| 832 |
-
var disabled = opts.element.prop("disabled");
|
| 833 |
-
if (disabled === undefined) disabled = false;
|
| 834 |
-
this.enable(!disabled);
|
| 835 |
-
|
| 836 |
-
var readonly = opts.element.prop("readonly");
|
| 837 |
-
if (readonly === undefined) readonly = false;
|
| 838 |
-
this.readonly(readonly);
|
| 839 |
-
|
| 840 |
-
// Calculate size of scrollbar
|
| 841 |
-
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
| 842 |
-
|
| 843 |
-
this.autofocus = opts.element.prop("autofocus");
|
| 844 |
-
opts.element.prop("autofocus", false);
|
| 845 |
-
if (this.autofocus) this.focus();
|
| 846 |
-
|
| 847 |
-
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
| 848 |
-
},
|
| 849 |
-
|
| 850 |
-
// abstract
|
| 851 |
-
destroy: function () {
|
| 852 |
-
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
| 853 |
-
|
| 854 |
-
this.close();
|
| 855 |
-
|
| 856 |
-
if (element.length && element[0].detachEvent && self._sync) {
|
| 857 |
-
element.each(function () {
|
| 858 |
-
if (self._sync) {
|
| 859 |
-
this.detachEvent("onpropertychange", self._sync);
|
| 860 |
-
}
|
| 861 |
-
});
|
| 862 |
-
}
|
| 863 |
-
if (this.propertyObserver) {
|
| 864 |
-
this.propertyObserver.disconnect();
|
| 865 |
-
this.propertyObserver = null;
|
| 866 |
-
}
|
| 867 |
-
this._sync = null;
|
| 868 |
-
|
| 869 |
-
if (select2 !== undefined) {
|
| 870 |
-
select2.container.remove();
|
| 871 |
-
select2.liveRegion.remove();
|
| 872 |
-
select2.dropdown.remove();
|
| 873 |
-
element
|
| 874 |
-
.show()
|
| 875 |
-
.removeData("select2")
|
| 876 |
-
.off(".select2")
|
| 877 |
-
.prop("autofocus", this.autofocus || false);
|
| 878 |
-
if (this.elementTabIndex) {
|
| 879 |
-
element.attr({tabindex: this.elementTabIndex});
|
| 880 |
-
} else {
|
| 881 |
-
element.removeAttr("tabindex");
|
| 882 |
-
}
|
| 883 |
-
element.show();
|
| 884 |
-
}
|
| 885 |
-
|
| 886 |
-
cleanupJQueryElements.call(this,
|
| 887 |
-
"container",
|
| 888 |
-
"liveRegion",
|
| 889 |
-
"dropdown",
|
| 890 |
-
"results",
|
| 891 |
-
"search"
|
| 892 |
-
);
|
| 893 |
-
},
|
| 894 |
-
|
| 895 |
-
// abstract
|
| 896 |
-
optionToData: function(element) {
|
| 897 |
-
if (element.is("option")) {
|
| 898 |
-
return {
|
| 899 |
-
id:element.prop("value"),
|
| 900 |
-
text:element.text(),
|
| 901 |
-
element: element.get(),
|
| 902 |
-
css: element.attr("class"),
|
| 903 |
-
disabled: element.prop("disabled"),
|
| 904 |
-
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
| 905 |
-
};
|
| 906 |
-
} else if (element.is("optgroup")) {
|
| 907 |
-
return {
|
| 908 |
-
text:element.attr("label"),
|
| 909 |
-
children:[],
|
| 910 |
-
element: element.get(),
|
| 911 |
-
css: element.attr("class")
|
| 912 |
-
};
|
| 913 |
-
}
|
| 914 |
-
},
|
| 915 |
-
|
| 916 |
-
// abstract
|
| 917 |
-
prepareOpts: function (opts) {
|
| 918 |
-
var element, select, idKey, ajaxUrl, self = this;
|
| 919 |
-
|
| 920 |
-
element = opts.element;
|
| 921 |
-
|
| 922 |
-
if (element.get(0).tagName.toLowerCase() === "select") {
|
| 923 |
-
this.select = select = opts.element;
|
| 924 |
-
}
|
| 925 |
-
|
| 926 |
-
if (select) {
|
| 927 |
-
// these options are not allowed when attached to a select because they are picked up off the element itself
|
| 928 |
-
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
| 929 |
-
if (this in opts) {
|
| 930 |
-
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
| 931 |
-
}
|
| 932 |
-
});
|
| 933 |
-
}
|
| 934 |
-
|
| 935 |
-
opts = $.extend({}, {
|
| 936 |
-
populateResults: function(container, results, query) {
|
| 937 |
-
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
| 938 |
-
|
| 939 |
-
populate=function(results, container, depth) {
|
| 940 |
-
|
| 941 |
-
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
| 942 |
-
|
| 943 |
-
results = opts.sortResults(results, container, query);
|
| 944 |
-
|
| 945 |
-
// collect the created nodes for bulk append
|
| 946 |
-
var nodes = [];
|
| 947 |
-
for (i = 0, l = results.length; i < l; i = i + 1) {
|
| 948 |
-
|
| 949 |
-
result=results[i];
|
| 950 |
-
|
| 951 |
-
disabled = (result.disabled === true);
|
| 952 |
-
selectable = (!disabled) && (id(result) !== undefined);
|
| 953 |
-
|
| 954 |
-
compound=result.children && result.children.length > 0;
|
| 955 |
-
|
| 956 |
-
node=$("<li></li>");
|
| 957 |
-
node.addClass("select2-results-dept-"+depth);
|
| 958 |
-
node.addClass("select2-result");
|
| 959 |
-
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
| 960 |
-
if (disabled) { node.addClass("select2-disabled"); }
|
| 961 |
-
if (compound) { node.addClass("select2-result-with-children"); }
|
| 962 |
-
node.addClass(self.opts.formatResultCssClass(result));
|
| 963 |
-
node.attr("role", "presentation");
|
| 964 |
-
|
| 965 |
-
label=$(document.createElement("div"));
|
| 966 |
-
label.addClass("select2-result-label");
|
| 967 |
-
label.attr("id", "select2-result-label-" + nextUid());
|
| 968 |
-
label.attr("role", "option");
|
| 969 |
-
|
| 970 |
-
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
| 971 |
-
if (formatted!==undefined) {
|
| 972 |
-
label.html(formatted);
|
| 973 |
-
node.append(label);
|
| 974 |
-
}
|
| 975 |
-
|
| 976 |
-
|
| 977 |
-
if (compound) {
|
| 978 |
-
|
| 979 |
-
innerContainer=$("<ul></ul>");
|
| 980 |
-
innerContainer.addClass("select2-result-sub");
|
| 981 |
-
populate(result.children, innerContainer, depth+1);
|
| 982 |
-
node.append(innerContainer);
|
| 983 |
-
}
|
| 984 |
-
|
| 985 |
-
node.data("select2-data", result);
|
| 986 |
-
nodes.push(node[0]);
|
| 987 |
-
}
|
| 988 |
-
|
| 989 |
-
// bulk append the created nodes
|
| 990 |
-
container.append(nodes);
|
| 991 |
-
liveRegion.text(opts.formatMatches(results.length));
|
| 992 |
-
};
|
| 993 |
-
|
| 994 |
-
populate(results, container, 0);
|
| 995 |
-
}
|
| 996 |
-
}, $.fn.select2.defaults, opts);
|
| 997 |
-
|
| 998 |
-
if (typeof(opts.id) !== "function") {
|
| 999 |
-
idKey = opts.id;
|
| 1000 |
-
opts.id = function (e) { return e[idKey]; };
|
| 1001 |
-
}
|
| 1002 |
-
|
| 1003 |
-
if ($.isArray(opts.element.data("select2Tags"))) {
|
| 1004 |
-
if ("tags" in opts) {
|
| 1005 |
-
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
| 1006 |
-
}
|
| 1007 |
-
opts.tags=opts.element.data("select2Tags");
|
| 1008 |
-
}
|
| 1009 |
-
|
| 1010 |
-
if (select) {
|
| 1011 |
-
opts.query = this.bind(function (query) {
|
| 1012 |
-
var data = { results: [], more: false },
|
| 1013 |
-
term = query.term,
|
| 1014 |
-
children, placeholderOption, process;
|
| 1015 |
-
|
| 1016 |
-
process=function(element, collection) {
|
| 1017 |
-
var group;
|
| 1018 |
-
if (element.is("option")) {
|
| 1019 |
-
if (query.matcher(term, element.text(), element)) {
|
| 1020 |
-
collection.push(self.optionToData(element));
|
| 1021 |
-
}
|
| 1022 |
-
} else if (element.is("optgroup")) {
|
| 1023 |
-
group=self.optionToData(element);
|
| 1024 |
-
element.children().each2(function(i, elm) { process(elm, group.children); });
|
| 1025 |
-
if (group.children.length>0) {
|
| 1026 |
-
collection.push(group);
|
| 1027 |
-
}
|
| 1028 |
-
}
|
| 1029 |
-
};
|
| 1030 |
-
|
| 1031 |
-
children=element.children();
|
| 1032 |
-
|
| 1033 |
-
// ignore the placeholder option if there is one
|
| 1034 |
-
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
| 1035 |
-
placeholderOption = this.getPlaceholderOption();
|
| 1036 |
-
if (placeholderOption) {
|
| 1037 |
-
children=children.not(placeholderOption);
|
| 1038 |
-
}
|
| 1039 |
-
}
|
| 1040 |
-
|
| 1041 |
-
children.each2(function(i, elm) { process(elm, data.results); });
|
| 1042 |
-
|
| 1043 |
-
query.callback(data);
|
| 1044 |
-
});
|
| 1045 |
-
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
| 1046 |
-
opts.id=function(e) { return e.id; };
|
| 1047 |
-
} else {
|
| 1048 |
-
if (!("query" in opts)) {
|
| 1049 |
-
|
| 1050 |
-
if ("ajax" in opts) {
|
| 1051 |
-
ajaxUrl = opts.element.data("ajax-url");
|
| 1052 |
-
if (ajaxUrl && ajaxUrl.length > 0) {
|
| 1053 |
-
opts.ajax.url = ajaxUrl;
|
| 1054 |
-
}
|
| 1055 |
-
opts.query = ajax.call(opts.element, opts.ajax);
|
| 1056 |
-
} else if ("data" in opts) {
|
| 1057 |
-
opts.query = local(opts.data);
|
| 1058 |
-
} else if ("tags" in opts) {
|
| 1059 |
-
opts.query = tags(opts.tags);
|
| 1060 |
-
if (opts.createSearchChoice === undefined) {
|
| 1061 |
-
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
| 1062 |
-
}
|
| 1063 |
-
if (opts.initSelection === undefined) {
|
| 1064 |
-
opts.initSelection = function (element, callback) {
|
| 1065 |
-
var data = [];
|
| 1066 |
-
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
| 1067 |
-
var obj = { id: this, text: this },
|
| 1068 |
-
tags = opts.tags;
|
| 1069 |
-
if ($.isFunction(tags)) tags=tags();
|
| 1070 |
-
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
| 1071 |
-
data.push(obj);
|
| 1072 |
-
});
|
| 1073 |
-
|
| 1074 |
-
callback(data);
|
| 1075 |
-
};
|
| 1076 |
-
}
|
| 1077 |
-
}
|
| 1078 |
-
}
|
| 1079 |
-
}
|
| 1080 |
-
if (typeof(opts.query) !== "function") {
|
| 1081 |
-
throw "query function not defined for Select2 " + opts.element.attr("id");
|
| 1082 |
-
}
|
| 1083 |
-
|
| 1084 |
-
if (opts.createSearchChoicePosition === 'top') {
|
| 1085 |
-
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
| 1086 |
-
}
|
| 1087 |
-
else if (opts.createSearchChoicePosition === 'bottom') {
|
| 1088 |
-
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
| 1089 |
-
}
|
| 1090 |
-
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
| 1091 |
-
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
| 1092 |
-
}
|
| 1093 |
-
|
| 1094 |
-
return opts;
|
| 1095 |
-
},
|
| 1096 |
-
|
| 1097 |
-
/**
|
| 1098 |
-
* Monitor the original element for changes and update select2 accordingly
|
| 1099 |
-
*/
|
| 1100 |
-
// abstract
|
| 1101 |
-
monitorSource: function () {
|
| 1102 |
-
var el = this.opts.element, observer, self = this;
|
| 1103 |
-
|
| 1104 |
-
el.on("change.select2", this.bind(function (e) {
|
| 1105 |
-
if (this.opts.element.data("select2-change-triggered") !== true) {
|
| 1106 |
-
this.initSelection();
|
| 1107 |
-
}
|
| 1108 |
-
}));
|
| 1109 |
-
|
| 1110 |
-
this._sync = this.bind(function () {
|
| 1111 |
-
|
| 1112 |
-
// sync enabled state
|
| 1113 |
-
var disabled = el.prop("disabled");
|
| 1114 |
-
if (disabled === undefined) disabled = false;
|
| 1115 |
-
this.enable(!disabled);
|
| 1116 |
-
|
| 1117 |
-
var readonly = el.prop("readonly");
|
| 1118 |
-
if (readonly === undefined) readonly = false;
|
| 1119 |
-
this.readonly(readonly);
|
| 1120 |
-
|
| 1121 |
-
if (this.container) {
|
| 1122 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 1123 |
-
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
| 1124 |
-
}
|
| 1125 |
-
|
| 1126 |
-
if (this.dropdown) {
|
| 1127 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 1128 |
-
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
| 1129 |
-
}
|
| 1130 |
-
|
| 1131 |
-
});
|
| 1132 |
-
|
| 1133 |
-
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
| 1134 |
-
if (el.length && el[0].attachEvent) {
|
| 1135 |
-
el.each(function() {
|
| 1136 |
-
this.attachEvent("onpropertychange", self._sync);
|
| 1137 |
-
});
|
| 1138 |
-
}
|
| 1139 |
-
|
| 1140 |
-
// safari, chrome, firefox, IE11
|
| 1141 |
-
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
| 1142 |
-
if (observer !== undefined) {
|
| 1143 |
-
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
| 1144 |
-
this.propertyObserver = new observer(function (mutations) {
|
| 1145 |
-
$.each(mutations, self._sync);
|
| 1146 |
-
});
|
| 1147 |
-
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
| 1148 |
-
}
|
| 1149 |
-
},
|
| 1150 |
-
|
| 1151 |
-
// abstract
|
| 1152 |
-
triggerSelect: function(data) {
|
| 1153 |
-
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
| 1154 |
-
this.opts.element.trigger(evt);
|
| 1155 |
-
return !evt.isDefaultPrevented();
|
| 1156 |
-
},
|
| 1157 |
-
|
| 1158 |
-
/**
|
| 1159 |
-
* Triggers the change event on the source element
|
| 1160 |
-
*/
|
| 1161 |
-
// abstract
|
| 1162 |
-
triggerChange: function (details) {
|
| 1163 |
-
|
| 1164 |
-
details = details || {};
|
| 1165 |
-
details= $.extend({}, details, { type: "change", val: this.val() });
|
| 1166 |
-
// prevents recursive triggering
|
| 1167 |
-
this.opts.element.data("select2-change-triggered", true);
|
| 1168 |
-
this.opts.element.trigger(details);
|
| 1169 |
-
this.opts.element.data("select2-change-triggered", false);
|
| 1170 |
-
|
| 1171 |
-
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
| 1172 |
-
// so here we trigger the click event manually
|
| 1173 |
-
this.opts.element.click();
|
| 1174 |
-
|
| 1175 |
-
// ValidationEngine ignores the change event and listens instead to blur
|
| 1176 |
-
// so here we trigger the blur event manually if so desired
|
| 1177 |
-
if (this.opts.blurOnChange)
|
| 1178 |
-
this.opts.element.blur();
|
| 1179 |
-
},
|
| 1180 |
-
|
| 1181 |
-
//abstract
|
| 1182 |
-
isInterfaceEnabled: function()
|
| 1183 |
-
{
|
| 1184 |
-
return this.enabledInterface === true;
|
| 1185 |
-
},
|
| 1186 |
-
|
| 1187 |
-
// abstract
|
| 1188 |
-
enableInterface: function() {
|
| 1189 |
-
var enabled = this._enabled && !this._readonly,
|
| 1190 |
-
disabled = !enabled;
|
| 1191 |
-
|
| 1192 |
-
if (enabled === this.enabledInterface) return false;
|
| 1193 |
-
|
| 1194 |
-
this.container.toggleClass("select2-container-disabled", disabled);
|
| 1195 |
-
this.close();
|
| 1196 |
-
this.enabledInterface = enabled;
|
| 1197 |
-
|
| 1198 |
-
return true;
|
| 1199 |
-
},
|
| 1200 |
-
|
| 1201 |
-
// abstract
|
| 1202 |
-
enable: function(enabled) {
|
| 1203 |
-
if (enabled === undefined) enabled = true;
|
| 1204 |
-
if (this._enabled === enabled) return;
|
| 1205 |
-
this._enabled = enabled;
|
| 1206 |
-
|
| 1207 |
-
this.opts.element.prop("disabled", !enabled);
|
| 1208 |
-
this.enableInterface();
|
| 1209 |
-
},
|
| 1210 |
-
|
| 1211 |
-
// abstract
|
| 1212 |
-
disable: function() {
|
| 1213 |
-
this.enable(false);
|
| 1214 |
-
},
|
| 1215 |
-
|
| 1216 |
-
// abstract
|
| 1217 |
-
readonly: function(enabled) {
|
| 1218 |
-
if (enabled === undefined) enabled = false;
|
| 1219 |
-
if (this._readonly === enabled) return;
|
| 1220 |
-
this._readonly = enabled;
|
| 1221 |
-
|
| 1222 |
-
this.opts.element.prop("readonly", enabled);
|
| 1223 |
-
this.enableInterface();
|
| 1224 |
-
},
|
| 1225 |
-
|
| 1226 |
-
// abstract
|
| 1227 |
-
opened: function () {
|
| 1228 |
-
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
| 1229 |
-
},
|
| 1230 |
-
|
| 1231 |
-
// abstract
|
| 1232 |
-
positionDropdown: function() {
|
| 1233 |
-
var $dropdown = this.dropdown,
|
| 1234 |
-
container = this.container,
|
| 1235 |
-
offset = container.offset(),
|
| 1236 |
-
height = container.outerHeight(false),
|
| 1237 |
-
width = container.outerWidth(false),
|
| 1238 |
-
dropHeight = $dropdown.outerHeight(false),
|
| 1239 |
-
$window = $(window),
|
| 1240 |
-
windowWidth = $window.width(),
|
| 1241 |
-
windowHeight = $window.height(),
|
| 1242 |
-
viewPortRight = $window.scrollLeft() + windowWidth,
|
| 1243 |
-
viewportBottom = $window.scrollTop() + windowHeight,
|
| 1244 |
-
dropTop = offset.top + height,
|
| 1245 |
-
dropLeft = offset.left,
|
| 1246 |
-
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
| 1247 |
-
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
| 1248 |
-
dropWidth = $dropdown.outerWidth(false),
|
| 1249 |
-
enoughRoomOnRight = function() {
|
| 1250 |
-
return dropLeft + dropWidth <= viewPortRight;
|
| 1251 |
-
},
|
| 1252 |
-
enoughRoomOnLeft = function() {
|
| 1253 |
-
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
| 1254 |
-
},
|
| 1255 |
-
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
| 1256 |
-
bodyOffset,
|
| 1257 |
-
above,
|
| 1258 |
-
changeDirection,
|
| 1259 |
-
css,
|
| 1260 |
-
resultsListNode;
|
| 1261 |
-
|
| 1262 |
-
// always prefer the current above/below alignment, unless there is not enough room
|
| 1263 |
-
if (aboveNow) {
|
| 1264 |
-
above = true;
|
| 1265 |
-
if (!enoughRoomAbove && enoughRoomBelow) {
|
| 1266 |
-
changeDirection = true;
|
| 1267 |
-
above = false;
|
| 1268 |
-
}
|
| 1269 |
-
} else {
|
| 1270 |
-
above = false;
|
| 1271 |
-
if (!enoughRoomBelow && enoughRoomAbove) {
|
| 1272 |
-
changeDirection = true;
|
| 1273 |
-
above = true;
|
| 1274 |
-
}
|
| 1275 |
-
}
|
| 1276 |
-
|
| 1277 |
-
//if we are changing direction we need to get positions when dropdown is hidden;
|
| 1278 |
-
if (changeDirection) {
|
| 1279 |
-
$dropdown.hide();
|
| 1280 |
-
offset = this.container.offset();
|
| 1281 |
-
height = this.container.outerHeight(false);
|
| 1282 |
-
width = this.container.outerWidth(false);
|
| 1283 |
-
dropHeight = $dropdown.outerHeight(false);
|
| 1284 |
-
viewPortRight = $window.scrollLeft() + windowWidth;
|
| 1285 |
-
viewportBottom = $window.scrollTop() + windowHeight;
|
| 1286 |
-
dropTop = offset.top + height;
|
| 1287 |
-
dropLeft = offset.left;
|
| 1288 |
-
dropWidth = $dropdown.outerWidth(false);
|
| 1289 |
-
$dropdown.show();
|
| 1290 |
-
|
| 1291 |
-
// fix so the cursor does not move to the left within the search-textbox in IE
|
| 1292 |
-
this.focusSearch();
|
| 1293 |
-
}
|
| 1294 |
-
|
| 1295 |
-
if (this.opts.dropdownAutoWidth) {
|
| 1296 |
-
resultsListNode = $('.select2-results', $dropdown)[0];
|
| 1297 |
-
$dropdown.addClass('select2-drop-auto-width');
|
| 1298 |
-
$dropdown.css('width', '');
|
| 1299 |
-
// Add scrollbar width to dropdown if vertical scrollbar is present
|
| 1300 |
-
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
| 1301 |
-
dropWidth > width ? width = dropWidth : dropWidth = width;
|
| 1302 |
-
dropHeight = $dropdown.outerHeight(false);
|
| 1303 |
-
}
|
| 1304 |
-
else {
|
| 1305 |
-
this.container.removeClass('select2-drop-auto-width');
|
| 1306 |
-
}
|
| 1307 |
-
|
| 1308 |
-
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
| 1309 |
-
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
| 1310 |
-
|
| 1311 |
-
// fix positioning when body has an offset and is not position: static
|
| 1312 |
-
if (this.body.css('position') !== 'static') {
|
| 1313 |
-
bodyOffset = this.body.offset();
|
| 1314 |
-
dropTop -= bodyOffset.top;
|
| 1315 |
-
dropLeft -= bodyOffset.left;
|
| 1316 |
-
}
|
| 1317 |
-
|
| 1318 |
-
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
| 1319 |
-
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
| 1320 |
-
}
|
| 1321 |
-
|
| 1322 |
-
css = {
|
| 1323 |
-
left: dropLeft,
|
| 1324 |
-
width: width
|
| 1325 |
-
};
|
| 1326 |
-
|
| 1327 |
-
if (above) {
|
| 1328 |
-
css.top = offset.top - dropHeight;
|
| 1329 |
-
css.bottom = 'auto';
|
| 1330 |
-
this.container.addClass("select2-drop-above");
|
| 1331 |
-
$dropdown.addClass("select2-drop-above");
|
| 1332 |
-
}
|
| 1333 |
-
else {
|
| 1334 |
-
css.top = dropTop;
|
| 1335 |
-
css.bottom = 'auto';
|
| 1336 |
-
this.container.removeClass("select2-drop-above");
|
| 1337 |
-
$dropdown.removeClass("select2-drop-above");
|
| 1338 |
-
}
|
| 1339 |
-
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
| 1340 |
-
|
| 1341 |
-
$dropdown.css(css);
|
| 1342 |
-
},
|
| 1343 |
-
|
| 1344 |
-
// abstract
|
| 1345 |
-
shouldOpen: function() {
|
| 1346 |
-
var event;
|
| 1347 |
-
|
| 1348 |
-
if (this.opened()) return false;
|
| 1349 |
-
|
| 1350 |
-
if (this._enabled === false || this._readonly === true) return false;
|
| 1351 |
-
|
| 1352 |
-
event = $.Event("select2-opening");
|
| 1353 |
-
this.opts.element.trigger(event);
|
| 1354 |
-
return !event.isDefaultPrevented();
|
| 1355 |
-
},
|
| 1356 |
-
|
| 1357 |
-
// abstract
|
| 1358 |
-
clearDropdownAlignmentPreference: function() {
|
| 1359 |
-
// clear the classes used to figure out the preference of where the dropdown should be opened
|
| 1360 |
-
this.container.removeClass("select2-drop-above");
|
| 1361 |
-
this.dropdown.removeClass("select2-drop-above");
|
| 1362 |
-
},
|
| 1363 |
-
|
| 1364 |
-
/**
|
| 1365 |
-
* Opens the dropdown
|
| 1366 |
-
*
|
| 1367 |
-
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
| 1368 |
-
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
| 1369 |
-
*/
|
| 1370 |
-
// abstract
|
| 1371 |
-
open: function () {
|
| 1372 |
-
|
| 1373 |
-
if (!this.shouldOpen()) return false;
|
| 1374 |
-
|
| 1375 |
-
this.opening();
|
| 1376 |
-
|
| 1377 |
-
// Only bind the document mousemove when the dropdown is visible
|
| 1378 |
-
$document.on("mousemove.select2Event", function (e) {
|
| 1379 |
-
lastMousePosition.x = e.pageX;
|
| 1380 |
-
lastMousePosition.y = e.pageY;
|
| 1381 |
-
});
|
| 1382 |
-
|
| 1383 |
-
return true;
|
| 1384 |
-
},
|
| 1385 |
-
|
| 1386 |
-
/**
|
| 1387 |
-
* Performs the opening of the dropdown
|
| 1388 |
-
*/
|
| 1389 |
-
// abstract
|
| 1390 |
-
opening: function() {
|
| 1391 |
-
var cid = this.containerEventName,
|
| 1392 |
-
scroll = "scroll." + cid,
|
| 1393 |
-
resize = "resize."+cid,
|
| 1394 |
-
orient = "orientationchange."+cid,
|
| 1395 |
-
mask;
|
| 1396 |
-
|
| 1397 |
-
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
| 1398 |
-
|
| 1399 |
-
this.clearDropdownAlignmentPreference();
|
| 1400 |
-
|
| 1401 |
-
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
| 1402 |
-
this.dropdown.detach().appendTo(this.body);
|
| 1403 |
-
}
|
| 1404 |
-
|
| 1405 |
-
// create the dropdown mask if doesn't already exist
|
| 1406 |
-
mask = $("#select2-drop-mask");
|
| 1407 |
-
if (mask.length === 0) {
|
| 1408 |
-
mask = $(document.createElement("div"));
|
| 1409 |
-
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
| 1410 |
-
mask.hide();
|
| 1411 |
-
mask.appendTo(this.body);
|
| 1412 |
-
mask.on("mousedown touchstart click", function (e) {
|
| 1413 |
-
// Prevent IE from generating a click event on the body
|
| 1414 |
-
reinsertElement(mask);
|
| 1415 |
-
|
| 1416 |
-
var dropdown = $("#select2-drop"), self;
|
| 1417 |
-
if (dropdown.length > 0) {
|
| 1418 |
-
self=dropdown.data("select2");
|
| 1419 |
-
if (self.opts.selectOnBlur) {
|
| 1420 |
-
self.selectHighlighted({noFocus: true});
|
| 1421 |
-
}
|
| 1422 |
-
self.close();
|
| 1423 |
-
e.preventDefault();
|
| 1424 |
-
e.stopPropagation();
|
| 1425 |
-
}
|
| 1426 |
-
});
|
| 1427 |
-
}
|
| 1428 |
-
|
| 1429 |
-
// ensure the mask is always right before the dropdown
|
| 1430 |
-
if (this.dropdown.prev()[0] !== mask[0]) {
|
| 1431 |
-
this.dropdown.before(mask);
|
| 1432 |
-
}
|
| 1433 |
-
|
| 1434 |
-
// move the global id to the correct dropdown
|
| 1435 |
-
$("#select2-drop").removeAttr("id");
|
| 1436 |
-
this.dropdown.attr("id", "select2-drop");
|
| 1437 |
-
|
| 1438 |
-
// show the elements
|
| 1439 |
-
mask.show();
|
| 1440 |
-
|
| 1441 |
-
this.positionDropdown();
|
| 1442 |
-
this.dropdown.show();
|
| 1443 |
-
this.positionDropdown();
|
| 1444 |
-
|
| 1445 |
-
this.dropdown.addClass("select2-drop-active");
|
| 1446 |
-
|
| 1447 |
-
// attach listeners to events that can change the position of the container and thus require
|
| 1448 |
-
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
| 1449 |
-
var that = this;
|
| 1450 |
-
this.container.parents().add(window).each(function () {
|
| 1451 |
-
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
| 1452 |
-
if (that.opened()) that.positionDropdown();
|
| 1453 |
-
});
|
| 1454 |
-
});
|
| 1455 |
-
|
| 1456 |
-
|
| 1457 |
-
},
|
| 1458 |
-
|
| 1459 |
-
// abstract
|
| 1460 |
-
close: function () {
|
| 1461 |
-
if (!this.opened()) return;
|
| 1462 |
-
|
| 1463 |
-
var cid = this.containerEventName,
|
| 1464 |
-
scroll = "scroll." + cid,
|
| 1465 |
-
resize = "resize."+cid,
|
| 1466 |
-
orient = "orientationchange."+cid;
|
| 1467 |
-
|
| 1468 |
-
// unbind event listeners
|
| 1469 |
-
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
| 1470 |
-
|
| 1471 |
-
this.clearDropdownAlignmentPreference();
|
| 1472 |
-
|
| 1473 |
-
$("#select2-drop-mask").hide();
|
| 1474 |
-
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
| 1475 |
-
this.dropdown.hide();
|
| 1476 |
-
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
| 1477 |
-
this.results.empty();
|
| 1478 |
-
|
| 1479 |
-
// Now that the dropdown is closed, unbind the global document mousemove event
|
| 1480 |
-
$document.off("mousemove.select2Event");
|
| 1481 |
-
|
| 1482 |
-
this.clearSearch();
|
| 1483 |
-
this.search.removeClass("select2-active");
|
| 1484 |
-
this.opts.element.trigger($.Event("select2-close"));
|
| 1485 |
-
},
|
| 1486 |
-
|
| 1487 |
-
/**
|
| 1488 |
-
* Opens control, sets input value, and updates results.
|
| 1489 |
-
*/
|
| 1490 |
-
// abstract
|
| 1491 |
-
externalSearch: function (term) {
|
| 1492 |
-
this.open();
|
| 1493 |
-
this.search.val(term);
|
| 1494 |
-
this.updateResults(false);
|
| 1495 |
-
},
|
| 1496 |
-
|
| 1497 |
-
// abstract
|
| 1498 |
-
clearSearch: function () {
|
| 1499 |
-
|
| 1500 |
-
},
|
| 1501 |
-
|
| 1502 |
-
//abstract
|
| 1503 |
-
getMaximumSelectionSize: function() {
|
| 1504 |
-
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
| 1505 |
-
},
|
| 1506 |
-
|
| 1507 |
-
// abstract
|
| 1508 |
-
ensureHighlightVisible: function () {
|
| 1509 |
-
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
| 1510 |
-
|
| 1511 |
-
index = this.highlight();
|
| 1512 |
-
|
| 1513 |
-
if (index < 0) return;
|
| 1514 |
-
|
| 1515 |
-
if (index == 0) {
|
| 1516 |
-
|
| 1517 |
-
// if the first element is highlighted scroll all the way to the top,
|
| 1518 |
-
// that way any unselectable headers above it will also be scrolled
|
| 1519 |
-
// into view
|
| 1520 |
-
|
| 1521 |
-
results.scrollTop(0);
|
| 1522 |
-
return;
|
| 1523 |
-
}
|
| 1524 |
-
|
| 1525 |
-
children = this.findHighlightableChoices().find('.select2-result-label');
|
| 1526 |
-
|
| 1527 |
-
child = $(children[index]);
|
| 1528 |
-
|
| 1529 |
-
topOffset = (child.offset() || {}).top || 0;
|
| 1530 |
-
|
| 1531 |
-
hb = topOffset + child.outerHeight(true);
|
| 1532 |
-
|
| 1533 |
-
// if this is the last child lets also make sure select2-more-results is visible
|
| 1534 |
-
if (index === children.length - 1) {
|
| 1535 |
-
more = results.find("li.select2-more-results");
|
| 1536 |
-
if (more.length > 0) {
|
| 1537 |
-
hb = more.offset().top + more.outerHeight(true);
|
| 1538 |
-
}
|
| 1539 |
-
}
|
| 1540 |
-
|
| 1541 |
-
rb = results.offset().top + results.outerHeight(false);
|
| 1542 |
-
if (hb > rb) {
|
| 1543 |
-
results.scrollTop(results.scrollTop() + (hb - rb));
|
| 1544 |
-
}
|
| 1545 |
-
y = topOffset - results.offset().top;
|
| 1546 |
-
|
| 1547 |
-
// make sure the top of the element is visible
|
| 1548 |
-
if (y < 0 && child.css('display') != 'none' ) {
|
| 1549 |
-
results.scrollTop(results.scrollTop() + y); // y is negative
|
| 1550 |
-
}
|
| 1551 |
-
},
|
| 1552 |
-
|
| 1553 |
-
// abstract
|
| 1554 |
-
findHighlightableChoices: function() {
|
| 1555 |
-
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
| 1556 |
-
},
|
| 1557 |
-
|
| 1558 |
-
// abstract
|
| 1559 |
-
moveHighlight: function (delta) {
|
| 1560 |
-
var choices = this.findHighlightableChoices(),
|
| 1561 |
-
index = this.highlight();
|
| 1562 |
-
|
| 1563 |
-
while (index > -1 && index < choices.length) {
|
| 1564 |
-
index += delta;
|
| 1565 |
-
var choice = $(choices[index]);
|
| 1566 |
-
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
| 1567 |
-
this.highlight(index);
|
| 1568 |
-
break;
|
| 1569 |
-
}
|
| 1570 |
-
}
|
| 1571 |
-
},
|
| 1572 |
-
|
| 1573 |
-
// abstract
|
| 1574 |
-
highlight: function (index) {
|
| 1575 |
-
var choices = this.findHighlightableChoices(),
|
| 1576 |
-
choice,
|
| 1577 |
-
data;
|
| 1578 |
-
|
| 1579 |
-
if (arguments.length === 0) {
|
| 1580 |
-
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
| 1581 |
-
}
|
| 1582 |
-
|
| 1583 |
-
if (index >= choices.length) index = choices.length - 1;
|
| 1584 |
-
if (index < 0) index = 0;
|
| 1585 |
-
|
| 1586 |
-
this.removeHighlight();
|
| 1587 |
-
|
| 1588 |
-
choice = $(choices[index]);
|
| 1589 |
-
choice.addClass("select2-highlighted");
|
| 1590 |
-
|
| 1591 |
-
// ensure assistive technology can determine the active choice
|
| 1592 |
-
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
| 1593 |
-
|
| 1594 |
-
this.ensureHighlightVisible();
|
| 1595 |
-
|
| 1596 |
-
this.liveRegion.text(choice.text());
|
| 1597 |
-
|
| 1598 |
-
data = choice.data("select2-data");
|
| 1599 |
-
if (data) {
|
| 1600 |
-
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
| 1601 |
-
}
|
| 1602 |
-
},
|
| 1603 |
-
|
| 1604 |
-
removeHighlight: function() {
|
| 1605 |
-
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
| 1606 |
-
},
|
| 1607 |
-
|
| 1608 |
-
touchMoved: function() {
|
| 1609 |
-
this._touchMoved = true;
|
| 1610 |
-
},
|
| 1611 |
-
|
| 1612 |
-
clearTouchMoved: function() {
|
| 1613 |
-
this._touchMoved = false;
|
| 1614 |
-
},
|
| 1615 |
-
|
| 1616 |
-
// abstract
|
| 1617 |
-
countSelectableResults: function() {
|
| 1618 |
-
return this.findHighlightableChoices().length;
|
| 1619 |
-
},
|
| 1620 |
-
|
| 1621 |
-
// abstract
|
| 1622 |
-
highlightUnderEvent: function (event) {
|
| 1623 |
-
var el = $(event.target).closest(".select2-result-selectable");
|
| 1624 |
-
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
| 1625 |
-
var choices = this.findHighlightableChoices();
|
| 1626 |
-
this.highlight(choices.index(el));
|
| 1627 |
-
} else if (el.length == 0) {
|
| 1628 |
-
// if we are over an unselectable item remove all highlights
|
| 1629 |
-
this.removeHighlight();
|
| 1630 |
-
}
|
| 1631 |
-
},
|
| 1632 |
-
|
| 1633 |
-
// abstract
|
| 1634 |
-
loadMoreIfNeeded: function () {
|
| 1635 |
-
var results = this.results,
|
| 1636 |
-
more = results.find("li.select2-more-results"),
|
| 1637 |
-
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
| 1638 |
-
page = this.resultsPage + 1,
|
| 1639 |
-
self=this,
|
| 1640 |
-
term=this.search.val(),
|
| 1641 |
-
context=this.context;
|
| 1642 |
-
|
| 1643 |
-
if (more.length === 0) return;
|
| 1644 |
-
below = more.offset().top - results.offset().top - results.height();
|
| 1645 |
-
|
| 1646 |
-
if (below <= this.opts.loadMorePadding) {
|
| 1647 |
-
more.addClass("select2-active");
|
| 1648 |
-
this.opts.query({
|
| 1649 |
-
element: this.opts.element,
|
| 1650 |
-
term: term,
|
| 1651 |
-
page: page,
|
| 1652 |
-
context: context,
|
| 1653 |
-
matcher: this.opts.matcher,
|
| 1654 |
-
callback: this.bind(function (data) {
|
| 1655 |
-
|
| 1656 |
-
// ignore a response if the select2 has been closed before it was received
|
| 1657 |
-
if (!self.opened()) return;
|
| 1658 |
-
|
| 1659 |
-
|
| 1660 |
-
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
| 1661 |
-
self.postprocessResults(data, false, false);
|
| 1662 |
-
|
| 1663 |
-
if (data.more===true) {
|
| 1664 |
-
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
| 1665 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1666 |
-
} else {
|
| 1667 |
-
more.remove();
|
| 1668 |
-
}
|
| 1669 |
-
self.positionDropdown();
|
| 1670 |
-
self.resultsPage = page;
|
| 1671 |
-
self.context = data.context;
|
| 1672 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1673 |
-
})});
|
| 1674 |
-
}
|
| 1675 |
-
},
|
| 1676 |
-
|
| 1677 |
-
/**
|
| 1678 |
-
* Default tokenizer function which does nothing
|
| 1679 |
-
*/
|
| 1680 |
-
tokenize: function() {
|
| 1681 |
-
|
| 1682 |
-
},
|
| 1683 |
-
|
| 1684 |
-
/**
|
| 1685 |
-
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
| 1686 |
-
*/
|
| 1687 |
-
// abstract
|
| 1688 |
-
updateResults: function (initial) {
|
| 1689 |
-
var search = this.search,
|
| 1690 |
-
results = this.results,
|
| 1691 |
-
opts = this.opts,
|
| 1692 |
-
data,
|
| 1693 |
-
self = this,
|
| 1694 |
-
input,
|
| 1695 |
-
term = search.val(),
|
| 1696 |
-
lastTerm = $.data(this.container, "select2-last-term"),
|
| 1697 |
-
// sequence number used to drop out-of-order responses
|
| 1698 |
-
queryNumber;
|
| 1699 |
-
|
| 1700 |
-
// prevent duplicate queries against the same term
|
| 1701 |
-
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
| 1702 |
-
|
| 1703 |
-
$.data(this.container, "select2-last-term", term);
|
| 1704 |
-
|
| 1705 |
-
// if the search is currently hidden we do not alter the results
|
| 1706 |
-
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
| 1707 |
-
return;
|
| 1708 |
-
}
|
| 1709 |
-
|
| 1710 |
-
function postRender() {
|
| 1711 |
-
search.removeClass("select2-active");
|
| 1712 |
-
self.positionDropdown();
|
| 1713 |
-
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
| 1714 |
-
self.liveRegion.text(results.text());
|
| 1715 |
-
}
|
| 1716 |
-
else {
|
| 1717 |
-
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
| 1718 |
-
}
|
| 1719 |
-
}
|
| 1720 |
-
|
| 1721 |
-
function render(html) {
|
| 1722 |
-
results.html(html);
|
| 1723 |
-
postRender();
|
| 1724 |
-
}
|
| 1725 |
-
|
| 1726 |
-
queryNumber = ++this.queryCount;
|
| 1727 |
-
|
| 1728 |
-
var maxSelSize = this.getMaximumSelectionSize();
|
| 1729 |
-
if (maxSelSize >=1) {
|
| 1730 |
-
data = this.data();
|
| 1731 |
-
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
| 1732 |
-
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
| 1733 |
-
return;
|
| 1734 |
-
}
|
| 1735 |
-
}
|
| 1736 |
-
|
| 1737 |
-
if (search.val().length < opts.minimumInputLength) {
|
| 1738 |
-
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
| 1739 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
| 1740 |
-
} else {
|
| 1741 |
-
render("");
|
| 1742 |
-
}
|
| 1743 |
-
if (initial && this.showSearch) this.showSearch(true);
|
| 1744 |
-
return;
|
| 1745 |
-
}
|
| 1746 |
-
|
| 1747 |
-
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
| 1748 |
-
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
| 1749 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
| 1750 |
-
} else {
|
| 1751 |
-
render("");
|
| 1752 |
-
}
|
| 1753 |
-
return;
|
| 1754 |
-
}
|
| 1755 |
-
|
| 1756 |
-
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
| 1757 |
-
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
| 1758 |
-
}
|
| 1759 |
-
|
| 1760 |
-
search.addClass("select2-active");
|
| 1761 |
-
|
| 1762 |
-
this.removeHighlight();
|
| 1763 |
-
|
| 1764 |
-
// give the tokenizer a chance to pre-process the input
|
| 1765 |
-
input = this.tokenize();
|
| 1766 |
-
if (input != undefined && input != null) {
|
| 1767 |
-
search.val(input);
|
| 1768 |
-
}
|
| 1769 |
-
|
| 1770 |
-
this.resultsPage = 1;
|
| 1771 |
-
|
| 1772 |
-
opts.query({
|
| 1773 |
-
element: opts.element,
|
| 1774 |
-
term: search.val(),
|
| 1775 |
-
page: this.resultsPage,
|
| 1776 |
-
context: null,
|
| 1777 |
-
matcher: opts.matcher,
|
| 1778 |
-
callback: this.bind(function (data) {
|
| 1779 |
-
var def; // default choice
|
| 1780 |
-
|
| 1781 |
-
// ignore old responses
|
| 1782 |
-
if (queryNumber != this.queryCount) {
|
| 1783 |
-
return;
|
| 1784 |
-
}
|
| 1785 |
-
|
| 1786 |
-
// ignore a response if the select2 has been closed before it was received
|
| 1787 |
-
if (!this.opened()) {
|
| 1788 |
-
this.search.removeClass("select2-active");
|
| 1789 |
-
return;
|
| 1790 |
-
}
|
| 1791 |
-
|
| 1792 |
-
// handle ajax error
|
| 1793 |
-
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
| 1794 |
-
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
| 1795 |
-
return;
|
| 1796 |
-
}
|
| 1797 |
-
|
| 1798 |
-
// save context, if any
|
| 1799 |
-
this.context = (data.context===undefined) ? null : data.context;
|
| 1800 |
-
// create a default choice and prepend it to the list
|
| 1801 |
-
if (this.opts.createSearchChoice && search.val() !== "") {
|
| 1802 |
-
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
| 1803 |
-
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
| 1804 |
-
if ($(data.results).filter(
|
| 1805 |
-
function () {
|
| 1806 |
-
return equal(self.id(this), self.id(def));
|
| 1807 |
-
}).length === 0) {
|
| 1808 |
-
this.opts.createSearchChoicePosition(data.results, def);
|
| 1809 |
-
}
|
| 1810 |
-
}
|
| 1811 |
-
}
|
| 1812 |
-
|
| 1813 |
-
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
| 1814 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
| 1815 |
-
return;
|
| 1816 |
-
}
|
| 1817 |
-
|
| 1818 |
-
results.empty();
|
| 1819 |
-
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
| 1820 |
-
|
| 1821 |
-
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
| 1822 |
-
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
| 1823 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1824 |
-
}
|
| 1825 |
-
|
| 1826 |
-
this.postprocessResults(data, initial);
|
| 1827 |
-
|
| 1828 |
-
postRender();
|
| 1829 |
-
|
| 1830 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1831 |
-
})});
|
| 1832 |
-
},
|
| 1833 |
-
|
| 1834 |
-
// abstract
|
| 1835 |
-
cancel: function () {
|
| 1836 |
-
this.close();
|
| 1837 |
-
},
|
| 1838 |
-
|
| 1839 |
-
// abstract
|
| 1840 |
-
blur: function () {
|
| 1841 |
-
// if selectOnBlur == true, select the currently highlighted option
|
| 1842 |
-
if (this.opts.selectOnBlur)
|
| 1843 |
-
this.selectHighlighted({noFocus: true});
|
| 1844 |
-
|
| 1845 |
-
this.close();
|
| 1846 |
-
this.container.removeClass("select2-container-active");
|
| 1847 |
-
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
| 1848 |
-
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
| 1849 |
-
this.clearSearch();
|
| 1850 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 1851 |
-
},
|
| 1852 |
-
|
| 1853 |
-
// abstract
|
| 1854 |
-
focusSearch: function () {
|
| 1855 |
-
focus(this.search);
|
| 1856 |
-
},
|
| 1857 |
-
|
| 1858 |
-
// abstract
|
| 1859 |
-
selectHighlighted: function (options) {
|
| 1860 |
-
if (this._touchMoved) {
|
| 1861 |
-
this.clearTouchMoved();
|
| 1862 |
-
return;
|
| 1863 |
-
}
|
| 1864 |
-
var index=this.highlight(),
|
| 1865 |
-
highlighted=this.results.find(".select2-highlighted"),
|
| 1866 |
-
data = highlighted.closest('.select2-result').data("select2-data");
|
| 1867 |
-
|
| 1868 |
-
if (data) {
|
| 1869 |
-
this.highlight(index);
|
| 1870 |
-
this.onSelect(data, options);
|
| 1871 |
-
} else if (options && options.noFocus) {
|
| 1872 |
-
this.close();
|
| 1873 |
-
}
|
| 1874 |
-
},
|
| 1875 |
-
|
| 1876 |
-
// abstract
|
| 1877 |
-
getPlaceholder: function () {
|
| 1878 |
-
var placeholderOption;
|
| 1879 |
-
return this.opts.element.attr("placeholder") ||
|
| 1880 |
-
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
| 1881 |
-
this.opts.element.data("placeholder") ||
|
| 1882 |
-
this.opts.placeholder ||
|
| 1883 |
-
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
| 1884 |
-
},
|
| 1885 |
-
|
| 1886 |
-
// abstract
|
| 1887 |
-
getPlaceholderOption: function() {
|
| 1888 |
-
if (this.select) {
|
| 1889 |
-
var firstOption = this.select.children('option').first();
|
| 1890 |
-
if (this.opts.placeholderOption !== undefined ) {
|
| 1891 |
-
//Determine the placeholder option based on the specified placeholderOption setting
|
| 1892 |
-
return (this.opts.placeholderOption === "first" && firstOption) ||
|
| 1893 |
-
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
| 1894 |
-
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
| 1895 |
-
//No explicit placeholder option specified, use the first if it's blank
|
| 1896 |
-
return firstOption;
|
| 1897 |
-
}
|
| 1898 |
-
}
|
| 1899 |
-
},
|
| 1900 |
-
|
| 1901 |
-
/**
|
| 1902 |
-
* Get the desired width for the container element. This is
|
| 1903 |
-
* derived first from option `width` passed to select2, then
|
| 1904 |
-
* the inline 'style' on the original element, and finally
|
| 1905 |
-
* falls back to the jQuery calculated element width.
|
| 1906 |
-
*/
|
| 1907 |
-
// abstract
|
| 1908 |
-
initContainerWidth: function () {
|
| 1909 |
-
function resolveContainerWidth() {
|
| 1910 |
-
var style, attrs, matches, i, l, attr;
|
| 1911 |
-
|
| 1912 |
-
if (this.opts.width === "off") {
|
| 1913 |
-
return null;
|
| 1914 |
-
} else if (this.opts.width === "element"){
|
| 1915 |
-
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
| 1916 |
-
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
| 1917 |
-
// check if there is inline style on the element that contains width
|
| 1918 |
-
style = this.opts.element.attr('style');
|
| 1919 |
-
if (style !== undefined) {
|
| 1920 |
-
attrs = style.split(';');
|
| 1921 |
-
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
| 1922 |
-
attr = attrs[i].replace(/\s/g, '');
|
| 1923 |
-
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
| 1924 |
-
if (matches !== null && matches.length >= 1)
|
| 1925 |
-
return matches[1];
|
| 1926 |
-
}
|
| 1927 |
-
}
|
| 1928 |
-
|
| 1929 |
-
if (this.opts.width === "resolve") {
|
| 1930 |
-
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
| 1931 |
-
// when attached to input type=hidden or elements hidden via css
|
| 1932 |
-
style = this.opts.element.css('width');
|
| 1933 |
-
if (style.indexOf("%") > 0) return style;
|
| 1934 |
-
|
| 1935 |
-
// finally, fallback on the calculated width of the element
|
| 1936 |
-
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
| 1937 |
-
}
|
| 1938 |
-
|
| 1939 |
-
return null;
|
| 1940 |
-
} else if ($.isFunction(this.opts.width)) {
|
| 1941 |
-
return this.opts.width();
|
| 1942 |
-
} else {
|
| 1943 |
-
return this.opts.width;
|
| 1944 |
-
}
|
| 1945 |
-
};
|
| 1946 |
-
|
| 1947 |
-
var width = resolveContainerWidth.call(this);
|
| 1948 |
-
if (width !== null) {
|
| 1949 |
-
this.container.css("width", width);
|
| 1950 |
-
}
|
| 1951 |
-
}
|
| 1952 |
-
});
|
| 1953 |
-
|
| 1954 |
-
SingleSelect2 = clazz(AbstractSelect2, {
|
| 1955 |
-
|
| 1956 |
-
// single
|
| 1957 |
-
|
| 1958 |
-
createContainer: function () {
|
| 1959 |
-
var container = $(document.createElement("div")).attr({
|
| 1960 |
-
"class": "select2-container"
|
| 1961 |
-
}).html([
|
| 1962 |
-
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
| 1963 |
-
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
| 1964 |
-
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
| 1965 |
-
"</a>",
|
| 1966 |
-
"<label for='' class='select2-offscreen'></label>",
|
| 1967 |
-
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
| 1968 |
-
"<div class='select2-drop select2-display-none'>",
|
| 1969 |
-
" <div class='select2-search'>",
|
| 1970 |
-
" <label for='' class='select2-offscreen'></label>",
|
| 1971 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
| 1972 |
-
" aria-autocomplete='list' />",
|
| 1973 |
-
" </div>",
|
| 1974 |
-
" <ul class='select2-results' role='listbox'>",
|
| 1975 |
-
" </ul>",
|
| 1976 |
-
"</div>"].join(""));
|
| 1977 |
-
return container;
|
| 1978 |
-
},
|
| 1979 |
-
|
| 1980 |
-
// single
|
| 1981 |
-
enableInterface: function() {
|
| 1982 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 1983 |
-
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
| 1984 |
-
}
|
| 1985 |
-
},
|
| 1986 |
-
|
| 1987 |
-
// single
|
| 1988 |
-
opening: function () {
|
| 1989 |
-
var el, range, len;
|
| 1990 |
-
|
| 1991 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
| 1992 |
-
this.showSearch(true);
|
| 1993 |
-
}
|
| 1994 |
-
|
| 1995 |
-
this.parent.opening.apply(this, arguments);
|
| 1996 |
-
|
| 1997 |
-
if (this.showSearchInput !== false) {
|
| 1998 |
-
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
| 1999 |
-
// all other browsers handle this just fine
|
| 2000 |
-
|
| 2001 |
-
this.search.val(this.focusser.val());
|
| 2002 |
-
}
|
| 2003 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2004 |
-
this.search.focus();
|
| 2005 |
-
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
| 2006 |
-
// new text will appear *before* focusser.val()
|
| 2007 |
-
el = this.search.get(0);
|
| 2008 |
-
if (el.createTextRange) {
|
| 2009 |
-
range = el.createTextRange();
|
| 2010 |
-
range.collapse(false);
|
| 2011 |
-
range.select();
|
| 2012 |
-
} else if (el.setSelectionRange) {
|
| 2013 |
-
len = this.search.val().length;
|
| 2014 |
-
el.setSelectionRange(len, len);
|
| 2015 |
-
}
|
| 2016 |
-
}
|
| 2017 |
-
|
| 2018 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2019 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2020 |
-
if(this.search.val() === "") {
|
| 2021 |
-
if(this.nextSearchTerm != undefined){
|
| 2022 |
-
this.search.val(this.nextSearchTerm);
|
| 2023 |
-
this.search.select();
|
| 2024 |
-
}
|
| 2025 |
-
}
|
| 2026 |
-
|
| 2027 |
-
this.focusser.prop("disabled", true).val("");
|
| 2028 |
-
this.updateResults(true);
|
| 2029 |
-
this.opts.element.trigger($.Event("select2-open"));
|
| 2030 |
-
},
|
| 2031 |
-
|
| 2032 |
-
// single
|
| 2033 |
-
close: function () {
|
| 2034 |
-
if (!this.opened()) return;
|
| 2035 |
-
this.parent.close.apply(this, arguments);
|
| 2036 |
-
|
| 2037 |
-
this.focusser.prop("disabled", false);
|
| 2038 |
-
|
| 2039 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2040 |
-
this.focusser.focus();
|
| 2041 |
-
}
|
| 2042 |
-
},
|
| 2043 |
-
|
| 2044 |
-
// single
|
| 2045 |
-
focus: function () {
|
| 2046 |
-
if (this.opened()) {
|
| 2047 |
-
this.close();
|
| 2048 |
-
} else {
|
| 2049 |
-
this.focusser.prop("disabled", false);
|
| 2050 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2051 |
-
this.focusser.focus();
|
| 2052 |
-
}
|
| 2053 |
-
}
|
| 2054 |
-
},
|
| 2055 |
-
|
| 2056 |
-
// single
|
| 2057 |
-
isFocused: function () {
|
| 2058 |
-
return this.container.hasClass("select2-container-active");
|
| 2059 |
-
},
|
| 2060 |
-
|
| 2061 |
-
// single
|
| 2062 |
-
cancel: function () {
|
| 2063 |
-
this.parent.cancel.apply(this, arguments);
|
| 2064 |
-
this.focusser.prop("disabled", false);
|
| 2065 |
-
|
| 2066 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2067 |
-
this.focusser.focus();
|
| 2068 |
-
}
|
| 2069 |
-
},
|
| 2070 |
-
|
| 2071 |
-
// single
|
| 2072 |
-
destroy: function() {
|
| 2073 |
-
$("label[for='" + this.focusser.attr('id') + "']")
|
| 2074 |
-
.attr('for', this.opts.element.attr("id"));
|
| 2075 |
-
this.parent.destroy.apply(this, arguments);
|
| 2076 |
-
|
| 2077 |
-
cleanupJQueryElements.call(this,
|
| 2078 |
-
"selection",
|
| 2079 |
-
"focusser"
|
| 2080 |
-
);
|
| 2081 |
-
},
|
| 2082 |
-
|
| 2083 |
-
// single
|
| 2084 |
-
initContainer: function () {
|
| 2085 |
-
|
| 2086 |
-
var selection,
|
| 2087 |
-
container = this.container,
|
| 2088 |
-
dropdown = this.dropdown,
|
| 2089 |
-
idSuffix = nextUid(),
|
| 2090 |
-
elementLabel;
|
| 2091 |
-
|
| 2092 |
-
if (this.opts.minimumResultsForSearch < 0) {
|
| 2093 |
-
this.showSearch(false);
|
| 2094 |
-
} else {
|
| 2095 |
-
this.showSearch(true);
|
| 2096 |
-
}
|
| 2097 |
-
|
| 2098 |
-
this.selection = selection = container.find(".select2-choice");
|
| 2099 |
-
|
| 2100 |
-
this.focusser = container.find(".select2-focusser");
|
| 2101 |
-
|
| 2102 |
-
// add aria associations
|
| 2103 |
-
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
| 2104 |
-
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
| 2105 |
-
this.results.attr("id", "select2-results-"+idSuffix);
|
| 2106 |
-
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
| 2107 |
-
|
| 2108 |
-
// rewrite labels from original element to focusser
|
| 2109 |
-
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
| 2110 |
-
|
| 2111 |
-
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
| 2112 |
-
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
| 2113 |
-
|
| 2114 |
-
this.focusser.prev()
|
| 2115 |
-
.text(elementLabel.text())
|
| 2116 |
-
.attr('for', this.focusser.attr('id'));
|
| 2117 |
-
|
| 2118 |
-
// Ensure the original element retains an accessible name
|
| 2119 |
-
var originalTitle = this.opts.element.attr("title");
|
| 2120 |
-
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
| 2121 |
-
|
| 2122 |
-
this.focusser.attr("tabindex", this.elementTabIndex);
|
| 2123 |
-
|
| 2124 |
-
// write label for search field using the label from the focusser element
|
| 2125 |
-
this.search.attr("id", this.focusser.attr('id') + '_search');
|
| 2126 |
-
|
| 2127 |
-
this.search.prev()
|
| 2128 |
-
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
| 2129 |
-
.attr('for', this.search.attr('id'));
|
| 2130 |
-
|
| 2131 |
-
this.search.on("keydown", this.bind(function (e) {
|
| 2132 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2133 |
-
|
| 2134 |
-
// filter 229 keyCodes (input method editor is processing key input)
|
| 2135 |
-
if (229 == e.keyCode) return;
|
| 2136 |
-
|
| 2137 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2138 |
-
// prevent the page from scrolling
|
| 2139 |
-
killEvent(e);
|
| 2140 |
-
return;
|
| 2141 |
-
}
|
| 2142 |
-
|
| 2143 |
-
switch (e.which) {
|
| 2144 |
-
case KEY.UP:
|
| 2145 |
-
case KEY.DOWN:
|
| 2146 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2147 |
-
killEvent(e);
|
| 2148 |
-
return;
|
| 2149 |
-
case KEY.ENTER:
|
| 2150 |
-
this.selectHighlighted();
|
| 2151 |
-
killEvent(e);
|
| 2152 |
-
return;
|
| 2153 |
-
case KEY.TAB:
|
| 2154 |
-
this.selectHighlighted({noFocus: true});
|
| 2155 |
-
return;
|
| 2156 |
-
case KEY.ESC:
|
| 2157 |
-
this.cancel(e);
|
| 2158 |
-
killEvent(e);
|
| 2159 |
-
return;
|
| 2160 |
-
}
|
| 2161 |
-
}));
|
| 2162 |
-
|
| 2163 |
-
this.search.on("blur", this.bind(function(e) {
|
| 2164 |
-
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
| 2165 |
-
// without this the search field loses focus which is annoying
|
| 2166 |
-
if (document.activeElement === this.body.get(0)) {
|
| 2167 |
-
window.setTimeout(this.bind(function() {
|
| 2168 |
-
if (this.opened()) {
|
| 2169 |
-
this.search.focus();
|
| 2170 |
-
}
|
| 2171 |
-
}), 0);
|
| 2172 |
-
}
|
| 2173 |
-
}));
|
| 2174 |
-
|
| 2175 |
-
this.focusser.on("keydown", this.bind(function (e) {
|
| 2176 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2177 |
-
|
| 2178 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
| 2179 |
-
return;
|
| 2180 |
-
}
|
| 2181 |
-
|
| 2182 |
-
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
| 2183 |
-
killEvent(e);
|
| 2184 |
-
return;
|
| 2185 |
-
}
|
| 2186 |
-
|
| 2187 |
-
if (e.which == KEY.DOWN || e.which == KEY.UP
|
| 2188 |
-
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
| 2189 |
-
|
| 2190 |
-
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
| 2191 |
-
|
| 2192 |
-
this.open();
|
| 2193 |
-
killEvent(e);
|
| 2194 |
-
return;
|
| 2195 |
-
}
|
| 2196 |
-
|
| 2197 |
-
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
| 2198 |
-
if (this.opts.allowClear) {
|
| 2199 |
-
this.clear();
|
| 2200 |
-
}
|
| 2201 |
-
killEvent(e);
|
| 2202 |
-
return;
|
| 2203 |
-
}
|
| 2204 |
-
}));
|
| 2205 |
-
|
| 2206 |
-
|
| 2207 |
-
installKeyUpChangeEvent(this.focusser);
|
| 2208 |
-
this.focusser.on("keyup-change input", this.bind(function(e) {
|
| 2209 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
| 2210 |
-
e.stopPropagation();
|
| 2211 |
-
if (this.opened()) return;
|
| 2212 |
-
this.open();
|
| 2213 |
-
}
|
| 2214 |
-
}));
|
| 2215 |
-
|
| 2216 |
-
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
| 2217 |
-
if (!this.isInterfaceEnabled()) {
|
| 2218 |
-
return;
|
| 2219 |
-
}
|
| 2220 |
-
|
| 2221 |
-
this.clear();
|
| 2222 |
-
killEventImmediately(e);
|
| 2223 |
-
this.close();
|
| 2224 |
-
|
| 2225 |
-
if (this.selection) {
|
| 2226 |
-
this.selection.focus();
|
| 2227 |
-
}
|
| 2228 |
-
}));
|
| 2229 |
-
|
| 2230 |
-
selection.on("mousedown touchstart", this.bind(function (e) {
|
| 2231 |
-
// Prevent IE from generating a click event on the body
|
| 2232 |
-
reinsertElement(selection);
|
| 2233 |
-
|
| 2234 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2235 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2236 |
-
}
|
| 2237 |
-
|
| 2238 |
-
if (this.opened()) {
|
| 2239 |
-
this.close();
|
| 2240 |
-
} else if (this.isInterfaceEnabled()) {
|
| 2241 |
-
this.open();
|
| 2242 |
-
}
|
| 2243 |
-
|
| 2244 |
-
killEvent(e);
|
| 2245 |
-
}));
|
| 2246 |
-
|
| 2247 |
-
dropdown.on("mousedown touchstart", this.bind(function() {
|
| 2248 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2249 |
-
this.search.focus();
|
| 2250 |
-
}
|
| 2251 |
-
}));
|
| 2252 |
-
|
| 2253 |
-
selection.on("focus", this.bind(function(e) {
|
| 2254 |
-
killEvent(e);
|
| 2255 |
-
}));
|
| 2256 |
-
|
| 2257 |
-
this.focusser.on("focus", this.bind(function(){
|
| 2258 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2259 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2260 |
-
}
|
| 2261 |
-
this.container.addClass("select2-container-active");
|
| 2262 |
-
})).on("blur", this.bind(function() {
|
| 2263 |
-
if (!this.opened()) {
|
| 2264 |
-
this.container.removeClass("select2-container-active");
|
| 2265 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
| 2266 |
-
}
|
| 2267 |
-
}));
|
| 2268 |
-
this.search.on("focus", this.bind(function(){
|
| 2269 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2270 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2271 |
-
}
|
| 2272 |
-
this.container.addClass("select2-container-active");
|
| 2273 |
-
}));
|
| 2274 |
-
|
| 2275 |
-
this.initContainerWidth();
|
| 2276 |
-
this.opts.element.hide();
|
| 2277 |
-
this.setPlaceholder();
|
| 2278 |
-
|
| 2279 |
-
},
|
| 2280 |
-
|
| 2281 |
-
// single
|
| 2282 |
-
clear: function(triggerChange) {
|
| 2283 |
-
var data=this.selection.data("select2-data");
|
| 2284 |
-
if (data) { // guard against queued quick consecutive clicks
|
| 2285 |
-
var evt = $.Event("select2-clearing");
|
| 2286 |
-
this.opts.element.trigger(evt);
|
| 2287 |
-
if (evt.isDefaultPrevented()) {
|
| 2288 |
-
return;
|
| 2289 |
-
}
|
| 2290 |
-
var placeholderOption = this.getPlaceholderOption();
|
| 2291 |
-
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
| 2292 |
-
this.selection.find(".select2-chosen").empty();
|
| 2293 |
-
this.selection.removeData("select2-data");
|
| 2294 |
-
this.setPlaceholder();
|
| 2295 |
-
|
| 2296 |
-
if (triggerChange !== false){
|
| 2297 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 2298 |
-
this.triggerChange({removed:data});
|
| 2299 |
-
}
|
| 2300 |
-
}
|
| 2301 |
-
},
|
| 2302 |
-
|
| 2303 |
-
/**
|
| 2304 |
-
* Sets selection based on source element's value
|
| 2305 |
-
*/
|
| 2306 |
-
// single
|
| 2307 |
-
initSelection: function () {
|
| 2308 |
-
var selected;
|
| 2309 |
-
if (this.isPlaceholderOptionSelected()) {
|
| 2310 |
-
this.updateSelection(null);
|
| 2311 |
-
this.close();
|
| 2312 |
-
this.setPlaceholder();
|
| 2313 |
-
} else {
|
| 2314 |
-
var self = this;
|
| 2315 |
-
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
| 2316 |
-
if (selected !== undefined && selected !== null) {
|
| 2317 |
-
self.updateSelection(selected);
|
| 2318 |
-
self.close();
|
| 2319 |
-
self.setPlaceholder();
|
| 2320 |
-
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
| 2321 |
-
}
|
| 2322 |
-
});
|
| 2323 |
-
}
|
| 2324 |
-
},
|
| 2325 |
-
|
| 2326 |
-
isPlaceholderOptionSelected: function() {
|
| 2327 |
-
var placeholderOption;
|
| 2328 |
-
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
| 2329 |
-
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
| 2330 |
-
|| (this.opts.element.val() === "")
|
| 2331 |
-
|| (this.opts.element.val() === undefined)
|
| 2332 |
-
|| (this.opts.element.val() === null);
|
| 2333 |
-
},
|
| 2334 |
-
|
| 2335 |
-
// single
|
| 2336 |
-
prepareOpts: function () {
|
| 2337 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2338 |
-
self=this;
|
| 2339 |
-
|
| 2340 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2341 |
-
// install the selection initializer
|
| 2342 |
-
opts.initSelection = function (element, callback) {
|
| 2343 |
-
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
| 2344 |
-
// a single select box always has a value, no need to null check 'selected'
|
| 2345 |
-
callback(self.optionToData(selected));
|
| 2346 |
-
};
|
| 2347 |
-
} else if ("data" in opts) {
|
| 2348 |
-
// install default initSelection when applied to hidden input and data is local
|
| 2349 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2350 |
-
var id = element.val();
|
| 2351 |
-
//search in data by id, storing the actual matching item
|
| 2352 |
-
var match = null;
|
| 2353 |
-
opts.query({
|
| 2354 |
-
matcher: function(term, text, el){
|
| 2355 |
-
var is_match = equal(id, opts.id(el));
|
| 2356 |
-
if (is_match) {
|
| 2357 |
-
match = el;
|
| 2358 |
-
}
|
| 2359 |
-
return is_match;
|
| 2360 |
-
},
|
| 2361 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2362 |
-
callback(match);
|
| 2363 |
-
}
|
| 2364 |
-
});
|
| 2365 |
-
};
|
| 2366 |
-
}
|
| 2367 |
-
|
| 2368 |
-
return opts;
|
| 2369 |
-
},
|
| 2370 |
-
|
| 2371 |
-
// single
|
| 2372 |
-
getPlaceholder: function() {
|
| 2373 |
-
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
| 2374 |
-
if (this.select) {
|
| 2375 |
-
if (this.getPlaceholderOption() === undefined) {
|
| 2376 |
-
return undefined;
|
| 2377 |
-
}
|
| 2378 |
-
}
|
| 2379 |
-
|
| 2380 |
-
return this.parent.getPlaceholder.apply(this, arguments);
|
| 2381 |
-
},
|
| 2382 |
-
|
| 2383 |
-
// single
|
| 2384 |
-
setPlaceholder: function () {
|
| 2385 |
-
var placeholder = this.getPlaceholder();
|
| 2386 |
-
|
| 2387 |
-
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
| 2388 |
-
|
| 2389 |
-
// check for a placeholder option if attached to a select
|
| 2390 |
-
if (this.select && this.getPlaceholderOption() === undefined) return;
|
| 2391 |
-
|
| 2392 |
-
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
| 2393 |
-
|
| 2394 |
-
this.selection.addClass("select2-default");
|
| 2395 |
-
|
| 2396 |
-
this.container.removeClass("select2-allowclear");
|
| 2397 |
-
}
|
| 2398 |
-
},
|
| 2399 |
-
|
| 2400 |
-
// single
|
| 2401 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 2402 |
-
var selected = 0, self = this, showSearchInput = true;
|
| 2403 |
-
|
| 2404 |
-
// find the selected element in the result list
|
| 2405 |
-
|
| 2406 |
-
this.findHighlightableChoices().each2(function (i, elm) {
|
| 2407 |
-
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
| 2408 |
-
selected = i;
|
| 2409 |
-
return false;
|
| 2410 |
-
}
|
| 2411 |
-
});
|
| 2412 |
-
|
| 2413 |
-
// and highlight it
|
| 2414 |
-
if (noHighlightUpdate !== false) {
|
| 2415 |
-
if (initial === true && selected >= 0) {
|
| 2416 |
-
this.highlight(selected);
|
| 2417 |
-
} else {
|
| 2418 |
-
this.highlight(0);
|
| 2419 |
-
}
|
| 2420 |
-
}
|
| 2421 |
-
|
| 2422 |
-
// hide the search box if this is the first we got the results and there are enough of them for search
|
| 2423 |
-
|
| 2424 |
-
if (initial === true) {
|
| 2425 |
-
var min = this.opts.minimumResultsForSearch;
|
| 2426 |
-
if (min >= 0) {
|
| 2427 |
-
this.showSearch(countResults(data.results) >= min);
|
| 2428 |
-
}
|
| 2429 |
-
}
|
| 2430 |
-
},
|
| 2431 |
-
|
| 2432 |
-
// single
|
| 2433 |
-
showSearch: function(showSearchInput) {
|
| 2434 |
-
if (this.showSearchInput === showSearchInput) return;
|
| 2435 |
-
|
| 2436 |
-
this.showSearchInput = showSearchInput;
|
| 2437 |
-
|
| 2438 |
-
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
| 2439 |
-
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
| 2440 |
-
//add "select2-with-searchbox" to the container if search box is shown
|
| 2441 |
-
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
| 2442 |
-
},
|
| 2443 |
-
|
| 2444 |
-
// single
|
| 2445 |
-
onSelect: function (data, options) {
|
| 2446 |
-
|
| 2447 |
-
if (!this.triggerSelect(data)) { return; }
|
| 2448 |
-
|
| 2449 |
-
var old = this.opts.element.val(),
|
| 2450 |
-
oldData = this.data();
|
| 2451 |
-
|
| 2452 |
-
this.opts.element.val(this.id(data));
|
| 2453 |
-
this.updateSelection(data);
|
| 2454 |
-
|
| 2455 |
-
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
| 2456 |
-
|
| 2457 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 2458 |
-
this.close();
|
| 2459 |
-
|
| 2460 |
-
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
| 2461 |
-
this.focusser.focus();
|
| 2462 |
-
}
|
| 2463 |
-
|
| 2464 |
-
if (!equal(old, this.id(data))) {
|
| 2465 |
-
this.triggerChange({ added: data, removed: oldData });
|
| 2466 |
-
}
|
| 2467 |
-
},
|
| 2468 |
-
|
| 2469 |
-
// single
|
| 2470 |
-
updateSelection: function (data) {
|
| 2471 |
-
|
| 2472 |
-
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
| 2473 |
-
|
| 2474 |
-
this.selection.data("select2-data", data);
|
| 2475 |
-
|
| 2476 |
-
container.empty();
|
| 2477 |
-
if (data !== null) {
|
| 2478 |
-
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
| 2479 |
-
}
|
| 2480 |
-
if (formatted !== undefined) {
|
| 2481 |
-
container.append(formatted);
|
| 2482 |
-
}
|
| 2483 |
-
cssClass=this.opts.formatSelectionCssClass(data, container);
|
| 2484 |
-
if (cssClass !== undefined) {
|
| 2485 |
-
container.addClass(cssClass);
|
| 2486 |
-
}
|
| 2487 |
-
|
| 2488 |
-
this.selection.removeClass("select2-default");
|
| 2489 |
-
|
| 2490 |
-
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
| 2491 |
-
this.container.addClass("select2-allowclear");
|
| 2492 |
-
}
|
| 2493 |
-
},
|
| 2494 |
-
|
| 2495 |
-
// single
|
| 2496 |
-
val: function () {
|
| 2497 |
-
var val,
|
| 2498 |
-
triggerChange = false,
|
| 2499 |
-
data = null,
|
| 2500 |
-
self = this,
|
| 2501 |
-
oldData = this.data();
|
| 2502 |
-
|
| 2503 |
-
if (arguments.length === 0) {
|
| 2504 |
-
return this.opts.element.val();
|
| 2505 |
-
}
|
| 2506 |
-
|
| 2507 |
-
val = arguments[0];
|
| 2508 |
-
|
| 2509 |
-
if (arguments.length > 1) {
|
| 2510 |
-
triggerChange = arguments[1];
|
| 2511 |
-
}
|
| 2512 |
-
|
| 2513 |
-
if (this.select) {
|
| 2514 |
-
this.select
|
| 2515 |
-
.val(val)
|
| 2516 |
-
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
| 2517 |
-
data = self.optionToData(elm);
|
| 2518 |
-
return false;
|
| 2519 |
-
});
|
| 2520 |
-
this.updateSelection(data);
|
| 2521 |
-
this.setPlaceholder();
|
| 2522 |
-
if (triggerChange) {
|
| 2523 |
-
this.triggerChange({added: data, removed:oldData});
|
| 2524 |
-
}
|
| 2525 |
-
} else {
|
| 2526 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 2527 |
-
if (!val && val !== 0) {
|
| 2528 |
-
this.clear(triggerChange);
|
| 2529 |
-
return;
|
| 2530 |
-
}
|
| 2531 |
-
if (this.opts.initSelection === undefined) {
|
| 2532 |
-
throw new Error("cannot call val() if initSelection() is not defined");
|
| 2533 |
-
}
|
| 2534 |
-
this.opts.element.val(val);
|
| 2535 |
-
this.opts.initSelection(this.opts.element, function(data){
|
| 2536 |
-
self.opts.element.val(!data ? "" : self.id(data));
|
| 2537 |
-
self.updateSelection(data);
|
| 2538 |
-
self.setPlaceholder();
|
| 2539 |
-
if (triggerChange) {
|
| 2540 |
-
self.triggerChange({added: data, removed:oldData});
|
| 2541 |
-
}
|
| 2542 |
-
});
|
| 2543 |
-
}
|
| 2544 |
-
},
|
| 2545 |
-
|
| 2546 |
-
// single
|
| 2547 |
-
clearSearch: function () {
|
| 2548 |
-
this.search.val("");
|
| 2549 |
-
this.focusser.val("");
|
| 2550 |
-
},
|
| 2551 |
-
|
| 2552 |
-
// single
|
| 2553 |
-
data: function(value) {
|
| 2554 |
-
var data,
|
| 2555 |
-
triggerChange = false;
|
| 2556 |
-
|
| 2557 |
-
if (arguments.length === 0) {
|
| 2558 |
-
data = this.selection.data("select2-data");
|
| 2559 |
-
if (data == undefined) data = null;
|
| 2560 |
-
return data;
|
| 2561 |
-
} else {
|
| 2562 |
-
if (arguments.length > 1) {
|
| 2563 |
-
triggerChange = arguments[1];
|
| 2564 |
-
}
|
| 2565 |
-
if (!value) {
|
| 2566 |
-
this.clear(triggerChange);
|
| 2567 |
-
} else {
|
| 2568 |
-
data = this.data();
|
| 2569 |
-
this.opts.element.val(!value ? "" : this.id(value));
|
| 2570 |
-
this.updateSelection(value);
|
| 2571 |
-
if (triggerChange) {
|
| 2572 |
-
this.triggerChange({added: value, removed:data});
|
| 2573 |
-
}
|
| 2574 |
-
}
|
| 2575 |
-
}
|
| 2576 |
-
}
|
| 2577 |
-
});
|
| 2578 |
-
|
| 2579 |
-
MultiSelect2 = clazz(AbstractSelect2, {
|
| 2580 |
-
|
| 2581 |
-
// multi
|
| 2582 |
-
createContainer: function () {
|
| 2583 |
-
var container = $(document.createElement("div")).attr({
|
| 2584 |
-
"class": "select2-container select2-container-multi"
|
| 2585 |
-
}).html([
|
| 2586 |
-
"<ul class='select2-choices'>",
|
| 2587 |
-
" <li class='select2-search-field'>",
|
| 2588 |
-
" <label for='' class='select2-offscreen'></label>",
|
| 2589 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
| 2590 |
-
" </li>",
|
| 2591 |
-
"</ul>",
|
| 2592 |
-
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
| 2593 |
-
" <ul class='select2-results'>",
|
| 2594 |
-
" </ul>",
|
| 2595 |
-
"</div>"].join(""));
|
| 2596 |
-
return container;
|
| 2597 |
-
},
|
| 2598 |
-
|
| 2599 |
-
// multi
|
| 2600 |
-
prepareOpts: function () {
|
| 2601 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2602 |
-
self=this;
|
| 2603 |
-
|
| 2604 |
-
// TODO validate placeholder is a string if specified
|
| 2605 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2606 |
-
// install the selection initializer
|
| 2607 |
-
opts.initSelection = function (element, callback) {
|
| 2608 |
-
|
| 2609 |
-
var data = [];
|
| 2610 |
-
|
| 2611 |
-
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
| 2612 |
-
data.push(self.optionToData(elm));
|
| 2613 |
-
});
|
| 2614 |
-
callback(data);
|
| 2615 |
-
};
|
| 2616 |
-
} else if ("data" in opts) {
|
| 2617 |
-
// install default initSelection when applied to hidden input and data is local
|
| 2618 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2619 |
-
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
| 2620 |
-
//search in data by array of ids, storing matching items in a list
|
| 2621 |
-
var matches = [];
|
| 2622 |
-
opts.query({
|
| 2623 |
-
matcher: function(term, text, el){
|
| 2624 |
-
var is_match = $.grep(ids, function(id) {
|
| 2625 |
-
return equal(id, opts.id(el));
|
| 2626 |
-
}).length;
|
| 2627 |
-
if (is_match) {
|
| 2628 |
-
matches.push(el);
|
| 2629 |
-
}
|
| 2630 |
-
return is_match;
|
| 2631 |
-
},
|
| 2632 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2633 |
-
// reorder matches based on the order they appear in the ids array because right now
|
| 2634 |
-
// they are in the order in which they appear in data array
|
| 2635 |
-
var ordered = [];
|
| 2636 |
-
for (var i = 0; i < ids.length; i++) {
|
| 2637 |
-
var id = ids[i];
|
| 2638 |
-
for (var j = 0; j < matches.length; j++) {
|
| 2639 |
-
var match = matches[j];
|
| 2640 |
-
if (equal(id, opts.id(match))) {
|
| 2641 |
-
ordered.push(match);
|
| 2642 |
-
matches.splice(j, 1);
|
| 2643 |
-
break;
|
| 2644 |
-
}
|
| 2645 |
-
}
|
| 2646 |
-
}
|
| 2647 |
-
callback(ordered);
|
| 2648 |
-
}
|
| 2649 |
-
});
|
| 2650 |
-
};
|
| 2651 |
-
}
|
| 2652 |
-
|
| 2653 |
-
return opts;
|
| 2654 |
-
},
|
| 2655 |
-
|
| 2656 |
-
// multi
|
| 2657 |
-
selectChoice: function (choice) {
|
| 2658 |
-
|
| 2659 |
-
var selected = this.container.find(".select2-search-choice-focus");
|
| 2660 |
-
if (selected.length && choice && choice[0] == selected[0]) {
|
| 2661 |
-
|
| 2662 |
-
} else {
|
| 2663 |
-
if (selected.length) {
|
| 2664 |
-
this.opts.element.trigger("choice-deselected", selected);
|
| 2665 |
-
}
|
| 2666 |
-
selected.removeClass("select2-search-choice-focus");
|
| 2667 |
-
if (choice && choice.length) {
|
| 2668 |
-
this.close();
|
| 2669 |
-
choice.addClass("select2-search-choice-focus");
|
| 2670 |
-
this.opts.element.trigger("choice-selected", choice);
|
| 2671 |
-
}
|
| 2672 |
-
}
|
| 2673 |
-
},
|
| 2674 |
-
|
| 2675 |
-
// multi
|
| 2676 |
-
destroy: function() {
|
| 2677 |
-
$("label[for='" + this.search.attr('id') + "']")
|
| 2678 |
-
.attr('for', this.opts.element.attr("id"));
|
| 2679 |
-
this.parent.destroy.apply(this, arguments);
|
| 2680 |
-
|
| 2681 |
-
cleanupJQueryElements.call(this,
|
| 2682 |
-
"searchContainer",
|
| 2683 |
-
"selection"
|
| 2684 |
-
);
|
| 2685 |
-
},
|
| 2686 |
-
|
| 2687 |
-
// multi
|
| 2688 |
-
initContainer: function () {
|
| 2689 |
-
|
| 2690 |
-
var selector = ".select2-choices", selection;
|
| 2691 |
-
|
| 2692 |
-
this.searchContainer = this.container.find(".select2-search-field");
|
| 2693 |
-
this.selection = selection = this.container.find(selector);
|
| 2694 |
-
|
| 2695 |
-
var _this = this;
|
| 2696 |
-
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
| 2697 |
-
_this.search[0].focus();
|
| 2698 |
-
_this.selectChoice($(this));
|
| 2699 |
-
});
|
| 2700 |
-
|
| 2701 |
-
// rewrite labels from original element to focusser
|
| 2702 |
-
this.search.attr("id", "s2id_autogen"+nextUid());
|
| 2703 |
-
|
| 2704 |
-
this.search.prev()
|
| 2705 |
-
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
| 2706 |
-
.attr('for', this.search.attr('id'));
|
| 2707 |
-
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
| 2708 |
-
|
| 2709 |
-
this.search.on("input paste", this.bind(function() {
|
| 2710 |
-
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
| 2711 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2712 |
-
if (!this.opened()) {
|
| 2713 |
-
this.open();
|
| 2714 |
-
}
|
| 2715 |
-
}));
|
| 2716 |
-
|
| 2717 |
-
this.search.attr("tabindex", this.elementTabIndex);
|
| 2718 |
-
|
| 2719 |
-
this.keydowns = 0;
|
| 2720 |
-
this.search.on("keydown", this.bind(function (e) {
|
| 2721 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2722 |
-
|
| 2723 |
-
++this.keydowns;
|
| 2724 |
-
var selected = selection.find(".select2-search-choice-focus");
|
| 2725 |
-
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
| 2726 |
-
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
| 2727 |
-
var pos = getCursorInfo(this.search);
|
| 2728 |
-
|
| 2729 |
-
if (selected.length &&
|
| 2730 |
-
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
| 2731 |
-
var selectedChoice = selected;
|
| 2732 |
-
if (e.which == KEY.LEFT && prev.length) {
|
| 2733 |
-
selectedChoice = prev;
|
| 2734 |
-
}
|
| 2735 |
-
else if (e.which == KEY.RIGHT) {
|
| 2736 |
-
selectedChoice = next.length ? next : null;
|
| 2737 |
-
}
|
| 2738 |
-
else if (e.which === KEY.BACKSPACE) {
|
| 2739 |
-
if (this.unselect(selected.first())) {
|
| 2740 |
-
this.search.width(10);
|
| 2741 |
-
selectedChoice = prev.length ? prev : next;
|
| 2742 |
-
}
|
| 2743 |
-
} else if (e.which == KEY.DELETE) {
|
| 2744 |
-
if (this.unselect(selected.first())) {
|
| 2745 |
-
this.search.width(10);
|
| 2746 |
-
selectedChoice = next.length ? next : null;
|
| 2747 |
-
}
|
| 2748 |
-
} else if (e.which == KEY.ENTER) {
|
| 2749 |
-
selectedChoice = null;
|
| 2750 |
-
}
|
| 2751 |
-
|
| 2752 |
-
this.selectChoice(selectedChoice);
|
| 2753 |
-
killEvent(e);
|
| 2754 |
-
if (!selectedChoice || !selectedChoice.length) {
|
| 2755 |
-
this.open();
|
| 2756 |
-
}
|
| 2757 |
-
return;
|
| 2758 |
-
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
| 2759 |
-
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
| 2760 |
-
|
| 2761 |
-
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
| 2762 |
-
killEvent(e);
|
| 2763 |
-
return;
|
| 2764 |
-
} else {
|
| 2765 |
-
this.selectChoice(null);
|
| 2766 |
-
}
|
| 2767 |
-
|
| 2768 |
-
if (this.opened()) {
|
| 2769 |
-
switch (e.which) {
|
| 2770 |
-
case KEY.UP:
|
| 2771 |
-
case KEY.DOWN:
|
| 2772 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2773 |
-
killEvent(e);
|
| 2774 |
-
return;
|
| 2775 |
-
case KEY.ENTER:
|
| 2776 |
-
this.selectHighlighted();
|
| 2777 |
-
killEvent(e);
|
| 2778 |
-
return;
|
| 2779 |
-
case KEY.TAB:
|
| 2780 |
-
this.selectHighlighted({noFocus:true});
|
| 2781 |
-
this.close();
|
| 2782 |
-
return;
|
| 2783 |
-
case KEY.ESC:
|
| 2784 |
-
this.cancel(e);
|
| 2785 |
-
killEvent(e);
|
| 2786 |
-
return;
|
| 2787 |
-
}
|
| 2788 |
-
}
|
| 2789 |
-
|
| 2790 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
| 2791 |
-
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
| 2792 |
-
return;
|
| 2793 |
-
}
|
| 2794 |
-
|
| 2795 |
-
if (e.which === KEY.ENTER) {
|
| 2796 |
-
if (this.opts.openOnEnter === false) {
|
| 2797 |
-
return;
|
| 2798 |
-
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
| 2799 |
-
return;
|
| 2800 |
-
}
|
| 2801 |
-
}
|
| 2802 |
-
|
| 2803 |
-
this.open();
|
| 2804 |
-
|
| 2805 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2806 |
-
// prevent the page from scrolling
|
| 2807 |
-
killEvent(e);
|
| 2808 |
-
}
|
| 2809 |
-
|
| 2810 |
-
if (e.which === KEY.ENTER) {
|
| 2811 |
-
// prevent form from being submitted
|
| 2812 |
-
killEvent(e);
|
| 2813 |
-
}
|
| 2814 |
-
|
| 2815 |
-
}));
|
| 2816 |
-
|
| 2817 |
-
this.search.on("keyup", this.bind(function (e) {
|
| 2818 |
-
this.keydowns = 0;
|
| 2819 |
-
this.resizeSearch();
|
| 2820 |
-
})
|
| 2821 |
-
);
|
| 2822 |
-
|
| 2823 |
-
this.search.on("blur", this.bind(function(e) {
|
| 2824 |
-
this.container.removeClass("select2-container-active");
|
| 2825 |
-
this.search.removeClass("select2-focused");
|
| 2826 |
-
this.selectChoice(null);
|
| 2827 |
-
if (!this.opened()) this.clearSearch();
|
| 2828 |
-
e.stopImmediatePropagation();
|
| 2829 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
| 2830 |
-
}));
|
| 2831 |
-
|
| 2832 |
-
this.container.on("click", selector, this.bind(function (e) {
|
| 2833 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2834 |
-
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
| 2835 |
-
// clicked inside a select2 search choice, do not open
|
| 2836 |
-
return;
|
| 2837 |
-
}
|
| 2838 |
-
this.selectChoice(null);
|
| 2839 |
-
this.clearPlaceholder();
|
| 2840 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2841 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2842 |
-
}
|
| 2843 |
-
this.open();
|
| 2844 |
-
this.focusSearch();
|
| 2845 |
-
e.preventDefault();
|
| 2846 |
-
}));
|
| 2847 |
-
|
| 2848 |
-
this.container.on("focus", selector, this.bind(function () {
|
| 2849 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2850 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2851 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2852 |
-
}
|
| 2853 |
-
this.container.addClass("select2-container-active");
|
| 2854 |
-
this.dropdown.addClass("select2-drop-active");
|
| 2855 |
-
this.clearPlaceholder();
|
| 2856 |
-
}));
|
| 2857 |
-
|
| 2858 |
-
this.initContainerWidth();
|
| 2859 |
-
this.opts.element.hide();
|
| 2860 |
-
|
| 2861 |
-
// set the placeholder if necessary
|
| 2862 |
-
this.clearSearch();
|
| 2863 |
-
},
|
| 2864 |
-
|
| 2865 |
-
// multi
|
| 2866 |
-
enableInterface: function() {
|
| 2867 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 2868 |
-
this.search.prop("disabled", !this.isInterfaceEnabled());
|
| 2869 |
-
}
|
| 2870 |
-
},
|
| 2871 |
-
|
| 2872 |
-
// multi
|
| 2873 |
-
initSelection: function () {
|
| 2874 |
-
var data;
|
| 2875 |
-
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
| 2876 |
-
this.updateSelection([]);
|
| 2877 |
-
this.close();
|
| 2878 |
-
// set the placeholder if necessary
|
| 2879 |
-
this.clearSearch();
|
| 2880 |
-
}
|
| 2881 |
-
if (this.select || this.opts.element.val() !== "") {
|
| 2882 |
-
var self = this;
|
| 2883 |
-
this.opts.initSelection.call(null, this.opts.element, function(data){
|
| 2884 |
-
if (data !== undefined && data !== null) {
|
| 2885 |
-
self.updateSelection(data);
|
| 2886 |
-
self.close();
|
| 2887 |
-
// set the placeholder if necessary
|
| 2888 |
-
self.clearSearch();
|
| 2889 |
-
}
|
| 2890 |
-
});
|
| 2891 |
-
}
|
| 2892 |
-
},
|
| 2893 |
-
|
| 2894 |
-
// multi
|
| 2895 |
-
clearSearch: function () {
|
| 2896 |
-
var placeholder = this.getPlaceholder(),
|
| 2897 |
-
maxWidth = this.getMaxSearchWidth();
|
| 2898 |
-
|
| 2899 |
-
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
| 2900 |
-
this.search.val(placeholder).addClass("select2-default");
|
| 2901 |
-
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
| 2902 |
-
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
| 2903 |
-
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
| 2904 |
-
} else {
|
| 2905 |
-
this.search.val("").width(10);
|
| 2906 |
-
}
|
| 2907 |
-
},
|
| 2908 |
-
|
| 2909 |
-
// multi
|
| 2910 |
-
clearPlaceholder: function () {
|
| 2911 |
-
if (this.search.hasClass("select2-default")) {
|
| 2912 |
-
this.search.val("").removeClass("select2-default");
|
| 2913 |
-
}
|
| 2914 |
-
},
|
| 2915 |
-
|
| 2916 |
-
// multi
|
| 2917 |
-
opening: function () {
|
| 2918 |
-
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
| 2919 |
-
this.resizeSearch();
|
| 2920 |
-
|
| 2921 |
-
this.parent.opening.apply(this, arguments);
|
| 2922 |
-
|
| 2923 |
-
this.focusSearch();
|
| 2924 |
-
|
| 2925 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2926 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2927 |
-
if(this.search.val() === "") {
|
| 2928 |
-
if(this.nextSearchTerm != undefined){
|
| 2929 |
-
this.search.val(this.nextSearchTerm);
|
| 2930 |
-
this.search.select();
|
| 2931 |
-
}
|
| 2932 |
-
}
|
| 2933 |
-
|
| 2934 |
-
this.updateResults(true);
|
| 2935 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2936 |
-
this.search.focus();
|
| 2937 |
-
}
|
| 2938 |
-
this.opts.element.trigger($.Event("select2-open"));
|
| 2939 |
-
},
|
| 2940 |
-
|
| 2941 |
-
// multi
|
| 2942 |
-
close: function () {
|
| 2943 |
-
if (!this.opened()) return;
|
| 2944 |
-
this.parent.close.apply(this, arguments);
|
| 2945 |
-
},
|
| 2946 |
-
|
| 2947 |
-
// multi
|
| 2948 |
-
focus: function () {
|
| 2949 |
-
this.close();
|
| 2950 |
-
this.search.focus();
|
| 2951 |
-
},
|
| 2952 |
-
|
| 2953 |
-
// multi
|
| 2954 |
-
isFocused: function () {
|
| 2955 |
-
return this.search.hasClass("select2-focused");
|
| 2956 |
-
},
|
| 2957 |
-
|
| 2958 |
-
// multi
|
| 2959 |
-
updateSelection: function (data) {
|
| 2960 |
-
var ids = [], filtered = [], self = this;
|
| 2961 |
-
|
| 2962 |
-
// filter out duplicates
|
| 2963 |
-
$(data).each(function () {
|
| 2964 |
-
if (indexOf(self.id(this), ids) < 0) {
|
| 2965 |
-
ids.push(self.id(this));
|
| 2966 |
-
filtered.push(this);
|
| 2967 |
-
}
|
| 2968 |
-
});
|
| 2969 |
-
data = filtered;
|
| 2970 |
-
|
| 2971 |
-
this.selection.find(".select2-search-choice").remove();
|
| 2972 |
-
$(data).each(function () {
|
| 2973 |
-
self.addSelectedChoice(this);
|
| 2974 |
-
});
|
| 2975 |
-
self.postprocessResults();
|
| 2976 |
-
},
|
| 2977 |
-
|
| 2978 |
-
// multi
|
| 2979 |
-
tokenize: function() {
|
| 2980 |
-
var input = this.search.val();
|
| 2981 |
-
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
| 2982 |
-
if (input != null && input != undefined) {
|
| 2983 |
-
this.search.val(input);
|
| 2984 |
-
if (input.length > 0) {
|
| 2985 |
-
this.open();
|
| 2986 |
-
}
|
| 2987 |
-
}
|
| 2988 |
-
|
| 2989 |
-
},
|
| 2990 |
-
|
| 2991 |
-
// multi
|
| 2992 |
-
onSelect: function (data, options) {
|
| 2993 |
-
|
| 2994 |
-
if (!this.triggerSelect(data) || data.text === "") { return; }
|
| 2995 |
-
|
| 2996 |
-
this.addSelectedChoice(data);
|
| 2997 |
-
|
| 2998 |
-
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
| 2999 |
-
|
| 3000 |
-
// keep track of the search's value before it gets cleared
|
| 3001 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 3002 |
-
|
| 3003 |
-
this.clearSearch();
|
| 3004 |
-
this.updateResults();
|
| 3005 |
-
|
| 3006 |
-
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
| 3007 |
-
|
| 3008 |
-
if (this.opts.closeOnSelect) {
|
| 3009 |
-
this.close();
|
| 3010 |
-
this.search.width(10);
|
| 3011 |
-
} else {
|
| 3012 |
-
if (this.countSelectableResults()>0) {
|
| 3013 |
-
this.search.width(10);
|
| 3014 |
-
this.resizeSearch();
|
| 3015 |
-
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
| 3016 |
-
// if we reached max selection size repaint the results so choices
|
| 3017 |
-
// are replaced with the max selection reached message
|
| 3018 |
-
this.updateResults(true);
|
| 3019 |
-
} else {
|
| 3020 |
-
// initializes search's value with nextSearchTerm and update search result
|
| 3021 |
-
if(this.nextSearchTerm != undefined){
|
| 3022 |
-
this.search.val(this.nextSearchTerm);
|
| 3023 |
-
this.updateResults();
|
| 3024 |
-
this.search.select();
|
| 3025 |
-
}
|
| 3026 |
-
}
|
| 3027 |
-
this.positionDropdown();
|
| 3028 |
-
} else {
|
| 3029 |
-
// if nothing left to select close
|
| 3030 |
-
this.close();
|
| 3031 |
-
this.search.width(10);
|
| 3032 |
-
}
|
| 3033 |
-
}
|
| 3034 |
-
|
| 3035 |
-
// since its not possible to select an element that has already been
|
| 3036 |
-
// added we do not need to check if this is a new element before firing change
|
| 3037 |
-
this.triggerChange({ added: data });
|
| 3038 |
-
|
| 3039 |
-
if (!options || !options.noFocus)
|
| 3040 |
-
this.focusSearch();
|
| 3041 |
-
},
|
| 3042 |
-
|
| 3043 |
-
// multi
|
| 3044 |
-
cancel: function () {
|
| 3045 |
-
this.close();
|
| 3046 |
-
this.focusSearch();
|
| 3047 |
-
},
|
| 3048 |
-
|
| 3049 |
-
addSelectedChoice: function (data) {
|
| 3050 |
-
var enableChoice = !data.locked,
|
| 3051 |
-
enabledItem = $(
|
| 3052 |
-
"<li class='select2-search-choice'>" +
|
| 3053 |
-
" <div></div>" +
|
| 3054 |
-
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
| 3055 |
-
"</li>"),
|
| 3056 |
-
disabledItem = $(
|
| 3057 |
-
"<li class='select2-search-choice select2-locked'>" +
|
| 3058 |
-
"<div></div>" +
|
| 3059 |
-
"</li>");
|
| 3060 |
-
var choice = enableChoice ? enabledItem : disabledItem,
|
| 3061 |
-
id = this.id(data),
|
| 3062 |
-
val = this.getVal(),
|
| 3063 |
-
formatted,
|
| 3064 |
-
cssClass;
|
| 3065 |
-
|
| 3066 |
-
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
| 3067 |
-
if (formatted != undefined) {
|
| 3068 |
-
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
| 3069 |
-
}
|
| 3070 |
-
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
| 3071 |
-
if (cssClass != undefined) {
|
| 3072 |
-
choice.addClass(cssClass);
|
| 3073 |
-
}
|
| 3074 |
-
|
| 3075 |
-
if(enableChoice){
|
| 3076 |
-
choice.find(".select2-search-choice-close")
|
| 3077 |
-
.on("mousedown", killEvent)
|
| 3078 |
-
.on("click dblclick", this.bind(function (e) {
|
| 3079 |
-
if (!this.isInterfaceEnabled()) return;
|
| 3080 |
-
|
| 3081 |
-
this.unselect($(e.target));
|
| 3082 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 3083 |
-
killEvent(e);
|
| 3084 |
-
this.close();
|
| 3085 |
-
this.focusSearch();
|
| 3086 |
-
})).on("focus", this.bind(function () {
|
| 3087 |
-
if (!this.isInterfaceEnabled()) return;
|
| 3088 |
-
this.container.addClass("select2-container-active");
|
| 3089 |
-
this.dropdown.addClass("select2-drop-active");
|
| 3090 |
-
}));
|
| 3091 |
-
}
|
| 3092 |
-
|
| 3093 |
-
choice.data("select2-data", data);
|
| 3094 |
-
choice.insertBefore(this.searchContainer);
|
| 3095 |
-
|
| 3096 |
-
val.push(id);
|
| 3097 |
-
this.setVal(val);
|
| 3098 |
-
},
|
| 3099 |
-
|
| 3100 |
-
// multi
|
| 3101 |
-
unselect: function (selected) {
|
| 3102 |
-
var val = this.getVal(),
|
| 3103 |
-
data,
|
| 3104 |
-
index;
|
| 3105 |
-
selected = selected.closest(".select2-search-choice");
|
| 3106 |
-
|
| 3107 |
-
if (selected.length === 0) {
|
| 3108 |
-
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
| 3109 |
-
}
|
| 3110 |
-
|
| 3111 |
-
data = selected.data("select2-data");
|
| 3112 |
-
|
| 3113 |
-
if (!data) {
|
| 3114 |
-
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
| 3115 |
-
// and invoked on an element already removed
|
| 3116 |
-
return;
|
| 3117 |
-
}
|
| 3118 |
-
|
| 3119 |
-
var evt = $.Event("select2-removing");
|
| 3120 |
-
evt.val = this.id(data);
|
| 3121 |
-
evt.choice = data;
|
| 3122 |
-
this.opts.element.trigger(evt);
|
| 3123 |
-
|
| 3124 |
-
if (evt.isDefaultPrevented()) {
|
| 3125 |
-
return false;
|
| 3126 |
-
}
|
| 3127 |
-
|
| 3128 |
-
while((index = indexOf(this.id(data), val)) >= 0) {
|
| 3129 |
-
val.splice(index, 1);
|
| 3130 |
-
this.setVal(val);
|
| 3131 |
-
if (this.select) this.postprocessResults();
|
| 3132 |
-
}
|
| 3133 |
-
|
| 3134 |
-
selected.remove();
|
| 3135 |
-
|
| 3136 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 3137 |
-
this.triggerChange({ removed: data });
|
| 3138 |
-
|
| 3139 |
-
return true;
|
| 3140 |
-
},
|
| 3141 |
-
|
| 3142 |
-
// multi
|
| 3143 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 3144 |
-
var val = this.getVal(),
|
| 3145 |
-
choices = this.results.find(".select2-result"),
|
| 3146 |
-
compound = this.results.find(".select2-result-with-children"),
|
| 3147 |
-
self = this;
|
| 3148 |
-
|
| 3149 |
-
choices.each2(function (i, choice) {
|
| 3150 |
-
var id = self.id(choice.data("select2-data"));
|
| 3151 |
-
if (indexOf(id, val) >= 0) {
|
| 3152 |
-
choice.addClass("select2-selected");
|
| 3153 |
-
// mark all children of the selected parent as selected
|
| 3154 |
-
choice.find(".select2-result-selectable").addClass("select2-selected");
|
| 3155 |
-
}
|
| 3156 |
-
});
|
| 3157 |
-
|
| 3158 |
-
compound.each2(function(i, choice) {
|
| 3159 |
-
// hide an optgroup if it doesn't have any selectable children
|
| 3160 |
-
if (!choice.is('.select2-result-selectable')
|
| 3161 |
-
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
| 3162 |
-
choice.addClass("select2-selected");
|
| 3163 |
-
}
|
| 3164 |
-
});
|
| 3165 |
-
|
| 3166 |
-
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
| 3167 |
-
self.highlight(0);
|
| 3168 |
-
}
|
| 3169 |
-
|
| 3170 |
-
//If all results are chosen render formatNoMatches
|
| 3171 |
-
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
| 3172 |
-
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
| 3173 |
-
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
| 3174 |
-
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
| 3175 |
-
}
|
| 3176 |
-
}
|
| 3177 |
-
}
|
| 3178 |
-
|
| 3179 |
-
},
|
| 3180 |
-
|
| 3181 |
-
// multi
|
| 3182 |
-
getMaxSearchWidth: function() {
|
| 3183 |
-
return this.selection.width() - getSideBorderPadding(this.search);
|
| 3184 |
-
},
|
| 3185 |
-
|
| 3186 |
-
// multi
|
| 3187 |
-
resizeSearch: function () {
|
| 3188 |
-
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
| 3189 |
-
sideBorderPadding = getSideBorderPadding(this.search);
|
| 3190 |
-
|
| 3191 |
-
minimumWidth = measureTextWidth(this.search) + 10;
|
| 3192 |
-
|
| 3193 |
-
left = this.search.offset().left;
|
| 3194 |
-
|
| 3195 |
-
maxWidth = this.selection.width();
|
| 3196 |
-
containerLeft = this.selection.offset().left;
|
| 3197 |
-
|
| 3198 |
-
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
| 3199 |
-
|
| 3200 |
-
if (searchWidth < minimumWidth) {
|
| 3201 |
-
searchWidth = maxWidth - sideBorderPadding;
|
| 3202 |
-
}
|
| 3203 |
-
|
| 3204 |
-
if (searchWidth < 40) {
|
| 3205 |
-
searchWidth = maxWidth - sideBorderPadding;
|
| 3206 |
-
}
|
| 3207 |
-
|
| 3208 |
-
if (searchWidth <= 0) {
|
| 3209 |
-
searchWidth = minimumWidth;
|
| 3210 |
-
}
|
| 3211 |
-
|
| 3212 |
-
this.search.width(Math.floor(searchWidth));
|
| 3213 |
-
},
|
| 3214 |
-
|
| 3215 |
-
// multi
|
| 3216 |
-
getVal: function () {
|
| 3217 |
-
var val;
|
| 3218 |
-
if (this.select) {
|
| 3219 |
-
val = this.select.val();
|
| 3220 |
-
return val === null ? [] : val;
|
| 3221 |
-
} else {
|
| 3222 |
-
val = this.opts.element.val();
|
| 3223 |
-
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
| 3224 |
-
}
|
| 3225 |
-
},
|
| 3226 |
-
|
| 3227 |
-
// multi
|
| 3228 |
-
setVal: function (val) {
|
| 3229 |
-
var unique;
|
| 3230 |
-
if (this.select) {
|
| 3231 |
-
this.select.val(val);
|
| 3232 |
-
} else {
|
| 3233 |
-
unique = [];
|
| 3234 |
-
// filter out duplicates
|
| 3235 |
-
$(val).each(function () {
|
| 3236 |
-
if (indexOf(this, unique) < 0) unique.push(this);
|
| 3237 |
-
});
|
| 3238 |
-
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
| 3239 |
-
}
|
| 3240 |
-
},
|
| 3241 |
-
|
| 3242 |
-
// multi
|
| 3243 |
-
buildChangeDetails: function (old, current) {
|
| 3244 |
-
var current = current.slice(0),
|
| 3245 |
-
old = old.slice(0);
|
| 3246 |
-
|
| 3247 |
-
// remove intersection from each array
|
| 3248 |
-
for (var i = 0; i < current.length; i++) {
|
| 3249 |
-
for (var j = 0; j < old.length; j++) {
|
| 3250 |
-
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
| 3251 |
-
current.splice(i, 1);
|
| 3252 |
-
if(i>0){
|
| 3253 |
-
i--;
|
| 3254 |
-
}
|
| 3255 |
-
old.splice(j, 1);
|
| 3256 |
-
j--;
|
| 3257 |
-
}
|
| 3258 |
-
}
|
| 3259 |
-
}
|
| 3260 |
-
|
| 3261 |
-
return {added: current, removed: old};
|
| 3262 |
-
},
|
| 3263 |
-
|
| 3264 |
-
|
| 3265 |
-
// multi
|
| 3266 |
-
val: function (val, triggerChange) {
|
| 3267 |
-
var oldData, self=this;
|
| 3268 |
-
|
| 3269 |
-
if (arguments.length === 0) {
|
| 3270 |
-
return this.getVal();
|
| 3271 |
-
}
|
| 3272 |
-
|
| 3273 |
-
oldData=this.data();
|
| 3274 |
-
if (!oldData.length) oldData=[];
|
| 3275 |
-
|
| 3276 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 3277 |
-
if (!val && val !== 0) {
|
| 3278 |
-
this.opts.element.val("");
|
| 3279 |
-
this.updateSelection([]);
|
| 3280 |
-
this.clearSearch();
|
| 3281 |
-
if (triggerChange) {
|
| 3282 |
-
this.triggerChange({added: this.data(), removed: oldData});
|
| 3283 |
-
}
|
| 3284 |
-
return;
|
| 3285 |
-
}
|
| 3286 |
-
|
| 3287 |
-
// val is a list of ids
|
| 3288 |
-
this.setVal(val);
|
| 3289 |
-
|
| 3290 |
-
if (this.select) {
|
| 3291 |
-
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
| 3292 |
-
if (triggerChange) {
|
| 3293 |
-
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
| 3294 |
-
}
|
| 3295 |
-
} else {
|
| 3296 |
-
if (this.opts.initSelection === undefined) {
|
| 3297 |
-
throw new Error("val() cannot be called if initSelection() is not defined");
|
| 3298 |
-
}
|
| 3299 |
-
|
| 3300 |
-
this.opts.initSelection(this.opts.element, function(data){
|
| 3301 |
-
var ids=$.map(data, self.id);
|
| 3302 |
-
self.setVal(ids);
|
| 3303 |
-
self.updateSelection(data);
|
| 3304 |
-
self.clearSearch();
|
| 3305 |
-
if (triggerChange) {
|
| 3306 |
-
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
| 3307 |
-
}
|
| 3308 |
-
});
|
| 3309 |
-
}
|
| 3310 |
-
this.clearSearch();
|
| 3311 |
-
},
|
| 3312 |
-
|
| 3313 |
-
// multi
|
| 3314 |
-
onSortStart: function() {
|
| 3315 |
-
if (this.select) {
|
| 3316 |
-
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
| 3317 |
-
}
|
| 3318 |
-
|
| 3319 |
-
// collapse search field into 0 width so its container can be collapsed as well
|
| 3320 |
-
this.search.width(0);
|
| 3321 |
-
// hide the container
|
| 3322 |
-
this.searchContainer.hide();
|
| 3323 |
-
},
|
| 3324 |
-
|
| 3325 |
-
// multi
|
| 3326 |
-
onSortEnd:function() {
|
| 3327 |
-
|
| 3328 |
-
var val=[], self=this;
|
| 3329 |
-
|
| 3330 |
-
// show search and move it to the end of the list
|
| 3331 |
-
this.searchContainer.show();
|
| 3332 |
-
// make sure the search container is the last item in the list
|
| 3333 |
-
this.searchContainer.appendTo(this.searchContainer.parent());
|
| 3334 |
-
// since we collapsed the width in dragStarted, we resize it here
|
| 3335 |
-
this.resizeSearch();
|
| 3336 |
-
|
| 3337 |
-
// update selection
|
| 3338 |
-
this.selection.find(".select2-search-choice").each(function() {
|
| 3339 |
-
val.push(self.opts.id($(this).data("select2-data")));
|
| 3340 |
-
});
|
| 3341 |
-
this.setVal(val);
|
| 3342 |
-
this.triggerChange();
|
| 3343 |
-
},
|
| 3344 |
-
|
| 3345 |
-
// multi
|
| 3346 |
-
data: function(values, triggerChange) {
|
| 3347 |
-
var self=this, ids, old;
|
| 3348 |
-
if (arguments.length === 0) {
|
| 3349 |
-
return this.selection
|
| 3350 |
-
.children(".select2-search-choice")
|
| 3351 |
-
.map(function() { return $(this).data("select2-data"); })
|
| 3352 |
-
.get();
|
| 3353 |
-
} else {
|
| 3354 |
-
old = this.data();
|
| 3355 |
-
if (!values) { values = []; }
|
| 3356 |
-
ids = $.map(values, function(e) { return self.opts.id(e); });
|
| 3357 |
-
this.setVal(ids);
|
| 3358 |
-
this.updateSelection(values);
|
| 3359 |
-
this.clearSearch();
|
| 3360 |
-
if (triggerChange) {
|
| 3361 |
-
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
| 3362 |
-
}
|
| 3363 |
-
}
|
| 3364 |
-
}
|
| 3365 |
-
});
|
| 3366 |
-
|
| 3367 |
-
$.fn.select2 = function () {
|
| 3368 |
-
|
| 3369 |
-
var args = Array.prototype.slice.call(arguments, 0),
|
| 3370 |
-
opts,
|
| 3371 |
-
select2,
|
| 3372 |
-
method, value, multiple,
|
| 3373 |
-
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
| 3374 |
-
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
| 3375 |
-
propertyMethods = ["val", "data"],
|
| 3376 |
-
methodsMap = { search: "externalSearch" };
|
| 3377 |
-
|
| 3378 |
-
this.each(function () {
|
| 3379 |
-
if (args.length === 0 || typeof(args[0]) === "object") {
|
| 3380 |
-
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
| 3381 |
-
opts.element = $(this);
|
| 3382 |
-
|
| 3383 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 3384 |
-
multiple = opts.element.prop("multiple");
|
| 3385 |
-
} else {
|
| 3386 |
-
multiple = opts.multiple || false;
|
| 3387 |
-
if ("tags" in opts) {opts.multiple = multiple = true;}
|
| 3388 |
-
}
|
| 3389 |
-
|
| 3390 |
-
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
| 3391 |
-
select2.init(opts);
|
| 3392 |
-
} else if (typeof(args[0]) === "string") {
|
| 3393 |
-
|
| 3394 |
-
if (indexOf(args[0], allowedMethods) < 0) {
|
| 3395 |
-
throw "Unknown method: " + args[0];
|
| 3396 |
-
}
|
| 3397 |
-
|
| 3398 |
-
value = undefined;
|
| 3399 |
-
select2 = $(this).data("select2");
|
| 3400 |
-
if (select2 === undefined) return;
|
| 3401 |
-
|
| 3402 |
-
method=args[0];
|
| 3403 |
-
|
| 3404 |
-
if (method === "container") {
|
| 3405 |
-
value = select2.container;
|
| 3406 |
-
} else if (method === "dropdown") {
|
| 3407 |
-
value = select2.dropdown;
|
| 3408 |
-
} else {
|
| 3409 |
-
if (methodsMap[method]) method = methodsMap[method];
|
| 3410 |
-
|
| 3411 |
-
value = select2[method].apply(select2, args.slice(1));
|
| 3412 |
-
}
|
| 3413 |
-
if (indexOf(args[0], valueMethods) >= 0
|
| 3414 |
-
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
| 3415 |
-
return false; // abort the iteration, ready to return first matched value
|
| 3416 |
-
}
|
| 3417 |
-
} else {
|
| 3418 |
-
throw "Invalid arguments to select2 plugin: " + args;
|
| 3419 |
-
}
|
| 3420 |
-
});
|
| 3421 |
-
return (value === undefined) ? this : value;
|
| 3422 |
-
};
|
| 3423 |
-
|
| 3424 |
-
// plugin defaults, accessible to users
|
| 3425 |
-
$.fn.select2.defaults = {
|
| 3426 |
-
width: "copy",
|
| 3427 |
-
loadMorePadding: 0,
|
| 3428 |
-
closeOnSelect: true,
|
| 3429 |
-
openOnEnter: true,
|
| 3430 |
-
containerCss: {},
|
| 3431 |
-
dropdownCss: {},
|
| 3432 |
-
containerCssClass: "",
|
| 3433 |
-
dropdownCssClass: "",
|
| 3434 |
-
formatResult: function(result, container, query, escapeMarkup) {
|
| 3435 |
-
var markup=[];
|
| 3436 |
-
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
| 3437 |
-
return markup.join("");
|
| 3438 |
-
},
|
| 3439 |
-
transformVal: function(val) {
|
| 3440 |
-
return $.trim(val);
|
| 3441 |
-
},
|
| 3442 |
-
formatSelection: function (data, container, escapeMarkup) {
|
| 3443 |
-
return data ? escapeMarkup(this.text(data)) : undefined;
|
| 3444 |
-
},
|
| 3445 |
-
sortResults: function (results, container, query) {
|
| 3446 |
-
return results;
|
| 3447 |
-
},
|
| 3448 |
-
formatResultCssClass: function(data) {return data.css;},
|
| 3449 |
-
formatSelectionCssClass: function(data, container) {return undefined;},
|
| 3450 |
-
minimumResultsForSearch: 0,
|
| 3451 |
-
minimumInputLength: 0,
|
| 3452 |
-
maximumInputLength: null,
|
| 3453 |
-
maximumSelectionSize: 0,
|
| 3454 |
-
id: function (e) { return e == undefined ? null : e.id; },
|
| 3455 |
-
text: function (e) {
|
| 3456 |
-
if (e && this.data && this.data.text) {
|
| 3457 |
-
if ($.isFunction(this.data.text)) {
|
| 3458 |
-
return this.data.text(e);
|
| 3459 |
-
} else {
|
| 3460 |
-
return e[this.data.text];
|
| 3461 |
-
}
|
| 3462 |
-
} else {
|
| 3463 |
-
return e.text;
|
| 3464 |
-
}
|
| 3465 |
-
},
|
| 3466 |
-
matcher: function(term, text) {
|
| 3467 |
-
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
| 3468 |
-
},
|
| 3469 |
-
separator: ",",
|
| 3470 |
-
tokenSeparators: [],
|
| 3471 |
-
tokenizer: defaultTokenizer,
|
| 3472 |
-
escapeMarkup: defaultEscapeMarkup,
|
| 3473 |
-
blurOnChange: false,
|
| 3474 |
-
selectOnBlur: false,
|
| 3475 |
-
adaptContainerCssClass: function(c) { return c; },
|
| 3476 |
-
adaptDropdownCssClass: function(c) { return null; },
|
| 3477 |
-
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
| 3478 |
-
searchInputPlaceholder: '',
|
| 3479 |
-
createSearchChoicePosition: 'top',
|
| 3480 |
-
shouldFocusInput: function (instance) {
|
| 3481 |
-
// Attempt to detect touch devices
|
| 3482 |
-
var supportsTouchEvents = (('ontouchstart' in window) ||
|
| 3483 |
-
(navigator.msMaxTouchPoints > 0));
|
| 3484 |
-
|
| 3485 |
-
// Only devices which support touch events should be special cased
|
| 3486 |
-
if (!supportsTouchEvents) {
|
| 3487 |
-
return true;
|
| 3488 |
-
}
|
| 3489 |
-
|
| 3490 |
-
// Never focus the input if search is disabled
|
| 3491 |
-
if (instance.opts.minimumResultsForSearch < 0) {
|
| 3492 |
-
return false;
|
| 3493 |
-
}
|
| 3494 |
-
|
| 3495 |
-
return true;
|
| 3496 |
-
}
|
| 3497 |
-
};
|
| 3498 |
-
|
| 3499 |
-
$.fn.select2.locales = [];
|
| 3500 |
-
|
| 3501 |
-
$.fn.select2.locales['en'] = {
|
| 3502 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 3503 |
-
formatNoMatches: function () { return "No matches found"; },
|
| 3504 |
-
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
| 3505 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 3506 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 3507 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 3508 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 3509 |
-
formatSearching: function () { return "Searching…"; }
|
| 3510 |
-
};
|
| 3511 |
-
|
| 3512 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 3513 |
-
|
| 3514 |
-
$.fn.select2.ajaxDefaults = {
|
| 3515 |
-
transport: $.ajax,
|
| 3516 |
-
params: {
|
| 3517 |
-
type: "GET",
|
| 3518 |
-
cache: false,
|
| 3519 |
-
dataType: "json"
|
| 3520 |
-
}
|
| 3521 |
-
};
|
| 3522 |
-
|
| 3523 |
-
// exports
|
| 3524 |
-
window.Select2 = {
|
| 3525 |
-
query: {
|
| 3526 |
-
ajax: ajax,
|
| 3527 |
-
local: local,
|
| 3528 |
-
tags: tags
|
| 3529 |
-
}, util: {
|
| 3530 |
-
debounce: debounce,
|
| 3531 |
-
markMatch: markMatch,
|
| 3532 |
-
escapeMarkup: defaultEscapeMarkup,
|
| 3533 |
-
stripDiacritics: stripDiacritics
|
| 3534 |
-
}, "class": {
|
| 3535 |
-
"abstract": AbstractSelect2,
|
| 3536 |
-
"single": SingleSelect2,
|
| 3537 |
-
"multi": MultiSelect2
|
| 3538 |
-
}
|
| 3539 |
-
};
|
| 3540 |
-
|
| 3541 |
-
}(jQuery));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/js/select2/select2.min.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Copyright 2014 Igor Vaynberg
|
| 3 |
-
|
| 4 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
-
|
| 6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
-
License or the GPL License.
|
| 10 |
-
|
| 11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
-
|
| 13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
-
|
| 16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 17 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 18 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
-
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
-
*/
|
| 21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
| 22 |
-
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
| 23 |
-
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/js/select2/select2.png
DELETED
|
Binary file
|
classes/admin/settings/assets/js/select2/select2x2.png
DELETED
|
Binary file
|
classes/admin/settings/assets/js/sf-jquery.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
jQuery(document).ready(function () {
|
| 2 |
-
|
| 3 |
-
jQuery(".sf-tips").tooltip({ animation: true, html: true, delay: { show: 300, hide: 100 } });
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
//This if statement checks if the color picker widget exists within jQuery UI
|
| 7 |
-
//If it does exist then we initialize the WordPress color picker on our text input field
|
| 8 |
-
if (typeof jQuery.wp === 'object' && typeof jQuery.wp.wpColorPicker === 'function') {
|
| 9 |
-
jQuery('.colorpick').wpColorPicker();
|
| 10 |
-
} else {
|
| 11 |
-
// Color picker
|
| 12 |
-
jQuery('.colorpick').each(function () {
|
| 13 |
-
jQuery('.colorpickdiv', jQuery(this).parent()).farbtastic(this);
|
| 14 |
-
jQuery(this).click(function () {
|
| 15 |
-
if (jQuery(this).val() == "") jQuery(this).val('#');
|
| 16 |
-
jQuery('.colorpickdiv', jQuery(this).parent()).show();
|
| 17 |
-
});
|
| 18 |
-
});
|
| 19 |
-
jQuery(document).mousedown(function () {
|
| 20 |
-
jQuery('.colorpickdiv').hide();
|
| 21 |
-
});
|
| 22 |
-
}
|
| 23 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/assets/js/wcvendors-media.js
DELETED
|
@@ -1,52 +0,0 @@
|
|
| 1 |
-
jQuery( function( $ ){
|
| 2 |
-
|
| 3 |
-
var id;
|
| 4 |
-
|
| 5 |
-
// Iterate over all instances of the uploader on the page
|
| 6 |
-
$('.wcv-img-id').each( function () {
|
| 7 |
-
|
| 8 |
-
id = $( this ).data( 'id' );
|
| 9 |
-
|
| 10 |
-
// Handle Add banner
|
| 11 |
-
$( '#wcv-add-' + id ).on( 'click', function(e) {
|
| 12 |
-
e.preventDefault();
|
| 13 |
-
file_uploader( id );
|
| 14 |
-
return false;
|
| 15 |
-
});
|
| 16 |
-
|
| 17 |
-
});
|
| 18 |
-
|
| 19 |
-
function file_uploader( id )
|
| 20 |
-
{
|
| 21 |
-
|
| 22 |
-
var media_uploader, json;
|
| 23 |
-
|
| 24 |
-
if (undefined !== media_uploader ) {
|
| 25 |
-
media_uploader.open();
|
| 26 |
-
return;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
media_uploader = wp.media({
|
| 30 |
-
title: $( '#wcv-add-' + id ).data('window_title'),
|
| 31 |
-
button: {
|
| 32 |
-
text: $( '#wcv-add-' + id ).data('save_button'),
|
| 33 |
-
},
|
| 34 |
-
multiple: false // Set to true to allow multiple files to be selected
|
| 35 |
-
});
|
| 36 |
-
|
| 37 |
-
media_uploader.on( 'select' , function(){
|
| 38 |
-
|
| 39 |
-
json = media_uploader.state().get('selection').first().toJSON();
|
| 40 |
-
|
| 41 |
-
if ( 0 > $.trim( json.url.length ) ) {
|
| 42 |
-
return;
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
$( '.wcv-image-container-' + id ).prop( 'src', json.sizes.full.url );
|
| 46 |
-
$( '#' + id ).val( json.sizes.full.url );
|
| 47 |
-
|
| 48 |
-
});
|
| 49 |
-
|
| 50 |
-
media_uploader.open();
|
| 51 |
-
}
|
| 52 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/class-wcv-settings-display.php
CHANGED
|
@@ -171,7 +171,7 @@ if ( ! class_exists( 'WCVendors_Settings_Display', false ) ) :
|
|
| 171 |
),
|
| 172 |
|
| 173 |
array(
|
| 174 |
-
'title' => sprintf( __( '%s store
|
| 175 |
'desc' => sprintf( __( 'The %s store info label', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 176 |
'id' => 'wcvendors_display_label_store_info',
|
| 177 |
'type' => 'text',
|
|
@@ -274,6 +274,15 @@ if ( ! class_exists( 'WCVendors_Settings_Display', false ) ) :
|
|
| 274 |
'type' => 'checkbox',
|
| 275 |
),
|
| 276 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 277 |
array(
|
| 278 |
'title' => __( 'Shop HTML', 'wc-vendors' ),
|
| 279 |
'desc' => sprintf( __( 'Allow HTML in %s shop description', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 171 |
),
|
| 172 |
|
| 173 |
array(
|
| 174 |
+
'title' => sprintf( __( '%s store info label', 'wc-vendors' ), wcv_get_vendor_name() ),
|
| 175 |
'desc' => sprintf( __( 'The %s store info label', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 176 |
'id' => 'wcvendors_display_label_store_info',
|
| 177 |
'type' => 'text',
|
| 274 |
'type' => 'checkbox',
|
| 275 |
),
|
| 276 |
|
| 277 |
+
array(
|
| 278 |
+
'title' => __( 'Shop Description', 'wc-vendors' ),
|
| 279 |
+
'desc' => sprintf( __( 'Enable %s shop description', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 280 |
+
'desc_tip' => sprintf( __( 'This enables the %1$s shop description on the %1$s store page.', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
| 281 |
+
'id' => 'wcvendors_display_shop_description',
|
| 282 |
+
'default' => 'no',
|
| 283 |
+
'type' => 'checkbox',
|
| 284 |
+
),
|
| 285 |
+
|
| 286 |
array(
|
| 287 |
'title' => __( 'Shop HTML', 'wc-vendors' ),
|
| 288 |
'desc' => sprintf( __( 'Allow HTML in %s shop description', 'wc-vendors' ), wcv_get_vendor_name( true, false ) ),
|
classes/admin/settings/classes/sf-class-format-options.php
DELETED
|
@@ -1,347 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Format an options array into HTML
|
| 5 |
-
* This class has been deprecated
|
| 6 |
-
*
|
| 7 |
-
* @author Matt Gates <http://mgates.me>
|
| 8 |
-
* @package WordPress
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
if ( !class_exists( 'SF_Format_Options' ) ) {
|
| 13 |
-
|
| 14 |
-
class SF_Format_Options extends SF_Settings_API
|
| 15 |
-
{
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Format an option array into HTML
|
| 19 |
-
*
|
| 20 |
-
*
|
| 21 |
-
* @access public
|
| 22 |
-
*
|
| 23 |
-
* @param unknown $setting
|
| 24 |
-
*
|
| 25 |
-
* @return string HTML.
|
| 26 |
-
*/
|
| 27 |
-
public function settings_options_format( $setting )
|
| 28 |
-
{
|
| 29 |
-
if ( empty( $setting ) ) return false;
|
| 30 |
-
|
| 31 |
-
$defaults = apply_filters( $this->id . '_options_defaults', array(
|
| 32 |
-
'name' => '',
|
| 33 |
-
'desc' => '',
|
| 34 |
-
'placeholder' => '',
|
| 35 |
-
'class' => '',
|
| 36 |
-
'tip' => '',
|
| 37 |
-
'id' => '',
|
| 38 |
-
'css' => '',
|
| 39 |
-
'type' => 'text',
|
| 40 |
-
'std' => '',
|
| 41 |
-
'select2' => false,
|
| 42 |
-
'multiple' => false,
|
| 43 |
-
'options' => array(),
|
| 44 |
-
'restrict' => array(),
|
| 45 |
-
'settings' => array()
|
| 46 |
-
) );
|
| 47 |
-
|
| 48 |
-
// Each to it's own variable for slim-ness' sakes.
|
| 49 |
-
$setting = shortcode_atts( $defaults, $setting );
|
| 50 |
-
|
| 51 |
-
$restrict_defaults = array(
|
| 52 |
-
'min' => 0,
|
| 53 |
-
'max' => '',
|
| 54 |
-
'step' => 'any',
|
| 55 |
-
);
|
| 56 |
-
|
| 57 |
-
$setting[ 'restrict' ] = shortcode_atts( $restrict_defaults, $setting[ 'restrict' ] );
|
| 58 |
-
|
| 59 |
-
$setting[ 'value' ] = $this->get_option( $setting[ 'id' ] );
|
| 60 |
-
$setting[ 'value' ] = $setting[ 'value' ] !== false ? maybe_unserialize( $setting[ 'value' ] ) : false;
|
| 61 |
-
$setting[ 'value' ] = SF_Format_Options::sanitize_value( $setting[ 'value' ], $setting );
|
| 62 |
-
|
| 63 |
-
$setting[ 'title' ] = $setting[ 'name' ];
|
| 64 |
-
$setting[ 'name' ] = $this->id . "_options[{$setting['id']}]";
|
| 65 |
-
|
| 66 |
-
$setting[ 'grouped' ] = !$setting[ 'title' ] ? ' style="padding-top:0px;"' : '';
|
| 67 |
-
$setting[ 'tip' ] = SF_Format_Options::get_formatted_tip( $setting[ 'tip' ] );
|
| 68 |
-
|
| 69 |
-
$header_types = apply_filters( $this->id . '_options_header_types', array( 'heading', 'title' ) );
|
| 70 |
-
|
| 71 |
-
extract( $setting );
|
| 72 |
-
|
| 73 |
-
$description = $desc && !$grouped && $type != 'checkbox'
|
| 74 |
-
? '<br /><small>' . $desc . '</small>'
|
| 75 |
-
: '<label for="' . $id . '"> ' . $desc . '</label>';
|
| 76 |
-
|
| 77 |
-
$description = ( ( in_array( $type, $header_types ) || $type == 'radio' ) && !empty( $desc ) )
|
| 78 |
-
? '<p>' . $desc . '</p>'
|
| 79 |
-
: $description;
|
| 80 |
-
|
| 81 |
-
?>
|
| 82 |
-
|
| 83 |
-
<?php if ( !in_array( $type, $header_types ) ) : ?>
|
| 84 |
-
<!-- Header of the option. -->
|
| 85 |
-
<tr valign="top">
|
| 86 |
-
<th scope="row"<?php echo $grouped; ?>>
|
| 87 |
-
|
| 88 |
-
<?php echo $tip; ?>
|
| 89 |
-
|
| 90 |
-
<?php if ( !$grouped ) : ?>
|
| 91 |
-
<label for="<?php echo $name; ?>" class="description"><?php echo $title; ?></label>
|
| 92 |
-
<?php endif; ?>
|
| 93 |
-
|
| 94 |
-
</th>
|
| 95 |
-
<td <?php echo $grouped; ?> >
|
| 96 |
-
<?php endif; ?>
|
| 97 |
-
|
| 98 |
-
<?php foreach ( $header_types as $header ) :
|
| 99 |
-
if ( $type != $header ) continue; ?>
|
| 100 |
-
<tr>
|
| 101 |
-
<th scope="col" colspan="2">
|
| 102 |
-
<h3 class="title"><?php echo $title; ?></h3>
|
| 103 |
-
<?php echo $description; ?>
|
| 104 |
-
</th>
|
| 105 |
-
</tr>
|
| 106 |
-
<?php endforeach; ?>
|
| 107 |
-
|
| 108 |
-
<?php switch ( $type ) :
|
| 109 |
-
|
| 110 |
-
case 'text' :
|
| 111 |
-
case 'color' :
|
| 112 |
-
case 'number' :
|
| 113 |
-
if ( $type == 'color' ) {
|
| 114 |
-
$type = 'text';
|
| 115 |
-
$class .= ' colorpick';
|
| 116 |
-
$description .= '<div id="colorPickerDiv_' . $id . '" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>';
|
| 117 |
-
}
|
| 118 |
-
?>
|
| 119 |
-
<input name="<?php echo $name; ?>"
|
| 120 |
-
id="<?php echo $id; ?>"
|
| 121 |
-
type="<?php echo $type; ?>"
|
| 122 |
-
|
| 123 |
-
<?php if ( $type == 'number' ): ?>
|
| 124 |
-
min="<?php echo $restrict[ 'min' ]; ?>"
|
| 125 |
-
max="<?php echo $restrict[ 'max' ]; ?>"
|
| 126 |
-
step="<?php echo $restrict[ 'step' ]; ?>"
|
| 127 |
-
<?php endif; ?>
|
| 128 |
-
|
| 129 |
-
class="regular-text <?php echo $class; ?>"
|
| 130 |
-
style="<?php echo $css; ?>"
|
| 131 |
-
placeholder="<?php echo $placeholder; ?>"
|
| 132 |
-
value="<?php echo $value !== false ? $value : $std; ?>"
|
| 133 |
-
/>
|
| 134 |
-
<?php echo $description;
|
| 135 |
-
break;
|
| 136 |
-
|
| 137 |
-
case 'checkbox':
|
| 138 |
-
|
| 139 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 140 |
-
|
| 141 |
-
if ( $multiple ) :
|
| 142 |
-
|
| 143 |
-
foreach ( $options as $key => $desc ) : ?>
|
| 144 |
-
|
| 145 |
-
<input name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 146 |
-
id="<?php echo $id . '_' . $key; ?>"
|
| 147 |
-
type="checkbox"
|
| 148 |
-
class="<?php echo $class; ?>"
|
| 149 |
-
style="<?php echo $css; ?>"
|
| 150 |
-
value="<?php echo $key; ?>"
|
| 151 |
-
<?php self::checked( $value, $key ); ?>
|
| 152 |
-
/>
|
| 153 |
-
<label for="<?php echo $id . '_' . $key; ?>">
|
| 154 |
-
<?php echo $desc; ?>
|
| 155 |
-
</label>
|
| 156 |
-
<br/>
|
| 157 |
-
<?php
|
| 158 |
-
|
| 159 |
-
endforeach;
|
| 160 |
-
|
| 161 |
-
else : ?>
|
| 162 |
-
|
| 163 |
-
<input name="<?php echo $name; ?>"
|
| 164 |
-
id="<?php echo $id ?>"
|
| 165 |
-
type="checkbox"
|
| 166 |
-
class="<?php echo $class; ?>"
|
| 167 |
-
style="<?php echo $css; ?>"
|
| 168 |
-
<?php checked( $selected, 1 ); ?>
|
| 169 |
-
/>
|
| 170 |
-
<?php echo $description;
|
| 171 |
-
endif;
|
| 172 |
-
break;
|
| 173 |
-
|
| 174 |
-
case 'radio':
|
| 175 |
-
|
| 176 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 177 |
-
|
| 178 |
-
foreach ( $options as $key => $val ) : ?>
|
| 179 |
-
<label class="radio">
|
| 180 |
-
<input type="radio"
|
| 181 |
-
name="<?php echo $name; ?>"
|
| 182 |
-
id="<?php echo $key; ?>"
|
| 183 |
-
value="<?php echo $key; ?>"
|
| 184 |
-
class="<?php echo $class; ?>"
|
| 185 |
-
<?php checked( $selected, $key ); ?>
|
| 186 |
-
/>
|
| 187 |
-
<?php echo $val; ?>
|
| 188 |
-
</label><br/>
|
| 189 |
-
<?php endforeach;
|
| 190 |
-
echo $description;
|
| 191 |
-
break;
|
| 192 |
-
|
| 193 |
-
case 'single_select_page':
|
| 194 |
-
|
| 195 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 196 |
-
|
| 197 |
-
$args = array(
|
| 198 |
-
'name' => $name,
|
| 199 |
-
'id' => $id,
|
| 200 |
-
'sort_order' => 'ASC',
|
| 201 |
-
'echo' => 0,
|
| 202 |
-
'selected' => $selected
|
| 203 |
-
);
|
| 204 |
-
|
| 205 |
-
echo str_replace( "'>", "'><option></option>", wp_dropdown_pages( $args ) );
|
| 206 |
-
|
| 207 |
-
echo $description;
|
| 208 |
-
|
| 209 |
-
if ( $select2 ) : ?>
|
| 210 |
-
<script type="text/javascript">jQuery(function () {
|
| 211 |
-
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px' });
|
| 212 |
-
});</script>
|
| 213 |
-
<?php endif;
|
| 214 |
-
|
| 215 |
-
break;
|
| 216 |
-
|
| 217 |
-
case 'select':
|
| 218 |
-
|
| 219 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 220 |
-
$options = apply_filters( $this->id . '_select_options', $options, $setting ); ?>
|
| 221 |
-
|
| 222 |
-
<select id="<?php echo $id; ?>"
|
| 223 |
-
class="<?php echo $class; ?>"
|
| 224 |
-
style="<?php echo $css; ?>"
|
| 225 |
-
name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 226 |
-
<?php echo $multiple ? 'multiple="multiple"' : ''; ?>>
|
| 227 |
-
|
| 228 |
-
<?php foreach ( $options as $key => $val ) : ?>
|
| 229 |
-
<option
|
| 230 |
-
value="<?php echo $key; ?>" <?php self::selected( $selected, $key ); ?>><?php echo $val; ?></option>
|
| 231 |
-
<?php endforeach; ?>
|
| 232 |
-
</select>
|
| 233 |
-
|
| 234 |
-
<?php echo $description;
|
| 235 |
-
|
| 236 |
-
if ( $select2 ) : ?>
|
| 237 |
-
<script type="text/javascript">jQuery(function () {
|
| 238 |
-
jQuery("#<?php echo $id; ?>").select2({ width: '350px' });
|
| 239 |
-
});</script>
|
| 240 |
-
<?php endif;
|
| 241 |
-
|
| 242 |
-
break;
|
| 243 |
-
|
| 244 |
-
case 'textarea':
|
| 245 |
-
?>
|
| 246 |
-
<textarea name="<?php echo $name; ?>"
|
| 247 |
-
id="<?php echo $id; ?>"
|
| 248 |
-
class="large-text <?php echo $class; ?>"
|
| 249 |
-
style="<?php if ( $css ) echo $css; else echo 'width:300px;'; ?>"
|
| 250 |
-
placeholder="<?php echo $placeholder; ?>"
|
| 251 |
-
rows="3"
|
| 252 |
-
><?php echo ( $value !== false ) ? $value : $std; ?></textarea>
|
| 253 |
-
<?php echo $description;
|
| 254 |
-
break;
|
| 255 |
-
|
| 256 |
-
case 'wysiwyg':
|
| 257 |
-
wp_editor( $value, $id, array( 'textarea_name' => $name ) );
|
| 258 |
-
echo $description;
|
| 259 |
-
break;
|
| 260 |
-
|
| 261 |
-
default :
|
| 262 |
-
do_action( $this->id . '_options_type_' . $type, $setting );
|
| 263 |
-
break;
|
| 264 |
-
|
| 265 |
-
endswitch;
|
| 266 |
-
|
| 267 |
-
/* Footer of the option. */
|
| 268 |
-
if ( !in_array( $type, $header_types ) ) echo '</td></tr>';
|
| 269 |
-
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
|
| 273 |
-
/**
|
| 274 |
-
*
|
| 275 |
-
*
|
| 276 |
-
* @param unknown $haystack
|
| 277 |
-
* @param unknown $current
|
| 278 |
-
*/
|
| 279 |
-
private function selected( $haystack, $current )
|
| 280 |
-
{
|
| 281 |
-
|
| 282 |
-
if ( is_array( $haystack ) && in_array( $current, $haystack ) ) {
|
| 283 |
-
$current = $haystack = 1;
|
| 284 |
-
}
|
| 285 |
-
|
| 286 |
-
selected( $haystack, $current );
|
| 287 |
-
}
|
| 288 |
-
|
| 289 |
-
|
| 290 |
-
/**
|
| 291 |
-
*
|
| 292 |
-
*
|
| 293 |
-
* @param unknown $haystack
|
| 294 |
-
* @param unknown $current
|
| 295 |
-
*/
|
| 296 |
-
private function checked( $haystack, $current )
|
| 297 |
-
{
|
| 298 |
-
|
| 299 |
-
if ( is_array( $haystack ) && !empty( $haystack[ $current ] ) ) {
|
| 300 |
-
$current = $haystack = 1;
|
| 301 |
-
}
|
| 302 |
-
|
| 303 |
-
checked( $haystack, $current );
|
| 304 |
-
}
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
/**
|
| 308 |
-
* Format a tooltip given a string
|
| 309 |
-
*
|
| 310 |
-
* @param string $tip
|
| 311 |
-
*
|
| 312 |
-
* @return string
|
| 313 |
-
*/
|
| 314 |
-
private function get_formatted_tip( $tip )
|
| 315 |
-
{
|
| 316 |
-
return $tip ? sprintf( '<a href="#" title="%s" class="sf-tips" tabindex="99"></a>', $tip ) : '';
|
| 317 |
-
}
|
| 318 |
-
|
| 319 |
-
|
| 320 |
-
/**
|
| 321 |
-
*
|
| 322 |
-
*
|
| 323 |
-
* @param unknown $value
|
| 324 |
-
* @param unknown $setting
|
| 325 |
-
*
|
| 326 |
-
* @return unknown
|
| 327 |
-
*/
|
| 328 |
-
private function sanitize_value( $value, $setting )
|
| 329 |
-
{
|
| 330 |
-
if ( $value !== false && $setting[ 'type' ] != 'wysiwyg' ) {
|
| 331 |
-
if ( is_array( $value ) ) {
|
| 332 |
-
foreach ( $value as $key => $output ) {
|
| 333 |
-
$value[ $key ] = esc_attr( $output );
|
| 334 |
-
}
|
| 335 |
-
} else {
|
| 336 |
-
$value = esc_attr( $value );
|
| 337 |
-
}
|
| 338 |
-
}
|
| 339 |
-
|
| 340 |
-
return apply_filters( $this->id . '_options_sanitize_value', $value, $setting );
|
| 341 |
-
}
|
| 342 |
-
|
| 343 |
-
|
| 344 |
-
}
|
| 345 |
-
|
| 346 |
-
|
| 347 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/classes/sf-class-sanitize.php
DELETED
|
@@ -1,199 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Sanitize filters
|
| 5 |
-
*
|
| 6 |
-
* @author Matt Gates <http://mgates.me>
|
| 7 |
-
* @package WordPress
|
| 8 |
-
*/
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
if ( !class_exists( 'SF_Sanitize' ) ) {
|
| 12 |
-
|
| 13 |
-
class SF_Sanitize
|
| 14 |
-
{
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Hooks
|
| 19 |
-
*/
|
| 20 |
-
function __construct()
|
| 21 |
-
{
|
| 22 |
-
add_filter( 'geczy_sanitize_color', 'sanitize_text_field' );
|
| 23 |
-
add_filter( 'geczy_sanitize_text', 'sanitize_text_field' );
|
| 24 |
-
add_filter( 'geczy_sanitize_number', array( 'SF_Sanitize', 'sanitize_number_field' ) );
|
| 25 |
-
add_filter( 'geczy_sanitize_textarea', array( 'SF_Sanitize', 'sanitize_textarea' ) );
|
| 26 |
-
add_filter( 'geczy_sanitize_wysiwyg', array( 'SF_Sanitize', 'sanitize_wysiwyg' ) );
|
| 27 |
-
add_filter( 'geczy_sanitize_checkbox', array( 'SF_Sanitize', 'sanitize_checkbox' ), 10, 2 );
|
| 28 |
-
add_filter( 'geczy_sanitize_radio', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
|
| 29 |
-
add_filter( 'geczy_sanitize_select', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
|
| 30 |
-
add_filter( 'geczy_sanitize_image', array( 'SF_Sanitize', 'sanitize_image_url' ), 10, 2 );
|
| 31 |
-
add_filter( 'geczy_sanitize_single_select_page', array( 'SF_Sanitize', 'sanitize_select_pages' ), 10, 2 );
|
| 32 |
-
add_filter( 'geczy_sanitize_multi_select_page', array( 'SF_Sanitize', 'sanitize_multi_pages' ), 10, 2 );
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Numeric sanitization
|
| 38 |
-
*
|
| 39 |
-
* @param int $input
|
| 40 |
-
*
|
| 41 |
-
* @return int
|
| 42 |
-
*/
|
| 43 |
-
public static function sanitize_number_field( $input )
|
| 44 |
-
{
|
| 45 |
-
$output = is_numeric( $input ) ? (float) $input : false;
|
| 46 |
-
|
| 47 |
-
return $input;
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Textarea sanitization
|
| 53 |
-
*
|
| 54 |
-
* @param string $input
|
| 55 |
-
*
|
| 56 |
-
* @return string
|
| 57 |
-
*/
|
| 58 |
-
public static function sanitize_textarea( $input )
|
| 59 |
-
{
|
| 60 |
-
global $allowedposttags;
|
| 61 |
-
$output = wp_kses( $input, $allowedposttags );
|
| 62 |
-
|
| 63 |
-
return $output;
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
/**
|
| 68 |
-
* WYSIWYG sanitization
|
| 69 |
-
*
|
| 70 |
-
* @param string $input
|
| 71 |
-
*
|
| 72 |
-
* @return string
|
| 73 |
-
*/
|
| 74 |
-
public static function sanitize_wysiwyg( $input )
|
| 75 |
-
{
|
| 76 |
-
return $input;
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
/**
|
| 81 |
-
* Checkbox sanitization
|
| 82 |
-
*
|
| 83 |
-
* @param int $input
|
| 84 |
-
* @param unknown $option
|
| 85 |
-
*
|
| 86 |
-
* @return int
|
| 87 |
-
*/
|
| 88 |
-
public static function sanitize_checkbox( $input, $option )
|
| 89 |
-
{
|
| 90 |
-
if ( !empty( $option[ 'multiple' ] ) ) {
|
| 91 |
-
|
| 92 |
-
$defaults = array_keys( $option[ 'options' ] );
|
| 93 |
-
|
| 94 |
-
foreach ( $defaults as $value ) {
|
| 95 |
-
|
| 96 |
-
if ( !is_array( $input ) ) {
|
| 97 |
-
$output[ $value ] = 0;
|
| 98 |
-
} else {
|
| 99 |
-
$output[ $value ] = in_array( $value, $input ) ? 1 : 0;
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
$output = serialize( $output );
|
| 105 |
-
} else {
|
| 106 |
-
$output = $input ? 1 : 0;
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
return $output;
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
/**
|
| 114 |
-
* Array sanitization
|
| 115 |
-
*
|
| 116 |
-
* @param unknown $input
|
| 117 |
-
* @param array $option
|
| 118 |
-
*
|
| 119 |
-
* @return bool
|
| 120 |
-
*/
|
| 121 |
-
public static function sanitize_enum( $input, $option )
|
| 122 |
-
{
|
| 123 |
-
$output = $input;
|
| 124 |
-
|
| 125 |
-
$sfs = new SF_Sanitize();
|
| 126 |
-
|
| 127 |
-
if ( is_array( $input ) ) {
|
| 128 |
-
foreach ( $input as $value ) {
|
| 129 |
-
if ( !$sfs->sanitize_enum( $value, $option ) ) {
|
| 130 |
-
$output = false;
|
| 131 |
-
break;
|
| 132 |
-
}
|
| 133 |
-
}
|
| 134 |
-
$output = $output ? serialize( $output ) : $output;
|
| 135 |
-
} else {
|
| 136 |
-
$output = array_key_exists( $input, $option[ 'options' ] ) ? $input : false;
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
return $output;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
/**
|
| 144 |
-
* Select box for pages sanitize
|
| 145 |
-
*
|
| 146 |
-
* @param int $input
|
| 147 |
-
* @param int $option
|
| 148 |
-
*
|
| 149 |
-
* @return int
|
| 150 |
-
*/
|
| 151 |
-
public static function sanitize_select_pages( $input, $option )
|
| 152 |
-
{
|
| 153 |
-
$output = get_page( $input ) ? (int) $input : 0;
|
| 154 |
-
|
| 155 |
-
return $output;
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
/**
|
| 159 |
-
* Select box for pages sanitize
|
| 160 |
-
*
|
| 161 |
-
* @param int $input
|
| 162 |
-
* @param int $option
|
| 163 |
-
*
|
| 164 |
-
* @return int
|
| 165 |
-
*/
|
| 166 |
-
public static function sanitize_multi_pages( $input, $option )
|
| 167 |
-
{
|
| 168 |
-
|
| 169 |
-
foreach ( $input as $value ){
|
| 170 |
-
$output[ $value ] = get_page( $value ) ? (int) $value : 0;
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
// $output = serialize( $output );
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
return $output;
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
|
| 180 |
-
|
| 181 |
-
/**
|
| 182 |
-
* Image uploader
|
| 183 |
-
*
|
| 184 |
-
* @param url $input
|
| 185 |
-
*
|
| 186 |
-
* @return int
|
| 187 |
-
*/
|
| 188 |
-
public static function sanitize_image_url( $input, $option ) {
|
| 189 |
-
|
| 190 |
-
$output = $input;
|
| 191 |
-
return $output;
|
| 192 |
-
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/classes/sf-class-settings.php
DELETED
|
@@ -1,978 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* WP-Simple-Settings-Framework
|
| 5 |
-
*
|
| 6 |
-
* Copyright (c) 2012 Matt Gates.
|
| 7 |
-
* All rights reserved.
|
| 8 |
-
*
|
| 9 |
-
* Redistribution and use in source and binary forms, with or without
|
| 10 |
-
* modification, are permitted provided that the following conditions
|
| 11 |
-
* are met:
|
| 12 |
-
*
|
| 13 |
-
* * Redistributions of source code must retain the above copyright
|
| 14 |
-
* notice, this list of conditions and the following disclaimer.
|
| 15 |
-
*
|
| 16 |
-
* * Redistributions in binary form must reproduce the above copyright
|
| 17 |
-
* notice, this list of conditions and the following disclaimer in
|
| 18 |
-
* the documentation and/or other materials provided with the
|
| 19 |
-
* distribution.
|
| 20 |
-
*
|
| 21 |
-
* * Neither the names of the copyright holders nor the names of the
|
| 22 |
-
* contributors may be used to endorse or promote products derived
|
| 23 |
-
* from this software without specific prior written permission.
|
| 24 |
-
*
|
| 25 |
-
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
|
| 26 |
-
* "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
|
| 27 |
-
* LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
|
| 28 |
-
* FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
| 29 |
-
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
|
| 30 |
-
* INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
|
| 31 |
-
* BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
|
| 32 |
-
* LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
|
| 33 |
-
* CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
|
| 34 |
-
* LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN
|
| 35 |
-
* ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
|
| 36 |
-
* POSSIBILITY OF SUCH DAMAGE.
|
| 37 |
-
*
|
| 38 |
-
* @subpackage WP-Simple-Settings-Framework
|
| 39 |
-
* @copyright 2012 Matt Gates.
|
| 40 |
-
* @license http://www.opensource.org/licenses/bsd-license.php BSD License
|
| 41 |
-
* @link http://mgates.me
|
| 42 |
-
* @version 1.1
|
| 43 |
-
* @author Matt Gates <info@mgates.me>
|
| 44 |
-
* @package WordPress
|
| 45 |
-
*/
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
if ( !class_exists( 'SF_Settings_API' ) ) {
|
| 49 |
-
|
| 50 |
-
class SF_Settings_API
|
| 51 |
-
{
|
| 52 |
-
|
| 53 |
-
private $data = array();
|
| 54 |
-
|
| 55 |
-
/**
|
| 56 |
-
* Init
|
| 57 |
-
*
|
| 58 |
-
* @param string $id
|
| 59 |
-
* @param string $title
|
| 60 |
-
* @param string $menu (optional)
|
| 61 |
-
* @param string $file
|
| 62 |
-
*/
|
| 63 |
-
public function __construct( $id, $title, $menu = '', $file )
|
| 64 |
-
{
|
| 65 |
-
$this->assets_url = trailingslashit( plugins_url( 'assets/', dirname( __FILE__ ) ) );
|
| 66 |
-
$this->id = $id;
|
| 67 |
-
$this->title = $title;
|
| 68 |
-
$this->menu = empty( $menu ) ? 'plugins.php' : $menu;
|
| 69 |
-
|
| 70 |
-
$this->file = $file;
|
| 71 |
-
|
| 72 |
-
$this->includes();
|
| 73 |
-
$this->actions();
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
// ==================================================================
|
| 78 |
-
//
|
| 79 |
-
// Getter and setter.
|
| 80 |
-
//
|
| 81 |
-
// ------------------------------------------------------------------
|
| 82 |
-
|
| 83 |
-
/**
|
| 84 |
-
* Setter
|
| 85 |
-
*
|
| 86 |
-
* @param unknown $name
|
| 87 |
-
* @param unknown $value
|
| 88 |
-
*/
|
| 89 |
-
public function __set( $name, $value )
|
| 90 |
-
{
|
| 91 |
-
if ( isset ( $this->data[ $name ] ) && is_array( $this->data[ $name ] ) ) {
|
| 92 |
-
$this->data[ $name ] = array_merge( $this->data[ $name ], $value );
|
| 93 |
-
} else {
|
| 94 |
-
$this->data[ $name ] = $value;
|
| 95 |
-
}
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
/**
|
| 100 |
-
* Getter
|
| 101 |
-
*
|
| 102 |
-
* @param unknown $name
|
| 103 |
-
*
|
| 104 |
-
* @return unknown
|
| 105 |
-
*/
|
| 106 |
-
public function __get( $name )
|
| 107 |
-
{
|
| 108 |
-
if ( array_key_exists( $name, $this->data ) ) {
|
| 109 |
-
return $this->data[ $name ];
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
return null;
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
/**
|
| 117 |
-
* Isset
|
| 118 |
-
*
|
| 119 |
-
* @param unknown $name
|
| 120 |
-
*
|
| 121 |
-
* @return unknown
|
| 122 |
-
*/
|
| 123 |
-
public function __isset( $name )
|
| 124 |
-
{
|
| 125 |
-
return isset( $this->data[ $name ] );
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
/**
|
| 130 |
-
* Unset
|
| 131 |
-
*
|
| 132 |
-
* @param unknown $name
|
| 133 |
-
*/
|
| 134 |
-
public function __unset( $name )
|
| 135 |
-
{
|
| 136 |
-
unset( $this->data[ $name ] );
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
|
| 140 |
-
/**
|
| 141 |
-
* Add a "Settings" link to the plugins.php page
|
| 142 |
-
*
|
| 143 |
-
* @param array $links
|
| 144 |
-
* @param array $file
|
| 145 |
-
*
|
| 146 |
-
* @return array
|
| 147 |
-
*/
|
| 148 |
-
public function add_settings_link( $links, $file )
|
| 149 |
-
{
|
| 150 |
-
$this_plugin = plugin_basename( $this->file );
|
| 151 |
-
$page = strpos( $this->menu, '.php' ) ? $this->menu : 'admin.php';
|
| 152 |
-
if ( $file == $this_plugin ) {
|
| 153 |
-
$settings_link = '<a href="' . $page . '?page=' . $this->id . '">' . __( 'Settings', 'wcvendors' ) . '</a>';
|
| 154 |
-
array_unshift( $links, $settings_link );
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
return $links;
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
|
| 161 |
-
// ==================================================================
|
| 162 |
-
//
|
| 163 |
-
// Begin initialization.
|
| 164 |
-
//
|
| 165 |
-
// ------------------------------------------------------------------
|
| 166 |
-
|
| 167 |
-
/**
|
| 168 |
-
* Core files
|
| 169 |
-
*/
|
| 170 |
-
private function includes()
|
| 171 |
-
{
|
| 172 |
-
require_once dirname( __FILE__ ) . '/sf-class-sanitize.php';
|
| 173 |
-
require_once dirname( __FILE__ ) . '/sf-class-format-options.php';
|
| 174 |
-
new SF_Sanitize;
|
| 175 |
-
}
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
/**
|
| 179 |
-
* Hooks
|
| 180 |
-
*/
|
| 181 |
-
private function actions()
|
| 182 |
-
{
|
| 183 |
-
add_action( 'admin_enqueue_scripts', array( &$this, 'admin_enqueue_scripts' ) );
|
| 184 |
-
add_action( 'admin_init', array( &$this, 'register_options' ) );
|
| 185 |
-
add_action( 'admin_menu', array( &$this, 'create_menu' ) );
|
| 186 |
-
add_filter( 'plugin_action_links', array( &$this, 'add_settings_link' ), 10, 2 );
|
| 187 |
-
}
|
| 188 |
-
|
| 189 |
-
|
| 190 |
-
/**
|
| 191 |
-
* Admin scripts and styles
|
| 192 |
-
*/
|
| 193 |
-
public function admin_enqueue_scripts()
|
| 194 |
-
{
|
| 195 |
-
|
| 196 |
-
$screen = get_current_screen();
|
| 197 |
-
$screen_id = $screen->id;
|
| 198 |
-
|
| 199 |
-
if ( $screen_id === 'woocommerce_page_wc_prd_vendor') {
|
| 200 |
-
wp_register_script( 'bootstrap-tooltip', $this->assets_url . 'js/bootstrap-tooltip.js', array( 'jquery' ), '1.0' );
|
| 201 |
-
wp_register_script( 'select2', $this->assets_url . 'js/select2/select2.min.js', array( 'jquery' ), '3.5.2' );
|
| 202 |
-
wp_register_script( 'wcvendors-media', $this->assets_url . 'js/wcvendors-media.js', array( 'jquery' ), '1.0' );
|
| 203 |
-
wp_register_script( 'sf-scripts', $this->assets_url . 'js/sf-jquery.js', array( 'jquery' ), '1.0' );
|
| 204 |
-
wp_register_style( 'select2', $this->assets_url . 'js/select2/select2.css' );
|
| 205 |
-
wp_register_style( 'sf-styles', $this->assets_url . 'css/sf-styles.css' );
|
| 206 |
-
}
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
/**
|
| 211 |
-
* Admin scripts and styles
|
| 212 |
-
*/
|
| 213 |
-
public function admin_print_scripts()
|
| 214 |
-
{
|
| 215 |
-
global $wp_version;
|
| 216 |
-
|
| 217 |
-
//Check wp version and load appropriate scripts for colorpicker.
|
| 218 |
-
if ( 3.5 <= $wp_version ) {
|
| 219 |
-
wp_enqueue_style( 'wp-color-picker' );
|
| 220 |
-
wp_enqueue_script( 'wp-color-picker' );
|
| 221 |
-
} else {
|
| 222 |
-
wp_enqueue_style( 'farbtastic' );
|
| 223 |
-
wp_enqueue_script( 'farbtastic' );
|
| 224 |
-
}
|
| 225 |
-
|
| 226 |
-
wp_enqueue_script( 'bootstrap-tooltip' );
|
| 227 |
-
wp_enqueue_script( 'select2' );
|
| 228 |
-
wp_enqueue_script( 'wcvendors-media' );
|
| 229 |
-
wp_enqueue_script( 'sf-scripts' );
|
| 230 |
-
|
| 231 |
-
wp_enqueue_style( 'wp-color-picker' );
|
| 232 |
-
wp_enqueue_style( 'select2' );
|
| 233 |
-
wp_enqueue_style( 'sf-styles' );
|
| 234 |
-
}
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
/**
|
| 238 |
-
* Register setting
|
| 239 |
-
*/
|
| 240 |
-
public function register_options()
|
| 241 |
-
{
|
| 242 |
-
register_setting( $this->id . '_options_nonce', $this->id . '_options', array( &$this, 'validate_options' ) );
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
/**
|
| 247 |
-
* Create menu
|
| 248 |
-
*/
|
| 249 |
-
public function create_menu()
|
| 250 |
-
{
|
| 251 |
-
$page = add_submenu_page( $this->menu, $this->title, $this->title, apply_filters( $this->id . '_manage_options', 'manage_options' ), $this->id, array( &$this, 'init_settings_page' ) );
|
| 252 |
-
add_action( 'admin_print_scripts-' . $page, array( &$this, 'admin_print_scripts' ) );
|
| 253 |
-
}
|
| 254 |
-
|
| 255 |
-
|
| 256 |
-
/**
|
| 257 |
-
* Parse options into tabbed organization
|
| 258 |
-
*
|
| 259 |
-
* @return array
|
| 260 |
-
*/
|
| 261 |
-
private function parse_options()
|
| 262 |
-
{
|
| 263 |
-
$options = $this->options;
|
| 264 |
-
|
| 265 |
-
foreach ( $options as $option ) {
|
| 266 |
-
|
| 267 |
-
if ( $option[ 'type' ] == 'heading' ) {
|
| 268 |
-
$tab_name = sanitize_title( $option[ 'name' ] );
|
| 269 |
-
$this->tab_headers = array( $tab_name => $option[ 'name' ] );
|
| 270 |
-
|
| 271 |
-
continue;
|
| 272 |
-
}
|
| 273 |
-
|
| 274 |
-
$option[ 'tab' ] = $tab_name;
|
| 275 |
-
$tabs[ $tab_name ][ ] = $option;
|
| 276 |
-
|
| 277 |
-
}
|
| 278 |
-
|
| 279 |
-
$this->tabs = $tabs;
|
| 280 |
-
|
| 281 |
-
return $tabs;
|
| 282 |
-
}
|
| 283 |
-
|
| 284 |
-
|
| 285 |
-
/**
|
| 286 |
-
* Load the options array from a file
|
| 287 |
-
*
|
| 288 |
-
* @param string $option_file
|
| 289 |
-
*/
|
| 290 |
-
public function load_options( $option_file )
|
| 291 |
-
{
|
| 292 |
-
if ( !empty( $this->options ) ) return;
|
| 293 |
-
|
| 294 |
-
if ( file_exists( $option_file ) ) {
|
| 295 |
-
require $option_file;
|
| 296 |
-
$this->options = apply_filters( $this->id . '_options', $options );
|
| 297 |
-
$this->parse_options();
|
| 298 |
-
|
| 299 |
-
$this->current_options = $this->get_current_options();
|
| 300 |
-
|
| 301 |
-
/* If the option has no saved data, load the defaults. */
|
| 302 |
-
/* @TODO: Can prob add this to the activation hook. */
|
| 303 |
-
$this->set_defaults( $this->current_options );
|
| 304 |
-
} else {
|
| 305 |
-
wp_die( __( 'Could not load settings at: ', 'wcvendors' ) . '<br/><code>' . $option_file . '</code>', __( 'Error - WP Settings Framework', 'wcvendors' ) );
|
| 306 |
-
}
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
|
| 310 |
-
/**
|
| 311 |
-
*
|
| 312 |
-
*
|
| 313 |
-
* @return unknown
|
| 314 |
-
*/
|
| 315 |
-
public function get_current_options()
|
| 316 |
-
{
|
| 317 |
-
if ( !empty( $this->current_options ) )
|
| 318 |
-
return $this->current_options;
|
| 319 |
-
|
| 320 |
-
$options = get_option( $this->id . '_options' );
|
| 321 |
-
|
| 322 |
-
if ( $options ) {
|
| 323 |
-
$options = array_map( 'maybe_unserialize', $options );
|
| 324 |
-
}
|
| 325 |
-
|
| 326 |
-
return $options;
|
| 327 |
-
}
|
| 328 |
-
|
| 329 |
-
|
| 330 |
-
/**
|
| 331 |
-
* Sanitize and validate post fields
|
| 332 |
-
*
|
| 333 |
-
* @param unknown $input
|
| 334 |
-
*
|
| 335 |
-
* @return unknown
|
| 336 |
-
*/
|
| 337 |
-
public function validate_options( $input )
|
| 338 |
-
{
|
| 339 |
-
if ( !isset( $_POST[ 'update' ] ) )
|
| 340 |
-
return $this->get_defaults();
|
| 341 |
-
|
| 342 |
-
$clean = $this->current_options;
|
| 343 |
-
$tabname = $_POST[ 'currentTab' ];
|
| 344 |
-
|
| 345 |
-
foreach ( $this->tabs[ $tabname ] as $option ) :
|
| 346 |
-
|
| 347 |
-
if ( !isset( $option[ 'id' ] ) )
|
| 348 |
-
continue;
|
| 349 |
-
|
| 350 |
-
if ( !isset( $option[ 'type' ] ) )
|
| 351 |
-
continue;
|
| 352 |
-
|
| 353 |
-
if ( $option[ 'type' ] == 'select' ) {
|
| 354 |
-
$option[ 'options' ] = apply_filters( $this->id . '_select_options', $option[ 'options' ], $option );
|
| 355 |
-
}
|
| 356 |
-
|
| 357 |
-
$id = sanitize_text_field( strtolower( $option[ 'id' ] ) );
|
| 358 |
-
|
| 359 |
-
// Set checkbox to false if it wasn't sent in the $_POST
|
| 360 |
-
if ( 'checkbox' == $option[ 'type' ] && !isset( $input[ $id ] ) )
|
| 361 |
-
$input[ $id ] = 0;
|
| 362 |
-
|
| 363 |
-
// For a value to be submitted to database it must pass through a sanitization filter
|
| 364 |
-
if ( has_filter( 'geczy_sanitize_' . $option[ 'type' ] ) ) {
|
| 365 |
-
$clean[ $id ] = apply_filters( 'geczy_sanitize_' . $option[ 'type' ], $input[ $id ], $option );
|
| 366 |
-
}
|
| 367 |
-
|
| 368 |
-
endforeach;
|
| 369 |
-
|
| 370 |
-
do_action( $this->id . '_options_updated', $clean, $tabname );
|
| 371 |
-
add_settings_error( $this->id, 'save_options', __( 'Settings saved.', 'wcvendors' ), 'updated' );
|
| 372 |
-
|
| 373 |
-
update_option( WC_Vendors::$id . '_flush_rules', true );
|
| 374 |
-
|
| 375 |
-
return apply_filters( $this->id . '_options_on_update', $clean, $tabname );
|
| 376 |
-
}
|
| 377 |
-
|
| 378 |
-
|
| 379 |
-
/**
|
| 380 |
-
* Create default options
|
| 381 |
-
*
|
| 382 |
-
* @param unknown $current_options (optional)
|
| 383 |
-
*/
|
| 384 |
-
private function set_defaults( $current_options = array() )
|
| 385 |
-
{
|
| 386 |
-
$options = $this->get_defaults( $current_options );
|
| 387 |
-
if ( $options ) {
|
| 388 |
-
update_option( $this->id . '_options', $options );
|
| 389 |
-
}
|
| 390 |
-
}
|
| 391 |
-
|
| 392 |
-
|
| 393 |
-
/**
|
| 394 |
-
* Retrieve default options
|
| 395 |
-
*
|
| 396 |
-
* @param unknown $currents (optional)
|
| 397 |
-
*
|
| 398 |
-
* @return array
|
| 399 |
-
*/
|
| 400 |
-
private function get_defaults( $currents = array() )
|
| 401 |
-
{
|
| 402 |
-
$output = array();
|
| 403 |
-
$config = $this->options;
|
| 404 |
-
$flag = false;
|
| 405 |
-
|
| 406 |
-
if ( $currents ) {
|
| 407 |
-
foreach ( $config as $value ) {
|
| 408 |
-
if ( !isset( $value[ 'id' ] ) || !isset( $value[ 'std' ] ) || !isset( $value[ 'type' ] ) )
|
| 409 |
-
continue;
|
| 410 |
-
|
| 411 |
-
if ( !isset( $currents[ $value[ 'id' ] ] ) ) {
|
| 412 |
-
$flag = true;
|
| 413 |
-
}
|
| 414 |
-
}
|
| 415 |
-
}
|
| 416 |
-
|
| 417 |
-
foreach ( $config as $option ) {
|
| 418 |
-
if ( !isset( $option[ 'id' ] ) || !isset( $option[ 'std' ] ) || !isset( $option[ 'type' ] ) )
|
| 419 |
-
continue;
|
| 420 |
-
|
| 421 |
-
if ( $currents && isset( $currents[ $option[ 'id' ] ] ) ) {
|
| 422 |
-
$output[ $option[ 'id' ] ] = $currents[ $option[ 'id' ] ];
|
| 423 |
-
} else if ( has_filter( 'geczy_sanitize_' . $option[ 'type' ] ) ) {
|
| 424 |
-
$output[ $option[ 'id' ] ] = apply_filters( 'geczy_sanitize_' . $option[ 'type' ], $option[ 'std' ], $option );
|
| 425 |
-
}
|
| 426 |
-
}
|
| 427 |
-
|
| 428 |
-
if ( $currents ) {
|
| 429 |
-
$output = array_merge( $currents, $output );
|
| 430 |
-
}
|
| 431 |
-
|
| 432 |
-
return !$flag && $currents ? array() : $output;
|
| 433 |
-
}
|
| 434 |
-
|
| 435 |
-
|
| 436 |
-
/**
|
| 437 |
-
* HTML header
|
| 438 |
-
*/
|
| 439 |
-
private function template_header()
|
| 440 |
-
{
|
| 441 |
-
?>
|
| 442 |
-
<div class="wrap">
|
| 443 |
-
<h2><?php echo $this->title; ?></h2>
|
| 444 |
-
|
| 445 |
-
<h2 class="nav-tab-wrapper">
|
| 446 |
-
<?php echo $this->display_tabs(); ?>
|
| 447 |
-
</h2><?php
|
| 448 |
-
|
| 449 |
-
if ( !empty ( $_REQUEST[ 'settings-updated' ] ) )
|
| 450 |
-
settings_errors();
|
| 451 |
-
|
| 452 |
-
}
|
| 453 |
-
|
| 454 |
-
|
| 455 |
-
/**
|
| 456 |
-
* HTML body
|
| 457 |
-
*
|
| 458 |
-
* @return unknown
|
| 459 |
-
*/
|
| 460 |
-
private function template_body()
|
| 461 |
-
{
|
| 462 |
-
|
| 463 |
-
if ( empty( $this->options ) ) return false;
|
| 464 |
-
|
| 465 |
-
|
| 466 |
-
$options = $this->options;
|
| 467 |
-
$tabs = $this->get_tabs();
|
| 468 |
-
$tabname = !empty ( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : $tabs[ 0 ][ 'slug' ];
|
| 469 |
-
|
| 470 |
-
$options = apply_filters( $this->id . '_options_tab-' . $tabname, $this->tabs[ $tabname ] ); ?>
|
| 471 |
-
|
| 472 |
-
<form method="post" action="options.php">
|
| 473 |
-
<?php settings_fields( $this->id . '_options_nonce' ); ?>
|
| 474 |
-
<table class="form-table">
|
| 475 |
-
|
| 476 |
-
<?php
|
| 477 |
-
foreach ( $options as $value ) :
|
| 478 |
-
$this->settings_options_format( $value );
|
| 479 |
-
endforeach;
|
| 480 |
-
|
| 481 |
-
do_action( $this->id . '_options_tab-' . $tabname );
|
| 482 |
-
?>
|
| 483 |
-
|
| 484 |
-
</table>
|
| 485 |
-
|
| 486 |
-
<p class="submit">
|
| 487 |
-
<input type="hidden" name="currentTab" value="<?php echo $tabname; ?>">
|
| 488 |
-
<input type="submit" name="update" class="button-primary"
|
| 489 |
-
value="<?php echo sprintf( __( 'Save %s changes', 'wcvendors' ), $this->tab_headers[ $tabname ] ); ?>"/>
|
| 490 |
-
</p>
|
| 491 |
-
</form> <?php
|
| 492 |
-
|
| 493 |
-
}
|
| 494 |
-
|
| 495 |
-
|
| 496 |
-
/**
|
| 497 |
-
* HTML footer
|
| 498 |
-
*/
|
| 499 |
-
private function template_footer()
|
| 500 |
-
{
|
| 501 |
-
|
| 502 |
-
$message = apply_filters( 'wcvendors_footer_msg', __( 'Please help with a <a href="https://wordpress.org/support/view/plugin-reviews/wc-vendors?rate=5#postform" target="top">High Five!</a> | <a href="https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_campaign=upgrade_promo" target="top">WC Vendors Pro</a> | <a href="https://www.wcvendors.com/product/stripe-commissions-gateway/?utm_source=plugin&utm_campaign=upgrade_promo" target="top">Stripe Commissions & Gateway</a> | <a href="https://docs.wcvendors.com/" target="top">Documentation</a> | <a href="https://wordpress.org/support/plugin/wc-vendors/" target="top">Free Support Forums</a>', 'wcvendors' ) );
|
| 503 |
-
|
| 504 |
-
echo '<div><p>' . $message . '</a></p>';
|
| 505 |
-
echo '</div>';
|
| 506 |
-
|
| 507 |
-
|
| 508 |
-
}
|
| 509 |
-
|
| 510 |
-
|
| 511 |
-
/**
|
| 512 |
-
* Create the settings page
|
| 513 |
-
*/
|
| 514 |
-
public function init_settings_page()
|
| 515 |
-
{
|
| 516 |
-
|
| 517 |
-
$this->template_header();
|
| 518 |
-
$this->template_body();
|
| 519 |
-
$this->template_footer();
|
| 520 |
-
|
| 521 |
-
}
|
| 522 |
-
|
| 523 |
-
|
| 524 |
-
/**
|
| 525 |
-
* Retrieve tabs
|
| 526 |
-
*
|
| 527 |
-
* @return array
|
| 528 |
-
*/
|
| 529 |
-
private function get_tabs()
|
| 530 |
-
{
|
| 531 |
-
$tabs = array();
|
| 532 |
-
foreach ( $this->options as $option ) {
|
| 533 |
-
|
| 534 |
-
if ( $option[ 'type' ] != 'heading' )
|
| 535 |
-
continue;
|
| 536 |
-
|
| 537 |
-
$option[ 'slug' ] = sanitize_title( $option[ 'name' ] );
|
| 538 |
-
unset( $option[ 'type' ] );
|
| 539 |
-
|
| 540 |
-
$tabs[ ] = $option;
|
| 541 |
-
}
|
| 542 |
-
|
| 543 |
-
return $tabs;
|
| 544 |
-
}
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
/**
|
| 548 |
-
* Heading for navigation
|
| 549 |
-
*
|
| 550 |
-
* @return string
|
| 551 |
-
*/
|
| 552 |
-
private function display_tabs()
|
| 553 |
-
{
|
| 554 |
-
$tabs = $this->get_tabs();
|
| 555 |
-
$tabname = !empty ( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : $tabs[ 0 ][ 'slug' ];
|
| 556 |
-
$menu = '';
|
| 557 |
-
|
| 558 |
-
foreach ( $tabs as $tab ) {
|
| 559 |
-
$class = $tabname == $tab[ 'slug' ] ? 'nav-tab-active' : '';
|
| 560 |
-
|
| 561 |
-
$fields = array(
|
| 562 |
-
'page' => $this->id,
|
| 563 |
-
'tab' => $tab[ 'slug' ],
|
| 564 |
-
);
|
| 565 |
-
|
| 566 |
-
$query = http_build_query( array_merge( $_GET, $fields ) );
|
| 567 |
-
$menu .= sprintf( '<a id="%s-tab" class="nav-tab %s" title="%s" href="?%s">%s</a>', $tab[ 'slug' ], $class, $tab[ 'name' ], $query, esc_html( $tab[ 'name' ] ) );
|
| 568 |
-
}
|
| 569 |
-
|
| 570 |
-
return $menu;
|
| 571 |
-
}
|
| 572 |
-
|
| 573 |
-
|
| 574 |
-
/**
|
| 575 |
-
* Update an option
|
| 576 |
-
*
|
| 577 |
-
* @param string $name
|
| 578 |
-
* @param string $value
|
| 579 |
-
*
|
| 580 |
-
* @return bool
|
| 581 |
-
*/
|
| 582 |
-
public function update_option( $name, $value )
|
| 583 |
-
{
|
| 584 |
-
// Overwrite the key/value pair
|
| 585 |
-
$this->current_options = array( $name => $value ) + (array) $this->current_options;
|
| 586 |
-
|
| 587 |
-
return update_option( $this->id . '_options', $this->current_options );
|
| 588 |
-
}
|
| 589 |
-
|
| 590 |
-
|
| 591 |
-
/**
|
| 592 |
-
* Get an option
|
| 593 |
-
*
|
| 594 |
-
* @param string $name
|
| 595 |
-
* @param string $default (optional)
|
| 596 |
-
*
|
| 597 |
-
* @return bool
|
| 598 |
-
*/
|
| 599 |
-
public function get_option( $name, $default = false )
|
| 600 |
-
{
|
| 601 |
-
return isset( $this->current_options[ $name ] ) ? maybe_unserialize( $this->current_options[ $name ] ) : $default;
|
| 602 |
-
}
|
| 603 |
-
|
| 604 |
-
|
| 605 |
-
public function settings_options_format( $setting )
|
| 606 |
-
{
|
| 607 |
-
if ( empty( $setting ) ) return false;
|
| 608 |
-
|
| 609 |
-
$defaults = apply_filters( $this->id . '_options_defaults', array(
|
| 610 |
-
'name' => '',
|
| 611 |
-
'desc' => '',
|
| 612 |
-
'placeholder' => '',
|
| 613 |
-
'class' => '',
|
| 614 |
-
'tip' => '',
|
| 615 |
-
'id' => '',
|
| 616 |
-
'css' => '',
|
| 617 |
-
'type' => 'text',
|
| 618 |
-
'std' => '',
|
| 619 |
-
'select2' => false,
|
| 620 |
-
'multiple' => false,
|
| 621 |
-
'options' => array(),
|
| 622 |
-
'restrict' => array(),
|
| 623 |
-
'settings' => array()
|
| 624 |
-
) );
|
| 625 |
-
|
| 626 |
-
// Each to it's own variable for slim-ness' sakes.
|
| 627 |
-
$setting = shortcode_atts( $defaults, $setting );
|
| 628 |
-
|
| 629 |
-
$restrict_defaults = array(
|
| 630 |
-
'min' => 0,
|
| 631 |
-
'max' => '',
|
| 632 |
-
'step' => 'any',
|
| 633 |
-
);
|
| 634 |
-
|
| 635 |
-
$setting[ 'restrict' ] = shortcode_atts( $restrict_defaults, $setting[ 'restrict' ] );
|
| 636 |
-
|
| 637 |
-
$setting[ 'value' ] = $this->get_option( $setting[ 'id' ] );
|
| 638 |
-
$setting[ 'value' ] = $setting[ 'value' ] !== false ? maybe_unserialize( $setting[ 'value' ] ) : false;
|
| 639 |
-
$setting[ 'value' ] = $this->sanitize_value( $setting[ 'value' ], $setting );
|
| 640 |
-
|
| 641 |
-
$setting[ 'title' ] = $setting[ 'name' ];
|
| 642 |
-
$setting[ 'name' ] = $this->id . "_options[{$setting['id']}]";
|
| 643 |
-
|
| 644 |
-
$setting[ 'grouped' ] = !$setting[ 'title' ] ? ' style="padding-top:0px;"' : '';
|
| 645 |
-
$setting[ 'tip' ] = $this->get_formatted_tip( $setting[ 'tip' ] );
|
| 646 |
-
|
| 647 |
-
$header_types = apply_filters( $this->id . '_options_header_types', array( 'heading', 'title' ) );
|
| 648 |
-
|
| 649 |
-
extract( $setting );
|
| 650 |
-
|
| 651 |
-
$description = $desc && !$grouped && $type != 'checkbox'
|
| 652 |
-
? '<br /><small>' . $desc . '</small>'
|
| 653 |
-
: '<label for="' . $id . '"> ' . $desc . '</label>';
|
| 654 |
-
|
| 655 |
-
$description = ( ( in_array( $type, $header_types ) || $type == 'radio' ) && !empty( $desc ) )
|
| 656 |
-
? '<p>' . $desc . '</p>'
|
| 657 |
-
: $description;
|
| 658 |
-
|
| 659 |
-
?>
|
| 660 |
-
|
| 661 |
-
<?php if ( !in_array( $type, $header_types ) ) : ?>
|
| 662 |
-
<!-- Header of the option. -->
|
| 663 |
-
<tr valign="top">
|
| 664 |
-
<th scope="row"<?php echo $grouped; ?>>
|
| 665 |
-
|
| 666 |
-
<?php echo $tip; ?>
|
| 667 |
-
|
| 668 |
-
<?php if ( !$grouped ) : ?>
|
| 669 |
-
<label for="<?php echo $name; ?>" class="description"><?php echo $title; ?></label>
|
| 670 |
-
<?php endif; ?>
|
| 671 |
-
|
| 672 |
-
</th>
|
| 673 |
-
<td <?php echo $grouped; ?> >
|
| 674 |
-
<?php endif; ?>
|
| 675 |
-
|
| 676 |
-
<?php foreach ( $header_types as $header ) :
|
| 677 |
-
if ( $type != $header ) continue; ?>
|
| 678 |
-
<tr>
|
| 679 |
-
<th scope="col" colspan="2">
|
| 680 |
-
<h3 class="title"><?php echo $title; ?></h3>
|
| 681 |
-
<?php echo $description; ?>
|
| 682 |
-
</th>
|
| 683 |
-
</tr>
|
| 684 |
-
<?php endforeach; ?>
|
| 685 |
-
|
| 686 |
-
<?php switch ( $type ) :
|
| 687 |
-
|
| 688 |
-
case 'text' :
|
| 689 |
-
case 'color' :
|
| 690 |
-
case 'number' :
|
| 691 |
-
if ( $type == 'color' ) {
|
| 692 |
-
$type = 'text';
|
| 693 |
-
$class .= ' colorpick';
|
| 694 |
-
$description .= '<div id="colorPickerDiv_' . $id . '" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>';
|
| 695 |
-
}
|
| 696 |
-
?>
|
| 697 |
-
<input name="<?php echo $name; ?>"
|
| 698 |
-
id="<?php echo $id; ?>"
|
| 699 |
-
type="<?php echo $type; ?>"
|
| 700 |
-
|
| 701 |
-
<?php if ( $type == 'number' ): ?>
|
| 702 |
-
min="<?php echo $restrict[ 'min' ]; ?>"
|
| 703 |
-
max="<?php echo $restrict[ 'max' ]; ?>"
|
| 704 |
-
step="<?php echo $restrict[ 'step' ]; ?>"
|
| 705 |
-
<?php endif; ?>
|
| 706 |
-
|
| 707 |
-
class="regular-text <?php echo $class; ?>"
|
| 708 |
-
style="<?php echo $css; ?>"
|
| 709 |
-
placeholder="<?php echo $placeholder; ?>"
|
| 710 |
-
value="<?php echo $value !== false ? $value : $std; ?>"
|
| 711 |
-
/>
|
| 712 |
-
<?php echo $description;
|
| 713 |
-
break;
|
| 714 |
-
|
| 715 |
-
case 'checkbox':
|
| 716 |
-
|
| 717 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 718 |
-
|
| 719 |
-
if ( $multiple ) :
|
| 720 |
-
|
| 721 |
-
foreach ( $options as $key => $desc ) : ?>
|
| 722 |
-
|
| 723 |
-
<input name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 724 |
-
id="<?php echo $id . '_' . $key; ?>"
|
| 725 |
-
type="checkbox"
|
| 726 |
-
class="<?php echo $class; ?>"
|
| 727 |
-
style="<?php echo $css; ?>"
|
| 728 |
-
value="<?php echo $key; ?>"
|
| 729 |
-
<?php @checked( $selected[$key], 1 ); ?>
|
| 730 |
-
/>
|
| 731 |
-
<label for="<?php echo $id . '_' . $key; ?>">
|
| 732 |
-
<?php echo $desc; ?>
|
| 733 |
-
</label>
|
| 734 |
-
<br/>
|
| 735 |
-
<?php
|
| 736 |
-
|
| 737 |
-
endforeach;
|
| 738 |
-
|
| 739 |
-
else : ?>
|
| 740 |
-
|
| 741 |
-
<input name="<?php echo $name; ?>"
|
| 742 |
-
id="<?php echo $id ?>"
|
| 743 |
-
type="checkbox"
|
| 744 |
-
class="<?php echo $class; ?>"
|
| 745 |
-
style="<?php echo $css; ?>"
|
| 746 |
-
<?php checked( $selected, 1 ); ?>
|
| 747 |
-
/>
|
| 748 |
-
<?php echo $description;
|
| 749 |
-
endif;
|
| 750 |
-
break;
|
| 751 |
-
|
| 752 |
-
case 'radio':
|
| 753 |
-
|
| 754 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 755 |
-
|
| 756 |
-
foreach ( $options as $key => $val ) : ?>
|
| 757 |
-
<label class="radio">
|
| 758 |
-
<input type="radio"
|
| 759 |
-
name="<?php echo $name; ?>"
|
| 760 |
-
id="<?php echo $key; ?>"
|
| 761 |
-
value="<?php echo $key; ?>"
|
| 762 |
-
class="<?php echo $class; ?>"
|
| 763 |
-
<?php checked( $selected, $key ); ?>
|
| 764 |
-
/>
|
| 765 |
-
<?php echo $val; ?>
|
| 766 |
-
</label><br/>
|
| 767 |
-
<?php endforeach;
|
| 768 |
-
echo $description;
|
| 769 |
-
break;
|
| 770 |
-
|
| 771 |
-
case 'single_select_page':
|
| 772 |
-
|
| 773 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 774 |
-
|
| 775 |
-
if ( $value == 0 ) $selected = $std;
|
| 776 |
-
|
| 777 |
-
$args = array(
|
| 778 |
-
'name' => $name,
|
| 779 |
-
'id' => $id,
|
| 780 |
-
'sort_order' => 'ASC',
|
| 781 |
-
'echo' => 0,
|
| 782 |
-
'selected' => $selected
|
| 783 |
-
);
|
| 784 |
-
|
| 785 |
-
echo str_replace( "'>", "'><option></option>", wp_dropdown_pages( $args ) );
|
| 786 |
-
|
| 787 |
-
echo '<a href="post.php?post='.$selected.'&action=edit" class="button">'.__( 'Edit Page', 'wcvendors' ).'</a>';
|
| 788 |
-
echo '<a href="'.get_permalink( $selected ). '" class="button">'.__( 'View Page', 'wcvendors' ).'</a>';
|
| 789 |
-
|
| 790 |
-
echo $description;
|
| 791 |
-
|
| 792 |
-
if ( $select2 ) : ?>
|
| 793 |
-
<script type="text/javascript">jQuery(function () {
|
| 794 |
-
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px', allowMultiple: true });
|
| 795 |
-
});</script>
|
| 796 |
-
<?php endif;
|
| 797 |
-
|
| 798 |
-
break;
|
| 799 |
-
|
| 800 |
-
case 'multi_select_page':
|
| 801 |
-
|
| 802 |
-
// TODO get this working with multiple page selection
|
| 803 |
-
|
| 804 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 805 |
-
$selected = implode( ',', array_keys( $selected ) );
|
| 806 |
-
|
| 807 |
-
if ( $value == 0 ) $selected = $std;
|
| 808 |
-
|
| 809 |
-
$name = $name . '[]';
|
| 810 |
-
|
| 811 |
-
$args = array(
|
| 812 |
-
'name' => $name,
|
| 813 |
-
'id' => $id,
|
| 814 |
-
'sort_order' => 'ASC',
|
| 815 |
-
'echo' => 0,
|
| 816 |
-
'selected' => $selected
|
| 817 |
-
);
|
| 818 |
-
|
| 819 |
-
echo str_replace( "'>", "' multiple=\"multiple\"><option></option>", wp_dropdown_pages( $args ) );
|
| 820 |
-
|
| 821 |
-
echo '<a href="post.php?post='.$selected.'&action=edit" class="button">'.__( 'Edit Page', 'wcvendors' ).'</a>';
|
| 822 |
-
echo '<a href="'.get_permalink( $selected ). '" class="button">'.__( 'View Page', 'wcvendors' ).'</a>';
|
| 823 |
-
|
| 824 |
-
echo $description;
|
| 825 |
-
|
| 826 |
-
if ( $select2 ) : ?>
|
| 827 |
-
<script type="text/javascript">jQuery(function () {
|
| 828 |
-
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px', allowMultiple: true });
|
| 829 |
-
});</script>
|
| 830 |
-
<?php endif;
|
| 831 |
-
|
| 832 |
-
break;
|
| 833 |
-
|
| 834 |
-
|
| 835 |
-
case 'select':
|
| 836 |
-
|
| 837 |
-
$selected = ( $value !== false ) ? $value : $std;
|
| 838 |
-
$options = apply_filters( $this->id . '_select_options', $options, $setting ); ?>
|
| 839 |
-
|
| 840 |
-
<select id="<?php echo $id; ?>"
|
| 841 |
-
class="<?php echo $class; ?>"
|
| 842 |
-
style="<?php echo $css; ?>"
|
| 843 |
-
name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 844 |
-
<?php echo $multiple ? 'multiple="multiple"' : ''; ?>>
|
| 845 |
-
|
| 846 |
-
<?php foreach ( $options as $key => $val ) : ?>
|
| 847 |
-
<option
|
| 848 |
-
value="<?php echo $key; ?>" <?php self::selected( $selected, $key ); ?>><?php echo $val; ?></option>
|
| 849 |
-
<?php endforeach; ?>
|
| 850 |
-
</select>
|
| 851 |
-
|
| 852 |
-
<?php echo $description;
|
| 853 |
-
|
| 854 |
-
if ( $select2 ) : ?>
|
| 855 |
-
<script type="text/javascript">jQuery(function () {
|
| 856 |
-
jQuery("#<?php echo $id; ?>").select2({ width: '350px' });
|
| 857 |
-
});</script>
|
| 858 |
-
<?php endif;
|
| 859 |
-
|
| 860 |
-
break;
|
| 861 |
-
|
| 862 |
-
case 'textarea':
|
| 863 |
-
?>
|
| 864 |
-
<textarea name="<?php echo $name; ?>"
|
| 865 |
-
id="<?php echo $id; ?>"
|
| 866 |
-
class="large-text <?php echo $class; ?>"
|
| 867 |
-
style="<?php if ( $css ) echo $css; else echo 'width:300px;'; ?>"
|
| 868 |
-
placeholder="<?php echo $placeholder; ?>"
|
| 869 |
-
rows="3"
|
| 870 |
-
><?php echo ( $value !== false ) ? $value : $std; ?></textarea>
|
| 871 |
-
<?php echo $description;
|
| 872 |
-
break;
|
| 873 |
-
|
| 874 |
-
case 'wysiwyg':
|
| 875 |
-
wp_editor( $value, $id, array( 'textarea_name' => $name ) );
|
| 876 |
-
echo $description;
|
| 877 |
-
break;
|
| 878 |
-
|
| 879 |
-
case 'image':
|
| 880 |
-
|
| 881 |
-
if ( empty ( $value ) ) $value = $std;
|
| 882 |
-
|
| 883 |
-
?>
|
| 884 |
-
<img class="wcv-image-container-<?php echo $id; ?>" src="<?php echo $value; ?>" alt="" style="max-width:100%;" />
|
| 885 |
-
<br />
|
| 886 |
-
<input id="wcv-add-<?php echo $id; ?>" type="button" class="<?php echo $class; ?>" value="<?php echo sprintf( __( 'Update %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-id="<?php echo $id; ?>" data-save_button="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), $title ); ?>" data-window_title="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-upload_notice="<?php echo sprintf( __( 'Upload an image for the %s', 'wcvendors' ), strtolower( $title ) ); ?>" />
|
| 887 |
-
<input type="hidden" name="<?php echo $name; ?>" id="<?php echo $id; ?>" value="<?php echo $value; ?>">
|
| 888 |
-
<?php
|
| 889 |
-
break;
|
| 890 |
-
|
| 891 |
-
default :
|
| 892 |
-
do_action( $this->id . '_options_type_' . $type, $setting );
|
| 893 |
-
break;
|
| 894 |
-
|
| 895 |
-
endswitch;
|
| 896 |
-
|
| 897 |
-
/* Footer of the option. */
|
| 898 |
-
if ( !in_array( $type, $header_types ) ) echo '</td></tr>';
|
| 899 |
-
|
| 900 |
-
}
|
| 901 |
-
|
| 902 |
-
|
| 903 |
-
/**
|
| 904 |
-
*
|
| 905 |
-
*
|
| 906 |
-
* @param unknown $haystack
|
| 907 |
-
* @param unknown $current
|
| 908 |
-
*/
|
| 909 |
-
private function selected( $haystack, $current )
|
| 910 |
-
{
|
| 911 |
-
|
| 912 |
-
if ( is_array( $haystack ) && in_array( $current, $haystack ) ) {
|
| 913 |
-
$current = $haystack = 1;
|
| 914 |
-
}
|
| 915 |
-
|
| 916 |
-
selected( $haystack, $current );
|
| 917 |
-
}
|
| 918 |
-
|
| 919 |
-
|
| 920 |
-
/**
|
| 921 |
-
*
|
| 922 |
-
*
|
| 923 |
-
* @param unknown $haystack
|
| 924 |
-
* @param unknown $current
|
| 925 |
-
*/
|
| 926 |
-
private function checked( $haystack, $current )
|
| 927 |
-
{
|
| 928 |
-
|
| 929 |
-
if ( is_array( $haystack ) && !empty( $haystack[ $current ] ) ) {
|
| 930 |
-
$current = $haystack = 1;
|
| 931 |
-
}
|
| 932 |
-
|
| 933 |
-
checked( $haystack, $current );
|
| 934 |
-
}
|
| 935 |
-
|
| 936 |
-
|
| 937 |
-
/**
|
| 938 |
-
* Format a tooltip given a string
|
| 939 |
-
*
|
| 940 |
-
* @param string $tip
|
| 941 |
-
*
|
| 942 |
-
* @return string
|
| 943 |
-
*/
|
| 944 |
-
private function get_formatted_tip( $tip )
|
| 945 |
-
{
|
| 946 |
-
return $tip ? sprintf( '<a href="#" title="%s" class="sf-tips" tabindex="99"></a>', $tip ) : '';
|
| 947 |
-
}
|
| 948 |
-
|
| 949 |
-
|
| 950 |
-
/**
|
| 951 |
-
*
|
| 952 |
-
*
|
| 953 |
-
* @param unknown $value
|
| 954 |
-
* @param unknown $setting
|
| 955 |
-
*
|
| 956 |
-
* @return unknown
|
| 957 |
-
*/
|
| 958 |
-
private function sanitize_value( $value, $setting )
|
| 959 |
-
{
|
| 960 |
-
if ( $value !== false && $setting[ 'type' ] != 'wysiwyg' ) {
|
| 961 |
-
if ( is_array( $value ) ) {
|
| 962 |
-
foreach ( $value as $key => $output ) {
|
| 963 |
-
$value[ $key ] = esc_attr( $output );
|
| 964 |
-
}
|
| 965 |
-
} else {
|
| 966 |
-
$value = esc_attr( $value );
|
| 967 |
-
}
|
| 968 |
-
}
|
| 969 |
-
|
| 970 |
-
return apply_filters( $this->id . '_options_sanitize_value', $value, $setting );
|
| 971 |
-
}
|
| 972 |
-
|
| 973 |
-
|
| 974 |
-
|
| 975 |
-
}
|
| 976 |
-
|
| 977 |
-
|
| 978 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/admin/settings/sf-options.php
DELETED
|
@@ -1,363 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
$options = array();
|
| 3 |
-
|
| 4 |
-
$options[ ] = array( 'name' => __( 'General', 'wcvendors' ), 'type' => 'heading' );
|
| 5 |
-
$options[ ] = array( 'name' => __( 'General options', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 6 |
-
|
| 7 |
-
$options[ ] = array(
|
| 8 |
-
'name' => __( 'Default commission (%)', 'wcvendors' ),
|
| 9 |
-
'desc' => __( 'The default rate you pay each vendor for a product sale. <br>You can also give vendors their own individual commission rates by editing the vendors user account.<br>Also, you can edit an individual products commission to override both of these settings on a per product basis.', 'wcvendors' ),
|
| 10 |
-
'id' => 'default_commission',
|
| 11 |
-
'css' => 'width:70px;',
|
| 12 |
-
'type' => 'number',
|
| 13 |
-
'restrict' => array(
|
| 14 |
-
'min' => 0,
|
| 15 |
-
'max' => 100
|
| 16 |
-
)
|
| 17 |
-
);
|
| 18 |
-
|
| 19 |
-
/* Customize registration message depending on if they have registration enabled on the my account page */
|
| 20 |
-
$registration_message = __( 'Allow users or guests to apply to become a vendor', 'wcvendors' );
|
| 21 |
-
if ( get_option( 'woocommerce_enable_myaccount_registration' ) === 'no' ) {
|
| 22 |
-
$registration_message = __( 'Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:</strong> You MUST "<strong>Enable registration on the "My Account" page</strong>" in your <strong>WooCommerce > Settings > Accounts</strong> page for this option to work. Currently, you have registration disabled.', 'wcvendors' );
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
$options[ ] = array(
|
| 26 |
-
'name' => __( 'Registration', 'wcvendors' ),
|
| 27 |
-
'desc' => __( 'Allow users or guests to apply to become a vendor', 'wcvendors' ),
|
| 28 |
-
'tip' => __( 'This will show a checkbox on the My Account page\'s registration form asking if the user would like to apply to be a vendor. Also, on the Vendor Dashboard, users can still apply to become a vendor even if this is disabled.', 'wcvendors' ),
|
| 29 |
-
'id' => 'show_vendor_registration',
|
| 30 |
-
'type' => 'checkbox',
|
| 31 |
-
'std' => true,
|
| 32 |
-
);
|
| 33 |
-
|
| 34 |
-
$options[ ] = array(
|
| 35 |
-
'desc' => __( 'Approve vendor applications manually', 'wcvendors' ),
|
| 36 |
-
'tip' => __( 'With this unchecked, all vendor applications are automatically accepted. Otherwise, you must approve each manually.', 'wcvendors' ),
|
| 37 |
-
'id' => 'manual_vendor_registration',
|
| 38 |
-
'type' => 'checkbox',
|
| 39 |
-
'std' => true,
|
| 40 |
-
);
|
| 41 |
-
|
| 42 |
-
$options[ ] = array(
|
| 43 |
-
'name' => __( 'Taxes', 'wcvendors' ),
|
| 44 |
-
'desc' => __( 'Give vendors any tax collected per-product', 'wcvendors' ),
|
| 45 |
-
'tip' => __( 'The tax collected on a vendor\'s product will be given in its entirety', 'wcvendors' ),
|
| 46 |
-
'id' => 'give_tax',
|
| 47 |
-
'type' => 'checkbox',
|
| 48 |
-
'std' => false,
|
| 49 |
-
);
|
| 50 |
-
|
| 51 |
-
$options[ ] = array(
|
| 52 |
-
'name' => __( 'Shipping', 'wcvendors' ),
|
| 53 |
-
'desc' => __( 'Give vendors any shipping collected per-product', 'wcvendors' ),
|
| 54 |
-
'tip' => __( 'WC Vendors Free - Give vendors shipping if using Per Product Shipping gateway. WC Vendors Pro - Give vendors shipping when using Vendor Shipping. No other shipping module is compatible with this option.', 'wcvendors' ),
|
| 55 |
-
'id' => 'give_shipping',
|
| 56 |
-
'type' => 'checkbox',
|
| 57 |
-
'std' => true,
|
| 58 |
-
);
|
| 59 |
-
|
| 60 |
-
$options[ ] = array( 'name' => __( 'Shop options', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 61 |
-
|
| 62 |
-
$options[ ] = array(
|
| 63 |
-
'name' => __( 'Shop HTML', 'wcvendors' ),
|
| 64 |
-
'desc' => __( 'Enable HTML for a vendor\'s shop description by default. You can enable or disable this per vendor by editing the vendors user account.', 'wcvendors' ),
|
| 65 |
-
'id' => 'shop_html_enabled',
|
| 66 |
-
'type' => 'checkbox',
|
| 67 |
-
'std' => true,
|
| 68 |
-
);
|
| 69 |
-
|
| 70 |
-
$options[ ] = array(
|
| 71 |
-
'name' => __( 'Vendor Shop Page', 'wcvendors' ),
|
| 72 |
-
'desc' => __( 'Enter one word for the URI. If you enter "<strong>vendors</strong>" your vendors store will be <code>yourdomain.com/vendors/store-name/</code>', 'wcvendors' ),
|
| 73 |
-
'id' => 'vendor_shop_permalink',
|
| 74 |
-
'type' => 'text',
|
| 75 |
-
'std' => 'vendors/',
|
| 76 |
-
);
|
| 77 |
-
|
| 78 |
-
$options[ ] = array(
|
| 79 |
-
'name' => __( 'Shop Headers', 'wcvendors' ),
|
| 80 |
-
'desc' => __( 'Enable vendor shop headers', 'wcvendors' ),
|
| 81 |
-
'tip' => __( 'This will override the HTML Shop description output on product-archive pages. In order to customize the shop headers visit wcvendors.com and read the article in the Knowledgebase titled Changing the Vendor Templates.', 'wcvendors' ),
|
| 82 |
-
'id' => 'shop_headers_enabled',
|
| 83 |
-
'type' => 'checkbox',
|
| 84 |
-
'std' => false,
|
| 85 |
-
);
|
| 86 |
-
|
| 87 |
-
$options[ ] = array(
|
| 88 |
-
'name' => __( 'Vendor Display Name', 'wcvendors' ),
|
| 89 |
-
'desc' => __( 'Select what will be displayed for the sold by text throughout the store.', 'wcvendors' ),
|
| 90 |
-
'id' => 'vendor_display_name',
|
| 91 |
-
'type' => 'select',
|
| 92 |
-
'options' => array(
|
| 93 |
-
'display_name' => __( 'Display Name', 'wcvendors'),
|
| 94 |
-
'shop_name' => __( 'Shop Name', 'wcvendors'),
|
| 95 |
-
'user_login' => __( 'User Login', 'wcvendors'),
|
| 96 |
-
'user_email' => __( 'User Email', 'wcvendors'),
|
| 97 |
-
),
|
| 98 |
-
'std' => 'shop_name'
|
| 99 |
-
|
| 100 |
-
);
|
| 101 |
-
|
| 102 |
-
$options[ ] = array(
|
| 103 |
-
'name' => __( 'Sold By', 'wcvendors' ),
|
| 104 |
-
'desc' => __( 'Enable sold by labels', 'wcvendors' ),
|
| 105 |
-
'tip' => __( 'This will enable or disable the sold by labels.', 'wcvendors' ),
|
| 106 |
-
'id' => 'sold_by',
|
| 107 |
-
'type' => 'checkbox',
|
| 108 |
-
'std' => true,
|
| 109 |
-
);
|
| 110 |
-
|
| 111 |
-
$options[ ] = array(
|
| 112 |
-
'name' => __( 'Sold By Label', 'wcvendors' ),
|
| 113 |
-
'desc' => __( 'The sold by label used on the site and emails.', 'wcvendors' ),
|
| 114 |
-
'id' => 'sold_by_label',
|
| 115 |
-
'type' => 'text',
|
| 116 |
-
'std' => __( 'Sold By', 'wcvendors' ),
|
| 117 |
-
);
|
| 118 |
-
|
| 119 |
-
$options[ ] = array(
|
| 120 |
-
'name' => __( 'Seller Info Label', 'wcvendors' ),
|
| 121 |
-
'desc' => __( 'The seller info tab title on the single product page.', 'wcvendors' ),
|
| 122 |
-
'id' => 'seller_info_label',
|
| 123 |
-
'type' => 'text',
|
| 124 |
-
'std' => __( 'Seller Info', 'wcvendors' ),
|
| 125 |
-
);
|
| 126 |
-
|
| 127 |
-
$options[ ] = array( 'name' => __( 'Products', 'wcvendors' ), 'type' => 'heading' );
|
| 128 |
-
$options[ ] = array( 'name' => __( 'Product Add Page', 'wcvendors' ), 'type' => 'title', 'desc' => __( 'Configure what to hide from all vendors when adding a product', 'wcvendors' ) );
|
| 129 |
-
|
| 130 |
-
$options[ ] = array(
|
| 131 |
-
'name' => __( 'Left side panel', 'wcvendors' ),
|
| 132 |
-
'desc' => __( 'CHECKING these boxes will **HIDE** these areas of the add product page for vendors', 'wcvendors' ),
|
| 133 |
-
'id' => 'hide_product_panel',
|
| 134 |
-
'options' => array(
|
| 135 |
-
'inventory' => __( 'Inventory', 'wcvendors' ),
|
| 136 |
-
'shipping' => __( 'Shipping', 'wcvendors' ),
|
| 137 |
-
'linked_product' => __( 'Linked Products', 'wcvendors' ),
|
| 138 |
-
'attribute' => __( 'Attributes', 'wcvendors' ),
|
| 139 |
-
'advanced' => __( 'Advanced', 'wcvendors' ),
|
| 140 |
-
),
|
| 141 |
-
'type' => 'checkbox',
|
| 142 |
-
'multiple' => true,
|
| 143 |
-
);
|
| 144 |
-
|
| 145 |
-
$options[ ] = array(
|
| 146 |
-
'name' => __( 'Types', 'wcvendors' ),
|
| 147 |
-
'desc' => __( 'CHECKING these boxes will HIDE these product types from the vendor', 'wcvendors' ),
|
| 148 |
-
'id' => 'hide_product_types',
|
| 149 |
-
'options' => array(
|
| 150 |
-
'simple' => __( 'Simple', 'wcvendors' ),
|
| 151 |
-
'variable' => __( 'Variable', 'wcvendors' ),
|
| 152 |
-
'grouped' => __( 'Grouped', 'wcvendors' ),
|
| 153 |
-
'external' => __( 'External / affiliate', 'wcvendors' ),
|
| 154 |
-
),
|
| 155 |
-
'type' => 'checkbox',
|
| 156 |
-
'multiple' => true,
|
| 157 |
-
);
|
| 158 |
-
|
| 159 |
-
$options[ ] = array(
|
| 160 |
-
'name' => __( 'Type options', 'wcvendors' ),
|
| 161 |
-
'desc' => __( 'CHECKING these boxes will **HIDE** these product options from the vendor', 'wcvendors' ),
|
| 162 |
-
'id' => 'hide_product_type_options',
|
| 163 |
-
'options' => array(
|
| 164 |
-
'virtual' => __( 'Virtual', 'wcvendors' ),
|
| 165 |
-
'downloadable' => __( 'Downloadable', 'wcvendors' ),
|
| 166 |
-
),
|
| 167 |
-
'type' => 'checkbox',
|
| 168 |
-
'multiple' => true,
|
| 169 |
-
);
|
| 170 |
-
|
| 171 |
-
$options[ ] = array(
|
| 172 |
-
'name' => __( 'Miscellaneous', 'wcvendors' ),
|
| 173 |
-
'id' => 'hide_product_misc',
|
| 174 |
-
'options' => array(
|
| 175 |
-
'taxes' => __( 'Taxes', 'wcvendors' ),
|
| 176 |
-
'sku' => __( 'SKU', 'wcvendors' ),
|
| 177 |
-
'featured' => __( 'Featured', 'wcvendors' ),
|
| 178 |
-
'duplicate' => __( 'Duplicate Product', 'wcvendors' ),
|
| 179 |
-
),
|
| 180 |
-
'type' => 'checkbox',
|
| 181 |
-
'multiple' => true,
|
| 182 |
-
);
|
| 183 |
-
|
| 184 |
-
$options[ ] = array(
|
| 185 |
-
'name' => __( 'Stylesheet', 'wcvendors' ),
|
| 186 |
-
'desc' => __( 'You can add CSS in this textarea, which will be loaded on the product add/edit page for vendors.', 'wcvendors' ),
|
| 187 |
-
'id' => 'product_page_css',
|
| 188 |
-
'type' => 'textarea',
|
| 189 |
-
);
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
$options[ ] = array( 'name' => __( 'Capabilities', 'wcvendors' ), 'type' => 'heading', 'id' => 'capabilities' );
|
| 193 |
-
$options[ ] = array( 'name' => __( 'Permissions', 'wcvendors' ), 'id' => 'permissions', 'type' => 'title', 'desc' => __( 'General permissions used around the shop', 'wcvendors' ) );
|
| 194 |
-
|
| 195 |
-
$options[ ] = array(
|
| 196 |
-
'name' => __( 'Orders', 'wcvendors' ),
|
| 197 |
-
'desc' => __( 'View orders', 'wcvendors' ),
|
| 198 |
-
'tip' => __( 'Show customer details such as email, address, name, etc, for each order', 'wcvendors' ),
|
| 199 |
-
'id' => 'can_show_orders',
|
| 200 |
-
'type' => 'checkbox',
|
| 201 |
-
'std' => true,
|
| 202 |
-
);
|
| 203 |
-
|
| 204 |
-
$options[ ] = array(
|
| 205 |
-
'desc' => __( 'View comments', 'wcvendors' ),
|
| 206 |
-
'tip' => __( 'View all vendor comments for an order on the frontend', 'wcvendors' ),
|
| 207 |
-
'id' => 'can_view_order_comments',
|
| 208 |
-
'type' => 'checkbox',
|
| 209 |
-
'std' => true,
|
| 210 |
-
);
|
| 211 |
-
|
| 212 |
-
$options[ ] = array(
|
| 213 |
-
'desc' => __( 'Submit comments', 'wcvendors' ),
|
| 214 |
-
'tip' => __( 'Submit comments for an order on the frontend. Eg, tracking ID for a product', 'wcvendors' ),
|
| 215 |
-
'id' => 'can_submit_order_comments',
|
| 216 |
-
'type' => 'checkbox',
|
| 217 |
-
'std' => true,
|
| 218 |
-
);
|
| 219 |
-
|
| 220 |
-
$options[ ] = array(
|
| 221 |
-
'desc' => __( 'View email addresses', 'wcvendors' ),
|
| 222 |
-
'tip' => __( 'While viewing order details on the frontend, you can disable or enable email addresses', 'wcvendors' ),
|
| 223 |
-
'id' => 'can_view_order_emails',
|
| 224 |
-
'type' => 'checkbox',
|
| 225 |
-
'std' => true,
|
| 226 |
-
);
|
| 227 |
-
|
| 228 |
-
$options[ ] = array(
|
| 229 |
-
'desc' => __( 'Export a CSV file of orders for a product', 'wcvendors' ),
|
| 230 |
-
'tip' => __( 'Vendors could export orders for a product on the frontend', 'wcvendors' ),
|
| 231 |
-
'id' => 'can_export_csv',
|
| 232 |
-
'type' => 'checkbox',
|
| 233 |
-
'std' => true,
|
| 234 |
-
);
|
| 235 |
-
|
| 236 |
-
$options[ ] = array(
|
| 237 |
-
'name' => __( 'Reports', 'wcvendors' ),
|
| 238 |
-
'desc' => __( '<strike>View backend sales reports</strike>. <strong>Depreciated</strong>', 'wcvendors' ),
|
| 239 |
-
'tip' => __( 'This option has been removed and will no longer function. It will be completely removed in future versions. Vendors should use their Vendor Dashboard for reports as all identical functionality is already there. ', 'wcvendors' ),
|
| 240 |
-
'id' => 'can_view_backend_reports',
|
| 241 |
-
'type' => 'checkbox',
|
| 242 |
-
'std' => false,
|
| 243 |
-
);
|
| 244 |
-
|
| 245 |
-
$options[ ] = array(
|
| 246 |
-
'desc' => __( 'View Frontend sales reports', 'wcvendors' ),
|
| 247 |
-
'tip' => __( 'Sales table on the frontend on the Vendor Dashboard page. The table will only display sales data that pertain to their products, and only for orders that are processing or completed.', 'wcvendors' ),
|
| 248 |
-
'id' => 'can_view_frontend_reports',
|
| 249 |
-
'type' => 'checkbox',
|
| 250 |
-
'std' => true,
|
| 251 |
-
);
|
| 252 |
-
|
| 253 |
-
$options[ ] = array(
|
| 254 |
-
'name' => __( 'Products', 'wcvendors' ),
|
| 255 |
-
'desc' => __( 'Submit products', 'wcvendors' ),
|
| 256 |
-
'tip' => __( 'Check to allow vendors to list new products. Admin must approve new products by editing the product, and clicking Publish.', 'wcvendors' ),
|
| 257 |
-
'id' => 'can_submit_products',
|
| 258 |
-
'type' => 'checkbox',
|
| 259 |
-
'std' => true,
|
| 260 |
-
);
|
| 261 |
-
|
| 262 |
-
$options[ ] = array(
|
| 263 |
-
'desc' => __( 'Edit live products', 'wcvendors' ),
|
| 264 |
-
'tip' => __( 'Vendors could edit an approved product after it has already gone live. There is no approval or review after editing a live product. This could be dangerous with malicious vendors, so take caution.', 'wcvendors' ),
|
| 265 |
-
'id' => 'can_edit_published_products',
|
| 266 |
-
'type' => 'checkbox',
|
| 267 |
-
'std' => false,
|
| 268 |
-
);
|
| 269 |
-
|
| 270 |
-
$options[ ] = array(
|
| 271 |
-
'desc' => __( 'Submit products live without requiring approval', 'wcvendors' ),
|
| 272 |
-
'tip' => __( 'Vendors can submit products without review or approval from a shop admin. This could be dangerous with malicious vendors, so take caution.', 'wcvendors' ),
|
| 273 |
-
'id' => 'can_submit_live_products',
|
| 274 |
-
'type' => 'checkbox',
|
| 275 |
-
'std' => false,
|
| 276 |
-
);
|
| 277 |
-
|
| 278 |
-
$options[ ] = array( 'name' => __( 'Pages', 'wcvendors' ), 'type' => 'heading' );
|
| 279 |
-
$options[ ] = array( 'name' => __( 'Page configuration', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 280 |
-
|
| 281 |
-
$options[ ] = array(
|
| 282 |
-
'name' => __( 'Vendor dashboard', 'wcvendors' ),
|
| 283 |
-
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</code><br/>. If this page is not set, you will break your site. If you upgrade to Pro, keep this page unchanged as both Pro Dashboard and this Dashboard page must be set.', 'wcvendors' ),
|
| 284 |
-
'id' => 'vendor_dashboard_page',
|
| 285 |
-
'type' => 'single_select_page',
|
| 286 |
-
'select2' => true,
|
| 287 |
-
);
|
| 288 |
-
|
| 289 |
-
$options[ ] = array(
|
| 290 |
-
'name' => __( 'Shop settings', 'wcvendors' ),
|
| 291 |
-
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/>These are the shop settings a vendor can configure. By default, Vendor Dashboard > Shop Settings should have this shortcode.', 'wcvendors' ),
|
| 292 |
-
'id' => 'shop_settings_page',
|
| 293 |
-
'type' => 'single_select_page',
|
| 294 |
-
'select2' => true,
|
| 295 |
-
);
|
| 296 |
-
|
| 297 |
-
$options[ ] = array(
|
| 298 |
-
'name' => __( 'Orders page', 'wcvendors' ),
|
| 299 |
-
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By default, Vendor Dashboard > Orders should have the shortcode.', 'wcvendors' ),
|
| 300 |
-
'id' => 'product_orders_page',
|
| 301 |
-
'type' => 'single_select_page',
|
| 302 |
-
'select2' => true,
|
| 303 |
-
);
|
| 304 |
-
|
| 305 |
-
$options[ ] = array(
|
| 306 |
-
'name' => __( 'Vendor terms', 'wcvendors' ),
|
| 307 |
-
'desc' => __( 'These terms are shown to a user when submitting an application to become a vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor must accept terms in order to register, if set.', 'wcvendors' ),
|
| 308 |
-
'id' => 'terms_to_apply_page',
|
| 309 |
-
'type' => 'single_select_page',
|
| 310 |
-
'select2' => true,
|
| 311 |
-
);
|
| 312 |
-
|
| 313 |
-
$total_due = 0;
|
| 314 |
-
if ( !empty( $_GET[ 'tab' ] ) && $_GET[ 'tab' ] == __( 'payments', 'wcvendors' ) ) {
|
| 315 |
-
global $wpdb;
|
| 316 |
-
|
| 317 |
-
$table_name = $wpdb->prefix . "pv_commission";
|
| 318 |
-
$query = "SELECT sum(total_due + total_shipping + tax) as total
|
| 319 |
-
FROM `{$table_name}`
|
| 320 |
-
WHERE status = %s";
|
| 321 |
-
$results = $wpdb->get_results( $wpdb->prepare( $query, 'due' ) );
|
| 322 |
-
|
| 323 |
-
$total_due = array_shift( $results )->total;
|
| 324 |
-
}
|
| 325 |
-
$options[ ] = array( 'name' => __( 'Payments', 'wcvendors' ), 'type' => 'heading' );
|
| 326 |
-
$options[ ] = array(
|
| 327 |
-
'name' => __( 'PayPal Adaptive Payments Scheduling - PayPal MassPay has been depreciated by PayPal as of September 2017', 'wcvendors' ), 'type' => 'title', 'desc' =>
|
| 328 |
-
sprintf( __( 'Total commission currently due: %s. <a href="%s">View details</a>.', 'wcvendors' ), !function_exists( 'wc_price' ) ? $total_due : wc_price( $total_due ), '?page=pv_admin_commissions' ) .
|
| 329 |
-
'<br/><br/>' . sprintf( __( 'Make sure you update your PayPal Adaptive Payments settings <a href="%s">here</a>. <br><br>To instantly pay with Adaptive Payments you must activate the PayPal AP gateway in your Checkout settings. <br><a href="https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/" target="top">PayPal AP Application Help</a>. <br><br>Another gateway that offers instant payments to vendors that also accepts credit cards directly on your checkout page is Stripe. <br><a href="https://www.wcvendors.com/product/stripe-commissions-gateway/" target="top">Stripe Commissions & Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a href="https://www.wcvendors.com/product/wc-vendors-pro/" target="top">WC Vendors Pro</a>.', 'wcvendors' ), 'admin.php?page=wc-settings&tab=checkout§ion=wc_paypalap' )
|
| 330 |
-
);
|
| 331 |
-
|
| 332 |
-
$options[ ] = array(
|
| 333 |
-
'name' => __( 'Instant pay', 'wcvendors' ),
|
| 334 |
-
'desc' => __( 'Instantly pay vendors their commission when an order is made, and if a vendor has a valid PayPal email added on their Shop Settings page.', 'wcvendors' ),
|
| 335 |
-
'tip' => __( 'For this to work, customers must checkout with the PayPal Adaptive Payments gateway. Using any other gateways will not pay vendors instantly', 'wcvendors' ),
|
| 336 |
-
'id' => 'instapay',
|
| 337 |
-
'type' => 'checkbox',
|
| 338 |
-
'std' => true,
|
| 339 |
-
);
|
| 340 |
-
|
| 341 |
-
$options[ ] = array(
|
| 342 |
-
'name' => __( 'Payment schedule', 'wcvendors' ),
|
| 343 |
-
'desc' => __( 'Note: Schedule will only work if instant pay is unchecked', 'wcvendors' ),
|
| 344 |
-
'id' => 'schedule',
|
| 345 |
-
'type' => 'radio',
|
| 346 |
-
'std' => 'manual',
|
| 347 |
-
'options' => array(
|
| 348 |
-
'daily' => __( 'Daily', 'wcvendors' ),
|
| 349 |
-
'weekly' => __( 'Weekly', 'wcvendors' ),
|
| 350 |
-
'biweekly' => __( 'Biweekly', 'wcvendors' ),
|
| 351 |
-
'monthly' => __( 'Monthly', 'wcvendors' ),
|
| 352 |
-
'manual' => __( 'Manual', 'wcvendors' ),
|
| 353 |
-
'now' => '<span style="color:green;"><strong>' . __( 'Now', 'wcvendors' ) . '</strong></span>',
|
| 354 |
-
)
|
| 355 |
-
);
|
| 356 |
-
|
| 357 |
-
$options[ ] = array(
|
| 358 |
-
'name' => __( 'Email notification', 'wcvendors' ),
|
| 359 |
-
'desc' => __( 'Send the WooCommerce admin an email each time a payment has been made via the payment schedule options above', 'wcvendors' ),
|
| 360 |
-
'id' => 'mail_mass_pay_results',
|
| 361 |
-
'type' => 'checkbox',
|
| 362 |
-
'std' => true,
|
| 363 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
classes/class-install.php
CHANGED
|
@@ -497,8 +497,8 @@ class WCVendors_Install {
|
|
| 497 |
$row_meta = array(
|
| 498 |
'docs' => '<a href="' . esc_url( apply_filters( 'wcvendors_docs_url', 'https://docs.wcvendors.com/' ) ) . '" aria-label="' . esc_attr__( 'View WC Vendors documentation', 'wc-vendors' ) . '">' . esc_html__( 'Docs', 'wc-vendors' ) . '</a>',
|
| 499 |
'free-support' => '<a href="' . esc_url( apply_filters( 'wcvendors_free_support_url', 'https://wordpress.org/plugins/wc-vendors' ) ) . '" aria-label="' . esc_attr__( 'Visit community forums', 'wc-vendors' ) . '">' . esc_html__( 'Free support', 'wc-vendors' ) . '</a>',
|
| 500 |
-
'support' => '<a href="' . esc_url( apply_filters( 'wcvendors_support_url', 'https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_campaign=premium_support' ) ) . '" aria-label="' . esc_attr__( 'Buy premium customer support', 'wc-vendors' ) . '">' . esc_html__( 'Premium support', 'wc-vendors' ) . '</a>',
|
| 501 |
-
'pro' => '<strong><a href="https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_campaign=upgrade_promo" target="_blank">' . __( 'Upgrade to Pro', 'wcvendors' ) . '</a></strong>',
|
| 502 |
);
|
| 503 |
|
| 504 |
if ( class_exists( 'WCVendors_Pro' ) ) {
|
| 497 |
$row_meta = array(
|
| 498 |
'docs' => '<a href="' . esc_url( apply_filters( 'wcvendors_docs_url', 'https://docs.wcvendors.com/' ) ) . '" aria-label="' . esc_attr__( 'View WC Vendors documentation', 'wc-vendors' ) . '">' . esc_html__( 'Docs', 'wc-vendors' ) . '</a>',
|
| 499 |
'free-support' => '<a href="' . esc_url( apply_filters( 'wcvendors_free_support_url', 'https://wordpress.org/plugins/wc-vendors' ) ) . '" aria-label="' . esc_attr__( 'Visit community forums', 'wc-vendors' ) . '">' . esc_html__( 'Free support', 'wc-vendors' ) . '</a>',
|
| 500 |
+
'support' => '<a href="' . esc_url( apply_filters( 'wcvendors_support_url', 'https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_medium=settings_page&utm_campaign=premium_support' ) ) . '" aria-label="' . esc_attr__( 'Buy premium customer support', 'wc-vendors' ) . '">' . esc_html__( 'Premium support', 'wc-vendors' ) . '</a>',
|
| 501 |
+
'pro' => '<strong><a href="https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_medium=settings_page&utm_campaign=upgrade_promo" target="_blank">' . __( 'Upgrade to Pro', 'wcvendors' ) . '</a></strong>',
|
| 502 |
);
|
| 503 |
|
| 504 |
if ( class_exists( 'WCVendors_Pro' ) ) {
|
classes/class-vendors.php
CHANGED
|
@@ -17,6 +17,7 @@ class WCV_Vendors {
|
|
| 17 |
|
| 18 |
add_action( 'woocommerce_checkout_order_processed', array( __CLASS__, 'create_child_orders' ), 10, 1 );
|
| 19 |
add_filter( 'init', array( $this, 'add_rewrite_rules' ), 0 );
|
|
|
|
| 20 |
}
|
| 21 |
|
| 22 |
/**
|
|
@@ -765,6 +766,32 @@ class WCV_Vendors {
|
|
| 765 |
|
| 766 |
}
|
| 767 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 768 |
/**
|
| 769 |
* Moved to vendors class
|
| 770 |
*
|
| 17 |
|
| 18 |
add_action( 'woocommerce_checkout_order_processed', array( __CLASS__, 'create_child_orders' ), 10, 1 );
|
| 19 |
add_filter( 'init', array( $this, 'add_rewrite_rules' ), 0 );
|
| 20 |
+
add_action( 'delete_post', array( $this, 'remove_child_orders' ), 10, 1 );
|
| 21 |
}
|
| 22 |
|
| 23 |
/**
|
| 766 |
|
| 767 |
}
|
| 768 |
|
| 769 |
+
/**
|
| 770 |
+
* Remove child orders if the parent order is deleted
|
| 771 |
+
*
|
| 772 |
+
* @since 2.1.13
|
| 773 |
+
* @access public
|
| 774 |
+
*/
|
| 775 |
+
public function remove_child_orders( $post_id ){
|
| 776 |
+
|
| 777 |
+
$post_type = get_post_type( $post_id );
|
| 778 |
+
|
| 779 |
+
if ( 'shop_order' !== $post_type ) return;
|
| 780 |
+
|
| 781 |
+
$child_orders = get_children(
|
| 782 |
+
array(
|
| 783 |
+
'post_parent' => $post_id,
|
| 784 |
+
'post_type' => 'shop_order_vendor'
|
| 785 |
+
)
|
| 786 |
+
);
|
| 787 |
+
|
| 788 |
+
if ( empty( $child_orders ) ) return;
|
| 789 |
+
|
| 790 |
+
foreach ( $child_orders as $child_order ) {
|
| 791 |
+
wp_delete_post( $child_order->ID, true );
|
| 792 |
+
}
|
| 793 |
+
}
|
| 794 |
+
|
| 795 |
/**
|
| 796 |
* Moved to vendors class
|
| 797 |
*
|
classes/front/account/class-wc-account-links.php
CHANGED
|
@@ -49,17 +49,19 @@ class WCV_Account_Links extends WCV_Vendor_Signup {
|
|
| 49 |
*/
|
| 50 |
public function add_account_menu_items( $items ) {
|
| 51 |
|
| 52 |
-
$become_a_vendor_label = get_option( 'wcvendors_label_become_a_vendor', __( 'Become a
|
| 53 |
|
| 54 |
$add_items = apply_filters(
|
| 55 |
-
'wcv_become_a_vendor_string',
|
|
|
|
| 56 |
'become-a-vendor' => sprintf( __( '%s %s', 'wc-vendors' ), $become_a_vendor_label, wcv_get_vendor_name() )
|
| 57 |
)
|
| 58 |
);
|
| 59 |
-
|
|
|
|
| 60 |
$first_part = array_slice( $items, 0, count( $items ) - 1, true );
|
| 61 |
$last_part = array_slice( $items, count( $items ) - 1, true );
|
| 62 |
-
// put the arrays together putting the logout link at the end
|
| 63 |
$items = $first_part + $add_items + $last_part;
|
| 64 |
|
| 65 |
return $items;
|
| 49 |
*/
|
| 50 |
public function add_account_menu_items( $items ) {
|
| 51 |
|
| 52 |
+
$become_a_vendor_label = __( get_option( 'wcvendors_label_become_a_vendor', __( 'Become a', 'wc-vendors' ) ), 'wc-vendors' );
|
| 53 |
|
| 54 |
$add_items = apply_filters(
|
| 55 |
+
'wcv_become_a_vendor_string',
|
| 56 |
+
array(
|
| 57 |
'become-a-vendor' => sprintf( __( '%s %s', 'wc-vendors' ), $become_a_vendor_label, wcv_get_vendor_name() )
|
| 58 |
)
|
| 59 |
);
|
| 60 |
+
|
| 61 |
+
// slice the array so the logout link goes at the end of the list.
|
| 62 |
$first_part = array_slice( $items, 0, count( $items ) - 1, true );
|
| 63 |
$last_part = array_slice( $items, count( $items ) - 1, true );
|
| 64 |
+
// put the arrays together putting the logout link at the end.
|
| 65 |
$items = $first_part + $add_items + $last_part;
|
| 66 |
|
| 67 |
return $items;
|
classes/front/class-vendor-cart.php
CHANGED
|
@@ -37,8 +37,8 @@ class WCV_Vendor_Cart {
|
|
| 37 |
$product_id = $cart_item['product_id'];
|
| 38 |
$post = get_post( $product_id );
|
| 39 |
$vendor_id = $post->post_author;
|
| 40 |
-
$sold_by_label = get_option( 'wcvendors_label_sold_by' );
|
| 41 |
-
$sold_by_separator = get_option( 'wcvendors_label_sold_by_separator' );
|
| 42 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 43 |
? sprintf( '<a href="%s" target="_TOP">%s </a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 44 |
: get_bloginfo( 'name' );
|
|
@@ -58,8 +58,8 @@ class WCV_Vendor_Cart {
|
|
| 58 |
public static function sold_by_meta() {
|
| 59 |
|
| 60 |
$vendor_id = get_the_author_meta( 'ID' );
|
| 61 |
-
$sold_by_label = get_option( 'wcvendors_label_sold_by' );
|
| 62 |
-
$sold_by_separator = get_option( 'wcvendors_label_sold_by_separator' );
|
| 63 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 64 |
? sprintf( '<a href="%s" class="wcvendors_cart_sold_by_meta">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 65 |
: get_bloginfo( 'name' );
|
| 37 |
$product_id = $cart_item['product_id'];
|
| 38 |
$post = get_post( $product_id );
|
| 39 |
$vendor_id = $post->post_author;
|
| 40 |
+
$sold_by_label = __( get_option( 'wcvendors_label_sold_by' ), 'wc-vendors' );
|
| 41 |
+
$sold_by_separator = __( get_option( 'wcvendors_label_sold_by_separator' ), 'wc-vendors' );
|
| 42 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 43 |
? sprintf( '<a href="%s" target="_TOP">%s </a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 44 |
: get_bloginfo( 'name' );
|
| 58 |
public static function sold_by_meta() {
|
| 59 |
|
| 60 |
$vendor_id = get_the_author_meta( 'ID' );
|
| 61 |
+
$sold_by_label = __( get_option( 'wcvendors_label_sold_by' ), 'wc-vendors' );
|
| 62 |
+
$sold_by_separator = __( get_option( 'wcvendors_label_sold_by_separator' ), 'wc-vendors' );
|
| 63 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 64 |
? sprintf( '<a href="%s" class="wcvendors_cart_sold_by_meta">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 65 |
: get_bloginfo( 'name' );
|
classes/front/class-vendor-shop.php
CHANGED
|
@@ -111,7 +111,7 @@ class WCV_Vendor_Shop {
|
|
| 111 |
$has_html = get_user_meta( $post->post_author, 'pv_shop_html_enabled', true );
|
| 112 |
$global_html = get_option( 'wcvendors_display_shop_description_html' );
|
| 113 |
|
| 114 |
-
$seller_info_label = get_option( 'wcvendors_display_label_store_info' );
|
| 115 |
|
| 116 |
// Run the built in WordPress oEmbed on the seller info if html is enabled.
|
| 117 |
if ( $global_html || $has_html ) {
|
|
@@ -154,7 +154,7 @@ class WCV_Vendor_Shop {
|
|
| 154 |
*/
|
| 155 |
public static function shop_description() {
|
| 156 |
|
| 157 |
-
if ( ! wc_string_to_bool( get_option( '
|
| 158 |
|
| 159 |
$vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
|
| 160 |
$vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
|
|
@@ -207,8 +207,8 @@ class WCV_Vendor_Shop {
|
|
| 207 |
public static function template_loop_sold_by( $product_id ) {
|
| 208 |
|
| 209 |
$vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 210 |
-
$sold_by_label = get_option( 'wcvendors_label_sold_by' );
|
| 211 |
-
$sold_by_separator = get_option( 'wcvendors_label_sold_by_separator' );
|
| 212 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 213 |
? sprintf( '<a href="%s">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 214 |
: get_bloginfo( 'name' );
|
|
@@ -339,7 +339,7 @@ class WCV_Vendor_Shop {
|
|
| 339 |
$cart_item = $cart[ $cart_item_key ];
|
| 340 |
$product_id = $cart_item['product_id'];
|
| 341 |
$vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 342 |
-
$sold_by_label = get_option( 'wcvendors_label_sold_by' );
|
| 343 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ) : get_bloginfo( 'name' );
|
| 344 |
|
| 345 |
$item->add_meta_data( apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by, true );
|
| 111 |
$has_html = get_user_meta( $post->post_author, 'pv_shop_html_enabled', true );
|
| 112 |
$global_html = get_option( 'wcvendors_display_shop_description_html' );
|
| 113 |
|
| 114 |
+
$seller_info_label = __( get_option( 'wcvendors_display_label_store_info' ), 'wc-vendors' );
|
| 115 |
|
| 116 |
// Run the built in WordPress oEmbed on the seller info if html is enabled.
|
| 117 |
if ( $global_html || $has_html ) {
|
| 154 |
*/
|
| 155 |
public static function shop_description() {
|
| 156 |
|
| 157 |
+
if ( ! wc_string_to_bool( get_option( 'wcvendors_display_shop_description', 'no' ) ) ) return;
|
| 158 |
|
| 159 |
$vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
|
| 160 |
$vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
|
| 207 |
public static function template_loop_sold_by( $product_id ) {
|
| 208 |
|
| 209 |
$vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 210 |
+
$sold_by_label = __( get_option( 'wcvendors_label_sold_by' ), 'wc-vendors' );
|
| 211 |
+
$sold_by_separator = __( get_option( 'wcvendors_label_sold_by_separator' ), 'wc-vendors' );
|
| 212 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 213 |
? sprintf( '<a href="%s">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 214 |
: get_bloginfo( 'name' );
|
| 339 |
$cart_item = $cart[ $cart_item_key ];
|
| 340 |
$product_id = $cart_item['product_id'];
|
| 341 |
$vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 342 |
+
$sold_by_label = __( get_option( 'wcvendors_label_sold_by' ), 'wc-vendors' );
|
| 343 |
$sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ) : get_bloginfo( 'name' );
|
| 344 |
|
| 345 |
$item->add_meta_data( apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by, true );
|
classes/front/signup/class-vendor-signup.php
CHANGED
|
@@ -42,7 +42,7 @@ class WCV_Vendor_Signup {
|
|
| 42 |
*/
|
| 43 |
public function vendor_option() {
|
| 44 |
|
| 45 |
-
$become_a_vendor_label = strtolower( get_option( 'wcvendors_label_become_a_vendor', __( 'Become a ', 'wc-vendors' ) ) );
|
| 46 |
|
| 47 |
apply_filters( 'wcvendors_vendor_signup_path', include_once 'views/html-vendor-signup.php' );
|
| 48 |
}
|
| 42 |
*/
|
| 43 |
public function vendor_option() {
|
| 44 |
|
| 45 |
+
$become_a_vendor_label = strtolower( __( get_option( 'wcvendors_label_become_a_vendor', __( 'Become a ', 'wc-vendors' ) ), 'wc-vendors' ) );
|
| 46 |
|
| 47 |
apply_filters( 'wcvendors_vendor_signup_path', include_once 'views/html-vendor-signup.php' );
|
| 48 |
}
|
classes/includes/class-functions.php
CHANGED
|
@@ -39,7 +39,7 @@ function wcv_get_vendor_name( $singluar = true, $upper_case = true ) {
|
|
| 39 |
$vendor_singular = get_option( 'wcvendors_vendor_singular', __( 'Vendor', 'wc-vendors' ) );
|
| 40 |
$vendor_plural = get_option( 'wcvendors_vendor_plural', __( 'Vendors', 'wc-vendors' ) );
|
| 41 |
|
| 42 |
-
$vendor_label = $singluar ? $vendor_singular : $vendor_plural;
|
| 43 |
$vendor_label = $upper_case ? ucfirst( $vendor_label ) : lcfirst( $vendor_label );
|
| 44 |
|
| 45 |
return apply_filters( 'wcv_vendor_display_name', $vendor_label, $vendor_singular, $vendor_plural, $singluar, $upper_case );
|
| 39 |
$vendor_singular = get_option( 'wcvendors_vendor_singular', __( 'Vendor', 'wc-vendors' ) );
|
| 40 |
$vendor_plural = get_option( 'wcvendors_vendor_plural', __( 'Vendors', 'wc-vendors' ) );
|
| 41 |
|
| 42 |
+
$vendor_label = $singluar ? __( $vendor_singular, 'wc-vendors' ) : __( $vendor_plural, 'wc-vendors' );
|
| 43 |
$vendor_label = $upper_case ? ucfirst( $vendor_label ) : lcfirst( $vendor_label );
|
| 44 |
|
| 45 |
return apply_filters( 'wcv_vendor_display_name', $vendor_label, $vendor_singular, $vendor_plural, $singluar, $upper_case );
|
classes/includes/class-wcv-shortcodes.php
CHANGED
|
@@ -741,8 +741,8 @@ class WCV_Shortcodes {
|
|
| 741 |
$atts = shortcode_atts(
|
| 742 |
array(
|
| 743 |
'vendor_id' => get_the_author_meta( 'ID' ),
|
| 744 |
-
'sold_by_label' => get_option( 'wcvendors_label_sold_by' ),
|
| 745 |
-
'sold_by_separator' => get_option( 'wcvendors_label_sold_by_separator' ),
|
| 746 |
),
|
| 747 |
$atts,
|
| 748 |
'wcv_sold_by'
|
| 741 |
$atts = shortcode_atts(
|
| 742 |
array(
|
| 743 |
'vendor_id' => get_the_author_meta( 'ID' ),
|
| 744 |
+
'sold_by_label' => __( get_option( 'wcvendors_label_sold_by' ), 'wc-vendors' ),
|
| 745 |
+
'sold_by_separator' => __( get_option( 'wcvendors_label_sold_by_separator' ), 'wc-vendors' ),
|
| 746 |
),
|
| 747 |
$atts,
|
| 748 |
'wcv_sold_by'
|
gulpfile.js
DELETED
|
@@ -1,47 +0,0 @@
|
|
| 1 |
-
// Load the dependencies
|
| 2 |
-
var gulp = require('gulp'),
|
| 3 |
-
sass = require('gulp-sass'),
|
| 4 |
-
autoprefixer = require('gulp-autoprefixer'),
|
| 5 |
-
minifycss = require('gulp-clean-css'),
|
| 6 |
-
jshint = require('gulp-jshint'),
|
| 7 |
-
uglify = require('gulp-uglify'),
|
| 8 |
-
rename = require('gulp-rename'),
|
| 9 |
-
concat = require('gulp-concat'),
|
| 10 |
-
notify = require('gulp-notify'),
|
| 11 |
-
cache = require('gulp-cache'),
|
| 12 |
-
livereload = require('gulp-livereload'),
|
| 13 |
-
del = require('del'),
|
| 14 |
-
wpPot = require('gulp-wp-pot'),
|
| 15 |
-
sort = require('gulp-sort'),
|
| 16 |
-
pump = require('pump');
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
// Styles
|
| 20 |
-
gulp.task('styles', function(cb) {
|
| 21 |
-
pump([
|
| 22 |
-
gulp.src( 'assets/css/*.scss' ),
|
| 23 |
-
sass( { 'sourcemap=none': true, outputStyle: 'compact' } ),
|
| 24 |
-
autoprefixer('last 2 version', 'safari 5', 'ie 8', 'ie 9', 'opera 12.1', 'ios 6', 'android 4'),
|
| 25 |
-
gulp.dest('assets/css'),
|
| 26 |
-
rename({suffix: '.min'}),
|
| 27 |
-
minifycss(),
|
| 28 |
-
gulp.dest('assets/css')
|
| 29 |
-
], cb);
|
| 30 |
-
});
|
| 31 |
-
|
| 32 |
-
// i18n files
|
| 33 |
-
gulp.task('build-i18n-pot', function () {
|
| 34 |
-
return gulp.src([ 'classes/**/*.php', 'templates/**/*.php', '*.php' ] )
|
| 35 |
-
.pipe( sort() )
|
| 36 |
-
.pipe( wpPot( {
|
| 37 |
-
domain: 'wc-vendors',
|
| 38 |
-
package: 'WC Vendors Marketplace',
|
| 39 |
-
bugReport: 'https://www.wcvendors.com',
|
| 40 |
-
lastTranslator: 'Jamie Madden <translate@wcvendors.com>',
|
| 41 |
-
team: 'WC Vendors <translate@wcvendors.com>'
|
| 42 |
-
} ) )
|
| 43 |
-
.pipe( gulp.dest('languages/wc-vendors.pot') );
|
| 44 |
-
});
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
gulp.task( 'default', [ 'styles', 'build-i18n-pot' ] );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/default.mo
DELETED
|
Binary file
|
languages/default.pot
DELETED
|
@@ -1,2434 +0,0 @@
|
|
| 1 |
-
# Copyright (C) 2018 wc-vendors
|
| 2 |
-
# This file is distributed under the same license as the wc-vendors package.
|
| 3 |
-
msgid ""
|
| 4 |
-
msgstr ""
|
| 5 |
-
"Project-Id-Version: wc-vendors\n"
|
| 6 |
-
"Report-Msgid-Bugs-To: https://www.wcvendors.com\n"
|
| 7 |
-
"MIME-Version: 1.0\n"
|
| 8 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 9 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 10 |
-
"PO-Revision-Date: 2018-MO-DA HO:MI+ZONE\n"
|
| 11 |
-
"Last-Translator: Jamie Madden <translate@wcvendors.com>\n"
|
| 12 |
-
"Language-Team: WC Vendors <translate@wcvendors.com>\n"
|
| 13 |
-
"X-Poedit-Basepath: ..\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-KeywordsList: __;_e;_n:1,2;_x:1,2c;_ex:1,2c;_nx:4c,1,2;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c;_n_noop:1,2;_nx_noop:3c,1,2;__ngettext_noop:1,2\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: .\n"
|
| 17 |
-
"X-Poedit-SearchPathExcluded-0: *.js\n"
|
| 18 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 19 |
-
#: class-wc-vendors.php:105
|
| 20 |
-
msgid "WC Vendors requires WooCommerce to run. Please install WooCommerce and activate before attempting to activate again."
|
| 21 |
-
msgstr ""
|
| 22 |
-
|
| 23 |
-
#: class-wc-vendors.php:205, classes/admin/class-admin-menus.php:41, classes/admin/class-admin-menus.php:41, classes/admin/class-admin-reports.php:41, classes/admin/class-admin-users.php:384
|
| 24 |
-
msgid "WC Vendors"
|
| 25 |
-
msgstr ""
|
| 26 |
-
|
| 27 |
-
#: class-wc-vendors.php:263
|
| 28 |
-
msgid "<b>WC Vendors is inactive</b>. WC Vendors requires a minimum of WooCommerce 3.0.0 to operate."
|
| 29 |
-
msgstr ""
|
| 30 |
-
|
| 31 |
-
#: class-wc-vendors.php:603, classes/admin/class-setup-wizard.php:74, classes/admin/settings/class-wcv-settings-capabilities.php:31, classes/admin/settings/sf-options.php:192
|
| 32 |
-
msgid "Capabilities"
|
| 33 |
-
msgstr ""
|
| 34 |
-
|
| 35 |
-
#: class-wc-vendors.php:647, classes/admin/class-admin-reports.php:178, classes/admin/class-admin-reports.php:461, classes/admin/class-product-meta.php:46, classes/admin/class-product-meta.php:187, classes/admin/class-product-meta.php:223, classes/admin/class-wcv-admin-setup.php:154, classes/admin/class-wcv-commissions-csv-exporter.php:43, classes/admin/class-wcv-commissions-page.php:121, classes/class-install.php:124, classes/includes/class-functions.php:55
|
| 36 |
-
msgid "Vendor"
|
| 37 |
-
msgstr ""
|
| 38 |
-
|
| 39 |
-
#: class-wc-vendors.php:651, classes/admin/settings/class-wcv-settings-capabilities.php:43, classes/admin/settings/class-wcv-settings-capabilities.php:105, classes/admin/settings/class-wcv-settings-commission.php:43, classes/admin/settings/class-wcv-settings-display.php:43, classes/admin/settings/class-wcv-settings-general.php:31, classes/admin/settings/class-wcv-settings-general.php:43, classes/admin/settings/class-wcv-settings-payments.php:43, classes/admin/settings/sf-options.php:4, classes/admin/views/setup/general.php:19
|
| 40 |
-
msgid "General"
|
| 41 |
-
msgstr ""
|
| 42 |
-
|
| 43 |
-
#: class-wc-vendors.php:729
|
| 44 |
-
msgid "Documentation"
|
| 45 |
-
msgstr ""
|
| 46 |
-
|
| 47 |
-
#: class-wc-vendors.php:731, class-wc-vendors.php:869
|
| 48 |
-
msgid "Upgrade to Pro"
|
| 49 |
-
msgstr ""
|
| 50 |
-
|
| 51 |
-
#: class-wc-vendors.php:733
|
| 52 |
-
msgid "Contact Us"
|
| 53 |
-
msgstr ""
|
| 54 |
-
|
| 55 |
-
#: class-wc-vendors.php:875
|
| 56 |
-
msgid "Upgrade to WC Vendors Pro!"
|
| 57 |
-
msgstr ""
|
| 58 |
-
|
| 59 |
-
#: class-wc-vendors.php:879
|
| 60 |
-
msgid ""
|
| 61 |
-
"WC Vendors Pro extends your marketplace to include some of the following enhanced features
|
| 62 |
-
" <ul>
|
| 63 |
-
" <li>Complete front end dashboard for your vendors</li>
|
| 64 |
-
" <li>Vendor Coupons</li>
|
| 65 |
-
" <li>Vendor product management</li>
|
| 66 |
-
" <li>Vendor Order management</li>
|
| 67 |
-
" <li>Vendor ratings</li>
|
| 68 |
-
" <li>Vendors can upload their own store banners</li>
|
| 69 |
-
" <li>A comprehensive shipping system for your vendors including two systems. Flat rate and Table rate shipping.</li>
|
| 70 |
-
" <li>All default product types supported on the front end</li>
|
| 71 |
-
" <li>Custom product-edit templates</li>
|
| 72 |
-
" <li>Complete vendor signup form</li>
|
| 73 |
-
" </ul>
|
| 74 |
-
" <a href=\"http://www.wcvendors.com/home/comparison/?utm_source=plugin\">See the complete comparison list here.</a>
|
| 75 |
-
" <h1><a href=\"https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_campaign=upgrade_promo\">Buy Pro Today</a></h1>"
|
| 76 |
-
msgstr ""
|
| 77 |
-
|
| 78 |
-
#: classes/admin/class-admin-menus.php:48
|
| 79 |
-
msgid "WC Vendors Extensions"
|
| 80 |
-
msgstr ""
|
| 81 |
-
|
| 82 |
-
#: classes/admin/class-admin-menus.php:48, classes/admin/views/setup/ready.php:65
|
| 83 |
-
msgid "Extensions"
|
| 84 |
-
msgstr ""
|
| 85 |
-
|
| 86 |
-
#: classes/admin/class-admin-reports.php:44
|
| 87 |
-
msgid "Overview"
|
| 88 |
-
msgstr ""
|
| 89 |
-
|
| 90 |
-
#: classes/admin/class-admin-reports.php:50
|
| 91 |
-
msgid "Commission by vendor"
|
| 92 |
-
msgstr ""
|
| 93 |
-
|
| 94 |
-
#: classes/admin/class-admin-reports.php:56
|
| 95 |
-
msgid "Commission by product"
|
| 96 |
-
msgstr ""
|
| 97 |
-
|
| 98 |
-
#: classes/admin/class-admin-reports.php:62, classes/admin/class-admin-reports.php:348
|
| 99 |
-
msgid "Commission Totals"
|
| 100 |
-
msgstr ""
|
| 101 |
-
|
| 102 |
-
#: classes/admin/class-admin-reports.php:63
|
| 103 |
-
msgid "Commission totals for all vendors includes shipping and taxes. By default no date range is used and all due commissions are returned. Use the date range to filter."
|
| 104 |
-
msgstr ""
|
| 105 |
-
|
| 106 |
-
#: classes/admin/class-admin-reports.php:124, classes/admin/class-admin-reports.php:440, templates/dashboard/date-picker.php:3
|
| 107 |
-
msgid "From:"
|
| 108 |
-
msgstr ""
|
| 109 |
-
|
| 110 |
-
#: classes/admin/class-admin-reports.php:126, classes/admin/class-admin-reports.php:442, templates/dashboard/date-picker.php:7
|
| 111 |
-
msgid "To:"
|
| 112 |
-
msgstr ""
|
| 113 |
-
|
| 114 |
-
#: classes/admin/class-admin-reports.php:128, classes/admin/class-admin-reports.php:286, classes/admin/class-admin-reports.php:451, templates/dashboard/date-picker.php:12
|
| 115 |
-
msgid "Show"
|
| 116 |
-
msgstr ""
|
| 117 |
-
|
| 118 |
-
#: classes/admin/class-admin-reports.php:134
|
| 119 |
-
msgid "Total paid in range"
|
| 120 |
-
msgstr ""
|
| 121 |
-
|
| 122 |
-
#: classes/admin/class-admin-reports.php:137, classes/admin/class-admin-reports.php:144, classes/admin/class-admin-reports.php:151
|
| 123 |
-
msgid "n/a"
|
| 124 |
-
msgstr ""
|
| 125 |
-
|
| 126 |
-
#: classes/admin/class-admin-reports.php:141
|
| 127 |
-
msgid "Total due in range"
|
| 128 |
-
msgstr ""
|
| 129 |
-
|
| 130 |
-
#: classes/admin/class-admin-reports.php:148
|
| 131 |
-
msgid "Total reversed in range"
|
| 132 |
-
msgstr ""
|
| 133 |
-
|
| 134 |
-
#: classes/admin/class-admin-reports.php:158
|
| 135 |
-
msgid "Recent Commission"
|
| 136 |
-
msgstr ""
|
| 137 |
-
|
| 138 |
-
#: classes/admin/class-admin-reports.php:176, classes/front/orders/class-orders.php:249, templates/dashboard/orders.php:44
|
| 139 |
-
msgid "Order"
|
| 140 |
-
msgstr ""
|
| 141 |
-
|
| 142 |
-
#: classes/admin/class-admin-reports.php:177, classes/admin/class-wcv-commissions-csv-exporter.php:41, classes/admin/class-wcv-commissions-page.php:119, templates/dashboard/reports.php:17, templates/emails/notify-vendor-shipped.php:26, templates/emails/vendor-new-order.php:30
|
| 143 |
-
msgid "Product"
|
| 144 |
-
msgstr ""
|
| 145 |
-
|
| 146 |
-
#: classes/admin/class-admin-reports.php:179, classes/admin/class-admin-reports.php:377, classes/admin/class-vendor-admin-dashboard.php:325, classes/admin/class-wcv-commissions-csv-exporter.php:47, classes/admin/class-wcv-commissions-page.php:125, templates/dashboard/orders.php:46
|
| 147 |
-
msgid "Total"
|
| 148 |
-
msgstr ""
|
| 149 |
-
|
| 150 |
-
#: classes/admin/class-admin-reports.php:180
|
| 151 |
-
msgid "Date & Time"
|
| 152 |
-
msgstr ""
|
| 153 |
-
|
| 154 |
-
#: classes/admin/class-admin-reports.php:181, classes/admin/class-admin-reports.php:464, classes/admin/class-wcv-commissions-csv-exporter.php:48, classes/admin/class-wcv-commissions-page.php:126
|
| 155 |
-
msgid "Status"
|
| 156 |
-
msgstr ""
|
| 157 |
-
|
| 158 |
-
#: classes/admin/class-admin-reports.php:189
|
| 159 |
-
msgid "N/A"
|
| 160 |
-
msgstr ""
|
| 161 |
-
|
| 162 |
-
#: classes/admin/class-admin-reports.php:194
|
| 163 |
-
msgid "D j M Y at h:ia"
|
| 164 |
-
msgstr ""
|
| 165 |
-
|
| 166 |
-
#: classes/admin/class-admin-reports.php:203
|
| 167 |
-
msgid "No commission yet"
|
| 168 |
-
msgstr ""
|
| 169 |
-
|
| 170 |
-
#: classes/admin/class-admin-reports.php:237
|
| 171 |
-
msgid "Show:"
|
| 172 |
-
msgstr ""
|
| 173 |
-
|
| 174 |
-
#: classes/admin/class-admin-reports.php:249
|
| 175 |
-
msgid "Type in a product name to start searching..."
|
| 176 |
-
msgstr ""
|
| 177 |
-
|
| 178 |
-
#: classes/admin/class-admin-reports.php:281
|
| 179 |
-
msgid "Select a vendor…"
|
| 180 |
-
msgstr ""
|
| 181 |
-
|
| 182 |
-
#: classes/admin/class-admin-reports.php:347
|
| 183 |
-
msgid "Month"
|
| 184 |
-
msgstr ""
|
| 185 |
-
|
| 186 |
-
#: classes/admin/class-admin-reports.php:349, classes/admin/class-wcv-commissions-csv-exporter.php:46, classes/admin/class-wcv-commissions-page.php:124
|
| 187 |
-
msgid "Tax"
|
| 188 |
-
msgstr ""
|
| 189 |
-
|
| 190 |
-
#: classes/admin/class-admin-reports.php:350, classes/admin/class-wcv-commissions-csv-exporter.php:45, classes/admin/class-wcv-commissions-page.php:123, classes/admin/settings/class-wcv-settings-capabilities.php:107, classes/admin/settings/sf-options.php:52, classes/admin/settings/sf-options.php:136, templates/dashboard/orders.php:45, templates/orders/orders.php:113
|
| 191 |
-
msgid "Shipping"
|
| 192 |
-
msgstr ""
|
| 193 |
-
|
| 194 |
-
#: classes/admin/class-admin-reports.php:351, classes/admin/class-admin-reports.php:448, classes/admin/class-wcv-commissions-page.php:284, classes/class-commission.php:57
|
| 195 |
-
msgid "Reversed"
|
| 196 |
-
msgstr ""
|
| 197 |
-
|
| 198 |
-
#: classes/admin/class-admin-reports.php:352, classes/admin/class-admin-reports.php:447, classes/admin/class-wcv-commissions-page.php:283, classes/admin/class-wcv-commissions-page.php:549, classes/class-commission.php:56
|
| 199 |
-
msgid "Paid"
|
| 200 |
-
msgstr ""
|
| 201 |
-
|
| 202 |
-
#: classes/admin/class-admin-reports.php:353, classes/admin/class-admin-reports.php:446, classes/admin/class-wcv-commissions-page.php:282, classes/admin/class-wcv-commissions-page.php:548, classes/class-commission.php:55
|
| 203 |
-
msgid "Due"
|
| 204 |
-
msgstr ""
|
| 205 |
-
|
| 206 |
-
#: classes/admin/class-admin-reports.php:462
|
| 207 |
-
msgid "Tax Total"
|
| 208 |
-
msgstr ""
|
| 209 |
-
|
| 210 |
-
#: classes/admin/class-admin-reports.php:463
|
| 211 |
-
msgid "Shipping Total"
|
| 212 |
-
msgstr ""
|
| 213 |
-
|
| 214 |
-
#: classes/admin/class-admin-reports.php:465
|
| 215 |
-
msgid "Commission Total"
|
| 216 |
-
msgstr ""
|
| 217 |
-
|
| 218 |
-
#: classes/admin/class-admin-reports.php:487
|
| 219 |
-
msgid "No commissions found."
|
| 220 |
-
msgstr ""
|
| 221 |
-
|
| 222 |
-
#: classes/admin/class-admin-users.php:394
|
| 223 |
-
msgid "Enable HTML for the shop description"
|
| 224 |
-
msgstr ""
|
| 225 |
-
|
| 226 |
-
#: classes/admin/class-admin-users.php:400, classes/admin/settings/class-wcv-settings-display.php:234
|
| 227 |
-
msgid "Shop name"
|
| 228 |
-
msgstr ""
|
| 229 |
-
|
| 230 |
-
#: classes/admin/class-admin-users.php:407
|
| 231 |
-
msgid "PayPal E-mail"
|
| 232 |
-
msgstr ""
|
| 233 |
-
|
| 234 |
-
#: classes/admin/class-admin-users.php:408
|
| 235 |
-
msgid "required"
|
| 236 |
-
msgstr ""
|
| 237 |
-
|
| 238 |
-
#: classes/admin/class-admin-users.php:415
|
| 239 |
-
msgid "Commission rate"
|
| 240 |
-
msgstr ""
|
| 241 |
-
|
| 242 |
-
#: classes/admin/class-admin-users.php:416, classes/admin/class-product-meta.php:174
|
| 243 |
-
msgid "Leave blank for default"
|
| 244 |
-
msgstr ""
|
| 245 |
-
|
| 246 |
-
#: classes/admin/class-admin-users.php:422
|
| 247 |
-
msgid "Give Tax"
|
| 248 |
-
msgstr ""
|
| 249 |
-
|
| 250 |
-
#: classes/admin/class-admin-users.php:427
|
| 251 |
-
msgid "Tax override for vendor"
|
| 252 |
-
msgstr ""
|
| 253 |
-
|
| 254 |
-
#: classes/admin/class-admin-users.php:433
|
| 255 |
-
msgid "Give Shipping"
|
| 256 |
-
msgstr ""
|
| 257 |
-
|
| 258 |
-
#: classes/admin/class-admin-users.php:438
|
| 259 |
-
msgid "Shipping override for vendor"
|
| 260 |
-
msgstr ""
|
| 261 |
-
|
| 262 |
-
#: classes/admin/class-admin-users.php:444, classes/admin/views/html-vendor-settings-page.php:30, templates/dashboard/settings/seller-info.php:3
|
| 263 |
-
msgid "Seller info"
|
| 264 |
-
msgstr ""
|
| 265 |
-
|
| 266 |
-
#: classes/admin/class-admin-users.php:449
|
| 267 |
-
msgid "Shop description"
|
| 268 |
-
msgstr ""
|
| 269 |
-
|
| 270 |
-
#: classes/admin/class-product-meta.php:151, classes/admin/class-product-meta.php:167, classes/admin/class-wcv-admin-setup.php:272, classes/admin/class-wcv-commissions-csv-exporter.php:44, classes/admin/class-wcv-commissions-page.php:122, classes/admin/settings/class-wcv-settings-commission.php:31, classes/admin/views/setup/general.php:79, templates/dashboard/reports.php:19
|
| 271 |
-
msgid "Commission"
|
| 272 |
-
msgstr ""
|
| 273 |
-
|
| 274 |
-
#: classes/admin/class-setup-wizard.php:69
|
| 275 |
-
msgid "Start"
|
| 276 |
-
msgstr ""
|
| 277 |
-
|
| 278 |
-
#: classes/admin/class-setup-wizard.php:79, classes/admin/settings/class-wcv-settings-display.php:138, classes/admin/settings/sf-options.php:269, classes/admin/views/setup/pages.php:19
|
| 279 |
-
msgid "Pages"
|
| 280 |
-
msgstr ""
|
| 281 |
-
|
| 282 |
-
#: classes/admin/class-setup-wizard.php:84
|
| 283 |
-
msgid "Ready!"
|
| 284 |
-
msgstr ""
|
| 285 |
-
|
| 286 |
-
#: classes/admin/class-setup-wizard.php:99
|
| 287 |
-
msgctxt "enhanced select"
|
| 288 |
-
msgid "No matches found"
|
| 289 |
-
msgstr ""
|
| 290 |
-
|
| 291 |
-
#: classes/admin/class-setup-wizard.php:100
|
| 292 |
-
msgctxt "enhanced select"
|
| 293 |
-
msgid "Loading failed"
|
| 294 |
-
msgstr ""
|
| 295 |
-
|
| 296 |
-
#: classes/admin/class-setup-wizard.php:101
|
| 297 |
-
msgctxt "enhanced select"
|
| 298 |
-
msgid "Please enter 1 or more characters"
|
| 299 |
-
msgstr ""
|
| 300 |
-
|
| 301 |
-
#: classes/admin/class-setup-wizard.php:102
|
| 302 |
-
msgctxt "enhanced select"
|
| 303 |
-
msgid "Please enter %qty% or more characters"
|
| 304 |
-
msgstr ""
|
| 305 |
-
|
| 306 |
-
#: classes/admin/class-setup-wizard.php:103
|
| 307 |
-
msgctxt "enhanced select"
|
| 308 |
-
msgid "Please delete 1 character"
|
| 309 |
-
msgstr ""
|
| 310 |
-
|
| 311 |
-
#: classes/admin/class-setup-wizard.php:104
|
| 312 |
-
msgctxt "enhanced select"
|
| 313 |
-
msgid "Please delete %qty% characters"
|
| 314 |
-
msgstr ""
|
| 315 |
-
|
| 316 |
-
#: classes/admin/class-setup-wizard.php:105
|
| 317 |
-
msgctxt "enhanced select"
|
| 318 |
-
msgid "You can only select 1 item"
|
| 319 |
-
msgstr ""
|
| 320 |
-
|
| 321 |
-
#: classes/admin/class-setup-wizard.php:106
|
| 322 |
-
msgctxt "enhanced select"
|
| 323 |
-
msgid "You can only select %qty% items"
|
| 324 |
-
msgstr ""
|
| 325 |
-
|
| 326 |
-
#: classes/admin/class-setup-wizard.php:107
|
| 327 |
-
msgctxt "enhanced select"
|
| 328 |
-
msgid "Loading more results…"
|
| 329 |
-
msgstr ""
|
| 330 |
-
|
| 331 |
-
#: classes/admin/class-setup-wizard.php:108
|
| 332 |
-
msgctxt "enhanced select"
|
| 333 |
-
msgid "Searching…"
|
| 334 |
-
msgstr ""
|
| 335 |
-
|
| 336 |
-
#: classes/admin/class-setup-wizard.php:339
|
| 337 |
-
msgid "Don't forget to check our <a href=\"%1$s\" target=\"_blank\">documentation</a> to learn more about setting up WC Vendors and if you need help, be sure to visit our <a href=\"%2$s\" target=\"_blank\">free support forums</a>."
|
| 338 |
-
msgstr ""
|
| 339 |
-
|
| 340 |
-
#: classes/admin/class-vendor-admin-dashboard.php:22, classes/admin/class-vendor-admin-dashboard.php:22, classes/admin/settings/class-wcv-settings-display.php:153
|
| 341 |
-
msgid "Shop Settings"
|
| 342 |
-
msgstr ""
|
| 343 |
-
|
| 344 |
-
#: classes/admin/class-vendor-admin-dashboard.php:23, classes/admin/class-vendor-admin-dashboard.php:23, classes/admin/class-vendor-admin-dashboard.php:183, classes/admin/settings/class-wcv-settings-capabilities.php:45, classes/admin/settings/class-wcv-settings-capabilities.php:281, classes/admin/settings/class-wcv-settings-display.php:162, classes/admin/settings/sf-options.php:196, classes/admin/views/setup/capabilities.php:70, templates/dashboard/orders.php:35
|
| 345 |
-
msgid "Orders"
|
| 346 |
-
msgstr ""
|
| 347 |
-
|
| 348 |
-
#: classes/admin/class-vendor-admin-dashboard.php:70, classes/front/dashboard/class-vendor-dashboard.php:117
|
| 349 |
-
msgid "Your PayPal address is not a valid email address."
|
| 350 |
-
msgstr ""
|
| 351 |
-
|
| 352 |
-
#: classes/admin/class-vendor-admin-dashboard.php:79, classes/front/dashboard/class-vendor-dashboard.php:126
|
| 353 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 354 |
-
msgstr ""
|
| 355 |
-
|
| 356 |
-
#: classes/admin/class-vendor-admin-dashboard.php:115, classes/admin/settings/classes/sf-class-settings.php:371, classes/front/dashboard/class-vendor-dashboard.php:144
|
| 357 |
-
msgid "Settings saved."
|
| 358 |
-
msgstr ""
|
| 359 |
-
|
| 360 |
-
#: classes/admin/class-vendor-admin-dashboard.php:246
|
| 361 |
-
msgid "order"
|
| 362 |
-
msgstr ""
|
| 363 |
-
|
| 364 |
-
#: classes/admin/class-vendor-admin-dashboard.php:247
|
| 365 |
-
msgid "orders"
|
| 366 |
-
msgstr ""
|
| 367 |
-
|
| 368 |
-
#: classes/admin/class-vendor-admin-dashboard.php:322, classes/admin/class-wcv-commissions-csv-exporter.php:42, classes/admin/class-wcv-commissions-page.php:120
|
| 369 |
-
msgid "Order ID"
|
| 370 |
-
msgstr ""
|
| 371 |
-
|
| 372 |
-
#: classes/admin/class-vendor-admin-dashboard.php:323
|
| 373 |
-
msgid "Customer"
|
| 374 |
-
msgstr ""
|
| 375 |
-
|
| 376 |
-
#: classes/admin/class-vendor-admin-dashboard.php:324, classes/admin/settings/class-wcv-settings-capabilities.php:44, classes/admin/settings/class-wcv-settings-capabilities.php:248, classes/admin/settings/sf-options.php:127, classes/admin/settings/sf-options.php:245, classes/admin/views/setup/capabilities.php:19
|
| 377 |
-
msgid "Products"
|
| 378 |
-
msgstr ""
|
| 379 |
-
|
| 380 |
-
#: classes/admin/class-vendor-admin-dashboard.php:326
|
| 381 |
-
msgid "Comments to Customer"
|
| 382 |
-
msgstr ""
|
| 383 |
-
|
| 384 |
-
#: classes/admin/class-vendor-admin-dashboard.php:327, classes/admin/class-wcv-commissions-csv-exporter.php:49, classes/admin/class-wcv-commissions-page.php:127, classes/front/orders/class-orders.php:257, templates/dashboard/orders.php:47
|
| 385 |
-
msgid "Date"
|
| 386 |
-
msgstr ""
|
| 387 |
-
|
| 388 |
-
#: classes/admin/class-vendor-admin-dashboard.php:328, templates/dashboard/orders.php:106
|
| 389 |
-
msgid "Shipped"
|
| 390 |
-
msgstr ""
|
| 391 |
-
|
| 392 |
-
#: classes/admin/class-vendor-admin-dashboard.php:364, templates/dashboard/orders.php:99
|
| 393 |
-
msgid "Mark shipped"
|
| 394 |
-
msgstr ""
|
| 395 |
-
|
| 396 |
-
#: classes/admin/class-vendor-admin-dashboard.php:390
|
| 397 |
-
msgid "Orders marked shipped."
|
| 398 |
-
msgstr ""
|
| 399 |
-
|
| 400 |
-
#: classes/admin/class-vendor-admin-dashboard.php:554
|
| 401 |
-
msgid "Yes"
|
| 402 |
-
msgstr ""
|
| 403 |
-
|
| 404 |
-
#: classes/admin/class-vendor-admin-dashboard.php:554
|
| 405 |
-
msgid "No"
|
| 406 |
-
msgstr ""
|
| 407 |
-
|
| 408 |
-
#: classes/admin/class-vendor-applicants.php:74
|
| 409 |
-
msgid "Vendor has been <b>denied</b>."
|
| 410 |
-
msgstr ""
|
| 411 |
-
|
| 412 |
-
#: classes/admin/class-vendor-applicants.php:85
|
| 413 |
-
msgid "Vendor has been <b>approved</b>."
|
| 414 |
-
msgstr ""
|
| 415 |
-
|
| 416 |
-
#: classes/admin/class-vendor-applicants.php:99
|
| 417 |
-
msgid "Pending Vendors"
|
| 418 |
-
msgstr ""
|
| 419 |
-
|
| 420 |
-
#: classes/admin/class-wcv-admin-setup.php:41
|
| 421 |
-
msgid "Vendors shipped"
|
| 422 |
-
msgstr ""
|
| 423 |
-
|
| 424 |
-
#: classes/admin/class-wcv-admin-setup.php:66
|
| 425 |
-
msgid "Vendors Shipped"
|
| 426 |
-
msgstr ""
|
| 427 |
-
|
| 428 |
-
#: classes/admin/class-wcv-admin-setup.php:90, classes/admin/class-wcv-admin-setup.php:90
|
| 429 |
-
msgid "Commissions"
|
| 430 |
-
msgstr ""
|
| 431 |
-
|
| 432 |
-
#: classes/admin/class-wcv-admin-setup.php:108
|
| 433 |
-
msgid "Reset WC Vendors roles "
|
| 434 |
-
msgstr ""
|
| 435 |
-
|
| 436 |
-
#: classes/admin/class-wcv-admin-setup.php:109
|
| 437 |
-
msgid "Reset WC Vendor Roles"
|
| 438 |
-
msgstr ""
|
| 439 |
-
|
| 440 |
-
#: classes/admin/class-wcv-admin-setup.php:110
|
| 441 |
-
msgid "This will reset the wcvendors roles ( vendor & pending_vendor ), back to the default capabilities."
|
| 442 |
-
msgstr ""
|
| 443 |
-
|
| 444 |
-
#: classes/admin/class-wcv-admin-setup.php:115
|
| 445 |
-
msgid "Reset WC Vendors "
|
| 446 |
-
msgstr ""
|
| 447 |
-
|
| 448 |
-
#: classes/admin/class-wcv-admin-setup.php:116
|
| 449 |
-
msgid "Reset WC Vendors Settings"
|
| 450 |
-
msgstr ""
|
| 451 |
-
|
| 452 |
-
#: classes/admin/class-wcv-admin-setup.php:117
|
| 453 |
-
msgid "This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings."
|
| 454 |
-
msgstr ""
|
| 455 |
-
|
| 456 |
-
#: classes/admin/class-wcv-admin-setup.php:157, classes/class-install.php:117
|
| 457 |
-
msgid "Pending Vendor"
|
| 458 |
-
msgstr ""
|
| 459 |
-
|
| 460 |
-
#: classes/admin/class-wcv-admin-setup.php:163
|
| 461 |
-
msgid "WC Vendor roles successfully reset."
|
| 462 |
-
msgstr ""
|
| 463 |
-
|
| 464 |
-
#: classes/admin/class-wcv-admin-setup.php:177
|
| 465 |
-
msgid "WC Vendors was successfully reset. All settings have been reset."
|
| 466 |
-
msgstr ""
|
| 467 |
-
|
| 468 |
-
#: classes/admin/class-wcv-admin-setup.php:191
|
| 469 |
-
msgid "Select a Vendor"
|
| 470 |
-
msgstr ""
|
| 471 |
-
|
| 472 |
-
#: classes/admin/class-wcv-commissions-page.php:171
|
| 473 |
-
msgid "Mark paid"
|
| 474 |
-
msgstr ""
|
| 475 |
-
|
| 476 |
-
#: classes/admin/class-wcv-commissions-page.php:172
|
| 477 |
-
msgid "Mark due"
|
| 478 |
-
msgstr ""
|
| 479 |
-
|
| 480 |
-
#: classes/admin/class-wcv-commissions-page.php:173
|
| 481 |
-
msgid "Mark reversed"
|
| 482 |
-
msgstr ""
|
| 483 |
-
|
| 484 |
-
#: classes/admin/class-wcv-commissions-page.php:174
|
| 485 |
-
msgid "Delete"
|
| 486 |
-
msgstr ""
|
| 487 |
-
|
| 488 |
-
#: classes/admin/class-wcv-commissions-page.php:246
|
| 489 |
-
msgid "Show all dates"
|
| 490 |
-
msgstr ""
|
| 491 |
-
|
| 492 |
-
#: classes/admin/class-wcv-commissions-page.php:281
|
| 493 |
-
msgid "Show all Statuses"
|
| 494 |
-
msgstr ""
|
| 495 |
-
|
| 496 |
-
#: classes/admin/class-wcv-commissions-page.php:337
|
| 497 |
-
msgid "Commission marked paid."
|
| 498 |
-
msgstr ""
|
| 499 |
-
|
| 500 |
-
#: classes/admin/class-wcv-commissions-page.php:344
|
| 501 |
-
msgid "Commission marked due."
|
| 502 |
-
msgstr ""
|
| 503 |
-
|
| 504 |
-
#: classes/admin/class-wcv-commissions-page.php:351
|
| 505 |
-
msgid "Commission marked reversed."
|
| 506 |
-
msgstr ""
|
| 507 |
-
|
| 508 |
-
#: classes/admin/class-wcv-commissions-page.php:547
|
| 509 |
-
msgid "All"
|
| 510 |
-
msgstr ""
|
| 511 |
-
|
| 512 |
-
#: classes/admin/class-wcv-commissions-page.php:550
|
| 513 |
-
msgid "Void"
|
| 514 |
-
msgstr ""
|
| 515 |
-
|
| 516 |
-
#: classes/admin/emails/class-emails.php:69, classes/admin/emails/class-emails.php:200, classes/admin/emails/class-wc-approve-vendor.php:70
|
| 517 |
-
msgid "pending"
|
| 518 |
-
msgstr ""
|
| 519 |
-
|
| 520 |
-
#: classes/admin/emails/class-emails.php:71
|
| 521 |
-
msgid "approved"
|
| 522 |
-
msgstr ""
|
| 523 |
-
|
| 524 |
-
#: classes/admin/emails/class-emails.php:73
|
| 525 |
-
msgid "denied"
|
| 526 |
-
msgstr ""
|
| 527 |
-
|
| 528 |
-
#: classes/admin/emails/class-emails.php:174
|
| 529 |
-
msgid "Resend vendor new order notification"
|
| 530 |
-
msgstr ""
|
| 531 |
-
|
| 532 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:28
|
| 533 |
-
msgid "Vendor Application"
|
| 534 |
-
msgstr ""
|
| 535 |
-
|
| 536 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:29
|
| 537 |
-
msgid "Vendor application will either be approved, denied, or pending."
|
| 538 |
-
msgstr ""
|
| 539 |
-
|
| 540 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:31
|
| 541 |
-
msgid "Application {status}"
|
| 542 |
-
msgstr ""
|
| 543 |
-
|
| 544 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:32
|
| 545 |
-
msgid "[{blogname}] Your vendor application has been {status}"
|
| 546 |
-
msgstr ""
|
| 547 |
-
|
| 548 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:123, classes/admin/emails/class-wc-notify-admin.php:134, classes/admin/emails/class-wc-notify-shipped.php:166, classes/admin/emails/class-wc-notify-vendor.php:268, classes/admin/emails/class-wcv-admin-notify-shipped.php:135, classes/admin/emails/class-wcv-vendor-notify-application.php:130, classes/admin/emails/class-wcv-vendor-notify-approved.php:138, classes/admin/emails/class-wcv-vendor-notify-denied.php:148, classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
|
| 549 |
-
msgid "Enable/Disable"
|
| 550 |
-
msgstr ""
|
| 551 |
-
|
| 552 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:125, classes/admin/emails/class-wc-notify-admin.php:136, classes/admin/emails/class-wc-notify-shipped.php:168, classes/admin/emails/class-wc-notify-vendor.php:270, classes/admin/emails/class-wcv-admin-notify-shipped.php:137, classes/admin/emails/class-wcv-vendor-notify-application.php:132, classes/admin/emails/class-wcv-vendor-notify-approved.php:140, classes/admin/emails/class-wcv-vendor-notify-denied.php:150
|
| 553 |
-
msgid "Enable this email notification"
|
| 554 |
-
msgstr ""
|
| 555 |
-
|
| 556 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:131
|
| 557 |
-
msgid "Enter recipients (comma separated) for this email. Defaults to <code>%s</code>."
|
| 558 |
-
msgstr ""
|
| 559 |
-
|
| 560 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:136, classes/admin/emails/class-wc-notify-admin.php:147, classes/admin/emails/class-wc-notify-shipped.php:172, classes/admin/emails/class-wc-notify-vendor.php:274, classes/admin/emails/class-wcv-admin-notify-shipped.php:149, classes/admin/emails/class-wcv-vendor-notify-application.php:136, classes/admin/emails/class-wcv-vendor-notify-approved.php:144, classes/admin/emails/class-wcv-vendor-notify-denied.php:154
|
| 561 |
-
msgid "Subject"
|
| 562 |
-
msgstr ""
|
| 563 |
-
|
| 564 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:138, classes/admin/emails/class-wc-notify-admin.php:149, classes/admin/emails/class-wc-notify-shipped.php:174, classes/admin/emails/class-wc-notify-vendor.php:276
|
| 565 |
-
msgid "This controls the email subject line. Leave blank to use the default subject: <code>%s</code>."
|
| 566 |
-
msgstr ""
|
| 567 |
-
|
| 568 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:143, classes/admin/emails/class-wc-notify-admin.php:154, classes/admin/emails/class-wc-notify-shipped.php:179, classes/admin/emails/class-wc-notify-vendor.php:281
|
| 569 |
-
msgid "Email Heading"
|
| 570 |
-
msgstr ""
|
| 571 |
-
|
| 572 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:145, classes/admin/emails/class-wc-notify-admin.php:156, classes/admin/emails/class-wc-notify-shipped.php:181, classes/admin/emails/class-wc-notify-vendor.php:283
|
| 573 |
-
msgid "This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>."
|
| 574 |
-
msgstr ""
|
| 575 |
-
|
| 576 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:150, classes/admin/emails/class-wc-notify-admin.php:161, classes/admin/emails/class-wc-notify-shipped.php:186, classes/admin/emails/class-wc-notify-vendor.php:294, classes/admin/emails/class-wcv-admin-notify-shipped.php:167, classes/admin/emails/class-wcv-vendor-notify-application.php:154, classes/admin/emails/class-wcv-vendor-notify-approved.php:171, classes/admin/emails/class-wcv-vendor-notify-denied.php:189
|
| 577 |
-
msgid "Email type"
|
| 578 |
-
msgstr ""
|
| 579 |
-
|
| 580 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:152, classes/admin/emails/class-wc-notify-admin.php:163, classes/admin/emails/class-wc-notify-shipped.php:188, classes/admin/emails/class-wc-notify-vendor.php:296, classes/admin/emails/class-wcv-admin-notify-shipped.php:169, classes/admin/emails/class-wcv-vendor-notify-application.php:156, classes/admin/emails/class-wcv-vendor-notify-approved.php:173, classes/admin/emails/class-wcv-vendor-notify-denied.php:191
|
| 581 |
-
msgid "Choose which format of email to send."
|
| 582 |
-
msgstr ""
|
| 583 |
-
|
| 584 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:156, classes/admin/emails/class-wc-notify-admin.php:167, classes/admin/emails/class-wc-notify-shipped.php:192, classes/admin/emails/class-wc-notify-vendor.php:300
|
| 585 |
-
msgid "Plain text"
|
| 586 |
-
msgstr ""
|
| 587 |
-
|
| 588 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:157, classes/admin/emails/class-wc-notify-admin.php:168, classes/admin/emails/class-wc-notify-shipped.php:193, classes/admin/emails/class-wc-notify-vendor.php:301
|
| 589 |
-
msgid "HTML"
|
| 590 |
-
msgstr ""
|
| 591 |
-
|
| 592 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:158, classes/admin/emails/class-wc-notify-admin.php:169, classes/admin/emails/class-wc-notify-shipped.php:194, classes/admin/emails/class-wc-notify-vendor.php:302
|
| 593 |
-
msgid "Multipart"
|
| 594 |
-
msgstr ""
|
| 595 |
-
|
| 596 |
-
#: classes/admin/emails/class-wc-notify-admin.php:28
|
| 597 |
-
msgid "New Vendor Product"
|
| 598 |
-
msgstr ""
|
| 599 |
-
|
| 600 |
-
#: classes/admin/emails/class-wc-notify-admin.php:29
|
| 601 |
-
msgid "New order emails are sent when a new product is submitted by a vendor"
|
| 602 |
-
msgstr ""
|
| 603 |
-
|
| 604 |
-
#: classes/admin/emails/class-wc-notify-admin.php:31
|
| 605 |
-
msgid "New product submitted: {product_name}"
|
| 606 |
-
msgstr ""
|
| 607 |
-
|
| 608 |
-
#: classes/admin/emails/class-wc-notify-admin.php:32
|
| 609 |
-
msgid "[{blogname}] New product submitted by {vendor_name} - {product_name}"
|
| 610 |
-
msgstr ""
|
| 611 |
-
|
| 612 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:28, classes/admin/emails/class-wcv-admin-notify-shipped.php:62
|
| 613 |
-
msgid "Vendor has shipped"
|
| 614 |
-
msgstr ""
|
| 615 |
-
|
| 616 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:29
|
| 617 |
-
msgid "An email is sent when a vendor has marked one of their orders as shipped."
|
| 618 |
-
msgstr ""
|
| 619 |
-
|
| 620 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:31
|
| 621 |
-
msgid "Your order has been shipped"
|
| 622 |
-
msgstr ""
|
| 623 |
-
|
| 624 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:32
|
| 625 |
-
msgid "[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 626 |
-
msgstr ""
|
| 627 |
-
|
| 628 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:115
|
| 629 |
-
msgid "Subtotal:"
|
| 630 |
-
msgstr ""
|
| 631 |
-
|
| 632 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:27
|
| 633 |
-
msgid "Notify vendors"
|
| 634 |
-
msgstr ""
|
| 635 |
-
|
| 636 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:28
|
| 637 |
-
msgid "New order emails are sent when an order is received/paid by a customer."
|
| 638 |
-
msgstr ""
|
| 639 |
-
|
| 640 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:30
|
| 641 |
-
msgid "New customer order"
|
| 642 |
-
msgstr ""
|
| 643 |
-
|
| 644 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:31
|
| 645 |
-
msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
|
| 646 |
-
msgstr ""
|
| 647 |
-
|
| 648 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:107
|
| 649 |
-
msgid "Commission Subtotal:"
|
| 650 |
-
msgstr ""
|
| 651 |
-
|
| 652 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:113
|
| 653 |
-
msgid "Tax Subtotal:"
|
| 654 |
-
msgstr ""
|
| 655 |
-
|
| 656 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:121
|
| 657 |
-
msgid "Shipping Subtotal:"
|
| 658 |
-
msgstr ""
|
| 659 |
-
|
| 660 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:288
|
| 661 |
-
msgid "Product Totals"
|
| 662 |
-
msgstr ""
|
| 663 |
-
|
| 664 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:290
|
| 665 |
-
msgid "Show the commission due/paid as the product totals instead of the product prices."
|
| 666 |
-
msgstr ""
|
| 667 |
-
|
| 668 |
-
#: classes/admin/emails/class-wcv-admin-notify-shipped.php:27
|
| 669 |
-
msgid "Admin notify vendor shipped"
|
| 670 |
-
msgstr ""
|
| 671 |
-
|
| 672 |
-
#: classes/admin/emails/class-wcv-admin-notify-shipped.php:28
|
| 673 |
-
msgid "Notification is sent to chosen recipient(s) when a vendor marks an order shipped."
|
| 674 |
-
msgstr ""
|
| 675 |
-
|
| 676 |
-
#: classes/admin/emails/class-wcv-admin-notify-shipped.php:52
|
| 677 |
-
msgid "[{site_title}] Vendor has marked shipped ({order_number}) - {order_date}"
|
| 678 |
-
msgstr ""
|
| 679 |
-
|
| 680 |
-
#: classes/admin/emails/class-wcv-admin-notify-shipped.php:141
|
| 681 |
-
msgid "Recipient(s)"
|
| 682 |
-
msgstr ""
|
| 683 |
-
|
| 684 |
-
#: classes/admin/emails/class-wcv-admin-notify-shipped.php:143
|
| 685 |
-
msgid "Enter recipients (comma separated) for this email. Defaults to %s."
|
| 686 |
-
msgstr ""
|
| 687 |
-
|
| 688 |
-
#: classes/admin/emails/class-wcv-admin-notify-shipped.php:153, classes/admin/emails/class-wcv-admin-notify-shipped.php:162, classes/admin/emails/class-wcv-vendor-notify-application.php:140, classes/admin/emails/class-wcv-vendor-notify-application.php:149, classes/admin/emails/class-wcv-vendor-notify-approved.php:148, classes/admin/emails/class-wcv-vendor-notify-approved.php:166, classes/admin/emails/class-wcv-vendor-notify-denied.php:158, classes/admin/emails/class-wcv-vendor-notify-denied.php:167, classes/admin/emails/class-wcv-vendor-notify-denied.php:184
|
| 689 |
-
msgid "Available placeholders: %s"
|
| 690 |
-
msgstr ""
|
| 691 |
-
|
| 692 |
-
#: classes/admin/emails/class-wcv-admin-notify-shipped.php:158, classes/admin/emails/class-wcv-vendor-notify-application.php:145, classes/admin/emails/class-wcv-vendor-notify-approved.php:162, classes/admin/emails/class-wcv-vendor-notify-denied.php:180
|
| 693 |
-
msgid "Email heading"
|
| 694 |
-
msgstr ""
|
| 695 |
-
|
| 696 |
-
#: classes/admin/emails/class-wcv-vendor-notify-application.php:27
|
| 697 |
-
msgid "Vendor notify application"
|
| 698 |
-
msgstr ""
|
| 699 |
-
|
| 700 |
-
#: classes/admin/emails/class-wcv-vendor-notify-application.php:28
|
| 701 |
-
msgid "Notification is sent to the vendor that their application has been received"
|
| 702 |
-
msgstr ""
|
| 703 |
-
|
| 704 |
-
#: classes/admin/emails/class-wcv-vendor-notify-application.php:48
|
| 705 |
-
msgid "[{site_title}] Your vendor application has been received"
|
| 706 |
-
msgstr ""
|
| 707 |
-
|
| 708 |
-
#: classes/admin/emails/class-wcv-vendor-notify-application.php:58
|
| 709 |
-
msgid "Vendor application received"
|
| 710 |
-
msgstr ""
|
| 711 |
-
|
| 712 |
-
#: classes/admin/emails/class-wcv-vendor-notify-application.php:62, templates/emails/application-status.php:5, templates/emails/plain/vendor-notify-application.php:21, templates/emails/vendor-notify-application.php:22
|
| 713 |
-
msgid "Hi there. This is a notification about a vendor application on %s."
|
| 714 |
-
msgstr ""
|
| 715 |
-
|
| 716 |
-
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:27
|
| 717 |
-
msgid "Vendor notify approved"
|
| 718 |
-
msgstr ""
|
| 719 |
-
|
| 720 |
-
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:28
|
| 721 |
-
msgid "Notification is sent to the vendor that their application has been approved"
|
| 722 |
-
msgstr ""
|
| 723 |
-
|
| 724 |
-
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:48
|
| 725 |
-
msgid "[{site_title}] Your vendor application has been approved"
|
| 726 |
-
msgstr ""
|
| 727 |
-
|
| 728 |
-
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:58
|
| 729 |
-
msgid "Vendor Application Approved"
|
| 730 |
-
msgstr ""
|
| 731 |
-
|
| 732 |
-
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:68
|
| 733 |
-
msgid "Your application to become a vendor on has been approved."
|
| 734 |
-
msgstr ""
|
| 735 |
-
|
| 736 |
-
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:153, classes/admin/emails/class-wcv-vendor-notify-denied.php:163
|
| 737 |
-
msgid "Content"
|
| 738 |
-
msgstr ""
|
| 739 |
-
|
| 740 |
-
#: classes/admin/emails/class-wcv-vendor-notify-denied.php:27
|
| 741 |
-
msgid "Vendor notify denied"
|
| 742 |
-
msgstr ""
|
| 743 |
-
|
| 744 |
-
#: classes/admin/emails/class-wcv-vendor-notify-denied.php:28
|
| 745 |
-
msgid "Notification is sent to the vendor that their application has been denied"
|
| 746 |
-
msgstr ""
|
| 747 |
-
|
| 748 |
-
#: classes/admin/emails/class-wcv-vendor-notify-denied.php:48
|
| 749 |
-
msgid "[{site_title}] Your vendor application has been denied"
|
| 750 |
-
msgstr ""
|
| 751 |
-
|
| 752 |
-
#: classes/admin/emails/class-wcv-vendor-notify-denied.php:58
|
| 753 |
-
msgid "Vendor Application Denied"
|
| 754 |
-
msgstr ""
|
| 755 |
-
|
| 756 |
-
#: classes/admin/emails/class-wcv-vendor-notify-denied.php:68
|
| 757 |
-
msgid "Your application to become a vendor has been denied."
|
| 758 |
-
msgstr ""
|
| 759 |
-
|
| 760 |
-
#: classes/admin/emails/class-wcv-vendor-notify-denied.php:78
|
| 761 |
-
msgid "We are not taking any new applications at this time."
|
| 762 |
-
msgstr ""
|
| 763 |
-
|
| 764 |
-
#: classes/admin/emails/class-wcv-vendor-notify-denied.php:172
|
| 765 |
-
msgid "Reason"
|
| 766 |
-
msgstr ""
|
| 767 |
-
|
| 768 |
-
#: classes/admin/emails/class-wcv-vendor-notify-denied.php:175
|
| 769 |
-
msgid "Provide a reason for denying the vendor application"
|
| 770 |
-
msgstr ""
|
| 771 |
-
|
| 772 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:63
|
| 773 |
-
msgid "Add / Edit Product"
|
| 774 |
-
msgstr ""
|
| 775 |
-
|
| 776 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:65
|
| 777 |
-
msgid "Configure what product information to hide from a %s when creating or editing a product"
|
| 778 |
-
msgstr ""
|
| 779 |
-
|
| 780 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:70
|
| 781 |
-
msgid "Product Types"
|
| 782 |
-
msgstr ""
|
| 783 |
-
|
| 784 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:71
|
| 785 |
-
msgid "This controls what product types a %s can create"
|
| 786 |
-
msgstr ""
|
| 787 |
-
|
| 788 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:82
|
| 789 |
-
msgid "Product Type Options"
|
| 790 |
-
msgstr ""
|
| 791 |
-
|
| 792 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:83
|
| 793 |
-
msgid "This controls what product type options a %s can use"
|
| 794 |
-
msgstr ""
|
| 795 |
-
|
| 796 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:90, classes/admin/settings/sf-options.php:164
|
| 797 |
-
msgid "Virtual"
|
| 798 |
-
msgstr ""
|
| 799 |
-
|
| 800 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:91, classes/admin/settings/sf-options.php:165
|
| 801 |
-
msgid "Downloadable"
|
| 802 |
-
msgstr ""
|
| 803 |
-
|
| 804 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:97
|
| 805 |
-
msgid "Product Data Tabs"
|
| 806 |
-
msgstr ""
|
| 807 |
-
|
| 808 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:98
|
| 809 |
-
msgid "This controls what product data tabs a %s can use"
|
| 810 |
-
msgstr ""
|
| 811 |
-
|
| 812 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:106, classes/admin/settings/sf-options.php:135
|
| 813 |
-
msgid "Inventory"
|
| 814 |
-
msgstr ""
|
| 815 |
-
|
| 816 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:108, classes/admin/settings/sf-options.php:137
|
| 817 |
-
msgid "Linked Products"
|
| 818 |
-
msgstr ""
|
| 819 |
-
|
| 820 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:109, classes/admin/settings/sf-options.php:138
|
| 821 |
-
msgid "Attributes"
|
| 822 |
-
msgstr ""
|
| 823 |
-
|
| 824 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:110
|
| 825 |
-
msgid "Variations"
|
| 826 |
-
msgstr ""
|
| 827 |
-
|
| 828 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:111, classes/admin/settings/class-wcv-settings-display.php:45, classes/admin/settings/sf-options.php:139
|
| 829 |
-
msgid "Advanced"
|
| 830 |
-
msgstr ""
|
| 831 |
-
|
| 832 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:118
|
| 833 |
-
msgid "Featured Product"
|
| 834 |
-
msgstr ""
|
| 835 |
-
|
| 836 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:119
|
| 837 |
-
msgid "Allow %s to use the featured product option"
|
| 838 |
-
msgstr ""
|
| 839 |
-
|
| 840 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:126, classes/admin/settings/sf-options.php:178
|
| 841 |
-
msgid "Duplicate Product"
|
| 842 |
-
msgstr ""
|
| 843 |
-
|
| 844 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:127
|
| 845 |
-
msgid "Allow %s to duplicate products"
|
| 846 |
-
msgstr ""
|
| 847 |
-
|
| 848 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:134, classes/admin/settings/sf-options.php:176
|
| 849 |
-
msgid "SKU"
|
| 850 |
-
msgstr ""
|
| 851 |
-
|
| 852 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:135
|
| 853 |
-
msgid "Hide sku field from %s"
|
| 854 |
-
msgstr ""
|
| 855 |
-
|
| 856 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:142, classes/admin/settings/sf-options.php:43, classes/admin/settings/sf-options.php:175
|
| 857 |
-
msgid "Taxes"
|
| 858 |
-
msgstr ""
|
| 859 |
-
|
| 860 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:143
|
| 861 |
-
msgid "Hide tax fields from %s"
|
| 862 |
-
msgstr ""
|
| 863 |
-
|
| 864 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:151
|
| 865 |
-
msgid "Import Products"
|
| 866 |
-
msgstr ""
|
| 867 |
-
|
| 868 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:152
|
| 869 |
-
msgid "Allow %s to import products"
|
| 870 |
-
msgstr ""
|
| 871 |
-
|
| 872 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:159
|
| 873 |
-
msgid "Export Products"
|
| 874 |
-
msgstr ""
|
| 875 |
-
|
| 876 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:160
|
| 877 |
-
msgid "Allow %s to export products"
|
| 878 |
-
msgstr ""
|
| 879 |
-
|
| 880 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:177
|
| 881 |
-
msgid "Configure what order information a %s can view from an order"
|
| 882 |
-
msgstr ""
|
| 883 |
-
|
| 884 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:182
|
| 885 |
-
msgid "View Order Notes"
|
| 886 |
-
msgstr ""
|
| 887 |
-
|
| 888 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:183, classes/admin/views/setup/capabilities.php:102
|
| 889 |
-
msgid "Allow %s to view order notes"
|
| 890 |
-
msgstr ""
|
| 891 |
-
|
| 892 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:190
|
| 893 |
-
msgid "Add Order notes"
|
| 894 |
-
msgstr ""
|
| 895 |
-
|
| 896 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:191, classes/admin/views/setup/capabilities.php:115
|
| 897 |
-
msgid "Allow %s to add order notes."
|
| 898 |
-
msgstr ""
|
| 899 |
-
|
| 900 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:198
|
| 901 |
-
msgid "Customer Billing Address"
|
| 902 |
-
msgstr ""
|
| 903 |
-
|
| 904 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:199
|
| 905 |
-
msgid "Allow %s to view customer billing address fields"
|
| 906 |
-
msgstr ""
|
| 907 |
-
|
| 908 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:206
|
| 909 |
-
msgid "Customer Shipping Address"
|
| 910 |
-
msgstr ""
|
| 911 |
-
|
| 912 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:207
|
| 913 |
-
msgid "Allow %s to view the customer shipping fields"
|
| 914 |
-
msgstr ""
|
| 915 |
-
|
| 916 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:214
|
| 917 |
-
msgid "Customer Email"
|
| 918 |
-
msgstr ""
|
| 919 |
-
|
| 920 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:215
|
| 921 |
-
msgid "Allow %s to view the customer email address"
|
| 922 |
-
msgstr ""
|
| 923 |
-
|
| 924 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:222
|
| 925 |
-
msgid "Customer Phone"
|
| 926 |
-
msgstr ""
|
| 927 |
-
|
| 928 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:223
|
| 929 |
-
msgid "Allow %s to view the customer phone number"
|
| 930 |
-
msgstr ""
|
| 931 |
-
|
| 932 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:238, classes/admin/settings/sf-options.php:193
|
| 933 |
-
msgid "Permissions"
|
| 934 |
-
msgstr ""
|
| 935 |
-
|
| 936 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:240
|
| 937 |
-
msgid "Enable or disable functionality for your %s"
|
| 938 |
-
msgstr ""
|
| 939 |
-
|
| 940 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:254
|
| 941 |
-
msgid "Submit Products"
|
| 942 |
-
msgstr ""
|
| 943 |
-
|
| 944 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:255, classes/admin/views/setup/capabilities.php:25
|
| 945 |
-
msgid "Allow %s to add/edit products"
|
| 946 |
-
msgstr ""
|
| 947 |
-
|
| 948 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:262
|
| 949 |
-
msgid "Edit Live Products"
|
| 950 |
-
msgstr ""
|
| 951 |
-
|
| 952 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:263, classes/admin/views/setup/capabilities.php:38
|
| 953 |
-
msgid "Allow %s to edit published (live) products"
|
| 954 |
-
msgstr ""
|
| 955 |
-
|
| 956 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:270
|
| 957 |
-
msgid "Publish Approval"
|
| 958 |
-
msgstr ""
|
| 959 |
-
|
| 960 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:271
|
| 961 |
-
msgid "Allow %s to publish products directly to the marketplace without requiring approval."
|
| 962 |
-
msgstr ""
|
| 963 |
-
|
| 964 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:287
|
| 965 |
-
msgid "View Orders"
|
| 966 |
-
msgstr ""
|
| 967 |
-
|
| 968 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:288, classes/admin/views/setup/capabilities.php:76
|
| 969 |
-
msgid "Allow %s to view orders"
|
| 970 |
-
msgstr ""
|
| 971 |
-
|
| 972 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:295
|
| 973 |
-
msgid "Export Orders"
|
| 974 |
-
msgstr ""
|
| 975 |
-
|
| 976 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:296, classes/admin/views/setup/capabilities.php:89
|
| 977 |
-
msgid "Allow %s to export their orders to a CSV file"
|
| 978 |
-
msgstr ""
|
| 979 |
-
|
| 980 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:303
|
| 981 |
-
msgid "Front End Sales Reports"
|
| 982 |
-
msgstr ""
|
| 983 |
-
|
| 984 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:304
|
| 985 |
-
msgid "Allow %s to view sales table on the frontend on the %s dashboard page."
|
| 986 |
-
msgstr ""
|
| 987 |
-
|
| 988 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:316
|
| 989 |
-
msgid "Reports"
|
| 990 |
-
msgstr ""
|
| 991 |
-
|
| 992 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:322
|
| 993 |
-
msgid "View Reports"
|
| 994 |
-
msgstr ""
|
| 995 |
-
|
| 996 |
-
#: classes/admin/settings/class-wcv-settings-capabilities.php:323
|
| 997 |
-
msgid "Allow %s to view reports"
|
| 998 |
-
msgstr ""
|
| 999 |
-
|
| 1000 |
-
#: classes/admin/settings/class-wcv-settings-commission.php:61
|
| 1001 |
-
msgid "These are the commission settings for your marketplace"
|
| 1002 |
-
msgstr ""
|
| 1003 |
-
|
| 1004 |
-
#: classes/admin/settings/class-wcv-settings-commission.php:65
|
| 1005 |
-
msgid "%s Commission %%"
|
| 1006 |
-
msgstr ""
|
| 1007 |
-
|
| 1008 |
-
#: classes/admin/settings/class-wcv-settings-commission.php:66
|
| 1009 |
-
msgid "The global commission rate for your %s"
|
| 1010 |
-
msgstr ""
|
| 1011 |
-
|
| 1012 |
-
#: classes/admin/settings/class-wcv-settings-display.php:31
|
| 1013 |
-
msgid "Display"
|
| 1014 |
-
msgstr ""
|
| 1015 |
-
|
| 1016 |
-
#: classes/admin/settings/class-wcv-settings-display.php:44
|
| 1017 |
-
msgid "Labels"
|
| 1018 |
-
msgstr ""
|
| 1019 |
-
|
| 1020 |
-
#: classes/admin/settings/class-wcv-settings-display.php:64, classes/admin/settings/class-wcv-settings-display.php:89, classes/admin/settings/class-wcv-settings-payments.php:80
|
| 1021 |
-
msgid ""
|
| 1022 |
-
msgstr ""
|
| 1023 |
-
|
| 1024 |
-
#: classes/admin/settings/class-wcv-settings-display.php:66
|
| 1025 |
-
msgid "Advanced options provide extra display options"
|
| 1026 |
-
msgstr ""
|
| 1027 |
-
|
| 1028 |
-
#: classes/admin/settings/class-wcv-settings-display.php:70
|
| 1029 |
-
msgid "Product Page Stylesheet"
|
| 1030 |
-
msgstr ""
|
| 1031 |
-
|
| 1032 |
-
#: classes/admin/settings/class-wcv-settings-display.php:71
|
| 1033 |
-
msgid "You can add CSS in this textarea, which will be loaded on the product add/edit page for vendors"
|
| 1034 |
-
msgstr ""
|
| 1035 |
-
|
| 1036 |
-
#: classes/admin/settings/class-wcv-settings-display.php:72, classes/admin/settings/class-wcv-settings-display.php:98
|
| 1037 |
-
msgid "This enables the sold by labels used to show which %s shop the product belongs to"
|
| 1038 |
-
msgstr ""
|
| 1039 |
-
|
| 1040 |
-
#: classes/admin/settings/class-wcv-settings-display.php:91
|
| 1041 |
-
msgid "Labels are shown on the front end, in orders and emails."
|
| 1042 |
-
msgstr ""
|
| 1043 |
-
|
| 1044 |
-
#: classes/admin/settings/class-wcv-settings-display.php:96
|
| 1045 |
-
msgid "Sold by"
|
| 1046 |
-
msgstr ""
|
| 1047 |
-
|
| 1048 |
-
#: classes/admin/settings/class-wcv-settings-display.php:97, classes/admin/settings/sf-options.php:104
|
| 1049 |
-
msgid "Enable sold by labels"
|
| 1050 |
-
msgstr ""
|
| 1051 |
-
|
| 1052 |
-
#: classes/admin/settings/class-wcv-settings-display.php:105
|
| 1053 |
-
msgid "Sold by label"
|
| 1054 |
-
msgstr ""
|
| 1055 |
-
|
| 1056 |
-
#: classes/admin/settings/class-wcv-settings-display.php:106
|
| 1057 |
-
msgid "The sold by label"
|
| 1058 |
-
msgstr ""
|
| 1059 |
-
|
| 1060 |
-
#: classes/admin/settings/class-wcv-settings-display.php:109, classes/admin/settings/sf-options.php:103, classes/admin/settings/sf-options.php:116
|
| 1061 |
-
msgid "Sold By"
|
| 1062 |
-
msgstr ""
|
| 1063 |
-
|
| 1064 |
-
#: classes/admin/settings/class-wcv-settings-display.php:113
|
| 1065 |
-
msgid "%s Store Info"
|
| 1066 |
-
msgstr ""
|
| 1067 |
-
|
| 1068 |
-
#: classes/admin/settings/class-wcv-settings-display.php:114
|
| 1069 |
-
msgid "Enable %s store info tab on the single product page"
|
| 1070 |
-
msgstr ""
|
| 1071 |
-
|
| 1072 |
-
#: classes/admin/settings/class-wcv-settings-display.php:121
|
| 1073 |
-
msgid "%s store Info label"
|
| 1074 |
-
msgstr ""
|
| 1075 |
-
|
| 1076 |
-
#: classes/admin/settings/class-wcv-settings-display.php:122
|
| 1077 |
-
msgid "The %s store info label"
|
| 1078 |
-
msgstr ""
|
| 1079 |
-
|
| 1080 |
-
#: classes/admin/settings/class-wcv-settings-display.php:125
|
| 1081 |
-
msgid "Store Info"
|
| 1082 |
-
msgstr ""
|
| 1083 |
-
|
| 1084 |
-
#: classes/admin/settings/class-wcv-settings-display.php:140
|
| 1085 |
-
msgid "These pages used on the front end by %s."
|
| 1086 |
-
msgstr ""
|
| 1087 |
-
|
| 1088 |
-
#: classes/admin/settings/class-wcv-settings-display.php:144
|
| 1089 |
-
msgid "Dashboard"
|
| 1090 |
-
msgstr ""
|
| 1091 |
-
|
| 1092 |
-
#: classes/admin/settings/class-wcv-settings-display.php:150
|
| 1093 |
-
msgid "<br />This sets the page used to display the front end %s dashboard. This page should contain the following shortcode. <code>[wcv_vendor_dashboard]</code>"
|
| 1094 |
-
msgstr ""
|
| 1095 |
-
|
| 1096 |
-
#: classes/admin/settings/class-wcv-settings-display.php:159
|
| 1097 |
-
msgid "<br />This sets the page used to display the %s shop settings page. This page should contain the following shortcode. <code>[wcv_shop_settings]</code>"
|
| 1098 |
-
msgstr ""
|
| 1099 |
-
|
| 1100 |
-
#: classes/admin/settings/class-wcv-settings-display.php:168
|
| 1101 |
-
msgid "<br />This sets the page used to display the %s orders page. This page should contain the following shortcode. <code>[wcv_orders]</code>"
|
| 1102 |
-
msgstr ""
|
| 1103 |
-
|
| 1104 |
-
#: classes/admin/settings/class-wcv-settings-display.php:171
|
| 1105 |
-
msgid "%s"
|
| 1106 |
-
msgstr ""
|
| 1107 |
-
|
| 1108 |
-
#: classes/admin/settings/class-wcv-settings-display.php:177
|
| 1109 |
-
msgid "<br />This sets the page used to display a paginated list of all %1$s stores. Your %1$s stores will be available at <code>%2$s/page-slug/store-name/</code><br />This page should contain the following shortcode. <code>[wcv_vendorslist]</code>"
|
| 1110 |
-
msgstr ""
|
| 1111 |
-
|
| 1112 |
-
#: classes/admin/settings/class-wcv-settings-display.php:180
|
| 1113 |
-
msgid "Terms and Conditions"
|
| 1114 |
-
msgstr ""
|
| 1115 |
-
|
| 1116 |
-
#: classes/admin/settings/class-wcv-settings-display.php:186
|
| 1117 |
-
msgid "<br />This sets the page used to display the terms and conditions when a %s signs up."
|
| 1118 |
-
msgstr ""
|
| 1119 |
-
|
| 1120 |
-
#: classes/admin/settings/class-wcv-settings-display.php:193, templates/dashboard/links.php:4
|
| 1121 |
-
msgid "Store Settings"
|
| 1122 |
-
msgstr ""
|
| 1123 |
-
|
| 1124 |
-
#: classes/admin/settings/class-wcv-settings-display.php:195
|
| 1125 |
-
msgid "These are the settings for the individual vendor stores."
|
| 1126 |
-
msgstr ""
|
| 1127 |
-
|
| 1128 |
-
#: classes/admin/settings/class-wcv-settings-display.php:200
|
| 1129 |
-
msgid "%s Store URL"
|
| 1130 |
-
msgstr ""
|
| 1131 |
-
|
| 1132 |
-
#: classes/admin/settings/class-wcv-settings-display.php:201
|
| 1133 |
-
msgid "If you enter \"vendors\" your %s store will be %s/vendors/store-name/"
|
| 1134 |
-
msgstr ""
|
| 1135 |
-
|
| 1136 |
-
#: classes/admin/settings/class-wcv-settings-display.php:208
|
| 1137 |
-
msgid "Shop Header"
|
| 1138 |
-
msgstr ""
|
| 1139 |
-
|
| 1140 |
-
#: classes/admin/settings/class-wcv-settings-display.php:209
|
| 1141 |
-
msgid "Enable %s shop headers"
|
| 1142 |
-
msgstr ""
|
| 1143 |
-
|
| 1144 |
-
#: classes/admin/settings/class-wcv-settings-display.php:210
|
| 1145 |
-
msgid "This enables the %s shop header template and disables the shop description text."
|
| 1146 |
-
msgstr ""
|
| 1147 |
-
|
| 1148 |
-
#: classes/admin/settings/class-wcv-settings-display.php:217, classes/admin/settings/sf-options.php:63
|
| 1149 |
-
msgid "Shop HTML"
|
| 1150 |
-
msgstr ""
|
| 1151 |
-
|
| 1152 |
-
#: classes/admin/settings/class-wcv-settings-display.php:218
|
| 1153 |
-
msgid "Allow HTML in %s shop desription"
|
| 1154 |
-
msgstr ""
|
| 1155 |
-
|
| 1156 |
-
#: classes/admin/settings/class-wcv-settings-display.php:219
|
| 1157 |
-
msgid "Enable HTML for a %s shop description. You can enable or disable this per vendor by editing the vendors user account."
|
| 1158 |
-
msgstr ""
|
| 1159 |
-
|
| 1160 |
-
#: classes/admin/settings/class-wcv-settings-display.php:226, classes/admin/settings/sf-options.php:93
|
| 1161 |
-
msgid "Display Name"
|
| 1162 |
-
msgstr ""
|
| 1163 |
-
|
| 1164 |
-
#: classes/admin/settings/class-wcv-settings-display.php:228
|
| 1165 |
-
msgid "Select what will be used to display the %s name throughout the marketplace."
|
| 1166 |
-
msgstr ""
|
| 1167 |
-
|
| 1168 |
-
#: classes/admin/settings/class-wcv-settings-display.php:233
|
| 1169 |
-
msgid "Display name"
|
| 1170 |
-
msgstr ""
|
| 1171 |
-
|
| 1172 |
-
#: classes/admin/settings/class-wcv-settings-display.php:235
|
| 1173 |
-
msgid "%s Username"
|
| 1174 |
-
msgstr ""
|
| 1175 |
-
|
| 1176 |
-
#: classes/admin/settings/class-wcv-settings-display.php:236
|
| 1177 |
-
msgid "%s Email"
|
| 1178 |
-
msgstr ""
|
| 1179 |
-
|
| 1180 |
-
#: classes/admin/settings/class-wcv-settings-general.php:60
|
| 1181 |
-
msgid "Marketplace Options"
|
| 1182 |
-
msgstr ""
|
| 1183 |
-
|
| 1184 |
-
#: classes/admin/settings/class-wcv-settings-general.php:62
|
| 1185 |
-
msgid "These are the general settings for your marketplace"
|
| 1186 |
-
msgstr ""
|
| 1187 |
-
|
| 1188 |
-
#: classes/admin/settings/class-wcv-settings-general.php:66
|
| 1189 |
-
msgid "%s Registration"
|
| 1190 |
-
msgstr ""
|
| 1191 |
-
|
| 1192 |
-
#: classes/admin/settings/class-wcv-settings-general.php:67, classes/admin/views/setup/general.php:25
|
| 1193 |
-
msgid "Allow users to apply to become a %s"
|
| 1194 |
-
msgstr ""
|
| 1195 |
-
|
| 1196 |
-
#: classes/admin/settings/class-wcv-settings-general.php:73
|
| 1197 |
-
msgid "%s Approval"
|
| 1198 |
-
msgstr ""
|
| 1199 |
-
|
| 1200 |
-
#: classes/admin/settings/class-wcv-settings-general.php:74
|
| 1201 |
-
msgid "Manually approve all %s applications"
|
| 1202 |
-
msgstr ""
|
| 1203 |
-
|
| 1204 |
-
#: classes/admin/settings/class-wcv-settings-general.php:81
|
| 1205 |
-
msgid "%s Taxes"
|
| 1206 |
-
msgstr ""
|
| 1207 |
-
|
| 1208 |
-
#: classes/admin/settings/class-wcv-settings-general.php:82
|
| 1209 |
-
msgid "Give any taxes to the %s"
|
| 1210 |
-
msgstr ""
|
| 1211 |
-
|
| 1212 |
-
#: classes/admin/settings/class-wcv-settings-general.php:88
|
| 1213 |
-
msgid "%s Shipping"
|
| 1214 |
-
msgstr ""
|
| 1215 |
-
|
| 1216 |
-
#: classes/admin/settings/class-wcv-settings-general.php:89
|
| 1217 |
-
msgid "Give any shipping to the %s"
|
| 1218 |
-
msgstr ""
|
| 1219 |
-
|
| 1220 |
-
#: classes/admin/settings/class-wcv-settings-payments.php:31, classes/admin/settings/sf-options.php:316
|
| 1221 |
-
msgid "Payments"
|
| 1222 |
-
msgstr ""
|
| 1223 |
-
|
| 1224 |
-
#: classes/admin/settings/class-wcv-settings-payments.php:82
|
| 1225 |
-
msgid "<strong>Payments controls how your %s commission is paid out. To enable commission payments you will be required to purchase one of our available payment extensions. </strong> "
|
| 1226 |
-
msgstr ""
|
| 1227 |
-
|
| 1228 |
-
#: classes/admin/settings/classes/sf-class-format-options.php:211, classes/admin/settings/classes/sf-class-settings.php:796, classes/admin/settings/classes/sf-class-settings.php:830
|
| 1229 |
-
msgid "Select a page..."
|
| 1230 |
-
msgstr ""
|
| 1231 |
-
|
| 1232 |
-
#: classes/admin/settings/classes/sf-class-settings.php:153, classes/class-install.php:400, templates/dashboard/settings/settings.php:1
|
| 1233 |
-
msgid "Settings"
|
| 1234 |
-
msgstr ""
|
| 1235 |
-
|
| 1236 |
-
#: classes/admin/settings/classes/sf-class-settings.php:251
|
| 1237 |
-
msgid "WC Vendors Settings"
|
| 1238 |
-
msgstr ""
|
| 1239 |
-
|
| 1240 |
-
#: classes/admin/settings/classes/sf-class-settings.php:251
|
| 1241 |
-
msgid "Settings Old"
|
| 1242 |
-
msgstr ""
|
| 1243 |
-
|
| 1244 |
-
#: classes/admin/settings/classes/sf-class-settings.php:305
|
| 1245 |
-
msgid "Could not load settings at: "
|
| 1246 |
-
msgstr ""
|
| 1247 |
-
|
| 1248 |
-
#: classes/admin/settings/classes/sf-class-settings.php:305
|
| 1249 |
-
msgid "Error - WP Settings Framework"
|
| 1250 |
-
msgstr ""
|
| 1251 |
-
|
| 1252 |
-
#: classes/admin/settings/classes/sf-class-settings.php:489
|
| 1253 |
-
msgid "Save %s changes"
|
| 1254 |
-
msgstr ""
|
| 1255 |
-
|
| 1256 |
-
#: classes/admin/settings/classes/sf-class-settings.php:502
|
| 1257 |
-
msgid "Please help with a <a href=\"https://wordpress.org/support/view/plugin-reviews/wc-vendors?rate=5#postform\" target=\"top\">High Five!</a> | <a href=\"https://www.wcvendors.com/product/wc-vendors-pro/?utm_source=plugin&utm_campaign=upgrade_promo\" target=\"top\">WC Vendors Pro</a> | <a href=\"https://www.wcvendors.com/product/stripe-commissions-gateway/?utm_source=plugin&utm_campaign=upgrade_promo\" target=\"top\">Stripe Commissions & Gateway</a> | <a href=\"https://docs.wcvendors.com/\" target=\"top\">Documentation</a> | <a href=\"https://wordpress.org/support/plugin/wc-vendors/\" target=\"top\">Free Support Forums</a>"
|
| 1258 |
-
msgstr ""
|
| 1259 |
-
|
| 1260 |
-
#: classes/admin/settings/classes/sf-class-settings.php:789, classes/admin/settings/classes/sf-class-settings.php:823
|
| 1261 |
-
msgid "Edit Page"
|
| 1262 |
-
msgstr ""
|
| 1263 |
-
|
| 1264 |
-
#: classes/admin/settings/classes/sf-class-settings.php:790, classes/admin/settings/classes/sf-class-settings.php:824
|
| 1265 |
-
msgid "View Page"
|
| 1266 |
-
msgstr ""
|
| 1267 |
-
|
| 1268 |
-
#: classes/admin/settings/classes/sf-class-settings.php:888
|
| 1269 |
-
msgid "Update %s"
|
| 1270 |
-
msgstr ""
|
| 1271 |
-
|
| 1272 |
-
#: classes/admin/settings/classes/sf-class-settings.php:888, classes/admin/settings/classes/sf-class-settings.php:888
|
| 1273 |
-
msgid "Add %s"
|
| 1274 |
-
msgstr ""
|
| 1275 |
-
|
| 1276 |
-
#: classes/admin/settings/classes/sf-class-settings.php:888
|
| 1277 |
-
msgid "Upload an image for the %s"
|
| 1278 |
-
msgstr ""
|
| 1279 |
-
|
| 1280 |
-
#: classes/admin/settings/sf-options.php:5
|
| 1281 |
-
msgid "General options"
|
| 1282 |
-
msgstr ""
|
| 1283 |
-
|
| 1284 |
-
#: classes/admin/settings/sf-options.php:8
|
| 1285 |
-
msgid "Default commission (%)"
|
| 1286 |
-
msgstr ""
|
| 1287 |
-
|
| 1288 |
-
#: classes/admin/settings/sf-options.php:9
|
| 1289 |
-
msgid "The default rate you pay each vendor for a product sale. <br>You can also give vendors their own individual commission rates by editing the vendors user account.<br>Also, you can edit an individual products commission to override both of these settings on a per product basis."
|
| 1290 |
-
msgstr ""
|
| 1291 |
-
|
| 1292 |
-
#: classes/admin/settings/sf-options.php:20, classes/admin/settings/sf-options.php:27
|
| 1293 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 1294 |
-
msgstr ""
|
| 1295 |
-
|
| 1296 |
-
#: classes/admin/settings/sf-options.php:22
|
| 1297 |
-
msgid "Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:</strong> You MUST \"<strong>Enable registration on the \"My Account\" page</strong>\" in your <strong>WooCommerce > Settings > Accounts</strong> page for this option to work. Currently, you have registration disabled."
|
| 1298 |
-
msgstr ""
|
| 1299 |
-
|
| 1300 |
-
#: classes/admin/settings/sf-options.php:26
|
| 1301 |
-
msgid "Registration"
|
| 1302 |
-
msgstr ""
|
| 1303 |
-
|
| 1304 |
-
#: classes/admin/settings/sf-options.php:28
|
| 1305 |
-
msgid "This will show a checkbox on the My Account page's registration form asking if the user would like to apply to be a vendor. Also, on the Vendor Dashboard, users can still apply to become a vendor even if this is disabled."
|
| 1306 |
-
msgstr ""
|
| 1307 |
-
|
| 1308 |
-
#: classes/admin/settings/sf-options.php:35
|
| 1309 |
-
msgid "Approve vendor applications manually"
|
| 1310 |
-
msgstr ""
|
| 1311 |
-
|
| 1312 |
-
#: classes/admin/settings/sf-options.php:36
|
| 1313 |
-
msgid "With this unchecked, all vendor applications are automatically accepted. Otherwise, you must approve each manually."
|
| 1314 |
-
msgstr ""
|
| 1315 |
-
|
| 1316 |
-
#: classes/admin/settings/sf-options.php:44
|
| 1317 |
-
msgid "Give vendors any tax collected per-product"
|
| 1318 |
-
msgstr ""
|
| 1319 |
-
|
| 1320 |
-
#: classes/admin/settings/sf-options.php:45
|
| 1321 |
-
msgid "The tax collected on a vendor's product will be given in its entirety"
|
| 1322 |
-
msgstr ""
|
| 1323 |
-
|
| 1324 |
-
#: classes/admin/settings/sf-options.php:53
|
| 1325 |
-
msgid "Give vendors any shipping collected per-product"
|
| 1326 |
-
msgstr ""
|
| 1327 |
-
|
| 1328 |
-
#: classes/admin/settings/sf-options.php:54
|
| 1329 |
-
msgid "WC Vendors Free - Give vendors shipping if using Per Product Shipping gateway. WC Vendors Pro - Give vendors shipping when using Vendor Shipping. No other shipping module is compatible with this option."
|
| 1330 |
-
msgstr ""
|
| 1331 |
-
|
| 1332 |
-
#: classes/admin/settings/sf-options.php:60
|
| 1333 |
-
msgid "Shop options"
|
| 1334 |
-
msgstr ""
|
| 1335 |
-
|
| 1336 |
-
#: classes/admin/settings/sf-options.php:64
|
| 1337 |
-
msgid "Enable HTML for a vendor's shop description by default. You can enable or disable this per vendor by editing the vendors user account."
|
| 1338 |
-
msgstr ""
|
| 1339 |
-
|
| 1340 |
-
#: classes/admin/settings/sf-options.php:71
|
| 1341 |
-
msgid "Vendor Shop Page"
|
| 1342 |
-
msgstr ""
|
| 1343 |
-
|
| 1344 |
-
#: classes/admin/settings/sf-options.php:72
|
| 1345 |
-
msgid "Enter one word for the URI. If you enter \"<strong>vendors</strong>\" your vendors store will be <code>yourdomain.com/vendors/store-name/</code>"
|
| 1346 |
-
msgstr ""
|
| 1347 |
-
|
| 1348 |
-
#: classes/admin/settings/sf-options.php:79
|
| 1349 |
-
msgid "Shop Headers"
|
| 1350 |
-
msgstr ""
|
| 1351 |
-
|
| 1352 |
-
#: classes/admin/settings/sf-options.php:80
|
| 1353 |
-
msgid "Enable vendor shop headers"
|
| 1354 |
-
msgstr ""
|
| 1355 |
-
|
| 1356 |
-
#: classes/admin/settings/sf-options.php:81
|
| 1357 |
-
msgid "This will override the HTML Shop description output on product-archive pages. In order to customize the shop headers visit wcvendors.com and read the article in the Knowledgebase titled Changing the Vendor Templates."
|
| 1358 |
-
msgstr ""
|
| 1359 |
-
|
| 1360 |
-
#: classes/admin/settings/sf-options.php:88
|
| 1361 |
-
msgid "Vendor Display Name"
|
| 1362 |
-
msgstr ""
|
| 1363 |
-
|
| 1364 |
-
#: classes/admin/settings/sf-options.php:89
|
| 1365 |
-
msgid "Select what will be displayed for the sold by text throughout the store."
|
| 1366 |
-
msgstr ""
|
| 1367 |
-
|
| 1368 |
-
#: classes/admin/settings/sf-options.php:94, classes/admin/views/html-vendor-settings-page.php:22, templates/dashboard/settings/shop-name.php:2
|
| 1369 |
-
msgid "Shop Name"
|
| 1370 |
-
msgstr ""
|
| 1371 |
-
|
| 1372 |
-
#: classes/admin/settings/sf-options.php:95
|
| 1373 |
-
msgid "User Login"
|
| 1374 |
-
msgstr ""
|
| 1375 |
-
|
| 1376 |
-
#: classes/admin/settings/sf-options.php:96
|
| 1377 |
-
msgid "User Email"
|
| 1378 |
-
msgstr ""
|
| 1379 |
-
|
| 1380 |
-
#: classes/admin/settings/sf-options.php:105
|
| 1381 |
-
msgid "This will enable or disable the sold by labels."
|
| 1382 |
-
msgstr ""
|
| 1383 |
-
|
| 1384 |
-
#: classes/admin/settings/sf-options.php:112
|
| 1385 |
-
msgid "Sold By Label"
|
| 1386 |
-
msgstr ""
|
| 1387 |
-
|
| 1388 |
-
#: classes/admin/settings/sf-options.php:113
|
| 1389 |
-
msgid "The sold by label used on the site and emails."
|
| 1390 |
-
msgstr ""
|
| 1391 |
-
|
| 1392 |
-
#: classes/admin/settings/sf-options.php:120
|
| 1393 |
-
msgid "Seller Info Label"
|
| 1394 |
-
msgstr ""
|
| 1395 |
-
|
| 1396 |
-
#: classes/admin/settings/sf-options.php:121
|
| 1397 |
-
msgid "The seller info tab title on the single product page."
|
| 1398 |
-
msgstr ""
|
| 1399 |
-
|
| 1400 |
-
#: classes/admin/settings/sf-options.php:124
|
| 1401 |
-
msgid "Seller Info"
|
| 1402 |
-
msgstr ""
|
| 1403 |
-
|
| 1404 |
-
#: classes/admin/settings/sf-options.php:128
|
| 1405 |
-
msgid "Product Add Page"
|
| 1406 |
-
msgstr ""
|
| 1407 |
-
|
| 1408 |
-
#: classes/admin/settings/sf-options.php:128
|
| 1409 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 1410 |
-
msgstr ""
|
| 1411 |
-
|
| 1412 |
-
#: classes/admin/settings/sf-options.php:131
|
| 1413 |
-
msgid "Left side panel"
|
| 1414 |
-
msgstr ""
|
| 1415 |
-
|
| 1416 |
-
#: classes/admin/settings/sf-options.php:132
|
| 1417 |
-
msgid "CHECKING these boxes will **HIDE** these areas of the add product page for vendors"
|
| 1418 |
-
msgstr ""
|
| 1419 |
-
|
| 1420 |
-
#: classes/admin/settings/sf-options.php:146
|
| 1421 |
-
msgid "Types"
|
| 1422 |
-
msgstr ""
|
| 1423 |
-
|
| 1424 |
-
#: classes/admin/settings/sf-options.php:147
|
| 1425 |
-
msgid "CHECKING these boxes will HIDE these product types from the vendor"
|
| 1426 |
-
msgstr ""
|
| 1427 |
-
|
| 1428 |
-
#: classes/admin/settings/sf-options.php:150
|
| 1429 |
-
msgid "Simple"
|
| 1430 |
-
msgstr ""
|
| 1431 |
-
|
| 1432 |
-
#: classes/admin/settings/sf-options.php:151
|
| 1433 |
-
msgid "Variable"
|
| 1434 |
-
msgstr ""
|
| 1435 |
-
|
| 1436 |
-
#: classes/admin/settings/sf-options.php:152
|
| 1437 |
-
msgid "Grouped"
|
| 1438 |
-
msgstr ""
|
| 1439 |
-
|
| 1440 |
-
#: classes/admin/settings/sf-options.php:153
|
| 1441 |
-
msgid "External / affiliate"
|
| 1442 |
-
msgstr ""
|
| 1443 |
-
|
| 1444 |
-
#: classes/admin/settings/sf-options.php:160
|
| 1445 |
-
msgid "Type options"
|
| 1446 |
-
msgstr ""
|
| 1447 |
-
|
| 1448 |
-
#: classes/admin/settings/sf-options.php:161
|
| 1449 |
-
msgid "CHECKING these boxes will **HIDE** these product options from the vendor"
|
| 1450 |
-
msgstr ""
|
| 1451 |
-
|
| 1452 |
-
#: classes/admin/settings/sf-options.php:172
|
| 1453 |
-
msgid "Miscellaneous"
|
| 1454 |
-
msgstr ""
|
| 1455 |
-
|
| 1456 |
-
#: classes/admin/settings/sf-options.php:177
|
| 1457 |
-
msgid "Featured"
|
| 1458 |
-
msgstr ""
|
| 1459 |
-
|
| 1460 |
-
#: classes/admin/settings/sf-options.php:185
|
| 1461 |
-
msgid "Stylesheet"
|
| 1462 |
-
msgstr ""
|
| 1463 |
-
|
| 1464 |
-
#: classes/admin/settings/sf-options.php:186
|
| 1465 |
-
msgid "You can add CSS in this textarea, which will be loaded on the product add/edit page for vendors."
|
| 1466 |
-
msgstr ""
|
| 1467 |
-
|
| 1468 |
-
#: classes/admin/settings/sf-options.php:193
|
| 1469 |
-
msgid "General permissions used around the shop"
|
| 1470 |
-
msgstr ""
|
| 1471 |
-
|
| 1472 |
-
#: classes/admin/settings/sf-options.php:197
|
| 1473 |
-
msgid "View orders"
|
| 1474 |
-
msgstr ""
|
| 1475 |
-
|
| 1476 |
-
#: classes/admin/settings/sf-options.php:198
|
| 1477 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 1478 |
-
msgstr ""
|
| 1479 |
-
|
| 1480 |
-
#: classes/admin/settings/sf-options.php:205
|
| 1481 |
-
msgid "View comments"
|
| 1482 |
-
msgstr ""
|
| 1483 |
-
|
| 1484 |
-
#: classes/admin/settings/sf-options.php:206
|
| 1485 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 1486 |
-
msgstr ""
|
| 1487 |
-
|
| 1488 |
-
#: classes/admin/settings/sf-options.php:213
|
| 1489 |
-
msgid "Submit comments"
|
| 1490 |
-
msgstr ""
|
| 1491 |
-
|
| 1492 |
-
#: classes/admin/settings/sf-options.php:214
|
| 1493 |
-
msgid "Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 1494 |
-
msgstr ""
|
| 1495 |
-
|
| 1496 |
-
#: classes/admin/settings/sf-options.php:221
|
| 1497 |
-
msgid "View email addresses"
|
| 1498 |
-
msgstr ""
|
| 1499 |
-
|
| 1500 |
-
#: classes/admin/settings/sf-options.php:222
|
| 1501 |
-
msgid "While viewing order details on the frontend, you can disable or enable email addresses"
|
| 1502 |
-
msgstr ""
|
| 1503 |
-
|
| 1504 |
-
#: classes/admin/settings/sf-options.php:229
|
| 1505 |
-
msgid "Export a CSV file of orders for a product"
|
| 1506 |
-
msgstr ""
|
| 1507 |
-
|
| 1508 |
-
#: classes/admin/settings/sf-options.php:230
|
| 1509 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 1510 |
-
msgstr ""
|
| 1511 |
-
|
| 1512 |
-
#: classes/admin/settings/sf-options.php:237
|
| 1513 |
-
msgid "View Frontend sales reports"
|
| 1514 |
-
msgstr ""
|
| 1515 |
-
|
| 1516 |
-
#: classes/admin/settings/sf-options.php:238
|
| 1517 |
-
msgid "Sales table on the frontend on the Vendor Dashboard page. The table will only display sales data that pertain to their products, and only for orders that are processing or completed."
|
| 1518 |
-
msgstr ""
|
| 1519 |
-
|
| 1520 |
-
#: classes/admin/settings/sf-options.php:246
|
| 1521 |
-
msgid "Submit products"
|
| 1522 |
-
msgstr ""
|
| 1523 |
-
|
| 1524 |
-
#: classes/admin/settings/sf-options.php:247
|
| 1525 |
-
msgid "Check to allow vendors to list new products. Admin must approve new products by editing the product, and clicking Publish."
|
| 1526 |
-
msgstr ""
|
| 1527 |
-
|
| 1528 |
-
#: classes/admin/settings/sf-options.php:254
|
| 1529 |
-
msgid "Edit live products"
|
| 1530 |
-
msgstr ""
|
| 1531 |
-
|
| 1532 |
-
#: classes/admin/settings/sf-options.php:255
|
| 1533 |
-
msgid "Vendors could edit an approved product after it has already gone live. There is no approval or review after editing a live product. This could be dangerous with malicious vendors, so take caution."
|
| 1534 |
-
msgstr ""
|
| 1535 |
-
|
| 1536 |
-
#: classes/admin/settings/sf-options.php:262
|
| 1537 |
-
msgid "Submit products live without requiring approval"
|
| 1538 |
-
msgstr ""
|
| 1539 |
-
|
| 1540 |
-
#: classes/admin/settings/sf-options.php:263
|
| 1541 |
-
msgid "Vendors can submit products without review or approval from a shop admin. This could be dangerous with malicious vendors, so take caution."
|
| 1542 |
-
msgstr ""
|
| 1543 |
-
|
| 1544 |
-
#: classes/admin/settings/sf-options.php:270
|
| 1545 |
-
msgid "Page configuration"
|
| 1546 |
-
msgstr ""
|
| 1547 |
-
|
| 1548 |
-
#: classes/admin/settings/sf-options.php:273
|
| 1549 |
-
msgid "Vendor dashboard"
|
| 1550 |
-
msgstr ""
|
| 1551 |
-
|
| 1552 |
-
#: classes/admin/settings/sf-options.php:274
|
| 1553 |
-
msgid "Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</code><br/>. If this page is not set, you will break your site. If you upgrade to Pro, keep this page unchanged as both Pro Dashboard and this Dashboard page must be set."
|
| 1554 |
-
msgstr ""
|
| 1555 |
-
|
| 1556 |
-
#: classes/admin/settings/sf-options.php:281
|
| 1557 |
-
msgid "Shop settings"
|
| 1558 |
-
msgstr ""
|
| 1559 |
-
|
| 1560 |
-
#: classes/admin/settings/sf-options.php:282
|
| 1561 |
-
msgid "Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/>These are the shop settings a vendor can configure. By default, Vendor Dashboard > Shop Settings should have this shortcode."
|
| 1562 |
-
msgstr ""
|
| 1563 |
-
|
| 1564 |
-
#: classes/admin/settings/sf-options.php:289
|
| 1565 |
-
msgid "Orders page"
|
| 1566 |
-
msgstr ""
|
| 1567 |
-
|
| 1568 |
-
#: classes/admin/settings/sf-options.php:290
|
| 1569 |
-
msgid "Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By default, Vendor Dashboard > Orders should have the shortcode."
|
| 1570 |
-
msgstr ""
|
| 1571 |
-
|
| 1572 |
-
#: classes/admin/settings/sf-options.php:297
|
| 1573 |
-
msgid "Vendor terms"
|
| 1574 |
-
msgstr ""
|
| 1575 |
-
|
| 1576 |
-
#: classes/admin/settings/sf-options.php:298
|
| 1577 |
-
msgid "These terms are shown to a user when submitting an application to become a vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor must accept terms in order to register, if set."
|
| 1578 |
-
msgstr ""
|
| 1579 |
-
|
| 1580 |
-
#: classes/admin/settings/sf-options.php:305
|
| 1581 |
-
msgid "payments"
|
| 1582 |
-
msgstr ""
|
| 1583 |
-
|
| 1584 |
-
#: classes/admin/settings/sf-options.php:318
|
| 1585 |
-
msgid "PayPal Adaptive Payments Scheduling - PayPal MassPay has been depreciated by PayPal as of September 2017"
|
| 1586 |
-
msgstr ""
|
| 1587 |
-
|
| 1588 |
-
#: classes/admin/settings/sf-options.php:319
|
| 1589 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 1590 |
-
msgstr ""
|
| 1591 |
-
|
| 1592 |
-
#: classes/admin/settings/sf-options.php:320
|
| 1593 |
-
msgid "Make sure you update your PayPal Adaptive Payments settings <a href=\"%s\">here</a>. <br><br>To instantly pay with Adaptive Payments you must activate the PayPal AP gateway in your Checkout settings. <br><a href=\"https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/\" target=\"top\">PayPal AP Application Help</a>. <br><br>Another gateway that offers instant payments to vendors that also accepts credit cards directly on your checkout page is Stripe. <br><a href=\"https://www.wcvendors.com/product/stripe-commissions-gateway/\" target=\"top\">Stripe Commissions & Gateway plugin</a> is specifically coded for WC Vendors and <a href=\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC Vendors Pro</a>."
|
| 1594 |
-
msgstr ""
|
| 1595 |
-
|
| 1596 |
-
#: classes/admin/settings/sf-options.php:324
|
| 1597 |
-
msgid "Instant pay"
|
| 1598 |
-
msgstr ""
|
| 1599 |
-
|
| 1600 |
-
#: classes/admin/settings/sf-options.php:325
|
| 1601 |
-
msgid "Instantly pay vendors their commission when an order is made, and if a vendor has a valid PayPal email added on their Shop Settings page."
|
| 1602 |
-
msgstr ""
|
| 1603 |
-
|
| 1604 |
-
#: classes/admin/settings/sf-options.php:326
|
| 1605 |
-
msgid "For this to work, customers must checkout with the PayPal Adaptive Payments gateway. Using any other gateways will not pay vendors instantly"
|
| 1606 |
-
msgstr ""
|
| 1607 |
-
|
| 1608 |
-
#: classes/admin/settings/sf-options.php:333
|
| 1609 |
-
msgid "Payment schedule"
|
| 1610 |
-
msgstr ""
|
| 1611 |
-
|
| 1612 |
-
#: classes/admin/settings/sf-options.php:334
|
| 1613 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 1614 |
-
msgstr ""
|
| 1615 |
-
|
| 1616 |
-
#: classes/admin/settings/sf-options.php:339
|
| 1617 |
-
msgid "Daily"
|
| 1618 |
-
msgstr ""
|
| 1619 |
-
|
| 1620 |
-
#: classes/admin/settings/sf-options.php:340
|
| 1621 |
-
msgid "Weekly"
|
| 1622 |
-
msgstr ""
|
| 1623 |
-
|
| 1624 |
-
#: classes/admin/settings/sf-options.php:341
|
| 1625 |
-
msgid "Biweekly"
|
| 1626 |
-
msgstr ""
|
| 1627 |
-
|
| 1628 |
-
#: classes/admin/settings/sf-options.php:342
|
| 1629 |
-
msgid "Monthly"
|
| 1630 |
-
msgstr ""
|
| 1631 |
-
|
| 1632 |
-
#: classes/admin/settings/sf-options.php:343
|
| 1633 |
-
msgid "Manual"
|
| 1634 |
-
msgstr ""
|
| 1635 |
-
|
| 1636 |
-
#: classes/admin/settings/sf-options.php:344
|
| 1637 |
-
msgid "Now"
|
| 1638 |
-
msgstr ""
|
| 1639 |
-
|
| 1640 |
-
#: classes/admin/settings/sf-options.php:349
|
| 1641 |
-
msgid "Email notification"
|
| 1642 |
-
msgstr ""
|
| 1643 |
-
|
| 1644 |
-
#: classes/admin/settings/sf-options.php:350
|
| 1645 |
-
msgid "Send the WooCommerce admin an email each time a payment has been made via the payment schedule options above"
|
| 1646 |
-
msgstr ""
|
| 1647 |
-
|
| 1648 |
-
#: classes/admin/views/html-vendor-settings-page.php:11, templates/dashboard/settings/paypal-email-form.php:2
|
| 1649 |
-
msgid "PayPal Address"
|
| 1650 |
-
msgstr ""
|
| 1651 |
-
|
| 1652 |
-
#: classes/admin/views/html-vendor-settings-page.php:15, templates/dashboard/settings/paypal-email-form.php:3
|
| 1653 |
-
msgid "Your PayPal address is used to send you your commission."
|
| 1654 |
-
msgstr ""
|
| 1655 |
-
|
| 1656 |
-
#: classes/admin/views/html-vendor-settings-page.php:24, templates/dashboard/settings/shop-name.php:3
|
| 1657 |
-
msgid "Your shop name is public and must be unique."
|
| 1658 |
-
msgstr ""
|
| 1659 |
-
|
| 1660 |
-
#: classes/admin/views/html-vendor-settings-page.php:43, templates/dashboard/settings/seller-info.php:4
|
| 1661 |
-
msgid "This is displayed on each of your products."
|
| 1662 |
-
msgstr ""
|
| 1663 |
-
|
| 1664 |
-
#: classes/admin/views/html-vendor-settings-page.php:49, templates/dashboard/settings/shop-description.php:2
|
| 1665 |
-
msgid "Shop Description"
|
| 1666 |
-
msgstr ""
|
| 1667 |
-
|
| 1668 |
-
#: classes/admin/views/html-vendor-settings-page.php:61, templates/dashboard/settings/shop-description.php:3
|
| 1669 |
-
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 1670 |
-
msgstr ""
|
| 1671 |
-
|
| 1672 |
-
#: classes/admin/views/html-vendor-settings-page.php:70
|
| 1673 |
-
msgid "Save Shop Settings"
|
| 1674 |
-
msgstr ""
|
| 1675 |
-
|
| 1676 |
-
#: classes/admin/views/notices/html-notice-custom.php:12, classes/admin/views/notices/html-notice-template-check.php:13, classes/admin/views/notices/html-notice-updated.php:12
|
| 1677 |
-
msgid "Dismiss"
|
| 1678 |
-
msgstr ""
|
| 1679 |
-
|
| 1680 |
-
#: classes/admin/views/notices/html-notice-install.php:12, classes/includes/views/html-notice-install.php:12
|
| 1681 |
-
msgid "<strong>Welcome to WC Vendors</strong> – You‘re almost ready to start your marketplace"
|
| 1682 |
-
msgstr ""
|
| 1683 |
-
|
| 1684 |
-
#: classes/admin/views/notices/html-notice-install.php:13, classes/includes/views/html-notice-install.php:13
|
| 1685 |
-
msgid "Run the Setup Wizard"
|
| 1686 |
-
msgstr ""
|
| 1687 |
-
|
| 1688 |
-
#: classes/admin/views/notices/html-notice-install.php:13, classes/includes/views/html-notice-install.php:13
|
| 1689 |
-
msgid "Skip setup"
|
| 1690 |
-
msgstr ""
|
| 1691 |
-
|
| 1692 |
-
#: classes/admin/views/notices/html-notice-template-check.php:15
|
| 1693 |
-
msgid "<strong>Your theme (%1$s) contains outdated copies of some WC Vendors template files.</strong> These files may need updating to ensure they are compatible with the current version of WC Vendors. You can see which files are affected from the <a href=\"%2$s\">system status page</a>. If in doubt, check with the author of the theme."
|
| 1694 |
-
msgstr ""
|
| 1695 |
-
|
| 1696 |
-
#: classes/admin/views/notices/html-notice-template-check.php:16
|
| 1697 |
-
msgid "Learn more about templates"
|
| 1698 |
-
msgstr ""
|
| 1699 |
-
|
| 1700 |
-
#: classes/admin/views/notices/html-notice-update.php:12, classes/includes/views/html-notice-update.php:12
|
| 1701 |
-
msgid "<strong>WC Vendors Update Required.</strong> – We need to upgrade your configuration to the latest version."
|
| 1702 |
-
msgstr ""
|
| 1703 |
-
|
| 1704 |
-
#: classes/admin/views/notices/html-notice-update.php:13, classes/includes/views/html-notice-update.php:13
|
| 1705 |
-
msgid "Run the update"
|
| 1706 |
-
msgstr ""
|
| 1707 |
-
|
| 1708 |
-
#: classes/admin/views/notices/html-notice-update.php:17, classes/includes/views/html-notice-update.php:17
|
| 1709 |
-
msgid "It is strongly recommended that you backup your database before proceeding. Are you sure you wish to run the updater now?"
|
| 1710 |
-
msgstr ""
|
| 1711 |
-
|
| 1712 |
-
#: classes/admin/views/notices/html-notice-updated.php:13
|
| 1713 |
-
msgid "WC Vendors data update complete. Thank you for updating to the latest version!"
|
| 1714 |
-
msgstr ""
|
| 1715 |
-
|
| 1716 |
-
#: classes/admin/views/notices/html-notice-updating.php:12
|
| 1717 |
-
msgid "WC Vendors data update"
|
| 1718 |
-
msgstr ""
|
| 1719 |
-
|
| 1720 |
-
#: classes/admin/views/notices/html-notice-updating.php:12
|
| 1721 |
-
msgid "Your database is being updated in the background."
|
| 1722 |
-
msgstr ""
|
| 1723 |
-
|
| 1724 |
-
#: classes/admin/views/notices/html-notice-updating.php:12
|
| 1725 |
-
msgid "Taking a while? Click here to run it now."
|
| 1726 |
-
msgstr ""
|
| 1727 |
-
|
| 1728 |
-
#: classes/admin/views/setup/capabilities.php:14
|
| 1729 |
-
msgid "Enable and disable capabilites of the %s"
|
| 1730 |
-
msgstr ""
|
| 1731 |
-
|
| 1732 |
-
#: classes/admin/views/setup/capabilities.php:51
|
| 1733 |
-
msgid "Allow %s to publish products without requiring approval."
|
| 1734 |
-
msgstr ""
|
| 1735 |
-
|
| 1736 |
-
#: classes/admin/views/setup/capabilities.php:132, classes/admin/views/setup/capabilities.php:132, classes/admin/views/setup/general.php:97, classes/admin/views/setup/general.php:97, classes/admin/views/setup/pages.php:85, classes/admin/views/setup/pages.php:85
|
| 1737 |
-
msgid "Next"
|
| 1738 |
-
msgstr ""
|
| 1739 |
-
|
| 1740 |
-
#: classes/admin/views/setup/footer.php:13
|
| 1741 |
-
msgid "Exit Wizard"
|
| 1742 |
-
msgstr ""
|
| 1743 |
-
|
| 1744 |
-
#: classes/admin/views/setup/footer.php:15
|
| 1745 |
-
msgid "Return to your dashboard"
|
| 1746 |
-
msgstr ""
|
| 1747 |
-
|
| 1748 |
-
#: classes/admin/views/setup/footer.php:17
|
| 1749 |
-
msgid "Skip this step"
|
| 1750 |
-
msgstr ""
|
| 1751 |
-
|
| 1752 |
-
#: classes/admin/views/setup/general.php:14
|
| 1753 |
-
msgid "The following wizard will help you configure your marketplace and get your vendors onboard quickly."
|
| 1754 |
-
msgstr ""
|
| 1755 |
-
|
| 1756 |
-
#: classes/admin/views/setup/general.php:38
|
| 1757 |
-
msgid "Manually approve %s applications"
|
| 1758 |
-
msgstr ""
|
| 1759 |
-
|
| 1760 |
-
#: classes/admin/views/setup/general.php:51
|
| 1761 |
-
msgid "Give any taxes to %s"
|
| 1762 |
-
msgstr ""
|
| 1763 |
-
|
| 1764 |
-
#: classes/admin/views/setup/general.php:64
|
| 1765 |
-
msgid "Give any shipping to %s"
|
| 1766 |
-
msgstr ""
|
| 1767 |
-
|
| 1768 |
-
#: classes/admin/views/setup/general.php:81
|
| 1769 |
-
msgid "Commissions are calculated per product. The commission rate can be set globally, at a vendor level or at a product level."
|
| 1770 |
-
msgstr ""
|
| 1771 |
-
|
| 1772 |
-
#: classes/admin/views/setup/general.php:86
|
| 1773 |
-
msgid "Global Commission Rate %"
|
| 1774 |
-
msgstr ""
|
| 1775 |
-
|
| 1776 |
-
#: classes/admin/views/setup/header.php:16
|
| 1777 |
-
msgid "WC Vendors › Setup Wizard"
|
| 1778 |
-
msgstr ""
|
| 1779 |
-
|
| 1780 |
-
#: classes/admin/views/setup/pages.php:14
|
| 1781 |
-
msgid "Select the pages for relevant frontend features for %s"
|
| 1782 |
-
msgstr ""
|
| 1783 |
-
|
| 1784 |
-
#: classes/admin/views/setup/pages.php:25
|
| 1785 |
-
msgid "Vendor Dashboard"
|
| 1786 |
-
msgstr ""
|
| 1787 |
-
|
| 1788 |
-
#: classes/admin/views/setup/pages.php:34
|
| 1789 |
-
msgid "This page should contain the following shortcode. <code>[wcv_vendor_dashboard]</code>"
|
| 1790 |
-
msgstr ""
|
| 1791 |
-
|
| 1792 |
-
#: classes/admin/views/setup/pages.php:38
|
| 1793 |
-
msgid "%s Shop Settings"
|
| 1794 |
-
msgstr ""
|
| 1795 |
-
|
| 1796 |
-
#: classes/admin/views/setup/pages.php:45
|
| 1797 |
-
msgid "This page should contain the following shortcode. <code>[wcv_shop_settings]</code>"
|
| 1798 |
-
msgstr ""
|
| 1799 |
-
|
| 1800 |
-
#: classes/admin/views/setup/pages.php:49
|
| 1801 |
-
msgid "Orders Page"
|
| 1802 |
-
msgstr ""
|
| 1803 |
-
|
| 1804 |
-
#: classes/admin/views/setup/pages.php:56
|
| 1805 |
-
msgid "This page should contain the following shortcode. <code>[wcv_orders]</code>"
|
| 1806 |
-
msgstr ""
|
| 1807 |
-
|
| 1808 |
-
#: classes/admin/views/setup/pages.php:60
|
| 1809 |
-
msgid "%s List Page"
|
| 1810 |
-
msgstr ""
|
| 1811 |
-
|
| 1812 |
-
#: classes/admin/views/setup/pages.php:67
|
| 1813 |
-
msgid "This page should contain the following shortcode. <code>[wcv_vendorslist]</code>"
|
| 1814 |
-
msgstr ""
|
| 1815 |
-
|
| 1816 |
-
#: classes/admin/views/setup/pages.php:71
|
| 1817 |
-
msgid "%s Terms Page"
|
| 1818 |
-
msgstr ""
|
| 1819 |
-
|
| 1820 |
-
#: classes/admin/views/setup/pages.php:78
|
| 1821 |
-
msgid "This optional page allows you to define terms and conidtions %s need to agree to before applying to your marketplace. "
|
| 1822 |
-
msgstr ""
|
| 1823 |
-
|
| 1824 |
-
#: classes/admin/views/setup/ready.php:12
|
| 1825 |
-
msgid "Your marketplace is ready!"
|
| 1826 |
-
msgstr ""
|
| 1827 |
-
|
| 1828 |
-
#: classes/admin/views/setup/ready.php:15
|
| 1829 |
-
msgid "Subscribe to our newsletter! Get product updates, marketplace tips, information and more."
|
| 1830 |
-
msgstr ""
|
| 1831 |
-
|
| 1832 |
-
#: classes/admin/views/setup/ready.php:23, classes/front/orders/class-orders.php:256
|
| 1833 |
-
msgid "Email address"
|
| 1834 |
-
msgstr ""
|
| 1835 |
-
|
| 1836 |
-
#: classes/admin/views/setup/ready.php:29, classes/admin/views/setup/ready.php:33
|
| 1837 |
-
msgid "Subscribe me"
|
| 1838 |
-
msgstr ""
|
| 1839 |
-
|
| 1840 |
-
#: classes/admin/views/setup/ready.php:42
|
| 1841 |
-
msgid "Next step"
|
| 1842 |
-
msgstr ""
|
| 1843 |
-
|
| 1844 |
-
#: classes/admin/views/setup/ready.php:43
|
| 1845 |
-
msgid "Upgrade to Pro!"
|
| 1846 |
-
msgstr ""
|
| 1847 |
-
|
| 1848 |
-
#: classes/admin/views/setup/ready.php:44
|
| 1849 |
-
msgid "Upgrade today to extend the features of your marketplace."
|
| 1850 |
-
msgstr ""
|
| 1851 |
-
|
| 1852 |
-
#: classes/admin/views/setup/ready.php:45
|
| 1853 |
-
msgid "Features"
|
| 1854 |
-
msgstr ""
|
| 1855 |
-
|
| 1856 |
-
#: classes/admin/views/setup/ready.php:47
|
| 1857 |
-
msgid "Complete frontend dashboard for vendors"
|
| 1858 |
-
msgstr ""
|
| 1859 |
-
|
| 1860 |
-
#: classes/admin/views/setup/ready.php:48
|
| 1861 |
-
msgid "Flat rate & table rate shipping module"
|
| 1862 |
-
msgstr ""
|
| 1863 |
-
|
| 1864 |
-
#: classes/admin/views/setup/ready.php:49
|
| 1865 |
-
msgid "Coupons, ratings, reports, orders and more."
|
| 1866 |
-
msgstr ""
|
| 1867 |
-
|
| 1868 |
-
#: classes/admin/views/setup/ready.php:50
|
| 1869 |
-
msgid "Advanced commissions"
|
| 1870 |
-
msgstr ""
|
| 1871 |
-
|
| 1872 |
-
#: classes/admin/views/setup/ready.php:51
|
| 1873 |
-
msgid "Premium support & updates"
|
| 1874 |
-
msgstr ""
|
| 1875 |
-
|
| 1876 |
-
#: classes/admin/views/setup/ready.php:57
|
| 1877 |
-
msgid "Upgrade Now"
|
| 1878 |
-
msgstr ""
|
| 1879 |
-
|
| 1880 |
-
#: classes/admin/views/setup/ready.php:64
|
| 1881 |
-
msgid "Extend your marketplace"
|
| 1882 |
-
msgstr ""
|
| 1883 |
-
|
| 1884 |
-
#: classes/admin/views/setup/ready.php:66
|
| 1885 |
-
msgid "Extend your marketplace today with a variety of extensions from us and 3rd party developers."
|
| 1886 |
-
msgstr ""
|
| 1887 |
-
|
| 1888 |
-
#: classes/admin/views/setup/ready.php:71
|
| 1889 |
-
msgid "View Extensions"
|
| 1890 |
-
msgstr ""
|
| 1891 |
-
|
| 1892 |
-
#: classes/admin/views/setup/ready.php:77
|
| 1893 |
-
msgid "Need Help?"
|
| 1894 |
-
msgstr ""
|
| 1895 |
-
|
| 1896 |
-
#: classes/class-cron.php:87
|
| 1897 |
-
msgid "Payment total: %s"
|
| 1898 |
-
msgstr ""
|
| 1899 |
-
|
| 1900 |
-
#: classes/class-install.php:171
|
| 1901 |
-
msgctxt "Page slug"
|
| 1902 |
-
msgid "vendor_dashboard"
|
| 1903 |
-
msgstr ""
|
| 1904 |
-
|
| 1905 |
-
#: classes/class-install.php:173
|
| 1906 |
-
msgctxt "Page title"
|
| 1907 |
-
msgid "%s Dashboard"
|
| 1908 |
-
msgstr ""
|
| 1909 |
-
|
| 1910 |
-
#: classes/class-install.php:179
|
| 1911 |
-
msgctxt "Page slug"
|
| 1912 |
-
msgid "vendors"
|
| 1913 |
-
msgstr ""
|
| 1914 |
-
|
| 1915 |
-
#: classes/class-install.php:181
|
| 1916 |
-
msgctxt "Page title"
|
| 1917 |
-
msgid "%s"
|
| 1918 |
-
msgstr ""
|
| 1919 |
-
|
| 1920 |
-
#: classes/class-install.php:189
|
| 1921 |
-
msgctxt "Page slug"
|
| 1922 |
-
msgid "shop_settings"
|
| 1923 |
-
msgstr ""
|
| 1924 |
-
|
| 1925 |
-
#: classes/class-install.php:190
|
| 1926 |
-
msgctxt "Page title"
|
| 1927 |
-
msgid "Shop Settings"
|
| 1928 |
-
msgstr ""
|
| 1929 |
-
|
| 1930 |
-
#: classes/class-install.php:195
|
| 1931 |
-
msgctxt "Page slug"
|
| 1932 |
-
msgid "product_orders"
|
| 1933 |
-
msgstr ""
|
| 1934 |
-
|
| 1935 |
-
#: classes/class-install.php:196
|
| 1936 |
-
msgctxt "Page title"
|
| 1937 |
-
msgid "Orders"
|
| 1938 |
-
msgstr ""
|
| 1939 |
-
|
| 1940 |
-
#: classes/class-install.php:400
|
| 1941 |
-
msgid "View WC Vendors settings"
|
| 1942 |
-
msgstr ""
|
| 1943 |
-
|
| 1944 |
-
#: classes/class-install.php:416
|
| 1945 |
-
msgid "View WC Vendors documentation"
|
| 1946 |
-
msgstr ""
|
| 1947 |
-
|
| 1948 |
-
#: classes/class-install.php:416
|
| 1949 |
-
msgid "Docs"
|
| 1950 |
-
msgstr ""
|
| 1951 |
-
|
| 1952 |
-
#: classes/class-install.php:417
|
| 1953 |
-
msgid "Visit community forums"
|
| 1954 |
-
msgstr ""
|
| 1955 |
-
|
| 1956 |
-
#: classes/class-install.php:417
|
| 1957 |
-
msgid "Free support"
|
| 1958 |
-
msgstr ""
|
| 1959 |
-
|
| 1960 |
-
#: classes/class-install.php:418
|
| 1961 |
-
msgid "Visit premium customer support"
|
| 1962 |
-
msgstr ""
|
| 1963 |
-
|
| 1964 |
-
#: classes/class-install.php:418
|
| 1965 |
-
msgid "Premium support"
|
| 1966 |
-
msgstr ""
|
| 1967 |
-
|
| 1968 |
-
#: classes/class-vendor-post-types.php:34
|
| 1969 |
-
msgid "Vendor Orders"
|
| 1970 |
-
msgstr ""
|
| 1971 |
-
|
| 1972 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:56
|
| 1973 |
-
msgid "Order marked shipped."
|
| 1974 |
-
msgstr ""
|
| 1975 |
-
|
| 1976 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:59
|
| 1977 |
-
msgid "%s has marked as shipped. "
|
| 1978 |
-
msgstr ""
|
| 1979 |
-
|
| 1980 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:88, classes/front/dashboard/class-vendor-dashboard.php:89
|
| 1981 |
-
msgid "Tracking number"
|
| 1982 |
-
msgstr ""
|
| 1983 |
-
|
| 1984 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:91
|
| 1985 |
-
msgid "Success. Your tracking number has been updated."
|
| 1986 |
-
msgstr ""
|
| 1987 |
-
|
| 1988 |
-
#: classes/front/orders/class-export-csv.php:19, templates/dashboard/reports.php:18, templates/emails/notify-vendor-shipped.php:27, templates/emails/vendor-new-order.php:31
|
| 1989 |
-
msgid "Quantity"
|
| 1990 |
-
msgstr ""
|
| 1991 |
-
|
| 1992 |
-
#: classes/front/orders/class-export-csv.php:20
|
| 1993 |
-
msgid "Item Meta"
|
| 1994 |
-
msgstr ""
|
| 1995 |
-
|
| 1996 |
-
#: classes/front/orders/class-orders.php:100, classes/front/orders/class-orders.php:166
|
| 1997 |
-
msgid "You haven't selected a product's orders to view! Please go back to the Vendor Dashboard and click Show Orders on the product you'd like to view."
|
| 1998 |
-
msgstr ""
|
| 1999 |
-
|
| 2000 |
-
#: classes/front/orders/class-orders.php:123, classes/front/orders/class-orders.php:189
|
| 2001 |
-
msgid "No orders."
|
| 2002 |
-
msgstr ""
|
| 2003 |
-
|
| 2004 |
-
#: classes/front/orders/class-orders.php:250
|
| 2005 |
-
msgid "Product Title"
|
| 2006 |
-
msgstr ""
|
| 2007 |
-
|
| 2008 |
-
#: classes/front/orders/class-orders.php:251
|
| 2009 |
-
msgid "Full name"
|
| 2010 |
-
msgstr ""
|
| 2011 |
-
|
| 2012 |
-
#: classes/front/orders/class-orders.php:252
|
| 2013 |
-
msgid "Address"
|
| 2014 |
-
msgstr ""
|
| 2015 |
-
|
| 2016 |
-
#: classes/front/orders/class-orders.php:253
|
| 2017 |
-
msgid "City"
|
| 2018 |
-
msgstr ""
|
| 2019 |
-
|
| 2020 |
-
#: classes/front/orders/class-orders.php:254
|
| 2021 |
-
msgid "State"
|
| 2022 |
-
msgstr ""
|
| 2023 |
-
|
| 2024 |
-
#: classes/front/orders/class-orders.php:255
|
| 2025 |
-
msgid "Zip"
|
| 2026 |
-
msgstr ""
|
| 2027 |
-
|
| 2028 |
-
#: classes/front/orders/class-submit-comment.php:41
|
| 2029 |
-
msgid "You've left the comment field empty!"
|
| 2030 |
-
msgstr ""
|
| 2031 |
-
|
| 2032 |
-
#: classes/front/orders/class-submit-comment.php:63
|
| 2033 |
-
msgid "Success. The customer has been notified of your comment."
|
| 2034 |
-
msgstr ""
|
| 2035 |
-
|
| 2036 |
-
#: classes/front/signup/class-vendor-signup.php:81
|
| 2037 |
-
msgid "ERROR"
|
| 2038 |
-
msgstr ""
|
| 2039 |
-
|
| 2040 |
-
#: classes/front/signup/class-vendor-signup.php:100
|
| 2041 |
-
msgid "Application denied. You are an administrator."
|
| 2042 |
-
msgstr ""
|
| 2043 |
-
|
| 2044 |
-
#: classes/front/signup/class-vendor-signup.php:102
|
| 2045 |
-
msgid "Your application has been submitted."
|
| 2046 |
-
msgstr ""
|
| 2047 |
-
|
| 2048 |
-
#: classes/front/signup/class-vendor-signup.php:149, classes/front/signup/class-vendor-signup.php:186, classes/front/signup/class-vendor-signup.php:198
|
| 2049 |
-
msgid "You must accept the terms and conditions to become a vendor."
|
| 2050 |
-
msgstr ""
|
| 2051 |
-
|
| 2052 |
-
#: classes/front/signup/views/html-vendor-signup.php:22, templates/dashboard/denied.php:22
|
| 2053 |
-
msgid "Apply to become a vendor? "
|
| 2054 |
-
msgstr ""
|
| 2055 |
-
|
| 2056 |
-
#: classes/front/signup/views/html-vendor-signup.php:36
|
| 2057 |
-
msgid "I have read and accepted the <a target=\"top\" href=\"%s\">terms and conditions</a>."
|
| 2058 |
-
msgstr ""
|
| 2059 |
-
|
| 2060 |
-
#: classes/front/signup/views/html-vendor-signup.php:45
|
| 2061 |
-
msgid "Please agree to the terms and conditions"
|
| 2062 |
-
msgstr ""
|
| 2063 |
-
|
| 2064 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 2065 |
-
msgid "PayPal Adaptive Payments"
|
| 2066 |
-
msgstr ""
|
| 2067 |
-
|
| 2068 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 2069 |
-
msgid "Something went wrong. Response from PayPal invalidated this order. Status: %s."
|
| 2070 |
-
msgstr ""
|
| 2071 |
-
|
| 2072 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 2073 |
-
msgid "IPN payment completed"
|
| 2074 |
-
msgstr ""
|
| 2075 |
-
|
| 2076 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 2077 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 2078 |
-
msgstr ""
|
| 2079 |
-
|
| 2080 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 2081 |
-
msgid "Method Title"
|
| 2082 |
-
msgstr ""
|
| 2083 |
-
|
| 2084 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:153, classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:70
|
| 2085 |
-
msgid "This controls the title which the user sees during checkout."
|
| 2086 |
-
msgstr ""
|
| 2087 |
-
|
| 2088 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 2089 |
-
msgid "PayPal"
|
| 2090 |
-
msgstr ""
|
| 2091 |
-
|
| 2092 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:159, classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:75
|
| 2093 |
-
msgid "Description"
|
| 2094 |
-
msgstr ""
|
| 2095 |
-
|
| 2096 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 2097 |
-
msgid "This controls the description which the user sees during checkout."
|
| 2098 |
-
msgstr ""
|
| 2099 |
-
|
| 2100 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 2101 |
-
msgid "Pay via PayPal!"
|
| 2102 |
-
msgstr ""
|
| 2103 |
-
|
| 2104 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 2105 |
-
msgid "Live Credentials"
|
| 2106 |
-
msgstr ""
|
| 2107 |
-
|
| 2108 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 2109 |
-
msgid "You must have an <a href=\"%s\">Application ID</a> to process live transactions. You do not need one for testing in Sandbox mode."
|
| 2110 |
-
msgstr ""
|
| 2111 |
-
|
| 2112 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:179, classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 2113 |
-
msgid "PayPal Email"
|
| 2114 |
-
msgstr ""
|
| 2115 |
-
|
| 2116 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:180, classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 2117 |
-
msgid "The email address main payments should go to."
|
| 2118 |
-
msgstr ""
|
| 2119 |
-
|
| 2120 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:185, classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 2121 |
-
msgid "API Username"
|
| 2122 |
-
msgstr ""
|
| 2123 |
-
|
| 2124 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:190, classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 2125 |
-
msgid "API Password"
|
| 2126 |
-
msgstr ""
|
| 2127 |
-
|
| 2128 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:195, classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 2129 |
-
msgid "API Signature"
|
| 2130 |
-
msgstr ""
|
| 2131 |
-
|
| 2132 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 2133 |
-
msgid "Application ID"
|
| 2134 |
-
msgstr ""
|
| 2135 |
-
|
| 2136 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 2137 |
-
msgid "Only required when doing live transactions."
|
| 2138 |
-
msgstr ""
|
| 2139 |
-
|
| 2140 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 2141 |
-
msgid "Sandbox Credentials"
|
| 2142 |
-
msgstr ""
|
| 2143 |
-
|
| 2144 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 2145 |
-
msgid "You can signup for a sandbox developer account <a href=\"%s\">here</a>. You need a developer account if you want to enable Sandbox mode for testing."
|
| 2146 |
-
msgstr ""
|
| 2147 |
-
|
| 2148 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 2149 |
-
msgid "Misc. Settings"
|
| 2150 |
-
msgstr ""
|
| 2151 |
-
|
| 2152 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 2153 |
-
msgid "Enable PayPal Sandbox mode"
|
| 2154 |
-
msgstr ""
|
| 2155 |
-
|
| 2156 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 2157 |
-
msgid "Enable logging"
|
| 2158 |
-
msgstr ""
|
| 2159 |
-
|
| 2160 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 2161 |
-
msgid "The PayPal Adaptive Payments gateway can instantly pay your vendors their due commission (if enabled). Also used to mass pay vendors on a schedule / manual method (if enabled)."
|
| 2162 |
-
msgstr ""
|
| 2163 |
-
|
| 2164 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:270
|
| 2165 |
-
msgid "Please Note: PayPal has depreciated Adaptive Payments. This will soon cease to function."
|
| 2166 |
-
msgstr ""
|
| 2167 |
-
|
| 2168 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:281
|
| 2169 |
-
msgid "Gateway Disabled"
|
| 2170 |
-
msgstr ""
|
| 2171 |
-
|
| 2172 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:281
|
| 2173 |
-
msgid "%s does not support your store currency."
|
| 2174 |
-
msgstr ""
|
| 2175 |
-
|
| 2176 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:390, classes/gateways/PayPal_AdvPayments/paypal_ap.php:506, classes/gateways/PayPal_Masspay/class-paypal-masspay.php:153
|
| 2177 |
-
msgid "Error: %s"
|
| 2178 |
-
msgstr ""
|
| 2179 |
-
|
| 2180 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:399, classes/gateways/PayPal_AdvPayments/paypal_ap.php:400
|
| 2181 |
-
msgid "Error ID: %s. %s"
|
| 2182 |
-
msgstr ""
|
| 2183 |
-
|
| 2184 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:514, classes/gateways/PayPal_AdvPayments/paypal_ap.php:515
|
| 2185 |
-
msgid "Error ID: %d. %s"
|
| 2186 |
-
msgstr ""
|
| 2187 |
-
|
| 2188 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 2189 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 2190 |
-
msgstr ""
|
| 2191 |
-
|
| 2192 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:167
|
| 2193 |
-
msgid "All due commission has been paid for."
|
| 2194 |
-
msgstr ""
|
| 2195 |
-
|
| 2196 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:173
|
| 2197 |
-
msgid "All due commission has been paid for, but I could not clear it from their profiles due to an internal error. Commission will still be listed as due. Please manually mark the commission as paid from the Commissions page."
|
| 2198 |
-
msgstr ""
|
| 2199 |
-
|
| 2200 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 2201 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 2202 |
-
msgstr ""
|
| 2203 |
-
|
| 2204 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:210
|
| 2205 |
-
msgid "Hello! A payment was just triggered to mass pay all vendors their due commission."
|
| 2206 |
-
msgstr ""
|
| 2207 |
-
|
| 2208 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:211
|
| 2209 |
-
msgid "Payment status: %s."
|
| 2210 |
-
msgstr ""
|
| 2211 |
-
|
| 2212 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 2213 |
-
msgid "Payment message: %s."
|
| 2214 |
-
msgstr ""
|
| 2215 |
-
|
| 2216 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:215
|
| 2217 |
-
msgid "Payment total: %s."
|
| 2218 |
-
msgstr ""
|
| 2219 |
-
|
| 2220 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:35, classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:71
|
| 2221 |
-
msgid "WC Vendors Test Gateway"
|
| 2222 |
-
msgstr ""
|
| 2223 |
-
|
| 2224 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:36
|
| 2225 |
-
msgid "This gateway will set orders to processing upon receipt allowing you to test transactions in your store. Some WooCommerce included gateways have problems with this - you should use this gateway for all of your non-PayPal testing."
|
| 2226 |
-
msgstr ""
|
| 2227 |
-
|
| 2228 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:64
|
| 2229 |
-
msgid "Enable WC Vendors Test Gateway Payment"
|
| 2230 |
-
msgstr ""
|
| 2231 |
-
|
| 2232 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:68
|
| 2233 |
-
msgid "Title"
|
| 2234 |
-
msgstr ""
|
| 2235 |
-
|
| 2236 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:77
|
| 2237 |
-
msgid "Payment method description that the customer will see on your checkout."
|
| 2238 |
-
msgstr ""
|
| 2239 |
-
|
| 2240 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:78
|
| 2241 |
-
msgid "This is a test gateway -- not to be used on live sites for live transactions. <a href=\"http://www.wcvendors.com/\" target=\"top\">Click here to visit WCVendors.com</a>."
|
| 2242 |
-
msgstr ""
|
| 2243 |
-
|
| 2244 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:82
|
| 2245 |
-
msgid "Instructions"
|
| 2246 |
-
msgstr ""
|
| 2247 |
-
|
| 2248 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:84
|
| 2249 |
-
msgid "Success! Your test order is now marked as processing and any vendors will be sent an email as long as you have the Notify Vendors email enabled under WooCommerce--Settings--Emails."
|
| 2250 |
-
msgstr ""
|
| 2251 |
-
|
| 2252 |
-
#: classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:127
|
| 2253 |
-
msgid "Test gateway transation complete. Order processing."
|
| 2254 |
-
msgstr ""
|
| 2255 |
-
|
| 2256 |
-
#: classes/includes/class-functions.php:57
|
| 2257 |
-
msgid "Vendors"
|
| 2258 |
-
msgstr ""
|
| 2259 |
-
|
| 2260 |
-
#: classes/includes/class-functions.php:75
|
| 2261 |
-
msgid "Select a page…"
|
| 2262 |
-
msgstr ""
|
| 2263 |
-
|
| 2264 |
-
#: classes/includes/views/html-notice-install.php:18
|
| 2265 |
-
msgid "Skipping the setup will require to configure your marketplace settings manually. Your marketplace is not ready for use until you do this."
|
| 2266 |
-
msgstr ""
|
| 2267 |
-
|
| 2268 |
-
#: templates/dashboard/denied.php:8
|
| 2269 |
-
msgid "Your account has not yet been approved to become a vendor. When it is, you will receive an email telling you that your account is approved!"
|
| 2270 |
-
msgstr ""
|
| 2271 |
-
|
| 2272 |
-
#: templates/dashboard/denied.php:12
|
| 2273 |
-
msgid "Your account is not setup as a vendor."
|
| 2274 |
-
msgstr ""
|
| 2275 |
-
|
| 2276 |
-
#: templates/dashboard/denied.php:33
|
| 2277 |
-
msgid "I have read and accepted the <a href=\"%s\">terms and conditions</a>"
|
| 2278 |
-
msgstr ""
|
| 2279 |
-
|
| 2280 |
-
#: templates/dashboard/denied.php:53
|
| 2281 |
-
msgid "Submit"
|
| 2282 |
-
msgstr ""
|
| 2283 |
-
|
| 2284 |
-
#: templates/dashboard/links.php:3
|
| 2285 |
-
msgid "View Your Store"
|
| 2286 |
-
msgstr ""
|
| 2287 |
-
|
| 2288 |
-
#: templates/dashboard/links.php:7
|
| 2289 |
-
msgid "Add New Product"
|
| 2290 |
-
msgstr ""
|
| 2291 |
-
|
| 2292 |
-
#: templates/dashboard/links.php:8
|
| 2293 |
-
msgid "Edit Products"
|
| 2294 |
-
msgstr ""
|
| 2295 |
-
|
| 2296 |
-
#: templates/dashboard/orders.php:18, templates/dashboard/orders.php:21
|
| 2297 |
-
msgid "Hide items"
|
| 2298 |
-
msgstr ""
|
| 2299 |
-
|
| 2300 |
-
#: templates/dashboard/orders.php:19, templates/dashboard/orders.php:93
|
| 2301 |
-
msgid "View items"
|
| 2302 |
-
msgstr ""
|
| 2303 |
-
|
| 2304 |
-
#: templates/dashboard/orders.php:48
|
| 2305 |
-
msgid "Links"
|
| 2306 |
-
msgstr ""
|
| 2307 |
-
|
| 2308 |
-
#: templates/dashboard/orders.php:114
|
| 2309 |
-
msgid "Tracking"
|
| 2310 |
-
msgstr ""
|
| 2311 |
-
|
| 2312 |
-
#: templates/dashboard/orders.php:188
|
| 2313 |
-
msgid "You have no orders during this period."
|
| 2314 |
-
msgstr ""
|
| 2315 |
-
|
| 2316 |
-
#: templates/dashboard/reports.php:1
|
| 2317 |
-
msgid "Sales Report"
|
| 2318 |
-
msgstr ""
|
| 2319 |
-
|
| 2320 |
-
#: templates/dashboard/reports.php:20
|
| 2321 |
-
msgid "Rate"
|
| 2322 |
-
msgstr ""
|
| 2323 |
-
|
| 2324 |
-
#: templates/dashboard/reports.php:47
|
| 2325 |
-
msgid "Show Orders"
|
| 2326 |
-
msgstr ""
|
| 2327 |
-
|
| 2328 |
-
#: templates/dashboard/reports.php:56
|
| 2329 |
-
msgid "Totals"
|
| 2330 |
-
msgstr ""
|
| 2331 |
-
|
| 2332 |
-
#: templates/dashboard/reports.php:71
|
| 2333 |
-
msgid "You have no sales during this period."
|
| 2334 |
-
msgstr ""
|
| 2335 |
-
|
| 2336 |
-
#: templates/dashboard/reports.php:82
|
| 2337 |
-
msgid "You haven't made any sales yet."
|
| 2338 |
-
msgstr ""
|
| 2339 |
-
|
| 2340 |
-
#: templates/dashboard/settings/settings.php:47
|
| 2341 |
-
msgid "Save"
|
| 2342 |
-
msgstr ""
|
| 2343 |
-
|
| 2344 |
-
#: templates/emails/application-status.php:8
|
| 2345 |
-
msgid "Application status: %s"
|
| 2346 |
-
msgstr ""
|
| 2347 |
-
|
| 2348 |
-
#: templates/emails/application-status.php:9, templates/emails/plain/vendor-notify-application.php:23, templates/emails/vendor-notify-application.php:24, templates/emails/vendor-notify-approved.php:24, templates/emails/vendor-notify-denied.php:26
|
| 2349 |
-
msgid "Applicant username: %s"
|
| 2350 |
-
msgstr ""
|
| 2351 |
-
|
| 2352 |
-
#: templates/emails/new-product.php:5
|
| 2353 |
-
msgid "Hi there. This is a notification about a new product on %s."
|
| 2354 |
-
msgstr ""
|
| 2355 |
-
|
| 2356 |
-
#: templates/emails/new-product.php:8
|
| 2357 |
-
msgid "Product title: %s"
|
| 2358 |
-
msgstr ""
|
| 2359 |
-
|
| 2360 |
-
#: templates/emails/new-product.php:9
|
| 2361 |
-
msgid "Submitted by: %s"
|
| 2362 |
-
msgstr ""
|
| 2363 |
-
|
| 2364 |
-
#: templates/emails/new-product.php:10
|
| 2365 |
-
msgid "Edit product: %s"
|
| 2366 |
-
msgstr ""
|
| 2367 |
-
|
| 2368 |
-
#: templates/emails/notify-vendor-shipped.php:17
|
| 2369 |
-
msgid "A vendor has marked part of your order as shipped. The items that are shipped are as follows:"
|
| 2370 |
-
msgstr ""
|
| 2371 |
-
|
| 2372 |
-
#: templates/emails/notify-vendor-shipped.php:21, templates/emails/vendor-new-order.php:25
|
| 2373 |
-
msgid "Order: %s"
|
| 2374 |
-
msgstr ""
|
| 2375 |
-
|
| 2376 |
-
#: templates/emails/notify-vendor-shipped.php:28, templates/emails/vendor-new-order.php:32
|
| 2377 |
-
msgid "Price"
|
| 2378 |
-
msgstr ""
|
| 2379 |
-
|
| 2380 |
-
#: templates/emails/notify-vendor-shipped.php:60, templates/emails/vendor-new-order.php:80
|
| 2381 |
-
msgid "Customer details"
|
| 2382 |
-
msgstr ""
|
| 2383 |
-
|
| 2384 |
-
#: templates/emails/notify-vendor-shipped.php:63, templates/emails/vendor-new-order.php:83
|
| 2385 |
-
msgid "Email:"
|
| 2386 |
-
msgstr ""
|
| 2387 |
-
|
| 2388 |
-
#: templates/emails/notify-vendor-shipped.php:66, templates/emails/vendor-new-order.php:86
|
| 2389 |
-
msgid "Tel:"
|
| 2390 |
-
msgstr ""
|
| 2391 |
-
|
| 2392 |
-
#: templates/emails/vendor-new-order.php:21
|
| 2393 |
-
msgid "You have received an order from %s. Their order is as follows:"
|
| 2394 |
-
msgstr ""
|
| 2395 |
-
|
| 2396 |
-
#: templates/emails/vendor-notify-application.php:23
|
| 2397 |
-
msgid "Your application is currently: %s"
|
| 2398 |
-
msgstr ""
|
| 2399 |
-
|
| 2400 |
-
#: templates/orders/comments/add-new-comment.php:11
|
| 2401 |
-
msgid "Add comment"
|
| 2402 |
-
msgstr ""
|
| 2403 |
-
|
| 2404 |
-
#: templates/orders/comments/existing-comments.php:9
|
| 2405 |
-
msgid "added %s ago"
|
| 2406 |
-
msgstr ""
|
| 2407 |
-
|
| 2408 |
-
#: templates/orders/csv-export.php:6
|
| 2409 |
-
msgid "Export orders"
|
| 2410 |
-
msgstr ""
|
| 2411 |
-
|
| 2412 |
-
#: templates/orders/customer-note/customer-note.php:4
|
| 2413 |
-
msgid "Customer note"
|
| 2414 |
-
msgstr ""
|
| 2415 |
-
|
| 2416 |
-
#: templates/orders/customer-note/customer-note.php:8
|
| 2417 |
-
msgid "No customer note."
|
| 2418 |
-
msgstr ""
|
| 2419 |
-
|
| 2420 |
-
#: templates/orders/orders.php:82
|
| 2421 |
-
msgid "Comments (%s)"
|
| 2422 |
-
msgstr ""
|
| 2423 |
-
|
| 2424 |
-
#: templates/orders/shipping/shipping-form.php:75
|
| 2425 |
-
msgid "Update tracking number"
|
| 2426 |
-
msgstr ""
|
| 2427 |
-
|
| 2428 |
-
#: templates/orders/shipping/shipping-form.php:77
|
| 2429 |
-
msgid "Mark as shipped"
|
| 2430 |
-
msgstr ""
|
| 2431 |
-
|
| 2432 |
-
#: templates/orders/table-body.php:25
|
| 2433 |
-
msgid "Quantity: %d"
|
| 2434 |
-
msgstr ""
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/wc-vendors.pot
CHANGED
|
@@ -56,11 +56,11 @@ msgstr ""
|
|
| 56 |
msgid "Payment total: %s"
|
| 57 |
msgstr ""
|
| 58 |
|
| 59 |
-
#: classes/class-install.php:158, classes/admin/class-wcv-admin-setup.php:
|
| 60 |
msgid "Pending %s"
|
| 61 |
msgstr ""
|
| 62 |
|
| 63 |
-
#: classes/class-install.php:172, classes/admin/class-admin-reports.php:207, classes/admin/class-admin-reports.php:530, classes/admin/class-product-meta.php:267, classes/admin/class-setup-wizard.php:349, classes/admin/class-wcv-admin-setup.php:
|
| 64 |
msgid "%s"
|
| 65 |
msgstr ""
|
| 66 |
|
|
@@ -268,11 +268,11 @@ msgstr ""
|
|
| 268 |
msgid "%s Orders"
|
| 269 |
msgstr ""
|
| 270 |
|
| 271 |
-
#: classes/class-vendors.php:
|
| 272 |
msgid "%1$s Order – %2$s"
|
| 273 |
msgstr ""
|
| 274 |
|
| 275 |
-
#: classes/class-vendors.php:
|
| 276 |
msgctxt "Order date parsed by strftime"
|
| 277 |
msgid "%1$b %2$d, %Y @ %I:%M %p"
|
| 278 |
msgstr ""
|
|
@@ -286,7 +286,7 @@ msgstr ""
|
|
| 286 |
msgid "None"
|
| 287 |
msgstr ""
|
| 288 |
|
| 289 |
-
#: classes/admin/class-admin-menus.php:46, classes/admin/class-admin-menus.php:47, classes/admin/class-admin-reports.php:40, classes/admin/class-wcv-admin-setup.php:
|
| 290 |
msgid "WC Vendors"
|
| 291 |
msgstr ""
|
| 292 |
|
|
@@ -742,40 +742,52 @@ msgstr ""
|
|
| 742 |
msgid "This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings."
|
| 743 |
msgstr ""
|
| 744 |
|
| 745 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 746 |
msgid "WC Vendor roles successfully reset."
|
| 747 |
msgstr ""
|
| 748 |
|
| 749 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
| 750 |
msgid "WC Vendors was successfully reset. All settings have been reset."
|
| 751 |
msgstr ""
|
| 752 |
|
| 753 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 754 |
msgid "All commissions marked as paid."
|
| 755 |
msgstr ""
|
| 756 |
|
| 757 |
#. translators: 1: WooCommerce 2:: five stars
|
| 758 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
| 759 |
msgid "If you like %1$s please leave us a %2$s rating. A huge thanks in advance!"
|
| 760 |
msgstr ""
|
| 761 |
|
| 762 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
| 763 |
msgid "Thanks :)"
|
| 764 |
msgstr ""
|
| 765 |
|
| 766 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
| 767 |
msgid "%s Notifications"
|
| 768 |
msgstr ""
|
| 769 |
|
| 770 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
| 771 |
msgid "Enable %s low stock notifications"
|
| 772 |
msgstr ""
|
| 773 |
|
| 774 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
| 775 |
msgid "Enable %s out of stock notifications"
|
| 776 |
msgstr ""
|
| 777 |
|
| 778 |
-
#: classes/admin/class-wcv-admin-setup.php:
|
| 779 |
msgid "Enable %s backorder stock notifications"
|
| 780 |
msgstr ""
|
| 781 |
|
|
@@ -991,7 +1003,7 @@ msgstr ""
|
|
| 991 |
msgid "You haven't made any sales yet."
|
| 992 |
msgstr ""
|
| 993 |
|
| 994 |
-
#: templates/emails/admin-notify-application.php:18, templates/emails/application-status.php:9, templates/emails/
|
| 995 |
msgid "Hi there. This is a notification about a %1$s application on %2$s."
|
| 996 |
msgstr ""
|
| 997 |
|
|
@@ -999,7 +1011,7 @@ msgstr ""
|
|
| 999 |
msgid "The application is currently: %s"
|
| 1000 |
msgstr ""
|
| 1001 |
|
| 1002 |
-
#: templates/emails/admin-notify-application.php:21, templates/emails/
|
| 1003 |
msgid "Applicant username: %s"
|
| 1004 |
msgstr ""
|
| 1005 |
|
|
@@ -1007,6 +1019,14 @@ msgstr ""
|
|
| 1007 |
msgid "You can approve or deny the application at the following link <a href=\"%1$s\">%1$s</a>"
|
| 1008 |
msgstr ""
|
| 1009 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1010 |
#: templates/emails/admin-notify-product.php:18, templates/emails/plain/admin-notify-product.php:20
|
| 1011 |
msgid "This is a notification about a new product on %s."
|
| 1012 |
msgstr ""
|
|
@@ -1027,10 +1047,6 @@ msgstr ""
|
|
| 1027 |
msgid "%1$s has marked order #%2$s as shipped."
|
| 1028 |
msgstr ""
|
| 1029 |
|
| 1030 |
-
#: templates/emails/application-status.php:12
|
| 1031 |
-
msgid "Application status: %s"
|
| 1032 |
-
msgstr ""
|
| 1033 |
-
|
| 1034 |
#: templates/emails/customer-notify-shipped.php:22
|
| 1035 |
msgid "%1$s has marked your order #%2$s as shipped. The items that are shipped are as follows"
|
| 1036 |
msgstr ""
|
|
@@ -1071,10 +1087,18 @@ msgstr ""
|
|
| 1071 |
msgid "You have received an order from %s. Their order is as follows:"
|
| 1072 |
msgstr ""
|
| 1073 |
|
| 1074 |
-
#: templates/emails/vendor-notify-application.php:22
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1075 |
msgid "Your application is currently: %s"
|
| 1076 |
msgstr ""
|
| 1077 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1078 |
#: templates/emails/vendor-notify-cancelled-order.php:22
|
| 1079 |
msgid "Your order has been cancelled. The order is as follows:"
|
| 1080 |
msgstr ""
|
|
@@ -1112,11 +1136,11 @@ msgstr ""
|
|
| 1112 |
msgid "Quantity: %d"
|
| 1113 |
msgstr ""
|
| 1114 |
|
| 1115 |
-
#: classes/admin/emails/class-emails.php:74, classes/admin/emails/class-emails.php:
|
| 1116 |
msgid "pending"
|
| 1117 |
msgstr ""
|
| 1118 |
|
| 1119 |
-
#: classes/admin/emails/class-emails.php:76, classes/admin/emails/class-emails.php:
|
| 1120 |
msgid "approved"
|
| 1121 |
msgstr ""
|
| 1122 |
|
|
@@ -1124,7 +1148,7 @@ msgstr ""
|
|
| 1124 |
msgid "denied"
|
| 1125 |
msgstr ""
|
| 1126 |
|
| 1127 |
-
#: classes/admin/emails/class-emails.php:
|
| 1128 |
msgid "Resend %s new order notification"
|
| 1129 |
msgstr ""
|
| 1130 |
|
|
@@ -1144,11 +1168,11 @@ msgstr ""
|
|
| 1144 |
msgid "[{blogname}] Your %s application has been {status}"
|
| 1145 |
msgstr ""
|
| 1146 |
|
| 1147 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:129, classes/admin/emails/class-wc-notify-admin.php:139, classes/admin/emails/class-wc-notify-shipped.php:170, classes/admin/emails/class-wc-notify-vendor.php:296, classes/admin/emails/class-wcv-admin-notify-application.php:141, classes/admin/emails/class-wcv-admin-notify-product.php:156, classes/admin/emails/class-wcv-admin-notify-shipped.php:144, classes/admin/emails/class-wcv-customer-notify-shipped.php:151, classes/admin/emails/class-wcv-vendor-notify-application.php:139, classes/admin/emails/class-wcv-vendor-notify-approved.php:148, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:163, classes/admin/emails/class-wcv-vendor-notify-denied.php:159, classes/admin/emails/class-wcv-vendor-notify-order.php:190, classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
|
| 1148 |
msgid "Enable/Disable"
|
| 1149 |
msgstr ""
|
| 1150 |
|
| 1151 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:131, classes/admin/emails/class-wc-notify-admin.php:141, classes/admin/emails/class-wc-notify-shipped.php:172, classes/admin/emails/class-wc-notify-vendor.php:298, classes/admin/emails/class-wcv-admin-notify-application.php:143, classes/admin/emails/class-wcv-admin-notify-product.php:158, classes/admin/emails/class-wcv-admin-notify-shipped.php:146, classes/admin/emails/class-wcv-customer-notify-shipped.php:153, classes/admin/emails/class-wcv-vendor-notify-application.php:141, classes/admin/emails/class-wcv-vendor-notify-approved.php:150, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:165, classes/admin/emails/class-wcv-vendor-notify-denied.php:161, classes/admin/emails/class-wcv-vendor-notify-order.php:192
|
| 1152 |
msgid "Enable this email notification"
|
| 1153 |
msgstr ""
|
| 1154 |
|
|
@@ -1156,7 +1180,7 @@ msgstr ""
|
|
| 1156 |
msgid "Enter recipients (comma separated) for this email. Defaults to <code>%s</code>."
|
| 1157 |
msgstr ""
|
| 1158 |
|
| 1159 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:142, classes/admin/emails/class-wc-notify-admin.php:152, classes/admin/emails/class-wc-notify-shipped.php:176, classes/admin/emails/class-wc-notify-vendor.php:302, classes/admin/emails/class-wcv-admin-notify-application.php:155, classes/admin/emails/class-wcv-admin-notify-product.php:170, classes/admin/emails/class-wcv-admin-notify-shipped.php:158, classes/admin/emails/class-wcv-customer-notify-shipped.php:157, classes/admin/emails/class-wcv-vendor-notify-application.php:145, classes/admin/emails/class-wcv-vendor-notify-approved.php:154, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:169, classes/admin/emails/class-wcv-vendor-notify-denied.php:165, classes/admin/emails/class-wcv-vendor-notify-order.php:196
|
| 1160 |
msgid "Subject"
|
| 1161 |
msgstr ""
|
| 1162 |
|
|
@@ -1172,11 +1196,11 @@ msgstr ""
|
|
| 1172 |
msgid "This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>."
|
| 1173 |
msgstr ""
|
| 1174 |
|
| 1175 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:156, classes/admin/emails/class-wc-notify-admin.php:166, classes/admin/emails/class-wc-notify-shipped.php:190, classes/admin/emails/class-wc-notify-vendor.php:322, classes/admin/emails/class-wcv-admin-notify-application.php:185, classes/admin/emails/class-wcv-admin-notify-product.php:188, classes/admin/emails/class-wcv-admin-notify-shipped.php:176, classes/admin/emails/class-wcv-customer-notify-shipped.php:175, classes/admin/emails/class-wcv-vendor-notify-application.php:163, classes/admin/emails/class-wcv-vendor-notify-approved.php:181, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:201, classes/admin/emails/class-wcv-vendor-notify-denied.php:200, classes/admin/emails/class-wcv-vendor-notify-order.php:234
|
| 1176 |
msgid "Email type"
|
| 1177 |
msgstr ""
|
| 1178 |
|
| 1179 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:158, classes/admin/emails/class-wc-notify-admin.php:168, classes/admin/emails/class-wc-notify-shipped.php:192, classes/admin/emails/class-wc-notify-vendor.php:324, classes/admin/emails/class-wcv-admin-notify-application.php:187, classes/admin/emails/class-wcv-admin-notify-product.php:190, classes/admin/emails/class-wcv-admin-notify-shipped.php:178, classes/admin/emails/class-wcv-customer-notify-shipped.php:177, classes/admin/emails/class-wcv-vendor-notify-application.php:165, classes/admin/emails/class-wcv-vendor-notify-approved.php:183, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:203, classes/admin/emails/class-wcv-vendor-notify-denied.php:202, classes/admin/emails/class-wcv-vendor-notify-order.php:236
|
| 1180 |
msgid "Choose which format of email to send."
|
| 1181 |
msgstr ""
|
| 1182 |
|
|
@@ -1280,11 +1304,11 @@ msgstr ""
|
|
| 1280 |
msgid "%s application received"
|
| 1281 |
msgstr ""
|
| 1282 |
|
| 1283 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:147, classes/admin/emails/class-wcv-admin-notify-product.php:162, classes/admin/emails/class-wcv-admin-notify-shipped.php:150
|
| 1284 |
msgid "Recipient(s)"
|
| 1285 |
msgstr ""
|
| 1286 |
|
| 1287 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:149, classes/admin/emails/class-wcv-admin-notify-product.php:164, classes/admin/emails/class-wcv-admin-notify-shipped.php:152
|
| 1288 |
msgid "Enter recipients (comma separated) for this email. Defaults to %s."
|
| 1289 |
msgstr ""
|
| 1290 |
|
|
@@ -1307,30 +1331,48 @@ msgstr ""
|
|
| 1307 |
#. translators: %s: list of placeholders
|
| 1308 |
#. translators: %s: list of placeholders
|
| 1309 |
#. translators: %s: list of placeholders
|
| 1310 |
-
|
|
|
|
|
|
|
| 1311 |
msgid "Available placeholders: %s"
|
| 1312 |
msgstr ""
|
| 1313 |
|
| 1314 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:164, classes/admin/emails/class-wcv-admin-notify-product.php:179, classes/admin/emails/class-wcv-admin-notify-shipped.php:167, classes/admin/emails/class-wcv-customer-notify-shipped.php:166, classes/admin/emails/class-wcv-vendor-notify-application.php:154, classes/admin/emails/class-wcv-vendor-notify-approved.php:172, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:178, classes/admin/emails/class-wcv-vendor-notify-denied.php:191, classes/admin/emails/class-wcv-vendor-notify-order.php:205
|
| 1315 |
msgid "Email heading"
|
| 1316 |
msgstr ""
|
| 1317 |
|
| 1318 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:173
|
| 1319 |
msgid "Notification"
|
| 1320 |
msgstr ""
|
| 1321 |
|
| 1322 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:175
|
| 1323 |
msgid "Choose when to be notified of an application."
|
| 1324 |
msgstr ""
|
| 1325 |
|
| 1326 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:179
|
| 1327 |
msgid "All Applications"
|
| 1328 |
msgstr ""
|
| 1329 |
|
| 1330 |
-
#: classes/admin/emails/class-wcv-admin-notify-application.php:180
|
| 1331 |
msgid "Pending Applications"
|
| 1332 |
msgstr ""
|
| 1333 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1334 |
#: classes/admin/emails/class-wcv-admin-notify-product.php:28
|
| 1335 |
msgid "Admin new %s product"
|
| 1336 |
msgstr ""
|
|
@@ -1392,7 +1434,7 @@ msgid "Notification is sent to the %s that their application has been approved"
|
|
| 1392 |
msgstr ""
|
| 1393 |
|
| 1394 |
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:50
|
| 1395 |
-
msgid "[{site_title}] Your
|
| 1396 |
msgstr ""
|
| 1397 |
|
| 1398 |
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:61
|
|
@@ -1954,39 +1996,51 @@ msgstr ""
|
|
| 1954 |
msgid "This enables the %s shop header template and disables the shop description text."
|
| 1955 |
msgstr ""
|
| 1956 |
|
| 1957 |
-
#: classes/admin/settings/class-wcv-settings-display.php:278
|
| 1958 |
-
msgid "Shop
|
| 1959 |
msgstr ""
|
| 1960 |
|
| 1961 |
#: classes/admin/settings/class-wcv-settings-display.php:279
|
| 1962 |
-
msgid "
|
| 1963 |
msgstr ""
|
| 1964 |
|
| 1965 |
#: classes/admin/settings/class-wcv-settings-display.php:280
|
| 1966 |
-
msgid "This
|
| 1967 |
msgstr ""
|
| 1968 |
|
| 1969 |
#: classes/admin/settings/class-wcv-settings-display.php:287
|
| 1970 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1971 |
msgstr ""
|
| 1972 |
|
| 1973 |
#: classes/admin/settings/class-wcv-settings-display.php:289
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1974 |
msgid "Select what will be used to display the %s name throughout the marketplace."
|
| 1975 |
msgstr ""
|
| 1976 |
|
| 1977 |
-
#: classes/admin/settings/class-wcv-settings-display.php:
|
| 1978 |
msgid "Display name"
|
| 1979 |
msgstr ""
|
| 1980 |
|
| 1981 |
-
#: classes/admin/settings/class-wcv-settings-display.php:
|
| 1982 |
msgid "Shop name"
|
| 1983 |
msgstr ""
|
| 1984 |
|
| 1985 |
-
#: classes/admin/settings/class-wcv-settings-display.php:
|
| 1986 |
msgid "%s Username"
|
| 1987 |
msgstr ""
|
| 1988 |
|
| 1989 |
-
#: classes/admin/settings/class-wcv-settings-display.php:
|
| 1990 |
msgid "%s Email"
|
| 1991 |
msgstr ""
|
| 1992 |
|
|
@@ -2310,10 +2364,6 @@ msgstr ""
|
|
| 2310 |
msgid "This is displayed on each of your products."
|
| 2311 |
msgstr ""
|
| 2312 |
|
| 2313 |
-
#: classes/admin/views/html-vendor-settings-page.php:161, templates/dashboard/settings/shop-description.php:18
|
| 2314 |
-
msgid "Shop Description"
|
| 2315 |
-
msgstr ""
|
| 2316 |
-
|
| 2317 |
#: classes/admin/views/html-vendor-settings-page.php:180, templates/dashboard/settings/shop-description.php:19
|
| 2318 |
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 2319 |
msgstr ""
|
|
@@ -2630,6 +2680,10 @@ msgstr ""
|
|
| 2630 |
msgid "You can approve or deny the application at the following link %s"
|
| 2631 |
msgstr ""
|
| 2632 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2633 |
#: templates/emails/plain/vendor-notify-cancelled-order.php:19
|
| 2634 |
msgid "Your order has been cancelled."
|
| 2635 |
msgstr ""
|
| 56 |
msgid "Payment total: %s"
|
| 57 |
msgstr ""
|
| 58 |
|
| 59 |
+
#: classes/class-install.php:158, classes/admin/class-wcv-admin-setup.php:153
|
| 60 |
msgid "Pending %s"
|
| 61 |
msgstr ""
|
| 62 |
|
| 63 |
+
#: classes/class-install.php:172, classes/admin/class-admin-reports.php:207, classes/admin/class-admin-reports.php:530, classes/admin/class-product-meta.php:267, classes/admin/class-setup-wizard.php:349, classes/admin/class-wcv-admin-setup.php:148, classes/admin/class-wcv-admin-setup.php:365, classes/admin/class-wcv-commissions-csv-exporter.php:45, classes/admin/class-wcv-commissions-page.php:130, classes/admin/class-wcv-commissions-sum-csv-exporter.php:43, classes/admin/settings/class-wcv-settings-display.php:113, classes/admin/settings/class-wcv-settings-display.php:121, classes/admin/settings/class-wcv-settings-display.php:229
|
| 64 |
msgid "%s"
|
| 65 |
msgstr ""
|
| 66 |
|
| 268 |
msgid "%s Orders"
|
| 269 |
msgstr ""
|
| 270 |
|
| 271 |
+
#: classes/class-vendors.php:619
|
| 272 |
msgid "%1$s Order – %2$s"
|
| 273 |
msgstr ""
|
| 274 |
|
| 275 |
+
#: classes/class-vendors.php:619
|
| 276 |
msgctxt "Order date parsed by strftime"
|
| 277 |
msgid "%1$b %2$d, %Y @ %I:%M %p"
|
| 278 |
msgstr ""
|
| 286 |
msgid "None"
|
| 287 |
msgstr ""
|
| 288 |
|
| 289 |
+
#: classes/admin/class-admin-menus.php:46, classes/admin/class-admin-menus.php:47, classes/admin/class-admin-reports.php:40, classes/admin/class-wcv-admin-setup.php:330, classes/admin/views/html-vendor-meta.php:1
|
| 290 |
msgid "WC Vendors"
|
| 291 |
msgstr ""
|
| 292 |
|
| 742 |
msgid "This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings."
|
| 743 |
msgstr ""
|
| 744 |
|
| 745 |
+
#: classes/admin/class-wcv-admin-setup.php:108, classes/admin/class-wcv-admin-setup.php:109
|
| 746 |
+
msgid "Remove orphaned sub orders"
|
| 747 |
+
msgstr ""
|
| 748 |
+
|
| 749 |
+
#: classes/admin/class-wcv-admin-setup.php:110
|
| 750 |
+
msgid "This will remove all orphaned sub orders "
|
| 751 |
+
msgstr ""
|
| 752 |
+
|
| 753 |
+
#: classes/admin/class-wcv-admin-setup.php:164
|
| 754 |
msgid "WC Vendor roles successfully reset."
|
| 755 |
msgstr ""
|
| 756 |
|
| 757 |
+
#: classes/admin/class-wcv-admin-setup.php:178
|
| 758 |
msgid "WC Vendors was successfully reset. All settings have been reset."
|
| 759 |
msgstr ""
|
| 760 |
|
| 761 |
+
#: classes/admin/class-wcv-admin-setup.php:207
|
| 762 |
+
msgid "Orphaned sub orders have been removed."
|
| 763 |
+
msgstr ""
|
| 764 |
+
|
| 765 |
+
#: classes/admin/class-wcv-admin-setup.php:284
|
| 766 |
msgid "All commissions marked as paid."
|
| 767 |
msgstr ""
|
| 768 |
|
| 769 |
#. translators: 1: WooCommerce 2:: five stars
|
| 770 |
+
#: classes/admin/class-wcv-admin-setup.php:329
|
| 771 |
msgid "If you like %1$s please leave us a %2$s rating. A huge thanks in advance!"
|
| 772 |
msgstr ""
|
| 773 |
|
| 774 |
+
#: classes/admin/class-wcv-admin-setup.php:331
|
| 775 |
msgid "Thanks :)"
|
| 776 |
msgstr ""
|
| 777 |
|
| 778 |
+
#: classes/admin/class-wcv-admin-setup.php:383
|
| 779 |
msgid "%s Notifications"
|
| 780 |
msgstr ""
|
| 781 |
|
| 782 |
+
#: classes/admin/class-wcv-admin-setup.php:384
|
| 783 |
msgid "Enable %s low stock notifications"
|
| 784 |
msgstr ""
|
| 785 |
|
| 786 |
+
#: classes/admin/class-wcv-admin-setup.php:393
|
| 787 |
msgid "Enable %s out of stock notifications"
|
| 788 |
msgstr ""
|
| 789 |
|
| 790 |
+
#: classes/admin/class-wcv-admin-setup.php:402
|
| 791 |
msgid "Enable %s backorder stock notifications"
|
| 792 |
msgstr ""
|
| 793 |
|
| 1003 |
msgid "You haven't made any sales yet."
|
| 1004 |
msgstr ""
|
| 1005 |
|
| 1006 |
+
#: templates/emails/admin-notify-application.php:18, templates/emails/application-status.php:9, templates/emails/plain/admin-notify-application.php:18, templates/emails/plain/vendor-notify-application.php:18
|
| 1007 |
msgid "Hi there. This is a notification about a %1$s application on %2$s."
|
| 1008 |
msgstr ""
|
| 1009 |
|
| 1011 |
msgid "The application is currently: %s"
|
| 1012 |
msgstr ""
|
| 1013 |
|
| 1014 |
+
#: templates/emails/admin-notify-application.php:21, templates/emails/admin-notify-approved.php:20, templates/emails/application-status.php:13, templates/emails/vendor-notify-denied.php:23, templates/emails/plain/admin-notify-application.php:19, templates/emails/plain/vendor-notify-application.php:20
|
| 1015 |
msgid "Applicant username: %s"
|
| 1016 |
msgstr ""
|
| 1017 |
|
| 1019 |
msgid "You can approve or deny the application at the following link <a href=\"%1$s\">%1$s</a>"
|
| 1020 |
msgstr ""
|
| 1021 |
|
| 1022 |
+
#: templates/emails/admin-notify-approved.php:18, templates/emails/plain/admin-notify-approved.php:18
|
| 1023 |
+
msgid "Hi there. You or another admin has approved a user to be a %1$s on %2$s."
|
| 1024 |
+
msgstr ""
|
| 1025 |
+
|
| 1026 |
+
#: templates/emails/admin-notify-approved.php:19, templates/emails/application-status.php:12, templates/emails/plain/admin-notify-approved.php:19
|
| 1027 |
+
msgid "Application status: %s"
|
| 1028 |
+
msgstr ""
|
| 1029 |
+
|
| 1030 |
#: templates/emails/admin-notify-product.php:18, templates/emails/plain/admin-notify-product.php:20
|
| 1031 |
msgid "This is a notification about a new product on %s."
|
| 1032 |
msgstr ""
|
| 1047 |
msgid "%1$s has marked order #%2$s as shipped."
|
| 1048 |
msgstr ""
|
| 1049 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1050 |
#: templates/emails/customer-notify-shipped.php:22
|
| 1051 |
msgid "%1$s has marked your order #%2$s as shipped. The items that are shipped are as follows"
|
| 1052 |
msgstr ""
|
| 1087 |
msgid "You have received an order from %s. Their order is as follows:"
|
| 1088 |
msgstr ""
|
| 1089 |
|
| 1090 |
+
#: templates/emails/vendor-notify-application.php:22, classes/admin/emails/class-wcv-vendor-notify-application.php:66
|
| 1091 |
+
msgid "Hi there. This is a notification about your %1$s application on %2$s."
|
| 1092 |
+
msgstr ""
|
| 1093 |
+
|
| 1094 |
+
#: templates/emails/vendor-notify-application.php:23
|
| 1095 |
msgid "Your application is currently: %s"
|
| 1096 |
msgstr ""
|
| 1097 |
|
| 1098 |
+
#: templates/emails/vendor-notify-application.php:24, templates/emails/vendor-notify-approved.php:23
|
| 1099 |
+
msgid "Your username: %s"
|
| 1100 |
+
msgstr ""
|
| 1101 |
+
|
| 1102 |
#: templates/emails/vendor-notify-cancelled-order.php:22
|
| 1103 |
msgid "Your order has been cancelled. The order is as follows:"
|
| 1104 |
msgstr ""
|
| 1136 |
msgid "Quantity: %d"
|
| 1137 |
msgstr ""
|
| 1138 |
|
| 1139 |
+
#: classes/admin/emails/class-emails.php:74, classes/admin/emails/class-emails.php:251, classes/admin/emails/class-wc-approve-vendor.php:72
|
| 1140 |
msgid "pending"
|
| 1141 |
msgstr ""
|
| 1142 |
|
| 1143 |
+
#: classes/admin/emails/class-emails.php:76, classes/admin/emails/class-emails.php:255
|
| 1144 |
msgid "approved"
|
| 1145 |
msgstr ""
|
| 1146 |
|
| 1148 |
msgid "denied"
|
| 1149 |
msgstr ""
|
| 1150 |
|
| 1151 |
+
#: classes/admin/emails/class-emails.php:203
|
| 1152 |
msgid "Resend %s new order notification"
|
| 1153 |
msgstr ""
|
| 1154 |
|
| 1168 |
msgid "[{blogname}] Your %s application has been {status}"
|
| 1169 |
msgstr ""
|
| 1170 |
|
| 1171 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:129, classes/admin/emails/class-wc-notify-admin.php:139, classes/admin/emails/class-wc-notify-shipped.php:170, classes/admin/emails/class-wc-notify-vendor.php:296, classes/admin/emails/class-wcv-admin-notify-application.php:141, classes/admin/emails/class-wcv-admin-notify-approved.php:146, classes/admin/emails/class-wcv-admin-notify-product.php:156, classes/admin/emails/class-wcv-admin-notify-shipped.php:144, classes/admin/emails/class-wcv-customer-notify-shipped.php:151, classes/admin/emails/class-wcv-vendor-notify-application.php:139, classes/admin/emails/class-wcv-vendor-notify-approved.php:148, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:163, classes/admin/emails/class-wcv-vendor-notify-denied.php:159, classes/admin/emails/class-wcv-vendor-notify-order.php:190, classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
|
| 1172 |
msgid "Enable/Disable"
|
| 1173 |
msgstr ""
|
| 1174 |
|
| 1175 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:131, classes/admin/emails/class-wc-notify-admin.php:141, classes/admin/emails/class-wc-notify-shipped.php:172, classes/admin/emails/class-wc-notify-vendor.php:298, classes/admin/emails/class-wcv-admin-notify-application.php:143, classes/admin/emails/class-wcv-admin-notify-approved.php:148, classes/admin/emails/class-wcv-admin-notify-product.php:158, classes/admin/emails/class-wcv-admin-notify-shipped.php:146, classes/admin/emails/class-wcv-customer-notify-shipped.php:153, classes/admin/emails/class-wcv-vendor-notify-application.php:141, classes/admin/emails/class-wcv-vendor-notify-approved.php:150, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:165, classes/admin/emails/class-wcv-vendor-notify-denied.php:161, classes/admin/emails/class-wcv-vendor-notify-order.php:192
|
| 1176 |
msgid "Enable this email notification"
|
| 1177 |
msgstr ""
|
| 1178 |
|
| 1180 |
msgid "Enter recipients (comma separated) for this email. Defaults to <code>%s</code>."
|
| 1181 |
msgstr ""
|
| 1182 |
|
| 1183 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:142, classes/admin/emails/class-wc-notify-admin.php:152, classes/admin/emails/class-wc-notify-shipped.php:176, classes/admin/emails/class-wc-notify-vendor.php:302, classes/admin/emails/class-wcv-admin-notify-application.php:155, classes/admin/emails/class-wcv-admin-notify-approved.php:160, classes/admin/emails/class-wcv-admin-notify-product.php:170, classes/admin/emails/class-wcv-admin-notify-shipped.php:158, classes/admin/emails/class-wcv-customer-notify-shipped.php:157, classes/admin/emails/class-wcv-vendor-notify-application.php:145, classes/admin/emails/class-wcv-vendor-notify-approved.php:154, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:169, classes/admin/emails/class-wcv-vendor-notify-denied.php:165, classes/admin/emails/class-wcv-vendor-notify-order.php:196
|
| 1184 |
msgid "Subject"
|
| 1185 |
msgstr ""
|
| 1186 |
|
| 1196 |
msgid "This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>."
|
| 1197 |
msgstr ""
|
| 1198 |
|
| 1199 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:156, classes/admin/emails/class-wc-notify-admin.php:166, classes/admin/emails/class-wc-notify-shipped.php:190, classes/admin/emails/class-wc-notify-vendor.php:322, classes/admin/emails/class-wcv-admin-notify-application.php:185, classes/admin/emails/class-wcv-admin-notify-approved.php:190, classes/admin/emails/class-wcv-admin-notify-product.php:188, classes/admin/emails/class-wcv-admin-notify-shipped.php:176, classes/admin/emails/class-wcv-customer-notify-shipped.php:175, classes/admin/emails/class-wcv-vendor-notify-application.php:163, classes/admin/emails/class-wcv-vendor-notify-approved.php:181, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:201, classes/admin/emails/class-wcv-vendor-notify-denied.php:200, classes/admin/emails/class-wcv-vendor-notify-order.php:234
|
| 1200 |
msgid "Email type"
|
| 1201 |
msgstr ""
|
| 1202 |
|
| 1203 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:158, classes/admin/emails/class-wc-notify-admin.php:168, classes/admin/emails/class-wc-notify-shipped.php:192, classes/admin/emails/class-wc-notify-vendor.php:324, classes/admin/emails/class-wcv-admin-notify-application.php:187, classes/admin/emails/class-wcv-admin-notify-approved.php:192, classes/admin/emails/class-wcv-admin-notify-product.php:190, classes/admin/emails/class-wcv-admin-notify-shipped.php:178, classes/admin/emails/class-wcv-customer-notify-shipped.php:177, classes/admin/emails/class-wcv-vendor-notify-application.php:165, classes/admin/emails/class-wcv-vendor-notify-approved.php:183, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:203, classes/admin/emails/class-wcv-vendor-notify-denied.php:202, classes/admin/emails/class-wcv-vendor-notify-order.php:236
|
| 1204 |
msgid "Choose which format of email to send."
|
| 1205 |
msgstr ""
|
| 1206 |
|
| 1304 |
msgid "%s application received"
|
| 1305 |
msgstr ""
|
| 1306 |
|
| 1307 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:147, classes/admin/emails/class-wcv-admin-notify-approved.php:152, classes/admin/emails/class-wcv-admin-notify-product.php:162, classes/admin/emails/class-wcv-admin-notify-shipped.php:150
|
| 1308 |
msgid "Recipient(s)"
|
| 1309 |
msgstr ""
|
| 1310 |
|
| 1311 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:149, classes/admin/emails/class-wcv-admin-notify-approved.php:154, classes/admin/emails/class-wcv-admin-notify-product.php:164, classes/admin/emails/class-wcv-admin-notify-shipped.php:152
|
| 1312 |
msgid "Enter recipients (comma separated) for this email. Defaults to %s."
|
| 1313 |
msgstr ""
|
| 1314 |
|
| 1331 |
#. translators: %s: list of placeholders
|
| 1332 |
#. translators: %s: list of placeholders
|
| 1333 |
#. translators: %s: list of placeholders
|
| 1334 |
+
#. translators: %s: list of placeholders
|
| 1335 |
+
#. translators: %s: list of placeholders
|
| 1336 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:159, classes/admin/emails/class-wcv-admin-notify-application.php:168, classes/admin/emails/class-wcv-admin-notify-approved.php:164, classes/admin/emails/class-wcv-admin-notify-approved.php:173, classes/admin/emails/class-wcv-admin-notify-product.php:174, classes/admin/emails/class-wcv-admin-notify-product.php:183, classes/admin/emails/class-wcv-admin-notify-shipped.php:162, classes/admin/emails/class-wcv-admin-notify-shipped.php:171, classes/admin/emails/class-wcv-customer-notify-shipped.php:161, classes/admin/emails/class-wcv-customer-notify-shipped.php:170, classes/admin/emails/class-wcv-vendor-notify-application.php:149, classes/admin/emails/class-wcv-vendor-notify-application.php:158, classes/admin/emails/class-wcv-vendor-notify-approved.php:158, classes/admin/emails/class-wcv-vendor-notify-approved.php:176, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:173, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:182, classes/admin/emails/class-wcv-vendor-notify-denied.php:169, classes/admin/emails/class-wcv-vendor-notify-denied.php:178, classes/admin/emails/class-wcv-vendor-notify-denied.php:195, classes/admin/emails/class-wcv-vendor-notify-order.php:200, classes/admin/emails/class-wcv-vendor-notify-order.php:209
|
| 1337 |
msgid "Available placeholders: %s"
|
| 1338 |
msgstr ""
|
| 1339 |
|
| 1340 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:164, classes/admin/emails/class-wcv-admin-notify-approved.php:169, classes/admin/emails/class-wcv-admin-notify-product.php:179, classes/admin/emails/class-wcv-admin-notify-shipped.php:167, classes/admin/emails/class-wcv-customer-notify-shipped.php:166, classes/admin/emails/class-wcv-vendor-notify-application.php:154, classes/admin/emails/class-wcv-vendor-notify-approved.php:172, classes/admin/emails/class-wcv-vendor-notify-cancelled-order.php:178, classes/admin/emails/class-wcv-vendor-notify-denied.php:191, classes/admin/emails/class-wcv-vendor-notify-order.php:205
|
| 1341 |
msgid "Email heading"
|
| 1342 |
msgstr ""
|
| 1343 |
|
| 1344 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:173, classes/admin/emails/class-wcv-admin-notify-approved.php:178
|
| 1345 |
msgid "Notification"
|
| 1346 |
msgstr ""
|
| 1347 |
|
| 1348 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:175, classes/admin/emails/class-wcv-admin-notify-approved.php:180
|
| 1349 |
msgid "Choose when to be notified of an application."
|
| 1350 |
msgstr ""
|
| 1351 |
|
| 1352 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:179, classes/admin/emails/class-wcv-admin-notify-approved.php:184
|
| 1353 |
msgid "All Applications"
|
| 1354 |
msgstr ""
|
| 1355 |
|
| 1356 |
+
#: classes/admin/emails/class-wcv-admin-notify-application.php:180, classes/admin/emails/class-wcv-admin-notify-approved.php:185
|
| 1357 |
msgid "Pending Applications"
|
| 1358 |
msgstr ""
|
| 1359 |
|
| 1360 |
+
#: classes/admin/emails/class-wcv-admin-notify-approved.php:32
|
| 1361 |
+
msgid "Admin notify %s approved"
|
| 1362 |
+
msgstr ""
|
| 1363 |
+
|
| 1364 |
+
#: classes/admin/emails/class-wcv-admin-notify-approved.php:33
|
| 1365 |
+
msgid "Notification is sent to chosen recipient(s) when admin approves a user to be a %s"
|
| 1366 |
+
msgstr ""
|
| 1367 |
+
|
| 1368 |
+
#: classes/admin/emails/class-wcv-admin-notify-approved.php:56
|
| 1369 |
+
msgid "[{site_title}] {user_name} has been approved to be a %s"
|
| 1370 |
+
msgstr ""
|
| 1371 |
+
|
| 1372 |
+
#: classes/admin/emails/class-wcv-admin-notify-approved.php:66
|
| 1373 |
+
msgid "%s application approved"
|
| 1374 |
+
msgstr ""
|
| 1375 |
+
|
| 1376 |
#: classes/admin/emails/class-wcv-admin-notify-product.php:28
|
| 1377 |
msgid "Admin new %s product"
|
| 1378 |
msgstr ""
|
| 1434 |
msgstr ""
|
| 1435 |
|
| 1436 |
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:50
|
| 1437 |
+
msgid "[{site_title}] Your %s application has been approved"
|
| 1438 |
msgstr ""
|
| 1439 |
|
| 1440 |
#: classes/admin/emails/class-wcv-vendor-notify-approved.php:61
|
| 1996 |
msgid "This enables the %s shop header template and disables the shop description text."
|
| 1997 |
msgstr ""
|
| 1998 |
|
| 1999 |
+
#: classes/admin/settings/class-wcv-settings-display.php:278, classes/admin/views/html-vendor-settings-page.php:161, templates/dashboard/settings/shop-description.php:18
|
| 2000 |
+
msgid "Shop Description"
|
| 2001 |
msgstr ""
|
| 2002 |
|
| 2003 |
#: classes/admin/settings/class-wcv-settings-display.php:279
|
| 2004 |
+
msgid "Enable %s shop description"
|
| 2005 |
msgstr ""
|
| 2006 |
|
| 2007 |
#: classes/admin/settings/class-wcv-settings-display.php:280
|
| 2008 |
+
msgid "This enables the %1$s shop description on the %1$s store page."
|
| 2009 |
msgstr ""
|
| 2010 |
|
| 2011 |
#: classes/admin/settings/class-wcv-settings-display.php:287
|
| 2012 |
+
msgid "Shop HTML"
|
| 2013 |
+
msgstr ""
|
| 2014 |
+
|
| 2015 |
+
#: classes/admin/settings/class-wcv-settings-display.php:288
|
| 2016 |
+
msgid "Allow HTML in %s shop description"
|
| 2017 |
msgstr ""
|
| 2018 |
|
| 2019 |
#: classes/admin/settings/class-wcv-settings-display.php:289
|
| 2020 |
+
msgid "This will enable the WYSIWYG editor and for the %1$s shop description. You can enable or disable this per %1$s by editing the %1$s user account."
|
| 2021 |
+
msgstr ""
|
| 2022 |
+
|
| 2023 |
+
#: classes/admin/settings/class-wcv-settings-display.php:296
|
| 2024 |
+
msgid "Display Name"
|
| 2025 |
+
msgstr ""
|
| 2026 |
+
|
| 2027 |
+
#: classes/admin/settings/class-wcv-settings-display.php:298
|
| 2028 |
msgid "Select what will be used to display the %s name throughout the marketplace."
|
| 2029 |
msgstr ""
|
| 2030 |
|
| 2031 |
+
#: classes/admin/settings/class-wcv-settings-display.php:303
|
| 2032 |
msgid "Display name"
|
| 2033 |
msgstr ""
|
| 2034 |
|
| 2035 |
+
#: classes/admin/settings/class-wcv-settings-display.php:304, classes/admin/views/html-vendor-meta.php:27
|
| 2036 |
msgid "Shop name"
|
| 2037 |
msgstr ""
|
| 2038 |
|
| 2039 |
+
#: classes/admin/settings/class-wcv-settings-display.php:305
|
| 2040 |
msgid "%s Username"
|
| 2041 |
msgstr ""
|
| 2042 |
|
| 2043 |
+
#: classes/admin/settings/class-wcv-settings-display.php:306
|
| 2044 |
msgid "%s Email"
|
| 2045 |
msgstr ""
|
| 2046 |
|
| 2364 |
msgid "This is displayed on each of your products."
|
| 2365 |
msgstr ""
|
| 2366 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2367 |
#: classes/admin/views/html-vendor-settings-page.php:180, templates/dashboard/settings/shop-description.php:19
|
| 2368 |
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 2369 |
msgstr ""
|
| 2680 |
msgid "You can approve or deny the application at the following link %s"
|
| 2681 |
msgstr ""
|
| 2682 |
|
| 2683 |
+
#: templates/emails/plain/admin-notify-approved.php:20
|
| 2684 |
+
msgid "Approved username: %s"
|
| 2685 |
+
msgstr ""
|
| 2686 |
+
|
| 2687 |
#: templates/emails/plain/vendor-notify-cancelled-order.php:19
|
| 2688 |
msgid "Your order has been cancelled."
|
| 2689 |
msgstr ""
|
languages/wcvendors-de_AT.mo
DELETED
|
Binary file
|
languages/wcvendors-de_AT.po
DELETED
|
@@ -1,1577 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: WC Vendors\n"
|
| 4 |
-
"POT-Creation-Date: 2015-01-08 14:31+1000\n"
|
| 5 |
-
"PO-Revision-Date: 2015-01-27 15:01+0100\n"
|
| 6 |
-
"Last-Translator: \n"
|
| 7 |
-
"Language-Team: WC Vendors <support@wcvendors.com>\n"
|
| 8 |
-
"MIME-Version: 1.0\n"
|
| 9 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 10 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 11 |
-
"X-Generator: Poedit 1.7.3\n"
|
| 12 |
-
"X-Poedit-Basepath: .\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-KeywordsList: __;_e\n"
|
| 16 |
-
"Language: de_DE\n"
|
| 17 |
-
"X-Poedit-SearchPath-0: .\n"
|
| 18 |
-
"X-Poedit-SearchPath-1: ..\n"
|
| 19 |
-
|
| 20 |
-
#: classes/admin/class-admin-page.php:28
|
| 21 |
-
msgid "Vendors shipped"
|
| 22 |
-
msgstr "vom Verkäufer versandt"
|
| 23 |
-
|
| 24 |
-
#: classes/admin/class-admin-page.php:51
|
| 25 |
-
msgid "Vendors Shipped"
|
| 26 |
-
msgstr "vom Verkäufer versandt"
|
| 27 |
-
|
| 28 |
-
#: classes/admin/class-admin-page.php:73
|
| 29 |
-
#: classes/admin/class-admin-page.php:133
|
| 30 |
-
#: classes/admin/class-admin-reports.php:345
|
| 31 |
-
#: classes/admin/class-product-meta.php:148
|
| 32 |
-
#: classes/admin/class-product-meta.php:164
|
| 33 |
-
#: views/dashboard/reports.php:19
|
| 34 |
-
msgid "Commission"
|
| 35 |
-
msgstr "Provision"
|
| 36 |
-
|
| 37 |
-
#: classes/admin/class-admin-page.php:252
|
| 38 |
-
#: classes/admin/class-admin-reports.php:175
|
| 39 |
-
#: views/dashboard/reports.php:17 views/emails/admin-new-order.php:22
|
| 40 |
-
#: views/emails/notify-vendor-shipped.php:22
|
| 41 |
-
msgid "Product"
|
| 42 |
-
msgstr "Produkt"
|
| 43 |
-
|
| 44 |
-
#: classes/admin/class-admin-page.php:253
|
| 45 |
-
msgid "Order ID"
|
| 46 |
-
msgstr "Bestell-Nr."
|
| 47 |
-
|
| 48 |
-
#: classes/admin/class-admin-page.php:254
|
| 49 |
-
#: classes/admin/class-admin-reports.php:176
|
| 50 |
-
#: classes/admin/class-product-meta.php:44
|
| 51 |
-
#: classes/admin/class-product-meta.php:184
|
| 52 |
-
#: classes/admin/class-product-meta.php:220
|
| 53 |
-
msgid "Vendor"
|
| 54 |
-
msgstr "Verkäufer"
|
| 55 |
-
|
| 56 |
-
#: classes/admin/class-admin-page.php:255
|
| 57 |
-
#: classes/admin/class-admin-reports.php:177
|
| 58 |
-
#: classes/admin/class-admin-reports.php:350
|
| 59 |
-
#: classes/admin/class-admin-reports.php:374
|
| 60 |
-
#: views/dashboard/orders.php:25
|
| 61 |
-
msgid "Total"
|
| 62 |
-
msgstr "Summe"
|
| 63 |
-
|
| 64 |
-
#: classes/admin/class-admin-page.php:256
|
| 65 |
-
#: classes/admin/class-admin-reports.php:179
|
| 66 |
-
msgid "Status"
|
| 67 |
-
msgstr "Status"
|
| 68 |
-
|
| 69 |
-
#: classes/admin/class-admin-page.php:257
|
| 70 |
-
#: classes/front/orders/class-orders.php:216
|
| 71 |
-
#: views/dashboard/orders.php:26
|
| 72 |
-
msgid "Date"
|
| 73 |
-
msgstr "Datum"
|
| 74 |
-
|
| 75 |
-
#: classes/admin/class-admin-page.php:294
|
| 76 |
-
msgid "Mark paid"
|
| 77 |
-
msgstr "Als bezahlt markieren"
|
| 78 |
-
|
| 79 |
-
#: classes/admin/class-admin-page.php:295
|
| 80 |
-
msgid "Mark due"
|
| 81 |
-
msgstr "Als noch offen kennzeichnen"
|
| 82 |
-
|
| 83 |
-
#: classes/admin/class-admin-page.php:296
|
| 84 |
-
msgid "Mark reversed"
|
| 85 |
-
msgstr "Als storniert kennzeichnen"
|
| 86 |
-
|
| 87 |
-
#: classes/admin/class-admin-page.php:313
|
| 88 |
-
msgid "Filter"
|
| 89 |
-
msgstr "Filter"
|
| 90 |
-
|
| 91 |
-
#: classes/admin/class-admin-page.php:347
|
| 92 |
-
msgid "Show all dates"
|
| 93 |
-
msgstr "Zeige alle Daten"
|
| 94 |
-
|
| 95 |
-
#: classes/admin/class-admin-page.php:360
|
| 96 |
-
#, php-format
|
| 97 |
-
msgid "%1$s %2$d"
|
| 98 |
-
msgstr "%1$s %2$d"
|
| 99 |
-
|
| 100 |
-
#: classes/admin/class-admin-page.php:386
|
| 101 |
-
msgid "Commission marked paid."
|
| 102 |
-
msgstr "Provision als ausgezahlt kennzeichnen"
|
| 103 |
-
|
| 104 |
-
#: classes/admin/class-admin-page.php:393
|
| 105 |
-
msgid "Commission marked due."
|
| 106 |
-
msgstr "Als Provision noch offen kennzeichnen"
|
| 107 |
-
|
| 108 |
-
#: classes/admin/class-admin-page.php:400
|
| 109 |
-
msgid "Commission marked reversed."
|
| 110 |
-
msgstr "Provision als storniert kennzeichnen"
|
| 111 |
-
|
| 112 |
-
#: classes/admin/class-admin-reports.php:41
|
| 113 |
-
#: classes/admin/class-admin-users.php:349
|
| 114 |
-
msgid "WC Vendors"
|
| 115 |
-
msgstr "WC Vendors"
|
| 116 |
-
|
| 117 |
-
#: classes/admin/class-admin-reports.php:44
|
| 118 |
-
msgid "Overview"
|
| 119 |
-
msgstr "Übersicht"
|
| 120 |
-
|
| 121 |
-
#: classes/admin/class-admin-reports.php:50
|
| 122 |
-
msgid "Commission by vendor"
|
| 123 |
-
msgstr "Provision nach Verkäufer"
|
| 124 |
-
|
| 125 |
-
#: classes/admin/class-admin-reports.php:56
|
| 126 |
-
msgid "Commission by product"
|
| 127 |
-
msgstr "Provision nach Produkt"
|
| 128 |
-
|
| 129 |
-
#: classes/admin/class-admin-reports.php:115
|
| 130 |
-
#: views/dashboard/date-picker.php:3
|
| 131 |
-
msgid "From:"
|
| 132 |
-
msgstr "Von:"
|
| 133 |
-
|
| 134 |
-
#: classes/admin/class-admin-reports.php:119
|
| 135 |
-
#: views/dashboard/date-picker.php:7
|
| 136 |
-
msgid "To:"
|
| 137 |
-
msgstr "An:"
|
| 138 |
-
|
| 139 |
-
#: classes/admin/class-admin-reports.php:122
|
| 140 |
-
#: classes/admin/class-admin-reports.php:283
|
| 141 |
-
#: views/dashboard/date-picker.php:12
|
| 142 |
-
msgid "Show"
|
| 143 |
-
msgstr "Zeige"
|
| 144 |
-
|
| 145 |
-
#: classes/admin/class-admin-reports.php:133
|
| 146 |
-
msgid "Total paid in range"
|
| 147 |
-
msgstr "Gesamt ausgezahlt im Zeitraum"
|
| 148 |
-
|
| 149 |
-
#: classes/admin/class-admin-reports.php:136
|
| 150 |
-
#: classes/admin/class-admin-reports.php:143
|
| 151 |
-
#: classes/admin/class-admin-reports.php:150
|
| 152 |
-
msgid "n/a"
|
| 153 |
-
msgstr "n/a"
|
| 154 |
-
|
| 155 |
-
#: classes/admin/class-admin-reports.php:140
|
| 156 |
-
msgid "Total due in range"
|
| 157 |
-
msgstr "Gesamt offen im Zeitraum"
|
| 158 |
-
|
| 159 |
-
#: classes/admin/class-admin-reports.php:147
|
| 160 |
-
msgid "Total reversed in range"
|
| 161 |
-
msgstr "Gesamt storniert im Zeitraum"
|
| 162 |
-
|
| 163 |
-
#: classes/admin/class-admin-reports.php:157
|
| 164 |
-
msgid "Recent Commission"
|
| 165 |
-
msgstr "Neueste Provision"
|
| 166 |
-
|
| 167 |
-
#: classes/admin/class-admin-reports.php:174
|
| 168 |
-
#: classes/front/orders/class-orders.php:208
|
| 169 |
-
#: views/dashboard/orders.php:23
|
| 170 |
-
msgid "Order"
|
| 171 |
-
msgstr "Bestellung"
|
| 172 |
-
|
| 173 |
-
#: classes/admin/class-admin-reports.php:178
|
| 174 |
-
msgid "Date & Time"
|
| 175 |
-
msgstr "Datum & Uhrzeit"
|
| 176 |
-
|
| 177 |
-
#: classes/admin/class-admin-reports.php:187
|
| 178 |
-
msgid "N/A"
|
| 179 |
-
msgstr "N/A"
|
| 180 |
-
|
| 181 |
-
#: classes/admin/class-admin-reports.php:192
|
| 182 |
-
msgid "D j M Y \\a\\t h:ia"
|
| 183 |
-
msgstr "D, j.m.Y \\u\\m H:i \\U\\h\\r"
|
| 184 |
-
|
| 185 |
-
#: classes/admin/class-admin-reports.php:201
|
| 186 |
-
msgid "No commission yet"
|
| 187 |
-
msgstr "Keine Provision fällig"
|
| 188 |
-
|
| 189 |
-
#: classes/admin/class-admin-reports.php:232
|
| 190 |
-
msgid "Show:"
|
| 191 |
-
msgstr "Zeige:"
|
| 192 |
-
|
| 193 |
-
#: classes/admin/class-admin-reports.php:243
|
| 194 |
-
msgid "Year"
|
| 195 |
-
msgstr "Jahr"
|
| 196 |
-
|
| 197 |
-
#: classes/admin/class-admin-reports.php:276
|
| 198 |
-
msgid "Select a vendor…"
|
| 199 |
-
msgstr "Einen Verkäufer wählen"
|
| 200 |
-
|
| 201 |
-
#: classes/admin/class-admin-reports.php:344
|
| 202 |
-
msgid "Month"
|
| 203 |
-
msgstr "Monat"
|
| 204 |
-
|
| 205 |
-
#: classes/admin/class-admin-reports.php:346
|
| 206 |
-
msgid "Tax"
|
| 207 |
-
msgstr "Steuer"
|
| 208 |
-
|
| 209 |
-
#: classes/admin/class-admin-reports.php:347
|
| 210 |
-
#: views/dashboard/orders.php:24 views/orders/orders.php:113
|
| 211 |
-
msgid "Shipping"
|
| 212 |
-
msgstr "Versand"
|
| 213 |
-
|
| 214 |
-
#: classes/admin/class-admin-reports.php:348
|
| 215 |
-
msgid "Reversed"
|
| 216 |
-
msgstr "Storniert"
|
| 217 |
-
|
| 218 |
-
#: classes/admin/class-admin-reports.php:349
|
| 219 |
-
msgid "Paid"
|
| 220 |
-
msgstr "Bezahlt"
|
| 221 |
-
|
| 222 |
-
#: classes/admin/class-admin-users.php:359
|
| 223 |
-
msgid "Enable HTML for the shop description"
|
| 224 |
-
msgstr "HTML für die Shop-Beschreibung erlauben"
|
| 225 |
-
|
| 226 |
-
#: classes/admin/class-admin-users.php:365
|
| 227 |
-
msgid "Shop name"
|
| 228 |
-
msgstr "Shop-Name"
|
| 229 |
-
|
| 230 |
-
#: classes/admin/class-admin-users.php:372
|
| 231 |
-
msgid "PayPal E-mail"
|
| 232 |
-
msgstr "PayPal E-Mail"
|
| 233 |
-
|
| 234 |
-
#: classes/admin/class-admin-users.php:373
|
| 235 |
-
msgid "required"
|
| 236 |
-
msgstr "notwendig"
|
| 237 |
-
|
| 238 |
-
#: classes/admin/class-admin-users.php:380
|
| 239 |
-
msgid "Commission rate"
|
| 240 |
-
msgstr "Provisionsrate"
|
| 241 |
-
|
| 242 |
-
#: classes/admin/class-admin-users.php:381
|
| 243 |
-
#: classes/admin/class-product-meta.php:171
|
| 244 |
-
msgid "Leave blank for default"
|
| 245 |
-
msgstr "Leer lassen für Voreinstellung"
|
| 246 |
-
|
| 247 |
-
#: classes/admin/class-admin-users.php:387
|
| 248 |
-
#: classes/front/class-vendor-shop.php:103
|
| 249 |
-
#: views/dashboard/settings/seller-info.php:3
|
| 250 |
-
msgid "Seller info"
|
| 251 |
-
msgstr "Verkäufer-Info"
|
| 252 |
-
|
| 253 |
-
#: classes/admin/class-admin-users.php:392
|
| 254 |
-
msgid "Shop description"
|
| 255 |
-
msgstr "Shopbeschreibung"
|
| 256 |
-
|
| 257 |
-
#: classes/admin/class-vendor-applicants.php:26
|
| 258 |
-
msgid "Approve"
|
| 259 |
-
msgstr "Freischalten"
|
| 260 |
-
|
| 261 |
-
#: classes/admin/class-vendor-applicants.php:27
|
| 262 |
-
msgid "Deny"
|
| 263 |
-
msgstr "Ablehnen"
|
| 264 |
-
|
| 265 |
-
#: classes/admin/class-vendor-applicants.php:71
|
| 266 |
-
msgid "Vendor has been <b>denied</b>."
|
| 267 |
-
msgstr "Verkäufer wurde <b>abgelehnt</b>"
|
| 268 |
-
|
| 269 |
-
#: classes/admin/class-vendor-applicants.php:82
|
| 270 |
-
msgid "Vendor has been <b>approved</b>."
|
| 271 |
-
msgstr "Verkäufer wurde <b>freigeschaltet</b>"
|
| 272 |
-
|
| 273 |
-
#: classes/admin/class-vendor-applicants.php:96
|
| 274 |
-
msgid "Pending Vendors"
|
| 275 |
-
msgstr "Freizuschaltende Verkäufer"
|
| 276 |
-
|
| 277 |
-
#: classes/admin/emails/class-emails.php:55
|
| 278 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:70
|
| 279 |
-
msgid "pending"
|
| 280 |
-
msgstr "in Bearbeitung"
|
| 281 |
-
|
| 282 |
-
#: classes/admin/emails/class-emails.php:57
|
| 283 |
-
msgid "approved"
|
| 284 |
-
msgstr "freigeschaltet"
|
| 285 |
-
|
| 286 |
-
#: classes/admin/emails/class-emails.php:59
|
| 287 |
-
msgid "denied"
|
| 288 |
-
msgstr "abgelehnt"
|
| 289 |
-
|
| 290 |
-
#: classes/admin/emails/class-emails.php:87
|
| 291 |
-
#: classes/front/class-vendor-cart.php:60
|
| 292 |
-
#: classes/front/class-vendor-shop.php:178
|
| 293 |
-
msgid "Sold by: "
|
| 294 |
-
msgstr "Verkauft von:"
|
| 295 |
-
|
| 296 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:28
|
| 297 |
-
msgid "Vendor Application"
|
| 298 |
-
msgstr "Bewerbung als Verkäufer"
|
| 299 |
-
|
| 300 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:29
|
| 301 |
-
msgid "Vendor application will either be approved, denied, or pending."
|
| 302 |
-
msgstr ""
|
| 303 |
-
"Die Bewerbung als Verkäufer wird entweder genehmigt, abgelehnt oder auf "
|
| 304 |
-
"\"\"in Bearbeitung gesetzt."
|
| 305 |
-
|
| 306 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:31
|
| 307 |
-
msgid "Application {status}"
|
| 308 |
-
msgstr "Bewerbung {status}"
|
| 309 |
-
|
| 310 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:32
|
| 311 |
-
msgid "[{blogname}] Your vendor application has been {status}"
|
| 312 |
-
msgstr "[{blogname}] Ihre Bewerbung als Verkäufer wurde {status}"
|
| 313 |
-
|
| 314 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:123
|
| 315 |
-
#: classes/admin/emails/class-wc-notify-admin.php:129
|
| 316 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:163
|
| 317 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:230
|
| 318 |
-
msgid "Enable/Disable"
|
| 319 |
-
msgstr "Aktivieren/Deaktivieren"
|
| 320 |
-
|
| 321 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:125
|
| 322 |
-
#: classes/admin/emails/class-wc-notify-admin.php:131
|
| 323 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:165
|
| 324 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:232
|
| 325 |
-
msgid "Enable this email notification"
|
| 326 |
-
msgstr "E-Mail-Benachrichtigung aktivieren"
|
| 327 |
-
|
| 328 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:129
|
| 329 |
-
#: classes/admin/emails/class-wc-notify-admin.php:135
|
| 330 |
-
msgid "Recipient(s)"
|
| 331 |
-
msgstr "Empfänger"
|
| 332 |
-
|
| 333 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:131
|
| 334 |
-
#: classes/admin/emails/class-wc-notify-admin.php:137
|
| 335 |
-
#, php-format
|
| 336 |
-
msgid ""
|
| 337 |
-
"Enter recipients (comma separated) for this email. Defaults to <code>%s</"
|
| 338 |
-
"code>."
|
| 339 |
-
msgstr ""
|
| 340 |
-
"Empfänger (mit Komma getrennt) eingeben. Standardmäßig "
|
| 341 |
-
"<code>%s</code>"
|
| 342 |
-
|
| 343 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:136
|
| 344 |
-
#: classes/admin/emails/class-wc-notify-admin.php:142
|
| 345 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:169
|
| 346 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:236
|
| 347 |
-
msgid "Subject"
|
| 348 |
-
msgstr "Betreff"
|
| 349 |
-
|
| 350 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:138
|
| 351 |
-
#: classes/admin/emails/class-wc-notify-admin.php:144
|
| 352 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:171
|
| 353 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:238
|
| 354 |
-
#, php-format
|
| 355 |
-
msgid ""
|
| 356 |
-
"This controls the email subject line. Leave blank to use the default "
|
| 357 |
-
"subject: <code>%s</code>."
|
| 358 |
-
msgstr ""
|
| 359 |
-
"Dies bestimmt den E-Mail-Betreff. Leer lassen für Standard-Betreff: <code>"
|
| 360 |
-
"%s</code>"
|
| 361 |
-
|
| 362 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:143
|
| 363 |
-
#: classes/admin/emails/class-wc-notify-admin.php:149
|
| 364 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:176
|
| 365 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:243
|
| 366 |
-
msgid "Email Heading"
|
| 367 |
-
msgstr "E-Mail-Header (Kopfzeile)"
|
| 368 |
-
|
| 369 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:145
|
| 370 |
-
#: classes/admin/emails/class-wc-notify-admin.php:151
|
| 371 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:178
|
| 372 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:245
|
| 373 |
-
#, php-format
|
| 374 |
-
msgid ""
|
| 375 |
-
"This controls the main heading contained within the email notification. "
|
| 376 |
-
"Leave blank to use the default heading: <code>%s</code>."
|
| 377 |
-
msgstr ""
|
| 378 |
-
"Dies bestimmt den Header-Abschnitt (Kopfzeile) der Benachrichtigungs-E-Mail."
|
| 379 |
-
"Leer lassen für den Standard-Inhalt: <code>%s</code>."
|
| 380 |
-
|
| 381 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:150
|
| 382 |
-
#: classes/admin/emails/class-wc-notify-admin.php:156
|
| 383 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:183
|
| 384 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:250
|
| 385 |
-
msgid "Email type"
|
| 386 |
-
msgstr "E-Mail-Typ"
|
| 387 |
-
|
| 388 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:152
|
| 389 |
-
#: classes/admin/emails/class-wc-notify-admin.php:158
|
| 390 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:185
|
| 391 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:252
|
| 392 |
-
msgid "Choose which format of email to send."
|
| 393 |
-
msgstr "Wählen Sie, in welchem Format die E-Mail gesendet werden soll."
|
| 394 |
-
|
| 395 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:156
|
| 396 |
-
#: classes/admin/emails/class-wc-notify-admin.php:162
|
| 397 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:189
|
| 398 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:256
|
| 399 |
-
msgid "Plain text"
|
| 400 |
-
msgstr "Klartext"
|
| 401 |
-
|
| 402 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:157
|
| 403 |
-
#: classes/admin/emails/class-wc-notify-admin.php:163
|
| 404 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:190
|
| 405 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:257
|
| 406 |
-
msgid "HTML"
|
| 407 |
-
msgstr "HTML"
|
| 408 |
-
|
| 409 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:158
|
| 410 |
-
#: classes/admin/emails/class-wc-notify-admin.php:164
|
| 411 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:191
|
| 412 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:258
|
| 413 |
-
msgid "Multipart"
|
| 414 |
-
msgstr "Multipart (Mehrteiler)"
|
| 415 |
-
|
| 416 |
-
#: classes/admin/emails/class-wc-notify-admin.php:28
|
| 417 |
-
msgid "New Vendor Product"
|
| 418 |
-
msgstr "Neues Produkt"
|
| 419 |
-
|
| 420 |
-
#: classes/admin/emails/class-wc-notify-admin.php:29
|
| 421 |
-
msgid "New order emails are sent when a new product is submitted by a vendor"
|
| 422 |
-
msgstr ""
|
| 423 |
-
"Neue Bestell-E-Mails werden gesendet, wenn eine Bestellung eingegangen ist / "
|
| 424 |
-
"von einem Kunden bezahlt wurde"
|
| 425 |
-
|
| 426 |
-
#: classes/admin/emails/class-wc-notify-admin.php:31
|
| 427 |
-
msgid "New product submitted: {product_name}"
|
| 428 |
-
msgstr "Neues Produkt erstellt {product_name}"
|
| 429 |
-
|
| 430 |
-
#: classes/admin/emails/class-wc-notify-admin.php:32
|
| 431 |
-
msgid "[{blogname}] New product submitted by {vendor_name} - {product_name}"
|
| 432 |
-
msgstr "[{blogname}] Neues Produkt von {vendor_name} erstellt - {product_name}"
|
| 433 |
-
|
| 434 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:28
|
| 435 |
-
msgid "Vendor has shipped"
|
| 436 |
-
msgstr "Verkäufer hat versandt"
|
| 437 |
-
|
| 438 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:29
|
| 439 |
-
msgid ""
|
| 440 |
-
"An email is sent when a vendor has marked one of their orders as shipped."
|
| 441 |
-
msgstr ""
|
| 442 |
-
"Eine E-Mail wird verschickt, wenn ein Verkäufer eine seiner "
|
| 443 |
-
"Bestellungen als versandt markiert hat. "
|
| 444 |
-
|
| 445 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:31
|
| 446 |
-
msgid "Your order has been shipped"
|
| 447 |
-
msgstr "Ihre Bestellung wurde versandt"
|
| 448 |
-
|
| 449 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:32
|
| 450 |
-
msgid ""
|
| 451 |
-
"[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 452 |
-
msgstr ""
|
| 453 |
-
"[{blogname}]Ihre Bestellung wurde versandt ({order_number}) - {order_date}"
|
| 454 |
-
|
| 455 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:112
|
| 456 |
-
msgid "Subtotal:"
|
| 457 |
-
msgstr "Zwischensumme:"
|
| 458 |
-
|
| 459 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:27
|
| 460 |
-
msgid "Notify vendors"
|
| 461 |
-
msgstr "Verkäufer benachrichtigen"
|
| 462 |
-
|
| 463 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:28
|
| 464 |
-
msgid "New order emails are sent when an order is received/paid by a customer."
|
| 465 |
-
msgstr ""
|
| 466 |
-
"Neue Bestell-E-Mails werden gesendet, wenn eine Bestellung eingegangen ist / "
|
| 467 |
-
"von einem Kunden bezahlt wurde."
|
| 468 |
-
|
| 469 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:30
|
| 470 |
-
msgid "New customer order"
|
| 471 |
-
msgstr "Neue Bestellung"
|
| 472 |
-
|
| 473 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:31
|
| 474 |
-
msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
|
| 475 |
-
msgstr "[{blogname}] Neue Kundenbestellung ({order_number}) - {order_date}"
|
| 476 |
-
|
| 477 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:103
|
| 478 |
-
msgid "Commission Subtotal:"
|
| 479 |
-
msgstr "Zwischensumme Provisionen:"
|
| 480 |
-
|
| 481 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:110
|
| 482 |
-
msgid "Shipping Subtotal:"
|
| 483 |
-
msgstr "Zwischensumme Versand:"
|
| 484 |
-
|
| 485 |
-
#: classes/admin/settings/classes/sf-class-format-options.php:211
|
| 486 |
-
#: classes/admin/settings/classes/sf-class-settings.php:773
|
| 487 |
-
msgid "Select a page..."
|
| 488 |
-
msgstr "Wählen Sie eine Seite"
|
| 489 |
-
|
| 490 |
-
#: classes/admin/settings/classes/sf-class-settings.php:153
|
| 491 |
-
#: views/dashboard/settings/settings.php:1
|
| 492 |
-
msgid "Settings"
|
| 493 |
-
msgstr "Einstellungen"
|
| 494 |
-
|
| 495 |
-
#: classes/admin/settings/classes/sf-class-settings.php:297
|
| 496 |
-
msgid "Could not load settings at: "
|
| 497 |
-
msgstr "Einstellungen konnten nicht geladen werden für:"
|
| 498 |
-
|
| 499 |
-
#: classes/admin/settings/classes/sf-class-settings.php:297
|
| 500 |
-
msgid "Error - WP Settings Framework"
|
| 501 |
-
msgstr "Fehler - WP Settings Framework"
|
| 502 |
-
|
| 503 |
-
#: classes/admin/settings/classes/sf-class-settings.php:363
|
| 504 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:96
|
| 505 |
-
msgid "Settings saved."
|
| 506 |
-
msgstr "Einstellungen gespeichert."
|
| 507 |
-
|
| 508 |
-
#: classes/admin/settings/classes/sf-class-settings.php:479
|
| 509 |
-
#, php-format
|
| 510 |
-
msgid "Save %s changes"
|
| 511 |
-
msgstr "Änderungen %s speichern"
|
| 512 |
-
|
| 513 |
-
#: classes/admin/settings/sf-options.php:4
|
| 514 |
-
msgid "General"
|
| 515 |
-
msgstr "Allgemein"
|
| 516 |
-
|
| 517 |
-
#: classes/admin/settings/sf-options.php:5
|
| 518 |
-
msgid "General options"
|
| 519 |
-
msgstr "Allgemeine Einstellugen"
|
| 520 |
-
|
| 521 |
-
#: classes/admin/settings/sf-options.php:5
|
| 522 |
-
#: classes/admin/settings/sf-options.php:45
|
| 523 |
-
#: classes/admin/settings/sf-options.php:223
|
| 524 |
-
msgid " "
|
| 525 |
-
msgstr ""
|
| 526 |
-
|
| 527 |
-
#: classes/admin/settings/sf-options.php:8
|
| 528 |
-
msgid "Default commission (%)"
|
| 529 |
-
msgstr "Standard-Provision (%)"
|
| 530 |
-
|
| 531 |
-
#: classes/admin/settings/sf-options.php:9
|
| 532 |
-
msgid ""
|
| 533 |
-
"The default rate the vendor receives for each product. If a product has a "
|
| 534 |
-
"commission rate already set, this value will be ignored for that product."
|
| 535 |
-
msgstr ""
|
| 536 |
-
"Die Standard-Provision, die ein Verkäufer für jedes Produkt erhält. "
|
| 537 |
-
"Wenn ein Produkt bereits eine Provisions-Einstellung besitzt, überschreibt "
|
| 538 |
-
"diese den hier festgelegten Standardwert."
|
| 539 |
-
|
| 540 |
-
#: classes/admin/settings/sf-options.php:20
|
| 541 |
-
msgid "Registration"
|
| 542 |
-
msgstr "Registrierung"
|
| 543 |
-
|
| 544 |
-
#: classes/admin/settings/sf-options.php:21
|
| 545 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 546 |
-
msgstr "Erlaube Benutzern oder Gästen sich als Verkäufer zu bewerben"
|
| 547 |
-
|
| 548 |
-
#: classes/admin/settings/sf-options.php:22
|
| 549 |
-
msgid ""
|
| 550 |
-
"This will show a checkbox on the My Account page's registration form asking "
|
| 551 |
-
"if the user would like to apply to be a vendor. Also, on the Vendor "
|
| 552 |
-
"Dashboard, users can apply to become a vendor."
|
| 553 |
-
msgstr ""
|
| 554 |
-
"Ist dies aktiviert, wird eine Checkbox auf der bei der Registration als "
|
| 555 |
-
"neuer Benutzer angezeigt, mit der der Benutzer gefragt wird, ob er sich auch "
|
| 556 |
-
"als Verkäufer bewerben möchte.Bereits registrierte Benutzer kö"
|
| 557 |
-
"nnen sich auch nachträglich auf der Verkäufer-Seite als Verkä"
|
| 558 |
-
"ufer bewerben."
|
| 559 |
-
|
| 560 |
-
#: classes/admin/settings/sf-options.php:29
|
| 561 |
-
msgid "Approve vendor applications manually"
|
| 562 |
-
msgstr "Verkäufer-Bewerbungen manuell akzeptieren"
|
| 563 |
-
|
| 564 |
-
#: classes/admin/settings/sf-options.php:30
|
| 565 |
-
msgid ""
|
| 566 |
-
"With this unchecked, all vendor applications are automatically accepted. "
|
| 567 |
-
"Otherwise, you must approve each manually."
|
| 568 |
-
msgstr ""
|
| 569 |
-
"Ist diese Option deaktiviert, werden alle Bewerbungen automatisch "
|
| 570 |
-
"akzeptiert. Ansonsten muss jede Bewerbung manuell akzeptiert werden."
|
| 571 |
-
|
| 572 |
-
#: classes/admin/settings/sf-options.php:37
|
| 573 |
-
msgid "Taxes"
|
| 574 |
-
msgstr "Steuern"
|
| 575 |
-
|
| 576 |
-
#: classes/admin/settings/sf-options.php:38
|
| 577 |
-
msgid "Give vendors any tax collected per-product"
|
| 578 |
-
msgstr "Verkäufer erhalten alle eingenommenen Steuern pro Produkt"
|
| 579 |
-
|
| 580 |
-
#: classes/admin/settings/sf-options.php:39
|
| 581 |
-
msgid ""
|
| 582 |
-
"The tax collected on a vendor's product will be given to him in its entirety"
|
| 583 |
-
msgstr ""
|
| 584 |
-
"Die Steuern, die für ein Produkt eingenommen wurden, werden dem Verkä"
|
| 585 |
-
"ufer zur Gänze überlassen"
|
| 586 |
-
|
| 587 |
-
#: classes/admin/settings/sf-options.php:45
|
| 588 |
-
msgid "Shop options"
|
| 589 |
-
msgstr "Shop-Optionen"
|
| 590 |
-
|
| 591 |
-
#: classes/admin/settings/sf-options.php:48
|
| 592 |
-
msgid "Shop HTML"
|
| 593 |
-
msgstr "Shop-HTML"
|
| 594 |
-
|
| 595 |
-
#: classes/admin/settings/sf-options.php:49
|
| 596 |
-
msgid "Enable HTML for a vendor's shop description by default"
|
| 597 |
-
msgstr ""
|
| 598 |
-
"Erlaube HTML in der Shop-Beschreibung für alle Verkäufer als "
|
| 599 |
-
"Voreinstellung"
|
| 600 |
-
|
| 601 |
-
#: classes/admin/settings/sf-options.php:56
|
| 602 |
-
msgid "Vendor shop page"
|
| 603 |
-
msgstr "Verkäufer-Seite"
|
| 604 |
-
|
| 605 |
-
#: classes/admin/settings/sf-options.php:57
|
| 606 |
-
msgid "Eg: <code>yoursite.com/[your_setting_here]/[vendor_name_here]</code>"
|
| 607 |
-
msgstr ""
|
| 608 |
-
"z.B.: <code>deineseite.de/[deine_einstellung_hier]/[verkä"
|
| 609 |
-
"ufer_name_hier] </code>"
|
| 610 |
-
|
| 611 |
-
#: classes/admin/settings/sf-options.php:64
|
| 612 |
-
msgid "Shop Headers"
|
| 613 |
-
msgstr "Kopfzeile der Shops"
|
| 614 |
-
|
| 615 |
-
#: classes/admin/settings/sf-options.php:65
|
| 616 |
-
msgid "Enable vendor shop headers"
|
| 617 |
-
msgstr "Kopfzeilen in Verkäufer-Shops aktivieren"
|
| 618 |
-
|
| 619 |
-
#: classes/admin/settings/sf-options.php:66
|
| 620 |
-
msgid ""
|
| 621 |
-
"This will override the HTML Shop description output on product-archive pages."
|
| 622 |
-
msgstr ""
|
| 623 |
-
"Dies wird die HTML Shop-Beschreibung auf den Produkt-Archiv-Seiten "
|
| 624 |
-
"überschreiben."
|
| 625 |
-
|
| 626 |
-
#: classes/admin/settings/sf-options.php:72
|
| 627 |
-
#: classes/admin/settings/sf-options.php:198
|
| 628 |
-
msgid "Products"
|
| 629 |
-
msgstr "Produkte"
|
| 630 |
-
|
| 631 |
-
#: classes/admin/settings/sf-options.php:73
|
| 632 |
-
msgid "Product Add Page"
|
| 633 |
-
msgstr "Produkt hinzufügen-Seite"
|
| 634 |
-
|
| 635 |
-
#: classes/admin/settings/sf-options.php:73
|
| 636 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 637 |
-
msgstr ""
|
| 638 |
-
"Stelle ein, was der Verkäufer nicht sehen darf, wenn er ein Produkt "
|
| 639 |
-
"hinzufügt"
|
| 640 |
-
|
| 641 |
-
#: classes/admin/settings/sf-options.php:76
|
| 642 |
-
msgid "Left side panel"
|
| 643 |
-
msgstr "Produktdaten (Feld auf der linken Seite)"
|
| 644 |
-
|
| 645 |
-
#: classes/admin/settings/sf-options.php:77
|
| 646 |
-
msgid "Hide these areas of the add product page for vendors"
|
| 647 |
-
msgstr ""
|
| 648 |
-
"Verberge diese Bereiche der Seite Produkt hinzufügen für den "
|
| 649 |
-
"Verkäufer"
|
| 650 |
-
|
| 651 |
-
#: classes/admin/settings/sf-options.php:91
|
| 652 |
-
msgid "Types"
|
| 653 |
-
msgstr "Produkttypen"
|
| 654 |
-
|
| 655 |
-
#: classes/admin/settings/sf-options.php:92
|
| 656 |
-
msgid "Hide these product types from the vendor"
|
| 657 |
-
msgstr "Verberge diese Produktdaten für den Verkäufer"
|
| 658 |
-
|
| 659 |
-
#: classes/admin/settings/sf-options.php:105
|
| 660 |
-
msgid "Type options"
|
| 661 |
-
msgstr "Produkttyp-Optionen"
|
| 662 |
-
|
| 663 |
-
#: classes/admin/settings/sf-options.php:106
|
| 664 |
-
msgid "Hide these product options from the vendor"
|
| 665 |
-
msgstr "Verberge diese Produktoptionen vor dem Verkäufer"
|
| 666 |
-
|
| 667 |
-
#: classes/admin/settings/sf-options.php:117
|
| 668 |
-
msgid "Miscellaneous"
|
| 669 |
-
msgstr "Diverses"
|
| 670 |
-
|
| 671 |
-
#: classes/admin/settings/sf-options.php:129
|
| 672 |
-
msgid "Stylesheet"
|
| 673 |
-
msgstr "Stylesheet (CSS)"
|
| 674 |
-
|
| 675 |
-
#: classes/admin/settings/sf-options.php:130
|
| 676 |
-
msgid ""
|
| 677 |
-
"You can add CSS in this textarea, which will be loaded on the product add/"
|
| 678 |
-
"edit page for vendors."
|
| 679 |
-
msgstr ""
|
| 680 |
-
"Sie können CSS in diesem Textfeld eintragen, welches auf der Seite "
|
| 681 |
-
"Produkt hinzufügen/editieren für Verkäufer angezeigt wird."
|
| 682 |
-
|
| 683 |
-
#: classes/admin/settings/sf-options.php:136
|
| 684 |
-
msgid "Capabilities"
|
| 685 |
-
msgstr "Verkäufer-Rechte"
|
| 686 |
-
|
| 687 |
-
#: classes/admin/settings/sf-options.php:137
|
| 688 |
-
msgid "Permissions"
|
| 689 |
-
msgstr "Berechtigungen"
|
| 690 |
-
|
| 691 |
-
#: classes/admin/settings/sf-options.php:137
|
| 692 |
-
msgid "General permissions used around the shop"
|
| 693 |
-
msgstr "Allgemeine Berechtigungen rund um den Shop"
|
| 694 |
-
|
| 695 |
-
#: classes/admin/settings/sf-options.php:140
|
| 696 |
-
#: classes/class-install.php:205 views/dashboard/orders.php:18
|
| 697 |
-
msgid "Orders"
|
| 698 |
-
msgstr "Bestellungen"
|
| 699 |
-
|
| 700 |
-
#: classes/admin/settings/sf-options.php:141
|
| 701 |
-
msgid "View orders"
|
| 702 |
-
msgstr "Bestellungen ansehen"
|
| 703 |
-
|
| 704 |
-
#: classes/admin/settings/sf-options.php:142
|
| 705 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 706 |
-
msgstr ""
|
| 707 |
-
"Zeige Käufer-Details für jede Bestellung, wie z.B. E-Mail-Adresse, "
|
| 708 |
-
"Name, etc."
|
| 709 |
-
|
| 710 |
-
#: classes/admin/settings/sf-options.php:149
|
| 711 |
-
msgid "View comments"
|
| 712 |
-
msgstr "Bestell-Kommentare ansehen"
|
| 713 |
-
|
| 714 |
-
#: classes/admin/settings/sf-options.php:150
|
| 715 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 716 |
-
msgstr ""
|
| 717 |
-
"Zeige alle Verkäufer-Kommentare für eine Bestellung im Frontend."
|
| 718 |
-
|
| 719 |
-
#: classes/admin/settings/sf-options.php:157
|
| 720 |
-
msgid "Submit comments"
|
| 721 |
-
msgstr "Bestell-Kommentare hinzufügen"
|
| 722 |
-
|
| 723 |
-
#: classes/admin/settings/sf-options.php:158
|
| 724 |
-
msgid ""
|
| 725 |
-
"Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 726 |
-
msgstr ""
|
| 727 |
-
"Kommentare zu einer Bestellung über das Frontend hinzufügen, z.B. "
|
| 728 |
-
"die Sendungsverfolgungs-Nr. für ein Produkt."
|
| 729 |
-
|
| 730 |
-
#: classes/admin/settings/sf-options.php:165
|
| 731 |
-
msgid "View email addresses"
|
| 732 |
-
msgstr "E-Mail-Adressen ansehen"
|
| 733 |
-
|
| 734 |
-
#: classes/admin/settings/sf-options.php:166
|
| 735 |
-
msgid ""
|
| 736 |
-
"While viewing order details on the frontend, you can disable or enable email "
|
| 737 |
-
"addresses"
|
| 738 |
-
msgstr ""
|
| 739 |
-
"Beim Ansehen der Bestelldetails im Frontend, kann hiermit die Anzeige der E-"
|
| 740 |
-
"Mail-Adressen der Käfer aktiviert/deaktiviert werden."
|
| 741 |
-
|
| 742 |
-
#: classes/admin/settings/sf-options.php:173
|
| 743 |
-
msgid "Export a CSV file of orders for a product"
|
| 744 |
-
msgstr "Bestelldetails eines Produktes als CSV-Datei exportieren"
|
| 745 |
-
|
| 746 |
-
#: classes/admin/settings/sf-options.php:174
|
| 747 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 748 |
-
msgstr ""
|
| 749 |
-
"Verkäufer kann Bestellungen eines Produktes im Frontend exportieren."
|
| 750 |
-
|
| 751 |
-
#: classes/admin/settings/sf-options.php:181
|
| 752 |
-
msgid "Reports"
|
| 753 |
-
msgstr "Berichte"
|
| 754 |
-
|
| 755 |
-
#: classes/admin/settings/sf-options.php:182
|
| 756 |
-
msgid "View backend sales reports"
|
| 757 |
-
msgstr "Verkaufs-Berichte im Backend ansehen"
|
| 758 |
-
|
| 759 |
-
#: classes/admin/settings/sf-options.php:183
|
| 760 |
-
msgid ""
|
| 761 |
-
"Graphs and tables via the Reports page in backend. The reports will only "
|
| 762 |
-
"display sales data that pertain to their products"
|
| 763 |
-
msgstr ""
|
| 764 |
-
"Grafiken und Tabellen in den Übersichten im Backend. Die Berichte "
|
| 765 |
-
"zeigen nur die Verkaufs-Daten zu den Produkten des jeweiligen Verkä"
|
| 766 |
-
"ufers an"
|
| 767 |
-
|
| 768 |
-
#: classes/admin/settings/sf-options.php:190
|
| 769 |
-
msgid "View Frontend sales reports"
|
| 770 |
-
msgstr "Verkaufs-Berichte im Frontend ansehen"
|
| 771 |
-
|
| 772 |
-
#: classes/admin/settings/sf-options.php:191
|
| 773 |
-
msgid ""
|
| 774 |
-
"Sales table on the frontend on the My Account page. The table will only "
|
| 775 |
-
"display sales data that pertain to their products"
|
| 776 |
-
msgstr ""
|
| 777 |
-
"Verkaufs-Übersicht im Frontend auf der Mein Konto-Seite. Die Ü"
|
| 778 |
-
"bersicht zeigt nur die Verkaufs-Daten zu den Produkten des jeweiligen "
|
| 779 |
-
"Verkäufers."
|
| 780 |
-
|
| 781 |
-
#: classes/admin/settings/sf-options.php:199
|
| 782 |
-
msgid "Submit products"
|
| 783 |
-
msgstr "Produkte hinzufügen"
|
| 784 |
-
|
| 785 |
-
#: classes/admin/settings/sf-options.php:200
|
| 786 |
-
msgid ""
|
| 787 |
-
"Vendors could submit a product through the backend, and an admin would "
|
| 788 |
-
"approve or deny it"
|
| 789 |
-
msgstr ""
|
| 790 |
-
"Verkäufer können ein neues Produkt im Backend hinzufügen. Ein "
|
| 791 |
-
"Admin kann es dann freischalten oder ablehnen."
|
| 792 |
-
|
| 793 |
-
#: classes/admin/settings/sf-options.php:207
|
| 794 |
-
msgid "Edit live products"
|
| 795 |
-
msgstr "Bereits veröffentlichte Produkte bearbeiten"
|
| 796 |
-
|
| 797 |
-
#: classes/admin/settings/sf-options.php:208
|
| 798 |
-
msgid ""
|
| 799 |
-
"Vendors could edit an approved product after it has already gone live. There "
|
| 800 |
-
"is no approval or review after editing a live product. This could be "
|
| 801 |
-
"dangerous with malicious vendors, so take caution."
|
| 802 |
-
msgstr ""
|
| 803 |
-
"Ist dies aktiviert, können Verkäufer ein bereits freigeschaltetes "
|
| 804 |
-
"Product bearbeiten. Es gibt keine erneute Freischaltung der Bearbeitung, "
|
| 805 |
-
"also Vorsicht!"
|
| 806 |
-
|
| 807 |
-
#: classes/admin/settings/sf-options.php:215
|
| 808 |
-
msgid "Submit products live without requiring approval"
|
| 809 |
-
msgstr ""
|
| 810 |
-
"Produkte hinzufügen, ohne dass eine Freischaltung durch den Admin "
|
| 811 |
-
"erforderlich ist"
|
| 812 |
-
|
| 813 |
-
#: classes/admin/settings/sf-options.php:216
|
| 814 |
-
msgid ""
|
| 815 |
-
"Vendors can submit products without review or approval from a shop admin. "
|
| 816 |
-
"This could be dangerous with malicious vendors, so take caution."
|
| 817 |
-
msgstr ""
|
| 818 |
-
"Ist dies aktiviert, können Verkäufer neue Produkte hinzufü"
|
| 819 |
-
"gen, ohne dass eine vorherige Freischaltung durch den Admin erforderlich "
|
| 820 |
-
"ist. Dies könnte bei böswilligen Verkäufern gefährlich "
|
| 821 |
-
"sein, daher Vorsicht!"
|
| 822 |
-
|
| 823 |
-
#: classes/admin/settings/sf-options.php:222
|
| 824 |
-
msgid "Pages"
|
| 825 |
-
msgstr "Seiten"
|
| 826 |
-
|
| 827 |
-
#: classes/admin/settings/sf-options.php:223
|
| 828 |
-
msgid "Page configuration"
|
| 829 |
-
msgstr "Seitenkonfiguration"
|
| 830 |
-
|
| 831 |
-
#: classes/admin/settings/sf-options.php:226
|
| 832 |
-
msgid "Vendor dashboard"
|
| 833 |
-
msgstr "Verkäufer-Seite"
|
| 834 |
-
|
| 835 |
-
#: classes/admin/settings/sf-options.php:227
|
| 836 |
-
msgid ""
|
| 837 |
-
"Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</"
|
| 838 |
-
"code><br/>By default, My Account > Vendor Dashboard should have the "
|
| 839 |
-
"shortcode."
|
| 840 |
-
msgstr ""
|
| 841 |
-
"Wähle die Seite, die den shortcode <code>[pv_vendor_dashboard]</"
|
| 842 |
-
"code><br/> enthält. Standardmäßig sollte dies Mein Konto > "
|
| 843 |
-
"Verkäufer-Seite sein."
|
| 844 |
-
|
| 845 |
-
#: classes/admin/settings/sf-options.php:234
|
| 846 |
-
msgid "Shop settings"
|
| 847 |
-
msgstr "Shop-Einstellungen"
|
| 848 |
-
|
| 849 |
-
#: classes/admin/settings/sf-options.php:235
|
| 850 |
-
msgid ""
|
| 851 |
-
"Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/"
|
| 852 |
-
">These are the shop settings a vendor can configure."
|
| 853 |
-
msgstr ""
|
| 854 |
-
"Wähle die Seite, die den shortcode <code>[pv_shop_settings]</code><br/> "
|
| 855 |
-
"enthält. Dies sind die Shop-Einstellungen, die ein Verkäufer "
|
| 856 |
-
"vornehmen kann."
|
| 857 |
-
|
| 858 |
-
#: classes/admin/settings/sf-options.php:242
|
| 859 |
-
msgid "Orders page"
|
| 860 |
-
msgstr "Bestellungsseite"
|
| 861 |
-
|
| 862 |
-
#: classes/admin/settings/sf-options.php:243
|
| 863 |
-
msgid ""
|
| 864 |
-
"Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 865 |
-
"default, My Account > Orders should have the shortcode."
|
| 866 |
-
msgstr ""
|
| 867 |
-
"Wähle die Seite, die den shortcode <code>[pv_orders]</code><br/> "
|
| 868 |
-
"enthält. Standardmäßig sollte dies Mein Konto > Bestellungen "
|
| 869 |
-
"sein."
|
| 870 |
-
|
| 871 |
-
#: classes/admin/settings/sf-options.php:250
|
| 872 |
-
msgid "Vendor terms"
|
| 873 |
-
msgstr "Verkäufer-Bedingungen"
|
| 874 |
-
|
| 875 |
-
#: classes/admin/settings/sf-options.php:251
|
| 876 |
-
msgid ""
|
| 877 |
-
"These terms are shown to a user when submitting an application to become a "
|
| 878 |
-
"vendor.<br/>If left blank, no terms will be shown to the applicant."
|
| 879 |
-
msgstr ""
|
| 880 |
-
"Diese Bedingungen werden einem Benutzer angezeigt, wenn er sich als "
|
| 881 |
-
"Verkäufer bewirbt.<br/>Falls leer gelassen, werden dem Bewerber keine "
|
| 882 |
-
"Bedingungen angezeigt."
|
| 883 |
-
|
| 884 |
-
#: classes/admin/settings/sf-options.php:269
|
| 885 |
-
msgid "Payments"
|
| 886 |
-
msgstr "Auszahlungen"
|
| 887 |
-
|
| 888 |
-
#: classes/admin/settings/sf-options.php:271
|
| 889 |
-
msgid "User payments"
|
| 890 |
-
msgstr "Benutzer-Zahlungen"
|
| 891 |
-
|
| 892 |
-
#: classes/admin/settings/sf-options.php:272
|
| 893 |
-
#, php-format
|
| 894 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 895 |
-
msgstr ""
|
| 896 |
-
"Gesamte derzeit ausstehende Provision: %s. <a href=\"%s\">Zeige Details</a>."
|
| 897 |
-
|
| 898 |
-
#: classes/admin/settings/sf-options.php:273
|
| 899 |
-
#, php-format
|
| 900 |
-
msgid ""
|
| 901 |
-
"Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 902 |
-
"\">here</a>."
|
| 903 |
-
msgstr ""
|
| 904 |
-
"Stellen Sie sicher, dass die PayPal Adaptive Payments Einstellungen <a href="
|
| 905 |
-
"\"%s\"> korrekt sind</a>."
|
| 906 |
-
|
| 907 |
-
#: classes/admin/settings/sf-options.php:277
|
| 908 |
-
msgid "Instant pay"
|
| 909 |
-
msgstr "Sofortzahlung"
|
| 910 |
-
|
| 911 |
-
#: classes/admin/settings/sf-options.php:278
|
| 912 |
-
msgid "Instantly pay vendors their commission when an order is made"
|
| 913 |
-
msgstr ""
|
| 914 |
-
"Zahlt dem Verkäufer seine Provision automatisch sofort, wenn eine "
|
| 915 |
-
"Bestellung für eines seiner Produkte erfolgt ist."
|
| 916 |
-
|
| 917 |
-
#: classes/admin/settings/sf-options.php:279
|
| 918 |
-
msgid ""
|
| 919 |
-
"For this to work, customers must checkout with the PayPal Adaptive Payments "
|
| 920 |
-
"gateway. Using other gateways will not pay vendors instantly"
|
| 921 |
-
msgstr ""
|
| 922 |
-
"Damit dies funktioniert, müssen Kunden via PayPal Adaptive Payments "
|
| 923 |
-
"auschecken.Bei anderen Bezahlmethoden wird der Verkäufer nicht direkt bezahlt"
|
| 924 |
-
|
| 925 |
-
#: classes/admin/settings/sf-options.php:286
|
| 926 |
-
msgid "Payment schedule"
|
| 927 |
-
msgstr "Zeitplan für Zahlungen"
|
| 928 |
-
|
| 929 |
-
#: classes/admin/settings/sf-options.php:287
|
| 930 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 931 |
-
msgstr ""
|
| 932 |
-
"Hinweis: Zeitplan funktioniert nur, wenn sofortige Zahlung deaktiviert ist."
|
| 933 |
-
|
| 934 |
-
#: classes/admin/settings/sf-options.php:292
|
| 935 |
-
msgid "Weekly"
|
| 936 |
-
msgstr "Wöchentlich"
|
| 937 |
-
|
| 938 |
-
#: classes/admin/settings/sf-options.php:293
|
| 939 |
-
msgid "Biweekly"
|
| 940 |
-
msgstr "Zweiwöchentlich"
|
| 941 |
-
|
| 942 |
-
#: classes/admin/settings/sf-options.php:294
|
| 943 |
-
msgid "Monthly"
|
| 944 |
-
msgstr "Monatlich"
|
| 945 |
-
|
| 946 |
-
#: classes/admin/settings/sf-options.php:295
|
| 947 |
-
msgid "Manual"
|
| 948 |
-
msgstr "Manuell"
|
| 949 |
-
|
| 950 |
-
#: classes/admin/settings/sf-options.php:296
|
| 951 |
-
msgid "Now"
|
| 952 |
-
msgstr "Sofort"
|
| 953 |
-
|
| 954 |
-
#: classes/admin/settings/sf-options.php:301
|
| 955 |
-
msgid "Email notification"
|
| 956 |
-
msgstr "E-Mail-Benachrichtigung"
|
| 957 |
-
|
| 958 |
-
#: classes/admin/settings/sf-options.php:302
|
| 959 |
-
msgid ""
|
| 960 |
-
"Send the WooCommerce admin an email each time a payment has been made via "
|
| 961 |
-
"the payment schedule options above"
|
| 962 |
-
msgstr ""
|
| 963 |
-
"Sendet dem WooCommerce-Admin eine automatische E-Mail, wenn eine Zahlung auf "
|
| 964 |
-
"Grund des Zahlungsplans ausgeführt wurde."
|
| 965 |
-
|
| 966 |
-
#: classes/class-cron.php:87
|
| 967 |
-
#, php-format
|
| 968 |
-
msgid "Payment total: %s"
|
| 969 |
-
msgstr "Zahlung gesamt: %s"
|
| 970 |
-
|
| 971 |
-
#: classes/class-cron.php:148
|
| 972 |
-
msgid "Once Weekly"
|
| 973 |
-
msgstr "Einmal wöchentlich"
|
| 974 |
-
|
| 975 |
-
#: classes/class-cron.php:153
|
| 976 |
-
msgid "Once every two weeks"
|
| 977 |
-
msgstr "Alle zweite Woche"
|
| 978 |
-
|
| 979 |
-
#: classes/class-cron.php:158
|
| 980 |
-
msgid "Once a month"
|
| 981 |
-
msgstr "Einmal im Monat"
|
| 982 |
-
|
| 983 |
-
#: classes/class-install.php:99 classes/class-install.php:253
|
| 984 |
-
msgid "Pending Vendor"
|
| 985 |
-
msgstr "Freizuschaltender Verkäufer"
|
| 986 |
-
|
| 987 |
-
#: classes/class-install.php:204
|
| 988 |
-
msgid "Vendor Dashboard"
|
| 989 |
-
msgstr "Verkäufer-Seite"
|
| 990 |
-
|
| 991 |
-
#: classes/class-install.php:206
|
| 992 |
-
msgid "Shop Settings"
|
| 993 |
-
msgstr "Shop-Einstellungen"
|
| 994 |
-
|
| 995 |
-
#: classes/front/class-vendor-cart.php:41
|
| 996 |
-
#: classes/front/class-vendor-shop.php:255
|
| 997 |
-
msgid "Sold by"
|
| 998 |
-
msgstr "Verkauft von"
|
| 999 |
-
|
| 1000 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:41
|
| 1001 |
-
msgid "Order unmarked shipped."
|
| 1002 |
-
msgstr "Bestellung nicht als versandt markiert"
|
| 1003 |
-
|
| 1004 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:51
|
| 1005 |
-
msgid "Order marked shipped."
|
| 1006 |
-
msgstr "Bestellung als versandt markiert."
|
| 1007 |
-
|
| 1008 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:69
|
| 1009 |
-
msgid "Your PayPal address is not a valid email address."
|
| 1010 |
-
msgstr "Ihre PayPal-Adresse ist keine gültige E-Mail-Adresse."
|
| 1011 |
-
|
| 1012 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:78
|
| 1013 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 1014 |
-
msgstr ""
|
| 1015 |
-
"Dieser Shopname ist bereits vergeben. Ihr Shopname muss einzigartig sein."
|
| 1016 |
-
|
| 1017 |
-
#: classes/front/orders/class-export-csv.php:37
|
| 1018 |
-
msgid "Extra data"
|
| 1019 |
-
msgstr "Zusätzliche Daten"
|
| 1020 |
-
|
| 1021 |
-
#: classes/front/orders/class-export-csv.php:38
|
| 1022 |
-
#: views/dashboard/reports.php:18 views/emails/admin-new-order.php:23
|
| 1023 |
-
#: views/emails/notify-vendor-shipped.php:23
|
| 1024 |
-
msgid "Quantity"
|
| 1025 |
-
msgstr "Menge"
|
| 1026 |
-
|
| 1027 |
-
#: classes/front/orders/class-orders.php:107
|
| 1028 |
-
msgid ""
|
| 1029 |
-
"You haven't selected a product's orders to view! Please go back to the "
|
| 1030 |
-
"Vendor Dashboard and click Show Orders on the product you'd like to view."
|
| 1031 |
-
msgstr ""
|
| 1032 |
-
"Sie haben keine Produktbestellungen ausgewählt! Bitte gehen Sie zurück zur "
|
| 1033 |
-
"Verkäferseite und klicken Sie auf Zeige Bestellungen bei dem Produkt, "
|
| 1034 |
-
"das Sie ansehen wollen."
|
| 1035 |
-
|
| 1036 |
-
#: classes/front/orders/class-orders.php:111
|
| 1037 |
-
msgid "No orders."
|
| 1038 |
-
msgstr "Keine Bestellungen."
|
| 1039 |
-
|
| 1040 |
-
#: classes/front/orders/class-orders.php:144
|
| 1041 |
-
#: classes/front/orders/class-orders.php:145
|
| 1042 |
-
msgid "Tracking number"
|
| 1043 |
-
msgstr "Sendungsnummer"
|
| 1044 |
-
|
| 1045 |
-
#: classes/front/orders/class-orders.php:147
|
| 1046 |
-
msgid "Success. Your tracking number has been updated."
|
| 1047 |
-
msgstr "Erfolgreich. Ihre Sendungsnummer wurde aktualisiert."
|
| 1048 |
-
|
| 1049 |
-
#: classes/front/orders/class-orders.php:209
|
| 1050 |
-
msgid "Product Title"
|
| 1051 |
-
msgstr "Produkttitel"
|
| 1052 |
-
|
| 1053 |
-
#: classes/front/orders/class-orders.php:210
|
| 1054 |
-
msgid "Full name"
|
| 1055 |
-
msgstr "Vollständiger Name"
|
| 1056 |
-
|
| 1057 |
-
#: classes/front/orders/class-orders.php:211
|
| 1058 |
-
msgid "Address"
|
| 1059 |
-
msgstr "Adresse"
|
| 1060 |
-
|
| 1061 |
-
#: classes/front/orders/class-orders.php:212
|
| 1062 |
-
msgid "City"
|
| 1063 |
-
msgstr "Stadt"
|
| 1064 |
-
|
| 1065 |
-
#: classes/front/orders/class-orders.php:213
|
| 1066 |
-
msgid "State"
|
| 1067 |
-
msgstr "Bundesland"
|
| 1068 |
-
|
| 1069 |
-
#: classes/front/orders/class-orders.php:214
|
| 1070 |
-
msgid "Zip"
|
| 1071 |
-
msgstr "PLZ"
|
| 1072 |
-
|
| 1073 |
-
#: classes/front/orders/class-orders.php:215
|
| 1074 |
-
msgid "Email address"
|
| 1075 |
-
msgstr "E-Mail-Adresse"
|
| 1076 |
-
|
| 1077 |
-
#: classes/front/orders/class-submit-comment.php:41
|
| 1078 |
-
msgid "You've left the comment field empty!"
|
| 1079 |
-
msgstr "Sie haben das Kommentar-Feld leer gelassen!"
|
| 1080 |
-
|
| 1081 |
-
#: classes/front/orders/class-submit-comment.php:63
|
| 1082 |
-
msgid "Success. The customer has been notified of your comment."
|
| 1083 |
-
msgstr "Erfolgreich. Der Kunde wurde über ihr Kommentar informiert."
|
| 1084 |
-
|
| 1085 |
-
#: classes/front/signup/class-vendor-signup.php:44
|
| 1086 |
-
#: views/dashboard/denied.php:22
|
| 1087 |
-
msgid "Apply to become a vendor? "
|
| 1088 |
-
msgstr "Als Verkäufer bewerben?"
|
| 1089 |
-
|
| 1090 |
-
#: classes/front/signup/class-vendor-signup.php:53
|
| 1091 |
-
#: views/dashboard/denied.php:33
|
| 1092 |
-
#, php-format
|
| 1093 |
-
msgid "I have read and accepted the <a href=\"%s\">terms and conditions</a>"
|
| 1094 |
-
msgstr ""
|
| 1095 |
-
"Ich habe die <a href=\"%s\">Geschäftsbedingungen</a> gelesen und "
|
| 1096 |
-
"akzeptiert"
|
| 1097 |
-
|
| 1098 |
-
#: classes/front/signup/class-vendor-signup.php:87
|
| 1099 |
-
msgid "Application denied. You are an administrator."
|
| 1100 |
-
msgstr "Bewerbung abgelehnt. Sie sind Administrator."
|
| 1101 |
-
|
| 1102 |
-
#: classes/front/signup/class-vendor-signup.php:89
|
| 1103 |
-
msgid "Your application has been submitted."
|
| 1104 |
-
msgstr "Ihre Bewerbung wurde eingereicht."
|
| 1105 |
-
|
| 1106 |
-
#: classes/front/signup/class-vendor-signup.php:125
|
| 1107 |
-
msgid "You must accept the terms and conditions to become a vendor."
|
| 1108 |
-
msgstr ""
|
| 1109 |
-
"Sie müssen die AGBs akzeptieren um Verkäufer werden zu können."
|
| 1110 |
-
|
| 1111 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1112 |
-
msgid "PayPal Adaptive Payments"
|
| 1113 |
-
msgstr "PayPal Adaptive Payments"
|
| 1114 |
-
|
| 1115 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 1116 |
-
#, php-format
|
| 1117 |
-
msgid ""
|
| 1118 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 1119 |
-
"%s."
|
| 1120 |
-
msgstr ""
|
| 1121 |
-
"Ein Fehler ist aufgetreten. Die Antwort von PayPl hat diese Bestellung als "
|
| 1122 |
-
"ungültig gekennzeichnet. Status: %s."
|
| 1123 |
-
|
| 1124 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 1125 |
-
msgid "IPN payment completed"
|
| 1126 |
-
msgstr "IPN Zahlung abgeschlossen"
|
| 1127 |
-
|
| 1128 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 1129 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 1130 |
-
msgstr "PayPal Adaptive Payments aktivieren"
|
| 1131 |
-
|
| 1132 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 1133 |
-
msgid "Method Title"
|
| 1134 |
-
msgstr "Methoden-Überschrift"
|
| 1135 |
-
|
| 1136 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 1137 |
-
msgid "This controls the title which the user sees during checkout."
|
| 1138 |
-
msgstr ""
|
| 1139 |
-
"Hier wird der Titel eingestellt, den der Benutzer während des "
|
| 1140 |
-
"Abschlusses an der Kasse sieht."
|
| 1141 |
-
|
| 1142 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 1143 |
-
msgid "PayPal"
|
| 1144 |
-
msgstr "PayPal"
|
| 1145 |
-
|
| 1146 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:159
|
| 1147 |
-
msgid "Description"
|
| 1148 |
-
msgstr "Beschreibung"
|
| 1149 |
-
|
| 1150 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 1151 |
-
msgid "This controls the description which the user sees during checkout."
|
| 1152 |
-
msgstr ""
|
| 1153 |
-
"Hier wird der Text eingestellt, den der Benutzer während des "
|
| 1154 |
-
"Abschlusses an der Kasse sieht."
|
| 1155 |
-
|
| 1156 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 1157 |
-
msgid "Pay via PayPal!"
|
| 1158 |
-
msgstr "Zahlen via PayPal!"
|
| 1159 |
-
|
| 1160 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 1161 |
-
msgid "Live Credentials"
|
| 1162 |
-
msgstr "Live Berechtigungen"
|
| 1163 |
-
|
| 1164 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 1165 |
-
#, php-format
|
| 1166 |
-
msgid ""
|
| 1167 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 1168 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 1169 |
-
msgstr ""
|
| 1170 |
-
"Sie benötigen eine <a href=\"%s\">Application ID</a> um Live-"
|
| 1171 |
-
"Transaktionen auszuführen. Nicht erforderlich zum Testen im Sandbox-"
|
| 1172 |
-
"Modus."
|
| 1173 |
-
|
| 1174 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:179
|
| 1175 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 1176 |
-
msgid "PayPal Email"
|
| 1177 |
-
msgstr "PayPal E-Mail"
|
| 1178 |
-
|
| 1179 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:180
|
| 1180 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 1181 |
-
msgid "The email address main payments should go to."
|
| 1182 |
-
msgstr "Die E-Mail-Adresse, an die die Hauptzahlungen gehen sollten."
|
| 1183 |
-
|
| 1184 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:185
|
| 1185 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 1186 |
-
msgid "API Username"
|
| 1187 |
-
msgstr "API Benutzername"
|
| 1188 |
-
|
| 1189 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:190
|
| 1190 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 1191 |
-
msgid "API Password"
|
| 1192 |
-
msgstr "API Passwort"
|
| 1193 |
-
|
| 1194 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:195
|
| 1195 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 1196 |
-
msgid "API Signature"
|
| 1197 |
-
msgstr "API Signatur"
|
| 1198 |
-
|
| 1199 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 1200 |
-
msgid "Application ID"
|
| 1201 |
-
msgstr "Application ID"
|
| 1202 |
-
|
| 1203 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 1204 |
-
msgid "Only required when doing live transactions."
|
| 1205 |
-
msgstr "Nur erforderlich, wenn Live-Zahlungen genutzt werden."
|
| 1206 |
-
|
| 1207 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 1208 |
-
msgid "Sandbox Credentials"
|
| 1209 |
-
msgstr "Sandbox Berechtigung"
|
| 1210 |
-
|
| 1211 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 1212 |
-
#, php-format
|
| 1213 |
-
msgid ""
|
| 1214 |
-
"You can signup for a sandbox developer account <a href=\"%s\">here</a>. You "
|
| 1215 |
-
"need a developer account if you want to enable Sandbox mode for testing."
|
| 1216 |
-
msgstr ""
|
| 1217 |
-
"Sie können sich für einen Sandbox Developer Account <a href=\"%s"
|
| 1218 |
-
"\">hier</a> anmelden. Sie benötigen einen Entwickler Account, wenn Sie "
|
| 1219 |
-
"den Sandbox-Modus zum Testen aktivieren wollen."
|
| 1220 |
-
|
| 1221 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 1222 |
-
msgid "Misc. Settings"
|
| 1223 |
-
msgstr "Einstellungen"
|
| 1224 |
-
|
| 1225 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 1226 |
-
msgid "Enable PayPal Sandbox mode"
|
| 1227 |
-
msgstr "PayPal Sandbox-Modus aktivieren"
|
| 1228 |
-
|
| 1229 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 1230 |
-
msgid "Enable logging"
|
| 1231 |
-
msgstr "Logging aktivieren"
|
| 1232 |
-
|
| 1233 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 1234 |
-
msgid ""
|
| 1235 |
-
"The PayPal Adaptive Payments gateway can instantly pay your vendors their "
|
| 1236 |
-
"due commission (if enabled). Also used to mass pay vendors on a schedule / "
|
| 1237 |
-
"manual method (if enabled)."
|
| 1238 |
-
msgstr ""
|
| 1239 |
-
"Der PayPal Adaptive Payments Gateway kann Ihren Verkäufern sofort nach "
|
| 1240 |
-
"einem Verkauf die angefallene Provision automatisch auszahlen(sofern "
|
| 1241 |
-
"aktiviert). Es wird auch benutzt, um Massenzahlungen an die Verkäufer - "
|
| 1242 |
-
"manuell oder nach Zeitplan - auszuführen."
|
| 1243 |
-
|
| 1244 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1245 |
-
msgid "Gateway Disabled"
|
| 1246 |
-
msgstr "Gateway deaktiviert"
|
| 1247 |
-
|
| 1248 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1249 |
-
#, php-format
|
| 1250 |
-
msgid "%s does not support your store currency."
|
| 1251 |
-
msgstr "%s unterstützt nicht die im Shop eingestellte Währung."
|
| 1252 |
-
|
| 1253 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:369
|
| 1254 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:483
|
| 1255 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:150
|
| 1256 |
-
#, php-format
|
| 1257 |
-
msgid "Error: %s"
|
| 1258 |
-
msgstr "Fehler: %s"
|
| 1259 |
-
|
| 1260 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:378
|
| 1261 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:379
|
| 1262 |
-
#, php-format
|
| 1263 |
-
msgid "Error ID: %s. %s"
|
| 1264 |
-
msgstr "Fehler-ID: %s. %s"
|
| 1265 |
-
|
| 1266 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 1267 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 1268 |
-
msgstr ""
|
| 1269 |
-
"Keine Verkäufer gefunden, an die gezahlt werden kann. Vielleicht haben "
|
| 1270 |
-
"diese keine PayPal-Adresse hinterlegt?"
|
| 1271 |
-
|
| 1272 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:164
|
| 1273 |
-
msgid "All due commission has been paid for."
|
| 1274 |
-
msgstr "Alle ausstehenden Provisionszahlungen wurden ausgezahlt."
|
| 1275 |
-
|
| 1276 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:170
|
| 1277 |
-
msgid ""
|
| 1278 |
-
"All due commission has been paid for, but I could not clear it from their "
|
| 1279 |
-
"profiles due to an internal error. Commission will still be listed as due. "
|
| 1280 |
-
"Please manually mark the commission as paid from the Commissions page."
|
| 1281 |
-
msgstr ""
|
| 1282 |
-
"Alle offenen Provisionen wurden ausgezahlt. Auf Grund eines internen Fehlers "
|
| 1283 |
-
"konnten die Provisionen aber nicht auf den Status bezahlt gesetzt werden. "
|
| 1284 |
-
"Die Provisionen werden weiterhin als offen gelistet. Bitte manuell auf "
|
| 1285 |
-
"bezahlt setzen."
|
| 1286 |
-
|
| 1287 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:205
|
| 1288 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 1289 |
-
msgstr "WooCommerce: Massenzahlung für Verkäfer Update"
|
| 1290 |
-
|
| 1291 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:207
|
| 1292 |
-
msgid ""
|
| 1293 |
-
"Hello! A payment was just triggered to mass pay all vendors their due "
|
| 1294 |
-
"commission."
|
| 1295 |
-
msgstr ""
|
| 1296 |
-
"Hallo! Eine Massenzahlung wurde so eben ausgelöst um allen Verkä"
|
| 1297 |
-
"ufern ihre ausstehenden Provisionen zu zahlen."
|
| 1298 |
-
|
| 1299 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 1300 |
-
#, php-format
|
| 1301 |
-
msgid "Payment status: %s."
|
| 1302 |
-
msgstr "Auszahlungsstatus: %s"
|
| 1303 |
-
|
| 1304 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:209
|
| 1305 |
-
#, php-format
|
| 1306 |
-
msgid "Payment message: %s."
|
| 1307 |
-
msgstr "Nachricht zur Zahlung: %s"
|
| 1308 |
-
|
| 1309 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 1310 |
-
#, php-format
|
| 1311 |
-
msgid "Payment total: %s."
|
| 1312 |
-
msgstr "Zahlung gesamt: %s"
|
| 1313 |
-
|
| 1314 |
-
#: views/dashboard/denied.php:8
|
| 1315 |
-
msgid ""
|
| 1316 |
-
"Your account has not yet been approved to become a vendor. When it is, you "
|
| 1317 |
-
"will receive an email telling you that your account is approved!"
|
| 1318 |
-
msgstr ""
|
| 1319 |
-
"Ihr Benutzerprofil ist noch nicht als Verkäufer-Account freigeschaltet. "
|
| 1320 |
-
"Sie erhalten eine E-Mail sobald dies geschehen ist."
|
| 1321 |
-
|
| 1322 |
-
#: views/dashboard/denied.php:12
|
| 1323 |
-
msgid ""
|
| 1324 |
-
"Your account is not setup as a vendor yet. If you would like to register, "
|
| 1325 |
-
"please complete this page!"
|
| 1326 |
-
msgstr ""
|
| 1327 |
-
"Ihr Benutzerprofil ist noch nicht als Verkäufer freigeschaltet. Sollten "
|
| 1328 |
-
"Sie sich bewerben wollen, füllen Sie bitte diese Seite aus!"
|
| 1329 |
-
|
| 1330 |
-
#: views/dashboard/denied.php:53
|
| 1331 |
-
msgid "Submit"
|
| 1332 |
-
msgstr "Absenden"
|
| 1333 |
-
|
| 1334 |
-
#: views/dashboard/links.php:1
|
| 1335 |
-
msgid "Control Center"
|
| 1336 |
-
msgstr "Kontrollzentrum"
|
| 1337 |
-
|
| 1338 |
-
#: views/dashboard/links.php:3
|
| 1339 |
-
msgid "My shop"
|
| 1340 |
-
msgstr "Mein Shop"
|
| 1341 |
-
|
| 1342 |
-
#: views/dashboard/links.php:7
|
| 1343 |
-
msgid "My settings"
|
| 1344 |
-
msgstr "Meine Einstellungen"
|
| 1345 |
-
|
| 1346 |
-
#: views/dashboard/links.php:13
|
| 1347 |
-
msgid "Submit a product"
|
| 1348 |
-
msgstr "Produkt hinzufügen"
|
| 1349 |
-
|
| 1350 |
-
#: views/dashboard/orders.php:7 views/dashboard/orders.php:10
|
| 1351 |
-
msgid "Hide items"
|
| 1352 |
-
msgstr "Produkte verstecken"
|
| 1353 |
-
|
| 1354 |
-
#: views/dashboard/orders.php:8 views/dashboard/orders.php:58
|
| 1355 |
-
msgid "View items"
|
| 1356 |
-
msgstr "Produkte anzeigen"
|
| 1357 |
-
|
| 1358 |
-
#: views/dashboard/orders.php:27
|
| 1359 |
-
msgid "Links"
|
| 1360 |
-
msgstr "Links"
|
| 1361 |
-
|
| 1362 |
-
#: views/dashboard/orders.php:58
|
| 1363 |
-
msgid "Unmark shipped"
|
| 1364 |
-
msgstr "Markierung als versandt aufheben"
|
| 1365 |
-
|
| 1366 |
-
#: views/dashboard/orders.php:58
|
| 1367 |
-
msgid "Mark shipped"
|
| 1368 |
-
msgstr "Als versandt markieren"
|
| 1369 |
-
|
| 1370 |
-
#: views/dashboard/orders.php:90
|
| 1371 |
-
msgid "You have no orders during this period."
|
| 1372 |
-
msgstr "Sie haben keine Bestellungen in diesem Zeitraum."
|
| 1373 |
-
|
| 1374 |
-
#: views/dashboard/reports.php:1
|
| 1375 |
-
msgid "Sales Report"
|
| 1376 |
-
msgstr "Verkauf-Bericht"
|
| 1377 |
-
|
| 1378 |
-
#: views/dashboard/reports.php:20
|
| 1379 |
-
msgid "Rate"
|
| 1380 |
-
msgstr "Quote"
|
| 1381 |
-
|
| 1382 |
-
#: views/dashboard/reports.php:47
|
| 1383 |
-
msgid "Show Orders"
|
| 1384 |
-
msgstr "Zeige Bestellungen"
|
| 1385 |
-
|
| 1386 |
-
#: views/dashboard/reports.php:56
|
| 1387 |
-
msgid "Totals"
|
| 1388 |
-
msgstr "Gesamt"
|
| 1389 |
-
|
| 1390 |
-
#: views/dashboard/reports.php:71
|
| 1391 |
-
msgid "You have no sales during this period."
|
| 1392 |
-
msgstr "Sie haben keine Verkäufe innerhalb dieses Zeitraums."
|
| 1393 |
-
|
| 1394 |
-
#: views/dashboard/reports.php:82
|
| 1395 |
-
msgid "You haven't made any sales yet."
|
| 1396 |
-
msgstr "Sie haben noch nichts verkauft."
|
| 1397 |
-
|
| 1398 |
-
#: views/dashboard/settings/paypal-email-form.php:2
|
| 1399 |
-
msgid "PayPal Address"
|
| 1400 |
-
msgstr "PayPal-Adresse"
|
| 1401 |
-
|
| 1402 |
-
#: views/dashboard/settings/paypal-email-form.php:3
|
| 1403 |
-
msgid "Your PayPal address is used to send you your commission."
|
| 1404 |
-
msgstr ""
|
| 1405 |
-
"Ihre PayPal-Adresse wird verwendet, um angefallene Provisionen auszuzahlen."
|
| 1406 |
-
|
| 1407 |
-
#: views/dashboard/settings/seller-info.php:4
|
| 1408 |
-
msgid "This is displayed on each of your products."
|
| 1409 |
-
msgstr "Dies wird bei jedem Ihrer Produkte angezeigt."
|
| 1410 |
-
|
| 1411 |
-
#: views/dashboard/settings/settings.php:47
|
| 1412 |
-
msgid "Save"
|
| 1413 |
-
msgstr "Speichern"
|
| 1414 |
-
|
| 1415 |
-
#: views/dashboard/settings/shop-description.php:2
|
| 1416 |
-
msgid "Shop Description"
|
| 1417 |
-
msgstr "Shop-Beschreibung"
|
| 1418 |
-
|
| 1419 |
-
#: views/dashboard/settings/shop-description.php:3
|
| 1420 |
-
#, php-format
|
| 1421 |
-
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 1422 |
-
msgstr "Dies wird auf Ihrer <a href=\"%s\">Shop-Seite</a> angezeigt."
|
| 1423 |
-
|
| 1424 |
-
#: views/dashboard/settings/shop-name.php:2
|
| 1425 |
-
msgid "Shop Name"
|
| 1426 |
-
msgstr "Shop-Name"
|
| 1427 |
-
|
| 1428 |
-
#: views/dashboard/settings/shop-name.php:3
|
| 1429 |
-
msgid "Your shop name is public and must be unique."
|
| 1430 |
-
msgstr "Ihr Shop-Name ist öffentlich und muss einzigartig sein."
|
| 1431 |
-
|
| 1432 |
-
#: views/emails/admin-new-order.php:13
|
| 1433 |
-
#, php-format
|
| 1434 |
-
msgid "You have received an order from %s. Their order is as follows:"
|
| 1435 |
-
msgstr "Sie haben eine Bestellung von %s erhalten. Diese Bestellung lautet:"
|
| 1436 |
-
|
| 1437 |
-
#: views/emails/admin-new-order.php:17
|
| 1438 |
-
#: views/emails/notify-vendor-shipped.php:17
|
| 1439 |
-
#, php-format
|
| 1440 |
-
msgid "Order: %s"
|
| 1441 |
-
msgstr "Bestellung: %s"
|
| 1442 |
-
|
| 1443 |
-
#: views/emails/admin-new-order.php:24
|
| 1444 |
-
#: views/emails/notify-vendor-shipped.php:24
|
| 1445 |
-
msgid "Price"
|
| 1446 |
-
msgstr "Preis"
|
| 1447 |
-
|
| 1448 |
-
#: views/emails/admin-new-order.php:50
|
| 1449 |
-
#: views/emails/notify-vendor-shipped.php:50
|
| 1450 |
-
msgid "Customer details"
|
| 1451 |
-
msgstr "Kundendetails"
|
| 1452 |
-
|
| 1453 |
-
#: views/emails/admin-new-order.php:53
|
| 1454 |
-
#: views/emails/notify-vendor-shipped.php:53
|
| 1455 |
-
msgid "Email:"
|
| 1456 |
-
msgstr "E-Mail:"
|
| 1457 |
-
|
| 1458 |
-
#: views/emails/admin-new-order.php:56
|
| 1459 |
-
#: views/emails/notify-vendor-shipped.php:56
|
| 1460 |
-
msgid "Tel:"
|
| 1461 |
-
msgstr "Tel:"
|
| 1462 |
-
|
| 1463 |
-
#: views/emails/application-status.php:5
|
| 1464 |
-
#, php-format
|
| 1465 |
-
msgid "Hi there. This is a notification about a vendor application on %s."
|
| 1466 |
-
msgstr ""
|
| 1467 |
-
"Hallo. Dies ist eine Benachrichtigung für eine Verkäufer-Bewerbung auf "
|
| 1468 |
-
"%s."
|
| 1469 |
-
|
| 1470 |
-
#: views/emails/application-status.php:8
|
| 1471 |
-
#, php-format
|
| 1472 |
-
msgid "Application status: %s"
|
| 1473 |
-
msgstr "Bewerbungs-Status: %s"
|
| 1474 |
-
|
| 1475 |
-
#: views/emails/application-status.php:9
|
| 1476 |
-
#, php-format
|
| 1477 |
-
msgid "Applicant username: %s"
|
| 1478 |
-
msgstr "Bewerbungs-Benutzername: %s"
|
| 1479 |
-
|
| 1480 |
-
#: views/emails/new-product.php:5
|
| 1481 |
-
#, php-format
|
| 1482 |
-
msgid "Hi there. This is a notification about a new product on %s."
|
| 1483 |
-
msgstr "Hallo. Dies ist eine Benachrichtigung für ein neues Produkt auf %s."
|
| 1484 |
-
|
| 1485 |
-
#: views/emails/new-product.php:8
|
| 1486 |
-
#, php-format
|
| 1487 |
-
msgid "Product title: %s"
|
| 1488 |
-
msgstr "Produkttitel: %s"
|
| 1489 |
-
|
| 1490 |
-
#: views/emails/new-product.php:9
|
| 1491 |
-
#, php-format
|
| 1492 |
-
msgid "Submitted by: %s"
|
| 1493 |
-
msgstr "Eingereicht von: %s"
|
| 1494 |
-
|
| 1495 |
-
#: views/emails/new-product.php:10
|
| 1496 |
-
#, php-format
|
| 1497 |
-
msgid "Edit product: %s"
|
| 1498 |
-
msgstr "Produkte bearbeiten: %s"
|
| 1499 |
-
|
| 1500 |
-
#: views/emails/notify-vendor-shipped.php:13
|
| 1501 |
-
msgid ""
|
| 1502 |
-
"A vendor has marked part of your order as shipped. The items that are "
|
| 1503 |
-
"shipped are as follows:"
|
| 1504 |
-
msgstr ""
|
| 1505 |
-
"Ein Verkäufer hat Teil Ihrer Bestellung als versandt markiert. Die "
|
| 1506 |
-
"versandten Produkte sind wie folgt:"
|
| 1507 |
-
|
| 1508 |
-
#: views/orders/comments/add-new-comment.php:11
|
| 1509 |
-
msgid "Add comment"
|
| 1510 |
-
msgstr "Kommentar hinzufügen"
|
| 1511 |
-
|
| 1512 |
-
#: views/orders/comments/existing-comments.php:9
|
| 1513 |
-
#, php-format
|
| 1514 |
-
msgid "added %s ago"
|
| 1515 |
-
msgstr "hinzugefügt vor %s"
|
| 1516 |
-
|
| 1517 |
-
#: views/orders/csv-export.php:6
|
| 1518 |
-
msgid "Export orders"
|
| 1519 |
-
msgstr "Bestellungen exportieren"
|
| 1520 |
-
|
| 1521 |
-
#: views/orders/customer-note/customer-note.php:4
|
| 1522 |
-
msgid "Customer note"
|
| 1523 |
-
msgstr "Kunden-Benachrichtigung"
|
| 1524 |
-
|
| 1525 |
-
#: views/orders/customer-note/customer-note.php:8
|
| 1526 |
-
msgid "No customer note."
|
| 1527 |
-
msgstr "Keine Kunden-Benachrichtung"
|
| 1528 |
-
|
| 1529 |
-
#: views/orders/orders.php:84
|
| 1530 |
-
#, php-format
|
| 1531 |
-
msgid "Comments (%s)"
|
| 1532 |
-
msgstr "Kommentare (%s)"
|
| 1533 |
-
|
| 1534 |
-
#: views/orders/shipping/shipping-form.php:46
|
| 1535 |
-
msgid "Provider:"
|
| 1536 |
-
msgstr "Versandunternehmen:"
|
| 1537 |
-
|
| 1538 |
-
#: views/orders/shipping/shipping-form.php:48
|
| 1539 |
-
msgid "Custom Provider"
|
| 1540 |
-
msgstr "Benutzerdefiniertes Versandunternehmen"
|
| 1541 |
-
|
| 1542 |
-
#: views/orders/shipping/shipping-form.php:68
|
| 1543 |
-
msgid "Provider Name:"
|
| 1544 |
-
msgstr "Name des Versandunternehmens:"
|
| 1545 |
-
|
| 1546 |
-
#: views/orders/shipping/shipping-form.php:76
|
| 1547 |
-
msgid "Tracking number:"
|
| 1548 |
-
msgstr "Sendungsnummer:"
|
| 1549 |
-
|
| 1550 |
-
#: views/orders/shipping/shipping-form.php:84
|
| 1551 |
-
msgid "Tracking link:"
|
| 1552 |
-
msgstr "Link zur Sendungsverfolgung:"
|
| 1553 |
-
|
| 1554 |
-
#: views/orders/shipping/shipping-form.php:93
|
| 1555 |
-
msgid "Date shipped:"
|
| 1556 |
-
msgstr "Versanddatum:"
|
| 1557 |
-
|
| 1558 |
-
#: views/orders/shipping/shipping-form.php:101
|
| 1559 |
-
msgid "Preview:"
|
| 1560 |
-
msgstr "Vorschau:"
|
| 1561 |
-
|
| 1562 |
-
#: views/orders/shipping/shipping-form.php:101
|
| 1563 |
-
msgid "Click here to track your shipment"
|
| 1564 |
-
msgstr "Hier klicken, um Ihre Sendung zu verfolgen"
|
| 1565 |
-
|
| 1566 |
-
#: views/orders/shipping/shipping-form.php:110
|
| 1567 |
-
msgid "Update tracking number"
|
| 1568 |
-
msgstr "Sendungsnummer aktualisieren"
|
| 1569 |
-
|
| 1570 |
-
#: views/orders/shipping/shipping-form.php:112
|
| 1571 |
-
msgid "Mark as shipped"
|
| 1572 |
-
msgstr "Als versandt markieren"
|
| 1573 |
-
|
| 1574 |
-
#: views/orders/table-body.php:25
|
| 1575 |
-
#, php-format
|
| 1576 |
-
msgid "Quantity: %d"
|
| 1577 |
-
msgstr "Menge: %d"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/wcvendors-de_DE.mo
DELETED
|
Binary file
|
languages/wcvendors-de_DE.po
DELETED
|
@@ -1,1577 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: WC Vendors\n"
|
| 4 |
-
"POT-Creation-Date: 2015-01-08 14:31+1000\n"
|
| 5 |
-
"PO-Revision-Date: 2015-01-27 15:01+0100\n"
|
| 6 |
-
"Last-Translator: \n"
|
| 7 |
-
"Language-Team: WC Vendors <support@wcvendors.com>\n"
|
| 8 |
-
"MIME-Version: 1.0\n"
|
| 9 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 10 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 11 |
-
"X-Generator: Poedit 1.7.3\n"
|
| 12 |
-
"X-Poedit-Basepath: .\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-KeywordsList: __;_e\n"
|
| 16 |
-
"Language: de_DE\n"
|
| 17 |
-
"X-Poedit-SearchPath-0: .\n"
|
| 18 |
-
"X-Poedit-SearchPath-1: ..\n"
|
| 19 |
-
|
| 20 |
-
#: classes/admin/class-admin-page.php:28
|
| 21 |
-
msgid "Vendors shipped"
|
| 22 |
-
msgstr "vom Verkäufer versandt"
|
| 23 |
-
|
| 24 |
-
#: classes/admin/class-admin-page.php:51
|
| 25 |
-
msgid "Vendors Shipped"
|
| 26 |
-
msgstr "vom Verkäufer versandt"
|
| 27 |
-
|
| 28 |
-
#: classes/admin/class-admin-page.php:73
|
| 29 |
-
#: classes/admin/class-admin-page.php:133
|
| 30 |
-
#: classes/admin/class-admin-reports.php:345
|
| 31 |
-
#: classes/admin/class-product-meta.php:148
|
| 32 |
-
#: classes/admin/class-product-meta.php:164
|
| 33 |
-
#: views/dashboard/reports.php:19
|
| 34 |
-
msgid "Commission"
|
| 35 |
-
msgstr "Provision"
|
| 36 |
-
|
| 37 |
-
#: classes/admin/class-admin-page.php:252
|
| 38 |
-
#: classes/admin/class-admin-reports.php:175
|
| 39 |
-
#: views/dashboard/reports.php:17 views/emails/admin-new-order.php:22
|
| 40 |
-
#: views/emails/notify-vendor-shipped.php:22
|
| 41 |
-
msgid "Product"
|
| 42 |
-
msgstr "Produkt"
|
| 43 |
-
|
| 44 |
-
#: classes/admin/class-admin-page.php:253
|
| 45 |
-
msgid "Order ID"
|
| 46 |
-
msgstr "Bestell-Nr."
|
| 47 |
-
|
| 48 |
-
#: classes/admin/class-admin-page.php:254
|
| 49 |
-
#: classes/admin/class-admin-reports.php:176
|
| 50 |
-
#: classes/admin/class-product-meta.php:44
|
| 51 |
-
#: classes/admin/class-product-meta.php:184
|
| 52 |
-
#: classes/admin/class-product-meta.php:220
|
| 53 |
-
msgid "Vendor"
|
| 54 |
-
msgstr "Verkäufer"
|
| 55 |
-
|
| 56 |
-
#: classes/admin/class-admin-page.php:255
|
| 57 |
-
#: classes/admin/class-admin-reports.php:177
|
| 58 |
-
#: classes/admin/class-admin-reports.php:350
|
| 59 |
-
#: classes/admin/class-admin-reports.php:374
|
| 60 |
-
#: views/dashboard/orders.php:25
|
| 61 |
-
msgid "Total"
|
| 62 |
-
msgstr "Summe"
|
| 63 |
-
|
| 64 |
-
#: classes/admin/class-admin-page.php:256
|
| 65 |
-
#: classes/admin/class-admin-reports.php:179
|
| 66 |
-
msgid "Status"
|
| 67 |
-
msgstr "Status"
|
| 68 |
-
|
| 69 |
-
#: classes/admin/class-admin-page.php:257
|
| 70 |
-
#: classes/front/orders/class-orders.php:216
|
| 71 |
-
#: views/dashboard/orders.php:26
|
| 72 |
-
msgid "Date"
|
| 73 |
-
msgstr "Datum"
|
| 74 |
-
|
| 75 |
-
#: classes/admin/class-admin-page.php:294
|
| 76 |
-
msgid "Mark paid"
|
| 77 |
-
msgstr "Als bezahlt markieren"
|
| 78 |
-
|
| 79 |
-
#: classes/admin/class-admin-page.php:295
|
| 80 |
-
msgid "Mark due"
|
| 81 |
-
msgstr "Als noch offen kennzeichnen"
|
| 82 |
-
|
| 83 |
-
#: classes/admin/class-admin-page.php:296
|
| 84 |
-
msgid "Mark reversed"
|
| 85 |
-
msgstr "Als storniert kennzeichnen"
|
| 86 |
-
|
| 87 |
-
#: classes/admin/class-admin-page.php:313
|
| 88 |
-
msgid "Filter"
|
| 89 |
-
msgstr "Filter"
|
| 90 |
-
|
| 91 |
-
#: classes/admin/class-admin-page.php:347
|
| 92 |
-
msgid "Show all dates"
|
| 93 |
-
msgstr "Zeige alle Daten"
|
| 94 |
-
|
| 95 |
-
#: classes/admin/class-admin-page.php:360
|
| 96 |
-
#, php-format
|
| 97 |
-
msgid "%1$s %2$d"
|
| 98 |
-
msgstr "%1$s %2$d"
|
| 99 |
-
|
| 100 |
-
#: classes/admin/class-admin-page.php:386
|
| 101 |
-
msgid "Commission marked paid."
|
| 102 |
-
msgstr "Provision als ausgezahlt kennzeichnen"
|
| 103 |
-
|
| 104 |
-
#: classes/admin/class-admin-page.php:393
|
| 105 |
-
msgid "Commission marked due."
|
| 106 |
-
msgstr "Als Provision noch offen kennzeichnen"
|
| 107 |
-
|
| 108 |
-
#: classes/admin/class-admin-page.php:400
|
| 109 |
-
msgid "Commission marked reversed."
|
| 110 |
-
msgstr "Provision als storniert kennzeichnen"
|
| 111 |
-
|
| 112 |
-
#: classes/admin/class-admin-reports.php:41
|
| 113 |
-
#: classes/admin/class-admin-users.php:349
|
| 114 |
-
msgid "WC Vendors"
|
| 115 |
-
msgstr "WC Vendors"
|
| 116 |
-
|
| 117 |
-
#: classes/admin/class-admin-reports.php:44
|
| 118 |
-
msgid "Overview"
|
| 119 |
-
msgstr "Übersicht"
|
| 120 |
-
|
| 121 |
-
#: classes/admin/class-admin-reports.php:50
|
| 122 |
-
msgid "Commission by vendor"
|
| 123 |
-
msgstr "Provision nach Verkäufer"
|
| 124 |
-
|
| 125 |
-
#: classes/admin/class-admin-reports.php:56
|
| 126 |
-
msgid "Commission by product"
|
| 127 |
-
msgstr "Provision nach Produkt"
|
| 128 |
-
|
| 129 |
-
#: classes/admin/class-admin-reports.php:115
|
| 130 |
-
#: views/dashboard/date-picker.php:3
|
| 131 |
-
msgid "From:"
|
| 132 |
-
msgstr "Von:"
|
| 133 |
-
|
| 134 |
-
#: classes/admin/class-admin-reports.php:119
|
| 135 |
-
#: views/dashboard/date-picker.php:7
|
| 136 |
-
msgid "To:"
|
| 137 |
-
msgstr "An:"
|
| 138 |
-
|
| 139 |
-
#: classes/admin/class-admin-reports.php:122
|
| 140 |
-
#: classes/admin/class-admin-reports.php:283
|
| 141 |
-
#: views/dashboard/date-picker.php:12
|
| 142 |
-
msgid "Show"
|
| 143 |
-
msgstr "Zeige"
|
| 144 |
-
|
| 145 |
-
#: classes/admin/class-admin-reports.php:133
|
| 146 |
-
msgid "Total paid in range"
|
| 147 |
-
msgstr "Gesamt ausgezahlt im Zeitraum"
|
| 148 |
-
|
| 149 |
-
#: classes/admin/class-admin-reports.php:136
|
| 150 |
-
#: classes/admin/class-admin-reports.php:143
|
| 151 |
-
#: classes/admin/class-admin-reports.php:150
|
| 152 |
-
msgid "n/a"
|
| 153 |
-
msgstr "n/a"
|
| 154 |
-
|
| 155 |
-
#: classes/admin/class-admin-reports.php:140
|
| 156 |
-
msgid "Total due in range"
|
| 157 |
-
msgstr "Gesamt offen im Zeitraum"
|
| 158 |
-
|
| 159 |
-
#: classes/admin/class-admin-reports.php:147
|
| 160 |
-
msgid "Total reversed in range"
|
| 161 |
-
msgstr "Gesamt storniert im Zeitraum"
|
| 162 |
-
|
| 163 |
-
#: classes/admin/class-admin-reports.php:157
|
| 164 |
-
msgid "Recent Commission"
|
| 165 |
-
msgstr "Neueste Provision"
|
| 166 |
-
|
| 167 |
-
#: classes/admin/class-admin-reports.php:174
|
| 168 |
-
#: classes/front/orders/class-orders.php:208
|
| 169 |
-
#: views/dashboard/orders.php:23
|
| 170 |
-
msgid "Order"
|
| 171 |
-
msgstr "Bestellung"
|
| 172 |
-
|
| 173 |
-
#: classes/admin/class-admin-reports.php:178
|
| 174 |
-
msgid "Date & Time"
|
| 175 |
-
msgstr "Datum & Uhrzeit"
|
| 176 |
-
|
| 177 |
-
#: classes/admin/class-admin-reports.php:187
|
| 178 |
-
msgid "N/A"
|
| 179 |
-
msgstr "N/A"
|
| 180 |
-
|
| 181 |
-
#: classes/admin/class-admin-reports.php:192
|
| 182 |
-
msgid "D j M Y \\a\\t h:ia"
|
| 183 |
-
msgstr "D, j.m.Y \\u\\m H:i \\U\\h\\r"
|
| 184 |
-
|
| 185 |
-
#: classes/admin/class-admin-reports.php:201
|
| 186 |
-
msgid "No commission yet"
|
| 187 |
-
msgstr "Keine Provision fällig"
|
| 188 |
-
|
| 189 |
-
#: classes/admin/class-admin-reports.php:232
|
| 190 |
-
msgid "Show:"
|
| 191 |
-
msgstr "Zeige:"
|
| 192 |
-
|
| 193 |
-
#: classes/admin/class-admin-reports.php:243
|
| 194 |
-
msgid "Year"
|
| 195 |
-
msgstr "Jahr"
|
| 196 |
-
|
| 197 |
-
#: classes/admin/class-admin-reports.php:276
|
| 198 |
-
msgid "Select a vendor…"
|
| 199 |
-
msgstr "Einen Verkäufer wählen"
|
| 200 |
-
|
| 201 |
-
#: classes/admin/class-admin-reports.php:344
|
| 202 |
-
msgid "Month"
|
| 203 |
-
msgstr "Monat"
|
| 204 |
-
|
| 205 |
-
#: classes/admin/class-admin-reports.php:346
|
| 206 |
-
msgid "Tax"
|
| 207 |
-
msgstr "Steuer"
|
| 208 |
-
|
| 209 |
-
#: classes/admin/class-admin-reports.php:347
|
| 210 |
-
#: views/dashboard/orders.php:24 views/orders/orders.php:113
|
| 211 |
-
msgid "Shipping"
|
| 212 |
-
msgstr "Versand"
|
| 213 |
-
|
| 214 |
-
#: classes/admin/class-admin-reports.php:348
|
| 215 |
-
msgid "Reversed"
|
| 216 |
-
msgstr "Storniert"
|
| 217 |
-
|
| 218 |
-
#: classes/admin/class-admin-reports.php:349
|
| 219 |
-
msgid "Paid"
|
| 220 |
-
msgstr "Bezahlt"
|
| 221 |
-
|
| 222 |
-
#: classes/admin/class-admin-users.php:359
|
| 223 |
-
msgid "Enable HTML for the shop description"
|
| 224 |
-
msgstr "HTML für die Shop-Beschreibung erlauben"
|
| 225 |
-
|
| 226 |
-
#: classes/admin/class-admin-users.php:365
|
| 227 |
-
msgid "Shop name"
|
| 228 |
-
msgstr "Shop-Name"
|
| 229 |
-
|
| 230 |
-
#: classes/admin/class-admin-users.php:372
|
| 231 |
-
msgid "PayPal E-mail"
|
| 232 |
-
msgstr "PayPal E-Mail"
|
| 233 |
-
|
| 234 |
-
#: classes/admin/class-admin-users.php:373
|
| 235 |
-
msgid "required"
|
| 236 |
-
msgstr "notwendig"
|
| 237 |
-
|
| 238 |
-
#: classes/admin/class-admin-users.php:380
|
| 239 |
-
msgid "Commission rate"
|
| 240 |
-
msgstr "Provisionsrate"
|
| 241 |
-
|
| 242 |
-
#: classes/admin/class-admin-users.php:381
|
| 243 |
-
#: classes/admin/class-product-meta.php:171
|
| 244 |
-
msgid "Leave blank for default"
|
| 245 |
-
msgstr "Leer lassen für Voreinstellung"
|
| 246 |
-
|
| 247 |
-
#: classes/admin/class-admin-users.php:387
|
| 248 |
-
#: classes/front/class-vendor-shop.php:103
|
| 249 |
-
#: views/dashboard/settings/seller-info.php:3
|
| 250 |
-
msgid "Seller info"
|
| 251 |
-
msgstr "Verkäufer-Info"
|
| 252 |
-
|
| 253 |
-
#: classes/admin/class-admin-users.php:392
|
| 254 |
-
msgid "Shop description"
|
| 255 |
-
msgstr "Shopbeschreibung"
|
| 256 |
-
|
| 257 |
-
#: classes/admin/class-vendor-applicants.php:26
|
| 258 |
-
msgid "Approve"
|
| 259 |
-
msgstr "Freischalten"
|
| 260 |
-
|
| 261 |
-
#: classes/admin/class-vendor-applicants.php:27
|
| 262 |
-
msgid "Deny"
|
| 263 |
-
msgstr "Ablehnen"
|
| 264 |
-
|
| 265 |
-
#: classes/admin/class-vendor-applicants.php:71
|
| 266 |
-
msgid "Vendor has been <b>denied</b>."
|
| 267 |
-
msgstr "Verkäufer wurde <b>abgelehnt</b>"
|
| 268 |
-
|
| 269 |
-
#: classes/admin/class-vendor-applicants.php:82
|
| 270 |
-
msgid "Vendor has been <b>approved</b>."
|
| 271 |
-
msgstr "Verkäufer wurde <b>freigeschaltet</b>"
|
| 272 |
-
|
| 273 |
-
#: classes/admin/class-vendor-applicants.php:96
|
| 274 |
-
msgid "Pending Vendors"
|
| 275 |
-
msgstr "Freizuschaltende Verkäufer"
|
| 276 |
-
|
| 277 |
-
#: classes/admin/emails/class-emails.php:55
|
| 278 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:70
|
| 279 |
-
msgid "pending"
|
| 280 |
-
msgstr "in Bearbeitung"
|
| 281 |
-
|
| 282 |
-
#: classes/admin/emails/class-emails.php:57
|
| 283 |
-
msgid "approved"
|
| 284 |
-
msgstr "freigeschaltet"
|
| 285 |
-
|
| 286 |
-
#: classes/admin/emails/class-emails.php:59
|
| 287 |
-
msgid "denied"
|
| 288 |
-
msgstr "abgelehnt"
|
| 289 |
-
|
| 290 |
-
#: classes/admin/emails/class-emails.php:87
|
| 291 |
-
#: classes/front/class-vendor-cart.php:60
|
| 292 |
-
#: classes/front/class-vendor-shop.php:178
|
| 293 |
-
msgid "Sold by: "
|
| 294 |
-
msgstr "Verkauft von:"
|
| 295 |
-
|
| 296 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:28
|
| 297 |
-
msgid "Vendor Application"
|
| 298 |
-
msgstr "Bewerbung als Verkäufer"
|
| 299 |
-
|
| 300 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:29
|
| 301 |
-
msgid "Vendor application will either be approved, denied, or pending."
|
| 302 |
-
msgstr ""
|
| 303 |
-
"Die Bewerbung als Verkäufer wird entweder genehmigt, abgelehnt oder auf "
|
| 304 |
-
"\"\"in Bearbeitung gesetzt."
|
| 305 |
-
|
| 306 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:31
|
| 307 |
-
msgid "Application {status}"
|
| 308 |
-
msgstr "Bewerbung {status}"
|
| 309 |
-
|
| 310 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:32
|
| 311 |
-
msgid "[{blogname}] Your vendor application has been {status}"
|
| 312 |
-
msgstr "[{blogname}] Ihre Bewerbung als Verkäufer wurde {status}"
|
| 313 |
-
|
| 314 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:123
|
| 315 |
-
#: classes/admin/emails/class-wc-notify-admin.php:129
|
| 316 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:163
|
| 317 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:230
|
| 318 |
-
msgid "Enable/Disable"
|
| 319 |
-
msgstr "Aktivieren/Deaktivieren"
|
| 320 |
-
|
| 321 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:125
|
| 322 |
-
#: classes/admin/emails/class-wc-notify-admin.php:131
|
| 323 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:165
|
| 324 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:232
|
| 325 |
-
msgid "Enable this email notification"
|
| 326 |
-
msgstr "E-Mail-Benachrichtigung aktivieren"
|
| 327 |
-
|
| 328 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:129
|
| 329 |
-
#: classes/admin/emails/class-wc-notify-admin.php:135
|
| 330 |
-
msgid "Recipient(s)"
|
| 331 |
-
msgstr "Empfänger"
|
| 332 |
-
|
| 333 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:131
|
| 334 |
-
#: classes/admin/emails/class-wc-notify-admin.php:137
|
| 335 |
-
#, php-format
|
| 336 |
-
msgid ""
|
| 337 |
-
"Enter recipients (comma separated) for this email. Defaults to <code>%s</"
|
| 338 |
-
"code>."
|
| 339 |
-
msgstr ""
|
| 340 |
-
"Empfänger (mit Komma getrennt) eingeben. Standardmäßig "
|
| 341 |
-
"<code>%s</code>"
|
| 342 |
-
|
| 343 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:136
|
| 344 |
-
#: classes/admin/emails/class-wc-notify-admin.php:142
|
| 345 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:169
|
| 346 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:236
|
| 347 |
-
msgid "Subject"
|
| 348 |
-
msgstr "Betreff"
|
| 349 |
-
|
| 350 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:138
|
| 351 |
-
#: classes/admin/emails/class-wc-notify-admin.php:144
|
| 352 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:171
|
| 353 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:238
|
| 354 |
-
#, php-format
|
| 355 |
-
msgid ""
|
| 356 |
-
"This controls the email subject line. Leave blank to use the default "
|
| 357 |
-
"subject: <code>%s</code>."
|
| 358 |
-
msgstr ""
|
| 359 |
-
"Dies bestimmt den E-Mail-Betreff. Leer lassen für Standard-Betreff: <code>"
|
| 360 |
-
"%s</code>"
|
| 361 |
-
|
| 362 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:143
|
| 363 |
-
#: classes/admin/emails/class-wc-notify-admin.php:149
|
| 364 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:176
|
| 365 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:243
|
| 366 |
-
msgid "Email Heading"
|
| 367 |
-
msgstr "E-Mail-Header (Kopfzeile)"
|
| 368 |
-
|
| 369 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:145
|
| 370 |
-
#: classes/admin/emails/class-wc-notify-admin.php:151
|
| 371 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:178
|
| 372 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:245
|
| 373 |
-
#, php-format
|
| 374 |
-
msgid ""
|
| 375 |
-
"This controls the main heading contained within the email notification. "
|
| 376 |
-
"Leave blank to use the default heading: <code>%s</code>."
|
| 377 |
-
msgstr ""
|
| 378 |
-
"Dies bestimmt den Header-Abschnitt (Kopfzeile) der Benachrichtigungs-E-Mail."
|
| 379 |
-
"Leer lassen für den Standard-Inhalt: <code>%s</code>."
|
| 380 |
-
|
| 381 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:150
|
| 382 |
-
#: classes/admin/emails/class-wc-notify-admin.php:156
|
| 383 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:183
|
| 384 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:250
|
| 385 |
-
msgid "Email type"
|
| 386 |
-
msgstr "E-Mail-Typ"
|
| 387 |
-
|
| 388 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:152
|
| 389 |
-
#: classes/admin/emails/class-wc-notify-admin.php:158
|
| 390 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:185
|
| 391 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:252
|
| 392 |
-
msgid "Choose which format of email to send."
|
| 393 |
-
msgstr "Wählen Sie, in welchem Format die E-Mail gesendet werden soll."
|
| 394 |
-
|
| 395 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:156
|
| 396 |
-
#: classes/admin/emails/class-wc-notify-admin.php:162
|
| 397 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:189
|
| 398 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:256
|
| 399 |
-
msgid "Plain text"
|
| 400 |
-
msgstr "Klartext"
|
| 401 |
-
|
| 402 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:157
|
| 403 |
-
#: classes/admin/emails/class-wc-notify-admin.php:163
|
| 404 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:190
|
| 405 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:257
|
| 406 |
-
msgid "HTML"
|
| 407 |
-
msgstr "HTML"
|
| 408 |
-
|
| 409 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:158
|
| 410 |
-
#: classes/admin/emails/class-wc-notify-admin.php:164
|
| 411 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:191
|
| 412 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:258
|
| 413 |
-
msgid "Multipart"
|
| 414 |
-
msgstr "Multipart (Mehrteiler)"
|
| 415 |
-
|
| 416 |
-
#: classes/admin/emails/class-wc-notify-admin.php:28
|
| 417 |
-
msgid "New Vendor Product"
|
| 418 |
-
msgstr "Neues Produkt"
|
| 419 |
-
|
| 420 |
-
#: classes/admin/emails/class-wc-notify-admin.php:29
|
| 421 |
-
msgid "New order emails are sent when a new product is submitted by a vendor"
|
| 422 |
-
msgstr ""
|
| 423 |
-
"Neue Bestell-E-Mails werden gesendet, wenn eine Bestellung eingegangen ist / "
|
| 424 |
-
"von einem Kunden bezahlt wurde"
|
| 425 |
-
|
| 426 |
-
#: classes/admin/emails/class-wc-notify-admin.php:31
|
| 427 |
-
msgid "New product submitted: {product_name}"
|
| 428 |
-
msgstr "Neues Produkt erstellt {product_name}"
|
| 429 |
-
|
| 430 |
-
#: classes/admin/emails/class-wc-notify-admin.php:32
|
| 431 |
-
msgid "[{blogname}] New product submitted by {vendor_name} - {product_name}"
|
| 432 |
-
msgstr "[{blogname}] Neues Produkt von {vendor_name} erstellt - {product_name}"
|
| 433 |
-
|
| 434 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:28
|
| 435 |
-
msgid "Vendor has shipped"
|
| 436 |
-
msgstr "Verkäufer hat versandt"
|
| 437 |
-
|
| 438 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:29
|
| 439 |
-
msgid ""
|
| 440 |
-
"An email is sent when a vendor has marked one of their orders as shipped."
|
| 441 |
-
msgstr ""
|
| 442 |
-
"Eine E-Mail wird verschickt, wenn ein Verkäufer eine seiner "
|
| 443 |
-
"Bestellungen als versandt markiert hat. "
|
| 444 |
-
|
| 445 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:31
|
| 446 |
-
msgid "Your order has been shipped"
|
| 447 |
-
msgstr "Ihre Bestellung wurde versandt"
|
| 448 |
-
|
| 449 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:32
|
| 450 |
-
msgid ""
|
| 451 |
-
"[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 452 |
-
msgstr ""
|
| 453 |
-
"[{blogname}]Ihre Bestellung wurde versandt ({order_number}) - {order_date}"
|
| 454 |
-
|
| 455 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:112
|
| 456 |
-
msgid "Subtotal:"
|
| 457 |
-
msgstr "Zwischensumme:"
|
| 458 |
-
|
| 459 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:27
|
| 460 |
-
msgid "Notify vendors"
|
| 461 |
-
msgstr "Verkäufer benachrichtigen"
|
| 462 |
-
|
| 463 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:28
|
| 464 |
-
msgid "New order emails are sent when an order is received/paid by a customer."
|
| 465 |
-
msgstr ""
|
| 466 |
-
"Neue Bestell-E-Mails werden gesendet, wenn eine Bestellung eingegangen ist / "
|
| 467 |
-
"von einem Kunden bezahlt wurde."
|
| 468 |
-
|
| 469 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:30
|
| 470 |
-
msgid "New customer order"
|
| 471 |
-
msgstr "Neue Bestellung"
|
| 472 |
-
|
| 473 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:31
|
| 474 |
-
msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
|
| 475 |
-
msgstr "[{blogname}] Neue Kundenbestellung ({order_number}) - {order_date}"
|
| 476 |
-
|
| 477 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:103
|
| 478 |
-
msgid "Commission Subtotal:"
|
| 479 |
-
msgstr "Zwischensumme Provisionen:"
|
| 480 |
-
|
| 481 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:110
|
| 482 |
-
msgid "Shipping Subtotal:"
|
| 483 |
-
msgstr "Zwischensumme Versand:"
|
| 484 |
-
|
| 485 |
-
#: classes/admin/settings/classes/sf-class-format-options.php:211
|
| 486 |
-
#: classes/admin/settings/classes/sf-class-settings.php:773
|
| 487 |
-
msgid "Select a page..."
|
| 488 |
-
msgstr "Wählen Sie eine Seite"
|
| 489 |
-
|
| 490 |
-
#: classes/admin/settings/classes/sf-class-settings.php:153
|
| 491 |
-
#: views/dashboard/settings/settings.php:1
|
| 492 |
-
msgid "Settings"
|
| 493 |
-
msgstr "Einstellungen"
|
| 494 |
-
|
| 495 |
-
#: classes/admin/settings/classes/sf-class-settings.php:297
|
| 496 |
-
msgid "Could not load settings at: "
|
| 497 |
-
msgstr "Einstellungen konnten nicht geladen werden für:"
|
| 498 |
-
|
| 499 |
-
#: classes/admin/settings/classes/sf-class-settings.php:297
|
| 500 |
-
msgid "Error - WP Settings Framework"
|
| 501 |
-
msgstr "Fehler - WP Settings Framework"
|
| 502 |
-
|
| 503 |
-
#: classes/admin/settings/classes/sf-class-settings.php:363
|
| 504 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:96
|
| 505 |
-
msgid "Settings saved."
|
| 506 |
-
msgstr "Einstellungen gespeichert."
|
| 507 |
-
|
| 508 |
-
#: classes/admin/settings/classes/sf-class-settings.php:479
|
| 509 |
-
#, php-format
|
| 510 |
-
msgid "Save %s changes"
|
| 511 |
-
msgstr "Änderungen %s speichern"
|
| 512 |
-
|
| 513 |
-
#: classes/admin/settings/sf-options.php:4
|
| 514 |
-
msgid "General"
|
| 515 |
-
msgstr "Allgemein"
|
| 516 |
-
|
| 517 |
-
#: classes/admin/settings/sf-options.php:5
|
| 518 |
-
msgid "General options"
|
| 519 |
-
msgstr "Allgemeine Einstellugen"
|
| 520 |
-
|
| 521 |
-
#: classes/admin/settings/sf-options.php:5
|
| 522 |
-
#: classes/admin/settings/sf-options.php:45
|
| 523 |
-
#: classes/admin/settings/sf-options.php:223
|
| 524 |
-
msgid " "
|
| 525 |
-
msgstr ""
|
| 526 |
-
|
| 527 |
-
#: classes/admin/settings/sf-options.php:8
|
| 528 |
-
msgid "Default commission (%)"
|
| 529 |
-
msgstr "Standard-Provision (%)"
|
| 530 |
-
|
| 531 |
-
#: classes/admin/settings/sf-options.php:9
|
| 532 |
-
msgid ""
|
| 533 |
-
"The default rate the vendor receives for each product. If a product has a "
|
| 534 |
-
"commission rate already set, this value will be ignored for that product."
|
| 535 |
-
msgstr ""
|
| 536 |
-
"Die Standard-Provision, die ein Verkäufer für jedes Produkt erhält. "
|
| 537 |
-
"Wenn ein Produkt bereits eine Provisions-Einstellung besitzt, überschreibt "
|
| 538 |
-
"diese den hier festgelegten Standardwert."
|
| 539 |
-
|
| 540 |
-
#: classes/admin/settings/sf-options.php:20
|
| 541 |
-
msgid "Registration"
|
| 542 |
-
msgstr "Registrierung"
|
| 543 |
-
|
| 544 |
-
#: classes/admin/settings/sf-options.php:21
|
| 545 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 546 |
-
msgstr "Erlaube Benutzern oder Gästen sich als Verkäufer zu bewerben"
|
| 547 |
-
|
| 548 |
-
#: classes/admin/settings/sf-options.php:22
|
| 549 |
-
msgid ""
|
| 550 |
-
"This will show a checkbox on the My Account page's registration form asking "
|
| 551 |
-
"if the user would like to apply to be a vendor. Also, on the Vendor "
|
| 552 |
-
"Dashboard, users can apply to become a vendor."
|
| 553 |
-
msgstr ""
|
| 554 |
-
"Ist dies aktiviert, wird eine Checkbox auf der bei der Registration als "
|
| 555 |
-
"neuer Benutzer angezeigt, mit der der Benutzer gefragt wird, ob er sich auch "
|
| 556 |
-
"als Verkäufer bewerben möchte.Bereits registrierte Benutzer kö"
|
| 557 |
-
"nnen sich auch nachträglich auf der Verkäufer-Seite als Verkä"
|
| 558 |
-
"ufer bewerben."
|
| 559 |
-
|
| 560 |
-
#: classes/admin/settings/sf-options.php:29
|
| 561 |
-
msgid "Approve vendor applications manually"
|
| 562 |
-
msgstr "Verkäufer-Bewerbungen manuell akzeptieren"
|
| 563 |
-
|
| 564 |
-
#: classes/admin/settings/sf-options.php:30
|
| 565 |
-
msgid ""
|
| 566 |
-
"With this unchecked, all vendor applications are automatically accepted. "
|
| 567 |
-
"Otherwise, you must approve each manually."
|
| 568 |
-
msgstr ""
|
| 569 |
-
"Ist diese Option deaktiviert, werden alle Bewerbungen automatisch "
|
| 570 |
-
"akzeptiert. Ansonsten muss jede Bewerbung manuell akzeptiert werden."
|
| 571 |
-
|
| 572 |
-
#: classes/admin/settings/sf-options.php:37
|
| 573 |
-
msgid "Taxes"
|
| 574 |
-
msgstr "Steuern"
|
| 575 |
-
|
| 576 |
-
#: classes/admin/settings/sf-options.php:38
|
| 577 |
-
msgid "Give vendors any tax collected per-product"
|
| 578 |
-
msgstr "Verkäufer erhalten alle eingenommenen Steuern pro Produkt"
|
| 579 |
-
|
| 580 |
-
#: classes/admin/settings/sf-options.php:39
|
| 581 |
-
msgid ""
|
| 582 |
-
"The tax collected on a vendor's product will be given to him in its entirety"
|
| 583 |
-
msgstr ""
|
| 584 |
-
"Die Steuern, die für ein Produkt eingenommen wurden, werden dem Verkä"
|
| 585 |
-
"ufer zur Gänze überlassen"
|
| 586 |
-
|
| 587 |
-
#: classes/admin/settings/sf-options.php:45
|
| 588 |
-
msgid "Shop options"
|
| 589 |
-
msgstr "Shop-Optionen"
|
| 590 |
-
|
| 591 |
-
#: classes/admin/settings/sf-options.php:48
|
| 592 |
-
msgid "Shop HTML"
|
| 593 |
-
msgstr "Shop-HTML"
|
| 594 |
-
|
| 595 |
-
#: classes/admin/settings/sf-options.php:49
|
| 596 |
-
msgid "Enable HTML for a vendor's shop description by default"
|
| 597 |
-
msgstr ""
|
| 598 |
-
"Erlaube HTML in der Shop-Beschreibung für alle Verkäufer als "
|
| 599 |
-
"Voreinstellung"
|
| 600 |
-
|
| 601 |
-
#: classes/admin/settings/sf-options.php:56
|
| 602 |
-
msgid "Vendor shop page"
|
| 603 |
-
msgstr "Verkäufer-Seite"
|
| 604 |
-
|
| 605 |
-
#: classes/admin/settings/sf-options.php:57
|
| 606 |
-
msgid "Eg: <code>yoursite.com/[your_setting_here]/[vendor_name_here]</code>"
|
| 607 |
-
msgstr ""
|
| 608 |
-
"z.B.: <code>deineseite.de/[deine_einstellung_hier]/[verkä"
|
| 609 |
-
"ufer_name_hier] </code>"
|
| 610 |
-
|
| 611 |
-
#: classes/admin/settings/sf-options.php:64
|
| 612 |
-
msgid "Shop Headers"
|
| 613 |
-
msgstr "Kopfzeile der Shops"
|
| 614 |
-
|
| 615 |
-
#: classes/admin/settings/sf-options.php:65
|
| 616 |
-
msgid "Enable vendor shop headers"
|
| 617 |
-
msgstr "Kopfzeilen in Verkäufer-Shops aktivieren"
|
| 618 |
-
|
| 619 |
-
#: classes/admin/settings/sf-options.php:66
|
| 620 |
-
msgid ""
|
| 621 |
-
"This will override the HTML Shop description output on product-archive pages."
|
| 622 |
-
msgstr ""
|
| 623 |
-
"Dies wird die HTML Shop-Beschreibung auf den Produkt-Archiv-Seiten "
|
| 624 |
-
"überschreiben."
|
| 625 |
-
|
| 626 |
-
#: classes/admin/settings/sf-options.php:72
|
| 627 |
-
#: classes/admin/settings/sf-options.php:198
|
| 628 |
-
msgid "Products"
|
| 629 |
-
msgstr "Produkte"
|
| 630 |
-
|
| 631 |
-
#: classes/admin/settings/sf-options.php:73
|
| 632 |
-
msgid "Product Add Page"
|
| 633 |
-
msgstr "Produkt hinzufügen-Seite"
|
| 634 |
-
|
| 635 |
-
#: classes/admin/settings/sf-options.php:73
|
| 636 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 637 |
-
msgstr ""
|
| 638 |
-
"Stelle ein, was der Verkäufer nicht sehen darf, wenn er ein Produkt "
|
| 639 |
-
"hinzufügt"
|
| 640 |
-
|
| 641 |
-
#: classes/admin/settings/sf-options.php:76
|
| 642 |
-
msgid "Left side panel"
|
| 643 |
-
msgstr "Produktdaten (Feld auf der linken Seite)"
|
| 644 |
-
|
| 645 |
-
#: classes/admin/settings/sf-options.php:77
|
| 646 |
-
msgid "Hide these areas of the add product page for vendors"
|
| 647 |
-
msgstr ""
|
| 648 |
-
"Verberge diese Bereiche der Seite Produkt hinzufügen für den "
|
| 649 |
-
"Verkäufer"
|
| 650 |
-
|
| 651 |
-
#: classes/admin/settings/sf-options.php:91
|
| 652 |
-
msgid "Types"
|
| 653 |
-
msgstr "Produkttypen"
|
| 654 |
-
|
| 655 |
-
#: classes/admin/settings/sf-options.php:92
|
| 656 |
-
msgid "Hide these product types from the vendor"
|
| 657 |
-
msgstr "Verberge diese Produktdaten für den Verkäufer"
|
| 658 |
-
|
| 659 |
-
#: classes/admin/settings/sf-options.php:105
|
| 660 |
-
msgid "Type options"
|
| 661 |
-
msgstr "Produkttyp-Optionen"
|
| 662 |
-
|
| 663 |
-
#: classes/admin/settings/sf-options.php:106
|
| 664 |
-
msgid "Hide these product options from the vendor"
|
| 665 |
-
msgstr "Verberge diese Produktoptionen vor dem Verkäufer"
|
| 666 |
-
|
| 667 |
-
#: classes/admin/settings/sf-options.php:117
|
| 668 |
-
msgid "Miscellaneous"
|
| 669 |
-
msgstr "Diverses"
|
| 670 |
-
|
| 671 |
-
#: classes/admin/settings/sf-options.php:129
|
| 672 |
-
msgid "Stylesheet"
|
| 673 |
-
msgstr "Stylesheet (CSS)"
|
| 674 |
-
|
| 675 |
-
#: classes/admin/settings/sf-options.php:130
|
| 676 |
-
msgid ""
|
| 677 |
-
"You can add CSS in this textarea, which will be loaded on the product add/"
|
| 678 |
-
"edit page for vendors."
|
| 679 |
-
msgstr ""
|
| 680 |
-
"Sie können CSS in diesem Textfeld eintragen, welches auf der Seite "
|
| 681 |
-
"Produkt hinzufügen/editieren für Verkäufer angezeigt wird."
|
| 682 |
-
|
| 683 |
-
#: classes/admin/settings/sf-options.php:136
|
| 684 |
-
msgid "Capabilities"
|
| 685 |
-
msgstr "Verkäufer-Rechte"
|
| 686 |
-
|
| 687 |
-
#: classes/admin/settings/sf-options.php:137
|
| 688 |
-
msgid "Permissions"
|
| 689 |
-
msgstr "Berechtigungen"
|
| 690 |
-
|
| 691 |
-
#: classes/admin/settings/sf-options.php:137
|
| 692 |
-
msgid "General permissions used around the shop"
|
| 693 |
-
msgstr "Allgemeine Berechtigungen rund um den Shop"
|
| 694 |
-
|
| 695 |
-
#: classes/admin/settings/sf-options.php:140
|
| 696 |
-
#: classes/class-install.php:205 views/dashboard/orders.php:18
|
| 697 |
-
msgid "Orders"
|
| 698 |
-
msgstr "Bestellungen"
|
| 699 |
-
|
| 700 |
-
#: classes/admin/settings/sf-options.php:141
|
| 701 |
-
msgid "View orders"
|
| 702 |
-
msgstr "Bestellungen ansehen"
|
| 703 |
-
|
| 704 |
-
#: classes/admin/settings/sf-options.php:142
|
| 705 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 706 |
-
msgstr ""
|
| 707 |
-
"Zeige Käufer-Details für jede Bestellung, wie z.B. E-Mail-Adresse, "
|
| 708 |
-
"Name, etc."
|
| 709 |
-
|
| 710 |
-
#: classes/admin/settings/sf-options.php:149
|
| 711 |
-
msgid "View comments"
|
| 712 |
-
msgstr "Bestell-Kommentare ansehen"
|
| 713 |
-
|
| 714 |
-
#: classes/admin/settings/sf-options.php:150
|
| 715 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 716 |
-
msgstr ""
|
| 717 |
-
"Zeige alle Verkäufer-Kommentare für eine Bestellung im Frontend."
|
| 718 |
-
|
| 719 |
-
#: classes/admin/settings/sf-options.php:157
|
| 720 |
-
msgid "Submit comments"
|
| 721 |
-
msgstr "Bestell-Kommentare hinzufügen"
|
| 722 |
-
|
| 723 |
-
#: classes/admin/settings/sf-options.php:158
|
| 724 |
-
msgid ""
|
| 725 |
-
"Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 726 |
-
msgstr ""
|
| 727 |
-
"Kommentare zu einer Bestellung über das Frontend hinzufügen, z.B. "
|
| 728 |
-
"die Sendungsverfolgungs-Nr. für ein Produkt."
|
| 729 |
-
|
| 730 |
-
#: classes/admin/settings/sf-options.php:165
|
| 731 |
-
msgid "View email addresses"
|
| 732 |
-
msgstr "E-Mail-Adressen ansehen"
|
| 733 |
-
|
| 734 |
-
#: classes/admin/settings/sf-options.php:166
|
| 735 |
-
msgid ""
|
| 736 |
-
"While viewing order details on the frontend, you can disable or enable email "
|
| 737 |
-
"addresses"
|
| 738 |
-
msgstr ""
|
| 739 |
-
"Beim Ansehen der Bestelldetails im Frontend, kann hiermit die Anzeige der E-"
|
| 740 |
-
"Mail-Adressen der Käfer aktiviert/deaktiviert werden."
|
| 741 |
-
|
| 742 |
-
#: classes/admin/settings/sf-options.php:173
|
| 743 |
-
msgid "Export a CSV file of orders for a product"
|
| 744 |
-
msgstr "Bestelldetails eines Produktes als CSV-Datei exportieren"
|
| 745 |
-
|
| 746 |
-
#: classes/admin/settings/sf-options.php:174
|
| 747 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 748 |
-
msgstr ""
|
| 749 |
-
"Verkäufer kann Bestellungen eines Produktes im Frontend exportieren."
|
| 750 |
-
|
| 751 |
-
#: classes/admin/settings/sf-options.php:181
|
| 752 |
-
msgid "Reports"
|
| 753 |
-
msgstr "Berichte"
|
| 754 |
-
|
| 755 |
-
#: classes/admin/settings/sf-options.php:182
|
| 756 |
-
msgid "View backend sales reports"
|
| 757 |
-
msgstr "Verkaufs-Berichte im Backend ansehen"
|
| 758 |
-
|
| 759 |
-
#: classes/admin/settings/sf-options.php:183
|
| 760 |
-
msgid ""
|
| 761 |
-
"Graphs and tables via the Reports page in backend. The reports will only "
|
| 762 |
-
"display sales data that pertain to their products"
|
| 763 |
-
msgstr ""
|
| 764 |
-
"Grafiken und Tabellen in den Übersichten im Backend. Die Berichte "
|
| 765 |
-
"zeigen nur die Verkaufs-Daten zu den Produkten des jeweiligen Verkä"
|
| 766 |
-
"ufers an"
|
| 767 |
-
|
| 768 |
-
#: classes/admin/settings/sf-options.php:190
|
| 769 |
-
msgid "View Frontend sales reports"
|
| 770 |
-
msgstr "Verkaufs-Berichte im Frontend ansehen"
|
| 771 |
-
|
| 772 |
-
#: classes/admin/settings/sf-options.php:191
|
| 773 |
-
msgid ""
|
| 774 |
-
"Sales table on the frontend on the My Account page. The table will only "
|
| 775 |
-
"display sales data that pertain to their products"
|
| 776 |
-
msgstr ""
|
| 777 |
-
"Verkaufs-Übersicht im Frontend auf der Mein Konto-Seite. Die Ü"
|
| 778 |
-
"bersicht zeigt nur die Verkaufs-Daten zu den Produkten des jeweiligen "
|
| 779 |
-
"Verkäufers."
|
| 780 |
-
|
| 781 |
-
#: classes/admin/settings/sf-options.php:199
|
| 782 |
-
msgid "Submit products"
|
| 783 |
-
msgstr "Produkte hinzufügen"
|
| 784 |
-
|
| 785 |
-
#: classes/admin/settings/sf-options.php:200
|
| 786 |
-
msgid ""
|
| 787 |
-
"Vendors could submit a product through the backend, and an admin would "
|
| 788 |
-
"approve or deny it"
|
| 789 |
-
msgstr ""
|
| 790 |
-
"Verkäufer können ein neues Produkt im Backend hinzufügen. Ein "
|
| 791 |
-
"Admin kann es dann freischalten oder ablehnen."
|
| 792 |
-
|
| 793 |
-
#: classes/admin/settings/sf-options.php:207
|
| 794 |
-
msgid "Edit live products"
|
| 795 |
-
msgstr "Bereits veröffentlichte Produkte bearbeiten"
|
| 796 |
-
|
| 797 |
-
#: classes/admin/settings/sf-options.php:208
|
| 798 |
-
msgid ""
|
| 799 |
-
"Vendors could edit an approved product after it has already gone live. There "
|
| 800 |
-
"is no approval or review after editing a live product. This could be "
|
| 801 |
-
"dangerous with malicious vendors, so take caution."
|
| 802 |
-
msgstr ""
|
| 803 |
-
"Ist dies aktiviert, können Verkäufer ein bereits freigeschaltetes "
|
| 804 |
-
"Product bearbeiten. Es gibt keine erneute Freischaltung der Bearbeitung, "
|
| 805 |
-
"also Vorsicht!"
|
| 806 |
-
|
| 807 |
-
#: classes/admin/settings/sf-options.php:215
|
| 808 |
-
msgid "Submit products live without requiring approval"
|
| 809 |
-
msgstr ""
|
| 810 |
-
"Produkte hinzufügen, ohne dass eine Freischaltung durch den Admin "
|
| 811 |
-
"erforderlich ist"
|
| 812 |
-
|
| 813 |
-
#: classes/admin/settings/sf-options.php:216
|
| 814 |
-
msgid ""
|
| 815 |
-
"Vendors can submit products without review or approval from a shop admin. "
|
| 816 |
-
"This could be dangerous with malicious vendors, so take caution."
|
| 817 |
-
msgstr ""
|
| 818 |
-
"Ist dies aktiviert, können Verkäufer neue Produkte hinzufü"
|
| 819 |
-
"gen, ohne dass eine vorherige Freischaltung durch den Admin erforderlich "
|
| 820 |
-
"ist. Dies könnte bei böswilligen Verkäufern gefährlich "
|
| 821 |
-
"sein, daher Vorsicht!"
|
| 822 |
-
|
| 823 |
-
#: classes/admin/settings/sf-options.php:222
|
| 824 |
-
msgid "Pages"
|
| 825 |
-
msgstr "Seiten"
|
| 826 |
-
|
| 827 |
-
#: classes/admin/settings/sf-options.php:223
|
| 828 |
-
msgid "Page configuration"
|
| 829 |
-
msgstr "Seitenkonfiguration"
|
| 830 |
-
|
| 831 |
-
#: classes/admin/settings/sf-options.php:226
|
| 832 |
-
msgid "Vendor dashboard"
|
| 833 |
-
msgstr "Verkäufer-Seite"
|
| 834 |
-
|
| 835 |
-
#: classes/admin/settings/sf-options.php:227
|
| 836 |
-
msgid ""
|
| 837 |
-
"Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</"
|
| 838 |
-
"code><br/>By default, My Account > Vendor Dashboard should have the "
|
| 839 |
-
"shortcode."
|
| 840 |
-
msgstr ""
|
| 841 |
-
"Wähle die Seite, die den shortcode <code>[pv_vendor_dashboard]</"
|
| 842 |
-
"code><br/> enthält. Standardmäßig sollte dies Mein Konto > "
|
| 843 |
-
"Verkäufer-Seite sein."
|
| 844 |
-
|
| 845 |
-
#: classes/admin/settings/sf-options.php:234
|
| 846 |
-
msgid "Shop settings"
|
| 847 |
-
msgstr "Shop-Einstellungen"
|
| 848 |
-
|
| 849 |
-
#: classes/admin/settings/sf-options.php:235
|
| 850 |
-
msgid ""
|
| 851 |
-
"Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/"
|
| 852 |
-
">These are the shop settings a vendor can configure."
|
| 853 |
-
msgstr ""
|
| 854 |
-
"Wähle die Seite, die den shortcode <code>[pv_shop_settings]</code><br/> "
|
| 855 |
-
"enthält. Dies sind die Shop-Einstellungen, die ein Verkäufer "
|
| 856 |
-
"vornehmen kann."
|
| 857 |
-
|
| 858 |
-
#: classes/admin/settings/sf-options.php:242
|
| 859 |
-
msgid "Orders page"
|
| 860 |
-
msgstr "Bestellungsseite"
|
| 861 |
-
|
| 862 |
-
#: classes/admin/settings/sf-options.php:243
|
| 863 |
-
msgid ""
|
| 864 |
-
"Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 865 |
-
"default, My Account > Orders should have the shortcode."
|
| 866 |
-
msgstr ""
|
| 867 |
-
"Wähle die Seite, die den shortcode <code>[pv_orders]</code><br/> "
|
| 868 |
-
"enthält. Standardmäßig sollte dies Mein Konto > Bestellungen "
|
| 869 |
-
"sein."
|
| 870 |
-
|
| 871 |
-
#: classes/admin/settings/sf-options.php:250
|
| 872 |
-
msgid "Vendor terms"
|
| 873 |
-
msgstr "Verkäufer-Bedingungen"
|
| 874 |
-
|
| 875 |
-
#: classes/admin/settings/sf-options.php:251
|
| 876 |
-
msgid ""
|
| 877 |
-
"These terms are shown to a user when submitting an application to become a "
|
| 878 |
-
"vendor.<br/>If left blank, no terms will be shown to the applicant."
|
| 879 |
-
msgstr ""
|
| 880 |
-
"Diese Bedingungen werden einem Benutzer angezeigt, wenn er sich als "
|
| 881 |
-
"Verkäufer bewirbt.<br/>Falls leer gelassen, werden dem Bewerber keine "
|
| 882 |
-
"Bedingungen angezeigt."
|
| 883 |
-
|
| 884 |
-
#: classes/admin/settings/sf-options.php:269
|
| 885 |
-
msgid "Payments"
|
| 886 |
-
msgstr "Auszahlungen"
|
| 887 |
-
|
| 888 |
-
#: classes/admin/settings/sf-options.php:271
|
| 889 |
-
msgid "User payments"
|
| 890 |
-
msgstr "Benutzer-Zahlungen"
|
| 891 |
-
|
| 892 |
-
#: classes/admin/settings/sf-options.php:272
|
| 893 |
-
#, php-format
|
| 894 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 895 |
-
msgstr ""
|
| 896 |
-
"Gesamte derzeit ausstehende Provision: %s. <a href=\"%s\">Zeige Details</a>."
|
| 897 |
-
|
| 898 |
-
#: classes/admin/settings/sf-options.php:273
|
| 899 |
-
#, php-format
|
| 900 |
-
msgid ""
|
| 901 |
-
"Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 902 |
-
"\">here</a>."
|
| 903 |
-
msgstr ""
|
| 904 |
-
"Stellen Sie sicher, dass die PayPal Adaptive Payments Einstellungen <a href="
|
| 905 |
-
"\"%s\"> korrekt sind</a>."
|
| 906 |
-
|
| 907 |
-
#: classes/admin/settings/sf-options.php:277
|
| 908 |
-
msgid "Instant pay"
|
| 909 |
-
msgstr "Sofortzahlung"
|
| 910 |
-
|
| 911 |
-
#: classes/admin/settings/sf-options.php:278
|
| 912 |
-
msgid "Instantly pay vendors their commission when an order is made"
|
| 913 |
-
msgstr ""
|
| 914 |
-
"Zahlt dem Verkäufer seine Provision automatisch sofort, wenn eine "
|
| 915 |
-
"Bestellung für eines seiner Produkte erfolgt ist."
|
| 916 |
-
|
| 917 |
-
#: classes/admin/settings/sf-options.php:279
|
| 918 |
-
msgid ""
|
| 919 |
-
"For this to work, customers must checkout with the PayPal Adaptive Payments "
|
| 920 |
-
"gateway. Using other gateways will not pay vendors instantly"
|
| 921 |
-
msgstr ""
|
| 922 |
-
"Damit dies funktioniert, müssen Kunden via PayPal Adaptive Payments "
|
| 923 |
-
"auschecken.Bei anderen Bezahlmethoden wird der Verkäufer nicht direkt bezahlt"
|
| 924 |
-
|
| 925 |
-
#: classes/admin/settings/sf-options.php:286
|
| 926 |
-
msgid "Payment schedule"
|
| 927 |
-
msgstr "Zeitplan für Zahlungen"
|
| 928 |
-
|
| 929 |
-
#: classes/admin/settings/sf-options.php:287
|
| 930 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 931 |
-
msgstr ""
|
| 932 |
-
"Hinweis: Zeitplan funktioniert nur, wenn sofortige Zahlung deaktiviert ist."
|
| 933 |
-
|
| 934 |
-
#: classes/admin/settings/sf-options.php:292
|
| 935 |
-
msgid "Weekly"
|
| 936 |
-
msgstr "Wöchentlich"
|
| 937 |
-
|
| 938 |
-
#: classes/admin/settings/sf-options.php:293
|
| 939 |
-
msgid "Biweekly"
|
| 940 |
-
msgstr "Zweiwöchentlich"
|
| 941 |
-
|
| 942 |
-
#: classes/admin/settings/sf-options.php:294
|
| 943 |
-
msgid "Monthly"
|
| 944 |
-
msgstr "Monatlich"
|
| 945 |
-
|
| 946 |
-
#: classes/admin/settings/sf-options.php:295
|
| 947 |
-
msgid "Manual"
|
| 948 |
-
msgstr "Manuell"
|
| 949 |
-
|
| 950 |
-
#: classes/admin/settings/sf-options.php:296
|
| 951 |
-
msgid "Now"
|
| 952 |
-
msgstr "Sofort"
|
| 953 |
-
|
| 954 |
-
#: classes/admin/settings/sf-options.php:301
|
| 955 |
-
msgid "Email notification"
|
| 956 |
-
msgstr "E-Mail-Benachrichtigung"
|
| 957 |
-
|
| 958 |
-
#: classes/admin/settings/sf-options.php:302
|
| 959 |
-
msgid ""
|
| 960 |
-
"Send the WooCommerce admin an email each time a payment has been made via "
|
| 961 |
-
"the payment schedule options above"
|
| 962 |
-
msgstr ""
|
| 963 |
-
"Sendet dem WooCommerce-Admin eine automatische E-Mail, wenn eine Zahlung auf "
|
| 964 |
-
"Grund des Zahlungsplans ausgeführt wurde."
|
| 965 |
-
|
| 966 |
-
#: classes/class-cron.php:87
|
| 967 |
-
#, php-format
|
| 968 |
-
msgid "Payment total: %s"
|
| 969 |
-
msgstr "Zahlung gesamt: %s"
|
| 970 |
-
|
| 971 |
-
#: classes/class-cron.php:148
|
| 972 |
-
msgid "Once Weekly"
|
| 973 |
-
msgstr "Einmal wöchentlich"
|
| 974 |
-
|
| 975 |
-
#: classes/class-cron.php:153
|
| 976 |
-
msgid "Once every two weeks"
|
| 977 |
-
msgstr "Alle zweite Woche"
|
| 978 |
-
|
| 979 |
-
#: classes/class-cron.php:158
|
| 980 |
-
msgid "Once a month"
|
| 981 |
-
msgstr "Einmal im Monat"
|
| 982 |
-
|
| 983 |
-
#: classes/class-install.php:99 classes/class-install.php:253
|
| 984 |
-
msgid "Pending Vendor"
|
| 985 |
-
msgstr "Freizuschaltender Verkäufer"
|
| 986 |
-
|
| 987 |
-
#: classes/class-install.php:204
|
| 988 |
-
msgid "Vendor Dashboard"
|
| 989 |
-
msgstr "Verkäufer-Seite"
|
| 990 |
-
|
| 991 |
-
#: classes/class-install.php:206
|
| 992 |
-
msgid "Shop Settings"
|
| 993 |
-
msgstr "Shop-Einstellungen"
|
| 994 |
-
|
| 995 |
-
#: classes/front/class-vendor-cart.php:41
|
| 996 |
-
#: classes/front/class-vendor-shop.php:255
|
| 997 |
-
msgid "Sold by"
|
| 998 |
-
msgstr "Verkauft von"
|
| 999 |
-
|
| 1000 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:41
|
| 1001 |
-
msgid "Order unmarked shipped."
|
| 1002 |
-
msgstr "Bestellung nicht als versandt markiert"
|
| 1003 |
-
|
| 1004 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:51
|
| 1005 |
-
msgid "Order marked shipped."
|
| 1006 |
-
msgstr "Bestellung als versandt markiert."
|
| 1007 |
-
|
| 1008 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:69
|
| 1009 |
-
msgid "Your PayPal address is not a valid email address."
|
| 1010 |
-
msgstr "Ihre PayPal-Adresse ist keine gültige E-Mail-Adresse."
|
| 1011 |
-
|
| 1012 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:78
|
| 1013 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 1014 |
-
msgstr ""
|
| 1015 |
-
"Dieser Shopname ist bereits vergeben. Ihr Shopname muss einzigartig sein."
|
| 1016 |
-
|
| 1017 |
-
#: classes/front/orders/class-export-csv.php:37
|
| 1018 |
-
msgid "Extra data"
|
| 1019 |
-
msgstr "Zusätzliche Daten"
|
| 1020 |
-
|
| 1021 |
-
#: classes/front/orders/class-export-csv.php:38
|
| 1022 |
-
#: views/dashboard/reports.php:18 views/emails/admin-new-order.php:23
|
| 1023 |
-
#: views/emails/notify-vendor-shipped.php:23
|
| 1024 |
-
msgid "Quantity"
|
| 1025 |
-
msgstr "Menge"
|
| 1026 |
-
|
| 1027 |
-
#: classes/front/orders/class-orders.php:107
|
| 1028 |
-
msgid ""
|
| 1029 |
-
"You haven't selected a product's orders to view! Please go back to the "
|
| 1030 |
-
"Vendor Dashboard and click Show Orders on the product you'd like to view."
|
| 1031 |
-
msgstr ""
|
| 1032 |
-
"Sie haben keine Produktbestellungen ausgewählt! Bitte gehen Sie zurück zur "
|
| 1033 |
-
"Verkäferseite und klicken Sie auf Zeige Bestellungen bei dem Produkt, "
|
| 1034 |
-
"das Sie ansehen wollen."
|
| 1035 |
-
|
| 1036 |
-
#: classes/front/orders/class-orders.php:111
|
| 1037 |
-
msgid "No orders."
|
| 1038 |
-
msgstr "Keine Bestellungen."
|
| 1039 |
-
|
| 1040 |
-
#: classes/front/orders/class-orders.php:144
|
| 1041 |
-
#: classes/front/orders/class-orders.php:145
|
| 1042 |
-
msgid "Tracking number"
|
| 1043 |
-
msgstr "Sendungsnummer"
|
| 1044 |
-
|
| 1045 |
-
#: classes/front/orders/class-orders.php:147
|
| 1046 |
-
msgid "Success. Your tracking number has been updated."
|
| 1047 |
-
msgstr "Erfolgreich. Ihre Sendungsnummer wurde aktualisiert."
|
| 1048 |
-
|
| 1049 |
-
#: classes/front/orders/class-orders.php:209
|
| 1050 |
-
msgid "Product Title"
|
| 1051 |
-
msgstr "Produkttitel"
|
| 1052 |
-
|
| 1053 |
-
#: classes/front/orders/class-orders.php:210
|
| 1054 |
-
msgid "Full name"
|
| 1055 |
-
msgstr "Vollständiger Name"
|
| 1056 |
-
|
| 1057 |
-
#: classes/front/orders/class-orders.php:211
|
| 1058 |
-
msgid "Address"
|
| 1059 |
-
msgstr "Adresse"
|
| 1060 |
-
|
| 1061 |
-
#: classes/front/orders/class-orders.php:212
|
| 1062 |
-
msgid "City"
|
| 1063 |
-
msgstr "Stadt"
|
| 1064 |
-
|
| 1065 |
-
#: classes/front/orders/class-orders.php:213
|
| 1066 |
-
msgid "State"
|
| 1067 |
-
msgstr "Bundesland"
|
| 1068 |
-
|
| 1069 |
-
#: classes/front/orders/class-orders.php:214
|
| 1070 |
-
msgid "Zip"
|
| 1071 |
-
msgstr "PLZ"
|
| 1072 |
-
|
| 1073 |
-
#: classes/front/orders/class-orders.php:215
|
| 1074 |
-
msgid "Email address"
|
| 1075 |
-
msgstr "E-Mail-Adresse"
|
| 1076 |
-
|
| 1077 |
-
#: classes/front/orders/class-submit-comment.php:41
|
| 1078 |
-
msgid "You've left the comment field empty!"
|
| 1079 |
-
msgstr "Sie haben das Kommentar-Feld leer gelassen!"
|
| 1080 |
-
|
| 1081 |
-
#: classes/front/orders/class-submit-comment.php:63
|
| 1082 |
-
msgid "Success. The customer has been notified of your comment."
|
| 1083 |
-
msgstr "Erfolgreich. Der Kunde wurde über ihr Kommentar informiert."
|
| 1084 |
-
|
| 1085 |
-
#: classes/front/signup/class-vendor-signup.php:44
|
| 1086 |
-
#: views/dashboard/denied.php:22
|
| 1087 |
-
msgid "Apply to become a vendor? "
|
| 1088 |
-
msgstr "Als Verkäufer bewerben?"
|
| 1089 |
-
|
| 1090 |
-
#: classes/front/signup/class-vendor-signup.php:53
|
| 1091 |
-
#: views/dashboard/denied.php:33
|
| 1092 |
-
#, php-format
|
| 1093 |
-
msgid "I have read and accepted the <a href=\"%s\">terms and conditions</a>"
|
| 1094 |
-
msgstr ""
|
| 1095 |
-
"Ich habe die <a href=\"%s\">Geschäftsbedingungen</a> gelesen und "
|
| 1096 |
-
"akzeptiert"
|
| 1097 |
-
|
| 1098 |
-
#: classes/front/signup/class-vendor-signup.php:87
|
| 1099 |
-
msgid "Application denied. You are an administrator."
|
| 1100 |
-
msgstr "Bewerbung abgelehnt. Sie sind Administrator."
|
| 1101 |
-
|
| 1102 |
-
#: classes/front/signup/class-vendor-signup.php:89
|
| 1103 |
-
msgid "Your application has been submitted."
|
| 1104 |
-
msgstr "Ihre Bewerbung wurde eingereicht."
|
| 1105 |
-
|
| 1106 |
-
#: classes/front/signup/class-vendor-signup.php:125
|
| 1107 |
-
msgid "You must accept the terms and conditions to become a vendor."
|
| 1108 |
-
msgstr ""
|
| 1109 |
-
"Sie müssen die AGBs akzeptieren um Verkäufer werden zu können."
|
| 1110 |
-
|
| 1111 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1112 |
-
msgid "PayPal Adaptive Payments"
|
| 1113 |
-
msgstr "PayPal Adaptive Payments"
|
| 1114 |
-
|
| 1115 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 1116 |
-
#, php-format
|
| 1117 |
-
msgid ""
|
| 1118 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 1119 |
-
"%s."
|
| 1120 |
-
msgstr ""
|
| 1121 |
-
"Ein Fehler ist aufgetreten. Die Antwort von PayPl hat diese Bestellung als "
|
| 1122 |
-
"ungültig gekennzeichnet. Status: %s."
|
| 1123 |
-
|
| 1124 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 1125 |
-
msgid "IPN payment completed"
|
| 1126 |
-
msgstr "IPN Zahlung abgeschlossen"
|
| 1127 |
-
|
| 1128 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 1129 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 1130 |
-
msgstr "PayPal Adaptive Payments aktivieren"
|
| 1131 |
-
|
| 1132 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 1133 |
-
msgid "Method Title"
|
| 1134 |
-
msgstr "Methoden-Überschrift"
|
| 1135 |
-
|
| 1136 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 1137 |
-
msgid "This controls the title which the user sees during checkout."
|
| 1138 |
-
msgstr ""
|
| 1139 |
-
"Hier wird der Titel eingestellt, den der Benutzer während des "
|
| 1140 |
-
"Abschlusses an der Kasse sieht."
|
| 1141 |
-
|
| 1142 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 1143 |
-
msgid "PayPal"
|
| 1144 |
-
msgstr "PayPal"
|
| 1145 |
-
|
| 1146 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:159
|
| 1147 |
-
msgid "Description"
|
| 1148 |
-
msgstr "Beschreibung"
|
| 1149 |
-
|
| 1150 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 1151 |
-
msgid "This controls the description which the user sees during checkout."
|
| 1152 |
-
msgstr ""
|
| 1153 |
-
"Hier wird der Text eingestellt, den der Benutzer während des "
|
| 1154 |
-
"Abschlusses an der Kasse sieht."
|
| 1155 |
-
|
| 1156 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 1157 |
-
msgid "Pay via PayPal!"
|
| 1158 |
-
msgstr "Zahlen via PayPal!"
|
| 1159 |
-
|
| 1160 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 1161 |
-
msgid "Live Credentials"
|
| 1162 |
-
msgstr "Live Berechtigungen"
|
| 1163 |
-
|
| 1164 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 1165 |
-
#, php-format
|
| 1166 |
-
msgid ""
|
| 1167 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 1168 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 1169 |
-
msgstr ""
|
| 1170 |
-
"Sie benötigen eine <a href=\"%s\">Application ID</a> um Live-"
|
| 1171 |
-
"Transaktionen auszuführen. Nicht erforderlich zum Testen im Sandbox-"
|
| 1172 |
-
"Modus."
|
| 1173 |
-
|
| 1174 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:179
|
| 1175 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 1176 |
-
msgid "PayPal Email"
|
| 1177 |
-
msgstr "PayPal E-Mail"
|
| 1178 |
-
|
| 1179 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:180
|
| 1180 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 1181 |
-
msgid "The email address main payments should go to."
|
| 1182 |
-
msgstr "Die E-Mail-Adresse, an die die Hauptzahlungen gehen sollten."
|
| 1183 |
-
|
| 1184 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:185
|
| 1185 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 1186 |
-
msgid "API Username"
|
| 1187 |
-
msgstr "API Benutzername"
|
| 1188 |
-
|
| 1189 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:190
|
| 1190 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 1191 |
-
msgid "API Password"
|
| 1192 |
-
msgstr "API Passwort"
|
| 1193 |
-
|
| 1194 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:195
|
| 1195 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 1196 |
-
msgid "API Signature"
|
| 1197 |
-
msgstr "API Signatur"
|
| 1198 |
-
|
| 1199 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 1200 |
-
msgid "Application ID"
|
| 1201 |
-
msgstr "Application ID"
|
| 1202 |
-
|
| 1203 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 1204 |
-
msgid "Only required when doing live transactions."
|
| 1205 |
-
msgstr "Nur erforderlich, wenn Live-Zahlungen genutzt werden."
|
| 1206 |
-
|
| 1207 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 1208 |
-
msgid "Sandbox Credentials"
|
| 1209 |
-
msgstr "Sandbox Berechtigung"
|
| 1210 |
-
|
| 1211 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 1212 |
-
#, php-format
|
| 1213 |
-
msgid ""
|
| 1214 |
-
"You can signup for a sandbox developer account <a href=\"%s\">here</a>. You "
|
| 1215 |
-
"need a developer account if you want to enable Sandbox mode for testing."
|
| 1216 |
-
msgstr ""
|
| 1217 |
-
"Sie können sich für einen Sandbox Developer Account <a href=\"%s"
|
| 1218 |
-
"\">hier</a> anmelden. Sie benötigen einen Entwickler Account, wenn Sie "
|
| 1219 |
-
"den Sandbox-Modus zum Testen aktivieren wollen."
|
| 1220 |
-
|
| 1221 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 1222 |
-
msgid "Misc. Settings"
|
| 1223 |
-
msgstr "Einstellungen"
|
| 1224 |
-
|
| 1225 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 1226 |
-
msgid "Enable PayPal Sandbox mode"
|
| 1227 |
-
msgstr "PayPal Sandbox-Modus aktivieren"
|
| 1228 |
-
|
| 1229 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 1230 |
-
msgid "Enable logging"
|
| 1231 |
-
msgstr "Logging aktivieren"
|
| 1232 |
-
|
| 1233 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 1234 |
-
msgid ""
|
| 1235 |
-
"The PayPal Adaptive Payments gateway can instantly pay your vendors their "
|
| 1236 |
-
"due commission (if enabled). Also used to mass pay vendors on a schedule / "
|
| 1237 |
-
"manual method (if enabled)."
|
| 1238 |
-
msgstr ""
|
| 1239 |
-
"Der PayPal Adaptive Payments Gateway kann Ihren Verkäufern sofort nach "
|
| 1240 |
-
"einem Verkauf die angefallene Provision automatisch auszahlen(sofern "
|
| 1241 |
-
"aktiviert). Es wird auch benutzt, um Massenzahlungen an die Verkäufer - "
|
| 1242 |
-
"manuell oder nach Zeitplan - auszuführen."
|
| 1243 |
-
|
| 1244 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1245 |
-
msgid "Gateway Disabled"
|
| 1246 |
-
msgstr "Gateway deaktiviert"
|
| 1247 |
-
|
| 1248 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1249 |
-
#, php-format
|
| 1250 |
-
msgid "%s does not support your store currency."
|
| 1251 |
-
msgstr "%s unterstützt nicht die im Shop eingestellte Währung."
|
| 1252 |
-
|
| 1253 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:369
|
| 1254 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:483
|
| 1255 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:150
|
| 1256 |
-
#, php-format
|
| 1257 |
-
msgid "Error: %s"
|
| 1258 |
-
msgstr "Fehler: %s"
|
| 1259 |
-
|
| 1260 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:378
|
| 1261 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:379
|
| 1262 |
-
#, php-format
|
| 1263 |
-
msgid "Error ID: %s. %s"
|
| 1264 |
-
msgstr "Fehler-ID: %s. %s"
|
| 1265 |
-
|
| 1266 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 1267 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 1268 |
-
msgstr ""
|
| 1269 |
-
"Keine Verkäufer gefunden, an die gezahlt werden kann. Vielleicht haben "
|
| 1270 |
-
"diese keine PayPal-Adresse hinterlegt?"
|
| 1271 |
-
|
| 1272 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:164
|
| 1273 |
-
msgid "All due commission has been paid for."
|
| 1274 |
-
msgstr "Alle ausstehenden Provisionszahlungen wurden ausgezahlt."
|
| 1275 |
-
|
| 1276 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:170
|
| 1277 |
-
msgid ""
|
| 1278 |
-
"All due commission has been paid for, but I could not clear it from their "
|
| 1279 |
-
"profiles due to an internal error. Commission will still be listed as due. "
|
| 1280 |
-
"Please manually mark the commission as paid from the Commissions page."
|
| 1281 |
-
msgstr ""
|
| 1282 |
-
"Alle offenen Provisionen wurden ausgezahlt. Auf Grund eines internen Fehlers "
|
| 1283 |
-
"konnten die Provisionen aber nicht auf den Status bezahlt gesetzt werden. "
|
| 1284 |
-
"Die Provisionen werden weiterhin als offen gelistet. Bitte manuell auf "
|
| 1285 |
-
"bezahlt setzen."
|
| 1286 |
-
|
| 1287 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:205
|
| 1288 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 1289 |
-
msgstr "WooCommerce: Massenzahlung für Verkäfer Update"
|
| 1290 |
-
|
| 1291 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:207
|
| 1292 |
-
msgid ""
|
| 1293 |
-
"Hello! A payment was just triggered to mass pay all vendors their due "
|
| 1294 |
-
"commission."
|
| 1295 |
-
msgstr ""
|
| 1296 |
-
"Hallo! Eine Massenzahlung wurde so eben ausgelöst um allen Verkä"
|
| 1297 |
-
"ufern ihre ausstehenden Provisionen zu zahlen."
|
| 1298 |
-
|
| 1299 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 1300 |
-
#, php-format
|
| 1301 |
-
msgid "Payment status: %s."
|
| 1302 |
-
msgstr "Auszahlungsstatus: %s"
|
| 1303 |
-
|
| 1304 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:209
|
| 1305 |
-
#, php-format
|
| 1306 |
-
msgid "Payment message: %s."
|
| 1307 |
-
msgstr "Nachricht zur Zahlung: %s"
|
| 1308 |
-
|
| 1309 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 1310 |
-
#, php-format
|
| 1311 |
-
msgid "Payment total: %s."
|
| 1312 |
-
msgstr "Zahlung gesamt: %s"
|
| 1313 |
-
|
| 1314 |
-
#: views/dashboard/denied.php:8
|
| 1315 |
-
msgid ""
|
| 1316 |
-
"Your account has not yet been approved to become a vendor. When it is, you "
|
| 1317 |
-
"will receive an email telling you that your account is approved!"
|
| 1318 |
-
msgstr ""
|
| 1319 |
-
"Ihr Benutzerprofil ist noch nicht als Verkäufer-Account freigeschaltet. "
|
| 1320 |
-
"Sie erhalten eine E-Mail sobald dies geschehen ist."
|
| 1321 |
-
|
| 1322 |
-
#: views/dashboard/denied.php:12
|
| 1323 |
-
msgid ""
|
| 1324 |
-
"Your account is not setup as a vendor yet. If you would like to register, "
|
| 1325 |
-
"please complete this page!"
|
| 1326 |
-
msgstr ""
|
| 1327 |
-
"Ihr Benutzerprofil ist noch nicht als Verkäufer freigeschaltet. Sollten "
|
| 1328 |
-
"Sie sich bewerben wollen, füllen Sie bitte diese Seite aus!"
|
| 1329 |
-
|
| 1330 |
-
#: views/dashboard/denied.php:53
|
| 1331 |
-
msgid "Submit"
|
| 1332 |
-
msgstr "Absenden"
|
| 1333 |
-
|
| 1334 |
-
#: views/dashboard/links.php:1
|
| 1335 |
-
msgid "Control Center"
|
| 1336 |
-
msgstr "Kontrollzentrum"
|
| 1337 |
-
|
| 1338 |
-
#: views/dashboard/links.php:3
|
| 1339 |
-
msgid "My shop"
|
| 1340 |
-
msgstr "Mein Shop"
|
| 1341 |
-
|
| 1342 |
-
#: views/dashboard/links.php:7
|
| 1343 |
-
msgid "My settings"
|
| 1344 |
-
msgstr "Meine Einstellungen"
|
| 1345 |
-
|
| 1346 |
-
#: views/dashboard/links.php:13
|
| 1347 |
-
msgid "Submit a product"
|
| 1348 |
-
msgstr "Produkt hinzufügen"
|
| 1349 |
-
|
| 1350 |
-
#: views/dashboard/orders.php:7 views/dashboard/orders.php:10
|
| 1351 |
-
msgid "Hide items"
|
| 1352 |
-
msgstr "Produkte verstecken"
|
| 1353 |
-
|
| 1354 |
-
#: views/dashboard/orders.php:8 views/dashboard/orders.php:58
|
| 1355 |
-
msgid "View items"
|
| 1356 |
-
msgstr "Produkte anzeigen"
|
| 1357 |
-
|
| 1358 |
-
#: views/dashboard/orders.php:27
|
| 1359 |
-
msgid "Links"
|
| 1360 |
-
msgstr "Links"
|
| 1361 |
-
|
| 1362 |
-
#: views/dashboard/orders.php:58
|
| 1363 |
-
msgid "Unmark shipped"
|
| 1364 |
-
msgstr "Markierung als versandt aufheben"
|
| 1365 |
-
|
| 1366 |
-
#: views/dashboard/orders.php:58
|
| 1367 |
-
msgid "Mark shipped"
|
| 1368 |
-
msgstr "Als versandt markieren"
|
| 1369 |
-
|
| 1370 |
-
#: views/dashboard/orders.php:90
|
| 1371 |
-
msgid "You have no orders during this period."
|
| 1372 |
-
msgstr "Sie haben keine Bestellungen in diesem Zeitraum."
|
| 1373 |
-
|
| 1374 |
-
#: views/dashboard/reports.php:1
|
| 1375 |
-
msgid "Sales Report"
|
| 1376 |
-
msgstr "Verkauf-Bericht"
|
| 1377 |
-
|
| 1378 |
-
#: views/dashboard/reports.php:20
|
| 1379 |
-
msgid "Rate"
|
| 1380 |
-
msgstr "Quote"
|
| 1381 |
-
|
| 1382 |
-
#: views/dashboard/reports.php:47
|
| 1383 |
-
msgid "Show Orders"
|
| 1384 |
-
msgstr "Zeige Bestellungen"
|
| 1385 |
-
|
| 1386 |
-
#: views/dashboard/reports.php:56
|
| 1387 |
-
msgid "Totals"
|
| 1388 |
-
msgstr "Gesamt"
|
| 1389 |
-
|
| 1390 |
-
#: views/dashboard/reports.php:71
|
| 1391 |
-
msgid "You have no sales during this period."
|
| 1392 |
-
msgstr "Sie haben keine Verkäufe innerhalb dieses Zeitraums."
|
| 1393 |
-
|
| 1394 |
-
#: views/dashboard/reports.php:82
|
| 1395 |
-
msgid "You haven't made any sales yet."
|
| 1396 |
-
msgstr "Sie haben noch nichts verkauft."
|
| 1397 |
-
|
| 1398 |
-
#: views/dashboard/settings/paypal-email-form.php:2
|
| 1399 |
-
msgid "PayPal Address"
|
| 1400 |
-
msgstr "PayPal-Adresse"
|
| 1401 |
-
|
| 1402 |
-
#: views/dashboard/settings/paypal-email-form.php:3
|
| 1403 |
-
msgid "Your PayPal address is used to send you your commission."
|
| 1404 |
-
msgstr ""
|
| 1405 |
-
"Ihre PayPal-Adresse wird verwendet, um angefallene Provisionen auszuzahlen."
|
| 1406 |
-
|
| 1407 |
-
#: views/dashboard/settings/seller-info.php:4
|
| 1408 |
-
msgid "This is displayed on each of your products."
|
| 1409 |
-
msgstr "Dies wird bei jedem Ihrer Produkte angezeigt."
|
| 1410 |
-
|
| 1411 |
-
#: views/dashboard/settings/settings.php:47
|
| 1412 |
-
msgid "Save"
|
| 1413 |
-
msgstr "Speichern"
|
| 1414 |
-
|
| 1415 |
-
#: views/dashboard/settings/shop-description.php:2
|
| 1416 |
-
msgid "Shop Description"
|
| 1417 |
-
msgstr "Shop-Beschreibung"
|
| 1418 |
-
|
| 1419 |
-
#: views/dashboard/settings/shop-description.php:3
|
| 1420 |
-
#, php-format
|
| 1421 |
-
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 1422 |
-
msgstr "Dies wird auf Ihrer <a href=\"%s\">Shop-Seite</a> angezeigt."
|
| 1423 |
-
|
| 1424 |
-
#: views/dashboard/settings/shop-name.php:2
|
| 1425 |
-
msgid "Shop Name"
|
| 1426 |
-
msgstr "Shop-Name"
|
| 1427 |
-
|
| 1428 |
-
#: views/dashboard/settings/shop-name.php:3
|
| 1429 |
-
msgid "Your shop name is public and must be unique."
|
| 1430 |
-
msgstr "Ihr Shop-Name ist öffentlich und muss einzigartig sein."
|
| 1431 |
-
|
| 1432 |
-
#: views/emails/admin-new-order.php:13
|
| 1433 |
-
#, php-format
|
| 1434 |
-
msgid "You have received an order from %s. Their order is as follows:"
|
| 1435 |
-
msgstr "Sie haben eine Bestellung von %s erhalten. Diese Bestellung lautet:"
|
| 1436 |
-
|
| 1437 |
-
#: views/emails/admin-new-order.php:17
|
| 1438 |
-
#: views/emails/notify-vendor-shipped.php:17
|
| 1439 |
-
#, php-format
|
| 1440 |
-
msgid "Order: %s"
|
| 1441 |
-
msgstr "Bestellung: %s"
|
| 1442 |
-
|
| 1443 |
-
#: views/emails/admin-new-order.php:24
|
| 1444 |
-
#: views/emails/notify-vendor-shipped.php:24
|
| 1445 |
-
msgid "Price"
|
| 1446 |
-
msgstr "Preis"
|
| 1447 |
-
|
| 1448 |
-
#: views/emails/admin-new-order.php:50
|
| 1449 |
-
#: views/emails/notify-vendor-shipped.php:50
|
| 1450 |
-
msgid "Customer details"
|
| 1451 |
-
msgstr "Kundendetails"
|
| 1452 |
-
|
| 1453 |
-
#: views/emails/admin-new-order.php:53
|
| 1454 |
-
#: views/emails/notify-vendor-shipped.php:53
|
| 1455 |
-
msgid "Email:"
|
| 1456 |
-
msgstr "E-Mail:"
|
| 1457 |
-
|
| 1458 |
-
#: views/emails/admin-new-order.php:56
|
| 1459 |
-
#: views/emails/notify-vendor-shipped.php:56
|
| 1460 |
-
msgid "Tel:"
|
| 1461 |
-
msgstr "Tel:"
|
| 1462 |
-
|
| 1463 |
-
#: views/emails/application-status.php:5
|
| 1464 |
-
#, php-format
|
| 1465 |
-
msgid "Hi there. This is a notification about a vendor application on %s."
|
| 1466 |
-
msgstr ""
|
| 1467 |
-
"Hallo. Dies ist eine Benachrichtigung für eine Verkäufer-Bewerbung auf "
|
| 1468 |
-
"%s."
|
| 1469 |
-
|
| 1470 |
-
#: views/emails/application-status.php:8
|
| 1471 |
-
#, php-format
|
| 1472 |
-
msgid "Application status: %s"
|
| 1473 |
-
msgstr "Bewerbungs-Status: %s"
|
| 1474 |
-
|
| 1475 |
-
#: views/emails/application-status.php:9
|
| 1476 |
-
#, php-format
|
| 1477 |
-
msgid "Applicant username: %s"
|
| 1478 |
-
msgstr "Bewerbungs-Benutzername: %s"
|
| 1479 |
-
|
| 1480 |
-
#: views/emails/new-product.php:5
|
| 1481 |
-
#, php-format
|
| 1482 |
-
msgid "Hi there. This is a notification about a new product on %s."
|
| 1483 |
-
msgstr "Hallo. Dies ist eine Benachrichtigung für ein neues Produkt auf %s."
|
| 1484 |
-
|
| 1485 |
-
#: views/emails/new-product.php:8
|
| 1486 |
-
#, php-format
|
| 1487 |
-
msgid "Product title: %s"
|
| 1488 |
-
msgstr "Produkttitel: %s"
|
| 1489 |
-
|
| 1490 |
-
#: views/emails/new-product.php:9
|
| 1491 |
-
#, php-format
|
| 1492 |
-
msgid "Submitted by: %s"
|
| 1493 |
-
msgstr "Eingereicht von: %s"
|
| 1494 |
-
|
| 1495 |
-
#: views/emails/new-product.php:10
|
| 1496 |
-
#, php-format
|
| 1497 |
-
msgid "Edit product: %s"
|
| 1498 |
-
msgstr "Produkte bearbeiten: %s"
|
| 1499 |
-
|
| 1500 |
-
#: views/emails/notify-vendor-shipped.php:13
|
| 1501 |
-
msgid ""
|
| 1502 |
-
"A vendor has marked part of your order as shipped. The items that are "
|
| 1503 |
-
"shipped are as follows:"
|
| 1504 |
-
msgstr ""
|
| 1505 |
-
"Ein Verkäufer hat Teil Ihrer Bestellung als versandt markiert. Die "
|
| 1506 |
-
"versandten Produkte sind wie folgt:"
|
| 1507 |
-
|
| 1508 |
-
#: views/orders/comments/add-new-comment.php:11
|
| 1509 |
-
msgid "Add comment"
|
| 1510 |
-
msgstr "Kommentar hinzufügen"
|
| 1511 |
-
|
| 1512 |
-
#: views/orders/comments/existing-comments.php:9
|
| 1513 |
-
#, php-format
|
| 1514 |
-
msgid "added %s ago"
|
| 1515 |
-
msgstr "hinzugefügt vor %s"
|
| 1516 |
-
|
| 1517 |
-
#: views/orders/csv-export.php:6
|
| 1518 |
-
msgid "Export orders"
|
| 1519 |
-
msgstr "Bestellungen exportieren"
|
| 1520 |
-
|
| 1521 |
-
#: views/orders/customer-note/customer-note.php:4
|
| 1522 |
-
msgid "Customer note"
|
| 1523 |
-
msgstr "Kunden-Benachrichtigung"
|
| 1524 |
-
|
| 1525 |
-
#: views/orders/customer-note/customer-note.php:8
|
| 1526 |
-
msgid "No customer note."
|
| 1527 |
-
msgstr "Keine Kunden-Benachrichtung"
|
| 1528 |
-
|
| 1529 |
-
#: views/orders/orders.php:84
|
| 1530 |
-
#, php-format
|
| 1531 |
-
msgid "Comments (%s)"
|
| 1532 |
-
msgstr "Kommentare (%s)"
|
| 1533 |
-
|
| 1534 |
-
#: views/orders/shipping/shipping-form.php:46
|
| 1535 |
-
msgid "Provider:"
|
| 1536 |
-
msgstr "Versandunternehmen:"
|
| 1537 |
-
|
| 1538 |
-
#: views/orders/shipping/shipping-form.php:48
|
| 1539 |
-
msgid "Custom Provider"
|
| 1540 |
-
msgstr "Benutzerdefiniertes Versandunternehmen"
|
| 1541 |
-
|
| 1542 |
-
#: views/orders/shipping/shipping-form.php:68
|
| 1543 |
-
msgid "Provider Name:"
|
| 1544 |
-
msgstr "Name des Versandunternehmens:"
|
| 1545 |
-
|
| 1546 |
-
#: views/orders/shipping/shipping-form.php:76
|
| 1547 |
-
msgid "Tracking number:"
|
| 1548 |
-
msgstr "Sendungsnummer:"
|
| 1549 |
-
|
| 1550 |
-
#: views/orders/shipping/shipping-form.php:84
|
| 1551 |
-
msgid "Tracking link:"
|
| 1552 |
-
msgstr "Link zur Sendungsverfolgung:"
|
| 1553 |
-
|
| 1554 |
-
#: views/orders/shipping/shipping-form.php:93
|
| 1555 |
-
msgid "Date shipped:"
|
| 1556 |
-
msgstr "Versanddatum:"
|
| 1557 |
-
|
| 1558 |
-
#: views/orders/shipping/shipping-form.php:101
|
| 1559 |
-
msgid "Preview:"
|
| 1560 |
-
msgstr "Vorschau:"
|
| 1561 |
-
|
| 1562 |
-
#: views/orders/shipping/shipping-form.php:101
|
| 1563 |
-
msgid "Click here to track your shipment"
|
| 1564 |
-
msgstr "Hier klicken, um Ihre Sendung zu verfolgen"
|
| 1565 |
-
|
| 1566 |
-
#: views/orders/shipping/shipping-form.php:110
|
| 1567 |
-
msgid "Update tracking number"
|
| 1568 |
-
msgstr "Sendungsnummer aktualisieren"
|
| 1569 |
-
|
| 1570 |
-
#: views/orders/shipping/shipping-form.php:112
|
| 1571 |
-
msgid "Mark as shipped"
|
| 1572 |
-
msgstr "Als versandt markieren"
|
| 1573 |
-
|
| 1574 |
-
#: views/orders/table-body.php:25
|
| 1575 |
-
#, php-format
|
| 1576 |
-
msgid "Quantity: %d"
|
| 1577 |
-
msgstr "Menge: %d"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/wcvendors-es_ES.mo
DELETED
|
Binary file
|
languages/wcvendors-es_ES.po
DELETED
|
@@ -1,2745 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: WC Vendors\n"
|
| 4 |
-
"POT-Creation-Date: 2017-05-21 19:18-0300\n"
|
| 5 |
-
"PO-Revision-Date: 2017-05-25 04:16-0300\n"
|
| 6 |
-
"Last-Translator: Dto2y3d <masyoututoriales@gmail.com>\n"
|
| 7 |
-
"Language-Team: WC Vendors <support@wcvendors.com>\n"
|
| 8 |
-
"Language: es\n"
|
| 9 |
-
"MIME-Version: 1.0\n"
|
| 10 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
-
"X-Generator: Poedit 2.0.1\n"
|
| 13 |
-
"X-Poedit-Basepath: .\n"
|
| 14 |
-
"Plural-Forms: nplurals=2; plural=n != 1;\n"
|
| 15 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 16 |
-
"X-Poedit-KeywordsList: __;_e\n"
|
| 17 |
-
"X-Poedit-SearchPath-0: .\n"
|
| 18 |
-
"X-Poedit-SearchPath-1: ..\n"
|
| 19 |
-
|
| 20 |
-
#: ../class-wc-vendors.php:51 ../trunk/class-wc-vendors.php:51
|
| 21 |
-
msgid ""
|
| 22 |
-
"WC Vendors requires WooCommerce to run. Please install WooCommerce and "
|
| 23 |
-
"activate before attempting to activate again."
|
| 24 |
-
msgstr ""
|
| 25 |
-
"WC Vendors necesita WooCommerce para funcionar. Por favor instala y activa "
|
| 26 |
-
"WooCommerce antes de intentar activar WC Vendors."
|
| 27 |
-
|
| 28 |
-
#: ../class-wc-vendors.php:100 ../classes/admin/class-admin-reports.php:41
|
| 29 |
-
#: ../classes/admin/class-admin-users.php:384 ../trunk/class-wc-vendors.php:100
|
| 30 |
-
#: ../trunk/classes/admin/class-admin-reports.php:41
|
| 31 |
-
#: ../trunk/classes/admin/class-admin-users.php:384
|
| 32 |
-
msgid "WC Vendors"
|
| 33 |
-
msgstr "WC Vendors"
|
| 34 |
-
|
| 35 |
-
#: ../class-wc-vendors.php:128 ../trunk/class-wc-vendors.php:128
|
| 36 |
-
msgid ""
|
| 37 |
-
"<b>WC Vendors is inactive</b>. WC Vendors requires a minimum of WooCommerce "
|
| 38 |
-
"v2.7.0."
|
| 39 |
-
msgstr ""
|
| 40 |
-
"<b>WC Vendors está deshabilitado</b>. WC Vendors requiere como mínimo "
|
| 41 |
-
"WooCommerce v2.7.0."
|
| 42 |
-
|
| 43 |
-
#: ../class-wc-vendors.php:298 ../classes/admin/settings/sf-options.php:192
|
| 44 |
-
#: ../trunk/class-wc-vendors.php:298
|
| 45 |
-
#: ../trunk/classes/admin/settings/sf-options.php:192
|
| 46 |
-
msgid "Capabilities"
|
| 47 |
-
msgstr "Capacidades"
|
| 48 |
-
|
| 49 |
-
#: ../class-wc-vendors.php:321 ../classes/admin/class-admin-page.php:153
|
| 50 |
-
#: ../classes/admin/class-admin-page.php:416
|
| 51 |
-
#: ../classes/admin/class-admin-reports.php:178
|
| 52 |
-
#: ../classes/admin/class-admin-reports.php:461
|
| 53 |
-
#: ../classes/admin/class-product-meta.php:46
|
| 54 |
-
#: ../classes/admin/class-product-meta.php:187
|
| 55 |
-
#: ../classes/admin/class-product-meta.php:223 ../classes/class-install.php:51
|
| 56 |
-
#: ../classes/class-install.php:105 ../trunk/class-wc-vendors.php:321
|
| 57 |
-
#: ../trunk/classes/admin/class-admin-page.php:153
|
| 58 |
-
#: ../trunk/classes/admin/class-admin-page.php:416
|
| 59 |
-
#: ../trunk/classes/admin/class-admin-reports.php:178
|
| 60 |
-
#: ../trunk/classes/admin/class-admin-reports.php:461
|
| 61 |
-
#: ../trunk/classes/admin/class-product-meta.php:46
|
| 62 |
-
#: ../trunk/classes/admin/class-product-meta.php:187
|
| 63 |
-
#: ../trunk/classes/admin/class-product-meta.php:223
|
| 64 |
-
#: ../trunk/classes/class-install.php:51 ../trunk/classes/class-install.php:105
|
| 65 |
-
msgid "Vendor"
|
| 66 |
-
msgstr "Vendedor"
|
| 67 |
-
|
| 68 |
-
#: ../class-wc-vendors.php:323 ../classes/admin/settings/sf-options.php:4
|
| 69 |
-
#: ../trunk/class-wc-vendors.php:323
|
| 70 |
-
#: ../trunk/classes/admin/settings/sf-options.php:4
|
| 71 |
-
msgid "General"
|
| 72 |
-
msgstr "General"
|
| 73 |
-
|
| 74 |
-
#: ../class-wc-vendors.php:361 ../trunk/class-wc-vendors.php:361
|
| 75 |
-
msgid "Documentation/KB"
|
| 76 |
-
msgstr "Documentación"
|
| 77 |
-
|
| 78 |
-
#: ../class-wc-vendors.php:362 ../trunk/class-wc-vendors.php:362
|
| 79 |
-
msgid "Help Forums"
|
| 80 |
-
msgstr "Foros de ayuda"
|
| 81 |
-
|
| 82 |
-
#: ../class-wc-vendors.php:363 ../trunk/class-wc-vendors.php:363
|
| 83 |
-
msgid "Paid Support"
|
| 84 |
-
msgstr "Soporte pago"
|
| 85 |
-
|
| 86 |
-
#: ../classes/admin/class-admin-page.php:31
|
| 87 |
-
#: ../trunk/classes/admin/class-admin-page.php:31
|
| 88 |
-
msgid "Vendors shipped"
|
| 89 |
-
msgstr "Vendedores han enviado"
|
| 90 |
-
|
| 91 |
-
#: ../classes/admin/class-admin-page.php:56
|
| 92 |
-
#: ../trunk/classes/admin/class-admin-page.php:56
|
| 93 |
-
msgid "Vendors Shipped"
|
| 94 |
-
msgstr "Vendedores han enviado"
|
| 95 |
-
|
| 96 |
-
#: ../classes/admin/class-admin-page.php:82
|
| 97 |
-
#: ../classes/admin/class-admin-page.php:277
|
| 98 |
-
#: ../classes/admin/class-admin-page.php:417
|
| 99 |
-
#: ../classes/admin/class-product-meta.php:151
|
| 100 |
-
#: ../classes/admin/class-product-meta.php:167
|
| 101 |
-
#: ../templates/dashboard/reports.php:19
|
| 102 |
-
#: ../trunk/classes/admin/class-admin-page.php:82
|
| 103 |
-
#: ../trunk/classes/admin/class-admin-page.php:277
|
| 104 |
-
#: ../trunk/classes/admin/class-admin-page.php:417
|
| 105 |
-
#: ../trunk/classes/admin/class-product-meta.php:151
|
| 106 |
-
#: ../trunk/classes/admin/class-product-meta.php:167
|
| 107 |
-
#: ../trunk/templates/dashboard/reports.php:19
|
| 108 |
-
msgid "Commission"
|
| 109 |
-
msgstr "Comisión"
|
| 110 |
-
|
| 111 |
-
#: ../classes/admin/class-admin-page.php:107
|
| 112 |
-
#: ../trunk/classes/admin/class-admin-page.php:107
|
| 113 |
-
msgid "Reset WC Vendors roles "
|
| 114 |
-
msgstr "Resetear roles de WC Vendors "
|
| 115 |
-
|
| 116 |
-
#: ../classes/admin/class-admin-page.php:108
|
| 117 |
-
#: ../trunk/classes/admin/class-admin-page.php:108
|
| 118 |
-
msgid "Reset WC Vendor Roles"
|
| 119 |
-
msgstr "Resetear roles de WC Vendors"
|
| 120 |
-
|
| 121 |
-
#: ../classes/admin/class-admin-page.php:109
|
| 122 |
-
#: ../trunk/classes/admin/class-admin-page.php:109
|
| 123 |
-
msgid ""
|
| 124 |
-
"This will reset the wcvendors roles ( vendor & pending_vendor ), back to the "
|
| 125 |
-
"default capabilities."
|
| 126 |
-
msgstr ""
|
| 127 |
-
"Esto resetea los roles de WC Vendor (vender & pending_vendor) a sus "
|
| 128 |
-
"capacidades por defecto."
|
| 129 |
-
|
| 130 |
-
#: ../classes/admin/class-admin-page.php:114
|
| 131 |
-
#: ../trunk/classes/admin/class-admin-page.php:114
|
| 132 |
-
msgid "Reset WC Vendors "
|
| 133 |
-
msgstr "Resetear WC Vendors "
|
| 134 |
-
|
| 135 |
-
#: ../classes/admin/class-admin-page.php:115
|
| 136 |
-
#: ../trunk/classes/admin/class-admin-page.php:115
|
| 137 |
-
msgid "Reset WC Vendors Settings"
|
| 138 |
-
msgstr "Restear ajustes de WC Vendors"
|
| 139 |
-
|
| 140 |
-
#: ../classes/admin/class-admin-page.php:116
|
| 141 |
-
#: ../trunk/classes/admin/class-admin-page.php:116
|
| 142 |
-
msgid ""
|
| 143 |
-
"This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings."
|
| 144 |
-
msgstr ""
|
| 145 |
-
"Esto resetea WC Vendors a la configuración original. Esto borra toda tu "
|
| 146 |
-
"configuración."
|
| 147 |
-
|
| 148 |
-
#: ../classes/admin/class-admin-page.php:156 ../classes/class-install.php:98
|
| 149 |
-
#: ../classes/class-install.php:254
|
| 150 |
-
#: ../trunk/classes/admin/class-admin-page.php:156
|
| 151 |
-
#: ../trunk/classes/class-install.php:98 ../trunk/classes/class-install.php:254
|
| 152 |
-
msgid "Pending Vendor"
|
| 153 |
-
msgstr "Vendedor Pendiente"
|
| 154 |
-
|
| 155 |
-
#: ../classes/admin/class-admin-page.php:162
|
| 156 |
-
#: ../trunk/classes/admin/class-admin-page.php:162
|
| 157 |
-
msgid "WC Vendor roles successfully reset."
|
| 158 |
-
msgstr "Roles de WC Vendors reseteados."
|
| 159 |
-
|
| 160 |
-
#: ../classes/admin/class-admin-page.php:176
|
| 161 |
-
#: ../trunk/classes/admin/class-admin-page.php:176
|
| 162 |
-
msgid "WC Vendors was successfully reset. All settings have been reset."
|
| 163 |
-
msgstr ""
|
| 164 |
-
"Roles de WC Vendors reseteados. Todas las configuraciones se han reseteado."
|
| 165 |
-
|
| 166 |
-
#: ../classes/admin/class-admin-page.php:190
|
| 167 |
-
#: ../trunk/classes/admin/class-admin-page.php:190
|
| 168 |
-
msgid "Select a Vendor"
|
| 169 |
-
msgstr "Seleccionar un vendedor"
|
| 170 |
-
|
| 171 |
-
#: ../classes/admin/class-admin-page.php:414
|
| 172 |
-
#: ../classes/admin/class-admin-reports.php:177
|
| 173 |
-
#: ../templates/dashboard/reports.php:17
|
| 174 |
-
#: ../templates/emails/admin-new-order.php:22
|
| 175 |
-
#: ../templates/emails/notify-vendor-shipped.php:26
|
| 176 |
-
#: ../templates/emails/vendor-new-order.php:30
|
| 177 |
-
#: ../trunk/classes/admin/class-admin-page.php:414
|
| 178 |
-
#: ../trunk/classes/admin/class-admin-reports.php:177
|
| 179 |
-
#: ../trunk/templates/dashboard/reports.php:17
|
| 180 |
-
#: ../trunk/templates/emails/admin-new-order.php:22
|
| 181 |
-
#: ../trunk/templates/emails/notify-vendor-shipped.php:26
|
| 182 |
-
#: ../trunk/templates/emails/vendor-new-order.php:30
|
| 183 |
-
msgid "Product"
|
| 184 |
-
msgstr "Producto"
|
| 185 |
-
|
| 186 |
-
#: ../classes/admin/class-admin-page.php:415
|
| 187 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:319
|
| 188 |
-
#: ../trunk/classes/admin/class-admin-page.php:415
|
| 189 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:319
|
| 190 |
-
msgid "Order ID"
|
| 191 |
-
msgstr "Pedido"
|
| 192 |
-
|
| 193 |
-
#: ../classes/admin/class-admin-page.php:418
|
| 194 |
-
#: ../classes/admin/class-admin-reports.php:350
|
| 195 |
-
#: ../classes/admin/settings/sf-options.php:52
|
| 196 |
-
#: ../classes/admin/settings/sf-options.php:136
|
| 197 |
-
#: ../templates/dashboard/orders.php:45 ../templates/orders/orders.php:111
|
| 198 |
-
#: ../trunk/classes/admin/class-admin-page.php:418
|
| 199 |
-
#: ../trunk/classes/admin/class-admin-reports.php:350
|
| 200 |
-
#: ../trunk/classes/admin/settings/sf-options.php:52
|
| 201 |
-
#: ../trunk/classes/admin/settings/sf-options.php:136
|
| 202 |
-
#: ../trunk/templates/dashboard/orders.php:45
|
| 203 |
-
#: ../trunk/templates/orders/orders.php:111
|
| 204 |
-
msgid "Shipping"
|
| 205 |
-
msgstr "Envíos"
|
| 206 |
-
|
| 207 |
-
#: ../classes/admin/class-admin-page.php:419
|
| 208 |
-
#: ../classes/admin/class-admin-reports.php:349
|
| 209 |
-
#: ../trunk/classes/admin/class-admin-page.php:419
|
| 210 |
-
#: ../trunk/classes/admin/class-admin-reports.php:349
|
| 211 |
-
msgid "Tax"
|
| 212 |
-
msgstr "Impuesto"
|
| 213 |
-
|
| 214 |
-
#: ../classes/admin/class-admin-page.php:420
|
| 215 |
-
#: ../classes/admin/class-admin-reports.php:179
|
| 216 |
-
#: ../classes/admin/class-admin-reports.php:377
|
| 217 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:322
|
| 218 |
-
#: ../templates/dashboard/orders.php:46
|
| 219 |
-
#: ../trunk/classes/admin/class-admin-page.php:420
|
| 220 |
-
#: ../trunk/classes/admin/class-admin-reports.php:179
|
| 221 |
-
#: ../trunk/classes/admin/class-admin-reports.php:377
|
| 222 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:322
|
| 223 |
-
#: ../trunk/templates/dashboard/orders.php:46
|
| 224 |
-
msgid "Total"
|
| 225 |
-
msgstr "Total"
|
| 226 |
-
|
| 227 |
-
#: ../classes/admin/class-admin-page.php:421
|
| 228 |
-
#: ../classes/admin/class-admin-reports.php:181
|
| 229 |
-
#: ../classes/admin/class-admin-reports.php:464
|
| 230 |
-
#: ../trunk/classes/admin/class-admin-page.php:421
|
| 231 |
-
#: ../trunk/classes/admin/class-admin-reports.php:181
|
| 232 |
-
#: ../trunk/classes/admin/class-admin-reports.php:464
|
| 233 |
-
msgid "Status"
|
| 234 |
-
msgstr "Estado"
|
| 235 |
-
|
| 236 |
-
#: ../classes/admin/class-admin-page.php:422
|
| 237 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:324
|
| 238 |
-
#: ../classes/front/orders/class-orders.php:257
|
| 239 |
-
#: ../templates/dashboard/orders.php:47
|
| 240 |
-
#: ../trunk/classes/admin/class-admin-page.php:422
|
| 241 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:324
|
| 242 |
-
#: ../trunk/classes/front/orders/class-orders.php:257
|
| 243 |
-
#: ../trunk/templates/dashboard/orders.php:47
|
| 244 |
-
msgid "Date"
|
| 245 |
-
msgstr "Fecha"
|
| 246 |
-
|
| 247 |
-
#: ../classes/admin/class-admin-page.php:466
|
| 248 |
-
#: ../trunk/classes/admin/class-admin-page.php:466
|
| 249 |
-
msgid "Mark paid"
|
| 250 |
-
msgstr "Marcar pagado"
|
| 251 |
-
|
| 252 |
-
#: ../classes/admin/class-admin-page.php:467
|
| 253 |
-
#: ../trunk/classes/admin/class-admin-page.php:467
|
| 254 |
-
msgid "Mark due"
|
| 255 |
-
msgstr "Marcar adeudado"
|
| 256 |
-
|
| 257 |
-
#: ../classes/admin/class-admin-page.php:468
|
| 258 |
-
#: ../trunk/classes/admin/class-admin-page.php:468
|
| 259 |
-
msgid "Mark reversed"
|
| 260 |
-
msgstr "Marcar revertido"
|
| 261 |
-
|
| 262 |
-
#: ../classes/admin/class-admin-page.php:495
|
| 263 |
-
#: ../trunk/classes/admin/class-admin-page.php:495
|
| 264 |
-
msgid "Filter"
|
| 265 |
-
msgstr "Filtrar"
|
| 266 |
-
|
| 267 |
-
#: ../classes/admin/class-admin-page.php:530
|
| 268 |
-
#: ../trunk/classes/admin/class-admin-page.php:530
|
| 269 |
-
msgid "Show all dates"
|
| 270 |
-
msgstr "Todas las fechas"
|
| 271 |
-
|
| 272 |
-
#: ../classes/admin/class-admin-page.php:543
|
| 273 |
-
#: ../trunk/classes/admin/class-admin-page.php:543
|
| 274 |
-
#, php-format
|
| 275 |
-
msgid "%1$s %2$d"
|
| 276 |
-
msgstr "%1$s %2$d"
|
| 277 |
-
|
| 278 |
-
#: ../classes/admin/class-admin-page.php:565
|
| 279 |
-
#: ../trunk/classes/admin/class-admin-page.php:565
|
| 280 |
-
msgid "Show all Statuses"
|
| 281 |
-
msgstr "Ver todos los estados"
|
| 282 |
-
|
| 283 |
-
#: ../classes/admin/class-admin-page.php:566
|
| 284 |
-
#: ../classes/admin/class-admin-reports.php:353
|
| 285 |
-
#: ../classes/admin/class-admin-reports.php:446
|
| 286 |
-
#: ../classes/class-commission.php:66
|
| 287 |
-
#: ../trunk/classes/admin/class-admin-page.php:566
|
| 288 |
-
#: ../trunk/classes/admin/class-admin-reports.php:353
|
| 289 |
-
#: ../trunk/classes/admin/class-admin-reports.php:446
|
| 290 |
-
#: ../trunk/classes/class-commission.php:66
|
| 291 |
-
msgid "Due"
|
| 292 |
-
msgstr "Adeudado"
|
| 293 |
-
|
| 294 |
-
#: ../classes/admin/class-admin-page.php:567
|
| 295 |
-
#: ../classes/admin/class-admin-reports.php:352
|
| 296 |
-
#: ../classes/admin/class-admin-reports.php:447
|
| 297 |
-
#: ../classes/class-commission.php:67
|
| 298 |
-
#: ../trunk/classes/admin/class-admin-page.php:567
|
| 299 |
-
#: ../trunk/classes/admin/class-admin-reports.php:352
|
| 300 |
-
#: ../trunk/classes/admin/class-admin-reports.php:447
|
| 301 |
-
#: ../trunk/classes/class-commission.php:67
|
| 302 |
-
msgid "Paid"
|
| 303 |
-
msgstr "Pagado"
|
| 304 |
-
|
| 305 |
-
#: ../classes/admin/class-admin-page.php:568
|
| 306 |
-
#: ../classes/admin/class-admin-reports.php:351
|
| 307 |
-
#: ../classes/admin/class-admin-reports.php:448
|
| 308 |
-
#: ../classes/class-commission.php:68
|
| 309 |
-
#: ../trunk/classes/admin/class-admin-page.php:568
|
| 310 |
-
#: ../trunk/classes/admin/class-admin-reports.php:351
|
| 311 |
-
#: ../trunk/classes/admin/class-admin-reports.php:448
|
| 312 |
-
#: ../trunk/classes/class-commission.php:68
|
| 313 |
-
msgid "Reversed"
|
| 314 |
-
msgstr "Revertido"
|
| 315 |
-
|
| 316 |
-
#: ../classes/admin/class-admin-page.php:621
|
| 317 |
-
#: ../trunk/classes/admin/class-admin-page.php:621
|
| 318 |
-
msgid "Commission marked paid."
|
| 319 |
-
msgstr "Comisión marcada pagada."
|
| 320 |
-
|
| 321 |
-
#: ../classes/admin/class-admin-page.php:628
|
| 322 |
-
#: ../trunk/classes/admin/class-admin-page.php:628
|
| 323 |
-
msgid "Commission marked due."
|
| 324 |
-
msgstr "Comisión marcada adeudada."
|
| 325 |
-
|
| 326 |
-
#: ../classes/admin/class-admin-page.php:635
|
| 327 |
-
#: ../trunk/classes/admin/class-admin-page.php:635
|
| 328 |
-
msgid "Commission marked reversed."
|
| 329 |
-
msgstr "Comisión marcada revertida."
|
| 330 |
-
|
| 331 |
-
#: ../classes/admin/class-admin-reports.php:44
|
| 332 |
-
#: ../trunk/classes/admin/class-admin-reports.php:44
|
| 333 |
-
msgid "Overview"
|
| 334 |
-
msgstr "Resumen"
|
| 335 |
-
|
| 336 |
-
#: ../classes/admin/class-admin-reports.php:50
|
| 337 |
-
#: ../trunk/classes/admin/class-admin-reports.php:50
|
| 338 |
-
msgid "Commission by vendor"
|
| 339 |
-
msgstr "Comisión por vendedor"
|
| 340 |
-
|
| 341 |
-
#: ../classes/admin/class-admin-reports.php:56
|
| 342 |
-
#: ../trunk/classes/admin/class-admin-reports.php:56
|
| 343 |
-
msgid "Commission by product"
|
| 344 |
-
msgstr "Comisión por producto"
|
| 345 |
-
|
| 346 |
-
#: ../classes/admin/class-admin-reports.php:62
|
| 347 |
-
#: ../classes/admin/class-admin-reports.php:348
|
| 348 |
-
#: ../trunk/classes/admin/class-admin-reports.php:62
|
| 349 |
-
#: ../trunk/classes/admin/class-admin-reports.php:348
|
| 350 |
-
msgid "Commission Totals"
|
| 351 |
-
msgstr "Totales de comisión"
|
| 352 |
-
|
| 353 |
-
#: ../classes/admin/class-admin-reports.php:63
|
| 354 |
-
#: ../trunk/classes/admin/class-admin-reports.php:63
|
| 355 |
-
msgid ""
|
| 356 |
-
"Commission totals for all vendors includes shipping and taxes. By default no "
|
| 357 |
-
"date range is used and all due commissions are returned. Use the date range "
|
| 358 |
-
"to filter."
|
| 359 |
-
msgstr ""
|
| 360 |
-
"Totales de comisiones para todos los vendedores incluyendo envíos e "
|
| 361 |
-
"impuestos. Por defecto no se utilizan rangos de fechas y se muestran todas "
|
| 362 |
-
"las comisiones adeudadas. Utiliza los rangos de fechas para filtrar."
|
| 363 |
-
|
| 364 |
-
#: ../classes/admin/class-admin-reports.php:124
|
| 365 |
-
#: ../classes/admin/class-admin-reports.php:440
|
| 366 |
-
#: ../templates/dashboard/date-picker.php:3
|
| 367 |
-
#: ../trunk/classes/admin/class-admin-reports.php:124
|
| 368 |
-
#: ../trunk/classes/admin/class-admin-reports.php:440
|
| 369 |
-
#: ../trunk/templates/dashboard/date-picker.php:3
|
| 370 |
-
msgid "From:"
|
| 371 |
-
msgstr "Desde:"
|
| 372 |
-
|
| 373 |
-
#: ../classes/admin/class-admin-reports.php:126
|
| 374 |
-
#: ../classes/admin/class-admin-reports.php:442
|
| 375 |
-
#: ../templates/dashboard/date-picker.php:7
|
| 376 |
-
#: ../trunk/classes/admin/class-admin-reports.php:126
|
| 377 |
-
#: ../trunk/classes/admin/class-admin-reports.php:442
|
| 378 |
-
#: ../trunk/templates/dashboard/date-picker.php:7
|
| 379 |
-
msgid "To:"
|
| 380 |
-
msgstr "Hasta:"
|
| 381 |
-
|
| 382 |
-
#: ../classes/admin/class-admin-reports.php:128
|
| 383 |
-
#: ../classes/admin/class-admin-reports.php:286
|
| 384 |
-
#: ../classes/admin/class-admin-reports.php:451
|
| 385 |
-
#: ../templates/dashboard/date-picker.php:12
|
| 386 |
-
#: ../trunk/classes/admin/class-admin-reports.php:128
|
| 387 |
-
#: ../trunk/classes/admin/class-admin-reports.php:286
|
| 388 |
-
#: ../trunk/classes/admin/class-admin-reports.php:451
|
| 389 |
-
#: ../trunk/templates/dashboard/date-picker.php:12
|
| 390 |
-
msgid "Show"
|
| 391 |
-
msgstr "Ver"
|
| 392 |
-
|
| 393 |
-
#: ../classes/admin/class-admin-reports.php:134
|
| 394 |
-
#: ../trunk/classes/admin/class-admin-reports.php:134
|
| 395 |
-
msgid "Total paid in range"
|
| 396 |
-
msgstr "Total pagado en el rango"
|
| 397 |
-
|
| 398 |
-
#: ../classes/admin/class-admin-reports.php:137
|
| 399 |
-
#: ../classes/admin/class-admin-reports.php:144
|
| 400 |
-
#: ../classes/admin/class-admin-reports.php:151
|
| 401 |
-
#: ../trunk/classes/admin/class-admin-reports.php:137
|
| 402 |
-
#: ../trunk/classes/admin/class-admin-reports.php:144
|
| 403 |
-
#: ../trunk/classes/admin/class-admin-reports.php:151
|
| 404 |
-
msgid "n/a"
|
| 405 |
-
msgstr "N/A"
|
| 406 |
-
|
| 407 |
-
#: ../classes/admin/class-admin-reports.php:141
|
| 408 |
-
#: ../trunk/classes/admin/class-admin-reports.php:141
|
| 409 |
-
msgid "Total due in range"
|
| 410 |
-
msgstr "Total adeudado en el rango"
|
| 411 |
-
|
| 412 |
-
#: ../classes/admin/class-admin-reports.php:148
|
| 413 |
-
#: ../trunk/classes/admin/class-admin-reports.php:148
|
| 414 |
-
msgid "Total reversed in range"
|
| 415 |
-
msgstr "Total revertido en el rango"
|
| 416 |
-
|
| 417 |
-
#: ../classes/admin/class-admin-reports.php:158
|
| 418 |
-
#: ../trunk/classes/admin/class-admin-reports.php:158
|
| 419 |
-
msgid "Recent Commission"
|
| 420 |
-
msgstr "Comisión reciente"
|
| 421 |
-
|
| 422 |
-
#: ../classes/admin/class-admin-reports.php:176
|
| 423 |
-
#: ../classes/front/orders/class-orders.php:249
|
| 424 |
-
#: ../templates/dashboard/orders.php:44
|
| 425 |
-
#: ../trunk/classes/admin/class-admin-reports.php:176
|
| 426 |
-
#: ../trunk/classes/front/orders/class-orders.php:249
|
| 427 |
-
#: ../trunk/templates/dashboard/orders.php:44
|
| 428 |
-
msgid "Order"
|
| 429 |
-
msgstr "Pedido"
|
| 430 |
-
|
| 431 |
-
#: ../classes/admin/class-admin-reports.php:180
|
| 432 |
-
#: ../trunk/classes/admin/class-admin-reports.php:180
|
| 433 |
-
msgid "Date & Time"
|
| 434 |
-
msgstr "Fecha & hora"
|
| 435 |
-
|
| 436 |
-
#: ../classes/admin/class-admin-reports.php:189
|
| 437 |
-
#: ../trunk/classes/admin/class-admin-reports.php:189
|
| 438 |
-
msgid "N/A"
|
| 439 |
-
msgstr "N/A"
|
| 440 |
-
|
| 441 |
-
#: ../classes/admin/class-admin-reports.php:194
|
| 442 |
-
#: ../trunk/classes/admin/class-admin-reports.php:194
|
| 443 |
-
msgid "D j M Y \\a\\t h:ia"
|
| 444 |
-
msgstr "D j M Y \\a\\t h:ia"
|
| 445 |
-
|
| 446 |
-
#: ../classes/admin/class-admin-reports.php:203
|
| 447 |
-
#: ../trunk/classes/admin/class-admin-reports.php:203
|
| 448 |
-
msgid "No commission yet"
|
| 449 |
-
msgstr "No hay comisión aún"
|
| 450 |
-
|
| 451 |
-
#: ../classes/admin/class-admin-reports.php:237
|
| 452 |
-
#: ../trunk/classes/admin/class-admin-reports.php:237
|
| 453 |
-
msgid "Show:"
|
| 454 |
-
msgstr "Ver:"
|
| 455 |
-
|
| 456 |
-
#: ../classes/admin/class-admin-reports.php:246
|
| 457 |
-
#: ../trunk/classes/admin/class-admin-reports.php:246
|
| 458 |
-
msgid "Search for a product…"
|
| 459 |
-
msgstr "Buscar un producto…"
|
| 460 |
-
|
| 461 |
-
#: ../classes/admin/class-admin-reports.php:249
|
| 462 |
-
#: ../trunk/classes/admin/class-admin-reports.php:249
|
| 463 |
-
msgid "Type in a product name to start searching..."
|
| 464 |
-
msgstr "Escribe un nombre de producto para comenzar la búsqueda..."
|
| 465 |
-
|
| 466 |
-
#: ../classes/admin/class-admin-reports.php:281
|
| 467 |
-
#: ../trunk/classes/admin/class-admin-reports.php:281
|
| 468 |
-
msgid "Select a vendor…"
|
| 469 |
-
msgstr "Seleccionar un vendedor…"
|
| 470 |
-
|
| 471 |
-
#: ../classes/admin/class-admin-reports.php:347
|
| 472 |
-
#: ../trunk/classes/admin/class-admin-reports.php:347
|
| 473 |
-
msgid "Month"
|
| 474 |
-
msgstr "Mes"
|
| 475 |
-
|
| 476 |
-
#: ../classes/admin/class-admin-reports.php:462
|
| 477 |
-
#: ../trunk/classes/admin/class-admin-reports.php:462
|
| 478 |
-
msgid "Tax Total"
|
| 479 |
-
msgstr "Total de impuestos"
|
| 480 |
-
|
| 481 |
-
#: ../classes/admin/class-admin-reports.php:463
|
| 482 |
-
#: ../trunk/classes/admin/class-admin-reports.php:463
|
| 483 |
-
msgid "Shipping Total"
|
| 484 |
-
msgstr "Total de envío"
|
| 485 |
-
|
| 486 |
-
#: ../classes/admin/class-admin-reports.php:465
|
| 487 |
-
#: ../trunk/classes/admin/class-admin-reports.php:465
|
| 488 |
-
msgid "Commission Total"
|
| 489 |
-
msgstr "Total de comisión"
|
| 490 |
-
|
| 491 |
-
#: ../classes/admin/class-admin-reports.php:487
|
| 492 |
-
#: ../trunk/classes/admin/class-admin-reports.php:487
|
| 493 |
-
msgid "No commissions found."
|
| 494 |
-
msgstr "No se han encontrado comisiones."
|
| 495 |
-
|
| 496 |
-
#: ../classes/admin/class-admin-users.php:394
|
| 497 |
-
#: ../trunk/classes/admin/class-admin-users.php:394
|
| 498 |
-
msgid "Enable HTML for the shop description"
|
| 499 |
-
msgstr "Permitir HTML en la descripción de la tienda"
|
| 500 |
-
|
| 501 |
-
#: ../classes/admin/class-admin-users.php:400
|
| 502 |
-
#: ../trunk/classes/admin/class-admin-users.php:400
|
| 503 |
-
msgid "Shop name"
|
| 504 |
-
msgstr "Nombre de la tienda"
|
| 505 |
-
|
| 506 |
-
#: ../classes/admin/class-admin-users.php:407
|
| 507 |
-
#: ../trunk/classes/admin/class-admin-users.php:407
|
| 508 |
-
msgid "PayPal E-mail"
|
| 509 |
-
msgstr "Email de PayPal"
|
| 510 |
-
|
| 511 |
-
#: ../classes/admin/class-admin-users.php:408
|
| 512 |
-
#: ../trunk/classes/admin/class-admin-users.php:408
|
| 513 |
-
msgid "required"
|
| 514 |
-
msgstr "requerido"
|
| 515 |
-
|
| 516 |
-
#: ../classes/admin/class-admin-users.php:415
|
| 517 |
-
#: ../trunk/classes/admin/class-admin-users.php:415
|
| 518 |
-
msgid "Commission rate"
|
| 519 |
-
msgstr "Tasa de comisión"
|
| 520 |
-
|
| 521 |
-
#: ../classes/admin/class-admin-users.php:416
|
| 522 |
-
#: ../classes/admin/class-product-meta.php:174
|
| 523 |
-
#: ../trunk/classes/admin/class-admin-users.php:416
|
| 524 |
-
#: ../trunk/classes/admin/class-product-meta.php:174
|
| 525 |
-
msgid "Leave blank for default"
|
| 526 |
-
msgstr "Dejar en blanco para usar el valor por defecto"
|
| 527 |
-
|
| 528 |
-
#: ../classes/admin/class-admin-users.php:422
|
| 529 |
-
#: ../trunk/classes/admin/class-admin-users.php:422
|
| 530 |
-
msgid "Give Tax"
|
| 531 |
-
msgstr "Dar impuesto"
|
| 532 |
-
|
| 533 |
-
#: ../classes/admin/class-admin-users.php:427
|
| 534 |
-
#: ../trunk/classes/admin/class-admin-users.php:427
|
| 535 |
-
msgid "Tax override for vendor"
|
| 536 |
-
msgstr "Impuesto para el vendedor"
|
| 537 |
-
|
| 538 |
-
#: ../classes/admin/class-admin-users.php:433
|
| 539 |
-
#: ../trunk/classes/admin/class-admin-users.php:433
|
| 540 |
-
msgid "Give Shipping"
|
| 541 |
-
msgstr "Dar envío"
|
| 542 |
-
|
| 543 |
-
#: ../classes/admin/class-admin-users.php:438
|
| 544 |
-
#: ../trunk/classes/admin/class-admin-users.php:438
|
| 545 |
-
msgid "Shipping override for vendor"
|
| 546 |
-
msgstr "Envío para el vendedor"
|
| 547 |
-
|
| 548 |
-
#: ../classes/admin/class-admin-users.php:444
|
| 549 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:30
|
| 550 |
-
#: ../templates/dashboard/settings/seller-info.php:3
|
| 551 |
-
#: ../trunk/classes/admin/class-admin-users.php:444
|
| 552 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:30
|
| 553 |
-
#: ../trunk/templates/dashboard/settings/seller-info.php:3
|
| 554 |
-
msgid "Seller info"
|
| 555 |
-
msgstr "Información del vendedor"
|
| 556 |
-
|
| 557 |
-
#: ../classes/admin/class-admin-users.php:449
|
| 558 |
-
#: ../trunk/classes/admin/class-admin-users.php:449
|
| 559 |
-
msgid "Shop description"
|
| 560 |
-
msgstr "Descripción de la tienda"
|
| 561 |
-
|
| 562 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:22
|
| 563 |
-
#: ../classes/class-install.php:207
|
| 564 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:22
|
| 565 |
-
#: ../trunk/classes/class-install.php:207
|
| 566 |
-
msgid "Shop Settings"
|
| 567 |
-
msgstr "Tienda"
|
| 568 |
-
|
| 569 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:23
|
| 570 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:180
|
| 571 |
-
#: ../classes/admin/settings/sf-options.php:196
|
| 572 |
-
#: ../classes/class-install.php:206 ../templates/dashboard/orders.php:35
|
| 573 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:23
|
| 574 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:180
|
| 575 |
-
#: ../trunk/classes/admin/settings/sf-options.php:196
|
| 576 |
-
#: ../trunk/classes/class-install.php:206
|
| 577 |
-
#: ../trunk/templates/dashboard/orders.php:35
|
| 578 |
-
msgid "Orders"
|
| 579 |
-
msgstr "Pedidos"
|
| 580 |
-
|
| 581 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:67
|
| 582 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:112
|
| 583 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:67
|
| 584 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:112
|
| 585 |
-
msgid "Your PayPal address is not a valid email address."
|
| 586 |
-
msgstr "Tu dirección de PayPal no es una dirección de email válida."
|
| 587 |
-
|
| 588 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:76
|
| 589 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:121
|
| 590 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:76
|
| 591 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:121
|
| 592 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 593 |
-
msgstr "Ese nombre de tienda ya está tomado. Tu tienda debe ser única."
|
| 594 |
-
|
| 595 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:112
|
| 596 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:371
|
| 597 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:139
|
| 598 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:112
|
| 599 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:371
|
| 600 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:139
|
| 601 |
-
msgid "Settings saved."
|
| 602 |
-
msgstr "Ajustes guardados."
|
| 603 |
-
|
| 604 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:243
|
| 605 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:243
|
| 606 |
-
msgid "order"
|
| 607 |
-
msgstr "pedido"
|
| 608 |
-
|
| 609 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:244
|
| 610 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:244
|
| 611 |
-
msgid "orders"
|
| 612 |
-
msgstr "pedidos"
|
| 613 |
-
|
| 614 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:320
|
| 615 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:320
|
| 616 |
-
msgid "Customer"
|
| 617 |
-
msgstr "Cliente"
|
| 618 |
-
|
| 619 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:321
|
| 620 |
-
#: ../classes/admin/settings/sf-options.php:127
|
| 621 |
-
#: ../classes/admin/settings/sf-options.php:254
|
| 622 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:321
|
| 623 |
-
#: ../trunk/classes/admin/settings/sf-options.php:127
|
| 624 |
-
#: ../trunk/classes/admin/settings/sf-options.php:254
|
| 625 |
-
msgid "Products"
|
| 626 |
-
msgstr "Productos"
|
| 627 |
-
|
| 628 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:325
|
| 629 |
-
#: ../templates/dashboard/orders.php:106
|
| 630 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:325
|
| 631 |
-
#: ../trunk/templates/dashboard/orders.php:106
|
| 632 |
-
msgid "Shipped"
|
| 633 |
-
msgstr "Enviado"
|
| 634 |
-
|
| 635 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:361
|
| 636 |
-
#: ../templates/dashboard/orders.php:99
|
| 637 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:361
|
| 638 |
-
#: ../trunk/templates/dashboard/orders.php:99
|
| 639 |
-
msgid "Mark shipped"
|
| 640 |
-
msgstr "Marcar como enviado"
|
| 641 |
-
|
| 642 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:386
|
| 643 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:386
|
| 644 |
-
msgid "Orders marked shipped."
|
| 645 |
-
msgstr "Pedidos marcados como enviados."
|
| 646 |
-
|
| 647 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:422
|
| 648 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:40
|
| 649 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:422
|
| 650 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:40
|
| 651 |
-
msgid "You are not allowed to modify this order."
|
| 652 |
-
msgstr "No tienes permiso para editar este pedido."
|
| 653 |
-
|
| 654 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:544
|
| 655 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:544
|
| 656 |
-
msgid "Yes"
|
| 657 |
-
msgstr "Sí"
|
| 658 |
-
|
| 659 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:544
|
| 660 |
-
#: ../trunk/classes/admin/class-vendor-admin-dashboard.php:544
|
| 661 |
-
msgid "No"
|
| 662 |
-
msgstr "No"
|
| 663 |
-
|
| 664 |
-
#: ../classes/admin/class-vendor-applicants.php:26
|
| 665 |
-
#: ../trunk/classes/admin/class-vendor-applicants.php:26
|
| 666 |
-
msgid "Approve"
|
| 667 |
-
msgstr "Aprobar"
|
| 668 |
-
|
| 669 |
-
#: ../classes/admin/class-vendor-applicants.php:27
|
| 670 |
-
#: ../trunk/classes/admin/class-vendor-applicants.php:27
|
| 671 |
-
msgid "Deny"
|
| 672 |
-
msgstr "Rechazar"
|
| 673 |
-
|
| 674 |
-
#: ../classes/admin/class-vendor-applicants.php:73
|
| 675 |
-
#: ../trunk/classes/admin/class-vendor-applicants.php:73
|
| 676 |
-
msgid "Vendor has been <b>denied</b>."
|
| 677 |
-
msgstr "Vendedor ha sido <b>rechazado</b>."
|
| 678 |
-
|
| 679 |
-
#: ../classes/admin/class-vendor-applicants.php:84
|
| 680 |
-
#: ../trunk/classes/admin/class-vendor-applicants.php:84
|
| 681 |
-
msgid "Vendor has been <b>approved</b>."
|
| 682 |
-
msgstr "Vendedor ha sido <b>aprobado</b>."
|
| 683 |
-
|
| 684 |
-
#: ../classes/admin/class-vendor-applicants.php:98
|
| 685 |
-
#: ../trunk/classes/admin/class-vendor-applicants.php:98
|
| 686 |
-
msgid "Pending Vendors"
|
| 687 |
-
msgstr "Vendedores pendientes"
|
| 688 |
-
|
| 689 |
-
#: ../classes/admin/emails/class-emails.php:59
|
| 690 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:70
|
| 691 |
-
#: ../trunk/classes/admin/emails/class-emails.php:59
|
| 692 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:70
|
| 693 |
-
msgid "pending"
|
| 694 |
-
msgstr "pendientes"
|
| 695 |
-
|
| 696 |
-
#: ../classes/admin/emails/class-emails.php:61
|
| 697 |
-
#: ../trunk/classes/admin/emails/class-emails.php:61
|
| 698 |
-
msgid "approved"
|
| 699 |
-
msgstr "aprobados"
|
| 700 |
-
|
| 701 |
-
#: ../classes/admin/emails/class-emails.php:63
|
| 702 |
-
#: ../trunk/classes/admin/emails/class-emails.php:63
|
| 703 |
-
msgid "denied"
|
| 704 |
-
msgstr "denegados"
|
| 705 |
-
|
| 706 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:28
|
| 707 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:28
|
| 708 |
-
msgid "Vendor Application"
|
| 709 |
-
msgstr "Postulación del vendedor"
|
| 710 |
-
|
| 711 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:29
|
| 712 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:29
|
| 713 |
-
msgid "Vendor application will either be approved, denied, or pending."
|
| 714 |
-
msgstr "La postulación del vendedor puede ser aprobada, denegada o pendiente."
|
| 715 |
-
|
| 716 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:31
|
| 717 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:31
|
| 718 |
-
msgid "Application {status}"
|
| 719 |
-
msgstr "Postulación {status}"
|
| 720 |
-
|
| 721 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:32
|
| 722 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:32
|
| 723 |
-
msgid "[{blogname}] Your vendor application has been {status}"
|
| 724 |
-
msgstr "[{blogname}] Tu postulación a vendedor está {status}"
|
| 725 |
-
|
| 726 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:123
|
| 727 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:134
|
| 728 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:166
|
| 729 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:265
|
| 730 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
|
| 731 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:123
|
| 732 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:134
|
| 733 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:166
|
| 734 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:265
|
| 735 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
|
| 736 |
-
msgid "Enable/Disable"
|
| 737 |
-
msgstr "Habilitar/deshabilitar"
|
| 738 |
-
|
| 739 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:125
|
| 740 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:136
|
| 741 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:168
|
| 742 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:267
|
| 743 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:125
|
| 744 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:136
|
| 745 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:168
|
| 746 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:267
|
| 747 |
-
msgid "Enable this email notification"
|
| 748 |
-
msgstr "Habilitar esta notificación por email"
|
| 749 |
-
|
| 750 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:129
|
| 751 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:140
|
| 752 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:129
|
| 753 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:140
|
| 754 |
-
msgid "Recipient(s)"
|
| 755 |
-
msgstr "Receptor(es)"
|
| 756 |
-
|
| 757 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:131
|
| 758 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:142
|
| 759 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:131
|
| 760 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:142
|
| 761 |
-
#, php-format
|
| 762 |
-
msgid ""
|
| 763 |
-
"Enter recipients (comma separated) for this email. Defaults to <code>%s</"
|
| 764 |
-
"code>."
|
| 765 |
-
msgstr ""
|
| 766 |
-
"Entrar los receptores (separados por coma) de este email. Por defecto a "
|
| 767 |
-
"<code>%s</code>."
|
| 768 |
-
|
| 769 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:136
|
| 770 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:147
|
| 771 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:172
|
| 772 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:271
|
| 773 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:136
|
| 774 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:147
|
| 775 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:172
|
| 776 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:271
|
| 777 |
-
msgid "Subject"
|
| 778 |
-
msgstr "Asunto"
|
| 779 |
-
|
| 780 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:138
|
| 781 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:149
|
| 782 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:174
|
| 783 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:273
|
| 784 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:138
|
| 785 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:149
|
| 786 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:174
|
| 787 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:273
|
| 788 |
-
#, php-format
|
| 789 |
-
msgid ""
|
| 790 |
-
"This controls the email subject line. Leave blank to use the default "
|
| 791 |
-
"subject: <code>%s</code>."
|
| 792 |
-
msgstr ""
|
| 793 |
-
"Esto controla el asunto del email. Dejar en blanco para usar el valor por "
|
| 794 |
-
"defecto: <code>%s</code>."
|
| 795 |
-
|
| 796 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:143
|
| 797 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:154
|
| 798 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:179
|
| 799 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:278
|
| 800 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:143
|
| 801 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:154
|
| 802 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:179
|
| 803 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:278
|
| 804 |
-
msgid "Email Heading"
|
| 805 |
-
msgstr "Título del email"
|
| 806 |
-
|
| 807 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:145
|
| 808 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:156
|
| 809 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:181
|
| 810 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:280
|
| 811 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:145
|
| 812 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:156
|
| 813 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:181
|
| 814 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:280
|
| 815 |
-
#, php-format
|
| 816 |
-
msgid ""
|
| 817 |
-
"This controls the main heading contained within the email notification. "
|
| 818 |
-
"Leave blank to use the default heading: <code>%s</code>."
|
| 819 |
-
msgstr ""
|
| 820 |
-
"Esto controla el título principal de la notificación por email. Dejar en "
|
| 821 |
-
"blanco para utilizar el valor por defecto: <code>%s</code>."
|
| 822 |
-
|
| 823 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:150
|
| 824 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:161
|
| 825 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:186
|
| 826 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:291
|
| 827 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:150
|
| 828 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:161
|
| 829 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:186
|
| 830 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:291
|
| 831 |
-
msgid "Email type"
|
| 832 |
-
msgstr "Tipo de email"
|
| 833 |
-
|
| 834 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:152
|
| 835 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:163
|
| 836 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:188
|
| 837 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:293
|
| 838 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:152
|
| 839 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:163
|
| 840 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:188
|
| 841 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:293
|
| 842 |
-
msgid "Choose which format of email to send."
|
| 843 |
-
msgstr "Elegir cuál formato de email se mandará."
|
| 844 |
-
|
| 845 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:156
|
| 846 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:167
|
| 847 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:192
|
| 848 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:297
|
| 849 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:156
|
| 850 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:167
|
| 851 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:192
|
| 852 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:297
|
| 853 |
-
msgid "Plain text"
|
| 854 |
-
msgstr "Texto plano"
|
| 855 |
-
|
| 856 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:157
|
| 857 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:168
|
| 858 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:193
|
| 859 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:298
|
| 860 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:157
|
| 861 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:168
|
| 862 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:193
|
| 863 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:298
|
| 864 |
-
msgid "HTML"
|
| 865 |
-
msgstr "HTML"
|
| 866 |
-
|
| 867 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:158
|
| 868 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:169
|
| 869 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:194
|
| 870 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:299
|
| 871 |
-
#: ../trunk/classes/admin/emails/class-wc-approve-vendor.php:158
|
| 872 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:169
|
| 873 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:194
|
| 874 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:299
|
| 875 |
-
msgid "Multipart"
|
| 876 |
-
msgstr "Multiparte"
|
| 877 |
-
|
| 878 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:28
|
| 879 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:28
|
| 880 |
-
msgid "New Vendor Product"
|
| 881 |
-
msgstr "Nuevo producto del vendedor"
|
| 882 |
-
|
| 883 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:29
|
| 884 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:29
|
| 885 |
-
msgid "New order emails are sent when a new product is submitted by a vendor"
|
| 886 |
-
msgstr ""
|
| 887 |
-
"Nuevos emails de pedido se envían cuando un nuevo producto es ingresado por "
|
| 888 |
-
"un vendedor"
|
| 889 |
-
|
| 890 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:31
|
| 891 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:31
|
| 892 |
-
msgid "New product submitted: {product_name}"
|
| 893 |
-
msgstr "Nuevo producto ingresado: {product_name}"
|
| 894 |
-
|
| 895 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:32
|
| 896 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-admin.php:32
|
| 897 |
-
msgid "[{blogname}] New product submitted by {vendor_name} - {product_name}"
|
| 898 |
-
msgstr ""
|
| 899 |
-
"[{blogname}] Nuevo producto ingresado por {vendor_name} - {product_name}"
|
| 900 |
-
|
| 901 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:28
|
| 902 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:28
|
| 903 |
-
msgid "Vendor has shipped"
|
| 904 |
-
msgstr "Vendedor ha enviado"
|
| 905 |
-
|
| 906 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:29
|
| 907 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:29
|
| 908 |
-
msgid ""
|
| 909 |
-
"An email is sent when a vendor has marked one of their orders as shipped."
|
| 910 |
-
msgstr ""
|
| 911 |
-
"Un email es enviado cada vez que un vendedor marca un pedido como enviado."
|
| 912 |
-
|
| 913 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:31
|
| 914 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:31
|
| 915 |
-
msgid "Your order has been shipped"
|
| 916 |
-
msgstr "Tu pedido ha sido enviado"
|
| 917 |
-
|
| 918 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:32
|
| 919 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:32
|
| 920 |
-
msgid ""
|
| 921 |
-
"[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 922 |
-
msgstr "[{blogname}] Tu pedido ha sido enviado ({order_number}) - {order_date}"
|
| 923 |
-
|
| 924 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:115
|
| 925 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-shipped.php:115
|
| 926 |
-
msgid "Subtotal:"
|
| 927 |
-
msgstr "Subtotal:"
|
| 928 |
-
|
| 929 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:27
|
| 930 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:27
|
| 931 |
-
msgid "Notify vendors"
|
| 932 |
-
msgstr "Notificar vendedores"
|
| 933 |
-
|
| 934 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:28
|
| 935 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:28
|
| 936 |
-
msgid "New order emails are sent when an order is received/paid by a customer."
|
| 937 |
-
msgstr ""
|
| 938 |
-
"Nuevos emails de pedido son enviados cada vez que un pedido es recibido/"
|
| 939 |
-
"pagado por un usuario."
|
| 940 |
-
|
| 941 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:30
|
| 942 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:30
|
| 943 |
-
msgid "New customer order"
|
| 944 |
-
msgstr "Nuevo pedido de cliente"
|
| 945 |
-
|
| 946 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:31
|
| 947 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:31
|
| 948 |
-
msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
|
| 949 |
-
msgstr "[{blogname}] Nuevo pedido de cliente ({order_number}) - {order_date}"
|
| 950 |
-
|
| 951 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:107
|
| 952 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:107
|
| 953 |
-
msgid "Commission Subtotal:"
|
| 954 |
-
msgstr "Subtotal de comisión:"
|
| 955 |
-
|
| 956 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:113
|
| 957 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:113
|
| 958 |
-
msgid "Tax Subtotal:"
|
| 959 |
-
msgstr "Subtotal de impuesto:"
|
| 960 |
-
|
| 961 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:121
|
| 962 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:121
|
| 963 |
-
msgid "Shipping Subtotal:"
|
| 964 |
-
msgstr "Subtotal de envío:"
|
| 965 |
-
|
| 966 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:285
|
| 967 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:285
|
| 968 |
-
msgid "Product Totals"
|
| 969 |
-
msgstr "Totales del producto"
|
| 970 |
-
|
| 971 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:287
|
| 972 |
-
#: ../trunk/classes/admin/emails/class-wc-notify-vendor.php:287
|
| 973 |
-
msgid ""
|
| 974 |
-
"Show the commission due/paid as the product totals instead of the product "
|
| 975 |
-
"prices."
|
| 976 |
-
msgstr ""
|
| 977 |
-
|
| 978 |
-
#: ../classes/admin/settings/classes/sf-class-format-options.php:211
|
| 979 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:794
|
| 980 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:828
|
| 981 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-format-options.php:211
|
| 982 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:794
|
| 983 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:828
|
| 984 |
-
msgid "Select a page..."
|
| 985 |
-
msgstr "Seleccionar una página..."
|
| 986 |
-
|
| 987 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:153
|
| 988 |
-
#: ../templates/dashboard/settings/settings.php:1
|
| 989 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:153
|
| 990 |
-
#: ../trunk/templates/dashboard/settings/settings.php:1
|
| 991 |
-
msgid "Settings"
|
| 992 |
-
msgstr "Ajustes"
|
| 993 |
-
|
| 994 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:305
|
| 995 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:305
|
| 996 |
-
msgid "Could not load settings at: "
|
| 997 |
-
msgstr "No se pueden cargar ajustes en: "
|
| 998 |
-
|
| 999 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:305
|
| 1000 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:305
|
| 1001 |
-
msgid "Error - WP Settings Framework"
|
| 1002 |
-
msgstr "Error - WP Settings Framework"
|
| 1003 |
-
|
| 1004 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:489
|
| 1005 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:489
|
| 1006 |
-
#, php-format
|
| 1007 |
-
msgid "Save %s changes"
|
| 1008 |
-
msgstr "Guardar cambios en %s"
|
| 1009 |
-
|
| 1010 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:502
|
| 1011 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:502
|
| 1012 |
-
msgid ""
|
| 1013 |
-
"Please help with a <a href=\"https://wordpress.org/support/view/plugin-"
|
| 1014 |
-
"reviews/wc-vendors?rate=5#postform\" target=\"top\">High Five!</a> | <a href="
|
| 1015 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 1016 |
-
"Vendors Pro</a> | <a href=\"https://www.wcvendors.com/product/stripe-"
|
| 1017 |
-
"commissions-gateway/\" target=\"top\">Stripe Commissions & Gateway</a> | <a "
|
| 1018 |
-
"href=\"https://www.wcvendors.com/kb/\" target=\"top\">KnowledgeBase</a> | <a "
|
| 1019 |
-
"href=\"https://www.wcvendors.com/help/\" target=\"top\">Help Forums</a>"
|
| 1020 |
-
msgstr ""
|
| 1021 |
-
"Por favor ayuda con una <a href=“https://wordpress.org/support/view/plugin-"
|
| 1022 |
-
"reviews/wc-vendors?rate=5#postform” target=“top”>calificación de cinco "
|
| 1023 |
-
"estrellas</a> | <a href=“https://www.wcvendors.com/product/wc-vendors-pro/“ "
|
| 1024 |
-
"target=“top”>WC Vendors Pro</a> | <a href=“https://www.wcvendors.com/product/"
|
| 1025 |
-
"stripe-commissions-gateway/“ target=“top”>Stripe Commissions & Gateway</a> | "
|
| 1026 |
-
"<a href=“https://www.wcvendors.com/kb/“ target=“top”>KnowledgeBase</a> | <a "
|
| 1027 |
-
"href=“https://www.wcvendors.com/help/“ target=“top”>Foros de ayuda</a>"
|
| 1028 |
-
|
| 1029 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:787
|
| 1030 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:821
|
| 1031 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:787
|
| 1032 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:821
|
| 1033 |
-
msgid "Edit Page"
|
| 1034 |
-
msgstr "Editar página"
|
| 1035 |
-
|
| 1036 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:788
|
| 1037 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:822
|
| 1038 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:788
|
| 1039 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:822
|
| 1040 |
-
msgid "View Page"
|
| 1041 |
-
msgstr "Ver página"
|
| 1042 |
-
|
| 1043 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:886
|
| 1044 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:886
|
| 1045 |
-
#, php-format
|
| 1046 |
-
msgid "Update %s"
|
| 1047 |
-
msgstr "Actualizar %s"
|
| 1048 |
-
|
| 1049 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:886
|
| 1050 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:886
|
| 1051 |
-
#, php-format
|
| 1052 |
-
msgid "Add %s"
|
| 1053 |
-
msgstr "Agregar %s"
|
| 1054 |
-
|
| 1055 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:886
|
| 1056 |
-
#: ../trunk/classes/admin/settings/classes/sf-class-settings.php:886
|
| 1057 |
-
#, php-format
|
| 1058 |
-
msgid "Upload an image for the %s"
|
| 1059 |
-
msgstr "Subir una imagen para el %s"
|
| 1060 |
-
|
| 1061 |
-
#: ../classes/admin/settings/sf-options.php:5
|
| 1062 |
-
#: ../trunk/classes/admin/settings/sf-options.php:5
|
| 1063 |
-
msgid "General options"
|
| 1064 |
-
msgstr "Opciones generales"
|
| 1065 |
-
|
| 1066 |
-
#: ../classes/admin/settings/sf-options.php:8
|
| 1067 |
-
#: ../trunk/classes/admin/settings/sf-options.php:8
|
| 1068 |
-
msgid "Default commission (%)"
|
| 1069 |
-
msgstr "Comisión por defecto (%)"
|
| 1070 |
-
|
| 1071 |
-
#: ../classes/admin/settings/sf-options.php:9
|
| 1072 |
-
#: ../trunk/classes/admin/settings/sf-options.php:9
|
| 1073 |
-
msgid ""
|
| 1074 |
-
"The default rate you pay each vendor for a product sale. <br>You can also "
|
| 1075 |
-
"give vendors their own individual commission rates by editing the vendors "
|
| 1076 |
-
"user account.<br>Also, you can edit an individual products commission to "
|
| 1077 |
-
"override both of these settings on a per product basis."
|
| 1078 |
-
msgstr ""
|
| 1079 |
-
"La comisión estándar que pagas a cada vendedor por cada producto vendido."
|
| 1080 |
-
"<br>También puedes dar a cada vendedor su propia comisión editando su cuenta "
|
| 1081 |
-
"de usuario.<br>También puedes dar a cada producto su propia comisión "
|
| 1082 |
-
"editando la página del producto."
|
| 1083 |
-
|
| 1084 |
-
#: ../classes/admin/settings/sf-options.php:20
|
| 1085 |
-
#: ../classes/admin/settings/sf-options.php:27
|
| 1086 |
-
#: ../trunk/classes/admin/settings/sf-options.php:20
|
| 1087 |
-
#: ../trunk/classes/admin/settings/sf-options.php:27
|
| 1088 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 1089 |
-
msgstr "Permitir a los usuarios o visitas solicitar ser vendedores"
|
| 1090 |
-
|
| 1091 |
-
#: ../classes/admin/settings/sf-options.php:22
|
| 1092 |
-
#: ../trunk/classes/admin/settings/sf-options.php:22
|
| 1093 |
-
msgid ""
|
| 1094 |
-
"Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:"
|
| 1095 |
-
"</strong> You MUST \"<strong>Enable registration on the \"My Account\" "
|
| 1096 |
-
"page</strong>\" in your <strong>WooCommerce > Settings > Accounts</strong> "
|
| 1097 |
-
"page for this option to work. Currently, you have registration disabled."
|
| 1098 |
-
msgstr ""
|
| 1099 |
-
"Permitir a los usuarios o visitas solicitar ser vendedores."
|
| 1100 |
-
"<br><br><strong>ATENCIÓN:</strong> Debes activar la registración en la "
|
| 1101 |
-
"página “Mi cuenta” en WooCommerce > Ajustes > Cuentas para que esta opción "
|
| 1102 |
-
"funcione. Actualmente está desactivada."
|
| 1103 |
-
|
| 1104 |
-
#: ../classes/admin/settings/sf-options.php:26
|
| 1105 |
-
#: ../trunk/classes/admin/settings/sf-options.php:26
|
| 1106 |
-
msgid "Registration"
|
| 1107 |
-
msgstr "Registración"
|
| 1108 |
-
|
| 1109 |
-
#: ../classes/admin/settings/sf-options.php:28
|
| 1110 |
-
#: ../trunk/classes/admin/settings/sf-options.php:28
|
| 1111 |
-
msgid ""
|
| 1112 |
-
"This will show a checkbox on the My Account page's registration form asking "
|
| 1113 |
-
"if the user would like to apply to be a vendor. Also, on the Vendor "
|
| 1114 |
-
"Dashboard, users can still apply to become a vendor even if this is disabled."
|
| 1115 |
-
msgstr ""
|
| 1116 |
-
"Esto mostrará una casilla en el formulario de la página mi cuenta "
|
| 1117 |
-
"preguntando si el usuario desea aplicar para ser un vendedor. Además, en el "
|
| 1118 |
-
"tablero del vendedor, los usuarios pueden aplicar aún para convertirse en un "
|
| 1119 |
-
"vendedor, incluso si éste está desactivado."
|
| 1120 |
-
|
| 1121 |
-
#: ../classes/admin/settings/sf-options.php:35
|
| 1122 |
-
#: ../trunk/classes/admin/settings/sf-options.php:35
|
| 1123 |
-
msgid "Approve vendor applications manually"
|
| 1124 |
-
msgstr "Aprobar las postulaciones de vendedor manualmente"
|
| 1125 |
-
|
| 1126 |
-
#: ../classes/admin/settings/sf-options.php:36
|
| 1127 |
-
#: ../trunk/classes/admin/settings/sf-options.php:36
|
| 1128 |
-
msgid ""
|
| 1129 |
-
"With this unchecked, all vendor applications are automatically accepted. "
|
| 1130 |
-
"Otherwise, you must approve each manually."
|
| 1131 |
-
msgstr ""
|
| 1132 |
-
"Si no está seleccionado, todas las postulaciones a vendedores se aprobarán "
|
| 1133 |
-
"automáticamente. De lo contrario, debes aprobarlas manualmente."
|
| 1134 |
-
|
| 1135 |
-
#: ../classes/admin/settings/sf-options.php:43
|
| 1136 |
-
#: ../classes/admin/settings/sf-options.php:175
|
| 1137 |
-
#: ../trunk/classes/admin/settings/sf-options.php:43
|
| 1138 |
-
#: ../trunk/classes/admin/settings/sf-options.php:175
|
| 1139 |
-
msgid "Taxes"
|
| 1140 |
-
msgstr "Impuestos"
|
| 1141 |
-
|
| 1142 |
-
#: ../classes/admin/settings/sf-options.php:44
|
| 1143 |
-
#: ../trunk/classes/admin/settings/sf-options.php:44
|
| 1144 |
-
msgid "Give vendors any tax collected per-product"
|
| 1145 |
-
msgstr "Dar a los vendedores todo el impuesto recolectado por producto"
|
| 1146 |
-
|
| 1147 |
-
#: ../classes/admin/settings/sf-options.php:45
|
| 1148 |
-
#: ../trunk/classes/admin/settings/sf-options.php:45
|
| 1149 |
-
msgid "The tax collected on a vendor's product will be given in its entirety"
|
| 1150 |
-
msgstr ""
|
| 1151 |
-
"Los impuestos recolectados en el producto de un vendedor se dará en su "
|
| 1152 |
-
"totalidad"
|
| 1153 |
-
|
| 1154 |
-
#: ../classes/admin/settings/sf-options.php:53
|
| 1155 |
-
#: ../trunk/classes/admin/settings/sf-options.php:53
|
| 1156 |
-
msgid "Give vendors any shipping collected per-product"
|
| 1157 |
-
msgstr "Dar a los vendedores cualquier envío recogido por producto"
|
| 1158 |
-
|
| 1159 |
-
#: ../classes/admin/settings/sf-options.php:54
|
| 1160 |
-
#: ../trunk/classes/admin/settings/sf-options.php:54
|
| 1161 |
-
msgid ""
|
| 1162 |
-
"WC Vendors Free - Give vendors shipping if using Per Product Shipping "
|
| 1163 |
-
"gateway. WC Vendors Pro - Give vendors shipping when using Vendor "
|
| 1164 |
-
"Shipping. No other shipping module is compatible with this option."
|
| 1165 |
-
msgstr ""
|
| 1166 |
-
|
| 1167 |
-
#: ../classes/admin/settings/sf-options.php:60
|
| 1168 |
-
#: ../trunk/classes/admin/settings/sf-options.php:60
|
| 1169 |
-
msgid "Shop options"
|
| 1170 |
-
msgstr "Opciones de la tienda"
|
| 1171 |
-
|
| 1172 |
-
#: ../classes/admin/settings/sf-options.php:63
|
| 1173 |
-
#: ../trunk/classes/admin/settings/sf-options.php:63
|
| 1174 |
-
msgid "Shop HTML"
|
| 1175 |
-
msgstr "HTML de la tienda"
|
| 1176 |
-
|
| 1177 |
-
#: ../classes/admin/settings/sf-options.php:64
|
| 1178 |
-
#: ../trunk/classes/admin/settings/sf-options.php:64
|
| 1179 |
-
msgid ""
|
| 1180 |
-
"Enable HTML for a vendor's shop description by default. You can enable or "
|
| 1181 |
-
"disable this per vendor by editing the vendors user account."
|
| 1182 |
-
msgstr ""
|
| 1183 |
-
"Habilitar HTML para la descripción de las tiendas de los vendedores. Usted "
|
| 1184 |
-
"puede activar o desactivar esto para cada vendedor editando la cuenta de los "
|
| 1185 |
-
"vendedores."
|
| 1186 |
-
|
| 1187 |
-
#: ../classes/admin/settings/sf-options.php:71
|
| 1188 |
-
#: ../trunk/classes/admin/settings/sf-options.php:71
|
| 1189 |
-
msgid "Vendor Shop Page"
|
| 1190 |
-
msgstr "Tienda del vendedor"
|
| 1191 |
-
|
| 1192 |
-
#: ../classes/admin/settings/sf-options.php:72
|
| 1193 |
-
#: ../trunk/classes/admin/settings/sf-options.php:72
|
| 1194 |
-
msgid ""
|
| 1195 |
-
"Enter one word for the URI. If you enter \"<strong>vendors</strong>\" your "
|
| 1196 |
-
"vendors store will be <code>yourdomain.com/vendors/store-name/</code>"
|
| 1197 |
-
msgstr ""
|
| 1198 |
-
"Ingresa una palabra para la dirección de las tiendas. Si ingresas "
|
| 1199 |
-
"“vendedores” la tienda de tus vendedores será <code>ejemplo.com/vendedores/"
|
| 1200 |
-
"nombre-de-la-tienda/</code>"
|
| 1201 |
-
|
| 1202 |
-
#: ../classes/admin/settings/sf-options.php:79
|
| 1203 |
-
#: ../trunk/classes/admin/settings/sf-options.php:79
|
| 1204 |
-
msgid "Shop Headers"
|
| 1205 |
-
msgstr "Encabezados de la tienda"
|
| 1206 |
-
|
| 1207 |
-
#: ../classes/admin/settings/sf-options.php:80
|
| 1208 |
-
#: ../trunk/classes/admin/settings/sf-options.php:80
|
| 1209 |
-
msgid "Enable vendor shop headers"
|
| 1210 |
-
msgstr "Habilitar encabezados de la tienda del vendedor"
|
| 1211 |
-
|
| 1212 |
-
#: ../classes/admin/settings/sf-options.php:81
|
| 1213 |
-
#: ../trunk/classes/admin/settings/sf-options.php:81
|
| 1214 |
-
msgid ""
|
| 1215 |
-
"This will override the HTML Shop description output on product-archive "
|
| 1216 |
-
"pages. In order to customize the shop headers visit wcvendors.com and read "
|
| 1217 |
-
"the article in the Knowledgebase titled Changing the Vendor Templates."
|
| 1218 |
-
msgstr ""
|
| 1219 |
-
"Esto sobrescribirá la descripción de la tienda en las páginas de productos y "
|
| 1220 |
-
"archivos. Para personalizar las cabeceras de tienda visita wcvendors.com y "
|
| 1221 |
-
"lee el artículo en la KnowledgeBase titulado “Changing the Vendor Templates”."
|
| 1222 |
-
|
| 1223 |
-
#: ../classes/admin/settings/sf-options.php:88
|
| 1224 |
-
#: ../trunk/classes/admin/settings/sf-options.php:88
|
| 1225 |
-
msgid "Vendor Display Name"
|
| 1226 |
-
msgstr "Nombre de los vendedores"
|
| 1227 |
-
|
| 1228 |
-
#: ../classes/admin/settings/sf-options.php:89
|
| 1229 |
-
#: ../trunk/classes/admin/settings/sf-options.php:89
|
| 1230 |
-
msgid ""
|
| 1231 |
-
"Select what will be displayed for the sold by text throughout the store."
|
| 1232 |
-
msgstr "Elige cómo se mostrará el nombre de los vendedores."
|
| 1233 |
-
|
| 1234 |
-
#: ../classes/admin/settings/sf-options.php:93
|
| 1235 |
-
#: ../trunk/classes/admin/settings/sf-options.php:93
|
| 1236 |
-
msgid "Display Name"
|
| 1237 |
-
msgstr "Mostrar nombre"
|
| 1238 |
-
|
| 1239 |
-
#: ../classes/admin/settings/sf-options.php:94
|
| 1240 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:22
|
| 1241 |
-
#: ../templates/dashboard/settings/shop-name.php:2
|
| 1242 |
-
#: ../trunk/classes/admin/settings/sf-options.php:94
|
| 1243 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:22
|
| 1244 |
-
#: ../trunk/templates/dashboard/settings/shop-name.php:2
|
| 1245 |
-
msgid "Shop Name"
|
| 1246 |
-
msgstr "Nombre de la tienda"
|
| 1247 |
-
|
| 1248 |
-
#: ../classes/admin/settings/sf-options.php:95
|
| 1249 |
-
#: ../trunk/classes/admin/settings/sf-options.php:95
|
| 1250 |
-
msgid "User Login"
|
| 1251 |
-
msgstr "Identificación del usuario"
|
| 1252 |
-
|
| 1253 |
-
#: ../classes/admin/settings/sf-options.php:96
|
| 1254 |
-
#: ../trunk/classes/admin/settings/sf-options.php:96
|
| 1255 |
-
msgid "User Email"
|
| 1256 |
-
msgstr "Email de usuario"
|
| 1257 |
-
|
| 1258 |
-
#: ../classes/admin/settings/sf-options.php:103
|
| 1259 |
-
#: ../classes/admin/settings/sf-options.php:116
|
| 1260 |
-
#: ../trunk/classes/admin/settings/sf-options.php:103
|
| 1261 |
-
#: ../trunk/classes/admin/settings/sf-options.php:116
|
| 1262 |
-
msgid "Sold By"
|
| 1263 |
-
msgstr "Vendido por"
|
| 1264 |
-
|
| 1265 |
-
#: ../classes/admin/settings/sf-options.php:104
|
| 1266 |
-
#: ../trunk/classes/admin/settings/sf-options.php:104
|
| 1267 |
-
msgid "Enable sold by labels"
|
| 1268 |
-
msgstr "Activar las etiquetas “Vendido por”"
|
| 1269 |
-
|
| 1270 |
-
#: ../classes/admin/settings/sf-options.php:105
|
| 1271 |
-
#: ../trunk/classes/admin/settings/sf-options.php:105
|
| 1272 |
-
msgid "This will enable or disable the sold by labels."
|
| 1273 |
-
msgstr "Esto activará o desactivará las etiquetas “Vendido por”."
|
| 1274 |
-
|
| 1275 |
-
#: ../classes/admin/settings/sf-options.php:112
|
| 1276 |
-
#: ../trunk/classes/admin/settings/sf-options.php:112
|
| 1277 |
-
msgid "Sold By Label"
|
| 1278 |
-
msgstr "Etiqueta “Vendido por”"
|
| 1279 |
-
|
| 1280 |
-
#: ../classes/admin/settings/sf-options.php:113
|
| 1281 |
-
#: ../trunk/classes/admin/settings/sf-options.php:113
|
| 1282 |
-
msgid "The sold by label used on the site and emails."
|
| 1283 |
-
msgstr "La etiqueta “Vendido por” utilizada en el sitio y los emails."
|
| 1284 |
-
|
| 1285 |
-
#: ../classes/admin/settings/sf-options.php:120
|
| 1286 |
-
#: ../trunk/classes/admin/settings/sf-options.php:120
|
| 1287 |
-
msgid "Seller Info Label"
|
| 1288 |
-
msgstr "Etiqueta “Acerca del vendedor”"
|
| 1289 |
-
|
| 1290 |
-
#: ../classes/admin/settings/sf-options.php:121
|
| 1291 |
-
#: ../trunk/classes/admin/settings/sf-options.php:121
|
| 1292 |
-
msgid "The seller info tab title on the single product page."
|
| 1293 |
-
msgstr ""
|
| 1294 |
-
"La etiqueta “Acerca del vendedor” en las páginas de productos individuales."
|
| 1295 |
-
|
| 1296 |
-
#: ../classes/admin/settings/sf-options.php:124
|
| 1297 |
-
#: ../trunk/classes/admin/settings/sf-options.php:124
|
| 1298 |
-
msgid "Seller Info"
|
| 1299 |
-
msgstr "Acerca del vendedor"
|
| 1300 |
-
|
| 1301 |
-
#: ../classes/admin/settings/sf-options.php:128
|
| 1302 |
-
#: ../trunk/classes/admin/settings/sf-options.php:128
|
| 1303 |
-
msgid "Product Add Page"
|
| 1304 |
-
msgstr "Página de nuevo producto"
|
| 1305 |
-
|
| 1306 |
-
#: ../classes/admin/settings/sf-options.php:128
|
| 1307 |
-
#: ../trunk/classes/admin/settings/sf-options.php:128
|
| 1308 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 1309 |
-
msgstr "Configurar qué esconder de los vendedores cuando se agrega un producto"
|
| 1310 |
-
|
| 1311 |
-
#: ../classes/admin/settings/sf-options.php:131
|
| 1312 |
-
#: ../trunk/classes/admin/settings/sf-options.php:131
|
| 1313 |
-
msgid "Left side panel"
|
| 1314 |
-
msgstr "Panel de la izquierda"
|
| 1315 |
-
|
| 1316 |
-
#: ../classes/admin/settings/sf-options.php:132
|
| 1317 |
-
#: ../trunk/classes/admin/settings/sf-options.php:132
|
| 1318 |
-
msgid ""
|
| 1319 |
-
"CHECKING these boxes will **HIDE** these areas of the add product page for "
|
| 1320 |
-
"vendors"
|
| 1321 |
-
msgstr ""
|
| 1322 |
-
"MARCAR estas cajas OCULTARÁ estas áreas de la página de nuevo producto para "
|
| 1323 |
-
"vendedores"
|
| 1324 |
-
|
| 1325 |
-
#: ../classes/admin/settings/sf-options.php:135
|
| 1326 |
-
#: ../trunk/classes/admin/settings/sf-options.php:135
|
| 1327 |
-
msgid "Inventory"
|
| 1328 |
-
msgstr "Inventario"
|
| 1329 |
-
|
| 1330 |
-
#: ../classes/admin/settings/sf-options.php:137
|
| 1331 |
-
#: ../trunk/classes/admin/settings/sf-options.php:137
|
| 1332 |
-
msgid "Linked Products"
|
| 1333 |
-
msgstr "Productos enlazados"
|
| 1334 |
-
|
| 1335 |
-
#: ../classes/admin/settings/sf-options.php:138
|
| 1336 |
-
#: ../trunk/classes/admin/settings/sf-options.php:138
|
| 1337 |
-
msgid "Attributes"
|
| 1338 |
-
msgstr "Atributos"
|
| 1339 |
-
|
| 1340 |
-
#: ../classes/admin/settings/sf-options.php:139
|
| 1341 |
-
#: ../trunk/classes/admin/settings/sf-options.php:139
|
| 1342 |
-
msgid "Advanced"
|
| 1343 |
-
msgstr "Avanzado"
|
| 1344 |
-
|
| 1345 |
-
#: ../classes/admin/settings/sf-options.php:146
|
| 1346 |
-
#: ../trunk/classes/admin/settings/sf-options.php:146
|
| 1347 |
-
msgid "Types"
|
| 1348 |
-
msgstr "Tipos"
|
| 1349 |
-
|
| 1350 |
-
#: ../classes/admin/settings/sf-options.php:147
|
| 1351 |
-
#: ../trunk/classes/admin/settings/sf-options.php:147
|
| 1352 |
-
msgid "CHECKING these boxes will HIDE these product types from the vendor"
|
| 1353 |
-
msgstr "MARCAR estas cajas OCULTARÁ estos tipos de productos para el vendedor"
|
| 1354 |
-
|
| 1355 |
-
#: ../classes/admin/settings/sf-options.php:150
|
| 1356 |
-
#: ../trunk/classes/admin/settings/sf-options.php:150
|
| 1357 |
-
msgid "Simple"
|
| 1358 |
-
msgstr "Simple"
|
| 1359 |
-
|
| 1360 |
-
#: ../classes/admin/settings/sf-options.php:151
|
| 1361 |
-
#: ../trunk/classes/admin/settings/sf-options.php:151
|
| 1362 |
-
msgid "Variable"
|
| 1363 |
-
msgstr "Variable"
|
| 1364 |
-
|
| 1365 |
-
#: ../classes/admin/settings/sf-options.php:152
|
| 1366 |
-
#: ../trunk/classes/admin/settings/sf-options.php:152
|
| 1367 |
-
msgid "Grouped"
|
| 1368 |
-
msgstr "Agrupado"
|
| 1369 |
-
|
| 1370 |
-
#: ../classes/admin/settings/sf-options.php:153
|
| 1371 |
-
#: ../trunk/classes/admin/settings/sf-options.php:153
|
| 1372 |
-
msgid "External / affiliate"
|
| 1373 |
-
msgstr "Externo / afiliado"
|
| 1374 |
-
|
| 1375 |
-
#: ../classes/admin/settings/sf-options.php:160
|
| 1376 |
-
#: ../trunk/classes/admin/settings/sf-options.php:160
|
| 1377 |
-
msgid "Type options"
|
| 1378 |
-
msgstr "Opciones de tipos"
|
| 1379 |
-
|
| 1380 |
-
#: ../classes/admin/settings/sf-options.php:161
|
| 1381 |
-
#: ../trunk/classes/admin/settings/sf-options.php:161
|
| 1382 |
-
msgid ""
|
| 1383 |
-
"CHECKING these boxes will **HIDE** these product options from the vendor"
|
| 1384 |
-
msgstr ""
|
| 1385 |
-
"MARCAR estas cajas se OCULTARÁ estas opciones de producto para el vendedor"
|
| 1386 |
-
|
| 1387 |
-
#: ../classes/admin/settings/sf-options.php:164
|
| 1388 |
-
#: ../trunk/classes/admin/settings/sf-options.php:164
|
| 1389 |
-
msgid "Virtual"
|
| 1390 |
-
msgstr "Virtual"
|
| 1391 |
-
|
| 1392 |
-
#: ../classes/admin/settings/sf-options.php:165
|
| 1393 |
-
#: ../trunk/classes/admin/settings/sf-options.php:165
|
| 1394 |
-
msgid "Downloadable"
|
| 1395 |
-
msgstr "Descargable"
|
| 1396 |
-
|
| 1397 |
-
#: ../classes/admin/settings/sf-options.php:172
|
| 1398 |
-
#: ../trunk/classes/admin/settings/sf-options.php:172
|
| 1399 |
-
msgid "Miscellaneous"
|
| 1400 |
-
msgstr "Otros"
|
| 1401 |
-
|
| 1402 |
-
#: ../classes/admin/settings/sf-options.php:176
|
| 1403 |
-
#: ../trunk/classes/admin/settings/sf-options.php:176
|
| 1404 |
-
msgid "SKU"
|
| 1405 |
-
msgstr "SKU"
|
| 1406 |
-
|
| 1407 |
-
#: ../classes/admin/settings/sf-options.php:177
|
| 1408 |
-
#: ../trunk/classes/admin/settings/sf-options.php:177
|
| 1409 |
-
msgid "Featured"
|
| 1410 |
-
msgstr "Destacado"
|
| 1411 |
-
|
| 1412 |
-
#: ../classes/admin/settings/sf-options.php:178
|
| 1413 |
-
#: ../trunk/classes/admin/settings/sf-options.php:178
|
| 1414 |
-
msgid "Duplicate Product"
|
| 1415 |
-
msgstr "Producto duplicado"
|
| 1416 |
-
|
| 1417 |
-
#: ../classes/admin/settings/sf-options.php:185
|
| 1418 |
-
#: ../trunk/classes/admin/settings/sf-options.php:185
|
| 1419 |
-
msgid "Stylesheet"
|
| 1420 |
-
msgstr "Hoja de estilo"
|
| 1421 |
-
|
| 1422 |
-
#: ../classes/admin/settings/sf-options.php:186
|
| 1423 |
-
#: ../trunk/classes/admin/settings/sf-options.php:186
|
| 1424 |
-
msgid ""
|
| 1425 |
-
"You can add CSS in this textarea, which will be loaded on the product add/"
|
| 1426 |
-
"edit page for vendors."
|
| 1427 |
-
msgstr ""
|
| 1428 |
-
"El CSS que agregues aquí será cargado en la página de agregar/editar "
|
| 1429 |
-
"productos del vendedor."
|
| 1430 |
-
|
| 1431 |
-
#: ../classes/admin/settings/sf-options.php:193
|
| 1432 |
-
#: ../trunk/classes/admin/settings/sf-options.php:193
|
| 1433 |
-
msgid "Permissions"
|
| 1434 |
-
msgstr "Permisos"
|
| 1435 |
-
|
| 1436 |
-
#: ../classes/admin/settings/sf-options.php:193
|
| 1437 |
-
#: ../trunk/classes/admin/settings/sf-options.php:193
|
| 1438 |
-
msgid "General permissions used around the shop"
|
| 1439 |
-
msgstr "Permisos generales usados en la tienda"
|
| 1440 |
-
|
| 1441 |
-
#: ../classes/admin/settings/sf-options.php:197
|
| 1442 |
-
#: ../trunk/classes/admin/settings/sf-options.php:197
|
| 1443 |
-
msgid "View orders"
|
| 1444 |
-
msgstr "Ver pedidos"
|
| 1445 |
-
|
| 1446 |
-
#: ../classes/admin/settings/sf-options.php:198
|
| 1447 |
-
#: ../trunk/classes/admin/settings/sf-options.php:198
|
| 1448 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 1449 |
-
msgstr ""
|
| 1450 |
-
"Mostrar detalles del cliente como email, dirección y nombre para cada pedido"
|
| 1451 |
-
|
| 1452 |
-
#: ../classes/admin/settings/sf-options.php:205
|
| 1453 |
-
#: ../trunk/classes/admin/settings/sf-options.php:205
|
| 1454 |
-
msgid "View comments"
|
| 1455 |
-
msgstr "Ver comentarios"
|
| 1456 |
-
|
| 1457 |
-
#: ../classes/admin/settings/sf-options.php:206
|
| 1458 |
-
#: ../trunk/classes/admin/settings/sf-options.php:206
|
| 1459 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 1460 |
-
msgstr ""
|
| 1461 |
-
"Ver todos los comentarios de los vendedores para un pedido en el frontend"
|
| 1462 |
-
|
| 1463 |
-
#: ../classes/admin/settings/sf-options.php:213
|
| 1464 |
-
#: ../trunk/classes/admin/settings/sf-options.php:213
|
| 1465 |
-
msgid "Submit comments"
|
| 1466 |
-
msgstr "Enviar comentarios"
|
| 1467 |
-
|
| 1468 |
-
#: ../classes/admin/settings/sf-options.php:214
|
| 1469 |
-
#: ../trunk/classes/admin/settings/sf-options.php:214
|
| 1470 |
-
msgid ""
|
| 1471 |
-
"Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 1472 |
-
msgstr ""
|
| 1473 |
-
"Enviar comentarios de un pedido en el frontend. Ejemplo: ID de rastreo del "
|
| 1474 |
-
"producto"
|
| 1475 |
-
|
| 1476 |
-
#: ../classes/admin/settings/sf-options.php:221
|
| 1477 |
-
#: ../trunk/classes/admin/settings/sf-options.php:221
|
| 1478 |
-
msgid "View email addresses"
|
| 1479 |
-
msgstr "Ver dirección de email"
|
| 1480 |
-
|
| 1481 |
-
#: ../classes/admin/settings/sf-options.php:222
|
| 1482 |
-
#: ../trunk/classes/admin/settings/sf-options.php:222
|
| 1483 |
-
msgid ""
|
| 1484 |
-
"While viewing order details on the frontend, you can disable or enable email "
|
| 1485 |
-
"addresses"
|
| 1486 |
-
msgstr ""
|
| 1487 |
-
"Al ver los detalles del pedido en el frontend se puede habilitar o "
|
| 1488 |
-
"deshabitar la dirección de email"
|
| 1489 |
-
|
| 1490 |
-
#: ../classes/admin/settings/sf-options.php:229
|
| 1491 |
-
#: ../trunk/classes/admin/settings/sf-options.php:229
|
| 1492 |
-
msgid "Export a CSV file of orders for a product"
|
| 1493 |
-
msgstr "Exportar un archivo CSV de los pedidos de un producto"
|
| 1494 |
-
|
| 1495 |
-
#: ../classes/admin/settings/sf-options.php:230
|
| 1496 |
-
#: ../trunk/classes/admin/settings/sf-options.php:230
|
| 1497 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 1498 |
-
msgstr "Los vendedores pueden exportar pedidos de un producto en el frontend"
|
| 1499 |
-
|
| 1500 |
-
#: ../classes/admin/settings/sf-options.php:237
|
| 1501 |
-
#: ../trunk/classes/admin/settings/sf-options.php:237
|
| 1502 |
-
msgid "Reports"
|
| 1503 |
-
msgstr "Reportes"
|
| 1504 |
-
|
| 1505 |
-
#: ../classes/admin/settings/sf-options.php:238
|
| 1506 |
-
#: ../trunk/classes/admin/settings/sf-options.php:238
|
| 1507 |
-
msgid ""
|
| 1508 |
-
"<strike>View backend sales reports</strike>. <strong>Depreciated</strong>"
|
| 1509 |
-
msgstr ""
|
| 1510 |
-
"<strike>Ver reportes de ventas en el backend</strike>. <strong>Despreciado</"
|
| 1511 |
-
"strong>"
|
| 1512 |
-
|
| 1513 |
-
#: ../classes/admin/settings/sf-options.php:239
|
| 1514 |
-
#: ../trunk/classes/admin/settings/sf-options.php:239
|
| 1515 |
-
msgid ""
|
| 1516 |
-
"This option has been removed and will no longer function. It will be "
|
| 1517 |
-
"completely removed in future versions. Vendors should use their Vendor "
|
| 1518 |
-
"Dashboard for reports as all identical functionality is already there. "
|
| 1519 |
-
msgstr ""
|
| 1520 |
-
"Esta opción se ha eliminado y ya no funciona. Será completamente eliminada "
|
| 1521 |
-
"en una versión futura. Los vendedores deberían usar su escritorio para "
|
| 1522 |
-
"enviar reportes. "
|
| 1523 |
-
|
| 1524 |
-
#: ../classes/admin/settings/sf-options.php:246
|
| 1525 |
-
#: ../trunk/classes/admin/settings/sf-options.php:246
|
| 1526 |
-
msgid "View Frontend sales reports"
|
| 1527 |
-
msgstr "Ver reportes de ventas en el frontend"
|
| 1528 |
-
|
| 1529 |
-
#: ../classes/admin/settings/sf-options.php:247
|
| 1530 |
-
#: ../trunk/classes/admin/settings/sf-options.php:247
|
| 1531 |
-
msgid ""
|
| 1532 |
-
"Sales table on the frontend on the Vendor Dashboard page. The table will "
|
| 1533 |
-
"only display sales data that pertain to their products, and only for orders "
|
| 1534 |
-
"that are processing or completed."
|
| 1535 |
-
msgstr ""
|
| 1536 |
-
"Tabla de ventas en el escritorio de los vendedores. La tabla solo muestra "
|
| 1537 |
-
"los datos de las ventas de sus productos, y solo para las órdenes en proceso "
|
| 1538 |
-
"o completas."
|
| 1539 |
-
|
| 1540 |
-
#: ../classes/admin/settings/sf-options.php:255
|
| 1541 |
-
#: ../trunk/classes/admin/settings/sf-options.php:255
|
| 1542 |
-
msgid "Submit products"
|
| 1543 |
-
msgstr "Crear productos"
|
| 1544 |
-
|
| 1545 |
-
#: ../classes/admin/settings/sf-options.php:256
|
| 1546 |
-
#: ../trunk/classes/admin/settings/sf-options.php:256
|
| 1547 |
-
msgid ""
|
| 1548 |
-
"Check to allow vendors to list new products. Admin must approve new "
|
| 1549 |
-
"products by editing the product, and clicking Publish."
|
| 1550 |
-
msgstr ""
|
| 1551 |
-
"Marca para permitir que los vendedores agreguen nuevos productos. Los "
|
| 1552 |
-
"administradores deben aprobar los productos editando el producto y haciendo "
|
| 1553 |
-
"click en “Publicar”."
|
| 1554 |
-
|
| 1555 |
-
#: ../classes/admin/settings/sf-options.php:263
|
| 1556 |
-
#: ../trunk/classes/admin/settings/sf-options.php:263
|
| 1557 |
-
msgid "Edit live products"
|
| 1558 |
-
msgstr "Editar productos publicados"
|
| 1559 |
-
|
| 1560 |
-
#: ../classes/admin/settings/sf-options.php:264
|
| 1561 |
-
#: ../trunk/classes/admin/settings/sf-options.php:264
|
| 1562 |
-
msgid ""
|
| 1563 |
-
"Vendors could edit an approved product after it has already gone live. There "
|
| 1564 |
-
"is no approval or review after editing a live product. This could be "
|
| 1565 |
-
"dangerous with malicious vendors, so take caution."
|
| 1566 |
-
msgstr ""
|
| 1567 |
-
"Los vendedores pueden editar un producto aprobado después de que ya ha sido "
|
| 1568 |
-
"publicado. No es necesario la aprobación o revisión. Esto puede ser "
|
| 1569 |
-
"peligroso con vendedores maliciosos, tomar con cuidado."
|
| 1570 |
-
|
| 1571 |
-
#: ../classes/admin/settings/sf-options.php:271
|
| 1572 |
-
#: ../trunk/classes/admin/settings/sf-options.php:271
|
| 1573 |
-
msgid "Submit products live without requiring approval"
|
| 1574 |
-
msgstr "Publicar productos sin necesidad de aprobación"
|
| 1575 |
-
|
| 1576 |
-
#: ../classes/admin/settings/sf-options.php:272
|
| 1577 |
-
#: ../trunk/classes/admin/settings/sf-options.php:272
|
| 1578 |
-
msgid ""
|
| 1579 |
-
"Vendors can submit products without review or approval from a shop admin. "
|
| 1580 |
-
"This could be dangerous with malicious vendors, so take caution."
|
| 1581 |
-
msgstr ""
|
| 1582 |
-
"Los vendedores pueden publicar un producto. No es necesario la aprobación o "
|
| 1583 |
-
"revisión. Esto puede ser peligroso con vendedores maliciosos, tomar con "
|
| 1584 |
-
"cuidado."
|
| 1585 |
-
|
| 1586 |
-
#: ../classes/admin/settings/sf-options.php:278
|
| 1587 |
-
#: ../trunk/classes/admin/settings/sf-options.php:278
|
| 1588 |
-
msgid "Pages"
|
| 1589 |
-
msgstr "Páginas"
|
| 1590 |
-
|
| 1591 |
-
#: ../classes/admin/settings/sf-options.php:279
|
| 1592 |
-
#: ../trunk/classes/admin/settings/sf-options.php:279
|
| 1593 |
-
msgid "Page configuration"
|
| 1594 |
-
msgstr "Configuración de la página"
|
| 1595 |
-
|
| 1596 |
-
#: ../classes/admin/settings/sf-options.php:282
|
| 1597 |
-
#: ../trunk/classes/admin/settings/sf-options.php:282
|
| 1598 |
-
msgid "Vendor dashboard"
|
| 1599 |
-
msgstr "Dashboard del vendedor"
|
| 1600 |
-
|
| 1601 |
-
#: ../classes/admin/settings/sf-options.php:283
|
| 1602 |
-
#: ../trunk/classes/admin/settings/sf-options.php:283
|
| 1603 |
-
msgid ""
|
| 1604 |
-
"Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</"
|
| 1605 |
-
"code><br/>. If this page is not set, you will break your site. If you "
|
| 1606 |
-
"upgrade to Pro, keep this page unchanged as both Pro Dashboard and this "
|
| 1607 |
-
"Dashboard page must be set."
|
| 1608 |
-
msgstr ""
|
| 1609 |
-
"Elige la página que tiene el shortcode <code>[wcv_vendor_dashboard]</"
|
| 1610 |
-
"code><br>Debes elegir una página o tu sitio se romperá."
|
| 1611 |
-
|
| 1612 |
-
#: ../classes/admin/settings/sf-options.php:290
|
| 1613 |
-
#: ../trunk/classes/admin/settings/sf-options.php:290
|
| 1614 |
-
msgid "Shop settings"
|
| 1615 |
-
msgstr "Ajustes de la tienda"
|
| 1616 |
-
|
| 1617 |
-
#: ../classes/admin/settings/sf-options.php:291
|
| 1618 |
-
#: ../trunk/classes/admin/settings/sf-options.php:291
|
| 1619 |
-
msgid ""
|
| 1620 |
-
"Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/"
|
| 1621 |
-
">These are the shop settings a vendor can configure. By default, Vendor "
|
| 1622 |
-
"Dashboard > Shop Settings should have this shortcode."
|
| 1623 |
-
msgstr ""
|
| 1624 |
-
"Elige la página que tiene el shortcode <code>[wcv_shop_settings]</"
|
| 1625 |
-
"code><br>Estos son los ajustes de la tienda que el vendedor puede configurar."
|
| 1626 |
-
|
| 1627 |
-
#: ../classes/admin/settings/sf-options.php:298
|
| 1628 |
-
#: ../trunk/classes/admin/settings/sf-options.php:298
|
| 1629 |
-
msgid "Orders page"
|
| 1630 |
-
msgstr "Página de pedidos"
|
| 1631 |
-
|
| 1632 |
-
#: ../classes/admin/settings/sf-options.php:299
|
| 1633 |
-
#: ../trunk/classes/admin/settings/sf-options.php:299
|
| 1634 |
-
msgid ""
|
| 1635 |
-
"Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 1636 |
-
"default, Vendor Dashboard > Orders should have the shortcode."
|
| 1637 |
-
msgstr "Elige la página que tiene el shortcode <code>[wcv_orders]</code>"
|
| 1638 |
-
|
| 1639 |
-
#: ../classes/admin/settings/sf-options.php:306
|
| 1640 |
-
#: ../trunk/classes/admin/settings/sf-options.php:306
|
| 1641 |
-
msgid "Vendor terms"
|
| 1642 |
-
msgstr "Condiciones de los vendedores"
|
| 1643 |
-
|
| 1644 |
-
#: ../classes/admin/settings/sf-options.php:307
|
| 1645 |
-
#: ../trunk/classes/admin/settings/sf-options.php:307
|
| 1646 |
-
msgid ""
|
| 1647 |
-
"These terms are shown to a user when submitting an application to become a "
|
| 1648 |
-
"vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor "
|
| 1649 |
-
"must accept terms in order to register, if set."
|
| 1650 |
-
msgstr ""
|
| 1651 |
-
"Estas condiciones se muestran al usuario cuando envía una postulación para "
|
| 1652 |
-
"ser vendedor.<br>Si se deja en blanco no se le mostrará nada."
|
| 1653 |
-
|
| 1654 |
-
#: ../classes/admin/settings/sf-options.php:314
|
| 1655 |
-
#: ../trunk/classes/admin/settings/sf-options.php:314
|
| 1656 |
-
msgid "payments"
|
| 1657 |
-
msgstr "pagos"
|
| 1658 |
-
|
| 1659 |
-
#: ../classes/admin/settings/sf-options.php:325
|
| 1660 |
-
#: ../trunk/classes/admin/settings/sf-options.php:325
|
| 1661 |
-
msgid "Payments"
|
| 1662 |
-
msgstr "Pagos"
|
| 1663 |
-
|
| 1664 |
-
#: ../classes/admin/settings/sf-options.php:327
|
| 1665 |
-
#: ../trunk/classes/admin/settings/sf-options.php:327
|
| 1666 |
-
msgid "PayPal Adaptive Payments Scheduling"
|
| 1667 |
-
msgstr "Calendario de PayPal Adaptive Payments"
|
| 1668 |
-
|
| 1669 |
-
#: ../classes/admin/settings/sf-options.php:328
|
| 1670 |
-
#: ../trunk/classes/admin/settings/sf-options.php:328
|
| 1671 |
-
#, php-format
|
| 1672 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 1673 |
-
msgstr "Deuda total de comisiones: %s. <a href=\"%s\">Ver detalles</a>."
|
| 1674 |
-
|
| 1675 |
-
#: ../classes/admin/settings/sf-options.php:329
|
| 1676 |
-
#: ../trunk/classes/admin/settings/sf-options.php:329
|
| 1677 |
-
#, php-format
|
| 1678 |
-
msgid ""
|
| 1679 |
-
"Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 1680 |
-
"\">here</a>. <br><br>To instantly pay with Adaptive Payments you must "
|
| 1681 |
-
"activate the PayPal AP gateway in your Checkout settings. <br><a href="
|
| 1682 |
-
"\"https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/\" "
|
| 1683 |
-
"target=\"top\">PayPal AP Application Help</a>. <br><br>Another gateway that "
|
| 1684 |
-
"offers instant payments to vendors that also accepts credit cards directly "
|
| 1685 |
-
"on your checkout page is Stripe. <br><a href=\"https://www.wcvendors.com/"
|
| 1686 |
-
"product/stripe-commissions-gateway/\" target=\"top\">Stripe Commissions & "
|
| 1687 |
-
"Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a href="
|
| 1688 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 1689 |
-
"Vendors Pro</a>."
|
| 1690 |
-
msgstr ""
|
| 1691 |
-
|
| 1692 |
-
#: ../classes/admin/settings/sf-options.php:333
|
| 1693 |
-
#: ../trunk/classes/admin/settings/sf-options.php:333
|
| 1694 |
-
msgid "Instant pay"
|
| 1695 |
-
msgstr "Pago instantáneo"
|
| 1696 |
-
|
| 1697 |
-
#: ../classes/admin/settings/sf-options.php:334
|
| 1698 |
-
#: ../trunk/classes/admin/settings/sf-options.php:334
|
| 1699 |
-
msgid ""
|
| 1700 |
-
"Instantly pay vendors their commission when an order is made, and if a "
|
| 1701 |
-
"vendor has a valid PayPal email added on their Shop Settings page."
|
| 1702 |
-
msgstr ""
|
| 1703 |
-
"Pagar instantáneamente la comisión a los vendedores cuando se hace un pedido "
|
| 1704 |
-
"(si el vendedor tiene un email de PayPal válido)."
|
| 1705 |
-
|
| 1706 |
-
#: ../classes/admin/settings/sf-options.php:335
|
| 1707 |
-
#: ../trunk/classes/admin/settings/sf-options.php:335
|
| 1708 |
-
msgid ""
|
| 1709 |
-
"For this to work, customers must checkout with the PayPal Adaptive Payments "
|
| 1710 |
-
"gateway. Using any other gateways will not pay vendors instantly"
|
| 1711 |
-
msgstr ""
|
| 1712 |
-
"Para que esto funcione, los clientes deben realizar el pago con PayPal "
|
| 1713 |
-
"Adaptive Payments. Utilizando cualquier otra pasarela no pagará a los "
|
| 1714 |
-
"vendedores al instante"
|
| 1715 |
-
|
| 1716 |
-
#: ../classes/admin/settings/sf-options.php:342
|
| 1717 |
-
#: ../trunk/classes/admin/settings/sf-options.php:342
|
| 1718 |
-
msgid "Payment schedule"
|
| 1719 |
-
msgstr "Calendario de pagos"
|
| 1720 |
-
|
| 1721 |
-
#: ../classes/admin/settings/sf-options.php:343
|
| 1722 |
-
#: ../trunk/classes/admin/settings/sf-options.php:343
|
| 1723 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 1724 |
-
msgstr "El calendario solo funciona si el “Pago instantáneo” no está marcado"
|
| 1725 |
-
|
| 1726 |
-
#: ../classes/admin/settings/sf-options.php:348
|
| 1727 |
-
#: ../trunk/classes/admin/settings/sf-options.php:348
|
| 1728 |
-
msgid "Daily"
|
| 1729 |
-
msgstr "Diario"
|
| 1730 |
-
|
| 1731 |
-
#: ../classes/admin/settings/sf-options.php:349
|
| 1732 |
-
#: ../trunk/classes/admin/settings/sf-options.php:349
|
| 1733 |
-
msgid "Weekly"
|
| 1734 |
-
msgstr "Semanal"
|
| 1735 |
-
|
| 1736 |
-
#: ../classes/admin/settings/sf-options.php:350
|
| 1737 |
-
#: ../trunk/classes/admin/settings/sf-options.php:350
|
| 1738 |
-
msgid "Biweekly"
|
| 1739 |
-
msgstr "Bisemanal"
|
| 1740 |
-
|
| 1741 |
-
#: ../classes/admin/settings/sf-options.php:351
|
| 1742 |
-
#: ../trunk/classes/admin/settings/sf-options.php:351
|
| 1743 |
-
msgid "Monthly"
|
| 1744 |
-
msgstr "Mensual"
|
| 1745 |
-
|
| 1746 |
-
#: ../classes/admin/settings/sf-options.php:352
|
| 1747 |
-
#: ../trunk/classes/admin/settings/sf-options.php:352
|
| 1748 |
-
msgid "Manual"
|
| 1749 |
-
msgstr "Manual"
|
| 1750 |
-
|
| 1751 |
-
#: ../classes/admin/settings/sf-options.php:353
|
| 1752 |
-
#: ../trunk/classes/admin/settings/sf-options.php:353
|
| 1753 |
-
msgid "Now"
|
| 1754 |
-
msgstr "Ahora"
|
| 1755 |
-
|
| 1756 |
-
#: ../classes/admin/settings/sf-options.php:358
|
| 1757 |
-
#: ../trunk/classes/admin/settings/sf-options.php:358
|
| 1758 |
-
msgid "Email notification"
|
| 1759 |
-
msgstr "Notificaciones por email"
|
| 1760 |
-
|
| 1761 |
-
#: ../classes/admin/settings/sf-options.php:359
|
| 1762 |
-
#: ../trunk/classes/admin/settings/sf-options.php:359
|
| 1763 |
-
msgid ""
|
| 1764 |
-
"Send the WooCommerce admin an email each time a payment has been made via "
|
| 1765 |
-
"the payment schedule options above"
|
| 1766 |
-
msgstr ""
|
| 1767 |
-
"Mandar un email al administrador de WooCommerce cada vez que se realice un "
|
| 1768 |
-
"pago por medio del calendario de pagos"
|
| 1769 |
-
|
| 1770 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:11
|
| 1771 |
-
#: ../templates/dashboard/settings/paypal-email-form.php:2
|
| 1772 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:11
|
| 1773 |
-
#: ../trunk/templates/dashboard/settings/paypal-email-form.php:2
|
| 1774 |
-
msgid "PayPal Address"
|
| 1775 |
-
msgstr "Dirección de PayPal"
|
| 1776 |
-
|
| 1777 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:15
|
| 1778 |
-
#: ../templates/dashboard/settings/paypal-email-form.php:3
|
| 1779 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:15
|
| 1780 |
-
#: ../trunk/templates/dashboard/settings/paypal-email-form.php:3
|
| 1781 |
-
msgid "Your PayPal address is used to send you your commission."
|
| 1782 |
-
msgstr "Tu dirección de PayPal se usa para enviarte tu comisión."
|
| 1783 |
-
|
| 1784 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:24
|
| 1785 |
-
#: ../templates/dashboard/settings/shop-name.php:3
|
| 1786 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:24
|
| 1787 |
-
#: ../trunk/templates/dashboard/settings/shop-name.php:3
|
| 1788 |
-
msgid "Your shop name is public and must be unique."
|
| 1789 |
-
msgstr "El nombre de tu tienda es público y único."
|
| 1790 |
-
|
| 1791 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:43
|
| 1792 |
-
#: ../templates/dashboard/settings/seller-info.php:4
|
| 1793 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:43
|
| 1794 |
-
#: ../trunk/templates/dashboard/settings/seller-info.php:4
|
| 1795 |
-
msgid "This is displayed on each of your products."
|
| 1796 |
-
msgstr "Esto se muestra en cada uno de tus productos."
|
| 1797 |
-
|
| 1798 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:49
|
| 1799 |
-
#: ../templates/dashboard/settings/shop-description.php:2
|
| 1800 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:49
|
| 1801 |
-
#: ../trunk/templates/dashboard/settings/shop-description.php:2
|
| 1802 |
-
msgid "Shop Description"
|
| 1803 |
-
msgstr "Descripción de la tienda"
|
| 1804 |
-
|
| 1805 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:61
|
| 1806 |
-
#: ../templates/dashboard/settings/shop-description.php:3
|
| 1807 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:61
|
| 1808 |
-
#: ../trunk/templates/dashboard/settings/shop-description.php:3
|
| 1809 |
-
#, php-format
|
| 1810 |
-
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 1811 |
-
msgstr "Esto se muestra en la <a href=\"%s\">página de tu tienda</a>."
|
| 1812 |
-
|
| 1813 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:70
|
| 1814 |
-
#: ../trunk/classes/admin/views/html-vendor-settings-page.php:70
|
| 1815 |
-
msgid "Save Shop Settings"
|
| 1816 |
-
msgstr "Guardar la configuración de la tienda"
|
| 1817 |
-
|
| 1818 |
-
#: ../classes/class-cron.php:87 ../trunk/classes/class-cron.php:87
|
| 1819 |
-
#, php-format
|
| 1820 |
-
msgid "Payment total: %s"
|
| 1821 |
-
msgstr "Total del pago: %s"
|
| 1822 |
-
|
| 1823 |
-
#: ../classes/class-cron.php:149 ../trunk/classes/class-cron.php:149
|
| 1824 |
-
msgid "Once Daily"
|
| 1825 |
-
msgstr "Diario"
|
| 1826 |
-
|
| 1827 |
-
#: ../classes/class-cron.php:154 ../trunk/classes/class-cron.php:154
|
| 1828 |
-
msgid "Once Weekly"
|
| 1829 |
-
msgstr "Semanal"
|
| 1830 |
-
|
| 1831 |
-
#: ../classes/class-cron.php:159 ../trunk/classes/class-cron.php:159
|
| 1832 |
-
msgid "Once every two weeks"
|
| 1833 |
-
msgstr "Bisemanal"
|
| 1834 |
-
|
| 1835 |
-
#: ../classes/class-cron.php:164 ../trunk/classes/class-cron.php:164
|
| 1836 |
-
msgid "Once a month"
|
| 1837 |
-
msgstr "Mensual"
|
| 1838 |
-
|
| 1839 |
-
#: ../classes/class-install.php:205 ../trunk/classes/class-install.php:205
|
| 1840 |
-
msgid "Vendor Dashboard"
|
| 1841 |
-
msgstr "Escritorio del vendedor"
|
| 1842 |
-
|
| 1843 |
-
#: ../classes/class-vendor-post-types.php:34
|
| 1844 |
-
#: ../trunk/classes/class-vendor-post-types.php:34
|
| 1845 |
-
msgid "Vendor Orders"
|
| 1846 |
-
msgstr "Pedidos del vendedor"
|
| 1847 |
-
|
| 1848 |
-
#: ../classes/class-vendors.php:554 ../trunk/classes/class-vendors.php:554
|
| 1849 |
-
#, php-format
|
| 1850 |
-
msgid "Vendor Order – %s"
|
| 1851 |
-
msgstr "Pedido del vendedor – %s"
|
| 1852 |
-
|
| 1853 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:53
|
| 1854 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:53
|
| 1855 |
-
msgid "Order marked shipped."
|
| 1856 |
-
msgstr "Marcar como pedido enviado."
|
| 1857 |
-
|
| 1858 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:55
|
| 1859 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:55
|
| 1860 |
-
#, php-format
|
| 1861 |
-
msgid "%s has marked as shipped. "
|
| 1862 |
-
msgstr "%s marcado como enviados. "
|
| 1863 |
-
|
| 1864 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:83
|
| 1865 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:84
|
| 1866 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:83
|
| 1867 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:84
|
| 1868 |
-
msgid "Tracking number"
|
| 1869 |
-
msgstr "Número de rastreo"
|
| 1870 |
-
|
| 1871 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:86
|
| 1872 |
-
#: ../trunk/classes/front/dashboard/class-vendor-dashboard.php:86
|
| 1873 |
-
msgid "Success. Your tracking number has been updated."
|
| 1874 |
-
msgstr "Tu número de rastreo ha sido actualizado."
|
| 1875 |
-
|
| 1876 |
-
#: ../classes/front/orders/class-export-csv.php:19
|
| 1877 |
-
#: ../templates/dashboard/reports.php:18
|
| 1878 |
-
#: ../templates/emails/admin-new-order.php:23
|
| 1879 |
-
#: ../templates/emails/notify-vendor-shipped.php:27
|
| 1880 |
-
#: ../templates/emails/vendor-new-order.php:31
|
| 1881 |
-
#: ../trunk/classes/front/orders/class-export-csv.php:19
|
| 1882 |
-
#: ../trunk/templates/dashboard/reports.php:18
|
| 1883 |
-
#: ../trunk/templates/emails/admin-new-order.php:23
|
| 1884 |
-
#: ../trunk/templates/emails/notify-vendor-shipped.php:27
|
| 1885 |
-
#: ../trunk/templates/emails/vendor-new-order.php:31
|
| 1886 |
-
msgid "Quantity"
|
| 1887 |
-
msgstr "Cantidad"
|
| 1888 |
-
|
| 1889 |
-
#: ../classes/front/orders/class-export-csv.php:20
|
| 1890 |
-
#: ../trunk/classes/front/orders/class-export-csv.php:20
|
| 1891 |
-
msgid "Item Meta"
|
| 1892 |
-
msgstr "Meta información del producto"
|
| 1893 |
-
|
| 1894 |
-
#: ../classes/front/orders/class-orders.php:100
|
| 1895 |
-
#: ../classes/front/orders/class-orders.php:166
|
| 1896 |
-
#: ../trunk/classes/front/orders/class-orders.php:100
|
| 1897 |
-
#: ../trunk/classes/front/orders/class-orders.php:166
|
| 1898 |
-
msgid ""
|
| 1899 |
-
"You haven't selected a product's orders to view! Please go back to the "
|
| 1900 |
-
"Vendor Dashboard and click Show Orders on the product you'd like to view."
|
| 1901 |
-
msgstr ""
|
| 1902 |
-
"No has seleccionado pedidos de productos para ver. Por favor ve al "
|
| 1903 |
-
"Escritorio del vendedor y haz click en “Mostrar pedidos” en el producto que "
|
| 1904 |
-
"quieres ver."
|
| 1905 |
-
|
| 1906 |
-
#: ../classes/front/orders/class-orders.php:123
|
| 1907 |
-
#: ../classes/front/orders/class-orders.php:189
|
| 1908 |
-
#: ../trunk/classes/front/orders/class-orders.php:123
|
| 1909 |
-
#: ../trunk/classes/front/orders/class-orders.php:189
|
| 1910 |
-
msgid "No orders."
|
| 1911 |
-
msgstr "No hay pedidos."
|
| 1912 |
-
|
| 1913 |
-
#: ../classes/front/orders/class-orders.php:250
|
| 1914 |
-
#: ../trunk/classes/front/orders/class-orders.php:250
|
| 1915 |
-
msgid "Product Title"
|
| 1916 |
-
msgstr "Producto"
|
| 1917 |
-
|
| 1918 |
-
#: ../classes/front/orders/class-orders.php:251
|
| 1919 |
-
#: ../trunk/classes/front/orders/class-orders.php:251
|
| 1920 |
-
msgid "Full name"
|
| 1921 |
-
msgstr "Nombre completo"
|
| 1922 |
-
|
| 1923 |
-
#: ../classes/front/orders/class-orders.php:252
|
| 1924 |
-
#: ../trunk/classes/front/orders/class-orders.php:252
|
| 1925 |
-
msgid "Address"
|
| 1926 |
-
msgstr "Dirección"
|
| 1927 |
-
|
| 1928 |
-
#: ../classes/front/orders/class-orders.php:253
|
| 1929 |
-
#: ../trunk/classes/front/orders/class-orders.php:253
|
| 1930 |
-
msgid "City"
|
| 1931 |
-
msgstr "Ciudad"
|
| 1932 |
-
|
| 1933 |
-
#: ../classes/front/orders/class-orders.php:254
|
| 1934 |
-
#: ../trunk/classes/front/orders/class-orders.php:254
|
| 1935 |
-
msgid "State"
|
| 1936 |
-
msgstr "Estado"
|
| 1937 |
-
|
| 1938 |
-
#: ../classes/front/orders/class-orders.php:255
|
| 1939 |
-
#: ../trunk/classes/front/orders/class-orders.php:255
|
| 1940 |
-
msgid "Zip"
|
| 1941 |
-
msgstr "CP"
|
| 1942 |
-
|
| 1943 |
-
#: ../classes/front/orders/class-orders.php:256
|
| 1944 |
-
#: ../trunk/classes/front/orders/class-orders.php:256
|
| 1945 |
-
msgid "Email address"
|
| 1946 |
-
msgstr "Email"
|
| 1947 |
-
|
| 1948 |
-
#: ../classes/front/orders/class-submit-comment.php:41
|
| 1949 |
-
#: ../trunk/classes/front/orders/class-submit-comment.php:41
|
| 1950 |
-
msgid "You've left the comment field empty!"
|
| 1951 |
-
msgstr "¡Has dejado el campo de comentarios vacío!"
|
| 1952 |
-
|
| 1953 |
-
#: ../classes/front/orders/class-submit-comment.php:63
|
| 1954 |
-
#: ../trunk/classes/front/orders/class-submit-comment.php:63
|
| 1955 |
-
msgid "Success. The customer has been notified of your comment."
|
| 1956 |
-
msgstr "Éxito. El cliente ha sido notificado de tu comentario."
|
| 1957 |
-
|
| 1958 |
-
#: ../classes/front/signup/class-vendor-signup.php:70
|
| 1959 |
-
#: ../trunk/classes/front/signup/class-vendor-signup.php:70
|
| 1960 |
-
msgid "Application denied. You are an administrator."
|
| 1961 |
-
msgstr "Aplicación denegada. Eres un administrador."
|
| 1962 |
-
|
| 1963 |
-
#: ../classes/front/signup/class-vendor-signup.php:72
|
| 1964 |
-
#: ../trunk/classes/front/signup/class-vendor-signup.php:72
|
| 1965 |
-
msgid "Your application has been submitted."
|
| 1966 |
-
msgstr "Su solicitud ha sido enviada."
|
| 1967 |
-
|
| 1968 |
-
#: ../classes/front/signup/class-vendor-signup.php:119
|
| 1969 |
-
#: ../classes/front/signup/class-vendor-signup.php:156
|
| 1970 |
-
#: ../classes/front/signup/class-vendor-signup.php:168
|
| 1971 |
-
#: ../trunk/classes/front/signup/class-vendor-signup.php:119
|
| 1972 |
-
#: ../trunk/classes/front/signup/class-vendor-signup.php:156
|
| 1973 |
-
#: ../trunk/classes/front/signup/class-vendor-signup.php:168
|
| 1974 |
-
msgid "You must accept the terms and conditions to become a vendor."
|
| 1975 |
-
msgstr "Debes aceptar los términos y condiciones para postular a vendedor."
|
| 1976 |
-
|
| 1977 |
-
#: ../classes/front/signup/views/html-vendor-signup.php:21
|
| 1978 |
-
#: ../templates/dashboard/denied.php:22
|
| 1979 |
-
#: ../trunk/classes/front/signup/views/html-vendor-signup.php:21
|
| 1980 |
-
#: ../trunk/templates/dashboard/denied.php:22
|
| 1981 |
-
msgid "Apply to become a vendor? "
|
| 1982 |
-
msgstr "¿Postularse para vendedor? "
|
| 1983 |
-
|
| 1984 |
-
#: ../classes/front/signup/views/html-vendor-signup.php:35
|
| 1985 |
-
#: ../trunk/classes/front/signup/views/html-vendor-signup.php:35
|
| 1986 |
-
#, php-format
|
| 1987 |
-
msgid ""
|
| 1988 |
-
"I have read and accepted the <a target=\"top\" href=\"%s\">terms and "
|
| 1989 |
-
"conditions</a>"
|
| 1990 |
-
msgstr "Leí y acepto los <a target=“top” href=“%s”>términos y condiciones</a>"
|
| 1991 |
-
|
| 1992 |
-
#: ../classes/front/signup/views/html-vendor-signup.php:44
|
| 1993 |
-
#: ../trunk/classes/front/signup/views/html-vendor-signup.php:44
|
| 1994 |
-
msgid "Please agree to the terms and conditions"
|
| 1995 |
-
msgstr "Por favor acepta los términos y condiciones"
|
| 1996 |
-
|
| 1997 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1998 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1999 |
-
msgid "PayPal Adaptive Payments"
|
| 2000 |
-
msgstr "PayPal Adaptive Payments"
|
| 2001 |
-
|
| 2002 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 2003 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 2004 |
-
#, php-format
|
| 2005 |
-
msgid ""
|
| 2006 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 2007 |
-
"%s."
|
| 2008 |
-
msgstr ""
|
| 2009 |
-
"Algo salió mal. La respuesta de PayPal invalidó este pedido. Estado: %s."
|
| 2010 |
-
|
| 2011 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 2012 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 2013 |
-
msgid "IPN payment completed"
|
| 2014 |
-
msgstr "Pago IPN completado"
|
| 2015 |
-
|
| 2016 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 2017 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 2018 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 2019 |
-
msgstr "Habilitar PayPal Adaptive Payments"
|
| 2020 |
-
|
| 2021 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 2022 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 2023 |
-
msgid "Method Title"
|
| 2024 |
-
msgstr "Título del método"
|
| 2025 |
-
|
| 2026 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 2027 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:70
|
| 2028 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 2029 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:70
|
| 2030 |
-
msgid "This controls the title which the user sees during checkout."
|
| 2031 |
-
msgstr "Esto controla el título que el usuario verá durante el checkout."
|
| 2032 |
-
|
| 2033 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 2034 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 2035 |
-
msgid "PayPal"
|
| 2036 |
-
msgstr "PayPal"
|
| 2037 |
-
|
| 2038 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:159
|
| 2039 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:75
|
| 2040 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:159
|
| 2041 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:75
|
| 2042 |
-
msgid "Description"
|
| 2043 |
-
msgstr "Descripción"
|
| 2044 |
-
|
| 2045 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 2046 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 2047 |
-
msgid "This controls the description which the user sees during checkout."
|
| 2048 |
-
msgstr "Esto controla la descripción que el usuario verá durante el checkout."
|
| 2049 |
-
|
| 2050 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 2051 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 2052 |
-
msgid "Pay via PayPal!"
|
| 2053 |
-
msgstr "¡Pagar vía PayPal!"
|
| 2054 |
-
|
| 2055 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 2056 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 2057 |
-
msgid "Live Credentials"
|
| 2058 |
-
msgstr "Credenciales publicadas"
|
| 2059 |
-
|
| 2060 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 2061 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 2062 |
-
#, php-format
|
| 2063 |
-
msgid ""
|
| 2064 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 2065 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 2066 |
-
msgstr ""
|
| 2067 |
-
"Debes tener un <a href=\"%s\">ID de postulación</a> para procesar "
|
| 2068 |
-
"transacciones. No se necesita uno para probar en modo Sandbox."
|
| 2069 |
-
|
| 2070 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:179
|
| 2071 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 2072 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:179
|
| 2073 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 2074 |
-
msgid "PayPal Email"
|
| 2075 |
-
msgstr "Email de PayPal"
|
| 2076 |
-
|
| 2077 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:180
|
| 2078 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 2079 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:180
|
| 2080 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 2081 |
-
msgid "The email address main payments should go to."
|
| 2082 |
-
msgstr "El email donde deben ir los pagos principales."
|
| 2083 |
-
|
| 2084 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:185
|
| 2085 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 2086 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:185
|
| 2087 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 2088 |
-
msgid "API Username"
|
| 2089 |
-
msgstr "API Nombre de Usuario"
|
| 2090 |
-
|
| 2091 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:190
|
| 2092 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 2093 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:190
|
| 2094 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 2095 |
-
msgid "API Password"
|
| 2096 |
-
msgstr "API Contraseña"
|
| 2097 |
-
|
| 2098 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:195
|
| 2099 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 2100 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:195
|
| 2101 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 2102 |
-
msgid "API Signature"
|
| 2103 |
-
msgstr "API Firma"
|
| 2104 |
-
|
| 2105 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 2106 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 2107 |
-
msgid "Application ID"
|
| 2108 |
-
msgstr "Postuación"
|
| 2109 |
-
|
| 2110 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 2111 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 2112 |
-
msgid "Only required when doing live transactions."
|
| 2113 |
-
msgstr "Solo requerida para hacer transacciones."
|
| 2114 |
-
|
| 2115 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 2116 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 2117 |
-
msgid "Sandbox Credentials"
|
| 2118 |
-
msgstr "Credenciales de Sandbox"
|
| 2119 |
-
|
| 2120 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 2121 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 2122 |
-
#, php-format
|
| 2123 |
-
msgid ""
|
| 2124 |
-
"You can signup for a sandbox developer account <a href=\"%s\">here</a>. You "
|
| 2125 |
-
"need a developer account if you want to enable Sandbox mode for testing."
|
| 2126 |
-
msgstr ""
|
| 2127 |
-
"Puedes hacer signup para una cuenta de Sandbox Developer <a href=\"%s"
|
| 2128 |
-
"\">aquí</a>. Necesitas una cuenta de Developer si quieres habilitar el modo "
|
| 2129 |
-
"de Sandbox para hacer pruebas."
|
| 2130 |
-
|
| 2131 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 2132 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 2133 |
-
msgid "Misc. Settings"
|
| 2134 |
-
msgstr "Otros Ajustes"
|
| 2135 |
-
|
| 2136 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 2137 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 2138 |
-
msgid "Enable PayPal Sandbox mode"
|
| 2139 |
-
msgstr "Habilitar modo Sandbox para PayPal"
|
| 2140 |
-
|
| 2141 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 2142 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 2143 |
-
msgid "Enable logging"
|
| 2144 |
-
msgstr "Habilitar logging"
|
| 2145 |
-
|
| 2146 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 2147 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 2148 |
-
msgid ""
|
| 2149 |
-
"The PayPal Adaptive Payments gateway can instantly pay your vendors their "
|
| 2150 |
-
"due commission (if enabled). Also used to mass pay vendors on a schedule / "
|
| 2151 |
-
"manual method (if enabled)."
|
| 2152 |
-
msgstr ""
|
| 2153 |
-
"El gateway de PayPal Adaptive Payments puede pagar instantáneamente a los "
|
| 2154 |
-
"vendedores la comisión adeudada (si está habilitado). Además puede ser usado "
|
| 2155 |
-
"para pagar en masa a los vendedores en una fecha o método manual (si está "
|
| 2156 |
-
"habilitado)."
|
| 2157 |
-
|
| 2158 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 2159 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 2160 |
-
msgid "Gateway Disabled"
|
| 2161 |
-
msgstr "Gateway deshabilitado"
|
| 2162 |
-
|
| 2163 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 2164 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 2165 |
-
#, php-format
|
| 2166 |
-
msgid "%s does not support your store currency."
|
| 2167 |
-
msgstr "%s no soporta la moneda de tu cuenta."
|
| 2168 |
-
|
| 2169 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:389
|
| 2170 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:505
|
| 2171 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:153
|
| 2172 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:389
|
| 2173 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:505
|
| 2174 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:153
|
| 2175 |
-
#, php-format
|
| 2176 |
-
msgid "Error: %s"
|
| 2177 |
-
msgstr "Error: %s"
|
| 2178 |
-
|
| 2179 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:398
|
| 2180 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:399
|
| 2181 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:398
|
| 2182 |
-
#: ../trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php:399
|
| 2183 |
-
#, php-format
|
| 2184 |
-
msgid "Error ID: %s. %s"
|
| 2185 |
-
msgstr "Error ID: %s. %s"
|
| 2186 |
-
|
| 2187 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 2188 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 2189 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 2190 |
-
msgstr ""
|
| 2191 |
-
"No se encontraron vendedores que pagar. ¿Quizás no tienen configurada su "
|
| 2192 |
-
"dirección de PayPal?"
|
| 2193 |
-
|
| 2194 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:167
|
| 2195 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:167
|
| 2196 |
-
msgid "All due commission has been paid for."
|
| 2197 |
-
msgstr "Se han pagado todas las comisiones adeudadas."
|
| 2198 |
-
|
| 2199 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:173
|
| 2200 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:173
|
| 2201 |
-
msgid ""
|
| 2202 |
-
"All due commission has been paid for, but I could not clear it from their "
|
| 2203 |
-
"profiles due to an internal error. Commission will still be listed as due. "
|
| 2204 |
-
"Please manually mark the commission as paid from the Commissions page."
|
| 2205 |
-
msgstr ""
|
| 2206 |
-
"Se han pagado todas las comisiones adeudadas, pero no se han limpiado del "
|
| 2207 |
-
"perfil por un error interno. Las comisiones van a seguir como adeudadas. Por "
|
| 2208 |
-
"favor marcar manualmente como pagadas desde la Página de Comisiones."
|
| 2209 |
-
|
| 2210 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 2211 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 2212 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 2213 |
-
msgstr "WooCommerce: Actualizar los pagos en masa de vendedores"
|
| 2214 |
-
|
| 2215 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:210
|
| 2216 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:210
|
| 2217 |
-
msgid ""
|
| 2218 |
-
"Hello! A payment was just triggered to mass pay all vendors their due "
|
| 2219 |
-
"commission."
|
| 2220 |
-
msgstr ""
|
| 2221 |
-
"¡Hola! Un pago ha sido desatado para pagar a todos los vendedores su "
|
| 2222 |
-
"comisión adeudada."
|
| 2223 |
-
|
| 2224 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:211
|
| 2225 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:211
|
| 2226 |
-
#, php-format
|
| 2227 |
-
msgid "Payment status: %s."
|
| 2228 |
-
msgstr "Estado del pago: %s."
|
| 2229 |
-
|
| 2230 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 2231 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 2232 |
-
#, php-format
|
| 2233 |
-
msgid "Payment message: %s."
|
| 2234 |
-
msgstr "Mensaje del pago: %s."
|
| 2235 |
-
|
| 2236 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:215
|
| 2237 |
-
#: ../trunk/classes/gateways/PayPal_Masspay/class-paypal-masspay.php:215
|
| 2238 |
-
#, php-format
|
| 2239 |
-
msgid "Payment total: %s."
|
| 2240 |
-
msgstr "Total del pago: %s."
|
| 2241 |
-
|
| 2242 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:35
|
| 2243 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:71
|
| 2244 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:35
|
| 2245 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:71
|
| 2246 |
-
msgid "WC Vendors Test Gateway"
|
| 2247 |
-
msgstr "Pasarela de prueba para WC Vendors"
|
| 2248 |
-
|
| 2249 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:36
|
| 2250 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:36
|
| 2251 |
-
msgid ""
|
| 2252 |
-
"This gateway will set orders to processing upon receipt allowing you to test "
|
| 2253 |
-
"transactions in your store. Some WooCommerce included gateways have "
|
| 2254 |
-
"problems with this - you should use this gateway for all of your non-PayPal "
|
| 2255 |
-
"testing."
|
| 2256 |
-
msgstr ""
|
| 2257 |
-
"Esta pasarela pondrá pedidos en procesamiento tras la recepción que permite "
|
| 2258 |
-
"poner a prueba las transacciones en su tienda. Algunos portales de "
|
| 2259 |
-
"WooCommerce incluido tienen problemas con esto - usted debe utilizar este "
|
| 2260 |
-
"portal para todas las pruebas - pero no para las pruebas de PayPal."
|
| 2261 |
-
|
| 2262 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:64
|
| 2263 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:64
|
| 2264 |
-
msgid "Enable WC Vendors Test Gateway Payment"
|
| 2265 |
-
msgstr "Habilitar WC Vendors pasarela de prueba con pago"
|
| 2266 |
-
|
| 2267 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:68
|
| 2268 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:68
|
| 2269 |
-
msgid "Title"
|
| 2270 |
-
msgstr "Título"
|
| 2271 |
-
|
| 2272 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:77
|
| 2273 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:77
|
| 2274 |
-
msgid "Payment method description that the customer will see on your checkout."
|
| 2275 |
-
msgstr "Forma de pago descripción que el cliente verá en su caja."
|
| 2276 |
-
|
| 2277 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:78
|
| 2278 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:78
|
| 2279 |
-
msgid ""
|
| 2280 |
-
"This is a test gateway -- not to be used on live sites for live "
|
| 2281 |
-
"transactions. <a href=\"http://www.wcvendors.com/\" target=\"top\">Click "
|
| 2282 |
-
"here to visit WCVendors.com</a>."
|
| 2283 |
-
msgstr ""
|
| 2284 |
-
"Este es un portal de prueba--no debe usarse en sitios en vivo para "
|
| 2285 |
-
"transacciones en vivo. <a href=\"http://www.wcvendors.com/\" target=\"top"
|
| 2286 |
-
"\">Haga clic aquí para visitar WCVendors.com</a>."
|
| 2287 |
-
|
| 2288 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:82
|
| 2289 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:82
|
| 2290 |
-
msgid "Instructions"
|
| 2291 |
-
msgstr "Instrucciones"
|
| 2292 |
-
|
| 2293 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:84
|
| 2294 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:84
|
| 2295 |
-
msgid ""
|
| 2296 |
-
"Success! Your test order is now marked as processing and any vendors will "
|
| 2297 |
-
"be sent an email as long as you have the Notify Vendors email enabled under "
|
| 2298 |
-
"WooCommerce--Settings--Emails."
|
| 2299 |
-
msgstr ""
|
| 2300 |
-
"¡Completo! El pedido de prueba ya está marcado como en proceso y se enviará "
|
| 2301 |
-
"un correo electrónico, siempre y cuando usted tenga la notificación por "
|
| 2302 |
-
"correo a vendedores activada en WooCommerce > Configuración de correos "
|
| 2303 |
-
"electrónicos."
|
| 2304 |
-
|
| 2305 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:127
|
| 2306 |
-
#: ../trunk/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:127
|
| 2307 |
-
msgid "Test gateway transation complete. Order processing."
|
| 2308 |
-
msgstr "Pasarela de prueba transacción completa. Procesando el pedido."
|
| 2309 |
-
|
| 2310 |
-
#: ../templates/dashboard/denied.php:8
|
| 2311 |
-
#: ../trunk/templates/dashboard/denied.php:8
|
| 2312 |
-
msgid ""
|
| 2313 |
-
"Your account has not yet been approved to become a vendor. When it is, you "
|
| 2314 |
-
"will receive an email telling you that your account is approved!"
|
| 2315 |
-
msgstr ""
|
| 2316 |
-
"Tu cuenta no ha sido aprobada para convertirte en un vendedor. ¡De ser "
|
| 2317 |
-
"aprobada, se te enviará un email!"
|
| 2318 |
-
|
| 2319 |
-
#: ../templates/dashboard/denied.php:12
|
| 2320 |
-
#: ../trunk/templates/dashboard/denied.php:12
|
| 2321 |
-
msgid "Your account is not setup as a vendor."
|
| 2322 |
-
msgstr "No tienes una cuenta configurada como vendedor."
|
| 2323 |
-
|
| 2324 |
-
#: ../templates/dashboard/denied.php:33
|
| 2325 |
-
#: ../trunk/templates/dashboard/denied.php:33
|
| 2326 |
-
#, php-format
|
| 2327 |
-
msgid "I have read and accepted the <a href=\"%s\">terms and conditions</a>"
|
| 2328 |
-
msgstr "Leí y acepto los <a href=\"%s\">términos y condiciones</a>"
|
| 2329 |
-
|
| 2330 |
-
#: ../templates/dashboard/denied.php:53
|
| 2331 |
-
#: ../trunk/templates/dashboard/denied.php:53
|
| 2332 |
-
msgid "Submit"
|
| 2333 |
-
msgstr "Enviar"
|
| 2334 |
-
|
| 2335 |
-
#: ../templates/dashboard/links.php:3 ../trunk/templates/dashboard/links.php:3
|
| 2336 |
-
msgid "View Your Store"
|
| 2337 |
-
msgstr "Ver tu tienda"
|
| 2338 |
-
|
| 2339 |
-
#: ../templates/dashboard/links.php:4 ../trunk/templates/dashboard/links.php:4
|
| 2340 |
-
msgid "Store Settings"
|
| 2341 |
-
msgstr "Ajustes de la tienda"
|
| 2342 |
-
|
| 2343 |
-
#: ../templates/dashboard/links.php:7 ../trunk/templates/dashboard/links.php:7
|
| 2344 |
-
msgid "Add New Product"
|
| 2345 |
-
msgstr "Nuevo producto"
|
| 2346 |
-
|
| 2347 |
-
#: ../templates/dashboard/links.php:8 ../trunk/templates/dashboard/links.php:8
|
| 2348 |
-
msgid "Edit Products"
|
| 2349 |
-
msgstr "Editar productos"
|
| 2350 |
-
|
| 2351 |
-
#: ../templates/dashboard/orders.php:18 ../templates/dashboard/orders.php:21
|
| 2352 |
-
#: ../trunk/templates/dashboard/orders.php:18
|
| 2353 |
-
#: ../trunk/templates/dashboard/orders.php:21
|
| 2354 |
-
msgid "Hide items"
|
| 2355 |
-
msgstr "Esconder productos"
|
| 2356 |
-
|
| 2357 |
-
#: ../templates/dashboard/orders.php:19 ../templates/dashboard/orders.php:93
|
| 2358 |
-
#: ../trunk/templates/dashboard/orders.php:19
|
| 2359 |
-
#: ../trunk/templates/dashboard/orders.php:93
|
| 2360 |
-
msgid "View items"
|
| 2361 |
-
msgstr "Ver productos"
|
| 2362 |
-
|
| 2363 |
-
#: ../templates/dashboard/orders.php:48
|
| 2364 |
-
#: ../trunk/templates/dashboard/orders.php:48
|
| 2365 |
-
msgid "Links"
|
| 2366 |
-
msgstr "Acciones"
|
| 2367 |
-
|
| 2368 |
-
#: ../templates/dashboard/orders.php:114
|
| 2369 |
-
#: ../trunk/templates/dashboard/orders.php:114
|
| 2370 |
-
msgid "Tracking"
|
| 2371 |
-
msgstr "Seguimiento"
|
| 2372 |
-
|
| 2373 |
-
#: ../templates/dashboard/orders.php:188
|
| 2374 |
-
#: ../trunk/templates/dashboard/orders.php:188
|
| 2375 |
-
msgid "You have no orders during this period."
|
| 2376 |
-
msgstr "No tienes pedidos en este período."
|
| 2377 |
-
|
| 2378 |
-
#: ../templates/dashboard/reports.php:1
|
| 2379 |
-
#: ../trunk/templates/dashboard/reports.php:1
|
| 2380 |
-
msgid "Sales Report"
|
| 2381 |
-
msgstr "Ventas"
|
| 2382 |
-
|
| 2383 |
-
#: ../templates/dashboard/reports.php:20
|
| 2384 |
-
#: ../trunk/templates/dashboard/reports.php:20
|
| 2385 |
-
msgid "Rate"
|
| 2386 |
-
msgstr "Porcentaje"
|
| 2387 |
-
|
| 2388 |
-
#: ../templates/dashboard/reports.php:47
|
| 2389 |
-
#: ../trunk/templates/dashboard/reports.php:47
|
| 2390 |
-
msgid "Show Orders"
|
| 2391 |
-
msgstr "Ver pedidos"
|
| 2392 |
-
|
| 2393 |
-
#: ../templates/dashboard/reports.php:56
|
| 2394 |
-
#: ../trunk/templates/dashboard/reports.php:56
|
| 2395 |
-
msgid "Totals"
|
| 2396 |
-
msgstr "Totales"
|
| 2397 |
-
|
| 2398 |
-
#: ../templates/dashboard/reports.php:71
|
| 2399 |
-
#: ../trunk/templates/dashboard/reports.php:71
|
| 2400 |
-
msgid "You have no sales during this period."
|
| 2401 |
-
msgstr "No tienes ventas en este período."
|
| 2402 |
-
|
| 2403 |
-
#: ../templates/dashboard/reports.php:82
|
| 2404 |
-
#: ../trunk/templates/dashboard/reports.php:82
|
| 2405 |
-
msgid "You haven't made any sales yet."
|
| 2406 |
-
msgstr "No tienes ventas aún."
|
| 2407 |
-
|
| 2408 |
-
#: ../templates/dashboard/settings/settings.php:47
|
| 2409 |
-
#: ../trunk/templates/dashboard/settings/settings.php:47
|
| 2410 |
-
msgid "Save"
|
| 2411 |
-
msgstr "Guardar"
|
| 2412 |
-
|
| 2413 |
-
#: ../templates/emails/admin-new-order.php:13
|
| 2414 |
-
#: ../templates/emails/vendor-new-order.php:21
|
| 2415 |
-
#: ../trunk/templates/emails/admin-new-order.php:13
|
| 2416 |
-
#: ../trunk/templates/emails/vendor-new-order.php:21
|
| 2417 |
-
#, php-format
|
| 2418 |
-
msgid "You have received an order from %s. Their order is as follows:"
|
| 2419 |
-
msgstr "Has recibido un pedido de %s:"
|
| 2420 |
-
|
| 2421 |
-
#: ../templates/emails/admin-new-order.php:17
|
| 2422 |
-
#: ../templates/emails/notify-vendor-shipped.php:21
|
| 2423 |
-
#: ../templates/emails/vendor-new-order.php:25
|
| 2424 |
-
#: ../trunk/templates/emails/admin-new-order.php:17
|
| 2425 |
-
#: ../trunk/templates/emails/notify-vendor-shipped.php:21
|
| 2426 |
-
#: ../trunk/templates/emails/vendor-new-order.php:25
|
| 2427 |
-
#, php-format
|
| 2428 |
-
msgid "Order: %s"
|
| 2429 |
-
msgstr "Pedido: %s"
|
| 2430 |
-
|
| 2431 |
-
#: ../templates/emails/admin-new-order.php:24
|
| 2432 |
-
#: ../templates/emails/notify-vendor-shipped.php:28
|
| 2433 |
-
#: ../templates/emails/vendor-new-order.php:32
|
| 2434 |
-
#: ../trunk/templates/emails/admin-new-order.php:24
|
| 2435 |
-
#: ../trunk/templates/emails/notify-vendor-shipped.php:28
|
| 2436 |
-
#: ../trunk/templates/emails/vendor-new-order.php:32
|
| 2437 |
-
msgid "Price"
|
| 2438 |
-
msgstr "Precio"
|
| 2439 |
-
|
| 2440 |
-
#: ../templates/emails/admin-new-order.php:50
|
| 2441 |
-
#: ../templates/emails/notify-vendor-shipped.php:60
|
| 2442 |
-
#: ../templates/emails/vendor-new-order.php:80
|
| 2443 |
-
#: ../trunk/templates/emails/admin-new-order.php:50
|
| 2444 |
-
#: ../trunk/templates/emails/notify-vendor-shipped.php:60
|
| 2445 |
-
#: ../trunk/templates/emails/vendor-new-order.php:80
|
| 2446 |
-
msgid "Customer details"
|
| 2447 |
-
msgstr "Detalle del cliente"
|
| 2448 |
-
|
| 2449 |
-
#: ../templates/emails/admin-new-order.php:53
|
| 2450 |
-
#: ../templates/emails/notify-vendor-shipped.php:63
|
| 2451 |
-
#: ../templates/emails/vendor-new-order.php:83
|
| 2452 |
-
#: ../trunk/templates/emails/admin-new-order.php:53
|
| 2453 |
-
#: ../trunk/templates/emails/notify-vendor-shipped.php:63
|
| 2454 |
-
#: ../trunk/templates/emails/vendor-new-order.php:83
|
| 2455 |
-
msgid "Email:"
|
| 2456 |
-
msgstr "Email:"
|
| 2457 |
-
|
| 2458 |
-
#: ../templates/emails/admin-new-order.php:56
|
| 2459 |
-
#: ../templates/emails/notify-vendor-shipped.php:66
|
| 2460 |
-
#: ../templates/emails/vendor-new-order.php:86
|
| 2461 |
-
#: ../trunk/templates/emails/admin-new-order.php:56
|
| 2462 |
-
#: ../trunk/templates/emails/notify-vendor-shipped.php:66
|
| 2463 |
-
#: ../trunk/templates/emails/vendor-new-order.php:86
|
| 2464 |
-
msgid "Tel:"
|
| 2465 |
-
msgstr "Tel:"
|
| 2466 |
-
|
| 2467 |
-
#: ../templates/emails/application-status.php:5
|
| 2468 |
-
#: ../trunk/templates/emails/application-status.php:5
|
| 2469 |
-
#, php-format
|
| 2470 |
-
msgid "Hi there. This is a notification about a vendor application on %s."
|
| 2471 |
-
msgstr "Hola. Esta es una notificación de la postulación de un vendedor en %s."
|
| 2472 |
-
|
| 2473 |
-
#: ../templates/emails/application-status.php:8
|
| 2474 |
-
#: ../trunk/templates/emails/application-status.php:8
|
| 2475 |
-
#, php-format
|
| 2476 |
-
msgid "Application status: %s"
|
| 2477 |
-
msgstr "Estado de la postulación: %s"
|
| 2478 |
-
|
| 2479 |
-
#: ../templates/emails/application-status.php:9
|
| 2480 |
-
#: ../trunk/templates/emails/application-status.php:9
|
| 2481 |
-
#, php-format
|
| 2482 |
-
msgid "Applicant username: %s"
|
| 2483 |
-
msgstr "Username del postulante: %s"
|
| 2484 |
-
|
| 2485 |
-
#: ../templates/emails/new-product.php:5
|
| 2486 |
-
#: ../trunk/templates/emails/new-product.php:5
|
| 2487 |
-
#, php-format
|
| 2488 |
-
msgid "Hi there. This is a notification about a new product on %s."
|
| 2489 |
-
msgstr "Hola. Esta es una notificación sobre un nuevo producto en %s."
|
| 2490 |
-
|
| 2491 |
-
#: ../templates/emails/new-product.php:8
|
| 2492 |
-
#: ../trunk/templates/emails/new-product.php:8
|
| 2493 |
-
#, php-format
|
| 2494 |
-
msgid "Product title: %s"
|
| 2495 |
-
msgstr "Título del producto: %s"
|
| 2496 |
-
|
| 2497 |
-
#: ../templates/emails/new-product.php:9
|
| 2498 |
-
#: ../trunk/templates/emails/new-product.php:9
|
| 2499 |
-
#, php-format
|
| 2500 |
-
msgid "Submitted by: %s"
|
| 2501 |
-
msgstr "Enviado por: %s"
|
| 2502 |
-
|
| 2503 |
-
#: ../templates/emails/new-product.php:10
|
| 2504 |
-
#: ../trunk/templates/emails/new-product.php:10
|
| 2505 |
-
#, php-format
|
| 2506 |
-
msgid "Edit product: %s"
|
| 2507 |
-
msgstr "Editar producto: %s"
|
| 2508 |
-
|
| 2509 |
-
#: ../templates/emails/notify-vendor-shipped.php:17
|
| 2510 |
-
#: ../trunk/templates/emails/notify-vendor-shipped.php:17
|
| 2511 |
-
msgid ""
|
| 2512 |
-
"A vendor has marked part of your order as shipped. The items that are "
|
| 2513 |
-
"shipped are as follows:"
|
| 2514 |
-
msgstr ""
|
| 2515 |
-
"Un vendedor ha marcado parte de tu pedido como enviado. Los elementos serán "
|
| 2516 |
-
"enviados de la siguiente forma:"
|
| 2517 |
-
|
| 2518 |
-
#: ../templates/orders/comments/add-new-comment.php:11
|
| 2519 |
-
#: ../trunk/templates/orders/comments/add-new-comment.php:11
|
| 2520 |
-
msgid "Add comment"
|
| 2521 |
-
msgstr "Agregar comentario"
|
| 2522 |
-
|
| 2523 |
-
#: ../templates/orders/comments/existing-comments.php:9
|
| 2524 |
-
#: ../trunk/templates/orders/comments/existing-comments.php:9
|
| 2525 |
-
#, php-format
|
| 2526 |
-
msgid "added %s ago"
|
| 2527 |
-
msgstr "Agregado hace %s"
|
| 2528 |
-
|
| 2529 |
-
#: ../templates/orders/csv-export.php:6
|
| 2530 |
-
#: ../trunk/templates/orders/csv-export.php:6
|
| 2531 |
-
msgid "Export orders"
|
| 2532 |
-
msgstr "Exportar pedidos"
|
| 2533 |
-
|
| 2534 |
-
#: ../templates/orders/customer-note/customer-note.php:4
|
| 2535 |
-
#: ../trunk/templates/orders/customer-note/customer-note.php:4
|
| 2536 |
-
msgid "Customer note"
|
| 2537 |
-
msgstr "Nota del cliente"
|
| 2538 |
-
|
| 2539 |
-
#: ../templates/orders/customer-note/customer-note.php:8
|
| 2540 |
-
#: ../trunk/templates/orders/customer-note/customer-note.php:8
|
| 2541 |
-
msgid "No customer note."
|
| 2542 |
-
msgstr "No hay nota del cliente."
|
| 2543 |
-
|
| 2544 |
-
#: ../templates/orders/orders.php:80 ../trunk/templates/orders/orders.php:80
|
| 2545 |
-
#, php-format
|
| 2546 |
-
msgid "Comments (%s)"
|
| 2547 |
-
msgstr "Comentarios (%s)"
|
| 2548 |
-
|
| 2549 |
-
#: ../templates/orders/shipping/shipping-form.php:6
|
| 2550 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:6
|
| 2551 |
-
msgid "Provider:"
|
| 2552 |
-
msgstr "Proveedor:"
|
| 2553 |
-
|
| 2554 |
-
#: ../templates/orders/shipping/shipping-form.php:8
|
| 2555 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:8
|
| 2556 |
-
msgid "Custom Provider"
|
| 2557 |
-
msgstr "Proveedor personalizado"
|
| 2558 |
-
|
| 2559 |
-
#: ../templates/orders/shipping/shipping-form.php:31
|
| 2560 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:31
|
| 2561 |
-
msgid "Provider Name:"
|
| 2562 |
-
msgstr "Nombre del proveedor:"
|
| 2563 |
-
|
| 2564 |
-
#: ../templates/orders/shipping/shipping-form.php:40
|
| 2565 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:40
|
| 2566 |
-
msgid "Tracking number:"
|
| 2567 |
-
msgstr "Número de rastreo:"
|
| 2568 |
-
|
| 2569 |
-
#: ../templates/orders/shipping/shipping-form.php:48
|
| 2570 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:48
|
| 2571 |
-
msgid "Tracking link:"
|
| 2572 |
-
msgstr "Enlace de rastreo:"
|
| 2573 |
-
|
| 2574 |
-
#: ../templates/orders/shipping/shipping-form.php:58
|
| 2575 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:58
|
| 2576 |
-
msgid "Date shipped:"
|
| 2577 |
-
msgstr "Fecha de envío:"
|
| 2578 |
-
|
| 2579 |
-
#: ../templates/orders/shipping/shipping-form.php:66
|
| 2580 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:66
|
| 2581 |
-
msgid "Preview:"
|
| 2582 |
-
msgstr "Previsualizar:"
|
| 2583 |
-
|
| 2584 |
-
#: ../templates/orders/shipping/shipping-form.php:66
|
| 2585 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:66
|
| 2586 |
-
msgid "Click here to track your shipment"
|
| 2587 |
-
msgstr "Haz click para rastrear tu envío"
|
| 2588 |
-
|
| 2589 |
-
#: ../templates/orders/shipping/shipping-form.php:75
|
| 2590 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:75
|
| 2591 |
-
msgid "Update tracking number"
|
| 2592 |
-
msgstr "Actualizar el numero de rastreo"
|
| 2593 |
-
|
| 2594 |
-
#: ../templates/orders/shipping/shipping-form.php:77
|
| 2595 |
-
#: ../trunk/templates/orders/shipping/shipping-form.php:77
|
| 2596 |
-
msgid "Mark as shipped"
|
| 2597 |
-
msgstr "Marcar como enviada"
|
| 2598 |
-
|
| 2599 |
-
#: ../templates/orders/table-body.php:25
|
| 2600 |
-
#: ../trunk/templates/orders/table-body.php:25
|
| 2601 |
-
#, php-format
|
| 2602 |
-
msgid "Quantity: %d"
|
| 2603 |
-
msgstr "Cantidad: %d"
|
| 2604 |
-
|
| 2605 |
-
#~ msgid ""
|
| 2606 |
-
#~ "WC Vendors requires the Vendor shop page value be set <a href=\"%s"
|
| 2607 |
-
#~ "\">click here to set it.</a> | <a href=\"%s\">Hide Notice</a>"
|
| 2608 |
-
#~ msgstr ""
|
| 2609 |
-
#~ "WC vendedores requiere fijar el valor de la pagina tienda del vendedor <a "
|
| 2610 |
-
#~ "href=\"%s\">haga clic aquí para definirlo</a> | <a href=\"%s\">Ocultar "
|
| 2611 |
-
#~ "aviso</a>"
|
| 2612 |
-
|
| 2613 |
-
#~ msgid ""
|
| 2614 |
-
#~ "You must save your permalinks once you have modified your vendor page. <a "
|
| 2615 |
-
#~ "href=\"%s\">click here to save</a>. | <a href=\"%s\">Hide Notice</a>"
|
| 2616 |
-
#~ msgstr ""
|
| 2617 |
-
#~ "Una vez que ha modificado su página vendedor debe guardar tus enlaces "
|
| 2618 |
-
#~ "permanentes. <a href=\"%s\">haga clic aquí para guardar</a>. | <a href="
|
| 2619 |
-
#~ "\"%s\">Ocultar aviso</a>"
|
| 2620 |
-
|
| 2621 |
-
#~ msgid ""
|
| 2622 |
-
#~ "The default rate you pay each vendor for a product sale. If a product has "
|
| 2623 |
-
#~ "a commission rate already set, this value will be ignored for that "
|
| 2624 |
-
#~ "product."
|
| 2625 |
-
#~ msgstr ""
|
| 2626 |
-
#~ "El monto que pagas a cada vendedor por la venta de un producto. Si un "
|
| 2627 |
-
#~ "producto tiene un monto de Comisión ya establecido, este valor se omitirá "
|
| 2628 |
-
#~ "para ese producto."
|
| 2629 |
-
|
| 2630 |
-
#~ msgid ""
|
| 2631 |
-
#~ "The shipping collected on a vendor's product will be given in its entirety"
|
| 2632 |
-
#~ msgstr ""
|
| 2633 |
-
#~ "Se dará el envío recogido por producto a un vendedor en su totalidad"
|
| 2634 |
-
|
| 2635 |
-
#~ msgid "Eg: <code>yoursite.com/[your_setting_here]/[vendor_name_here]</code>"
|
| 2636 |
-
#~ msgstr "Ej: <code>tusitio.com/[your_setting_here]/[vendor_name_here]</code>"
|
| 2637 |
-
|
| 2638 |
-
#~ msgid "View backend sales reports"
|
| 2639 |
-
#~ msgstr "Ver reportes de venta en el backend"
|
| 2640 |
-
|
| 2641 |
-
#~ msgid ""
|
| 2642 |
-
#~ "Graphs and tables via the Reports page in backend. The reports will only "
|
| 2643 |
-
#~ "display sales data that pertain to their products"
|
| 2644 |
-
#~ msgstr ""
|
| 2645 |
-
#~ "Gráficos y tablas vía la página de Reportes en el backend. Los reportes "
|
| 2646 |
-
#~ "solo mostrarán datos de ventas que perteneces a sus productos."
|
| 2647 |
-
|
| 2648 |
-
#~ msgid ""
|
| 2649 |
-
#~ "Vendors could submit a product through the backend, and an admin would "
|
| 2650 |
-
#~ "approve or deny it"
|
| 2651 |
-
#~ msgstr ""
|
| 2652 |
-
#~ "Los vendedores pueden enviar un producto a través del backend, un "
|
| 2653 |
-
#~ "administrador pueden aprobarlos o rechazarlos."
|
| 2654 |
-
|
| 2655 |
-
#~ msgid "User payments"
|
| 2656 |
-
#~ msgstr "Pagos de Usuarios"
|
| 2657 |
-
|
| 2658 |
-
#~ msgid ""
|
| 2659 |
-
#~ "Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 2660 |
-
#~ "\">here</a>."
|
| 2661 |
-
#~ msgstr ""
|
| 2662 |
-
#~ "Asegúrate de actualizar tus ajustes de PayPal Adaptive Payments <a href="
|
| 2663 |
-
#~ "\"%s\">acá</a>."
|
| 2664 |
-
|
| 2665 |
-
#~ msgid "Unmark shipped"
|
| 2666 |
-
#~ msgstr "Desmarcar enviado"
|
| 2667 |
-
|
| 2668 |
-
#~ msgid "Extra data"
|
| 2669 |
-
#~ msgstr "Data adicional"
|
| 2670 |
-
|
| 2671 |
-
#~ msgid "Year"
|
| 2672 |
-
#~ msgstr "Año"
|
| 2673 |
-
|
| 2674 |
-
#~ msgid ""
|
| 2675 |
-
#~ "The default rate the vendor receives for each product. If a product has a "
|
| 2676 |
-
#~ "commission rate already set, this value will be ignored for that product."
|
| 2677 |
-
#~ msgstr ""
|
| 2678 |
-
#~ "La tarifa por defecto que cada vendedor recibe por producto. Si un "
|
| 2679 |
-
#~ "producto tiene una tarifa de comisión configurada, el valor será ignorado "
|
| 2680 |
-
#~ "para ese producto."
|
| 2681 |
-
|
| 2682 |
-
#~ msgid ""
|
| 2683 |
-
#~ "This will show a checkbox on the My Account page's registration form "
|
| 2684 |
-
#~ "asking if the user would like to apply to be a vendor. Also, on the "
|
| 2685 |
-
#~ "Vendor Dashboard, users can apply to become a vendor."
|
| 2686 |
-
#~ msgstr ""
|
| 2687 |
-
#~ "Esto va a mostrar un checkbox en el formulario de registro de la página "
|
| 2688 |
-
#~ "de Mi Cuenta, preguntando al usuario si quiere solicitar ser un vendedor. "
|
| 2689 |
-
#~ "También, en el Dashboard del Vendedor, los usuarios pueden postular para "
|
| 2690 |
-
#~ "convertirse en vendedor."
|
| 2691 |
-
|
| 2692 |
-
#~ msgid ""
|
| 2693 |
-
#~ "The tax collected on a vendor's product will be given to him in its "
|
| 2694 |
-
#~ "entirety"
|
| 2695 |
-
#~ msgstr ""
|
| 2696 |
-
#~ "El impuesto recolectado por producto será dado completo al vendedor."
|
| 2697 |
-
|
| 2698 |
-
#~ msgid "Enable HTML for a vendor's shop description by default"
|
| 2699 |
-
#~ msgstr "Habilitar por defecto HTML para la descripción de la tienda"
|
| 2700 |
-
|
| 2701 |
-
#~ msgid ""
|
| 2702 |
-
#~ "This will override the HTML Shop description output on product-archive "
|
| 2703 |
-
#~ "pages."
|
| 2704 |
-
#~ msgstr ""
|
| 2705 |
-
#~ "Esto va a sobrescribir el HTML de la descripción de la Tienda en las "
|
| 2706 |
-
#~ "páginas de producto-archivo."
|
| 2707 |
-
|
| 2708 |
-
#~ msgid "Hide these areas of the add product page for vendors"
|
| 2709 |
-
#~ msgstr "Esconder estas áreas de la Página de Agregar Producto"
|
| 2710 |
-
|
| 2711 |
-
#~ msgid "Hide these product types from the vendor"
|
| 2712 |
-
#~ msgstr "Esconder estos tipos de productos para el vendedor"
|
| 2713 |
-
|
| 2714 |
-
#~ msgid "Hide these product options from the vendor"
|
| 2715 |
-
#~ msgstr "Esconder estas opciones de productos para el vendedor"
|
| 2716 |
-
|
| 2717 |
-
#~ msgid ""
|
| 2718 |
-
#~ "For this to work, customers must checkout with the PayPal Adaptive "
|
| 2719 |
-
#~ "Payments gateway. Using other gateways will not pay vendors instantly"
|
| 2720 |
-
#~ msgstr ""
|
| 2721 |
-
#~ "Para que esto funcione los clientes debe pagar por PayPal Adaptive "
|
| 2722 |
-
#~ "Payments. No se podrá pagar automáticamente a los vendedores si es de "
|
| 2723 |
-
#~ "otra forma."
|
| 2724 |
-
|
| 2725 |
-
#~ msgid "Order unmarked shipped."
|
| 2726 |
-
#~ msgstr "Desmarcar como orden enviada."
|
| 2727 |
-
|
| 2728 |
-
#~ msgid ""
|
| 2729 |
-
#~ "Your account is not setup as a vendor yet. If you would like to "
|
| 2730 |
-
#~ "register, please complete this page!"
|
| 2731 |
-
#~ msgstr ""
|
| 2732 |
-
#~ "Tu cuenta no está configurada como vendedor aún. ¡Si quieres registrarte "
|
| 2733 |
-
#~ "completa esta página!"
|
| 2734 |
-
|
| 2735 |
-
#~ msgid "Control Center"
|
| 2736 |
-
#~ msgstr "Centro de Mando"
|
| 2737 |
-
|
| 2738 |
-
#~ msgid "My shop"
|
| 2739 |
-
#~ msgstr "Mi tienda"
|
| 2740 |
-
|
| 2741 |
-
#~ msgid "My settings"
|
| 2742 |
-
#~ msgstr "Mis ajustes"
|
| 2743 |
-
|
| 2744 |
-
#~ msgid "Submit a product"
|
| 2745 |
-
#~ msgstr "Enviar un producto"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/wcvendors-fa_IR.mo
DELETED
|
Binary file
|
languages/wcvendors-fa_IR.po
DELETED
|
@@ -1,2156 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: WC Vendors\n"
|
| 4 |
-
"POT-Creation-Date: 2016-08-06 22:25+0430\n"
|
| 5 |
-
"PO-Revision-Date: 2016-08-06 22:25+0430\n"
|
| 6 |
-
"Last-Translator: Alireza Rastegar <alireza.mine@gmail.com>\n"
|
| 7 |
-
"Language-Team: Alireza Rastegar <info@mining-eng.ir>\n"
|
| 8 |
-
"Language: fa_IR\n"
|
| 9 |
-
"MIME-Version: 1.0\n"
|
| 10 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
-
"X-Generator: Poedit 1.8.4\n"
|
| 13 |
-
"X-Poedit-Basepath: .\n"
|
| 14 |
-
"Plural-Forms: nplurals=1; plural=0;\n"
|
| 15 |
-
"X-Poedit-KeywordsList: _;__;_e;_n:1,2;_x:1,2c;_ex:1,2c;_nx:4c,1,2;esc_attr__;"
|
| 16 |
-
"esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c;_n_noop:1,2;"
|
| 17 |
-
"_nx_noop:3c,1,2;__ngettext_noop:1,2;__:1;_e:1;_c:1;_n:1,2;"
|
| 18 |
-
"__ngettext_noop:1,2;_n_noop:1,2;_c;_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;"
|
| 19 |
-
"_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;"
|
| 20 |
-
"esc_html_e;esc_html_x:1,2c\n"
|
| 21 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 22 |
-
"X-Poedit-SearchPath-0: .\n"
|
| 23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
| 24 |
-
|
| 25 |
-
#: ../class-wc-vendors.php:51
|
| 26 |
-
msgid ""
|
| 27 |
-
"WC Vendors requires WooCommerce to run. Please install WooCommerce and "
|
| 28 |
-
"activate before attempting to activate again."
|
| 29 |
-
msgstr ""
|
| 30 |
-
"فروشندگان ووکامرس برای اجرا نیاز به ووکامرس دارد لطفا ابتدا ووکامر را نصب و "
|
| 31 |
-
"فعال نمایید سپس دوباره این افزونه را فعال نمایید."
|
| 32 |
-
|
| 33 |
-
#: ../class-wc-vendors.php:100 ../classes/admin/class-admin-reports.php:41
|
| 34 |
-
#: ../classes/admin/class-admin-users.php:408
|
| 35 |
-
msgid "WC Vendors"
|
| 36 |
-
msgstr "فروشندگان ووکامرس"
|
| 37 |
-
|
| 38 |
-
#: ../class-wc-vendors.php:127
|
| 39 |
-
msgid ""
|
| 40 |
-
"<b>WC Vendors is disabled</b>. WC Vendors requires a minimum of WooCommerce "
|
| 41 |
-
"v2.5.0."
|
| 42 |
-
msgstr ""
|
| 43 |
-
"<b> افزونه فروشندگان ووکامرس غیر فعال شده است</b>. این افزونه حداقل نیاز به "
|
| 44 |
-
"افزونه ووکامرس نسخه 2.2.0 دارد."
|
| 45 |
-
|
| 46 |
-
#: ../class-wc-vendors.php:288 ../classes/admin/settings/sf-options.php:192
|
| 47 |
-
msgid "Capabilities"
|
| 48 |
-
msgstr "دسترسیها"
|
| 49 |
-
|
| 50 |
-
#: ../class-wc-vendors.php:311 ../classes/admin/class-admin-page.php:149
|
| 51 |
-
#: ../classes/admin/class-admin-page.php:372
|
| 52 |
-
#: ../classes/admin/class-admin-reports.php:175
|
| 53 |
-
#: ../classes/admin/class-admin-reports.php:458
|
| 54 |
-
#: ../classes/admin/class-product-meta.php:46
|
| 55 |
-
#: ../classes/admin/class-product-meta.php:187
|
| 56 |
-
#: ../classes/admin/class-product-meta.php:223 ../classes/class-install.php:91
|
| 57 |
-
msgid "Vendor"
|
| 58 |
-
msgstr "فروشنده"
|
| 59 |
-
|
| 60 |
-
#: ../class-wc-vendors.php:313 ../classes/admin/settings/sf-options.php:4
|
| 61 |
-
msgid "General"
|
| 62 |
-
msgstr "عمومی"
|
| 63 |
-
|
| 64 |
-
#: ../class-wc-vendors.php:351
|
| 65 |
-
msgid "Documentation/KB"
|
| 66 |
-
msgstr "مستندات / KB"
|
| 67 |
-
|
| 68 |
-
#: ../class-wc-vendors.php:352
|
| 69 |
-
msgid "Help Forums"
|
| 70 |
-
msgstr "انجمن راهنما"
|
| 71 |
-
|
| 72 |
-
#: ../class-wc-vendors.php:353
|
| 73 |
-
msgid "Paid Support"
|
| 74 |
-
msgstr "هزینه پشتیبانی"
|
| 75 |
-
|
| 76 |
-
#: ../classes/admin/class-admin-page.php:29
|
| 77 |
-
msgid "Vendors shipped"
|
| 78 |
-
msgstr "حمل و نقل در فروشندگان"
|
| 79 |
-
|
| 80 |
-
#: ../classes/admin/class-admin-page.php:52
|
| 81 |
-
msgid "Vendors Shipped"
|
| 82 |
-
msgstr "عرضه در فروشندگان"
|
| 83 |
-
|
| 84 |
-
#: ../classes/admin/class-admin-page.php:78
|
| 85 |
-
#: ../classes/admin/class-admin-page.php:240
|
| 86 |
-
#: ../classes/admin/class-product-meta.php:151
|
| 87 |
-
#: ../classes/admin/class-product-meta.php:167
|
| 88 |
-
#: ../templates/dashboard/reports.php:19
|
| 89 |
-
msgid "Commission"
|
| 90 |
-
msgstr "کمیسیون"
|
| 91 |
-
|
| 92 |
-
#: ../classes/admin/class-admin-page.php:103
|
| 93 |
-
msgid "Reset WC Vendors roles "
|
| 94 |
-
msgstr "تنظیم مجدد نقش های فروشندگان ووکامرس"
|
| 95 |
-
|
| 96 |
-
#: ../classes/admin/class-admin-page.php:104
|
| 97 |
-
msgid "Reset WC Vendor Roles"
|
| 98 |
-
msgstr "تنظیم مجدد نقش های فروشندگان ووکامرس"
|
| 99 |
-
|
| 100 |
-
#: ../classes/admin/class-admin-page.php:105
|
| 101 |
-
msgid ""
|
| 102 |
-
"This will reset the wcvendors roles ( vendor & pending_vendor ), back to the "
|
| 103 |
-
"default capabilities."
|
| 104 |
-
msgstr ""
|
| 105 |
-
|
| 106 |
-
#: ../classes/admin/class-admin-page.php:110
|
| 107 |
-
msgid "Reset WC Vendors "
|
| 108 |
-
msgstr "تنظیم مجدد افزونه فروشندگان ووکامرس"
|
| 109 |
-
|
| 110 |
-
#: ../classes/admin/class-admin-page.php:111
|
| 111 |
-
msgid "Reset WC Vendors Settings"
|
| 112 |
-
msgstr "بازنشانی تنظیمات پیشفرض افزونه فروشندگان ووکامرس"
|
| 113 |
-
|
| 114 |
-
#: ../classes/admin/class-admin-page.php:112
|
| 115 |
-
msgid ""
|
| 116 |
-
"This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings."
|
| 117 |
-
msgstr "این گزینه، تمامی تنظیماتِ موجود را به حالت پیشفرض افزونه در میآورد."
|
| 118 |
-
|
| 119 |
-
#: ../classes/admin/class-admin-page.php:152 ../classes/class-install.php:84
|
| 120 |
-
#: ../classes/class-install.php:239
|
| 121 |
-
msgid "Pending Vendor"
|
| 122 |
-
msgstr "فروشنده در حال انتظار"
|
| 123 |
-
|
| 124 |
-
#: ../classes/admin/class-admin-page.php:158
|
| 125 |
-
msgid "WC Vendor roles successfully reset."
|
| 126 |
-
msgstr "نقش های فروشندگان ووکامرس با موفقیت بازنشانی شد."
|
| 127 |
-
|
| 128 |
-
#: ../classes/admin/class-admin-page.php:172
|
| 129 |
-
msgid "WC Vendors was successfully reset. All settings have been reset."
|
| 130 |
-
msgstr ""
|
| 131 |
-
|
| 132 |
-
#: ../classes/admin/class-admin-page.php:370
|
| 133 |
-
#: ../classes/admin/class-admin-reports.php:174
|
| 134 |
-
#: ../templates/dashboard/reports.php:17
|
| 135 |
-
#: ../templates/emails/admin-new-order.php:22
|
| 136 |
-
#: ../templates/emails/notify-vendor-shipped.php:22
|
| 137 |
-
#: ../templates/emails/vendor-new-order.php:22
|
| 138 |
-
msgid "Product"
|
| 139 |
-
msgstr "محصول"
|
| 140 |
-
|
| 141 |
-
#: ../classes/admin/class-admin-page.php:371
|
| 142 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:283
|
| 143 |
-
msgid "Order ID"
|
| 144 |
-
msgstr "شناسه سفارش"
|
| 145 |
-
|
| 146 |
-
#: ../classes/admin/class-admin-page.php:373
|
| 147 |
-
#: ../classes/admin/class-admin-reports.php:176
|
| 148 |
-
#: ../classes/admin/class-admin-reports.php:374
|
| 149 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:286
|
| 150 |
-
#: ../templates/dashboard/orders.php:35
|
| 151 |
-
msgid "Total"
|
| 152 |
-
msgstr "جمع کل"
|
| 153 |
-
|
| 154 |
-
#: ../classes/admin/class-admin-page.php:374
|
| 155 |
-
#: ../classes/admin/class-admin-reports.php:178
|
| 156 |
-
#: ../classes/admin/class-admin-reports.php:461
|
| 157 |
-
msgid "Status"
|
| 158 |
-
msgstr "وضعیت"
|
| 159 |
-
|
| 160 |
-
#: ../classes/admin/class-admin-page.php:375
|
| 161 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:288
|
| 162 |
-
#: ../classes/front/orders/class-orders.php:195
|
| 163 |
-
#: ../templates/dashboard/orders.php:36
|
| 164 |
-
msgid "Date"
|
| 165 |
-
msgstr "تاریخ"
|
| 166 |
-
|
| 167 |
-
#: ../classes/admin/class-admin-page.php:412
|
| 168 |
-
msgid "Mark paid"
|
| 169 |
-
msgstr "پرداخت شده"
|
| 170 |
-
|
| 171 |
-
#: ../classes/admin/class-admin-page.php:413
|
| 172 |
-
msgid "Mark due"
|
| 173 |
-
msgstr "در انتظار پرداخت"
|
| 174 |
-
|
| 175 |
-
#: ../classes/admin/class-admin-page.php:414
|
| 176 |
-
msgid "Mark reversed"
|
| 177 |
-
msgstr "لغو شده"
|
| 178 |
-
|
| 179 |
-
#: ../classes/admin/class-admin-page.php:439
|
| 180 |
-
msgid "Filter"
|
| 181 |
-
msgstr "فیلتر"
|
| 182 |
-
|
| 183 |
-
#: ../classes/admin/class-admin-page.php:474
|
| 184 |
-
msgid "Show all dates"
|
| 185 |
-
msgstr "نمایش همه تاریخ ها"
|
| 186 |
-
|
| 187 |
-
#: ../classes/admin/class-admin-page.php:487
|
| 188 |
-
#, php-format
|
| 189 |
-
msgid "%1$s %2$d"
|
| 190 |
-
msgstr ""
|
| 191 |
-
|
| 192 |
-
#: ../classes/admin/class-admin-page.php:509
|
| 193 |
-
msgid "Show all Statuses"
|
| 194 |
-
msgstr "نمایش همه وضعیت ها"
|
| 195 |
-
|
| 196 |
-
#: ../classes/admin/class-admin-page.php:564
|
| 197 |
-
msgid "Commission marked paid."
|
| 198 |
-
msgstr "کمیسیون پرداخت شده."
|
| 199 |
-
|
| 200 |
-
#: ../classes/admin/class-admin-page.php:571
|
| 201 |
-
msgid "Commission marked due."
|
| 202 |
-
msgstr "کمیسیون در انتظار پرداخت."
|
| 203 |
-
|
| 204 |
-
#: ../classes/admin/class-admin-page.php:578
|
| 205 |
-
msgid "Commission marked reversed."
|
| 206 |
-
msgstr "کمیسیون لغو شد"
|
| 207 |
-
|
| 208 |
-
#: ../classes/admin/class-admin-reports.php:44
|
| 209 |
-
msgid "Overview"
|
| 210 |
-
msgstr "نمای کلی"
|
| 211 |
-
|
| 212 |
-
#: ../classes/admin/class-admin-reports.php:50
|
| 213 |
-
msgid "Commission by vendor"
|
| 214 |
-
msgstr "کمیسیون فروشنده"
|
| 215 |
-
|
| 216 |
-
#: ../classes/admin/class-admin-reports.php:56
|
| 217 |
-
msgid "Commission by product"
|
| 218 |
-
msgstr "کمیسیون محصول"
|
| 219 |
-
|
| 220 |
-
#: ../classes/admin/class-admin-reports.php:62
|
| 221 |
-
#: ../classes/admin/class-admin-reports.php:345
|
| 222 |
-
msgid "Commission Totals"
|
| 223 |
-
msgstr "مجموع کمیسیون"
|
| 224 |
-
|
| 225 |
-
#: ../classes/admin/class-admin-reports.php:63
|
| 226 |
-
msgid ""
|
| 227 |
-
"Commission totals for all vendors includes shipping and taxes. By default no "
|
| 228 |
-
"date range is used and all due commissions are returned. Use the date range "
|
| 229 |
-
"to filter."
|
| 230 |
-
msgstr ""
|
| 231 |
-
|
| 232 |
-
#: ../classes/admin/class-admin-reports.php:121
|
| 233 |
-
#: ../classes/admin/class-admin-reports.php:437
|
| 234 |
-
#: ../templates/dashboard/date-picker.php:3
|
| 235 |
-
msgid "From:"
|
| 236 |
-
msgstr "از:"
|
| 237 |
-
|
| 238 |
-
#: ../classes/admin/class-admin-reports.php:123
|
| 239 |
-
#: ../classes/admin/class-admin-reports.php:439
|
| 240 |
-
#: ../templates/dashboard/date-picker.php:7
|
| 241 |
-
msgid "To:"
|
| 242 |
-
msgstr "به:"
|
| 243 |
-
|
| 244 |
-
#: ../classes/admin/class-admin-reports.php:125
|
| 245 |
-
#: ../classes/admin/class-admin-reports.php:283
|
| 246 |
-
#: ../classes/admin/class-admin-reports.php:448
|
| 247 |
-
#: ../templates/dashboard/date-picker.php:12
|
| 248 |
-
msgid "Show"
|
| 249 |
-
msgstr "نمایش"
|
| 250 |
-
|
| 251 |
-
#: ../classes/admin/class-admin-reports.php:131
|
| 252 |
-
msgid "Total paid in range"
|
| 253 |
-
msgstr "جمع کل پرداختی ها"
|
| 254 |
-
|
| 255 |
-
#: ../classes/admin/class-admin-reports.php:134
|
| 256 |
-
#: ../classes/admin/class-admin-reports.php:141
|
| 257 |
-
#: ../classes/admin/class-admin-reports.php:148
|
| 258 |
-
msgid "n/a"
|
| 259 |
-
msgstr "n/a"
|
| 260 |
-
|
| 261 |
-
#: ../classes/admin/class-admin-reports.php:138
|
| 262 |
-
msgid "Total due in range"
|
| 263 |
-
msgstr "جمع کل قابل پرداخت\t"
|
| 264 |
-
|
| 265 |
-
#: ../classes/admin/class-admin-reports.php:145
|
| 266 |
-
msgid "Total reversed in range"
|
| 267 |
-
msgstr "جمع کل لغو شده ها"
|
| 268 |
-
|
| 269 |
-
#: ../classes/admin/class-admin-reports.php:155
|
| 270 |
-
msgid "Recent Commission"
|
| 271 |
-
msgstr "درآمدهای اخیر"
|
| 272 |
-
|
| 273 |
-
#: ../classes/admin/class-admin-reports.php:173
|
| 274 |
-
#: ../classes/front/orders/class-orders.php:187
|
| 275 |
-
#: ../templates/dashboard/orders.php:33
|
| 276 |
-
msgid "Order"
|
| 277 |
-
msgstr "ترتیب"
|
| 278 |
-
|
| 279 |
-
#: ../classes/admin/class-admin-reports.php:177
|
| 280 |
-
msgid "Date & Time"
|
| 281 |
-
msgstr "تاریخ و زمان"
|
| 282 |
-
|
| 283 |
-
#: ../classes/admin/class-admin-reports.php:186
|
| 284 |
-
msgid "N/A"
|
| 285 |
-
msgstr "N/A"
|
| 286 |
-
|
| 287 |
-
#: ../classes/admin/class-admin-reports.php:191
|
| 288 |
-
msgid "D j M Y \\a\\t h:ia"
|
| 289 |
-
msgstr ""
|
| 290 |
-
|
| 291 |
-
#: ../classes/admin/class-admin-reports.php:200
|
| 292 |
-
msgid "No commission yet"
|
| 293 |
-
msgstr "در حال حاضر درآمدی کسب نکرده اید"
|
| 294 |
-
|
| 295 |
-
#: ../classes/admin/class-admin-reports.php:234
|
| 296 |
-
msgid "Show:"
|
| 297 |
-
msgstr "نمایش:"
|
| 298 |
-
|
| 299 |
-
#: ../classes/admin/class-admin-reports.php:243
|
| 300 |
-
msgid "Search for a product…"
|
| 301 |
-
msgstr "جستجوی یک محصول ؛"
|
| 302 |
-
|
| 303 |
-
#: ../classes/admin/class-admin-reports.php:246
|
| 304 |
-
msgid "Type in a product name to start searching..."
|
| 305 |
-
msgstr "تایپ نام محصول برای شروع جستجو ..."
|
| 306 |
-
|
| 307 |
-
#: ../classes/admin/class-admin-reports.php:278
|
| 308 |
-
msgid "Select a vendor…"
|
| 309 |
-
msgstr "انتخاب یک فروشنده ;"
|
| 310 |
-
|
| 311 |
-
#: ../classes/admin/class-admin-reports.php:344
|
| 312 |
-
msgid "Month"
|
| 313 |
-
msgstr "ماهانه"
|
| 314 |
-
|
| 315 |
-
#: ../classes/admin/class-admin-reports.php:346
|
| 316 |
-
msgid "Tax"
|
| 317 |
-
msgstr "مالیات"
|
| 318 |
-
|
| 319 |
-
#: ../classes/admin/class-admin-reports.php:347
|
| 320 |
-
#: ../classes/admin/settings/sf-options.php:52
|
| 321 |
-
#: ../classes/admin/settings/sf-options.php:136
|
| 322 |
-
#: ../templates/dashboard/orders.php:34 ../templates/orders/orders.php:115
|
| 323 |
-
msgid "Shipping"
|
| 324 |
-
msgstr "حمل و نقل"
|
| 325 |
-
|
| 326 |
-
#: ../classes/admin/class-admin-reports.php:348
|
| 327 |
-
#: ../classes/admin/class-admin-reports.php:445
|
| 328 |
-
msgid "Reversed"
|
| 329 |
-
msgstr "لغو شده"
|
| 330 |
-
|
| 331 |
-
#: ../classes/admin/class-admin-reports.php:349
|
| 332 |
-
#: ../classes/admin/class-admin-reports.php:444
|
| 333 |
-
msgid "Paid"
|
| 334 |
-
msgstr "پرداخت شده"
|
| 335 |
-
|
| 336 |
-
#: ../classes/admin/class-admin-reports.php:350
|
| 337 |
-
#: ../classes/admin/class-admin-reports.php:443
|
| 338 |
-
msgid "Due"
|
| 339 |
-
msgstr "قابل پرداخت"
|
| 340 |
-
|
| 341 |
-
#: ../classes/admin/class-admin-reports.php:459
|
| 342 |
-
msgid "Tax Total"
|
| 343 |
-
msgstr "کل مالیات"
|
| 344 |
-
|
| 345 |
-
#: ../classes/admin/class-admin-reports.php:460
|
| 346 |
-
msgid "Shipping Total"
|
| 347 |
-
msgstr "جمع هزینه حمل و نقل"
|
| 348 |
-
|
| 349 |
-
#: ../classes/admin/class-admin-reports.php:462
|
| 350 |
-
msgid "Commission Total"
|
| 351 |
-
msgstr "مجموع کمیسیون"
|
| 352 |
-
|
| 353 |
-
#: ../classes/admin/class-admin-reports.php:484
|
| 354 |
-
msgid "No commissions found."
|
| 355 |
-
msgstr "هیچ کمیسیونی یافت نشد."
|
| 356 |
-
|
| 357 |
-
#: ../classes/admin/class-admin-users.php:418
|
| 358 |
-
msgid "Enable HTML for the shop description"
|
| 359 |
-
msgstr "فعال کردن HTML در توضیحات فروشگاه"
|
| 360 |
-
|
| 361 |
-
#: ../classes/admin/class-admin-users.php:424
|
| 362 |
-
msgid "Shop name"
|
| 363 |
-
msgstr "نام فروشگاه"
|
| 364 |
-
|
| 365 |
-
#: ../classes/admin/class-admin-users.php:431
|
| 366 |
-
msgid "PayPal E-mail"
|
| 367 |
-
msgstr "ایمیل شما در PayPal"
|
| 368 |
-
|
| 369 |
-
#: ../classes/admin/class-admin-users.php:432
|
| 370 |
-
msgid "required"
|
| 371 |
-
msgstr "ضروری"
|
| 372 |
-
|
| 373 |
-
#: ../classes/admin/class-admin-users.php:439
|
| 374 |
-
msgid "Commission rate"
|
| 375 |
-
msgstr "نرخ کمیسیون:"
|
| 376 |
-
|
| 377 |
-
#: ../classes/admin/class-admin-users.php:440
|
| 378 |
-
#: ../classes/admin/class-product-meta.php:174
|
| 379 |
-
msgid "Leave blank for default"
|
| 380 |
-
msgstr "به صورت پیش فرض خالی بگذارید"
|
| 381 |
-
|
| 382 |
-
#: ../classes/admin/class-admin-users.php:446
|
| 383 |
-
msgid "Give Tax"
|
| 384 |
-
msgstr "دریافت مالیات"
|
| 385 |
-
|
| 386 |
-
#: ../classes/admin/class-admin-users.php:451
|
| 387 |
-
msgid "Tax override for vendor"
|
| 388 |
-
msgstr "نادیده گرفتن مالیات برای فروشنده"
|
| 389 |
-
|
| 390 |
-
#: ../classes/admin/class-admin-users.php:457
|
| 391 |
-
msgid "Give Shipping"
|
| 392 |
-
msgstr "دریافت هزینه حمل و نقل"
|
| 393 |
-
|
| 394 |
-
#: ../classes/admin/class-admin-users.php:462
|
| 395 |
-
msgid "Shipping override for vendor"
|
| 396 |
-
msgstr "لغو هزینه حمل و نقل برای فروشنده"
|
| 397 |
-
|
| 398 |
-
#: ../classes/admin/class-admin-users.php:468
|
| 399 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:30
|
| 400 |
-
#: ../templates/dashboard/settings/seller-info.php:3
|
| 401 |
-
msgid "Seller info"
|
| 402 |
-
msgstr "مشخصات فروشنده"
|
| 403 |
-
|
| 404 |
-
#: ../classes/admin/class-admin-users.php:473
|
| 405 |
-
msgid "Shop description"
|
| 406 |
-
msgstr "توضیحات فروشگاه"
|
| 407 |
-
|
| 408 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:20
|
| 409 |
-
#: ../classes/class-install.php:192
|
| 410 |
-
msgid "Shop Settings"
|
| 411 |
-
msgstr "تنظیمات فروشگاه"
|
| 412 |
-
|
| 413 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:21
|
| 414 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:146
|
| 415 |
-
#: ../classes/admin/settings/sf-options.php:196
|
| 416 |
-
#: ../classes/class-install.php:191 ../templates/dashboard/orders.php:24
|
| 417 |
-
msgid "Orders"
|
| 418 |
-
msgstr "سفارشات"
|
| 419 |
-
|
| 420 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:58
|
| 421 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:112
|
| 422 |
-
msgid "Your PayPal address is not a valid email address."
|
| 423 |
-
msgstr "آدرس PayPal شما یک آدرس ایمیل معتبر نیست."
|
| 424 |
-
|
| 425 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:67
|
| 426 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:121
|
| 427 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 428 |
-
msgstr ""
|
| 429 |
-
"این نام فروشگاه قبلا گرفته شده است. نام فروشگاه شما باید منحصر به فرد باشد."
|
| 430 |
-
|
| 431 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:87
|
| 432 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:368
|
| 433 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:139
|
| 434 |
-
msgid "Settings saved."
|
| 435 |
-
msgstr "تنظیمات ذخیره شد."
|
| 436 |
-
|
| 437 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:284
|
| 438 |
-
msgid "Customer"
|
| 439 |
-
msgstr "مشتری"
|
| 440 |
-
|
| 441 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:285
|
| 442 |
-
#: ../classes/admin/settings/sf-options.php:127
|
| 443 |
-
#: ../classes/admin/settings/sf-options.php:254
|
| 444 |
-
msgid "Products"
|
| 445 |
-
msgstr "محصولات"
|
| 446 |
-
|
| 447 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:289
|
| 448 |
-
#: ../templates/dashboard/orders.php:92
|
| 449 |
-
msgid "Shipped"
|
| 450 |
-
msgstr "ارسال پستی"
|
| 451 |
-
|
| 452 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:324
|
| 453 |
-
#: ../templates/dashboard/orders.php:85
|
| 454 |
-
msgid "Mark shipped"
|
| 455 |
-
msgstr "انتخاب به عنوان محصول ارسال شده"
|
| 456 |
-
|
| 457 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:349
|
| 458 |
-
msgid "Orders marked shipped."
|
| 459 |
-
msgstr "سفارشات پستی مشخص شده اند."
|
| 460 |
-
|
| 461 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:385
|
| 462 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:40
|
| 463 |
-
msgid "You are not allowed to modify this order."
|
| 464 |
-
msgstr "شما مجاز به تغییر این ترتیب هستند."
|
| 465 |
-
|
| 466 |
-
#: ../classes/admin/class-vendor-applicants.php:26
|
| 467 |
-
msgid "Approve"
|
| 468 |
-
msgstr "تایید"
|
| 469 |
-
|
| 470 |
-
#: ../classes/admin/class-vendor-applicants.php:27
|
| 471 |
-
msgid "Deny"
|
| 472 |
-
msgstr "رد کردن"
|
| 473 |
-
|
| 474 |
-
#: ../classes/admin/class-vendor-applicants.php:73
|
| 475 |
-
msgid "Vendor has been <b>denied</b>."
|
| 476 |
-
msgstr "فروشنده <b>محروم</b>بوده است."
|
| 477 |
-
|
| 478 |
-
#: ../classes/admin/class-vendor-applicants.php:84
|
| 479 |
-
msgid "Vendor has been <b>approved</b>."
|
| 480 |
-
msgstr "فروشنده <b>تایید</b>شده است."
|
| 481 |
-
|
| 482 |
-
#: ../classes/admin/class-vendor-applicants.php:98
|
| 483 |
-
msgid "Pending Vendors"
|
| 484 |
-
msgstr "فروشندگان در انتظار تایید"
|
| 485 |
-
|
| 486 |
-
#: ../classes/admin/emails/class-emails.php:59
|
| 487 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:70
|
| 488 |
-
msgid "pending"
|
| 489 |
-
msgstr "در انتظار"
|
| 490 |
-
|
| 491 |
-
#: ../classes/admin/emails/class-emails.php:61
|
| 492 |
-
msgid "approved"
|
| 493 |
-
msgstr "تایید شده"
|
| 494 |
-
|
| 495 |
-
#: ../classes/admin/emails/class-emails.php:63
|
| 496 |
-
msgid "denied"
|
| 497 |
-
msgstr "رد شده"
|
| 498 |
-
|
| 499 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:28
|
| 500 |
-
msgid "Vendor Application"
|
| 501 |
-
msgstr "درخواست فروشنده"
|
| 502 |
-
|
| 503 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:29
|
| 504 |
-
msgid "Vendor application will either be approved, denied, or pending."
|
| 505 |
-
msgstr "درخواست فروشنده یا مورد تایید باشند، لغو شدد و یا در انتظار خواهد بود"
|
| 506 |
-
|
| 507 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:31
|
| 508 |
-
msgid "Application {status}"
|
| 509 |
-
msgstr "وضعیت درخواست: {status}"
|
| 510 |
-
|
| 511 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:32
|
| 512 |
-
msgid "[{blogname}] Your vendor application has been {status}"
|
| 513 |
-
msgstr "[{blogname}] درخواست فروشندگی شما: {status}"
|
| 514 |
-
|
| 515 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:123
|
| 516 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:134
|
| 517 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:163
|
| 518 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:256
|
| 519 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
|
| 520 |
-
msgid "Enable/Disable"
|
| 521 |
-
msgstr "فعال/غیر فعال"
|
| 522 |
-
|
| 523 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:125
|
| 524 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:136
|
| 525 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:165
|
| 526 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:258
|
| 527 |
-
msgid "Enable this email notification"
|
| 528 |
-
msgstr "فعال کردن دریافت اطلاعیه ها از طریق ایمیل"
|
| 529 |
-
|
| 530 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:129
|
| 531 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:140
|
| 532 |
-
msgid "Recipient(s)"
|
| 533 |
-
msgstr "دریافت کننده"
|
| 534 |
-
|
| 535 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:131
|
| 536 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:142
|
| 537 |
-
#, php-format
|
| 538 |
-
msgid ""
|
| 539 |
-
"Enter recipients (comma separated) for this email. Defaults to <code>%s</"
|
| 540 |
-
"code>."
|
| 541 |
-
msgstr ""
|
| 542 |
-
"ایمیل گیرندگان را وارد نمایید (جدا شده با کاما). پیشفرض <code>%s</code> است."
|
| 543 |
-
|
| 544 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:136
|
| 545 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:147
|
| 546 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:169
|
| 547 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:262
|
| 548 |
-
msgid "Subject"
|
| 549 |
-
msgstr "موضوع"
|
| 550 |
-
|
| 551 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:138
|
| 552 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:149
|
| 553 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:171
|
| 554 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:264
|
| 555 |
-
#, php-format
|
| 556 |
-
msgid ""
|
| 557 |
-
"This controls the email subject line. Leave blank to use the default "
|
| 558 |
-
"subject: <code>%s</code>."
|
| 559 |
-
msgstr ""
|
| 560 |
-
"اینجا موضوع ایمیل انتخاب میشود. خالی رها کنید تا از موضوع پیشفرض استفاده "
|
| 561 |
-
"شود: <code>%s</code>."
|
| 562 |
-
|
| 563 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:143
|
| 564 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:154
|
| 565 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:176
|
| 566 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:269
|
| 567 |
-
msgid "Email Heading"
|
| 568 |
-
msgstr "عنوان ایمیل"
|
| 569 |
-
|
| 570 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:145
|
| 571 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:156
|
| 572 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:178
|
| 573 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:271
|
| 574 |
-
#, php-format
|
| 575 |
-
msgid ""
|
| 576 |
-
"This controls the main heading contained within the email notification. "
|
| 577 |
-
"Leave blank to use the default heading: <code>%s</code>."
|
| 578 |
-
msgstr ""
|
| 579 |
-
"اینجا عنوان اصلی موجود در ایمیل انتخاب میشود. خالی رها کنید تا از عنوان "
|
| 580 |
-
"پیشفرض استفاده شود: <code>%s</code>."
|
| 581 |
-
|
| 582 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:150
|
| 583 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:161
|
| 584 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:183
|
| 585 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:282
|
| 586 |
-
msgid "Email type"
|
| 587 |
-
msgstr "نوع ایمیل"
|
| 588 |
-
|
| 589 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:152
|
| 590 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:163
|
| 591 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:185
|
| 592 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:284
|
| 593 |
-
msgid "Choose which format of email to send."
|
| 594 |
-
msgstr "ساختار ایمیل برای فرستادن را انتخاب کنید."
|
| 595 |
-
|
| 596 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:156
|
| 597 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:167
|
| 598 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:189
|
| 599 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:288
|
| 600 |
-
msgid "Plain text"
|
| 601 |
-
msgstr "متن ساده"
|
| 602 |
-
|
| 603 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:157
|
| 604 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:168
|
| 605 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:190
|
| 606 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:289
|
| 607 |
-
msgid "HTML"
|
| 608 |
-
msgstr "HTML"
|
| 609 |
-
|
| 610 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:158
|
| 611 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:169
|
| 612 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:191
|
| 613 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:290
|
| 614 |
-
msgid "Multipart"
|
| 615 |
-
msgstr "چند بخشی"
|
| 616 |
-
|
| 617 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:28
|
| 618 |
-
msgid "New Vendor Product"
|
| 619 |
-
msgstr "اضافه کردن محصول جدید"
|
| 620 |
-
|
| 621 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:29
|
| 622 |
-
msgid "New order emails are sent when a new product is submitted by a vendor"
|
| 623 |
-
msgstr ""
|
| 624 |
-
"هنگامی که محصول جدید توسط یک فروشنده ارسال می شود یک ایمیل اطلاع رسانی "
|
| 625 |
-
"فرستاده خواهد شد"
|
| 626 |
-
|
| 627 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:31
|
| 628 |
-
msgid "New product submitted: {product_name}"
|
| 629 |
-
msgstr "محصول جدید ارسال شده: {product_name}"
|
| 630 |
-
|
| 631 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:32
|
| 632 |
-
msgid "[{blogname}] New product submitted by {vendor_name} - {product_name}"
|
| 633 |
-
msgstr "[{blogname}] محصول جدید ارسال شده توسط {vendor_name}- {product_name}"
|
| 634 |
-
|
| 635 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:28
|
| 636 |
-
msgid "Vendor has shipped"
|
| 637 |
-
msgstr "فروشنده فرستاده است"
|
| 638 |
-
|
| 639 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:29
|
| 640 |
-
msgid ""
|
| 641 |
-
"An email is sent when a vendor has marked one of their orders as shipped."
|
| 642 |
-
msgstr ""
|
| 643 |
-
"هنگامی که فروشنده یکی از سفارشات خود را به عنوان محصول پستی مشخص کرده یک "
|
| 644 |
-
"ایمیل برای او ارسال می شود."
|
| 645 |
-
|
| 646 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:31
|
| 647 |
-
msgid "Your order has been shipped"
|
| 648 |
-
msgstr "سفارش شما ارسال شده است"
|
| 649 |
-
|
| 650 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:32
|
| 651 |
-
msgid ""
|
| 652 |
-
"[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 653 |
-
msgstr "[{blogname}] سفارش شما ارسال شده است ({order_number}) - {order_date}"
|
| 654 |
-
|
| 655 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:112
|
| 656 |
-
msgid "Subtotal:"
|
| 657 |
-
msgstr "جمع کل:"
|
| 658 |
-
|
| 659 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:27
|
| 660 |
-
msgid "Notify vendors"
|
| 661 |
-
msgstr "اطلاعیه فروشندگان"
|
| 662 |
-
|
| 663 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:28
|
| 664 |
-
msgid "New order emails are sent when an order is received/paid by a customer."
|
| 665 |
-
msgstr ""
|
| 666 |
-
"ایمیل های، سفارش جدید / پرداخت شده توسط مشتری در هنگام سفارش فرستاده می شود."
|
| 667 |
-
|
| 668 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:30
|
| 669 |
-
msgid "New customer order"
|
| 670 |
-
msgstr "سفارش جدید مشتری"
|
| 671 |
-
|
| 672 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:31
|
| 673 |
-
msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
|
| 674 |
-
msgstr "[{blogname}] سفارش جدید مشتری ({order_number}) - {order_date}"
|
| 675 |
-
|
| 676 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:105
|
| 677 |
-
msgid "Commission Subtotal:"
|
| 678 |
-
msgstr "میزان درآمد"
|
| 679 |
-
|
| 680 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:111
|
| 681 |
-
msgid "Tax Subtotal:"
|
| 682 |
-
msgstr "میزان مالیات"
|
| 683 |
-
|
| 684 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:119
|
| 685 |
-
msgid "Shipping Subtotal:"
|
| 686 |
-
msgstr "هزینه حمل و نقل:"
|
| 687 |
-
|
| 688 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:276
|
| 689 |
-
msgid "Product Totals"
|
| 690 |
-
msgstr "تمامی محصولات"
|
| 691 |
-
|
| 692 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:278
|
| 693 |
-
msgid ""
|
| 694 |
-
"Show the commission due/paid as the product totals instead of the product "
|
| 695 |
-
"prices."
|
| 696 |
-
msgstr ""
|
| 697 |
-
|
| 698 |
-
#: ../classes/admin/settings/classes/sf-class-format-options.php:211
|
| 699 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:791
|
| 700 |
-
msgid "Select a page..."
|
| 701 |
-
msgstr "انتخاب یک برگه..."
|
| 702 |
-
|
| 703 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:153
|
| 704 |
-
#: ../templates/dashboard/settings/settings.php:1
|
| 705 |
-
msgid "Settings"
|
| 706 |
-
msgstr "تنظیمات"
|
| 707 |
-
|
| 708 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:302
|
| 709 |
-
msgid "Could not load settings at: "
|
| 710 |
-
msgstr "تنظیمات بارگیری نشد:"
|
| 711 |
-
|
| 712 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:302
|
| 713 |
-
msgid "Error - WP Settings Framework"
|
| 714 |
-
msgstr "خطا در تنظیمات کلی وردپرس"
|
| 715 |
-
|
| 716 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:486
|
| 717 |
-
#, php-format
|
| 718 |
-
msgid "Save %s changes"
|
| 719 |
-
msgstr "%s تغییرات ذخیره شد"
|
| 720 |
-
|
| 721 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:499
|
| 722 |
-
msgid ""
|
| 723 |
-
"Please help with a <a href=\"https://wordpress.org/support/view/plugin-"
|
| 724 |
-
"reviews/wc-vendors?rate=5#postform\" target=\"top\">High Five!</a> | <a href="
|
| 725 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 726 |
-
"Vendors Pro</a> | <a href=\"https://www.wcvendors.com/product/stripe-"
|
| 727 |
-
"commissions-gateway/\" target=\"top\">Stripe Commissions & Gateway</a> | <a "
|
| 728 |
-
"href=\"https://www.wcvendors.com/kb/\" target=\"top\">KnowledgeBase</a> | <a "
|
| 729 |
-
"href=\"https://www.wcvendors.com/help/\" target=\"top\">Help Forums</a>"
|
| 730 |
-
msgstr ""
|
| 731 |
-
|
| 732 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:784
|
| 733 |
-
msgid "Edit Page"
|
| 734 |
-
msgstr "ویرایش صفحه"
|
| 735 |
-
|
| 736 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:785
|
| 737 |
-
msgid "View Page"
|
| 738 |
-
msgstr "مشاهده صفحه"
|
| 739 |
-
|
| 740 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:848
|
| 741 |
-
#, php-format
|
| 742 |
-
msgid "Update %s"
|
| 743 |
-
msgstr "بهروزرسانی %s"
|
| 744 |
-
|
| 745 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:848
|
| 746 |
-
#, php-format
|
| 747 |
-
msgid "Add %s"
|
| 748 |
-
msgstr "اضافه کردن %s"
|
| 749 |
-
|
| 750 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:848
|
| 751 |
-
#, php-format
|
| 752 |
-
msgid "Upload an image for the %s"
|
| 753 |
-
msgstr "آپلود تصویری برای %s"
|
| 754 |
-
|
| 755 |
-
#: ../classes/admin/settings/sf-options.php:5
|
| 756 |
-
msgid "General options"
|
| 757 |
-
msgstr "تنظیمات عمومی"
|
| 758 |
-
|
| 759 |
-
#: ../classes/admin/settings/sf-options.php:8
|
| 760 |
-
msgid "Default commission (%)"
|
| 761 |
-
msgstr "پیش فرض کمیسیون (٪)"
|
| 762 |
-
|
| 763 |
-
#: ../classes/admin/settings/sf-options.php:9
|
| 764 |
-
msgid ""
|
| 765 |
-
"The default rate you pay each vendor for a product sale. <br>You can also "
|
| 766 |
-
"give vendors their own individual commission rates by editing the vendors "
|
| 767 |
-
"user account.<br>Also, you can edit an individual products commission to "
|
| 768 |
-
"override both of these settings on a per product basis."
|
| 769 |
-
msgstr ""
|
| 770 |
-
|
| 771 |
-
#: ../classes/admin/settings/sf-options.php:20
|
| 772 |
-
#: ../classes/admin/settings/sf-options.php:27
|
| 773 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 774 |
-
msgstr "به کاربران و مهمان ها اجازه می دهد برای درخواست فروشندگی"
|
| 775 |
-
|
| 776 |
-
#: ../classes/admin/settings/sf-options.php:22
|
| 777 |
-
msgid ""
|
| 778 |
-
"Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:"
|
| 779 |
-
"</strong> You MUST \"<strong>Enable registration on the \"My Account\" "
|
| 780 |
-
"page</strong>\" in your <strong>WooCommerce > Settings > Accounts</strong> "
|
| 781 |
-
"page for this option to work. Currently, you have registration disabled."
|
| 782 |
-
msgstr ""
|
| 783 |
-
|
| 784 |
-
#: ../classes/admin/settings/sf-options.php:26
|
| 785 |
-
msgid "Registration"
|
| 786 |
-
msgstr "ثبت نام"
|
| 787 |
-
|
| 788 |
-
#: ../classes/admin/settings/sf-options.php:28
|
| 789 |
-
msgid ""
|
| 790 |
-
"This will show a checkbox on the My Account page's registration form asking "
|
| 791 |
-
"if the user would like to apply to be a vendor. Also, on the Vendor "
|
| 792 |
-
"Dashboard, users can still apply to become a vendor even if this is disabled."
|
| 793 |
-
msgstr ""
|
| 794 |
-
"اگر این گزینه را فعال کنید هنگام ثبت نام یک کاربر یک گزینه جهت درخواست "
|
| 795 |
-
"فروشنده شدن در سایت اضافه می گردد. البته در صورت انتخاب نکردن کاربر بعدا "
|
| 796 |
-
"دوباره می تواند درخواست دهد"
|
| 797 |
-
|
| 798 |
-
#: ../classes/admin/settings/sf-options.php:35
|
| 799 |
-
msgid "Approve vendor applications manually"
|
| 800 |
-
msgstr "تایید دستی درخواست فروشنده شدن"
|
| 801 |
-
|
| 802 |
-
#: ../classes/admin/settings/sf-options.php:36
|
| 803 |
-
msgid ""
|
| 804 |
-
"With this unchecked, all vendor applications are automatically accepted. "
|
| 805 |
-
"Otherwise, you must approve each manually."
|
| 806 |
-
msgstr ""
|
| 807 |
-
"اگر این گزینه را فعال نکنید درخواست های فروشنده شدن ها به صورت خودکار تایید "
|
| 808 |
-
"می شود. در غیر این صورت باید به صورت دستی تایید کنید"
|
| 809 |
-
|
| 810 |
-
#: ../classes/admin/settings/sf-options.php:43
|
| 811 |
-
#: ../classes/admin/settings/sf-options.php:175
|
| 812 |
-
msgid "Taxes"
|
| 813 |
-
msgstr "ماليات ها"
|
| 814 |
-
|
| 815 |
-
#: ../classes/admin/settings/sf-options.php:44
|
| 816 |
-
msgid "Give vendors any tax collected per-product"
|
| 817 |
-
msgstr "قرار دادن مالیات به ازای هر محصول برای فروشندگان"
|
| 818 |
-
|
| 819 |
-
#: ../classes/admin/settings/sf-options.php:45
|
| 820 |
-
msgid "The tax collected on a vendor's product will be given in its entirety"
|
| 821 |
-
msgstr "مالیات هریک از محصولات فروشنده بر روی جمع کل اضافه خواهد شد"
|
| 822 |
-
|
| 823 |
-
#: ../classes/admin/settings/sf-options.php:53
|
| 824 |
-
msgid "Give vendors any shipping collected per-product"
|
| 825 |
-
msgstr "دادن هزینه حمل و نقل (هزینه پستی) هر محصول به فروشنده"
|
| 826 |
-
|
| 827 |
-
#: ../classes/admin/settings/sf-options.php:54
|
| 828 |
-
msgid ""
|
| 829 |
-
"WC Vendors Free - Give vendors shipping if using Per Product Shipping "
|
| 830 |
-
"gateway. WC Vendors Pro - Give vendors shipping when using Vendor "
|
| 831 |
-
"Shipping. No other shipping module is compatible with this option."
|
| 832 |
-
msgstr ""
|
| 833 |
-
|
| 834 |
-
#: ../classes/admin/settings/sf-options.php:60
|
| 835 |
-
msgid "Shop options"
|
| 836 |
-
msgstr "گزینه های فروشگاه"
|
| 837 |
-
|
| 838 |
-
#: ../classes/admin/settings/sf-options.php:63
|
| 839 |
-
msgid "Shop HTML"
|
| 840 |
-
msgstr "HTML فروشگاه"
|
| 841 |
-
|
| 842 |
-
#: ../classes/admin/settings/sf-options.php:64
|
| 843 |
-
msgid ""
|
| 844 |
-
"Enable HTML for a vendor's shop description by default. You can enable or "
|
| 845 |
-
"disable this per vendor by editing the vendors user account."
|
| 846 |
-
msgstr ""
|
| 847 |
-
|
| 848 |
-
#: ../classes/admin/settings/sf-options.php:71
|
| 849 |
-
msgid "Vendor Shop Page"
|
| 850 |
-
msgstr "صفحه فروشنده"
|
| 851 |
-
|
| 852 |
-
#: ../classes/admin/settings/sf-options.php:72
|
| 853 |
-
msgid ""
|
| 854 |
-
"Enter one word for the URI. If you enter \"<strong>vendors</strong>\" your "
|
| 855 |
-
"vendors store will be <code>yourdomain.com/vendors/store-name/</code>"
|
| 856 |
-
msgstr ""
|
| 857 |
-
|
| 858 |
-
#: ../classes/admin/settings/sf-options.php:79
|
| 859 |
-
msgid "Shop Headers"
|
| 860 |
-
msgstr "عنوان فروشگاه"
|
| 861 |
-
|
| 862 |
-
#: ../classes/admin/settings/sf-options.php:80
|
| 863 |
-
msgid "Enable vendor shop headers"
|
| 864 |
-
msgstr "فعال کردن عنوان فروشنده فروشگاه"
|
| 865 |
-
|
| 866 |
-
#: ../classes/admin/settings/sf-options.php:81
|
| 867 |
-
msgid ""
|
| 868 |
-
"This will override the HTML Shop description output on product-archive "
|
| 869 |
-
"pages. In order to customize the shop headers visit wcvendors.com and read "
|
| 870 |
-
"the article in the Knowledgebase titled Changing the Vendor Templates."
|
| 871 |
-
msgstr ""
|
| 872 |
-
"این HTML توضیحاتی در صفحات محصول فروشگاه در قسمت آجزئیاتاضافه می کند. به "
|
| 873 |
-
"منظور سفارشی کردن عنوان فروشنده فروشگاه به سایت wcvendors.com مراجعه کرده و "
|
| 874 |
-
"مقاله در مرکز آموزش تحت عنوان titled Changing the Vendor Template را مطالعه "
|
| 875 |
-
"نمایید."
|
| 876 |
-
|
| 877 |
-
#: ../classes/admin/settings/sf-options.php:88
|
| 878 |
-
msgid "Vendor Display Name"
|
| 879 |
-
msgstr "نام نمایش فروشنده"
|
| 880 |
-
|
| 881 |
-
#: ../classes/admin/settings/sf-options.php:89
|
| 882 |
-
msgid ""
|
| 883 |
-
"Select what will be displayed for the sold by text throughout the store."
|
| 884 |
-
msgstr ""
|
| 885 |
-
"متنی که که میخواهید به جای 'به tروش می رسد توسط' که در فروشگاه به نمایش "
|
| 886 |
-
"گذاشته میشود را وارد نمایید"
|
| 887 |
-
|
| 888 |
-
#: ../classes/admin/settings/sf-options.php:93
|
| 889 |
-
msgid "Display Name"
|
| 890 |
-
msgstr "نمایش نام"
|
| 891 |
-
|
| 892 |
-
#: ../classes/admin/settings/sf-options.php:94
|
| 893 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:22
|
| 894 |
-
#: ../templates/dashboard/settings/shop-name.php:2
|
| 895 |
-
msgid "Shop Name"
|
| 896 |
-
msgstr "نام فروشگاه"
|
| 897 |
-
|
| 898 |
-
#: ../classes/admin/settings/sf-options.php:95
|
| 899 |
-
msgid "User Login"
|
| 900 |
-
msgstr "ورود کاربر"
|
| 901 |
-
|
| 902 |
-
#: ../classes/admin/settings/sf-options.php:96
|
| 903 |
-
msgid "User Email"
|
| 904 |
-
msgstr "ایمیل کاربر"
|
| 905 |
-
|
| 906 |
-
#: ../classes/admin/settings/sf-options.php:103
|
| 907 |
-
#: ../classes/admin/settings/sf-options.php:116
|
| 908 |
-
msgid "Sold By"
|
| 909 |
-
msgstr "فروشنده"
|
| 910 |
-
|
| 911 |
-
#: ../classes/admin/settings/sf-options.php:104
|
| 912 |
-
msgid "Enable sold by labels"
|
| 913 |
-
msgstr "فعال کردن برچسب نام فروشنده"
|
| 914 |
-
|
| 915 |
-
#: ../classes/admin/settings/sf-options.php:105
|
| 916 |
-
msgid "This will enable or disable the sold by labels."
|
| 917 |
-
msgstr "با این قابلیت امکان نمایش نام فروشنده در صفحه محصول فراهم می گردد."
|
| 918 |
-
|
| 919 |
-
#: ../classes/admin/settings/sf-options.php:112
|
| 920 |
-
msgid "Sold By Label"
|
| 921 |
-
msgstr "برچسب فروخته شده"
|
| 922 |
-
|
| 923 |
-
#: ../classes/admin/settings/sf-options.php:113
|
| 924 |
-
msgid "The sold by label used on the site and emails."
|
| 925 |
-
msgstr "استفاده از برچسب فروخته شده توسط در فروشگاه و ایمیل ها"
|
| 926 |
-
|
| 927 |
-
#: ../classes/admin/settings/sf-options.php:120
|
| 928 |
-
msgid "Seller Info Label"
|
| 929 |
-
msgstr "برچسب مشخصات فروشنده"
|
| 930 |
-
|
| 931 |
-
#: ../classes/admin/settings/sf-options.php:121
|
| 932 |
-
msgid "The seller info tab title on the single product page."
|
| 933 |
-
msgstr "عنوان برگه اطلاعات فروشنده در صفحه محصول واحد."
|
| 934 |
-
|
| 935 |
-
#: ../classes/admin/settings/sf-options.php:124
|
| 936 |
-
msgid "Seller Info"
|
| 937 |
-
msgstr "مشخصات فروشنده"
|
| 938 |
-
|
| 939 |
-
#: ../classes/admin/settings/sf-options.php:128
|
| 940 |
-
msgid "Product Add Page"
|
| 941 |
-
msgstr "صفحه اضافه کردن محصولات"
|
| 942 |
-
|
| 943 |
-
#: ../classes/admin/settings/sf-options.php:128
|
| 944 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 945 |
-
msgstr ""
|
| 946 |
-
"تنظیمات مخفی کردن قسمت هایی که میخواهید فروشندگان عنگام اضافه کردن محصول "
|
| 947 |
-
"نبینند"
|
| 948 |
-
|
| 949 |
-
#: ../classes/admin/settings/sf-options.php:131
|
| 950 |
-
msgid "Left side panel"
|
| 951 |
-
msgstr "محل پنل سمت چپ"
|
| 952 |
-
|
| 953 |
-
#: ../classes/admin/settings/sf-options.php:132
|
| 954 |
-
msgid ""
|
| 955 |
-
"CHECKING these boxes will **HIDE** these areas of the add product page for "
|
| 956 |
-
"vendors"
|
| 957 |
-
msgstr ""
|
| 958 |
-
"تیک زردن این جعبه خواهد شد ** **مخفی کردن این مناطق از صفحه محصولات اضافه "
|
| 959 |
-
"کردن برای فروشندگان"
|
| 960 |
-
|
| 961 |
-
#: ../classes/admin/settings/sf-options.php:135
|
| 962 |
-
msgid "Inventory"
|
| 963 |
-
msgstr "موجودی انبار"
|
| 964 |
-
|
| 965 |
-
#: ../classes/admin/settings/sf-options.php:137
|
| 966 |
-
msgid "Linked Products"
|
| 967 |
-
msgstr "محصولات مرتبط"
|
| 968 |
-
|
| 969 |
-
#: ../classes/admin/settings/sf-options.php:138
|
| 970 |
-
msgid "Attributes"
|
| 971 |
-
msgstr "ویژگیها"
|
| 972 |
-
|
| 973 |
-
#: ../classes/admin/settings/sf-options.php:139
|
| 974 |
-
msgid "Advanced"
|
| 975 |
-
msgstr "پیشرفته"
|
| 976 |
-
|
| 977 |
-
#: ../classes/admin/settings/sf-options.php:146
|
| 978 |
-
msgid "Types"
|
| 979 |
-
msgstr "انواع"
|
| 980 |
-
|
| 981 |
-
#: ../classes/admin/settings/sf-options.php:147
|
| 982 |
-
msgid "CHECKING these boxes will HIDE these product types from the vendor"
|
| 983 |
-
msgstr "بررسی این جعبه جهت مخفی کردن برای فروشنده بر اساس نوع محصول"
|
| 984 |
-
|
| 985 |
-
#: ../classes/admin/settings/sf-options.php:150
|
| 986 |
-
msgid "Simple"
|
| 987 |
-
msgstr "ساده"
|
| 988 |
-
|
| 989 |
-
#: ../classes/admin/settings/sf-options.php:151
|
| 990 |
-
msgid "Variable"
|
| 991 |
-
msgstr "متغیر"
|
| 992 |
-
|
| 993 |
-
#: ../classes/admin/settings/sf-options.php:152
|
| 994 |
-
msgid "Grouped"
|
| 995 |
-
msgstr "گروه بندی شده"
|
| 996 |
-
|
| 997 |
-
#: ../classes/admin/settings/sf-options.php:153
|
| 998 |
-
msgid "External / affiliate"
|
| 999 |
-
msgstr "همکار فروش / خارجی"
|
| 1000 |
-
|
| 1001 |
-
#: ../classes/admin/settings/sf-options.php:160
|
| 1002 |
-
msgid "Type options"
|
| 1003 |
-
msgstr "نوع گزینه های"
|
| 1004 |
-
|
| 1005 |
-
#: ../classes/admin/settings/sf-options.php:161
|
| 1006 |
-
msgid ""
|
| 1007 |
-
"CHECKING these boxes will **HIDE** these product options from the vendor"
|
| 1008 |
-
msgstr "تیک زدن این جعبه خواهد شد ** **مخفی کردن این گزینه کالا از فروشنده"
|
| 1009 |
-
|
| 1010 |
-
#: ../classes/admin/settings/sf-options.php:164
|
| 1011 |
-
msgid "Virtual"
|
| 1012 |
-
msgstr "مجازی"
|
| 1013 |
-
|
| 1014 |
-
#: ../classes/admin/settings/sf-options.php:165
|
| 1015 |
-
msgid "Downloadable"
|
| 1016 |
-
msgstr "دانلودی"
|
| 1017 |
-
|
| 1018 |
-
#: ../classes/admin/settings/sf-options.php:172
|
| 1019 |
-
msgid "Miscellaneous"
|
| 1020 |
-
msgstr "گوناگون"
|
| 1021 |
-
|
| 1022 |
-
#: ../classes/admin/settings/sf-options.php:176
|
| 1023 |
-
msgid "SKU"
|
| 1024 |
-
msgstr "SKU"
|
| 1025 |
-
|
| 1026 |
-
#: ../classes/admin/settings/sf-options.php:177
|
| 1027 |
-
msgid "Featured"
|
| 1028 |
-
msgstr "ویژه (برجسته)"
|
| 1029 |
-
|
| 1030 |
-
#: ../classes/admin/settings/sf-options.php:178
|
| 1031 |
-
msgid "Duplicate Product"
|
| 1032 |
-
msgstr "محصول تکراری"
|
| 1033 |
-
|
| 1034 |
-
#: ../classes/admin/settings/sf-options.php:185
|
| 1035 |
-
msgid "Stylesheet"
|
| 1036 |
-
msgstr "سبک صفحه"
|
| 1037 |
-
|
| 1038 |
-
#: ../classes/admin/settings/sf-options.php:186
|
| 1039 |
-
msgid ""
|
| 1040 |
-
"You can add CSS in this textarea, which will be loaded on the product add/"
|
| 1041 |
-
"edit page for vendors."
|
| 1042 |
-
msgstr ""
|
| 1043 |
-
"به کار بردن کلاس CSS اصافه در این ناحیه ی متن که در صفحه اضافه/ ویرایش برای "
|
| 1044 |
-
"فروشندگان بارگزاری خواهد شد"
|
| 1045 |
-
|
| 1046 |
-
#: ../classes/admin/settings/sf-options.php:193
|
| 1047 |
-
msgid "Permissions"
|
| 1048 |
-
msgstr "مجوز های کاربری"
|
| 1049 |
-
|
| 1050 |
-
#: ../classes/admin/settings/sf-options.php:193
|
| 1051 |
-
msgid "General permissions used around the shop"
|
| 1052 |
-
msgstr "مجوز ها به صورت عمومی در سراسر فروشگاه استفاده می شود"
|
| 1053 |
-
|
| 1054 |
-
#: ../classes/admin/settings/sf-options.php:197
|
| 1055 |
-
msgid "View orders"
|
| 1056 |
-
msgstr "مشاهده سفارشات"
|
| 1057 |
-
|
| 1058 |
-
#: ../classes/admin/settings/sf-options.php:198
|
| 1059 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 1060 |
-
msgstr "نمایش جزئیات مشتری مانند ایمیل، آدرس، نام، و غیره، برای هر سفارش"
|
| 1061 |
-
|
| 1062 |
-
#: ../classes/admin/settings/sf-options.php:205
|
| 1063 |
-
msgid "View comments"
|
| 1064 |
-
msgstr "مشاهده نظرات"
|
| 1065 |
-
|
| 1066 |
-
#: ../classes/admin/settings/sf-options.php:206
|
| 1067 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 1068 |
-
msgstr "مشاهده همه نظر فروشنده برای یک سفارش در بخش کاربری"
|
| 1069 |
-
|
| 1070 |
-
#: ../classes/admin/settings/sf-options.php:213
|
| 1071 |
-
msgid "Submit comments"
|
| 1072 |
-
msgstr "ثبت کردن نظرات"
|
| 1073 |
-
|
| 1074 |
-
#: ../classes/admin/settings/sf-options.php:214
|
| 1075 |
-
msgid ""
|
| 1076 |
-
"Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 1077 |
-
msgstr "ارسال جواب نظرات در پایان سفارش.به عنوان مثال، ردیابی ID برای یک محصول"
|
| 1078 |
-
|
| 1079 |
-
#: ../classes/admin/settings/sf-options.php:221
|
| 1080 |
-
msgid "View email addresses"
|
| 1081 |
-
msgstr "مشاهده آدرس ایمیل"
|
| 1082 |
-
|
| 1083 |
-
#: ../classes/admin/settings/sf-options.php:222
|
| 1084 |
-
msgid ""
|
| 1085 |
-
"While viewing order details on the frontend, you can disable or enable email "
|
| 1086 |
-
"addresses"
|
| 1087 |
-
msgstr ""
|
| 1088 |
-
"زمانی که در حال مشاهده جزئیات سفارش در بخش کاربری هستید،آدرس ایمیل را می "
|
| 1089 |
-
"توانید فعال یا غیرفعال نمایید."
|
| 1090 |
-
|
| 1091 |
-
#: ../classes/admin/settings/sf-options.php:229
|
| 1092 |
-
msgid "Export a CSV file of orders for a product"
|
| 1093 |
-
msgstr "ایجاد خروجی یک فایل CSV از سفارشات برای یک محصول"
|
| 1094 |
-
|
| 1095 |
-
#: ../classes/admin/settings/sf-options.php:230
|
| 1096 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 1097 |
-
msgstr ""
|
| 1098 |
-
"فروشندگان می توانند از سفارشات خود در بخش کاربری از هر محصول یک فایل خروجی "
|
| 1099 |
-
"بگیرند"
|
| 1100 |
-
|
| 1101 |
-
#: ../classes/admin/settings/sf-options.php:237
|
| 1102 |
-
msgid "Reports"
|
| 1103 |
-
msgstr "گزارشات"
|
| 1104 |
-
|
| 1105 |
-
#: ../classes/admin/settings/sf-options.php:238
|
| 1106 |
-
msgid ""
|
| 1107 |
-
"<strike>View backend sales reports</strike>. <strong>Depreciated</strong>"
|
| 1108 |
-
msgstr "<strike>مشاهده گزارش فروش </strike>. <strong>گزارش کامل</strong>"
|
| 1109 |
-
|
| 1110 |
-
#: ../classes/admin/settings/sf-options.php:239
|
| 1111 |
-
msgid ""
|
| 1112 |
-
"This option has been removed and will no longer function. It will be "
|
| 1113 |
-
"completely removed in future versions. Vendors should use their Vendor "
|
| 1114 |
-
"Dashboard for reports as all identical functionality is already there. "
|
| 1115 |
-
msgstr ""
|
| 1116 |
-
|
| 1117 |
-
#: ../classes/admin/settings/sf-options.php:246
|
| 1118 |
-
msgid "View Frontend sales reports"
|
| 1119 |
-
msgstr "مشاهده مشخصات گزارش فروش"
|
| 1120 |
-
|
| 1121 |
-
#: ../classes/admin/settings/sf-options.php:247
|
| 1122 |
-
msgid ""
|
| 1123 |
-
"Sales table on the frontend on the Vendor Dashboard page. The table will "
|
| 1124 |
-
"only display sales data that pertain to their products, and only for orders "
|
| 1125 |
-
"that are processing or completed."
|
| 1126 |
-
msgstr ""
|
| 1127 |
-
"جدول فروش در ظاهر در صفحه داشبورد فروشنده. جدول تنها داده های فروش که به "
|
| 1128 |
-
"محصولات خود مربوط است، و تنها برای سفارشات صفحه نمایش است که در حال پردازش و "
|
| 1129 |
-
"یا تکمیل شده است."
|
| 1130 |
-
|
| 1131 |
-
#: ../classes/admin/settings/sf-options.php:255
|
| 1132 |
-
msgid "Submit products"
|
| 1133 |
-
msgstr "ارسال محصولات"
|
| 1134 |
-
|
| 1135 |
-
#: ../classes/admin/settings/sf-options.php:256
|
| 1136 |
-
msgid ""
|
| 1137 |
-
"Check to allow vendors to list new products. Admin must approve new "
|
| 1138 |
-
"products by editing the product, and clicking Publish."
|
| 1139 |
-
msgstr ""
|
| 1140 |
-
"بررسی اجازه به فروشندگان به لیست محصولات جدید است. محیط مدیریت باید محصولات "
|
| 1141 |
-
"جدید با ویرایش از محصول، و کلیک کردن انتشار تایید کند."
|
| 1142 |
-
|
| 1143 |
-
#: ../classes/admin/settings/sf-options.php:263
|
| 1144 |
-
msgid "Edit live products"
|
| 1145 |
-
msgstr "ویرایش محصولات فعال"
|
| 1146 |
-
|
| 1147 |
-
#: ../classes/admin/settings/sf-options.php:264
|
| 1148 |
-
msgid ""
|
| 1149 |
-
"Vendors could edit an approved product after it has already gone live. There "
|
| 1150 |
-
"is no approval or review after editing a live product. This could be "
|
| 1151 |
-
"dangerous with malicious vendors, so take caution."
|
| 1152 |
-
msgstr ""
|
| 1153 |
-
"فروشندگان می توانند بعد از تایید شدن یک محصول آن را ویرایش نمایند، پس از "
|
| 1154 |
-
"ویرایش نیز در حالت فعال باقی خواهد ماند. این گزینه می تواند برای شما خطرناک "
|
| 1155 |
-
"باشد بنابرین احتیاط کنید."
|
| 1156 |
-
|
| 1157 |
-
#: ../classes/admin/settings/sf-options.php:271
|
| 1158 |
-
msgid "Submit products live without requiring approval"
|
| 1159 |
-
msgstr "ارسال محصولات فعال بدون نیاز به تایید"
|
| 1160 |
-
|
| 1161 |
-
#: ../classes/admin/settings/sf-options.php:272
|
| 1162 |
-
msgid ""
|
| 1163 |
-
"Vendors can submit products without review or approval from a shop admin. "
|
| 1164 |
-
"This could be dangerous with malicious vendors, so take caution."
|
| 1165 |
-
msgstr ""
|
| 1166 |
-
"فروشندگان می توانند محصولات را بدون بررسی و یا تایید یک مدیر فروشگاه ارسال "
|
| 1167 |
-
"کند. این می تواند برای فروشندگان مخرب خطرناک است، بنابراین احتیاط. کنید"
|
| 1168 |
-
|
| 1169 |
-
#: ../classes/admin/settings/sf-options.php:278
|
| 1170 |
-
msgid "Pages"
|
| 1171 |
-
msgstr "صفحات"
|
| 1172 |
-
|
| 1173 |
-
#: ../classes/admin/settings/sf-options.php:279
|
| 1174 |
-
msgid "Page configuration"
|
| 1175 |
-
msgstr "صفحه پیکربندی"
|
| 1176 |
-
|
| 1177 |
-
#: ../classes/admin/settings/sf-options.php:282
|
| 1178 |
-
msgid "Vendor dashboard"
|
| 1179 |
-
msgstr "بخش کاربری فروشنده"
|
| 1180 |
-
|
| 1181 |
-
#: ../classes/admin/settings/sf-options.php:283
|
| 1182 |
-
msgid ""
|
| 1183 |
-
"Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</"
|
| 1184 |
-
"code><br/>. If this page is not set, you will break your site. If you "
|
| 1185 |
-
"upgrade to Pro, keep this page unchanged as both Pro Dashboard and this "
|
| 1186 |
-
"Dashboard page must be set."
|
| 1187 |
-
msgstr ""
|
| 1188 |
-
"صفحه ای که دارد از کوتاه را انتخاب کنید <code>[wcv_vendor_dashboard]</code> "
|
| 1189 |
-
"<br/> . اگر این صفحه را تنظیم نشده است، شما سایت خود را شکستن. اگر شما به "
|
| 1190 |
-
"نرم افزار ارتقاء، این صفحه را بدون تغییر به عنوان هر دو داشبورد نرم افزار "
|
| 1191 |
-
"حفظ و این صفحه داشبورد باید تنظیم شود."
|
| 1192 |
-
|
| 1193 |
-
#: ../classes/admin/settings/sf-options.php:290
|
| 1194 |
-
msgid "Shop settings"
|
| 1195 |
-
msgstr "تنظیمات فروشگاه"
|
| 1196 |
-
|
| 1197 |
-
#: ../classes/admin/settings/sf-options.php:291
|
| 1198 |
-
msgid ""
|
| 1199 |
-
"Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/"
|
| 1200 |
-
">These are the shop settings a vendor can configure. By default, Vendor "
|
| 1201 |
-
"Dashboard > Shop Settings should have this shortcode."
|
| 1202 |
-
msgstr ""
|
| 1203 |
-
"صفحه ای که دارد از کوتاه را انتخاب کنید <code>[wcv_shop_settings]</code> <br/"
|
| 1204 |
-
"> این تنظیمات فروشگاه یک فروشنده می تواند پیکربندی شده است. به طور پیش فرض، "
|
| 1205 |
-
"داشبورد فروشنده> تنظیمات فروشگاه باید این کوتاه است."
|
| 1206 |
-
|
| 1207 |
-
#: ../classes/admin/settings/sf-options.php:298
|
| 1208 |
-
msgid "Orders page"
|
| 1209 |
-
msgstr "صفحه سفارشات"
|
| 1210 |
-
|
| 1211 |
-
#: ../classes/admin/settings/sf-options.php:299
|
| 1212 |
-
msgid ""
|
| 1213 |
-
"Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 1214 |
-
"default, Vendor Dashboard > Orders should have the shortcode."
|
| 1215 |
-
msgstr ""
|
| 1216 |
-
"صفحه ای که دارد از کوتاه را انتخاب کنید <code>[wcv_orders]</code> <br/> به "
|
| 1217 |
-
"طور پیش فرض، داشبورد فروشنده> سفارشات باید کوتاه است."
|
| 1218 |
-
|
| 1219 |
-
#: ../classes/admin/settings/sf-options.php:306
|
| 1220 |
-
msgid "Vendor terms"
|
| 1221 |
-
msgstr "قوانین فروشنده شدن"
|
| 1222 |
-
|
| 1223 |
-
#: ../classes/admin/settings/sf-options.php:307
|
| 1224 |
-
msgid ""
|
| 1225 |
-
"These terms are shown to a user when submitting an application to become a "
|
| 1226 |
-
"vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor "
|
| 1227 |
-
"must accept terms in order to register, if set."
|
| 1228 |
-
msgstr ""
|
| 1229 |
-
"این شرایط به یک کاربر در هنگام ارائه یک برنامه کاربردی برای تبدیل شدن به یک "
|
| 1230 |
-
"فروشنده نشان داده شده است. <br/> اگر خالی بماند، هیچ شرایط خواهد شد به "
|
| 1231 |
-
"متقاضی نشان داده شده است. فروشنده باید شرایط به منظور ثبت نام، در صورت تنظیم "
|
| 1232 |
-
"می پذیرند."
|
| 1233 |
-
|
| 1234 |
-
#: ../classes/admin/settings/sf-options.php:314
|
| 1235 |
-
msgid "payments"
|
| 1236 |
-
msgstr "پرداخت ها"
|
| 1237 |
-
|
| 1238 |
-
#: ../classes/admin/settings/sf-options.php:325
|
| 1239 |
-
msgid "Payments"
|
| 1240 |
-
msgstr "پرداخت ها"
|
| 1241 |
-
|
| 1242 |
-
#: ../classes/admin/settings/sf-options.php:327
|
| 1243 |
-
msgid "PayPal Adaptive Payments Scheduling"
|
| 1244 |
-
msgstr "پی پال تطبیقی پرداخت زمانبندی"
|
| 1245 |
-
|
| 1246 |
-
#: ../classes/admin/settings/sf-options.php:328
|
| 1247 |
-
#, php-format
|
| 1248 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 1249 |
-
msgstr "درآمدهای کسب شده تا این لحظه: %s. <a href=\"%s\">مشاهده جزئیات</a>."
|
| 1250 |
-
|
| 1251 |
-
#: ../classes/admin/settings/sf-options.php:329
|
| 1252 |
-
#, php-format
|
| 1253 |
-
msgid ""
|
| 1254 |
-
"Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 1255 |
-
"\">here</a>. <br><br>To instantly pay with Adaptive Payments you must "
|
| 1256 |
-
"activate the paypalap gateway in your Checkout settings. <br><a href="
|
| 1257 |
-
"\"https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/\" "
|
| 1258 |
-
"target=\"top\">PayPal AP Application Help</a>. <br><br>Another gateway that "
|
| 1259 |
-
"offers instant payments to vendors that also accepts credit cards directly "
|
| 1260 |
-
"on your checkout page is Stripe. <br><a href=\"https://www.wcvendors.com/"
|
| 1261 |
-
"product/stripe-commissions-gateway/\" target=\"top\">Stripe Commissions & "
|
| 1262 |
-
"Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a href="
|
| 1263 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 1264 |
-
"Vendors Pro</a>."
|
| 1265 |
-
msgstr ""
|
| 1266 |
-
|
| 1267 |
-
#: ../classes/admin/settings/sf-options.php:333
|
| 1268 |
-
msgid "Instant pay"
|
| 1269 |
-
msgstr "هم اکنون پرداخت کنید"
|
| 1270 |
-
|
| 1271 |
-
#: ../classes/admin/settings/sf-options.php:334
|
| 1272 |
-
msgid ""
|
| 1273 |
-
"Instantly pay vendors their commission when an order is made, and if a "
|
| 1274 |
-
"vendor has a valid PayPal email added on their Shop Settings page."
|
| 1275 |
-
msgstr ""
|
| 1276 |
-
|
| 1277 |
-
#: ../classes/admin/settings/sf-options.php:335
|
| 1278 |
-
msgid ""
|
| 1279 |
-
"For this to work, customers must checkout with the PayPal Adaptive Payments "
|
| 1280 |
-
"gateway. Using any other gateways will not pay vendors instantly"
|
| 1281 |
-
msgstr ""
|
| 1282 |
-
"برای این کار، پرداخت های فروشگاه باید توسط درگاه پرداخت PayPal صورت گیرد در "
|
| 1283 |
-
"غیر این صورت امکان استفاده از این روش مقدور نمی باشد."
|
| 1284 |
-
|
| 1285 |
-
#: ../classes/admin/settings/sf-options.php:342
|
| 1286 |
-
msgid "Payment schedule"
|
| 1287 |
-
msgstr "برنامه پرداخت"
|
| 1288 |
-
|
| 1289 |
-
#: ../classes/admin/settings/sf-options.php:343
|
| 1290 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 1291 |
-
msgstr ""
|
| 1292 |
-
"توجه: در صورتی که برنامه پرداخت فعال باشد کمیسون فروشندگان در همان لحظه "
|
| 1293 |
-
"واریز می گردد."
|
| 1294 |
-
|
| 1295 |
-
#: ../classes/admin/settings/sf-options.php:348
|
| 1296 |
-
msgid "Daily"
|
| 1297 |
-
msgstr "روزانه"
|
| 1298 |
-
|
| 1299 |
-
#: ../classes/admin/settings/sf-options.php:349
|
| 1300 |
-
msgid "Weekly"
|
| 1301 |
-
msgstr "هفتگی"
|
| 1302 |
-
|
| 1303 |
-
#: ../classes/admin/settings/sf-options.php:350
|
| 1304 |
-
msgid "Biweekly"
|
| 1305 |
-
msgstr "دو هفته یکبار"
|
| 1306 |
-
|
| 1307 |
-
#: ../classes/admin/settings/sf-options.php:351
|
| 1308 |
-
msgid "Monthly"
|
| 1309 |
-
msgstr "ماهانه"
|
| 1310 |
-
|
| 1311 |
-
#: ../classes/admin/settings/sf-options.php:352
|
| 1312 |
-
msgid "Manual"
|
| 1313 |
-
msgstr "دستی"
|
| 1314 |
-
|
| 1315 |
-
#: ../classes/admin/settings/sf-options.php:353
|
| 1316 |
-
msgid "Now"
|
| 1317 |
-
msgstr "هم اکنون"
|
| 1318 |
-
|
| 1319 |
-
#: ../classes/admin/settings/sf-options.php:358
|
| 1320 |
-
msgid "Email notification"
|
| 1321 |
-
msgstr "اطلاع رسانی از طریق ایمیل"
|
| 1322 |
-
|
| 1323 |
-
#: ../classes/admin/settings/sf-options.php:359
|
| 1324 |
-
msgid ""
|
| 1325 |
-
"Send the WooCommerce admin an email each time a payment has been made via "
|
| 1326 |
-
"the payment schedule options above"
|
| 1327 |
-
msgstr ""
|
| 1328 |
-
"ارسال ایمیل به مدیر ووکامرس بعد از هر پرداخت طبق برنامه پرداخت که در بالا "
|
| 1329 |
-
"تنظیم کردید"
|
| 1330 |
-
|
| 1331 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:11
|
| 1332 |
-
#: ../templates/dashboard/settings/paypal-email-form.php:2
|
| 1333 |
-
msgid "PayPal Address"
|
| 1334 |
-
msgstr "آدرس PayPal"
|
| 1335 |
-
|
| 1336 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:15
|
| 1337 |
-
#: ../templates/dashboard/settings/paypal-email-form.php:3
|
| 1338 |
-
msgid "Your PayPal address is used to send you your commission."
|
| 1339 |
-
msgstr "آدرس PayPal شما جهت واریز درآمد استفاده می شود."
|
| 1340 |
-
|
| 1341 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:24
|
| 1342 |
-
#: ../templates/dashboard/settings/shop-name.php:3
|
| 1343 |
-
msgid "Your shop name is public and must be unique."
|
| 1344 |
-
msgstr "نام فروشگاه تکراری است. نام دیگری وارد نمایید."
|
| 1345 |
-
|
| 1346 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:43
|
| 1347 |
-
#: ../templates/dashboard/settings/seller-info.php:4
|
| 1348 |
-
msgid "This is displayed on each of your products."
|
| 1349 |
-
msgstr "پیش نمایشی از محصولات شما"
|
| 1350 |
-
|
| 1351 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:49
|
| 1352 |
-
#: ../templates/dashboard/settings/shop-description.php:2
|
| 1353 |
-
msgid "Shop Description"
|
| 1354 |
-
msgstr "توضیحات فروشگاه"
|
| 1355 |
-
|
| 1356 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:61
|
| 1357 |
-
#: ../templates/dashboard/settings/shop-description.php:3
|
| 1358 |
-
#, php-format
|
| 1359 |
-
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 1360 |
-
msgstr "صفحه نمایشی شما<a href=\"%s\">صفحه فروشگاه</a>."
|
| 1361 |
-
|
| 1362 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:70
|
| 1363 |
-
msgid "Save Shop Settings"
|
| 1364 |
-
msgstr "ذخیره تنظیمات فروشگاه"
|
| 1365 |
-
|
| 1366 |
-
#: ../classes/class-cron.php:87
|
| 1367 |
-
#, php-format
|
| 1368 |
-
msgid "Payment total: %s"
|
| 1369 |
-
msgstr "جمع کل پرداختی ها: %s"
|
| 1370 |
-
|
| 1371 |
-
#: ../classes/class-cron.php:149
|
| 1372 |
-
msgid "Once Daily"
|
| 1373 |
-
msgstr "یک بار در روز"
|
| 1374 |
-
|
| 1375 |
-
#: ../classes/class-cron.php:154
|
| 1376 |
-
msgid "Once Weekly"
|
| 1377 |
-
msgstr "یک بار در هفته"
|
| 1378 |
-
|
| 1379 |
-
#: ../classes/class-cron.php:159
|
| 1380 |
-
msgid "Once every two weeks"
|
| 1381 |
-
msgstr "یک بار در هر دو هفته"
|
| 1382 |
-
|
| 1383 |
-
#: ../classes/class-cron.php:164
|
| 1384 |
-
msgid "Once a month"
|
| 1385 |
-
msgstr "یک بار در ماه"
|
| 1386 |
-
|
| 1387 |
-
#: ../classes/class-install.php:190
|
| 1388 |
-
msgid "Vendor Dashboard"
|
| 1389 |
-
msgstr "بخش کاربری فروشنده"
|
| 1390 |
-
|
| 1391 |
-
#: ../classes/class-vendor-post-types.php:34
|
| 1392 |
-
msgid "Vendor Orders"
|
| 1393 |
-
msgstr "سفارش های فروشنده"
|
| 1394 |
-
|
| 1395 |
-
#: ../classes/class-vendors.php:551
|
| 1396 |
-
#, php-format
|
| 1397 |
-
msgid "Vendor Order – %s"
|
| 1398 |
-
msgstr "سفارش فروشنده – %s"
|
| 1399 |
-
|
| 1400 |
-
#: ../classes/class-vendors.php:551
|
| 1401 |
-
msgctxt "Order date parsed by strftime"
|
| 1402 |
-
msgid "%b %d, %Y @ %I:%M %p"
|
| 1403 |
-
msgstr ""
|
| 1404 |
-
|
| 1405 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:53
|
| 1406 |
-
msgid "Order marked shipped."
|
| 1407 |
-
msgstr "سفارش انتخابی ارسال شده است."
|
| 1408 |
-
|
| 1409 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:55
|
| 1410 |
-
#, php-format
|
| 1411 |
-
msgid "%s has marked as shipped. "
|
| 1412 |
-
msgstr "%s به عنوان محصول پستی مشخص است."
|
| 1413 |
-
|
| 1414 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:83
|
| 1415 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:84
|
| 1416 |
-
msgid "Tracking number"
|
| 1417 |
-
msgstr "شماره پیگیری"
|
| 1418 |
-
|
| 1419 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:86
|
| 1420 |
-
msgid "Success. Your tracking number has been updated."
|
| 1421 |
-
msgstr "با موفقیت. شماره پیگیری شما به روز شد."
|
| 1422 |
-
|
| 1423 |
-
#: ../classes/front/orders/class-export-csv.php:19
|
| 1424 |
-
#: ../templates/dashboard/reports.php:18
|
| 1425 |
-
#: ../templates/emails/admin-new-order.php:23
|
| 1426 |
-
#: ../templates/emails/notify-vendor-shipped.php:23
|
| 1427 |
-
#: ../templates/emails/vendor-new-order.php:23
|
| 1428 |
-
msgid "Quantity"
|
| 1429 |
-
msgstr "تعداد"
|
| 1430 |
-
|
| 1431 |
-
#: ../classes/front/orders/class-orders.php:120
|
| 1432 |
-
msgid ""
|
| 1433 |
-
"You haven't selected a product's orders to view! Please go back to the "
|
| 1434 |
-
"Vendor Dashboard and click Show Orders on the product you'd like to view."
|
| 1435 |
-
msgstr ""
|
| 1436 |
-
"شما سفارشات محصول را برای مشاهده انتخاب کرده اید! به بخش کاربری فروشنده "
|
| 1437 |
-
"برگردید و جهت نمایش سفارشات بر روی محصول شما را می خواهم ببینیم کلیک کنید"
|
| 1438 |
-
|
| 1439 |
-
#: ../classes/front/orders/class-orders.php:124
|
| 1440 |
-
msgid "No orders."
|
| 1441 |
-
msgstr "بدون سفارشات."
|
| 1442 |
-
|
| 1443 |
-
#: ../classes/front/orders/class-orders.php:188
|
| 1444 |
-
msgid "Product Title"
|
| 1445 |
-
msgstr "عنوان محصولات"
|
| 1446 |
-
|
| 1447 |
-
#: ../classes/front/orders/class-orders.php:189
|
| 1448 |
-
msgid "Full name"
|
| 1449 |
-
msgstr "نام کامل"
|
| 1450 |
-
|
| 1451 |
-
#: ../classes/front/orders/class-orders.php:190
|
| 1452 |
-
msgid "Address"
|
| 1453 |
-
msgstr "آدرس"
|
| 1454 |
-
|
| 1455 |
-
#: ../classes/front/orders/class-orders.php:191
|
| 1456 |
-
msgid "City"
|
| 1457 |
-
msgstr "شهر"
|
| 1458 |
-
|
| 1459 |
-
#: ../classes/front/orders/class-orders.php:192
|
| 1460 |
-
msgid "State"
|
| 1461 |
-
msgstr "خیابان"
|
| 1462 |
-
|
| 1463 |
-
#: ../classes/front/orders/class-orders.php:193
|
| 1464 |
-
msgid "Zip"
|
| 1465 |
-
msgstr "کدپستی"
|
| 1466 |
-
|
| 1467 |
-
#: ../classes/front/orders/class-orders.php:194
|
| 1468 |
-
msgid "Email address"
|
| 1469 |
-
msgstr "آدرس ایمیل"
|
| 1470 |
-
|
| 1471 |
-
#: ../classes/front/orders/class-submit-comment.php:41
|
| 1472 |
-
msgid "You've left the comment field empty!"
|
| 1473 |
-
msgstr "ما را فراموش کرده اید. هیچ نظری ارسال نکرده اید."
|
| 1474 |
-
|
| 1475 |
-
#: ../classes/front/orders/class-submit-comment.php:63
|
| 1476 |
-
msgid "Success. The customer has been notified of your comment."
|
| 1477 |
-
msgstr "با موفقیت. مشتری از نظر شما آگاه شد"
|
| 1478 |
-
|
| 1479 |
-
#: ../classes/front/signup/class-vendor-signup.php:58
|
| 1480 |
-
#: ../classes/front/signup/views/html-vendor-signup.php:21
|
| 1481 |
-
#: ../templates/dashboard/denied.php:22
|
| 1482 |
-
msgid "Apply to become a vendor? "
|
| 1483 |
-
msgstr "درخواست برای تبدیل شدن به یک فروشنده؟"
|
| 1484 |
-
|
| 1485 |
-
#: ../classes/front/signup/class-vendor-signup.php:72
|
| 1486 |
-
#: ../classes/front/signup/views/html-vendor-signup.php:35
|
| 1487 |
-
#, php-format
|
| 1488 |
-
msgid ""
|
| 1489 |
-
"I have read and accepted the <a target=\"top\" href=\"%s\">terms and "
|
| 1490 |
-
"conditions</a>"
|
| 1491 |
-
msgstr "من خوانده و قبول میکنم <a target=\"top\" href=\"%s\">شرایط و ضوابط</a>"
|
| 1492 |
-
|
| 1493 |
-
#: ../classes/front/signup/class-vendor-signup.php:122
|
| 1494 |
-
msgid "Application denied. You are an administrator."
|
| 1495 |
-
msgstr "مدیر درخواست شما را تایید نکرد"
|
| 1496 |
-
|
| 1497 |
-
#: ../classes/front/signup/class-vendor-signup.php:124
|
| 1498 |
-
msgid "Your application has been submitted."
|
| 1499 |
-
msgstr "درخواست شما ارائه شده است."
|
| 1500 |
-
|
| 1501 |
-
#: ../classes/front/signup/class-vendor-signup.php:171
|
| 1502 |
-
#: ../classes/front/signup/class-vendor-signup.php:208
|
| 1503 |
-
#: ../classes/front/signup/class-vendor-signup.php:220
|
| 1504 |
-
msgid "You must accept the terms and conditions to become a vendor."
|
| 1505 |
-
msgstr "شما باید قوانین را برای ثبت نام در بخش فروشنده بپذیرید."
|
| 1506 |
-
|
| 1507 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1508 |
-
msgid "PayPal Adaptive Payments"
|
| 1509 |
-
msgstr "انجام پرداخت با PayPal"
|
| 1510 |
-
|
| 1511 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 1512 |
-
#, php-format
|
| 1513 |
-
msgid ""
|
| 1514 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 1515 |
-
"%s."
|
| 1516 |
-
msgstr ""
|
| 1517 |
-
"موردی را اشتباه وارد کرده اید. به همین منظور پاسخ اعتبار از PayPal دریافت "
|
| 1518 |
-
"نشد. وضعیت %s است."
|
| 1519 |
-
|
| 1520 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 1521 |
-
msgid "IPN payment completed"
|
| 1522 |
-
msgstr "IPN تکمیل پرداخت"
|
| 1523 |
-
|
| 1524 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 1525 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 1526 |
-
msgstr "فعال کردن تطبیق پرداخت با PayPal"
|
| 1527 |
-
|
| 1528 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 1529 |
-
msgid "Method Title"
|
| 1530 |
-
msgstr "عنوان روش"
|
| 1531 |
-
|
| 1532 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 1533 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:70
|
| 1534 |
-
msgid "This controls the title which the user sees during checkout."
|
| 1535 |
-
msgstr "این عنوانی را کنترل می کند که کاربر در طول پرداخت می بیند."
|
| 1536 |
-
|
| 1537 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 1538 |
-
msgid "PayPal"
|
| 1539 |
-
msgstr "PayPal"
|
| 1540 |
-
|
| 1541 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:159
|
| 1542 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:75
|
| 1543 |
-
msgid "Description"
|
| 1544 |
-
msgstr "توضیحات"
|
| 1545 |
-
|
| 1546 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 1547 |
-
msgid "This controls the description which the user sees during checkout."
|
| 1548 |
-
msgstr "این توضیحاتی را کنترل می کند که کاربر در طول پرداخت می بیند."
|
| 1549 |
-
|
| 1550 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 1551 |
-
msgid "Pay via PayPal!"
|
| 1552 |
-
msgstr "پرداخت از طریق PayPal!"
|
| 1553 |
-
|
| 1554 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 1555 |
-
msgid "Live Credentials"
|
| 1556 |
-
msgstr "تاییده زنده"
|
| 1557 |
-
|
| 1558 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 1559 |
-
#, php-format
|
| 1560 |
-
msgid ""
|
| 1561 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 1562 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 1563 |
-
msgstr ""
|
| 1564 |
-
"شما باید دارای <a href=\"%s\">شناسه سفارش</a>to process live transactions. "
|
| 1565 |
-
"You do not need one for testing in Sandbox mode."
|
| 1566 |
-
|
| 1567 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:179
|
| 1568 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 1569 |
-
msgid "PayPal Email"
|
| 1570 |
-
msgstr "شماره کارت و نام بانک"
|
| 1571 |
-
|
| 1572 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:180
|
| 1573 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 1574 |
-
msgid "The email address main payments should go to."
|
| 1575 |
-
msgstr ""
|
| 1576 |
-
"شماره کارت و نام بانک که فقط بایستی به نام فروشنده باشد تا درآمد شما واریز "
|
| 1577 |
-
"گردد. توجه داشته باشید هرگونه اشتباه در اطلاعات وارد شده بر عهده شما می باشد."
|
| 1578 |
-
|
| 1579 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:185
|
| 1580 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 1581 |
-
msgid "API Username"
|
| 1582 |
-
msgstr "شناسه نام کاربری"
|
| 1583 |
-
|
| 1584 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:190
|
| 1585 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 1586 |
-
msgid "API Password"
|
| 1587 |
-
msgstr "شناسه کلمه عبور"
|
| 1588 |
-
|
| 1589 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:195
|
| 1590 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 1591 |
-
msgid "API Signature"
|
| 1592 |
-
msgstr "شناسه امضا"
|
| 1593 |
-
|
| 1594 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 1595 |
-
msgid "Application ID"
|
| 1596 |
-
msgstr "شناسه برنامه"
|
| 1597 |
-
|
| 1598 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 1599 |
-
msgid "Only required when doing live transactions."
|
| 1600 |
-
msgstr "تنها جهت انجام تراکنش های زنده مورد نیاز است."
|
| 1601 |
-
|
| 1602 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 1603 |
-
msgid "Sandbox Credentials"
|
| 1604 |
-
msgstr "مجوز Sandbox"
|
| 1605 |
-
|
| 1606 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 1607 |
-
#, php-format
|
| 1608 |
-
msgid ""
|
| 1609 |
-
"You can signup for a sandbox developer account <a href=\"%s\">here</a>. You "
|
| 1610 |
-
"need a developer account if you want to enable Sandbox mode for testing."
|
| 1611 |
-
msgstr ""
|
| 1612 |
-
"اگر میخواهید به جمع توسعه دهندگان این افزونه ملحق شوید کافی است یک حساب "
|
| 1613 |
-
"کاربری ایجاد نمایید. <a href=\"%s\">ایجاد حساب کاربر توسعه دهنده</a>"
|
| 1614 |
-
|
| 1615 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 1616 |
-
msgid "Misc. Settings"
|
| 1617 |
-
msgstr "تنظیمات متفرقه"
|
| 1618 |
-
|
| 1619 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 1620 |
-
msgid "Enable PayPal Sandbox mode"
|
| 1621 |
-
msgstr "فعال کردن حالت Sandbox PayPal"
|
| 1622 |
-
|
| 1623 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 1624 |
-
msgid "Enable logging"
|
| 1625 |
-
msgstr "فعال کردن ورود به سیستم"
|
| 1626 |
-
|
| 1627 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 1628 |
-
msgid ""
|
| 1629 |
-
"The PayPal Adaptive Payments gateway can instantly pay your vendors their "
|
| 1630 |
-
"due commission (if enabled). Also used to mass pay vendors on a schedule / "
|
| 1631 |
-
"manual method (if enabled)."
|
| 1632 |
-
msgstr ""
|
| 1633 |
-
"پرداخت سریع کمیسون فروشندگان از طریق PayPal در صورتی که این گزینه فعال باشد"
|
| 1634 |
-
|
| 1635 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1636 |
-
msgid "Gateway Disabled"
|
| 1637 |
-
msgstr "غیر فعال کردن درگاه پرداخت"
|
| 1638 |
-
|
| 1639 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1640 |
-
#, php-format
|
| 1641 |
-
msgid "%s does not support your store currency."
|
| 1642 |
-
msgstr "%s واحد پول تعیین شده در فروشگاه شما را پشتیبانی نمی کند."
|
| 1643 |
-
|
| 1644 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:384
|
| 1645 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:500
|
| 1646 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:153
|
| 1647 |
-
#, php-format
|
| 1648 |
-
msgid "Error: %s"
|
| 1649 |
-
msgstr "خطای %s"
|
| 1650 |
-
|
| 1651 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:393
|
| 1652 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:394
|
| 1653 |
-
#, php-format
|
| 1654 |
-
msgid "Error ID: %s. %s"
|
| 1655 |
-
msgstr "شناسه خطا: %s. %s"
|
| 1656 |
-
|
| 1657 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 1658 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 1659 |
-
msgstr ""
|
| 1660 |
-
"این فروشندگان جهت واریز شدن کمیسیون خود تنظیمات PayPal انجام نداده اند؟"
|
| 1661 |
-
|
| 1662 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:167
|
| 1663 |
-
msgid "All due commission has been paid for."
|
| 1664 |
-
msgstr "همه کمیسیون ها پرداخت شده است."
|
| 1665 |
-
|
| 1666 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:173
|
| 1667 |
-
msgid ""
|
| 1668 |
-
"All due commission has been paid for, but I could not clear it from their "
|
| 1669 |
-
"profiles due to an internal error. Commission will still be listed as due. "
|
| 1670 |
-
"Please manually mark the commission as paid from the Commissions page."
|
| 1671 |
-
msgstr ""
|
| 1672 |
-
"همه کمیسیون به دلیل شده است به دلیل خطای داخلی پرداخت می شود، اما من می "
|
| 1673 |
-
"توانم آن را از پروفایل خود را روشن نمی کند. کمیسیون هنوز هم به عنوان دلیل "
|
| 1674 |
-
"خواهد ذکر شده است. لطفا دستی علامت کمیسیون به عنوان از صفحه کمیسیون پرداخت "
|
| 1675 |
-
"می شود."
|
| 1676 |
-
|
| 1677 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 1678 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 1679 |
-
msgstr "به روز رسانی پرداخت انبوه فروشندگان ووکامرس"
|
| 1680 |
-
|
| 1681 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:210
|
| 1682 |
-
msgid ""
|
| 1683 |
-
"Hello! A payment was just triggered to mass pay all vendors their due "
|
| 1684 |
-
"commission."
|
| 1685 |
-
msgstr ""
|
| 1686 |
-
"این پرداخت انبوه به درخواست شما جهت واریز تمامی کمیسیون های فروشندگان بود."
|
| 1687 |
-
|
| 1688 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:211
|
| 1689 |
-
#, php-format
|
| 1690 |
-
msgid "Payment status: %s."
|
| 1691 |
-
msgstr "وضعيت پرداخت: %s"
|
| 1692 |
-
|
| 1693 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 1694 |
-
#, php-format
|
| 1695 |
-
msgid "Payment message: %s."
|
| 1696 |
-
msgstr "جمع کل پرداختی ها: %s"
|
| 1697 |
-
|
| 1698 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:215
|
| 1699 |
-
#, php-format
|
| 1700 |
-
msgid "Payment total: %s."
|
| 1701 |
-
msgstr "جمع کل پرداخت ها: %s"
|
| 1702 |
-
|
| 1703 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:35
|
| 1704 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:71
|
| 1705 |
-
msgid "WC Vendors Test Gateway"
|
| 1706 |
-
msgstr "تست دروازه فروشندگان ووکامرس"
|
| 1707 |
-
|
| 1708 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:36
|
| 1709 |
-
msgid ""
|
| 1710 |
-
"This gateway will set orders to processing upon receipt allowing you to test "
|
| 1711 |
-
"transactions in your store. Some WooCommerce included gateways have "
|
| 1712 |
-
"problems with this - you should use this gateway for all of your non-PayPal "
|
| 1713 |
-
"testing."
|
| 1714 |
-
msgstr ""
|
| 1715 |
-
"این درگاهی است جهت تست مراحل سفارش در معاملات فروشندگان که امکانات زیادی جهت "
|
| 1716 |
-
"پیدا کردن مشکلات ووکامرس به شما می دهد. شما می توانید این درگاه را برای همه "
|
| 1717 |
-
"ی تست ها به غیر از PayPal استفاده نمایید."
|
| 1718 |
-
|
| 1719 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:64
|
| 1720 |
-
msgid "Enable WC Vendors Test Gateway Payment"
|
| 1721 |
-
msgstr "فعال کردن تست درگاه پرداخت فروشندگان ووکامرس"
|
| 1722 |
-
|
| 1723 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:68
|
| 1724 |
-
msgid "Title"
|
| 1725 |
-
msgstr "عنوان"
|
| 1726 |
-
|
| 1727 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:77
|
| 1728 |
-
msgid "Payment method description that the customer will see on your checkout."
|
| 1729 |
-
msgstr "توضیح روش پرداخت هنگامی که مشتری میخواهد پرداخت را انجام دهد."
|
| 1730 |
-
|
| 1731 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:78
|
| 1732 |
-
msgid ""
|
| 1733 |
-
"This is a test gateway -- not to be used on live sites for live "
|
| 1734 |
-
"transactions. <a href=\"http://www.wcvendors.com/\" target=\"top\">Click "
|
| 1735 |
-
"here to visit WCVendors.com</a>."
|
| 1736 |
-
msgstr ""
|
| 1737 |
-
"این یک درگاه تست است - نمی توان در سایت های های فعال برای انجام معاملات "
|
| 1738 |
-
"واقعی استفاده کرد. <a href=\"http://www.wcvendors.com/\" target=\"top\">برای "
|
| 1739 |
-
"بازدید از WCVendors.com اینجا را کلیک کنید</a>."
|
| 1740 |
-
|
| 1741 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:82
|
| 1742 |
-
msgid "Instructions"
|
| 1743 |
-
msgstr "دستورالعمل"
|
| 1744 |
-
|
| 1745 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:84
|
| 1746 |
-
msgid ""
|
| 1747 |
-
"Success! Your test order is now marked as processing and any vendors will "
|
| 1748 |
-
"be sent an email as long as you have the Notify Vendors email enabled under "
|
| 1749 |
-
"WooCommerce--Settings--Emails."
|
| 1750 |
-
msgstr ""
|
| 1751 |
-
"ارسال ایمیل آگاه سازی فروشندگان تحت عنوان محصول شما با موفقیت جهت تست ازسال "
|
| 1752 |
-
"شد و در حال پردازش است. برای فعال سازی این ایمیل به مسیر: ووکامرس-> تنظیمات-"
|
| 1753 |
-
"> ایمیل ،بروید"
|
| 1754 |
-
|
| 1755 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:124
|
| 1756 |
-
msgid "Test gateway transation complete. Order processing."
|
| 1757 |
-
msgstr "تست کامل محصول اضافه شده، پردازش سفارش"
|
| 1758 |
-
|
| 1759 |
-
#: ../templates/dashboard/denied.php:8
|
| 1760 |
-
msgid ""
|
| 1761 |
-
"Your account has not yet been approved to become a vendor. When it is, you "
|
| 1762 |
-
"will receive an email telling you that your account is approved!"
|
| 1763 |
-
msgstr ""
|
| 1764 |
-
"حساب شما تایید نشده است. حساب شما زمانی فعال می گردد که ایمیل تحت عنوان "
|
| 1765 |
-
"\"حساب شما تایید شد\" دریافت نمایید."
|
| 1766 |
-
|
| 1767 |
-
#: ../templates/dashboard/denied.php:12
|
| 1768 |
-
msgid "Your account is not setup as a vendor."
|
| 1769 |
-
msgstr "حساب کاربری شما به عنوان فروشنده راه اندازی نشده است."
|
| 1770 |
-
|
| 1771 |
-
#: ../templates/dashboard/denied.php:33
|
| 1772 |
-
#, php-format
|
| 1773 |
-
msgid "I have read and accepted the <a href=\"%s\">terms and conditions</a>"
|
| 1774 |
-
msgstr ""
|
| 1775 |
-
"من قوانین را خوانده ام و آنها را قبول می کنم<a href=\"%s\">شرایط و ضوابط</a>"
|
| 1776 |
-
|
| 1777 |
-
#: ../templates/dashboard/denied.php:53
|
| 1778 |
-
msgid "Submit"
|
| 1779 |
-
msgstr "ارسال"
|
| 1780 |
-
|
| 1781 |
-
#: ../templates/dashboard/links.php:3
|
| 1782 |
-
msgid "View Your Store"
|
| 1783 |
-
msgstr "نمایش فروشگاه"
|
| 1784 |
-
|
| 1785 |
-
#: ../templates/dashboard/links.php:4
|
| 1786 |
-
msgid "Store Settings"
|
| 1787 |
-
msgstr "تنظیمات فروشگاه"
|
| 1788 |
-
|
| 1789 |
-
#: ../templates/dashboard/links.php:7
|
| 1790 |
-
msgid "Add New Product"
|
| 1791 |
-
msgstr "اضافه کردن محصول جدید"
|
| 1792 |
-
|
| 1793 |
-
#: ../templates/dashboard/links.php:8
|
| 1794 |
-
msgid "Edit Products"
|
| 1795 |
-
msgstr "ویرایش محصولات"
|
| 1796 |
-
|
| 1797 |
-
#: ../templates/dashboard/orders.php:7 ../templates/dashboard/orders.php:10
|
| 1798 |
-
msgid "Hide items"
|
| 1799 |
-
msgstr "پنهان کردن گزینه ها"
|
| 1800 |
-
|
| 1801 |
-
#: ../templates/dashboard/orders.php:8 ../templates/dashboard/orders.php:79
|
| 1802 |
-
msgid "View items"
|
| 1803 |
-
msgstr "نمایش گزینه ها"
|
| 1804 |
-
|
| 1805 |
-
#: ../templates/dashboard/orders.php:37
|
| 1806 |
-
msgid "Links"
|
| 1807 |
-
msgstr "لینک ها"
|
| 1808 |
-
|
| 1809 |
-
#: ../templates/dashboard/orders.php:100
|
| 1810 |
-
msgid "Tracking"
|
| 1811 |
-
msgstr "پیگیری"
|
| 1812 |
-
|
| 1813 |
-
#: ../templates/dashboard/orders.php:216
|
| 1814 |
-
msgid "You have no orders during this period."
|
| 1815 |
-
msgstr "شما در این مدت زمان سفارشی نداشته اید."
|
| 1816 |
-
|
| 1817 |
-
#: ../templates/dashboard/reports.php:1
|
| 1818 |
-
msgid "Sales Report"
|
| 1819 |
-
msgstr "گزارش فروش"
|
| 1820 |
-
|
| 1821 |
-
#: ../templates/dashboard/reports.php:20
|
| 1822 |
-
msgid "Rate"
|
| 1823 |
-
msgstr "امتیاز"
|
| 1824 |
-
|
| 1825 |
-
#: ../templates/dashboard/reports.php:47
|
| 1826 |
-
msgid "Show Orders"
|
| 1827 |
-
msgstr "نمایش سفارشات"
|
| 1828 |
-
|
| 1829 |
-
#: ../templates/dashboard/reports.php:56
|
| 1830 |
-
msgid "Totals"
|
| 1831 |
-
msgstr "مجموع"
|
| 1832 |
-
|
| 1833 |
-
#: ../templates/dashboard/reports.php:71
|
| 1834 |
-
msgid "You have no sales during this period."
|
| 1835 |
-
msgstr "هیچ فروشی در این مدت زمان نداشته اید."
|
| 1836 |
-
|
| 1837 |
-
#: ../templates/dashboard/reports.php:82
|
| 1838 |
-
msgid "You haven't made any sales yet."
|
| 1839 |
-
msgstr "شما فروشی از محصولات ارائه شده نداشته اید"
|
| 1840 |
-
|
| 1841 |
-
#: ../templates/dashboard/settings/settings.php:47
|
| 1842 |
-
msgid "Save"
|
| 1843 |
-
msgstr "ذخیره"
|
| 1844 |
-
|
| 1845 |
-
#: ../templates/emails/admin-new-order.php:13
|
| 1846 |
-
#: ../templates/emails/vendor-new-order.php:13
|
| 1847 |
-
#, php-format
|
| 1848 |
-
msgid "You have received an order from %s. Their order is as follows:"
|
| 1849 |
-
msgstr "شما یک سفارش از %s را دریافت کرده اید. سفارش به شرح زیر است:"
|
| 1850 |
-
|
| 1851 |
-
#: ../templates/emails/admin-new-order.php:17
|
| 1852 |
-
#: ../templates/emails/notify-vendor-shipped.php:17
|
| 1853 |
-
#: ../templates/emails/vendor-new-order.php:17
|
| 1854 |
-
#, php-format
|
| 1855 |
-
msgid "Order: %s"
|
| 1856 |
-
msgstr "سفارش: %s"
|
| 1857 |
-
|
| 1858 |
-
#: ../templates/emails/admin-new-order.php:24
|
| 1859 |
-
#: ../templates/emails/notify-vendor-shipped.php:24
|
| 1860 |
-
#: ../templates/emails/vendor-new-order.php:24
|
| 1861 |
-
msgid "Price"
|
| 1862 |
-
msgstr "قیمت"
|
| 1863 |
-
|
| 1864 |
-
#: ../templates/emails/admin-new-order.php:50
|
| 1865 |
-
#: ../templates/emails/notify-vendor-shipped.php:56
|
| 1866 |
-
#: ../templates/emails/vendor-new-order.php:56
|
| 1867 |
-
msgid "Customer details"
|
| 1868 |
-
msgstr "مشخصات مشتری"
|
| 1869 |
-
|
| 1870 |
-
#: ../templates/emails/admin-new-order.php:53
|
| 1871 |
-
#: ../templates/emails/notify-vendor-shipped.php:59
|
| 1872 |
-
#: ../templates/emails/vendor-new-order.php:59
|
| 1873 |
-
msgid "Email:"
|
| 1874 |
-
msgstr "ایمیل:"
|
| 1875 |
-
|
| 1876 |
-
#: ../templates/emails/admin-new-order.php:56
|
| 1877 |
-
#: ../templates/emails/notify-vendor-shipped.php:62
|
| 1878 |
-
#: ../templates/emails/vendor-new-order.php:62
|
| 1879 |
-
msgid "Tel:"
|
| 1880 |
-
msgstr "تلفن:"
|
| 1881 |
-
|
| 1882 |
-
#: ../templates/emails/application-status.php:5
|
| 1883 |
-
#, php-format
|
| 1884 |
-
msgid "Hi there. This is a notification about a vendor application on %s."
|
| 1885 |
-
msgstr "سلام. این یک اطلاعیه در مورد درخواست فروشنده در %s است"
|
| 1886 |
-
|
| 1887 |
-
#: ../templates/emails/application-status.php:8
|
| 1888 |
-
#, php-format
|
| 1889 |
-
msgid "Application status: %s"
|
| 1890 |
-
msgstr "وضعیت درخواست: %s"
|
| 1891 |
-
|
| 1892 |
-
#: ../templates/emails/application-status.php:9
|
| 1893 |
-
#, php-format
|
| 1894 |
-
msgid "Applicant username: %s"
|
| 1895 |
-
msgstr "نام کاربری متقاضی: %s"
|
| 1896 |
-
|
| 1897 |
-
#: ../templates/emails/new-product.php:5
|
| 1898 |
-
#, php-format
|
| 1899 |
-
msgid "Hi there. This is a notification about a new product on %s."
|
| 1900 |
-
msgstr ""
|
| 1901 |
-
"سلام. این یک اطلاعیه جهت اعلام ارائه محصول جدید در فروشگاه توسط %s است."
|
| 1902 |
-
|
| 1903 |
-
#: ../templates/emails/new-product.php:8
|
| 1904 |
-
#, php-format
|
| 1905 |
-
msgid "Product title: %s"
|
| 1906 |
-
msgstr "عنوان محصول: %s"
|
| 1907 |
-
|
| 1908 |
-
#: ../templates/emails/new-product.php:9
|
| 1909 |
-
#, php-format
|
| 1910 |
-
msgid "Submitted by: %s"
|
| 1911 |
-
msgstr "ارائه شده توسط: %s"
|
| 1912 |
-
|
| 1913 |
-
#: ../templates/emails/new-product.php:10
|
| 1914 |
-
#, php-format
|
| 1915 |
-
msgid "Edit product: %s"
|
| 1916 |
-
msgstr "ویرایش محصول: %s"
|
| 1917 |
-
|
| 1918 |
-
#: ../templates/emails/notify-vendor-shipped.php:13
|
| 1919 |
-
msgid ""
|
| 1920 |
-
"A vendor has marked part of your order as shipped. The items that are "
|
| 1921 |
-
"shipped are as follows:"
|
| 1922 |
-
msgstr ""
|
| 1923 |
-
"فروشنده بخشی از سفارش خود را به عنوان محصول پستی مشخص کرده است. مواردی که "
|
| 1924 |
-
"پست می شوند به شرح زیر است:"
|
| 1925 |
-
|
| 1926 |
-
#: ../templates/orders/comments/add-new-comment.php:11
|
| 1927 |
-
msgid "Add comment"
|
| 1928 |
-
msgstr "ارسال دیدگاه"
|
| 1929 |
-
|
| 1930 |
-
#: ../templates/orders/comments/existing-comments.php:9
|
| 1931 |
-
#, php-format
|
| 1932 |
-
msgid "added %s ago"
|
| 1933 |
-
msgstr "اضافه شده در %s پیش"
|
| 1934 |
-
|
| 1935 |
-
#: ../templates/orders/csv-export.php:6
|
| 1936 |
-
msgid "Export orders"
|
| 1937 |
-
msgstr "برون ریزی سفارشات"
|
| 1938 |
-
|
| 1939 |
-
#: ../templates/orders/customer-note/customer-note.php:4
|
| 1940 |
-
msgid "Customer note"
|
| 1941 |
-
msgstr "دیدگاه مشتری"
|
| 1942 |
-
|
| 1943 |
-
#: ../templates/orders/customer-note/customer-note.php:8
|
| 1944 |
-
msgid "No customer note."
|
| 1945 |
-
msgstr "بدون دیدگاه مشتری"
|
| 1946 |
-
|
| 1947 |
-
#: ../templates/orders/orders.php:84
|
| 1948 |
-
#, php-format
|
| 1949 |
-
msgid "Comments (%s)"
|
| 1950 |
-
msgstr "نظرات (%s)"
|
| 1951 |
-
|
| 1952 |
-
#: ../templates/orders/shipping/shipping-form.php:6
|
| 1953 |
-
msgid "Provider:"
|
| 1954 |
-
msgstr "ارائه دهنده:"
|
| 1955 |
-
|
| 1956 |
-
#: ../templates/orders/shipping/shipping-form.php:8
|
| 1957 |
-
msgid "Custom Provider"
|
| 1958 |
-
msgstr "ارائه دهنده سفارشی"
|
| 1959 |
-
|
| 1960 |
-
#: ../templates/orders/shipping/shipping-form.php:31
|
| 1961 |
-
msgid "Provider Name:"
|
| 1962 |
-
msgstr "نام ارائه دهنده:"
|
| 1963 |
-
|
| 1964 |
-
#: ../templates/orders/shipping/shipping-form.php:40
|
| 1965 |
-
msgid "Tracking number:"
|
| 1966 |
-
msgstr "شماره پیگیری:"
|
| 1967 |
-
|
| 1968 |
-
#: ../templates/orders/shipping/shipping-form.php:48
|
| 1969 |
-
msgid "Tracking link:"
|
| 1970 |
-
msgstr "لینک پیگیری:"
|
| 1971 |
-
|
| 1972 |
-
#: ../templates/orders/shipping/shipping-form.php:58
|
| 1973 |
-
msgid "Date shipped:"
|
| 1974 |
-
msgstr "تاریخ ارسال محصول پستی:"
|
| 1975 |
-
|
| 1976 |
-
#: ../templates/orders/shipping/shipping-form.php:66
|
| 1977 |
-
msgid "Preview:"
|
| 1978 |
-
msgstr "پیش نمایش:"
|
| 1979 |
-
|
| 1980 |
-
#: ../templates/orders/shipping/shipping-form.php:66
|
| 1981 |
-
msgid "Click here to track your shipment"
|
| 1982 |
-
msgstr "برای پیگیری محصول پستی خود اینجا را کلیک کنید"
|
| 1983 |
-
|
| 1984 |
-
#: ../templates/orders/shipping/shipping-form.php:75
|
| 1985 |
-
msgid "Update tracking number"
|
| 1986 |
-
msgstr "به روز رسانی شماره پیگیری"
|
| 1987 |
-
|
| 1988 |
-
#: ../templates/orders/shipping/shipping-form.php:77
|
| 1989 |
-
msgid "Mark as shipped"
|
| 1990 |
-
msgstr "انتخاب به عنوان مجصول پستی"
|
| 1991 |
-
|
| 1992 |
-
#: ../templates/orders/table-body.php:25
|
| 1993 |
-
#, php-format
|
| 1994 |
-
msgid "Quantity: %d"
|
| 1995 |
-
msgstr "تعداد: %d"
|
| 1996 |
-
|
| 1997 |
-
#~ msgid ""
|
| 1998 |
-
#~ "<b>WC Vendors is disabled</b>. WC Vendors requires a minimum of "
|
| 1999 |
-
#~ "WooCommerce v2.4.0."
|
| 2000 |
-
#~ msgstr ""
|
| 2001 |
-
#~ "<b> افزونه فروشندگان ووکامرس غیر فعال شده است</b>. این افزونه حداقل نیاز "
|
| 2002 |
-
#~ "به نسخه 2.2.0 افزونه ووکامرس دارد."
|
| 2003 |
-
|
| 2004 |
-
#~ msgid ""
|
| 2005 |
-
#~ "WC Vendors requires the Vendor shop page value be set <a href=\"%s"
|
| 2006 |
-
#~ "\">click here to set it.</a> | <a href=\"%s\">Hide Notice</a>"
|
| 2007 |
-
#~ msgstr ""
|
| 2008 |
-
#~ "افزونه فروشندگان ووکامرس نیاز به تنظیمات صفحه فروشندگان دارد<a href=\"%s"
|
| 2009 |
-
#~ "\">جهت انجام تنظیمات اینجا کلیک کنید.</a> | <a href=\"%s\">مخفی کردن "
|
| 2010 |
-
#~ "اطلاعیه</a>"
|
| 2011 |
-
|
| 2012 |
-
#~ msgid ""
|
| 2013 |
-
#~ "You must save your permalinks once you have modified your vendor page. <a "
|
| 2014 |
-
#~ "href=\"%s\">click here to save</a>. | <a href=\"%s\">Hide Notice</a>"
|
| 2015 |
-
#~ msgstr ""
|
| 2016 |
-
#~ "زمانی که پیوند یکتا را تغییر میدهید باید صفحه فروشندگان را در تنظیمات "
|
| 2017 |
-
#~ "تغییر دهید. <a href=\"%s\">برای تنظیمات کلیک کنید</a>. | <a href=\"%s"
|
| 2018 |
-
#~ "\">مخفی کردن این اطلاعیه</a>"
|
| 2019 |
-
|
| 2020 |
-
#~ msgid " has marked as shipped. "
|
| 2021 |
-
#~ msgstr "به عنوان محصول پستی مشخص است."
|
| 2022 |
-
|
| 2023 |
-
#~ msgid "Comments to Customer"
|
| 2024 |
-
#~ msgstr "نظر به مشتری"
|
| 2025 |
-
|
| 2026 |
-
#~ msgid "No comments currently to customer."
|
| 2027 |
-
#~ msgstr "در حال حاضر هیچ نظری به مشتری وجود ندارد"
|
| 2028 |
-
|
| 2029 |
-
#~ msgid "Sold by : "
|
| 2030 |
-
#~ msgstr "فروشنده:"
|
| 2031 |
-
|
| 2032 |
-
#~ msgid ""
|
| 2033 |
-
#~ "<b>WC Vendors is disabled</b>. WC Vendors requires a minimum of "
|
| 2034 |
-
#~ "WooCommerce v2.2.0."
|
| 2035 |
-
#~ msgstr ""
|
| 2036 |
-
#~ "<b> افزونه فروشندگان ووکامرس غیر فعال شده است</b>. این افزونه حداقل نیاز "
|
| 2037 |
-
#~ "به WooCommerce v2.2.0 دارد"
|
| 2038 |
-
|
| 2039 |
-
#~ msgid "Sold by: "
|
| 2040 |
-
#~ msgstr "فروشنده:"
|
| 2041 |
-
|
| 2042 |
-
#~ msgid ""
|
| 2043 |
-
#~ "The default rate you pay each vendor for a product sale. If a product has "
|
| 2044 |
-
#~ "a commission rate already set, this value will be ignored for that "
|
| 2045 |
-
#~ "product."
|
| 2046 |
-
#~ msgstr "این میزان کمیسون دریافتی هر فروشنده از محصولاتش می باشد."
|
| 2047 |
-
|
| 2048 |
-
#~ msgid ""
|
| 2049 |
-
#~ "The shipping collected on a vendor's product will be given in its entirety"
|
| 2050 |
-
#~ msgstr "هزینه حمل نقل هر محصول بر روی جمع هزینه ها اضافه خواهد شد"
|
| 2051 |
-
|
| 2052 |
-
#~ msgid ""
|
| 2053 |
-
#~ "Enable HTML for a vendor's shop description by default. You can enable "
|
| 2054 |
-
#~ "or disable this per vendor by editing the vendors username."
|
| 2055 |
-
#~ msgstr ""
|
| 2056 |
-
#~ "فعال کردن HTML برای توضیحات محصول فروشنده در فروشگاه به صورت پیش فرض. "
|
| 2057 |
-
#~ "شما می توانید فعال یا غیر فعال کنید آن را در فروشگاه با ویرایش نام کاربری "
|
| 2058 |
-
#~ "فروشندگان."
|
| 2059 |
-
|
| 2060 |
-
#~ msgid "Vendor shop page"
|
| 2061 |
-
#~ msgstr "صفحه فروشنده فروشگاه"
|
| 2062 |
-
|
| 2063 |
-
#~ msgid "Eg: <code>yoursite.com/[your_setting_here]/[vendor_name_here]</code>"
|
| 2064 |
-
#~ msgstr ""
|
| 2065 |
-
#~ "به عنوان مثال: <code>yoursite.com/[your_setting_here]/[vendor_name_here]</"
|
| 2066 |
-
#~ "code>"
|
| 2067 |
-
|
| 2068 |
-
#~ msgid ""
|
| 2069 |
-
#~ "CHECKING these boxes will HIDE these areas of the add product page for "
|
| 2070 |
-
#~ "vendors"
|
| 2071 |
-
#~ msgstr ""
|
| 2072 |
-
#~ "بررسی این جعبه برای مخفی کردن قسمت های که میخواهید فروشندگان در صفحه "
|
| 2073 |
-
#~ "اضافه کردن محصول نبینند"
|
| 2074 |
-
|
| 2075 |
-
#~ msgid "CHECKING these boxes will HIDE these product options from the vendor"
|
| 2076 |
-
#~ msgstr "بررسی این جعبه جهت مخفی کردن گزینه های محصول برای فروشنده"
|
| 2077 |
-
|
| 2078 |
-
#~ msgid ""
|
| 2079 |
-
#~ "Sales table on the frontend on the My Account page. The table will only "
|
| 2080 |
-
#~ "display sales data that pertain to their products"
|
| 2081 |
-
#~ msgstr ""
|
| 2082 |
-
#~ "جدول فروش در بخش کاربری در صفحه حساب من. در این قسمت فقط جدول فروش مربوط "
|
| 2083 |
-
#~ "به محصولات هر فروشنده نمایش داده خواهد شد"
|
| 2084 |
-
|
| 2085 |
-
#~ msgid ""
|
| 2086 |
-
#~ "Vendors could submit a product through the backend, and an admin would "
|
| 2087 |
-
#~ "approve or deny it"
|
| 2088 |
-
#~ msgstr ""
|
| 2089 |
-
#~ "فروشندگان می تواند یک محصول از طریق بخش مدیریت ارسال نمایند، و همچنین "
|
| 2090 |
-
#~ "مدیر توانایی تایید یا رد آن را دارد"
|
| 2091 |
-
|
| 2092 |
-
#~ msgid ""
|
| 2093 |
-
#~ "Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</"
|
| 2094 |
-
#~ "code><br/>By default, My Account > Vendor Dashboard should have the "
|
| 2095 |
-
#~ "shortcode."
|
| 2096 |
-
#~ msgstr ""
|
| 2097 |
-
#~ "صفحه ای که کد کوتاه در آن قرار دارد را انتخاب کنید "
|
| 2098 |
-
#~ "<code>[wcv_vendor_dashboard]</code><br/>By default, My Account > بخش "
|
| 2099 |
-
#~ "کاربری فروشنده باید دارای این کد کوتاه باشد.."
|
| 2100 |
-
|
| 2101 |
-
#~ msgid ""
|
| 2102 |
-
#~ "Choose the page that has the shortcode <code>[wcv_shop_settings]</"
|
| 2103 |
-
#~ "code><br/>These are the shop settings a vendor can configure."
|
| 2104 |
-
#~ msgstr ""
|
| 2105 |
-
#~ "صفحه ای که کد کوتاه در آن قرار دارد را انتخاب کنید "
|
| 2106 |
-
#~ "<code>[wcv_shop_settings]</code><br/>تنظیمات فروشگاه فروشنده قابل "
|
| 2107 |
-
#~ "پیکربندی است."
|
| 2108 |
-
|
| 2109 |
-
#~ msgid ""
|
| 2110 |
-
#~ "Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 2111 |
-
#~ "default, My Account > Orders should have the shortcode."
|
| 2112 |
-
#~ msgstr ""
|
| 2113 |
-
#~ "صفحه ای که کد کوتاه در آن قرار دارد را انتخاب کنید <code>[wcv_orders]</"
|
| 2114 |
-
#~ "code><br/>به طور پیش فرض، حساب من> سفارشات باید دارای کد کوتاه بالا باشد."
|
| 2115 |
-
|
| 2116 |
-
#~ msgid ""
|
| 2117 |
-
#~ "These terms are shown to a user when submitting an application to become "
|
| 2118 |
-
#~ "a vendor.<br/>If left blank, no terms will be shown to the applicant."
|
| 2119 |
-
#~ msgstr ""
|
| 2120 |
-
#~ "این شرایط هنگام ارسال درخواست برای تبدیل شدن به یک فروشنده به یک کاربر "
|
| 2121 |
-
#~ "نشان داده خواهد شد <br/> اگر خالی بگذاریذ، هیچ چیزی به درخواست کننده نشان "
|
| 2122 |
-
#~ "داده نخواهد شد."
|
| 2123 |
-
|
| 2124 |
-
#~ msgid "User payments"
|
| 2125 |
-
#~ msgstr "پرداختی های کاربران"
|
| 2126 |
-
|
| 2127 |
-
#~ msgid ""
|
| 2128 |
-
#~ "Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 2129 |
-
#~ "\">here</a>."
|
| 2130 |
-
#~ msgstr ""
|
| 2131 |
-
#~ "از تنظیمات حساب خود در PayPal اطمینان حاصل کنید و آن را به روز رسانی "
|
| 2132 |
-
#~ "نمایید <a href=\"%s\">اینجا</a>."
|
| 2133 |
-
|
| 2134 |
-
#~ msgid "Instantly pay vendors their commission when an order is made"
|
| 2135 |
-
#~ msgstr ""
|
| 2136 |
-
#~ "در همان لحظه کمیسون های فروشندگان را پرداخت کنید زمانی که این حساب را "
|
| 2137 |
-
#~ "ایجاد کرده اند."
|
| 2138 |
-
|
| 2139 |
-
#~ msgid "Sold by"
|
| 2140 |
-
#~ msgstr "فروشنده"
|
| 2141 |
-
|
| 2142 |
-
#~ msgid "Unmark shipped"
|
| 2143 |
-
#~ msgstr "انتخاب به عنوان محصول ارسال نشده"
|
| 2144 |
-
|
| 2145 |
-
#~ msgid "View backend sales reports"
|
| 2146 |
-
#~ msgstr "مشاهده گزارش فروش در بخش مدیریت"
|
| 2147 |
-
|
| 2148 |
-
#~ msgid ""
|
| 2149 |
-
#~ "Graphs and tables via the Reports page in backend. The reports will only "
|
| 2150 |
-
#~ "display sales data that pertain to their products"
|
| 2151 |
-
#~ msgstr ""
|
| 2152 |
-
#~ "نمودار و جداول از طریق صفحه گزارش فروش در بخش مدیریت در دسترس است. "
|
| 2153 |
-
#~ "فروشندگان تنها می توانند گزارسات محصولات مربوط به خود را تماشا کنند."
|
| 2154 |
-
|
| 2155 |
-
#~ msgid "Extra data"
|
| 2156 |
-
#~ msgstr "اطلاعات اضافی"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/wcvendors-fr_FR.mo
DELETED
|
Binary file
|
languages/wcvendors-fr_FR.po
DELETED
|
@@ -1,2208 +0,0 @@
|
|
| 1 |
-
# Woocommerce translation strings
|
| 2 |
-
# Copyright (C) 2011-2012
|
| 3 |
-
# This file is distributed under the same license as the Woocommerce package.
|
| 4 |
-
# Last Updated: August 17, 2013.
|
| 5 |
-
msgid ""
|
| 6 |
-
msgstr ""
|
| 7 |
-
"Project-Id-Version: WC-Vendors\n"
|
| 8 |
-
"Report-Msgid-Bugs-To: Woocommerce <info@Woocommerce.com>\n"
|
| 9 |
-
"POT-Creation-Date: 2016-07-29 11:53+0200\n"
|
| 10 |
-
"PO-Revision-Date: 2017-01-17 10:05+1000\n"
|
| 11 |
-
"Last-Translator: Nicolas Bernier <nicolas.bernier@synagila.com>\n"
|
| 12 |
-
"Language-Team: TWF <info@themes-wordpress-francais.com>\n"
|
| 13 |
-
"Language: fr_FR\n"
|
| 14 |
-
"MIME-Version: 1.0\n"
|
| 15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 17 |
-
"X-Generator: Poedit 1.8.11\n"
|
| 18 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 19 |
-
"X-Poedit-KeywordsList: __;_e\n"
|
| 20 |
-
"X-Poedit-Basepath: .\n"
|
| 21 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 22 |
-
|
| 23 |
-
#: ../class-wc-vendors.php:50
|
| 24 |
-
msgid ""
|
| 25 |
-
"WC Vendors requires WooCommerce to run. Please install WooCommerce and "
|
| 26 |
-
"activate before attempting to activate again."
|
| 27 |
-
msgstr ""
|
| 28 |
-
"WC vendeurs Pro nécessite WooCommerce. Merci d'installer WooCommerce et "
|
| 29 |
-
"activez-le avant de tenter d'activer à nouveau WC vendeurs Pro."
|
| 30 |
-
|
| 31 |
-
#: ../class-wc-vendors.php:99 ../classes/admin/class-admin-reports.php:41
|
| 32 |
-
#: ../classes/admin/class-admin-users.php:408
|
| 33 |
-
msgid "WC Vendors"
|
| 34 |
-
msgstr "WC Vendors"
|
| 35 |
-
|
| 36 |
-
#: ../class-wc-vendors.php:128
|
| 37 |
-
msgid ""
|
| 38 |
-
"<b>WC Vendors is disabled</b>. WC Vendors requires a minimum of WooCommerce "
|
| 39 |
-
"v2.5.0."
|
| 40 |
-
msgstr ""
|
| 41 |
-
"<b>WC Vendors est désactivé</b>. WC Vendors nécessite au minimum WooCommerce "
|
| 42 |
-
"v2.5.0."
|
| 43 |
-
|
| 44 |
-
#: ../class-wc-vendors.php:289 ../classes/admin/settings/sf-options.php:192
|
| 45 |
-
msgid "Capabilities"
|
| 46 |
-
msgstr "Fonctionnalités"
|
| 47 |
-
|
| 48 |
-
#: ../class-wc-vendors.php:312 ../classes/admin/class-admin-page.php:254
|
| 49 |
-
#: ../classes/admin/class-admin-reports.php:175
|
| 50 |
-
#: ../classes/admin/class-admin-reports.php:458
|
| 51 |
-
#: ../classes/admin/class-product-meta.php:46
|
| 52 |
-
#: ../classes/admin/class-product-meta.php:187
|
| 53 |
-
#: ../classes/admin/class-product-meta.php:223 ../classes/class-install.php:91
|
| 54 |
-
msgid "Vendor"
|
| 55 |
-
msgstr "Vendeur"
|
| 56 |
-
|
| 57 |
-
#: ../class-wc-vendors.php:314 ../classes/admin/settings/sf-options.php:4
|
| 58 |
-
msgid "General"
|
| 59 |
-
msgstr "Général"
|
| 60 |
-
|
| 61 |
-
#: ../class-wc-vendors.php:352
|
| 62 |
-
msgid "Documentation/KB"
|
| 63 |
-
msgstr "Documentation/FAQ"
|
| 64 |
-
|
| 65 |
-
#: ../class-wc-vendors.php:353
|
| 66 |
-
msgid "Help Forums"
|
| 67 |
-
msgstr "Forums d’aide"
|
| 68 |
-
|
| 69 |
-
#: ../class-wc-vendors.php:354
|
| 70 |
-
msgid "Paid Support"
|
| 71 |
-
msgstr "Support payant"
|
| 72 |
-
|
| 73 |
-
#: ../class-wc-vendors.php:377
|
| 74 |
-
#, php-format
|
| 75 |
-
msgid ""
|
| 76 |
-
"WC Vendors requires the Vendor shop page value be set <a href=\"%s\">click "
|
| 77 |
-
"here to set it.</a> | <a href=\"%s\">Hide Notice</a>"
|
| 78 |
-
msgstr ""
|
| 79 |
-
"WC Vendors nécessite que la page boutique vendeur soit définie, <a href=\"%s"
|
| 80 |
-
"\">cliquez ici pour le faire</a>. | <a href=\"%s\">Masquer</a>"
|
| 81 |
-
|
| 82 |
-
#: ../class-wc-vendors.php:383
|
| 83 |
-
#, php-format
|
| 84 |
-
msgid ""
|
| 85 |
-
"You must save your permalinks once you have modified your vendor page. <a "
|
| 86 |
-
"href=\"%s\">click here to save</a>. | <a href=\"%s\">Hide Notice</a>"
|
| 87 |
-
msgstr ""
|
| 88 |
-
"Vous devez enregistrer vos permaliens une fois que vous avez modifié votre "
|
| 89 |
-
"page vendeur. <a href=\"%s\">Cliquez ici pour enregistrer</a> . | <a href="
|
| 90 |
-
"\"%s\">Masquer</a>"
|
| 91 |
-
|
| 92 |
-
#: ../classes/admin/class-admin-page.php:27
|
| 93 |
-
msgid "Vendors shipped"
|
| 94 |
-
msgstr "Envoyé par le vendeur"
|
| 95 |
-
|
| 96 |
-
#: ../classes/admin/class-admin-page.php:50
|
| 97 |
-
msgid "Vendors Shipped"
|
| 98 |
-
msgstr "Envoyé par le vendeur"
|
| 99 |
-
|
| 100 |
-
#: ../classes/admin/class-admin-page.php:72
|
| 101 |
-
#: ../classes/admin/class-admin-page.php:132
|
| 102 |
-
#: ../classes/admin/class-product-meta.php:151
|
| 103 |
-
#: ../classes/admin/class-product-meta.php:167
|
| 104 |
-
#: ../templates/dashboard/reports.php:19
|
| 105 |
-
msgid "Commission"
|
| 106 |
-
msgstr "Commission"
|
| 107 |
-
|
| 108 |
-
#: ../classes/admin/class-admin-page.php:252
|
| 109 |
-
#: ../classes/admin/class-admin-reports.php:174
|
| 110 |
-
#: ../templates/dashboard/reports.php:17
|
| 111 |
-
#: ../templates/emails/notify-vendor-shipped.php:22
|
| 112 |
-
#: ../templates/emails/vendor-new-order.php:22
|
| 113 |
-
msgid "Product"
|
| 114 |
-
msgstr "Produit"
|
| 115 |
-
|
| 116 |
-
#: ../classes/admin/class-admin-page.php:253
|
| 117 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:283
|
| 118 |
-
msgid "Order ID"
|
| 119 |
-
msgstr "Numero de commande"
|
| 120 |
-
|
| 121 |
-
#: ../classes/admin/class-admin-page.php:255
|
| 122 |
-
#: ../classes/admin/class-admin-reports.php:176
|
| 123 |
-
#: ../classes/admin/class-admin-reports.php:374
|
| 124 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:286
|
| 125 |
-
#: ../templates/dashboard/orders.php:35
|
| 126 |
-
msgid "Total"
|
| 127 |
-
msgstr "Total"
|
| 128 |
-
|
| 129 |
-
#: ../classes/admin/class-admin-page.php:256
|
| 130 |
-
#: ../classes/admin/class-admin-reports.php:178
|
| 131 |
-
#: ../classes/admin/class-admin-reports.php:461
|
| 132 |
-
msgid "Status"
|
| 133 |
-
msgstr "Statut"
|
| 134 |
-
|
| 135 |
-
#: ../classes/admin/class-admin-page.php:257
|
| 136 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:288
|
| 137 |
-
#: ../classes/front/orders/class-orders.php:195
|
| 138 |
-
#: ../templates/dashboard/orders.php:36
|
| 139 |
-
msgid "Date"
|
| 140 |
-
msgstr "Date"
|
| 141 |
-
|
| 142 |
-
#: ../classes/admin/class-admin-page.php:294
|
| 143 |
-
msgid "Mark paid"
|
| 144 |
-
msgstr "Indiquer Payer"
|
| 145 |
-
|
| 146 |
-
#: ../classes/admin/class-admin-page.php:295
|
| 147 |
-
msgid "Mark due"
|
| 148 |
-
msgstr "Indiquer A Payer"
|
| 149 |
-
|
| 150 |
-
#: ../classes/admin/class-admin-page.php:296
|
| 151 |
-
msgid "Mark reversed"
|
| 152 |
-
msgstr "Indiquer reverser"
|
| 153 |
-
|
| 154 |
-
#: ../classes/admin/class-admin-page.php:313
|
| 155 |
-
#: ../classes/admin/class-admin-page.php:317
|
| 156 |
-
msgid "Filter"
|
| 157 |
-
msgstr "Filtres"
|
| 158 |
-
|
| 159 |
-
#: ../classes/admin/class-admin-page.php:352
|
| 160 |
-
msgid "Show all dates"
|
| 161 |
-
msgstr "Montrer Toutes Les Dates"
|
| 162 |
-
|
| 163 |
-
#: ../classes/admin/class-admin-page.php:365
|
| 164 |
-
#, php-format
|
| 165 |
-
msgid "%1$s %2$d"
|
| 166 |
-
msgstr "%1$s %2$d"
|
| 167 |
-
|
| 168 |
-
#: ../classes/admin/class-admin-page.php:387
|
| 169 |
-
msgid "Show all Statuses"
|
| 170 |
-
msgstr "Montrer Toutes Les Dates"
|
| 171 |
-
|
| 172 |
-
#: ../classes/admin/class-admin-page.php:413
|
| 173 |
-
msgid "Commission marked paid."
|
| 174 |
-
msgstr "Commission payée"
|
| 175 |
-
|
| 176 |
-
#: ../classes/admin/class-admin-page.php:420
|
| 177 |
-
msgid "Commission marked due."
|
| 178 |
-
msgstr "Commission à payer"
|
| 179 |
-
|
| 180 |
-
#: ../classes/admin/class-admin-page.php:427
|
| 181 |
-
msgid "Commission marked reversed."
|
| 182 |
-
msgstr "Commission reversée"
|
| 183 |
-
|
| 184 |
-
#: ../classes/admin/class-admin-reports.php:44
|
| 185 |
-
msgid "Overview"
|
| 186 |
-
msgstr "Vue d'ensemble"
|
| 187 |
-
|
| 188 |
-
#: ../classes/admin/class-admin-reports.php:50
|
| 189 |
-
msgid "Commission by vendor"
|
| 190 |
-
msgstr "Commission par vendeur"
|
| 191 |
-
|
| 192 |
-
#: ../classes/admin/class-admin-reports.php:56
|
| 193 |
-
msgid "Commission by product"
|
| 194 |
-
msgstr "Commission par produit"
|
| 195 |
-
|
| 196 |
-
#: ../classes/admin/class-admin-reports.php:62
|
| 197 |
-
#: ../classes/admin/class-admin-reports.php:345
|
| 198 |
-
msgid "Commission Totals"
|
| 199 |
-
msgstr "Total commissions"
|
| 200 |
-
|
| 201 |
-
#: ../classes/admin/class-admin-reports.php:63
|
| 202 |
-
msgid ""
|
| 203 |
-
"Commission totals for all vendors includes shipping and taxes. By default no "
|
| 204 |
-
"date range is used and all due commissions are returned. Use the date range "
|
| 205 |
-
"to filter."
|
| 206 |
-
msgstr ""
|
| 207 |
-
"Les totaux de commission pour tous les vendeurs comprennent la livraison et "
|
| 208 |
-
"les taxes. Par défaut aucune plage de dates n’est utilisée et toute la "
|
| 209 |
-
"diligence des commissions sont retournées. Utiliser la plage de dates pour "
|
| 210 |
-
"filtrer."
|
| 211 |
-
|
| 212 |
-
#: ../classes/admin/class-admin-reports.php:121
|
| 213 |
-
#: ../classes/admin/class-admin-reports.php:437
|
| 214 |
-
#: ../templates/dashboard/date-picker.php:3
|
| 215 |
-
msgid "From:"
|
| 216 |
-
msgstr "De:"
|
| 217 |
-
|
| 218 |
-
#: ../classes/admin/class-admin-reports.php:123
|
| 219 |
-
#: ../classes/admin/class-admin-reports.php:439
|
| 220 |
-
#: ../templates/dashboard/date-picker.php:7
|
| 221 |
-
msgid "To:"
|
| 222 |
-
msgstr "A:"
|
| 223 |
-
|
| 224 |
-
#: ../classes/admin/class-admin-reports.php:125
|
| 225 |
-
#: ../classes/admin/class-admin-reports.php:283
|
| 226 |
-
#: ../classes/admin/class-admin-reports.php:448
|
| 227 |
-
#: ../templates/dashboard/date-picker.php:12
|
| 228 |
-
msgid "Show"
|
| 229 |
-
msgstr "Voir"
|
| 230 |
-
|
| 231 |
-
#: ../classes/admin/class-admin-reports.php:131
|
| 232 |
-
msgid "Total paid in range"
|
| 233 |
-
msgstr "Total des sommes versées"
|
| 234 |
-
|
| 235 |
-
#: ../classes/admin/class-admin-reports.php:134
|
| 236 |
-
#: ../classes/admin/class-admin-reports.php:141
|
| 237 |
-
#: ../classes/admin/class-admin-reports.php:148
|
| 238 |
-
msgid "n/a"
|
| 239 |
-
msgstr "s/o"
|
| 240 |
-
|
| 241 |
-
#: ../classes/admin/class-admin-reports.php:138
|
| 242 |
-
msgid "Total due in range"
|
| 243 |
-
msgstr "Total des sommes dues"
|
| 244 |
-
|
| 245 |
-
#: ../classes/admin/class-admin-reports.php:145
|
| 246 |
-
msgid "Total reversed in range"
|
| 247 |
-
msgstr "Total des sommes reversées"
|
| 248 |
-
|
| 249 |
-
#: ../classes/admin/class-admin-reports.php:155
|
| 250 |
-
msgid "Recent Commission"
|
| 251 |
-
msgstr "Commission Recentes"
|
| 252 |
-
|
| 253 |
-
#: ../classes/admin/class-admin-reports.php:173
|
| 254 |
-
#: ../classes/front/orders/class-orders.php:187
|
| 255 |
-
#: ../templates/dashboard/orders.php:33
|
| 256 |
-
msgid "Order"
|
| 257 |
-
msgstr "Commande"
|
| 258 |
-
|
| 259 |
-
#: ../classes/admin/class-admin-reports.php:177
|
| 260 |
-
msgid "Date & Time"
|
| 261 |
-
msgstr "Date & Heure"
|
| 262 |
-
|
| 263 |
-
#: ../classes/admin/class-admin-reports.php:186
|
| 264 |
-
msgid "N/A"
|
| 265 |
-
msgstr "N/A"
|
| 266 |
-
|
| 267 |
-
#: ../classes/admin/class-admin-reports.php:191
|
| 268 |
-
msgid "D j M Y \\a\\t h:ia"
|
| 269 |
-
msgstr "D j M Y \\à h:ia"
|
| 270 |
-
|
| 271 |
-
#: ../classes/admin/class-admin-reports.php:200
|
| 272 |
-
msgid "No commission yet"
|
| 273 |
-
msgstr "Pas encore de commission"
|
| 274 |
-
|
| 275 |
-
#: ../classes/admin/class-admin-reports.php:234
|
| 276 |
-
msgid "Show:"
|
| 277 |
-
msgstr "Montrer:"
|
| 278 |
-
|
| 279 |
-
#: ../classes/admin/class-admin-reports.php:243
|
| 280 |
-
msgid "Search for a product…"
|
| 281 |
-
msgstr "Recherche d'un produit…"
|
| 282 |
-
|
| 283 |
-
#: ../classes/admin/class-admin-reports.php:246
|
| 284 |
-
msgid "Type in a product name to start searching..."
|
| 285 |
-
msgstr "Ecrivez le nom du produit pour lancer la recherche ..."
|
| 286 |
-
|
| 287 |
-
#: ../classes/admin/class-admin-reports.php:278
|
| 288 |
-
msgid "Select a vendor…"
|
| 289 |
-
msgstr "Choisir un Vendeur…"
|
| 290 |
-
|
| 291 |
-
#: ../classes/admin/class-admin-reports.php:344
|
| 292 |
-
msgid "Month"
|
| 293 |
-
msgstr "Mois"
|
| 294 |
-
|
| 295 |
-
#: ../classes/admin/class-admin-reports.php:346
|
| 296 |
-
msgid "Tax"
|
| 297 |
-
msgstr "Taxes"
|
| 298 |
-
|
| 299 |
-
#: ../classes/admin/class-admin-reports.php:347
|
| 300 |
-
#: ../classes/admin/settings/sf-options.php:52
|
| 301 |
-
#: ../classes/admin/settings/sf-options.php:136
|
| 302 |
-
#: ../templates/dashboard/orders.php:34 ../templates/orders/orders.php:115
|
| 303 |
-
msgid "Shipping"
|
| 304 |
-
msgstr "Livraison"
|
| 305 |
-
|
| 306 |
-
#: ../classes/admin/class-admin-reports.php:348
|
| 307 |
-
#: ../classes/admin/class-admin-reports.php:445
|
| 308 |
-
msgid "Reversed"
|
| 309 |
-
msgstr "Reverser"
|
| 310 |
-
|
| 311 |
-
#: ../classes/admin/class-admin-reports.php:349
|
| 312 |
-
#: ../classes/admin/class-admin-reports.php:444
|
| 313 |
-
msgid "Paid"
|
| 314 |
-
msgstr "Payer"
|
| 315 |
-
|
| 316 |
-
#: ../classes/admin/class-admin-reports.php:350
|
| 317 |
-
#: ../classes/admin/class-admin-reports.php:443
|
| 318 |
-
msgid "Due"
|
| 319 |
-
msgstr "Due"
|
| 320 |
-
|
| 321 |
-
#: ../classes/admin/class-admin-reports.php:459
|
| 322 |
-
msgid "Tax Total"
|
| 323 |
-
msgstr "Total taxes"
|
| 324 |
-
|
| 325 |
-
#: ../classes/admin/class-admin-reports.php:460
|
| 326 |
-
msgid "Shipping Total"
|
| 327 |
-
msgstr "Total livraison"
|
| 328 |
-
|
| 329 |
-
#: ../classes/admin/class-admin-reports.php:462
|
| 330 |
-
msgid "Commission Total"
|
| 331 |
-
msgstr "Total commission"
|
| 332 |
-
|
| 333 |
-
#: ../classes/admin/class-admin-reports.php:484
|
| 334 |
-
msgid "No commissions found."
|
| 335 |
-
msgstr "Aucune commission trouvée."
|
| 336 |
-
|
| 337 |
-
#: ../classes/admin/class-admin-users.php:418
|
| 338 |
-
msgid "Enable HTML for the shop description"
|
| 339 |
-
msgstr "Activer le HTML pour la description de la boutique."
|
| 340 |
-
|
| 341 |
-
#: ../classes/admin/class-admin-users.php:424
|
| 342 |
-
msgid "Shop name"
|
| 343 |
-
msgstr "Nom de la boutique"
|
| 344 |
-
|
| 345 |
-
#: ../classes/admin/class-admin-users.php:431
|
| 346 |
-
msgid "PayPal E-mail"
|
| 347 |
-
msgstr "E-Mail Paypal"
|
| 348 |
-
|
| 349 |
-
#: ../classes/admin/class-admin-users.php:432
|
| 350 |
-
msgid "required"
|
| 351 |
-
msgstr "required"
|
| 352 |
-
|
| 353 |
-
#: ../classes/admin/class-admin-users.php:439
|
| 354 |
-
msgid "Commission rate"
|
| 355 |
-
msgstr "Taux de la commission"
|
| 356 |
-
|
| 357 |
-
#: ../classes/admin/class-admin-users.php:440
|
| 358 |
-
#: ../classes/admin/class-product-meta.php:174
|
| 359 |
-
msgid "Leave blank for default"
|
| 360 |
-
msgstr "Laisser blanc par défaut"
|
| 361 |
-
|
| 362 |
-
#: ../classes/admin/class-admin-users.php:446
|
| 363 |
-
msgid "Give Tax"
|
| 364 |
-
msgstr "Offrir taxes"
|
| 365 |
-
|
| 366 |
-
#: ../classes/admin/class-admin-users.php:451
|
| 367 |
-
msgid "Tax override for vendor"
|
| 368 |
-
msgstr "Redéfinir taxe pour vendeur"
|
| 369 |
-
|
| 370 |
-
#: ../classes/admin/class-admin-users.php:457
|
| 371 |
-
msgid "Give Shipping"
|
| 372 |
-
msgstr "Offrir livraison"
|
| 373 |
-
|
| 374 |
-
#: ../classes/admin/class-admin-users.php:462
|
| 375 |
-
msgid "Shipping override for vendor"
|
| 376 |
-
msgstr "Redéfinir livraison pour vendeur"
|
| 377 |
-
|
| 378 |
-
#: ../classes/admin/class-admin-users.php:468
|
| 379 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:30
|
| 380 |
-
#: ../templates/dashboard/settings/seller-info.php:3
|
| 381 |
-
msgid "Seller info"
|
| 382 |
-
msgstr "Information du vendeur"
|
| 383 |
-
|
| 384 |
-
#: ../classes/admin/class-admin-users.php:473
|
| 385 |
-
msgid "Shop description"
|
| 386 |
-
msgstr "Description de la boutique"
|
| 387 |
-
|
| 388 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:20
|
| 389 |
-
#: ../classes/class-install.php:192
|
| 390 |
-
msgid "Shop Settings"
|
| 391 |
-
msgstr "Paramètres de votre boutique"
|
| 392 |
-
|
| 393 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:21
|
| 394 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:146
|
| 395 |
-
#: ../classes/admin/settings/sf-options.php:196
|
| 396 |
-
#: ../classes/class-install.php:191 ../templates/dashboard/orders.php:24
|
| 397 |
-
msgid "Orders"
|
| 398 |
-
msgstr "Commandes"
|
| 399 |
-
|
| 400 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:58
|
| 401 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:112
|
| 402 |
-
msgid "Your PayPal address is not a valid email address."
|
| 403 |
-
msgstr "Votre E-mail PayPal n'est pas valide."
|
| 404 |
-
|
| 405 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:67
|
| 406 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:121
|
| 407 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 408 |
-
msgstr ""
|
| 409 |
-
"Ce nom de la boutique est déjà pris. Votre nom de la boutique doit être "
|
| 410 |
-
"unique."
|
| 411 |
-
|
| 412 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:87
|
| 413 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:368
|
| 414 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:139
|
| 415 |
-
msgid "Settings saved."
|
| 416 |
-
msgstr "Paramètres sauvegardés"
|
| 417 |
-
|
| 418 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:284
|
| 419 |
-
msgid "Customer"
|
| 420 |
-
msgstr "Client"
|
| 421 |
-
|
| 422 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:285
|
| 423 |
-
#: ../classes/admin/settings/sf-options.php:127
|
| 424 |
-
#: ../classes/admin/settings/sf-options.php:254
|
| 425 |
-
msgid "Products"
|
| 426 |
-
msgstr "Produits"
|
| 427 |
-
|
| 428 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:289
|
| 429 |
-
#: ../templates/dashboard/orders.php:92
|
| 430 |
-
msgid "Shipped"
|
| 431 |
-
msgstr "Expédié"
|
| 432 |
-
|
| 433 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:324
|
| 434 |
-
#: ../templates/dashboard/orders.php:85
|
| 435 |
-
msgid "Mark shipped"
|
| 436 |
-
msgstr "Marquer comme envoyé"
|
| 437 |
-
|
| 438 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:349
|
| 439 |
-
msgid "Orders marked shipped."
|
| 440 |
-
msgstr "Commandes marquées comme livrées."
|
| 441 |
-
|
| 442 |
-
#: ../classes/admin/class-vendor-admin-dashboard.php:385
|
| 443 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:40
|
| 444 |
-
msgid "You are not allowed to modify this order."
|
| 445 |
-
msgstr "Vous n’avez pas la permission de modifier cette commande."
|
| 446 |
-
|
| 447 |
-
#: ../classes/admin/class-vendor-applicants.php:26
|
| 448 |
-
msgid "Approve"
|
| 449 |
-
msgstr "Accepter"
|
| 450 |
-
|
| 451 |
-
#: ../classes/admin/class-vendor-applicants.php:27
|
| 452 |
-
msgid "Deny"
|
| 453 |
-
msgstr "Refuser"
|
| 454 |
-
|
| 455 |
-
#: ../classes/admin/class-vendor-applicants.php:73
|
| 456 |
-
msgid "Vendor has been <b>denied</b>."
|
| 457 |
-
msgstr "Le vendeur a été <b>refusé</b>."
|
| 458 |
-
|
| 459 |
-
#: ../classes/admin/class-vendor-applicants.php:84
|
| 460 |
-
msgid "Vendor has been <b>approved</b>."
|
| 461 |
-
msgstr "Le vendeur a été <b>accepté</b>."
|
| 462 |
-
|
| 463 |
-
#: ../classes/admin/class-vendor-applicants.php:98
|
| 464 |
-
msgid "Pending Vendors"
|
| 465 |
-
msgstr "Vendeur en attente"
|
| 466 |
-
|
| 467 |
-
#: ../classes/admin/emails/class-emails.php:59
|
| 468 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:70
|
| 469 |
-
msgid "pending"
|
| 470 |
-
msgstr "en attente"
|
| 471 |
-
|
| 472 |
-
#: ../classes/admin/emails/class-emails.php:61
|
| 473 |
-
msgid "approved"
|
| 474 |
-
msgstr "approuvé"
|
| 475 |
-
|
| 476 |
-
#: ../classes/admin/emails/class-emails.php:63
|
| 477 |
-
msgid "denied"
|
| 478 |
-
msgstr "refusé"
|
| 479 |
-
|
| 480 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:28
|
| 481 |
-
msgid "Vendor Application"
|
| 482 |
-
msgstr "Demande de vendeur"
|
| 483 |
-
|
| 484 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:29
|
| 485 |
-
msgid "Vendor application will either be approved, denied, or pending."
|
| 486 |
-
msgstr "La demande du vendeur sera soit approuvée, refusée, ou en attente."
|
| 487 |
-
|
| 488 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:31
|
| 489 |
-
msgid "Application {status}"
|
| 490 |
-
msgstr "Demande {status}"
|
| 491 |
-
|
| 492 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:32
|
| 493 |
-
msgid "[{blogname}] Your vendor application has been {status}"
|
| 494 |
-
msgstr "[{blogname}] Votre demande pour etre vendeur a été {status}"
|
| 495 |
-
|
| 496 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:123
|
| 497 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:134
|
| 498 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:163
|
| 499 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:256
|
| 500 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
|
| 501 |
-
msgid "Enable/Disable"
|
| 502 |
-
msgstr "Activer / Désactiver"
|
| 503 |
-
|
| 504 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:125
|
| 505 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:136
|
| 506 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:165
|
| 507 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:258
|
| 508 |
-
msgid "Enable this email notification"
|
| 509 |
-
msgstr "Activer cette notification "
|
| 510 |
-
|
| 511 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:129
|
| 512 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:140
|
| 513 |
-
msgid "Recipient(s)"
|
| 514 |
-
msgstr "Destinataire(s)"
|
| 515 |
-
|
| 516 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:131
|
| 517 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:142
|
| 518 |
-
#, php-format
|
| 519 |
-
msgid ""
|
| 520 |
-
"Enter recipients (comma separated) for this email. Defaults to <code>%s</"
|
| 521 |
-
"code>."
|
| 522 |
-
msgstr ""
|
| 523 |
-
"Entrez les destinataires (séparés par une virgule) pour cet email. Par "
|
| 524 |
-
"défaut <code>%s</code>."
|
| 525 |
-
|
| 526 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:136
|
| 527 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:147
|
| 528 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:169
|
| 529 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:262
|
| 530 |
-
msgid "Subject"
|
| 531 |
-
msgstr "Sujet"
|
| 532 |
-
|
| 533 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:138
|
| 534 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:149
|
| 535 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:171
|
| 536 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:264
|
| 537 |
-
#, php-format
|
| 538 |
-
msgid ""
|
| 539 |
-
"This controls the email subject line. Leave blank to use the default "
|
| 540 |
-
"subject: <code>%s</code>."
|
| 541 |
-
msgstr ""
|
| 542 |
-
"Control du sujet. Laissez vide pour utiliser l'objet par défaut: <code>%s</"
|
| 543 |
-
"code>."
|
| 544 |
-
|
| 545 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:143
|
| 546 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:154
|
| 547 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:176
|
| 548 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:269
|
| 549 |
-
msgid "Email Heading"
|
| 550 |
-
msgstr "Entête de l'email"
|
| 551 |
-
|
| 552 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:145
|
| 553 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:156
|
| 554 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:178
|
| 555 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:271
|
| 556 |
-
#, php-format
|
| 557 |
-
msgid ""
|
| 558 |
-
"This controls the main heading contained within the email notification. "
|
| 559 |
-
"Leave blank to use the default heading: <code>%s</code>."
|
| 560 |
-
msgstr ""
|
| 561 |
-
"Control du entête. Laissez vide pour utiliser l'entête par défaut: <code>"
|
| 562 |
-
"%s</code>."
|
| 563 |
-
|
| 564 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:150
|
| 565 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:161
|
| 566 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:183
|
| 567 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:282
|
| 568 |
-
msgid "Email type"
|
| 569 |
-
msgstr "Email type"
|
| 570 |
-
|
| 571 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:152
|
| 572 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:163
|
| 573 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:185
|
| 574 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:284
|
| 575 |
-
msgid "Choose which format of email to send."
|
| 576 |
-
msgstr "Choisir le format d'email"
|
| 577 |
-
|
| 578 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:156
|
| 579 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:167
|
| 580 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:189
|
| 581 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:288
|
| 582 |
-
msgid "Plain text"
|
| 583 |
-
msgstr "Texte"
|
| 584 |
-
|
| 585 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:157
|
| 586 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:168
|
| 587 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:190
|
| 588 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:289
|
| 589 |
-
msgid "HTML"
|
| 590 |
-
msgstr "HTML"
|
| 591 |
-
|
| 592 |
-
#: ../classes/admin/emails/class-wc-approve-vendor.php:158
|
| 593 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:169
|
| 594 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:191
|
| 595 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:290
|
| 596 |
-
msgid "Multipart"
|
| 597 |
-
msgstr "Multipart"
|
| 598 |
-
|
| 599 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:28
|
| 600 |
-
msgid "New Vendor Product"
|
| 601 |
-
msgstr "Nouveau Produit"
|
| 602 |
-
|
| 603 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:29
|
| 604 |
-
msgid "New order emails are sent when a new product is submitted by a vendor"
|
| 605 |
-
msgstr ""
|
| 606 |
-
"E-mails de nouvelles commandes envoyées quand un nouveau produit est "
|
| 607 |
-
"présentée par un vendeur"
|
| 608 |
-
|
| 609 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:31
|
| 610 |
-
msgid "New product submitted: {product_name}"
|
| 611 |
-
msgstr "Nouveau produit soumis: {product_name}"
|
| 612 |
-
|
| 613 |
-
#: ../classes/admin/emails/class-wc-notify-admin.php:32
|
| 614 |
-
msgid "[{blogname}] New product submitted by {vendor_name} - {product_name}"
|
| 615 |
-
msgstr "[{blogname}] Nouveau produit soumis par {vendor_name} - {product_name}"
|
| 616 |
-
|
| 617 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:28
|
| 618 |
-
msgid "Vendor has shipped"
|
| 619 |
-
msgstr "Le vendeur à expédié"
|
| 620 |
-
|
| 621 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:29
|
| 622 |
-
msgid ""
|
| 623 |
-
"An email is sent when a vendor has marked one of their orders as shipped."
|
| 624 |
-
msgstr ""
|
| 625 |
-
"Un email sera envoyé quand un vendeur aura marqué une de commande comme "
|
| 626 |
-
"envoyée."
|
| 627 |
-
|
| 628 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:31
|
| 629 |
-
msgid "Your order has been shipped"
|
| 630 |
-
msgstr "Votre commande a été expédiée"
|
| 631 |
-
|
| 632 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:32
|
| 633 |
-
msgid ""
|
| 634 |
-
"[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 635 |
-
msgstr ""
|
| 636 |
-
"[{blogname}] Votre commande ({order_number} du {order_date}) a été expediée."
|
| 637 |
-
|
| 638 |
-
#: ../classes/admin/emails/class-wc-notify-shipped.php:112
|
| 639 |
-
msgid "Subtotal:"
|
| 640 |
-
msgstr "Sous-total:"
|
| 641 |
-
|
| 642 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:27
|
| 643 |
-
msgid "Notify vendors"
|
| 644 |
-
msgstr "Notifier les vendeurs"
|
| 645 |
-
|
| 646 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:28
|
| 647 |
-
msgid "New order emails are sent when an order is received/paid by a customer."
|
| 648 |
-
msgstr ""
|
| 649 |
-
"E-mails de nouvelles commandes envoyées quand un ordre est reçu / payé par "
|
| 650 |
-
"un client."
|
| 651 |
-
|
| 652 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:30
|
| 653 |
-
msgid "New customer order"
|
| 654 |
-
msgstr "Nouvelle Commande"
|
| 655 |
-
|
| 656 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:31
|
| 657 |
-
msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
|
| 658 |
-
msgstr "[{blogname}] Nouvelle Commande {order_number}) - {order_date}"
|
| 659 |
-
|
| 660 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:105
|
| 661 |
-
msgid "Commission Subtotal:"
|
| 662 |
-
msgstr "Sous-Total Commission :"
|
| 663 |
-
|
| 664 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:111
|
| 665 |
-
msgid "Tax Subtotal:"
|
| 666 |
-
msgstr "Total taxes :"
|
| 667 |
-
|
| 668 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:119
|
| 669 |
-
msgid "Shipping Subtotal:"
|
| 670 |
-
msgstr "Sous-total livraison:"
|
| 671 |
-
|
| 672 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:276
|
| 673 |
-
msgid "Product Totals"
|
| 674 |
-
msgstr "Total des produits"
|
| 675 |
-
|
| 676 |
-
#: ../classes/admin/emails/class-wc-notify-vendor.php:278
|
| 677 |
-
msgid ""
|
| 678 |
-
"Show the commission due/paid as the product totals instead of the product "
|
| 679 |
-
"prices."
|
| 680 |
-
msgstr ""
|
| 681 |
-
"Afficher la commission due/payée comme total produits à la place du prix des "
|
| 682 |
-
"produits."
|
| 683 |
-
|
| 684 |
-
#: ../classes/admin/settings/classes/sf-class-format-options.php:211
|
| 685 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:789
|
| 686 |
-
msgid "Select a page..."
|
| 687 |
-
msgstr "Choisir une page..."
|
| 688 |
-
|
| 689 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:153
|
| 690 |
-
#: ../templates/dashboard/settings/settings.php:1
|
| 691 |
-
msgid "Settings"
|
| 692 |
-
msgstr "Paramètres"
|
| 693 |
-
|
| 694 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:302
|
| 695 |
-
msgid "Could not load settings at: "
|
| 696 |
-
msgstr "Impossible de charger les paramètres à l'adresse:"
|
| 697 |
-
|
| 698 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:302
|
| 699 |
-
msgid "Error - WP Settings Framework"
|
| 700 |
-
msgstr "Erreur"
|
| 701 |
-
|
| 702 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:484
|
| 703 |
-
#, php-format
|
| 704 |
-
msgid "Save %s changes"
|
| 705 |
-
msgstr "Enregistrer les %s changements"
|
| 706 |
-
|
| 707 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:497
|
| 708 |
-
msgid ""
|
| 709 |
-
"Please help with a <a href=\"https://wordpress.org/support/view/plugin-"
|
| 710 |
-
"reviews/wc-vendors?rate=5#postform\" target=\"top\">High Five!</a> | <a href="
|
| 711 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 712 |
-
"Vendors Pro</a> | <a href=\"https://www.wcvendors.com/product/stripe-"
|
| 713 |
-
"commissions-gateway/\" target=\"top\">Stripe Commissions & Gateway</a> | <a "
|
| 714 |
-
"href=\"https://www.wcvendors.com/kb/\" target=\"top\">KnowledgeBase</a> | <a "
|
| 715 |
-
"href=\"https://www.wcvendors.com/help/\" target=\"top\">Help Forums</a>"
|
| 716 |
-
msgstr ""
|
| 717 |
-
"Aidez-nous avec <a href=\"https://wordpress.org/support/view/plugin-reviews/"
|
| 718 |
-
"wc-vendors?rate=5#postform\" target=\"top\">Cinq Étoiles</a> ! | <a href="
|
| 719 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 720 |
-
"Vendors Pro</a> | <a href=\"https://www.wcvendors.com/product/stripe-"
|
| 721 |
-
"commissions-gateway/\" target=\"top\">Stripe Commissions & Gateway</a> | <a "
|
| 722 |
-
"href=\"https://www.wcvendors.com/kb/\" target=\"top\">KnowledgeBase</a> | <a "
|
| 723 |
-
"href=\"https://www.wcvendors.com/help/\" target=\"top\">Forums d’aide</a>"
|
| 724 |
-
|
| 725 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:782
|
| 726 |
-
msgid "Edit Page"
|
| 727 |
-
msgstr "Modifier page"
|
| 728 |
-
|
| 729 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:783
|
| 730 |
-
msgid "View Page"
|
| 731 |
-
msgstr "Voir page"
|
| 732 |
-
|
| 733 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:846
|
| 734 |
-
#, php-format
|
| 735 |
-
msgid "Update %s"
|
| 736 |
-
msgstr "Mettre à jour %s"
|
| 737 |
-
|
| 738 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:846
|
| 739 |
-
#, php-format
|
| 740 |
-
msgid "Add %s"
|
| 741 |
-
msgstr "Ajouter %s"
|
| 742 |
-
|
| 743 |
-
#: ../classes/admin/settings/classes/sf-class-settings.php:846
|
| 744 |
-
#, php-format
|
| 745 |
-
msgid "Upload an image for the %s"
|
| 746 |
-
msgstr "Envoyer une image pour %s"
|
| 747 |
-
|
| 748 |
-
#: ../classes/admin/settings/sf-options.php:5
|
| 749 |
-
msgid "General options"
|
| 750 |
-
msgstr "Options Générales"
|
| 751 |
-
|
| 752 |
-
#: ../classes/admin/settings/sf-options.php:8
|
| 753 |
-
msgid "Default commission (%)"
|
| 754 |
-
msgstr "Commission par défaut(%)"
|
| 755 |
-
|
| 756 |
-
#: ../classes/admin/settings/sf-options.php:9
|
| 757 |
-
msgid ""
|
| 758 |
-
"The default rate you pay each vendor for a product sale. <br>You can also "
|
| 759 |
-
"give vendors their own individual commission rates by editing the vendors "
|
| 760 |
-
"user account.<br>Also, you can edit an individual products commission to "
|
| 761 |
-
"override both of these settings on a per product basis."
|
| 762 |
-
msgstr ""
|
| 763 |
-
"Le taux de défaut que vous payez chaque vendeur pour une vente de produits. "
|
| 764 |
-
"<br> Vous pouvez également donner aux vendeurs leurs propres taux de "
|
| 765 |
-
"commission individuels en modifiant le compte des vendeurs de l'utilisateur. "
|
| 766 |
-
"<br> En outre, vous pouvez modifier une commission des produits individuels "
|
| 767 |
-
"pour remplacer ces deux paramètres sur une base par produit."
|
| 768 |
-
|
| 769 |
-
#: ../classes/admin/settings/sf-options.php:20
|
| 770 |
-
#: ../classes/admin/settings/sf-options.php:27
|
| 771 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 772 |
-
msgstr ""
|
| 773 |
-
"Autoriser les utilisateurs ou les invités à s'inscrire pour devenir un "
|
| 774 |
-
"vendeur"
|
| 775 |
-
|
| 776 |
-
#: ../classes/admin/settings/sf-options.php:22
|
| 777 |
-
msgid ""
|
| 778 |
-
"Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:"
|
| 779 |
-
"</strong> You MUST \"<strong>Enable registration on the \"My Account\" "
|
| 780 |
-
"page</strong>\" in your <strong>WooCommerce > Settings > Accounts</strong> "
|
| 781 |
-
"page for this option to work. Currently, you have registration disabled."
|
| 782 |
-
msgstr ""
|
| 783 |
-
"Autoriser des invités ou clients de postuler pour devenir un vendeur."
|
| 784 |
-
"<br><br><strong>Avertissement :</strong> Vous devez «<strong>activer "
|
| 785 |
-
"l’enregistrement dans la page « mon compte »</strong>» dans votre page "
|
| 786 |
-
"<strong>WooCommerce > paramètres > comptes</strong> pour que cette option "
|
| 787 |
-
"fonctionne. Actuellement, vous avez l'enregistrement désactivé."
|
| 788 |
-
|
| 789 |
-
#: ../classes/admin/settings/sf-options.php:26
|
| 790 |
-
msgid "Registration"
|
| 791 |
-
msgstr "Inscription"
|
| 792 |
-
|
| 793 |
-
#: ../classes/admin/settings/sf-options.php:28
|
| 794 |
-
msgid ""
|
| 795 |
-
"This will show a checkbox on the My Account page's registration form asking "
|
| 796 |
-
"if the user would like to apply to be a vendor. Also, on the Vendor "
|
| 797 |
-
"Dashboard, users can still apply to become a vendor even if this is disabled."
|
| 798 |
-
msgstr ""
|
| 799 |
-
"Cela montrera une case à cocher sur le formulaire d'inscription de la page "
|
| 800 |
-
"Mon compte demandant si l'utilisateur souhaite demander à être un vendeur. "
|
| 801 |
-
"En outre, sur le tableau de bord du vendeur, les utilisateurs peuvent "
|
| 802 |
-
"toujours demander à devenir un vendeur, même si cette option est désactivée."
|
| 803 |
-
|
| 804 |
-
#: ../classes/admin/settings/sf-options.php:35
|
| 805 |
-
msgid "Approve vendor applications manually"
|
| 806 |
-
msgstr "Approuver les demandes des vendeurs manuellement"
|
| 807 |
-
|
| 808 |
-
#: ../classes/admin/settings/sf-options.php:36
|
| 809 |
-
msgid ""
|
| 810 |
-
"With this unchecked, all vendor applications are automatically accepted. "
|
| 811 |
-
"Otherwise, you must approve each manually."
|
| 812 |
-
msgstr ""
|
| 813 |
-
"Avec cette cochée, toutes les actions de vendeurs sont automatiquement "
|
| 814 |
-
"acceptés. Sinon, vous devez approuver chacune manuellement."
|
| 815 |
-
|
| 816 |
-
#: ../classes/admin/settings/sf-options.php:43
|
| 817 |
-
#: ../classes/admin/settings/sf-options.php:175
|
| 818 |
-
msgid "Taxes"
|
| 819 |
-
msgstr "Taxes"
|
| 820 |
-
|
| 821 |
-
#: ../classes/admin/settings/sf-options.php:44
|
| 822 |
-
msgid "Give vendors any tax collected per-product"
|
| 823 |
-
msgstr "Donnez au vendeur toutes taxes perçues par produit"
|
| 824 |
-
|
| 825 |
-
#: ../classes/admin/settings/sf-options.php:45
|
| 826 |
-
msgid "The tax collected on a vendor's product will be given in its entirety"
|
| 827 |
-
msgstr ""
|
| 828 |
-
"La taxe perçue sur le produit d'un vendeur sera donné dans son intégralité"
|
| 829 |
-
|
| 830 |
-
#: ../classes/admin/settings/sf-options.php:53
|
| 831 |
-
msgid "Give vendors any shipping collected per-product"
|
| 832 |
-
msgstr "Donnez aux vendeurs toute expédition recueillie par produit"
|
| 833 |
-
|
| 834 |
-
#: ../classes/admin/settings/sf-options.php:54
|
| 835 |
-
msgid ""
|
| 836 |
-
"WC Vendors Free - Give vendors shipping if using Per Product Shipping "
|
| 837 |
-
"gateway. WC Vendors Pro - Give vendors shipping when using Vendor "
|
| 838 |
-
"Shipping. No other shipping module is compatible with this option."
|
| 839 |
-
msgstr ""
|
| 840 |
-
"WC Vendors Free - Offrir aux vendeurs l’expédition en cas d'utilisation du "
|
| 841 |
-
"mode d’expédition par produit. WC Vendors Pro - Offrir aux vendeurs "
|
| 842 |
-
"l’expédition en cas d'utilisation du mode d’expédition par le vendeur. Aucun "
|
| 843 |
-
"autre module d'expédition est compatible avec cette option."
|
| 844 |
-
|
| 845 |
-
#: ../classes/admin/settings/sf-options.php:60
|
| 846 |
-
msgid "Shop options"
|
| 847 |
-
msgstr "Options de la boutique"
|
| 848 |
-
|
| 849 |
-
#: ../classes/admin/settings/sf-options.php:63
|
| 850 |
-
msgid "Shop HTML"
|
| 851 |
-
msgstr "Boutique HTML"
|
| 852 |
-
|
| 853 |
-
#: ../classes/admin/settings/sf-options.php:64
|
| 854 |
-
msgid ""
|
| 855 |
-
"Enable HTML for a vendor's shop description by default. You can enable or "
|
| 856 |
-
"disable this per vendor by editing the vendors user account."
|
| 857 |
-
msgstr ""
|
| 858 |
-
"Activer HTML par défaut pour la description du magasin du vendeur. Vous "
|
| 859 |
-
"pouvez activer ou désactiver ceci par vendeur en modifiant le compte vendeur "
|
| 860 |
-
"de l'utilisateur."
|
| 861 |
-
|
| 862 |
-
#: ../classes/admin/settings/sf-options.php:71
|
| 863 |
-
msgid "Vendor Shop Page"
|
| 864 |
-
msgstr "Page boutique vendeur"
|
| 865 |
-
|
| 866 |
-
#: ../classes/admin/settings/sf-options.php:72
|
| 867 |
-
msgid ""
|
| 868 |
-
"Enter one word for the URI. If you enter \"<strong>vendors</strong>\" your "
|
| 869 |
-
"vendors store will be <code>yourdomain.com/vendors/store-name/</code>"
|
| 870 |
-
msgstr ""
|
| 871 |
-
"Entrez un mot pour l'URI. Si vous entrez <strong>\"vendeurs\"</strong> votre "
|
| 872 |
-
"magasin vendeur sera <code>votredomaine.com/vendeurs/nom-magasin/</code>"
|
| 873 |
-
|
| 874 |
-
#: ../classes/admin/settings/sf-options.php:79
|
| 875 |
-
msgid "Shop Headers"
|
| 876 |
-
msgstr "Entêtes des boutiques"
|
| 877 |
-
|
| 878 |
-
#: ../classes/admin/settings/sf-options.php:80
|
| 879 |
-
msgid "Enable vendor shop headers"
|
| 880 |
-
msgstr "Activer les entêtes vendeurs"
|
| 881 |
-
|
| 882 |
-
#: ../classes/admin/settings/sf-options.php:81
|
| 883 |
-
msgid ""
|
| 884 |
-
"This will override the HTML Shop description output on product-archive "
|
| 885 |
-
"pages. In order to customize the shop headers visit wcvendors.com and read "
|
| 886 |
-
"the article in the Knowledgebase titled Changing the Vendor Templates."
|
| 887 |
-
msgstr ""
|
| 888 |
-
"Cela remplacer l'afficahge du HTML dans la description de la boutique sur "
|
| 889 |
-
"les pages d'archives produits. Afin de personnaliser les en-êtes de la "
|
| 890 |
-
"boutique, visitez wcvendors.com et lisez l’article correspondant dans la "
|
| 891 |
-
"base de connaissances intitulé \"changer les modèles du vendeur\"."
|
| 892 |
-
|
| 893 |
-
#: ../classes/admin/settings/sf-options.php:88
|
| 894 |
-
msgid "Vendor Display Name"
|
| 895 |
-
msgstr "Nom d’affichage du marchand"
|
| 896 |
-
|
| 897 |
-
#: ../classes/admin/settings/sf-options.php:89
|
| 898 |
-
msgid ""
|
| 899 |
-
"Select what will be displayed for the sold by text throughout the store."
|
| 900 |
-
msgstr ""
|
| 901 |
-
"Sélectionnez ce qui sera affiché comme texte \"vendu par\" dans tout le "
|
| 902 |
-
"magasin."
|
| 903 |
-
|
| 904 |
-
#: ../classes/admin/settings/sf-options.php:93
|
| 905 |
-
msgid "Display Name"
|
| 906 |
-
msgstr "Nom affiché"
|
| 907 |
-
|
| 908 |
-
#: ../classes/admin/settings/sf-options.php:94
|
| 909 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:22
|
| 910 |
-
#: ../templates/dashboard/settings/shop-name.php:2
|
| 911 |
-
msgid "Shop Name"
|
| 912 |
-
msgstr "Nom de votre boutique"
|
| 913 |
-
|
| 914 |
-
#: ../classes/admin/settings/sf-options.php:95
|
| 915 |
-
msgid "User Login"
|
| 916 |
-
msgstr "Nom d'utilisateur"
|
| 917 |
-
|
| 918 |
-
#: ../classes/admin/settings/sf-options.php:96
|
| 919 |
-
msgid "User Email"
|
| 920 |
-
msgstr "Email utilisateur"
|
| 921 |
-
|
| 922 |
-
#: ../classes/admin/settings/sf-options.php:103
|
| 923 |
-
#: ../classes/admin/settings/sf-options.php:116
|
| 924 |
-
msgid "Sold By"
|
| 925 |
-
msgstr "Vendu par"
|
| 926 |
-
|
| 927 |
-
#: ../classes/admin/settings/sf-options.php:104
|
| 928 |
-
msgid "Enable sold by labels"
|
| 929 |
-
msgstr "Activer étiquette \"vendu par\""
|
| 930 |
-
|
| 931 |
-
#: ../classes/admin/settings/sf-options.php:105
|
| 932 |
-
msgid "This will enable or disable the sold by labels."
|
| 933 |
-
msgstr "Cela active ou désactive l'étiquette \"vendu par\""
|
| 934 |
-
|
| 935 |
-
#: ../classes/admin/settings/sf-options.php:112
|
| 936 |
-
msgid "Sold By Label"
|
| 937 |
-
msgstr "Étiquette \"vendu par\""
|
| 938 |
-
|
| 939 |
-
#: ../classes/admin/settings/sf-options.php:113
|
| 940 |
-
msgid "The sold by label used on the site and emails."
|
| 941 |
-
msgstr "L'étiquette \"vendu par\" est utilisée sur le site et dans les e-mails"
|
| 942 |
-
|
| 943 |
-
#: ../classes/admin/settings/sf-options.php:120
|
| 944 |
-
msgid "Seller Info Label"
|
| 945 |
-
msgstr "Étiquette Informations vendeur"
|
| 946 |
-
|
| 947 |
-
#: ../classes/admin/settings/sf-options.php:121
|
| 948 |
-
msgid "The seller info tab title on the single product page."
|
| 949 |
-
msgstr "Titre de l'onglet Informations vendeur sur la page produit."
|
| 950 |
-
|
| 951 |
-
#: ../classes/admin/settings/sf-options.php:124
|
| 952 |
-
msgid "Seller Info"
|
| 953 |
-
msgstr "Informations vendeur"
|
| 954 |
-
|
| 955 |
-
#: ../classes/admin/settings/sf-options.php:128
|
| 956 |
-
msgid "Product Add Page"
|
| 957 |
-
msgstr "Page pour ajouter un produit"
|
| 958 |
-
|
| 959 |
-
#: ../classes/admin/settings/sf-options.php:128
|
| 960 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 961 |
-
msgstr ""
|
| 962 |
-
"Configurez ce que vous voulez cacher pour tous les vendeurs lors de l'ajout "
|
| 963 |
-
"d'un produit"
|
| 964 |
-
|
| 965 |
-
#: ../classes/admin/settings/sf-options.php:131
|
| 966 |
-
msgid "Left side panel"
|
| 967 |
-
msgstr "Panneau latéral gauche"
|
| 968 |
-
|
| 969 |
-
#: ../classes/admin/settings/sf-options.php:132
|
| 970 |
-
msgid ""
|
| 971 |
-
"CHECKING these boxes will **HIDE** these areas of the add product page for "
|
| 972 |
-
"vendors"
|
| 973 |
-
msgstr ""
|
| 974 |
-
"COCHER ces cases va ** CACHER ** ces zones de la page d'ajout de produit "
|
| 975 |
-
"pour les vendeurs"
|
| 976 |
-
|
| 977 |
-
#: ../classes/admin/settings/sf-options.php:135
|
| 978 |
-
msgid "Inventory"
|
| 979 |
-
msgstr "Inventaire"
|
| 980 |
-
|
| 981 |
-
#: ../classes/admin/settings/sf-options.php:137
|
| 982 |
-
msgid "Linked Products"
|
| 983 |
-
msgstr "Produits liés"
|
| 984 |
-
|
| 985 |
-
#: ../classes/admin/settings/sf-options.php:138
|
| 986 |
-
msgid "Attributes"
|
| 987 |
-
msgstr "Attributs"
|
| 988 |
-
|
| 989 |
-
#: ../classes/admin/settings/sf-options.php:139
|
| 990 |
-
msgid "Advanced"
|
| 991 |
-
msgstr "Avancé"
|
| 992 |
-
|
| 993 |
-
#: ../classes/admin/settings/sf-options.php:146
|
| 994 |
-
msgid "Types"
|
| 995 |
-
msgstr "Types"
|
| 996 |
-
|
| 997 |
-
#: ../classes/admin/settings/sf-options.php:147
|
| 998 |
-
msgid "CHECKING these boxes will HIDE these product types from the vendor"
|
| 999 |
-
msgstr ""
|
| 1000 |
-
"COCHER de ces cases permet de masquer ces types de produit auprès du vendeur"
|
| 1001 |
-
|
| 1002 |
-
#: ../classes/admin/settings/sf-options.php:150
|
| 1003 |
-
msgid "Simple"
|
| 1004 |
-
msgstr "Simple"
|
| 1005 |
-
|
| 1006 |
-
#: ../classes/admin/settings/sf-options.php:151
|
| 1007 |
-
msgid "Variable"
|
| 1008 |
-
msgstr "Variable"
|
| 1009 |
-
|
| 1010 |
-
#: ../classes/admin/settings/sf-options.php:152
|
| 1011 |
-
msgid "Grouped"
|
| 1012 |
-
msgstr "Groupé"
|
| 1013 |
-
|
| 1014 |
-
#: ../classes/admin/settings/sf-options.php:153
|
| 1015 |
-
msgid "External / affiliate"
|
| 1016 |
-
msgstr "Externe / affilié"
|
| 1017 |
-
|
| 1018 |
-
#: ../classes/admin/settings/sf-options.php:160
|
| 1019 |
-
msgid "Type options"
|
| 1020 |
-
msgstr "Type options"
|
| 1021 |
-
|
| 1022 |
-
#: ../classes/admin/settings/sf-options.php:161
|
| 1023 |
-
msgid ""
|
| 1024 |
-
"CHECKING these boxes will **HIDE** these product options from the vendor"
|
| 1025 |
-
msgstr ""
|
| 1026 |
-
"COCHER ces cases va ** MASQUER ** ces options de produits pour le vendeur"
|
| 1027 |
-
|
| 1028 |
-
#: ../classes/admin/settings/sf-options.php:164
|
| 1029 |
-
msgid "Virtual"
|
| 1030 |
-
msgstr "Virtuel"
|
| 1031 |
-
|
| 1032 |
-
#: ../classes/admin/settings/sf-options.php:165
|
| 1033 |
-
msgid "Downloadable"
|
| 1034 |
-
msgstr "Téléchargeable"
|
| 1035 |
-
|
| 1036 |
-
#: ../classes/admin/settings/sf-options.php:172
|
| 1037 |
-
msgid "Miscellaneous"
|
| 1038 |
-
msgstr "Divers"
|
| 1039 |
-
|
| 1040 |
-
#: ../classes/admin/settings/sf-options.php:176
|
| 1041 |
-
msgid "SKU"
|
| 1042 |
-
msgstr "UGS"
|
| 1043 |
-
|
| 1044 |
-
#: ../classes/admin/settings/sf-options.php:177
|
| 1045 |
-
msgid "Featured"
|
| 1046 |
-
msgstr "Mis en avant"
|
| 1047 |
-
|
| 1048 |
-
#: ../classes/admin/settings/sf-options.php:178
|
| 1049 |
-
msgid "Duplicate Product"
|
| 1050 |
-
msgstr "Dupliquer produit"
|
| 1051 |
-
|
| 1052 |
-
#: ../classes/admin/settings/sf-options.php:185
|
| 1053 |
-
msgid "Stylesheet"
|
| 1054 |
-
msgstr "Feuille de style"
|
| 1055 |
-
|
| 1056 |
-
#: ../classes/admin/settings/sf-options.php:186
|
| 1057 |
-
msgid ""
|
| 1058 |
-
"You can add CSS in this textarea, which will be loaded on the product add/"
|
| 1059 |
-
"edit page for vendors."
|
| 1060 |
-
msgstr ""
|
| 1061 |
-
"Vous pouvez ajouter des CSS dans cette zone de texte, qui sera chargée sur "
|
| 1062 |
-
"la page ajouter / modifier produit pour les vendeurs."
|
| 1063 |
-
|
| 1064 |
-
#: ../classes/admin/settings/sf-options.php:193
|
| 1065 |
-
msgid "Permissions"
|
| 1066 |
-
msgstr "Autorisations"
|
| 1067 |
-
|
| 1068 |
-
#: ../classes/admin/settings/sf-options.php:193
|
| 1069 |
-
msgid "General permissions used around the shop"
|
| 1070 |
-
msgstr "Autorisations générales utiliséespour la boutique"
|
| 1071 |
-
|
| 1072 |
-
#: ../classes/admin/settings/sf-options.php:197
|
| 1073 |
-
msgid "View orders"
|
| 1074 |
-
msgstr "Voir Commandes"
|
| 1075 |
-
|
| 1076 |
-
#: ../classes/admin/settings/sf-options.php:198
|
| 1077 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 1078 |
-
msgstr ""
|
| 1079 |
-
"Afficher les détails des clients tels que e-mail, adresse, nom, etc, pour "
|
| 1080 |
-
"chaque commande"
|
| 1081 |
-
|
| 1082 |
-
#: ../classes/admin/settings/sf-options.php:205
|
| 1083 |
-
msgid "View comments"
|
| 1084 |
-
msgstr "Voir les commentaires"
|
| 1085 |
-
|
| 1086 |
-
#: ../classes/admin/settings/sf-options.php:206
|
| 1087 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 1088 |
-
msgstr ""
|
| 1089 |
-
"Voir tous les commentaires des vendeurs pour une commande sur le frontend"
|
| 1090 |
-
|
| 1091 |
-
#: ../classes/admin/settings/sf-options.php:213
|
| 1092 |
-
msgid "Submit comments"
|
| 1093 |
-
msgstr "Envois commentaires"
|
| 1094 |
-
|
| 1095 |
-
#: ../classes/admin/settings/sf-options.php:214
|
| 1096 |
-
msgid ""
|
| 1097 |
-
"Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 1098 |
-
msgstr ""
|
| 1099 |
-
"Envois commentaires pour une commande en frontend. Ex numero de suivi par "
|
| 1100 |
-
"produit"
|
| 1101 |
-
|
| 1102 |
-
#: ../classes/admin/settings/sf-options.php:221
|
| 1103 |
-
msgid "View email addresses"
|
| 1104 |
-
msgstr "Voir adresse email"
|
| 1105 |
-
|
| 1106 |
-
#: ../classes/admin/settings/sf-options.php:222
|
| 1107 |
-
msgid ""
|
| 1108 |
-
"While viewing order details on the frontend, you can disable or enable email "
|
| 1109 |
-
"addresses"
|
| 1110 |
-
msgstr ""
|
| 1111 |
-
"Lors de l'affichage des détails de la commande sur l'interface, vous pouvez "
|
| 1112 |
-
"activer ou désactiver les adresses e-mail"
|
| 1113 |
-
|
| 1114 |
-
#: ../classes/admin/settings/sf-options.php:229
|
| 1115 |
-
msgid "Export a CSV file of orders for a product"
|
| 1116 |
-
msgstr "Export CSV des commandes pour un produit"
|
| 1117 |
-
|
| 1118 |
-
#: ../classes/admin/settings/sf-options.php:230
|
| 1119 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 1120 |
-
msgstr ""
|
| 1121 |
-
"Les vendeurs peuvent exporter les commandes pour un produit sur le frontend"
|
| 1122 |
-
|
| 1123 |
-
#: ../classes/admin/settings/sf-options.php:237
|
| 1124 |
-
msgid "Reports"
|
| 1125 |
-
msgstr "Rapports"
|
| 1126 |
-
|
| 1127 |
-
#: ../classes/admin/settings/sf-options.php:238
|
| 1128 |
-
msgid ""
|
| 1129 |
-
"<strike>View backend sales reports</strike>. <strong>Depreciated</strong>"
|
| 1130 |
-
msgstr ""
|
| 1131 |
-
"<strike>Voir les rapports des ventes en back office</strike>. "
|
| 1132 |
-
"<strong>Obsolète</strong>"
|
| 1133 |
-
|
| 1134 |
-
#: ../classes/admin/settings/sf-options.php:239
|
| 1135 |
-
msgid ""
|
| 1136 |
-
"This option has been removed and will no longer function. It will be "
|
| 1137 |
-
"completely removed in future versions. Vendors should use their Vendor "
|
| 1138 |
-
"Dashboard for reports as all identical functionality is already there. "
|
| 1139 |
-
msgstr ""
|
| 1140 |
-
"Cette option a été supprimée et n’est plus fonctionnelle. Elle sera "
|
| 1141 |
-
"complètement supprimé dans les versions futures."
|
| 1142 |
-
|
| 1143 |
-
#: ../classes/admin/settings/sf-options.php:246
|
| 1144 |
-
msgid "View Frontend sales reports"
|
| 1145 |
-
msgstr "Voir les rapports de ventes en frontend"
|
| 1146 |
-
|
| 1147 |
-
#: ../classes/admin/settings/sf-options.php:247
|
| 1148 |
-
msgid ""
|
| 1149 |
-
"Sales table on the frontend on the Vendor Dashboard page. The table will "
|
| 1150 |
-
"only display sales data that pertain to their products, and only for orders "
|
| 1151 |
-
"that are processing or completed."
|
| 1152 |
-
msgstr ""
|
| 1153 |
-
"Table des ventes sur l’interface du tableau de bord du vendeur. Le tableau "
|
| 1154 |
-
"affiche uniquement les données de ventes qui se rapportent à leurs produits "
|
| 1155 |
-
"et uniquement pour les commandes en cours ou achevés."
|
| 1156 |
-
|
| 1157 |
-
#: ../classes/admin/settings/sf-options.php:255
|
| 1158 |
-
msgid "Submit products"
|
| 1159 |
-
msgstr "Soummettre produits"
|
| 1160 |
-
|
| 1161 |
-
#: ../classes/admin/settings/sf-options.php:256
|
| 1162 |
-
msgid ""
|
| 1163 |
-
"Check to allow vendors to list new products. Admin must approve new "
|
| 1164 |
-
"products by editing the product, and clicking Publish."
|
| 1165 |
-
msgstr ""
|
| 1166 |
-
"Cochez pour permettre aux vendeurs d’inscrire de nouveaux produits. "
|
| 1167 |
-
"L'administrateur doit approuver les nouveaux produits en éditant le produit "
|
| 1168 |
-
"puis en cliquant sur publier."
|
| 1169 |
-
|
| 1170 |
-
#: ../classes/admin/settings/sf-options.php:263
|
| 1171 |
-
msgid "Edit live products"
|
| 1172 |
-
msgstr "Editer produit en ligne"
|
| 1173 |
-
|
| 1174 |
-
#: ../classes/admin/settings/sf-options.php:264
|
| 1175 |
-
msgid ""
|
| 1176 |
-
"Vendors could edit an approved product after it has already gone live. There "
|
| 1177 |
-
"is no approval or review after editing a live product. This could be "
|
| 1178 |
-
"dangerous with malicious vendors, so take caution."
|
| 1179 |
-
msgstr ""
|
| 1180 |
-
"Les vendeurs peuvent modifier un produit approuvé après qu'il soit en ligne. "
|
| 1181 |
-
"Il n'y a pas d'approbation ou d'examen après la modification d'un produit "
|
| 1182 |
-
"vivant. Cela pourrait être dangereux avec les vendeurs malveillants. Soyez "
|
| 1183 |
-
"vigileant."
|
| 1184 |
-
|
| 1185 |
-
#: ../classes/admin/settings/sf-options.php:271
|
| 1186 |
-
msgid "Submit products live without requiring approval"
|
| 1187 |
-
msgstr "Soumettre Produits en ligne sans approbation"
|
| 1188 |
-
|
| 1189 |
-
#: ../classes/admin/settings/sf-options.php:272
|
| 1190 |
-
msgid ""
|
| 1191 |
-
"Vendors can submit products without review or approval from a shop admin. "
|
| 1192 |
-
"This could be dangerous with malicious vendors, so take caution."
|
| 1193 |
-
msgstr ""
|
| 1194 |
-
"Les vendeurs peuvent soumettre produits sans révision ou l'approbation d'un "
|
| 1195 |
-
"administrateur de la boutique. Cela pourrait être dangereux avec les "
|
| 1196 |
-
"vendeurs malveillants. Soyez vigileant."
|
| 1197 |
-
|
| 1198 |
-
#: ../classes/admin/settings/sf-options.php:278
|
| 1199 |
-
msgid "Pages"
|
| 1200 |
-
msgstr "Pages"
|
| 1201 |
-
|
| 1202 |
-
#: ../classes/admin/settings/sf-options.php:279
|
| 1203 |
-
msgid "Page configuration"
|
| 1204 |
-
msgstr "Page de configuration"
|
| 1205 |
-
|
| 1206 |
-
#: ../classes/admin/settings/sf-options.php:282
|
| 1207 |
-
msgid "Vendor dashboard"
|
| 1208 |
-
msgstr "Panneau vendeur"
|
| 1209 |
-
|
| 1210 |
-
#: ../classes/admin/settings/sf-options.php:283
|
| 1211 |
-
msgid ""
|
| 1212 |
-
"Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</"
|
| 1213 |
-
"code><br/>. If this page is not set, you will break your site. If you "
|
| 1214 |
-
"upgrade to Pro, keep this page unchanged as both Pro Dashboard and this "
|
| 1215 |
-
"Dashboard page must be set."
|
| 1216 |
-
msgstr ""
|
| 1217 |
-
"Choisir la page qui contient le shortcode<code>[wcv_vendor_dashboard]</"
|
| 1218 |
-
"code><br>. Si cette page n’est pas définie, vous casserez votre site. Si "
|
| 1219 |
-
"vous mettez à niveau vers Pro, gardez cette page inchangée car le tableau de "
|
| 1220 |
-
"bord Pro ainsi que cette page de tableau de bord doivent être définis."
|
| 1221 |
-
|
| 1222 |
-
#: ../classes/admin/settings/sf-options.php:290
|
| 1223 |
-
msgid "Shop settings"
|
| 1224 |
-
msgstr "Paramètres de la boutique"
|
| 1225 |
-
|
| 1226 |
-
#: ../classes/admin/settings/sf-options.php:291
|
| 1227 |
-
msgid ""
|
| 1228 |
-
"Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/"
|
| 1229 |
-
">These are the shop settings a vendor can configure. By default, Vendor "
|
| 1230 |
-
"Dashboard > Shop Settings should have this shortcode."
|
| 1231 |
-
msgstr ""
|
| 1232 |
-
"Choisir la page qui contient le shortcode<code>[wcv_shop_settings]</"
|
| 1233 |
-
"code><br>Ce sont les paramètres de la boutique qu'un vendeur peut "
|
| 1234 |
-
"configurer. Par défaut, le tableau de bord du vendeur > Paramètres boutique "
|
| 1235 |
-
"devraient avoir ce shortcode."
|
| 1236 |
-
|
| 1237 |
-
#: ../classes/admin/settings/sf-options.php:298
|
| 1238 |
-
msgid "Orders page"
|
| 1239 |
-
msgstr "Page Commandes"
|
| 1240 |
-
|
| 1241 |
-
#: ../classes/admin/settings/sf-options.php:299
|
| 1242 |
-
msgid ""
|
| 1243 |
-
"Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 1244 |
-
"default, Vendor Dashboard > Orders should have the shortcode."
|
| 1245 |
-
msgstr ""
|
| 1246 |
-
"Choisir la page qui contient le shortcode<code>[wcv_orders]</code><br>Par "
|
| 1247 |
-
"défaut, le tableau de bord du vendeur > Commandes devraient avoir le "
|
| 1248 |
-
"shortcode."
|
| 1249 |
-
|
| 1250 |
-
#: ../classes/admin/settings/sf-options.php:306
|
| 1251 |
-
msgid "Vendor terms"
|
| 1252 |
-
msgstr "Termes du vendeur"
|
| 1253 |
-
|
| 1254 |
-
#: ../classes/admin/settings/sf-options.php:307
|
| 1255 |
-
msgid ""
|
| 1256 |
-
"These terms are shown to a user when submitting an application to become a "
|
| 1257 |
-
"vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor "
|
| 1258 |
-
"must accept terms in order to register, if set."
|
| 1259 |
-
msgstr ""
|
| 1260 |
-
"Ces conditions sont indiquése à l’utilisateur lorsqu'il postule pour devenir "
|
| 1261 |
-
"un vendeur.<br>Si laissées vides, aucun condition ne seront montrées au "
|
| 1262 |
-
"demandeur. Le vendeur doit accepter les conditions pour s’inscrire, si "
|
| 1263 |
-
"définies."
|
| 1264 |
-
|
| 1265 |
-
#: ../classes/admin/settings/sf-options.php:314
|
| 1266 |
-
msgid "payments"
|
| 1267 |
-
msgstr "paiements"
|
| 1268 |
-
|
| 1269 |
-
#: ../classes/admin/settings/sf-options.php:325
|
| 1270 |
-
msgid "Payments"
|
| 1271 |
-
msgstr "Paiements"
|
| 1272 |
-
|
| 1273 |
-
#: ../classes/admin/settings/sf-options.php:327
|
| 1274 |
-
msgid "PayPal Adaptive Payments Scheduling"
|
| 1275 |
-
msgstr "Planification des paiements PayPal Adaptive"
|
| 1276 |
-
|
| 1277 |
-
#: ../classes/admin/settings/sf-options.php:328
|
| 1278 |
-
#, php-format
|
| 1279 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 1280 |
-
msgstr "Total des commissions dues: %s. <a href=\"%s\">Voir Détails</a>."
|
| 1281 |
-
|
| 1282 |
-
#: ../classes/admin/settings/sf-options.php:329
|
| 1283 |
-
#, php-format
|
| 1284 |
-
msgid ""
|
| 1285 |
-
"Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 1286 |
-
"\">here</a>. <br><br>To instantly pay with Adaptive Payments you must "
|
| 1287 |
-
"activate the paypalap gateway in your Checkout settings. <br><a href="
|
| 1288 |
-
"\"https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/\" "
|
| 1289 |
-
"target=\"top\">PayPal AP Application Help</a>. <br><br>Another gateway that "
|
| 1290 |
-
"offers instant payments to vendors that also accepts credit cards directly "
|
| 1291 |
-
"on your checkout page is Stripe. <br><a href=\"https://www.wcvendors.com/"
|
| 1292 |
-
"product/stripe-commissions-gateway/\" target=\"top\">Stripe Commissions & "
|
| 1293 |
-
"Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a href="
|
| 1294 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 1295 |
-
"Vendors Pro</a>."
|
| 1296 |
-
msgstr ""
|
| 1297 |
-
"Assurez-vous de bien mettre à jour vos paramètres PayPal Adaptive Payments "
|
| 1298 |
-
"<a href=\"%s\">ici</a>. <br><br>Pour payer instantanément avec Adaptive "
|
| 1299 |
-
"Payments, vous devez activer la plateforme paypalap dans vos paramètres de "
|
| 1300 |
-
"commande.<br><a href=\"https://www.wcvendors.com/kb/configuring-paypal-"
|
| 1301 |
-
"adaptive-payments/\" target=\"top\">Aide Application PayPal AP</a>. "
|
| 1302 |
-
"<br><br>Une autre plateforme de paiement qui offre des paiements instantanés "
|
| 1303 |
-
"est Stripe. <br><a href=\"https://www.wcvendors.com/product/stripe-"
|
| 1304 |
-
"commissions-gateway/\" target=\"top\">Stripe Commissions & Gateway plugin</"
|
| 1305 |
-
"a> coûte $49 et est spécifiquement conçu pour WC Vendors et <a href="
|
| 1306 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 1307 |
-
"Vendors Pro</a>."
|
| 1308 |
-
|
| 1309 |
-
#: ../classes/admin/settings/sf-options.php:333
|
| 1310 |
-
msgid "Instant pay"
|
| 1311 |
-
msgstr "Paiement instantané"
|
| 1312 |
-
|
| 1313 |
-
#: ../classes/admin/settings/sf-options.php:334
|
| 1314 |
-
msgid ""
|
| 1315 |
-
"Instantly pay vendors their commission when an order is made, and if a "
|
| 1316 |
-
"vendor has a valid PayPal email added on their Shop Settings page."
|
| 1317 |
-
msgstr ""
|
| 1318 |
-
"Payer immédiatement leur commission aux vendeurs lorsqu’une commande est "
|
| 1319 |
-
"effectuée, si le vendeur a correctement renseigné son email PayPal validé "
|
| 1320 |
-
"dans les paramètres de la boutique."
|
| 1321 |
-
|
| 1322 |
-
#: ../classes/admin/settings/sf-options.php:335
|
| 1323 |
-
msgid ""
|
| 1324 |
-
"For this to work, customers must checkout with the PayPal Adaptive Payments "
|
| 1325 |
-
"gateway. Using any other gateways will not pay vendors instantly"
|
| 1326 |
-
msgstr ""
|
| 1327 |
-
"Pour ce faire, les visiteurs doivent commander avec la passerelle PayPal "
|
| 1328 |
-
"Adaptive Payments. Utiliser une autre passerelle ne paiera pas vendeurs "
|
| 1329 |
-
"instantanément."
|
| 1330 |
-
|
| 1331 |
-
#: ../classes/admin/settings/sf-options.php:342
|
| 1332 |
-
msgid "Payment schedule"
|
| 1333 |
-
msgstr "Calendrier des paiements"
|
| 1334 |
-
|
| 1335 |
-
#: ../classes/admin/settings/sf-options.php:343
|
| 1336 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 1337 |
-
msgstr ""
|
| 1338 |
-
"Note: Calendrier des paiements ne fonctionne que si le paiement instantané "
|
| 1339 |
-
"est décoché"
|
| 1340 |
-
|
| 1341 |
-
#: ../classes/admin/settings/sf-options.php:348
|
| 1342 |
-
msgid "Weekly"
|
| 1343 |
-
msgstr "Par semaine"
|
| 1344 |
-
|
| 1345 |
-
#: ../classes/admin/settings/sf-options.php:349
|
| 1346 |
-
msgid "Biweekly"
|
| 1347 |
-
msgstr "Par 2 semaines"
|
| 1348 |
-
|
| 1349 |
-
#: ../classes/admin/settings/sf-options.php:350
|
| 1350 |
-
msgid "Monthly"
|
| 1351 |
-
msgstr "Par mois"
|
| 1352 |
-
|
| 1353 |
-
#: ../classes/admin/settings/sf-options.php:351
|
| 1354 |
-
msgid "Manual"
|
| 1355 |
-
msgstr "Manuel"
|
| 1356 |
-
|
| 1357 |
-
#: ../classes/admin/settings/sf-options.php:352
|
| 1358 |
-
msgid "Now"
|
| 1359 |
-
msgstr "Maintenant"
|
| 1360 |
-
|
| 1361 |
-
#: ../classes/admin/settings/sf-options.php:357
|
| 1362 |
-
msgid "Email notification"
|
| 1363 |
-
msgstr "Email de notification"
|
| 1364 |
-
|
| 1365 |
-
#: ../classes/admin/settings/sf-options.php:358
|
| 1366 |
-
msgid ""
|
| 1367 |
-
"Send the WooCommerce admin an email each time a payment has been made via "
|
| 1368 |
-
"the payment schedule options above"
|
| 1369 |
-
msgstr ""
|
| 1370 |
-
"Envoyer a l'admin WooCommerce un email chaque fois qu'un paiement a été "
|
| 1371 |
-
"effectué via les options du calendrier de paiement ci-dessus"
|
| 1372 |
-
|
| 1373 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:11
|
| 1374 |
-
#: ../templates/dashboard/settings/paypal-email-form.php:2
|
| 1375 |
-
msgid "PayPal Address"
|
| 1376 |
-
msgstr "Adresse Email Paypal"
|
| 1377 |
-
|
| 1378 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:15
|
| 1379 |
-
#: ../templates/dashboard/settings/paypal-email-form.php:3
|
| 1380 |
-
msgid "Your PayPal address is used to send you your commission."
|
| 1381 |
-
msgstr "Votre adresse PayPal est utilisée pour vous payer votre commission."
|
| 1382 |
-
|
| 1383 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:24
|
| 1384 |
-
#: ../templates/dashboard/settings/shop-name.php:3
|
| 1385 |
-
msgid "Your shop name is public and must be unique."
|
| 1386 |
-
msgstr "Le nom de votre boutique est publique et doit être unique."
|
| 1387 |
-
|
| 1388 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:43
|
| 1389 |
-
#: ../templates/dashboard/settings/seller-info.php:4
|
| 1390 |
-
msgid "This is displayed on each of your products."
|
| 1391 |
-
msgstr "Ce message s'affiche sur chacun de vos produits."
|
| 1392 |
-
|
| 1393 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:49
|
| 1394 |
-
#: ../templates/dashboard/settings/shop-description.php:2
|
| 1395 |
-
msgid "Shop Description"
|
| 1396 |
-
msgstr "Description de votre boutique"
|
| 1397 |
-
|
| 1398 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:61
|
| 1399 |
-
#: ../templates/dashboard/settings/shop-description.php:3
|
| 1400 |
-
#, php-format
|
| 1401 |
-
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 1402 |
-
msgstr "Ceci est affiché sur <a href=\"%s\">page boutique</a>. "
|
| 1403 |
-
|
| 1404 |
-
#: ../classes/admin/views/html-vendor-settings-page.php:70
|
| 1405 |
-
msgid "Save Shop Settings"
|
| 1406 |
-
msgstr "Sauvegarder les paramètres de la boutique"
|
| 1407 |
-
|
| 1408 |
-
#: ../classes/class-cron.php:87
|
| 1409 |
-
#, php-format
|
| 1410 |
-
msgid "Payment total: %s"
|
| 1411 |
-
msgstr "Total a payer: %s"
|
| 1412 |
-
|
| 1413 |
-
#: ../classes/class-cron.php:148
|
| 1414 |
-
msgid "Once Weekly"
|
| 1415 |
-
msgstr "Chaque semaine"
|
| 1416 |
-
|
| 1417 |
-
#: ../classes/class-cron.php:153
|
| 1418 |
-
msgid "Once every two weeks"
|
| 1419 |
-
msgstr "Aux 2 semaines"
|
| 1420 |
-
|
| 1421 |
-
#: ../classes/class-cron.php:158
|
| 1422 |
-
msgid "Once a month"
|
| 1423 |
-
msgstr "Chaque mois"
|
| 1424 |
-
|
| 1425 |
-
#: ../classes/class-install.php:84 ../classes/class-install.php:239
|
| 1426 |
-
msgid "Pending Vendor"
|
| 1427 |
-
msgstr "Vendeur En Attente"
|
| 1428 |
-
|
| 1429 |
-
#: ../classes/class-install.php:190
|
| 1430 |
-
msgid "Vendor Dashboard"
|
| 1431 |
-
msgstr "Tableau de bord Du vendeur"
|
| 1432 |
-
|
| 1433 |
-
#: ../classes/class-vendor-post-types.php:34
|
| 1434 |
-
msgid "Vendor Orders"
|
| 1435 |
-
msgstr "Commandes vendeur"
|
| 1436 |
-
|
| 1437 |
-
#: ../classes/class-vendors.php:551
|
| 1438 |
-
#, php-format
|
| 1439 |
-
msgid "Vendor Order – %s"
|
| 1440 |
-
msgstr "Commande vendeur – %s"
|
| 1441 |
-
|
| 1442 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:53
|
| 1443 |
-
msgid "Order marked shipped."
|
| 1444 |
-
msgstr "Commande portant la mention \"expédiée\"."
|
| 1445 |
-
|
| 1446 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:55
|
| 1447 |
-
#, php-format
|
| 1448 |
-
msgid "%s has marked as shipped. "
|
| 1449 |
-
msgstr "%s a été marquée comme expédiée. "
|
| 1450 |
-
|
| 1451 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:83
|
| 1452 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:84
|
| 1453 |
-
msgid "Tracking number"
|
| 1454 |
-
msgstr "Numero de suivi"
|
| 1455 |
-
|
| 1456 |
-
#: ../classes/front/dashboard/class-vendor-dashboard.php:86
|
| 1457 |
-
msgid "Success. Your tracking number has been updated."
|
| 1458 |
-
msgstr "Succes. Votre numéro de suivi a ete mis a jour"
|
| 1459 |
-
|
| 1460 |
-
#: ../classes/front/orders/class-export-csv.php:19
|
| 1461 |
-
#: ../templates/dashboard/reports.php:18
|
| 1462 |
-
#: ../templates/emails/notify-vendor-shipped.php:23
|
| 1463 |
-
#: ../templates/emails/vendor-new-order.php:23
|
| 1464 |
-
msgid "Quantity"
|
| 1465 |
-
msgstr "Quantité"
|
| 1466 |
-
|
| 1467 |
-
#: ../classes/front/orders/class-orders.php:120
|
| 1468 |
-
msgid ""
|
| 1469 |
-
"You haven't selected a product's orders to view! Please go back to the "
|
| 1470 |
-
"Vendor Dashboard and click Show Orders on the product you'd like to view."
|
| 1471 |
-
msgstr ""
|
| 1472 |
-
"Vous n'avez pas choisi les commandes d'un produit a voir ! S'il vous plaît "
|
| 1473 |
-
"revenir au tableau de bord du vendeur et cliquez sur Afficher les commandes "
|
| 1474 |
-
"du produit que vous souhaitez consulter."
|
| 1475 |
-
|
| 1476 |
-
#: ../classes/front/orders/class-orders.php:124
|
| 1477 |
-
msgid "No orders."
|
| 1478 |
-
msgstr "Pas de Commandes"
|
| 1479 |
-
|
| 1480 |
-
#: ../classes/front/orders/class-orders.php:188
|
| 1481 |
-
msgid "Product Title"
|
| 1482 |
-
msgstr "Titre du Produit"
|
| 1483 |
-
|
| 1484 |
-
#: ../classes/front/orders/class-orders.php:189
|
| 1485 |
-
msgid "Full name"
|
| 1486 |
-
msgstr "Nom Complet"
|
| 1487 |
-
|
| 1488 |
-
#: ../classes/front/orders/class-orders.php:190
|
| 1489 |
-
msgid "Address"
|
| 1490 |
-
msgstr "Adresse"
|
| 1491 |
-
|
| 1492 |
-
#: ../classes/front/orders/class-orders.php:191
|
| 1493 |
-
msgid "City"
|
| 1494 |
-
msgstr "Ville"
|
| 1495 |
-
|
| 1496 |
-
#: ../classes/front/orders/class-orders.php:192
|
| 1497 |
-
msgid "State"
|
| 1498 |
-
msgstr "Etat"
|
| 1499 |
-
|
| 1500 |
-
#: ../classes/front/orders/class-orders.php:193
|
| 1501 |
-
msgid "Zip"
|
| 1502 |
-
msgstr "Code Postal "
|
| 1503 |
-
|
| 1504 |
-
#: ../classes/front/orders/class-orders.php:194
|
| 1505 |
-
msgid "Email address"
|
| 1506 |
-
msgstr "Adresse Email"
|
| 1507 |
-
|
| 1508 |
-
#: ../classes/front/orders/class-submit-comment.php:41
|
| 1509 |
-
msgid "You've left the comment field empty!"
|
| 1510 |
-
msgstr "Vous avez laissé le champ de commentaire vide!"
|
| 1511 |
-
|
| 1512 |
-
#: ../classes/front/orders/class-submit-comment.php:63
|
| 1513 |
-
msgid "Success. The customer has been notified of your comment."
|
| 1514 |
-
msgstr "Succès. Le client a été avisé de votre commentaire."
|
| 1515 |
-
|
| 1516 |
-
#: ../classes/front/signup/class-vendor-signup.php:58
|
| 1517 |
-
#: ../classes/front/signup/views/html-vendor-signup.php:21
|
| 1518 |
-
#: ../templates/dashboard/denied.php:22
|
| 1519 |
-
msgid "Apply to become a vendor? "
|
| 1520 |
-
msgstr "S'incrire pour devenir vendeur ?"
|
| 1521 |
-
|
| 1522 |
-
#: ../classes/front/signup/class-vendor-signup.php:72
|
| 1523 |
-
#: ../classes/front/signup/views/html-vendor-signup.php:35
|
| 1524 |
-
#, php-format
|
| 1525 |
-
msgid ""
|
| 1526 |
-
"I have read and accepted the <a target=\"top\" href=\"%s\">terms and "
|
| 1527 |
-
"conditions</a>"
|
| 1528 |
-
msgstr ""
|
| 1529 |
-
"J’ai lu et j’accepte les <a target=\"top\" href=\"%s\">Conditions générales "
|
| 1530 |
-
"d'utilisation</a>"
|
| 1531 |
-
|
| 1532 |
-
#: ../classes/front/signup/class-vendor-signup.php:122
|
| 1533 |
-
msgid "Application denied. You are an administrator."
|
| 1534 |
-
msgstr "Demande rejetée. Vous êtes un administrateur."
|
| 1535 |
-
|
| 1536 |
-
#: ../classes/front/signup/class-vendor-signup.php:124
|
| 1537 |
-
msgid "Your application has been submitted."
|
| 1538 |
-
msgstr "Votre demande a été soumise."
|
| 1539 |
-
|
| 1540 |
-
#: ../classes/front/signup/class-vendor-signup.php:171
|
| 1541 |
-
#: ../classes/front/signup/class-vendor-signup.php:208
|
| 1542 |
-
#: ../classes/front/signup/class-vendor-signup.php:220
|
| 1543 |
-
msgid "You must accept the terms and conditions to become a vendor."
|
| 1544 |
-
msgstr "Vous devez accepter les termes et conditions pour devenir un vendeur."
|
| 1545 |
-
|
| 1546 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1547 |
-
msgid "PayPal Adaptive Payments"
|
| 1548 |
-
msgstr "PayPal Adaptive Payments"
|
| 1549 |
-
|
| 1550 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 1551 |
-
#, php-format
|
| 1552 |
-
msgid ""
|
| 1553 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 1554 |
-
"%s."
|
| 1555 |
-
msgstr ""
|
| 1556 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 1557 |
-
"%s."
|
| 1558 |
-
|
| 1559 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 1560 |
-
msgid "IPN payment completed"
|
| 1561 |
-
msgstr "IPN payment completed"
|
| 1562 |
-
|
| 1563 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 1564 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 1565 |
-
msgstr "Activer PayPal Adaptive Payments"
|
| 1566 |
-
|
| 1567 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 1568 |
-
msgid "Method Title"
|
| 1569 |
-
msgstr "Titre de la méthode"
|
| 1570 |
-
|
| 1571 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 1572 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:70
|
| 1573 |
-
msgid "This controls the title which the user sees during checkout."
|
| 1574 |
-
msgstr "Contrôle du titre que voit l'utilisateur lors de la commande."
|
| 1575 |
-
|
| 1576 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 1577 |
-
msgid "PayPal"
|
| 1578 |
-
msgstr "PayPal"
|
| 1579 |
-
|
| 1580 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:159
|
| 1581 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:75
|
| 1582 |
-
msgid "Description"
|
| 1583 |
-
msgstr "Description"
|
| 1584 |
-
|
| 1585 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 1586 |
-
msgid "This controls the description which the user sees during checkout."
|
| 1587 |
-
msgstr "Contrôle la description que voit l'utilisateur lors de la commande."
|
| 1588 |
-
|
| 1589 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 1590 |
-
msgid "Pay via PayPal!"
|
| 1591 |
-
msgstr "Payer via Paypal!"
|
| 1592 |
-
|
| 1593 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 1594 |
-
msgid "Live Credentials"
|
| 1595 |
-
msgstr "Certificats en ligne"
|
| 1596 |
-
|
| 1597 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 1598 |
-
#, php-format
|
| 1599 |
-
msgid ""
|
| 1600 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 1601 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 1602 |
-
msgstr ""
|
| 1603 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 1604 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 1605 |
-
|
| 1606 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:179
|
| 1607 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 1608 |
-
msgid "PayPal Email"
|
| 1609 |
-
msgstr "Email PayPal"
|
| 1610 |
-
|
| 1611 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:180
|
| 1612 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 1613 |
-
msgid "The email address main payments should go to."
|
| 1614 |
-
msgstr "L'email principal de paiement"
|
| 1615 |
-
|
| 1616 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:185
|
| 1617 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 1618 |
-
msgid "API Username"
|
| 1619 |
-
msgstr "API Username"
|
| 1620 |
-
|
| 1621 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:190
|
| 1622 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 1623 |
-
msgid "API Password"
|
| 1624 |
-
msgstr "API Password"
|
| 1625 |
-
|
| 1626 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:195
|
| 1627 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 1628 |
-
msgid "API Signature"
|
| 1629 |
-
msgstr "API Signature"
|
| 1630 |
-
|
| 1631 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 1632 |
-
msgid "Application ID"
|
| 1633 |
-
msgstr "Application ID"
|
| 1634 |
-
|
| 1635 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 1636 |
-
msgid "Only required when doing live transactions."
|
| 1637 |
-
msgstr ""
|
| 1638 |
-
"N'est nécessaire que lorsque vous effectuez des transactions en direct."
|
| 1639 |
-
|
| 1640 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 1641 |
-
msgid "Sandbox Credentials"
|
| 1642 |
-
msgstr "Sandbox Credentials"
|
| 1643 |
-
|
| 1644 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 1645 |
-
#, php-format
|
| 1646 |
-
msgid ""
|
| 1647 |
-
"You can signup for a sandbox developer account <a href=\"%s\">here</a>. You "
|
| 1648 |
-
"need a developer account if you want to enable Sandbox mode for testing."
|
| 1649 |
-
msgstr ""
|
| 1650 |
-
"Vous devez souscrire un compte développeur Sandox <a href=\"%s\">ici</a>. "
|
| 1651 |
-
|
| 1652 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 1653 |
-
msgid "Misc. Settings"
|
| 1654 |
-
msgstr "Configurations diverses"
|
| 1655 |
-
|
| 1656 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 1657 |
-
msgid "Enable PayPal Sandbox mode"
|
| 1658 |
-
msgstr "Activer le mode PayPal Sandbox"
|
| 1659 |
-
|
| 1660 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 1661 |
-
msgid "Enable logging"
|
| 1662 |
-
msgstr "Activer logging"
|
| 1663 |
-
|
| 1664 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 1665 |
-
msgid ""
|
| 1666 |
-
"The PayPal Adaptive Payments gateway can instantly pay your vendors their "
|
| 1667 |
-
"due commission (if enabled). Also used to mass pay vendors on a schedule / "
|
| 1668 |
-
"manual method (if enabled)."
|
| 1669 |
-
msgstr ""
|
| 1670 |
-
"La passerelle PayPal Adaptive Payments peut instantanément payer les "
|
| 1671 |
-
"vendeurs selon leur commission (si activé). Également utilisé pour les "
|
| 1672 |
-
"vendeurs de rémunération en masse programmée ou par la méthode manuelle (si "
|
| 1673 |
-
"activé)."
|
| 1674 |
-
|
| 1675 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1676 |
-
msgid "Gateway Disabled"
|
| 1677 |
-
msgstr "Passerelle désactivée"
|
| 1678 |
-
|
| 1679 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1680 |
-
#, php-format
|
| 1681 |
-
msgid "%s does not support your store currency."
|
| 1682 |
-
msgstr "%s ne supporte pas votre système monétaire."
|
| 1683 |
-
|
| 1684 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:384
|
| 1685 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:500
|
| 1686 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:153
|
| 1687 |
-
#, php-format
|
| 1688 |
-
msgid "Error: %s"
|
| 1689 |
-
msgstr "Erreur: %s"
|
| 1690 |
-
|
| 1691 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:393
|
| 1692 |
-
#: ../classes/gateways/PayPal_AdvPayments/paypal_ap.php:394
|
| 1693 |
-
#, php-format
|
| 1694 |
-
msgid "Error ID: %s. %s"
|
| 1695 |
-
msgstr "Erreur ID: %s. %s"
|
| 1696 |
-
|
| 1697 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 1698 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 1699 |
-
msgstr ""
|
| 1700 |
-
"Pas de vendeurs trouvés à payer. Peut-être qu'ils n'ont pas défini une "
|
| 1701 |
-
"adresse PayPal?"
|
| 1702 |
-
|
| 1703 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:167
|
| 1704 |
-
msgid "All due commission has been paid for."
|
| 1705 |
-
msgstr "Toutes les commissions ont été payée."
|
| 1706 |
-
|
| 1707 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:173
|
| 1708 |
-
msgid ""
|
| 1709 |
-
"All due commission has been paid for, but I could not clear it from their "
|
| 1710 |
-
"profiles due to an internal error. Commission will still be listed as due. "
|
| 1711 |
-
"Please manually mark the commission as paid from the Commissions page."
|
| 1712 |
-
msgstr ""
|
| 1713 |
-
"Toutes les commission ont été payé, mais je ne pouvais pas le faire "
|
| 1714 |
-
"disparaître de leurs profils en raison d'une erreur interne. Les commissions "
|
| 1715 |
-
"seront toujours listé comme a payer. S'il vous plaît marquer manuellement "
|
| 1716 |
-
"les commissions comme payés à la page des commissions."
|
| 1717 |
-
|
| 1718 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 1719 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 1720 |
-
msgstr "WooCommerce: mise à jour des paiements groupés des vendeurs"
|
| 1721 |
-
|
| 1722 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:210
|
| 1723 |
-
msgid ""
|
| 1724 |
-
"Hello! A payment was just triggered to mass pay all vendors their due "
|
| 1725 |
-
"commission."
|
| 1726 |
-
msgstr ""
|
| 1727 |
-
"Bonjour! Un paiement a été déclenché pour payer tous les vendeurs leurs "
|
| 1728 |
-
"commissions dues."
|
| 1729 |
-
|
| 1730 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:211
|
| 1731 |
-
#, php-format
|
| 1732 |
-
msgid "Payment status: %s."
|
| 1733 |
-
msgstr "Statut des paiement: %s."
|
| 1734 |
-
|
| 1735 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 1736 |
-
#, php-format
|
| 1737 |
-
msgid "Payment message: %s."
|
| 1738 |
-
msgstr "Message Paiement: %s."
|
| 1739 |
-
|
| 1740 |
-
#: ../classes/gateways/PayPal_Masspay/class-paypal-masspay.php:215
|
| 1741 |
-
#, php-format
|
| 1742 |
-
msgid "Payment total: %s."
|
| 1743 |
-
msgstr "Paiement total: %s."
|
| 1744 |
-
|
| 1745 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:35
|
| 1746 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:71
|
| 1747 |
-
msgid "WC Vendors Test Gateway"
|
| 1748 |
-
msgstr "Passerelle de test WC Vendors"
|
| 1749 |
-
|
| 1750 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:36
|
| 1751 |
-
msgid ""
|
| 1752 |
-
"This gateway will set orders to processing upon receipt allowing you to test "
|
| 1753 |
-
"transactions in your store. Some WooCommerce included gateways have "
|
| 1754 |
-
"problems with this - you should use this gateway for all of your non-PayPal "
|
| 1755 |
-
"testing."
|
| 1756 |
-
msgstr ""
|
| 1757 |
-
"Cette passerelle passera les commandes à \"en cours\" à réception, vous "
|
| 1758 |
-
"permettant de tester les transactions dans votre magasin. Certaines "
|
| 1759 |
-
"passerelles incluses dans WooCommerce ont des problèmes avec cela - vous "
|
| 1760 |
-
"devez utiliser cette passerelle pour tous vos tests hors PayPal."
|
| 1761 |
-
|
| 1762 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:64
|
| 1763 |
-
msgid "Enable WC Vendors Test Gateway Payment"
|
| 1764 |
-
msgstr "Activer la passerelle de test de paiements de WC Vendors"
|
| 1765 |
-
|
| 1766 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:68
|
| 1767 |
-
msgid "Title"
|
| 1768 |
-
msgstr "Titre"
|
| 1769 |
-
|
| 1770 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:77
|
| 1771 |
-
msgid "Payment method description that the customer will see on your checkout."
|
| 1772 |
-
msgstr ""
|
| 1773 |
-
"La description de méthode de paiement que vos clients verront lors du "
|
| 1774 |
-
"processus de commande."
|
| 1775 |
-
|
| 1776 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:78
|
| 1777 |
-
msgid ""
|
| 1778 |
-
"This is a test gateway -- not to be used on live sites for live "
|
| 1779 |
-
"transactions. <a href=\"http://www.wcvendors.com/\" target=\"top\">Click "
|
| 1780 |
-
"here to visit WCVendors.com</a>."
|
| 1781 |
-
msgstr ""
|
| 1782 |
-
"Il s’agit d’une passerelle de test -- à ne pas utiliser sur un site en "
|
| 1783 |
-
"production pour des transactions réelles. <a href=\"http://www.wcvendors.com/"
|
| 1784 |
-
"\" target=\"top\">Cliquez ici pour visiter WCVendors.com</a>."
|
| 1785 |
-
|
| 1786 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:82
|
| 1787 |
-
msgid "Instructions"
|
| 1788 |
-
msgstr "Instructions"
|
| 1789 |
-
|
| 1790 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:84
|
| 1791 |
-
msgid ""
|
| 1792 |
-
"Success! Your test order is now marked as processing and any vendors will "
|
| 1793 |
-
"be sent an email as long as you have the Notify Vendors email enabled under "
|
| 1794 |
-
"WooCommerce--Settings--Emails."
|
| 1795 |
-
msgstr ""
|
| 1796 |
-
"Succès ! Votre commande de test est maintenant marquée comme en cours et "
|
| 1797 |
-
"les vendeurs seront notifiés par e-mail tant que vous avez \"Notifier les "
|
| 1798 |
-
"vendeurs par e-mail\" activé sous WooCommerce--Paramètres--Emails."
|
| 1799 |
-
|
| 1800 |
-
#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:124
|
| 1801 |
-
msgid "Test gateway transation complete. Order processing."
|
| 1802 |
-
msgstr "Transaction sur plateforme de test terminée. Commande en cours."
|
| 1803 |
-
|
| 1804 |
-
#: ../templates/dashboard/denied.php:8
|
| 1805 |
-
msgid ""
|
| 1806 |
-
"Your account has not yet been approved to become a vendor. When it is, you "
|
| 1807 |
-
"will receive an email telling you that your account is approved!"
|
| 1808 |
-
msgstr ""
|
| 1809 |
-
"Votre compte vendeur n'est pas encore approuvé. Quand il y sera, vous "
|
| 1810 |
-
"recevrez un email vous indiquant que votre compte est approuvé!"
|
| 1811 |
-
|
| 1812 |
-
#: ../templates/dashboard/denied.php:12
|
| 1813 |
-
msgid "Your account is not setup as a vendor."
|
| 1814 |
-
msgstr "Votre compte n’est pas configuré en tant que vendeur."
|
| 1815 |
-
|
| 1816 |
-
#: ../templates/dashboard/denied.php:33
|
| 1817 |
-
#, php-format
|
| 1818 |
-
msgid "I have read and accepted the <a href=\"%s\">terms and conditions</a>"
|
| 1819 |
-
msgstr "J'ai lu et accepté <a href=\"%s\">les termes et conditions</a>"
|
| 1820 |
-
|
| 1821 |
-
#: ../templates/dashboard/denied.php:53
|
| 1822 |
-
msgid "Submit"
|
| 1823 |
-
msgstr "Soumettre"
|
| 1824 |
-
|
| 1825 |
-
#: ../templates/dashboard/links.php:3
|
| 1826 |
-
msgid "View Your Store"
|
| 1827 |
-
msgstr "Voir votre magasin"
|
| 1828 |
-
|
| 1829 |
-
#: ../templates/dashboard/links.php:4
|
| 1830 |
-
msgid "Store Settings"
|
| 1831 |
-
msgstr "Paramètres du magasin"
|
| 1832 |
-
|
| 1833 |
-
#: ../templates/dashboard/links.php:7
|
| 1834 |
-
msgid "Add New Product"
|
| 1835 |
-
msgstr "Ajouter un nouveau produit"
|
| 1836 |
-
|
| 1837 |
-
#: ../templates/dashboard/links.php:8
|
| 1838 |
-
msgid "Edit Products"
|
| 1839 |
-
msgstr "Modifier produits"
|
| 1840 |
-
|
| 1841 |
-
#: ../templates/dashboard/orders.php:7 ../templates/dashboard/orders.php:10
|
| 1842 |
-
msgid "Hide items"
|
| 1843 |
-
msgstr "Masquer les items"
|
| 1844 |
-
|
| 1845 |
-
#: ../templates/dashboard/orders.php:8 ../templates/dashboard/orders.php:79
|
| 1846 |
-
msgid "View items"
|
| 1847 |
-
msgstr "Voir les articles"
|
| 1848 |
-
|
| 1849 |
-
#: ../templates/dashboard/orders.php:37
|
| 1850 |
-
msgid "Links"
|
| 1851 |
-
msgstr "Liens"
|
| 1852 |
-
|
| 1853 |
-
#: ../templates/dashboard/orders.php:100
|
| 1854 |
-
msgid "Tracking"
|
| 1855 |
-
msgstr "Suivi d'envoi"
|
| 1856 |
-
|
| 1857 |
-
#: ../templates/dashboard/orders.php:216
|
| 1858 |
-
msgid "You have no orders during this period."
|
| 1859 |
-
msgstr "Vous n'avez pas de commande pendant cette période."
|
| 1860 |
-
|
| 1861 |
-
#: ../templates/dashboard/reports.php:1
|
| 1862 |
-
msgid "Sales Report"
|
| 1863 |
-
msgstr "Rapport des ventes"
|
| 1864 |
-
|
| 1865 |
-
#: ../templates/dashboard/reports.php:20
|
| 1866 |
-
msgid "Rate"
|
| 1867 |
-
msgstr "Taux"
|
| 1868 |
-
|
| 1869 |
-
#: ../templates/dashboard/reports.php:47
|
| 1870 |
-
msgid "Show Orders"
|
| 1871 |
-
msgstr "Voir Commandes"
|
| 1872 |
-
|
| 1873 |
-
#: ../templates/dashboard/reports.php:56
|
| 1874 |
-
msgid "Totals"
|
| 1875 |
-
msgstr "Totales"
|
| 1876 |
-
|
| 1877 |
-
#: ../templates/dashboard/reports.php:71
|
| 1878 |
-
msgid "You have no sales during this period."
|
| 1879 |
-
msgstr "Vous n'avez pas de ventes au cours de cette période."
|
| 1880 |
-
|
| 1881 |
-
#: ../templates/dashboard/reports.php:82
|
| 1882 |
-
msgid "You haven't made any sales yet."
|
| 1883 |
-
msgstr "Vous n'avez pas encore fait de vente."
|
| 1884 |
-
|
| 1885 |
-
#: ../templates/dashboard/settings/settings.php:47
|
| 1886 |
-
msgid "Save"
|
| 1887 |
-
msgstr "Sauvegarder"
|
| 1888 |
-
|
| 1889 |
-
#: ../templates/emails/application-status.php:5
|
| 1890 |
-
#, php-format
|
| 1891 |
-
msgid "Hi there. This is a notification about a vendor application on %s."
|
| 1892 |
-
msgstr "Il s'agit d'une notification pour une inscription Vendeur sur % s."
|
| 1893 |
-
|
| 1894 |
-
#: ../templates/emails/application-status.php:8
|
| 1895 |
-
#, php-format
|
| 1896 |
-
msgid "Application status: %s"
|
| 1897 |
-
msgstr "Statut du Candidat: %s"
|
| 1898 |
-
|
| 1899 |
-
#: ../templates/emails/application-status.php:9
|
| 1900 |
-
#, php-format
|
| 1901 |
-
msgid "Applicant username: %s"
|
| 1902 |
-
msgstr "Nom d'utilisateur du Candidat: %s"
|
| 1903 |
-
|
| 1904 |
-
#: ../templates/emails/new-product.php:5
|
| 1905 |
-
#, php-format
|
| 1906 |
-
msgid "Hi there. This is a notification about a new product on %s."
|
| 1907 |
-
msgstr ""
|
| 1908 |
-
"Hello. Il s'agit d'une notification a propos d'un nouveau produit sur% s."
|
| 1909 |
-
|
| 1910 |
-
#: ../templates/emails/new-product.php:8
|
| 1911 |
-
#, php-format
|
| 1912 |
-
msgid "Product title: %s"
|
| 1913 |
-
msgstr "Titre du Produit: %s"
|
| 1914 |
-
|
| 1915 |
-
#: ../templates/emails/new-product.php:9
|
| 1916 |
-
#, php-format
|
| 1917 |
-
msgid "Submitted by: %s"
|
| 1918 |
-
msgstr "Soumis par: %s"
|
| 1919 |
-
|
| 1920 |
-
#: ../templates/emails/new-product.php:10
|
| 1921 |
-
#, php-format
|
| 1922 |
-
msgid "Edit product: %s"
|
| 1923 |
-
msgstr "Editer produit: %s"
|
| 1924 |
-
|
| 1925 |
-
#: ../templates/emails/notify-vendor-shipped.php:13
|
| 1926 |
-
msgid ""
|
| 1927 |
-
"A vendor has marked part of your order as shipped. The items that are "
|
| 1928 |
-
"shipped are as follows:"
|
| 1929 |
-
msgstr ""
|
| 1930 |
-
"Un vendeur a marqué une partie de votre commande comme envoyée. Les articles "
|
| 1931 |
-
"envoyés sont les suivants:"
|
| 1932 |
-
|
| 1933 |
-
#: ../templates/emails/notify-vendor-shipped.php:17
|
| 1934 |
-
#: ../templates/emails/vendor-new-order.php:17
|
| 1935 |
-
#, php-format
|
| 1936 |
-
msgid "Order: %s"
|
| 1937 |
-
msgstr "Commande: %s"
|
| 1938 |
-
|
| 1939 |
-
#: ../templates/emails/notify-vendor-shipped.php:24
|
| 1940 |
-
#: ../templates/emails/vendor-new-order.php:24
|
| 1941 |
-
msgid "Price"
|
| 1942 |
-
msgstr "Prix"
|
| 1943 |
-
|
| 1944 |
-
#: ../templates/emails/notify-vendor-shipped.php:56
|
| 1945 |
-
#: ../templates/emails/vendor-new-order.php:56
|
| 1946 |
-
msgid "Customer details"
|
| 1947 |
-
msgstr "Détails client"
|
| 1948 |
-
|
| 1949 |
-
#: ../templates/emails/notify-vendor-shipped.php:59
|
| 1950 |
-
#: ../templates/emails/vendor-new-order.php:59
|
| 1951 |
-
msgid "Email:"
|
| 1952 |
-
msgstr "Courriel:"
|
| 1953 |
-
|
| 1954 |
-
#: ../templates/emails/notify-vendor-shipped.php:62
|
| 1955 |
-
#: ../templates/emails/vendor-new-order.php:62
|
| 1956 |
-
msgid "Tel:"
|
| 1957 |
-
msgstr "Tél:"
|
| 1958 |
-
|
| 1959 |
-
#: ../templates/emails/vendor-new-order.php:13
|
| 1960 |
-
#, php-format
|
| 1961 |
-
msgid "You have received an order from %s. Their order is as follows:"
|
| 1962 |
-
msgstr "Vous avez reçu une commande de %s. Cette commande est la suivante:"
|
| 1963 |
-
|
| 1964 |
-
#: ../templates/orders/comments/add-new-comment.php:11
|
| 1965 |
-
msgid "Add comment"
|
| 1966 |
-
msgstr "Ajouter Commentaire"
|
| 1967 |
-
|
| 1968 |
-
#: ../templates/orders/comments/existing-comments.php:9
|
| 1969 |
-
#, php-format
|
| 1970 |
-
msgid "added %s ago"
|
| 1971 |
-
msgstr "Ajouter il y a %s"
|
| 1972 |
-
|
| 1973 |
-
#: ../templates/orders/csv-export.php:6
|
| 1974 |
-
msgid "Export orders"
|
| 1975 |
-
msgstr "Export Commandes"
|
| 1976 |
-
|
| 1977 |
-
#: ../templates/orders/customer-note/customer-note.php:4
|
| 1978 |
-
msgid "Customer note"
|
| 1979 |
-
msgstr "Note de l'acheteur"
|
| 1980 |
-
|
| 1981 |
-
#: ../templates/orders/customer-note/customer-note.php:8
|
| 1982 |
-
msgid "No customer note."
|
| 1983 |
-
msgstr "Pas de note de l'acheteur"
|
| 1984 |
-
|
| 1985 |
-
#: ../templates/orders/orders.php:84
|
| 1986 |
-
#, php-format
|
| 1987 |
-
msgid "Comments (%s)"
|
| 1988 |
-
msgstr "Commentaires (%s)"
|
| 1989 |
-
|
| 1990 |
-
#: ../templates/orders/shipping/shipping-form.php:6
|
| 1991 |
-
msgid "Provider:"
|
| 1992 |
-
msgstr "Vendeur"
|
| 1993 |
-
|
| 1994 |
-
#: ../templates/orders/shipping/shipping-form.php:8
|
| 1995 |
-
msgid "Custom Provider"
|
| 1996 |
-
msgstr "Vendeur personnalisé"
|
| 1997 |
-
|
| 1998 |
-
#: ../templates/orders/shipping/shipping-form.php:31
|
| 1999 |
-
msgid "Provider Name:"
|
| 2000 |
-
msgstr "Nom du vendeur:"
|
| 2001 |
-
|
| 2002 |
-
#: ../templates/orders/shipping/shipping-form.php:40
|
| 2003 |
-
msgid "Tracking number:"
|
| 2004 |
-
msgstr "Numéro de suivi:"
|
| 2005 |
-
|
| 2006 |
-
#: ../templates/orders/shipping/shipping-form.php:48
|
| 2007 |
-
msgid "Tracking link:"
|
| 2008 |
-
msgstr "Lien de suivi:"
|
| 2009 |
-
|
| 2010 |
-
#: ../templates/orders/shipping/shipping-form.php:58
|
| 2011 |
-
msgid "Date shipped:"
|
| 2012 |
-
msgstr "Date de l'expédition:"
|
| 2013 |
-
|
| 2014 |
-
#: ../templates/orders/shipping/shipping-form.php:66
|
| 2015 |
-
msgid "Preview:"
|
| 2016 |
-
msgstr "Aperçu:"
|
| 2017 |
-
|
| 2018 |
-
#: ../templates/orders/shipping/shipping-form.php:66
|
| 2019 |
-
msgid "Click here to track your shipment"
|
| 2020 |
-
msgstr "Cliquez ici pour votre numero de tracking"
|
| 2021 |
-
|
| 2022 |
-
#: ../templates/orders/shipping/shipping-form.php:75
|
| 2023 |
-
msgid "Update tracking number"
|
| 2024 |
-
msgstr "Update numéro de tracking"
|
| 2025 |
-
|
| 2026 |
-
#: ../templates/orders/shipping/shipping-form.php:77
|
| 2027 |
-
msgid "Mark as shipped"
|
| 2028 |
-
msgstr "Marquer comme envoyé"
|
| 2029 |
-
|
| 2030 |
-
#: ../templates/orders/table-body.php:25
|
| 2031 |
-
#, php-format
|
| 2032 |
-
msgid "Quantity: %d"
|
| 2033 |
-
msgstr "Quantité: %d"
|
| 2034 |
-
|
| 2035 |
-
#~ msgid ""
|
| 2036 |
-
#~ "The default rate the vendor receives for each product. If a product has a "
|
| 2037 |
-
#~ "commission rate already set, this value will be ignored for that product."
|
| 2038 |
-
#~ msgstr ""
|
| 2039 |
-
#~ "Le taux par défaut que le vendeur reçoit pour chaque produit. Si un "
|
| 2040 |
-
#~ "produit a un taux de commission déjà défini, cette valeur sera ignorée "
|
| 2041 |
-
#~ "pour ce produit."
|
| 2042 |
-
|
| 2043 |
-
#~ msgid "Enable HTML for a vendor's shop description by default"
|
| 2044 |
-
#~ msgstr ""
|
| 2045 |
-
#~ "Activer la description HTML pour la boutique d'un vendeur par défaut"
|
| 2046 |
-
|
| 2047 |
-
#~ msgid "Eg: <code>yoursite.com/[your_setting_here]/[vendor_name_here]</code>"
|
| 2048 |
-
#~ msgstr ""
|
| 2049 |
-
#~ "Ex: <code>votre-site.com/[le_reglage_ici]/[le_nom_du_vendeur_ici]</code>"
|
| 2050 |
-
|
| 2051 |
-
#~ msgid ""
|
| 2052 |
-
#~ "This will override the HTML Shop description output on product-archive "
|
| 2053 |
-
#~ "pages."
|
| 2054 |
-
#~ msgstr ""
|
| 2055 |
-
#~ "Ceci remplacera le code HTML de la description de la boutique sur les "
|
| 2056 |
-
#~ "pages archives produit ."
|
| 2057 |
-
|
| 2058 |
-
#~ msgid "View backend sales reports"
|
| 2059 |
-
#~ msgstr "Voir les commandes dans l'administration"
|
| 2060 |
-
|
| 2061 |
-
#~ msgid ""
|
| 2062 |
-
#~ "Graphs and tables via the Reports page in backend. The reports will only "
|
| 2063 |
-
#~ "display sales data that pertain to their products"
|
| 2064 |
-
#~ msgstr ""
|
| 2065 |
-
#~ "Graphiques et tableaux via la page Rapports en backend. Les rapports "
|
| 2066 |
-
#~ "n'affichent que les données sur les ventes qui se rapportent à leurs "
|
| 2067 |
-
#~ "produits"
|
| 2068 |
-
|
| 2069 |
-
#~ msgid ""
|
| 2070 |
-
#~ "Vendors could submit a product through the backend, and an admin would "
|
| 2071 |
-
#~ "approve or deny it"
|
| 2072 |
-
#~ msgstr ""
|
| 2073 |
-
#~ "Les vendeurs peuvent soumettre un produit à travers le backend, et un "
|
| 2074 |
-
#~ "admin devra approuver ou refuser."
|
| 2075 |
-
|
| 2076 |
-
#~ msgid "User payments"
|
| 2077 |
-
#~ msgstr "Paiements Utilisateur"
|
| 2078 |
-
|
| 2079 |
-
#~ msgid ""
|
| 2080 |
-
#~ "Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 2081 |
-
#~ "\">here</a>."
|
| 2082 |
-
#~ msgstr ""
|
| 2083 |
-
#~ "Assurez-vous que vous avez mis à jour vos paramètres de paiements PayPal "
|
| 2084 |
-
#~ "<a href=\"%s\">ici</a>."
|
| 2085 |
-
|
| 2086 |
-
#~ msgid ""
|
| 2087 |
-
#~ "Order unmarked shipped. <br><br>Caution: Clicking Reload in your "
|
| 2088 |
-
#~ "browser will mark the order as shipped and email the buyer again, "
|
| 2089 |
-
#~ "potentially spamming them."
|
| 2090 |
-
#~ msgstr ""
|
| 2091 |
-
#~ "Commande envoyée. <br><br>Attension: Si vous rechargez la page la "
|
| 2092 |
-
#~ "commande peut être marquée envoyée et le courriel pour le vendeur peut "
|
| 2093 |
-
#~ "être envoyé une nouvelle fois, ceci peut être considéré comme du spam."
|
| 2094 |
-
|
| 2095 |
-
#~ msgid ""
|
| 2096 |
-
#~ "Order marked shipped. <br><br>Caution: Clicking Reload in your browser "
|
| 2097 |
-
#~ "will unmark the order as shipped."
|
| 2098 |
-
#~ msgstr ""
|
| 2099 |
-
#~ "Commande envoyée. <br><br>Attension: Si vous rechargez la page la "
|
| 2100 |
-
#~ "commande peut être marquée comme non-envoyée."
|
| 2101 |
-
|
| 2102 |
-
#~ msgid "Extra data"
|
| 2103 |
-
#~ msgstr "Extra data"
|
| 2104 |
-
|
| 2105 |
-
#~ msgid ""
|
| 2106 |
-
#~ "Your account is not setup as a vendor yet. If you would like to "
|
| 2107 |
-
#~ "register, please complete this page!"
|
| 2108 |
-
#~ msgstr ""
|
| 2109 |
-
#~ "Votre compte n'est pas configuré comme vendeur. <br />Si vous souhaitez "
|
| 2110 |
-
#~ "vous inscrire, merci compléter cette page!"
|
| 2111 |
-
|
| 2112 |
-
#~ msgid "Control Center"
|
| 2113 |
-
#~ msgstr "Mon Espace"
|
| 2114 |
-
|
| 2115 |
-
#~ msgid "My shop"
|
| 2116 |
-
#~ msgstr "Ma boutique"
|
| 2117 |
-
|
| 2118 |
-
#~ msgid "My settings"
|
| 2119 |
-
#~ msgstr "Mes paramètres"
|
| 2120 |
-
|
| 2121 |
-
#~ msgid "Submit a product"
|
| 2122 |
-
#~ msgstr "Soumettre un produit"
|
| 2123 |
-
|
| 2124 |
-
#~ msgid "Product Vendor"
|
| 2125 |
-
#~ msgstr "Product Vendor"
|
| 2126 |
-
|
| 2127 |
-
#~ msgid "Product Vendors"
|
| 2128 |
-
#~ msgstr "Vendeurs"
|
| 2129 |
-
|
| 2130 |
-
#~ msgid "Commission Due"
|
| 2131 |
-
#~ msgstr "Commission due"
|
| 2132 |
-
|
| 2133 |
-
#~ msgid ""
|
| 2134 |
-
#~ "<b>Important:</b> Unless you're using the <a href=\"%s\">beta version of "
|
| 2135 |
-
#~ "TRS2</a>, all shipping costs will be given to the shop admin. Vendors "
|
| 2136 |
-
#~ "will not receive shipping costs."
|
| 2137 |
-
#~ msgstr ""
|
| 2138 |
-
#~ "<b>Important:</b> Unless you're using the <a href=\"%s\">beta version of "
|
| 2139 |
-
#~ "TRS2</a>, all shipping costs will be given to the shop admin. Vendors "
|
| 2140 |
-
#~ "will not receive shipping costs."
|
| 2141 |
-
|
| 2142 |
-
#~ msgid ""
|
| 2143 |
-
#~ "The plugin has been updated, but could not be reactivated. Please "
|
| 2144 |
-
#~ "reactivate it manually."
|
| 2145 |
-
#~ msgstr ""
|
| 2146 |
-
#~ "The plugin has been updated, but could not be reactivated. Please "
|
| 2147 |
-
#~ "reactivate it manually."
|
| 2148 |
-
|
| 2149 |
-
#~ msgid "Plugin reactivated successfully."
|
| 2150 |
-
#~ msgstr "Plugin réactivé avec succès."
|
| 2151 |
-
|
| 2152 |
-
#~ msgid "MGates.me Updates"
|
| 2153 |
-
#~ msgstr "Mises a jour MGates.me"
|
| 2154 |
-
|
| 2155 |
-
#~ msgid "MGates.me Plugin Updater"
|
| 2156 |
-
#~ msgstr "MGates.me Plugin Updater"
|
| 2157 |
-
|
| 2158 |
-
#~ msgid "Enter your license key to automatically receive updates."
|
| 2159 |
-
#~ msgstr ""
|
| 2160 |
-
#~ "Entrez votre numéro de licence afin de recevoir automatiquement les mises "
|
| 2161 |
-
#~ "à jour."
|
| 2162 |
-
|
| 2163 |
-
#~ msgid "Check for updates <b>now</b>"
|
| 2164 |
-
#~ msgstr "Check for updates <b>now</b>"
|
| 2165 |
-
|
| 2166 |
-
#~ msgid ""
|
| 2167 |
-
#~ "<b style=\"color: #468847;\">Key deactivated.</b> License key for <i>%s</"
|
| 2168 |
-
#~ "i> has been <b>deactivated</b>."
|
| 2169 |
-
#~ msgstr ""
|
| 2170 |
-
#~ "<b style=\"color: #468847;\">Key deactivated.</b> License key for <i>%s</"
|
| 2171 |
-
#~ "i> has been <b>deactivated</b>."
|
| 2172 |
-
|
| 2173 |
-
#~ msgid ""
|
| 2174 |
-
#~ "<b style=\"color: #B94A48;\">Error.</b> License key for <i>%s</i> could "
|
| 2175 |
-
#~ "not be deactivated."
|
| 2176 |
-
#~ msgstr ""
|
| 2177 |
-
#~ "<b style=\"color: #B94A48;\">Error.</b> License key for <i>%s</i> could "
|
| 2178 |
-
#~ "not be deactivated."
|
| 2179 |
-
|
| 2180 |
-
#~ msgid ""
|
| 2181 |
-
#~ "<b style=\"color: #468847;\">Key activated.</b> License key for <i>%s</i> "
|
| 2182 |
-
#~ "has been <b>activated</b>."
|
| 2183 |
-
#~ msgstr ""
|
| 2184 |
-
#~ "<b style=\"color: #468847;\">Key activated.</b> License key for <i>%s</i> "
|
| 2185 |
-
#~ "has been <b>activated</b>."
|
| 2186 |
-
|
| 2187 |
-
#~ msgid ""
|
| 2188 |
-
#~ "<b style=\"color: #B94A48;\">Erreur.</b> La clé de licence pour <i>%s</i> "
|
| 2189 |
-
#~ "est invalide."
|
| 2190 |
-
#~ msgstr ""
|
| 2191 |
-
#~ "<b style=\"color: #B94A48;\">Erreur.</b> La clé de licence pour <i>%s</i> "
|
| 2192 |
-
#~ "est invalide."
|
| 2193 |
-
|
| 2194 |
-
#~ msgid "Enable MGates.me Plugin Updates."
|
| 2195 |
-
#~ msgstr "Authoriser les mises a jour des plugin MGates.me."
|
| 2196 |
-
|
| 2197 |
-
#~ msgid ""
|
| 2198 |
-
#~ "<a href=\"%1$s\">Add your license keys</a> to enable automatic plugin "
|
| 2199 |
-
#~ "updates."
|
| 2200 |
-
#~ msgstr ""
|
| 2201 |
-
#~ "<a href=\"%1$s\">Ajouter votre clé de licence</a> pour activer le plugin "
|
| 2202 |
-
#~ "automatiquement updates."
|
| 2203 |
-
|
| 2204 |
-
#~ msgid "Hide This Message"
|
| 2205 |
-
#~ msgstr "Masquer ce message"
|
| 2206 |
-
|
| 2207 |
-
#~ msgid "Your account has not yet been approved to become a vendor."
|
| 2208 |
-
#~ msgstr "Votre compte n'a pas encore été approuvé pour devenir Vendeur."
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/wcvendors-it_IT.mo
DELETED
|
Binary file
|
languages/wcvendors-it_IT.po
DELETED
|
@@ -1,1676 +0,0 @@
|
|
| 1 |
-
# Woocommerce translation strings
|
| 2 |
-
# Copyright (C) 2011-2012
|
| 3 |
-
# This file is distributed under the same license as the Woocommerce package.
|
| 4 |
-
# Last Updated: August 17, 2013.
|
| 5 |
-
msgid ""
|
| 6 |
-
msgstr ""
|
| 7 |
-
"Project-Id-Version: WC Vendors\n"
|
| 8 |
-
"Report-Msgid-Bugs-To: Woocommerce <info@Woocommerce.com>\n"
|
| 9 |
-
"POT-Creation-Date: 2015-01-08 14:31+1000\n"
|
| 10 |
-
"PO-Revision-Date: 2015-01-26 18:10+0100\n"
|
| 11 |
-
"Last-Translator: ItsEasy <ncurioni@itseasy.com>\n"
|
| 12 |
-
"Language-Team: Nicole Curioni | NC web.design <info@nicolecurioni.com>\n"
|
| 13 |
-
"Language: it_IT\n"
|
| 14 |
-
"MIME-Version: 1.0\n"
|
| 15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 17 |
-
"X-Generator: Poedit 1.7.3\n"
|
| 18 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 19 |
-
|
| 20 |
-
#: classes/admin/class-admin-page.php:28
|
| 21 |
-
msgid "Vendors shipped"
|
| 22 |
-
msgstr "Il venditore ha spedito"
|
| 23 |
-
|
| 24 |
-
#: classes/admin/class-admin-page.php:51
|
| 25 |
-
msgid "Vendors Shipped"
|
| 26 |
-
msgstr "Il venditore ha spedito"
|
| 27 |
-
|
| 28 |
-
#: classes/admin/class-admin-page.php:73
|
| 29 |
-
#: classes/admin/class-admin-page.php:133
|
| 30 |
-
#: classes/admin/class-admin-reports.php:345
|
| 31 |
-
#: classes/admin/class-product-meta.php:148
|
| 32 |
-
#: classes/admin/class-product-meta.php:164
|
| 33 |
-
#: views/dashboard/reports.php:19
|
| 34 |
-
msgid "Commission"
|
| 35 |
-
msgstr "Commissione"
|
| 36 |
-
|
| 37 |
-
#: classes/admin/class-admin-page.php:252
|
| 38 |
-
#: classes/admin/class-admin-reports.php:175
|
| 39 |
-
#: views/dashboard/reports.php:17 views/emails/admin-new-order.php:22
|
| 40 |
-
#: views/emails/notify-vendor-shipped.php:22
|
| 41 |
-
msgid "Product"
|
| 42 |
-
msgstr "Prodotto"
|
| 43 |
-
|
| 44 |
-
#: classes/admin/class-admin-page.php:253
|
| 45 |
-
msgid "Order ID"
|
| 46 |
-
msgstr "ID ordine"
|
| 47 |
-
|
| 48 |
-
#: classes/admin/class-admin-page.php:254
|
| 49 |
-
#: classes/admin/class-admin-reports.php:176
|
| 50 |
-
#: classes/admin/class-product-meta.php:44
|
| 51 |
-
#: classes/admin/class-product-meta.php:184
|
| 52 |
-
#: classes/admin/class-product-meta.php:220
|
| 53 |
-
msgid "Vendor"
|
| 54 |
-
msgstr "Venditore"
|
| 55 |
-
|
| 56 |
-
#: classes/admin/class-admin-page.php:255
|
| 57 |
-
#: classes/admin/class-admin-reports.php:177
|
| 58 |
-
#: classes/admin/class-admin-reports.php:350
|
| 59 |
-
#: classes/admin/class-admin-reports.php:374
|
| 60 |
-
#: views/dashboard/orders.php:25
|
| 61 |
-
msgid "Total"
|
| 62 |
-
msgstr "Totale"
|
| 63 |
-
|
| 64 |
-
#: classes/admin/class-admin-page.php:256
|
| 65 |
-
#: classes/admin/class-admin-reports.php:179
|
| 66 |
-
msgid "Status"
|
| 67 |
-
msgstr "Stato"
|
| 68 |
-
|
| 69 |
-
#: classes/admin/class-admin-page.php:257
|
| 70 |
-
#: classes/front/orders/class-orders.php:216
|
| 71 |
-
#: views/dashboard/orders.php:26
|
| 72 |
-
msgid "Date"
|
| 73 |
-
msgstr "Data"
|
| 74 |
-
|
| 75 |
-
#: classes/admin/class-admin-page.php:294
|
| 76 |
-
msgid "Mark paid"
|
| 77 |
-
msgstr "Segna come pagato"
|
| 78 |
-
|
| 79 |
-
#: classes/admin/class-admin-page.php:295
|
| 80 |
-
msgid "Mark due"
|
| 81 |
-
msgstr "Segna come dovuto"
|
| 82 |
-
|
| 83 |
-
#: classes/admin/class-admin-page.php:296
|
| 84 |
-
msgid "Mark reversed"
|
| 85 |
-
msgstr "Segna come revocato"
|
| 86 |
-
|
| 87 |
-
#: classes/admin/class-admin-page.php:313
|
| 88 |
-
msgid "Filter"
|
| 89 |
-
msgstr "Filtro"
|
| 90 |
-
|
| 91 |
-
#: classes/admin/class-admin-page.php:347
|
| 92 |
-
msgid "Show all dates"
|
| 93 |
-
msgstr "Visualizza tutti i dati"
|
| 94 |
-
|
| 95 |
-
#: classes/admin/class-admin-page.php:360
|
| 96 |
-
#, php-format
|
| 97 |
-
msgid "%1$s %2$d"
|
| 98 |
-
msgstr "%1$s %2$d"
|
| 99 |
-
|
| 100 |
-
#: classes/admin/class-admin-page.php:386
|
| 101 |
-
msgid "Commission marked paid."
|
| 102 |
-
msgstr "Commissione segnata come pagata."
|
| 103 |
-
|
| 104 |
-
#: classes/admin/class-admin-page.php:393
|
| 105 |
-
msgid "Commission marked due."
|
| 106 |
-
msgstr "Commissione segnata come dovuta."
|
| 107 |
-
|
| 108 |
-
#: classes/admin/class-admin-page.php:400
|
| 109 |
-
msgid "Commission marked reversed."
|
| 110 |
-
msgstr "Commissione segnata come revocata."
|
| 111 |
-
|
| 112 |
-
#: classes/admin/class-admin-reports.php:41
|
| 113 |
-
#: classes/admin/class-admin-users.php:349
|
| 114 |
-
msgid "WC Vendors"
|
| 115 |
-
msgstr "WC Vendors"
|
| 116 |
-
|
| 117 |
-
#: classes/admin/class-admin-reports.php:44
|
| 118 |
-
msgid "Overview"
|
| 119 |
-
msgstr "Panoramica"
|
| 120 |
-
|
| 121 |
-
#: classes/admin/class-admin-reports.php:50
|
| 122 |
-
msgid "Commission by vendor"
|
| 123 |
-
msgstr "Commissione del venditore"
|
| 124 |
-
|
| 125 |
-
#: classes/admin/class-admin-reports.php:56
|
| 126 |
-
msgid "Commission by product"
|
| 127 |
-
msgstr "Commissione del prodotto"
|
| 128 |
-
|
| 129 |
-
#: classes/admin/class-admin-reports.php:115
|
| 130 |
-
#: views/dashboard/date-picker.php:3
|
| 131 |
-
msgid "From:"
|
| 132 |
-
msgstr "Da:"
|
| 133 |
-
|
| 134 |
-
#: classes/admin/class-admin-reports.php:119
|
| 135 |
-
#: views/dashboard/date-picker.php:7
|
| 136 |
-
msgid "To:"
|
| 137 |
-
msgstr "A:"
|
| 138 |
-
|
| 139 |
-
#: classes/admin/class-admin-reports.php:122
|
| 140 |
-
#: classes/admin/class-admin-reports.php:283
|
| 141 |
-
#: views/dashboard/date-picker.php:12
|
| 142 |
-
msgid "Show"
|
| 143 |
-
msgstr "Mostra"
|
| 144 |
-
|
| 145 |
-
#: classes/admin/class-admin-reports.php:133
|
| 146 |
-
msgid "Total paid in range"
|
| 147 |
-
msgstr "Totale pagato in gamma"
|
| 148 |
-
|
| 149 |
-
#: classes/admin/class-admin-reports.php:136
|
| 150 |
-
#: classes/admin/class-admin-reports.php:143
|
| 151 |
-
#: classes/admin/class-admin-reports.php:150
|
| 152 |
-
msgid "n/a"
|
| 153 |
-
msgstr "n/a"
|
| 154 |
-
|
| 155 |
-
#: classes/admin/class-admin-reports.php:140
|
| 156 |
-
msgid "Total due in range"
|
| 157 |
-
msgstr "Totale dovuto nel range"
|
| 158 |
-
|
| 159 |
-
#: classes/admin/class-admin-reports.php:147
|
| 160 |
-
msgid "Total reversed in range"
|
| 161 |
-
msgstr "Totale invertita nel range"
|
| 162 |
-
|
| 163 |
-
#: classes/admin/class-admin-reports.php:157
|
| 164 |
-
msgid "Recent Commission"
|
| 165 |
-
msgstr "Commissione Recente"
|
| 166 |
-
|
| 167 |
-
#: classes/admin/class-admin-reports.php:174
|
| 168 |
-
#: classes/front/orders/class-orders.php:208
|
| 169 |
-
#: views/dashboard/orders.php:23
|
| 170 |
-
msgid "Order"
|
| 171 |
-
msgstr "Ordine"
|
| 172 |
-
|
| 173 |
-
#: classes/admin/class-admin-reports.php:178
|
| 174 |
-
msgid "Date & Time"
|
| 175 |
-
msgstr "Data & Orario"
|
| 176 |
-
|
| 177 |
-
#: classes/admin/class-admin-reports.php:187
|
| 178 |
-
msgid "N/A"
|
| 179 |
-
msgstr "N/A"
|
| 180 |
-
|
| 181 |
-
#: classes/admin/class-admin-reports.php:192
|
| 182 |
-
msgid "D j M Y \\a\\t h:ia"
|
| 183 |
-
msgstr "D j M Y \\a\\t h:ia"
|
| 184 |
-
|
| 185 |
-
#: classes/admin/class-admin-reports.php:201
|
| 186 |
-
msgid "No commission yet"
|
| 187 |
-
msgstr "Nessuna commissione ancora"
|
| 188 |
-
|
| 189 |
-
#: classes/admin/class-admin-reports.php:232
|
| 190 |
-
msgid "Show:"
|
| 191 |
-
msgstr "Mostra:"
|
| 192 |
-
|
| 193 |
-
#: classes/admin/class-admin-reports.php:243
|
| 194 |
-
msgid "Year"
|
| 195 |
-
msgstr "Anno"
|
| 196 |
-
|
| 197 |
-
#: classes/admin/class-admin-reports.php:276
|
| 198 |
-
msgid "Select a vendor…"
|
| 199 |
-
msgstr "Seleziona un venditore…"
|
| 200 |
-
|
| 201 |
-
#: classes/admin/class-admin-reports.php:344
|
| 202 |
-
msgid "Month"
|
| 203 |
-
msgstr "Mese"
|
| 204 |
-
|
| 205 |
-
#: classes/admin/class-admin-reports.php:346
|
| 206 |
-
msgid "Tax"
|
| 207 |
-
msgstr "Tassa"
|
| 208 |
-
|
| 209 |
-
#: classes/admin/class-admin-reports.php:347
|
| 210 |
-
#: views/dashboard/orders.php:24 views/orders/orders.php:113
|
| 211 |
-
msgid "Shipping"
|
| 212 |
-
msgstr "Spedizione"
|
| 213 |
-
|
| 214 |
-
#: classes/admin/class-admin-reports.php:348
|
| 215 |
-
msgid "Reversed"
|
| 216 |
-
msgstr "Revocato"
|
| 217 |
-
|
| 218 |
-
#: classes/admin/class-admin-reports.php:349
|
| 219 |
-
msgid "Paid"
|
| 220 |
-
msgstr "Pagato"
|
| 221 |
-
|
| 222 |
-
#: classes/admin/class-admin-users.php:359
|
| 223 |
-
msgid "Enable HTML for the shop description"
|
| 224 |
-
msgstr "Abilita l'Html per la descrizione del negozio"
|
| 225 |
-
|
| 226 |
-
#: classes/admin/class-admin-users.php:365
|
| 227 |
-
msgid "Shop name"
|
| 228 |
-
msgstr "Nome del negozio"
|
| 229 |
-
|
| 230 |
-
#: classes/admin/class-admin-users.php:372
|
| 231 |
-
msgid "PayPal E-mail"
|
| 232 |
-
msgstr "E-mail PayPal"
|
| 233 |
-
|
| 234 |
-
#: classes/admin/class-admin-users.php:373
|
| 235 |
-
msgid "required"
|
| 236 |
-
msgstr "Richiesta"
|
| 237 |
-
|
| 238 |
-
#: classes/admin/class-admin-users.php:380
|
| 239 |
-
msgid "Commission rate"
|
| 240 |
-
msgstr "Tasso di Commissione"
|
| 241 |
-
|
| 242 |
-
#: classes/admin/class-admin-users.php:381
|
| 243 |
-
#: classes/admin/class-product-meta.php:171
|
| 244 |
-
msgid "Leave blank for default"
|
| 245 |
-
msgstr "Lascia bianco di default"
|
| 246 |
-
|
| 247 |
-
#: classes/admin/class-admin-users.php:387
|
| 248 |
-
#: classes/front/class-vendor-shop.php:103
|
| 249 |
-
#: views/dashboard/settings/seller-info.php:3
|
| 250 |
-
msgid "Seller info"
|
| 251 |
-
msgstr "Informazioni venditore"
|
| 252 |
-
|
| 253 |
-
#: classes/admin/class-admin-users.php:392
|
| 254 |
-
msgid "Shop description"
|
| 255 |
-
msgstr "Descrizione del negozio"
|
| 256 |
-
|
| 257 |
-
#: classes/admin/class-vendor-applicants.php:26
|
| 258 |
-
msgid "Approve"
|
| 259 |
-
msgstr "Approva"
|
| 260 |
-
|
| 261 |
-
#: classes/admin/class-vendor-applicants.php:27
|
| 262 |
-
msgid "Deny"
|
| 263 |
-
msgstr "Nega"
|
| 264 |
-
|
| 265 |
-
#: classes/admin/class-vendor-applicants.php:71
|
| 266 |
-
msgid "Vendor has been <b>denied</b>."
|
| 267 |
-
msgstr "Il venditore <b>non è stato accettato</b>."
|
| 268 |
-
|
| 269 |
-
#: classes/admin/class-vendor-applicants.php:82
|
| 270 |
-
msgid "Vendor has been <b>approved</b>."
|
| 271 |
-
msgstr "Il venditore è stato <b>approvato</b>."
|
| 272 |
-
|
| 273 |
-
#: classes/admin/class-vendor-applicants.php:96
|
| 274 |
-
msgid "Pending Vendors"
|
| 275 |
-
msgstr "Venditori in sospeso"
|
| 276 |
-
|
| 277 |
-
#: classes/admin/emails/class-emails.php:55
|
| 278 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:70
|
| 279 |
-
msgid "pending"
|
| 280 |
-
msgstr "ricevuta"
|
| 281 |
-
|
| 282 |
-
#: classes/admin/emails/class-emails.php:57
|
| 283 |
-
msgid "approved"
|
| 284 |
-
msgstr "approvata"
|
| 285 |
-
|
| 286 |
-
#: classes/admin/emails/class-emails.php:59
|
| 287 |
-
msgid "denied"
|
| 288 |
-
msgstr "negata"
|
| 289 |
-
|
| 290 |
-
#: classes/admin/emails/class-emails.php:87
|
| 291 |
-
#: classes/front/class-vendor-cart.php:60
|
| 292 |
-
#: classes/front/class-vendor-shop.php:178
|
| 293 |
-
msgid "Sold by: "
|
| 294 |
-
msgstr "Venduto da:"
|
| 295 |
-
|
| 296 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:28
|
| 297 |
-
msgid "Vendor Application"
|
| 298 |
-
msgstr "Richiesta venditore"
|
| 299 |
-
|
| 300 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:29
|
| 301 |
-
msgid "Vendor application will either be approved, denied, or pending."
|
| 302 |
-
msgstr "La richiesta del venditore sarà approvata, negata o messa in sospeso."
|
| 303 |
-
|
| 304 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:31
|
| 305 |
-
msgid "Application {status}"
|
| 306 |
-
msgstr "Richiesta {status}"
|
| 307 |
-
|
| 308 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:32
|
| 309 |
-
msgid "[{blogname}] Your vendor application has been {status}"
|
| 310 |
-
msgstr "[{blogname}] La richiesta per diventare venditore è stata {status}"
|
| 311 |
-
|
| 312 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:123
|
| 313 |
-
#: classes/admin/emails/class-wc-notify-admin.php:129
|
| 314 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:163
|
| 315 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:230
|
| 316 |
-
msgid "Enable/Disable"
|
| 317 |
-
msgstr "Abilita/Disabilita"
|
| 318 |
-
|
| 319 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:125
|
| 320 |
-
#: classes/admin/emails/class-wc-notify-admin.php:131
|
| 321 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:165
|
| 322 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:232
|
| 323 |
-
msgid "Enable this email notification"
|
| 324 |
-
msgstr "Abilita questa notificazione email"
|
| 325 |
-
|
| 326 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:129
|
| 327 |
-
#: classes/admin/emails/class-wc-notify-admin.php:135
|
| 328 |
-
msgid "Recipient(s)"
|
| 329 |
-
msgstr "Destinatari"
|
| 330 |
-
|
| 331 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:131
|
| 332 |
-
#: classes/admin/emails/class-wc-notify-admin.php:137
|
| 333 |
-
#, php-format
|
| 334 |
-
msgid ""
|
| 335 |
-
"Enter recipients (comma separated) for this email. Defaults to <code>%s</"
|
| 336 |
-
"code>."
|
| 337 |
-
msgstr ""
|
| 338 |
-
"Inserisci i destinatari (separati da virgola) per questa email. Default "
|
| 339 |
-
"<code>%s</code>."
|
| 340 |
-
|
| 341 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:136
|
| 342 |
-
#: classes/admin/emails/class-wc-notify-admin.php:142
|
| 343 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:169
|
| 344 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:236
|
| 345 |
-
msgid "Subject"
|
| 346 |
-
msgstr "Soggetto"
|
| 347 |
-
|
| 348 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:138
|
| 349 |
-
#: classes/admin/emails/class-wc-notify-admin.php:144
|
| 350 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:171
|
| 351 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:238
|
| 352 |
-
#, php-format
|
| 353 |
-
msgid ""
|
| 354 |
-
"This controls the email subject line. Leave blank to use the default "
|
| 355 |
-
"subject: <code>%s</code>."
|
| 356 |
-
msgstr ""
|
| 357 |
-
"Questo controlla la linea del soggetto dell'email. Lascia bianco per usare "
|
| 358 |
-
"il soggetto di default: <code>%s</code>."
|
| 359 |
-
|
| 360 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:143
|
| 361 |
-
#: classes/admin/emails/class-wc-notify-admin.php:149
|
| 362 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:176
|
| 363 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:243
|
| 364 |
-
msgid "Email Heading"
|
| 365 |
-
msgstr "Testata email."
|
| 366 |
-
|
| 367 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:145
|
| 368 |
-
#: classes/admin/emails/class-wc-notify-admin.php:151
|
| 369 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:178
|
| 370 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:245
|
| 371 |
-
#, php-format
|
| 372 |
-
msgid ""
|
| 373 |
-
"This controls the main heading contained within the email notification. "
|
| 374 |
-
"Leave blank to use the default heading: <code>%s</code>."
|
| 375 |
-
msgstr ""
|
| 376 |
-
"Questo controlla il contenuto della testata principale senza notificazione "
|
| 377 |
-
"mail. Lascia bianco per usare la testata di default: <code>%s</code>."
|
| 378 |
-
|
| 379 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:150
|
| 380 |
-
#: classes/admin/emails/class-wc-notify-admin.php:156
|
| 381 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:183
|
| 382 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:250
|
| 383 |
-
msgid "Email type"
|
| 384 |
-
msgstr "Tipo email"
|
| 385 |
-
|
| 386 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:152
|
| 387 |
-
#: classes/admin/emails/class-wc-notify-admin.php:158
|
| 388 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:185
|
| 389 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:252
|
| 390 |
-
msgid "Choose which format of email to send."
|
| 391 |
-
msgstr "Scegli quale formato di email spedire."
|
| 392 |
-
|
| 393 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:156
|
| 394 |
-
#: classes/admin/emails/class-wc-notify-admin.php:162
|
| 395 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:189
|
| 396 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:256
|
| 397 |
-
msgid "Plain text"
|
| 398 |
-
msgstr "Testo normale"
|
| 399 |
-
|
| 400 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:157
|
| 401 |
-
#: classes/admin/emails/class-wc-notify-admin.php:163
|
| 402 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:190
|
| 403 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:257
|
| 404 |
-
msgid "HTML"
|
| 405 |
-
msgstr "HTML"
|
| 406 |
-
|
| 407 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:158
|
| 408 |
-
#: classes/admin/emails/class-wc-notify-admin.php:164
|
| 409 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:191
|
| 410 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:258
|
| 411 |
-
msgid "Multipart"
|
| 412 |
-
msgstr "Multipart"
|
| 413 |
-
|
| 414 |
-
#: classes/admin/emails/class-wc-notify-admin.php:28
|
| 415 |
-
msgid "New Vendor Product"
|
| 416 |
-
msgstr "Nuovo prodotto del venditore"
|
| 417 |
-
|
| 418 |
-
#: classes/admin/emails/class-wc-notify-admin.php:29
|
| 419 |
-
msgid "New order emails are sent when a new product is submitted by a vendor"
|
| 420 |
-
msgstr ""
|
| 421 |
-
"Le email del nuovo ordine sono inviate quando un nuovo prodotto è inserito "
|
| 422 |
-
"da un venditore."
|
| 423 |
-
|
| 424 |
-
#: classes/admin/emails/class-wc-notify-admin.php:31
|
| 425 |
-
msgid "New product submitted: {product_name}"
|
| 426 |
-
msgstr "Nuovo prodotto inserito: {product_name}"
|
| 427 |
-
|
| 428 |
-
#: classes/admin/emails/class-wc-notify-admin.php:32
|
| 429 |
-
msgid "[{blogname}] New product submitted by {vendor_name} - {product_name}"
|
| 430 |
-
msgstr "[{blogname}] Nuovo prodotto inserito da {vendor_name} - {product_name}"
|
| 431 |
-
|
| 432 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:28
|
| 433 |
-
msgid "Vendor has shipped"
|
| 434 |
-
msgstr "Il venditore ha spedito l'ordine"
|
| 435 |
-
|
| 436 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:29
|
| 437 |
-
msgid ""
|
| 438 |
-
"An email is sent when a vendor has marked one of their orders as shipped."
|
| 439 |
-
msgstr "Un email sarà inviata quando un venditore segna l'ordine come inviato."
|
| 440 |
-
|
| 441 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:31
|
| 442 |
-
msgid "Your order has been shipped"
|
| 443 |
-
msgstr "Il tuo ordine è stato spedito"
|
| 444 |
-
|
| 445 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:32
|
| 446 |
-
msgid ""
|
| 447 |
-
"[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 448 |
-
msgstr ""
|
| 449 |
-
"[{blogname}] Il tuo ordine è stato spedito ({order_number}) - {order_date}"
|
| 450 |
-
|
| 451 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:112
|
| 452 |
-
msgid "Subtotal:"
|
| 453 |
-
msgstr "Subtotale:"
|
| 454 |
-
|
| 455 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:27
|
| 456 |
-
msgid "Notify vendors"
|
| 457 |
-
msgstr "Notifica venditori"
|
| 458 |
-
|
| 459 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:28
|
| 460 |
-
msgid "New order emails are sent when an order is received/paid by a customer."
|
| 461 |
-
msgstr ""
|
| 462 |
-
"Le email dei nuovo ordine sono inviate quando un ordine è ricevuto/pagato da "
|
| 463 |
-
"un cliente."
|
| 464 |
-
|
| 465 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:30
|
| 466 |
-
msgid "New customer order"
|
| 467 |
-
msgstr "Nuovo ordine del cliente"
|
| 468 |
-
|
| 469 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:31
|
| 470 |
-
msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
|
| 471 |
-
msgstr "[{blogname}] Nuovo ordine del cliente ({order_number}) - {order_date}"
|
| 472 |
-
|
| 473 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:103
|
| 474 |
-
msgid "Commission Subtotal:"
|
| 475 |
-
msgstr "Subtotale commissione:"
|
| 476 |
-
|
| 477 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:110
|
| 478 |
-
msgid "Shipping Subtotal:"
|
| 479 |
-
msgstr "Subtotale Spedizione:"
|
| 480 |
-
|
| 481 |
-
#: classes/admin/settings/classes/sf-class-format-options.php:211
|
| 482 |
-
#: classes/admin/settings/classes/sf-class-settings.php:773
|
| 483 |
-
msgid "Select a page..."
|
| 484 |
-
msgstr "Seleziona una pagina..."
|
| 485 |
-
|
| 486 |
-
#: classes/admin/settings/classes/sf-class-settings.php:153
|
| 487 |
-
#: views/dashboard/settings/settings.php:1
|
| 488 |
-
msgid "Settings"
|
| 489 |
-
msgstr "Impostazioni"
|
| 490 |
-
|
| 491 |
-
#: classes/admin/settings/classes/sf-class-settings.php:297
|
| 492 |
-
msgid "Could not load settings at: "
|
| 493 |
-
msgstr "Impossibile caricare le impostazioni a:"
|
| 494 |
-
|
| 495 |
-
#: classes/admin/settings/classes/sf-class-settings.php:297
|
| 496 |
-
msgid "Error - WP Settings Framework"
|
| 497 |
-
msgstr "Errore - Impostazioni Framework WP"
|
| 498 |
-
|
| 499 |
-
#: classes/admin/settings/classes/sf-class-settings.php:363
|
| 500 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:96
|
| 501 |
-
msgid "Settings saved."
|
| 502 |
-
msgstr "Impostazioni salvate."
|
| 503 |
-
|
| 504 |
-
#: classes/admin/settings/classes/sf-class-settings.php:479
|
| 505 |
-
#, php-format
|
| 506 |
-
msgid "Save %s changes"
|
| 507 |
-
msgstr "Salva %s cambiamenti"
|
| 508 |
-
|
| 509 |
-
#: classes/admin/settings/sf-options.php:4
|
| 510 |
-
msgid "General"
|
| 511 |
-
msgstr "Generale"
|
| 512 |
-
|
| 513 |
-
#: classes/admin/settings/sf-options.php:5
|
| 514 |
-
msgid "General options"
|
| 515 |
-
msgstr "Opzioni generali"
|
| 516 |
-
|
| 517 |
-
#: classes/admin/settings/sf-options.php:5
|
| 518 |
-
#: classes/admin/settings/sf-options.php:45
|
| 519 |
-
#: classes/admin/settings/sf-options.php:223
|
| 520 |
-
msgid " "
|
| 521 |
-
msgstr ""
|
| 522 |
-
|
| 523 |
-
#: classes/admin/settings/sf-options.php:8
|
| 524 |
-
msgid "Default commission (%)"
|
| 525 |
-
msgstr "Commissione di default (%)"
|
| 526 |
-
|
| 527 |
-
#: classes/admin/settings/sf-options.php:9
|
| 528 |
-
msgid ""
|
| 529 |
-
"The default rate the vendor receives for each product. If a product has a "
|
| 530 |
-
"commission rate already set, this value will be ignored for that product."
|
| 531 |
-
msgstr ""
|
| 532 |
-
"Il tasso di default che il venditore riceve per ogni prodotto. Se un "
|
| 533 |
-
"prodotto ha un tasso di commissione già settato, questovalore sarà ignorato "
|
| 534 |
-
"per quel prodotto."
|
| 535 |
-
|
| 536 |
-
#: classes/admin/settings/sf-options.php:20
|
| 537 |
-
msgid "Registration"
|
| 538 |
-
msgstr "Registrazione"
|
| 539 |
-
|
| 540 |
-
#: classes/admin/settings/sf-options.php:21
|
| 541 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 542 |
-
msgstr "Consentire agli utenti o agli ospiti di diventare venditori"
|
| 543 |
-
|
| 544 |
-
#: classes/admin/settings/sf-options.php:22
|
| 545 |
-
msgid ""
|
| 546 |
-
"This will show a checkbox on the My Account page's registration form asking "
|
| 547 |
-
"if the user would like to apply to be a vendor. Also, on the Vendor "
|
| 548 |
-
"Dashboard, users can apply to become a vendor."
|
| 549 |
-
msgstr ""
|
| 550 |
-
"Questo mostrerà un checkbox sul modulo di registrazione della pagina del "
|
| 551 |
-
"\"Mio account\" chiedendo se l'utente vuole fare domanda per essere "
|
| 552 |
-
"venditore. Inoltre, sulla Dashboard del venditore, gli utenti possono "
|
| 553 |
-
"diventare venditori."
|
| 554 |
-
|
| 555 |
-
#: classes/admin/settings/sf-options.php:29
|
| 556 |
-
msgid "Approve vendor applications manually"
|
| 557 |
-
msgstr "Approva le richieste del venditore manualmente"
|
| 558 |
-
|
| 559 |
-
#: classes/admin/settings/sf-options.php:30
|
| 560 |
-
msgid ""
|
| 561 |
-
"With this unchecked, all vendor applications are automatically accepted. "
|
| 562 |
-
"Otherwise, you must approve each manually."
|
| 563 |
-
msgstr ""
|
| 564 |
-
"Con questo non spuntato, tutte le richieste del venditore sono "
|
| 565 |
-
"automaticamente accettate. Diversamente, tu puoi approvarle manualmente."
|
| 566 |
-
|
| 567 |
-
#: classes/admin/settings/sf-options.php:37
|
| 568 |
-
msgid "Taxes"
|
| 569 |
-
msgstr "Tasse"
|
| 570 |
-
|
| 571 |
-
#: classes/admin/settings/sf-options.php:38
|
| 572 |
-
msgid "Give vendors any tax collected per-product"
|
| 573 |
-
msgstr "Dai ai venditori ogni tassa collezionata per prodotto"
|
| 574 |
-
|
| 575 |
-
#: classes/admin/settings/sf-options.php:39
|
| 576 |
-
msgid ""
|
| 577 |
-
"The tax collected on a vendor's product will be given to him in its entirety"
|
| 578 |
-
msgstr ""
|
| 579 |
-
"La tassa raccolta sul prodotto del venditore sarà data a lui per intero"
|
| 580 |
-
|
| 581 |
-
#: classes/admin/settings/sf-options.php:45
|
| 582 |
-
msgid "Shop options"
|
| 583 |
-
msgstr "Opzioni negozio"
|
| 584 |
-
|
| 585 |
-
#: classes/admin/settings/sf-options.php:48
|
| 586 |
-
msgid "Shop HTML"
|
| 587 |
-
msgstr "HTML negozio"
|
| 588 |
-
|
| 589 |
-
#: classes/admin/settings/sf-options.php:49
|
| 590 |
-
msgid "Enable HTML for a vendor's shop description by default"
|
| 591 |
-
msgstr "Abilita l'HTML per la descrizione del nogozio del venditore di default"
|
| 592 |
-
|
| 593 |
-
#: classes/admin/settings/sf-options.php:56
|
| 594 |
-
msgid "Vendor shop page"
|
| 595 |
-
msgstr "Pagina del negozio del venditore"
|
| 596 |
-
|
| 597 |
-
#: classes/admin/settings/sf-options.php:57
|
| 598 |
-
msgid "Eg: <code>yoursite.com/[your_setting_here]/[vendor_name_here]</code>"
|
| 599 |
-
msgstr "Eg: <code>tuosito.com/[your_setting_here]/[vendor_name_here]</code>"
|
| 600 |
-
|
| 601 |
-
#: classes/admin/settings/sf-options.php:64
|
| 602 |
-
msgid "Shop Headers"
|
| 603 |
-
msgstr "Testata Negozio"
|
| 604 |
-
|
| 605 |
-
#: classes/admin/settings/sf-options.php:65
|
| 606 |
-
msgid "Enable vendor shop headers"
|
| 607 |
-
msgstr "Abilita testata negozio"
|
| 608 |
-
|
| 609 |
-
#: classes/admin/settings/sf-options.php:66
|
| 610 |
-
msgid ""
|
| 611 |
-
"This will override the HTML Shop description output on product-archive pages."
|
| 612 |
-
msgstr ""
|
| 613 |
-
"Questo scovrascriverà la descrizione in HTML del negozio, nelle pagine di "
|
| 614 |
-
"archivio dei prodotti."
|
| 615 |
-
|
| 616 |
-
#: classes/admin/settings/sf-options.php:72
|
| 617 |
-
#: classes/admin/settings/sf-options.php:198
|
| 618 |
-
msgid "Products"
|
| 619 |
-
msgstr "Prodotti"
|
| 620 |
-
|
| 621 |
-
#: classes/admin/settings/sf-options.php:73
|
| 622 |
-
msgid "Product Add Page"
|
| 623 |
-
msgstr "Pagina aggiunta prodotto"
|
| 624 |
-
|
| 625 |
-
#: classes/admin/settings/sf-options.php:73
|
| 626 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 627 |
-
msgstr ""
|
| 628 |
-
"Configura cosa nascondere a tutti i venditori quando aggiungono un prodotto"
|
| 629 |
-
|
| 630 |
-
#: classes/admin/settings/sf-options.php:76
|
| 631 |
-
msgid "Left side panel"
|
| 632 |
-
msgstr "Pannello laterale sinistro"
|
| 633 |
-
|
| 634 |
-
#: classes/admin/settings/sf-options.php:77
|
| 635 |
-
msgid "Hide these areas of the add product page for vendors"
|
| 636 |
-
msgstr "Nascondi queste aree di pagina aggiunta prodotto per i venditori"
|
| 637 |
-
|
| 638 |
-
#: classes/admin/settings/sf-options.php:91
|
| 639 |
-
msgid "Types"
|
| 640 |
-
msgstr "Tipi"
|
| 641 |
-
|
| 642 |
-
#: classes/admin/settings/sf-options.php:92
|
| 643 |
-
msgid "Hide these product types from the vendor"
|
| 644 |
-
msgstr "Nascondi questi tipi di prodotti al venditore"
|
| 645 |
-
|
| 646 |
-
#: classes/admin/settings/sf-options.php:105
|
| 647 |
-
msgid "Type options"
|
| 648 |
-
msgstr "Opzioni di tipo"
|
| 649 |
-
|
| 650 |
-
#: classes/admin/settings/sf-options.php:106
|
| 651 |
-
msgid "Hide these product options from the vendor"
|
| 652 |
-
msgstr "Nascondi queste opzioni del prodotto al venditore"
|
| 653 |
-
|
| 654 |
-
#: classes/admin/settings/sf-options.php:117
|
| 655 |
-
msgid "Miscellaneous"
|
| 656 |
-
msgstr "Varie"
|
| 657 |
-
|
| 658 |
-
#: classes/admin/settings/sf-options.php:129
|
| 659 |
-
msgid "Stylesheet"
|
| 660 |
-
msgstr "Foglio di stile"
|
| 661 |
-
|
| 662 |
-
#: classes/admin/settings/sf-options.php:130
|
| 663 |
-
msgid ""
|
| 664 |
-
"You can add CSS in this textarea, which will be loaded on the product add/"
|
| 665 |
-
"edit page for vendors."
|
| 666 |
-
msgstr ""
|
| 667 |
-
"Puoi aggiungere codice CSS in questa area di testo, che sarà caricato sulla "
|
| 668 |
-
"pagina aggiungi/modifica dei venditori."
|
| 669 |
-
|
| 670 |
-
#: classes/admin/settings/sf-options.php:136
|
| 671 |
-
msgid "Capabilities"
|
| 672 |
-
msgstr "Capacità"
|
| 673 |
-
|
| 674 |
-
#: classes/admin/settings/sf-options.php:137
|
| 675 |
-
msgid "Permissions"
|
| 676 |
-
msgstr "Autorizzazioni"
|
| 677 |
-
|
| 678 |
-
#: classes/admin/settings/sf-options.php:137
|
| 679 |
-
msgid "General permissions used around the shop"
|
| 680 |
-
msgstr "Autorizzazioni generali usati per il negozio"
|
| 681 |
-
|
| 682 |
-
#: classes/admin/settings/sf-options.php:140
|
| 683 |
-
#: classes/class-install.php:205 views/dashboard/orders.php:18
|
| 684 |
-
msgid "Orders"
|
| 685 |
-
msgstr "Ordini"
|
| 686 |
-
|
| 687 |
-
#: classes/admin/settings/sf-options.php:141
|
| 688 |
-
msgid "View orders"
|
| 689 |
-
msgstr "Visualizza ordini"
|
| 690 |
-
|
| 691 |
-
#: classes/admin/settings/sf-options.php:142
|
| 692 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 693 |
-
msgstr ""
|
| 694 |
-
"Mostra i dettagli del cliente come email, indiizzo, nome, etc, per ogni "
|
| 695 |
-
"ordine"
|
| 696 |
-
|
| 697 |
-
#: classes/admin/settings/sf-options.php:149
|
| 698 |
-
msgid "View comments"
|
| 699 |
-
msgstr "Visualizza commenti"
|
| 700 |
-
|
| 701 |
-
#: classes/admin/settings/sf-options.php:150
|
| 702 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 703 |
-
msgstr "Visualizza tutti i commenti del venditore per un ordine sul frontend"
|
| 704 |
-
|
| 705 |
-
#: classes/admin/settings/sf-options.php:157
|
| 706 |
-
msgid "Submit comments"
|
| 707 |
-
msgstr "Invia commenti"
|
| 708 |
-
|
| 709 |
-
#: classes/admin/settings/sf-options.php:158
|
| 710 |
-
msgid ""
|
| 711 |
-
"Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 712 |
-
msgstr ""
|
| 713 |
-
"Invia commenti per un ordine sul fronend. Eg, ID rilevamento per un prodotto"
|
| 714 |
-
|
| 715 |
-
#: classes/admin/settings/sf-options.php:165
|
| 716 |
-
msgid "View email addresses"
|
| 717 |
-
msgstr "Visualizza indirizzi email"
|
| 718 |
-
|
| 719 |
-
#: classes/admin/settings/sf-options.php:166
|
| 720 |
-
msgid ""
|
| 721 |
-
"While viewing order details on the frontend, you can disable or enable email "
|
| 722 |
-
"addresses"
|
| 723 |
-
msgstr ""
|
| 724 |
-
"Durante la visualizzazione dei dettagli dell'ordine sul front-end, è "
|
| 725 |
-
"possibile disabilitare o abilitare gli indirizzi email"
|
| 726 |
-
|
| 727 |
-
#: classes/admin/settings/sf-options.php:173
|
| 728 |
-
msgid "Export a CSV file of orders for a product"
|
| 729 |
-
msgstr "Esporta un file CSV degli ordini per un prodotto"
|
| 730 |
-
|
| 731 |
-
#: classes/admin/settings/sf-options.php:174
|
| 732 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 733 |
-
msgstr "I venditori possono esportare ordini per un prodotto sul fronted"
|
| 734 |
-
|
| 735 |
-
#: classes/admin/settings/sf-options.php:181
|
| 736 |
-
msgid "Reports"
|
| 737 |
-
msgstr "Rapporti"
|
| 738 |
-
|
| 739 |
-
#: classes/admin/settings/sf-options.php:182
|
| 740 |
-
msgid "View backend sales reports"
|
| 741 |
-
msgstr "Visualizza i rapporti delle vendite del backend"
|
| 742 |
-
|
| 743 |
-
#: classes/admin/settings/sf-options.php:183
|
| 744 |
-
msgid ""
|
| 745 |
-
"Graphs and tables via the Reports page in backend. The reports will only "
|
| 746 |
-
"display sales data that pertain to their products"
|
| 747 |
-
msgstr ""
|
| 748 |
-
"Grafici e tabelle tramite la pagina dei rapporti nel backend. I rapporti "
|
| 749 |
-
"visualizzeranno solo i dati di vendita che appartengono ai loro prodotti"
|
| 750 |
-
|
| 751 |
-
#: classes/admin/settings/sf-options.php:190
|
| 752 |
-
msgid "View Frontend sales reports"
|
| 753 |
-
msgstr "Visualizza i rapporti delle vendite del frontend"
|
| 754 |
-
|
| 755 |
-
#: classes/admin/settings/sf-options.php:191
|
| 756 |
-
msgid ""
|
| 757 |
-
"Sales table on the frontend on the My Account page. The table will only "
|
| 758 |
-
"display sales data that pertain to their products"
|
| 759 |
-
msgstr ""
|
| 760 |
-
"Tabella vendita sul frontend sulla pagina Mio Account . Nella tabella "
|
| 761 |
-
"verranno visualizzati solo i dati di vendita che appartengono ai loro "
|
| 762 |
-
"prodotti"
|
| 763 |
-
|
| 764 |
-
#: classes/admin/settings/sf-options.php:199
|
| 765 |
-
msgid "Submit products"
|
| 766 |
-
msgstr "Invia prodotti"
|
| 767 |
-
|
| 768 |
-
#: classes/admin/settings/sf-options.php:200
|
| 769 |
-
msgid ""
|
| 770 |
-
"Vendors could submit a product through the backend, and an admin would "
|
| 771 |
-
"approve or deny it"
|
| 772 |
-
msgstr ""
|
| 773 |
-
"I venditori possono inviare un prodotto attraverso il backend, e un admin "
|
| 774 |
-
"può approvarlo o negarlo"
|
| 775 |
-
|
| 776 |
-
#: classes/admin/settings/sf-options.php:207
|
| 777 |
-
msgid "Edit live products"
|
| 778 |
-
msgstr "Modifica prodotti dal vivo"
|
| 779 |
-
|
| 780 |
-
#: classes/admin/settings/sf-options.php:208
|
| 781 |
-
msgid ""
|
| 782 |
-
"Vendors could edit an approved product after it has already gone live. There "
|
| 783 |
-
"is no approval or review after editing a live product. This could be "
|
| 784 |
-
"dangerous with malicious vendors, so take caution."
|
| 785 |
-
msgstr ""
|
| 786 |
-
"I venditori possono modificare un prodotto approvato dopo che è già stato "
|
| 787 |
-
"inserito. Non c'è alcuna approvazione o revisione dopo la modifica di un "
|
| 788 |
-
"prodotto inserito. Questo potrebbe essere pericoloso con venditori "
|
| 789 |
-
"scorretti, quindi di fare attenzione.\t"
|
| 790 |
-
|
| 791 |
-
#: classes/admin/settings/sf-options.php:215
|
| 792 |
-
msgid "Submit products live without requiring approval"
|
| 793 |
-
msgstr "Inviare prodotti senza chiedere l'approvazione"
|
| 794 |
-
|
| 795 |
-
#: classes/admin/settings/sf-options.php:216
|
| 796 |
-
msgid ""
|
| 797 |
-
"Vendors can submit products without review or approval from a shop admin. "
|
| 798 |
-
"This could be dangerous with malicious vendors, so take caution."
|
| 799 |
-
msgstr ""
|
| 800 |
-
"I venditori possono inviare prodotti senza revisione e approvazione da parte "
|
| 801 |
-
"di un amministratore di negozio. Questo potrebbe essere pericoloso con "
|
| 802 |
-
"venditori scorretti, quindi di fare attenzione."
|
| 803 |
-
|
| 804 |
-
#: classes/admin/settings/sf-options.php:222
|
| 805 |
-
msgid "Pages"
|
| 806 |
-
msgstr "Pagine"
|
| 807 |
-
|
| 808 |
-
#: classes/admin/settings/sf-options.php:223
|
| 809 |
-
msgid "Page configuration"
|
| 810 |
-
msgstr "Configurazione pagina"
|
| 811 |
-
|
| 812 |
-
#: classes/admin/settings/sf-options.php:226
|
| 813 |
-
msgid "Vendor dashboard"
|
| 814 |
-
msgstr "Dashboard venditore"
|
| 815 |
-
|
| 816 |
-
#: classes/admin/settings/sf-options.php:227
|
| 817 |
-
msgid ""
|
| 818 |
-
"Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</"
|
| 819 |
-
"code><br/>By default, My Account > Vendor Dashboard should have the "
|
| 820 |
-
"shortcode."
|
| 821 |
-
msgstr ""
|
| 822 |
-
"Seleziona la pagina con il shortcode <code>[wcv_vendor_dashboard]</code><br/"
|
| 823 |
-
">Di Default, My Account > Vendor Dashboard sarà la pagina con lo shortcode"
|
| 824 |
-
|
| 825 |
-
#: classes/admin/settings/sf-options.php:234
|
| 826 |
-
msgid "Shop settings"
|
| 827 |
-
msgstr "Impostazioni del negozio"
|
| 828 |
-
|
| 829 |
-
#: classes/admin/settings/sf-options.php:235
|
| 830 |
-
msgid ""
|
| 831 |
-
"Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/"
|
| 832 |
-
">These are the shop settings a vendor can configure."
|
| 833 |
-
msgstr ""
|
| 834 |
-
"Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/"
|
| 835 |
-
">These are the shop settings a vendor can configure."
|
| 836 |
-
|
| 837 |
-
#: classes/admin/settings/sf-options.php:242
|
| 838 |
-
msgid "Orders page"
|
| 839 |
-
msgstr "Pagina ordini"
|
| 840 |
-
|
| 841 |
-
#: classes/admin/settings/sf-options.php:243
|
| 842 |
-
msgid ""
|
| 843 |
-
"Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 844 |
-
"default, My Account > Orders should have the shortcode."
|
| 845 |
-
msgstr ""
|
| 846 |
-
"Seleziona la pagina con lo shortcode<code>[wcv_orders]</code><br/>Di "
|
| 847 |
-
"default, My Account > Orders è la pagina con il shortcode."
|
| 848 |
-
|
| 849 |
-
#: classes/admin/settings/sf-options.php:250
|
| 850 |
-
msgid "Vendor terms"
|
| 851 |
-
msgstr "Termini venditore"
|
| 852 |
-
|
| 853 |
-
#: classes/admin/settings/sf-options.php:251
|
| 854 |
-
msgid ""
|
| 855 |
-
"These terms are shown to a user when submitting an application to become a "
|
| 856 |
-
"vendor.<br/>If left blank, no terms will be shown to the applicant."
|
| 857 |
-
msgstr ""
|
| 858 |
-
"Questi termini sono indicati ad un utente quando invia una richiesta per "
|
| 859 |
-
"diventare un venditore. <br/>Se lasciato vuoto, nessun termine verrà "
|
| 860 |
-
"mostrato al richiedente."
|
| 861 |
-
|
| 862 |
-
#: classes/admin/settings/sf-options.php:269
|
| 863 |
-
msgid "Payments"
|
| 864 |
-
msgstr "Pagamenti"
|
| 865 |
-
|
| 866 |
-
#: classes/admin/settings/sf-options.php:271
|
| 867 |
-
msgid "User payments"
|
| 868 |
-
msgstr "Pagamenti utente"
|
| 869 |
-
|
| 870 |
-
#: classes/admin/settings/sf-options.php:272
|
| 871 |
-
#, php-format
|
| 872 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 873 |
-
msgstr ""
|
| 874 |
-
"Totale Commissione attualmente dovuto: %s. <a href=\"%s\">Visualizzare i "
|
| 875 |
-
"dettagli</a>."
|
| 876 |
-
|
| 877 |
-
#: classes/admin/settings/sf-options.php:273
|
| 878 |
-
#, php-format
|
| 879 |
-
msgid ""
|
| 880 |
-
"Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 881 |
-
"\">here</a>."
|
| 882 |
-
msgstr ""
|
| 883 |
-
"Aggiornare le impostazioni di Pagamenti adattativi PayPal <a href=\"%s"
|
| 884 |
-
"\">qui</a>."
|
| 885 |
-
|
| 886 |
-
#: classes/admin/settings/sf-options.php:277
|
| 887 |
-
msgid "Instant pay"
|
| 888 |
-
msgstr "Pagamento instantaneo"
|
| 889 |
-
|
| 890 |
-
#: classes/admin/settings/sf-options.php:278
|
| 891 |
-
msgid "Instantly pay vendors their commission when an order is made"
|
| 892 |
-
msgstr ""
|
| 893 |
-
"Paga instantaneamente le commissioni ai venditori quando è fatto un ordine"
|
| 894 |
-
|
| 895 |
-
#: classes/admin/settings/sf-options.php:279
|
| 896 |
-
msgid ""
|
| 897 |
-
"For this to work, customers must checkout with the PayPal Adaptive Payments "
|
| 898 |
-
"gateway. Using other gateways will not pay vendors instantly"
|
| 899 |
-
msgstr ""
|
| 900 |
-
"Per questo lavoro, i clienti devono effettuare il checkout con il gateway di "
|
| 901 |
-
"pagamenti adattivo PayPal. Utilizzando altri gateway i venditori non "
|
| 902 |
-
"verranno pagati istantaneamente"
|
| 903 |
-
|
| 904 |
-
#: classes/admin/settings/sf-options.php:286
|
| 905 |
-
msgid "Payment schedule"
|
| 906 |
-
msgstr "Scadenze di pagamento"
|
| 907 |
-
|
| 908 |
-
#: classes/admin/settings/sf-options.php:287
|
| 909 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 910 |
-
msgstr ""
|
| 911 |
-
"Nota: Il programma funzionerà solo se la paga istantanea è deselezionata"
|
| 912 |
-
|
| 913 |
-
#: classes/admin/settings/sf-options.php:292
|
| 914 |
-
msgid "Weekly"
|
| 915 |
-
msgstr "Settimanale"
|
| 916 |
-
|
| 917 |
-
#: classes/admin/settings/sf-options.php:293
|
| 918 |
-
msgid "Biweekly"
|
| 919 |
-
msgstr "Bisettimanale"
|
| 920 |
-
|
| 921 |
-
#: classes/admin/settings/sf-options.php:294
|
| 922 |
-
msgid "Monthly"
|
| 923 |
-
msgstr "Mensile"
|
| 924 |
-
|
| 925 |
-
#: classes/admin/settings/sf-options.php:295
|
| 926 |
-
msgid "Manual"
|
| 927 |
-
msgstr "Manuale"
|
| 928 |
-
|
| 929 |
-
#: classes/admin/settings/sf-options.php:296
|
| 930 |
-
msgid "Now"
|
| 931 |
-
msgstr "Adesso"
|
| 932 |
-
|
| 933 |
-
#: classes/admin/settings/sf-options.php:301
|
| 934 |
-
msgid "Email notification"
|
| 935 |
-
msgstr "Notificazione email"
|
| 936 |
-
|
| 937 |
-
#: classes/admin/settings/sf-options.php:302
|
| 938 |
-
msgid ""
|
| 939 |
-
"Send the WooCommerce admin an email each time a payment has been made via "
|
| 940 |
-
"the payment schedule options above"
|
| 941 |
-
msgstr ""
|
| 942 |
-
"Invia all'amministratore WooCommerce un'e-mail ogni volta che è stato "
|
| 943 |
-
"effettuato un pagamento tramite le opzioni del programma di pagamento sopra\t"
|
| 944 |
-
|
| 945 |
-
#: classes/class-cron.php:87
|
| 946 |
-
#, php-format
|
| 947 |
-
msgid "Payment total: %s"
|
| 948 |
-
msgstr "Totale Pagamento: %s"
|
| 949 |
-
|
| 950 |
-
#: classes/class-cron.php:148
|
| 951 |
-
msgid "Once Weekly"
|
| 952 |
-
msgstr "Una volta a settimana"
|
| 953 |
-
|
| 954 |
-
#: classes/class-cron.php:153
|
| 955 |
-
msgid "Once every two weeks"
|
| 956 |
-
msgstr "Una volta ogni due settimane"
|
| 957 |
-
|
| 958 |
-
#: classes/class-cron.php:158
|
| 959 |
-
msgid "Once a month"
|
| 960 |
-
msgstr "Una volta al mese"
|
| 961 |
-
|
| 962 |
-
#: classes/class-install.php:99 classes/class-install.php:253
|
| 963 |
-
msgid "Pending Vendor"
|
| 964 |
-
msgstr "Venditore in sospeso"
|
| 965 |
-
|
| 966 |
-
#: classes/class-install.php:204
|
| 967 |
-
msgid "Vendor Dashboard"
|
| 968 |
-
msgstr "Dashboard venditore"
|
| 969 |
-
|
| 970 |
-
#: classes/class-install.php:206
|
| 971 |
-
msgid "Shop Settings"
|
| 972 |
-
msgstr "Impostazioni del negozio"
|
| 973 |
-
|
| 974 |
-
#: classes/front/class-vendor-cart.php:41
|
| 975 |
-
#: classes/front/class-vendor-shop.php:255
|
| 976 |
-
msgid "Sold by"
|
| 977 |
-
msgstr "Venduto da"
|
| 978 |
-
|
| 979 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:41
|
| 980 |
-
msgid "Order unmarked shipped."
|
| 981 |
-
msgstr "Ordine non più segnato come spedito."
|
| 982 |
-
|
| 983 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:51
|
| 984 |
-
msgid "Order marked shipped."
|
| 985 |
-
msgstr "Ordine segnato come spedito."
|
| 986 |
-
|
| 987 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:69
|
| 988 |
-
msgid "Your PayPal address is not a valid email address."
|
| 989 |
-
msgstr "Il tuo indirizzo PayPal non è un indirizzo email valido."
|
| 990 |
-
|
| 991 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:78
|
| 992 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 993 |
-
msgstr ""
|
| 994 |
-
"Il nome del negozio già esiste. Il nome del tuo negozio deve essere unico."
|
| 995 |
-
|
| 996 |
-
#: classes/front/orders/class-export-csv.php:37
|
| 997 |
-
msgid "Extra data"
|
| 998 |
-
msgstr "Dati aggiuntivi"
|
| 999 |
-
|
| 1000 |
-
#: classes/front/orders/class-export-csv.php:38
|
| 1001 |
-
#: views/dashboard/reports.php:18 views/emails/admin-new-order.php:23
|
| 1002 |
-
#: views/emails/notify-vendor-shipped.php:23
|
| 1003 |
-
msgid "Quantity"
|
| 1004 |
-
msgstr "Quantità"
|
| 1005 |
-
|
| 1006 |
-
#: classes/front/orders/class-orders.php:107
|
| 1007 |
-
msgid ""
|
| 1008 |
-
"You haven't selected a product's orders to view! Please go back to the "
|
| 1009 |
-
"Vendor Dashboard and click Show Orders on the product you'd like to view."
|
| 1010 |
-
msgstr ""
|
| 1011 |
-
"Non hai selezionato gli ordini di un prodotto da visualizzare! Si prega di "
|
| 1012 |
-
"tornare alla Dashboard Vendor e fare clic su Visualizza ordini sul prodotto "
|
| 1013 |
-
"che si desidera visualizzare."
|
| 1014 |
-
|
| 1015 |
-
#: classes/front/orders/class-orders.php:111
|
| 1016 |
-
msgid "No orders."
|
| 1017 |
-
msgstr "Nessun ordine."
|
| 1018 |
-
|
| 1019 |
-
#: classes/front/orders/class-orders.php:144
|
| 1020 |
-
#: classes/front/orders/class-orders.php:145
|
| 1021 |
-
msgid "Tracking number"
|
| 1022 |
-
msgstr "Numero identificativo (Tracking number)"
|
| 1023 |
-
|
| 1024 |
-
#: classes/front/orders/class-orders.php:147
|
| 1025 |
-
msgid "Success. Your tracking number has been updated."
|
| 1026 |
-
msgstr "Bene. Il numero identificativo (Tracking number) è stato aggiornato."
|
| 1027 |
-
|
| 1028 |
-
#: classes/front/orders/class-orders.php:209
|
| 1029 |
-
msgid "Product Title"
|
| 1030 |
-
msgstr "Titolo Prodotto"
|
| 1031 |
-
|
| 1032 |
-
#: classes/front/orders/class-orders.php:210
|
| 1033 |
-
msgid "Full name"
|
| 1034 |
-
msgstr "Nome completo"
|
| 1035 |
-
|
| 1036 |
-
#: classes/front/orders/class-orders.php:211
|
| 1037 |
-
msgid "Address"
|
| 1038 |
-
msgstr "Indirizzo"
|
| 1039 |
-
|
| 1040 |
-
#: classes/front/orders/class-orders.php:212
|
| 1041 |
-
msgid "City"
|
| 1042 |
-
msgstr "Città"
|
| 1043 |
-
|
| 1044 |
-
#: classes/front/orders/class-orders.php:213
|
| 1045 |
-
msgid "State"
|
| 1046 |
-
msgstr "Stato"
|
| 1047 |
-
|
| 1048 |
-
#: classes/front/orders/class-orders.php:214
|
| 1049 |
-
msgid "Zip"
|
| 1050 |
-
msgstr "CAP"
|
| 1051 |
-
|
| 1052 |
-
#: classes/front/orders/class-orders.php:215
|
| 1053 |
-
msgid "Email address"
|
| 1054 |
-
msgstr "Indirizzo email"
|
| 1055 |
-
|
| 1056 |
-
#: classes/front/orders/class-submit-comment.php:41
|
| 1057 |
-
msgid "You've left the comment field empty!"
|
| 1058 |
-
msgstr "Hai lasciato il campo di commento vuoto!"
|
| 1059 |
-
|
| 1060 |
-
#: classes/front/orders/class-submit-comment.php:63
|
| 1061 |
-
msgid "Success. The customer has been notified of your comment."
|
| 1062 |
-
msgstr "Bene. E' stato notificato il tuo commento al cliente."
|
| 1063 |
-
|
| 1064 |
-
#: classes/front/signup/class-vendor-signup.php:44
|
| 1065 |
-
#: views/dashboard/denied.php:22
|
| 1066 |
-
msgid "Apply to become a vendor? "
|
| 1067 |
-
msgstr "Vuoi diventare un venditore?"
|
| 1068 |
-
|
| 1069 |
-
#: classes/front/signup/class-vendor-signup.php:53
|
| 1070 |
-
#: views/dashboard/denied.php:33
|
| 1071 |
-
#, php-format
|
| 1072 |
-
msgid "I have read and accepted the <a href=\"%s\">terms and conditions</a>"
|
| 1073 |
-
msgstr "Ho letto e accettato i <a href=\"%s\">termini e le condizioni</a>"
|
| 1074 |
-
|
| 1075 |
-
#: classes/front/signup/class-vendor-signup.php:87
|
| 1076 |
-
msgid "Application denied. You are an administrator."
|
| 1077 |
-
msgstr "Richiesta negata. Sei un amministratore."
|
| 1078 |
-
|
| 1079 |
-
#: classes/front/signup/class-vendor-signup.php:89
|
| 1080 |
-
msgid "Your application has been submitted."
|
| 1081 |
-
msgstr "La tua richiesta è stata inviata."
|
| 1082 |
-
|
| 1083 |
-
#: classes/front/signup/class-vendor-signup.php:125
|
| 1084 |
-
msgid "You must accept the terms and conditions to become a vendor."
|
| 1085 |
-
msgstr "Devi accettare i termini e le condizioni per diventare un venditore."
|
| 1086 |
-
|
| 1087 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1088 |
-
msgid "PayPal Adaptive Payments"
|
| 1089 |
-
msgstr "Pagamenti adattivi PayPal"
|
| 1090 |
-
|
| 1091 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 1092 |
-
#, php-format
|
| 1093 |
-
msgid ""
|
| 1094 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 1095 |
-
"%s."
|
| 1096 |
-
msgstr ""
|
| 1097 |
-
"Qualcosa è andato storto. La risposta da PayPal invalida questo ordine. "
|
| 1098 |
-
"Stato: % s."
|
| 1099 |
-
|
| 1100 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 1101 |
-
msgid "IPN payment completed"
|
| 1102 |
-
msgstr "Pagamento IPN completato"
|
| 1103 |
-
|
| 1104 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 1105 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 1106 |
-
msgstr "Abilita i pagamenti adattativi PayPal"
|
| 1107 |
-
|
| 1108 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 1109 |
-
msgid "Method Title"
|
| 1110 |
-
msgstr "Metodo titolo"
|
| 1111 |
-
|
| 1112 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 1113 |
-
msgid "This controls the title which the user sees during checkout."
|
| 1114 |
-
msgstr "Questo controlla il titolo che l'utente vede durante il checkout."
|
| 1115 |
-
|
| 1116 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 1117 |
-
msgid "PayPal"
|
| 1118 |
-
msgstr "PayPal"
|
| 1119 |
-
|
| 1120 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:159
|
| 1121 |
-
msgid "Description"
|
| 1122 |
-
msgstr "Descrizione"
|
| 1123 |
-
|
| 1124 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 1125 |
-
msgid "This controls the description which the user sees during checkout."
|
| 1126 |
-
msgstr "Questo controlla la descrizione che l'utente vede durante il checkout"
|
| 1127 |
-
|
| 1128 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 1129 |
-
msgid "Pay via PayPal!"
|
| 1130 |
-
msgstr "Paga tramite PayPal!"
|
| 1131 |
-
|
| 1132 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 1133 |
-
msgid "Live Credentials"
|
| 1134 |
-
msgstr "Credenziali Live"
|
| 1135 |
-
|
| 1136 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 1137 |
-
#, php-format
|
| 1138 |
-
msgid ""
|
| 1139 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 1140 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 1141 |
-
msgstr ""
|
| 1142 |
-
"Devi avere un <a href=\"%s\">Application ID</a> per processare le "
|
| 1143 |
-
"transazioni inserite. Tu non ne hai bisogno per il testing nel Sandbox mode."
|
| 1144 |
-
|
| 1145 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:179
|
| 1146 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 1147 |
-
msgid "PayPal Email"
|
| 1148 |
-
msgstr "Email PayPal"
|
| 1149 |
-
|
| 1150 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:180
|
| 1151 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 1152 |
-
msgid "The email address main payments should go to."
|
| 1153 |
-
msgstr "I pagamenti dell'indirizzo email principale dovrebbero andare a:"
|
| 1154 |
-
|
| 1155 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:185
|
| 1156 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 1157 |
-
msgid "API Username"
|
| 1158 |
-
msgstr "Username API (API Username)"
|
| 1159 |
-
|
| 1160 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:190
|
| 1161 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 1162 |
-
msgid "API Password"
|
| 1163 |
-
msgstr "Password API (API Password)"
|
| 1164 |
-
|
| 1165 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:195
|
| 1166 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 1167 |
-
msgid "API Signature"
|
| 1168 |
-
msgstr "Firma API (API Signature)"
|
| 1169 |
-
|
| 1170 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 1171 |
-
msgid "Application ID"
|
| 1172 |
-
msgstr "ID Richiesta (Application ID)"
|
| 1173 |
-
|
| 1174 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 1175 |
-
msgid "Only required when doing live transactions."
|
| 1176 |
-
msgstr "Richiesto solo quando si effettuano delle transazioni."
|
| 1177 |
-
|
| 1178 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 1179 |
-
msgid "Sandbox Credentials"
|
| 1180 |
-
msgstr "Credenziali Sandbox"
|
| 1181 |
-
|
| 1182 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 1183 |
-
#, php-format
|
| 1184 |
-
msgid ""
|
| 1185 |
-
"You can signup for a sandbox developer account <a href=\"%s\">here</a>. You "
|
| 1186 |
-
"need a developer account if you want to enable Sandbox mode for testing."
|
| 1187 |
-
msgstr ""
|
| 1188 |
-
"Puoi iscriverti ad un account sandbox sviluppatore <a href=\"%s\">qui</a>. "
|
| 1189 |
-
"Tu hai bisogno di un account sviluppatore se tu vuoi abilitare il Sandbox "
|
| 1190 |
-
"mode per i test."
|
| 1191 |
-
|
| 1192 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 1193 |
-
msgid "Misc. Settings"
|
| 1194 |
-
msgstr "Impostazioni varie"
|
| 1195 |
-
|
| 1196 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 1197 |
-
msgid "Enable PayPal Sandbox mode"
|
| 1198 |
-
msgstr "Attiva la modalità PayPal Sandbox"
|
| 1199 |
-
|
| 1200 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 1201 |
-
msgid "Enable logging"
|
| 1202 |
-
msgstr "Abilitare il logging"
|
| 1203 |
-
|
| 1204 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 1205 |
-
msgid ""
|
| 1206 |
-
"The PayPal Adaptive Payments gateway can instantly pay your vendors their "
|
| 1207 |
-
"due commission (if enabled). Also used to mass pay vendors on a schedule / "
|
| 1208 |
-
"manual method (if enabled)."
|
| 1209 |
-
msgstr ""
|
| 1210 |
-
"Il gateway dei pagamenti adattativi PayPal può instantaneamente pagare i "
|
| 1211 |
-
"tuoi venditori le loro commissioni dovute (se abilitato). Utilizzato anche "
|
| 1212 |
-
"per pagare in massa i venditori su un programma / metodo manuale (se "
|
| 1213 |
-
"abilitato)."
|
| 1214 |
-
|
| 1215 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1216 |
-
msgid "Gateway Disabled"
|
| 1217 |
-
msgstr "Gateway disabilitato"
|
| 1218 |
-
|
| 1219 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 1220 |
-
#, php-format
|
| 1221 |
-
msgid "%s does not support your store currency."
|
| 1222 |
-
msgstr "%s non supporta la valuta del tuo negozio."
|
| 1223 |
-
|
| 1224 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:369
|
| 1225 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:483
|
| 1226 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:150
|
| 1227 |
-
#, php-format
|
| 1228 |
-
msgid "Error: %s"
|
| 1229 |
-
msgstr "Errore: %s"
|
| 1230 |
-
|
| 1231 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:378
|
| 1232 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:379
|
| 1233 |
-
#, php-format
|
| 1234 |
-
msgid "Error ID: %s. %s"
|
| 1235 |
-
msgstr "Errore ID: %s. %s"
|
| 1236 |
-
|
| 1237 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 1238 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 1239 |
-
msgstr ""
|
| 1240 |
-
"Nessun venditore trovato per pagare. Forse non hanno impostato un indirizzo "
|
| 1241 |
-
"di PayPal?"
|
| 1242 |
-
|
| 1243 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:164
|
| 1244 |
-
msgid "All due commission has been paid for."
|
| 1245 |
-
msgstr "Tutte le commissioni dovute sono state pagate."
|
| 1246 |
-
|
| 1247 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:170
|
| 1248 |
-
msgid ""
|
| 1249 |
-
"All due commission has been paid for, but I could not clear it from their "
|
| 1250 |
-
"profiles due to an internal error. Commission will still be listed as due. "
|
| 1251 |
-
"Please manually mark the commission as paid from the Commissions page."
|
| 1252 |
-
msgstr ""
|
| 1253 |
-
"Tutta la commissione dovuta è stata pagata, ma non riuscivo a cancellarlo "
|
| 1254 |
-
"dai loro profili a causa di un errore interno. La commissione sarà ancora "
|
| 1255 |
-
"elencata come dovuta. Per favore contrassegna manualmente la commissione "
|
| 1256 |
-
"come pagato dalla pagina di commissioni."
|
| 1257 |
-
|
| 1258 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:205
|
| 1259 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 1260 |
-
msgstr "WooCommerce: I pagamenti di massa per aggiornamento venditori"
|
| 1261 |
-
|
| 1262 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:207
|
| 1263 |
-
msgid ""
|
| 1264 |
-
"Hello! A payment was just triggered to mass pay all vendors their due "
|
| 1265 |
-
"commission."
|
| 1266 |
-
msgstr ""
|
| 1267 |
-
"Ciao! Un pagamento è stato appena attivato per pagare in massa a tutti i "
|
| 1268 |
-
"venditori la loro commissione dovuta."
|
| 1269 |
-
|
| 1270 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 1271 |
-
#, php-format
|
| 1272 |
-
msgid "Payment status: %s."
|
| 1273 |
-
msgstr "Stato pagamento: %s."
|
| 1274 |
-
|
| 1275 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:209
|
| 1276 |
-
#, php-format
|
| 1277 |
-
msgid "Payment message: %s."
|
| 1278 |
-
msgstr "Messaggio pagamento: %s."
|
| 1279 |
-
|
| 1280 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 1281 |
-
#, php-format
|
| 1282 |
-
msgid "Payment total: %s."
|
| 1283 |
-
msgstr "Totale pagamento: % s."
|
| 1284 |
-
|
| 1285 |
-
#: views/dashboard/denied.php:8
|
| 1286 |
-
msgid ""
|
| 1287 |
-
"Your account has not yet been approved to become a vendor. When it is, you "
|
| 1288 |
-
"will receive an email telling you that your account is approved!"
|
| 1289 |
-
msgstr ""
|
| 1290 |
-
"Il tuo account non è ancora stato approvato per diventare un venditore. "
|
| 1291 |
-
"Quando la tua richiesta verrà approvata, riceverai un'email con "
|
| 1292 |
-
"l'aggiornamento della tua richiesta!"
|
| 1293 |
-
|
| 1294 |
-
#: views/dashboard/denied.php:12
|
| 1295 |
-
msgid ""
|
| 1296 |
-
"Your account is not setup as a vendor yet. If you would like to register, "
|
| 1297 |
-
"please complete this page!"
|
| 1298 |
-
msgstr ""
|
| 1299 |
-
"Il tuo account non è impostato come account venditore. Se desideri "
|
| 1300 |
-
"registrarti, perfavore completa questa pagina!"
|
| 1301 |
-
|
| 1302 |
-
#: views/dashboard/denied.php:53
|
| 1303 |
-
msgid "Submit"
|
| 1304 |
-
msgstr "Invia"
|
| 1305 |
-
|
| 1306 |
-
#: views/dashboard/links.php:1
|
| 1307 |
-
msgid "Control Center"
|
| 1308 |
-
msgstr "Centro di controllo"
|
| 1309 |
-
|
| 1310 |
-
#: views/dashboard/links.php:3
|
| 1311 |
-
msgid "My shop"
|
| 1312 |
-
msgstr "Il mio negozio"
|
| 1313 |
-
|
| 1314 |
-
#: views/dashboard/links.php:7
|
| 1315 |
-
msgid "My settings"
|
| 1316 |
-
msgstr "Le mie impostazioni"
|
| 1317 |
-
|
| 1318 |
-
#: views/dashboard/links.php:13
|
| 1319 |
-
msgid "Submit a product"
|
| 1320 |
-
msgstr "Invia un prodotto"
|
| 1321 |
-
|
| 1322 |
-
#: views/dashboard/orders.php:7 views/dashboard/orders.php:10
|
| 1323 |
-
msgid "Hide items"
|
| 1324 |
-
msgstr "Nascondi Items"
|
| 1325 |
-
|
| 1326 |
-
#: views/dashboard/orders.php:8 views/dashboard/orders.php:58
|
| 1327 |
-
msgid "View items"
|
| 1328 |
-
msgstr "Visualizza Items"
|
| 1329 |
-
|
| 1330 |
-
#: views/dashboard/orders.php:27
|
| 1331 |
-
msgid "Links"
|
| 1332 |
-
msgstr "Links"
|
| 1333 |
-
|
| 1334 |
-
#: views/dashboard/orders.php:58
|
| 1335 |
-
msgid "Unmark shipped"
|
| 1336 |
-
msgstr "Segna come non spedito"
|
| 1337 |
-
|
| 1338 |
-
#: views/dashboard/orders.php:58
|
| 1339 |
-
msgid "Mark shipped"
|
| 1340 |
-
msgstr "Segna come spedito"
|
| 1341 |
-
|
| 1342 |
-
#: views/dashboard/orders.php:90
|
| 1343 |
-
msgid "You have no orders during this period."
|
| 1344 |
-
msgstr "Non hai nessun ordine in questo periodo."
|
| 1345 |
-
|
| 1346 |
-
#: views/dashboard/reports.php:1
|
| 1347 |
-
msgid "Sales Report"
|
| 1348 |
-
msgstr "Rapporto Vendite\t"
|
| 1349 |
-
|
| 1350 |
-
#: views/dashboard/reports.php:20
|
| 1351 |
-
msgid "Rate"
|
| 1352 |
-
msgstr "Tasso"
|
| 1353 |
-
|
| 1354 |
-
#: views/dashboard/reports.php:47
|
| 1355 |
-
msgid "Show Orders"
|
| 1356 |
-
msgstr "Mostra ordini"
|
| 1357 |
-
|
| 1358 |
-
#: views/dashboard/reports.php:56
|
| 1359 |
-
msgid "Totals"
|
| 1360 |
-
msgstr "Totali"
|
| 1361 |
-
|
| 1362 |
-
#: views/dashboard/reports.php:71
|
| 1363 |
-
msgid "You have no sales during this period."
|
| 1364 |
-
msgstr "Non hai vendite in questo periodo."
|
| 1365 |
-
|
| 1366 |
-
#: views/dashboard/reports.php:82
|
| 1367 |
-
msgid "You haven't made any sales yet."
|
| 1368 |
-
msgstr "Non hai venduto ancora niente."
|
| 1369 |
-
|
| 1370 |
-
#: views/dashboard/settings/paypal-email-form.php:2
|
| 1371 |
-
msgid "PayPal Address"
|
| 1372 |
-
msgstr "Indirizzo PayPal"
|
| 1373 |
-
|
| 1374 |
-
#: views/dashboard/settings/paypal-email-form.php:3
|
| 1375 |
-
msgid "Your PayPal address is used to send you your commission."
|
| 1376 |
-
msgstr "Il tuo indirizzo PayPal è usato per inviare a te la tua commissione."
|
| 1377 |
-
|
| 1378 |
-
#: views/dashboard/settings/seller-info.php:4
|
| 1379 |
-
msgid "This is displayed on each of your products."
|
| 1380 |
-
msgstr "Questo è mostrato su tutti i tuoi prodotti."
|
| 1381 |
-
|
| 1382 |
-
#: views/dashboard/settings/settings.php:47
|
| 1383 |
-
msgid "Save"
|
| 1384 |
-
msgstr "Salva"
|
| 1385 |
-
|
| 1386 |
-
#: views/dashboard/settings/shop-description.php:2
|
| 1387 |
-
msgid "Shop Description"
|
| 1388 |
-
msgstr "Descrizione negozio"
|
| 1389 |
-
|
| 1390 |
-
#: views/dashboard/settings/shop-description.php:3
|
| 1391 |
-
#, php-format
|
| 1392 |
-
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 1393 |
-
msgstr "Questo è mostrato sulla tua <a href=\"%s\">pagina del negozio</a>."
|
| 1394 |
-
|
| 1395 |
-
#: views/dashboard/settings/shop-name.php:2
|
| 1396 |
-
msgid "Shop Name"
|
| 1397 |
-
msgstr "Nome negozio"
|
| 1398 |
-
|
| 1399 |
-
#: views/dashboard/settings/shop-name.php:3
|
| 1400 |
-
msgid "Your shop name is public and must be unique."
|
| 1401 |
-
msgstr "Il nome del tuo negozio è pubblico e deve essere unico."
|
| 1402 |
-
|
| 1403 |
-
#: views/emails/admin-new-order.php:13
|
| 1404 |
-
#, php-format
|
| 1405 |
-
msgid "You have received an order from %s. Their order is as follows:"
|
| 1406 |
-
msgstr "Hai ricevuto un ordine da %s. Ecco i dettagli:"
|
| 1407 |
-
|
| 1408 |
-
#: views/emails/admin-new-order.php:17
|
| 1409 |
-
#: views/emails/notify-vendor-shipped.php:17
|
| 1410 |
-
#, php-format
|
| 1411 |
-
msgid "Order: %s"
|
| 1412 |
-
msgstr "Ordine: %s"
|
| 1413 |
-
|
| 1414 |
-
#: views/emails/admin-new-order.php:24
|
| 1415 |
-
#: views/emails/notify-vendor-shipped.php:24
|
| 1416 |
-
msgid "Price"
|
| 1417 |
-
msgstr "Prezzo"
|
| 1418 |
-
|
| 1419 |
-
#: views/emails/admin-new-order.php:50
|
| 1420 |
-
#: views/emails/notify-vendor-shipped.php:50
|
| 1421 |
-
msgid "Customer details"
|
| 1422 |
-
msgstr "Dettagli Cliente"
|
| 1423 |
-
|
| 1424 |
-
#: views/emails/admin-new-order.php:53
|
| 1425 |
-
#: views/emails/notify-vendor-shipped.php:53
|
| 1426 |
-
msgid "Email:"
|
| 1427 |
-
msgstr "Email:"
|
| 1428 |
-
|
| 1429 |
-
#: views/emails/admin-new-order.php:56
|
| 1430 |
-
#: views/emails/notify-vendor-shipped.php:56
|
| 1431 |
-
msgid "Tel:"
|
| 1432 |
-
msgstr "Tel:"
|
| 1433 |
-
|
| 1434 |
-
#: views/emails/application-status.php:5
|
| 1435 |
-
#, php-format
|
| 1436 |
-
msgid "Hi there. This is a notification about a vendor application on %s."
|
| 1437 |
-
msgstr ""
|
| 1438 |
-
"Ehilà. Questa è una notifica relativa ad una richiesta del venditore su % s."
|
| 1439 |
-
|
| 1440 |
-
#: views/emails/application-status.php:8
|
| 1441 |
-
#, php-format
|
| 1442 |
-
msgid "Application status: %s"
|
| 1443 |
-
msgstr "Stato richiesta: %s"
|
| 1444 |
-
|
| 1445 |
-
#: views/emails/application-status.php:9
|
| 1446 |
-
#, php-format
|
| 1447 |
-
msgid "Applicant username: %s"
|
| 1448 |
-
msgstr "Nome utente richiedente: %s"
|
| 1449 |
-
|
| 1450 |
-
#: views/emails/new-product.php:5
|
| 1451 |
-
#, php-format
|
| 1452 |
-
msgid "Hi there. This is a notification about a new product on %s."
|
| 1453 |
-
msgstr "Ehilà. Questa è una notifica di un nuovo prodotto su %s."
|
| 1454 |
-
|
| 1455 |
-
#: views/emails/new-product.php:8
|
| 1456 |
-
#, php-format
|
| 1457 |
-
msgid "Product title: %s"
|
| 1458 |
-
msgstr "Titolo prodotto: %s"
|
| 1459 |
-
|
| 1460 |
-
#: views/emails/new-product.php:9
|
| 1461 |
-
#, php-format
|
| 1462 |
-
msgid "Submitted by: %s"
|
| 1463 |
-
msgstr "Inviato da: %s"
|
| 1464 |
-
|
| 1465 |
-
#: views/emails/new-product.php:10
|
| 1466 |
-
#, php-format
|
| 1467 |
-
msgid "Edit product: %s"
|
| 1468 |
-
msgstr "Modifica prodotto: %s"
|
| 1469 |
-
|
| 1470 |
-
#: views/emails/notify-vendor-shipped.php:13
|
| 1471 |
-
msgid ""
|
| 1472 |
-
"A vendor has marked part of your order as shipped. The items that are "
|
| 1473 |
-
"shipped are as follows:"
|
| 1474 |
-
msgstr ""
|
| 1475 |
-
"Il venditore ha segnato parte del tuo ordine come spedito. Gli articoli "
|
| 1476 |
-
"segnati come spediti sono i seguenti:"
|
| 1477 |
-
|
| 1478 |
-
#: views/orders/comments/add-new-comment.php:11
|
| 1479 |
-
msgid "Add comment"
|
| 1480 |
-
msgstr "Aggiungi commento"
|
| 1481 |
-
|
| 1482 |
-
#: views/orders/comments/existing-comments.php:9
|
| 1483 |
-
#, php-format
|
| 1484 |
-
msgid "added %s ago"
|
| 1485 |
-
msgstr "Aggiunto %s giorni fà"
|
| 1486 |
-
|
| 1487 |
-
#: views/orders/csv-export.php:6
|
| 1488 |
-
msgid "Export orders"
|
| 1489 |
-
msgstr "Esporta ordini"
|
| 1490 |
-
|
| 1491 |
-
#: views/orders/customer-note/customer-note.php:4
|
| 1492 |
-
msgid "Customer note"
|
| 1493 |
-
msgstr "Nota del cliente"
|
| 1494 |
-
|
| 1495 |
-
#: views/orders/customer-note/customer-note.php:8
|
| 1496 |
-
msgid "No customer note."
|
| 1497 |
-
msgstr "Nessuna nota del cliente."
|
| 1498 |
-
|
| 1499 |
-
#: views/orders/orders.php:84
|
| 1500 |
-
#, php-format
|
| 1501 |
-
msgid "Comments (%s)"
|
| 1502 |
-
msgstr "Commenti (%s)"
|
| 1503 |
-
|
| 1504 |
-
#: views/orders/shipping/shipping-form.php:46
|
| 1505 |
-
msgid "Provider:"
|
| 1506 |
-
msgstr "Provider:"
|
| 1507 |
-
|
| 1508 |
-
#: views/orders/shipping/shipping-form.php:48
|
| 1509 |
-
msgid "Custom Provider"
|
| 1510 |
-
msgstr "Provider personalizzato"
|
| 1511 |
-
|
| 1512 |
-
#: views/orders/shipping/shipping-form.php:68
|
| 1513 |
-
msgid "Provider Name:"
|
| 1514 |
-
msgstr "Nome provider:"
|
| 1515 |
-
|
| 1516 |
-
#: views/orders/shipping/shipping-form.php:76
|
| 1517 |
-
msgid "Tracking number:"
|
| 1518 |
-
msgstr "Numero identificativo (Tracking number):"
|
| 1519 |
-
|
| 1520 |
-
#: views/orders/shipping/shipping-form.php:84
|
| 1521 |
-
msgid "Tracking link:"
|
| 1522 |
-
msgstr "Link identificativo (Tracking link):"
|
| 1523 |
-
|
| 1524 |
-
#: views/orders/shipping/shipping-form.php:93
|
| 1525 |
-
msgid "Date shipped:"
|
| 1526 |
-
msgstr "Data di spedizione:"
|
| 1527 |
-
|
| 1528 |
-
#: views/orders/shipping/shipping-form.php:101
|
| 1529 |
-
msgid "Preview:"
|
| 1530 |
-
msgstr "Anteprima:"
|
| 1531 |
-
|
| 1532 |
-
#: views/orders/shipping/shipping-form.php:101
|
| 1533 |
-
msgid "Click here to track your shipment"
|
| 1534 |
-
msgstr "Clicca qui per rilevare la tua spedizione"
|
| 1535 |
-
|
| 1536 |
-
#: views/orders/shipping/shipping-form.php:110
|
| 1537 |
-
msgid "Update tracking number"
|
| 1538 |
-
msgstr "Aggiorna numero identificativo (Tracking link)"
|
| 1539 |
-
|
| 1540 |
-
#: views/orders/shipping/shipping-form.php:112
|
| 1541 |
-
msgid "Mark as shipped"
|
| 1542 |
-
msgstr "Segna come spedito"
|
| 1543 |
-
|
| 1544 |
-
#: views/orders/table-body.php:25
|
| 1545 |
-
#, php-format
|
| 1546 |
-
msgid "Quantity: %d"
|
| 1547 |
-
msgstr "Quantità: %d"
|
| 1548 |
-
|
| 1549 |
-
#~ msgid "Product Vendor"
|
| 1550 |
-
#~ msgstr "Product Vendor"
|
| 1551 |
-
|
| 1552 |
-
#~ msgid ""
|
| 1553 |
-
#~ "<b>Product Vendor is disabled</b>. Product Vendor requires WooCommerce "
|
| 1554 |
-
#~ "v2.0.1."
|
| 1555 |
-
#~ msgstr ""
|
| 1556 |
-
#~ "<b>Product Vendor è disabilitato</b>. Product Vendor richiede WooCommerce "
|
| 1557 |
-
#~ "v2.0.1."
|
| 1558 |
-
|
| 1559 |
-
#~ msgid "Product Vendors"
|
| 1560 |
-
#~ msgstr "Prodotto dei Venditori"
|
| 1561 |
-
|
| 1562 |
-
#~ msgid "Search for a product…"
|
| 1563 |
-
#~ msgstr "Cerca un prodotto…"
|
| 1564 |
-
|
| 1565 |
-
#~ msgid "Commission due"
|
| 1566 |
-
#~ msgstr "Commissione dovuta"
|
| 1567 |
-
|
| 1568 |
-
#~ msgid "Commission Due"
|
| 1569 |
-
#~ msgstr "Commissione dovuta"
|
| 1570 |
-
|
| 1571 |
-
#~ msgid ""
|
| 1572 |
-
#~ "Choose the page that has the shortcode <code>[pv_vendor_dashboard]</"
|
| 1573 |
-
#~ "code><br/>By default, My Account > Vendor Dashboard should have the "
|
| 1574 |
-
#~ "shortcode."
|
| 1575 |
-
#~ msgstr ""
|
| 1576 |
-
#~ "Scegli la pagina che ha lo shortcode <code>[pv_vendor_dashboard]</"
|
| 1577 |
-
#~ "code><br/>Di default, Mio Account > Dashboard venditore dovrebbe avere lo "
|
| 1578 |
-
#~ "shortcode."
|
| 1579 |
-
|
| 1580 |
-
#~ msgid ""
|
| 1581 |
-
#~ "Choose the page that has the shortcode <code>[pv_shop_settings]</code><br/"
|
| 1582 |
-
#~ ">These are the shop settings a vendor can configure."
|
| 1583 |
-
#~ msgstr ""
|
| 1584 |
-
#~ "Scegli la pagina che ha lo shortcode <code>[pv_shop_settings]</code><br/"
|
| 1585 |
-
#~ ">Queste sono le impostazioni del negozio che un venditore può configurare."
|
| 1586 |
-
|
| 1587 |
-
#~ msgid ""
|
| 1588 |
-
#~ "Choose the page that has the shortcode <code>[pv_orders]</code><br/>By "
|
| 1589 |
-
#~ "default, My Account > Orders should have the shortcode."
|
| 1590 |
-
#~ msgstr ""
|
| 1591 |
-
#~ "Scegli la pagina che ha lo shortcode <code>[pv_orders]</code><br/>Di "
|
| 1592 |
-
#~ "default, Mio Account > Ordini dovrebbe avere lo shortcode."
|
| 1593 |
-
|
| 1594 |
-
#~ msgid "Apply to become a vendor?"
|
| 1595 |
-
#~ msgstr "Domanda per diventare un venditore?"
|
| 1596 |
-
|
| 1597 |
-
#~ msgid ""
|
| 1598 |
-
#~ "<b>Important:</b> Unless you're using the <a href=\"%s\">beta version of "
|
| 1599 |
-
#~ "TRS2</a>, all shipping costs will be given to the shop admin. Vendors "
|
| 1600 |
-
#~ "will not receive shipping costs."
|
| 1601 |
-
#~ msgstr ""
|
| 1602 |
-
#~ "<b>Importante:</b> A meno che non stai usando il<a href=\"%s\">beta "
|
| 1603 |
-
#~ "version of TRS2</a>, tutti i costi di spedizione saranno dati al negozio "
|
| 1604 |
-
#~ "dell'amministrazione. I venditori non riceveranno i costi di spedizione."
|
| 1605 |
-
|
| 1606 |
-
#~ msgid ""
|
| 1607 |
-
#~ "The plugin has been updated, but could not be reactivated. Please "
|
| 1608 |
-
#~ "reactivate it manually."
|
| 1609 |
-
#~ msgstr ""
|
| 1610 |
-
#~ "Il plugin è stato aggiornato, ma potrebbe non essere tato riattivato. Si "
|
| 1611 |
-
#~ "prega di riattivarlo manualmente."
|
| 1612 |
-
|
| 1613 |
-
#~ msgid "Plugin reactivated successfully."
|
| 1614 |
-
#~ msgstr "Plugin riattivato con successo."
|
| 1615 |
-
|
| 1616 |
-
#~ msgid "MGates.me Updates"
|
| 1617 |
-
#~ msgstr "Aggiornamenti MGates.me"
|
| 1618 |
-
|
| 1619 |
-
#~ msgid "MGates.me Plugin Updater"
|
| 1620 |
-
#~ msgstr "MGates.me Plugin Updater"
|
| 1621 |
-
|
| 1622 |
-
#~ msgid "Enter your license key to automatically receive updates."
|
| 1623 |
-
#~ msgstr ""
|
| 1624 |
-
#~ "Inserisci la tua chiave di licenza per ricevere aggiornamenti "
|
| 1625 |
-
#~ "automaticamente."
|
| 1626 |
-
|
| 1627 |
-
#~ msgid "Check for updates <b>now</b>"
|
| 1628 |
-
#~ msgstr "Cerca aggiornamenti <b>ora</b>"
|
| 1629 |
-
|
| 1630 |
-
#~ msgid ""
|
| 1631 |
-
#~ "<b style=\"color: #468847;\">Key deactivated.</b> License key for <i>%s</"
|
| 1632 |
-
#~ "i> has been <b>deactivated</b>."
|
| 1633 |
-
#~ msgstr ""
|
| 1634 |
-
#~ "<b style=\"color: #468847;\">Chiave disattivata.</b>La chiave della "
|
| 1635 |
-
#~ "licenza per<i>%s</i> è stata <b>disattivata</b>."
|
| 1636 |
-
|
| 1637 |
-
#~ msgid ""
|
| 1638 |
-
#~ "<b style=\"color: #B94A48;\">Error.</b> License key for <i>%s</i> could "
|
| 1639 |
-
#~ "not be deactivated."
|
| 1640 |
-
#~ msgstr ""
|
| 1641 |
-
#~ "<b style=\"color: #B94A48;\">Errore.</b> La chiave della licenza per<i>"
|
| 1642 |
-
#~ "%s</i> potrebbe non essere disattivata."
|
| 1643 |
-
|
| 1644 |
-
#~ msgid ""
|
| 1645 |
-
#~ "<b style=\"color: #468847;\">Key activated.</b> License key for <i>%s</i> "
|
| 1646 |
-
#~ "has been <b>activated</b>."
|
| 1647 |
-
#~ msgstr ""
|
| 1648 |
-
#~ "<b style=\"color: #468847;\">Chiave attivata.</b> La chiave della licenza "
|
| 1649 |
-
#~ "per <i>%s</i>è stata<b>attivata</b>."
|
| 1650 |
-
|
| 1651 |
-
#~ msgid ""
|
| 1652 |
-
#~ "<b style=\"color: #B94A48;\">Error.</b> License key for <i>%s</i> is "
|
| 1653 |
-
#~ "invalid."
|
| 1654 |
-
#~ msgstr ""
|
| 1655 |
-
#~ "<b style=\"color: #B94A48;\">Errore.</b> La chiave della licenza per<i>"
|
| 1656 |
-
#~ "%s</i> non è valida."
|
| 1657 |
-
|
| 1658 |
-
#~ msgid "Enable MGates.me Plugin Updates."
|
| 1659 |
-
#~ msgstr "Abilita Aggiornamenti MGates.me Plugin"
|
| 1660 |
-
|
| 1661 |
-
#~ msgid ""
|
| 1662 |
-
#~ "<a href=\"%1$s\">Add your license keys</a> to enable automatic plugin "
|
| 1663 |
-
#~ "updates."
|
| 1664 |
-
#~ msgstr ""
|
| 1665 |
-
#~ "<a href=\"%1$s\">Aggiungi le tue chiavi licenza</a> per abilitare gli "
|
| 1666 |
-
#~ "aggiornamenti automatici del plugin."
|
| 1667 |
-
|
| 1668 |
-
#~ msgid "Hide This Message"
|
| 1669 |
-
#~ msgstr "Nascondi questo messaggio"
|
| 1670 |
-
|
| 1671 |
-
#~ msgid "Your account has not yet been approved to become a vendor."
|
| 1672 |
-
#~ msgstr ""
|
| 1673 |
-
#~ "Il tuo account non è stato ancora approvato per diventare un venditore."
|
| 1674 |
-
|
| 1675 |
-
#~ msgid "Your account is not vendor capable."
|
| 1676 |
-
#~ msgstr "Il tuo account non è un account venditore."
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/wcvendors-ja.mo
DELETED
|
Binary file
|
languages/wcvendors-ja.po
DELETED
|
@@ -1,1886 +0,0 @@
|
|
| 1 |
-
# Translation of WooCommerce other plugins - WC Vendors in Japanese
|
| 2 |
-
# This file is distributed under the same license as the WooCommerce other plugins - WC Vendors package.
|
| 3 |
-
msgid ""
|
| 4 |
-
msgstr ""
|
| 5 |
-
"PO-Revision-Date: 2017-01-12 18:00+0900\n"
|
| 6 |
-
"MIME-Version: 1.0\n"
|
| 7 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 8 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 9 |
-
"Plural-Forms: nplurals=1; plural=0;\n"
|
| 10 |
-
"X-Generator: Poedit 1.5.7\n"
|
| 11 |
-
"Language: ja_JP\n"
|
| 12 |
-
"Project-Id-Version: WooCommerce other plugins - WC Vendors\n"
|
| 13 |
-
"POT-Creation-Date: \n"
|
| 14 |
-
"Last-Translator: Shohei Tanaka <shohei.t@artws.info>\n"
|
| 15 |
-
"Language-Team: \n"
|
| 16 |
-
|
| 17 |
-
#: templates/orders/table-body.php:25
|
| 18 |
-
msgid "Quantity: %d"
|
| 19 |
-
msgstr "数量 : %d"
|
| 20 |
-
|
| 21 |
-
#: templates/orders/shipping/shipping-form.php:77
|
| 22 |
-
msgid "Mark as shipped"
|
| 23 |
-
msgstr "出荷済みとしてマーク"
|
| 24 |
-
|
| 25 |
-
#: templates/orders/shipping/shipping-form.php:75
|
| 26 |
-
msgid "Update tracking number"
|
| 27 |
-
msgstr "トラッキング番号を更新"
|
| 28 |
-
|
| 29 |
-
#: templates/orders/customer-note/customer-note.php:8
|
| 30 |
-
msgid "No customer note."
|
| 31 |
-
msgstr "顧客メモはありません。"
|
| 32 |
-
|
| 33 |
-
#: templates/orders/customer-note/customer-note.php:4
|
| 34 |
-
msgid "Customer note"
|
| 35 |
-
msgstr "顧客メモ"
|
| 36 |
-
|
| 37 |
-
#: templates/orders/csv-export.php:6
|
| 38 |
-
msgid "Export orders"
|
| 39 |
-
msgstr "注文をエクスポート"
|
| 40 |
-
|
| 41 |
-
#: templates/emails/vendor-new-order.php:13
|
| 42 |
-
msgid "You have received an order from %s. Their order is as follows:"
|
| 43 |
-
msgstr "%s から注文を受け取りました。 その注文は次のとおりです。"
|
| 44 |
-
|
| 45 |
-
#: templates/emails/notify-vendor-shipped.php:62,
|
| 46 |
-
#: templates/emails/vendor-new-order.php:62
|
| 47 |
-
msgid "Tel:"
|
| 48 |
-
msgstr "電話番号 : "
|
| 49 |
-
|
| 50 |
-
#: templates/emails/notify-vendor-shipped.php:59,
|
| 51 |
-
#: templates/emails/vendor-new-order.php:59
|
| 52 |
-
msgid "Email:"
|
| 53 |
-
msgstr "メールアドレス : "
|
| 54 |
-
|
| 55 |
-
#: templates/emails/notify-vendor-shipped.php:56,
|
| 56 |
-
#: templates/emails/vendor-new-order.php:56
|
| 57 |
-
msgid "Customer details"
|
| 58 |
-
msgstr "お客様の詳細"
|
| 59 |
-
|
| 60 |
-
#: templates/emails/notify-vendor-shipped.php:24,
|
| 61 |
-
#: templates/emails/vendor-new-order.php:24
|
| 62 |
-
msgid "Price"
|
| 63 |
-
msgstr "価格"
|
| 64 |
-
|
| 65 |
-
#: templates/emails/notify-vendor-shipped.php:17,
|
| 66 |
-
#: templates/emails/vendor-new-order.php:17
|
| 67 |
-
msgid "Order: %s"
|
| 68 |
-
msgstr "注文 : %s"
|
| 69 |
-
|
| 70 |
-
#: templates/emails/notify-vendor-shipped.php:13
|
| 71 |
-
msgid ""
|
| 72 |
-
"A vendor has marked part of your order as shipped. The items that are "
|
| 73 |
-
"shipped are as follows:"
|
| 74 |
-
msgstr ""
|
| 75 |
-
"販売者が出荷時に注文の一部をマークしています。 出荷される品目は次のとおりで"
|
| 76 |
-
"す。"
|
| 77 |
-
|
| 78 |
-
#: templates/emails/new-product.php:10
|
| 79 |
-
msgid "Edit product: %s"
|
| 80 |
-
msgstr "商品編集 : %s"
|
| 81 |
-
|
| 82 |
-
#: templates/emails/new-product.php:9
|
| 83 |
-
msgid "Submitted by: %s"
|
| 84 |
-
msgstr "送信者 : %s"
|
| 85 |
-
|
| 86 |
-
#: templates/emails/new-product.php:8
|
| 87 |
-
msgid "Product title: %s"
|
| 88 |
-
msgstr "商品名 : %s"
|
| 89 |
-
|
| 90 |
-
#: templates/emails/new-product.php:5
|
| 91 |
-
msgid "Hi there. This is a notification about a new product on %s."
|
| 92 |
-
msgstr "こんにちは。 これは %s の新製品に関する通知です。"
|
| 93 |
-
|
| 94 |
-
#: templates/emails/application-status.php:9
|
| 95 |
-
msgid "Applicant username: %s"
|
| 96 |
-
msgstr "契約ユーザー名 : %s"
|
| 97 |
-
|
| 98 |
-
#: templates/emails/application-status.php:8
|
| 99 |
-
msgid "Application status: %s"
|
| 100 |
-
msgstr "契約状況 : %s"
|
| 101 |
-
|
| 102 |
-
#: templates/emails/application-status.php:5
|
| 103 |
-
msgid "Hi there. This is a notification about a vendor application on %s."
|
| 104 |
-
msgstr "こんにちは。 これは、%sの販売者契約に関する通知です。"
|
| 105 |
-
|
| 106 |
-
#: templates/dashboard/settings/settings.php:47
|
| 107 |
-
msgid "Save"
|
| 108 |
-
msgstr "保存"
|
| 109 |
-
|
| 110 |
-
#: templates/dashboard/reports.php:82
|
| 111 |
-
msgid "You haven't made any sales yet."
|
| 112 |
-
msgstr "まだ売上がありません。"
|
| 113 |
-
|
| 114 |
-
#: templates/dashboard/reports.php:71
|
| 115 |
-
msgid "You have no sales during this period."
|
| 116 |
-
msgstr "指定の期間の売上はありません。"
|
| 117 |
-
|
| 118 |
-
#: templates/dashboard/reports.php:56
|
| 119 |
-
msgid "Totals"
|
| 120 |
-
msgstr "合計"
|
| 121 |
-
|
| 122 |
-
#: templates/dashboard/reports.php:47
|
| 123 |
-
msgid "Show Orders"
|
| 124 |
-
msgstr "注文を表示"
|
| 125 |
-
|
| 126 |
-
#: templates/dashboard/reports.php:20
|
| 127 |
-
msgid "Rate"
|
| 128 |
-
msgstr "割合"
|
| 129 |
-
|
| 130 |
-
#: templates/dashboard/reports.php:1
|
| 131 |
-
msgid "Sales Report"
|
| 132 |
-
msgstr "販売レポート"
|
| 133 |
-
|
| 134 |
-
#: templates/dashboard/orders.php:185
|
| 135 |
-
msgid "You have no orders during this period."
|
| 136 |
-
msgstr "この期間の注文はありません。"
|
| 137 |
-
|
| 138 |
-
#: templates/dashboard/orders.php:111
|
| 139 |
-
msgid "Tracking"
|
| 140 |
-
msgstr "トラッキング"
|
| 141 |
-
|
| 142 |
-
#: templates/dashboard/orders.php:48
|
| 143 |
-
msgid "Links"
|
| 144 |
-
msgstr "リンク"
|
| 145 |
-
|
| 146 |
-
#: templates/dashboard/orders.php:19, templates/dashboard/orders.php:90
|
| 147 |
-
msgid "View items"
|
| 148 |
-
msgstr "商品を表示"
|
| 149 |
-
|
| 150 |
-
#: templates/dashboard/orders.php:18, templates/dashboard/orders.php:21
|
| 151 |
-
msgid "Hide items"
|
| 152 |
-
msgstr "商品を隠す"
|
| 153 |
-
|
| 154 |
-
#: templates/dashboard/links.php:8
|
| 155 |
-
msgid "Edit Products"
|
| 156 |
-
msgstr "商品を編集"
|
| 157 |
-
|
| 158 |
-
#: templates/dashboard/links.php:7
|
| 159 |
-
msgid "Add New Product"
|
| 160 |
-
msgstr "新しい商品を追加"
|
| 161 |
-
|
| 162 |
-
#: templates/dashboard/links.php:4
|
| 163 |
-
msgid "Store Settings"
|
| 164 |
-
msgstr "店舗設定"
|
| 165 |
-
|
| 166 |
-
#: templates/dashboard/links.php:3
|
| 167 |
-
msgid "View Your Store"
|
| 168 |
-
msgstr "店舗を見る"
|
| 169 |
-
|
| 170 |
-
#: templates/dashboard/denied.php:53
|
| 171 |
-
msgid "Submit"
|
| 172 |
-
msgstr "送信"
|
| 173 |
-
|
| 174 |
-
#: templates/dashboard/denied.php:33
|
| 175 |
-
msgid "I have read and accepted the <a href=\"%s\">terms and conditions</a>"
|
| 176 |
-
msgstr "私は<a href=\"%s\">利用規約</a>を読み、同意しました。"
|
| 177 |
-
|
| 178 |
-
#: templates/dashboard/denied.php:12
|
| 179 |
-
msgid "Your account is not setup as a vendor."
|
| 180 |
-
msgstr "このアカウントは販売者として設定されていません。"
|
| 181 |
-
|
| 182 |
-
#: templates/dashboard/denied.php:8
|
| 183 |
-
msgid ""
|
| 184 |
-
"Your account has not yet been approved to become a vendor. When it is, you "
|
| 185 |
-
"will receive an email telling you that your account is approved!"
|
| 186 |
-
msgstr ""
|
| 187 |
-
"このアカウントはまだ販売者になることが承認されていません。 承認されれば、この"
|
| 188 |
-
"アカウントが承認されたことを伝えるメールが届きます！"
|
| 189 |
-
|
| 190 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:215
|
| 191 |
-
msgid "Payment total: %s."
|
| 192 |
-
msgstr "支払合計 : %s"
|
| 193 |
-
|
| 194 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:212
|
| 195 |
-
msgid "Payment message: %s."
|
| 196 |
-
msgstr "決済メッセージ : %s"
|
| 197 |
-
|
| 198 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:211
|
| 199 |
-
msgid "Payment status: %s."
|
| 200 |
-
msgstr "決済状況 : %s"
|
| 201 |
-
|
| 202 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:210
|
| 203 |
-
msgid ""
|
| 204 |
-
"Hello! A payment was just triggered to mass pay all vendors their due "
|
| 205 |
-
"commission."
|
| 206 |
-
msgstr ""
|
| 207 |
-
"こんにちは！ すべての販売者に報酬を支払うためにマスペイメントの支払いが開始さ"
|
| 208 |
-
"れました。"
|
| 209 |
-
|
| 210 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:208
|
| 211 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 212 |
-
msgstr "WooCommerce : 販売者更新のためのマスペイメント"
|
| 213 |
-
|
| 214 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:173
|
| 215 |
-
msgid ""
|
| 216 |
-
"All due commission has been paid for, but I could not clear it from their "
|
| 217 |
-
"profiles due to an internal error. Commission will still be listed as due. "
|
| 218 |
-
"Please manually mark the commission as paid from the Commissions page."
|
| 219 |
-
msgstr ""
|
| 220 |
-
"すべての報酬は支払われましたが、内部エラーのためにプロファイルからそれをクリ"
|
| 221 |
-
"アすることはできませんでした。 報酬は引き続き支払期限として表示されます。 報"
|
| 222 |
-
"酬は報酬ページから支払済みとして手動でマークしてください。"
|
| 223 |
-
|
| 224 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:167
|
| 225 |
-
msgid "All due commission has been paid for."
|
| 226 |
-
msgstr "すべての報酬が支払われました。"
|
| 227 |
-
|
| 228 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:115
|
| 229 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 230 |
-
msgstr ""
|
| 231 |
-
"販売者は支払うことができませんでした。 PayPal アドレスを設定していない可能性"
|
| 232 |
-
"がありますか？"
|
| 233 |
-
|
| 234 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:508
|
| 235 |
-
msgid "sprintfError ID: %s. %s"
|
| 236 |
-
msgstr "sprintfError ID: %s. %s"
|
| 237 |
-
|
| 238 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:393,
|
| 239 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:394
|
| 240 |
-
msgid "Error ID: %s. %s"
|
| 241 |
-
msgstr "エラー ID : %s. %s"
|
| 242 |
-
|
| 243 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:384,
|
| 244 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:500,
|
| 245 |
-
#: classes/gateways/PayPal_Masspay/class-paypal-masspay.php:153
|
| 246 |
-
msgid "Error: %s"
|
| 247 |
-
msgstr "エラー : %s"
|
| 248 |
-
|
| 249 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 250 |
-
msgid "%s does not support your store currency."
|
| 251 |
-
msgstr "%s は店舗通貨をサポートしていません。"
|
| 252 |
-
|
| 253 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 254 |
-
msgid "Gateway Disabled"
|
| 255 |
-
msgstr "決済無効"
|
| 256 |
-
|
| 257 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 258 |
-
msgid ""
|
| 259 |
-
"The PayPal Adaptive Payments gateway can instantly pay your vendors their "
|
| 260 |
-
"due commission (if enabled). Also used to mass pay vendors on a schedule / "
|
| 261 |
-
"manual method (if enabled)."
|
| 262 |
-
msgstr ""
|
| 263 |
-
"PayPal アダプティブペイメント決済は即座に販売者に支払手数料を支払うことができ"
|
| 264 |
-
"ます（有効な場合）。 また、スケジュール/手動方法（有効になっている場合）で販"
|
| 265 |
-
"売者を大量に支払うためにも使用されます。"
|
| 266 |
-
|
| 267 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 268 |
-
msgid "Enable logging"
|
| 269 |
-
msgstr "ログを有効に"
|
| 270 |
-
|
| 271 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 272 |
-
msgid "Enable PayPal Sandbox mode"
|
| 273 |
-
msgstr "PayPal サンドボックスモードを有効"
|
| 274 |
-
|
| 275 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 276 |
-
msgid "Misc. Settings"
|
| 277 |
-
msgstr "その他の設定"
|
| 278 |
-
|
| 279 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 280 |
-
msgid ""
|
| 281 |
-
"You can signup for a sandbox developer account <a href=\"%s\">here</a>. You "
|
| 282 |
-
"need a developer account if you want to enable Sandbox mode for testing."
|
| 283 |
-
msgstr ""
|
| 284 |
-
"<a href=\"%s\">ここ</a>でサンドボックスデベロッパーアカウントにサインアップで"
|
| 285 |
-
"きます。テストのためにサンドボックスモードを有効にする場合は、開発者アカウン"
|
| 286 |
-
"トが必要です。"
|
| 287 |
-
|
| 288 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 289 |
-
msgid "Sandbox Credentials"
|
| 290 |
-
msgstr "サンドボックス環境"
|
| 291 |
-
|
| 292 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 293 |
-
msgid "Only required when doing live transactions."
|
| 294 |
-
msgstr "本番トランザクションを行うときにのみ必要です。"
|
| 295 |
-
|
| 296 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 297 |
-
msgid "Application ID"
|
| 298 |
-
msgstr "アプリケーション ID"
|
| 299 |
-
|
| 300 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:195,
|
| 301 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 302 |
-
msgid "API Signature"
|
| 303 |
-
msgstr "API 署名"
|
| 304 |
-
|
| 305 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:190,
|
| 306 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 307 |
-
msgid "API Password"
|
| 308 |
-
msgstr "API パスワード"
|
| 309 |
-
|
| 310 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:185,
|
| 311 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 312 |
-
msgid "API Username"
|
| 313 |
-
msgstr "API ユーザー名"
|
| 314 |
-
|
| 315 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:180,
|
| 316 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 317 |
-
msgid "The email address main payments should go to."
|
| 318 |
-
msgstr "メインの決済となるメールアドレス。"
|
| 319 |
-
|
| 320 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:179,
|
| 321 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 322 |
-
msgid "PayPal Email"
|
| 323 |
-
msgstr "PayPal メールアドレス"
|
| 324 |
-
|
| 325 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 326 |
-
msgid ""
|
| 327 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 328 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 329 |
-
msgstr ""
|
| 330 |
-
"本番環境を進めるには<a href=\"%s\">アプリケーション ID</a>が必要です。サンド"
|
| 331 |
-
"ボックスモードでのテストには必要ありません。"
|
| 332 |
-
|
| 333 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 334 |
-
msgid "Live Credentials"
|
| 335 |
-
msgstr "本番環境"
|
| 336 |
-
|
| 337 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:161
|
| 338 |
-
msgid "Pay via PayPal!"
|
| 339 |
-
msgstr "PayPalで支払"
|
| 340 |
-
|
| 341 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 342 |
-
msgid "This controls the description which the user sees during checkout."
|
| 343 |
-
msgstr "これは、支払中にユーザが見る記述を設定する。"
|
| 344 |
-
|
| 345 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:159
|
| 346 |
-
msgid "Description"
|
| 347 |
-
msgstr "詳細"
|
| 348 |
-
|
| 349 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:154
|
| 350 |
-
msgid "PayPal"
|
| 351 |
-
msgstr "PayPal"
|
| 352 |
-
|
| 353 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 354 |
-
msgid "This controls the title which the user sees during checkout."
|
| 355 |
-
msgstr "これは、支払中にユーザーが見るタイトルを設定します。"
|
| 356 |
-
|
| 357 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 358 |
-
msgid "Method Title"
|
| 359 |
-
msgstr "決済タイトル"
|
| 360 |
-
|
| 361 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 362 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 363 |
-
msgstr "PayPal アダプティブペイメントを有効にする"
|
| 364 |
-
|
| 365 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 366 |
-
msgid "IPN payment completed"
|
| 367 |
-
msgstr "IPN 決済完了"
|
| 368 |
-
|
| 369 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 370 |
-
msgid ""
|
| 371 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 372 |
-
"%s."
|
| 373 |
-
msgstr ""
|
| 374 |
-
"何かが間違っていました。 PayPalからの応答がこの注文を無効にしました。 状態："
|
| 375 |
-
"%s"
|
| 376 |
-
|
| 377 |
-
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 378 |
-
msgid "PayPal Adaptive Payments"
|
| 379 |
-
msgstr "PayPal アダプティブペイメント"
|
| 380 |
-
|
| 381 |
-
#: classes/front/signup/class-vendor-signup.php:171,
|
| 382 |
-
#: classes/front/signup/class-vendor-signup.php:208,
|
| 383 |
-
#: classes/front/signup/class-vendor-signup.php:220
|
| 384 |
-
msgid "You must accept the terms and conditions to become a vendor."
|
| 385 |
-
msgstr "販売者になるには、利用規約に同意する必要があります。"
|
| 386 |
-
|
| 387 |
-
#: classes/front/signup/class-vendor-signup.php:124
|
| 388 |
-
msgid "Your application has been submitted."
|
| 389 |
-
msgstr "申請書が提出されました。"
|
| 390 |
-
|
| 391 |
-
#: classes/front/signup/class-vendor-signup.php:122
|
| 392 |
-
msgid "Application denied. You are an administrator."
|
| 393 |
-
msgstr "申込が拒否されました。 あなたは管理者です。"
|
| 394 |
-
|
| 395 |
-
#: classes/front/signup/class-vendor-signup.php:72,
|
| 396 |
-
#: classes/front/signup/views/html-vendor-signup.php:35
|
| 397 |
-
msgid ""
|
| 398 |
-
"I have read and accepted the <a target=\"top\" href=\"%s\">terms and "
|
| 399 |
-
"conditions</a>"
|
| 400 |
-
msgstr "私は<a target=\"top\" href=\"%s\">利用規約</a>を読み、同意しました。"
|
| 401 |
-
|
| 402 |
-
#: classes/front/signup/class-vendor-signup.php:58,
|
| 403 |
-
#: classes/front/signup/views/html-vendor-signup.php:21,
|
| 404 |
-
#: templates/dashboard/denied.php:22
|
| 405 |
-
msgid "Apply to become a vendor? "
|
| 406 |
-
msgstr "販売者になるために申請しますか？"
|
| 407 |
-
|
| 408 |
-
#: classes/front/orders/class-submit-comment.php:63
|
| 409 |
-
msgid "Success. The customer has been notified of your comment."
|
| 410 |
-
msgstr "成功。 お客様に注文コメントが通知されました。"
|
| 411 |
-
|
| 412 |
-
#: classes/front/orders/class-submit-comment.php:41
|
| 413 |
-
msgid "You've left the comment field empty!"
|
| 414 |
-
msgstr "注文コメント欄を空のままにしました！"
|
| 415 |
-
|
| 416 |
-
#: classes/front/orders/class-orders.php:256
|
| 417 |
-
msgid "Email address"
|
| 418 |
-
msgstr "メールアドレス"
|
| 419 |
-
|
| 420 |
-
#: classes/front/orders/class-orders.php:255
|
| 421 |
-
msgid "Zip"
|
| 422 |
-
msgstr "郵便番号"
|
| 423 |
-
|
| 424 |
-
#: classes/front/orders/class-orders.php:254
|
| 425 |
-
msgid "State"
|
| 426 |
-
msgstr "都道府県"
|
| 427 |
-
|
| 428 |
-
#: classes/front/orders/class-orders.php:253
|
| 429 |
-
msgid "City"
|
| 430 |
-
msgstr "市"
|
| 431 |
-
|
| 432 |
-
#: classes/front/orders/class-orders.php:252
|
| 433 |
-
msgid "Address"
|
| 434 |
-
msgstr "住所"
|
| 435 |
-
|
| 436 |
-
#: classes/front/orders/class-orders.php:251
|
| 437 |
-
msgid "Full name"
|
| 438 |
-
msgstr "氏名"
|
| 439 |
-
|
| 440 |
-
#: classes/front/orders/class-orders.php:250
|
| 441 |
-
msgid "Product Title"
|
| 442 |
-
msgstr "商品名"
|
| 443 |
-
|
| 444 |
-
#: classes/front/orders/class-orders.php:123,
|
| 445 |
-
#: classes/front/orders/class-orders.php:189
|
| 446 |
-
msgid "No orders."
|
| 447 |
-
msgstr "注文がありません。"
|
| 448 |
-
|
| 449 |
-
#: classes/front/orders/class-orders.php:100,
|
| 450 |
-
#: classes/front/orders/class-orders.php:166
|
| 451 |
-
msgid ""
|
| 452 |
-
"You haven't selected a product's orders to view! Please go back to the "
|
| 453 |
-
"Vendor Dashboard and click Show Orders on the product you'd like to view."
|
| 454 |
-
msgstr ""
|
| 455 |
-
"表示する商品の注文を選択していません！ 販売者ダッシュボードに戻り、表示する商"
|
| 456 |
-
"品の[注文を表示]をクリックしてください。"
|
| 457 |
-
|
| 458 |
-
#: classes/front/orders/class-export-csv.php:20
|
| 459 |
-
msgid "Item Meta"
|
| 460 |
-
msgstr "アイテムメタ"
|
| 461 |
-
|
| 462 |
-
#: classes/front/orders/class-export-csv.php:19,
|
| 463 |
-
#: templates/dashboard/reports.php:18,
|
| 464 |
-
#: templates/emails/notify-vendor-shipped.php:23,
|
| 465 |
-
#: templates/emails/vendor-new-order.php:23
|
| 466 |
-
msgid "Quantity"
|
| 467 |
-
msgstr "数"
|
| 468 |
-
|
| 469 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:86
|
| 470 |
-
msgid "Success. Your tracking number has been updated."
|
| 471 |
-
msgstr "成功。 追跡番号が更新されました。"
|
| 472 |
-
|
| 473 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:83,
|
| 474 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:84
|
| 475 |
-
msgid "Tracking number"
|
| 476 |
-
msgstr "追跡番号"
|
| 477 |
-
|
| 478 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:55
|
| 479 |
-
msgid "%s has marked as shipped. "
|
| 480 |
-
msgstr "%s が出荷済みにしました。"
|
| 481 |
-
|
| 482 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:53
|
| 483 |
-
msgid "Order marked shipped."
|
| 484 |
-
msgstr "注文した商品は出荷されました。"
|
| 485 |
-
|
| 486 |
-
#: classes/class-install.php:205
|
| 487 |
-
msgid "Vendor Dashboard"
|
| 488 |
-
msgstr "Vendor ダッシュボード"
|
| 489 |
-
|
| 490 |
-
#: classes/class-cron.php:87
|
| 491 |
-
msgid "Payment total: %s"
|
| 492 |
-
msgstr "決済合計 : %s"
|
| 493 |
-
|
| 494 |
-
#: classes/admin/views/html-vendor-settings-page.php:70
|
| 495 |
-
msgid "Save Shop Settings"
|
| 496 |
-
msgstr "店舗設定を保存"
|
| 497 |
-
|
| 498 |
-
#: classes/admin/views/html-vendor-settings-page.php:61,
|
| 499 |
-
#: templates/dashboard/settings/shop-description.php:3
|
| 500 |
-
msgid "This is displayed on your <a href=\"%s\">shop page</a>."
|
| 501 |
-
msgstr "これは、<a href=\"%s\">店舗ページ</a>に表示されます。"
|
| 502 |
-
|
| 503 |
-
#: classes/admin/views/html-vendor-settings-page.php:49,
|
| 504 |
-
#: templates/dashboard/settings/shop-description.php:2
|
| 505 |
-
msgid "Shop Description"
|
| 506 |
-
msgstr "店舗詳細"
|
| 507 |
-
|
| 508 |
-
#: classes/admin/views/html-vendor-settings-page.php:43,
|
| 509 |
-
#: templates/dashboard/settings/seller-info.php:4
|
| 510 |
-
msgid "This is displayed on each of your products."
|
| 511 |
-
msgstr "これは各商品に表示されます。"
|
| 512 |
-
|
| 513 |
-
#: classes/admin/views/html-vendor-settings-page.php:24,
|
| 514 |
-
#: templates/dashboard/settings/shop-name.php:3
|
| 515 |
-
msgid "Your shop name is public and must be unique."
|
| 516 |
-
msgstr "お店の名前は公開され、一意である必要があります。"
|
| 517 |
-
|
| 518 |
-
#: classes/admin/views/html-vendor-settings-page.php:15,
|
| 519 |
-
#: templates/dashboard/settings/paypal-email-form.php:3
|
| 520 |
-
msgid "Your PayPal address is used to send you your commission."
|
| 521 |
-
msgstr "手数料を送るために PayPal アドレスが使用されます。"
|
| 522 |
-
|
| 523 |
-
#: classes/admin/views/html-vendor-settings-page.php:11,
|
| 524 |
-
#: templates/dashboard/settings/paypal-email-form.php:2
|
| 525 |
-
msgid "PayPal Address"
|
| 526 |
-
msgstr "PayPal アドレス"
|
| 527 |
-
|
| 528 |
-
#: classes/admin/settings/sf-options.php:359
|
| 529 |
-
msgid ""
|
| 530 |
-
"Send the WooCommerce admin an email each time a payment has been made via "
|
| 531 |
-
"the payment schedule options above"
|
| 532 |
-
msgstr ""
|
| 533 |
-
"上記の支払いスケジュールオプションで支払いが行われるたびに、 WooCommerce 管理"
|
| 534 |
-
"者にメールを送信してください"
|
| 535 |
-
|
| 536 |
-
#: classes/admin/settings/sf-options.php:358
|
| 537 |
-
msgid "Email notification"
|
| 538 |
-
msgstr "メール通知"
|
| 539 |
-
|
| 540 |
-
#: classes/admin/settings/sf-options.php:353
|
| 541 |
-
msgid "Now"
|
| 542 |
-
msgstr "今"
|
| 543 |
-
|
| 544 |
-
#: classes/admin/settings/sf-options.php:352
|
| 545 |
-
msgid "Manual"
|
| 546 |
-
msgstr "手動"
|
| 547 |
-
|
| 548 |
-
#: classes/admin/settings/sf-options.php:351
|
| 549 |
-
msgid "Monthly"
|
| 550 |
-
msgstr "月"
|
| 551 |
-
|
| 552 |
-
#: classes/admin/settings/sf-options.php:350
|
| 553 |
-
msgid "Biweekly"
|
| 554 |
-
msgstr "隔週"
|
| 555 |
-
|
| 556 |
-
#: classes/admin/settings/sf-options.php:349
|
| 557 |
-
msgid "Weekly"
|
| 558 |
-
msgstr "週"
|
| 559 |
-
|
| 560 |
-
#: classes/admin/settings/sf-options.php:348
|
| 561 |
-
msgid "Daily"
|
| 562 |
-
msgstr "日"
|
| 563 |
-
|
| 564 |
-
#: classes/admin/settings/sf-options.php:343
|
| 565 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 566 |
-
msgstr "注：スケジュールは即時支払いがチェックされていない場合にのみ機能します"
|
| 567 |
-
|
| 568 |
-
#: classes/admin/settings/sf-options.php:342
|
| 569 |
-
msgid "Payment schedule"
|
| 570 |
-
msgstr "支払スケジュール"
|
| 571 |
-
|
| 572 |
-
#: classes/admin/settings/sf-options.php:335
|
| 573 |
-
msgid ""
|
| 574 |
-
"For this to work, customers must checkout with the PayPal Adaptive Payments "
|
| 575 |
-
"gateway. Using any other gateways will not pay vendors instantly"
|
| 576 |
-
msgstr ""
|
| 577 |
-
"これを行うには、PayPal アダプティブペイメント決済で支払する必要があります。 "
|
| 578 |
-
"他の決済を使用してもすぐに販売者に支払うことはありません"
|
| 579 |
-
|
| 580 |
-
#: classes/admin/settings/sf-options.php:334
|
| 581 |
-
msgid ""
|
| 582 |
-
"Instantly pay vendors their commission when an order is made, and if a "
|
| 583 |
-
"vendor has a valid PayPal email added on their Shop Settings page."
|
| 584 |
-
msgstr ""
|
| 585 |
-
"注文時に即座に販売者に手数料を払い、販売店には店舗設定ページに有効な PayPal "
|
| 586 |
-
"メールが追加されているかどうかを確認します。"
|
| 587 |
-
|
| 588 |
-
#: classes/admin/settings/sf-options.php:333
|
| 589 |
-
msgid "Instant pay"
|
| 590 |
-
msgstr "即時決済"
|
| 591 |
-
|
| 592 |
-
#: classes/admin/settings/sf-options.php:329
|
| 593 |
-
msgid ""
|
| 594 |
-
"Make sure you update your PayPal Adaptive Payments settings <a href=\"%s"
|
| 595 |
-
"\">here</a>. <br><br>To instantly pay with Adaptive Payments you must "
|
| 596 |
-
"activate the PayPal AP gateway in your Checkout settings. <br><a href="
|
| 597 |
-
"\"https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/\" "
|
| 598 |
-
"target=\"top\">PayPal AP Application Help</a>. <br><br>Another gateway that "
|
| 599 |
-
"offers instant payments to vendors that also accepts credit cards directly "
|
| 600 |
-
"on your checkout page is Stripe. <br><a href=\"https://www.wcvendors.com/"
|
| 601 |
-
"product/stripe-commissions-gateway/\" target=\"top\">Stripe Commissions & "
|
| 602 |
-
"Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a href="
|
| 603 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 604 |
-
"Vendors Pro</a>."
|
| 605 |
-
msgstr ""
|
| 606 |
-
"PayPal アダプティブペイメントの設定を<a href=\"%s\">ここから</a>更新してくだ"
|
| 607 |
-
"さい。<br><br>アダプティブペイメントで即座に支払いを行うには、支払設定で "
|
| 608 |
-
"PayPal API ゲートウェイを有効にする必要があります。<br><a href=\"https://www."
|
| 609 |
-
"wcvendors.com/kb/configuring-paypal-adaptive-payments/\" target=\"top"
|
| 610 |
-
"\">PayPal API アプリケーションヘルプ。</a><br><br>チェックアウトページで直接"
|
| 611 |
-
"クレジットカードを受け入れる販売者への即時支払いを提供する別の決済はStripeで"
|
| 612 |
-
"す。<br><a href=\"https://www.wcvendors.com/product/stripe-commissions-"
|
| 613 |
-
"gateway/\" target=\"top\">Stripeによる報酬及び決済プラグイン</a>は $49 で<a "
|
| 614 |
-
"href=\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 615 |
-
"Vendors Pro</a>に同梱されています。"
|
| 616 |
-
|
| 617 |
-
#: classes/admin/settings/sf-options.php:328
|
| 618 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 619 |
-
msgstr "現在支払う総手数料 : %s <a href=\"%s\">詳細はこちら。</a>"
|
| 620 |
-
|
| 621 |
-
#: classes/admin/settings/sf-options.php:327
|
| 622 |
-
msgid "PayPal Adaptive Payments Scheduling"
|
| 623 |
-
msgstr "PayPal Adaptive 決済スケジュール"
|
| 624 |
-
|
| 625 |
-
#: classes/admin/settings/sf-options.php:325
|
| 626 |
-
msgid "Payments"
|
| 627 |
-
msgstr "Payments"
|
| 628 |
-
|
| 629 |
-
#: classes/admin/settings/sf-options.php:314
|
| 630 |
-
msgid "payments"
|
| 631 |
-
msgstr "決済"
|
| 632 |
-
|
| 633 |
-
#: classes/admin/settings/sf-options.php:307
|
| 634 |
-
msgid ""
|
| 635 |
-
"These terms are shown to a user when submitting an application to become a "
|
| 636 |
-
"vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor "
|
| 637 |
-
"must accept terms in order to register, if set."
|
| 638 |
-
msgstr ""
|
| 639 |
-
"これらの規約は、販売者になるためにアプリケーションを提出するときにユーザーに"
|
| 640 |
-
"表示されます。<br/>空白のままにすると、申請者に条件が表示されません。 ベン"
|
| 641 |
-
"ダーは、登録されている場合は、登録するために条件を受け入れる必要があります。"
|
| 642 |
-
|
| 643 |
-
#: classes/admin/settings/sf-options.php:306
|
| 644 |
-
msgid "Vendor terms"
|
| 645 |
-
msgstr "販売者規約"
|
| 646 |
-
|
| 647 |
-
#: classes/admin/settings/sf-options.php:299
|
| 648 |
-
msgid ""
|
| 649 |
-
"Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 650 |
-
"default, Vendor Dashboard > Orders should have the shortcode."
|
| 651 |
-
msgstr ""
|
| 652 |
-
"ショートコード<code>[wcv_orders]</code>を持つページを選択します。<br/>デフォ"
|
| 653 |
-
"ルトでは、ベンダダッシュボード>注文にショートコードが必要です。"
|
| 654 |
-
|
| 655 |
-
#: classes/admin/settings/sf-options.php:298
|
| 656 |
-
msgid "Orders page"
|
| 657 |
-
msgstr "注文ページ"
|
| 658 |
-
|
| 659 |
-
#: classes/admin/settings/sf-options.php:291
|
| 660 |
-
msgid ""
|
| 661 |
-
"Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/"
|
| 662 |
-
">These are the shop settings a vendor can configure. By default, Vendor "
|
| 663 |
-
"Dashboard > Shop Settings should have this shortcode."
|
| 664 |
-
msgstr ""
|
| 665 |
-
"ショートコード<code>[wcv_shop_settings]</code>を持つページを選択します。<br/>"
|
| 666 |
-
"販売者が設定できるショップの設定です。 デフォルトでは、販売者ダッシュボード "
|
| 667 |
-
"> ショップ設定にこのショートコードが必要です。"
|
| 668 |
-
|
| 669 |
-
#: classes/admin/settings/sf-options.php:290
|
| 670 |
-
msgid "Shop settings"
|
| 671 |
-
msgstr "店舗設定"
|
| 672 |
-
|
| 673 |
-
#: classes/admin/settings/sf-options.php:283
|
| 674 |
-
msgid ""
|
| 675 |
-
"Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</"
|
| 676 |
-
"code><br/>. If this page is not set, you will break your site. If you "
|
| 677 |
-
"upgrade to Pro, keep this page unchanged as both Pro Dashboard and this "
|
| 678 |
-
"Dashboard page must be set."
|
| 679 |
-
msgstr ""
|
| 680 |
-
"ショートコード<code>[wcv_vendor_dashboard]</code>を持つページを選択します。"
|
| 681 |
-
"<br/>このページが設定されていない場合は、サイトを中断します。 Pro にアッグ"
|
| 682 |
-
"レードする場合は、Pro ダッシュボードとこのダッシュボードページの両方を設定す"
|
| 683 |
-
"る必要があるため、このページは変更しないでください。"
|
| 684 |
-
|
| 685 |
-
#: classes/admin/settings/sf-options.php:282
|
| 686 |
-
msgid "Vendor dashboard"
|
| 687 |
-
msgstr "販売者ダッシュボード"
|
| 688 |
-
|
| 689 |
-
#: classes/admin/settings/sf-options.php:279
|
| 690 |
-
msgid "Page configuration"
|
| 691 |
-
msgstr "ページ構成"
|
| 692 |
-
|
| 693 |
-
#: classes/admin/settings/sf-options.php:278
|
| 694 |
-
msgid "Pages"
|
| 695 |
-
msgstr "Pages"
|
| 696 |
-
|
| 697 |
-
#: classes/admin/settings/sf-options.php:272
|
| 698 |
-
msgid ""
|
| 699 |
-
"Vendors can submit products without review or approval from a shop admin. "
|
| 700 |
-
"This could be dangerous with malicious vendors, so take caution."
|
| 701 |
-
msgstr ""
|
| 702 |
-
"販売者は、店舗管理者からのレビューや承認を受けずに商品を提出できます。 これは"
|
| 703 |
-
"悪意のある販売者にとっては危険かもしれませんので、注意してください。"
|
| 704 |
-
|
| 705 |
-
#: classes/admin/settings/sf-options.php:271
|
| 706 |
-
msgid "Submit products live without requiring approval"
|
| 707 |
-
msgstr "承認不要の商品を送信する"
|
| 708 |
-
|
| 709 |
-
#: classes/admin/settings/sf-options.php:264
|
| 710 |
-
msgid ""
|
| 711 |
-
"Vendors could edit an approved product after it has already gone live. There "
|
| 712 |
-
"is no approval or review after editing a live product. This could be "
|
| 713 |
-
"dangerous with malicious vendors, so take caution."
|
| 714 |
-
msgstr ""
|
| 715 |
-
"既に販売された後、販売者は承認された商品を編集することができます。 販売中商品"
|
| 716 |
-
"を編集した後、承認またはレビューはありません。 これは悪意のある販売者にとって"
|
| 717 |
-
"は危険かもしれませんので、注意してください。"
|
| 718 |
-
|
| 719 |
-
#: classes/admin/settings/sf-options.php:263
|
| 720 |
-
msgid "Edit live products"
|
| 721 |
-
msgstr "販売中商品の編集"
|
| 722 |
-
|
| 723 |
-
#: classes/admin/settings/sf-options.php:256
|
| 724 |
-
msgid ""
|
| 725 |
-
"Check to allow vendors to list new products. Admin must approve new "
|
| 726 |
-
"products by editing the product, and clicking Publish."
|
| 727 |
-
msgstr ""
|
| 728 |
-
"販売者に新製品のリストを許可するかどうかをチェックします。 管理者は、商品を編"
|
| 729 |
-
"集し、[公開]をクリックして新しい製品を承認する必要があります。"
|
| 730 |
-
|
| 731 |
-
#: classes/admin/settings/sf-options.php:255
|
| 732 |
-
msgid "Submit products"
|
| 733 |
-
msgstr "商品の送信"
|
| 734 |
-
|
| 735 |
-
#: classes/admin/settings/sf-options.php:247
|
| 736 |
-
msgid ""
|
| 737 |
-
"Sales table on the frontend on the Vendor Dashboard page. The table will "
|
| 738 |
-
"only display sales data that pertain to their products, and only for orders "
|
| 739 |
-
"that are processing or completed."
|
| 740 |
-
msgstr ""
|
| 741 |
-
"販売者ダッシュボードページのフロントエンドの売上表。 この表には、商品に関連す"
|
| 742 |
-
"る販売データのみが表示され、処理中または完了した注文のみが表示されます。"
|
| 743 |
-
|
| 744 |
-
#: classes/admin/settings/sf-options.php:246
|
| 745 |
-
msgid "View Frontend sales reports"
|
| 746 |
-
msgstr "フロントエンドの売上レポートを表示"
|
| 747 |
-
|
| 748 |
-
#: classes/admin/settings/sf-options.php:239
|
| 749 |
-
msgid ""
|
| 750 |
-
"This option has been removed and will no longer function. It will be "
|
| 751 |
-
"completely removed in future versions. Vendors should use their Vendor "
|
| 752 |
-
"Dashboard for reports as all identical functionality is already there. "
|
| 753 |
-
msgstr ""
|
| 754 |
-
"このオプションは削除され、機能しなくなります。 将来のバージョンでは完全に削除"
|
| 755 |
-
"されます。 販売者は、同じ機能がすべて既に存在するため、レポートには販売者ダッ"
|
| 756 |
-
"シュボードを使用するべきです。"
|
| 757 |
-
|
| 758 |
-
#: classes/admin/settings/sf-options.php:238
|
| 759 |
-
msgid ""
|
| 760 |
-
"<strike>View backend sales reports</strike>. <strong>Depreciated</strong>"
|
| 761 |
-
msgstr ""
|
| 762 |
-
"<strike>バックエンド販売レポートを表示する</strike>. <strong>非推奨</strong>"
|
| 763 |
-
|
| 764 |
-
#: classes/admin/settings/sf-options.php:237
|
| 765 |
-
msgid "Reports"
|
| 766 |
-
msgstr "レポート"
|
| 767 |
-
|
| 768 |
-
#: classes/admin/settings/sf-options.php:230
|
| 769 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 770 |
-
msgstr "販売者は、フロントエンドで商品の注文をエクスポートすることができます"
|
| 771 |
-
|
| 772 |
-
#: classes/admin/settings/sf-options.php:229
|
| 773 |
-
msgid "Export a CSV file of orders for a product"
|
| 774 |
-
msgstr "商品の受注 CSV ファイルをエクスポートする"
|
| 775 |
-
|
| 776 |
-
#: classes/admin/settings/sf-options.php:222
|
| 777 |
-
msgid ""
|
| 778 |
-
"While viewing order details on the frontend, you can disable or enable email "
|
| 779 |
-
"addresses"
|
| 780 |
-
msgstr ""
|
| 781 |
-
"フロントエンドで注文の詳細を表示している間に、メールアドレスを無効または有効"
|
| 782 |
-
"にすることができます"
|
| 783 |
-
|
| 784 |
-
#: classes/admin/settings/sf-options.php:221
|
| 785 |
-
msgid "View email addresses"
|
| 786 |
-
msgstr "メールアドレスを表示"
|
| 787 |
-
|
| 788 |
-
#: classes/admin/settings/sf-options.php:214
|
| 789 |
-
msgid ""
|
| 790 |
-
"Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 791 |
-
msgstr ""
|
| 792 |
-
"フロントエンドの注文に関するコメントを送信します。 たとえば、商品のトラッキン"
|
| 793 |
-
"グ ID"
|
| 794 |
-
|
| 795 |
-
#: classes/admin/settings/sf-options.php:213
|
| 796 |
-
msgid "Submit comments"
|
| 797 |
-
msgstr "コメントをソウシン"
|
| 798 |
-
|
| 799 |
-
#: classes/admin/settings/sf-options.php:206
|
| 800 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 801 |
-
msgstr "フロントエンドでの注文に関するすべての販売者コメントを表示する"
|
| 802 |
-
|
| 803 |
-
#: classes/admin/settings/sf-options.php:205
|
| 804 |
-
msgid "View comments"
|
| 805 |
-
msgstr "コメントを表示"
|
| 806 |
-
|
| 807 |
-
#: classes/admin/settings/sf-options.php:198
|
| 808 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 809 |
-
msgstr "注文ごとにメール、住所、名前などの顧客の詳細を表示する"
|
| 810 |
-
|
| 811 |
-
#: classes/admin/settings/sf-options.php:197
|
| 812 |
-
msgid "View orders"
|
| 813 |
-
msgstr "注文を表示"
|
| 814 |
-
|
| 815 |
-
#: classes/admin/settings/sf-options.php:193
|
| 816 |
-
msgid "General permissions used around the shop"
|
| 817 |
-
msgstr "店舗の一般的な権限"
|
| 818 |
-
|
| 819 |
-
#: classes/admin/settings/sf-options.php:193
|
| 820 |
-
msgid "Permissions"
|
| 821 |
-
msgstr "権限"
|
| 822 |
-
|
| 823 |
-
#: classes/admin/settings/sf-options.php:186
|
| 824 |
-
msgid ""
|
| 825 |
-
"You can add CSS in this textarea, which will be loaded on the product add/"
|
| 826 |
-
"edit page for vendors."
|
| 827 |
-
msgstr ""
|
| 828 |
-
"このテキストエリアに CSS を追加することができます。このテキストエリアは、販売"
|
| 829 |
-
"者の商品追加/編集ページにロードされます。"
|
| 830 |
-
|
| 831 |
-
#: classes/admin/settings/sf-options.php:185
|
| 832 |
-
msgid "Stylesheet"
|
| 833 |
-
msgstr "スタイルシート"
|
| 834 |
-
|
| 835 |
-
#: classes/admin/settings/sf-options.php:178
|
| 836 |
-
msgid "Duplicate Product"
|
| 837 |
-
msgstr "重複した商品"
|
| 838 |
-
|
| 839 |
-
#: classes/admin/settings/sf-options.php:177
|
| 840 |
-
msgid "Featured"
|
| 841 |
-
msgstr "オススメ商品"
|
| 842 |
-
|
| 843 |
-
#: classes/admin/settings/sf-options.php:176
|
| 844 |
-
msgid "SKU"
|
| 845 |
-
msgstr "SKU"
|
| 846 |
-
|
| 847 |
-
#: classes/admin/settings/sf-options.php:172
|
| 848 |
-
msgid "Miscellaneous"
|
| 849 |
-
msgstr "その他"
|
| 850 |
-
|
| 851 |
-
#: classes/admin/settings/sf-options.php:165
|
| 852 |
-
msgid "Downloadable"
|
| 853 |
-
msgstr "ダウンロード商品"
|
| 854 |
-
|
| 855 |
-
#: classes/admin/settings/sf-options.php:164
|
| 856 |
-
msgid "Virtual"
|
| 857 |
-
msgstr "バーチャル"
|
| 858 |
-
|
| 859 |
-
#: classes/admin/settings/sf-options.php:161
|
| 860 |
-
msgid ""
|
| 861 |
-
"CHECKING these boxes will **HIDE** these product options from the vendor"
|
| 862 |
-
msgstr ""
|
| 863 |
-
"これらのチェックボックスをオンにすると、販売者からこれらの商品タイプオプショ"
|
| 864 |
-
"ンが隠されます"
|
| 865 |
-
|
| 866 |
-
#: classes/admin/settings/sf-options.php:160
|
| 867 |
-
msgid "Type options"
|
| 868 |
-
msgstr "商品タイプオプション"
|
| 869 |
-
|
| 870 |
-
#: classes/admin/settings/sf-options.php:153
|
| 871 |
-
msgid "External / affiliate"
|
| 872 |
-
msgstr "外部 / アフェリエイト リンク"
|
| 873 |
-
|
| 874 |
-
#: classes/admin/settings/sf-options.php:152
|
| 875 |
-
msgid "Grouped"
|
| 876 |
-
msgstr "グループ化された商品"
|
| 877 |
-
|
| 878 |
-
#: classes/admin/settings/sf-options.php:151
|
| 879 |
-
msgid "Variable"
|
| 880 |
-
msgstr "バリエーションのある商品"
|
| 881 |
-
|
| 882 |
-
#: classes/admin/settings/sf-options.php:150
|
| 883 |
-
msgid "Simple"
|
| 884 |
-
msgstr "簡単な商品"
|
| 885 |
-
|
| 886 |
-
#: classes/admin/settings/sf-options.php:147
|
| 887 |
-
msgid "CHECKING these boxes will HIDE these product types from the vendor"
|
| 888 |
-
msgstr ""
|
| 889 |
-
"これらのチェックボックスをオンにすると、販売者からこれらの商品タイプが隠され"
|
| 890 |
-
"ます"
|
| 891 |
-
|
| 892 |
-
#: classes/admin/settings/sf-options.php:146
|
| 893 |
-
msgid "Types"
|
| 894 |
-
msgstr "商品タイプ"
|
| 895 |
-
|
| 896 |
-
#: classes/admin/settings/sf-options.php:139
|
| 897 |
-
msgid "Advanced"
|
| 898 |
-
msgstr "高度"
|
| 899 |
-
|
| 900 |
-
#: classes/admin/settings/sf-options.php:138
|
| 901 |
-
msgid "Attributes"
|
| 902 |
-
msgstr "属性"
|
| 903 |
-
|
| 904 |
-
#: classes/admin/settings/sf-options.php:137
|
| 905 |
-
msgid "Linked Products"
|
| 906 |
-
msgstr "リンクされた製品"
|
| 907 |
-
|
| 908 |
-
#: classes/admin/settings/sf-options.php:135
|
| 909 |
-
msgid "Inventory"
|
| 910 |
-
msgstr "在庫"
|
| 911 |
-
|
| 912 |
-
#: classes/admin/settings/sf-options.php:132
|
| 913 |
-
msgid ""
|
| 914 |
-
"CHECKING these boxes will **HIDE** these areas of the add product page for "
|
| 915 |
-
"vendors"
|
| 916 |
-
msgstr ""
|
| 917 |
-
"これらのチェックボックスをオンにすると、販売者の商品追加ページのこれらの領域"
|
| 918 |
-
"が **隠されます**"
|
| 919 |
-
|
| 920 |
-
#: classes/admin/settings/sf-options.php:131
|
| 921 |
-
msgid "Left side panel"
|
| 922 |
-
msgstr "左側のサイドパネル"
|
| 923 |
-
|
| 924 |
-
#: classes/admin/settings/sf-options.php:128
|
| 925 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 926 |
-
msgstr "商品を追加するときにすべての販売者から隠す内容を設定する"
|
| 927 |
-
|
| 928 |
-
#: classes/admin/settings/sf-options.php:128
|
| 929 |
-
msgid "Product Add Page"
|
| 930 |
-
msgstr "商品追加ページ設定"
|
| 931 |
-
|
| 932 |
-
#: classes/admin/settings/sf-options.php:124
|
| 933 |
-
msgid "Seller Info"
|
| 934 |
-
msgstr "販売者情報"
|
| 935 |
-
|
| 936 |
-
#: classes/admin/settings/sf-options.php:121
|
| 937 |
-
msgid "The seller info tab title on the single product page."
|
| 938 |
-
msgstr "商品ページの販売者情報タブのタイトル"
|
| 939 |
-
|
| 940 |
-
#: classes/admin/settings/sf-options.php:120
|
| 941 |
-
msgid "Seller Info Label"
|
| 942 |
-
msgstr "販売者情報ラベル"
|
| 943 |
-
|
| 944 |
-
#: classes/admin/settings/sf-options.php:113
|
| 945 |
-
msgid "The sold by label used on the site and emails."
|
| 946 |
-
msgstr "販売者ラベルをサイトとメールで利用します。"
|
| 947 |
-
|
| 948 |
-
#: classes/admin/settings/sf-options.php:112
|
| 949 |
-
msgid "Sold By Label"
|
| 950 |
-
msgstr "販売者ラベル"
|
| 951 |
-
|
| 952 |
-
#: classes/admin/settings/sf-options.php:105
|
| 953 |
-
msgid "This will enable or disable the sold by labels."
|
| 954 |
-
msgstr "これは販売者のラベルの表示を有効にするか無効にするかです。"
|
| 955 |
-
|
| 956 |
-
#: classes/admin/settings/sf-options.php:104
|
| 957 |
-
msgid "Enable sold by labels"
|
| 958 |
-
msgstr "販売者のラベルと有効にします"
|
| 959 |
-
|
| 960 |
-
#: classes/admin/settings/sf-options.php:103,
|
| 961 |
-
#: classes/admin/settings/sf-options.php:116
|
| 962 |
-
msgid "Sold By"
|
| 963 |
-
msgstr "販売者"
|
| 964 |
-
|
| 965 |
-
#: classes/admin/settings/sf-options.php:96
|
| 966 |
-
msgid "User Email"
|
| 967 |
-
msgstr "ユーザーメールアドレス"
|
| 968 |
-
|
| 969 |
-
#: classes/admin/settings/sf-options.php:95
|
| 970 |
-
msgid "User Login"
|
| 971 |
-
msgstr "ユーザーログイン"
|
| 972 |
-
|
| 973 |
-
#: classes/admin/settings/sf-options.php:94,
|
| 974 |
-
#: classes/admin/views/html-vendor-settings-page.php:22,
|
| 975 |
-
#: templates/dashboard/settings/shop-name.php:2
|
| 976 |
-
msgid "Shop Name"
|
| 977 |
-
msgstr "店舗名"
|
| 978 |
-
|
| 979 |
-
#: classes/admin/settings/sf-options.php:93
|
| 980 |
-
msgid "Display Name"
|
| 981 |
-
msgstr "表示名"
|
| 982 |
-
|
| 983 |
-
#: classes/admin/settings/sf-options.php:89
|
| 984 |
-
msgid ""
|
| 985 |
-
"Select what will be displayed for the sold by text throughout the store."
|
| 986 |
-
msgstr "店舗で販売する時に表示されるテキストを選択します。"
|
| 987 |
-
|
| 988 |
-
#: classes/admin/settings/sf-options.php:88
|
| 989 |
-
msgid "Vendor Display Name"
|
| 990 |
-
msgstr "販売者表示名"
|
| 991 |
-
|
| 992 |
-
#: classes/admin/settings/sf-options.php:81
|
| 993 |
-
msgid ""
|
| 994 |
-
"This will override the HTML Shop description output on product-archive "
|
| 995 |
-
"pages. In order to customize the shop headers visit wcvendors.com and read "
|
| 996 |
-
"the article in the Knowledgebase titled Changing the Vendor Templates."
|
| 997 |
-
msgstr ""
|
| 998 |
-
"これは、商品・アーカイブ・ページに HTML 店舗の説明出力を上書きします。 店舗の"
|
| 999 |
-
"ヘッダーをカスタマイズするには、 wcvendors.com にアクセスし、ナレッジベースの"
|
| 1000 |
-
"記事「ベンダーテンプレートの変更」を参照してください。"
|
| 1001 |
-
|
| 1002 |
-
#: classes/admin/settings/sf-options.php:80
|
| 1003 |
-
msgid "Enable vendor shop headers"
|
| 1004 |
-
msgstr "販売者の店舗ヘッダーを有効にする"
|
| 1005 |
-
|
| 1006 |
-
#: classes/admin/settings/sf-options.php:79
|
| 1007 |
-
msgid "Shop Headers"
|
| 1008 |
-
msgstr "店舗ヘッダー"
|
| 1009 |
-
|
| 1010 |
-
#: classes/admin/settings/sf-options.php:72
|
| 1011 |
-
msgid ""
|
| 1012 |
-
"Enter one word for the URI. If you enter \"<strong>vendors</strong>\" your "
|
| 1013 |
-
"vendors store will be <code>yourdomain.com/vendors/store-name/</code>"
|
| 1014 |
-
msgstr ""
|
| 1015 |
-
"URI の単語を1つ入力します。 \"<strong>vendors</strong>\" に入ると、販売者の"
|
| 1016 |
-
"店舗は <code>yourdomain.com/vendors/store-name/</code> になります"
|
| 1017 |
-
|
| 1018 |
-
#: classes/admin/settings/sf-options.php:71
|
| 1019 |
-
msgid "Vendor Shop Page"
|
| 1020 |
-
msgstr "販売者店舗ページ"
|
| 1021 |
-
|
| 1022 |
-
#: classes/admin/settings/sf-options.php:64
|
| 1023 |
-
msgid ""
|
| 1024 |
-
"Enable HTML for a vendor's shop description by default. You can enable or "
|
| 1025 |
-
"disable this per vendor by editing the vendors user account."
|
| 1026 |
-
msgstr ""
|
| 1027 |
-
"デフォルトでは、販売者のショップ説明に HTML を有効にします。販売者のユーザー"
|
| 1028 |
-
"アカウントを編集することで、販売者ごとにこれを有効または無効にすることができ"
|
| 1029 |
-
"ます。"
|
| 1030 |
-
|
| 1031 |
-
#: classes/admin/settings/sf-options.php:63
|
| 1032 |
-
msgid "Shop HTML"
|
| 1033 |
-
msgstr "店舗 HTML"
|
| 1034 |
-
|
| 1035 |
-
#: classes/admin/settings/sf-options.php:60
|
| 1036 |
-
msgid "Shop options"
|
| 1037 |
-
msgstr "店舗オプション"
|
| 1038 |
-
|
| 1039 |
-
#: classes/admin/settings/sf-options.php:54
|
| 1040 |
-
msgid ""
|
| 1041 |
-
"WC Vendors Free - Give vendors shipping if using Per Product Shipping "
|
| 1042 |
-
"gateway. WC Vendors Pro - Give vendors shipping when using Vendor "
|
| 1043 |
-
"Shipping. No other shipping module is compatible with this option."
|
| 1044 |
-
msgstr ""
|
| 1045 |
-
"WC Vendors Free - 商品ごとの配送決済を使用する場合は、販売者に出荷を指示しま"
|
| 1046 |
-
"す。 WC Vendors Pro - Vendor Shippingを使用している場合、販売者に出荷を促しま"
|
| 1047 |
-
"す。 他の配送モジュールはこのオプションと互換性がありません。"
|
| 1048 |
-
|
| 1049 |
-
#: classes/admin/settings/sf-options.php:53
|
| 1050 |
-
msgid "Give vendors any shipping collected per-product"
|
| 1051 |
-
msgstr "販売者が商品ごとに収集された送料"
|
| 1052 |
-
|
| 1053 |
-
#: classes/admin/settings/sf-options.php:45
|
| 1054 |
-
msgid "The tax collected on a vendor's product will be given in its entirety"
|
| 1055 |
-
msgstr "販売者の商品に集めた税金は、そのすべてが与えられます"
|
| 1056 |
-
|
| 1057 |
-
#: classes/admin/settings/sf-options.php:44
|
| 1058 |
-
msgid "Give vendors any tax collected per-product"
|
| 1059 |
-
msgstr "販売者に商品ごとに収集された税金を与える"
|
| 1060 |
-
|
| 1061 |
-
#: classes/admin/settings/sf-options.php:43,
|
| 1062 |
-
#: classes/admin/settings/sf-options.php:175
|
| 1063 |
-
msgid "Taxes"
|
| 1064 |
-
msgstr "税金"
|
| 1065 |
-
|
| 1066 |
-
#: classes/admin/settings/sf-options.php:36
|
| 1067 |
-
msgid ""
|
| 1068 |
-
"With this unchecked, all vendor applications are automatically accepted. "
|
| 1069 |
-
"Otherwise, you must approve each manually."
|
| 1070 |
-
msgstr ""
|
| 1071 |
-
"このチェックを外すと、すべての販売者契約が自動的に承認されます。 それ以外の場"
|
| 1072 |
-
"合は、それぞれを手動で承認する必要があります。"
|
| 1073 |
-
|
| 1074 |
-
#: classes/admin/settings/sf-options.php:35
|
| 1075 |
-
msgid "Approve vendor applications manually"
|
| 1076 |
-
msgstr "販売者契約を手動で承認する"
|
| 1077 |
-
|
| 1078 |
-
#: classes/admin/settings/sf-options.php:28
|
| 1079 |
-
msgid ""
|
| 1080 |
-
"This will show a checkbox on the My Account page's registration form asking "
|
| 1081 |
-
"if the user would like to apply to be a vendor. Also, on the Vendor "
|
| 1082 |
-
"Dashboard, users can still apply to become a vendor even if this is disabled."
|
| 1083 |
-
msgstr ""
|
| 1084 |
-
"これにより、ユーザーが販売者として応募したいかどうかを尋ねるマイアカウント"
|
| 1085 |
-
"ページの登録フォームにチェックボックスが表示されます。 また、仕入先ダッシュ"
|
| 1086 |
-
"ボードでは、これが無効になっていても、販売者になるよう依頼することができま"
|
| 1087 |
-
"す。"
|
| 1088 |
-
|
| 1089 |
-
#: classes/admin/settings/sf-options.php:26
|
| 1090 |
-
msgid "Registration"
|
| 1091 |
-
msgstr "登録"
|
| 1092 |
-
|
| 1093 |
-
#: classes/admin/settings/sf-options.php:22
|
| 1094 |
-
msgid ""
|
| 1095 |
-
"Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:"
|
| 1096 |
-
"</strong> You MUST \"<strong>Enable registration on the \"My Account\" "
|
| 1097 |
-
"page</strong>\" in your <strong>WooCommerce > Settings > Accounts</strong> "
|
| 1098 |
-
"page for this option to work. Currently, you have registration disabled."
|
| 1099 |
-
msgstr ""
|
| 1100 |
-
"すべてのユーザーまたはゲストが販売者になることを許可する。<br><br><strong>警"
|
| 1101 |
-
"告:</strong> <strong>WooCommerce > 設定 > アカウント</strong>ページで<strong>"
|
| 1102 |
-
"\"マイアカウント \"ページへの登録を有効にする</strong>必要があります。現在、"
|
| 1103 |
-
"登録が無効になっています。"
|
| 1104 |
-
|
| 1105 |
-
#: classes/admin/settings/sf-options.php:20,
|
| 1106 |
-
#: classes/admin/settings/sf-options.php:27
|
| 1107 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 1108 |
-
msgstr "ユーザーまたはゲストが販売者になることを許可する"
|
| 1109 |
-
|
| 1110 |
-
#: classes/admin/settings/sf-options.php:9
|
| 1111 |
-
msgid ""
|
| 1112 |
-
"The default rate you pay each vendor for a product sale. <br>You can also "
|
| 1113 |
-
"give vendors their own individual commission rates by editing the vendors "
|
| 1114 |
-
"user account.<br>Also, you can edit an individual products commission to "
|
| 1115 |
-
"override both of these settings on a per product basis."
|
| 1116 |
-
msgstr ""
|
| 1117 |
-
"商品販売のために各販売者に支払う基本報酬率。 <br>販売者のユーザーアカウントを"
|
| 1118 |
-
"編集することで、販売者に独自の手数料を与えることもできます。<br>また、個々の"
|
| 1119 |
-
"商品報酬を編集して、これらの両方の設定を商品ごとに上書きすることができます。"
|
| 1120 |
-
|
| 1121 |
-
#: classes/admin/settings/sf-options.php:8
|
| 1122 |
-
msgid "Default commission (%)"
|
| 1123 |
-
msgstr "基本の報酬額(%)"
|
| 1124 |
-
|
| 1125 |
-
#: classes/admin/settings/sf-options.php:5
|
| 1126 |
-
msgid "General options"
|
| 1127 |
-
msgstr "一般オプション"
|
| 1128 |
-
|
| 1129 |
-
#: classes/admin/settings/classes/sf-class-settings.php:848
|
| 1130 |
-
msgid "Upload an image for the %s"
|
| 1131 |
-
msgstr "%s のために画像をアップリード"
|
| 1132 |
-
|
| 1133 |
-
#: classes/admin/settings/classes/sf-class-settings.php:848,
|
| 1134 |
-
#: classes/admin/settings/classes/sf-class-settings.php:848
|
| 1135 |
-
msgid "Add %s"
|
| 1136 |
-
msgstr "%s を追加"
|
| 1137 |
-
|
| 1138 |
-
#: classes/admin/settings/classes/sf-class-settings.php:848
|
| 1139 |
-
msgid "Update %s"
|
| 1140 |
-
msgstr "%s を更新"
|
| 1141 |
-
|
| 1142 |
-
#: classes/admin/settings/classes/sf-class-settings.php:785
|
| 1143 |
-
msgid "View Page"
|
| 1144 |
-
msgstr "固定ページを表示"
|
| 1145 |
-
|
| 1146 |
-
#: classes/admin/settings/classes/sf-class-settings.php:784
|
| 1147 |
-
msgid "Edit Page"
|
| 1148 |
-
msgstr "固定ページを編集"
|
| 1149 |
-
|
| 1150 |
-
#: classes/admin/settings/classes/sf-class-settings.php:499
|
| 1151 |
-
msgid ""
|
| 1152 |
-
"Please help with a <a href=\"https://wordpress.org/support/view/plugin-"
|
| 1153 |
-
"reviews/wc-vendors?rate=5#postform\" target=\"top\">High Five!</a> | <a href="
|
| 1154 |
-
"\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 1155 |
-
"Vendors Pro</a> | <a href=\"https://www.wcvendors.com/product/stripe-"
|
| 1156 |
-
"commissions-gateway/\" target=\"top\">Stripe Commissions & Gateway</a> | <a "
|
| 1157 |
-
"href=\"https://www.wcvendors.com/kb/\" target=\"top\">KnowledgeBase</a> | <a "
|
| 1158 |
-
"href=\"https://www.wcvendors.com/help/\" target=\"top\">Help Forums</a>"
|
| 1159 |
-
msgstr ""
|
| 1160 |
-
"<a href=\"https://wordpress.org/support/view/plugin-reviews/wc-vendors?"
|
| 1161 |
-
"rate=5#postform\" target=\"top\">評価!</a> | <a href=\"https://www.wcvendors."
|
| 1162 |
-
"com/product/wc-vendors-pro/\" target=\"top\">WC Vendors Pro</a> | <a href="
|
| 1163 |
-
"\"https://www.wcvendors.com/product/stripe-commissions-gateway/\" target="
|
| 1164 |
-
"\"top\">Stripe 報酬と決済</a> | <a href=\"https://www.wcvendors.com/kb/\" "
|
| 1165 |
-
"target=\"top\">ナレッジベース</a> | <a href=\"https://www.wcvendors.com/help/"
|
| 1166 |
-
"\" target=\"top\">ヘルプフォーラム</a>のご利用をご検討ください。"
|
| 1167 |
-
|
| 1168 |
-
#: classes/admin/settings/classes/sf-class-settings.php:486
|
| 1169 |
-
msgid "Save %s changes"
|
| 1170 |
-
msgstr "%s の変更を保存"
|
| 1171 |
-
|
| 1172 |
-
#: classes/admin/settings/classes/sf-class-settings.php:302
|
| 1173 |
-
msgid "Error - WP Settings Framework"
|
| 1174 |
-
msgstr "エラー - WP Settings フレームワーク"
|
| 1175 |
-
|
| 1176 |
-
#: classes/admin/settings/classes/sf-class-settings.php:302
|
| 1177 |
-
msgid "Could not load settings at: "
|
| 1178 |
-
msgstr "設定をロードできませんでした : "
|
| 1179 |
-
|
| 1180 |
-
#: classes/admin/settings/classes/sf-class-settings.php:153,
|
| 1181 |
-
#: templates/dashboard/settings/settings.php:1
|
| 1182 |
-
msgid "Settings"
|
| 1183 |
-
msgstr "設定"
|
| 1184 |
-
|
| 1185 |
-
#: classes/admin/settings/classes/sf-class-format-options.php:211,
|
| 1186 |
-
#: classes/admin/settings/classes/sf-class-settings.php:791
|
| 1187 |
-
msgid "Select a page..."
|
| 1188 |
-
msgstr "ページを選択"
|
| 1189 |
-
|
| 1190 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:278
|
| 1191 |
-
msgid ""
|
| 1192 |
-
"Show the commission due/paid as the product totals instead of the product "
|
| 1193 |
-
"prices."
|
| 1194 |
-
msgstr "商品価格の代わりに商品総額として支払うべき手数料を表示します。"
|
| 1195 |
-
|
| 1196 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:276
|
| 1197 |
-
msgid "Product Totals"
|
| 1198 |
-
msgstr "商品合計"
|
| 1199 |
-
|
| 1200 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:119
|
| 1201 |
-
msgid "Shipping Subtotal:"
|
| 1202 |
-
msgstr "送料小計 : "
|
| 1203 |
-
|
| 1204 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:111
|
| 1205 |
-
msgid "Tax Subtotal:"
|
| 1206 |
-
msgstr "消費税小計 : "
|
| 1207 |
-
|
| 1208 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:105
|
| 1209 |
-
msgid "Commission Subtotal:"
|
| 1210 |
-
msgstr "報酬小計 : "
|
| 1211 |
-
|
| 1212 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:31
|
| 1213 |
-
msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
|
| 1214 |
-
msgstr "[{blogname}] 新規注文 ({order_number}) - {order_date}"
|
| 1215 |
-
|
| 1216 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:30
|
| 1217 |
-
msgid "New customer order"
|
| 1218 |
-
msgstr "新しい顧客注文"
|
| 1219 |
-
|
| 1220 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:28
|
| 1221 |
-
msgid "New order emails are sent when an order is received/paid by a customer."
|
| 1222 |
-
msgstr ""
|
| 1223 |
-
"新しい注文メールは、注文が顧客によって受信/支払されたときに送信されます。"
|
| 1224 |
-
|
| 1225 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:27
|
| 1226 |
-
msgid "Notify vendors"
|
| 1227 |
-
msgstr "販売者への通知"
|
| 1228 |
-
|
| 1229 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:112
|
| 1230 |
-
msgid "Subtotal:"
|
| 1231 |
-
msgstr "小計 : "
|
| 1232 |
-
|
| 1233 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:32
|
| 1234 |
-
msgid ""
|
| 1235 |
-
"[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 1236 |
-
msgstr "[{blogname}] 注文は出荷されました ({order_number}) - {order_date}"
|
| 1237 |
-
|
| 1238 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:31
|
| 1239 |
-
msgid "Your order has been shipped"
|
| 1240 |
-
msgstr "注文は出荷されました"
|
| 1241 |
-
|
| 1242 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:29
|
| 1243 |
-
msgid ""
|
| 1244 |
-
"An email is sent when a vendor has marked one of their orders as shipped."
|
| 1245 |
-
msgstr "販売者が出荷された注文の1つをマークしたときにメールが送信されます。"
|
| 1246 |
-
|
| 1247 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:28
|
| 1248 |
-
msgid "Vendor has shipped"
|
| 1249 |
-
msgstr "販売者が出荷されました"
|
| 1250 |
-
|
| 1251 |
-
#: classes/admin/emails/class-wc-notify-admin.php:32
|
| 1252 |
-
msgid "[{blogname}] New product submitted by {vendor_name} - {product_name}"
|
| 1253 |
-
msgstr ""
|
| 1254 |
-
"[{blogname}] 新しい商品が{vendor_name}によって送信されました - {product_name}"
|
| 1255 |
-
|
| 1256 |
-
#: classes/admin/emails/class-wc-notify-admin.php:31
|
| 1257 |
-
msgid "New product submitted: {product_name}"
|
| 1258 |
-
msgstr "新しい商品が送信されました : {product_name}"
|
| 1259 |
-
|
| 1260 |
-
#: classes/admin/emails/class-wc-notify-admin.php:29
|
| 1261 |
-
msgid "New order emails are sent when a new product is submitted by a vendor"
|
| 1262 |
-
msgstr ""
|
| 1263 |
-
"新しい商品が販売者によって送信されたときに新しい注文メールが送信されます"
|
| 1264 |
-
|
| 1265 |
-
#: classes/admin/emails/class-wc-notify-admin.php:28
|
| 1266 |
-
msgid "New Vendor Product"
|
| 1267 |
-
msgstr "新しい販売者商品"
|
| 1268 |
-
|
| 1269 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:158,
|
| 1270 |
-
#: classes/admin/emails/class-wc-notify-admin.php:169,
|
| 1271 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:191,
|
| 1272 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:290
|
| 1273 |
-
msgid "Multipart"
|
| 1274 |
-
msgstr "マルチ形式"
|
| 1275 |
-
|
| 1276 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:157,
|
| 1277 |
-
#: classes/admin/emails/class-wc-notify-admin.php:168,
|
| 1278 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:190,
|
| 1279 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:289
|
| 1280 |
-
msgid "HTML"
|
| 1281 |
-
msgstr "HTML形式"
|
| 1282 |
-
|
| 1283 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:156,
|
| 1284 |
-
#: classes/admin/emails/class-wc-notify-admin.php:167,
|
| 1285 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:189,
|
| 1286 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:288
|
| 1287 |
-
msgid "Plain text"
|
| 1288 |
-
msgstr "テキスト形式"
|
| 1289 |
-
|
| 1290 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:152,
|
| 1291 |
-
#: classes/admin/emails/class-wc-notify-admin.php:163,
|
| 1292 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:185,
|
| 1293 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:284
|
| 1294 |
-
msgid "Choose which format of email to send."
|
| 1295 |
-
msgstr "送信する電子メールの形式を選択します。"
|
| 1296 |
-
|
| 1297 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:150,
|
| 1298 |
-
#: classes/admin/emails/class-wc-notify-admin.php:161,
|
| 1299 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:183,
|
| 1300 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:282
|
| 1301 |
-
msgid "Email type"
|
| 1302 |
-
msgstr "メール形式"
|
| 1303 |
-
|
| 1304 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:145,
|
| 1305 |
-
#: classes/admin/emails/class-wc-notify-admin.php:156,
|
| 1306 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:178,
|
| 1307 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:271
|
| 1308 |
-
msgid ""
|
| 1309 |
-
"This controls the main heading contained within the email notification. "
|
| 1310 |
-
"Leave blank to use the default heading: <code>%s</code>."
|
| 1311 |
-
msgstr ""
|
| 1312 |
-
"これは、送信メール通知に含まれるメインメールヘッダーを制御します。 空白のまま"
|
| 1313 |
-
"にして、デフォルトの見出しを使用します。<code>%s</code>"
|
| 1314 |
-
|
| 1315 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:143,
|
| 1316 |
-
#: classes/admin/emails/class-wc-notify-admin.php:154,
|
| 1317 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:176,
|
| 1318 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:269
|
| 1319 |
-
msgid "Email Heading"
|
| 1320 |
-
msgstr "メールヘッダー"
|
| 1321 |
-
|
| 1322 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:138,
|
| 1323 |
-
#: classes/admin/emails/class-wc-notify-admin.php:149,
|
| 1324 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:171,
|
| 1325 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:264
|
| 1326 |
-
msgid ""
|
| 1327 |
-
"This controls the email subject line. Leave blank to use the default "
|
| 1328 |
-
"subject: <code>%s</code>."
|
| 1329 |
-
msgstr ""
|
| 1330 |
-
"これは送信メールの件名を制御します。 デフォルトの件名を使用する場合は空白のま"
|
| 1331 |
-
"まにします。<code>%s</code>"
|
| 1332 |
-
|
| 1333 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:136,
|
| 1334 |
-
#: classes/admin/emails/class-wc-notify-admin.php:147,
|
| 1335 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:169,
|
| 1336 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:262
|
| 1337 |
-
msgid "Subject"
|
| 1338 |
-
msgstr "件名"
|
| 1339 |
-
|
| 1340 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:131
|
| 1341 |
-
msgid ""
|
| 1342 |
-
"Enter recipients (comma separated) for this email. Defaults to <code>%s</"
|
| 1343 |
-
"code>."
|
| 1344 |
-
msgstr ""
|
| 1345 |
-
"このメールの受信者（コンマ区切り）を入力します。 デフォルトは<code>%s</code>"
|
| 1346 |
-
"です。"
|
| 1347 |
-
|
| 1348 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:125,
|
| 1349 |
-
#: classes/admin/emails/class-wc-notify-admin.php:136,
|
| 1350 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:165,
|
| 1351 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:258
|
| 1352 |
-
msgid "Enable this email notification"
|
| 1353 |
-
msgstr "このメール通知を有効にする"
|
| 1354 |
-
|
| 1355 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:123,
|
| 1356 |
-
#: classes/admin/emails/class-wc-notify-admin.php:134,
|
| 1357 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:163,
|
| 1358 |
-
#: classes/admin/emails/class-wc-notify-vendor.php:256
|
| 1359 |
-
msgid "Enable/Disable"
|
| 1360 |
-
msgstr "有効 / 無効"
|
| 1361 |
-
|
| 1362 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:32
|
| 1363 |
-
msgid "[{blogname}] Your vendor application has been {status}"
|
| 1364 |
-
msgstr "[{blogname}] 販売者契約が{status}になりました"
|
| 1365 |
-
|
| 1366 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:31
|
| 1367 |
-
msgid "Application {status}"
|
| 1368 |
-
msgstr "契約 {status}"
|
| 1369 |
-
|
| 1370 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:29
|
| 1371 |
-
msgid "Vendor application will either be approved, denied, or pending."
|
| 1372 |
-
msgstr "販売者契約は、承認、拒否、保留のいずれかになります。"
|
| 1373 |
-
|
| 1374 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:28
|
| 1375 |
-
msgid "Vendor Application"
|
| 1376 |
-
msgstr "販売者契約"
|
| 1377 |
-
|
| 1378 |
-
#: classes/admin/emails/class-emails.php:63
|
| 1379 |
-
msgid "denied"
|
| 1380 |
-
msgstr "承認拒否"
|
| 1381 |
-
|
| 1382 |
-
#: classes/admin/emails/class-emails.php:61
|
| 1383 |
-
msgid "approved"
|
| 1384 |
-
msgstr "承認済み"
|
| 1385 |
-
|
| 1386 |
-
#: classes/admin/emails/class-emails.php:59,
|
| 1387 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:70
|
| 1388 |
-
msgid "pending"
|
| 1389 |
-
msgstr "承認保留"
|
| 1390 |
-
|
| 1391 |
-
#: classes/admin/class-vendor-applicants.php:98
|
| 1392 |
-
msgid "Pending Vendors"
|
| 1393 |
-
msgstr "承認待ち販売者"
|
| 1394 |
-
|
| 1395 |
-
#: classes/admin/class-vendor-applicants.php:84
|
| 1396 |
-
msgid "Vendor has been <b>approved</b>."
|
| 1397 |
-
msgstr "販売者は<b>承認されました</b>。"
|
| 1398 |
-
|
| 1399 |
-
#: classes/admin/class-vendor-applicants.php:73
|
| 1400 |
-
msgid "Vendor has been <b>denied</b>."
|
| 1401 |
-
msgstr "販売者は<b>拒否</b>されました。"
|
| 1402 |
-
|
| 1403 |
-
#: classes/admin/class-vendor-admin-dashboard.php:543,
|
| 1404 |
-
#: templates/orders/comments/add-new-comment.php:11
|
| 1405 |
-
msgid "Add comment"
|
| 1406 |
-
msgstr "注文コメントを追加"
|
| 1407 |
-
|
| 1408 |
-
#: classes/admin/class-vendor-admin-dashboard.php:534
|
| 1409 |
-
msgid "No comments currently to customer."
|
| 1410 |
-
msgstr "現在お客様へのコメントはありません。"
|
| 1411 |
-
|
| 1412 |
-
#: classes/admin/class-vendor-admin-dashboard.php:528,
|
| 1413 |
-
#: templates/orders/comments/existing-comments.php:9
|
| 1414 |
-
msgid "added %s ago"
|
| 1415 |
-
msgstr "%s 前に追加"
|
| 1416 |
-
|
| 1417 |
-
#: classes/admin/class-vendor-admin-dashboard.php:516,
|
| 1418 |
-
#: templates/orders/orders.php:84
|
| 1419 |
-
msgid "Comments (%s)"
|
| 1420 |
-
msgstr "注文コメント (%s)"
|
| 1421 |
-
|
| 1422 |
-
#: classes/admin/class-vendor-admin-dashboard.php:501
|
| 1423 |
-
msgid "No"
|
| 1424 |
-
msgstr "未"
|
| 1425 |
-
|
| 1426 |
-
#: classes/admin/class-vendor-admin-dashboard.php:501
|
| 1427 |
-
msgid "Yes"
|
| 1428 |
-
msgstr "完了"
|
| 1429 |
-
|
| 1430 |
-
#: classes/admin/class-vendor-admin-dashboard.php:392,
|
| 1431 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:40
|
| 1432 |
-
msgid "You are not allowed to modify this order."
|
| 1433 |
-
msgstr "この注文を変更することはできません。"
|
| 1434 |
-
|
| 1435 |
-
#: classes/admin/class-vendor-admin-dashboard.php:356
|
| 1436 |
-
msgid "Orders marked shipped."
|
| 1437 |
-
msgstr "注文が出荷済みマークされました。"
|
| 1438 |
-
|
| 1439 |
-
#: classes/admin/class-vendor-admin-dashboard.php:331,
|
| 1440 |
-
#: templates/dashboard/orders.php:96
|
| 1441 |
-
msgid "Mark shipped"
|
| 1442 |
-
msgstr "出荷済みにマーク"
|
| 1443 |
-
|
| 1444 |
-
#: classes/admin/class-vendor-admin-dashboard.php:296,
|
| 1445 |
-
#: templates/dashboard/orders.php:103
|
| 1446 |
-
msgid "Shipped"
|
| 1447 |
-
msgstr "出荷"
|
| 1448 |
-
|
| 1449 |
-
#: classes/admin/class-vendor-admin-dashboard.php:294,
|
| 1450 |
-
#: classes/admin/class-vendor-admin-dashboard.php:519
|
| 1451 |
-
msgid "Comments to Customer"
|
| 1452 |
-
msgstr "お客様への注文コメント"
|
| 1453 |
-
|
| 1454 |
-
#: classes/admin/class-vendor-admin-dashboard.php:292,
|
| 1455 |
-
#: classes/admin/settings/sf-options.php:127,
|
| 1456 |
-
#: classes/admin/settings/sf-options.php:254
|
| 1457 |
-
msgid "Products"
|
| 1458 |
-
msgstr "商品ページ"
|
| 1459 |
-
|
| 1460 |
-
#: classes/admin/class-vendor-admin-dashboard.php:291
|
| 1461 |
-
msgid "Customer"
|
| 1462 |
-
msgstr "お客様"
|
| 1463 |
-
|
| 1464 |
-
#: classes/admin/class-vendor-admin-dashboard.php:217
|
| 1465 |
-
msgid "orders"
|
| 1466 |
-
msgstr "注文"
|
| 1467 |
-
|
| 1468 |
-
#: classes/admin/class-vendor-admin-dashboard.php:216
|
| 1469 |
-
msgid "order"
|
| 1470 |
-
msgstr "注文"
|
| 1471 |
-
|
| 1472 |
-
#: classes/admin/class-vendor-admin-dashboard.php:94,
|
| 1473 |
-
#: classes/admin/settings/classes/sf-class-settings.php:368,
|
| 1474 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:139
|
| 1475 |
-
msgid "Settings saved."
|
| 1476 |
-
msgstr "設定が保存されました。"
|
| 1477 |
-
|
| 1478 |
-
#: classes/admin/class-vendor-admin-dashboard.php:74,
|
| 1479 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:121
|
| 1480 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 1481 |
-
msgstr "その店名は既に使われています。 店名はユニークでなければなりません。"
|
| 1482 |
-
|
| 1483 |
-
#: classes/admin/class-vendor-admin-dashboard.php:65,
|
| 1484 |
-
#: classes/front/dashboard/class-vendor-dashboard.php:112
|
| 1485 |
-
msgid "Your PayPal address is not a valid email address."
|
| 1486 |
-
msgstr "PayPalアドレスは有効なメールアドレスではありません。"
|
| 1487 |
-
|
| 1488 |
-
#: classes/admin/class-vendor-admin-dashboard.php:21,
|
| 1489 |
-
#: classes/admin/class-vendor-admin-dashboard.php:153,
|
| 1490 |
-
#: classes/admin/settings/sf-options.php:196, classes/class-install.php:206,
|
| 1491 |
-
#: templates/dashboard/orders.php:35
|
| 1492 |
-
msgid "Orders"
|
| 1493 |
-
msgstr "注文"
|
| 1494 |
-
|
| 1495 |
-
#: classes/admin/class-vendor-admin-dashboard.php:20,
|
| 1496 |
-
#: classes/class-install.php:207
|
| 1497 |
-
msgid "Shop Settings"
|
| 1498 |
-
msgstr "店舗設定"
|
| 1499 |
-
|
| 1500 |
-
#: classes/admin/class-admin-users.php:473
|
| 1501 |
-
msgid "Shop description"
|
| 1502 |
-
msgstr "店舗詳細"
|
| 1503 |
-
|
| 1504 |
-
#: classes/admin/class-admin-users.php:468,
|
| 1505 |
-
#: classes/admin/views/html-vendor-settings-page.php:30,
|
| 1506 |
-
#: templates/dashboard/settings/seller-info.php:3
|
| 1507 |
-
msgid "Seller info"
|
| 1508 |
-
msgstr "販売者情報"
|
| 1509 |
-
|
| 1510 |
-
#: classes/admin/class-admin-users.php:462
|
| 1511 |
-
msgid "Shipping override for vendor"
|
| 1512 |
-
msgstr "販売者のために送料を無視"
|
| 1513 |
-
|
| 1514 |
-
#: classes/admin/class-admin-users.php:457
|
| 1515 |
-
msgid "Give Shipping"
|
| 1516 |
-
msgstr "送料を払う"
|
| 1517 |
-
|
| 1518 |
-
#: classes/admin/class-admin-users.php:451
|
| 1519 |
-
msgid "Tax override for vendor"
|
| 1520 |
-
msgstr "販売者のために税金を無視"
|
| 1521 |
-
|
| 1522 |
-
#: classes/admin/class-admin-users.php:446
|
| 1523 |
-
msgid "Give Tax"
|
| 1524 |
-
msgstr "税金を払う"
|
| 1525 |
-
|
| 1526 |
-
#: classes/admin/class-admin-users.php:440,
|
| 1527 |
-
#: classes/admin/class-product-meta.php:174
|
| 1528 |
-
msgid "Leave blank for default"
|
| 1529 |
-
msgstr "空欄の場合、デフォルト設定で対応"
|
| 1530 |
-
|
| 1531 |
-
#: classes/admin/class-admin-users.php:439
|
| 1532 |
-
msgid "Commission rate"
|
| 1533 |
-
msgstr "報酬率"
|
| 1534 |
-
|
| 1535 |
-
#: classes/admin/class-admin-users.php:432
|
| 1536 |
-
msgid "required"
|
| 1537 |
-
msgstr "必須"
|
| 1538 |
-
|
| 1539 |
-
#: classes/admin/class-admin-users.php:431
|
| 1540 |
-
msgid "PayPal E-mail"
|
| 1541 |
-
msgstr "PayPal メールアドレス"
|
| 1542 |
-
|
| 1543 |
-
#: classes/admin/class-admin-users.php:424
|
| 1544 |
-
msgid "Shop name"
|
| 1545 |
-
msgstr "店舗名"
|
| 1546 |
-
|
| 1547 |
-
#: classes/admin/class-admin-users.php:418
|
| 1548 |
-
msgid "Enable HTML for the shop description"
|
| 1549 |
-
msgstr "ショップの説明に HTML を有効にする"
|
| 1550 |
-
|
| 1551 |
-
#: classes/admin/class-admin-reports.php:487
|
| 1552 |
-
msgid "No commissions found."
|
| 1553 |
-
msgstr "報酬がありません"
|
| 1554 |
-
|
| 1555 |
-
#: classes/admin/class-admin-reports.php:465
|
| 1556 |
-
msgid "Commission Total"
|
| 1557 |
-
msgstr "報酬合計"
|
| 1558 |
-
|
| 1559 |
-
#: classes/admin/class-admin-reports.php:463
|
| 1560 |
-
msgid "Shipping Total"
|
| 1561 |
-
msgstr "送料合計"
|
| 1562 |
-
|
| 1563 |
-
#: classes/admin/class-admin-reports.php:462
|
| 1564 |
-
msgid "Tax Total"
|
| 1565 |
-
msgstr "税金合計"
|
| 1566 |
-
|
| 1567 |
-
#: classes/admin/class-admin-reports.php:350,
|
| 1568 |
-
#: classes/admin/settings/sf-options.php:52,
|
| 1569 |
-
#: classes/admin/settings/sf-options.php:136,
|
| 1570 |
-
#: templates/dashboard/orders.php:45, templates/orders/orders.php:115
|
| 1571 |
-
msgid "Shipping"
|
| 1572 |
-
msgstr "送料"
|
| 1573 |
-
|
| 1574 |
-
#: classes/admin/class-admin-reports.php:349
|
| 1575 |
-
msgid "Tax"
|
| 1576 |
-
msgstr "税金"
|
| 1577 |
-
|
| 1578 |
-
#: classes/admin/class-admin-reports.php:347
|
| 1579 |
-
msgid "Month"
|
| 1580 |
-
msgstr "月"
|
| 1581 |
-
|
| 1582 |
-
#: classes/admin/class-admin-reports.php:281
|
| 1583 |
-
msgid "Select a vendor…"
|
| 1584 |
-
msgstr "販売者を選択…"
|
| 1585 |
-
|
| 1586 |
-
#: classes/admin/class-admin-reports.php:249
|
| 1587 |
-
msgid "Type in a product name to start searching..."
|
| 1588 |
-
msgstr "検索を開始する商品名を入力してください..."
|
| 1589 |
-
|
| 1590 |
-
#: classes/admin/class-admin-reports.php:237
|
| 1591 |
-
msgid "Show:"
|
| 1592 |
-
msgstr "表示 : "
|
| 1593 |
-
|
| 1594 |
-
#: classes/admin/class-admin-reports.php:203
|
| 1595 |
-
msgid "No commission yet"
|
| 1596 |
-
msgstr "まだ報酬がありません"
|
| 1597 |
-
|
| 1598 |
-
#: classes/admin/class-admin-reports.php:194
|
| 1599 |
-
msgid "D j M Y at h:ia"
|
| 1600 |
-
msgstr "Y年n月j日(D) h:i a"
|
| 1601 |
-
|
| 1602 |
-
#: classes/admin/class-admin-reports.php:189
|
| 1603 |
-
msgid "N/A"
|
| 1604 |
-
msgstr "N/A"
|
| 1605 |
-
|
| 1606 |
-
#: classes/admin/class-admin-reports.php:180
|
| 1607 |
-
msgid "Date & Time"
|
| 1608 |
-
msgstr "日付 & 時間"
|
| 1609 |
-
|
| 1610 |
-
#: classes/admin/class-admin-reports.php:176,
|
| 1611 |
-
#: classes/front/orders/class-orders.php:249,
|
| 1612 |
-
#: templates/dashboard/orders.php:44
|
| 1613 |
-
msgid "Order"
|
| 1614 |
-
msgstr "注文"
|
| 1615 |
-
|
| 1616 |
-
#: classes/admin/class-admin-reports.php:158
|
| 1617 |
-
msgid "Recent Commission"
|
| 1618 |
-
msgstr "最近の報酬"
|
| 1619 |
-
|
| 1620 |
-
#: classes/admin/class-admin-reports.php:148
|
| 1621 |
-
msgid "Total reversed in range"
|
| 1622 |
-
msgstr "期間範囲で返金された合計"
|
| 1623 |
-
|
| 1624 |
-
#: classes/admin/class-admin-reports.php:141
|
| 1625 |
-
msgid "Total due in range"
|
| 1626 |
-
msgstr "期間範囲で未払いの合計"
|
| 1627 |
-
|
| 1628 |
-
#: classes/admin/class-admin-reports.php:137,
|
| 1629 |
-
#: classes/admin/class-admin-reports.php:144,
|
| 1630 |
-
#: classes/admin/class-admin-reports.php:151
|
| 1631 |
-
msgid "n/a"
|
| 1632 |
-
msgstr "n/a"
|
| 1633 |
-
|
| 1634 |
-
#: classes/admin/class-admin-reports.php:134
|
| 1635 |
-
msgid "Total paid in range"
|
| 1636 |
-
msgstr "期間範囲で支払われた合計"
|
| 1637 |
-
|
| 1638 |
-
#: classes/admin/class-admin-reports.php:128,
|
| 1639 |
-
#: classes/admin/class-admin-reports.php:286,
|
| 1640 |
-
#: classes/admin/class-admin-reports.php:451,
|
| 1641 |
-
#: templates/dashboard/date-picker.php:12
|
| 1642 |
-
msgid "Show"
|
| 1643 |
-
msgstr "表示"
|
| 1644 |
-
|
| 1645 |
-
#: classes/admin/class-admin-reports.php:126,
|
| 1646 |
-
#: classes/admin/class-admin-reports.php:442,
|
| 1647 |
-
#: templates/dashboard/date-picker.php:7
|
| 1648 |
-
msgid "To:"
|
| 1649 |
-
msgstr "終了 : "
|
| 1650 |
-
|
| 1651 |
-
#: classes/admin/class-admin-reports.php:124,
|
| 1652 |
-
#: classes/admin/class-admin-reports.php:440,
|
| 1653 |
-
#: templates/dashboard/date-picker.php:3
|
| 1654 |
-
msgid "From:"
|
| 1655 |
-
msgstr "開始 : "
|
| 1656 |
-
|
| 1657 |
-
#: classes/admin/class-admin-reports.php:63
|
| 1658 |
-
msgid ""
|
| 1659 |
-
"Commission totals for all vendors includes shipping and taxes. By default no "
|
| 1660 |
-
"date range is used and all due commissions are returned. Use the date range "
|
| 1661 |
-
"to filter."
|
| 1662 |
-
msgstr ""
|
| 1663 |
-
"すべての販売者の報酬合計には出荷と税金が含まれています。 デフォルトでは、日付"
|
| 1664 |
-
"範囲は使用されず、すべての手数料が返されます。 フィルターするには、日付範囲を"
|
| 1665 |
-
"使用します。"
|
| 1666 |
-
|
| 1667 |
-
#: classes/admin/class-admin-reports.php:62,
|
| 1668 |
-
#: classes/admin/class-admin-reports.php:348
|
| 1669 |
-
msgid "Commission Totals"
|
| 1670 |
-
msgstr "報酬合計"
|
| 1671 |
-
|
| 1672 |
-
#: classes/admin/class-admin-reports.php:56
|
| 1673 |
-
msgid "Commission by product"
|
| 1674 |
-
msgstr "商品ごとの報酬"
|
| 1675 |
-
|
| 1676 |
-
#: classes/admin/class-admin-reports.php:50
|
| 1677 |
-
msgid "Commission by vendor"
|
| 1678 |
-
msgstr "販売者ごとの報酬"
|
| 1679 |
-
|
| 1680 |
-
#: classes/admin/class-admin-reports.php:44
|
| 1681 |
-
msgid "Overview"
|
| 1682 |
-
msgstr "概要"
|
| 1683 |
-
|
| 1684 |
-
#: classes/admin/class-admin-page.php:587
|
| 1685 |
-
msgid "Commission marked reversed."
|
| 1686 |
-
msgstr "報酬が返品にマークされました。"
|
| 1687 |
-
|
| 1688 |
-
#: classes/admin/class-admin-page.php:580
|
| 1689 |
-
msgid "Commission marked due."
|
| 1690 |
-
msgstr "報酬が未払いにマークされました。"
|
| 1691 |
-
|
| 1692 |
-
#: classes/admin/class-admin-page.php:573
|
| 1693 |
-
msgid "Commission marked paid."
|
| 1694 |
-
msgstr "報酬が支払済みにマークされました。"
|
| 1695 |
-
|
| 1696 |
-
#: classes/admin/class-admin-page.php:520,
|
| 1697 |
-
#: classes/admin/class-admin-reports.php:351,
|
| 1698 |
-
#: classes/admin/class-admin-reports.php:448, classes/class-commission.php:68
|
| 1699 |
-
msgid "Reversed"
|
| 1700 |
-
msgstr "返品"
|
| 1701 |
-
|
| 1702 |
-
#: classes/admin/class-admin-page.php:519,
|
| 1703 |
-
#: classes/admin/class-admin-reports.php:352,
|
| 1704 |
-
#: classes/admin/class-admin-reports.php:447, classes/class-commission.php:67
|
| 1705 |
-
msgid "Paid"
|
| 1706 |
-
msgstr "支払済み"
|
| 1707 |
-
|
| 1708 |
-
#: classes/admin/class-admin-page.php:518,
|
| 1709 |
-
#: classes/admin/class-admin-reports.php:353,
|
| 1710 |
-
#: classes/admin/class-admin-reports.php:446, classes/class-commission.php:66
|
| 1711 |
-
msgid "Due"
|
| 1712 |
-
msgstr "未払い"
|
| 1713 |
-
|
| 1714 |
-
#: classes/admin/class-admin-page.php:517
|
| 1715 |
-
msgid "Show all Statuses"
|
| 1716 |
-
msgstr "すべての状況を表示"
|
| 1717 |
-
|
| 1718 |
-
#: classes/admin/class-admin-page.php:482
|
| 1719 |
-
msgid "Show all dates"
|
| 1720 |
-
msgstr "すべての日付を表示"
|
| 1721 |
-
|
| 1722 |
-
#: classes/admin/class-admin-page.php:423
|
| 1723 |
-
msgid "Delete"
|
| 1724 |
-
msgstr "削除"
|
| 1725 |
-
|
| 1726 |
-
#: classes/admin/class-admin-page.php:422
|
| 1727 |
-
msgid "Mark reversed"
|
| 1728 |
-
msgstr "返品にマーク"
|
| 1729 |
-
|
| 1730 |
-
#: classes/admin/class-admin-page.php:421
|
| 1731 |
-
msgid "Mark due"
|
| 1732 |
-
msgstr "未払いにマーク"
|
| 1733 |
-
|
| 1734 |
-
#: classes/admin/class-admin-page.php:420
|
| 1735 |
-
msgid "Mark paid"
|
| 1736 |
-
msgstr "支払済みにマーク"
|
| 1737 |
-
|
| 1738 |
-
#: classes/admin/class-admin-page.php:383,
|
| 1739 |
-
#: classes/admin/class-vendor-admin-dashboard.php:295,
|
| 1740 |
-
#: classes/front/orders/class-orders.php:257,
|
| 1741 |
-
#: templates/dashboard/orders.php:47
|
| 1742 |
-
msgid "Date"
|
| 1743 |
-
msgstr "日付"
|
| 1744 |
-
|
| 1745 |
-
#: classes/admin/class-admin-page.php:382,
|
| 1746 |
-
#: classes/admin/class-admin-reports.php:181,
|
| 1747 |
-
#: classes/admin/class-admin-reports.php:464
|
| 1748 |
-
msgid "Status"
|
| 1749 |
-
msgstr "状況"
|
| 1750 |
-
|
| 1751 |
-
#: classes/admin/class-admin-page.php:381,
|
| 1752 |
-
#: classes/admin/class-admin-reports.php:179,
|
| 1753 |
-
#: classes/admin/class-admin-reports.php:377,
|
| 1754 |
-
#: classes/admin/class-vendor-admin-dashboard.php:293,
|
| 1755 |
-
#: templates/dashboard/orders.php:46
|
| 1756 |
-
msgid "Total"
|
| 1757 |
-
msgstr "合計"
|
| 1758 |
-
|
| 1759 |
-
#: classes/admin/class-admin-page.php:379,
|
| 1760 |
-
#: classes/admin/class-vendor-admin-dashboard.php:290
|
| 1761 |
-
msgid "Order ID"
|
| 1762 |
-
msgstr "注文 ID"
|
| 1763 |
-
|
| 1764 |
-
#: classes/admin/class-admin-page.php:378,
|
| 1765 |
-
#: classes/admin/class-admin-reports.php:177,
|
| 1766 |
-
#: templates/dashboard/reports.php:17,
|
| 1767 |
-
#: templates/emails/notify-vendor-shipped.php:22,
|
| 1768 |
-
#: templates/emails/vendor-new-order.php:22
|
| 1769 |
-
msgid "Product"
|
| 1770 |
-
msgstr "商品"
|
| 1771 |
-
|
| 1772 |
-
#: classes/admin/class-admin-page.php:186
|
| 1773 |
-
msgid "Select a Vendor"
|
| 1774 |
-
msgstr "販売者を選択"
|
| 1775 |
-
|
| 1776 |
-
#: classes/admin/class-admin-page.php:172
|
| 1777 |
-
msgid "WC Vendors was successfully reset. All settings have been reset."
|
| 1778 |
-
msgstr "WC Vendor のリセットが完了しました。すべての設定がリセットされました。"
|
| 1779 |
-
|
| 1780 |
-
#: classes/admin/class-admin-page.php:158
|
| 1781 |
-
msgid "WC Vendor roles successfully reset."
|
| 1782 |
-
msgstr "WC Vendor の権限のリセットが完了しました。"
|
| 1783 |
-
|
| 1784 |
-
#: classes/admin/class-admin-page.php:152, classes/class-install.php:98,
|
| 1785 |
-
#: classes/class-install.php:254
|
| 1786 |
-
msgid "Pending Vendor"
|
| 1787 |
-
msgstr "承認待ち販売者"
|
| 1788 |
-
|
| 1789 |
-
#: classes/admin/class-admin-page.php:112
|
| 1790 |
-
msgid ""
|
| 1791 |
-
"This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings."
|
| 1792 |
-
msgstr ""
|
| 1793 |
-
"これにより、wcvendors がデフォルトに戻されます。 これにより、すべての設定が削"
|
| 1794 |
-
"除されます。"
|
| 1795 |
-
|
| 1796 |
-
#: classes/admin/class-admin-page.php:111
|
| 1797 |
-
msgid "Reset WC Vendors Settings"
|
| 1798 |
-
msgstr "WC Vendors の設定をリセット"
|
| 1799 |
-
|
| 1800 |
-
#: classes/admin/class-admin-page.php:110
|
| 1801 |
-
msgid "Reset WC Vendors "
|
| 1802 |
-
msgstr "WC Vendors をリセット"
|
| 1803 |
-
|
| 1804 |
-
#: classes/admin/class-admin-page.php:105
|
| 1805 |
-
msgid ""
|
| 1806 |
-
"This will reset the wcvendors roles ( vendor & pending_vendor ), back to the "
|
| 1807 |
-
"default capabilities."
|
| 1808 |
-
msgstr ""
|
| 1809 |
-
"これにより、 wcvendors の権限（販売者および承認待ち販売者）がデフォルトの機能"
|
| 1810 |
-
"にリセットされます。"
|
| 1811 |
-
|
| 1812 |
-
#: classes/admin/class-admin-page.php:104
|
| 1813 |
-
msgid "Reset WC Vendor Roles"
|
| 1814 |
-
msgstr "WC Vendors の権限をリセット"
|
| 1815 |
-
|
| 1816 |
-
#: classes/admin/class-admin-page.php:103
|
| 1817 |
-
msgid "Reset WC Vendors roles "
|
| 1818 |
-
msgstr "WC Vendors の権限をリセット"
|
| 1819 |
-
|
| 1820 |
-
#: classes/admin/class-admin-page.php:78,
|
| 1821 |
-
#: classes/admin/class-admin-page.php:248,
|
| 1822 |
-
#: classes/admin/class-product-meta.php:151,
|
| 1823 |
-
#: classes/admin/class-product-meta.php:167,
|
| 1824 |
-
#: templates/dashboard/reports.php:19
|
| 1825 |
-
msgid "Commission"
|
| 1826 |
-
msgstr "報酬"
|
| 1827 |
-
|
| 1828 |
-
#: classes/admin/class-admin-page.php:52
|
| 1829 |
-
msgid "Vendors Shipped"
|
| 1830 |
-
msgstr "出荷販売者"
|
| 1831 |
-
|
| 1832 |
-
#: classes/admin/class-admin-page.php:29
|
| 1833 |
-
msgid "Vendors shipped"
|
| 1834 |
-
msgstr "出荷販売者"
|
| 1835 |
-
|
| 1836 |
-
#: class-wc-vendors.php:731
|
| 1837 |
-
msgid "Paid Support"
|
| 1838 |
-
msgstr "有料サポート"
|
| 1839 |
-
|
| 1840 |
-
#: class-wc-vendors.php:729
|
| 1841 |
-
msgid "Help Forums"
|
| 1842 |
-
msgstr "ヘルプフォーラム"
|
| 1843 |
-
|
| 1844 |
-
#: class-wc-vendors.php:727
|
| 1845 |
-
msgid "Documentation/KB"
|
| 1846 |
-
msgstr "ドキュメント/ナレッジベース"
|
| 1847 |
-
|
| 1848 |
-
#: class-wc-vendors.php:651, classes/admin/settings/sf-options.php:4
|
| 1849 |
-
msgid "General"
|
| 1850 |
-
msgstr "一般設定"
|
| 1851 |
-
|
| 1852 |
-
#: class-wc-vendors.php:647, classes/admin/class-admin-page.php:149,
|
| 1853 |
-
#: classes/admin/class-admin-page.php:380,
|
| 1854 |
-
#: classes/admin/class-admin-reports.php:178,
|
| 1855 |
-
#: classes/admin/class-admin-reports.php:461,
|
| 1856 |
-
#: classes/admin/class-product-meta.php:46,
|
| 1857 |
-
#: classes/admin/class-product-meta.php:187,
|
| 1858 |
-
#: classes/admin/class-product-meta.php:223, classes/class-install.php:51,
|
| 1859 |
-
#: classes/class-install.php:105
|
| 1860 |
-
msgid "Vendor"
|
| 1861 |
-
msgstr "販売者"
|
| 1862 |
-
|
| 1863 |
-
#: class-wc-vendors.php:601, classes/admin/settings/sf-options.php:192
|
| 1864 |
-
msgid "Capabilities"
|
| 1865 |
-
msgstr "機能"
|
| 1866 |
-
|
| 1867 |
-
#: class-wc-vendors.php:255
|
| 1868 |
-
msgid ""
|
| 1869 |
-
"<b>WC Vendors is disabled</b>. WC Vendors requires a minimum of WooCommerce "
|
| 1870 |
-
"v2.5.0."
|
| 1871 |
-
msgstr ""
|
| 1872 |
-
"<b>WC Vendors が利用できません。</b>WC Vendors は WooCommerce のバージョンが"
|
| 1873 |
-
"2.5.0以上の必要があります。"
|
| 1874 |
-
|
| 1875 |
-
#: class-wc-vendors.php:199, classes/admin/class-admin-reports.php:41,
|
| 1876 |
-
#: classes/admin/class-admin-users.php:408
|
| 1877 |
-
msgid "WC Vendors"
|
| 1878 |
-
msgstr "WC Vendors"
|
| 1879 |
-
|
| 1880 |
-
#: class-wc-vendors.php:101
|
| 1881 |
-
msgid ""
|
| 1882 |
-
"WC Vendors requires WooCommerce to run. Please install WooCommerce and "
|
| 1883 |
-
"activate before attempting to activate again."
|
| 1884 |
-
msgstr ""
|
| 1885 |
-
"WC Vendors は WooCommerce を有効にする必要があります。 再度有効化する前に、"
|
| 1886 |
-
"WooCommerce をインストールして有効にしてください。"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
languages/wcvendors-nl_NL.mo
DELETED
|
Binary file
|
languages/wcvendors-nl_NL.po
DELETED
|
@@ -1,1938 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: WC Vendors\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Mon Jun 20 2016 17:18:18 GMT+0200 (West-Europa "
|
| 6 |
-
"(zomertijd))\n"
|
| 7 |
-
"PO-Revision-Date: Mon Jun 20 2016 18:26:51 GMT+0200 (West-Europa "
|
| 8 |
-
"(zomertijd))\n"
|
| 9 |
-
"Last-Translator: jjclinton <jjclinton15@gmail.com>\n"
|
| 10 |
-
"Language-Team: \n"
|
| 11 |
-
"Language: Dutch\n"
|
| 12 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 13 |
-
"MIME-Version: 1.0\n"
|
| 14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 16 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 17 |
-
"X-Poedit-Basepath: .\n"
|
| 18 |
-
"X-Poedit-SearchPath-0: ../../plugins/wc-vendors\n"
|
| 19 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 20 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 21 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 22 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 23 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 24 |
-
"X-Loco-Target-Locale: nl_NL\n"
|
| 25 |
-
"X-Generator: Loco - https://localise.biz/"
|
| 26 |
-
|
| 27 |
-
#. Name of the plugin
|
| 28 |
-
msgid "WC Vendors"
|
| 29 |
-
msgstr ""
|
| 30 |
-
|
| 31 |
-
#. URI of the plugin
|
| 32 |
-
msgid "https://www.wcvendors.com"
|
| 33 |
-
msgstr ""
|
| 34 |
-
|
| 35 |
-
#. Description of the plugin
|
| 36 |
-
msgid ""
|
| 37 |
-
"Allow vendors to sell their own products and receive a commission for each "
|
| 38 |
-
"sale."
|
| 39 |
-
msgstr ""
|
| 40 |
-
|
| 41 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:36
|
| 42 |
-
msgid ""
|
| 43 |
-
"WC Vendors requires WooCommerce to run. Please install WooCommerce and "
|
| 44 |
-
"activate before attempting to activate again."
|
| 45 |
-
msgstr ""
|
| 46 |
-
|
| 47 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:114
|
| 48 |
-
msgid ""
|
| 49 |
-
"<b>WC Vendors is disabled</b>. WC Vendors requires a minimum of WooCommerce "
|
| 50 |
-
"v2.4.0."
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:273 ../../plugins/wc-
|
| 54 |
-
#: vendors/classes/admin/settings/sf-options.php:192
|
| 55 |
-
msgid "Capabilities"
|
| 56 |
-
msgstr ""
|
| 57 |
-
|
| 58 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:336
|
| 59 |
-
msgid "Documentation/KB"
|
| 60 |
-
msgstr ""
|
| 61 |
-
|
| 62 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:337
|
| 63 |
-
msgid "Help Forums"
|
| 64 |
-
msgstr ""
|
| 65 |
-
|
| 66 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:338
|
| 67 |
-
msgid "Paid Support"
|
| 68 |
-
msgstr ""
|
| 69 |
-
|
| 70 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:360
|
| 71 |
-
#, php-format
|
| 72 |
-
msgid ""
|
| 73 |
-
"WC Vendors requires the Vendor shop page value be set <a href=\"%s\">click "
|
| 74 |
-
"here to set it.</a> | <a href=\"%s\">Hide Notice</a>"
|
| 75 |
-
msgstr ""
|
| 76 |
-
|
| 77 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:368
|
| 78 |
-
#, php-format
|
| 79 |
-
msgid ""
|
| 80 |
-
"You must save your permalinks once you have modified your vendor page. <a "
|
| 81 |
-
"href=\"%s\">click here to save</a>. | <a href=\"%s\">Hide Notice</a>"
|
| 82 |
-
msgstr ""
|
| 83 |
-
|
| 84 |
-
#: ../../plugins/wc-vendors/classes/class-cron.php:87
|
| 85 |
-
#, php-format
|
| 86 |
-
msgid "Payment total: %s"
|
| 87 |
-
msgstr ""
|
| 88 |
-
|
| 89 |
-
#: ../../plugins/wc-vendors/classes/class-cron.php:148
|
| 90 |
-
msgid "Once Weekly"
|
| 91 |
-
msgstr ""
|
| 92 |
-
|
| 93 |
-
#: ../../plugins/wc-vendors/classes/class-cron.php:153
|
| 94 |
-
msgid "Once every two weeks"
|
| 95 |
-
msgstr ""
|
| 96 |
-
|
| 97 |
-
#: ../../plugins/wc-vendors/classes/class-cron.php:158
|
| 98 |
-
msgid "Once a month"
|
| 99 |
-
msgstr ""
|
| 100 |
-
|
| 101 |
-
#: ../../plugins/wc-vendors/classes/class-install.php:80 ../../plugins/wc-
|
| 102 |
-
#: vendors/classes/class-install.php:235
|
| 103 |
-
msgid "Pending Vendor"
|
| 104 |
-
msgstr ""
|
| 105 |
-
|
| 106 |
-
#: ../../plugins/wc-vendors/classes/class-install.php:187 ../../plugins/wc-
|
| 107 |
-
#: vendors/classes/admin/class-vendor-admin-dashboard.php:21 ../../plugins/wc-
|
| 108 |
-
#: vendors/classes/admin/class-vendor-admin-dashboard.php:21 ../../plugins/wc-
|
| 109 |
-
#: vendors/classes/admin/class-vendor-admin-dashboard.php:146 ../../plugins/wc-
|
| 110 |
-
#: vendors/classes/admin/settings/sf-options.php:196 ../../plugins/wc-
|
| 111 |
-
#: vendors/templates/dashboard/orders.php:24
|
| 112 |
-
msgid "Orders"
|
| 113 |
-
msgstr ""
|
| 114 |
-
|
| 115 |
-
#: ../../plugins/wc-vendors/classes/class-vendors.php:551
|
| 116 |
-
#, php-format
|
| 117 |
-
msgctxt "Order date parsed by strftime"
|
| 118 |
-
msgid "%b %d, %Y @ %I:%M %p"
|
| 119 |
-
msgstr ""
|
| 120 |
-
|
| 121 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-page.php:252 ../..
|
| 122 |
-
#: plugins/wc-vendors/classes/admin/class-admin-reports.php:174 ../../plugins/wc-
|
| 123 |
-
#: vendors/templates/dashboard/reports.php:17 ../../plugins/wc-
|
| 124 |
-
#: vendors/templates/emails/admin-new-order.php:22 ../../plugins/wc-
|
| 125 |
-
#: vendors/templates/emails/notify-vendor-shipped.php:22 ../../plugins/wc-
|
| 126 |
-
#: vendors/templates/emails/vendor-new-order.php:22
|
| 127 |
-
msgid "Product"
|
| 128 |
-
msgstr ""
|
| 129 |
-
|
| 130 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-page.php:253 ../..
|
| 131 |
-
#: plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:283
|
| 132 |
-
msgid "Order ID"
|
| 133 |
-
msgstr ""
|
| 134 |
-
|
| 135 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-page.php:256 ../..
|
| 136 |
-
#: plugins/wc-vendors/classes/admin/class-admin-reports.php:178 ../../plugins/wc-
|
| 137 |
-
#: vendors/classes/admin/class-admin-reports.php:461
|
| 138 |
-
msgid "Status"
|
| 139 |
-
msgstr ""
|
| 140 |
-
|
| 141 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-page.php:313 ../..
|
| 142 |
-
#: plugins/wc-vendors/classes/admin/class-admin-page.php:317
|
| 143 |
-
msgid "Filter"
|
| 144 |
-
msgstr ""
|
| 145 |
-
|
| 146 |
-
#. translators: 1: month name, 2: 4-digit year
|
| 147 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-page.php:365
|
| 148 |
-
#, php-format
|
| 149 |
-
msgid "%1$s %2$d"
|
| 150 |
-
msgstr ""
|
| 151 |
-
|
| 152 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:134 ../..
|
| 153 |
-
#: plugins/wc-vendors/classes/admin/class-admin-reports.php:141 ../../plugins/wc-
|
| 154 |
-
#: vendors/classes/admin/class-admin-reports.php:148
|
| 155 |
-
msgid "n/a"
|
| 156 |
-
msgstr ""
|
| 157 |
-
|
| 158 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:173 ../..
|
| 159 |
-
#: plugins/wc-vendors/classes/front/orders/class-orders.php:183 ../../plugins/wc-
|
| 160 |
-
#: vendors/templates/dashboard/orders.php:33
|
| 161 |
-
msgid "Order"
|
| 162 |
-
msgstr ""
|
| 163 |
-
|
| 164 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:186
|
| 165 |
-
msgid "N/A"
|
| 166 |
-
msgstr ""
|
| 167 |
-
|
| 168 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:191
|
| 169 |
-
msgid "D j M Y \\a\\t h:ia"
|
| 170 |
-
msgstr ""
|
| 171 |
-
|
| 172 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:58 ../.
|
| 173 |
-
#: ./plugins/wc-vendors/classes/front/dashboard/class-vendor-dashboard.php:112
|
| 174 |
-
msgid "Your PayPal address is not a valid email address."
|
| 175 |
-
msgstr ""
|
| 176 |
-
|
| 177 |
-
#: ../../plugins/wc-vendors/classes/admin/emails/class-wc-approve-vendor.php:150 .
|
| 178 |
-
#: ./../plugins/wc-vendors/classes/admin/emails/class-wc-notify-admin.php:161 ../.
|
| 179 |
-
#: ./plugins/wc-vendors/classes/admin/emails/class-wc-notify-shipped.php:183 ../..
|
| 180 |
-
#: plugins/wc-vendors/classes/admin/emails/class-wc-notify-vendor.php:282
|
| 181 |
-
msgid "Email type"
|
| 182 |
-
msgstr ""
|
| 183 |
-
|
| 184 |
-
#: ../../plugins/wc-vendors/classes/admin/emails/class-wc-approve-vendor.php:157 .
|
| 185 |
-
#: ./../plugins/wc-vendors/classes/admin/emails/class-wc-notify-admin.php:168 ../.
|
| 186 |
-
#: ./plugins/wc-vendors/classes/admin/emails/class-wc-notify-shipped.php:190 ../..
|
| 187 |
-
#: plugins/wc-vendors/classes/admin/emails/class-wc-notify-vendor.php:289
|
| 188 |
-
msgid "HTML"
|
| 189 |
-
msgstr ""
|
| 190 |
-
|
| 191 |
-
#: ../../plugins/wc-vendors/classes/admin/emails/class-wc-approve-vendor.php:158 .
|
| 192 |
-
#: ./../plugins/wc-vendors/classes/admin/emails/class-wc-notify-admin.php:169 ../.
|
| 193 |
-
#: ./plugins/wc-vendors/classes/admin/emails/class-wc-notify-shipped.php:191 ../..
|
| 194 |
-
#: plugins/wc-vendors/classes/admin/emails/class-wc-notify-vendor.php:290
|
| 195 |
-
msgid "Multipart"
|
| 196 |
-
msgstr ""
|
| 197 |
-
|
| 198 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:9
|
| 199 |
-
msgid ""
|
| 200 |
-
"The default rate you pay each vendor for a product sale. <br>You can also "
|
| 201 |
-
"give vendors their own individual commission rates by editing the vendors "
|
| 202 |
-
"user account.<br>Also, you can edit an individual products commission to "
|
| 203 |
-
"override both of these settings on a per product basis."
|
| 204 |
-
msgstr ""
|
| 205 |
-
|
| 206 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:20 ../..
|
| 207 |
-
#: plugins/wc-vendors/classes/admin/settings/sf-options.php:27
|
| 208 |
-
msgid "Allow users or guests to apply to become a vendor"
|
| 209 |
-
msgstr ""
|
| 210 |
-
|
| 211 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:22
|
| 212 |
-
msgid ""
|
| 213 |
-
"Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:"
|
| 214 |
-
"</strong> You MUST \"<strong>Enable registration on the \"My Account\" "
|
| 215 |
-
"page</strong>\" in your <strong>WooCommerce > Settings > Accounts</strong> "
|
| 216 |
-
"page for this option to work. Currently, you have registration disabled."
|
| 217 |
-
msgstr ""
|
| 218 |
-
|
| 219 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:26
|
| 220 |
-
msgid "Registration"
|
| 221 |
-
msgstr ""
|
| 222 |
-
|
| 223 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:28
|
| 224 |
-
msgid ""
|
| 225 |
-
"This will show a checkbox on the My Account page's registration form asking "
|
| 226 |
-
"if the user would like to apply to be a vendor. Also, on the Vendor "
|
| 227 |
-
"Dashboard, users can still apply to become a vendor even if this is disabled."
|
| 228 |
-
msgstr ""
|
| 229 |
-
|
| 230 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:35
|
| 231 |
-
msgid "Approve vendor applications manually"
|
| 232 |
-
msgstr ""
|
| 233 |
-
|
| 234 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:36
|
| 235 |
-
msgid ""
|
| 236 |
-
"With this unchecked, all vendor applications are automatically accepted. "
|
| 237 |
-
"Otherwise, you must approve each manually."
|
| 238 |
-
msgstr ""
|
| 239 |
-
|
| 240 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:43 ../..
|
| 241 |
-
#: plugins/wc-vendors/classes/admin/settings/sf-options.php:175
|
| 242 |
-
msgid "Taxes"
|
| 243 |
-
msgstr ""
|
| 244 |
-
|
| 245 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:44
|
| 246 |
-
msgid "Give vendors any tax collected per-product"
|
| 247 |
-
msgstr ""
|
| 248 |
-
|
| 249 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:45
|
| 250 |
-
msgid "The tax collected on a vendor's product will be given in its entirety"
|
| 251 |
-
msgstr ""
|
| 252 |
-
|
| 253 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:53
|
| 254 |
-
msgid "Give vendors any shipping collected per-product"
|
| 255 |
-
msgstr ""
|
| 256 |
-
|
| 257 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:54
|
| 258 |
-
msgid ""
|
| 259 |
-
"WC Vendors Free - Give vendors shipping if using Per Product Shipping "
|
| 260 |
-
"gateway. WC Vendors Pro - Give vendors shipping when using Vendor Shipping. "
|
| 261 |
-
" No other shipping module is compatible with this option."
|
| 262 |
-
msgstr ""
|
| 263 |
-
|
| 264 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:60
|
| 265 |
-
msgid "Shop options"
|
| 266 |
-
msgstr ""
|
| 267 |
-
|
| 268 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:63
|
| 269 |
-
msgid "Shop HTML"
|
| 270 |
-
msgstr ""
|
| 271 |
-
|
| 272 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:64
|
| 273 |
-
msgid ""
|
| 274 |
-
"Enable HTML for a vendor's shop description by default. You can enable or "
|
| 275 |
-
"disable this per vendor by editing the vendors user account."
|
| 276 |
-
msgstr ""
|
| 277 |
-
|
| 278 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:71
|
| 279 |
-
msgid "Vendor Shop Page"
|
| 280 |
-
msgstr ""
|
| 281 |
-
|
| 282 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:72
|
| 283 |
-
msgid ""
|
| 284 |
-
"Enter one word for the URI. If you enter \"<strong>vendors</strong>\" your "
|
| 285 |
-
"vendors store will be <code>yourdomain.com/vendors/store-name/</code>"
|
| 286 |
-
msgstr ""
|
| 287 |
-
|
| 288 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:79
|
| 289 |
-
msgid "Shop Headers"
|
| 290 |
-
msgstr ""
|
| 291 |
-
|
| 292 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:80
|
| 293 |
-
msgid "Enable vendor shop headers"
|
| 294 |
-
msgstr ""
|
| 295 |
-
|
| 296 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:81
|
| 297 |
-
msgid ""
|
| 298 |
-
"This will override the HTML Shop description output on product-archive pages."
|
| 299 |
-
" In order to customize the shop headers visit wcvendors.com and read the "
|
| 300 |
-
"article in the Knowledgebase titled Changing the Vendor Templates."
|
| 301 |
-
msgstr ""
|
| 302 |
-
|
| 303 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:88
|
| 304 |
-
msgid "Vendor Display Name"
|
| 305 |
-
msgstr ""
|
| 306 |
-
|
| 307 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:89
|
| 308 |
-
msgid "Select what will be displayed for the sold by text throughout the store."
|
| 309 |
-
msgstr ""
|
| 310 |
-
|
| 311 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:93
|
| 312 |
-
msgid "Display Name"
|
| 313 |
-
msgstr ""
|
| 314 |
-
|
| 315 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:94 ../..
|
| 316 |
-
#: plugins/wc-vendors/classes/admin/views/html-vendor-settings-page.php:22 ../..
|
| 317 |
-
#: plugins/wc-vendors/templates/dashboard/settings/shop-name.php:2
|
| 318 |
-
msgid "Shop Name"
|
| 319 |
-
msgstr ""
|
| 320 |
-
|
| 321 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:95
|
| 322 |
-
msgid "User Login"
|
| 323 |
-
msgstr ""
|
| 324 |
-
|
| 325 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:96
|
| 326 |
-
msgid "User Email"
|
| 327 |
-
msgstr ""
|
| 328 |
-
|
| 329 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:103 ../..
|
| 330 |
-
#: plugins/wc-vendors/classes/admin/settings/sf-options.php:116
|
| 331 |
-
msgid "Sold By"
|
| 332 |
-
msgstr ""
|
| 333 |
-
|
| 334 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:104
|
| 335 |
-
msgid "Enable sold by labels"
|
| 336 |
-
msgstr ""
|
| 337 |
-
|
| 338 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:105
|
| 339 |
-
msgid "This will enable or disable the sold by labels."
|
| 340 |
-
msgstr ""
|
| 341 |
-
|
| 342 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:112
|
| 343 |
-
msgid "Sold By Label"
|
| 344 |
-
msgstr ""
|
| 345 |
-
|
| 346 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:113
|
| 347 |
-
msgid "The sold by label used on the site and emails."
|
| 348 |
-
msgstr ""
|
| 349 |
-
|
| 350 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:120
|
| 351 |
-
msgid "Seller Info Label"
|
| 352 |
-
msgstr ""
|
| 353 |
-
|
| 354 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:121
|
| 355 |
-
msgid "The seller info tab title on the single product page."
|
| 356 |
-
msgstr ""
|
| 357 |
-
|
| 358 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:124
|
| 359 |
-
msgid "Seller Info"
|
| 360 |
-
msgstr ""
|
| 361 |
-
|
| 362 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:128
|
| 363 |
-
msgid "Product Add Page"
|
| 364 |
-
msgstr ""
|
| 365 |
-
|
| 366 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:128
|
| 367 |
-
msgid "Configure what to hide from all vendors when adding a product"
|
| 368 |
-
msgstr ""
|
| 369 |
-
|
| 370 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:131
|
| 371 |
-
msgid "Left side panel"
|
| 372 |
-
msgstr ""
|
| 373 |
-
|
| 374 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:132
|
| 375 |
-
msgid ""
|
| 376 |
-
"CHECKING these boxes will **HIDE** these areas of the add product page for "
|
| 377 |
-
"vendors"
|
| 378 |
-
msgstr ""
|
| 379 |
-
|
| 380 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:135
|
| 381 |
-
msgid "Inventory"
|
| 382 |
-
msgstr ""
|
| 383 |
-
|
| 384 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:137
|
| 385 |
-
msgid "Linked Products"
|
| 386 |
-
msgstr ""
|
| 387 |
-
|
| 388 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:138
|
| 389 |
-
msgid "Attributes"
|
| 390 |
-
msgstr ""
|
| 391 |
-
|
| 392 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:139
|
| 393 |
-
msgid "Advanced"
|
| 394 |
-
msgstr ""
|
| 395 |
-
|
| 396 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:146
|
| 397 |
-
msgid "Types"
|
| 398 |
-
msgstr ""
|
| 399 |
-
|
| 400 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:147
|
| 401 |
-
msgid "CHECKING these boxes will HIDE these product types from the vendor"
|
| 402 |
-
msgstr ""
|
| 403 |
-
|
| 404 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:150
|
| 405 |
-
msgid "Simple"
|
| 406 |
-
msgstr ""
|
| 407 |
-
|
| 408 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:151
|
| 409 |
-
msgid "Variable"
|
| 410 |
-
msgstr ""
|
| 411 |
-
|
| 412 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:152
|
| 413 |
-
msgid "Grouped"
|
| 414 |
-
msgstr ""
|
| 415 |
-
|
| 416 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:153
|
| 417 |
-
msgid "External / affiliate"
|
| 418 |
-
msgstr ""
|
| 419 |
-
|
| 420 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:160
|
| 421 |
-
msgid "Type options"
|
| 422 |
-
msgstr ""
|
| 423 |
-
|
| 424 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:161
|
| 425 |
-
msgid "CHECKING these boxes will **HIDE** these product options from the vendor"
|
| 426 |
-
msgstr ""
|
| 427 |
-
|
| 428 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:164
|
| 429 |
-
msgid "Virtual"
|
| 430 |
-
msgstr ""
|
| 431 |
-
|
| 432 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:165
|
| 433 |
-
msgid "Downloadable"
|
| 434 |
-
msgstr ""
|
| 435 |
-
|
| 436 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:172
|
| 437 |
-
msgid "Miscellaneous"
|
| 438 |
-
msgstr ""
|
| 439 |
-
|
| 440 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:176
|
| 441 |
-
msgid "SKU"
|
| 442 |
-
msgstr ""
|
| 443 |
-
|
| 444 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:177
|
| 445 |
-
msgid "Featured"
|
| 446 |
-
msgstr ""
|
| 447 |
-
|
| 448 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:178
|
| 449 |
-
msgid "Duplicate Product"
|
| 450 |
-
msgstr ""
|
| 451 |
-
|
| 452 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:185
|
| 453 |
-
msgid "Stylesheet"
|
| 454 |
-
msgstr ""
|
| 455 |
-
|
| 456 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:186
|
| 457 |
-
msgid ""
|
| 458 |
-
"You can add CSS in this textarea, which will be loaded on the product "
|
| 459 |
-
"add/edit page for vendors."
|
| 460 |
-
msgstr ""
|
| 461 |
-
|
| 462 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:193
|
| 463 |
-
msgid "Permissions"
|
| 464 |
-
msgstr ""
|
| 465 |
-
|
| 466 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:193
|
| 467 |
-
msgid "General permissions used around the shop"
|
| 468 |
-
msgstr ""
|
| 469 |
-
|
| 470 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:197
|
| 471 |
-
msgid "View orders"
|
| 472 |
-
msgstr ""
|
| 473 |
-
|
| 474 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:198
|
| 475 |
-
msgid "Show customer details such as email, address, name, etc, for each order"
|
| 476 |
-
msgstr ""
|
| 477 |
-
|
| 478 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:205
|
| 479 |
-
msgid "View comments"
|
| 480 |
-
msgstr ""
|
| 481 |
-
|
| 482 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:206
|
| 483 |
-
msgid "View all vendor comments for an order on the frontend"
|
| 484 |
-
msgstr ""
|
| 485 |
-
|
| 486 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:213
|
| 487 |
-
msgid "Submit comments"
|
| 488 |
-
msgstr ""
|
| 489 |
-
|
| 490 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:214
|
| 491 |
-
msgid "Submit comments for an order on the frontend. Eg, tracking ID for a product"
|
| 492 |
-
msgstr ""
|
| 493 |
-
|
| 494 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:221
|
| 495 |
-
msgid "View email addresses"
|
| 496 |
-
msgstr ""
|
| 497 |
-
|
| 498 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:222
|
| 499 |
-
msgid ""
|
| 500 |
-
"While viewing order details on the frontend, you can disable or enable email "
|
| 501 |
-
"addresses"
|
| 502 |
-
msgstr ""
|
| 503 |
-
|
| 504 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:229
|
| 505 |
-
msgid "Export a CSV file of orders for a product"
|
| 506 |
-
msgstr ""
|
| 507 |
-
|
| 508 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:230
|
| 509 |
-
msgid "Vendors could export orders for a product on the frontend"
|
| 510 |
-
msgstr ""
|
| 511 |
-
|
| 512 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:237
|
| 513 |
-
msgid "Reports"
|
| 514 |
-
msgstr ""
|
| 515 |
-
|
| 516 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:238
|
| 517 |
-
msgid "<strike>View backend sales reports</strike>. <strong>Depreciated</strong>"
|
| 518 |
-
msgstr ""
|
| 519 |
-
|
| 520 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:239
|
| 521 |
-
msgid ""
|
| 522 |
-
"This option has been removed and will no longer function. It will be "
|
| 523 |
-
"completely removed in future versions. Vendors should use their Vendor "
|
| 524 |
-
"Dashboard for reports as all identical functionality is already there. "
|
| 525 |
-
msgstr ""
|
| 526 |
-
|
| 527 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:246
|
| 528 |
-
msgid "View Frontend sales reports"
|
| 529 |
-
msgstr ""
|
| 530 |
-
|
| 531 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:247
|
| 532 |
-
msgid ""
|
| 533 |
-
"Sales table on the frontend on the Vendor Dashboard page. The table will "
|
| 534 |
-
"only display sales data that pertain to their products, and only for orders "
|
| 535 |
-
"that are processing or completed."
|
| 536 |
-
msgstr ""
|
| 537 |
-
|
| 538 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:255
|
| 539 |
-
msgid "Submit products"
|
| 540 |
-
msgstr ""
|
| 541 |
-
|
| 542 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:256
|
| 543 |
-
msgid ""
|
| 544 |
-
"Check to allow vendors to list new products. Admin must approve new "
|
| 545 |
-
"products by editing the product, and clicking Publish."
|
| 546 |
-
msgstr ""
|
| 547 |
-
|
| 548 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:263
|
| 549 |
-
msgid "Edit live products"
|
| 550 |
-
msgstr ""
|
| 551 |
-
|
| 552 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:264
|
| 553 |
-
msgid ""
|
| 554 |
-
"Vendors could edit an approved product after it has already gone live. There "
|
| 555 |
-
"is no approval or review after editing a live product. This could be "
|
| 556 |
-
"dangerous with malicious vendors, so take caution."
|
| 557 |
-
msgstr ""
|
| 558 |
-
|
| 559 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:271
|
| 560 |
-
msgid "Submit products live without requiring approval"
|
| 561 |
-
msgstr ""
|
| 562 |
-
|
| 563 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:272
|
| 564 |
-
msgid ""
|
| 565 |
-
"Vendors can submit products without review or approval from a shop admin. "
|
| 566 |
-
"This could be dangerous with malicious vendors, so take caution."
|
| 567 |
-
msgstr ""
|
| 568 |
-
|
| 569 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:278
|
| 570 |
-
msgid "Pages"
|
| 571 |
-
msgstr ""
|
| 572 |
-
|
| 573 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:279
|
| 574 |
-
msgid "Page configuration"
|
| 575 |
-
msgstr ""
|
| 576 |
-
|
| 577 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:282
|
| 578 |
-
msgid "Vendor dashboard"
|
| 579 |
-
msgstr ""
|
| 580 |
-
|
| 581 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:283
|
| 582 |
-
msgid ""
|
| 583 |
-
"Choose the page that has the shortcode "
|
| 584 |
-
"<code>[wcv_vendor_dashboard]</code><br/>. If this page is not set, you will "
|
| 585 |
-
"break your site. If you upgrade to Pro, keep this page unchanged as both "
|
| 586 |
-
"Pro Dashboard and this Dashboard page must be set."
|
| 587 |
-
msgstr ""
|
| 588 |
-
|
| 589 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:290
|
| 590 |
-
msgid "Shop settings"
|
| 591 |
-
msgstr ""
|
| 592 |
-
|
| 593 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:291
|
| 594 |
-
msgid ""
|
| 595 |
-
"Choose the page that has the shortcode "
|
| 596 |
-
"<code>[wcv_shop_settings]</code><br/>These are the shop settings a vendor "
|
| 597 |
-
"can configure. By default, Vendor Dashboard > Shop Settings should have "
|
| 598 |
-
"this shortcode."
|
| 599 |
-
msgstr ""
|
| 600 |
-
|
| 601 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:298
|
| 602 |
-
msgid "Orders page"
|
| 603 |
-
msgstr ""
|
| 604 |
-
|
| 605 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:299
|
| 606 |
-
msgid ""
|
| 607 |
-
"Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By "
|
| 608 |
-
"default, Vendor Dashboard > Orders should have the shortcode."
|
| 609 |
-
msgstr ""
|
| 610 |
-
|
| 611 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:306
|
| 612 |
-
msgid "Vendor terms"
|
| 613 |
-
msgstr ""
|
| 614 |
-
|
| 615 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:307
|
| 616 |
-
msgid ""
|
| 617 |
-
"These terms are shown to a user when submitting an application to become a "
|
| 618 |
-
"vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor "
|
| 619 |
-
"must accept terms in order to register, if set."
|
| 620 |
-
msgstr ""
|
| 621 |
-
|
| 622 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:314
|
| 623 |
-
msgid "payments"
|
| 624 |
-
msgstr ""
|
| 625 |
-
|
| 626 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:325
|
| 627 |
-
msgid "Payments"
|
| 628 |
-
msgstr ""
|
| 629 |
-
|
| 630 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:327
|
| 631 |
-
msgid "PayPal Adaptive Payments Scheduling"
|
| 632 |
-
msgstr ""
|
| 633 |
-
|
| 634 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:328
|
| 635 |
-
#, php-format
|
| 636 |
-
msgid "Total commission currently due: %s. <a href=\"%s\">View details</a>."
|
| 637 |
-
msgstr ""
|
| 638 |
-
|
| 639 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:329
|
| 640 |
-
#, php-format
|
| 641 |
-
msgid ""
|
| 642 |
-
"Make sure you update your PayPal Adaptive Payments settings <a "
|
| 643 |
-
"href=\"%s\">here</a>. <br><br>To instantly pay with Adaptive Payments you "
|
| 644 |
-
"must activate the paypalap gateway in your Checkout settings. <br><a "
|
| 645 |
-
"href=\"https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/\" "
|
| 646 |
-
"target=\"top\">PayPal AP Application Help</a>. <br><br>Another gateway that "
|
| 647 |
-
"offers instant payments to vendors that also accepts credit cards directly "
|
| 648 |
-
"on your checkout page is Stripe. <br><a href=\"https://www.wcvendors."
|
| 649 |
-
"com/product/stripe-commissions-gateway/\" target=\"top\">Stripe Commissions & "
|
| 650 |
-
"Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a "
|
| 651 |
-
"href=\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 652 |
-
"Vendors Pro</a>."
|
| 653 |
-
msgstr ""
|
| 654 |
-
|
| 655 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:333
|
| 656 |
-
msgid "Instant pay"
|
| 657 |
-
msgstr ""
|
| 658 |
-
|
| 659 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:334
|
| 660 |
-
msgid ""
|
| 661 |
-
"Instantly pay vendors their commission when an order is made, and if a "
|
| 662 |
-
"vendor has a valid PayPal email added on their Shop Settings page."
|
| 663 |
-
msgstr ""
|
| 664 |
-
|
| 665 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:335
|
| 666 |
-
msgid ""
|
| 667 |
-
"For this to work, customers must checkout with the PayPal Adaptive Payments "
|
| 668 |
-
"gateway. Using any other gateways will not pay vendors instantly"
|
| 669 |
-
msgstr ""
|
| 670 |
-
|
| 671 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:342
|
| 672 |
-
msgid "Payment schedule"
|
| 673 |
-
msgstr ""
|
| 674 |
-
|
| 675 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:343
|
| 676 |
-
msgid "Note: Schedule will only work if instant pay is unchecked"
|
| 677 |
-
msgstr ""
|
| 678 |
-
|
| 679 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:348
|
| 680 |
-
msgid "Weekly"
|
| 681 |
-
msgstr ""
|
| 682 |
-
|
| 683 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:349
|
| 684 |
-
msgid "Biweekly"
|
| 685 |
-
msgstr ""
|
| 686 |
-
|
| 687 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:350
|
| 688 |
-
msgid "Monthly"
|
| 689 |
-
msgstr ""
|
| 690 |
-
|
| 691 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:351
|
| 692 |
-
msgid "Manual"
|
| 693 |
-
msgstr ""
|
| 694 |
-
|
| 695 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:352
|
| 696 |
-
msgid "Now"
|
| 697 |
-
msgstr ""
|
| 698 |
-
|
| 699 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:357
|
| 700 |
-
msgid "Email notification"
|
| 701 |
-
msgstr ""
|
| 702 |
-
|
| 703 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/sf-options.php:358
|
| 704 |
-
msgid ""
|
| 705 |
-
"Send the WooCommerce admin an email each time a payment has been made via "
|
| 706 |
-
"the payment schedule options above"
|
| 707 |
-
msgstr ""
|
| 708 |
-
|
| 709 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-format-
|
| 710 |
-
#: options.php:211 ../../plugins/wc-vendors/classes/admin/settings/classes/sf-
|
| 711 |
-
#: class-settings.php:789
|
| 712 |
-
msgid "Select a page..."
|
| 713 |
-
msgstr ""
|
| 714 |
-
|
| 715 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 716 |
-
#: 153 ../../plugins/wc-vendors/templates/dashboard/settings/settings.php:1
|
| 717 |
-
msgid "Settings"
|
| 718 |
-
msgstr ""
|
| 719 |
-
|
| 720 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 721 |
-
#: 302
|
| 722 |
-
msgid "Could not load settings at: "
|
| 723 |
-
msgstr ""
|
| 724 |
-
|
| 725 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 726 |
-
#: 302
|
| 727 |
-
msgid "Error - WP Settings Framework"
|
| 728 |
-
msgstr ""
|
| 729 |
-
|
| 730 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 731 |
-
#: 484
|
| 732 |
-
#, php-format
|
| 733 |
-
msgid "Save %s changes"
|
| 734 |
-
msgstr ""
|
| 735 |
-
|
| 736 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 737 |
-
#: 497
|
| 738 |
-
msgid ""
|
| 739 |
-
"Please help with a <a href=\"https://wordpress.org/support/view/plugin-"
|
| 740 |
-
"reviews/wc-vendors?rate=5#postform\" target=\"top\">High Five!</a> | <a "
|
| 741 |
-
"href=\"https://www.wcvendors.com/product/wc-vendors-pro/\" target=\"top\">WC "
|
| 742 |
-
"Vendors Pro</a> | <a href=\"https://www.wcvendors.com/product/stripe-"
|
| 743 |
-
"commissions-gateway/\" target=\"top\">Stripe Commissions & Gateway</a> | <a "
|
| 744 |
-
"href=\"https://www.wcvendors.com/kb/\" target=\"top\">KnowledgeBase</a> | <a "
|
| 745 |
-
"href=\"https://www.wcvendors.com/help/\" target=\"top\">Help Forums</a>"
|
| 746 |
-
msgstr ""
|
| 747 |
-
|
| 748 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 749 |
-
#: 782
|
| 750 |
-
msgid "Edit Page"
|
| 751 |
-
msgstr ""
|
| 752 |
-
|
| 753 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 754 |
-
#: 783
|
| 755 |
-
msgid "View Page"
|
| 756 |
-
msgstr ""
|
| 757 |
-
|
| 758 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 759 |
-
#: 846
|
| 760 |
-
#, php-format
|
| 761 |
-
msgid "Update %s"
|
| 762 |
-
msgstr ""
|
| 763 |
-
|
| 764 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 765 |
-
#: 846 ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.
|
| 766 |
-
#: php:846
|
| 767 |
-
#, php-format
|
| 768 |
-
msgid "Add %s"
|
| 769 |
-
msgstr ""
|
| 770 |
-
|
| 771 |
-
#: ../../plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:
|
| 772 |
-
#: 846
|
| 773 |
-
#, php-format
|
| 774 |
-
msgid "Upload an image for the %s"
|
| 775 |
-
msgstr ""
|
| 776 |
-
|
| 777 |
-
#: ../../plugins/wc-vendors/classes/front/signup/class-vendor-signup.php:122
|
| 778 |
-
msgid "Application denied. You are an administrator."
|
| 779 |
-
msgstr ""
|
| 780 |
-
|
| 781 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 782 |
-
msgid "PayPal Adaptive Payments"
|
| 783 |
-
msgstr ""
|
| 784 |
-
|
| 785 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:119
|
| 786 |
-
#, php-format
|
| 787 |
-
msgid ""
|
| 788 |
-
"Something went wrong. Response from PayPal invalidated this order. Status: "
|
| 789 |
-
"%s."
|
| 790 |
-
msgstr ""
|
| 791 |
-
|
| 792 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:124
|
| 793 |
-
msgid "IPN payment completed"
|
| 794 |
-
msgstr ""
|
| 795 |
-
|
| 796 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:146
|
| 797 |
-
msgid "Enable PayPal Adaptive Payments"
|
| 798 |
-
msgstr ""
|
| 799 |
-
|
| 800 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:152
|
| 801 |
-
msgid "Method Title"
|
| 802 |
-
msgstr ""
|
| 803 |
-
|
| 804 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:153
|
| 805 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 806 |
-
#: test.php:70
|
| 807 |
-
msgid "This controls the title which the user sees during checkout."
|
| 808 |
-
msgstr ""
|
| 809 |
-
|
| 810 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:160
|
| 811 |
-
msgid "This controls the description which the user sees during checkout."
|
| 812 |
-
msgstr ""
|
| 813 |
-
|
| 814 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:172
|
| 815 |
-
msgid "Live Credentials"
|
| 816 |
-
msgstr ""
|
| 817 |
-
|
| 818 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:174
|
| 819 |
-
#, php-format
|
| 820 |
-
msgid ""
|
| 821 |
-
"You must have an <a href=\"%s\">Application ID</a> to process live "
|
| 822 |
-
"transactions. You do not need one for testing in Sandbox mode."
|
| 823 |
-
msgstr ""
|
| 824 |
-
|
| 825 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:179
|
| 826 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:213
|
| 827 |
-
msgid "PayPal Email"
|
| 828 |
-
msgstr ""
|
| 829 |
-
|
| 830 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:180
|
| 831 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:214
|
| 832 |
-
msgid "The email address main payments should go to."
|
| 833 |
-
msgstr ""
|
| 834 |
-
|
| 835 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:185
|
| 836 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:219
|
| 837 |
-
msgid "API Username"
|
| 838 |
-
msgstr ""
|
| 839 |
-
|
| 840 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:190
|
| 841 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:224
|
| 842 |
-
msgid "API Password"
|
| 843 |
-
msgstr ""
|
| 844 |
-
|
| 845 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:195
|
| 846 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:229
|
| 847 |
-
msgid "API Signature"
|
| 848 |
-
msgstr ""
|
| 849 |
-
|
| 850 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:200
|
| 851 |
-
msgid "Application ID"
|
| 852 |
-
msgstr ""
|
| 853 |
-
|
| 854 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:202
|
| 855 |
-
msgid "Only required when doing live transactions."
|
| 856 |
-
msgstr ""
|
| 857 |
-
|
| 858 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:206
|
| 859 |
-
msgid "Sandbox Credentials"
|
| 860 |
-
msgstr ""
|
| 861 |
-
|
| 862 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:208
|
| 863 |
-
#, php-format
|
| 864 |
-
msgid ""
|
| 865 |
-
"You can signup for a sandbox developer account <a href=\"%s\">here</a>. You "
|
| 866 |
-
"need a developer account if you want to enable Sandbox mode for testing."
|
| 867 |
-
msgstr ""
|
| 868 |
-
|
| 869 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:240
|
| 870 |
-
msgid "Misc. Settings"
|
| 871 |
-
msgstr ""
|
| 872 |
-
|
| 873 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:245
|
| 874 |
-
msgid "Enable PayPal Sandbox mode"
|
| 875 |
-
msgstr ""
|
| 876 |
-
|
| 877 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:251
|
| 878 |
-
msgid "Enable logging"
|
| 879 |
-
msgstr ""
|
| 880 |
-
|
| 881 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:269
|
| 882 |
-
msgid ""
|
| 883 |
-
"The PayPal Adaptive Payments gateway can instantly pay your vendors their "
|
| 884 |
-
"due commission (if enabled). Also used to mass pay vendors on a schedule / "
|
| 885 |
-
"manual method (if enabled)."
|
| 886 |
-
msgstr ""
|
| 887 |
-
|
| 888 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 889 |
-
msgid "Gateway Disabled"
|
| 890 |
-
msgstr ""
|
| 891 |
-
|
| 892 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:280
|
| 893 |
-
#, php-format
|
| 894 |
-
msgid "%s does not support your store currency."
|
| 895 |
-
msgstr ""
|
| 896 |
-
|
| 897 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:384
|
| 898 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:500
|
| 899 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 900 |
-
#: php:153
|
| 901 |
-
#, php-format
|
| 902 |
-
msgid "Error: %s"
|
| 903 |
-
msgstr ""
|
| 904 |
-
|
| 905 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:393
|
| 906 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_AdvPayments/paypal_ap.php:394
|
| 907 |
-
#, php-format
|
| 908 |
-
msgid "Error ID: %s. %s"
|
| 909 |
-
msgstr ""
|
| 910 |
-
|
| 911 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 912 |
-
#: php:115
|
| 913 |
-
msgid "No vendors found to pay. Maybe they haven't set a PayPal address?"
|
| 914 |
-
msgstr ""
|
| 915 |
-
|
| 916 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 917 |
-
#: php:167
|
| 918 |
-
msgid "All due commission has been paid for."
|
| 919 |
-
msgstr ""
|
| 920 |
-
|
| 921 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 922 |
-
#: php:173
|
| 923 |
-
msgid ""
|
| 924 |
-
"All due commission has been paid for, but I could not clear it from their "
|
| 925 |
-
"profiles due to an internal error. Commission will still be listed as due. "
|
| 926 |
-
"Please manually mark the commission as paid from the Commissions page."
|
| 927 |
-
msgstr ""
|
| 928 |
-
|
| 929 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 930 |
-
#: php:208
|
| 931 |
-
msgid "WooCommerce: Mass payments for vendors update"
|
| 932 |
-
msgstr ""
|
| 933 |
-
|
| 934 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 935 |
-
#: php:210
|
| 936 |
-
msgid ""
|
| 937 |
-
"Hello! A payment was just triggered to mass pay all vendors their due "
|
| 938 |
-
"commission."
|
| 939 |
-
msgstr ""
|
| 940 |
-
|
| 941 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 942 |
-
#: php:211
|
| 943 |
-
#, php-format
|
| 944 |
-
msgid "Payment status: %s."
|
| 945 |
-
msgstr ""
|
| 946 |
-
|
| 947 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 948 |
-
#: php:212
|
| 949 |
-
#, php-format
|
| 950 |
-
msgid "Payment message: %s."
|
| 951 |
-
msgstr ""
|
| 952 |
-
|
| 953 |
-
#: ../../plugins/wc-vendors/classes/gateways/PayPal_Masspay/class-paypal-masspay.
|
| 954 |
-
#: php:215
|
| 955 |
-
#, php-format
|
| 956 |
-
msgid "Payment total: %s."
|
| 957 |
-
msgstr ""
|
| 958 |
-
|
| 959 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 960 |
-
#: test.php:35 ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-
|
| 961 |
-
#: wcv-gateway-test.php:71
|
| 962 |
-
msgid "WC Vendors Test Gateway"
|
| 963 |
-
msgstr ""
|
| 964 |
-
|
| 965 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 966 |
-
#: test.php:36
|
| 967 |
-
msgid ""
|
| 968 |
-
"This gateway will set orders to processing upon receipt allowing you to test "
|
| 969 |
-
"transactions in your store. Some WooCommerce included gateways have "
|
| 970 |
-
"problems with this - you should use this gateway for all of your non-PayPal "
|
| 971 |
-
"testing."
|
| 972 |
-
msgstr ""
|
| 973 |
-
|
| 974 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 975 |
-
#: test.php:64
|
| 976 |
-
msgid "Enable WC Vendors Test Gateway Payment"
|
| 977 |
-
msgstr ""
|
| 978 |
-
|
| 979 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 980 |
-
#: test.php:68
|
| 981 |
-
msgid "Title"
|
| 982 |
-
msgstr "Titel"
|
| 983 |
-
|
| 984 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 985 |
-
#: test.php:77
|
| 986 |
-
msgid "Payment method description that the customer will see on your checkout."
|
| 987 |
-
msgstr ""
|
| 988 |
-
|
| 989 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 990 |
-
#: test.php:78
|
| 991 |
-
msgid ""
|
| 992 |
-
"This is a test gateway -- not to be used on live sites for live transactions."
|
| 993 |
-
" <a href=\"http://www.wcvendors.com/\" target=\"top\">Click here to visit "
|
| 994 |
-
"WCVendors.com</a>."
|
| 995 |
-
msgstr ""
|
| 996 |
-
|
| 997 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 998 |
-
#: test.php:82
|
| 999 |
-
msgid "Instructions"
|
| 1000 |
-
msgstr "Instructies"
|
| 1001 |
-
|
| 1002 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 1003 |
-
#: test.php:84
|
| 1004 |
-
msgid ""
|
| 1005 |
-
"Success! Your test order is now marked as processing and any vendors will "
|
| 1006 |
-
"be sent an email as long as you have the Notify Vendors email enabled under "
|
| 1007 |
-
"WooCommerce--Settings--Emails."
|
| 1008 |
-
msgstr ""
|
| 1009 |
-
|
| 1010 |
-
#: ../../plugins/wc-vendors/classes/gateways/WCV_Gateway_Test/class-wcv-gateway-
|
| 1011 |
-
#: test.php:124
|
| 1012 |
-
msgid "Test gateway transation complete. Order processing."
|
| 1013 |
-
msgstr ""
|
| 1014 |
-
|
| 1015 |
-
#: ../../plugins/wc-vendors/templates/dashboard/denied.php:8
|
| 1016 |
-
msgid ""
|
| 1017 |
-
"Your account has not yet been approved to become a vendor. When it is, you "
|
| 1018 |
-
"will receive an email telling you that your account is approved!"
|
| 1019 |
-
msgstr ""
|
| 1020 |
-
"Je account is nog niet goedgekeurd als verkoper, wanneer dit wel het geval "
|
| 1021 |
-
"is ontvang je een email, waarin staat dat je account is goedgekeurd!"
|
| 1022 |
-
|
| 1023 |
-
#: ../../plugins/wc-vendors/templates/dashboard/orders.php:37
|
| 1024 |
-
msgid "Links"
|
| 1025 |
-
msgstr ""
|
| 1026 |
-
|
| 1027 |
-
#: ../../plugins/wc-vendors/templates/dashboard/orders.php:100
|
| 1028 |
-
msgid "Tracking"
|
| 1029 |
-
msgstr ""
|
| 1030 |
-
|
| 1031 |
-
#: ../../plugins/wc-vendors/templates/emails/admin-new-order.php:17 ../..
|
| 1032 |
-
#: plugins/wc-vendors/templates/emails/notify-vendor-shipped.php:17 ../..
|
| 1033 |
-
#: plugins/wc-vendors/templates/emails/vendor-new-order.php:17
|
| 1034 |
-
#, php-format
|
| 1035 |
-
msgid "Order: %s"
|
| 1036 |
-
msgstr ""
|
| 1037 |
-
|
| 1038 |
-
#: ../../plugins/wc-vendors/templates/emails/admin-new-order.php:53 ../..
|
| 1039 |
-
#: plugins/wc-vendors/templates/emails/notify-vendor-shipped.php:59 ../..
|
| 1040 |
-
#: plugins/wc-vendors/templates/emails/vendor-new-order.php:59
|
| 1041 |
-
msgid "Email:"
|
| 1042 |
-
msgstr ""
|
| 1043 |
-
|
| 1044 |
-
#: ../../plugins/wc-vendors/templates/emails/admin-new-order.php:56 ../..
|
| 1045 |
-
#: plugins/wc-vendors/templates/emails/notify-vendor-shipped.php:62 ../..
|
| 1046 |
-
#: plugins/wc-vendors/templates/emails/vendor-new-order.php:62
|
| 1047 |
-
msgid "Tel:"
|
| 1048 |
-
msgstr ""
|
| 1049 |
-
|
| 1050 |
-
#: ../../plugins/wc-vendors/templates/orders/shipping/shipping-form.php:6
|
| 1051 |
-
msgid "Provider:"
|
| 1052 |
-
msgstr ""
|
| 1053 |
-
|
| 1054 |
-
#: ../../plugins/wc-vendors/templates/orders/shipping/shipping-form.php:8
|
| 1055 |
-
msgid "Custom Provider"
|
| 1056 |
-
msgstr ""
|
| 1057 |
-
|
| 1058 |
-
#: ../../plugins/wc-vendors/templates/orders/shipping/shipping-form.php:48
|
| 1059 |
-
msgid "Tracking link:"
|
| 1060 |
-
msgstr ""
|
| 1061 |
-
|
| 1062 |
-
#: ../../plugins/wc-vendors/templates/orders/shipping/shipping-form.php:66
|
| 1063 |
-
msgid "Preview:"
|
| 1064 |
-
msgstr ""
|
| 1065 |
-
|
| 1066 |
-
#: ../../plugins/wc-vendors/class-wc-vendors.php:296 ../../plugins/wc-
|
| 1067 |
-
#: vendors/classes/class-install.php:87 ../../plugins/wc-
|
| 1068 |
-
#: vendors/classes/admin/class-admin-page.php:254 ../../plugins/wc-
|
| 1069 |
-
#: vendors/classes/admin/class-admin-reports.php:175 ../../plugins/wc-
|
| 1070 |
-
#: vendors/classes/admin/class-admin-reports.php:458 ../../plugins/wc-
|
| 1071 |
-
#: vendors/classes/admin/class-product-meta.php:46 ../../plugins/wc-
|
| 1072 |
-
#: vendors/classes/admin/class-product-meta.php:187 ../../plugins/wc-
|
| 1073 |
-
#: vendors/classes/admin/class-product-meta.php:223
|
| 1074 |
-
msgid "Vendor"
|
| 1075 |
-
msgstr "Verkoper"
|
| 1076 |
-
|
| 1077 |
-
#: ../../plugins/wc-vendors/classes/class-install.php:186
|
| 1078 |
-
msgid "Vendor Dashboard"
|
| 1079 |
-
msgstr "Verkoper dashboard"
|
| 1080 |
-
|
| 1081 |
-
#: ../../plugins/wc-vendors/classes/class-install.php:188 ../../plugins/wc-
|
| 1082 |
-
#: vendors/classes/admin/class-vendor-admin-dashboard.php:20 ../../plugins/wc-
|
| 1083 |
-
#: vendors/classes/admin/class-vendor-admin-dashboard.php:20
|
| 1084 |
-
msgid "Shop Settings"
|
| 1085 |
-
msgstr "Winkel instellingen"
|
| 1086 |
-
|
| 1087 |
-
#: ../../plugins/wc-vendors/classes/class-vendor-post-types.php:34
|
| 1088 |
-
msgid "Vendor Orders"
|
| 1089 |
-
msgstr "Verkoper orders"
|
| 1090 |
-
|
| 1091 |
-
#: ../../plugins/wc-vendors/classes/class-vendors.php:551
|
| 1092 |
-
#, php-format
|
| 1093 |
-
msgid "Vendor Order – %s"
|
| 1094 |
-
msgstr "Verkoper Order – %s"
|
| 1095 |
-
|
| 1096 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-page.php:27
|
| 1097 |
-
msgid "Vendors shipped"
|
| 1098 |
-
msgstr "Verkopers verzonden"
|
| 1099 |
-
|
| 1100 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-page.php:50
|
| 1101 |
-
msgid "Vendors Shipped"
|
| 1102 |
-
msgstr "Verkopers verzonden"
|
| 1103 |
-
|
| 1104 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-page.php:387
|
| 1105 |
-
msgid "Show all Statuses"
|
| 1106 |
-
msgstr "Alle statussen tonen"
|
| 1107 |
-
|
| 1108 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:44
|
| 1109 |
-
msgid "Overview"
|
| 1110 |
-
msgstr "Overzicht"
|
| 1111 |
-
|
| 1112 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:56
|
| 1113 |
-
msgid "Commission by product"
|
| 1114 |
-
msgstr "Commissie per product"
|
| 1115 |
-
|
| 1116 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:62 ../..
|
| 1117 |
-
#: plugins/wc-vendors/classes/admin/class-admin-reports.php:345
|
| 1118 |
-
msgid "Commission Totals"
|
| 1119 |
-
msgstr "Commissie totalen"
|
| 1120 |
-
|
| 1121 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:63
|
| 1122 |
-
msgid ""
|
| 1123 |
-
"Commission totals for all vendors includes shipping and taxes. By default no "
|
| 1124 |
-
"date range is used and all due commissions are returned. Use the date range "
|
| 1125 |
-
"to filter."
|
| 1126 |
-
msgstr ""
|
| 1127 |
-
"Commissie totalen voor alle verkopers is inclusief verzending en belastingen."
|
| 1128 |
-
" Standaard wordt er geen datum bereik gebruikt en alle verschuldigde "
|
| 1129 |
-
"commissies worden teruggestort. Gebruik de datum filter."
|
| 1130 |
-
|
| 1131 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:131
|
| 1132 |
-
msgid "Total paid in range"
|
| 1133 |
-
msgstr "Totaal betaald in bereik"
|
| 1134 |
-
|
| 1135 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:138
|
| 1136 |
-
msgid "Total due in range"
|
| 1137 |
-
msgstr "Totaal verschuldigd in bereik"
|
| 1138 |
-
|
| 1139 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:145
|
| 1140 |
-
msgid "Total reversed in range"
|
| 1141 |
-
msgstr "Totaal gereserveerd in bereik"
|
| 1142 |
-
|
| 1143 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:155
|
| 1144 |
-
msgid "Recent Commission"
|
| 1145 |
-
msgstr "Recente commissie"
|
| 1146 |
-
|
| 1147 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:177
|
| 1148 |
-
msgid "Date & Time"
|
| 1149 |
-
msgstr "Datum & tijd"
|
| 1150 |
-
|
| 1151 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:200
|
| 1152 |
-
msgid "No commission yet"
|
| 1153 |
-
msgstr "Nog geen commissie"
|
| 1154 |
-
|
| 1155 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:234
|
| 1156 |
-
msgid "Show:"
|
| 1157 |
-
msgstr "Toon:"
|
| 1158 |
-
|
| 1159 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:243
|
| 1160 |
-
msgid "Search for a product…"
|
| 1161 |
-
msgstr "Zoek een product"
|
| 1162 |
-
|
| 1163 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:246
|
| 1164 |
-
msgid "Type in a product name to start searching..."
|
| 1165 |
-
msgstr "Type een product naam in om te beginnen met zoeken"
|
| 1166 |
-
|
| 1167 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:278
|
| 1168 |
-
msgid "Select a vendor…"
|
| 1169 |
-
msgstr "Selecteer een verkoper..."
|
| 1170 |
-
|
| 1171 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:344
|
| 1172 |
-
msgid "Month"
|
| 1173 |
-
msgstr "Maand"
|
| 1174 |
-
|
| 1175 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:346
|
| 1176 |
-
msgid "Tax"
|
| 1177 |
-
msgstr "Belasting"
|
| 1178 |
-
|
| 1179 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:347 ../..
|
| 1180 |
-
#: plugins/wc-vendors/classes/admin/settings/sf-options.php:52 ../../plugins/wc-
|
| 1181 |
-
#: vendors/classes/admin/settings/sf-options.php:136 ../../plugins/wc-
|
| 1182 |
-
#: vendors/templates/dashboard/orders.php:34 ../../plugins/wc-
|
| 1183 |
-
#: vendors/templates/orders/orders.php:115
|
| 1184 |
-
msgid "Shipping"
|
| 1185 |
-
msgstr "Verzending"
|
| 1186 |
-
|
| 1187 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:348 ../..
|
| 1188 |
-
#: plugins/wc-vendors/classes/admin/class-admin-reports.php:445
|
| 1189 |
-
msgid "Reversed"
|
| 1190 |
-
msgstr "Teruggedraaid"
|
| 1191 |
-
|
| 1192 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:349 ../..
|
| 1193 |
-
#: plugins/wc-vendors/classes/admin/class-admin-reports.php:444
|
| 1194 |
-
msgid "Paid"
|
| 1195 |
-
msgstr "Betaald"
|
| 1196 |
-
|
| 1197 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:350 ../..
|
| 1198 |
-
#: plugins/wc-vendors/classes/admin/class-admin-reports.php:443
|
| 1199 |
-
msgid "Due"
|
| 1200 |
-
msgstr "Verschuldigd"
|
| 1201 |
-
|
| 1202 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:459
|
| 1203 |
-
msgid "Tax Total"
|
| 1204 |
-
msgstr "Totale belasting"
|
| 1205 |
-
|
| 1206 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:460
|
| 1207 |
-
msgid "Shipping Total"
|
| 1208 |
-
msgstr "Totale verzending"
|
| 1209 |
-
|
| 1210 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:462
|
| 1211 |
-
msgid "Commission Total"
|
| 1212 |
-
msgstr "Totale commissie"
|
| 1213 |
-
|
| 1214 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-reports.php:484
|
| 1215 |
-
msgid "No commissions found."
|
| 1216 |
-
msgstr "Geen commissie gevonden."
|
| 1217 |
-
|
| 1218 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:418
|
| 1219 |
-
msgid "Enable HTML for the shop description"
|
| 1220 |
-
msgstr "Activeer HTML in shop beschrijving"
|
| 1221 |
-
|
| 1222 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:424
|
| 1223 |
-
msgid "Shop name"
|
| 1224 |
-
msgstr "Winkelnaam"
|
| 1225 |
-
|
| 1226 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:431
|
| 1227 |
-
msgid "PayPal E-mail"
|
| 1228 |
-
msgstr "IBAN"
|
| 1229 |
-
|
| 1230 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:432
|
| 1231 |
-
msgid "required"
|
| 1232 |
-
msgstr "Nodig"
|
| 1233 |
-
|
| 1234 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:439
|
| 1235 |
-
msgid "Commission rate"
|
| 1236 |
-
msgstr "Commissie tarief"
|
| 1237 |
-
|
| 1238 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:440 ../..
|
| 1239 |
-
#: plugins/wc-vendors/classes/admin/class-product-meta.php:174
|
| 1240 |
-
msgid "Leave blank for default"
|
| 1241 |
-
msgstr "Laat leeg voor standaard"
|
| 1242 |
-
|
| 1243 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:446
|
| 1244 |
-
msgid "Give Tax"
|
| 1245 |
-
msgstr "Geef belasting"
|
| 1246 |
-
|
| 1247 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:451
|
| 1248 |
-
msgid "Tax override for vendor"
|
| 1249 |
-
msgstr "Belasting overschrijving voor verkoper"
|
| 1250 |
-
|
| 1251 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:457
|
| 1252 |
-
msgid "Give Shipping"
|
| 1253 |
-
msgstr "Geef verzendkosten"
|
| 1254 |
-
|
| 1255 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:462
|
| 1256 |
-
msgid "Shipping override for vendor"
|
| 1257 |
-
msgstr "Verzend overschrijving voor verkoper"
|
| 1258 |
-
|
| 1259 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:468 ../..
|
| 1260 |
-
#: plugins/wc-vendors/classes/admin/views/html-vendor-settings-page.php:30 ../..
|
| 1261 |
-
#: plugins/wc-vendors/templates/dashboard/settings/seller-info.php:3
|
| 1262 |
-
msgid "Seller info"
|
| 1263 |
-
msgstr "Verkoper info"
|
| 1264 |
-
|
| 1265 |
-
#: ../../plugins/wc-vendors/classes/admin/class-admin-users.php:473
|
| 1266 |
-
msgid "Shop description"
|
| 1267 |
-
msgstr "Winkelbeschrijving"
|
| 1268 |
-
|
| 1269 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:67 ../.
|
| 1270 |
-
#: ./plugins/wc-vendors/classes/front/dashboard/class-vendor-dashboard.php:121
|
| 1271 |
-
msgid "That shop name is already taken. Your shop name must be unique."
|
| 1272 |
-
msgstr "Die winkelnaam is al in gebruik. Je winkelnaam dient uniek te zijn."
|
| 1273 |
-
|
| 1274 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:87 ../.
|
| 1275 |
-
#: ./plugins/wc-vendors/classes/admin/settings/classes/sf-class-settings.php:368 .
|
| 1276 |
-
#: ./../plugins/wc-vendors/classes/front/dashboard/class-vendor-dashboard.php:139
|
| 1277 |
-
msgid "Settings saved."
|
| 1278 |
-
msgstr "Instellingen opgeslagen!"
|
| 1279 |
-
|
| 1280 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:284
|
| 1281 |
-
msgid "Customer"
|
| 1282 |
-
msgstr "Klant"
|
| 1283 |
-
|
| 1284 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:285 ..
|
| 1285 |
-
#: ../plugins/wc-vendors/classes/admin/settings/sf-options.php:127 ../..
|
| 1286 |
-
#: plugins/wc-vendors/classes/admin/settings/sf-options.php:254
|
| 1287 |
-
msgid "Products"
|
| 1288 |
-
msgstr "Producten"
|
| 1289 |
-
|
| 1290 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:289 ..
|
| 1291 |
-
#: ../plugins/wc-vendors/templates/dashboard/orders.php:92
|
| 1292 |
-
msgid "Shipped"
|
| 1293 |
-
msgstr "Verzonden"
|
| 1294 |
-
|
| 1295 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:324 ..
|
| 1296 |
-
#: ../plugins/wc-vendors/templates/dashboard/orders.php:85
|
| 1297 |
-
msgid "Mark shipped"
|
| 1298 |
-
msgstr "Markeer als verzonden"
|
| 1299 |
-
|
| 1300 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:349
|
| 1301 |
-
msgid "Orders marked shipped."
|
| 1302 |
-
msgstr "Orders gemarkeerd als verzonden"
|
| 1303 |
-
|
| 1304 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-admin-dashboard.php:385 ..
|
| 1305 |
-
#: ../plugins/wc-vendors/classes/front/dashboard/class-vendor-dashboard.php:40
|
| 1306 |
-
msgid "You are not allowed to modify this order."
|
| 1307 |
-
msgstr "Het is niet toegestaan om deze order te bewerken."
|
| 1308 |
-
|
| 1309 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-applicants.php:26
|
| 1310 |
-
msgid "Approve"
|
| 1311 |
-
msgstr "Goedkeuren"
|
| 1312 |
-
|
| 1313 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-applicants.php:27
|
| 1314 |
-
msgid "Deny"
|
| 1315 |
-
msgstr "Weigeren"
|
| 1316 |
-
|
| 1317 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-applicants.php:73
|
| 1318 |
-
msgid "Vendor has been <b>denied</b>."
|
| 1319 |
-
msgstr "Verkoper is <b>geweigerd </b>."
|
| 1320 |
-
|
| 1321 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-applicants.php:84
|
| 1322 |
-
msgid "Vendor has been <b>approved</b>."
|
| 1323 |
-
msgstr "Verkoper is <b>geaccepteerd</a>"
|
| 1324 |
-
|
| 1325 |
-
#: ../../plugins/wc-vendors/classes/admin/class-vendor-applicants.php:98
|
| 1326 |
-
msgid "Pending Vendors"
|
| 1327 |
-
msgstr "Afwachtende verkopers"
|
| 1328 |
-
|
| 1329 |
-
#: ../../plugins/wc-vendors/classes/admin/emails/class-emails.php:59 ../..
|
| 1330 |
-
#: plugins/wc-vendors/classes/admin/emails/class-wc-approve-vendor.php:70
|
| 1331 |
-
msgid "pending"
|
| 1332 |
-
msgstr "Afwachtend"
|
| 1333 |
-
|
| 1334 |
-
#: ../../plugins/wc-vendors/classes/admin/emails/c
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
