Shield Security for WordPress

Version Description

Latest Point Release = Released: 18th December, 2017

(v.0) ADDED: All-new Shield Welcome and Setup Wizard - more helpful guided wizards to come.
(v.0) ADDED: [PRO] Shield options import and export
(v.0) ADDED: [PRO] In conjunction with import/export - Shield Security Network: automated options syncing.
(v.0) CHANGED: Going forward, new features and options will support only PHP 5.4+. Existing features will remain unaffected.

Release Info

Developer	paultgoodchild
Plugin	Shield Security for WordPress
Version	6.0.0
Comparing to
See all releases

Code changes from version 5.20.1 to 6.0.0

Files changed (182) hide show

icwp-plugin-controller.php +55 -10
icwp-wpsf.php +3 -2
plugin-spec.php +1 -1
readme.txt +10 -10
resources/css/global-plugin.css +41 -57
resources/css/jquery.fancybox.min.css +1 -0
resources/css/jquery.steps.css +383 -0
resources/css/pages.css +13 -0
resources/css/plugin.css +31 -14
resources/css/wizard.css +70 -0
resources/images/shield/shieldnetworkmini.png +0 -0
resources/images/wizard/general-module_onoff.png +0 -0
resources/images/wizard/general-option_help.png +0 -0
resources/images/wizard/general-shield_actions.png +0 -0
resources/images/wizard/general-shield_help.png +0 -0
resources/images/wizard/general-shield_modules.png +0 -0
resources/images/wizard/general-shield_options.png +0 -0
resources/images/wizard/general-shield_where.png +0 -0
resources/js/jquery.fancybox.min.js +12 -0
resources/js/jquery.steps.min.js +6 -0
resources/js/wizard.js +0 -0
src/common/icwp-data.php +529 -480
src/common/icwp-edd.php +37 -0
src/common/icwp-factory.php +2 -3
src/common/icwp-foundation.php +2 -2
src/common/icwp-googlearecaptcha.php +35 -34
src/common/icwp-googleauthenticator.php +58 -57
src/common/icwp-optionsvo.php +21 -18
src/common/icwp-render.php +289 -287
src/common/icwp-wpcron.php +111 -110
src/common/icwp-wpdb.php +193 -200
src/common/icwp-wpfilesystem.php +414 -417
src/common/icwp-wpfunctions.php +1 -0
src/common/lib/composer.json +28 -0
src/common/lib/composer.lock +299 -0
src/common/lib/vendor/autoload.php +7 -0
src/common/lib/vendor/composer/ClassLoader.php +445 -0
src/common/lib/vendor/composer/LICENSE +21 -0
src/common/lib/vendor/composer/autoload_classmap.php +9 -0
src/common/lib/vendor/composer/autoload_files.php +10 -0
src/common/lib/vendor/composer/autoload_namespaces.php +10 -0
src/common/lib/vendor/composer/autoload_psr4.php +14 -0
src/common/lib/vendor/composer/autoload_real.php +70 -0
src/common/lib/vendor/composer/autoload_static.php +75 -0
src/common/lib/vendor/composer/installed.json +291 -0
src/common/lib/vendor/fernleafsystems/utilities/src/Data/Adapter/StdClassAdapter.php +151 -0
src/common/lib/vendor/fernleafsystems/utilities/src/Response.php +158 -0
src/common/lib/vendor/nesbot/carbon/.php_cs.dist +57 -0
src/common/lib/vendor/nesbot/carbon/LICENSE +19 -0
src/common/lib/vendor/nesbot/carbon/readme.md +92 -0
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Carbon.php +3355 -3355
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/CarbonInterval.php +557 -557
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Exceptions/InvalidDateException.php +67 -67
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/af.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ar.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/az.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/bg.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/bn.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ca.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/cs.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/da.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/de.php +40 -40
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/el.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/en.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/eo.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/es.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/et.php +38 -38
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/eu.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/fa.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/fi.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/fo.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/fr.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/gl.php +24 -24
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/he.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/hr.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/hu.php +52 -52
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/hy.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/id.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/it.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ja.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ka.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/km.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ko.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/lt.php +38 -38
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/lv.php +47 -47
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/mk.php +24 -24
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ms.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/nl.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/no.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/pl.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/pt.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/pt_BR.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ro.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ru.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sk.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sl.php +38 -38
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sq.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sr.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sr_Cyrl_ME.php +38 -38
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sr_Latn_ME.php +38 -38
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sr_ME.php +38 -38
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sv.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/th.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/tr.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/uk.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ur.php +24 -24
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/uz.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/vi.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/zh.php +31 -31
src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/zh_TW.php +31 -31
src/common/lib/vendor/symfony/polyfill-mbstring/LICENSE +19 -0
src/common/lib/vendor/symfony/polyfill-mbstring/Mbstring.php +664 -0
src/common/lib/vendor/symfony/polyfill-mbstring/Resources/unidata/lowerCase.php +1101 -0
src/common/lib/vendor/symfony/polyfill-mbstring/Resources/unidata/upperCase.php +1109 -0
src/common/lib/vendor/symfony/polyfill-mbstring/bootstrap.php +56 -0
src/common/lib/vendor/symfony/translation/CHANGELOG.md +94 -0
src/common/lib/vendor/symfony/translation/Catalogue/AbstractOperation.php +158 -0
src/common/lib/vendor/symfony/translation/Catalogue/MergeOperation.php +55 -0
src/common/lib/vendor/symfony/translation/Catalogue/OperationInterface.php +77 -0
src/common/lib/vendor/symfony/translation/Catalogue/TargetOperation.php +69 -0
src/common/lib/vendor/symfony/translation/Command/XliffLintCommand.php +245 -0
src/common/lib/vendor/symfony/translation/DataCollector/TranslationDataCollector.php +167 -0
src/common/lib/vendor/symfony/translation/DataCollectorTranslator.php +165 -0
src/common/lib/vendor/symfony/translation/DependencyInjection/TranslationDumperPass.php +44 -0
src/common/lib/vendor/symfony/translation/DependencyInjection/TranslationExtractorPass.php +49 -0
src/common/lib/vendor/symfony/translation/DependencyInjection/TranslatorPass.php +95 -0
src/common/lib/vendor/symfony/translation/Dumper/CsvFileDumper.php +63 -0
src/common/lib/vendor/symfony/translation/Dumper/DumperInterface.php +31 -0
src/common/lib/vendor/symfony/translation/Dumper/FileDumper.php +126 -0
src/common/lib/vendor/symfony/translation/Dumper/IcuResFileDumper.php +106 -0
src/common/lib/vendor/symfony/translation/Dumper/IniFileDumper.php +45 -0
src/common/lib/vendor/symfony/translation/Dumper/JsonFileDumper.php +44 -0
src/common/lib/vendor/symfony/translation/Dumper/MoFileDumper.php +82 -0
src/common/lib/vendor/symfony/translation/Dumper/PhpFileDumper.php +38 -0
src/common/lib/vendor/symfony/translation/Dumper/PoFileDumper.php +61 -0
src/common/lib/vendor/symfony/translation/Dumper/QtFileDumper.php +50 -0
src/common/lib/vendor/symfony/translation/Dumper/XliffFileDumper.php +200 -0
src/common/lib/vendor/symfony/translation/Dumper/YamlFileDumper.php +62 -0
src/common/lib/vendor/symfony/translation/Exception/ExceptionInterface.php +21 -0
src/common/lib/vendor/symfony/translation/Exception/InvalidArgumentException.php +21 -0
src/common/lib/vendor/symfony/translation/Exception/InvalidResourceException.php +21 -0
src/common/lib/vendor/symfony/translation/Exception/LogicException.php +21 -0
src/common/lib/vendor/symfony/translation/Exception/NotFoundResourceException.php +21 -0
src/common/lib/vendor/symfony/translation/Exception/RuntimeException.php +21 -0
src/common/lib/vendor/symfony/translation/Extractor/AbstractFileExtractor.php +85 -0
src/common/lib/vendor/symfony/translation/Extractor/ChainExtractor.php +60 -0
src/common/lib/vendor/symfony/translation/Extractor/ExtractorInterface.php +38 -0
src/common/lib/vendor/symfony/translation/Extractor/PhpExtractor.php +258 -0
src/common/lib/vendor/symfony/translation/Extractor/PhpStringTokenParser.php +142 -0
src/common/lib/vendor/symfony/translation/Formatter/ChoiceMessageFormatterInterface.php +30 -0
src/common/lib/vendor/symfony/translation/Formatter/MessageFormatter.php +48 -0
src/common/lib/vendor/symfony/translation/Formatter/MessageFormatterInterface.php +30 -0
src/common/lib/vendor/symfony/translation/IdentityTranslator.php +63 -0
src/common/lib/vendor/symfony/translation/Interval.php +109 -0
src/common/lib/vendor/symfony/translation/LICENSE +19 -0
src/common/lib/vendor/symfony/translation/Loader/ArrayLoader.php +66 -0
src/common/lib/vendor/symfony/translation/Loader/CsvFileLoader.php +65 -0
src/common/lib/vendor/symfony/translation/Loader/FileLoader.php +65 -0
src/common/lib/vendor/symfony/translation/Loader/IcuDatFileLoader.php +62 -0
src/common/lib/vendor/symfony/translation/Loader/IcuResFileLoader.php +92 -0
src/common/lib/vendor/symfony/translation/Loader/IniFileLoader.php +28 -0
src/common/lib/vendor/symfony/translation/Loader/JsonFileLoader.php +64 -0
src/common/lib/vendor/symfony/translation/Loader/LoaderInterface.php +38 -0
src/common/lib/vendor/symfony/translation/Loader/MoFileLoader.php +148 -0
src/common/lib/vendor/symfony/translation/Loader/PhpFileLoader.php +28 -0
src/common/lib/vendor/symfony/translation/Loader/PoFileLoader.php +148 -0
src/common/lib/vendor/symfony/translation/Loader/QtFileLoader.php +77 -0
src/common/lib/vendor/symfony/translation/Loader/XliffFileLoader.php +342 -0
src/common/lib/vendor/symfony/translation/Loader/YamlFileLoader.php +57 -0
src/common/lib/vendor/symfony/translation/Loader/schema/dic/xliff-core/xliff-core-1.2-strict.xsd +2223 -0
src/common/lib/vendor/symfony/translation/Loader/schema/dic/xliff-core/xliff-core-2.0.xsd +411 -0
src/common/lib/vendor/symfony/translation/Loader/schema/dic/xliff-core/xml.xsd +309 -0
src/common/lib/vendor/symfony/translation/LoggingTranslator.php +136 -0
src/common/lib/vendor/symfony/translation/MessageCatalogue.php +271 -0
src/common/lib/vendor/symfony/translation/MessageCatalogueInterface.php +136 -0
src/common/lib/vendor/symfony/translation/MessageSelector.php +94 -0
src/common/lib/vendor/symfony/translation/MetadataAwareInterface.php +54 -0
src/common/lib/vendor/symfony/translation/PluralizationRules.php +208 -0
src/common/lib/vendor/symfony/translation/README.md +13 -0
src/common/lib/vendor/symfony/translation/Reader/TranslationReader.php +63 -0
src/common/lib/vendor/symfony/translation/Reader/TranslationReaderInterface.php +30 -0
src/common/lib/vendor/symfony/translation/Resources/schemas/xliff-core-1.2-strict.xsd +482 -0

icwp-plugin-controller.php CHANGED Viewed

	@@ -104,6 +104,11 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
104	*/
105	protected $oFeatureHandlerPlugin;
106





107	/**
108	* @param $sRootFile
109	* @return ICWP_WPSF_Plugin_Controller
	@@ -263,7 +268,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
263	protected function doRegisterHooks() {
264	$this->registerActivationHooks();
265
266	- add_action( 'init', array( $this, 'onWpInit' ) );
267	add_action( 'admin_init', array( $this, 'onWpAdminInit' ) );
268	add_action( 'wp_loaded', array( $this, 'onWpLoaded' ) );
269
	@@ -357,7 +362,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
357	* @return boolean
358	*/
359	public function getMeetsBasePermissions() {
360	- return $this->bMeetsBasePermissions;
361	}
362
363	/**
	@@ -981,12 +986,19 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
981	}
982
983	/**
984	- * @param bool $bCheckUserPermissions
985	* @return bool
986	*/
987	- public function ~~getIsValidAdminArea~~( ~~$bCheckUserPermissions = true~~ ) {
988	- if ( $~~bCheckUserPermissions && $~~this->~~loadWpTrack~~()
989	- ~~->getWpActionHasFired( 'init' ) && !current_user_can( $this->getBasePermissions() ) ) {~~








990	return false;
991	}
992
	@@ -1249,6 +1261,21 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
1249	return $this->getPath_Assets( 'images' . DIRECTORY_SEPARATOR . $sAsset );
1250	}
1251















1252	/**
1253	* get the root directory for the plugin with the trailing slash
1254	* @return string
	@@ -1527,6 +1554,21 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
1527	return $bSuccess;
1528	}
1529















1530	/**
1531	* @param array $aFeatureProperties
1532	* @param bool $bRecreate
	@@ -1538,13 +1580,14 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
1538
1539	$sFeatureSlug = $aFeatureProperties[ 'slug' ];
1540





1541	$sFeatureName = str_replace( ' ', '', ucwords( str_replace( '_', ' ', $sFeatureSlug ) ) );
1542	$sOptionsVarName = sprintf( 'oFeatureHandler%s', $sFeatureName ); // e.g. oFeatureHandlerPlugin
1543
1544	- if ( isset( $this->{$sOptionsVarName} ) ) {
1545	- return $this->{$sOptionsVarName};
1546	- }
1547	-
1548	$sSourceFile = $this->getPath_SourceFile(
1549	sprintf(
1550	'features/%s.php',
	@@ -1574,6 +1617,8 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
1574	$sMessage .= sprintf( 'Class "%s" %s', $sClassName, $bClassExists ? 'exists' : 'missing' );
1575	throw new Exception( $sMessage );
1576	}


1577	return $this->{$sOptionsVarName};
1578	}
1579	}


104	*/
105	protected $oFeatureHandlerPlugin;
106
107	+ /**
108	+ * @var ICWP_WPSF_FeatureHandler_Base[]
109	+ */
110	+ protected $aModules;
111	+
112	/**
113	* @param $sRootFile
114	* @return ICWP_WPSF_Plugin_Controller

268	protected function doRegisterHooks() {
269	$this->registerActivationHooks();
270
271	+ add_action( 'init', array( $this, 'onWpInit' ), 0 );
272	add_action( 'admin_init', array( $this, 'onWpAdminInit' ) );
273	add_action( 'wp_loaded', array( $this, 'onWpLoaded' ) );
274

362	* @return boolean
363	*/
364	public function getMeetsBasePermissions() {
365	+ return (bool)$this->bMeetsBasePermissions;
366	}
367
368	/**

986	}
987
988	/**

989	* @return bool
990	*/
991	+ public function getUserCanBasePerms() {
992	+ return current_user_can( $this->getBasePermissions() );
993	+ }
994	+
995	+ /**
996	+ * @param bool $bCheckUserPerms - do we check the logged-in user permissions
997	+ * @return bool
998	+ */
999	+ public function getIsValidAdminArea( $bCheckUserPerms = true ) {
1000	+ if ( $bCheckUserPerms && $this->loadWpTrack()->getWpActionHasFired( 'init' )
1001	+ && !$this->getUserCanBasePerms() ) {
1002	return false;
1003	}
1004

1261	return $this->getPath_Assets( 'images' . DIRECTORY_SEPARATOR . $sAsset );
1262	}
1263
1264	+ /**
1265	+ * @return string
1266	+ */
1267	+ public function getPath_Config() {
1268	+ return $this->getPath_Source().'config/';
1269	+ }
1270	+
1271	+ /**
1272	+ * @param string $sSlug
1273	+ * @return string
1274	+ */
1275	+ public function getPath_ConfigFile( $sSlug ) {
1276	+ return $this->getPath_Config().sprintf( 'feature-%s.php', $sSlug );
1277	+ }
1278	+
1279	/**
1280	* get the root directory for the plugin with the trailing slash
1281	* @return string

1554	return $bSuccess;
1555	}
1556
1557	+ /**
1558	+ * @param string $sSlug
1559	+ * @return ICWP_WPSF_FeatureHandler_Base\|null
1560	+ */
1561	+ public function getModule( $sSlug ) {
1562	+ if ( !is_array( $this->aModules ) ) {
1563	+ $this->aModules = array();
1564	+ }
1565	+ $oModule = isset( $this->aModules[ $sSlug ] ) ? $this->aModules[ $sSlug ] : null;
1566	+ if ( !is_null( $oModule ) && !( $oModule instanceof ICWP_WPSF_FeatureHandler_Base ) ) {
1567	+ $oModule = null;
1568	+ }
1569	+ return $oModule;
1570	+ }
1571	+
1572	/**
1573	* @param array $aFeatureProperties
1574	* @param bool $bRecreate

1580
1581	$sFeatureSlug = $aFeatureProperties[ 'slug' ];
1582
1583	+ $oHandler = $this->getModule( $sFeatureSlug );
1584	+ if ( !empty( $oHandler ) ) {
1585	+ return $oHandler;
1586	+ }
1587	+
1588	$sFeatureName = str_replace( ' ', '', ucwords( str_replace( '_', ' ', $sFeatureSlug ) ) );
1589	$sOptionsVarName = sprintf( 'oFeatureHandler%s', $sFeatureName ); // e.g. oFeatureHandlerPlugin
1590




1591	$sSourceFile = $this->getPath_SourceFile(
1592	sprintf(
1593	'features/%s.php',

1617	$sMessage .= sprintf( 'Class "%s" %s', $sClassName, $bClassExists ? 'exists' : 'missing' );
1618	throw new Exception( $sMessage );
1619	}
1620	+
1621	+ $this->aModules[ $sFeatureSlug ] = $this->{$sOptionsVarName};
1622	return $this->{$sOptionsVarName};
1623	}
1624	}

icwp-wpsf.php CHANGED Viewed

	@@ -3,7 +3,7 @@
3	* Plugin Name: Shield Security
4	* Plugin URI: http://icwp.io/2f
5	* Description: Powerful, Easy-To-Use #1 Rated WordPress Security System
6	- * Version: 5.20.1
7	* Text Domain: wp-simple-firewall
8	* Domain Path: /languages/
9	* Author: iControlWP
	@@ -135,7 +135,8 @@ class ICWP_WPSF_Shield_Security extends ICWP_Wordpress_Simple_Firewall {
135	}
136	}
137
138	- $oICWP_Wpsf ~~= null~~;

139	try {
140	$oICWP_Wpsf_Controller = ICWP_WPSF_Plugin_Controller::GetInstance( __FILE__ );
141	$oICWP_Wpsf = ICWP_WPSF_Shield_Security::GetInstance( $oICWP_Wpsf_Controller );


3	* Plugin Name: Shield Security
4	* Plugin URI: http://icwp.io/2f
5	* Description: Powerful, Easy-To-Use #1 Rated WordPress Security System
6	+ * Version: 6.0.0
7	* Text Domain: wp-simple-firewall
8	* Domain Path: /languages/
9	* Author: iControlWP

135	}
136	}
137
138	+ global $oICWP_Wpsf;
139	+
140	try {
141	$oICWP_Wpsf_Controller = ICWP_WPSF_Plugin_Controller::GetInstance( __FILE__ );
142	$oICWP_Wpsf = ICWP_WPSF_Shield_Security::GetInstance( $oICWP_Wpsf_Controller );

plugin-spec.php CHANGED Viewed

	@@ -1,6 +1,6 @@
1	{
2	"properties": {
3	- "version": "5.20.1",
4	"slug_parent": "icwp",
5	"slug_plugin": "wpsf",
6	"human_name": "Shield",


1	{
2	"properties": {
3	+ "version": "6.0.0",
4	"slug_parent": "icwp",
5	"slug_plugin": "wpsf",
6	"human_name": "Shield",

readme.txt CHANGED Viewed

	@@ -6,7 +6,7 @@ License URI: http://www.gnu.org/licenses/gpl.html
6	Tags: security, firewall, spam, scan, two-factor authentication, login, 2FA, ithemes, wordfence, better wp security, all-in-one, lockdown, hack
7	Requires at least: 3.5.0
8	Tested up to: 4.9
9	- Stable tag: 5.20.1
10
11	Protect your reputation, your customers' reputation, and your WordPress sites for free with Shield - the most powerful security system for WordPress
12
	@@ -338,16 +338,16 @@ Technical support, and some newer options and features will not be available to
338
339	You can [go Pro for just $1/month](http://icwp.io/aa). Technical support is available to premium clients only.
340
341	- = 5.20.1 Latest Point Release =
342	- Released: ~~11th~~ December, 2017
343
344	- * (v.1) ~~FIXED~~: ~~File~~ ~~include~~ ~~error~~.
345	- * (v.0) ~~IMPROVED~~: [PRO] ~~Audit~~ ~~Trail~~ ~~length~~ is ~~configurable~~. ~~Length for free is 50 entries (the original unpaginated limit~~)
346	- * (v.0) ~~IMPROVED~~: ~~Large~~ ~~redesign~~ of ~~options~~ ~~sections~~ to be ~~more~~ ~~intuitive~~ ~~and~~ ~~cleaner~~
347	- * (v.0) ~~IMPROVED~~: ~~Added~~ ~~dedicated~~ ~~help~~ ~~section~~ ~~for~~ ~~each~~ ~~module~~.
348	- * (v.0) IMPROVED: Certain modules have an new Actions centre, such a Audit Trail viewer and User Sessions manager
349	- * (v.0~~) IMPROVED: Audit Trails are now ajax-paginated~~. ~~You~~ ~~can browse through all your audit trail entries~~
350	- * (v.0) IMPROVED: ~~User~~ ~~session~~ ~~tables~~ ~~are also ajax-paginated.~~
351
352	= 5.20.0 Series =
353	Released: 11th December, 2017


6	Tags: security, firewall, spam, scan, two-factor authentication, login, 2FA, ithemes, wordfence, better wp security, all-in-one, lockdown, hack
7	Requires at least: 3.5.0
8	Tested up to: 4.9
9	+ Stable tag: 6.0.0
10
11	Protect your reputation, your customers' reputation, and your WordPress sites for free with Shield - the most powerful security system for WordPress
12

338
339	You can [go Pro for just $1/month](http://icwp.io/aa). Technical support is available to premium clients only.
340
341	+ = 6.0.0 Latest Point Release =
342	+ Released: 18th December, 2017
343
344	+ * (v.0) ADDED: All-new Shield Welcome and Setup Wizard - more helpful guided wizards to come.
345	+ * (v.0) ADDED: [PRO] [Shield options import and export](http://icwp.io/at)
346	+ * (v.0) ADDED: [PRO] In conjunction with import/export - Shield Security Network: automated options syncing.
347	+ * (v.0) CHANGED: Going forward, new features and options will [support only PHP 5.4+](http://icwp.io/au). Existing features will remain unaffected.
348	+
349	+ = 6.0.0 Series =
350	+ Released: 18th December, 2017
351
352	= 5.20.0 Series =
353	Released: 11th December, 2017

resources/css/global-plugin.css CHANGED Viewed

	@@ -8,14 +8,13 @@
8	border-right-width: 5px;
9	border-left-width: 5px;
10	}
11	-
12	#wpbody-content .icwp-admin-notice,
13	#wpbody-content .icwp-admin-notice p {
14	- text-shadow: -1px -1px 0 rgba( 255, 255, 255, 0.4 );
15	}
16	#wpbody-content .icwp-admin-notice.updated,
17	#wpbody-content .icwp-admin-notice.updated p {
18	- color: rgba( 26, 111, 0, 1 );
19	}
20	#wpbody-content .icwp-admin-notice form {
21	margin: 0;
	@@ -26,18 +25,16 @@
26	#wpbody-content .icwp-admin-notice .button:hover {
27	text-decoration: none;
28	}
29	-
30	#wpbody-content .icwp-admin-notice .notice-dismiss::before {
31	color: rgba(0, 0, 0, 0.5);
32	font-size: 24px;
33	line-height: 21px;
34	padding-right: 4px;
35	}
36	-
37	#wpbody-content .info.icwp-admin-notice,
38	#wpbody-content .promo.icwp-admin-notice {
39	- background-color: rgba(40, ~~158~~, ~~214~~, 0.25);
40	- border-color: rgba(25, ~~104~~, ~~137~~, 0.99);
41	}
42	#wpbody-content .info.icwp-admin-notice,
43	#wpbody-content .info.icwp-admin-notice p,
	@@ -45,7 +42,6 @@
45	#wpbody-content .promo.icwp-admin-notice p {
46	color: rgba(21, 77, 111, 0.99);
47	}
48	-
49	#wpbody-content .error.icwp-admin-notice {
50	border-color: rgba(240, 51, 4, 0.56);
51	background-color: rgba(255, 185, 167, 0.25);
	@@ -53,30 +49,37 @@
53	#wpbody-content .error.icwp-admin-notice h3 {
54	color: rgba(199, 41, 0, 1);
55	}
56	-










57	ul.nav-tabs li a {
58	color: rgba(69, 119, 0, 1);
59	}
60	ul.nav-tabs li.active a {
61	color: #000000;
62	}
63	-
64	.bootstrap-wpadmin .form-horizontal .form-actions {
65	- background-color: rgba(0,0,0,0.07);
66	- border: 1px solid #~~ddd~~;
67	border-top: 1px solid transparent;
68	}
69	-
70	.bootstrap-wpadmin .icwpTopLevelRow {
71	}
72	.bootstrap-wpadmin .icwpTopLevelRow .icwpTopLevelSpan {
73	margin-left: 0;
74	}
75	-
76	#icwpOptionsTopPill {
77	}
78	#icwpOptionsTopPill > .nav-pills {
79	- border-bottom: 1px dashed #~~999~~;
80	padding-bottom: 10px;
81	}
82	#icwpOptionsTopPill > .nav-pills li {
	@@ -85,7 +88,7 @@ ul.nav-tabs li.active a {
85	#icwpOptionsTopPill > .nav-pills li a {
86	background-color: rgba(0, 0, 0, 0.2);
87	text-shadow: 1px 0 0 rgba(255, 255, 255, 0.4);
88	- color: #~~666~~;
89	height: 50px;
90	}
91	#icwpOptionsTopPill > .nav-pills li a:hover {
	@@ -104,7 +107,7 @@ ul.nav-tabs li.active a {
104	#icwpOptionsTopPill > .nav-pills li.active a {
105	background-color: rgba(69, 119, 0, 1);
106	color: #ffffff;
107	- text-shadow: 1px 0 0 rgba(0,0,0,0.5);
108	}
109	#icwpOptionsTopPill > .nav-pills li a .title {
110	font-weight: bolder;
	@@ -136,7 +139,7 @@ ul.nav-tabs li.active a {
136	font-size: 14px;
137	}
138	#icwpOptionsTopPill .content-help dt {
139	- border-bottom: 1px dotted rgba(0,0,0,0.2);
140	font-size: 16px;
141	margin-bottom: 7px;
142	padding-bottom: 3px;
	@@ -145,7 +148,6 @@ ul.nav-tabs li.active a {
145	margin-bottom: 15px;
146	margin-left: 12px;
147	}
148	-
149	th.column-icwp_autoupdate, td.icwp_autoupdate, th#icwp_autoupdate {
150	text-align: center;
151	vertical-align: middle;
	@@ -156,27 +158,25 @@ td.icwp_autoupdate span.icwp-pluginautoupdateicon.dashicons-update {
156	td.icwp_autoupdate span.icwp-pluginautoupdateicon.dashicons-hammer {
157	color: #87492e;
158	}
159	-
160	body.plugins-php .wrap > ul li.vulnerable a {
161	color: darkred;
162	}
163	-
164	tr.icwp-plugin-vulnerability > td {
165	/* Permalink - use to edit and share this gradient: http://colorzilla.com/gradient-editor/#fff4f4+0,f7e3e3+100 */
166	background: #fff4f4; /* Old browsers */
167	background: -moz-linear-gradient(top, #fff4f4 0%, #f7e3e3 100%); /* FF3.6-15 */
168	- background: -webkit-linear-gradient(top, #fff4f4 0~~%,#~~f7e3e3 100%); /* Chrome10-25,Safari5.1-6 */
169	- background: linear-gradient(to bottom, #fff4f4 0~~%,#~~f7e3e3 100%); /* W3C, IE10+, FF16+, Chrome26+, Opera12+, Safari7+ */
170	- filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#fff4f4', endColorstr='#f7e3e3',GradientType=0 ); /* IE6-9 */
171
172	padding: 12px 40px;
173	- box-shadow: inset 0 -1px 0 rgba(0,0,0,.1);
174	}
175	tr.icwp-plugin-vulnerability > td table {
176	width: 100%;
177	}
178	tr.icwp-plugin-vulnerability > td table th {
179	- color: #~~444~~;
180	font-weight: bolder;
181	}
182	tr.icwp-plugin-vulnerability a {
	@@ -189,7 +189,6 @@ tr.icwp-plugin-vulnerability dl {
189	tr.icwp-plugin-vulnerability dd {
190	margin-bottom: 3px;
191	}
192	-
193	.restricted-option {
194	background-color: rgba(255, 255, 255, 0.6);
195	border: 1px solid;
	@@ -201,7 +200,6 @@ tr.icwp-plugin-vulnerability dd {
201	margin: 2px 0 4px;
202	padding: 7px 8px 5px 6px;
203	}
204	-
205	.shield-user-options-block {
206	}
207	.shield-user-options-block table {
	@@ -211,16 +209,14 @@ tr.icwp-plugin-vulnerability dd {
211	letter-spacing: 5px;
212	font-family: monospace;
213	font-size: 24px;
214	- text-shadow: 1px 1px 0 rgba(0,0,0,0.4);
215	- border: 1px solid rgba(0,0,0,0.1);
216	padding: 0 7px;
217	background-color: whitesmoke;
218	}
219	-
220	.wp-submenu-wrap a .icwp_highlighted {
221	color: yellow;
222	}
223	-
224	#icwp-wpsf-dashboard_widget {
225	}
226	#tableShieldStatisticsWidget {
	@@ -229,18 +225,16 @@ tr.icwp-plugin-vulnerability dd {
229	padding: 5px 10px;
230	width: 100%;
231	}
232	-
233	-
234	.icwp-toggle-switch {
235	position: relative;
236	display: inline-block;
237	width: 60px;
238	height: 34px;
239	}
240	-
241	/* Hide default HTML checkbox */
242	- .icwp-toggle-switch input {~~display:none;}~~
243	-

244	/* The slider */
245	.icwp-toggle-switch {
246	cursor: pointer;
	@@ -255,7 +249,6 @@ tr.icwp-plugin-vulnerability dd {
255	-webkit-transition: .4s;
256	transition: .4s;
257	}
258	-
259	.icwp-toggle-switch .slider:before {
260	position: absolute;
261	content: "";
	@@ -267,25 +260,20 @@ tr.icwp-plugin-vulnerability dd {
267	-webkit-transition: .4s;
268	transition: .4s;
269	}
270	-
271	.icwp-toggle-switch input:checked + .slider {
272	background-color: #65bd84;
273	}
274	-
275	.icwp-toggle-switch.disabled input + .slider {
276	background-color: #bd7429;
277	}
278	-
279	.icwp-toggle-switch input:focus + .slider {
280	box-shadow: 0 0 1px #65bd84;
281	}
282	-
283	.icwp-toggle-switch input:checked + .slider:before {
284	-webkit-transform: translateX(26px);
285	-ms-transform: translateX(26px);
286	transform: translateX(26px);
287	}
288	-
289	.icwp-growl-notice {
290	-webkit-transition: width 1.5s;
291	transition: width 1.5s;
	@@ -302,10 +290,10 @@ tr.icwp-plugin-vulnerability dd {
302	position: fixed;
303	bottom: 0;
304	line-height: 22px;
305	- box-shadow: 1px 2px 6px rgba(0,0,0,0.6);
306	z-index: 100000;
307	opacity: 0.94;
308	- text-shadow: 1px 1px 0 rgba(0,0,0,0.5);
309	}
310	.icwp-growl-notice.shown {
311	padding: 23px 20px;
	@@ -327,18 +315,17 @@ tr.icwp-plugin-vulnerability dd {
327	.icwp-growl-notice.success {
328	background: #008a00; /* Old browsers */
329	background: -moz-linear-gradient(45deg, #008a00 0%, #005700 91%, #004200 100%); /* FF3.6-15 */
330	- background: -webkit-linear-gradient(45deg, #008a00 0~~%,#~~005700 91~~%,#~~004200 100%); /* Chrome10-25,Safari5.1-6 */
331	- background: linear-gradient(45deg, #008a00 0~~%,#~~005700 91~~%,#~~004200 100%); /* W3C, IE10+, FF16+, Chrome26+, Opera12+, Safari7+ */
332	- filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#008a00', endColorstr='#004200',GradientType=1 ); /* IE6-9 fallback on horizontal gradient */
333	}
334	.icwp-growl-notice.failed {
335	background: #a90329; /* Old browsers */
336	background: -moz-linear-gradient(45deg, #a90329 0%, #8f0222 44%, #6d0019 100%); /* FF3.6-15 */
337	- background: -webkit-linear-gradient(45deg, #a90329 0~~%,#~~8f0222 44~~%,#~~6d0019 100%); /* Chrome10-25,Safari5.1-6 */
338	- background: linear-gradient(45deg, #a90329 0~~%,#~~8f0222 44~~%,#~~6d0019 100%); /* W3C, IE10+, FF16+, Chrome26+, Opera12+, Safari7+ */
339	- filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#a90329', endColorstr='#6d0019',GradientType=1 ); /* IE6-9 fallback on horizontal gradient */
340	}
341	-
342	#icwp-fade-wrapper {
343	display: none;
344	position: fixed;
	@@ -346,10 +333,9 @@ tr.icwp-plugin-vulnerability dd {
346	width: 100vw;
347	top: 0;
348	left: 0;
349	- background: rgba(0, 0, 0, 0.8);
350	z-index: 999999;
351	}
352	-
353	.icwp-waiting {
354	width: 200px;
355	height: 200px;
	@@ -360,8 +346,7 @@ tr.icwp-plugin-vulnerability dd {
360	background: url("https://media.giphy.com/media/sxJ1nCeUoNSfe/giphy.gif") no-repeat 0 0 transparent;
361	background-size: 40px;
362	}
363	-
364	- .icwpAjaxTableContainer .tablenav {
365	padding: 5px 8px 5px 3px;
366	}
367	.icwpAjaxTableContainer .row-fluid .tablenav-pages [class*="span"] {
	@@ -383,7 +368,6 @@ tr.icwp-plugin-vulnerability dd {
383	.icwpAjaxTableContainer .tablenav-pages a:hover {
384	text-decoration: none;
385	}
386	-
387	.icwpAjaxTableContainer table {
388	border-left: 1px solid transparent;
389	border-right: 1px solid transparent;


8	border-right-width: 5px;
9	border-left-width: 5px;
10	}

11	#wpbody-content .icwp-admin-notice,
12	#wpbody-content .icwp-admin-notice p {
13	+ text-shadow: -1px -1px 0 rgba(255, 255, 255, 0.4);
14	}
15	#wpbody-content .icwp-admin-notice.updated,
16	#wpbody-content .icwp-admin-notice.updated p {
17	+ color: rgba(26, 111, 0, 1);
18	}
19	#wpbody-content .icwp-admin-notice form {
20	margin: 0;

25	#wpbody-content .icwp-admin-notice .button:hover {
26	text-decoration: none;
27	}

28	#wpbody-content .icwp-admin-notice .notice-dismiss::before {
29	color: rgba(0, 0, 0, 0.5);
30	font-size: 24px;
31	line-height: 21px;
32	padding-right: 4px;
33	}

34	#wpbody-content .info.icwp-admin-notice,
35	#wpbody-content .promo.icwp-admin-notice {
36	+ background-color: rgba(199, 226, 239, 0.25);
37	+ border-color: rgba(108, 138, 150, 0.99);
38	}
39	#wpbody-content .info.icwp-admin-notice,
40	#wpbody-content .info.icwp-admin-notice p,

42	#wpbody-content .promo.icwp-admin-notice p {
43	color: rgba(21, 77, 111, 0.99);
44	}

45	#wpbody-content .error.icwp-admin-notice {
46	border-color: rgba(240, 51, 4, 0.56);
47	background-color: rgba(255, 185, 167, 0.25);

49	#wpbody-content .error.icwp-admin-notice h3 {
50	color: rgba(199, 41, 0, 1);
51	}
52	+ #wpbody-content .icwp-admin-notice .dismiss-p {
53	+ float: right;
54	+ position: relative;
55	+ bottom: 24px;
56	+ margin: 0;
57	+ }
58	+ #wpbody-content .icwp-admin-notice .dismiss-p,
59	+ #wpbody-content .icwp-admin-notice .dismiss-p a {
60	+ color: rgb(103, 21, 0);
61	+ text-align: right;
62	+ }
63	ul.nav-tabs li a {
64	color: rgba(69, 119, 0, 1);
65	}
66	ul.nav-tabs li.active a {
67	color: #000000;
68	}

69	.bootstrap-wpadmin .form-horizontal .form-actions {
70	+ background-color: rgba(0, 0, 0, 0.07);
71	+ border: 1px solid #dddddd;
72	border-top: 1px solid transparent;
73	}

74	.bootstrap-wpadmin .icwpTopLevelRow {
75	}
76	.bootstrap-wpadmin .icwpTopLevelRow .icwpTopLevelSpan {
77	margin-left: 0;
78	}

79	#icwpOptionsTopPill {
80	}
81	#icwpOptionsTopPill > .nav-pills {
82	+ border-bottom: 1px dashed #999999;
83	padding-bottom: 10px;
84	}
85	#icwpOptionsTopPill > .nav-pills li {

88	#icwpOptionsTopPill > .nav-pills li a {
89	background-color: rgba(0, 0, 0, 0.2);
90	text-shadow: 1px 0 0 rgba(255, 255, 255, 0.4);
91	+ color: #666666;
92	height: 50px;
93	}
94	#icwpOptionsTopPill > .nav-pills li a:hover {

107	#icwpOptionsTopPill > .nav-pills li.active a {
108	background-color: rgba(69, 119, 0, 1);
109	color: #ffffff;
110	+ text-shadow: 1px 0 0 rgba(0, 0, 0, 0.5);
111	}
112	#icwpOptionsTopPill > .nav-pills li a .title {
113	font-weight: bolder;

139	font-size: 14px;
140	}
141	#icwpOptionsTopPill .content-help dt {
142	+ border-bottom: 1px dotted rgba(0, 0, 0, 0.2);
143	font-size: 16px;
144	margin-bottom: 7px;
145	padding-bottom: 3px;

148	margin-bottom: 15px;
149	margin-left: 12px;
150	}

151	th.column-icwp_autoupdate, td.icwp_autoupdate, th#icwp_autoupdate {
152	text-align: center;
153	vertical-align: middle;

158	td.icwp_autoupdate span.icwp-pluginautoupdateicon.dashicons-hammer {
159	color: #87492e;
160	}

161	body.plugins-php .wrap > ul li.vulnerable a {
162	color: darkred;
163	}

164	tr.icwp-plugin-vulnerability > td {
165	/* Permalink - use to edit and share this gradient: http://colorzilla.com/gradient-editor/#fff4f4+0,f7e3e3+100 */
166	background: #fff4f4; /* Old browsers */
167	background: -moz-linear-gradient(top, #fff4f4 0%, #f7e3e3 100%); /* FF3.6-15 */
168	+ background: -webkit-linear-gradient(top, #fff4f4 0%, #f7e3e3 100%); /* Chrome10-25,Safari5.1-6 */
169	+ background: linear-gradient(to bottom, #fff4f4 0%, #f7e3e3 100%); /* W3C, IE10+, FF16+, Chrome26+, Opera12+, Safari7+ */
170	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff4f4', endColorstr='#f7e3e3', GradientType=0); /* IE6-9 */
171
172	padding: 12px 40px;
173	+ box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .1);
174	}
175	tr.icwp-plugin-vulnerability > td table {
176	width: 100%;
177	}
178	tr.icwp-plugin-vulnerability > td table th {
179	+ color: #444444;
180	font-weight: bolder;
181	}
182	tr.icwp-plugin-vulnerability a {

189	tr.icwp-plugin-vulnerability dd {
190	margin-bottom: 3px;
191	}

192	.restricted-option {
193	background-color: rgba(255, 255, 255, 0.6);
194	border: 1px solid;

200	margin: 2px 0 4px;
201	padding: 7px 8px 5px 6px;
202	}

203	.shield-user-options-block {
204	}
205	.shield-user-options-block table {

209	letter-spacing: 5px;
210	font-family: monospace;
211	font-size: 24px;
212	+ text-shadow: 1px 1px 0 rgba(0, 0, 0, 0.4);
213	+ border: 1px solid rgba(0, 0, 0, 0.1);
214	padding: 0 7px;
215	background-color: whitesmoke;
216	}

217	.wp-submenu-wrap a .icwp_highlighted {
218	color: yellow;
219	}

220	#icwp-wpsf-dashboard_widget {
221	}
222	#tableShieldStatisticsWidget {

225	padding: 5px 10px;
226	width: 100%;
227	}


228	.icwp-toggle-switch {
229	position: relative;
230	display: inline-block;
231	width: 60px;
232	height: 34px;
233	}

234	/* Hide default HTML checkbox */
235	+ .icwp-toggle-switch input {
236	+ display: none;
237	+ }
238	/* The slider */
239	.icwp-toggle-switch {
240	cursor: pointer;

249	-webkit-transition: .4s;
250	transition: .4s;
251	}

252	.icwp-toggle-switch .slider:before {
253	position: absolute;
254	content: "";

260	-webkit-transition: .4s;
261	transition: .4s;
262	}

263	.icwp-toggle-switch input:checked + .slider {
264	background-color: #65bd84;
265	}

266	.icwp-toggle-switch.disabled input + .slider {
267	background-color: #bd7429;
268	}

269	.icwp-toggle-switch input:focus + .slider {
270	box-shadow: 0 0 1px #65bd84;
271	}

272	.icwp-toggle-switch input:checked + .slider:before {
273	-webkit-transform: translateX(26px);
274	-ms-transform: translateX(26px);
275	transform: translateX(26px);
276	}

277	.icwp-growl-notice {
278	-webkit-transition: width 1.5s;
279	transition: width 1.5s;

290	position: fixed;
291	bottom: 0;
292	line-height: 22px;
293	+ box-shadow: 1px 2px 6px rgba(0, 0, 0, 0.6);
294	z-index: 100000;
295	opacity: 0.94;
296	+ text-shadow: 1px 1px 0 rgba(0, 0, 0, 0.5);
297	}
298	.icwp-growl-notice.shown {
299	padding: 23px 20px;

315	.icwp-growl-notice.success {
316	background: #008a00; /* Old browsers */
317	background: -moz-linear-gradient(45deg, #008a00 0%, #005700 91%, #004200 100%); /* FF3.6-15 */
318	+ background: -webkit-linear-gradient(45deg, #008a00 0%, #005700 91%, #004200 100%); /* Chrome10-25,Safari5.1-6 */
319	+ background: linear-gradient(45deg, #008a00 0%, #005700 91%, #004200 100%); /* W3C, IE10+, FF16+, Chrome26+, Opera12+, Safari7+ */
320	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#008a00', endColorstr='#004200', GradientType=1); /* IE6-9 fallback on horizontal gradient */
321	}
322	.icwp-growl-notice.failed {
323	background: #a90329; /* Old browsers */
324	background: -moz-linear-gradient(45deg, #a90329 0%, #8f0222 44%, #6d0019 100%); /* FF3.6-15 */
325	+ background: -webkit-linear-gradient(45deg, #a90329 0%, #8f0222 44%, #6d0019 100%); /* Chrome10-25,Safari5.1-6 */
326	+ background: linear-gradient(45deg, #a90329 0%, #8f0222 44%, #6d0019 100%); /* W3C, IE10+, FF16+, Chrome26+, Opera12+, Safari7+ */
327	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#a90329', endColorstr='#6d0019', GradientType=1); /* IE6-9 fallback on horizontal gradient */
328	}

329	#icwp-fade-wrapper {
330	display: none;
331	position: fixed;

333	width: 100vw;
334	top: 0;
335	left: 0;
336	+ background: rgba(0, 0, 0, 0.25);
337	z-index: 999999;
338	}

339	.icwp-waiting {
340	width: 200px;
341	height: 200px;

346	background: url("https://media.giphy.com/media/sxJ1nCeUoNSfe/giphy.gif") no-repeat 0 0 transparent;
347	background-size: 40px;
348	}
349	+ .icwpAjaxTableContainer .tablenav {

350	padding: 5px 8px 5px 3px;
351	}
352	.icwpAjaxTableContainer .row-fluid .tablenav-pages [class*="span"] {

368	.icwpAjaxTableContainer .tablenav-pages a:hover {
369	text-decoration: none;
370	}

371	.icwpAjaxTableContainer table {
372	border-left: 1px solid transparent;
373	border-right: 1px solid transparent;

resources/css/jquery.fancybox.min.css ADDED Viewed

	@@ -0,0 +1 @@

+ @charset "UTF-8";body.fancybox-active{overflow:hidden}body.fancybox-iosfix{position:fixed;left:0;right:0}.fancybox-is-hidden{position:absolute;top:-9999px;left:-9999px;visibility:hidden}.fancybox-container{position:fixed;top:0;left:0;width:100%;height:100%;z-index:99992;-webkit-tap-highlight-color:transparent;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform:translateZ(0);transform:translateZ(0);font-family:-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,sans-serif}.fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-stage{position:absolute;top:0;right:0;bottom:0;left:0}.fancybox-outer{overflow-y:auto;-webkit-overflow-scrolling:touch}.fancybox-bg{background:#1e1e1e;opacity:0;transition-duration:inherit;transition-property:opacity;transition-timing-function:cubic-bezier(.47,0,.74,.71)}.fancybox-is-open .fancybox-bg{opacity:.87;transition-timing-function:cubic-bezier(.22,.61,.36,1)}.fancybox-caption-wrap,.fancybox-infobar,.fancybox-toolbar{position:absolute;direction:ltr;z-index:99997;opacity:0;visibility:hidden;transition:opacity .25s,visibility 0s linear .25s;box-sizing:border-box}.fancybox-show-caption .fancybox-caption-wrap,.fancybox-show-infobar .fancybox-infobar,.fancybox-show-toolbar .fancybox-toolbar{opacity:1;visibility:visible;transition:opacity .25s,visibility 0s}.fancybox-infobar{top:0;left:0;font-size:13px;padding:0 10px;height:44px;min-width:44px;line-height:44px;color:#ccc;text-align:center;pointer-events:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-touch-callout:none;-webkit-tap-highlight-color:transparent;-webkit-font-smoothing:subpixel-antialiased;mix-blend-mode:exclusion}.fancybox-toolbar{top:0;right:0;margin:0;padding:0}.fancybox-stage{overflow:hidden;direction:ltr;z-index:99994;-webkit-transform:translateZ(0)}.fancybox-is-closing .fancybox-stage{overflow:visible}.fancybox-slide{position:absolute;top:0;left:0;width:100%;height:100%;margin:0;padding:0;overflow:auto;outline:none;white-space:normal;box-sizing:border-box;text-align:center;z-index:99994;-webkit-overflow-scrolling:touch;display:none;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition-property:opacity,-webkit-transform;transition-property:transform,opacity;transition-property:transform,opacity,-webkit-transform}.fancybox-slide:before{content:"";display:inline-block;vertical-align:middle;height:100%;width:0}.fancybox-is-sliding .fancybox-slide,.fancybox-slide--current,.fancybox-slide--next,.fancybox-slide--previous{display:block}.fancybox-slide--image{overflow:visible}.fancybox-slide--image:before{display:none}.fancybox-slide--video .fancybox-content,.fancybox-slide--video iframe{background:#000}.fancybox-slide--map .fancybox-content,.fancybox-slide--map iframe{background:#e5e3df}.fancybox-slide--next{z-index:99995}.fancybox-slide>*{display:inline-block;position:relative;padding:24px;margin:44px 0;border-width:0;vertical-align:middle;text-align:left;background-color:#fff;overflow:auto;box-sizing:border-box}.fancybox-slide>base,.fancybox-slide>link,.fancybox-slide>meta,.fancybox-slide>script,.fancybox-slide>style,.fancybox-slide>title{display:none}.fancybox-slide .fancybox-image-wrap{position:absolute;top:0;left:0;margin:0;padding:0;border:0;z-index:99995;background:transparent;cursor:default;overflow:visible;-webkit-transform-origin:top left;transform-origin:top left;background-size:100% 100%;background-repeat:no-repeat;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;transition-property:opacity,-webkit-transform;transition-property:transform,opacity;transition-property:transform,opacity,-webkit-transform}.fancybox-can-zoomOut .fancybox-image-wrap{cursor:zoom-out}.fancybox-can-zoomIn .fancybox-image-wrap{cursor:zoom-in}.fancybox-can-drag .fancybox-image-wrap{cursor:-webkit-grab;cursor:grab}.fancybox-is-dragging .fancybox-image-wrap{cursor:-webkit-grabbing;cursor:grabbing}.fancybox-image,.fancybox-spaceball{position:absolute;top:0;left:0;width:100%;height:100%;margin:0;padding:0;border:0;max-width:none;max-height:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-spaceball{z-index:1}.fancybox-slide--iframe .fancybox-content{padding:0;width:80%;height:80%;max-width:calc(100% - 100px);max-height:calc(100% - 88px);overflow:visible;background:#fff}.fancybox-iframe{display:block;padding:0;border:0;height:100%}.fancybox-error,.fancybox-iframe{margin:0;width:100%;background:#fff}.fancybox-error{padding:40px;max-width:380px;cursor:default}.fancybox-error p{margin:0;padding:0;color:#444;font-size:16px;line-height:20px}.fancybox-button{box-sizing:border-box;display:inline-block;vertical-align:top;width:44px;height:44px;margin:0;padding:10px;border:0;border-radius:0;background:rgba(30,30,30,.6);transition:color .3s ease;cursor:pointer;outline:none}.fancybox-button,.fancybox-button:link,.fancybox-button:visited{color:#ccc}.fancybox-button:focus,.fancybox-button:hover{color:#fff}.fancybox-button[disabled]{color:#ccc;cursor:default;opacity:.6}.fancybox-button svg{display:block;position:relative;overflow:visible;shape-rendering:geometricPrecision}.fancybox-button svg path{fill:currentColor;stroke:currentColor;stroke-linejoin:round;stroke-width:3}.fancybox-button--share svg path{stroke-width:1}.fancybox-button--pause svg path:nth-child(1),.fancybox-button--play svg path:nth-child(2){display:none}.fancybox-button--zoom svg path{fill:transparent}.fancybox-navigation{display:none}.fancybox-show-nav .fancybox-navigation{display:block}.fancybox-navigation button{position:absolute;top:50%;margin:-50px 0 0;z-index:99997;background:transparent;width:60px;height:100px;padding:17px}.fancybox-navigation button:before{content:"";position:absolute;top:30px;right:10px;width:40px;height:40px;background:rgba(30,30,30,.6)}.fancybox-navigation .fancybox-button--arrow_left{left:0}.fancybox-navigation .fancybox-button--arrow_right{right:0}.fancybox-close-small{position:absolute;top:0;right:0;width:40px;height:40px;padding:0;margin:0;border:0;border-radius:0;background:transparent;z-index:10;cursor:pointer}.fancybox-close-small:after{content:"×";position:absolute;top:5px;right:5px;width:30px;height:30px;font:22px/30px Arial,Helvetica Neue,Helvetica,sans-serif;color:#888;font-weight:300;text-align:center;border-radius:50%;border-width:0;background-color:transparent;transition:background-color .25s;box-sizing:border-box;z-index:2}.fancybox-close-small:focus{outline:none}.fancybox-close-small:focus:after{outline:1px dotted #888}.fancybox-close-small:hover:after{color:#555;background:#eee}.fancybox-slide--iframe .fancybox-close-small,.fancybox-slide--image .fancybox-close-small{top:0;right:-40px}.fancybox-slide--iframe .fancybox-close-small:after,.fancybox-slide--image .fancybox-close-small:after{font-size:35px;color:#aaa}.fancybox-slide--iframe .fancybox-close-small:hover:after,.fancybox-slide--image .fancybox-close-small:hover:after{color:#fff;background:transparent}.fancybox-is-scaling .fancybox-close-small,.fancybox-is-zoomable.fancybox-can-drag .fancybox-close-small{display:none}.fancybox-caption-wrap{bottom:0;left:0;right:0;padding:60px 2vw 0;background:linear-gradient(180deg,transparent 0,rgba(0,0,0,.1) 20%,rgba(0,0,0,.2) 40%,rgba(0,0,0,.6) 80%,rgba(0,0,0,.8));pointer-events:none}.fancybox-caption{padding:30px 0;border-top:1px solid hsla(0,0%,100%,.4);font-size:14px;color:#fff;line-height:20px;-webkit-text-size-adjust:none}.fancybox-caption a,.fancybox-caption button,.fancybox-caption select{pointer-events:all;position:relative}.fancybox-caption a{color:#fff;text-decoration:underline}.fancybox-slide>.fancybox-loading{border:6px solid hsla(0,0%,39%,.4);border-top:6px solid hsla(0,0%,100%,.6);border-radius:100%;height:50px;width:50px;-webkit-animation:a .8s infinite linear;animation:a .8s infinite linear;background:transparent;position:absolute;top:50%;left:50%;margin-top:-30px;margin-left:-30px;z-index:99999}@-webkit-keyframes a{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@keyframes a{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}.fancybox-animated{transition-timing-function:cubic-bezier(0,0,.25,1)}.fancybox-fx-slide.fancybox-slide--previous{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0);opacity:0}.fancybox-fx-slide.fancybox-slide--next{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0);opacity:0}.fancybox-fx-slide.fancybox-slide--current{-webkit-transform:translateZ(0);transform:translateZ(0);opacity:1}.fancybox-fx-fade.fancybox-slide--next,.fancybox-fx-fade.fancybox-slide--previous{opacity:0;transition-timing-function:cubic-bezier(.19,1,.22,1)}.fancybox-fx-fade.fancybox-slide--current{opacity:1}.fancybox-fx-zoom-in-out.fancybox-slide--previous{-webkit-transform:scale3d(1.5,1.5,1.5);transform:scale3d(1.5,1.5,1.5);opacity:0}.fancybox-fx-zoom-in-out.fancybox-slide--next{-webkit-transform:scale3d(.5,.5,.5);transform:scale3d(.5,.5,.5);opacity:0}.fancybox-fx-zoom-in-out.fancybox-slide--current{-webkit-transform:scaleX(1);transform:scaleX(1);opacity:1}.fancybox-fx-rotate.fancybox-slide--previous{-webkit-transform:rotate(-1turn);transform:rotate(-1turn);opacity:0}.fancybox-fx-rotate.fancybox-slide--next{-webkit-transform:rotate(1turn);transform:rotate(1turn);opacity:0}.fancybox-fx-rotate.fancybox-slide--current{-webkit-transform:rotate(0deg);transform:rotate(0deg);opacity:1}.fancybox-fx-circular.fancybox-slide--previous{-webkit-transform:scale3d(0,0,0) translate3d(-100%,0,0);transform:scale3d(0,0,0) translate3d(-100%,0,0);opacity:0}.fancybox-fx-circular.fancybox-slide--next{-webkit-transform:scale3d(0,0,0) translate3d(100%,0,0);transform:scale3d(0,0,0) translate3d(100%,0,0);opacity:0}.fancybox-fx-circular.fancybox-slide--current{-webkit-transform:scaleX(1) translateZ(0);transform:scaleX(1) translateZ(0);opacity:1}.fancybox-fx-tube.fancybox-slide--previous{-webkit-transform:translate3d(-100%,0,0) scale(.1) skew(-10deg);transform:translate3d(-100%,0,0) scale(.1) skew(-10deg)}.fancybox-fx-tube.fancybox-slide--next{-webkit-transform:translate3d(100%,0,0) scale(.1) skew(10deg);transform:translate3d(100%,0,0) scale(.1) skew(10deg)}.fancybox-fx-tube.fancybox-slide--current{-webkit-transform:translateZ(0) scale(1);transform:translateZ(0) scale(1)}.fancybox-share{padding:30px;border-radius:3px;background:#f4f4f4;max-width:90%;text-align:center}.fancybox-share h1{color:#222;margin:0 0 20px;font-size:35px;font-weight:700}.fancybox-share p{margin:0;padding:0}p.fancybox-share__links{margin-right:-10px}.fancybox-share__button{display:inline-block;text-decoration:none;margin:0 10px 10px 0;padding:0 15px;min-width:130px;border:0;border-radius:3px;background:#fff;white-space:nowrap;font-size:14px;font-weight:700;line-height:40px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;color:#fff;transition:all .2s}.fancybox-share__button:hover{text-decoration:none}.fancybox-share__button--fb{background:#3b5998}.fancybox-share__button--fb:hover{background:#344e86}.fancybox-share__button--pt{background:#bd081d}.fancybox-share__button--pt:hover{background:#aa0719}.fancybox-share__button--tw{background:#1da1f2}.fancybox-share__button--tw:hover{background:#0d95e8}.fancybox-share__button svg{position:relative;top:-1px;width:25px;height:25px;margin-right:7px;vertical-align:middle}.fancybox-share__button svg path{fill:#fff}.fancybox-share__input{box-sizing:border-box;width:100%;margin:10px 0 0;padding:10px 15px;background:transparent;color:#5d5b5b;font-size:14px;outline:none;border:0;border-bottom:2px solid #d7d7d7}.fancybox-thumbs{display:none;position:absolute;top:0;bottom:0;right:0;width:212px;margin:0;padding:2px 2px 4px;background:#fff;-webkit-tap-highlight-color:transparent;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar;box-sizing:border-box;z-index:99995}.fancybox-thumbs-x{overflow-y:hidden;overflow-x:auto}.fancybox-show-thumbs .fancybox-thumbs{display:block}.fancybox-show-thumbs .fancybox-inner{right:212px}.fancybox-thumbs>ul{list-style:none;position:absolute;position:relative;width:100%;height:100%;margin:0;padding:0;overflow-x:hidden;overflow-y:auto;font-size:0;white-space:nowrap}.fancybox-thumbs-x>ul{overflow:hidden}.fancybox-thumbs-y>ul::-webkit-scrollbar{width:7px}.fancybox-thumbs-y>ul::-webkit-scrollbar-track{background:#fff;border-radius:10px;box-shadow:inset 0 0 6px rgba(0,0,0,.3)}.fancybox-thumbs-y>ul::-webkit-scrollbar-thumb{background:#2a2a2a;border-radius:10px}.fancybox-thumbs>ul>li{float:left;overflow:hidden;padding:0;margin:2px;width:100px;height:75px;max-width:calc(50% - 4px);max-height:calc(100% - 8px);position:relative;cursor:pointer;outline:none;-webkit-tap-highlight-color:transparent;-webkit-backface-visibility:hidden;backface-visibility:hidden;box-sizing:border-box}li.fancybox-thumbs-loading{background:rgba(0,0,0,.1)}.fancybox-thumbs>ul>li>img{position:absolute;top:0;left:0;max-width:none;max-height:none;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-thumbs>ul>li:before{content:"";position:absolute;top:0;right:0;bottom:0;left:0;border:4px solid #4ea7f9;z-index:99991;opacity:0;transition:all .2s cubic-bezier(.25,.46,.45,.94)}.fancybox-thumbs>ul>li.fancybox-thumbs-active:before{opacity:1}@media (max-width:800px){.fancybox-thumbs{width:110px}.fancybox-show-thumbs .fancybox-inner{right:110px}.fancybox-thumbs>ul>li{max-width:calc(100% - 10px)}}

resources/css/jquery.steps.css ADDED Viewed

	@@ -0,0 +1,383 @@


1	+ /*
2	+ Common
3	+ */
4	+
5	+ .wizard,
6	+ .tabcontrol
7	+ {
8	+ display: block;
9	+ width: 100%;
10	+ overflow: hidden;
11	+ }
12	+
13	+ .wizard a,
14	+ .tabcontrol a
15	+ {
16	+ outline: 0;
17	+ }
18	+
19	+ .wizard ul,
20	+ .tabcontrol ul
21	+ {
22	+ list-style: none;
23	+ padding: 0;
24	+ margin: 0;
25	+ }
26	+
27	+ .wizard ul > li,
28	+ .tabcontrol ul > li
29	+ {
30	+ display: block;
31	+ padding: 0;
32	+ }
33	+
34	+ /* Accessibility */
35	+ .wizard > .steps .current-info,
36	+ .tabcontrol > .steps .current-info
37	+ {
38	+ position: absolute;
39	+ left: -999em;
40	+ }
41	+
42	+ .wizard > .content > .title,
43	+ .tabcontrol > .content > .title
44	+ {
45	+ position: absolute;
46	+ left: -999em;
47	+ }
48	+
49	+
50	+
51	+ /*
52	+ Wizard
53	+ */
54	+
55	+ .wizard > .steps
56	+ {
57	+ position: relative;
58	+ display: block;
59	+ width: 100%;
60	+ }
61	+
62	+ .wizard.vertical > .steps
63	+ {
64	+ display: inline;
65	+ float: left;
66	+ width: 30%;
67	+ }
68	+
69	+ .wizard > .steps .number
70	+ {
71	+ font-size: 1.429em;
72	+ }
73	+
74	+ .wizard > .steps > ul > li
75	+ {
76	+ width: 25%;
77	+ }
78	+
79	+ .wizard > .steps > ul > li,
80	+ .wizard > .actions > ul > li
81	+ {
82	+ float: left;
83	+ }
84	+
85	+ .wizard.vertical > .steps > ul > li
86	+ {
87	+ float: none;
88	+ width: 100%;
89	+ }
90	+
91	+ .wizard > .steps a,
92	+ .wizard > .steps a:hover,
93	+ .wizard > .steps a:active
94	+ {
95	+ display: block;
96	+ width: auto;
97	+ margin: 0 0.5em 0.5em;
98	+ padding: 1em 1em;
99	+ text-decoration: none;
100	+
101	+ -webkit-border-radius: 5px;
102	+ -moz-border-radius: 5px;
103	+ border-radius: 5px;
104	+ }
105	+
106	+ .wizard > .steps .disabled a,
107	+ .wizard > .steps .disabled a:hover,
108	+ .wizard > .steps .disabled a:active
109	+ {
110	+ background: #eee;
111	+ color: #aaa;
112	+ cursor: default;
113	+ }
114	+
115	+ .wizard > .steps .current a,
116	+ .wizard > .steps .current a:hover,
117	+ .wizard > .steps .current a:active
118	+ {
119	+ background: rgba(69, 119, 0, 1);
120	+ color: #fff;
121	+ cursor: default;
122	+ }
123	+
124	+ .wizard > .steps .done a,
125	+ .wizard > .steps .done a:hover,
126	+ .wizard > .steps .done a:active
127	+ {
128	+ background: rgba(69, 119, 0, 0.5);
129	+ color: #fff;
130	+ }
131	+
132	+ .wizard > .steps .error a,
133	+ .wizard > .steps .error a:hover,
134	+ .wizard > .steps .error a:active
135	+ {
136	+ background: #ff3111;
137	+ color: #fff;
138	+ }
139	+
140	+ .wizard > .content
141	+ {
142	+ background: transparent;
143	+ display: block;
144	+ margin: 0.5em;
145	+ min-height: 35em;
146	+ overflow: hidden;
147	+ position: relative;
148	+ width: auto;
149	+
150	+ -webkit-border-radius: 5px;
151	+ -moz-border-radius: 5px;
152	+ border-radius: 5px;
153	+ border: 1px solid transparent;
154	+ }
155	+
156	+ .wizard.vertical > .content
157	+ {
158	+ display: inline;
159	+ float: left;
160	+ margin: 0 2.5% 0.5em 2.5%;
161	+ width: 65%;
162	+ }
163	+
164	+ .wizard > .content > .body
165	+ {
166	+ float: left;
167	+ position: absolute;
168	+ width: 95%;
169	+ height: 95%;
170	+ padding: 2.5%;
171	+ }
172	+
173	+ .wizard > .content > .body ul
174	+ {
175	+ list-style: disc ;
176	+ }
177	+
178	+ .wizard > .content > .body ul > li
179	+ {
180	+ display: list-item;
181	+ }
182	+
183	+ .wizard > .content > .body > iframe
184	+ {
185	+ border: 0 none;
186	+ width: 100%;
187	+ height: 100%;
188	+ }
189	+
190	+ .wizard > .content > .body input
191	+ {
192	+ /display: block;/
193	+ /border: 1px solid #ccc;/
194	+ }
195	+
196	+ .wizard > .content > .body input[type="checkbox"]
197	+ {
198	+ display: inline-block;
199	+ }
200	+
201	+ .wizard > .content > .body input.error
202	+ {
203	+ background: rgb(251, 227, 228);
204	+ border: 1px solid #fbc2c4;
205	+ color: #8a1f11;
206	+ }
207	+
208	+ .wizard > .content > .body label
209	+ {
210	+ /display: inline-block;/
211	+ /margin-bottom: 0.5em;/
212	+ }
213	+
214	+ .wizard > .content > .body label.error
215	+ {
216	+ color: #8a1f11;
217	+ display: inline-block;
218	+ margin-left: 1.5em;
219	+ }
220	+
221	+ .wizard > .actions
222	+ {
223	+ position: relative;
224	+ display: block;
225	+ text-align: right;
226	+ width: 100%;
227	+ }
228	+
229	+ .wizard.vertical > .actions
230	+ {
231	+ display: inline;
232	+ float: right;
233	+ margin: 0 2.5%;
234	+ width: 95%;
235	+ }
236	+
237	+ .wizard > .actions > ul
238	+ {
239	+ display: inline-block;
240	+ text-align: right;
241	+ }
242	+
243	+ .wizard > .actions > ul > li
244	+ {
245	+ margin: 0 0.5em;
246	+ }
247	+
248	+ .wizard.vertical > .actions > ul > li
249	+ {
250	+ margin: 0 0 0 1em;
251	+ }
252	+
253	+ .wizard > .actions a,
254	+ .wizard > .actions a:hover,
255	+ .wizard > .actions a:active
256	+ {
257	+ background: rgba(69, 119, 0, 1);
258	+ color: #fff;
259	+ display: block;
260	+ padding: 0.5em 1em;
261	+ text-decoration: none;
262	+
263	+ -webkit-border-radius: 5px;
264	+ -moz-border-radius: 5px;
265	+ border-radius: 5px;
266	+ }
267	+
268	+ .wizard > .actions .disabled a,
269	+ .wizard > .actions .disabled a:hover,
270	+ .wizard > .actions .disabled a:active
271	+ {
272	+ background: #eee;
273	+ color: #aaa;
274	+ }
275	+
276	+ .wizard > .loading
277	+ {
278	+ }
279	+
280	+ .wizard > .loading .spinner
281	+ {
282	+ }
283	+
284	+
285	+
286	+ /*
287	+ Tabcontrol
288	+ */
289	+
290	+ .tabcontrol > .steps
291	+ {
292	+ position: relative;
293	+ display: block;
294	+ width: 100%;
295	+ }
296	+
297	+ .tabcontrol > .steps > ul
298	+ {
299	+ position: relative;
300	+ margin: 6px 0 0 0;
301	+ top: 1px;
302	+ z-index: 1;
303	+ }
304	+
305	+ .tabcontrol > .steps > ul > li
306	+ {
307	+ float: left;
308	+ margin: 5px 2px 0 0;
309	+ padding: 1px;
310	+
311	+ -webkit-border-top-left-radius: 5px;
312	+ -webkit-border-top-right-radius: 5px;
313	+ -moz-border-radius-topleft: 5px;
314	+ -moz-border-radius-topright: 5px;
315	+ border-top-left-radius: 5px;
316	+ border-top-right-radius: 5px;
317	+ }
318	+
319	+ .tabcontrol > .steps > ul > li:hover
320	+ {
321	+ background: #edecec;
322	+ border: 1px solid #bbb;
323	+ padding: 0;
324	+ }
325	+
326	+ .tabcontrol > .steps > ul > li.current
327	+ {
328	+ background: #fff;
329	+ border: 1px solid #bbb;
330	+ border-bottom: 0 none;
331	+ padding: 0 0 1px 0;
332	+ margin-top: 0;
333	+ }
334	+
335	+ .tabcontrol > .steps > ul > li > a
336	+ {
337	+ color: #5f5f5f;
338	+ display: inline-block;
339	+ border: 0 none;
340	+ margin: 0;
341	+ padding: 10px 30px;
342	+ text-decoration: none;
343	+ }
344	+
345	+ .tabcontrol > .steps > ul > li > a:hover
346	+ {
347	+ text-decoration: none;
348	+ }
349	+
350	+ .tabcontrol > .steps > ul > li.current > a
351	+ {
352	+ padding: 15px 30px 10px 30px;
353	+ }
354	+
355	+ .tabcontrol > .content
356	+ {
357	+ position: relative;
358	+ display: inline-block;
359	+ width: 100%;
360	+ height: 35em;
361	+ overflow: hidden;
362	+ border-top: 1px solid #bbb;
363	+ padding-top: 20px;
364	+ }
365	+
366	+ .tabcontrol > .content > .body
367	+ {
368	+ float: left;
369	+ position: absolute;
370	+ width: 95%;
371	+ height: 95%;
372	+ padding: 2.5%;
373	+ }
374	+
375	+ .tabcontrol > .content > .body ul
376	+ {
377	+ list-style: disc !important;
378	+ }
379	+
380	+ .tabcontrol > .content > .body ul > li
381	+ {
382	+ display: list-item;
383	+ }

resources/css/pages.css ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ body {
2	+ background: #fafafa;
3	+ color: #555;
4	+ }
5	+
6	+ #ShieldLogo {
7	+ padding: 40px;
8	+ }
9	+
10	+ .wizard > .content {
11	+ background: #ffffff;
12	+ box-shadow: 1px 1px 4px rgba(0, 0, 0, 0.2);
13	+ }

resources/css/plugin.css CHANGED Viewed

	@@ -7,6 +7,9 @@
7	.bootstrap-wpadmin .row {
8	margin-left: 0;
9	}



10	#pluginlogo_32 {
11	background: url("../images/pluginlogo_32x32.png?ver=1.0.0") no-repeat 0 3px transparent;
12	}
	@@ -96,7 +99,7 @@ table.table-audit_trail .cell-ip {
96	.bootstrap-wpadmin .page-header {
97	padding-bottom: 17px;
98	margin: 18px 0 0;
99	- border-bottom: 1px solid ~~#EEE~~;
100	}
101	/* Form elements */
102	.bootstrap-wpadmin form fieldset {
	@@ -330,15 +333,15 @@ label input[type=checkbox] {
330
331	/ FEature summaries /
332	.bootstrap-wpadmin .feature-summary-blocks {
333	- border: 1px solid transparent;
334	- border-left: 1px solid #ddd;
335	text-align: center;
336	- width: 80%;


337	}
338	.feature-summary-blocks .feature-icon:before {
339	-webkit-font-smoothing: antialiased;
340	display: inline-block;
341	- font: ~~48px~~/1 'dashicons';
342	vertical-align: top;
343	}
344	.feature-summary-blocks a {
	@@ -346,12 +349,6 @@ label input[type=checkbox] {
346	text-shadow: 1px 0 0 rgba(0, 0, 0, 0.4);
347	width: 100%;
348	}
349	- .feature-summary-blocks .feature-icon:before {
350	- -webkit-font-smoothing: antialiased;
351	- display: inline-block;
352	- font: 48px/1 'dashicons';
353	- vertical-align: top;
354	- }
355
356	.feature-summary-blocks .summary-state {
357	border: 1px solid transparent;
	@@ -359,7 +356,27 @@ label input[type=checkbox] {
359	text-align: center;
360	margin-bottom: -1px;
361	}
362	- ~~.feature-summary-blocks .summary-state.active-feature,~~




















363	.feature-summary-blocks .summary-state:hover {
364	border: 1px solid rgba(0, 0, 0, 0.1);
365	border-left: 1px solid transparent;
	@@ -383,7 +400,7 @@ label input[type=checkbox] {
383	font-size: 8px;
384	}
385	.feature-summary-blocks .feature-icon:before {
386	- font-size: ~~32px~~;
387	}
388	}
389	.feature-summary-blocks .state-on a {
	@@ -459,4 +476,4 @@ input[type="email"] {
459	}
460	.bootstrap-wpadmin .row .shield-free-block p {
461	margin-bottom: 18px;
462	- }


7	.bootstrap-wpadmin .row {
8	margin-left: 0;
9	}
10	+ .bootstrap-wpadmin > .row > div[class*=span]:first-child {
11	+ margin-left: 0;
12	+ }
13	#pluginlogo_32 {
14	background: url("../images/pluginlogo_32x32.png?ver=1.0.0") no-repeat 0 3px transparent;
15	}

99	.bootstrap-wpadmin .page-header {
100	padding-bottom: 17px;
101	margin: 18px 0 0;
102	+ border-bottom: 1px solid transparent;
103	}
104	/* Form elements */
105	.bootstrap-wpadmin form fieldset {

333
334	/ FEature summaries /
335	.bootstrap-wpadmin .feature-summary-blocks {


336	text-align: center;
337	+ width: 100%;
338	+ margin-top: 20px;
339	+ box-shadow: 3px 3px 6px 0 rgba(0,0,0,0.3);
340	}
341	.feature-summary-blocks .feature-icon:before {
342	-webkit-font-smoothing: antialiased;
343	display: inline-block;
344	+ font: 32px/1 'dashicons';
345	vertical-align: top;
346	}
347	.feature-summary-blocks a {

349	text-shadow: 1px 0 0 rgba(0, 0, 0, 0.4);
350	width: 100%;
351	}






352
353	.feature-summary-blocks .summary-state {
354	border: 1px solid transparent;

356	text-align: center;
357	margin-bottom: -1px;
358	}
359	+
360	+ .feature-summary-blocks .summary-state.active-feature {
361	+ background-color: rgba(69, 119, 0, 1);
362	+ }
363	+ .feature-summary-blocks .summary-state.active-feature a {
364	+ color: rgba(255,255,255,1);
365	+ }
366	+ .feature-summary-blocks .summary-state.active-feature.state-off {
367	+ background-color: rgba( 173, 84, 0, 0.85 );
368	+ }
369	+ .feature-summary-blocks .summary-state .popover {
370	+ box-shadow: 2px 2px 5px rgba(0, 0, 0, 0.4);
371	+ padding: 0;
372	+ border-radius: 1px;
373	+ text-align: left;
374	+ width: 200px;
375	+ }
376	+ .feature-summary-blocks .summary-state .popover .arrow {
377	+ display: none;
378	+ }
379	+ .feature-summary-blocks .summary-state.active-feature.state-off:hover,
380	.feature-summary-blocks .summary-state:hover {
381	border: 1px solid rgba(0, 0, 0, 0.1);
382	border-left: 1px solid transparent;

400	font-size: 8px;
401	}
402	.feature-summary-blocks .feature-icon:before {
403	+ font-size: 16px;
404	}
405	}
406	.feature-summary-blocks .state-on a {

476	}
477	.bootstrap-wpadmin .row .shield-free-block p {
478	margin-bottom: 18px;
479	+ }

resources/css/wizard.css ADDED Viewed

	@@ -0,0 +1,70 @@


1	+ html {
2	+ overflow-y: scroll;
3	+ }
4	+ body {
5	+ padding-bottom: 200px;
6	+ }
7	+ body.wait {
8	+ cursor: wait !important;
9	+ }
10	+ .wizard > .content {
11	+ background: #ffffff;
12	+ box-shadow: 1px 1px 4px rgba(0, 0, 0, 0.2);
13	+ }
14	+ .wizard.vertical > .steps {
15	+ width: 20%; / from 30 /
16	+ }
17	+ .wizard.vertical > .content {
18	+ width: 75%; / from 65 /
19	+ }
20	+ .wizard > .content > .body {
21	+ height: auto;
22	+ position: relative;
23	+ padding: 0;
24	+ width: 100%
25	+ }
26	+ .wizard > .content > .body .slide-header {
27	+ padding: 3% 3% 0 3%;
28	+ }
29	+ .wizard > .content > .body .slide-header .btn-block {
30	+ margin-bottom: -1px;
31	+ }
32	+ .wizard > .content > .body .slide-header hr {
33	+ margin: 15px 0;
34	+ }
35	+ .wizard > .content > .body .slide-body {
36	+ padding: 0 6% 0 6%;
37	+ }
38	+ .wizard > .content > .body .slide-footer {
39	+ padding: 0 6% 3% 6%;
40	+ }
41	+ .wizard.vertical > .actions {
42	+ margin-bottom: 20px;
43	+ }
44	+ .wizard h3 {
45	+ margin-bottom: 20px;
46	+ }
47	+ .wizard p {
48	+ margin-bottom: 20px;
49	+ }
50	+ .wizard .body ul {
51	+ list-style: square inside none;
52	+ padding-left: 20px;
53	+ }
54	+ .wizard p.wizard-response {
55	+ padding: 10px 15px;
56	+ }
57	+
58	+ .wizard .slide-body img {
59	+ float: left;
60	+ width: 40%;
61	+ margin-right: 20px;
62	+ }
63	+ .wizard .slide-body .media {
64	+ margin-top: 25px
65	+ }
66	+ .wizard .slide-body .media-object {
67	+ border: 1px solid #888;
68	+ height: 64px;
69	+ width: 64px;
70	+ }

resources/images/shield/shieldnetworkmini.png ADDED Viewed

Binary file

resources/images/wizard/general-module_onoff.png ADDED Viewed

Binary file

resources/images/wizard/general-option_help.png ADDED Viewed

Binary file

resources/images/wizard/general-shield_actions.png ADDED Viewed

Binary file

resources/images/wizard/general-shield_help.png ADDED Viewed

Binary file

resources/images/wizard/general-shield_modules.png ADDED Viewed

Binary file

resources/images/wizard/general-shield_options.png ADDED Viewed

Binary file

resources/images/wizard/general-shield_where.png ADDED Viewed

Binary file

resources/js/jquery.fancybox.min.js ADDED Viewed

	@@ -0,0 +1,12 @@


1	+ // ==================================================
2	+ // fancyBox v3.2.10
3	+ //
4	+ // Licensed GPLv3 for open source use
5	+ // or fancyBox Commercial License for commercial use
6	+ //
7	+ // http://fancyapps.com/fancybox/
8	+ // Copyright 2017 fancyApps
9	+ //
10	+ // ==================================================
11	+ !function(t,e,n,o){"use strict";function i(t){var e=n(t.currentTarget),o=t.data?t.data.options:{},i=e.attr("data-fancybox")\|\|"",a=0,s=[];t.isDefaultPrevented()\|\|(t.preventDefault(),i?(s=o.selector?n(o.selector):t.data?t.data.items:[],s=s.length?s.filter('[data-fancybox="'+i+'"]'):n('[data-fancybox="'+i+'"]'),a=s.index(e),a<0&&(a=0)):s=[e],n.fancybox.open(s,o,a))}if(n){if(n.fn.fancybox)return void("console"in t&&console.log("fancyBox already initialized"));var a={loop:!1,margin:[44,0],gutter:50,keyboard:!0,arrows:!0,infobar:!0,toolbar:!0,buttons:["slideShow","fullScreen","thumbs","share","close"],idleTime:3,smallBtn:"auto",protect:!1,modal:!1,image:{preload:"auto"},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" webkitAllowFullScreen mozallowfullscreen allowFullScreen allowtransparency="true" src=""></iframe>',preload:!0,css:{},attr:{scrolling:"auto"}},defaultType:"image",animationEffect:"zoom",animationDuration:500,zoomOpacity:"auto",transitionEffect:"fade",transitionDuration:366,slideClass:"",baseClass:"",baseTpl:'<div class="fancybox-container" role="dialog" tabindex="-1"><div class="fancybox-bg"></div><div class="fancybox-inner"><div class="fancybox-infobar"><span data-fancybox-index></span> / <span data-fancybox-count></span></div><div class="fancybox-toolbar">{{buttons}}</div><div class="fancybox-navigation">{{arrows}}</div><div class="fancybox-stage"></div><div class="fancybox-caption-wrap"><div class="fancybox-caption"></div></div></div></div>',spinnerTpl:'<div class="fancybox-loading"></div>',errorTpl:'<div class="fancybox-error"><p>{{ERROR}}<p></div>',btnTpl:{download:'<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}"><svg viewBox="0 0 40 40"><path d="M20,23 L20,8 L20,23 L13,16 L20,23 L27,16 L20,23 M26,28 L13,28 L27,28 L14,28" /></svg></a>',zoom:'<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}"><svg viewBox="0 0 40 40"><path d="M 18,17 m-8,0 a 8,8 0 1,0 16,0 a 8,8 0 1,0 -16,0 M25,23 L31,29 L25,23" /></svg></button>',close:'<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}"><svg viewBox="0 0 40 40"><path d="M10,10 L30,30 M30,10 L10,30" /></svg></button>',smallBtn:'<button data-fancybox-close class="fancybox-close-small" title="{{CLOSE}}"></button>',arrowLeft:'<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}"><svg viewBox="0 0 40 40"><path d="M10,20 L30,20 L10,20 L18,28 L10,20 L18,12 L10,20"></path></svg></button>',arrowRight:'<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}"><svg viewBox="0 0 40 40"><path d="M30,20 L10,20 L30,20 L22,28 L30,20 L22,12 L30,20"></path></svg></button>'},parentEl:"body",autoFocus:!1,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:4e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"},wheel:"auto",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return"image"===t.type&&"zoom"},clickSlide:"close",clickOutside:"close",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{idleTime:!1,margin:0,clickContent:function(t,e){return"image"===t.type&&"toggleControls"},clickSlide:function(t,e){return"image"===t.type?"toggleControls":"close"},dblclickContent:function(t,e){return"image"===t.type&&"zoom"},dblclickSlide:function(t,e){return"image"===t.type&&"zoom"}},lang:"en",i18n:{en:{CLOSE:"Close",NEXT:"Next",PREV:"Previous",ERROR:"The requested content cannot be loaded. <br/> Please try again later.",PLAY_START:"Start slideshow",PLAY_STOP:"Pause slideshow",FULL_SCREEN:"Full screen",THUMBS:"Thumbnails",DOWNLOAD:"Download",SHARE:"Share",ZOOM:"Zoom"},de:{CLOSE:"Schliessen",NEXT:"Weiter",PREV:"Zurück",ERROR:"Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es später nochmal.",PLAY_START:"Diaschau starten",PLAY_STOP:"Diaschau beenden",FULL_SCREEN:"Vollbild",THUMBS:"Vorschaubilder",DOWNLOAD:"Herunterladen",SHARE:"Teilen",ZOOM:"Maßstab"}}},s=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},u=function(){return t.requestAnimationFrame\|\|t.webkitRequestAnimationFrame\|\|t.mozRequestAnimationFrame\|\|t.oRequestAnimationFrame\|\|function(e){return t.setTimeout(e,1e3/60)}}(),d=function(){var t,n=e.createElement("fakeelement"),i={transition:"transitionend",OTransition:"oTransitionEnd",MozTransition:"transitionend",WebkitTransition:"webkitTransitionEnd"};for(t in i)if(n.style[t]!==o)return i[t];return"transitionend"}(),f=function(t){return t&&t.length&&t[0].offsetHeight},p=function(t,o,i){var a=this;a.opts=n.extend(!0,{index:i},n.fancybox.defaults,o\|\|{}),n.fancybox.isMobile&&(a.opts=n.extend(!0,{},a.opts,a.opts.mobile)),o&&n.isArray(o.buttons)&&(a.opts.buttons=o.buttons),a.id=a.opts.id\|\|++c,a.group=[],a.currIndex=parseInt(a.opts.index,10)\|\|0,a.prevIndex=null,a.prevPos=null,a.currPos=0,a.firstRun=null,a.createGroup(t),a.group.length&&(a.$lastFocus=n(e.activeElement).blur(),a.slides={},a.init())};n.extend(p.prototype,{init:function(){var i,a,s,c=this,l=c.group[c.currIndex],u=l.opts,d=n.fancybox.scrollbarWidth;c.scrollTop=r.scrollTop(),c.scrollLeft=r.scrollLeft(),n.fancybox.getInstance()\|\|(n("body").addClass("fancybox-active"),/iPad\|iPhone\|iPod/.test(navigator.userAgent)&&!t.MSStream?"image"!==l.type&&n("body").css("top",n("body").scrollTop()-1).addClass("fancybox-iosfix"):!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(d===o&&(i=n('<div style="width:50px;height:50px;overflow:scroll;" />').appendTo("body"),d=n.fancybox.scrollbarWidth=i[0].offsetWidth-i[0].clientWidth,i.remove()),n("head").append('<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar { margin-right: '+d+"px; }</style>"),n("body").addClass("compensate-for-scrollbar"))),s="",n.each(u.buttons,function(t,e){s+=u.btnTpl[e]\|\|""}),a=n(c.translate(c,u.baseTpl.replace("{{buttons}}",s).replace("{{arrows}}",u.btnTpl.arrowLeft+u.btnTpl.arrowRight))).attr("id","fancybox-container-"+c.id).addClass("fancybox-is-hidden").addClass(u.baseClass).data("FancyBox",c).appendTo(u.parentEl),c.$refs={container:a},["bg","inner","infobar","toolbar","stage","caption","navigation"].forEach(function(t){c.$refs[t]=a.find(".fancybox-"+t)}),c.trigger("onInit"),c.activate(),c.jumpTo(c.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang];return e.replace(/\{\{(\w+)\}\}/g,function(t,e){var i=n[e];return i===o?t:i})},createGroup:function(t){var e=this,i=n.makeArray(t);n.each(i,function(t,i){var a,s,r,c,l,u={},d={};n.isPlainObject(i)?(u=i,d=i.opts\|\|i):"object"===n.type(i)&&n(i).length?(a=n(i),d=a.data(),d=n.extend({},d,d.options\|\|{}),d.$orig=a,u.src=d.src\|\|a.attr("href"),u.type\|\|u.src\|\|(u.type="inline",u.src=i)):u={type:"html",src:i+""},u.opts=n.extend(!0,{},e.opts,d),n.isArray(d.buttons)&&(u.opts.buttons=d.buttons),s=u.type\|\|u.opts.type,c=u.src\|\|"",!s&&c&&(c.match(/(^data:image\/[a-z0-9+\/=],)\|(\.(jp(e\|g\|eg)\|gif\|png\|bmp\|webp\|svg\|ico)((\?\|#).)?$)/i)?s="image":c.match(/\.(pdf)((\?\|#).)?$/i)?s="pdf":(r=c.match(/\.(mp4\|mov\|ogv)((\?\|#).)?$/i))?(s="video",u.opts.videoFormat\|\|(u.opts.videoFormat="video/"+("ogv"===r[1]?"ogg":r[1]))):"#"===c.charAt(0)&&(s="inline")),s?u.type=s:e.trigger("objectNeedsType",u),u.index=e.group.length,u.opts.$orig&&!u.opts.$orig.length&&delete u.opts.$orig,!u.opts.$thumb&&u.opts.$orig&&(u.opts.$thumb=u.opts.$orig.find("img:first")),u.opts.$thumb&&!u.opts.$thumb.length&&delete u.opts.$thumb,"function"===n.type(u.opts.caption)&&(u.opts.caption=u.opts.caption.apply(i,[e,u])),"function"===n.type(e.opts.caption)&&(u.opts.caption=e.opts.caption.apply(i,[e,u])),u.opts.caption instanceof n\|\|(u.opts.caption=u.opts.caption===o?"":u.opts.caption+""),"ajax"===s&&(l=c.split(/\s+/,2),l.length>1&&(u.src=l.shift(),u.opts.filter=l.shift())),"auto"==u.opts.smallBtn&&(n.inArray(s,["html","inline","ajax"])>-1?(u.opts.toolbar=!1,u.opts.smallBtn=!0):u.opts.smallBtn=!1),"pdf"===s&&(u.type="iframe",u.opts.iframe.preload=!1),u.opts.modal&&(u.opts=n.extend(!0,u.opts,{infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),e.group.push(u)})},addEvents:function(){var o=this;o.removeEvents(),o.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),o.close(t)}).on("click.fb-prev touchend.fb-prev","[data-fancybox-prev]",function(t){t.stopPropagation(),t.preventDefault(),o.previous()}).on("click.fb-next touchend.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),o.next()}).on("click.fb","[data-fancybox-zoom]",function(t){o[o.isScaledDown()?"scaleToActual":"scaleToFit"]()}),s.on("orientationchange.fb resize.fb",function(t){t&&t.originalEvent&&"resize"===t.originalEvent.type?u(function(){o.update()}):(o.$refs.stage.hide(),setTimeout(function(){o.$refs.stage.show(),o.update()},600))}),r.on("focusin.fb",function(t){var i=n.fancybox?n.fancybox.getInstance():null;i.isClosing\|\|!i.current\|\|!i.current.opts.trapFocus\|\|n(t.target).hasClass("fancybox-container")\|\|n(t.target).is(e)\|\|i&&"fixed"!==n(t.target).css("position")&&!i.$refs.container.has(t.target).length&&(t.stopPropagation(),i.focus(),s.scrollTop(o.scrollTop).scrollLeft(o.scrollLeft))}),r.on("keydown.fb",function(t){var e=o.current,i=t.keyCode\|\|t.which;if(e&&e.opts.keyboard&&!n(t.target).is("input")&&!n(t.target).is("textarea"))return 8===i\|\|27===i?(t.preventDefault(),void o.close(t)):37===i\|\|38===i?(t.preventDefault(),void o.previous()):39===i\|\|40===i?(t.preventDefault(),void o.next()):void o.trigger("afterKeydown",t,i)}),o.group[o.currIndex].opts.idleTime&&(o.idleSecondsCounter=0,r.on("mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",function(t){o.idleSecondsCounter=0,o.isIdle&&o.showControls(),o.isIdle=!1}),o.idleInterval=t.setInterval(function(){o.idleSecondsCounter++,o.idleSecondsCounter>=o.group[o.currIndex].opts.idleTime&&!o.isDragging&&(o.isIdle=!0,o.idleSecondsCounter=0,o.hideControls())},1e3))},removeEvents:function(){var e=this;s.off("orientationchange.fb resize.fb"),r.off("focusin.fb keydown.fb .fb-idle"),this.$refs.container.off(".fb-close .fb-prev .fb-next"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e,i){var a,s,r,c,l,u,d,p=this,h=p.group.length;if(!(p.isDragging\|\|p.isClosing\|\|p.isAnimating&&p.firstRun)){if(t=parseInt(t,10),s=p.current?p.current.opts.loop:p.opts.loop,!s&&(t<0\|\|t>=h))return!1;if(a=p.firstRun=null===p.firstRun,!(h<2&&!a&&p.isDragging)){if(c=p.current,p.prevIndex=p.currIndex,p.prevPos=p.currPos,r=p.createSlide(t),h>1&&((s\|\|r.index>0)&&p.createSlide(t-1),(s\|\|r.index<h-1)&&p.createSlide(t+1)),p.current=r,p.currIndex=r.index,p.currPos=r.pos,p.trigger("beforeShow",a),p.updateControls(),u=n.fancybox.getTranslate(r.$slide),r.isMoved=(0!==u.left\|\|0!==u.top)&&!r.$slide.hasClass("fancybox-animated"),r.forcedDuration=o,n.isNumeric(e)?r.forcedDuration=e:e=r.opts[a?"animationDuration":"transitionDuration"],e=parseInt(e,10),a)return r.opts.animationEffect&&e&&p.$refs.container.css("transition-duration",e+"ms"),p.$refs.container.removeClass("fancybox-is-hidden"),f(p.$refs.container),p.$refs.container.addClass("fancybox-is-open"),r.$slide.addClass("fancybox-slide--current"),p.loadSlide(r),void p.preload("image");n.each(p.slides,function(t,e){n.fancybox.stop(e.$slide)}),r.$slide.removeClass("fancybox-slide--next fancybox-slide--previous").addClass("fancybox-slide--current"),r.isMoved?(l=Math.round(r.$slide.width()),n.each(p.slides,function(t,o){var i=o.pos-r.pos;n.fancybox.animate(o.$slide,{top:0,left:il+io.opts.gutter},e,function(){o.$slide.removeAttr("style").removeClass("fancybox-slide--next fancybox-slide--previous"),o.pos===p.currPos&&(r.isMoved=!1,p.complete())})})):p.$refs.stage.children().removeAttr("style"),r.isLoaded?p.revealContent(r):p.loadSlide(r),p.preload("image"),c.pos!==r.pos&&(d="fancybox-slide--"+(c.pos>r.pos?"next":"previous"),c.$slide.removeClass("fancybox-slide--complete fancybox-slide--current fancybox-slide--next fancybox-slide--previous"),c.isComplete=!1,e&&(r.isMoved\|\|r.opts.transitionEffect)&&(r.isMoved?c.$slide.addClass(d):(d="fancybox-animated "+d+" fancybox-fx-"+r.opts.transitionEffect,n.fancybox.animate(c.$slide,d,e,function(){c.$slide.removeClass(d).removeAttr("style")}))))}}},createSlide:function(t){var e,o,i=this;return o=t%i.group.length,o=o<0?i.group.length+o:o,!i.slides[t]&&i.group[o]&&(e=n('<div class="fancybox-slide"></div>').appendTo(i.$refs.stage),i.slides[t]=n.extend(!0,{},i.group[o],{pos:t,$slide:e,isLoaded:!1}),i.updateSlide(i.slides[t])),i.slides[t]},scaleToActual:function(t,e,i){var a,s,r,c,l,u=this,d=u.current,f=d.$content,p=parseInt(d.$slide.width(),10),h=parseInt(d.$slide.height(),10),g=d.width,b=d.height;"image"!=d.type\|\|d.hasError\|\|!f\|\|u.isAnimating\|\|(n.fancybox.stop(f),u.isAnimating=!0,t=t===o?.5p:t,e=e===o?.5h:e,a=n.fancybox.getTranslate(f),c=g/a.width,l=b/a.height,s=.5p-.5g,r=.5h-.5b,g>p&&(s=a.leftc-(tc-t),s>0&&(s=0),s<p-g&&(s=p-g)),b>h&&(r=a.topl-(el-e),r>0&&(r=0),r<h-b&&(r=h-b)),u.updateCursor(g,b),n.fancybox.animate(f,{top:r,left:s,scaleX:c,scaleY:l},i\|\|330,function(){u.isAnimating=!1}),u.SlideShow&&u.SlideShow.isActive&&u.SlideShow.stop())},scaleToFit:function(t){var e,o=this,i=o.current,a=i.$content;"image"!=i.type\|\|i.hasError\|\|!a\|\|o.isAnimating\|\|(n.fancybox.stop(a),o.isAnimating=!0,e=o.getFitPos(i),o.updateCursor(e.width,e.height),n.fancybox.animate(a,{top:e.top,left:e.left,scaleX:e.width/a.width(),scaleY:e.height/a.height()},t\|\|330,function(){o.isAnimating=!1}))},getFitPos:function(t){var e,o,i,a,s,r=this,c=t.$content,l=t.width,u=t.height,d=t.opts.margin;return!(!c\|\|!c.length\|\|!l&&!u)&&("number"===n.type(d)&&(d=[d,d]),2==d.length&&(d=[d[0],d[1],d[0],d[1]]),e=parseInt(r.$refs.stage.width(),10)-(d[1]+d[3]),o=parseInt(r.$refs.stage.height(),10)-(d[0]+d[2]),i=Math.min(1,e/l,o/u),a=Math.floor(il),s=Math.floor(iu),{top:Math.floor(.5(o-s))+d[0],left:Math.floor(.5(e-a))+d[3],width:a,height:s})},update:function(){var t=this;n.each(t.slides,function(e,n){t.updateSlide(n)})},updateSlide:function(t,e){var o=this,i=t&&t.$content;i&&(t.width\|\|t.height)&&(o.isAnimating=!1,n.fancybox.stop(i),n.fancybox.setTranslate(i,o.getFitPos(t)),t.pos===o.currPos&&o.updateCursor()),t.$slide.trigger("refresh"),o.trigger("onUpdate",t)},centerSlide:function(t,e){var i,a,s=this;s.current&&(i=Math.round(t.$slide.width()),a=t.pos-s.current.pos,n.fancybox.animate(t.$slide,{top:0,left:ai+at.opts.gutter,opacity:1},e===o?0:e,null,!1))},updateCursor:function(t,e){var n,i=this,a=i.$refs.container.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-drag fancybox-can-zoomOut");i.current&&!i.isClosing&&(i.isZoomable()?(a.addClass("fancybox-is-zoomable"),n=t!==o&&e!==o?t<i.current.width&&e<i.current.height:i.isScaledDown(),n?a.addClass("fancybox-can-zoomIn"):i.current.opts.touch?a.addClass("fancybox-can-drag"):a.addClass("fancybox-can-zoomOut")):i.current.opts.touch&&a.addClass("fancybox-can-drag"))},isZoomable:function(){var t,e=this,o=e.current;if(o&&!e.isClosing)return!!("image"===o.type&&o.isLoaded&&!o.hasError&&("zoom"===o.opts.clickContent\|\|n.isFunction(o.opts.clickContent)&&"zoom"===o.opts.clickContent(o))&&(t=e.getFitPos(o),o.width>t.width\|\|o.height>t.height))},isScaledDown:function(){var t=this,e=t.current,o=e.$content,i=!1;return o&&(i=n.fancybox.getTranslate(o),i=i.width<e.width\|\|i.height<e.height),i},canPan:function(){var t=this,e=t.current,n=e.$content,o=!1;return n&&(o=t.getFitPos(e),o=Math.abs(n.width()-o.width)>1\|\|Math.abs(n.height()-o.height)>1),o},loadSlide:function(t){var e,o,i,a=this;if(!t.isLoading&&!t.isLoaded){switch(t.isLoading=!0,a.trigger("beforeLoad",t),e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass("fancybox-slide--"+(e\|\|"unknown")).addClass(t.opts.slideClass),e){case"image":a.setImage(t);break;case"iframe":a.setIframe(t);break;case"html":a.setContent(t,t.src\|\|t.content);break;case"inline":n(t.src).length?a.setContent(t,n(t.src)):a.setError(t);break;case"ajax":a.showLoading(t),i=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&a.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&a.setError(t)}})),o.one("onReset",function(){i.abort()});break;case"video":a.setContent(t,'<video controls><source src="'+t.src+'" type="'+t.opts.videoFormat+"\">Your browser doesn't support HTML5 video</video>");break;default:a.setError(t)}return!0}},setImage:function(e){var o,i,a,s,r=this,c=e.opts.srcset\|\|e.opts.image.srcset;if(c){a=t.devicePixelRatio\|\|1,s=t.innerWidtha,i=c.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);return 0===n?e.url=t:void(o&&(e.value=o,e.postfix=t[t.length-1]))}),e}),i.sort(function(t,e){return t.value-e.value});for(var l=0;l<i.length;l++){var u=i[l];if("w"===u.postfix&&u.value>=s\|\|"x"===u.postfix&&u.value>=a){o=u;break}}!o&&i.length&&(o=i[i.length-1]),o&&(e.src=o.url,e.width&&e.height&&"w"==o.postfix&&(e.height=e.width/e.heighto.value,e.width=o.value))}e.$content=n('<div class="fancybox-image-wrap"></div>').addClass("fancybox-is-hidden").appendTo(e.$slide),e.opts.preload!==!1&&e.opts.width&&e.opts.height&&(e.opts.thumb\|\|e.opts.$thumb)?(e.width=e.opts.width,e.height=e.opts.height,e.$ghost=n("<img />").one("error",function(){n(this).remove(),e.$ghost=null,r.setBigImage(e)}).one("load",function(){r.afterLoad(e),r.setBigImage(e)}).addClass("fancybox-image").appendTo(e.$content).attr("src",e.opts.thumb\|\|e.opts.$thumb.attr("src"))):r.setBigImage(e)},setBigImage:function(t){var e=this,o=n("<img />");t.$image=o.one("error",function(){e.setError(t)}).one("load",function(){clearTimeout(t.timouts),t.timouts=null,e.isClosing\|\|(t.width=t.opts.width\|\|this.naturalWidth,t.height=t.opts.height\|\|this.naturalHeight,t.opts.image.srcset&&o.attr("sizes","100vw").attr("srcset",t.opts.image.srcset),e.hideLoading(t),t.$ghost?t.timouts=setTimeout(function(){t.timouts=null,t.$ghost.hide()},Math.min(300,Math.max(1e3,t.height/1600))):e.afterLoad(t))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$content),(o[0].complete\|\|"complete"==o[0].readyState)&&o[0].naturalWidth&&o[0].naturalHeight?o.trigger("load"):o[0].error?o.trigger("error"):t.timouts=setTimeout(function(){o[0].complete\|\|t.hasError\|\|e.showLoading(t)},100)},setIframe:function(t){var e,i=this,a=t.opts.iframe,s=t.$slide;t.$content=n('<div class="fancybox-content'+(a.preload?" fancybox-is-hidden":"")+'"></div>').css(a.css).appendTo(s),e=n(a.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr(a.attr).appendTo(t.$content),a.preload?(i.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),i.afterLoad(t)}),s.on("refresh.fb",function(){var n,i,s,r=t.$content,c=a.css.width,l=a.css.height;if(1===e[0].isReady){try{i=e.contents(),s=i.find("body")}catch(t){}s&&s.length&&(c===o&&(n=e[0].contentWindow.document.documentElement.scrollWidth,c=Math.ceil(s.outerWidth(!0)+(r.width()-n)),c+=r.outerWidth()-r.innerWidth()),l===o&&(l=Math.ceil(s.outerHeight(!0)),l+=r.outerHeight()-r.innerHeight()),c&&r.width(c),l&&r.height(l)),r.removeClass("fancybox-is-hidden")}})):this.afterLoad(t),e.attr("src",t.src),t.opts.smallBtn===!0&&t.$content.prepend(i.translate(t,t.opts.btnTpl.smallBtn)),s.one("onReset",function(){try{n(this).find("iframe").hide().attr("src","//about:blank")}catch(t){}n(this).empty(),t.isLoaded=!1})},setContent:function(t,e){var o=this;o.isClosing\|\|(o.hideLoading(t),t.$slide.empty(),l(e)&&e.parent().length?(e.parent(".fancybox-slide--inline").trigger("onReset"),t.$placeholder=n("<div></div>").hide().insertAfter(e),e.css("display","inline-block")):t.hasError\|\|("string"===n.type(e)&&(e=n("<div>").append(n.trim(e)).contents(),3===e[0].nodeType&&(e=n("<div>").html(e))),t.opts.filter&&(e=n("<div>").html(e).find(t.opts.filter))),t.$slide.one("onReset",function(){n(this).find("video,audio").trigger("pause"),t.$placeholder&&(t.$placeholder.after(e.hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError\|\|(n(this).empty(),t.isLoaded=!1)}),t.$content=n(e).appendTo(t.$slide),this.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.removeClass("fancybox-slide--"+t.type),this.setContent(t,this.translate(t,t.opts.errorTpl))},showLoading:function(t){var e=this;t=t\|\|e.current,t&&!t.$spinner&&(t.$spinner=n(e.opts.spinnerTpl).appendTo(t.$slide))},hideLoading:function(t){var e=this;t=t\|\|e.current,t&&t.$spinner&&(t.$spinner.remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing\|\|(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),t.opts.smallBtn&&!t.$smallBtn&&(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content.filter("div,form").first())),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0}),"image"===t.type&&n('<div class="fancybox-spaceball"></div>').appendTo(t.$content)),e.revealContent(t))},revealContent:function(t){var e,i,a,s,r,c=this,l=t.$slide,u=!1;return e=t.opts[c.firstRun?"animationEffect":"transitionEffect"],a=t.opts[c.firstRun?"animationDuration":"transitionDuration"],a=parseInt(t.forcedDuration===o?a:t.forcedDuration,10),!t.isMoved&&t.pos===c.currPos&&a\|\|(e=!1),"zoom"!==e\|\|t.pos===c.currPos&&a&&"image"===t.type&&!t.hasError&&(u=c.getThumbPos(t))\|\|(e="fade"),"zoom"===e?(r=c.getFitPos(t),r.scaleX=r.width/u.width,r.scaleY=r.height/u.height,delete r.width,delete r.height,s=t.opts.zoomOpacity,"auto"==s&&(s=Math.abs(t.width/t.height-u.width/u.height)>.1),s&&(u.opacity=.1,r.opacity=1),n.fancybox.setTranslate(t.$content.removeClass("fancybox-is-hidden"),u),f(t.$content),void n.fancybox.animate(t.$content,r,a,function(){c.complete()})):(c.updateSlide(t),e?(n.fancybox.stop(l),i="fancybox-animated fancybox-slide--"+(t.pos>=c.prevPos?"next":"previous")+" fancybox-fx-"+e,l.removeAttr("style").removeClass("fancybox-slide--current fancybox-slide--next fancybox-slide--previous").addClass(i),t.$content.removeClass("fancybox-is-hidden"),f(l),void n.fancybox.animate(l,"fancybox-slide--current",a,function(e){l.removeClass(i).removeAttr("style"),t.pos===c.currPos&&c.complete()},!0)):(f(l),t.$content.removeClass("fancybox-is-hidden"),void(t.pos===c.currPos&&c.complete())))},getThumbPos:function(o){var i,a=this,s=!1,r=function(e){for(var o,i=e[0],a=i.getBoundingClientRect(),s=[];null!==i.parentElement;)"hidden"!==n(i.parentElement).css("overflow")&&"auto"!==n(i.parentElement).css("overflow")\|\|s.push(i.parentElement.getBoundingClientRect()),i=i.parentElement;return o=s.every(function(t){var e=Math.min(a.right,t.right)-Math.max(a.left,t.left),n=Math.min(a.bottom,t.bottom)-Math.max(a.top,t.top);return e>0&&n>0}),o&&a.bottom>0&&a.right>0&&a.left<n(t).width()&&a.top<n(t).height()},c=o.opts.$thumb,l=c?c.offset():0;return l&&c[0].ownerDocument===e&&r(c)&&(i=a.$refs.stage.offset(),s={top:l.top-i.top+parseFloat(c.css("border-top-width")\|\|0),left:l.left-i.left+parseFloat(c.css("border-left-width")\|\|0),width:c.width(),height:c.height(),scaleX:1,scaleY:1}),s},complete:function(){var t=this,o=t.current,i={};o.isMoved\|\|!o.isLoaded\|\|o.isComplete\|\|(o.isComplete=!0,o.$slide.siblings().trigger("onReset"),t.preload("inline"),f(o.$slide),o.$slide.addClass("fancybox-slide--complete"),n.each(t.slides,function(e,o){o.pos>=t.currPos-1&&o.pos<=t.currPos+1?i[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),t.slides=i,t.updateCursor(),t.trigger("afterShow"),o.$slide.find("video,audio").first().trigger("play"),(n(e.activeElement).is("[disabled]")\|\|o.opts.autoFocus&&"image"!=o.type&&"iframe"!==o.type)&&t.focus())},preload:function(t){var e=this,n=e.slides[e.currPos+1],o=e.slides[e.currPos-1];n&&n.type===t&&e.loadSlide(n),o&&o.type===t&&e.loadSlide(o)},focus:function(){var t,e=this.current;this.isClosing\|\|(e&&e.isComplete&&(t=e.$slide.find("input[autofocus]:enabled:visible:first"),t.length\|\|(t=e.$slide.find("button,:input,[tabindex],a").filter(":enabled:visible:first"))),t=t&&t.length?t:this.$refs.container,t.focus())},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.id!==t.id&&!e.isClosing&&(e.trigger("onDeactivate"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current\|\|t.isIdle)&&(t.update(),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t,e){var o,i,a,s,r,c,l=this,p=l.current,h=function(){l.cleanUp(t)};return!l.isClosing&&(l.isClosing=!0,l.trigger("beforeClose",t)===!1?(l.isClosing=!1,u(function(){l.update()}),!1):(l.removeEvents(),p.timouts&&clearTimeout(p.timouts),a=p.$content,o=p.opts.animationEffect,i=n.isNumeric(e)?e:o?p.opts.animationDuration:0,p.$slide.off(d).removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated"),p.$slide.siblings().trigger("onReset").remove(),i&&l.$refs.container.removeClass("fancybox-is-open").addClass("fancybox-is-closing"),l.hideLoading(p),l.hideControls(),l.updateCursor(),"zoom"!==o\|\|t!==!0&&a&&i&&"image"===p.type&&!p.hasError&&(c=l.getThumbPos(p))\|\|(o="fade"),"zoom"===o?(n.fancybox.stop(a),r=n.fancybox.getTranslate(a),r.width=r.widthr.scaleX,r.height=r.heightr.scaleY,s=p.opts.zoomOpacity,"auto"==s&&(s=Math.abs(p.width/p.height-c.width/c.height)>.1),s&&(c.opacity=0),r.scaleX=r.width/c.width,r.scaleY=r.height/c.height,r.width=c.width,r.height=c.height,n.fancybox.setTranslate(p.$content,r),f(p.$content),n.fancybox.animate(p.$content,c,i,h),!0):(o&&i?t===!0?setTimeout(h,i):n.fancybox.animate(p.$slide.removeClass("fancybox-slide--current"),"fancybox-animated fancybox-slide--previous fancybox-fx-"+o,i,h):h(),!0)))},cleanUp:function(t){var o,i,a=this,r=n("body");a.current.$slide.trigger("onReset"),a.$refs.container.empty().remove(),a.trigger("afterClose",t),a.$lastFocus&&a.current.opts.backFocus&&a.$lastFocus.focus(),a.current=null,o=n.fancybox.getInstance(),o?o.activate():(s.scrollTop(a.scrollTop).scrollLeft(a.scrollLeft),r.removeClass("fancybox-active compensate-for-scrollbar"),r.hasClass("fancybox-iosfix")&&(i=parseInt(e.body.style.top,10),r.removeClass("fancybox-iosfix").css("top","").scrollTop(i-1)),n("#fancybox-style-noscroll").remove())},trigger:function(t,e){var o,i=Array.prototype.slice.call(arguments,1),a=this,s=e&&e.opts?e:a.current;return s?i.unshift(s):s=a,i.unshift(a),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,i)),o===!1?o:void("afterClose"!==t&&a.$refs?a.$refs.container.trigger(t+".fb",i):r.trigger(t+".fb",i))},updateControls:function(t){var e=this,n=e.current,o=n.index,i=n.opts.caption,a=e.$refs.container,s=e.$refs.caption;n.$slide.trigger("refresh"),e.$caption=i&&i.length?s.html(i):null,e.isHiddenControls\|\|e.isIdle\|\|e.showControls(),a.find("[data-fancybox-count]").html(e.group.length),a.find("[data-fancybox-index]").html(o+1),a.find("[data-fancybox-prev]").prop("disabled",!n.opts.loop&&o<=0),a.find("[data-fancybox-next]").prop("disabled",!n.opts.loop&&o>=e.group.length-1),"image"===n.type?a.find("[data-fancybox-download]").attr("href",n.opts.image.src\|\|n.src).show():a.find("[data-fancybox-download],[data-fancybox-zoom]").hide()},hideControls:function(){this.isHiddenControls=!0,this.$refs.container.removeClass("fancybox-show-infobar fancybox-show-toolbar fancybox-show-caption fancybox-show-nav")},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.isHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass("fancybox-show-toolbar",!(!e.toolbar\|\|!e.buttons)).toggleClass("fancybox-show-infobar",!!(e.infobar&&t.group.length>1)).toggleClass("fancybox-show-nav",!!(e.arrows&&t.group.length>1)).toggleClass("fancybox-is-modal",!!e.modal),t.$caption?n.addClass("fancybox-show-caption "):n.removeClass("fancybox-show-caption")},toggleControls:function(){this.isHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:"3.2.10",defaults:a,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof p&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new p(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),t===!0&&this.close())},destroy:function(){this.close(!0),r.off("click.fb-start")},isMobile:e.createTouch!==o&&/Android\|webOS\|iPhone\|iPad\|iPod\|BlackBerry\|IEMobile\|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle&&t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;if(!t\|\|!t.length)return!1;if(e=t.eq(0).css("transform"),e&&e.indexOf("matrix")!==-1?(e=e.split("(")[1],e=e.split(")")[0],e=e.split(",")):e=[],e.length)e=e.length>10?[e[13],e[12],e[0],e[5]]:[e[5],e[4],e[0],e[3]],e=e.map(parseFloat);else{e=[0,0,1,1];var n=/\.translate$(.)px,(.)px$/i,o=n.exec(t.eq(0).attr("style"));o&&(e[0]=parseFloat(o[2]),e[1]=parseFloat(o[1]))}return{top:e[0],left:e[1],scaleX:e[2],scaleY:e[3],opacity:parseFloat(t.css("opacity")),width:t.width(),height:t.height()}},setTranslate:function(t,e){var n="",i={};if(t&&e)return e.left===o&&e.top===o\|\|(n=(e.left===o?t.position().left:e.left)+"px, "+(e.top===o?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),e.scaleX!==o&&e.scaleY!==o&&(n=(n.length?n+" ":"")+"scale("+e.scaleX+", "+e.scaleY+")"),n.length&&(i.transform=n),e.opacity!==o&&(i.opacity=e.opacity),e.width!==o&&(i.width=e.width),e.height!==o&&(i.height=e.height),t.css(i)},animate:function(t,e,i,a,s){n.isFunction(i)&&(a=i,i=null),n.isPlainObject(e)\|\|t.removeAttr("style"),t.on(d,function(i){(!i\|\|!i.originalEvent\|\|t.is(i.originalEvent.target)&&"z-index"!=i.originalEvent.propertyName)&&(n.fancybox.stop(t),n.isPlainObject(e)?(e.scaleX!==o&&e.scaleY!==o&&(t.css("transition-duration",""),e.width=Math.round(t.width()e.scaleX),e.height=Math.round(t.height()e.scaleY),e.scaleX=1,e.scaleY=1,n.fancybox.setTranslate(t,e)),s===!1&&t.removeAttr("style")):s!==!0&&t.removeClass(e),n.isFunction(a)&&a(i))}),n.isNumeric(i)&&t.css("transition-duration",i+"ms"),n.isPlainObject(e)?n.fancybox.setTranslate(t,e):t.addClass(e),e.scaleX&&t.hasClass("fancybox-image-wrap")&&t.parent().addClass("fancybox-is-scaling"),t.data("timer",setTimeout(function(){t.trigger("transitionend")},i+16))},stop:function(t){clearTimeout(t.data("timer")),t.off("transitionend").css("transition-duration",""),t.hasClass("fancybox-image-wrap")&&t.parent().removeClass("fancybox-is-scaling")}},n.fn.fancybox=function(t){var e;return t=t\|\|{},e=t.selector\|\|!1,e?n("body").off("click.fb-start",e).on("click.fb-start",e,{options:t},i):this.off("click.fb-start").on("click.fb-start",{items:this,options:t},i),this},r.on("click.fb-start","[data-fancybox]",i)}}(window,document,window.jQuery\|\|jQuery),function(t){"use strict";var e=function(e,n,o){if(e)return o=o\|\|"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n\|\|"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e},n={youtube:{matcher:/(youtube\.com\|youtu\.be\|youtube\-nocookie\.com)\/(watch\?(.&)?v=\|v\/\|u\/\|embed\/?)?(videoseries\?list=(.)\|[\w-]{11}\|\?listType=(.)&list=(.))(.)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"//www.youtube.com/embed/$4",thumb:"//img.youtube.com/vi/$4/hqdefault.jpg"
12	+ },vimeo:{matcher:/^.+vimeo.com\/(.\/)?([\d]+)(.)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1,api:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},metacafe:{matcher:/metacafe.com\/watch\/(\d+)\/(.)?/,type:"iframe",url:"//www.metacafe.com/embed/$1/?ap=1"},dailymotion:{matcher:/dailymotion.com\/video\/(.)\/?(.)/,params:{additionalInfos:0,autoStart:1},type:"iframe",url:"//www.dailymotion.com/embed/video/$1"},vine:{matcher:/vine.co\/v\/([a-zA-Z0-9\?\=\-]+)/,type:"iframe",url:"//vine.co/v/$1/embed/simple"},instagram:{matcher:/(instagr\.am\|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},gmap_place:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.)\/)?\@(.),(\d+.?\d+?)z))\|(\?ll=))(.)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12])+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}},gmap_search:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.)/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/maps?q="+t[5].replace("query=","q=").replace("api=1","")+"&output=embed"}}};t(document).on("objectNeedsType.fb",function(o,i,a){var s,r,c,l,u,d,f,p=a.src\|\|"",h=!1;s=t.extend(!0,{},n,a.opts.media),t.each(s,function(n,o){if(c=p.match(o.matcher)){if(h=o.type,d={},o.paramPlace&&c[o.paramPlace]){u=c[o.paramPlace],"?"==u[0]&&(u=u.substring(1)),u=u.split("&");for(var i=0;i<u.length;++i){var s=u[i].split("=",2);2==s.length&&(d[s[0]]=decodeURIComponent(s[1].replace(/\+/g," ")))}}return l=t.extend(!0,{},o.params,a.opts[n],d),p="function"===t.type(o.url)?o.url.call(this,c,l,a):e(o.url,c,l),r="function"===t.type(o.thumb)?o.thumb.call(this,c,l,a):e(o.thumb,c),"vimeo"===n&&(p=p.replace("&%23","#")),!1}}),h?(a.src=p,a.type=h,a.opts.thumb\|\|a.opts.$thumb&&a.opts.$thumb.length\|\|(a.opts.thumb=r),"iframe"===h&&(t.extend(!0,a.opts,{iframe:{preload:!1,attr:{scrolling:"no"}}}),a.contentProvider=f,a.opts.slideClass+=" fancybox-slide--"+("gmap_place"==f\|\|"gmap_search"==f?"map":"video"))):p&&(a.type=a.opts.defaultType)})}(window.jQuery\|\|jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame\|\|t.webkitRequestAnimationFrame\|\|t.mozRequestAnimationFrame\|\|t.oRequestAnimationFrame\|\|function(e){return t.setTimeout(e,1e3/60)}}(),i=function(){return t.cancelAnimationFrame\|\|t.webkitCancelAnimationFrame\|\|t.mozCancelAnimationFrame\|\|t.oCancelAnimationFrame\|\|function(e){t.clearTimeout(e)}}(),a=function(e){var n=[];e=e.originalEvent\|\|e\|\|t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role="button"],input,label,select,summary,textarea')\|\|n.isFunction(t.get(0).onclick)\|\|t.data("selectable"))return!0;for(var e=0,o=t[0].attributes,i=o.length;e<i;e++)if("data-fancybox-"===o[e].nodeName.substr(0,14))return!0;return!1},c=function(e){var n=t.getComputedStyle(e)["overflow-y"],o=t.getComputedStyle(e)["overflow-x"],i=("scroll"===n\|\|"auto"===n)&&e.scrollHeight>e.clientHeight,a=("scroll"===o\|\|"auto"===o)&&e.scrollWidth>e.clientWidth;return i\|\|a},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length\|\|t.hasClass("fancybox-stage")\|\|t.is("body"))break}return e},u=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on("touchstart.fb.touch mousedown.fb.touch",n.proxy(e,"ontouchstart"))};u.prototype.destroy=function(){this.$container.off(".fb.touch")},u.prototype.ontouchstart=function(o){var i=this,c=n(o.target),u=i.instance,d=u.current,f=d.$content,p="touchstart"==o.type;if(p&&i.$container.off("mousedown.fb.touch"),(!o.originalEvent\|\|2!=o.originalEvent.button)&&c.length&&!r(c)&&!r(c.parent())&&(c.is("img")\|\|!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!d\|\|i.instance.isAnimating\|\|i.instance.isClosing)return o.stopPropagation(),void o.preventDefault();if(i.realPoints=i.startPoints=a(o),i.startPoints){if(o.stopPropagation(),i.startEvent=o,i.canTap=!0,i.$target=c,i.$content=f,i.opts=d.opts.touch,i.isPanning=!1,i.isSwiping=!1,i.isZooming=!1,i.isScrolling=!1,i.sliderStartPos=i.sliderLastPos\|\|{top:0,left:0},i.contentStartPos=n.fancybox.getTranslate(i.$content),i.contentLastPos=null,i.startTime=(new Date).getTime(),i.distanceX=i.distanceY=i.distance=0,i.canvasWidth=Math.round(d.$slide[0].clientWidth),i.canvasHeight=Math.round(d.$slide[0].clientHeight),n(e).off(".fb.touch").on(p?"touchend.fb.touch touchcancel.fb.touch":"mouseup.fb.touch mouseleave.fb.touch",n.proxy(i,"ontouchend")).on(p?"touchmove.fb.touch":"mousemove.fb.touch",n.proxy(i,"ontouchmove")),n.fancybox.isMobile&&e.addEventListener("scroll",i.onscroll,!0),!i.opts&&!u.canPan()\|\|!c.is(i.$stage)&&!i.$stage.find(c).length)return void(c.is("img")&&o.preventDefault());n.fancybox.isMobile&&(l(c)\|\|l(c.parent()))\|\|o.preventDefault(),1===i.startPoints.length&&("image"===d.type&&(i.contentStartPos.width>i.canvasWidth+1\|\|i.contentStartPos.height>i.canvasHeight+1)?(n.fancybox.stop(i.$content),i.$content.css("transition-duration",""),i.isPanning=!0):i.isSwiping=!0,i.$container.addClass("fancybox-controls--isGrabbing")),2!==i.startPoints.length\|\|u.isAnimating\|\|d.hasError\|\|"image"!==d.type\|\|!d.isLoaded&&!d.$ghost\|\|(i.canTap=!1,i.isSwiping=!1,i.isPanning=!1,i.isZooming=!0,n.fancybox.stop(i.$content),i.$content.css("transition-duration",""),i.centerPointStartX=.5(i.startPoints[0].x+i.startPoints[1].x)-n(t).scrollLeft(),i.centerPointStartY=.5(i.startPoints[0].y+i.startPoints[1].y)-n(t).scrollTop(),i.percentageOfImageAtPinchPointX=(i.centerPointStartX-i.contentStartPos.left)/i.contentStartPos.width,i.percentageOfImageAtPinchPointY=(i.centerPointStartY-i.contentStartPos.top)/i.contentStartPos.height,i.startDistanceBetweenFingers=s(i.startPoints[0],i.startPoints[1]))}}},u.prototype.onscroll=function(t){self.isScrolling=!0},u.prototype.ontouchmove=function(t){var e=this,o=n(t.target);return e.isScrolling\|\|!o.is(e.$stage)&&!e.$stage.find(o).length?void(e.canTap=!1):(e.newPoints=a(t),void((e.opts\|\|e.instance.canPan())&&e.newPoints&&e.newPoints.length&&(e.isSwiping&&e.isSwiping===!0\|\|t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=s(e.newPoints[0],e.startPoints[0],"y"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},u.prototype.onSwipe=function(e){var a,s=this,r=s.isSwiping,c=s.sliderStartPos.left\|\|0;if(r!==!0)"x"==r&&(s.distanceX>0&&(s.instance.group.length<2\|\|0===s.instance.current.index&&!s.instance.current.opts.loop)?c+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2\|\|s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?c-=Math.pow(-s.distanceX,.8):c+=s.distanceX),s.sliderLastPos={top:"x"==r?0:s.sliderStartPos.top+s.distanceY,left:c},s.requestId&&(i(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+os.canvasWidth+oe.opts.gutter})}),s.$container.addClass("fancybox-is-sliding"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,s.instance.group.length<2&&s.opts.vertical?s.isSwiping="y":s.instance.isDragging\|\|s.opts.vertical===!1\|\|"auto"===s.opts.vertical&&n(t).width()>800?s.isSwiping="x":(a=Math.abs(180Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=a>45&&a<135?"y":"x"),s.canTap=!1,"y"===s.isSwiping&&n.fancybox.isMobile&&(l(s.$target)\|\|l(s.$target.parent())))return void(s.isScrolling=!0);s.instance.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(s.instance.slides,function(t,e){n.fancybox.stop(e.$slide),e.$slide.css("transition-duration",""),e.inTransition=!1,e.pos===s.instance.current.pos&&(s.sliderStartPos.left=n.fancybox.getTranslate(e.$slide).left)}),s.instance.SlideShow&&s.instance.SlideShow.isActive&&s.instance.SlideShow.stop()}},u.prototype.onPan=function(){var t=this;return s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5)?void(t.startPoints=t.newPoints):(t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&(i(t.requestId),t.requestId=null),void(t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})))},u.prototype.limitMovement=function(){var t,e,n,o,i,a,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,u=s.distanceY,d=s.contentStartPos,f=d.left,p=d.top,h=d.width,g=d.height;return i=h>r?f+l:f,a=p+u,t=Math.max(0,.5r-.5h),e=Math.max(0,.5c-.5g),n=Math.min(r-h,.5r-.5h),o=Math.min(c-g,.5c-.5g),h>r&&(l>0&&i>t&&(i=t-1+Math.pow(-t+f+l,.8)\|\|0),l<0&&i<n&&(i=n+1-Math.pow(n-f-l,.8)\|\|0)),g>c&&(u>0&&a>e&&(a=e-1+Math.pow(-e+p+u,.8)\|\|0),u<0&&a<o&&(a=o+1-Math.pow(o-p-u,.8)\|\|0)),{top:a,left:i,scaleX:d.scaleX,scaleY:d.scaleY}},u.prototype.limitPosition=function(t,e,n,o){var i=this,a=i.canvasWidth,s=i.canvasHeight;return n>a?(t=t>0?0:t,t=t<a-n?a-n:t):t=Math.max(0,a/2-n/2),o>s?(e=e>0?0:e,e=e<s-o?s-o:e):e=Math.max(0,s/2-o/2),{top:e,left:t}},u.prototype.onZoom=function(){var e=this,a=e.contentStartPos.width,r=e.contentStartPos.height,c=e.contentStartPos.left,l=e.contentStartPos.top,u=s(e.newPoints[0],e.newPoints[1]),d=u/e.startDistanceBetweenFingers,f=Math.floor(ad),p=Math.floor(rd),h=(a-f)e.percentageOfImageAtPinchPointX,g=(r-p)e.percentageOfImageAtPinchPointY,b=(e.newPoints[0].x+e.newPoints[1].x)/2-n(t).scrollLeft(),m=(e.newPoints[0].y+e.newPoints[1].y)/2-n(t).scrollTop(),y=b-e.centerPointStartX,v=m-e.centerPointStartY,x=c+(h+y),w=l+(g+v),$={top:w,left:x,scaleX:e.contentStartPos.scaleXd,scaleY:e.contentStartPos.scaleYd};e.canTap=!1,e.newWidth=f,e.newHeight=p,e.contentLastPos=$,e.requestId&&(i(e.requestId),e.requestId=null),e.requestId=o(function(){n.fancybox.setTranslate(e.$content,e.contentLastPos)})},u.prototype.ontouchend=function(t){var o=this,s=Math.max((new Date).getTime()-o.startTime,1),r=o.isSwiping,c=o.isPanning,l=o.isZooming,u=o.isScrolling;return o.endPoints=a(t),o.$container.removeClass("fancybox-controls--isGrabbing"),n(e).off(".fb.touch"),e.removeEventListener("scroll",o.onscroll,!0),o.requestId&&(i(o.requestId),o.requestId=null),o.isSwiping=!1,o.isPanning=!1,o.isZooming=!1,o.isScrolling=!1,o.instance.isDragging=!1,o.canTap?o.onTap(t):(o.speed=366,o.velocityX=o.distanceX/s.5,o.velocityY=o.distanceY/s.5,o.speedX=Math.max(.5o.speed,Math.min(1.5o.speed,1/Math.abs(o.velocityX)o.speed)),void(c?o.endPanning():l?o.endZooming():o.endSwiping(r,u)))},u.prototype.endSwiping=function(t,e){var o=this,i=!1,a=o.instance.group.length;o.sliderLastPos=null,"y"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150o.velocityY,opacity:0},150),i=o.instance.close(!0,300)):"x"==t&&o.distanceX>50&&a>1?i=o.instance.previous(o.speedX):"x"==t&&o.distanceX<-50&&a>1&&(i=o.instance.next(o.speedX)),i!==!1\|\|"x"!=t&&"y"!=t\|\|(e\|\|a<2?o.instance.centerSlide(o.instance.current,150):o.instance.jumpTo(o.instance.current.index)),o.$container.removeClass("fancybox-is-sliding")},u.prototype.endPanning=function(){var t,e,o,i=this;i.contentLastPos&&(i.opts.momentum===!1?(t=i.contentLastPos.left,e=i.contentLastPos.top):(t=i.contentLastPos.left+i.velocityXi.speed,e=i.contentLastPos.top+i.velocityYi.speed),o=i.limitPosition(t,e,i.contentStartPos.width,i.contentStartPos.height),o.width=i.contentStartPos.width,o.height=i.contentStartPos.height,n.fancybox.animate(i.$content,o,330))},u.prototype.endZooming=function(){var t,e,o,i,a=this,s=a.instance.current,r=a.newWidth,c=a.newHeight;a.contentLastPos&&(t=a.contentLastPos.left,e=a.contentLastPos.top,i={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(a.$content,i),r<a.canvasWidth&&c<a.canvasHeight?a.instance.scaleToFit(150):r>s.width\|\|c>s.height?a.instance.scaleToActual(a.centerPointStartX,a.centerPointStartY,150):(o=a.limitPosition(t,e,r,c),n.fancybox.setTranslate(a.content,n.fancybox.getTranslate(a.$content)),n.fancybox.animate(a.$content,o,150)))},u.prototype.onTap=function(t){var e,o=this,i=n(t.target),s=o.instance,r=s.current,c=t&&a(t)\|\|o.startPoints,l=c[0]?c[0].x-o.$stage.offset().left:0,u=c[0]?c[0].y-o.$stage.offset().top:0,d=function(e){var i=r.opts[e];if(n.isFunction(i)&&(i=i.apply(s,[r,t])),i)switch(i){case"close":s.close(o.startEvent);break;case"toggleControls":s.toggleControls(!0);break;case"next":s.next();break;case"nextOrClose":s.group.length>1?s.next():s.close(o.startEvent);break;case"zoom":"image"==r.type&&(r.isLoaded\|\|r.$ghost)&&(s.canPan()?s.scaleToFit():s.isScaledDown()?s.scaleToActual(l,u):s.group.length<2&&s.close(o.startEvent))}};if((!t.originalEvent\|\|2!=t.originalEvent.button)&&(i.is("img")\|\|!(l>i[0].clientWidth+i.offset().left))){if(i.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container"))e="Outside";else if(i.is(".fancybox-slide"))e="Slide";else{if(!s.current.$content\|\|!s.current.$content.find(i).addBack().filter(i).length)return;e="Content"}if(o.tapped){if(clearTimeout(o.tapped),o.tapped=null,Math.abs(l-o.tapX)>50\|\|Math.abs(u-o.tapY)>50)return this;d("dblclick"+e)}else o.tapX=l,o.tapY=u,r.opts["dblclick"+e]&&r.opts["dblclick"+e]!==r.opts["click"+e]?o.tapped=setTimeout(function(){o.tapped=null,d("click"+e)},500):d("click"+e);return this}},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new u(e))})}(window,document,window.jQuery\|\|jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:'<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}"><svg viewBox="0 0 40 40"><path d="M13,12 L27,20 L13,27 Z" /><path d="M15,10 v19 M23,10 v19" /></svg></button>'},slideShow:{autoStart:!1,speed:3e3}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this;t.$button=t.instance.$refs.toolbar.find("[data-fancybox-play]").on("click",function(){t.toggle()}),(t.instance.group.length<2\|\|!t.instance.group[t.instance.currIndex].opts.slideShow)&&t.$button.hide()},set:function(t){var e=this;e.instance&&e.instance.current&&(t===!0\|\|e.instance.current.opts.loop\|\|e.instance.currIndex<e.instance.group.length-1)?e.timer=setTimeout(function(){e.isActive&&e.instance.jumpTo((e.instance.currIndex+1)%e.instance.group.length)},e.instance.current.opts.slideShow.speed):(e.stop(),e.instance.idleSecondsCounter=0,e.instance.showControls())},clear:function(){var t=this;clearTimeout(t.timer),t.timer=null},start:function(){var t=this,e=t.instance.current;e&&(t.isActive=!0,t.$button.attr("title",e.opts.i18n[e.opts.lang].PLAY_STOP).removeClass("fancybox-button--play").addClass("fancybox-button--pause"),t.set(!0))},stop:function(){var t=this,e=t.instance.current;t.clear(),t.$button.attr("title",e.opts.i18n[e.opts.lang].PLAY_START).removeClass("fancybox-button--pause").addClass("fancybox-button--play"),t.isActive=!1},toggle:function(){var t=this;t.isActive?t.stop():t.start()}}),e(t).on({"onInit.fb":function(t,e){e&&!e.SlideShow&&(e.SlideShow=new n(e))},"beforeShow.fb":function(t,e,n,o){var i=e&&e.SlideShow;o?i&&n.opts.slideShow.autoStart&&i.start():i&&i.isActive&&i.clear()},"afterShow.fb":function(t,e,n){var o=e&&e.SlideShow;o&&o.isActive&&o.set()},"afterKeydown.fb":function(n,o,i,a,s){var r=o&&o.SlideShow;!r\|\|!i.opts.slideShow\|\|80!==s&&32!==s\|\|e(t.activeElement).is("button,a,input")\|\|(a.preventDefault(),r.toggle())},"beforeClose.fb onDeactivate.fb":function(t,e){var n=e&&e.SlideShow;n&&n.stop()}}),e(t).on("visibilitychange",function(){var n=e.fancybox.getInstance(),o=n&&n.SlideShow;o&&o.isActive&&(t.hidden?o.clear():o.set())})}(document,window.jQuery\|\|jQuery),function(t,e){"use strict";var n=function(){var e,n,o,i=[["requestFullscreen","exitFullscreen","fullscreenElement","fullscreenEnabled","fullscreenchange","fullscreenerror"],["webkitRequestFullscreen","webkitExitFullscreen","webkitFullscreenElement","webkitFullscreenEnabled","webkitfullscreenchange","webkitfullscreenerror"],["webkitRequestFullScreen","webkitCancelFullScreen","webkitCurrentFullScreenElement","webkitCancelFullScreen","webkitfullscreenchange","webkitfullscreenerror"],["mozRequestFullScreen","mozCancelFullScreen","mozFullScreenElement","mozFullScreenEnabled","mozfullscreenchange","mozfullscreenerror"],["msRequestFullscreen","msExitFullscreen","msFullscreenElement","msFullscreenEnabled","MSFullscreenChange","MSFullscreenError"]],a={};for(n=0;n<i.length;n++)if(e=i[n],e&&e[1]in t){for(o=0;o<e.length;o++)a[i[0][o]]=e[o];return a}return!1}();if(!n)return void(e&&e.fancybox&&(e.fancybox.defaults.btnTpl.fullScreen=!1));var o={request:function(e){e=e\|\|t.documentElement,e[n.requestFullscreen](e.ALLOW_KEYBOARD_INPUT)},exit:function(){t[n.exitFullscreen]()},toggle:function(e){e=e\|\|t.documentElement,this.isFullscreen()?this.exit():this.request(e)},isFullscreen:function(){return Boolean(t[n.fullscreenElement])},enabled:function(){return Boolean(t[n.fullscreenEnabled])}};e.extend(!0,e.fancybox.defaults,{btnTpl:{fullScreen:'<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fullscreen" title="{{FULL_SCREEN}}"><svg viewBox="0 0 40 40"><path d="M9,12 h22 v16 h-22 v-16 v16 h22 v-16 Z" /></svg></button>'},fullScreen:{autoStart:!1}}),e(t).on({"onInit.fb":function(t,e){var n;e&&e.group[e.currIndex].opts.fullScreen?(n=e.$refs.container,n.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle(n[0])}),e.opts.fullScreen&&e.opts.fullScreen.autoStart===!0&&o.request(n[0]),e.FullScreen=o):e&&e.$refs.toolbar.find("[data-fancybox-fullscreen]").hide()},"afterKeydown.fb":function(t,e,n,o,i){e&&e.FullScreen&&70===i&&(o.preventDefault(),e.FullScreen.toggle(e.$refs.container[0]))},"beforeClose.fb":function(t){t&&t.FullScreen&&o.exit()}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&"image"===n.current.type&&n.isAnimating&&(n.current.$content.css("transition","none"),n.isAnimating=!1,n.update(!0,!0,0)),n.trigger("onFullscreenChange",t),n.$refs.container.toggleClass("fancybox-is-fullscreen",t))})}(document,window.jQuery\|\|jQuery),function(t,e){"use strict";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:'<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}"><svg viewBox="0 0 120 120"><path d="M30,30 h14 v14 h-14 Z M50,30 h14 v14 h-14 Z M70,30 h14 v14 h-14 Z M30,50 h14 v14 h-14 Z M50,50 h14 v14 h-14 Z M70,50 h14 v14 h-14 Z M30,70 h14 v14 h-14 Z M50,70 h14 v14 h-14 Z M70,70 h14 v14 h-14 Z" /></svg></button>'},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"}},e.fancybox.defaults);var n=function(t){this.init(t)};e.extend(n.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this;e.instance=t,t.Thumbs=e;var n=t.group[0],o=t.group[1];e.opts=t.group[t.currIndex].opts.thumbs,e.$button=t.$refs.toolbar.find("[data-fancybox-thumbs]"),e.opts&&n&&o&&("image"==n.type\|\|n.opts.thumb\|\|n.opts.$thumb)&&("image"==o.type\|\|o.opts.thumb\|\|o.opts.$thumb)?(e.$button.show().on("click",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,n,o=this,i=o.instance,a=o.opts.parentEl;o.$grid=e('<div class="fancybox-thumbs fancybox-thumbs-'+o.opts.axis+'"></div>').appendTo(i.$refs.container.find(a).addBack().filter(a)),t="<ul>",e.each(i.group,function(e,o){n=o.opts.thumb\|\|(o.opts.$thumb?o.opts.$thumb.attr("src"):null),n\|\|"image"!==o.type\|\|(n=o.src),n&&n.length&&(t+='<li data-index="'+e+'" tabindex="0" class="fancybox-thumbs-loading"><img data-src="'+n+'" /></li>')}),t+="</ul>",o.$list=e(t).appendTo(o.$grid).on("click","li",function(){i.jumpTo(e(this).data("index"))}),o.$list.find("img").hide().one("load",function(){var t,n,o,i,a=e(this).parent().removeClass("fancybox-thumbs-loading"),s=a.outerWidth(),r=a.outerHeight();t=this.naturalWidth\|\|this.width,n=this.naturalHeight\|\|this.height,o=t/s,i=n/r,o>=1&&i>=1&&(o>i?(t/=i,n=r):(t=s,n/=o)),e(this).css({width:Math.floor(t),height:Math.floor(n),"margin-top":n>r?Math.floor(.3r-.3n):Math.floor(.5r-.5n),"margin-left":Math.floor(.5s-.5t)}).show()}).each(function(){this.src=e(this).data("src")}),"x"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css("padding-right"))+i.group.length*o.$list.children().eq(0).outerWidth(!0)+"px")},focus:function(t){var e,n,o=this,i=o.$list;o.instance.current&&(e=i.children().removeClass("fancybox-thumbs-active").filter('[data-index="'+o.instance.current.index+'"]').addClass("fancybox-thumbs-active"),n=e.position(),"y"===o.opts.axis&&(n.top<0\|\|n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):"x"===o.opts.axis&&(n.left<i.parent().scrollLeft()\|\|n.left>i.parent().scrollLeft()+(i.parent().width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){this.instance.$refs.container.toggleClass("fancybox-show-thumbs",this.isVisible),this.isVisible?(this.$grid\|\|this.create(),this.instance.trigger("onThumbsShow"),this.focus(0)):this.$grid&&this.instance.trigger("onThumbsHide"),this.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({"onInit.fb":function(t,e){var o;e&&!e.Thumbs&&(o=new n(e),o.isActive&&o.opts.autoStart===!0&&o.show())},"beforeShow.fb":function(t,e,n,o){var i=e&&e.Thumbs;i&&i.isVisible&&i.focus(o?0:250)},"afterKeydown.fb":function(t,e,n,o,i){var a=e&&e.Thumbs;a&&a.isActive&&71===i&&(o.preventDefault(),a.toggle())},"beforeClose.fb":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&n.opts.hideOnClose!==!1&&n.$grid.hide()}})}(document,window.jQuery),function(t,e){"use strict";function n(t){var e={"&":"&","<":"<",">":">",'"':""","'":"'","/":"/","`":"`","=":"="};return String(t).replace(/[&<>"'`=\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:'<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}"><svg viewBox="0 0 40 40"><path d="M6,30 C8,18 19,16 23,16 L23,16 L23,10 L33,20 L23,29 L23,24 C19,24 8,27 6,30 Z"></svg></button>'},share:{tpl:'<div class="fancybox-share"><h1>{{SHARE}}</h1><p class="fancybox-share__links"><a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg><span>Facebook</span></a><a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg><span>Pinterest</span></a><a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg><span>Twitter</span></a></p><p><input class="fancybox-share__input" type="text" value="{{url_raw}}" /></p></div>'}}),e(t).on("click","[data-fancybox-share]",function(){var t,o,i=e.fancybox.getInstance();i&&(t=i.current.opts.hash===!1?i.current.src:window.location,o=i.current.opts.share.tpl.replace(/\{\{media\}\}/g,"image"===i.current.type?encodeURIComponent(i.current.src):"").replace(/\{\{url\}\}/g,encodeURIComponent(t)).replace(/\{\{url_raw\}\}/g,n(t)).replace(/\{\{descr\}\}/g,i.$caption?encodeURIComponent(i.$caption.text()):""),e.fancybox.open({src:i.translate(i,o),type:"html",opts:{animationEffect:"fade",animationDuration:250,afterLoad:function(t,e){e.$content.find(".fancybox-share__links a").click(function(){return window.open(this.href,"Share","width=550, height=450"),!1})}}}))})}(document,window.jQuery\|\|jQuery),function(t,e,n){"use strict";function o(){var t=e.location.hash.substr(1),n=t.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)\|\|1:1,i=n.join("-");return o<1&&(o=1),{hash:t,index:o,gallery:i}}function i(t){var e;""!==t.gallery&&(e=n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1),e.length\|\|(e=n("#"+n.escapeSelector(t.gallery))),e.length&&(s=!1,e.trigger("click")))}function a(t){var e;return!!t&&(e=t.current?t.current.opts:t.opts,e.hash\|\|(e.$orig?e.$orig.data("fancybox"):""))}n.escapeSelector\|\|(n.escapeSelector=function(t){var e=/([\0-\x1f\x7f]\|^-?\d)\|^-$\|[^\x80-\uFFFF\w-]/g,n=function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t};return(t+"").replace(e,n)});var s=!0,r=null,c=null;n(function(){n.fancybox.defaults.hash!==!1&&(n(t).on({"onInit.fb":function(t,e){var n,i;e.group[e.currIndex].opts.hash!==!1&&(n=o(),i=a(e),i&&n.gallery&&i==n.gallery&&(e.currIndex=n.index-1))},"beforeShow.fb":function(n,o,i){var l;i&&i.opts.hash!==!1&&(l=a(o),l&&""!==l&&(e.location.hash.indexOf(l)<0&&(o.opts.origHash=e.location.hash),r=l+(o.group.length>1?"-"+(i.index+1):""),"replaceState"in e.history?(c&&clearTimeout(c),c=setTimeout(function(){e.history[s?"pushState":"replaceState"]({},t.title,e.location.pathname+e.location.search+"#"+r),c=null,s=!1},300)):e.location.hash=r))},"beforeClose.fb":function(o,i,s){var l,u;c&&clearTimeout(c),s.opts.hash!==!1&&(l=a(i),u=i&&i.opts.origHash?i.opts.origHash:"",l&&""!==l&&("replaceState"in history?e.history.replaceState({},t.title,e.location.pathname+e.location.search+u):(e.location.hash=u,n(e).scrollTop(i.scrollTop).scrollLeft(i.scrollLeft))),r=null)}}),n(e).on("hashchange.fb",function(){var t=o();n.fancybox.getInstance()?!r\|\|r===t.gallery+"-"+t.index\|\|1===t.index&&r==t.gallery\|\|(r=null,n.fancybox.close()):""!==t.gallery&&i(t)}),setTimeout(function(){i(o())},50))})}(document,window,window.jQuery\|\|jQuery),function(t,e){"use strict";var n=(new Date).getTime();e(t).on({"onInit.fb":function(t,e,o){e.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll",function(t){var o=e.current,i=(new Date).getTime();e.group.length<1\|\|o.opts.wheel===!1\|\|"auto"===o.opts.wheel&&"image"!==o.type\|\|(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass("fancybox-animated")\|\|(t=t.originalEvent\|\|t,i-n<250\|\|(n=i,e[(-t.deltaY\|\|-t.deltaX\|\|t.wheelDelta\|\|-t.detail)<0?"next":"previous"]())))})}})}(document,window.jQuery\|\|jQuery);

resources/js/jquery.steps.min.js ADDED Viewed

	@@ -0,0 +1,6 @@


1	+ /*!
2	+ * jQuery Steps v1.1.0 - 09/04/2014
3	+ * Copyright (c) 2014 Rafael Staib (http://www.jquery-steps.com)
4	+ * Licensed under MIT http://www.opensource.org/licenses/MIT
5	+ */
6	+ !function(a,b){function c(a,b){o(a).push(b)}function d(d,e,f){var g=d.children(e.headerTag),h=d.children(e.bodyTag);g.length>h.length?R(Z,"contents"):g.length<h.length&&R(Z,"titles");var i=e.startIndex;if(f.stepCount=g.length,e.saveState&&a.cookie){var j=a.cookie(U+q(d)),k=parseInt(j,0);!isNaN(k)&&k<f.stepCount&&(i=k)}f.currentIndex=i,g.each(function(e){var f=a(this),g=h.eq(e),i=g.data("mode"),j=null==i?$.html:r($,/^\s$/.test(i)\|\|isNaN(i)?i:parseInt(i,0)),k=j===$.html\|\|g.data("url")===b?"":g.data("url"),l=j!==$.html&&"1"===g.data("loaded"),m=a.extend({},bb,{title:f.html(),content:j===$.html?g.html():"",contentUrl:k,contentMode:j,contentLoaded:l});c(d,m)})}function e(a){a.triggerHandler("canceled")}function f(a,b){return a.currentIndex-b}function g(b,c){var d=i(b);b.unbind(d).removeData("uid").removeData("options").removeData("state").removeData("steps").removeData("eventNamespace").find(".actions a").unbind(d),b.removeClass(c.clearFixCssClass+" vertical");var e=b.find(".content > ");e.removeData("loaded").removeData("mode").removeData("url"),e.removeAttr("id").removeAttr("role").removeAttr("tabindex").removeAttr("class").removeAttr("style")._removeAria("labelledby")._removeAria("hidden"),b.find(".content > [data-mode='async'],.content > [data-mode='iframe']").empty();var f=a('<{0} class="{1}"></{0}>'.format(b.get(0).tagName,b.attr("class"))),g=b._id();return null!=g&&""!==g&&f._id(g),f.html(b.find(".content").html()),b.after(f),b.remove(),f}function h(a,b){var c=a.find(".steps li").eq(b.currentIndex);a.triggerHandler("finishing",[b.currentIndex])?(c.addClass("done").removeClass("error"),a.triggerHandler("finished",[b.currentIndex])):c.addClass("error")}function i(a){var b=a.data("eventNamespace");return null==b&&(b="."+q(a),a.data("eventNamespace",b)),b}function j(a,b){var c=q(a);return a.find("#"+c+V+b)}function k(a,b){var c=q(a);return a.find("#"+c+W+b)}function l(a,b){var c=q(a);return a.find("#"+c+X+b)}function m(a){return a.data("options")}function n(a){return a.data("state")}function o(a){return a.data("steps")}function p(a,b){var c=o(a);return(0>b\|\|b>=c.length)&&R(Y),c[b]}function q(a){var b=a.data("uid");return null==b&&(b=a._id(),null==b&&(b="steps-uid-".concat(T),a._id(b)),T++,a.data("uid",b)),b}function r(a,c){if(S("enumType",a),S("keyOrValue",c),"string"==typeof c){var d=a[c];return d===b&&R("The enum key '{0}' does not exist.",c),d}if("number"==typeof c){for(var e in a)if(a[e]===c)return c;R("Invalid enum value '{0}'.",c)}else R("Invalid key or value type.")}function s(a,b,c){return B(a,b,c,v(c,1))}function t(a,b,c){return B(a,b,c,f(c,1))}function u(a,b,c,d){if((0>d\|\|d>=c.stepCount)&&R(Y),!(b.forceMoveForward&&d<c.currentIndex)){var e=c.currentIndex;return a.triggerHandler("stepChanging",[c.currentIndex,d])?(c.currentIndex=d,O(a,b,c),E(a,b,c,e),D(a,b,c),A(a,b,c),P(a,b,c,d,e,function(){a.triggerHandler("stepChanged",[d,e])})):a.find(".steps li").eq(e).addClass("error"),!0}}function v(a,b){return a.currentIndex+b}function w(b){var c=a.extend(!0,{},cb,b);return this.each(function(){var b=a(this),e={currentIndex:c.startIndex,currentStep:null,stepCount:0,transitionElement:null};b.data("options",c),b.data("state",e),b.data("steps",[]),d(b,c,e),J(b,c,e),G(b,c),c.autoFocus&&0===T&&j(b,c.startIndex).focus(),b.triggerHandler("init",[c.startIndex])})}function x(b,c,d,e,f){(0>e\|\|e>d.stepCount)&&R(Y),f=a.extend({},bb,f),y(b,e,f),d.currentIndex!==d.stepCount&&d.currentIndex>=e&&(d.currentIndex++,O(b,c,d)),d.stepCount++;var g=b.find(".content"),h=a("<{0}>{1}</{0}>".format(c.headerTag,f.title)),i=a("<{0}></{0}>".format(c.bodyTag));return(null==f.contentMode\|\|f.contentMode===$.html)&&i.html(f.content),0===e?g.prepend(i).prepend(h):k(b,e-1).after(i).after(h),K(b,d,i,e),N(b,c,d,h,e),F(b,c,d,e),e===d.currentIndex&&E(b,c,d),D(b,c,d),b}function y(a,b,c){o(a).splice(b,0,c)}function z(b){var c=a(this),d=m(c),e=n(c);if(d.suppressPaginationOnFocus&&c.find(":focus").is(":input"))return b.preventDefault(),!1;var f={left:37,right:39};b.keyCode===f.left?(b.preventDefault(),t(c,d,e)):b.keyCode===f.right&&(b.preventDefault(),s(c,d,e))}function A(b,c,d){if(d.stepCount>0){var e=d.currentIndex,f=p(b,e);if(!c.enableContentCache\|\|!f.contentLoaded)switch(r($,f.contentMode)){case $.iframe:b.find(".content > .body").eq(d.currentIndex).empty().html('<iframe src="'+f.contentUrl+'" frameborder="0" scrolling="no" />').data("loaded","1");break;case $.async:var g=k(b,e)._aria("busy","true").empty().append(M(c.loadingTemplate,{text:c.labels.loading}));a.ajax({url:f.contentUrl,cache:!1}).done(function(a){g.empty().html(a)._aria("busy","false").data("loaded","1"),b.triggerHandler("contentLoaded",[e])})}}}function B(a,b,c,d){var e=c.currentIndex;if(d>=0&&d<c.stepCount&&!(b.forceMoveForward&&d<c.currentIndex)){var f=j(a,d),g=f.parent(),h=g.hasClass("disabled");return g._enableAria(),f.click(),e===c.currentIndex&&h?(g._enableAria(!1),!1):!0}return!1}function C(b){b.preventDefault();var c=a(this),d=c.parent().parent().parent().parent(),f=m(d),g=n(d),i=c.attr("href");switch(i.substring(i.lastIndexOf("#")+1)){case"cancel":e(d);break;case"finish":h(d,g);break;case"next":s(d,f,g);break;case"previous":t(d,f,g)}}function D(a,b,c){if(b.enablePagination){var d=a.find(".actions a[href$='#finish']").parent(),e=a.find(".actions a[href$='#next']").parent();if(!b.forceMoveForward){var f=a.find(".actions a[href$='#previous']").parent();f._enableAria(c.currentIndex>0)}b.enableFinishButton&&b.showFinishButtonAlways?(d._enableAria(c.stepCount>0),e._enableAria(c.stepCount>1&&c.stepCount>c.currentIndex+1)):(d._showAria(b.enableFinishButton&&c.stepCount===c.currentIndex+1),e._showAria(0===c.stepCount\|\|c.stepCount>c.currentIndex+1)._enableAria(c.stepCount>c.currentIndex+1\|\|!b.enableFinishButton))}}function E(b,c,d,e){var f=j(b,d.currentIndex),g=a('<span class="current-info audible">'+c.labels.current+" </span>"),h=b.find(".content > .title");if(null!=e){var i=j(b,e);i.parent().addClass("done").removeClass("error")._selectAria(!1),h.eq(e).removeClass("current").next(".body").removeClass("current"),g=i.find(".current-info"),f.focus()}f.prepend(g).parent()._selectAria().removeClass("done")._enableAria(),h.eq(d.currentIndex).addClass("current").next(".body").addClass("current")}function F(a,b,c,d){for(var e=q(a),f=d;f<c.stepCount;f++){var g=e+V+f,h=e+W+f,i=e+X+f,j=a.find(".title").eq(f)._id(i);a.find(".steps a").eq(f)._id(g)._aria("controls",h).attr("href","#"+i).html(M(b.titleTemplate,{index:f+1,title:j.html()})),a.find(".body").eq(f)._id(h)._aria("labelledby",i)}}function G(a,b){var c=i(a);a.bind("canceled"+c,b.onCanceled),a.bind("contentLoaded"+c,b.onContentLoaded),a.bind("finishing"+c,b.onFinishing),a.bind("finished"+c,b.onFinished),a.bind("init"+c,b.onInit),a.bind("stepChanging"+c,b.onStepChanging),a.bind("stepChanged"+c,b.onStepChanged),b.enableKeyNavigation&&a.bind("keyup"+c,z),a.find(".actions a").bind("click"+c,C)}function H(a,b,c,d){return 0>d\|\|d>=c.stepCount\|\|c.currentIndex===d?!1:(I(a,d),c.currentIndex>d&&(c.currentIndex--,O(a,b,c)),c.stepCount--,l(a,d).remove(),k(a,d).remove(),j(a,d).parent().remove(),0===d&&a.find(".steps li").first().addClass("first"),d===c.stepCount&&a.find(".steps li").eq(d).addClass("last"),F(a,b,c,d),D(a,b,c),!0)}function I(a,b){o(a).splice(b,1)}function J(b,c,d){var e='<{0} class="{1}">{2}</{0}>',f=r(_,c.stepsOrientation),g=f===_.vertical?" vertical":"",h=a(e.format(c.contentContainerTag,"content "+c.clearFixCssClass,b.html())),i=a(e.format(c.stepsContainerTag,"steps "+c.clearFixCssClass,'<ul role="tablist"></ul>')),j=h.children(c.headerTag),k=h.children(c.bodyTag);b.attr("role","application").empty().append(i).append(h).addClass(c.cssClass+" "+c.clearFixCssClass+g),k.each(function(c){K(b,d,a(this),c)}),j.each(function(e){N(b,c,d,a(this),e)}),E(b,c,d),L(b,c,d)}function K(a,b,c,d){var e=q(a),f=e+W+d,g=e+X+d;c._id(f).attr("role","tabpanel")._aria("labelledby",g).addClass("body")._showAria(b.currentIndex===d)}function L(a,b,c){if(b.enablePagination){var d='<{0} class="actions {1}"><ul role="menu" aria-label="{2}">{3}</ul></{0}>',e='<li><a href="#{0}" role="menuitem">{1}</a></li>',f="";b.forceMoveForward\|\|(f+=e.format("previous",b.labels.previous)),f+=e.format("next",b.labels.next),b.enableFinishButton&&(f+=e.format("finish",b.labels.finish)),b.enableCancelButton&&(f+=e.format("cancel",b.labels.cancel)),a.append(d.format(b.actionContainerTag,b.clearFixCssClass,b.labels.pagination,f)),D(a,b,c),A(a,b,c)}}function M(a,c){for(var d=a.match(/#([a-z]*)#/gi),e=0;e<d.length;e++){var f=d[e],g=f.substring(1,f.length-1);c[g]===b&&R("The key '{0}' does not exist in the substitute collection!",g),a=a.replace(f,c[g])}return a}function N(b,c,d,e,f){var g=q(b),h=g+V+f,j=g+W+f,k=g+X+f,l=b.find(".steps > ul"),m=M(c.titleTemplate,{index:f+1,title:e.html()}),n=a('<li role="tab"><a id="'+h+'" href="#'+k+'" aria-controls="'+j+'">'+m+"</a></li>");n._enableAria(c.enableAllSteps\|\|d.currentIndex>f),d.currentIndex>f&&n.addClass("done"),e._id(k).attr("tabindex","-1").addClass("title"),0===f?l.prepend(n):l.find("li").eq(f-1).after(n),0===f&&l.find("li").removeClass("first").eq(f).addClass("first"),f===d.stepCount-1&&l.find("li").removeClass("last").eq(f).addClass("last"),n.children("a").bind("click"+i(b),Q)}function O(b,c,d){c.saveState&&a.cookie&&a.cookie(U+q(b),d.currentIndex)}function P(b,c,d,e,f,g){var h=b.find(".content > .body"),i=r(ab,c.transitionEffect),j=c.transitionEffectSpeed,k=h.eq(e),l=h.eq(f);switch(i){case ab.fade:case ab.slide:var m=i===ab.fade?"fadeOut":"slideUp",o=i===ab.fade?"fadeIn":"slideDown";d.transitionElement=k,l[m](j,function(){var b=a(this)._showAria(!1).parent().parent(),c=n(b);c.transitionElement&&(c.transitionElement[o](j,function(){a(this)._showAria()}).promise().done(g),c.transitionElement=null)});break;case ab.slideLeft:var p=l.outerWidth(!0),q=e>f?-p:p,s=e>f?p:-p;a.when(l.animate({left:q},j,function(){a(this)._showAria(!1)}),k.css("left",s+"px")._showAria().animate({left:0},j)).done(g);break;default:a.when(l._showAria(!1),k._showAria()).done(g)}}function Q(b){b.preventDefault();var c=a(this),d=c.parent().parent().parent().parent(),e=m(d),f=n(d),g=f.currentIndex;if(c.parent().is(":not(.disabled):not(.current)")){var h=c.attr("href"),i=parseInt(h.substring(h.lastIndexOf("-")+1),0);u(d,e,f,i)}return g===f.currentIndex?(j(d,g).focus(),!1):void 0}function R(a){throw arguments.length>1&&(a=a.format(Array.prototype.slice.call(arguments,1))),new Error(a)}function S(a,b){null==b&&R("The argument '{0}' is null or undefined.",a)}a.fn.extend({_aria:function(a,b){return this.attr("aria-"+a,b)},_removeAria:function(a){return this.removeAttr("aria-"+a)},_enableAria:function(a){return null==a\|\|a?this.removeClass("disabled")._aria("disabled","false"):this.addClass("disabled")._aria("disabled","true")},_showAria:function(a){return null==a\|\|a?this.show()._aria("hidden","false"):this.hide()._aria("hidden","true")},_selectAria:function(a){return null==a\|\|a?this.addClass("current")._aria("selected","true"):this.removeClass("current")._aria("selected","false")},_id:function(a){return a?this.attr("id",a):this.attr("id")}}),String.prototype.format\|\|(String.prototype.format=function(){for(var b=1===arguments.length&&a.isArray(arguments[0])?arguments[0]:arguments,c=this,d=0;d<b.length;d++){var e=new RegExp("\\{"+d+"\\}","gm");c=c.replace(e,b[d])}return c});var T=0,U="jQu3ry_5teps_St@te_",V="-t-",W="-p-",X="-h-",Y="Index out of range.",Z="One or more corresponding step {0} are missing.";a.fn.steps=function(b){return a.fn.steps[b]?a.fn.steps[b].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof b&&b?void a.error("Method "+b+" does not exist on jQuery.steps"):w.apply(this,arguments)},a.fn.steps.add=function(a){var b=n(this);return x(this,m(this),b,b.stepCount,a)},a.fn.steps.destroy=function(){return g(this,m(this))},a.fn.steps.finish=function(){h(this,n(this))},a.fn.steps.getCurrentIndex=function(){return n(this).currentIndex},a.fn.steps.getCurrentStep=function(){return p(this,n(this).currentIndex)},a.fn.steps.getStep=function(a){return p(this,a)},a.fn.steps.insert=function(a,b){return x(this,m(this),n(this),a,b)},a.fn.steps.next=function(){return s(this,m(this),n(this))},a.fn.steps.previous=function(){return t(this,m(this),n(this))},a.fn.steps.remove=function(a){return H(this,m(this),n(this),a)},a.fn.steps.setStep=function(){throw new Error("Not yet implemented!")},a.fn.steps.skip=function(){throw new Error("Not yet implemented!")};var $=a.fn.steps.contentMode={html:0,iframe:1,async:2},_=a.fn.steps.stepsOrientation={horizontal:0,vertical:1},ab=a.fn.steps.transitionEffect={none:0,fade:1,slide:2,slideLeft:3},bb=a.fn.steps.stepModel={title:"",content:"",contentUrl:"",contentMode:$.html,contentLoaded:!1},cb=a.fn.steps.defaults={headerTag:"h1",bodyTag:"div",contentContainerTag:"div",actionContainerTag:"div",stepsContainerTag:"div",cssClass:"wizard",clearFixCssClass:"clearfix",stepsOrientation:_.horizontal,titleTemplate:'<span class="number">#index#.</span> #title#',loadingTemplate:'<span class="spinner"></span> #text#',autoFocus:!1,enableAllSteps:!1,enableKeyNavigation:!0,enablePagination:!0,suppressPaginationOnFocus:!0,enableContentCache:!0,enableCancelButton:!1,enableFinishButton:!0,preloadContent:!1,showFinishButtonAlways:!1,forceMoveForward:!1,saveState:!1,startIndex:0,transitionEffect:ab.none,transitionEffectSpeed:200,onStepChanging:function(){return!0},onStepChanged:function(){},onCanceled:function(){},onFinishing:function(){return!0},onFinished:function(){},onContentLoaded:function(){},onInit:function(){},labels:{cancel:"Cancel",current:"current step:",pagination:"Pagination",finish:"Finish",next:"Next",previous:"Previous",loading:"Loading ..."}}}(jQuery);

resources/js/wizard.js ADDED Viewed

File without changes

src/common/icwp-data.php CHANGED Viewed

@@ -1,573 +1,622 @@
             <?php
-            -
            if ( !class_exists( 'ICWP_WPSF_DataProcessor', false ) ):
-            -
            	class ICWP_WPSF_DataProcessor extends ICWP_WPSF_Foundation {
-            -
            		/**
-            -
            		 * @var ICWP_WPSF_DataProcessor
-            -
            		 */
-            -
            		protected static $oInstance = null;
-            -
            		/**
-            -
            		 * @var bool
-            -
            		 */
-            -
            		public static $bUseFilterInput = false;
-            -
            		/**
-            -
            		 * @var integer
-            -
            		 */
-            -
            		protected static $nRequestTime;
-            -
            		/**
-            -
            		 * @var array
-            -
            		 */
-            -
            		protected $aRequestUriParts;
-            -
            		protected function __construct() {
-            -
            		}
-            -
            		/**
-            -
            		 * @return ICWP_WPSF_DataProcessor
-            -
            		 */
-            -
            		public static function GetInstance() {
-            -
            			if ( is_null( self::$oInstance ) ) {
-            -
            				self::$oInstance = new self();
-            -
            			}
-            -
            			return self::$oInstance;
-            -
            		}
-            -
            		/**
-            -
            		 * @return int
-            -
            		 */
-            -
            		public static function GetRequestTime() {
-            -
            			if ( empty( self::$nRequestTime ) ) {
-            -
            				self::$nRequestTime = time();
-            -
            			}
-            -
            			return self::$nRequestTime;
+            		}
-            -
            		/**
-            -
            		 * @param array $aArray1
-            -
            		 * @param array $aArray2
-            -
            		 * @return array
-            -
            		 */
-            -
            		public function mergeArraysRecursive( $aArray1, $aArray2 ) {
-            -
            			foreach ( $aArray2 as $key => $Value ) {
-            -
            				if ( array_key_exists( $key, $aArray1 ) && is_array( $Value ) ) {
-            -
            					$aArray1[ $key ] = $this->mergeArraysRecursive( $aArray1[ $key ], $aArray2[ $key ] );
-            -
            				}
-            -
            				else {
-            -
            					$aArray1[ $key ] = $Value;
-            -
            				}
-            -
            			}
-            -
            			return $aArray1;
-            -
            		}
-            -
            		/**
-            -
            		 * @return string URI Path in lowercase
-            -
            		 */
-            -
            		public function getRequestPath() {
-            -
            			$aRequestParts = $this->getRequestUriParts();
-            -
            			return $aRequestParts[ 'path' ];
-            -
            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getRequestUri() {
-            -
            			return $this->FetchServer( 'REQUEST_URI' );
+            		}
-            -
            		/**
-            -
            		 * @param bool $bIncludeCookie
-            -
            		 * @return array
-            -
            		 */
-            -
            		public function getRawRequestParams( $bIncludeCookie = true ) {
-            -
            			$aParams = array_merge( $_GET, $_POST );
-            -
            			return $bIncludeCookie ? array_merge( $aParams, $_COOKIE ) : $aParams;
+            		}
-            -
            		/**
-            -
            		 * @return array
-            -
            		 */
-            -
            		public function getRequestUriParts() {
-            -
            			if ( !isset( $this->aRequestUriParts ) ) {
-            -
            				$aExploded = explode( '?', $this->getRequestUri(), 2 );
-            -
            				$this->aRequestUriParts = array(
-            -
            					'path' => empty( $aExploded[ 0 ] ) ? '' : $aExploded[ 0 ],
-            -
            					'query' => empty( $aExploded[ 1 ] ) ? '' : $aExploded[ 1 ],
-            -
            				);
-            -
            			}
-            -
            			return $this->aRequestUriParts;
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sPath
-            -
            		 * @param string $sExtensionToAdd
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function addExtensionToFilePath( $sPath, $sExtensionToAdd ) {
-            -
            			if ( strpos( $sExtensionToAdd, '.' ) === false ) {
-            -
            				$sExtensionToAdd = '.' . $sExtensionToAdd;
-            -
            			}
-            -
            			if ( !$this->getIfStringEndsIn( $sPath, $sExtensionToAdd ) ) {
-            -
            				$sPath = $sPath . $sExtensionToAdd;
+            			}
-            -
            			return $sPath;
+            		}
-            -
            		/**
-            -
            		 * @param string $sHaystack
-            -
            		 * @param string $sNeedle
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function getIfStringEndsIn( $sHaystack, $sNeedle ) {
-            -
            			$nNeedleLength = strlen( $sNeedle );
-            -
            			$sStringEndsIn = substr( $sHaystack, strlen( $sHaystack ) - $nNeedleLength, $nNeedleLength );
-            -
            			return ( $sStringEndsIn == $sNeedle );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sPath
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getExtension( $sPath ) {
-            -
            			$nLastPeriod = strrpos( $sPath, '.' );
-            -
            			return ( $nLastPeriod === false ) ? $sPath : str_replace( '.', '', substr( $sPath, $nLastPeriod ) );
-            -
            		}
-            -
            		/**
-            -
            		 * @return boolean
-            -
            		 */
-            -
            		public function validEmail( $sEmail ) {
-            -
            			return ( !empty( $sEmail ) && function_exists( 'is_email' ) && is_email( $sEmail ) );
+            		}
-            -
            		/**
-            -
            		 * @param string $sRawList
-            -
            		 * @return array
-            -
            		 */
-            -
            		public function extractCommaSeparatedList( $sRawList = '' ) {
-            -
            			$aRawList = array();
-            -
            			if ( empty( $sRawList ) ) {
-            -
            				return $aRawList;
+            			}
-            -
-            -
            			$aRawList = array_map( 'trim', preg_split( '/\r\n|\r|\n/', $sRawList ) );
-            -
            			$aNewList = array();
-            -
            			$bHadStar = false;
-            -
            			foreach ( $aRawList as $sKey => $sRawLine ) {
-            -
-            -
            				if ( empty( $sRawLine ) ) {
             					continue;
+            				}
-            -
            				$sRawLine = str_replace( ' ', '', $sRawLine );
-            -
            				$aParts = explode( ',', $sRawLine, 2 );
-            -
            				// we only permit 1x line beginning with *
-            -
            				if ( $aParts[ 0 ] == '*' ) {
-            -
            					if ( $bHadStar ) {
-            -
            						continue;
-            -
            					}
-            -
            					$bHadStar = true;
-            -
            				}
-            -
            				else {
-            -
            					//If there's only 1 item on the line, we assume it to be a global
-            -
            					// parameter rule
-            -
            					if ( count( $aParts ) == 1 || empty( $aParts[ 1 ] ) ) { // there was no comma in this line in the first place
-            -
            						array_unshift( $aParts, '*' );
-            -
            					}
+            				}
-            -
-            -
            				$aParams = empty( $aParts[ 1 ] ) ? array() : explode( ',', $aParts[ 1 ] );
-            -
            				$aNewList[ $aParts[ 0 ] ] = $aParams;
+            			}
-            -
            			return $aNewList;
-            -
            		}
-            -
            		/**
-            -
            		 * Taken from http://www.phacks.net/detecting-search-engine-bot-and-web-spiders/
-            -
            		 */
-            -
            		public static function IsSearchEngineBot() {
-            -
-            -
            			$sUserAgent = self::FetchServer( 'HTTP_USER_AGENT' );
-            -
            			if ( empty( $sUserAgent ) ) {
-            -
            				return false;
-            -
            			}
-            -
            			$sBots = 'Googlebot|bingbot|Twitterbot|Baiduspider|ia_archiver|R6_FeedFetcher|NetcraftSurveyAgent'
-            -
            				. '|Sogou web spider|Yahoo! Slurp|facebookexternalhit|PrintfulBot|msnbot|UnwindFetchor|urlresolver|Butterfly|TweetmemeBot';
-            -
            			return ( preg_match( "/$sBots/", $sUserAgent ) > 0 );
+            		}
-            -
            		/**
-            -
            		 * Strength can be 1, 3, 7, 15
-            -
            		 * @param integer $nLength
-            -
            		 * @param integer $nStrength
-            -
            		 * @param boolean $bIgnoreAmb
-            -
            		 * @return string
-            -
            		 */
-            -
            		static public function GenerateRandomString( $nLength = 10, $nStrength = 7, $bIgnoreAmb = true ) {
-            -
            			$aChars = array( 'abcdefghijkmnopqrstuvwxyz' );
-            -
-            -
            			if ( $nStrength & 2 ) {
-            -
            				$aChars[] = '023456789';
-            -
            			}
-            -
-            -
            			if ( $nStrength & 4 ) {
-            -
            				$aChars[] = 'ABCDEFGHJKLMNPQRSTUVWXYZ';
-            -
            			}
-            -
            			if ( $nStrength & 8 ) {
-            -
            				$aChars[] = '$%^&*#';
-            -
            			}
-            -
            			if ( !$bIgnoreAmb ) {
-            -
            				$aChars[] = 'OOlI1';
-            -
            			}
-            -
            			$sPassword = '';
-            -
            			$sCharset = implode( '', $aChars );
-            -
            			for ( $i = 0; $i < $nLength; $i++ ) {
-            -
            				$sPassword .= $sCharset[ ( rand() % strlen( $sCharset ) ) ];
-            -
            			}
-            -
            			return $sPassword;
+            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		static public function GenerateRandomLetter() {
-            -
            			$sAtoZ = "abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ";
-            -
            			$nRandomInt = rand( 0, ( strlen( $sAtoZ ) - 1 ) );
-            -
            			return $sAtoZ[ $nRandomInt ];
+            		}
-            -
            		/**
-            -
            		 * @return bool
-            -
            		 */
-            -
            		static public function GetIsRequestPost() {
-            -
            			return ( self::GetRequestMethod() == 'post' );
+            		}
-            -
            		/**
-            -
            		 * Returns the current request method as an all-lower-case string
-            -
            		 * @return bool|string
-            -
            		 */
-            -
            		static public function GetRequestMethod() {
-            -
            			$sRequestMethod = self::FetchServer( 'REQUEST_METHOD' );
-            -
            			return ( empty( $sRequestMethod ) ? false : strtolower( $sRequestMethod ) );
+            		}
-            -
            		/**
-            -
            		 * @return string|null
-            -
            		 */
-            -
            		static public function GetScriptName() {
-            -
            			$sScriptName = self::FetchServer( 'SCRIPT_NAME' );
-            -
            			return !empty( $sScriptName ) ? $sScriptName : self::FetchServer( 'PHP_SELF' );
+            		}
-            -
            		/**
-            -
            		 * @return bool
-            -
            		 */
-            -
            		static public function GetUseFilterInput() {
-            -
            			return self::$bUseFilterInput && function_exists( 'filter_input' );
-            -
            		}
-            -
            		/**
-            -
            		 * @param array  $aArray
-            -
            		 * @param string $sKey The array key to fetch
-            -
            		 * @param mixed  $mDefault
-            -
            		 * @return mixed|null
-            -
            		 */
-            -
            		public static function ArrayFetch( &$aArray, $sKey, $mDefault = null ) {
-            -
            			if ( !isset( $aArray[ $sKey ] ) ) {
-            -
            				return $mDefault;
-            -
            			}
-            -
            			return $aArray[ $sKey ];
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sKey The $_COOKIE key
-            -
            		 * @param mixed  $mDefault
-            -
            		 * @return mixed|null
-            -
            		 */
-            -
            		public static function FetchCookie( $sKey, $mDefault = null ) {
-            -
            			if ( self::GetUseFilterInput() && defined( 'INPUT_COOKIE' ) ) {
-            -
            				$mPossible = filter_input( INPUT_COOKIE, $sKey );
-            -
            				if ( !empty( $mPossible ) ) {
-            -
            					return $mPossible;
-            -
            				}
+            			}
-            -
            			return self::ArrayFetch( $_COOKIE, $sKey, $mDefault );
+            		}
-            -
            		/**
-            -
            		 * @param string $sKey
-            -
            		 * @param mixed  $mDefault
-            -
            		 * @return mixed|null
-            -
            		 */
-            -
            		public static function FetchEnv( $sKey, $mDefault = null ) {
-            -
            			if ( self::GetUseFilterInput() && defined( 'INPUT_ENV' ) ) {
-            -
            				$sPossible = filter_input( INPUT_ENV, $sKey );
-            -
            				if ( !empty( $sPossible ) ) {
-            -
            					return $sPossible;
-            -
            				}
+            			}
-            -
            			return self::ArrayFetch( $_ENV, $sKey, $mDefault );
+            		}
-            -
            		/**
-            -
            		 * @param string $sKey
-            -
            		 * @param mixed  $mDefault
-            -
            		 * @return mixed|null
-            -
            		 */
-            -
            		public static function FetchGet( $sKey, $mDefault = null ) {
-            -
            			if ( self::GetUseFilterInput() && defined( 'INPUT_GET' ) ) {
-            -
            				$mPossible = filter_input( INPUT_GET, $sKey );
-            -
            				if ( !empty( $mPossible ) ) {
-            -
            					return $mPossible;
-            -
            				}
+            			}
-            -
            			return self::ArrayFetch( $_GET, $sKey, $mDefault );
+            		}
-            -
            		/**
-            -
            		 * @param string $sKey The $_POST key
-            -
            		 * @param mixed  $mDefault
-            -
            		 * @return mixed|null
-            -
            		 */
-            -
            		public static function FetchPost( $sKey, $mDefault = null ) {
-            -
            			if ( self::GetUseFilterInput() && defined( 'INPUT_POST' ) ) {
-            -
            				$mPossible = filter_input( INPUT_POST, $sKey );
-            -
            				if ( !empty( $mPossible ) ) {
-            -
            					return $mPossible;
-            -
            				}
+            			}
-            -
            			return self::ArrayFetch( $_POST, $sKey, $mDefault );
+            		}
-            -
            		/**
-            -
            		 * @param string  $sKey
-            -
            		 * @param boolean $bIncludeCookie
-            -
            		 * @param mixed   $mDefault
-            -
            		 * @return mixed|null
-            -
            		 */
-            -
            		public static function FetchRequest( $sKey, $bIncludeCookie = false, $mDefault = null ) {
-            -
            			$mFetchVal = self::FetchPost( $sKey );
-            -
            			if ( is_null( $mFetchVal ) ) {
-            -
            				$mFetchVal = self::FetchGet( $sKey );
-            -
            				if ( is_null( $mFetchVal && $bIncludeCookie ) ) {
-            -
            					$mFetchVal = self::FetchCookie( $sKey );
-            -
            				}
+            			}
-            -
            			return is_null( $mFetchVal ) ? $mDefault : $mFetchVal;
+            		}
-            -
            		/**
-            -
            		 * @param string $sKey
-            -
            		 * @param mixed  $mDefault
-            -
            		 * @return mixed|null
-            -
            		 */
-            -
            		public static function FetchServer( $sKey, $mDefault = null ) {
-            -
            			if ( self::GetUseFilterInput() && defined( 'INPUT_SERVER' ) ) {
-            -
            				$sPossible = filter_input( INPUT_SERVER, $sKey );
-            -
            				if ( !empty( $sPossible ) ) {
-            -
            					return $sPossible;
-            -
            				}
+            			}
-            -
            			return self::ArrayFetch( $_SERVER, $sKey, $mDefault );
+            		}
-            -
            		/**
-            -
            		 * @param string $sRequestedUrl
-            -
            		 * @param string $sBaseUrl
-            -
            		 */
-            -
            		public function doSendApache404( $sRequestedUrl, $sBaseUrl ) {
-            -
            			$bForwardedProto = $this->FetchServer( 'HTTP_X_FORWARDED_PROTO' ) == 'https';
-            -
            			header( 'HTTP/1.1 404 Not Found' );
-            -
            			$sDie = sprintf(
-            -
            				'<html><head><title>404 Not Found</title><style type="text/css"></style></head><body><h1>Not Found</h1><p>The requested URL %s was not found on this server.</p><p>Additionally, a 404 Not Found error was encountered while trying to use an ErrorDocument to handle the request.</p><hr><address>Apache Server at %s Port %s</address></body></html>',
-            -
            				$sRequestedUrl,
-            -
            				$sBaseUrl,
-            -
            				( $bForwardedProto || is_ssl() ) ? 443 : $this->FetchServer( 'SERVER_PORT' )
-            -
            			);
-            -
            			die( $sDie );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sStringContent
-            -
            		 * @param string $sFilename
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function downloadStringAsFile( $sStringContent, $sFilename ) {
-            -
            			header( "Content-type: application/octet-stream" );
-            -
            			header( "Content-disposition: attachment; filename=" . $sFilename );
-            -
            			header( "Content-Transfer-Encoding: binary" );
-            -
            			header( "Content-Length: " . strlen( $sStringContent ) );
-            -
            			echo $sStringContent;
-            -
            			die();
-            -
            		}
-            -
            		/**
-            -
            		 * Use this to reliably read the contents of a PHP file that doesn't have executable
-            -
            		 * PHP Code.
-            -
            		 * Why use this? In the name of naive security, silly web hosts can prevent reading the contents of
-            -
            		 * non-PHP files so we simply put the content we want to have read into a php file and then "include" it.
-            -
            		 * @param string $sFile
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function readFileContentsUsingInclude( $sFile ) {
-            -
            			ob_start();
-            -
            			include( $sFile );
-            -
            			return ob_get_clean();
-            -
            		}
-            -
            		/**
-            -
            		 * @param      $sKey
-            -
            		 * @param      $mValue
-            -
            		 * @param int  $nExpireLength
-            -
            		 * @param null $sPath
-            -
            		 * @param null $sDomain
-            -
            		 * @param bool $bSsl
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function setCookie( $sKey, $mValue, $nExpireLength = 3600, $sPath = null, $sDomain = null, $bSsl = false ) {
-            -
            			if ( function_exists( 'headers_sent' ) && headers_sent() ) {
-            -
            				return false;
-            -
            			}
-            -
            			$_COOKIE[ $sKey ] = $mValue;
-            -
            			return setcookie(
-            -
            				$sKey,
-            -
            				$mValue,
-            -
            				(int)( $this->time() + $nExpireLength ),
-            -
            				( is_null( $sPath ) && defined( 'COOKIEPATH' ) ) ? COOKIEPATH : $sPath,
-            -
            				( is_null( $sDomain ) && defined( 'COOKIE_DOMAIN' ) ) ? COOKIE_DOMAIN : $sDomain,
-            -
            				$bSsl
-            -
            			);
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sKey
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function setDeleteCookie( $sKey ) {
-            -
            			unset( $_COOKIE[ $sKey ] );
-            -
            			return $this->setCookie( $sKey, '', -3600 );
-            -
            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getPhpVersion() {
-            -
            			return ( defined( 'PHP_VERSION' ) ? PHP_VERSION : phpversion() );
-            -
            		}
-            -
            		/**
-            -
            		 * Cleans out any of the junk that can appear in a PHP version and returns just the 5.4.45
-            -
            		 * e.g. 5.4.45-0+deb7u5
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getPhpVersionCleaned() {
-            -
            			$sVersion = $this->getPhpVersion();
-            -
            			if ( preg_match( '#^[0-9]{1}\.[0-9]{1}(\.[0-9]{1,3})?#', $sVersion, $aMatches ) ) {
-            -
            				return $aMatches[ 0 ];
-            -
            			}
-            -
            			else {
-            -
            				return $sVersion;
-            -
            			}
+            		}
-            -
-            -
            		/**
-            -
            		 * @param string $sAtLeastVersion
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function getPhpVersionIsAtLeast( $sAtLeastVersion ) {
-            -
            			return version_compare( $this->getPhpVersion(), $sAtLeastVersion, '>=' );
+            		}
-            -
            		/**
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function getPhpSupportsNamespaces() {
-            -
            			return $this->getPhpVersionIsAtLeast( '5.3' );
-            -
            		}
-            -
            		/**
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function getCanOpensslSign() {
-            -
            			return function_exists( 'base64_decode' )
-            -
            				&& function_exists( 'openssl_sign' )
-            -
            				&& function_exists( 'openssl_verify' )
-            -
            				&& defined( 'OPENSSL_ALGO_SHA1' );
-            -
            		}
-            -
            		/**
-            -
            		 * @param array $aArray
-            -
            		 * @return stdClass
-            -
            		 */
-            -
            		public function convertArrayToStdClass( $aArray ) {
-            -
            			$oObject = new stdClass();
-            -
            			if ( !empty( $aArray ) && is_array( $aArray ) ) {
-            -
            				foreach ( $aArray as $sKey => $mValue ) {
-            -
            					$oObject->{$sKey} = $mValue;
-            -
            				}
+            			}
-            -
            			return $oObject;
+            		}
-            -
            		/**
-            -
            		 * @param array $aSubjectArray
-            -
            		 * @param mixed $mValue
-            -
            		 * @param int   $nDesiredPosition
-            -
            		 * @return array
-            -
            		 */
-            -
            		public function setArrayValueToPosition( $aSubjectArray, $mValue, $nDesiredPosition ) {
-            -
            			if ( $nDesiredPosition < 0 ) {
-            -
            				return $aSubjectArray;
-            -
            			}
-            -
            			$nMaxPossiblePosition = count( $aSubjectArray ) - 1;
-            -
            			if ( $nDesiredPosition > $nMaxPossiblePosition ) {
-            -
            				$nDesiredPosition = $nMaxPossiblePosition;
-            -
            			}
-            -
            			$nPosition = array_search( $mValue, $aSubjectArray );
-            -
            			if ( $nPosition !== false && $nPosition != $nDesiredPosition ) {
-            -
            				// remove existing and reset index
-            -
            				unset( $aSubjectArray[ $nPosition ] );
-            -
            				$aSubjectArray = array_values( $aSubjectArray );
-            -
            				// insert and update
-            -
            				// http://stackoverflow.com/questions/3797239/insert-new-item-in-array-on-any-position-in-php
-            -
            				array_splice( $aSubjectArray, $nDesiredPosition, 0, $mValue );
-            -
            			}
-            -
-            -
            			return $aSubjectArray;
+            		}
-            -
            		/**
-            -
            		 * Taken from: http://stackoverflow.com/questions/1755144/how-to-validate-domain-name-in-php
-            -
            		 * @param string $sDomainName
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function isValidDomainName( $sDomainName ) {
-            -
            			$sDomainName = trim( $sDomainName );
-            -
            			return ( preg_match( "/^([a-z\d](-*[a-z\d])*)(\.([a-z\d](-*[a-z\d])*))*$/i", $sDomainName ) //valid chars check
-            -
            				&& preg_match( "/^.{1,253}$/", $sDomainName ) //overall length check
-            -
            				&& preg_match( "/^[^\.]{1,63}(\.[^\.]{1,63})*$/", $sDomainName ) );//length of each label
-            -
            		}
-            -
            		/**
-            -
            		 * @return int
-            -
            		 */
-            -
            		public function time() {
-            -
            			return self::GetRequestTime();
-            -
            		}
+            	}
-            -
            endif;


1	<?php
2	+ if ( class_exists( 'ICWP_WPSF_DataProcessor', false ) ) {
3	+ return;
4	+ }
5	+
6	+ class ICWP_WPSF_DataProcessor extends ICWP_WPSF_Foundation {
7	+
8	+ /**
9	+ * @var ICWP_WPSF_DataProcessor
10	+ */
11	+ protected static $oInstance = null;
12	+
13	+ /**
14	+ * @var bool
15	+ */
16	+ public static $bUseFilterInput = false;
17	+
18	+ /**
19	+ * @var integer
20	+ */
21	+ protected static $nRequestTime;
22	+
23	+ /**
24	+ * @var array
25	+ */
26	+ protected $aRequestUriParts;
27	+
28	+ protected function __construct() {}
29	+
30	+ /**
31	+ * @return ICWP_WPSF_DataProcessor
32	+ */
33	+ public static function GetInstance() {
34	+ if ( is_null( self::$oInstance ) ) {
35	+ self::$oInstance = new self();
36	+ }
37	+ return self::$oInstance;
38	+ }
39
40	+ /**
41	+ * @return int
42	+ */
43	+ public static function GetRequestTime() {
44	+ if ( empty( self::$nRequestTime ) ) {
45	+ self::$nRequestTime = time();
46	+ }
47	+ return self::$nRequestTime;
48	+ }
49
50	+ /**
51	+ * @param array $aArray1
52	+ * @param array $aArray2
53	+ * @return array
54	+ */
55	+ public function mergeArraysRecursive( $aArray1, $aArray2 ) {
56	+ foreach ( $aArray2 as $key => $Value ) {
57	+ if ( array_key_exists( $key, $aArray1 ) && is_array( $Value ) ) {
58	+ $aArray1[ $key ] = $this->mergeArraysRecursive( $aArray1[ $key ], $aArray2[ $key ] );
59	+ }
60	+ else {
61	+ $aArray1[ $key ] = $Value;
62	+ }
63	+ }
64	+ return $aArray1;
65	+ }
66
67	+ /**
68	+ * @param string $sKey
69	+ * @param null $mDefault
70	+ * @param bool $bTrim -automatically trim whitespace
71	+ * @return mixed\|null
72	+ */
73	+ public function query( $sKey, $mDefault = null, $bTrim = true ) {
74	+ $mVal = $this->FetchGet( $sKey, $mDefault );
75	+ return ( $bTrim && is_scalar( $mVal ) ) ? trim( $mVal ) : $mVal;
76	+ }
77
78	+ /**
79	+ * @param string $sKey
80	+ * @param null $mDefault
81	+ * @param bool $bTrim -automatically trim whitespace
82	+ * @return mixed\|null
83	+ */
84	+ public function post( $sKey, $mDefault = null, $bTrim = true ) {
85	+ $mVal = $this->FetchPost( $sKey, $mDefault );
86	+ return ( $bTrim && is_scalar( $mVal ) ) ? trim( $mVal ) : $mVal;
87	+ }
88
89	+ /**
90	+ * @return string URI Path in lowercase
91	+ */
92	+ public function getRequestPath() {
93	+ $aRequestParts = $this->getRequestUriParts();
94	+ return $aRequestParts[ 'path' ];
95	+ }
96
97	+ /**
98	+ * @return string
99	+ */
100	+ public function getRequestUri() {
101	+ return $this->FetchServer( 'REQUEST_URI' );
102	+ }
103
104	+ /**
105	+ * @param bool $bIncludeCookie
106	+ * @return array
107	+ */
108	+ public function getRawRequestParams( $bIncludeCookie = true ) {
109	+ $aParams = array_merge( $_GET, $_POST );
110	+ return $bIncludeCookie ? array_merge( $aParams, $_COOKIE ) : $aParams;
111	+ }

112
113	+ /**
114	+ * @return array
115	+ */
116	+ public function getRequestUriParts() {
117	+ if ( !isset( $this->aRequestUriParts ) ) {
118	+ $aExploded = explode( '?', $this->getRequestUri(), 2 );
119	+ $this->aRequestUriParts = array(
120	+ 'path' => empty( $aExploded[ 0 ] ) ? '' : $aExploded[ 0 ],
121	+ 'query' => empty( $aExploded[ 1 ] ) ? '' : $aExploded[ 1 ],
122	+ );
123	}
124	+ return $this->aRequestUriParts;
125	+ }
126
127	+ /**
128	+ * @param string $sPath
129	+ * @param string $sExtensionToAdd
130	+ * @return string
131	+ */
132	+ public function addExtensionToFilePath( $sPath, $sExtensionToAdd ) {

















133
134	+ if ( strpos( $sExtensionToAdd, '.' ) === false ) {
135	+ $sExtensionToAdd = '.'.$sExtensionToAdd;



136	}
137
138	+ if ( !$this->getIfStringEndsIn( $sPath, $sExtensionToAdd ) ) {
139	+ $sPath = $sPath.$sExtensionToAdd;





140	}
141	+ return $sPath;
142	+ }
143
144	+ /**
145	+ * @param string $sHaystack
146	+ * @param string $sNeedle
147	+ * @return bool
148	+ */
149	+ public function getIfStringEndsIn( $sHaystack, $sNeedle ) {
150	+ $nNeedleLength = strlen( $sNeedle );
151	+ $sStringEndsIn = substr( $sHaystack, strlen( $sHaystack ) - $nNeedleLength, $nNeedleLength );
152	+ return ( $sStringEndsIn == $sNeedle );
153	+ }



154
155	+ /**
156	+ * @param string $sPath
157	+ * @return string
158	+ */
159	+ public function getExtension( $sPath ) {
160	+ $nLastPeriod = strrpos( $sPath, '.' );
161	+ return ( $nLastPeriod === false ) ? $sPath : str_replace( '.', '', substr( $sPath, $nLastPeriod ) );
162	+ }
163
164	+ /**
165	+ * @param string $sUrl
166	+ * @return string
167	+ */
168	+ public function urlStripQueryPart( $sUrl ) {
169	+ return preg_replace( '#\s?\?.*$#', '', $sUrl );
170	+ }
171
172	+ /**
173	+ * Will strip everything from a URL except Scheme+Host and requires that Scheme+Host be present
174	+ * @return string\|false
175	+ */
176	+ public function validateSimpleHttpUrl( $sUrl ) {
177	+ $sValidatedUrl = false;
178	+
179	+ $sUrl = trim( $this->urlStripQueryPart( $sUrl ) );
180	+ if ( filter_var( $sUrl, FILTER_VALIDATE_URL ) ) { // we have a scheme+host
181	+ $aParts = parse_url( $sUrl );
182	+ if ( in_array( $aParts[ 'scheme' ], array( 'http', 'https' ) ) ) {
183	+ $sValidatedUrl = rtrim( $sUrl, '/' );
184	}

185	}
186
187	+ return $sValidatedUrl;
188	+ }








189
190	+ /**
191	+ * @return boolean
192	+ */
193	+ public function validEmail( $sEmail ) {
194	+ return ( !empty( $sEmail ) && function_exists( 'is_email' ) && is_email( $sEmail ) );
195	+ }


196
197	+ /**
198	+ * @param string $sRawList
199	+ * @return array
200	+ */
201	+ public function extractCommaSeparatedList( $sRawList = '' ) {
202	+
203	+ $aRawList = array();
204	+ if ( empty( $sRawList ) ) {
205	+ return $aRawList;
206	}
207
208	+ $aRawList = array_map( 'trim', preg_split( '/\r\n\|\r\|\n/', $sRawList ) );
209	+ $aNewList = array();
210	+ $bHadStar = false;
211	+ foreach ( $aRawList as $sKey => $sRawLine ) {

212
213	+ if ( empty( $sRawLine ) ) {
214	+ continue;

215	}
216	+ $sRawLine = str_replace( ' ', '', $sRawLine );
217	+ $aParts = explode( ',', $sRawLine, 2 );
218	+ // we only permit 1x line beginning with *
219	+ if ( $aParts[ 0 ] == '*' ) {
220	+ if ( $bHadStar ) {


221	continue;
222	}
223	+ $bHadStar = true;
224	+ }
225	+ else {
226	+ //If there's only 1 item on the line, we assume it to be a global
227	+ // parameter rule
228	+ if ( count( $aParts ) == 1 \|\| empty( $aParts[ 1 ] ) ) { // there was no comma in this line in the first place
229	+ array_unshift( $aParts, '*' );








230	}



231	}


232
233	+ $aParams = empty( $aParts[ 1 ] ) ? array() : explode( ',', $aParts[ 1 ] );
234	+ $aNewList[ $aParts[ 0 ] ] = $aParams;
235	+ }
236	+ return $aNewList;
237	+ }




238
239	+ /**
240	+ * Taken from http://www.phacks.net/detecting-search-engine-bot-and-web-spiders/
241	+ */
242	+ public static function IsSearchEngineBot() {
243
244	+ $sUserAgent = self::FetchServer( 'HTTP_USER_AGENT' );
245	+ if ( empty( $sUserAgent ) ) {
246	+ return false;
247	}
248
249	+ $sBots = 'Googlebot\|bingbot\|Twitterbot\|Baiduspider\|ia_archiver\|R6_FeedFetcher\|NetcraftSurveyAgent'
250	+ .'\|Sogou web spider\|Yahoo! Slurp\|facebookexternalhit\|PrintfulBot\|msnbot\|UnwindFetchor\|urlresolver\|Butterfly\|TweetmemeBot';















251
252	+ return ( preg_match( "/$sBots/", $sUserAgent ) > 0 );
253	+ }

254
255	+ /**
256	+ * Strength can be 1, 3, 7, 15
257	+ * @param integer $nLength
258	+ * @param integer $nStrength
259	+ * @param boolean $bIgnoreAmb
260	+ * @return string
261	+ */
262	+ static public function GenerateRandomString( $nLength = 10, $nStrength = 7, $bIgnoreAmb = true ) {
263	+ $aChars = array( 'abcdefghijkmnopqrstuvwxyz' );
264
265	+ if ( $nStrength & 2 ) {
266	+ $aChars[] = '023456789';




267	}
268
269	+ if ( $nStrength & 4 ) {
270	+ $aChars[] = 'ABCDEFGHJKLMNPQRSTUVWXYZ';





271	}
272
273	+ if ( $nStrength & 8 ) {
274	+ $aChars[] = '$%^&*#';



275	}
276
277	+ if ( !$bIgnoreAmb ) {
278	+ $aChars[] = 'OOlI1';





279	}
280
281	+ $sPassword = '';
282	+ $sCharset = implode( '', $aChars );
283	+ for ( $i = 0 ; $i < $nLength ; $i++ ) {
284	+ $sPassword .= $sCharset[ ( rand()%strlen( $sCharset ) ) ];


285	}
286	+ return $sPassword;
287	+ }
288
289	+ /**
290	+ * @return string
291	+ */
292	+ static public function GenerateRandomLetter() {
293	+ $sAtoZ = "abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ";
294	+ $nRandomInt = rand( 0, ( strlen( $sAtoZ ) - 1 ) );
295	+ return $sAtoZ[ $nRandomInt ];
296	+ }
297
298	+ /**
299	+ * @return bool
300	+ */
301	+ static public function GetIsRequestPost() {
302	+ return ( self::GetRequestMethod() == 'post' );
303	+ }






304
305	+ /**
306	+ * Returns the current request method as an all-lower-case string
307	+ * @return bool\|string
308	+ */
309	+ static public function GetRequestMethod() {
310	+ $sRequestMethod = self::FetchServer( 'REQUEST_METHOD' );
311	+ return ( empty( $sRequestMethod ) ? false : strtolower( $sRequestMethod ) );
312	+ }
313	+
314	+ /**
315	+ * @return string\|null
316	+ */
317	+ static public function GetScriptName() {
318	+ $sScriptName = self::FetchServer( 'SCRIPT_NAME' );
319	+ return !empty( $sScriptName ) ? $sScriptName : self::FetchServer( 'PHP_SELF' );
320	+ }
321	+
322	+ /**
323	+ * @return bool
324	+ */
325	+ static public function GetUseFilterInput() {
326	+ return self::$bUseFilterInput && function_exists( 'filter_input' );
327	+ }
328	+
329	+ /**
330	+ * @param array $aArray
331	+ * @param string $sKey The array key to fetch
332	+ * @param mixed $mDefault
333	+ * @return mixed\|null
334	+ */
335	+ public static function ArrayFetch( &$aArray, $sKey, $mDefault = null ) {
336	+ if ( !isset( $aArray[ $sKey ] ) ) {
337	+ return $mDefault;
338	+ }
339	+ return $aArray[ $sKey ];
340	+ }
341	+
342	+ /**
343	+ * @param string $sKey The $_COOKIE key
344	+ * @param mixed $mDefault
345	+ * @return mixed\|null
346	+ */
347	+ public static function FetchCookie( $sKey, $mDefault = null ) {
348	+ if ( self::GetUseFilterInput() && defined( 'INPUT_COOKIE' ) ) {
349	+ $mPossible = filter_input( INPUT_COOKIE, $sKey );
350	+ if ( !empty( $mPossible ) ) {
351	+ return $mPossible;
352	}

353	}
354	+ return self::ArrayFetch( $_COOKIE, $sKey, $mDefault );
355	+ }
356
357	+ /**
358	+ * @param string $sKey
359	+ * @param mixed $mDefault
360	+ * @return mixed\|null
361	+ */
362	+ public static function FetchEnv( $sKey, $mDefault = null ) {
363	+ if ( self::GetUseFilterInput() && defined( 'INPUT_ENV' ) ) {
364	+ $sPossible = filter_input( INPUT_ENV, $sKey );
365	+ if ( !empty( $sPossible ) ) {
366	+ return $sPossible;

367	}

368	}
369	+ return self::ArrayFetch( $_ENV, $sKey, $mDefault );
370	+ }
371
372	+ /**
373	+ * @param string $sKey
374	+ * @param mixed $mDefault
375	+ * @return mixed\|null
376	+ */
377	+ public static function FetchGet( $sKey, $mDefault = null ) {
378	+ if ( self::GetUseFilterInput() && defined( 'INPUT_GET' ) ) {
379	+ $mPossible = filter_input( INPUT_GET, $sKey );
380	+ if ( !empty( $mPossible ) ) {
381	+ return $mPossible;

382	}

383	}
384	+ return self::ArrayFetch( $_GET, $sKey, $mDefault );
385	+ }
386
387	+ /**
388	+ * @param string $sKey The $_POST key
389	+ * @param mixed $mDefault
390	+ * @return mixed\|null
391	+ */
392	+ public static function FetchPost( $sKey, $mDefault = null ) {
393	+ if ( self::GetUseFilterInput() && defined( 'INPUT_POST' ) ) {
394	+ $mPossible = filter_input( INPUT_POST, $sKey );
395	+ if ( !empty( $mPossible ) ) {
396	+ return $mPossible;

397	}

398	}
399	+ return self::ArrayFetch( $_POST, $sKey, $mDefault );
400	+ }
401
402	+ /**
403	+ * @param string $sKey
404	+ * @param boolean $bIncludeCookie
405	+ * @param mixed $mDefault
406	+ * @return mixed\|null
407	+ */
408	+ public static function FetchRequest( $sKey, $bIncludeCookie = false, $mDefault = null ) {
409	+ $mFetchVal = self::FetchPost( $sKey );
410	+ if ( is_null( $mFetchVal ) ) {
411	+ $mFetchVal = self::FetchGet( $sKey );
412	+ if ( is_null( $mFetchVal && $bIncludeCookie ) ) {
413	+ $mFetchVal = self::FetchCookie( $sKey );

414	}

415	}
416	+ return is_null( $mFetchVal ) ? $mDefault : $mFetchVal;
417	+ }
418
419	+ /**
420	+ * @param string $sKey
421	+ * @param mixed $mDefault
422	+ * @return mixed\|null
423	+ */
424	+ public static function FetchServer( $sKey, $mDefault = null ) {
425	+ if ( self::GetUseFilterInput() && defined( 'INPUT_SERVER' ) ) {
426	+ $sPossible = filter_input( INPUT_SERVER, $sKey );
427	+ if ( !empty( $sPossible ) ) {
428	+ return $sPossible;

429	}

430	}
431	+ return self::ArrayFetch( $_SERVER, $sKey, $mDefault );
432	+ }
433
434	+ /**
435	+ * @param string $sRequestedUrl
436	+ * @param string $sBaseUrl
437	+ */
438	+ public function doSendApache404( $sRequestedUrl, $sBaseUrl ) {
439	+ $bForwardedProto = $this->FetchServer( 'HTTP_X_FORWARDED_PROTO' ) == 'https';
440	+ header( 'HTTP/1.1 404 Not Found' );
441	+ $sDie = sprintf(
442	+ '<html><head><title>404 Not Found</title><style type="text/css"></style></head><body><h1>Not Found</h1><p>The requested URL %s was not found on this server.</p><p>Additionally, a 404 Not Found error was encountered while trying to use an ErrorDocument to handle the request.</p><hr><address>Apache Server at %s Port %s</address></body></html>',
443	+ $sRequestedUrl,
444	+ $sBaseUrl,
445	+ ( $bForwardedProto \|\| is_ssl() ) ? 443 : $this->FetchServer( 'SERVER_PORT' )
446	+ );
447	+ die( $sDie );
448	+ }
449
450	+ /**
451	+ * @param string $sStringContent
452	+ * @param string $sFilename
453	+ * @return bool
454	+ */
455	+ public function downloadStringAsFile( $sStringContent, $sFilename ) {
456	+ header( "Content-type: application/octet-stream" );
457	+ header( "Content-disposition: attachment; filename=".$sFilename );
458	+ header( "Content-Transfer-Encoding: binary" );
459	+ header( "Content-Length: ".strlen( $sStringContent ) );
460	+ echo $sStringContent;
461	+ die();
462	+ }
463
464	+ /**
465	+ * Use this to reliably read the contents of a PHP file that doesn't have executable
466	+ * PHP Code.
467	+ * Why use this? In the name of naive security, silly web hosts can prevent reading the contents of
468	+ * non-PHP files so we simply put the content we want to have read into a php file and then "include" it.
469	+ * @param string $sFile
470	+ * @return string
471	+ */
472	+ public function readFileContentsUsingInclude( $sFile ) {
473	+ ob_start();
474	+ include( $sFile );
475	+ return ob_get_clean();
476	+ }
477
478	+ /**
479	+ * @param $sKey
480	+ * @param $mValue
481	+ * @param int $nExpireLength
482	+ * @param null $sPath
483	+ * @param null $sDomain
484	+ * @param bool $bSsl
485	+ * @return bool
486	+ */
487	+ public function setCookie( $sKey, $mValue, $nExpireLength = 3600, $sPath = null, $sDomain = null, $bSsl = false ) {
488	+ if ( function_exists( 'headers_sent' ) && headers_sent() ) {
489	+ return false;
490	+ }
491	+ $_COOKIE[ $sKey ] = $mValue;
492	+ return setcookie(
493	+ $sKey,
494	+ $mValue,
495	+ (int)( $this->time() + $nExpireLength ),
496	+ ( is_null( $sPath ) && defined( 'COOKIEPATH' ) ) ? COOKIEPATH : $sPath,
497	+ ( is_null( $sDomain ) && defined( 'COOKIE_DOMAIN' ) ) ? COOKIE_DOMAIN : $sDomain,
498	+ $bSsl
499	+ );
500	+ }
501
502	+ /**
503	+ * @param string $sKey
504	+ * @return bool
505	+ */
506	+ public function setDeleteCookie( $sKey ) {
507	+ unset( $_COOKIE[ $sKey ] );
508	+ return $this->setCookie( $sKey, '', -3600 );
509	+ }
510
511	+ /**
512	+ * @return string
513	+ */
514	+ public function getPhpVersion() {
515	+ return ( defined( 'PHP_VERSION' ) ? PHP_VERSION : phpversion() );
516	+ }
517
518	+ /**
519	+ * Cleans out any of the junk that can appear in a PHP version and returns just the 5.4.45
520	+ * e.g. 5.4.45-0+deb7u5
521	+ * @return string
522	+ */
523	+ public function getPhpVersionCleaned() {
524	+ $sVersion = $this->getPhpVersion();
525	+ if ( preg_match( '#^[0-9]{1}\.[0-9]{1}(\.[0-9]{1,3})?#', $sVersion, $aMatches ) ) {
526	+ return $aMatches[ 0 ];




527	}
528	+ else {
529	+ return $sVersion;





530	}
531	+ }
532
533	+ /**
534	+ * @param string $sAtLeastVersion
535	+ * @return bool
536	+ */
537	+ public function getPhpVersionIsAtLeast( $sAtLeastVersion ) {
538	+ return version_compare( $this->getPhpVersion(), $sAtLeastVersion, '>=' );
539	+ }
540
541	+ /**
542	+ * @return bool
543	+ */
544	+ public function getPhpSupportsNamespaces() {
545	+ return $this->getPhpVersionIsAtLeast( '5.3' );
546	+ }



547
548	+ /**
549	+ * @return bool
550	+ */
551	+ public function getCanOpensslSign() {
552	+ return function_exists( 'base64_decode' )
553	+ && function_exists( 'openssl_sign' )
554	+ && function_exists( 'openssl_verify' )
555	+ && defined( 'OPENSSL_ALGO_SHA1' );
556	+ }
557	+
558	+ /**
559	+ * @param array $aArray
560	+ * @return stdClass
561	+ */
562	+ public function convertArrayToStdClass( $aArray ) {
563	+ $oObject = new stdClass();
564	+ if ( !empty( $aArray ) && is_array( $aArray ) ) {
565	+ foreach ( $aArray as $sKey => $mValue ) {
566	+ $oObject->{$sKey} = $mValue;
567	}

568	}
569	+ return $oObject;
570	+ }
571
572	+ /**
573	+ * @param array $aSubjectArray
574	+ * @param mixed $mValue
575	+ * @param int $nDesiredPosition
576	+ * @return array
577	+ */
578	+ public function setArrayValueToPosition( $aSubjectArray, $mValue, $nDesiredPosition ) {
579
580	+ if ( $nDesiredPosition < 0 ) {
581	+ return $aSubjectArray;
582	+ }
583
584	+ $nMaxPossiblePosition = count( $aSubjectArray ) - 1;
585	+ if ( $nDesiredPosition > $nMaxPossiblePosition ) {
586	+ $nDesiredPosition = $nMaxPossiblePosition;
587	+ }
588
589	+ $nPosition = array_search( $mValue, $aSubjectArray );
590	+ if ( $nPosition !== false && $nPosition != $nDesiredPosition ) {
591
592	+ // remove existing and reset index
593	+ unset( $aSubjectArray[ $nPosition ] );
594	+ $aSubjectArray = array_values( $aSubjectArray );
595
596	+ // insert and update
597	+ // http://stackoverflow.com/questions/3797239/insert-new-item-in-array-on-any-position-in-php
598	+ array_splice( $aSubjectArray, $nDesiredPosition, 0, $mValue );



599	}
600
601	+ return $aSubjectArray;
602	+ }









603
604	+ /**
605	+ * Taken from: http://stackoverflow.com/questions/1755144/how-to-validate-domain-name-in-php
606	+ * @param string $sDomainName
607	+ * @return bool
608	+ */
609	+ public function isValidDomainName( $sDomainName ) {
610	+ $sDomainName = trim( $sDomainName );
611	+ return ( preg_match( "/^([a-z\d](-[a-z\d]))(\.([a-z\d](-[a-z\d])))*$/i", $sDomainName ) //valid chars check
612	+ && preg_match( "/^.{1,253}$/", $sDomainName ) //overall length check
613	+ && preg_match( "/^[^\.]{1,63}(\.[^\.]{1,63})*$/", $sDomainName ) );//length of each label
614	+ }
615	+
616	+ /**
617	+ * @return int
618	+ */
619	+ public function time() {
620	+ return self::GetRequestTime();
621	}
622	+ }

src/common/icwp-edd.php CHANGED Viewed

@@ -20,6 +20,43 @@ class ICWP_WPSF_Edd extends ICWP_WPSF_Foundation {
             		return self::$oInstance;
+            	}
             	/**
             	 * @param string $sStoreUrl
             	 * @param string $sKey


20	return self::$oInstance;
21	}
22
23	+ /**
24	+ * A simple outgoing POST request to see that we can communicate with the ODP servers
25	+ * @param string $sStoreUrl
26	+ * @return string
27	+ */
28	+ public function ping( $sStoreUrl ) {
29	+ $oLicense = null;
30	+
31	+ $sStoreUrl = add_query_arg(
32	+ array( 'license_ping' => 'Y' ),
33	+ $sStoreUrl
34	+ );
35	+
36	+ $aParams = array(
37	+ 'method' => 'POST',
38	+ 'body' => array(
39	+ 'ping' => 'pong',
40	+ 'license' => 'abcdefghi',
41	+ 'item_id' => '123',
42	+ 'url' => $this->loadWp()->getWpUrl()
43	+ )
44	+ );
45	+
46	+ $mResponse = $this->loadFS()
47	+ ->requestUrl( $sStoreUrl, $aParams );
48	+
49	+ $sResult = 'Unknown error communicating with license server';
50	+ if ( is_array( $mResponse ) && !empty( $mResponse[ 'body' ] ) ) {
51	+ $aResult = @json_decode( $mResponse[ 'body' ], true );
52	+ $sResult = ( isset( $aResult[ 'success' ] ) && $aResult[ 'success' ] ) ? 'success' : 'unknown failure';
53	+ }
54	+ else if ( is_wp_error( $mResponse ) ) {
55	+ $sResult = $mResponse->get_error_message();
56	+ }
57	+ return $sResult;
58	+ }
59	+
60	/**
61	* @param string $sStoreUrl
62	* @param string $sKey

src/common/icwp-factory.php CHANGED Viewed

	@@ -6,14 +6,13 @@ if ( class_exists( 'ICWP_WPSF_Factory', false ) ) {
6	class ICWP_WPSF_Factory {
7
8	/**
9	- * @param string $sOptionsName
10	* @return ICWP_WPSF_OptionsVO
11	*/
12	- static public function OptionsVo( ~~$sOptionsName~~ ) {
13	if ( !class_exists( 'ICWP_WPSF_OptionsVO' ) ) {
14	require_once( dirname( __FILE__ ).DIRECTORY_SEPARATOR.'icwp-optionsvo.php' );
15	}
16	- return new ICWP_WPSF_OptionsVO( ~~$sOptionsName~~ );
17	}
18
19	/**


6	class ICWP_WPSF_Factory {
7
8	/**

9	* @return ICWP_WPSF_OptionsVO
10	*/
11	+ static public function OptionsVo() {
12	if ( !class_exists( 'ICWP_WPSF_OptionsVO' ) ) {
13	require_once( dirname( __FILE__ ).DIRECTORY_SEPARATOR.'icwp-optionsvo.php' );
14	}
15	+ return new ICWP_WPSF_OptionsVO();
16	}
17
18	/**

src/common/icwp-foundation.php CHANGED Viewed

	@@ -314,8 +314,8 @@ class ICWP_WPSF_Foundation {
314
315	/**
316	*/
317	- static public function ~~loadLib_Carbon~~() {
318	- self::requireCommonLib( 'lib'.~~DIRECTORY_SEPARATOR.'Carbon'.DIRECTORY_SEPARATOR.'Carbon.~~php' );
319	}
320
321	/**


314
315	/**
316	*/
317	+ static public function loadAutoload() {
318	+ self::requireCommonLib( 'lib/vendor/autoload.php' );
319	}
320
321	/**

src/common/icwp-googlearecaptcha.php CHANGED Viewed

@@ -1,45 +1,46 @@
             <?php
-            -
            if ( !class_exists( 'ICWP_WPSF_GoogleRecaptcha', false ) ):
-            -
            	class ICWP_WPSF_GoogleRecaptcha {
-            -
            		/**
-            -
            		 * @var ICWP_WPSF_GoogleRecaptcha
-            -
            		 */
-            -
            		protected static $oInstance = NULL;
-            -
            		/**
-            -
            		 * @var \ReCaptcha\ReCaptcha
-            -
            		 */
-            -
            		protected static $oGR;
-            -
            		/**
-            -
            		 * @return ICWP_WPSF_GoogleRecaptcha
-            -
            		 */
-            -
            		public static function GetInstance() {
-            -
            			if ( is_null( self::$oInstance ) ) {
-            -
            				self::$oInstance = new self();
-            -
            			}
-            -
            			return self::$oInstance;
+            		}
-            -
            		/**
-            -
            		 */
-            -
            		protected function loadGoogleRecaptchaLib() {
-            -
            			return require_once( dirname(__FILE__).DIRECTORY_SEPARATOR.'googlerecaptcha/autoload.php' );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sSecret
-            -
            		 * @return \ReCaptcha\ReCaptcha
-            -
            		 */
-            -
            		public function getGoogleRecaptchaLib( $sSecret ) {
-            -
            			if ( !isset( self::$oGR ) ) {
-            -
            				if ( $this->loadGoogleRecaptchaLib() ) {
-            -
            					self::$oGR = new \ReCaptcha\ReCaptcha( $sSecret, new \ReCaptcha\RequestMethod\WordpressPost() );
-            -
            				}
+            			}
-            -
            			return self::$oGR;
+            		}
+            	}
-            -
            endif;


1	<?php
2	+ if ( class_exists( 'ICWP_WPSF_GoogleRecaptcha', false ) ) {
3	+ return;
4	+ }
5
6	+ class ICWP_WPSF_GoogleRecaptcha {
7
8	+ /**
9	+ * @var ICWP_WPSF_GoogleRecaptcha
10	+ */
11	+ protected static $oInstance = null;
12
13	+ /**
14	+ * @var \ReCaptcha\ReCaptcha
15	+ */
16	+ protected static $oGR;
17
18	+ /**
19	+ * @return ICWP_WPSF_GoogleRecaptcha
20	+ */
21	+ public static function GetInstance() {
22	+ if ( is_null( self::$oInstance ) ) {
23	+ self::$oInstance = new self();


24	}
25	+ return self::$oInstance;
26	+ }
27
28	+ /**
29	+ */
30	+ protected function loadGoogleRecaptchaLib() {
31	+ return require_once( dirname( __FILE__ ).DIRECTORY_SEPARATOR.'googlerecaptcha/autoload.php' );
32	+ }
33
34	+ /**
35	+ * @param string $sSecret
36	+ * @return \ReCaptcha\ReCaptcha
37	+ */
38	+ public function getGoogleRecaptchaLib( $sSecret ) {
39	+ if ( !isset( self::$oGR ) ) {
40	+ if ( $this->loadGoogleRecaptchaLib() ) {
41	+ self::$oGR = new \ReCaptcha\ReCaptcha( $sSecret, new \ReCaptcha\RequestMethod\WordpressPost() );

42	}

43	}
44	+ return self::$oGR;
45	}
46	+ }

src/common/icwp-googleauthenticator.php CHANGED Viewed

@@ -1,72 +1,73 @@
             <?php
-            -
            if ( !class_exists( 'ICWP_WPSF_GoogleAuthenticator', false ) ):
-            -
            	class ICWP_WPSF_GoogleAuthenticator {
-            -
            		/**
-            -
            		 * @var ICWP_WPSF_GoogleAuthenticator
-            -
            		 */
-            -
            		protected static $oInstance = NULL;
-            -
            		/**
-            -
            		 * @var PHPGangsta_GoogleAuthenticator
-            -
            		 */
-            -
            		protected static $oGA;
-            -
            		/**
-            -
            		 * @return ICWP_WPSF_GoogleAuthenticator
-            -
            		 */
-            -
            		public static function GetInstance() {
-            -
            			if ( is_null( self::$oInstance ) ) {
-            -
            				self::$oInstance = new self();
-            -
            			}
-            -
            			return self::$oInstance;
+            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function generateNewSecret() {
-            -
            			return $this->getGoogleAuthenticatorLib()->createSecret();
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sSecret
-            -
            		 * @param string $sName
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getGoogleQrChartUrl( $sSecret, $sName = 'icwp' ) {
-            -
            			return $this->getGoogleAuthenticatorLib()->getQRCodeGoogleUrl( $sName, $sSecret );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sSecret
-            -
            		 * @param string $sPassword
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function verifyOtp( $sSecret, $sPassword ) {
-            -
            			return $this->getGoogleAuthenticatorLib()->verifyCode( $sSecret, $sPassword );
-            -
            		}
-            -
            		/**
-            -
            		 */
-            -
            		protected function loadGoogleAuthenticatorLib() {
-            -
            			if ( !class_exists( 'PHPGangsta_GoogleAuthenticator', false ) ) {
-            -
            				require_once( dirname(__FILE__).DIRECTORY_SEPARATOR.'googleauthenticator/googleauthenticator.php' );
-            -
            			}
-            -
            			return class_exists( 'PHPGangsta_GoogleAuthenticator', false );
+            		}
-            -
            		/**
-            -
            		 * @return PHPGangsta_GoogleAuthenticator
-            -
            		 */
-            -
            		protected function getGoogleAuthenticatorLib() {
-            -
            			if ( !isset( self::$oGA ) ) {
-            -
            				if ( $this->loadGoogleAuthenticatorLib() ) {
-            -
            					self::$oGA = new PHPGangsta_GoogleAuthenticator();
-            -
            				}
+            			}
-            -
            			return self::$oGA;
+            		}
+            	}
-            -
            endif;


1	<?php
2	+ if ( class_exists( 'ICWP_WPSF_GoogleAuthenticator', false ) ) {
3	+ return;
4	+ }
5
6	+ class ICWP_WPSF_GoogleAuthenticator {
7
8	+ /**
9	+ * @var ICWP_WPSF_GoogleAuthenticator
10	+ */
11	+ protected static $oInstance = null;
12
13	+ /**
14	+ * @var PHPGangsta_GoogleAuthenticator
15	+ */
16	+ protected static $oGA;
17
18	+ /**
19	+ * @return ICWP_WPSF_GoogleAuthenticator
20	+ */
21	+ public static function GetInstance() {
22	+ if ( is_null( self::$oInstance ) ) {
23	+ self::$oInstance = new self();


24	}
25	+ return self::$oInstance;
26	+ }
27
28	+ /**
29	+ * @return string
30	+ */
31	+ public function generateNewSecret() {
32	+ return $this->getGoogleAuthenticatorLib()->createSecret();
33	+ }
34
35	+ /**
36	+ * @param string $sSecret
37	+ * @param string $sName
38	+ * @return string
39	+ */
40	+ public function getGoogleQrChartUrl( $sSecret, $sName = 'icwp' ) {
41	+ return $this->getGoogleAuthenticatorLib()->getQRCodeGoogleUrl( $sName, $sSecret );
42	+ }
43
44	+ /**
45	+ * @param string $sSecret
46	+ * @param string $sPassword
47	+ * @return bool
48	+ */
49	+ public function verifyOtp( $sSecret, $sPassword ) {
50	+ return $this->getGoogleAuthenticatorLib()->verifyCode( $sSecret, $sPassword );
51	+ }
52
53	+ /**
54	+ */
55	+ protected function loadGoogleAuthenticatorLib() {
56	+ if ( !class_exists( 'PHPGangsta_GoogleAuthenticator', false ) ) {
57	+ require_once( dirname( __FILE__ ).DIRECTORY_SEPARATOR.'googleauthenticator/googleauthenticator.php' );


58	}
59	+ return class_exists( 'PHPGangsta_GoogleAuthenticator', false );
60	+ }
61
62	+ /**
63	+ * @return PHPGangsta_GoogleAuthenticator
64	+ */
65	+ protected function getGoogleAuthenticatorLib() {
66	+ if ( !isset( self::$oGA ) ) {
67	+ if ( $this->loadGoogleAuthenticatorLib() ) {
68	+ self::$oGA = new PHPGangsta_GoogleAuthenticator();

69	}

70	}
71	+ return self::$oGA;
72	}
73	+ }

src/common/icwp-optionsvo.php CHANGED Viewed

	@@ -45,13 +45,11 @@ class ICWP_WPSF_OptionsVO extends ICWP_WPSF_Foundation {
45	/**
46	* @var string
47	*/
48	- protected $~~sOptionsName~~;
49
50	/**
51	- * @param string $sOptionsName
52	*/
53	- public function __construct( ~~$sOptionsName~~ ) {
54	- $this->sOptionsName = $sOptionsName;
55	}
56
57	/**
	@@ -96,6 +94,13 @@ class ICWP_WPSF_OptionsVO extends ICWP_WPSF_Foundation {
96	return $this->getStoredOptions();
97	}
98







99	/**
100	* Returns an array of all the transferable options and their values
101	* @return array
	@@ -377,8 +382,8 @@ class ICWP_WPSF_OptionsVO extends ICWP_WPSF_Foundation {
377	/**
378	* @return string
379	*/
380	- public function ~~getOptionsName~~() {
381	- return $this->~~sOptionsName~~;
382	}
383
384	/**
	@@ -412,7 +417,6 @@ class ICWP_WPSF_OptionsVO extends ICWP_WPSF_Foundation {
412
413	/**
414	* @return array
415	- * @throws Exception
416	*/
417	public function getRawData_FullFeatureConfig() {
418	if ( empty( $this->aRawOptionsConfigData ) ) {
	@@ -674,7 +678,6 @@ class ICWP_WPSF_OptionsVO extends ICWP_WPSF_Foundation {
674
675	/**
676	* @return array
677	- * @throws Exception
678	*/
679	private function readConfiguration() {
680	$oWp = $this->loadWp();
	@@ -705,7 +708,7 @@ class ICWP_WPSF_OptionsVO extends ICWP_WPSF_Foundation {
705	private function readConfigurationJson() {
706	$aConfig = json_decode( $this->readConfigurationFileContents(), true );
707	if ( empty( $aConfig ) ) {
708	- throw new Exception( sprintf( 'Reading JSON configuration from file "%s" failed.', $this->~~getOptionsName~~() ) );
709	}
710	return $aConfig;
711	}
	@@ -716,32 +719,32 @@ class ICWP_WPSF_OptionsVO extends ICWP_WPSF_Foundation {
716	*/
717	private function readConfigurationFileContents() {
718	if ( !$this->getConfigFileExists() ) {
719	- throw new Exception( sprintf( 'Configuration file "%s" does not exist.', $this->~~getConfigFilePath~~() ) );
720	}
721	- return $this->~~loadDataProcessor~~()->readFileContentsUsingInclude( $this->~~getConfigFilePath~~() );
722	}
723
724	/**
725	* @return string
726	*/
727	private function getSpecTransientStorageKey() {
728	- return 'icwp_'.md5( $this->~~getConfigFilePath~~() );
729	}
730
731	/**
732	* @return bool
733	*/
734	private function getConfigFileExists() {
735	- $sPath = $this->~~getConfigFilePath~~();
736	return !empty( $sPath ) && $this->loadFS()->isFile( $sPath );
737	}
738
739	/**
740	- * @~~return~~ string

741	*/
742	- ~~private~~ function ~~getConfigFilePath~~() {
743	- ~~return~~ ~~realpath(~~ ~~dirname( __FILE__ ).DIRECTORY_SEPARATOR.'..'.DIRECTORY_SEPARATOR~~
744	- ~~.sprintf(~~ ~~'config'.DIRECTORY_SEPARATOR.'feature-%s.%s',~~ $this~~->getOptionsName(), 'php' )~~
745	- );
746	}
747	}


45	/**
46	* @var string
47	*/
48	+ protected $sPathToConfig;
49
50	/**

51	*/
52	+ public function __construct() {

53	}
54
55	/**

94	return $this->getStoredOptions();
95	}
96
97	+ /**
98	+ * @return string
99	+ */
100	+ public function getSlug() {
101	+ return $this->getFeatureProperty( 'slug' );
102	+ }
103	+
104	/**
105	* Returns an array of all the transferable options and their values
106	* @return array

382	/**
383	* @return string
384	*/
385	+ public function getPathToConfig() {
386	+ return $this->sPathToConfig;
387	}
388
389	/**

417
418	/**
419	* @return array

420	*/
421	public function getRawData_FullFeatureConfig() {
422	if ( empty( $this->aRawOptionsConfigData ) ) {

678
679	/**
680	* @return array

681	*/
682	private function readConfiguration() {
683	$oWp = $this->loadWp();

708	private function readConfigurationJson() {
709	$aConfig = json_decode( $this->readConfigurationFileContents(), true );
710	if ( empty( $aConfig ) ) {
711	+ throw new Exception( sprintf( 'Reading JSON configuration from file "%s" failed.', $this->getSlug() ) );
712	}
713	return $aConfig;
714	}

719	*/
720	private function readConfigurationFileContents() {
721	if ( !$this->getConfigFileExists() ) {
722	+ throw new Exception( sprintf( 'Configuration file "%s" does not exist.', $this->getPathToConfig() ) );
723	}
724	+ return $this->loadDP()->readFileContentsUsingInclude( $this->getPathToConfig() );
725	}
726
727	/**
728	* @return string
729	*/
730	private function getSpecTransientStorageKey() {
731	+ return 'icwp_'.md5( $this->getPathToConfig() );
732	}
733
734	/**
735	* @return bool
736	*/
737	private function getConfigFileExists() {
738	+ $sPath = $this->getPathToConfig();
739	return !empty( $sPath ) && $this->loadFS()->isFile( $sPath );
740	}
741
742	/**
743	+ * @param string $sPathToConfig
744	+ * @return $this
745	*/
746	+ public function setPathToConfig( $sPathToConfig ) {
747	+ $this->sPathToConfig = $sPathToConfig;
748	+ return $this;

749	}
750	}

src/common/icwp-render.php CHANGED Viewed

@@ -1,332 +1,334 @@
             <?php
-            -
            if ( !class_exists( 'ICWP_WPSF_Render', false ) ):
-            -
            	class ICWP_WPSF_Render extends ICWP_WPSF_Foundation {
-            -
            		const TEMPLATE_ENGINE_TWIG = 0;
-            -
            		const TEMPLATE_ENGINE_PHP = 1;
-            -
            		const TEMPLATE_ENGINE_HTML = 2;
-            -
            		/**
-            -
            		 * @var ICWP_WPSF_Render
-            -
            		 */
-            -
            		protected static $oInstance = NULL;
-            -
            		private function __construct() {}
-            -
            		/**
-            -
            		 * @return ICWP_WPSF_Render
-            -
            		 */
-            -
            		public static function GetInstance() {
-            -
            			if ( is_null( self::$oInstance ) ) {
-            -
            				self::$oInstance = new self();
-            -
            			}
-            -
            			return self::$oInstance;
+            		}
-            -
            		/**
-            -
            		 * @var array
-            -
            		 */
-            -
            		protected $aRenderVars;
-            -
-            -
            		/**
-            -
            		 * @var string
-            -
            		 */
-            -
            		protected $sTemplatePath;
-            -
-            -
            		/**
-            -
            		 * @var string
-            -
            		 */
-            -
            		protected $sAutoloaderPath;
-            -
-            -
            		/**
-            -
            		 * @var string
-            -
            		 */
-            -
            		protected $sTemplate;
-            -
-            -
            		/**
-            -
            		 * @var int
-            -
            		 */
-            -
            		protected $nTemplateEngine;
-            -
-            -
            		/**
-            -
            		 * @var Twig_Environment
-            -
            		 */
-            -
            		protected $oTwigEnv;
-            -
-            -
            		/**
-            -
            		 * @var Twig_Loader_Filesystem
-            -
            		 */
-            -
            		protected $oTwigLoader;
-            -
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function render() {
-            -
-            -
            			switch( $this->getTemplateEngine() ) {
-            -
-            -
            				case self::TEMPLATE_ENGINE_TWIG :
-            -
            					$sOutput = $this->renderTwig();
-            -
            					break;
-            -
-            -
            				case self::TEMPLATE_ENGINE_HTML :
-            -
            					$sOutput = $this->renderHtml();
-            -
            					break;
-            -
-            -
            				default:
-            -
            					$sOutput = $this->renderPhp();
-            -
            					break;
-            -
            			}
-            -
            			return $sOutput;
+            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		private function renderHtml() {
-            -
            			ob_start();
-            -
            			@include( $this->getTemplateRoot().ltrim( $this->getTemplate(), DIRECTORY_SEPARATOR ) );
-            -
            			$sContents = ob_get_contents();
-            -
            			ob_end_clean();
-            -
            			return $sContents;
-            -
            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		private function renderPhp() {
-            -
            			if ( count( $this->getRenderVars() ) > 0 ) {
-            -
            				extract( $this->getRenderVars() );
-            -
            			}
-            -
-            -
            			$sTemplate = $this->getTemplateRoot() . ltrim( $this->getTemplate(), DIRECTORY_SEPARATOR );
-            -
            			if ( $this->loadFS()->isFile( $sTemplate ) ) {
-            -
            				ob_start();
-            -
            				include( $sTemplate );
-            -
            				$sContents = ob_get_contents();
-            -
            				ob_end_clean();
-            -
            			}
-            -
            			else {
-            -
            				$sContents = 'Error: Template file not found: ' . $sTemplate;
-            -
            			}
-            -
-            -
            			return $sContents;
+            		}
-            -
            		/**
-            -
            		 * @deprecated
-            -
            		 * @return string
-            -
            		 * @throws Exception
-            -
            		 */
-            -
            		private function renderTwig() {
-            -
            			throw new Exception( 'Twig codebase has been removed since version 5.3.3. Render using PHP instead.' );
-            -
            			$oTwig = $this->getTwigEnvironment();
-            -
            			return $oTwig->render( $this->getTemplate(), $this->getRenderVars() );
+            		}
-            -
-            -
            		/**
-            -
            		 */
-            -
            		public function display() {
-            -
            			echo $this->render();
-            -
            			return $this;
+            		}
-            -
            		/**
-            -
            		 */
-            -
            		protected function autoload() {
-            -
            			if ( !class_exists( 'Twig_Autoloader', false ) ) {
-            -
            				require_once( $this->sAutoloaderPath );
-            -
            				Twig_Autoloader::register();
-            -
            			}
-            -
            		}
-            -
            		/**
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function clearRenderVars() {
-            -
            			return $this->setRenderVars( array() );
-            -
            		}
-            -
            		/**
-            -
            		 * @return Twig_Environment
-            -
            		 */
-            -
            		protected function getTwigEnvironment() {
-            -
            			if ( !isset( $this->oTwigEnv )  ) {
-            -
            				$this->autoload();
-            -
            				$this->oTwigEnv = new Twig_Environment( $this->getTwigLoader(),
-            -
            					array(
-            -
            						'debug' => true,
-            -
            						'strict_variables' => true,
-            -
            					)
-            -
            				);
-            -
            			}
-            -
            			return $this->oTwigEnv;
-            -
            		}
-            -
            		/**
-            -
            		 * @return Twig_Loader_Filesystem
-            -
            		 */
-            -
            		protected function getTwigLoader() {
-            -
            			if ( !isset( $this->oTwigLoader )  ) {
-            -
            				$this->autoload();
-            -
            				$this->oTwigLoader = new Twig_Loader_Filesystem( $this->getTemplateRoot() );
-            -
            			}
-            -
            			return $this->oTwigLoader;
+            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getTemplate() {
-            -
            			$this->sTemplate = $this->loadDataProcessor()->addExtensionToFilePath( $this->sTemplate, $this->getEngineStub() );
-            -
            			return $this->sTemplate;
-            -
            		}
-            -
            		/**
-            -
            		 * @return int
-            -
            		 */
-            -
            		public function getTemplateEngine() {
-            -
            			if ( !isset( $this->nTemplateEngine )
-            -
            				 || !in_array( $this->nTemplateEngine, array( self::TEMPLATE_ENGINE_TWIG, self::TEMPLATE_ENGINE_PHP, self::TEMPLATE_ENGINE_HTML ) ) ) {
-            -
            				$this->nTemplateEngine = self::TEMPLATE_ENGINE_PHP;
-            -
            			}
-            -
            			return $this->nTemplateEngine;
+            		}
-            -
            		/**
-            -
            		 * @param string $sTemplate
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getTemplateExists( $sTemplate = '' ) {
-            -
            			$sFullPath = $this->getTemplateFullPath( $sTemplate );
-            -
            			return $this->loadFS()->exists( $sFullPath );
+            		}
-            -
            		/**
-            -
            		 * @param string $sTemplate
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getTemplateFullPath( $sTemplate = '' ) {
-            -
            			if ( empty( $sTemplate ) ) {
-            -
            				$sTemplate = $this->getTemplate();
-            -
            			}
-            -
            			$sTemplate = $this->loadDataProcessor()->addExtensionToFilePath( $sTemplate, $this->getEngineStub() );
-            -
            			return path_join( $this->getTemplateRoot(), $sTemplate );
-            -
            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getTemplateRoot() {
-            -
            			$sPath = rtrim( $this->sTemplatePath, DIRECTORY_SEPARATOR );
-            -
            			$sStub = $this->getEngineStub();
-            -
            			if ( !preg_match( sprintf( '#%s$#', $sStub ), $sPath ) ) {
-            -
            				$sPath = $sPath.DIRECTORY_SEPARATOR.$sStub;
-            -
            			}
-            -
            			return $sPath.DIRECTORY_SEPARATOR;
+            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getRenderVars() {
-            -
            			return $this->aRenderVars;
-            -
            		}
-            -
            		/**
-            -
            		 * @param array $aVars
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setRenderVars( $aVars ) {
-            -
            			$this->aRenderVars = $aVars;
-            -
            			return $this;
+            		}
-            -
            		/**
-            -
            		 * @param string $sPath
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setAutoloaderPath( $sPath ) {
-            -
            			$this->sAutoloaderPath = $sPath;
-            -
            			return $this;
+            		}
-            -
            		/**
-            -
            		 * @param string $sPath
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setTemplate( $sPath ) {
             //			if ( !preg_match( '#\.twig$#', $sPath ) ) {
             //				$sPath = $sPath . '.twig';
             //			}
-            -
            			$this->sTemplate = $sPath;
-            -
            			return $this;
-            -
            		}
-            -
            		/**
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setTemplateEngineHtml() {
-            -
            			return $this->setTemplateEngine( self::TEMPLATE_ENGINE_HTML );
-            -
            		}
-            -
            		/**
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setTemplateEnginePhp() {
-            -
            			return $this->setTemplateEngine( self::TEMPLATE_ENGINE_PHP );
-            -
            		}
-            -
            		/**
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setTemplateEngineTwig() {
-            -
            			return $this->setTemplateEngine( self::TEMPLATE_ENGINE_TWIG );
-            -
            		}
-            -
            		/**
-            -
            		 * @param int $nEngine
-            -
            		 * @return $this
-            -
            		 */
-            -
            		protected function setTemplateEngine( $nEngine ) {
-            -
            			$this->nTemplateEngine = $nEngine;
-            -
            			return $this;
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sPath
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setTemplateRoot( $sPath ) {
-            -
            			$this->sTemplatePath = $sPath;
-            -
            			return $this;
-            -
            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		private function getEngineStub() {
-            -
            			switch( $this->getTemplateEngine() ) {
-            -
-            -
            				case self::TEMPLATE_ENGINE_TWIG:
-            -
            					$sStub = 'twig';
-            -
            					break;
-            -
-            -
            				case self::TEMPLATE_ENGINE_HTML:
-            -
            					$sStub = 'html';
-            -
            					break;
-            -
-            -
            				case self::TEMPLATE_ENGINE_PHP:
-            -
            					$sStub = 'php';
-            -
            					break;
-            -
-            -
            				default:
-            -
            					$sStub = 'php';
-            -
            					break;
-            -
            			}
-            -
            			return $sStub;
+            		}
+            	}
-            -
-            -
            endif;


1	<?php
2	+ if ( class_exists( 'ICWP_WPSF_Render', false ) ) {
3	+ return;
4	+ }
5
6	+ class ICWP_WPSF_Render extends ICWP_WPSF_Foundation {
7
8	+ const TEMPLATE_ENGINE_TWIG = 0;
9	+ const TEMPLATE_ENGINE_PHP = 1;
10	+ const TEMPLATE_ENGINE_HTML = 2;
11
12	+ /**
13	+ * @var ICWP_WPSF_Render
14	+ */
15	+ protected static $oInstance = null;
16
17	+ private function __construct() {}
18
19	+ /**
20	+ * @return ICWP_WPSF_Render
21	+ */
22	+ public static function GetInstance() {
23	+ if ( is_null( self::$oInstance ) ) {
24	+ self::$oInstance = new self();


25	}
26	+ return self::$oInstance;
27	+ }
28
29	+ /**
30	+ * @var array
31	+ */
32	+ protected $aRenderVars;
33	+
34	+ /**
35	+ * @var string
36	+ */
37	+ protected $sTemplatePath;
38	+
39	+ /**
40	+ * @var string
41	+ */
42	+ protected $sAutoloaderPath;
43	+
44	+ /**
45	+ * @var string
46	+ */
47	+ protected $sTemplate;
48	+
49	+ /**
50	+ * @var int
51	+ */
52	+ protected $nTemplateEngine;
53	+
54	+ /**
55	+ * @var Twig_Environment
56	+ */
57	+ protected $oTwigEnv;
58	+
59	+ /**
60	+ * @var Twig_Loader_Filesystem
61	+ */
62	+ protected $oTwigLoader;
63	+
64	+ /**
65	+ * @return string
66	+ * @throws Exception
67	+ */
68	+ public function render() {
69	+
70	+ switch ( $this->getTemplateEngine() ) {
71	+
72	+ case self::TEMPLATE_ENGINE_TWIG :
73	+ $sOutput = $this->renderTwig();
74	+ break;
75	+
76	+ case self::TEMPLATE_ENGINE_HTML :
77	+ $sOutput = $this->renderHtml();
78	+ break;
79	+
80	+ default:
81	+ $sOutput = $this->renderPhp();
82	+ break;

83	}
84	+ return $sOutput;
85	+ }
86
87	+ /**
88	+ * @return string
89	+ */
90	+ private function renderHtml() {
91	+ ob_start();
92	+ @include( $this->getTemplateRoot().ltrim( $this->getTemplate(), DIRECTORY_SEPARATOR ) );
93	+ return ob_get_clean();
94	+ }


95
96	+ /**
97	+ * @return string
98	+ */
99	+ private function renderPhp() {
100	+ if ( count( $this->getRenderVars() ) > 0 ) {
101	+ extract( $this->getRenderVars() );














102	}
103
104	+ $sTemplate = $this->getTemplateRoot().ltrim( $this->getTemplate(), DIRECTORY_SEPARATOR );
105	+ if ( $this->loadFS()->isFile( $sTemplate ) ) {
106	+ ob_start();
107	+ include( $sTemplate );
108	+ $sContents = ob_get_clean();




109	}
110	+ else {
111	+ $sContents = 'Error: Template file not found: '.$sTemplate;




112	}
113
114	+ return $sContents;
115	+ }






116
117	+ /**
118	+ * @deprecated
119	+ * @return string
120	+ * @throws Exception
121	+ */
122	+ private function renderTwig() {
123	+ // throw new Exception( 'Twig codebase has been removed since version 5.3.3. Render using PHP instead.' );
124	+ $oTwig = $this->getTwigEnvironment();
125	+ return $oTwig->render( $this->getTemplate(), $this->getRenderVars() );
126	+ }
127
128	+ /**
129	+ */
130	+ public function display() {
131	+ echo $this->render();
132	+ return $this;
133	+ }









134
135	+ /**
136	+ */
137	+ protected function autoload() {
138	+ if ( !class_exists( 'Twig_Autoloader', false ) ) {
139	+ require_once( $this->sAutoloaderPath );
140	+ Twig_Autoloader::register();



141	}
142	+ }
143
144	+ /**
145	+ * @return $this
146	+ */
147	+ public function clearRenderVars() {
148	+ return $this->setRenderVars( array() );
149	+ }

150
151	+ /**
152	+ * @return Twig_Environment
153	+ */
154	+ protected function getTwigEnvironment() {
155	+ if ( !isset( $this->oTwigEnv ) ) {
156	+ self::loadAutoload();
157	+ $this->oTwigEnv = new Twig_Environment( $this->getTwigLoader(),
158	+ array(
159	+ 'debug' => true,
160	+ 'strict_variables' => true,
161	+ )
162	+ );
163	}
164	+ return $this->oTwigEnv;
165	+ }
166
167	+ /**
168	+ * @return Twig_Loader_Filesystem
169	+ */
170	+ protected function getTwigLoader() {
171	+ if ( !isset( $this->oTwigLoader ) ) {
172	+ $this->oTwigLoader = new Twig_Loader_Filesystem( $this->getTemplateRoot() );

173	}
174	+ return $this->oTwigLoader;
175	+ }
176
177	+ /**
178	+ * @return string
179	+ */
180	+ public function getTemplate() {
181	+ $this->sTemplate = $this->loadDataProcessor()
182	+ ->addExtensionToFilePath( $this->sTemplate, $this->getEngineStub() );
183	+ return $this->sTemplate;
184	+ }



185
186	+ /**
187	+ * @return int
188	+ */
189	+ public function getTemplateEngine() {
190	+ if ( !isset( $this->nTemplateEngine )
191	+ \|\| !in_array( $this->nTemplateEngine, array(
192	+ self::TEMPLATE_ENGINE_TWIG,
193	+ self::TEMPLATE_ENGINE_PHP,
194	+ self::TEMPLATE_ENGINE_HTML
195	+ ) ) ) {
196	+ $this->nTemplateEngine = self::TEMPLATE_ENGINE_PHP;
197	}
198	+ return $this->nTemplateEngine;
199	+ }
200
201	+ /**
202	+ * @param string $sTemplate
203	+ * @return string
204	+ */
205	+ public function getTemplateExists( $sTemplate = '' ) {
206	+ $sFullPath = $this->getTemplateFullPath( $sTemplate );
207	+ return $this->loadFS()->exists( $sFullPath );
208	+ }
209
210	+ /**
211	+ * @param string $sTemplate
212	+ * @return string
213	+ */
214	+ public function getTemplateFullPath( $sTemplate = '' ) {
215	+ if ( empty( $sTemplate ) ) {
216	+ $sTemplate = $this->getTemplate();
217	}
218	+ $sTemplate = $this->loadDataProcessor()->addExtensionToFilePath( $sTemplate, $this->getEngineStub() );
219	+ return path_join( $this->getTemplateRoot(), $sTemplate );
220	+ }
221
222	+ /**
223	+ * @return string
224	+ */
225	+ public function getTemplateRoot() {
226	+ $sPath = rtrim( $this->sTemplatePath, DIRECTORY_SEPARATOR );
227	+ $sStub = $this->getEngineStub();
228	+ if ( !preg_match( sprintf( '#%s$#', $sStub ), $sPath ) ) {
229	+ $sPath = $sPath.DIRECTORY_SEPARATOR.$sStub;
230	}
231	+ return $sPath.DIRECTORY_SEPARATOR;
232	+ }
233	+
234	+ /**
235	+ * @return array
236	+ */
237	+ public function getRenderVars() {
238	+ return $this->aRenderVars;
239	+ }
240	+
241	+ /**
242	+ * @param array $aVars
243	+ * @return $this
244	+ */
245	+ public function setRenderVars( $aVars ) {
246	+ $this->aRenderVars = $aVars;
247	+ return $this;
248	+ }
249	+
250	+ /**
251	+ * @param string $sPath
252	+ * @return $this
253	+ */
254	+ public function setAutoloaderPath( $sPath ) {
255	+ $this->sAutoloaderPath = $sPath;
256	+ return $this;
257	+ }
258
259	+ /**
260	+ * @param string $sPath
261	+ * @return $this
262	+ */
263	+ public function setTemplate( $sPath ) {
264	// if ( !preg_match( '#\.twig$#', $sPath ) ) {
265	// $sPath = $sPath . '.twig';
266	// }
267	+ $this->sTemplate = $sPath;
268	+ return $this;
269	+ }
270
271	+ /**
272	+ * @return $this
273	+ */
274	+ public function setTemplateEngineHtml() {
275	+ return $this->setTemplateEngine( self::TEMPLATE_ENGINE_HTML );
276	+ }
277
278	+ /**
279	+ * @return $this
280	+ */
281	+ public function setTemplateEnginePhp() {
282	+ return $this->setTemplateEngine( self::TEMPLATE_ENGINE_PHP );
283	+ }
284
285	+ /**
286	+ * @return $this
287	+ */
288	+ public function setTemplateEngineTwig() {
289	+ return $this->setTemplateEngine( self::TEMPLATE_ENGINE_TWIG );
290	+ }
291
292	+ /**
293	+ * @param int $nEngine
294	+ * @return $this
295	+ */
296	+ protected function setTemplateEngine( $nEngine ) {
297	+ $this->nTemplateEngine = $nEngine;
298	+ return $this;
299	+ }
300
301	+ /**
302	+ * @param string $sPath
303	+ * @return $this
304	+ */
305	+ public function setTemplateRoot( $sPath ) {
306	+ $this->sTemplatePath = $sPath;
307	+ return $this;
308	+ }
309	+
310	+ /**
311	+ * @return string
312	+ */
313	+ private function getEngineStub() {
314	+ switch ( $this->getTemplateEngine() ) {
315	+
316	+ case self::TEMPLATE_ENGINE_TWIG:
317	+ $sStub = 'twig';
318	+ break;
319
320	+ case self::TEMPLATE_ENGINE_HTML:
321	+ $sStub = 'html';
322	+ break;
323	+
324	+ case self::TEMPLATE_ENGINE_PHP:
325	+ $sStub = 'php';
326	+ break;
327	+
328	+ default:
329	+ $sStub = 'php';
330	+ break;












331	}
332	+ return $sStub;
333	}
334	+ }

src/common/icwp-wpcron.php CHANGED Viewed

@@ -1,127 +1,128 @@
             <?php
-            -
            if ( !class_exists( 'ICWP_WPSF_WpCron', false ) ):
-            -
-            -
            	class ICWP_WPSF_WpCron {
-            -
-            -
            		/**
-            -
            		 * @var ICWP_WPSF_WpCron
-            -
            		 */
-            -
            		protected static $oInstance = NULL;
-            -
            		private function __construct() {}
-            -
-            -
            		/**
-            -
            		 * @var int
-            -
            		 */
-            -
            		protected $nNextRun;
-            -
-            -
            		/**
-            -
            		 * @var string
-            -
            		 */
-            -
            		protected $sRecurrence;
-            -
-            -
            		/**
-            -
            		 * @return ICWP_WPSF_WpCron
-            -
            		 */
-            -
            		public static function GetInstance() {
-            -
            			if ( is_null( self::$oInstance ) ) {
-            -
            				self::$oInstance = new self();
-            -
            			}
-            -
            			return self::$oInstance;
-            -
            		}
-            -
-            -
            		/**
-            -
            		 * @param string $sCronName
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function getIfCronExists( $sCronName ) {
-            -
            			return (bool)wp_next_scheduled( $sCronName );
+            		}
-            -
            		/**
-            -
            		 * @return int
-            -
            		 */
-            -
            		public function getNextRun() {
-            -
            			if ( is_null( $this->nNextRun ) ) {
-            -
            				return strtotime( 'tomorrow 4am' ) - get_option( 'gmt_offset' ) * HOUR_IN_SECONDS;
-            -
            			}
-            -
            			return $this->nNextRun;
-            -
            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getRecurrence() {
-            -
            			if ( empty( $this->sRecurrence ) || !in_array( $this->sRecurrence, $this->getPermittedRecurrences() ) ) {
-            -
            				return 'daily';
-            -
            			}
-            -
            			return $this->sRecurrence;
+            		}
-            -
            		/**
-            -
            		 * @param int $nNextRun
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setNextRun( $nNextRun ) {
-            -
            			$this->nNextRun = $nNextRun;
-            -
            			return $this;
+            		}
-            -
            		/**
-            -
            		 * @param string $sRecurrence
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function setRecurrence( $sRecurrence ) {
-            -
            			$this->sRecurrence = $sRecurrence;
-            -
            			return $this;
-            -
            		}
-            -
            		/**
-            -
            		 * @return $this
-            -
            		 */
-            -
            		public function reset() {
-            -
            			return $this
-            -
            				->setNextRun( null )
-            -
            				->setRecurrence( null );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string   $sUniqueCronName
-            -
            		 * @param callback $cCallback
-            -
            		 * @return $this
-            -
            		 * @throws Exception
-            -
            		 */
-            -
            		public function createCronJob( $sUniqueCronName, $cCallback ) {
-            -
            			if ( !is_callable( $cCallback ) ) {
-            -
            				throw new Exception( sprintf( 'Tried to schedule a new cron but the Callback function is not callable: %s', print_r( $cCallback, true ) ) );
-            -
            			}
-            -
            			add_action( $sUniqueCronName, $cCallback );
-            -
            			return $this->setCronSchedule( $sUniqueCronName );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sUniqueCronName
-            -
            		 */
-            -
            		public function deleteCronJob( $sUniqueCronName ) {
-            -
            			wp_clear_scheduled_hook( $sUniqueCronName );
+            		}
-            -
            		/**
-            -
            		 * @param string $sUniqueCronActionName
-            -
            		 * @return $this
-            -
            		 */
-            -
            		protected function setCronSchedule( $sUniqueCronActionName ) {
-            -
            			if ( ! wp_next_scheduled( $sUniqueCronActionName ) && ! defined( 'WP_INSTALLING' ) ) {
-            -
            				wp_schedule_event( $this->getNextRun(), $this->getRecurrence(), $sUniqueCronActionName );
-            -
            			}
-            -
            			return $this;
-            -
            		}
-            -
            		/**
-            -
            		 * @return array
-            -
            		 */
-            -
            		private function getPermittedRecurrences() {
-            -
            			return array( 'hourly', 'twicedaily', 'daily' );
+            		}
+            	}
-            -
            endif;


1	<?php
2	+ if ( class_exists( 'ICWP_WPSF_WpCron', false ) ) {
3	+ return;
4	+ }
5	+
6	+ class ICWP_WPSF_WpCron {
7	+
8	+ /**
9	+ * @var ICWP_WPSF_WpCron
10	+ */
11	+ protected static $oInstance = null;
12	+ private function __construct() { }
13	+
14	+ /**
15	+ * @var int
16	+ */
17	+ protected $nNextRun;
18	+
19	+ /**
20	+ * @var string
21	+ */
22	+ protected $sRecurrence;
23	+
24	+ /**
25	+ * @return ICWP_WPSF_WpCron
26	+ */
27	+ public static function GetInstance() {
28	+ if ( is_null( self::$oInstance ) ) {
29	+ self::$oInstance = new self();








30	}
31	+ return self::$oInstance;
32	+ }
33
34	+ /**
35	+ * @param string $sCronName
36	+ * @return bool
37	+ */
38	+ public function getIfCronExists( $sCronName ) {
39	+ return (bool)wp_next_scheduled( $sCronName );
40	+ }


41
42	+ /**
43	+ * @return int
44	+ */
45	+ public function getNextRun() {
46	+ if ( is_null( $this->nNextRun ) ) {
47	+ return strtotime( 'tomorrow 4am' ) - get_option( 'gmt_offset' )*HOUR_IN_SECONDS;


48	}
49	+ return $this->nNextRun;
50	+ }
51
52	+ /**
53	+ * @return string
54	+ */
55	+ public function getRecurrence() {
56	+ if ( empty( $this->sRecurrence ) \|\| !in_array( $this->sRecurrence, $this->getPermittedRecurrences() ) ) {
57	+ return 'daily';

58	}
59	+ return $this->sRecurrence;
60	+ }
61
62	+ /**
63	+ * @param int $nNextRun
64	+ * @return $this
65	+ */
66	+ public function setNextRun( $nNextRun ) {
67	+ $this->nNextRun = $nNextRun;
68	+ return $this;
69	+ }
70
71	+ /**
72	+ * @param string $sRecurrence
73	+ * @return $this
74	+ */
75	+ public function setRecurrence( $sRecurrence ) {
76	+ $this->sRecurrence = $sRecurrence;
77	+ return $this;
78	+ }
79
80	+ /**
81	+ * @return $this
82	+ */
83	+ public function reset() {
84	+ return $this
85	+ ->setNextRun( null )
86	+ ->setRecurrence( null );
87	+ }





88
89	+ /**
90	+ * @param string $sUniqueCronName
91	+ * @param callback $cCallback
92	+ * @return $this
93	+ * @throws Exception
94	+ */
95	+ public function createCronJob( $sUniqueCronName, $cCallback ) {
96	+ if ( !is_callable( $cCallback ) ) {
97	+ throw new Exception( sprintf( 'Tried to schedule a new cron but the Callback function is not callable: %s', print_r( $cCallback, true ) ) );
98	}
99	+ add_action( $sUniqueCronName, $cCallback );
100	+ return $this->setCronSchedule( $sUniqueCronName );
101	+ }
102
103	+ /**
104	+ * @param string $sUniqueCronName
105	+ */
106	+ public function deleteCronJob( $sUniqueCronName ) {
107	+ wp_clear_scheduled_hook( $sUniqueCronName );
108	+ }




109
110	+ /**
111	+ * @param string $sUniqueCronActionName
112	+ * @return $this
113	+ */
114	+ protected function setCronSchedule( $sUniqueCronActionName ) {
115	+ if ( !wp_next_scheduled( $sUniqueCronActionName ) && !defined( 'WP_INSTALLING' ) ) {
116	+ wp_schedule_event( $this->getNextRun(), $this->getRecurrence(), $sUniqueCronActionName );
117	+ $this->reset();
118	}
119	+ return $this;
120	}
121
122	+ /**
123	+ * @return array
124	+ */
125	+ private function getPermittedRecurrences() {
126	+ return array( 'hourly', 'twicedaily', 'daily' );
127	+ }
128	+ }

src/common/icwp-wpdb.php CHANGED Viewed

@@ -1,227 +1,220 @@
             <?php
-            -
            if ( !class_exists( 'ICWP_WPSF_WpDb', false ) ):
-            -
-            -
            	class ICWP_WPSF_WpDb {
-            -
-            -
            		/**
-            -
            		 * @var ICWP_WPSF_WpDb
-            -
            		 */
-            -
            		protected static $oInstance = NULL;
-            -
-            -
            		/**
-            -
            		 * @var wpdb
-            -
            		 */
-            -
            		protected $oWpdb;
-            -
-            -
            		/**
-            -
            		 * @return ICWP_WPSF_WpDb
-            -
            		 */
-            -
            		public static function GetInstance() {
-            -
            			if ( is_null( self::$oInstance ) ) {
-            -
            				self::$oInstance = new self;
-            -
            			}
-            -
            			return self::$oInstance;
-            -
            		}
-            -
            		public function __construct() {}
-            -
            		/**
-            -
            		 * @param string $sSQL
-            -
            		 * @return array
-            -
            		 */
-            -
            		public function dbDelta( $sSQL ) {
-            -
            			require_once( ABSPATH . 'wp-admin/includes/upgrade.php' );
-            -
            			return dbDelta( $sSQL );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sTable
-            -
            		 * @param array $aWhere - delete where (associative array)
-            -
            		 * @return false|int
-            -
            		 */
-            -
            		public function deleteRowsFromTableWhere( $sTable, $aWhere ) {
-            -
            			return $this->loadWpdb()->delete( $sTable, $aWhere );
-            -
            		}
-            -
            		/**
-            -
            		 * Will completely remove this table from the database
-            -
            		 *
-            -
            		 * @param string $sTable
-            -
            		 * @return bool|int
-            -
            		 */
-            -
            		public function doDropTable( $sTable ) {
-            -
            			$sQuery = sprintf( 'DROP TABLE IF EXISTS `%s`', $sTable ) ;
-            -
            			return $this->doSql( $sQuery );
-            -
            		}
-            -
            		/**
-            -
            		 * Alias for doTruncateTable()
-            -
            		 *
-            -
            		 * @param string $sTable
-            -
            		 * @return bool|int
-            -
            		 */
-            -
            		public function doEmptyTable( $sTable ) {
-            -
            			return $this->doTruncateTable( $sTable );
-            -
            		}
-            -
            		/**
-            -
            		 * Given any SQL query, will perform it using the WordPress database object.
-            -
            		 *
-            -
            		 * @param string $sSqlQuery
-            -
            		 * @return integer|boolean (number of rows affected or just true/false)
-            -
            		 */
-            -
            		public function doSql( $sSqlQuery ) {
-            -
            			$mResult = $this->loadWpdb()->query( $sSqlQuery );
-            -
            			return $mResult;
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sTable
-            -
            		 * @return bool|int
-            -
            		 */
-            -
            		public function doTruncateTable( $sTable ) {
-            -
            			if ( !$this->getIfTableExists( $sTable ) ) {
-            -
            				return false;
-            -
            			}
-            -
            			$sQuery = sprintf( 'TRUNCATE TABLE `%s`', $sTable );
-            -
            			return $this->doSql( $sQuery );
+            		}
-            -
            		public function getCharCollate() {
-            -
            			return $this->getWpdb()->get_charset_collate();
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sTable
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function getIfTableExists( $sTable ) {
-            -
            			$sQuery = sprintf( "SHOW TABLES LIKE '%s'", $sTable );
-            -
            			$mResult = $this->loadWpdb()->get_var( $sQuery );
-            -
            			return !is_null( $mResult );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sTableName
-            -
            		 * @param string $sArrayMapCallBack
-            -
            		 * @return array
-            -
            		 */
-            -
            		public function getColumnsForTable( $sTableName, $sArrayMapCallBack = '' ) {
-            -
            			$aColumns = $this->loadWpdb()->get_col( "DESCRIBE " . $sTableName, 0 );
-            -
-            -
            			if ( !empty( $sArrayMapCallBack ) && function_exists( $sArrayMapCallBack ) ) {
-            -
            				return array_map( $sArrayMapCallBack, $aColumns );
-            -
            			}
-            -
            			return $aColumns;
-            -
            		}
-            -
            		/**
-            -
            		 * @param bool $bSiteBase
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getPrefix( $bSiteBase = true ) {
-            -
            			$oDb = $this->loadWpdb();
-            -
            			return $bSiteBase ? $oDb->base_prefix : $oDb->prefix;
+            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getTable_Comments() {
-            -
            			return $this->loadWpdb()->comments;
-            -
            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getTable_Options() {
-            -
            			return $this->loadWpdb()->options;
-            -
            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getTable_Posts() {
-            -
            			return $this->loadWpdb()->posts;
-            -
            		}
-            -
            		/**
-            -
            		 * @param $sSql
-            -
            		 *
-            -
            		 * @return null|mixed
-            -
            		 */
-            -
            		public function getVar( $sSql ) {
-            -
            			return $this->loadWpdb()->get_var( $sSql );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sTable
-            -
            		 * @param array $aData
-            -
            		 *
-            -
            		 * @return int|boolean
-            -
            		 */
-            -
            		public function insertDataIntoTable( $sTable, $aData ) {
-            -
            			return $this->loadWpdb()->insert( $sTable, $aData );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sTable
-            -
            		 * @param string $nFormat
-            -
            		 *
-            -
            		 * @return mixed
-            -
            		 */
-            -
            		public function selectAllFromTable( $sTable, $nFormat = ARRAY_A ) {
-            -
            			$sQuery = sprintf( "SELECT * FROM `%s` WHERE `deleted_at` = 0", $sTable );
-            -
            			return $this->loadWpdb()->get_results( $sQuery, $nFormat );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sQuery
-            -
            		 * @param $nFormat
-            -
            		 * @return array|boolean
-            -
            		 */
-            -
            		public function selectCustom( $sQuery, $nFormat = ARRAY_A ) {
-            -
            			return $this->loadWpdb()->get_results( $sQuery, $nFormat );
-            -
            		}
-            -
            		/**
-            -
            		 * @param $sQuery
-            -
            		 * @param string $nFormat
-            -
            		 *
-            -
            		 * @return null|object|array
-            -
            		 */
-            -
            		public function selectRow( $sQuery, $nFormat = ARRAY_A ) {
-            -
            			return $this->loadWpdb()->get_row( $sQuery, $nFormat );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sTable
-            -
            		 * @param array $aData - new insert data (associative array, column=>data)
-            -
            		 * @param array $aWhere - insert where (associative array)
-            -
            		 *
-            -
            		 * @return integer|boolean (number of rows affected)
-            -
            		 */
-            -
            		public function updateRowsFromTableWhere( $sTable, $aData, $aWhere ) {
-            -
            			return $this->loadWpdb()->update( $sTable, $aData, $aWhere );
-            -
            		}
-            -
            		/**
-            -
            		 * Loads our WPDB object if required.
-            -
            		 *
-            -
            		 * @return \wpdb
-            -
            		 */
-            -
            		protected function loadWpdb() {
-            -
            			if ( is_null( $this->oWpdb ) ) {
-            -
            				$this->oWpdb = $this->getWpdb();
-            -
            			}
-            -
            			return $this->oWpdb;
-            -
            		}
-            -
            		/**
-            -
            		 */
-            -
            		private function getWpdb() {
-            -
            			global $wpdb;
-            -
            			return $wpdb;
+            		}
+            	}
-            -
            endif;


1	<?php
2	+ if ( class_exists( 'ICWP_WPSF_WpDb', false ) ) {
3	+ return;
4	+ }
5	+
6	+ class ICWP_WPSF_WpDb {
7	+
8	+ /**
9	+ * @var ICWP_WPSF_WpDb
10	+ */
11	+ protected static $oInstance = null;
12	+
13	+ /**
14	+ * @var wpdb
15	+ */
16	+ protected $oWpdb;
17	+
18	+ /**
19	+ * @return ICWP_WPSF_WpDb
20	+ */
21	+ public static function GetInstance() {
22	+ if ( is_null( self::$oInstance ) ) {
23	+ self::$oInstance = new self;
24	+ }
25	+ return self::$oInstance;
26	+ }
27
28	+ public function __construct() {
29	+ }
30
31	+ /**
32	+ * @param string $sSQL
33	+ * @return array
34	+ */
35	+ public function dbDelta( $sSQL ) {
36	+ require_once( ABSPATH.'wp-admin/includes/upgrade.php' );
37	+ return dbDelta( $sSQL );
38	+ }
39
40	+ /**
41	+ * @param string $sTable
42	+ * @param array $aWhere - delete where (associative array)
43	+ * @return false\|int
44	+ */
45	+ public function deleteRowsFromTableWhere( $sTable, $aWhere ) {
46	+ return $this->loadWpdb()->delete( $sTable, $aWhere );
47	+ }
48
49	+ /**
50	+ * Will completely remove this table from the database
51	+ * @param string $sTable
52	+ * @return bool\|int
53	+ */
54	+ public function doDropTable( $sTable ) {
55	+ $sQuery = sprintf( 'DROP TABLE IF EXISTS `%s`', $sTable );
56	+ return $this->doSql( $sQuery );
57	+ }

58
59	+ /**
60	+ * Alias for doTruncateTable()
61	+ * @param string $sTable
62	+ * @return bool\|int
63	+ */
64	+ public function doEmptyTable( $sTable ) {
65	+ return $this->doTruncateTable( $sTable );
66	+ }

67
68	+ /**
69	+ * Given any SQL query, will perform it using the WordPress database object.
70	+ * @param string $sSqlQuery
71	+ * @return integer\|boolean (number of rows affected or just true/false)
72	+ */
73	+ public function doSql( $sSqlQuery ) {
74	+ $mResult = $this->loadWpdb()->query( $sSqlQuery );
75	+ return $mResult;
76	+ }

77
78	+ /**
79	+ * @param string $sTable
80	+ * @return bool\|int
81	+ */
82	+ public function doTruncateTable( $sTable ) {
83	+ if ( !$this->getIfTableExists( $sTable ) ) {
84	+ return false;



85	}
86	+ $sQuery = sprintf( 'TRUNCATE TABLE `%s`', $sTable );
87	+ return $this->doSql( $sQuery );
88	+ }
89
90	+ public function getCharCollate() {
91	+ return $this->getWpdb()->get_charset_collate();
92	+ }
93
94	+ /**
95	+ * @param string $sTable
96	+ * @return bool
97	+ */
98	+ public function getIfTableExists( $sTable ) {
99	+ $sQuery = sprintf( "SHOW TABLES LIKE '%s'", $sTable );
100	+ $mResult = $this->loadWpdb()->get_var( $sQuery );
101	+ return !is_null( $mResult );
102	+ }
103
104	+ /**
105	+ * @param string $sTableName
106	+ * @param string $sArrayMapCallBack
107	+ * @return array
108	+ */
109	+ public function getColumnsForTable( $sTableName, $sArrayMapCallBack = '' ) {
110	+ $aColumns = $this->loadWpdb()->get_col( "DESCRIBE ".$sTableName, 0 );






111
112	+ if ( !empty( $sArrayMapCallBack ) && function_exists( $sArrayMapCallBack ) ) {
113	+ return array_map( $sArrayMapCallBack, $aColumns );





114	}
115	+ return $aColumns;
116	+ }
117
118	+ /**
119	+ * @param bool $bSiteBase
120	+ * @return string
121	+ */
122	+ public function getPrefix( $bSiteBase = true ) {
123	+ $oDb = $this->loadWpdb();
124	+ return $bSiteBase ? $oDb->base_prefix : $oDb->prefix;
125	+ }
126
127	+ /**
128	+ * @return string
129	+ */
130	+ public function getTable_Comments() {
131	+ return $this->loadWpdb()->comments;
132	+ }
133
134	+ /**
135	+ * @return string
136	+ */
137	+ public function getTable_Options() {
138	+ return $this->loadWpdb()->options;
139	+ }
140
141	+ /**
142	+ * @return string
143	+ */
144	+ public function getTable_Posts() {
145	+ return $this->loadWpdb()->posts;
146	+ }


147
148	+ /**
149	+ * @param $sSql
150	+ * @return null\|mixed
151	+ */
152	+ public function getVar( $sSql ) {
153	+ return $this->loadWpdb()->get_var( $sSql );
154	+ }


155
156	+ /**
157	+ * @param string $sTable
158	+ * @param array $aData
159	+ * @return int\|boolean
160	+ */
161	+ public function insertDataIntoTable( $sTable, $aData ) {
162	+ return $this->loadWpdb()->insert( $sTable, $aData );
163	+ }


164
165	+ /**
166	+ * @param string $sTable
167	+ * @param string $nFormat
168	+ * @return mixed
169	+ */
170	+ public function selectAllFromTable( $sTable, $nFormat = ARRAY_A ) {
171	+ $sQuery = sprintf( "SELECT * FROM `%s` WHERE `deleted_at` = 0", $sTable );
172	+ return $this->loadWpdb()->get_results( $sQuery, $nFormat );
173	+ }
174
175	+ /**
176	+ * @param string $sQuery
177	+ * @param $nFormat
178	+ * @return array\|boolean
179	+ */
180	+ public function selectCustom( $sQuery, $nFormat = ARRAY_A ) {
181	+ return $this->loadWpdb()->get_results( $sQuery, $nFormat );
182	+ }

183
184	+ /**
185	+ * @param $sQuery
186	+ * @param string $nFormat
187	+ * @return null\|object\|array
188	+ */
189	+ public function selectRow( $sQuery, $nFormat = ARRAY_A ) {
190	+ return $this->loadWpdb()->get_row( $sQuery, $nFormat );
191	+ }


192
193	+ /**
194	+ * @param string $sTable
195	+ * @param array $aData - new insert data (associative array, column=>data)
196	+ * @param array $aWhere - insert where (associative array)
197	+ * @return integer\|boolean (number of rows affected)
198	+ */
199	+ public function updateRowsFromTableWhere( $sTable, $aData, $aWhere ) {
200	+ return $this->loadWpdb()->update( $sTable, $aData, $aWhere );
201	+ }


202
203	+ /**
204	+ * Loads our WPDB object if required.
205	+ * @return \wpdb
206	+ */
207	+ protected function loadWpdb() {
208	+ if ( is_null( $this->oWpdb ) ) {
209	+ $this->oWpdb = $this->getWpdb();
210	}
211	+ return $this->oWpdb;
212	+ }
213	+
214	+ /**
215	+ */
216	+ private function getWpdb() {
217	+ global $wpdb;
218	+ return $wpdb;
219	}
220	+ }

src/common/icwp-wpfilesystem.php CHANGED Viewed

@@ -1,495 +1,492 @@
             <?php
-            -
            if ( !class_exists( 'ICWP_WPSF_WpFilesystem', false ) ):
-            -
-            -
            	class ICWP_WPSF_WpFilesystem {
-            -
-            -
            		/**
-            -
            		 * @var ICWP_WPSF_WpFilesystem
-            -
            		 */
-            -
            		protected static $oInstance = NULL;
-            -
-            -
            		/**
-            -
            		 * @var WP_Filesystem_Base
-            -
            		 */
-            -
            		protected $oWpfs = null;
-            -
-            -
            		/**
-            -
            		 * @var string
-            -
            		 */
-            -
            		protected $sWpConfigPath = null;
-            -
-            -
            		/**
-            -
            		 * @return ICWP_WPSF_WpFilesystem
-            -
            		 */
-            -
            		public static function GetInstance() {
-            -
            			if ( is_null( self::$oInstance ) ) {
-            -
            				self::$oInstance = new self();
-            -
            			}
-            -
            			return self::$oInstance;
+            		}
-            -
            		/**
-            -
            		 * @param string $sBase
-            -
            		 * @param string $sPath
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function pathJoin( $sBase, $sPath ) {
-            -
            			return rtrim( $sBase, DIRECTORY_SEPARATOR ).DIRECTORY_SEPARATOR.ltrim( $sPath, DIRECTORY_SEPARATOR );
+            		}
-            -
            		/**
-            -
            		 * @param $sFilePath
-            -
            		 * @return boolean|null	true/false whether file/directory exists
-            -
            		 */
-            -
            		public function exists( $sFilePath ) {
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs && $oFs->exists( $sFilePath ) ) {
-            -
            				return true;
+            			}
-            -
            			return function_exists( 'file_exists' ) ? file_exists( $sFilePath ) : null;
-            -
            		}
-            -
-            -
            		/**
-            -
            		 * @param string $sNeedle
-            -
            		 * @param string $sDir
-            -
            		 * @param boolean $bIncludeExtension
-            -
            		 * @param boolean $bCaseSensitive
-            -
            		 *
-            -
            		 * @return bool|null
-            -
            		 */
-            -
            		public function fileExistsInDir( $sNeedle, $sDir, $bIncludeExtension = true, $bCaseSensitive = false ) {
-            -
            			if ( empty( $sNeedle ) || empty( $sDir ) ) {
-            -
            				return false;
+            			}
-            -
            			if ( !$bCaseSensitive ) {
-            -
            				$sNeedle = strtolower( $sNeedle );
-            -
            			}
-            -
            			$oDirIt = null;
-            -
            			$bUseDirectoryIterator = class_exists( 'DirectoryIterator', false );
-            -
            			if ( $bUseDirectoryIterator ) {
-            -
            				try {
-            -
            					$oDirIt = new DirectoryIterator( $sDir );
+            				}
-            -
            				catch( Exception $oE ) { //  UnexpectedValueException, RuntimeException, Exception
-            -
            					$bUseDirectoryIterator = false; // Path doesn't exist or don't have access to open
+            				}
-            -
            			}
-            -
            			if ( $bUseDirectoryIterator && $oDirIt ) {
-            -
-            -
            				//if the file you're searching for doesn't have an extension, then we don't include extensions in search
-            -
            				$nDotPosition = strpos( $sNeedle, '.' );
-            -
            				$bHasExtension = $nDotPosition !== false;
-            -
            				$bIncludeExtension = $bIncludeExtension && $bHasExtension;
-            -
-            -
            				$sNeedlePreExtension = $bHasExtension ? substr( $sNeedle, 0, $nDotPosition ) : $sNeedle;
-            -
-            -
            				$bFound = false;
-            -
            				foreach ( $oDirIt as $oFileItem ) {
-            -
            					if ( !$oFileItem->isFile() ) {
-            -
            						continue;
-            -
            					}
-            -
            					$sFilename = $oFileItem->getFilename();
-            -
            					if ( !$bCaseSensitive ) {
-            -
            						$sFilename = strtolower( $sFilename );
-            -
            					}
-            -
-            -
            					if ( $bIncludeExtension ) {
-            -
            						$bFound = ( $sFilename == $sNeedle );
-            -
            					}
-            -
            					else {
-            -
            						// This is not entirely accurate as it only finds whether a file "starts" with needle, ignoring subsequent characters
-            -
            						$bFound = ( strpos( $sFilename, $sNeedlePreExtension ) === 0 );
-            -
            					}
-            -
-            -
            					if ( $bFound ) {
-            -
            						break;
-            -
            					}
+            				}
-            -
            				return $bFound;
-            -
            			}
-            -
-            -
            			if ( $bCaseSensitive ) {
-            -
            				return $this->exists( $this->pathJoin( $sDir, $sNeedle ) );
-            -
            			}
-            -
            			$sNeedle = strtolower( $sNeedle );
-            -
            			if ( $oHandle = opendir( $sDir ) ) {
-            -
-            -
            				while ( false !== ( $sFileEntry = readdir( $oHandle ) ) ) {
-            -
            					if ( !$this->isFile( $this->pathJoin( $sDir, $sFileEntry ) ) ) {
-            -
            						continue;
-            -
            					}
-            -
            					if ( $sNeedle == strtolower( $sFileEntry ) ) {
-            -
            						return true;
-            -
            					}
+            				}
+            			}
-            -
            			return false;
+            		}
-            -
            		/**
-            -
            		 * Returns a path where all backslashes "\" are converted to "/"
-            -
            		 * @param string $sPath
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function normalizeFilePathDS( $sPath ) {
-            -
            			return ( DIRECTORY_SEPARATOR == '/' ) ? $sPath : str_replace( '\\', '/', $sPath );
+            		}
-            -
            		protected function setWpConfigPath() {
-            -
            			$this->sWpConfigPath = ABSPATH.'wp-config.php';
-            -
            			if ( !$this->exists($this->sWpConfigPath)  ) {
-            -
            				$this->sWpConfigPath = ABSPATH.'..'.DIRECTORY_SEPARATOR.'wp-config.php';
-            -
            				if ( !$this->exists($this->sWpConfigPath)  ) {
-            -
            					$this->sWpConfigPath = false;
+            				}
+            			}
+            		}
-            -
            		public function getContent_WpConfig() {
-            -
            			return $this->getFileContent( $this->sWpConfigPath );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sContent
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function putContent_WpConfig( $sContent ) {
-            -
            			return $this->putFileContent( $this->sWpConfigPath, $sContent );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sUrl
-            -
            		 * @param boolean $bSecure
-            -
            		 *
-            -
            		 * @return boolean
-            -
            		 */
-            -
            		public function getIsUrlValid( $sUrl, $bSecure = false ) {
-            -
            			$sSchema = $bSecure? 'https://' : 'http://';
-            -
            			$sUrl = ( strpos( $sUrl, 'http' ) !== 0 )? $sSchema.$sUrl : $sUrl;
-            -
            			return ( $this->getUrl( $sUrl ) != false );
+            		}
-            -
            		/**
-            -
            		 * @return string
-            -
            		 */
-            -
            		public function getWpConfigPath() {
-            -
            			return $this->sWpConfigPath;
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sUrl
-            -
            		 * @param array $aRequestArgs
-            -
            		 * @return array|bool
-            -
            		 */
-            -
            		public function requestUrl( $sUrl, $aRequestArgs = array(), $bAlwaysRawResponse = false ) {
-            -
            			$mResult = wp_remote_request( $sUrl, $aRequestArgs );
-            -
            			if ( $bAlwaysRawResponse ) {
-            -
            				return $mResult;
-            -
            			}
-            -
            			if ( is_wp_error( $mResult ) || !isset( $mResult['response']['code'] ) || $mResult['response']['code'] != 200 ) {
-            -
            				return false;
-            -
            			}
             			return $mResult;
+            		}
-            -
-            -
            		/**
-            -
            		 * @param string $sUrl
-            -
            		 * @param array  $aRequestArgs
-            -
            		 * @return array|bool
-            -
            		 */
-            -
            		public function getUrl( $sUrl, $aRequestArgs = array() ) {
-            -
            			$aRequestArgs['method'] = 'GET';
-            -
            			return $this->requestUrl( $sUrl, $aRequestArgs );
-            -
            		}
-            -
-            -
            		/**
-            -
            		 * @param string $sUrl
-            -
            		 * @param array $aRequestArgs
-            -
            		 * @return false|string
-            -
            		 */
-            -
            		public function getUrlContent( $sUrl, $aRequestArgs = array() ) {
-            -
            			$aResponse = $this->getUrl( $sUrl, $aRequestArgs );
-            -
            			if ( !$aResponse || !isset( $aResponse['body'] ) ) {
-            -
            				return false;
-            -
            			}
-            -
            			return $aResponse['body'];
-            -
            		}
-            -
-            -
            		/**
-            -
            		 * @param string $sUrl
-            -
            		 * @param array  $aRequestArgs
-            -
            		 * @return array|false
-            -
            		 */
-            -
            		public function postUrl( $sUrl, $aRequestArgs = array() ) {
-            -
            			$aRequestArgs[ 'method' ] = 'POST';
-            -
            			return $this->requestUrl( $sUrl, $aRequestArgs );
-            -
            		}
-            -
-            -
            		public function getCanWpRemoteGet() {
-            -
            			$aUrlsToTest = array(
-            -
            				'https://www.microsoft.com',
-            -
            				'https://www.google.com',
-            -
            				'https://www.facebook.com'
-            -
            			);
-            -
            			foreach( $aUrlsToTest as $sUrl ) {
-            -
            				if ( $this->getUrl( $sUrl ) !== false ) {
-            -
            					return true;
-            -
            				}
-            -
            			}
             			return false;
+            		}
-            -
            		public function getCanDiskWrite() {
-            -
            			$sFilePath = dirname( __FILE__ ).'/testfile.'.rand().'txt';
-            -
            			$sContents = "Testing icwp file read and write.";
-            -
            			// Write, read, verify, delete.
-            -
            			if ( $this->putFileContent( $sFilePath, $sContents ) ) {
-            -
            				$sFileContents = $this->getFileContent( $sFilePath );
-            -
            				if ( !is_null( $sFileContents ) && $sFileContents === $sContents ) {
-            -
            					return $this->deleteFile( $sFilePath );
-            -
            				}
-            -
            			}
             			return false;
+            		}
-            -
            		/**
-            -
            		 * @param string $sFilePath
-            -
            		 * @return int|null
-            -
            		 */
-            -
            		public function getModifiedTime( $sFilePath ) {
-            -
            			return $this->getTime( $sFilePath, 'modified' );
-            -
            		}
-            -
            		/**
-            -
            		 * @param string $sFilePath
-            -
            		 * @return int|null
-            -
            		 */
-            -
            		public function getAccessedTime( $sFilePath ) {
-            -
            			return $this->getTime( $sFilePath, 'accessed' );
+            		}
-            -
            		/**
-            -
            		 * @param string $sFilePath
-            -
            		 * @param string $sProperty
-            -
            		 * @return int|null
-            -
            		 */
-            -
            		public function getTime( $sFilePath, $sProperty = 'modified' ) {
-            -
            			if ( !$this->exists( $sFilePath ) ) {
-            -
            				return null;
+            			}
-            -
            			$oFs = $this->getWpfs();
-            -
            			switch ( $sProperty ) {
-            -
            				case 'modified' :
-            -
            					return $oFs? $oFs->mtime( $sFilePath ) : filemtime( $sFilePath );
-            -
            					break;
-            -
            				case 'accessed' :
-            -
            					return $oFs? $oFs->atime( $sFilePath ) : fileatime( $sFilePath );
-            -
            					break;
-            -
            				default:
-            -
            					return null;
-            -
            					break;
-            -
            			}
+            		}
-            -
            		/**
-            -
            		 * @param string $sFilePath
-            -
            		 * @return NULL|boolean
-            -
            		 */
-            -
            		public function getCanReadWriteFile( $sFilePath ) {
-            -
            			if ( !file_exists( $sFilePath ) ) {
-            -
            				return null;
-            -
            			}
-            -
            			$nFileSize = filesize( $sFilePath );
-            -
            			if ( $nFileSize === 0 ) {
             				return null;
-            -
            			}
-            -
-            -
            			$sFileContent = $this->getFileContent( $sFilePath );
-            -
            			if ( empty( $sFileContent ) ) {
-            -
            				return false; //can't even read the file!
-            -
            			}
-            -
            			return $this->putFileContent( $sFilePath, $sFileContent );
-            -
            		}
-            -
-            -
            		/**
-            -
            		 * @param string $sFilePath
-            -
            		 * @return string|null
-            -
            		 */
-            -
            		public function getFileContent( $sFilePath ) {
-            -
            			$sContents = null;
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs ) {
-            -
            				$sContents = $oFs->get_contents( $sFilePath );
-            -
            			}
-            -
            			if ( empty( $sContents ) && function_exists( 'file_get_contents' ) ) {
-            -
            				$sContents = file_get_contents( $sFilePath );
-            -
            			}
-            -
            			return $sContents;
+            		}
-            -
            		/**
-            -
            		 * @param $sFilePath
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function getFileSize( $sFilePath ) {
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs && ( $oFs->size( $sFilePath ) > 0 ) ) {
-            -
            				return $oFs->size( $sFilePath );
-            -
            			}
-            -
            			return @filesize( $sFilePath );
-            -
            		}
-            -
-            -
            		/**
-            -
            		 * @param string|null $sBaseDir
-            -
            		 * @param string $sPrefix
-            -
            		 * @param string $outsRandomDir
-            -
            		 * @return bool|string
-            -
            		 */
-            -
            		public function getTempDir( $sBaseDir = null, $sPrefix = '', &$outsRandomDir = '' ) {
-            -
            			$sTemp = rtrim( (is_null( $sBaseDir )? get_temp_dir(): $sBaseDir), DIRECTORY_SEPARATOR ).DIRECTORY_SEPARATOR;
-            -
-            -
            			$sCharset = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz0123456789';
-            -
            			do {
-            -
            				$sDir = $sPrefix;
-            -
            				for ( $i = 0; $i < 8; $i++ ) {
-            -
            					$sDir .= $sCharset[(rand() % strlen( $sCharset ))];
-            -
            				}
-            -
            			}
-            -
            			while ( is_dir( $sTemp.$sDir ) );
-            -
            			$outsRandomDir = $sDir;
-            -
            			$bSuccess = true;
-            -
            			if ( !@mkdir( $sTemp.$sDir, 0755, true ) ) {
-            -
            				$bSuccess = false;
-            -
            			}
-            -
            			return ($bSuccess? $sTemp.$sDir: false);
+            		}
-            -
            		/**
-            -
            		 * @param string $sFilePath
-            -
            		 * @param string $sContents
-            -
            		 * @return boolean
-            -
            		 */
-            -
            		public function putFileContent( $sFilePath, $sContents ) {
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs && $oFs->put_contents( $sFilePath, $sContents, FS_CHMOD_FILE ) ) {
-            -
            				return true;
-            -
            			}
-            -
            			if ( function_exists( 'file_put_contents' ) ) {
-            -
            				return file_put_contents( $sFilePath, $sContents ) !== false;
-            -
            			}
-            -
            			return false;
+            		}
-            -
            		/**
-            -
            		 * Recursive delete
-            -
            		 *
-            -
            		 * @param string $sDir
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function deleteDir( $sDir ) {
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs && $oFs->rmdir( $sDir, true ) ) {
-            -
            				return true;
+            			}
-            -
            			return @rmdir( $sDir );
+            		}
-            -
            		/**
-            -
            		 * @param string $sFilePath
-            -
            		 * @return boolean|null
-            -
            		 */
-            -
            		public function deleteFile( $sFilePath ) {
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs && $oFs->delete( $sFilePath ) ) {
-            -
            				return true;
-            -
            			}
-            -
            			return function_exists( 'unlink' ) ? @unlink( $sFilePath ) : null;
+            		}
-            -
            		/**
-            -
            		 * @param string $sFilePathSource
-            -
            		 * @param string $sFilePathDestination
-            -
            		 * @return bool|null
-            -
            		 */
-            -
            		public function move( $sFilePathSource, $sFilePathDestination ) {
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs && $oFs->move( $sFilePathSource, $sFilePathDestination ) ) {
-            -
            				return true;
-            -
            			}
-            -
            			return function_exists( 'rename' ) ? @rename( $sFilePathSource, $sFilePathDestination ) : null;
+            		}
-            -
            		/**
-            -
            		 * @param $sFilePath
-            -
            		 * @return bool|mixed
-            -
            		 */
-            -
            		public function isFile( $sFilePath ) {
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs && $oFs->is_file( $sFilePath ) ) {
-            -
            				return true;
-            -
            			}
-            -
            			return function_exists( 'is_file' ) ? is_file( $sFilePath ) : null;
+            		}
-            -
            		/**
-            -
            		 * @param $sDirPath
-            -
            		 * @return bool
-            -
            		 */
-            -
            		public function mkdir( $sDirPath ) {
-            -
            			return wp_mkdir_p( $sDirPath );
+            		}
-            -
            		/**
-            -
            		 * @param string $sFilePath
-            -
            		 * @param int $nTime
-            -
            		 * @return bool|mixed
-            -
            		 */
-            -
            		public function touch( $sFilePath, $nTime = null ) {
-            -
            			$oFs = $this->getWpfs();
-            -
            			if ( $oFs && $oFs->touch( $sFilePath, $nTime ) ) {
-            -
            				return true;
-            -
            			}
-            -
            			return function_exists( 'touch' ) ? @touch( $sFilePath, $nTime ) : null;
+            		}
-            -
            		/**
-            -
            		 * @return WP_Filesystem_Base
-            -
            		 */
-            -
            		protected function getWpfs() {
-            -
            			if ( is_null( $this->oWpfs ) ) {
-            -
            				$this->initFileSystem();
-            -
            			}
-            -
            			return $this->oWpfs;
-            -
            		}
-            -
-            -
            		/**
-            -
            		 */
-            -
            		private function initFileSystem() {
-            -
            			if ( is_null( $this->oWpfs ) ) {
-            -
            				$this->oWpfs = false;
-            -
            				require_once( ABSPATH . 'wp-admin'.DIRECTORY_SEPARATOR.'includes'.DIRECTORY_SEPARATOR.'file.php' );
-            -
            				if ( WP_Filesystem() ) {
-            -
            					global $wp_filesystem;
-            -
            					if ( isset( $wp_filesystem ) && is_object( $wp_filesystem ) ) {
-            -
            						$this->oWpfs = $wp_filesystem;
-            -
            					}
+            				}
+            			}
+            		}
+            	}
-            -
            endif;


1	<?php
2	+ if ( class_exists( 'ICWP_WPSF_WpFilesystem', false ) ) {
3	+ return;
4	+ }
5	+
6	+ class ICWP_WPSF_WpFilesystem {
7	+
8	+ /**
9	+ * @var ICWP_WPSF_WpFilesystem
10	+ */
11	+ protected static $oInstance = null;
12	+
13	+ /**
14	+ * @var WP_Filesystem_Base
15	+ */
16	+ protected $oWpfs = null;
17	+
18	+ /**
19	+ * @var string
20	+ */
21	+ protected $sWpConfigPath = null;
22	+
23	+ /**
24	+ * @return ICWP_WPSF_WpFilesystem
25	+ */
26	+ public static function GetInstance() {
27	+ if ( is_null( self::$oInstance ) ) {
28	+ self::$oInstance = new self();
29	+ }
30	+ return self::$oInstance;
31	+ }
32	+
33	+ /**
34	+ * @param string $sBase
35	+ * @param string $sPath
36	+ * @return string
37	+ */
38	+ public function pathJoin( $sBase, $sPath ) {
39	+ return rtrim( $sBase, DIRECTORY_SEPARATOR ).DIRECTORY_SEPARATOR.ltrim( $sPath, DIRECTORY_SEPARATOR );
40	+ }
41	+
42	+ /**
43	+ * @param $sFilePath
44	+ * @return boolean\|null true/false whether file/directory exists
45	+ */
46	+ public function exists( $sFilePath ) {
47	+ $oFs = $this->getWpfs();
48	+ if ( $oFs && $oFs->exists( $sFilePath ) ) {
49	+ return true;
50	}
51	+ return function_exists( 'file_exists' ) ? file_exists( $sFilePath ) : null;
52	+ }
53
54	+ /**
55	+ * @param string $sNeedle
56	+ * @param string $sDir
57	+ * @param boolean $bIncludeExtension
58	+ * @param boolean $bCaseSensitive
59	+ * @return bool\|null
60	+ */
61	+ public function fileExistsInDir( $sNeedle, $sDir, $bIncludeExtension = true, $bCaseSensitive = false ) {
62	+ if ( empty( $sNeedle ) \|\| empty( $sDir ) ) {
63	+ return false;
64	}
65
66	+ if ( !$bCaseSensitive ) {
67	+ $sNeedle = strtolower( $sNeedle );
68	+ }
69	+
70	+ $oDirIt = null;
71	+ $bUseDirectoryIterator = class_exists( 'DirectoryIterator', false );
72	+ if ( $bUseDirectoryIterator ) {
73	+ try {
74	+ $oDirIt = new DirectoryIterator( $sDir );
75	}
76	+ catch ( Exception $oE ) { // UnexpectedValueException, RuntimeException, Exception
77	+ $bUseDirectoryIterator = false; // Path doesn't exist or don't have access to open












78	}
79	+ }
80
81	+ if ( $bUseDirectoryIterator && $oDirIt ) {
82	+
83	+ //if the file you're searching for doesn't have an extension, then we don't include extensions in search
84	+ $nDotPosition = strpos( $sNeedle, '.' );
85	+ $bHasExtension = $nDotPosition !== false;
86	+ $bIncludeExtension = $bIncludeExtension && $bHasExtension;
87	+
88	+ $sNeedlePreExtension = $bHasExtension ? substr( $sNeedle, 0, $nDotPosition ) : $sNeedle;
89
90	+ $bFound = false;
91	+ foreach ( $oDirIt as $oFileItem ) {
92	+ if ( !$oFileItem->isFile() ) {
93	+ continue;

94	}
95	+ $sFilename = $oFileItem->getFilename();
96	+ if ( !$bCaseSensitive ) {
97	+ $sFilename = strtolower( $sFilename );
98	}

99
100	+ if ( $bIncludeExtension ) {
101	+ $bFound = ( $sFilename == $sNeedle );
102	+ }
103	+ else {
104	+ // This is not entirely accurate as it only finds whether a file "starts" with needle, ignoring subsequent characters
105	+ $bFound = ( strpos( $sFilename, $sNeedlePreExtension ) === 0 );
























106	}
107
108	+ if ( $bFound ) {
109	+ break;














110	}
111	}
112
113	+ return $bFound;
114	}
115
116	+ if ( $bCaseSensitive ) {
117	+ return $this->exists( $this->pathJoin( $sDir, $sNeedle ) );





118	}
119	+ $sNeedle = strtolower( $sNeedle );
120	+ if ( $oHandle = opendir( $sDir ) ) {
121
122	+ while ( false !== ( $sFileEntry = readdir( $oHandle ) ) ) {
123	+ if ( !$this->isFile( $this->pathJoin( $sDir, $sFileEntry ) ) ) {
124	+ continue;
125	+ }
126	+ if ( $sNeedle == strtolower( $sFileEntry ) ) {
127	+ return true;
128	}
129	}
130	}
131
132	+ return false;
133	+ }

134
135	+ /**
136	+ * Returns a path where all backslashes "\" are converted to "/"
137	+ * @param string $sPath
138	+ * @return string
139	+ */
140	+ public function normalizeFilePathDS( $sPath ) {
141	+ return ( DIRECTORY_SEPARATOR == '/' ) ? $sPath : str_replace( '\\', '/', $sPath );
142	+ }
143
144	+ protected function setWpConfigPath() {
145	+ $this->sWpConfigPath = ABSPATH.'wp-config.php';
146	+ if ( !$this->exists( $this->sWpConfigPath ) ) {
147	+ $this->sWpConfigPath = ABSPATH.'..'.DIRECTORY_SEPARATOR.'wp-config.php';
148	+ if ( !$this->exists( $this->sWpConfigPath ) ) {
149	+ $this->sWpConfigPath = false;
150	+ }



151	}
152	+ }
153
154	+ public function getContent_WpConfig() {
155	+ return $this->getFileContent( $this->sWpConfigPath );
156	+ }



157
158	+ /**
159	+ * @param string $sContent
160	+ * @return bool
161	+ */
162	+ public function putContent_WpConfig( $sContent ) {
163	+ return $this->putFileContent( $this->sWpConfigPath, $sContent );
164	+ }
165
166	+ /**
167	+ * @param string $sUrl
168	+ * @param boolean $bSecure
169	+ * @return boolean
170	+ */
171	+ public function getIsUrlValid( $sUrl, $bSecure = false ) {
172	+ $sSchema = $bSecure ? 'https://' : 'http://';
173	+ $sUrl = ( strpos( $sUrl, 'http' ) !== 0 ) ? $sSchema.$sUrl : $sUrl;
174	+ return ( $this->getUrl( $sUrl ) != false );
175	+ }
176	+
177	+ /**
178	+ * @return string
179	+ */
180	+ public function getWpConfigPath() {
181	+ return $this->sWpConfigPath;
182	+ }
183	+
184	+ /**
185	+ * @param string $sUrl
186	+ * @param array $aRequestArgs
187	+ * @return array\|WP_Error\|bool
188	+ */
189	+ public function requestUrl( $sUrl, $aRequestArgs = array(), $bAlwaysRawResponse = false ) {
190	+
191	+ $mResult = wp_remote_request( $sUrl, $aRequestArgs );
192	+ if ( $bAlwaysRawResponse ) {
193	return $mResult;
194	}
195	+ if ( is_wp_error( $mResult ) \|\| !isset( $mResult[ 'response' ][ 'code' ] ) \|\| $mResult[ 'response' ][ 'code' ] != 200 ) {












































196	return false;
197	}
198	+ return $mResult;
199	+ }
200
201	+ /**
202	+ * @param string $sUrl
203	+ * @param array $aRequestArgs
204	+ * @return array\|bool
205	+ */
206	+ public function getUrl( $sUrl, $aRequestArgs = array() ) {
207	+ $aRequestArgs[ 'method' ] = 'GET';
208	+ return $this->requestUrl( $sUrl, $aRequestArgs );
209	+ }
210
211	+ /**
212	+ * @param string $sUrl
213	+ * @param array $aRequestArgs
214	+ * @return false\|string
215	+ */
216	+ public function getUrlContent( $sUrl, $aRequestArgs = array() ) {
217	+ $aResponse = $this->getUrl( $sUrl, $aRequestArgs );
218	+ if ( !$aResponse \|\| !isset( $aResponse[ 'body' ] ) ) {
219	return false;
220	}
221	+ return $aResponse[ 'body' ];
222	+ }
223
224	+ /**
225	+ * @param string $sUrl
226	+ * @param array $aRequestArgs
227	+ * @return array\|false
228	+ */
229	+ public function postUrl( $sUrl, $aRequestArgs = array() ) {
230	+ $aRequestArgs[ 'method' ] = 'POST';
231	+ return $this->requestUrl( $sUrl, $aRequestArgs );
232	+ }
233
234	+ public function getCanWpRemoteGet() {
235	+ $aUrlsToTest = array(
236	+ 'https://www.microsoft.com',
237	+ 'https://www.google.com',
238	+ 'https://www.facebook.com'
239	+ );
240	+ foreach ( $aUrlsToTest as $sUrl ) {
241	+ if ( $this->getUrl( $sUrl ) !== false ) {
242	+ return true;
243	+ }
244	}
245	+ return false;
246	+ }
247
248	+ public function getCanDiskWrite() {
249	+ $sFilePath = dirname( __FILE__ ).'/testfile.'.rand().'txt';
250	+ $sContents = "Testing icwp file read and write.";



251
252	+ // Write, read, verify, delete.
253	+ if ( $this->putFileContent( $sFilePath, $sContents ) ) {
254	+ $sFileContents = $this->getFileContent( $sFilePath );
255	+ if ( !is_null( $sFileContents ) && $sFileContents === $sContents ) {
256	+ return $this->deleteFile( $sFilePath );
257	}
258	+ }
259	+ return false;
260	+ }
261
262	+ /**
263	+ * @param string $sFilePath
264	+ * @return int\|null
265	+ */
266	+ public function getModifiedTime( $sFilePath ) {
267	+ return $this->getTime( $sFilePath, 'modified' );
268	+ }
269
270	+ /**
271	+ * @param string $sFilePath
272	+ * @return int\|null
273	+ */
274	+ public function getAccessedTime( $sFilePath ) {
275	+ return $this->getTime( $sFilePath, 'accessed' );
276	+ }
277	+
278	+ /**
279	+ * @param string $sFilePath
280	+ * @param string $sProperty
281	+ * @return int\|null
282	+ */
283	+ public function getTime( $sFilePath, $sProperty = 'modified' ) {
284	+
285	+ if ( !$this->exists( $sFilePath ) ) {
286	+ return null;
287	}
288
289	+ $oFs = $this->getWpfs();
290	+ switch ( $sProperty ) {






291
292	+ case 'modified' :
293	+ return $oFs ? $oFs->mtime( $sFilePath ) : filemtime( $sFilePath );
294	+ break;
295	+ case 'accessed' :
296	+ return $oFs ? $oFs->atime( $sFilePath ) : fileatime( $sFilePath );
297	+ break;
298	+ default:
299	return null;
300	+ break;
301	+ }
302	+ }
















303
304	+ /**
305	+ * @param string $sFilePath
306	+ * @return NULL\|boolean
307	+ */
308	+ public function getCanReadWriteFile( $sFilePath ) {
309	+ if ( !file_exists( $sFilePath ) ) {
310	+ return null;
311	}
312
313	+ $nFileSize = filesize( $sFilePath );
314	+ if ( $nFileSize === 0 ) {
315	+ return null;
316	+ }

























317
318	+ $sFileContent = $this->getFileContent( $sFilePath );
319	+ if ( empty( $sFileContent ) ) {
320	+ return false; //can't even read the file!
321	+ }
322	+ return $this->putFileContent( $sFilePath, $sFileContent );
323	+ }
324
325	+ /**
326	+ * @param string $sFilePath
327	+ * @return string\|null
328	+ */
329	+ public function getFileContent( $sFilePath ) {
330	+ $sContents = null;
331	+ $oFs = $this->getWpfs();
332	+ if ( $oFs ) {
333	+ $sContents = $oFs->get_contents( $sFilePath );
334	}
335
336	+ if ( empty( $sContents ) && function_exists( 'file_get_contents' ) ) {
337	+ $sContents = file_get_contents( $sFilePath );
338	+ }
339	+ return $sContents;
340	+ }





341
342	+ /**
343	+ * @param $sFilePath
344	+ * @return bool
345	+ */
346	+ public function getFileSize( $sFilePath ) {
347	+ $oFs = $this->getWpfs();
348	+ if ( $oFs && ( $oFs->size( $sFilePath ) > 0 ) ) {
349	+ return $oFs->size( $sFilePath );
350	}
351	+ return @filesize( $sFilePath );
352	+ }
353
354	+ /**
355	+ * @param string\|null $sBaseDir
356	+ * @param string $sPrefix
357	+ * @param string $outsRandomDir
358	+ * @return bool\|string
359	+ */
360	+ public function getTempDir( $sBaseDir = null, $sPrefix = '', &$outsRandomDir = '' ) {
361	+ $sTemp = rtrim( ( is_null( $sBaseDir ) ? get_temp_dir() : $sBaseDir ), DIRECTORY_SEPARATOR ).DIRECTORY_SEPARATOR;
362	+
363	+ $sCharset = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz0123456789';
364	+ do {
365	+ $sDir = $sPrefix;
366	+ for ( $i = 0 ; $i < 8 ; $i++ ) {
367	+ $sDir .= $sCharset[ ( rand()%strlen( $sCharset ) ) ];
368	}
369	+ } while ( is_dir( $sTemp.$sDir ) );
370	+
371	+ $outsRandomDir = $sDir;
372	+
373	+ $bSuccess = true;
374	+ if ( !@mkdir( $sTemp.$sDir, 0755, true ) ) {
375	+ $bSuccess = false;
376	}
377	+ return ( $bSuccess ? $sTemp.$sDir : false );
378	+ }
379
380	+ /**
381	+ * @param string $sFilePath
382	+ * @param string $sContents
383	+ * @return boolean
384	+ */
385	+ public function putFileContent( $sFilePath, $sContents ) {
386	+ $oFs = $this->getWpfs();
387	+ if ( $oFs && $oFs->put_contents( $sFilePath, $sContents, FS_CHMOD_FILE ) ) {
388	+ return true;

389	}
390
391	+ if ( function_exists( 'file_put_contents' ) ) {
392	+ return file_put_contents( $sFilePath, $sContents ) !== false;









393	}
394	+ return false;
395	+ }
396
397	+ /**
398	+ * Recursive delete
399	+ * @param string $sDir
400	+ * @return bool
401	+ */
402	+ public function deleteDir( $sDir ) {
403	+ $oFs = $this->getWpfs();
404	+ if ( $oFs && $oFs->rmdir( $sDir, true ) ) {
405	+ return true;
406	+ }
407	+ return @rmdir( $sDir );
408	+ }
409	+
410	+ /**
411	+ * @param string $sFilePath
412	+ * @return boolean\|null
413	+ */
414	+ public function deleteFile( $sFilePath ) {
415	+ $oFs = $this->getWpfs();
416	+ if ( $oFs && $oFs->delete( $sFilePath ) ) {
417	+ return true;
418	}
419	+ return function_exists( 'unlink' ) ? @unlink( $sFilePath ) : null;
420	+ }
421
422	+ /**
423	+ * @param string $sFilePathSource
424	+ * @param string $sFilePathDestination
425	+ * @return bool\|null
426	+ */
427	+ public function move( $sFilePathSource, $sFilePathDestination ) {
428	+ $oFs = $this->getWpfs();
429	+ if ( $oFs && $oFs->move( $sFilePathSource, $sFilePathDestination ) ) {
430	+ return true;
431	+ }
432	+ return function_exists( 'rename' ) ? @rename( $sFilePathSource, $sFilePathDestination ) : null;
433	+ }
434	+
435	+ /**
436	+ * @param $sFilePath
437	+ * @return bool\|mixed
438	+ */
439	+ public function isFile( $sFilePath ) {
440	+ $oFs = $this->getWpfs();
441	+ if ( $oFs && $oFs->is_file( $sFilePath ) ) {
442	+ return true;
443	}
444	+ return function_exists( 'is_file' ) ? is_file( $sFilePath ) : null;
445	+ }
446
447	+ /**
448	+ * @param $sDirPath
449	+ * @return bool
450	+ */
451	+ public function mkdir( $sDirPath ) {
452	+ return wp_mkdir_p( $sDirPath );
453	+ }
454	+
455	+ /**
456	+ * @param string $sFilePath
457	+ * @param int $nTime
458	+ * @return bool\|mixed
459	+ */
460	+ public function touch( $sFilePath, $nTime = null ) {
461	+ $oFs = $this->getWpfs();
462	+ if ( $oFs && $oFs->touch( $sFilePath, $nTime ) ) {
463	+ return true;
464	+ }
465	+ return function_exists( 'touch' ) ? @touch( $sFilePath, $nTime ) : null;
466	+ }
467	+
468	+ /**
469	+ * @return WP_Filesystem_Base
470	+ */
471	+ protected function getWpfs() {
472	+ if ( is_null( $this->oWpfs ) ) {
473	+ $this->initFileSystem();
474	}
475	+ return $this->oWpfs;
476	+ }
477
478	+ /**
479	+ */
480	+ private function initFileSystem() {
481	+ if ( is_null( $this->oWpfs ) ) {
482	+ $this->oWpfs = false;
483	+ require_once( ABSPATH.'wp-admin'.DIRECTORY_SEPARATOR.'includes'.DIRECTORY_SEPARATOR.'file.php' );
484	+ if ( WP_Filesystem() ) {
485	+ global $wp_filesystem;
486	+ if ( isset( $wp_filesystem ) && is_object( $wp_filesystem ) ) {
487	+ $this->oWpfs = $wp_filesystem;











488	}
489	}
490	}
491	}
492	+ }

src/common/icwp-wpfunctions.php CHANGED Viewed

	@@ -512,6 +512,7 @@ class ICWP_WPSF_WpFunctions extends ICWP_WPSF_Foundation {
512	}
513
514	/**

515	* @return bool
516	*/
517	public function isLoginUrl( $sUrlPath ) {


512	}
513
514	/**
515	+ * @param string $sUrlPath
516	* @return bool
517	*/
518	public function isLoginUrl( $sUrlPath ) {

src/common/lib/composer.json ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ {
2	+ "name": "shield requirement",
3	+ "description": "shield requirement",
4	+ "authors": [
5	+ {
6	+ "name": "Paul Goodchild",
7	+ "email": "paul@paulgoodchild.me",
8	+ "homepage": "https://paulgoodchild.me"
9	+ }
10	+ ],
11	+ "license": "MIT",
12	+ "keywords": [
13	+ ],
14	+ "repositories": [
15	+ ],
16	+ "require": {
17	+ "php": ">=5.3.3",
18	+ "fernleafsystems/utilities": "^1.0",
19	+ "nesbot/carbon": "^1.22.0",
20	+ "twig/twig": "^1.0"
21	+ },
22	+ "require-dev": {
23	+ },
24	+ "autoload": {
25	+ "psr-4": {
26	+ }
27	+ }
28	+ }

src/common/lib/composer.lock ADDED Viewed

	@@ -0,0 +1,299 @@


1	+ {
2	+ "_readme": [
3	+ "This file locks the dependencies of your project to a known state",
4	+ "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#composer-lock-the-lock-file",
5	+ "This file is @generated automatically"
6	+ ],
7	+ "content-hash": "2689fdaca716a455a807827f8266ed2e",
8	+ "packages": [
9	+ {
10	+ "name": "fernleafsystems/utilities",
11	+ "version": "1.1.0",
12	+ "source": {
13	+ "type": "git",
14	+ "url": "https://github.com/FernleafSystems/Utilities.git",
15	+ "reference": "0195f7ff690cc5163174f033d6bc92b3eac20c03"
16	+ },
17	+ "dist": {
18	+ "type": "zip",
19	+ "url": "https://api.github.com/repos/FernleafSystems/Utilities/zipball/0195f7ff690cc5163174f033d6bc92b3eac20c03",
20	+ "reference": "0195f7ff690cc5163174f033d6bc92b3eac20c03",
21	+ "shasum": ""
22	+ },
23	+ "require": {
24	+ "php": ">=5.4"
25	+ },
26	+ "type": "library",
27	+ "autoload": {
28	+ "psr-4": {
29	+ "FernleafSystems\\Utilities\\": "src"
30	+ }
31	+ },
32	+ "notification-url": "https://packagist.org/downloads/",
33	+ "authors": [
34	+ {
35	+ "name": "Paul Goodchild",
36	+ "email": "paul@paulgoodchild.me",
37	+ "homepage": "https://paulgoodchild.me"
38	+ }
39	+ ],
40	+ "description": "Collection of simple utilities and traits",
41	+ "time": "2017-12-09T13:31:16+00:00"
42	+ },
43	+ {
44	+ "name": "nesbot/carbon",
45	+ "version": "1.22.1",
46	+ "source": {
47	+ "type": "git",
48	+ "url": "https://github.com/briannesbitt/Carbon.git",
49	+ "reference": "7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc"
50	+ },
51	+ "dist": {
52	+ "type": "zip",
53	+ "url": "https://api.github.com/repos/briannesbitt/Carbon/zipball/7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc",
54	+ "reference": "7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc",
55	+ "shasum": ""
56	+ },
57	+ "require": {
58	+ "php": ">=5.3.0",
59	+ "symfony/translation": "~2.6 \|\| ~3.0"
60	+ },
61	+ "require-dev": {
62	+ "friendsofphp/php-cs-fixer": "~2",
63	+ "phpunit/phpunit": "~4.0 \|\| ~5.0"
64	+ },
65	+ "type": "library",
66	+ "extra": {
67	+ "branch-alias": {
68	+ "dev-master": "1.23-dev"
69	+ }
70	+ },
71	+ "autoload": {
72	+ "psr-4": {
73	+ "Carbon\\": "src/Carbon/"
74	+ }
75	+ },
76	+ "notification-url": "https://packagist.org/downloads/",
77	+ "license": [
78	+ "MIT"
79	+ ],
80	+ "authors": [
81	+ {
82	+ "name": "Brian Nesbitt",
83	+ "email": "brian@nesbot.com",
84	+ "homepage": "http://nesbot.com"
85	+ }
86	+ ],
87	+ "description": "A simple API extension for DateTime.",
88	+ "homepage": "http://carbon.nesbot.com",
89	+ "keywords": [
90	+ "date",
91	+ "datetime",
92	+ "time"
93	+ ],
94	+ "time": "2017-01-16T07:55:07+00:00"
95	+ },
96	+ {
97	+ "name": "symfony/polyfill-mbstring",
98	+ "version": "v1.6.0",
99	+ "source": {
100	+ "type": "git",
101	+ "url": "https://github.com/symfony/polyfill-mbstring.git",
102	+ "reference": "2ec8b39c38cb16674bbf3fea2b6ce5bf117e1296"
103	+ },
104	+ "dist": {
105	+ "type": "zip",
106	+ "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/2ec8b39c38cb16674bbf3fea2b6ce5bf117e1296",
107	+ "reference": "2ec8b39c38cb16674bbf3fea2b6ce5bf117e1296",
108	+ "shasum": ""
109	+ },
110	+ "require": {
111	+ "php": ">=5.3.3"
112	+ },
113	+ "suggest": {
114	+ "ext-mbstring": "For best performance"
115	+ },
116	+ "type": "library",
117	+ "extra": {
118	+ "branch-alias": {
119	+ "dev-master": "1.6-dev"
120	+ }
121	+ },
122	+ "autoload": {
123	+ "psr-4": {
124	+ "Symfony\\Polyfill\\Mbstring\\": ""
125	+ },
126	+ "files": [
127	+ "bootstrap.php"
128	+ ]
129	+ },
130	+ "notification-url": "https://packagist.org/downloads/",
131	+ "license": [
132	+ "MIT"
133	+ ],
134	+ "authors": [
135	+ {
136	+ "name": "Nicolas Grekas",
137	+ "email": "p@tchwork.com"
138	+ },
139	+ {
140	+ "name": "Symfony Community",
141	+ "homepage": "https://symfony.com/contributors"
142	+ }
143	+ ],
144	+ "description": "Symfony polyfill for the Mbstring extension",
145	+ "homepage": "https://symfony.com",
146	+ "keywords": [
147	+ "compatibility",
148	+ "mbstring",
149	+ "polyfill",
150	+ "portable",
151	+ "shim"
152	+ ],
153	+ "time": "2017-10-11T12:05:26+00:00"
154	+ },
155	+ {
156	+ "name": "symfony/translation",
157	+ "version": "v3.4.2",
158	+ "source": {
159	+ "type": "git",
160	+ "url": "https://github.com/symfony/translation.git",
161	+ "reference": "4c5d5582baf2829751a5207659329c1f52eedeb6"
162	+ },
163	+ "dist": {
164	+ "type": "zip",
165	+ "url": "https://api.github.com/repos/symfony/translation/zipball/4c5d5582baf2829751a5207659329c1f52eedeb6",
166	+ "reference": "4c5d5582baf2829751a5207659329c1f52eedeb6",
167	+ "shasum": ""
168	+ },
169	+ "require": {
170	+ "php": "^5.5.9\|>=7.0.8",
171	+ "symfony/polyfill-mbstring": "~1.0"
172	+ },
173	+ "conflict": {
174	+ "symfony/config": "<2.8",
175	+ "symfony/dependency-injection": "<3.4",
176	+ "symfony/yaml": "<3.4"
177	+ },
178	+ "require-dev": {
179	+ "psr/log": "~1.0",
180	+ "symfony/config": "~2.8\|~3.0\|~4.0",
181	+ "symfony/dependency-injection": "~3.4\|~4.0",
182	+ "symfony/finder": "~2.8\|~3.0\|~4.0",
183	+ "symfony/intl": "^2.8.18\|^3.2.5\|~4.0",
184	+ "symfony/yaml": "~3.4\|~4.0"
185	+ },
186	+ "suggest": {
187	+ "psr/log": "To use logging capability in translator",
188	+ "symfony/config": "",
189	+ "symfony/yaml": ""
190	+ },
191	+ "type": "library",
192	+ "extra": {
193	+ "branch-alias": {
194	+ "dev-master": "3.4-dev"
195	+ }
196	+ },
197	+ "autoload": {
198	+ "psr-4": {
199	+ "Symfony\\Component\\Translation\\": ""
200	+ },
201	+ "exclude-from-classmap": [
202	+ "/Tests/"
203	+ ]
204	+ },
205	+ "notification-url": "https://packagist.org/downloads/",
206	+ "license": [
207	+ "MIT"
208	+ ],
209	+ "authors": [
210	+ {
211	+ "name": "Fabien Potencier",
212	+ "email": "fabien@symfony.com"
213	+ },
214	+ {
215	+ "name": "Symfony Community",
216	+ "homepage": "https://symfony.com/contributors"
217	+ }
218	+ ],
219	+ "description": "Symfony Translation Component",
220	+ "homepage": "https://symfony.com",
221	+ "time": "2017-12-12T08:27:14+00:00"
222	+ },
223	+ {
224	+ "name": "twig/twig",
225	+ "version": "v1.35.0",
226	+ "source": {
227	+ "type": "git",
228	+ "url": "https://github.com/twigphp/Twig.git",
229	+ "reference": "daa657073e55b0a78cce8fdd22682fddecc6385f"
230	+ },
231	+ "dist": {
232	+ "type": "zip",
233	+ "url": "https://api.github.com/repos/twigphp/Twig/zipball/daa657073e55b0a78cce8fdd22682fddecc6385f",
234	+ "reference": "daa657073e55b0a78cce8fdd22682fddecc6385f",
235	+ "shasum": ""
236	+ },
237	+ "require": {
238	+ "php": ">=5.3.3"
239	+ },
240	+ "require-dev": {
241	+ "psr/container": "^1.0",
242	+ "symfony/debug": "~2.7",
243	+ "symfony/phpunit-bridge": "~3.3@dev"
244	+ },
245	+ "type": "library",
246	+ "extra": {
247	+ "branch-alias": {
248	+ "dev-master": "1.35-dev"
249	+ }
250	+ },
251	+ "autoload": {
252	+ "psr-0": {
253	+ "Twig_": "lib/"
254	+ },
255	+ "psr-4": {
256	+ "Twig\\": "src/"
257	+ }
258	+ },
259	+ "notification-url": "https://packagist.org/downloads/",
260	+ "license": [
261	+ "BSD-3-Clause"
262	+ ],
263	+ "authors": [
264	+ {
265	+ "name": "Fabien Potencier",
266	+ "email": "fabien@symfony.com",
267	+ "homepage": "http://fabien.potencier.org",
268	+ "role": "Lead Developer"
269	+ },
270	+ {
271	+ "name": "Armin Ronacher",
272	+ "email": "armin.ronacher@active-4.com",
273	+ "role": "Project Founder"
274	+ },
275	+ {
276	+ "name": "Twig Team",
277	+ "homepage": "http://twig.sensiolabs.org/contributors",
278	+ "role": "Contributors"
279	+ }
280	+ ],
281	+ "description": "Twig, the flexible, fast, and secure template language for PHP",
282	+ "homepage": "http://twig.sensiolabs.org",
283	+ "keywords": [
284	+ "templating"
285	+ ],
286	+ "time": "2017-09-27T18:06:46+00:00"
287	+ }
288	+ ],
289	+ "packages-dev": [],
290	+ "aliases": [],
291	+ "minimum-stability": "stable",
292	+ "stability-flags": [],
293	+ "prefer-stable": false,
294	+ "prefer-lowest": false,
295	+ "platform": {
296	+ "php": ">=5.3.3"
297	+ },
298	+ "platform-dev": []
299	+ }

src/common/lib/vendor/autoload.php ADDED Viewed

	@@ -0,0 +1,7 @@


1	+ <?php
2	+
3	+ // autoload.php @generated by Composer
4	+
5	+ require_once __DIR__ . '/composer/autoload_real.php';
6	+
7	+ return ComposerAutoloaderInit18a31866e67f0a0bfffdc031786ecae1::getLoader();

src/common/lib/vendor/composer/ClassLoader.php ADDED Viewed

	@@ -0,0 +1,445 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of Composer.
5	+ *
6	+ * (c) Nils Adermann <naderman@naderman.de>
7	+ * Jordi Boggiano <j.boggiano@seld.be>
8	+ *
9	+ * For the full copyright and license information, please view the LICENSE
10	+ * file that was distributed with this source code.
11	+ */
12	+
13	+ namespace Composer\Autoload;
14	+
15	+ /**
16	+ * ClassLoader implements a PSR-0, PSR-4 and classmap class loader.
17	+ *
18	+ * $loader = new \Composer\Autoload\ClassLoader();
19	+ *
20	+ * // register classes with namespaces
21	+ * $loader->add('Symfony\Component', __DIR__.'/component');
22	+ * $loader->add('Symfony', __DIR__.'/framework');
23	+ *
24	+ * // activate the autoloader
25	+ * $loader->register();
26	+ *
27	+ * // to enable searching the include path (eg. for PEAR packages)
28	+ * $loader->setUseIncludePath(true);
29	+ *
30	+ * In this example, if you try to use a class in the Symfony\Component
31	+ * namespace or one of its children (Symfony\Component\Console for instance),
32	+ * the autoloader will first look for the class under the component/
33	+ * directory, and it will then fallback to the framework/ directory if not
34	+ * found before giving up.
35	+ *
36	+ * This class is loosely based on the Symfony UniversalClassLoader.
37	+ *
38	+ * @author Fabien Potencier <fabien@symfony.com>
39	+ * @author Jordi Boggiano <j.boggiano@seld.be>
40	+ * @see http://www.php-fig.org/psr/psr-0/
41	+ * @see http://www.php-fig.org/psr/psr-4/
42	+ */
43	+ class ClassLoader
44	+ {
45	+ // PSR-4
46	+ private $prefixLengthsPsr4 = array();
47	+ private $prefixDirsPsr4 = array();
48	+ private $fallbackDirsPsr4 = array();
49	+
50	+ // PSR-0
51	+ private $prefixesPsr0 = array();
52	+ private $fallbackDirsPsr0 = array();
53	+
54	+ private $useIncludePath = false;
55	+ private $classMap = array();
56	+ private $classMapAuthoritative = false;
57	+ private $missingClasses = array();
58	+ private $apcuPrefix;
59	+
60	+ public function getPrefixes()
61	+ {
62	+ if (!empty($this->prefixesPsr0)) {
63	+ return call_user_func_array('array_merge', $this->prefixesPsr0);
64	+ }
65	+
66	+ return array();
67	+ }
68	+
69	+ public function getPrefixesPsr4()
70	+ {
71	+ return $this->prefixDirsPsr4;
72	+ }
73	+
74	+ public function getFallbackDirs()
75	+ {
76	+ return $this->fallbackDirsPsr0;
77	+ }
78	+
79	+ public function getFallbackDirsPsr4()
80	+ {
81	+ return $this->fallbackDirsPsr4;
82	+ }
83	+
84	+ public function getClassMap()
85	+ {
86	+ return $this->classMap;
87	+ }
88	+
89	+ /**
90	+ * @param array $classMap Class to filename map
91	+ */
92	+ public function addClassMap(array $classMap)
93	+ {
94	+ if ($this->classMap) {
95	+ $this->classMap = array_merge($this->classMap, $classMap);
96	+ } else {
97	+ $this->classMap = $classMap;
98	+ }
99	+ }
100	+
101	+ /**
102	+ * Registers a set of PSR-0 directories for a given prefix, either
103	+ * appending or prepending to the ones previously set for this prefix.
104	+ *
105	+ * @param string $prefix The prefix
106	+ * @param array\|string $paths The PSR-0 root directories
107	+ * @param bool $prepend Whether to prepend the directories
108	+ */
109	+ public function add($prefix, $paths, $prepend = false)
110	+ {
111	+ if (!$prefix) {
112	+ if ($prepend) {
113	+ $this->fallbackDirsPsr0 = array_merge(
114	+ (array) $paths,
115	+ $this->fallbackDirsPsr0
116	+ );
117	+ } else {
118	+ $this->fallbackDirsPsr0 = array_merge(
119	+ $this->fallbackDirsPsr0,
120	+ (array) $paths
121	+ );
122	+ }
123	+
124	+ return;
125	+ }
126	+
127	+ $first = $prefix[0];
128	+ if (!isset($this->prefixesPsr0[$first][$prefix])) {
129	+ $this->prefixesPsr0[$first][$prefix] = (array) $paths;
130	+
131	+ return;
132	+ }
133	+ if ($prepend) {
134	+ $this->prefixesPsr0[$first][$prefix] = array_merge(
135	+ (array) $paths,
136	+ $this->prefixesPsr0[$first][$prefix]
137	+ );
138	+ } else {
139	+ $this->prefixesPsr0[$first][$prefix] = array_merge(
140	+ $this->prefixesPsr0[$first][$prefix],
141	+ (array) $paths
142	+ );
143	+ }
144	+ }
145	+
146	+ /**
147	+ * Registers a set of PSR-4 directories for a given namespace, either
148	+ * appending or prepending to the ones previously set for this namespace.
149	+ *
150	+ * @param string $prefix The prefix/namespace, with trailing '\\'
151	+ * @param array\|string $paths The PSR-4 base directories
152	+ * @param bool $prepend Whether to prepend the directories
153	+ *
154	+ * @throws \InvalidArgumentException
155	+ */
156	+ public function addPsr4($prefix, $paths, $prepend = false)
157	+ {
158	+ if (!$prefix) {
159	+ // Register directories for the root namespace.
160	+ if ($prepend) {
161	+ $this->fallbackDirsPsr4 = array_merge(
162	+ (array) $paths,
163	+ $this->fallbackDirsPsr4
164	+ );
165	+ } else {
166	+ $this->fallbackDirsPsr4 = array_merge(
167	+ $this->fallbackDirsPsr4,
168	+ (array) $paths
169	+ );
170	+ }
171	+ } elseif (!isset($this->prefixDirsPsr4[$prefix])) {
172	+ // Register directories for a new namespace.
173	+ $length = strlen($prefix);
174	+ if ('\\' !== $prefix[$length - 1]) {
175	+ throw new \InvalidArgumentException("A non-empty PSR-4 prefix must end with a namespace separator.");
176	+ }
177	+ $this->prefixLengthsPsr4[$prefix[0]][$prefix] = $length;
178	+ $this->prefixDirsPsr4[$prefix] = (array) $paths;
179	+ } elseif ($prepend) {
180	+ // Prepend directories for an already registered namespace.
181	+ $this->prefixDirsPsr4[$prefix] = array_merge(
182	+ (array) $paths,
183	+ $this->prefixDirsPsr4[$prefix]
184	+ );
185	+ } else {
186	+ // Append directories for an already registered namespace.
187	+ $this->prefixDirsPsr4[$prefix] = array_merge(
188	+ $this->prefixDirsPsr4[$prefix],
189	+ (array) $paths
190	+ );
191	+ }
192	+ }
193	+
194	+ /**
195	+ * Registers a set of PSR-0 directories for a given prefix,
196	+ * replacing any others previously set for this prefix.
197	+ *
198	+ * @param string $prefix The prefix
199	+ * @param array\|string $paths The PSR-0 base directories
200	+ */
201	+ public function set($prefix, $paths)
202	+ {
203	+ if (!$prefix) {
204	+ $this->fallbackDirsPsr0 = (array) $paths;
205	+ } else {
206	+ $this->prefixesPsr0[$prefix[0]][$prefix] = (array) $paths;
207	+ }
208	+ }
209	+
210	+ /**
211	+ * Registers a set of PSR-4 directories for a given namespace,
212	+ * replacing any others previously set for this namespace.
213	+ *
214	+ * @param string $prefix The prefix/namespace, with trailing '\\'
215	+ * @param array\|string $paths The PSR-4 base directories
216	+ *
217	+ * @throws \InvalidArgumentException
218	+ */
219	+ public function setPsr4($prefix, $paths)
220	+ {
221	+ if (!$prefix) {
222	+ $this->fallbackDirsPsr4 = (array) $paths;
223	+ } else {
224	+ $length = strlen($prefix);
225	+ if ('\\' !== $prefix[$length - 1]) {
226	+ throw new \InvalidArgumentException("A non-empty PSR-4 prefix must end with a namespace separator.");
227	+ }
228	+ $this->prefixLengthsPsr4[$prefix[0]][$prefix] = $length;
229	+ $this->prefixDirsPsr4[$prefix] = (array) $paths;
230	+ }
231	+ }
232	+
233	+ /**
234	+ * Turns on searching the include path for class files.
235	+ *
236	+ * @param bool $useIncludePath
237	+ */
238	+ public function setUseIncludePath($useIncludePath)
239	+ {
240	+ $this->useIncludePath = $useIncludePath;
241	+ }
242	+
243	+ /**
244	+ * Can be used to check if the autoloader uses the include path to check
245	+ * for classes.
246	+ *
247	+ * @return bool
248	+ */
249	+ public function getUseIncludePath()
250	+ {
251	+ return $this->useIncludePath;
252	+ }
253	+
254	+ /**
255	+ * Turns off searching the prefix and fallback directories for classes
256	+ * that have not been registered with the class map.
257	+ *
258	+ * @param bool $classMapAuthoritative
259	+ */
260	+ public function setClassMapAuthoritative($classMapAuthoritative)
261	+ {
262	+ $this->classMapAuthoritative = $classMapAuthoritative;
263	+ }
264	+
265	+ /**
266	+ * Should class lookup fail if not found in the current class map?
267	+ *
268	+ * @return bool
269	+ */
270	+ public function isClassMapAuthoritative()
271	+ {
272	+ return $this->classMapAuthoritative;
273	+ }
274	+
275	+ /**
276	+ * APCu prefix to use to cache found/not-found classes, if the extension is enabled.
277	+ *
278	+ * @param string\|null $apcuPrefix
279	+ */
280	+ public function setApcuPrefix($apcuPrefix)
281	+ {
282	+ $this->apcuPrefix = function_exists('apcu_fetch') && ini_get('apc.enabled') ? $apcuPrefix : null;
283	+ }
284	+
285	+ /**
286	+ * The APCu prefix in use, or null if APCu caching is not enabled.
287	+ *
288	+ * @return string\|null
289	+ */
290	+ public function getApcuPrefix()
291	+ {
292	+ return $this->apcuPrefix;
293	+ }
294	+
295	+ /**
296	+ * Registers this instance as an autoloader.
297	+ *
298	+ * @param bool $prepend Whether to prepend the autoloader or not
299	+ */
300	+ public function register($prepend = false)
301	+ {
302	+ spl_autoload_register(array($this, 'loadClass'), true, $prepend);
303	+ }
304	+
305	+ /**
306	+ * Unregisters this instance as an autoloader.
307	+ */
308	+ public function unregister()
309	+ {
310	+ spl_autoload_unregister(array($this, 'loadClass'));
311	+ }
312	+
313	+ /**
314	+ * Loads the given class or interface.
315	+ *
316	+ * @param string $class The name of the class
317	+ * @return bool\|null True if loaded, null otherwise
318	+ */
319	+ public function loadClass($class)
320	+ {
321	+ if ($file = $this->findFile($class)) {
322	+ includeFile($file);
323	+
324	+ return true;
325	+ }
326	+ }
327	+
328	+ /**
329	+ * Finds the path to the file where the class is defined.
330	+ *
331	+ * @param string $class The name of the class
332	+ *
333	+ * @return string\|false The path if found, false otherwise
334	+ */
335	+ public function findFile($class)
336	+ {
337	+ // class map lookup
338	+ if (isset($this->classMap[$class])) {
339	+ return $this->classMap[$class];
340	+ }
341	+ if ($this->classMapAuthoritative \|\| isset($this->missingClasses[$class])) {
342	+ return false;
343	+ }
344	+ if (null !== $this->apcuPrefix) {
345	+ $file = apcu_fetch($this->apcuPrefix.$class, $hit);
346	+ if ($hit) {
347	+ return $file;
348	+ }
349	+ }
350	+
351	+ $file = $this->findFileWithExtension($class, '.php');
352	+
353	+ // Search for Hack files if we are running on HHVM
354	+ if (false === $file && defined('HHVM_VERSION')) {
355	+ $file = $this->findFileWithExtension($class, '.hh');
356	+ }
357	+
358	+ if (null !== $this->apcuPrefix) {
359	+ apcu_add($this->apcuPrefix.$class, $file);
360	+ }
361	+
362	+ if (false === $file) {
363	+ // Remember that this class does not exist.
364	+ $this->missingClasses[$class] = true;
365	+ }
366	+
367	+ return $file;
368	+ }
369	+
370	+ private function findFileWithExtension($class, $ext)
371	+ {
372	+ // PSR-4 lookup
373	+ $logicalPathPsr4 = strtr($class, '\\', DIRECTORY_SEPARATOR) . $ext;
374	+
375	+ $first = $class[0];
376	+ if (isset($this->prefixLengthsPsr4[$first])) {
377	+ $subPath = $class;
378	+ while (false !== $lastPos = strrpos($subPath, '\\')) {
379	+ $subPath = substr($subPath, 0, $lastPos);
380	+ $search = $subPath.'\\';
381	+ if (isset($this->prefixDirsPsr4[$search])) {
382	+ foreach ($this->prefixDirsPsr4[$search] as $dir) {
383	+ $length = $this->prefixLengthsPsr4[$first][$search];
384	+ if (file_exists($file = $dir . DIRECTORY_SEPARATOR . substr($logicalPathPsr4, $length))) {
385	+ return $file;
386	+ }
387	+ }
388	+ }
389	+ }
390	+ }
391	+
392	+ // PSR-4 fallback dirs
393	+ foreach ($this->fallbackDirsPsr4 as $dir) {
394	+ if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr4)) {
395	+ return $file;
396	+ }
397	+ }
398	+
399	+ // PSR-0 lookup
400	+ if (false !== $pos = strrpos($class, '\\')) {
401	+ // namespaced class name
402	+ $logicalPathPsr0 = substr($logicalPathPsr4, 0, $pos + 1)
403	+ . strtr(substr($logicalPathPsr4, $pos + 1), '_', DIRECTORY_SEPARATOR);
404	+ } else {
405	+ // PEAR-like class name
406	+ $logicalPathPsr0 = strtr($class, '_', DIRECTORY_SEPARATOR) . $ext;
407	+ }
408	+
409	+ if (isset($this->prefixesPsr0[$first])) {
410	+ foreach ($this->prefixesPsr0[$first] as $prefix => $dirs) {
411	+ if (0 === strpos($class, $prefix)) {
412	+ foreach ($dirs as $dir) {
413	+ if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) {
414	+ return $file;
415	+ }
416	+ }
417	+ }
418	+ }
419	+ }
420	+
421	+ // PSR-0 fallback dirs
422	+ foreach ($this->fallbackDirsPsr0 as $dir) {
423	+ if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) {
424	+ return $file;
425	+ }
426	+ }
427	+
428	+ // PSR-0 include paths.
429	+ if ($this->useIncludePath && $file = stream_resolve_include_path($logicalPathPsr0)) {
430	+ return $file;
431	+ }
432	+
433	+ return false;
434	+ }
435	+ }
436	+
437	+ /**
438	+ * Scope isolated include.
439	+ *
440	+ * Prevents access to $this/self from included files.
441	+ */
442	+ function includeFile($file)
443	+ {
444	+ include $file;
445	+ }

src/common/lib/vendor/composer/LICENSE ADDED Viewed

	@@ -0,0 +1,21 @@


1	+
2	+ Copyright (c) Nils Adermann, Jordi Boggiano
3	+
4	+ Permission is hereby granted, free of charge, to any person obtaining a copy
5	+ of this software and associated documentation files (the "Software"), to deal
6	+ in the Software without restriction, including without limitation the rights
7	+ to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
8	+ copies of the Software, and to permit persons to whom the Software is furnished
9	+ to do so, subject to the following conditions:
10	+
11	+ The above copyright notice and this permission notice shall be included in all
12	+ copies or substantial portions of the Software.
13	+
14	+ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
15	+ IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
16	+ FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
17	+ AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
18	+ LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
19	+ OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
20	+ THE SOFTWARE.
21	+

src/common/lib/vendor/composer/autoload_classmap.php ADDED Viewed

	@@ -0,0 +1,9 @@


1	+ <?php
2	+
3	+ // autoload_classmap.php @generated by Composer
4	+
5	+ $vendorDir = dirname(dirname(__FILE__));
6	+ $baseDir = dirname($vendorDir);
7	+
8	+ return array(
9	+ );

src/common/lib/vendor/composer/autoload_files.php ADDED Viewed

	@@ -0,0 +1,10 @@


1	+ <?php
2	+
3	+ // autoload_files.php @generated by Composer
4	+
5	+ $vendorDir = dirname(dirname(__FILE__));
6	+ $baseDir = dirname($vendorDir);
7	+
8	+ return array(
9	+ '0e6d7bf4a5811bfa5cf40c5ccd6fae6a' => $vendorDir . '/symfony/polyfill-mbstring/bootstrap.php',
10	+ );

src/common/lib/vendor/composer/autoload_namespaces.php ADDED Viewed

	@@ -0,0 +1,10 @@


1	+ <?php
2	+
3	+ // autoload_namespaces.php @generated by Composer
4	+
5	+ $vendorDir = dirname(dirname(__FILE__));
6	+ $baseDir = dirname($vendorDir);
7	+
8	+ return array(
9	+ 'Twig_' => array($vendorDir . '/twig/twig/lib'),
10	+ );

src/common/lib/vendor/composer/autoload_psr4.php ADDED Viewed

	@@ -0,0 +1,14 @@


1	+ <?php
2	+
3	+ // autoload_psr4.php @generated by Composer
4	+
5	+ $vendorDir = dirname(dirname(__FILE__));
6	+ $baseDir = dirname($vendorDir);
7	+
8	+ return array(
9	+ 'Twig\\' => array($vendorDir . '/twig/twig/src'),
10	+ 'Symfony\\Polyfill\\Mbstring\\' => array($vendorDir . '/symfony/polyfill-mbstring'),
11	+ 'Symfony\\Component\\Translation\\' => array($vendorDir . '/symfony/translation'),
12	+ 'FernleafSystems\\Utilities\\' => array($vendorDir . '/fernleafsystems/utilities/src'),
13	+ 'Carbon\\' => array($vendorDir . '/nesbot/carbon/src/Carbon'),
14	+ );

src/common/lib/vendor/composer/autoload_real.php ADDED Viewed

	@@ -0,0 +1,70 @@


1	+ <?php
2	+
3	+ // autoload_real.php @generated by Composer
4	+
5	+ class ComposerAutoloaderInit18a31866e67f0a0bfffdc031786ecae1
6	+ {
7	+ private static $loader;
8	+
9	+ public static function loadClassLoader($class)
10	+ {
11	+ if ('Composer\Autoload\ClassLoader' === $class) {
12	+ require __DIR__ . '/ClassLoader.php';
13	+ }
14	+ }
15	+
16	+ public static function getLoader()
17	+ {
18	+ if (null !== self::$loader) {
19	+ return self::$loader;
20	+ }
21	+
22	+ spl_autoload_register(array('ComposerAutoloaderInit18a31866e67f0a0bfffdc031786ecae1', 'loadClassLoader'), true, true);
23	+ self::$loader = $loader = new \Composer\Autoload\ClassLoader();
24	+ spl_autoload_unregister(array('ComposerAutoloaderInit18a31866e67f0a0bfffdc031786ecae1', 'loadClassLoader'));
25	+
26	+ $useStaticLoader = PHP_VERSION_ID >= 50600 && !defined('HHVM_VERSION') && (!function_exists('zend_loader_file_encoded') \|\| !zend_loader_file_encoded());
27	+ if ($useStaticLoader) {
28	+ require_once __DIR__ . '/autoload_static.php';
29	+
30	+ call_user_func(\Composer\Autoload\ComposerStaticInit18a31866e67f0a0bfffdc031786ecae1::getInitializer($loader));
31	+ } else {
32	+ $map = require __DIR__ . '/autoload_namespaces.php';
33	+ foreach ($map as $namespace => $path) {
34	+ $loader->set($namespace, $path);
35	+ }
36	+
37	+ $map = require __DIR__ . '/autoload_psr4.php';
38	+ foreach ($map as $namespace => $path) {
39	+ $loader->setPsr4($namespace, $path);
40	+ }
41	+
42	+ $classMap = require __DIR__ . '/autoload_classmap.php';
43	+ if ($classMap) {
44	+ $loader->addClassMap($classMap);
45	+ }
46	+ }
47	+
48	+ $loader->register(true);
49	+
50	+ if ($useStaticLoader) {
51	+ $includeFiles = Composer\Autoload\ComposerStaticInit18a31866e67f0a0bfffdc031786ecae1::$files;
52	+ } else {
53	+ $includeFiles = require __DIR__ . '/autoload_files.php';
54	+ }
55	+ foreach ($includeFiles as $fileIdentifier => $file) {
56	+ composerRequire18a31866e67f0a0bfffdc031786ecae1($fileIdentifier, $file);
57	+ }
58	+
59	+ return $loader;
60	+ }
61	+ }
62	+
63	+ function composerRequire18a31866e67f0a0bfffdc031786ecae1($fileIdentifier, $file)
64	+ {
65	+ if (empty($GLOBALS['__composer_autoload_files'][$fileIdentifier])) {
66	+ require $file;
67	+
68	+ $GLOBALS['__composer_autoload_files'][$fileIdentifier] = true;
69	+ }
70	+ }

src/common/lib/vendor/composer/autoload_static.php ADDED Viewed

	@@ -0,0 +1,75 @@


1	+ <?php
2	+
3	+ // autoload_static.php @generated by Composer
4	+
5	+ namespace Composer\Autoload;
6	+
7	+ class ComposerStaticInit18a31866e67f0a0bfffdc031786ecae1
8	+ {
9	+ public static $files = array (
10	+ '0e6d7bf4a5811bfa5cf40c5ccd6fae6a' => __DIR__ . '/..' . '/symfony/polyfill-mbstring/bootstrap.php',
11	+ );
12	+
13	+ public static $prefixLengthsPsr4 = array (
14	+ 'T' =>
15	+ array (
16	+ 'Twig\\' => 5,
17	+ ),
18	+ 'S' =>
19	+ array (
20	+ 'Symfony\\Polyfill\\Mbstring\\' => 26,
21	+ 'Symfony\\Component\\Translation\\' => 30,
22	+ ),
23	+ 'F' =>
24	+ array (
25	+ 'FernleafSystems\\Utilities\\' => 26,
26	+ ),
27	+ 'C' =>
28	+ array (
29	+ 'Carbon\\' => 7,
30	+ ),
31	+ );
32	+
33	+ public static $prefixDirsPsr4 = array (
34	+ 'Twig\\' =>
35	+ array (
36	+ 0 => __DIR__ . '/..' . '/twig/twig/src',
37	+ ),
38	+ 'Symfony\\Polyfill\\Mbstring\\' =>
39	+ array (
40	+ 0 => __DIR__ . '/..' . '/symfony/polyfill-mbstring',
41	+ ),
42	+ 'Symfony\\Component\\Translation\\' =>
43	+ array (
44	+ 0 => __DIR__ . '/..' . '/symfony/translation',
45	+ ),
46	+ 'FernleafSystems\\Utilities\\' =>
47	+ array (
48	+ 0 => __DIR__ . '/..' . '/fernleafsystems/utilities/src',
49	+ ),
50	+ 'Carbon\\' =>
51	+ array (
52	+ 0 => __DIR__ . '/..' . '/nesbot/carbon/src/Carbon',
53	+ ),
54	+ );
55	+
56	+ public static $prefixesPsr0 = array (
57	+ 'T' =>
58	+ array (
59	+ 'Twig_' =>
60	+ array (
61	+ 0 => __DIR__ . '/..' . '/twig/twig/lib',
62	+ ),
63	+ ),
64	+ );
65	+
66	+ public static function getInitializer(ClassLoader $loader)
67	+ {
68	+ return \Closure::bind(function () use ($loader) {
69	+ $loader->prefixLengthsPsr4 = ComposerStaticInit18a31866e67f0a0bfffdc031786ecae1::$prefixLengthsPsr4;
70	+ $loader->prefixDirsPsr4 = ComposerStaticInit18a31866e67f0a0bfffdc031786ecae1::$prefixDirsPsr4;
71	+ $loader->prefixesPsr0 = ComposerStaticInit18a31866e67f0a0bfffdc031786ecae1::$prefixesPsr0;
72	+
73	+ }, null, ClassLoader::class);
74	+ }
75	+ }

src/common/lib/vendor/composer/installed.json ADDED Viewed

	@@ -0,0 +1,291 @@


1	+ [
2	+ {
3	+ "name": "symfony/polyfill-mbstring",
4	+ "version": "v1.6.0",
5	+ "version_normalized": "1.6.0.0",
6	+ "source": {
7	+ "type": "git",
8	+ "url": "https://github.com/symfony/polyfill-mbstring.git",
9	+ "reference": "2ec8b39c38cb16674bbf3fea2b6ce5bf117e1296"
10	+ },
11	+ "dist": {
12	+ "type": "zip",
13	+ "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/2ec8b39c38cb16674bbf3fea2b6ce5bf117e1296",
14	+ "reference": "2ec8b39c38cb16674bbf3fea2b6ce5bf117e1296",
15	+ "shasum": ""
16	+ },
17	+ "require": {
18	+ "php": ">=5.3.3"
19	+ },
20	+ "suggest": {
21	+ "ext-mbstring": "For best performance"
22	+ },
23	+ "time": "2017-10-11T12:05:26+00:00",
24	+ "type": "library",
25	+ "extra": {
26	+ "branch-alias": {
27	+ "dev-master": "1.6-dev"
28	+ }
29	+ },
30	+ "installation-source": "dist",
31	+ "autoload": {
32	+ "psr-4": {
33	+ "Symfony\\Polyfill\\Mbstring\\": ""
34	+ },
35	+ "files": [
36	+ "bootstrap.php"
37	+ ]
38	+ },
39	+ "notification-url": "https://packagist.org/downloads/",
40	+ "license": [
41	+ "MIT"
42	+ ],
43	+ "authors": [
44	+ {
45	+ "name": "Nicolas Grekas",
46	+ "email": "p@tchwork.com"
47	+ },
48	+ {
49	+ "name": "Symfony Community",
50	+ "homepage": "https://symfony.com/contributors"
51	+ }
52	+ ],
53	+ "description": "Symfony polyfill for the Mbstring extension",
54	+ "homepage": "https://symfony.com",
55	+ "keywords": [
56	+ "compatibility",
57	+ "mbstring",
58	+ "polyfill",
59	+ "portable",
60	+ "shim"
61	+ ]
62	+ },
63	+ {
64	+ "name": "nesbot/carbon",
65	+ "version": "1.22.1",
66	+ "version_normalized": "1.22.1.0",
67	+ "source": {
68	+ "type": "git",
69	+ "url": "https://github.com/briannesbitt/Carbon.git",
70	+ "reference": "7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc"
71	+ },
72	+ "dist": {
73	+ "type": "zip",
74	+ "url": "https://api.github.com/repos/briannesbitt/Carbon/zipball/7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc",
75	+ "reference": "7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc",
76	+ "shasum": ""
77	+ },
78	+ "require": {
79	+ "php": ">=5.3.0",
80	+ "symfony/translation": "~2.6 \|\| ~3.0"
81	+ },
82	+ "require-dev": {
83	+ "friendsofphp/php-cs-fixer": "~2",
84	+ "phpunit/phpunit": "~4.0 \|\| ~5.0"
85	+ },
86	+ "time": "2017-01-16T07:55:07+00:00",
87	+ "type": "library",
88	+ "extra": {
89	+ "branch-alias": {
90	+ "dev-master": "1.23-dev"
91	+ }
92	+ },
93	+ "installation-source": "dist",
94	+ "autoload": {
95	+ "psr-4": {
96	+ "Carbon\\": "src/Carbon/"
97	+ }
98	+ },
99	+ "notification-url": "https://packagist.org/downloads/",
100	+ "license": [
101	+ "MIT"
102	+ ],
103	+ "authors": [
104	+ {
105	+ "name": "Brian Nesbitt",
106	+ "email": "brian@nesbot.com",
107	+ "homepage": "http://nesbot.com"
108	+ }
109	+ ],
110	+ "description": "A simple API extension for DateTime.",
111	+ "homepage": "http://carbon.nesbot.com",
112	+ "keywords": [
113	+ "date",
114	+ "datetime",
115	+ "time"
116	+ ]
117	+ },
118	+ {
119	+ "name": "fernleafsystems/utilities",
120	+ "version": "1.1.0",
121	+ "version_normalized": "1.1.0.0",
122	+ "source": {
123	+ "type": "git",
124	+ "url": "https://github.com/FernleafSystems/Utilities.git",
125	+ "reference": "0195f7ff690cc5163174f033d6bc92b3eac20c03"
126	+ },
127	+ "dist": {
128	+ "type": "zip",
129	+ "url": "https://api.github.com/repos/FernleafSystems/Utilities/zipball/0195f7ff690cc5163174f033d6bc92b3eac20c03",
130	+ "reference": "0195f7ff690cc5163174f033d6bc92b3eac20c03",
131	+ "shasum": ""
132	+ },
133	+ "require": {
134	+ "php": ">=5.4"
135	+ },
136	+ "time": "2017-12-09T13:31:16+00:00",
137	+ "type": "library",
138	+ "installation-source": "dist",
139	+ "autoload": {
140	+ "psr-4": {
141	+ "FernleafSystems\\Utilities\\": "src"
142	+ }
143	+ },
144	+ "notification-url": "https://packagist.org/downloads/",
145	+ "authors": [
146	+ {
147	+ "name": "Paul Goodchild",
148	+ "email": "paul@paulgoodchild.me",
149	+ "homepage": "https://paulgoodchild.me"
150	+ }
151	+ ],
152	+ "description": "Collection of simple utilities and traits"
153	+ },
154	+ {
155	+ "name": "symfony/translation",
156	+ "version": "v3.4.2",
157	+ "version_normalized": "3.4.2.0",
158	+ "source": {
159	+ "type": "git",
160	+ "url": "https://github.com/symfony/translation.git",
161	+ "reference": "4c5d5582baf2829751a5207659329c1f52eedeb6"
162	+ },
163	+ "dist": {
164	+ "type": "zip",
165	+ "url": "https://api.github.com/repos/symfony/translation/zipball/4c5d5582baf2829751a5207659329c1f52eedeb6",
166	+ "reference": "4c5d5582baf2829751a5207659329c1f52eedeb6",
167	+ "shasum": ""
168	+ },
169	+ "require": {
170	+ "php": "^5.5.9\|>=7.0.8",
171	+ "symfony/polyfill-mbstring": "~1.0"
172	+ },
173	+ "conflict": {
174	+ "symfony/config": "<2.8",
175	+ "symfony/dependency-injection": "<3.4",
176	+ "symfony/yaml": "<3.4"
177	+ },
178	+ "require-dev": {
179	+ "psr/log": "~1.0",
180	+ "symfony/config": "~2.8\|~3.0\|~4.0",
181	+ "symfony/dependency-injection": "~3.4\|~4.0",
182	+ "symfony/finder": "~2.8\|~3.0\|~4.0",
183	+ "symfony/intl": "^2.8.18\|^3.2.5\|~4.0",
184	+ "symfony/yaml": "~3.4\|~4.0"
185	+ },
186	+ "suggest": {
187	+ "psr/log": "To use logging capability in translator",
188	+ "symfony/config": "",
189	+ "symfony/yaml": ""
190	+ },
191	+ "time": "2017-12-12T08:27:14+00:00",
192	+ "type": "library",
193	+ "extra": {
194	+ "branch-alias": {
195	+ "dev-master": "3.4-dev"
196	+ }
197	+ },
198	+ "installation-source": "dist",
199	+ "autoload": {
200	+ "psr-4": {
201	+ "Symfony\\Component\\Translation\\": ""
202	+ },
203	+ "exclude-from-classmap": [
204	+ "/Tests/"
205	+ ]
206	+ },
207	+ "notification-url": "https://packagist.org/downloads/",
208	+ "license": [
209	+ "MIT"
210	+ ],
211	+ "authors": [
212	+ {
213	+ "name": "Fabien Potencier",
214	+ "email": "fabien@symfony.com"
215	+ },
216	+ {
217	+ "name": "Symfony Community",
218	+ "homepage": "https://symfony.com/contributors"
219	+ }
220	+ ],
221	+ "description": "Symfony Translation Component",
222	+ "homepage": "https://symfony.com"
223	+ },
224	+ {
225	+ "name": "twig/twig",
226	+ "version": "v1.35.0",
227	+ "version_normalized": "1.35.0.0",
228	+ "source": {
229	+ "type": "git",
230	+ "url": "https://github.com/twigphp/Twig.git",
231	+ "reference": "daa657073e55b0a78cce8fdd22682fddecc6385f"
232	+ },
233	+ "dist": {
234	+ "type": "zip",
235	+ "url": "https://api.github.com/repos/twigphp/Twig/zipball/daa657073e55b0a78cce8fdd22682fddecc6385f",
236	+ "reference": "daa657073e55b0a78cce8fdd22682fddecc6385f",
237	+ "shasum": ""
238	+ },
239	+ "require": {
240	+ "php": ">=5.3.3"
241	+ },
242	+ "require-dev": {
243	+ "psr/container": "^1.0",
244	+ "symfony/debug": "~2.7",
245	+ "symfony/phpunit-bridge": "~3.3@dev"
246	+ },
247	+ "time": "2017-09-27T18:06:46+00:00",
248	+ "type": "library",
249	+ "extra": {
250	+ "branch-alias": {
251	+ "dev-master": "1.35-dev"
252	+ }
253	+ },
254	+ "installation-source": "dist",
255	+ "autoload": {
256	+ "psr-0": {
257	+ "Twig_": "lib/"
258	+ },
259	+ "psr-4": {
260	+ "Twig\\": "src/"
261	+ }
262	+ },
263	+ "notification-url": "https://packagist.org/downloads/",
264	+ "license": [
265	+ "BSD-3-Clause"
266	+ ],
267	+ "authors": [
268	+ {
269	+ "name": "Fabien Potencier",
270	+ "email": "fabien@symfony.com",
271	+ "homepage": "http://fabien.potencier.org",
272	+ "role": "Lead Developer"
273	+ },
274	+ {
275	+ "name": "Armin Ronacher",
276	+ "email": "armin.ronacher@active-4.com",
277	+ "role": "Project Founder"
278	+ },
279	+ {
280	+ "name": "Twig Team",
281	+ "homepage": "http://twig.sensiolabs.org/contributors",
282	+ "role": "Contributors"
283	+ }
284	+ ],
285	+ "description": "Twig, the flexible, fast, and secure template language for PHP",
286	+ "homepage": "http://twig.sensiolabs.org",
287	+ "keywords": [
288	+ "templating"
289	+ ]
290	+ }
291	+ ]

src/common/lib/vendor/fernleafsystems/utilities/src/Data/Adapter/StdClassAdapter.php ADDED Viewed

	@@ -0,0 +1,151 @@


1	+ <?php
2	+
3	+ namespace FernleafSystems\Utilities\Data\Adapter;
4	+
5	+ /**
6	+ * Trait StdClassAdapter
7	+ * @package FernleafSystems\Utilities\Data\Adapter
8	+ */
9	+ trait StdClassAdapter {
10	+
11	+ /**
12	+ * @var \stdClass
13	+ */
14	+ private $oRaw;
15	+
16	+ /**
17	+ * @param string $sProperty
18	+ * @return mixed
19	+ */
20	+ public function __get( $sProperty ) {
21	+ return $this->getParam( $sProperty );
22	+ }
23	+
24	+ /**
25	+ * @param string $sProperty
26	+ * @param mixed $mValue
27	+ * @return $this
28	+ */
29	+ public function __set( $sProperty, $mValue ) {
30	+ return $this->setParam( $sProperty, $mValue );
31	+ }
32	+
33	+ /**
34	+ * @param array $aDataValues associative with parameter keys and values
35	+ * @param array $aRestrictedKeys
36	+ * @return $this
37	+ */
38	+ public function applyFromArray( $aDataValues, $aRestrictedKeys = array() ) {
39	+ if ( !empty( $aRestrictedKeys ) ) {
40	+ $aDataValues = array_intersect_key( $aDataValues, array_flip( $aRestrictedKeys ) );
41	+ }
42	+ $this->reset();
43	+ foreach ( $aDataValues as $sKey => $mValue ) {
44	+ $this->setParam( $sKey, $mValue );
45	+ }
46	+ return $this;
47	+ }
48	+
49	+ /**
50	+ * @return $this
51	+ */
52	+ public function reset() {
53	+ $this->oRaw = new \stdClass();
54	+ return $this;
55	+ }
56	+
57	+ /**
58	+ * @param bool $bClone
59	+ * @return \stdClass
60	+ */
61	+ public function getRawData( $bClone = false ) {
62	+ if ( !is_object( $this->oRaw ) ) {
63	+ $this->oRaw = new \stdClass();
64	+ }
65	+ return $bClone ? clone $this->oRaw : $this->oRaw;
66	+ }
67	+
68	+ /**
69	+ * @return array
70	+ */
71	+ public function getRawDataAsArray() {
72	+ return (array)$this->getRawData();
73	+ }
74	+
75	+ /**
76	+ * @param string $sKey
77	+ * @param mixed $mComparison
78	+ * @return bool
79	+ */
80	+ public function isParam( $sKey, $mComparison ) {
81	+ return ( $this->getParam( $sKey ) == $mComparison );
82	+ }
83	+
84	+ /**
85	+ * @param string $sKey
86	+ * @param array $nDefault
87	+ * @return array
88	+ */
89	+ public function getArrayParam( $sKey, $nDefault = array() ) {
90	+ $aVal = $this->getParam( $sKey, $nDefault );
91	+ return ( !is_null( $aVal ) && is_array( $aVal ) ) ? $aVal : $nDefault;
92	+ }
93	+
94	+ /**
95	+ * @param string $sKey
96	+ * @param int $nDefault
97	+ * @return int\|float\|null
98	+ */
99	+ public function getNumericParam( $sKey, $nDefault = null ) {
100	+ $nVal = $this->getParam( $sKey, $nDefault );
101	+ return ( !is_null( $nVal ) && is_numeric( $nVal ) ) ? $nVal : $nDefault;
102	+ }
103	+
104	+ /**
105	+ * @param string $sKey
106	+ * @param mixed $mDefault
107	+ * @return mixed
108	+ */
109	+ public function getParam( $sKey, $mDefault = null ) {
110	+ return isset( $this->getRawData()->{$sKey} ) ? $this->getRawData()->{$sKey} : $mDefault;
111	+ }
112	+
113	+ /**
114	+ * @param string $sKey
115	+ * @param string $mDefault
116	+ * @return string
117	+ */
118	+ public function getStringParam( $sKey, $mDefault = '' ) {
119	+ $sVal = $this->getParam( $sKey, $mDefault );
120	+ return ( !is_null( $sVal ) && is_string( $sVal ) ) ? trim( $sVal ) : $mDefault;
121	+ }
122	+
123	+ /**
124	+ * @param object $oRaw
125	+ * @return $this
126	+ */
127	+ public function setRawData( $oRaw ) {
128	+ $this->oRaw = $oRaw;
129	+ return $this;
130	+ }
131	+
132	+ /**
133	+ * @param string $sKey
134	+ * @param mixed $mValue
135	+ * @return $this
136	+ */
137	+ public function setParam( $sKey, $mValue ) {
138	+ $this->getRawData()->{$sKey} = $mValue;
139	+ return $this;
140	+ }
141	+
142	+ /**
143	+ * @alias TODO remove
144	+ * @param string $sKey
145	+ * @param mixed $mValue
146	+ * @return $this
147	+ */
148	+ public function setRawDataItem( $sKey, $mValue ) {
149	+ return $this->setParam( $sKey, $mValue );
150	+ }
151	+ }

src/common/lib/vendor/fernleafsystems/utilities/src/Response.php ADDED Viewed

	@@ -0,0 +1,158 @@


1	+ <?php
2	+
3	+ namespace FernleafSystems\Utilities;
4	+
5	+ use FernleafSystems\Utilities\Data\Adapter\StdClassAdapter;
6	+
7	+ /**
8	+ * Class Response
9	+ * @package FernleafSystems\Utilities
10	+ */
11	+ class Response {
12	+
13	+ use StdClassAdapter;
14	+
15	+ /**
16	+ * @var string
17	+ */
18	+ private $sErrorCode = null;
19	+
20	+ /**
21	+ * @var string
22	+ */
23	+ private $sErrorText = null;
24	+
25	+ /**
26	+ * @var string
27	+ */
28	+ private $sMessageText = null;
29	+
30	+ /**
31	+ * @var boolean
32	+ */
33	+ private $bSuccessful = null;
34	+
35	+ /**
36	+ * @var array
37	+ */
38	+ private $aDebug = array();
39	+
40	+ /**
41	+ * @return array
42	+ */
43	+ public function getData() {
44	+ return $this->getRawDataAsArray();
45	+ }
46	+
47	+ /**
48	+ * @param string $sKey
49	+ * @return mixed\|null
50	+ */
51	+ public function getDataValue( $sKey ) {
52	+ return $this->getParam( $sKey );
53	+ }
54	+
55	+ /**
56	+ * @return array
57	+ */
58	+ public function getDebug() {
59	+ return $this->aDebug;
60	+ }
61	+
62	+ /**
63	+ * @return string
64	+ */
65	+ public function getErrorCode() {
66	+ return $this->sErrorCode;
67	+ }
68	+
69	+ /**
70	+ * @return string
71	+ */
72	+ public function getErrorText() {
73	+ return $this->sErrorText;
74	+ }
75	+
76	+ /**
77	+ * @return string
78	+ */
79	+ public function getMessageText() {
80	+ return $this->sMessageText;
81	+ }
82	+
83	+ /**
84	+ * @param array $aData
85	+ * @return $this
86	+ */
87	+ public function setData( $aData ) {
88	+ return $this->applyFromArray( $aData );
89	+ }
90	+
91	+ /**
92	+ * @param array $aDebug
93	+ * @return $this
94	+ */
95	+ public function setDebug( $aDebug ) {
96	+ $this->aDebug = $aDebug;
97	+ return $this;
98	+ }
99	+
100	+ /**
101	+ * @param string $sCode
102	+ * @return $this
103	+ */
104	+ public function setErrorCode( $sCode ) {
105	+ $this->sErrorCode = $sCode;
106	+ return $this;
107	+ }
108	+
109	+ /**
110	+ * @param string $sText
111	+ * @return $this
112	+ */
113	+ public function setErrorText( $sText ) {
114	+ $this->sErrorText = $sText;
115	+ return $this;
116	+ }
117	+
118	+ /**
119	+ * @param string $sText
120	+ * @return $this
121	+ */
122	+ public function setMessageText( $sText ) {
123	+ $this->sMessageText = $sText;
124	+ return $this;
125	+ }
126	+
127	+ /**
128	+ * @param boolean $bSuccess
129	+ * @return $this
130	+ */
131	+ public function setSuccessful( $bSuccess ) {
132	+ $this->bSuccessful = $bSuccess;
133	+ return $this;
134	+ }
135	+
136	+ /**
137	+ * @param string $sMessage
138	+ * @return $this
139	+ */
140	+ public function addDebug( $sMessage ) {
141	+ $this->aDebug[] = $sMessage;
142	+ return $this;
143	+ }
144	+
145	+ /**
146	+ * @return boolean
147	+ */
148	+ public function failed() {
149	+ return !$this->successful();
150	+ }
151	+
152	+ /**
153	+ * @return boolean
154	+ */
155	+ public function successful() {
156	+ return $this->bSuccessful;
157	+ }
158	+ }

src/common/lib/vendor/nesbot/carbon/.php_cs.dist ADDED Viewed

	@@ -0,0 +1,57 @@


1	+ <?php
2	+
3	+ use PhpCsFixer\Config;
4	+ use PhpCsFixer\Finder;
5	+
6	+ $rules = [
7	+ '@PSR2' => true,
8	+ 'array_syntax' => [
9	+ 'syntax' => 'long',
10	+ ],
11	+ 'binary_operator_spaces' => [
12	+ 'align_double_arrow' => false,
13	+ 'align_equals' => false,
14	+ ],
15	+ 'blank_line_before_return' => true,
16	+ 'cast_spaces' => true,
17	+ 'concat_space' => [
18	+ 'spacing' => 'none',
19	+ ],
20	+ 'ereg_to_preg' => true,
21	+ 'method_separation' => true,
22	+ 'no_blank_lines_after_phpdoc' => true,
23	+ 'no_extra_consecutive_blank_lines' => true,
24	+ 'no_short_bool_cast' => true,
25	+ 'no_unneeded_control_parentheses' => true,
26	+ 'no_unused_imports' => true,
27	+ 'no_whitespace_in_blank_line' => true,
28	+ 'ordered_imports' => true,
29	+ 'phpdoc_align' => true,
30	+ 'phpdoc_indent' => true,
31	+ 'phpdoc_inline_tag' => true,
32	+ 'phpdoc_no_access' => true,
33	+ 'phpdoc_no_alias_tag' => [
34	+ 'type' => 'var',
35	+ ],
36	+ 'phpdoc_no_package' => true,
37	+ 'phpdoc_order' => true,
38	+ 'phpdoc_scalar' => true,
39	+ 'phpdoc_separation' => true,
40	+ 'phpdoc_to_comment' => true,
41	+ 'phpdoc_trim' => true,
42	+ 'phpdoc_types' => true,
43	+ 'phpdoc_var_without_name' => true,
44	+ 'self_accessor' => true,
45	+ 'single_quote' => true,
46	+ 'space_after_semicolon' => true,
47	+ 'standardize_not_equals' => true,
48	+ 'ternary_operator_spaces' => true,
49	+ 'trailing_comma_in_multiline_array' => true,
50	+ 'trim_array_spaces' => true,
51	+ 'unary_operator_spaces' => true,
52	+ ];
53	+
54	+ return Config::create()->setRules($rules)
55	+ ->setFinder(Finder::create()->in(__DIR__))
56	+ ->setUsingCache(true)
57	+ ->setRiskyAllowed(true);

src/common/lib/vendor/nesbot/carbon/LICENSE ADDED Viewed

	@@ -0,0 +1,19 @@


1	+ Copyright (C) Brian Nesbitt
2	+
3	+ Permission is hereby granted, free of charge, to any person obtaining a copy
4	+ of this software and associated documentation files (the "Software"), to deal
5	+ in the Software without restriction, including without limitation the rights
6	+ to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
7	+ copies of the Software, and to permit persons to whom the Software is furnished
8	+ to do so, subject to the following conditions:
9	+
10	+ The above copyright notice and this permission notice shall be included in all
11	+ copies or substantial portions of the Software.
12	+
13	+ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
14	+ IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
15	+ FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
16	+ AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
17	+ LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
18	+ OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
19	+ THE SOFTWARE.

src/common/lib/vendor/nesbot/carbon/readme.md ADDED Viewed

	@@ -0,0 +1,92 @@


1	+ # Carbon
2	+
3	+ [![Latest Stable Version](https://poser.pugx.org/nesbot/carbon/v/stable.png)](https://packagist.org/packages/nesbot/carbon)
4	+ [![Total Downloads](https://poser.pugx.org/nesbot/carbon/downloads.png)](https://packagist.org/packages/nesbot/carbon)
5	+ [![Build Status](https://travis-ci.org/briannesbitt/Carbon.svg?branch=master)](https://travis-ci.org/briannesbitt/Carbon)
6	+ [![StyleCI](https://styleci.io/repos/5724990/shield?style=flat)](https://styleci.io/repos/5724990)
7	+ [![codecov.io](https://codecov.io/github/briannesbitt/Carbon/coverage.svg?branch=master)](https://codecov.io/github/briannesbitt/Carbon?branch=master)
8	+ [![PHP-Eye](https://php-eye.com/badge/nesbot/carbon/tested.svg?style=flat)](https://php-eye.com/package/nesbot/carbon)
9	+
10	+ A simple PHP API extension for DateTime. [http://carbon.nesbot.com](http://carbon.nesbot.com)
11	+
12	+ ```php
13	+ use Carbon\Carbon;
14	+
15	+ printf("Right now is %s", Carbon::now()->toDateTimeString());
16	+ printf("Right now in Vancouver is %s", Carbon::now('America/Vancouver')); //implicit __toString()
17	+ $tomorrow = Carbon::now()->addDay();
18	+ $lastWeek = Carbon::now()->subWeek();
19	+ $nextSummerOlympics = Carbon::createFromDate(2012)->addYears(4);
20	+
21	+ $officialDate = Carbon::now()->toRfc2822String();
22	+
23	+ $howOldAmI = Carbon::createFromDate(1975, 5, 21)->age;
24	+
25	+ $noonTodayLondonTime = Carbon::createFromTime(12, 0, 0, 'Europe/London');
26	+
27	+ $worldWillEnd = Carbon::createFromDate(2012, 12, 21, 'GMT');
28	+
29	+ // Don't really want to die so mock now
30	+ Carbon::setTestNow(Carbon::createFromDate(2000, 1, 1));
31	+
32	+ // comparisons are always done in UTC
33	+ if (Carbon::now()->gte($worldWillEnd)) {
34	+ die();
35	+ }
36	+
37	+ // Phew! Return to normal behaviour
38	+ Carbon::setTestNow();
39	+
40	+ if (Carbon::now()->isWeekend()) {
41	+ echo 'Party!';
42	+ }
43	+ echo Carbon::now()->subMinutes(2)->diffForHumans(); // '2 minutes ago'
44	+
45	+ // ... but also does 'from now', 'after' and 'before'
46	+ // rolling up to seconds, minutes, hours, days, months, years
47	+
48	+ $daysSinceEpoch = Carbon::createFromTimestamp(0)->diffInDays();
49	+ ```
50	+
51	+ ## Installation
52	+
53	+ ### With Composer
54	+
55	+ ```
56	+ $ composer require nesbot/carbon
57	+ ```
58	+
59	+ ```json
60	+ {
61	+ "require": {
62	+ "nesbot/carbon": "~1.21"
63	+ }
64	+ }
65	+ ```
66	+
67	+ ```php
68	+ <?php
69	+ require 'vendor/autoload.php';
70	+
71	+ use Carbon\Carbon;
72	+
73	+ printf("Now: %s", Carbon::now());
74	+ ```
75	+
76	+ <a name="install-nocomposer"/>
77	+ ### Without Composer
78	+
79	+ Why are you not using [composer](http://getcomposer.org/)? Download [Carbon.php](https://github.com/briannesbitt/Carbon/blob/master/src/Carbon/Carbon.php) from the repo and save the file into your project path somewhere.
80	+
81	+ ```php
82	+ <?php
83	+ require 'path/to/Carbon.php';
84	+
85	+ use Carbon\Carbon;
86	+
87	+ printf("Now: %s", Carbon::now());
88	+ ```
89	+
90	+ ## Docs
91	+
92	+ [http://carbon.nesbot.com/docs](http://carbon.nesbot.com/docs)

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Carbon.php RENAMED Viewed

@@ -1,3355 +1,3355 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            namespace Carbon;
-            -
-            -
            use Carbon\Exceptions\InvalidDateException;
-            -
            use Closure;
-            -
            use DatePeriod;
-            -
            use DateTime;
-            -
            use DateTimeZone;
-            -
            use InvalidArgumentException;
-            -
            use Symfony\Component\Translation\Loader\ArrayLoader;
-            -
            use Symfony\Component\Translation\Translator;
-            -
            use Symfony\Component\Translation\TranslatorInterface;
-            -
-            -
            /**
-            -
             * A simple API extension for DateTime
-            -
             *
-            -
             * @property      int $year
-            -
             * @property      int $yearIso
-            -
             * @property      int $month
-            -
             * @property      int $day
-            -
             * @property      int $hour
-            -
             * @property      int $minute
-            -
             * @property      int $second
-            -
             * @property      int $timestamp seconds since the Unix Epoch
-            -
             * @property      \DateTimeZone $timezone the current timezone
-            -
             * @property      \DateTimeZone $tz alias of timezone
-            -
             * @property-read int $micro
-            -
             * @property-read int $dayOfWeek 0 (for Sunday) through 6 (for Saturday)
-            -
             * @property-read int $dayOfYear 0 through 365
-            -
             * @property-read int $weekOfMonth 1 through 5
-            -
             * @property-read int $weekOfYear ISO-8601 week number of year, weeks starting on Monday
-            -
             * @property-read int $daysInMonth number of days in the given month
-            -
             * @property-read int $age does a diffInYears() with default parameters
-            -
             * @property-read int $quarter the quarter of this instance, 1 - 4
-            -
             * @property-read int $offset the timezone offset in seconds from UTC
-            -
             * @property-read int $offsetHours the timezone offset in hours from UTC
-            -
             * @property-read bool $dst daylight savings time indicator, true if DST, false otherwise
-            -
             * @property-read bool $local checks if the timezone is local, true if local, false otherwise
-            -
             * @property-read bool $utc checks if the timezone is UTC, true if UTC, false otherwise
-            -
             * @property-read string $timezoneName
-            -
             * @property-read string $tzName
-            -
             */
-            -
            class Carbon extends DateTime
-            -
            {
-            -
                /**
-            -
                 * The day constants.
-            -
                 */
-            -
                const SUNDAY = 0;
-            -
                const MONDAY = 1;
-            -
                const TUESDAY = 2;
-            -
                const WEDNESDAY = 3;
-            -
                const THURSDAY = 4;
-            -
                const FRIDAY = 5;
-            -
                const SATURDAY = 6;
-            -
-            -
                /**
-            -
                 * Names of days of the week.
-            -
                 *
-            -
                 * @var array
-            -
                 */
-            -
                protected static $days = array(
-            -
                    self::SUNDAY => 'Sunday',
-            -
                    self::MONDAY => 'Monday',
-            -
                    self::TUESDAY => 'Tuesday',
-            -
                    self::WEDNESDAY => 'Wednesday',
-            -
                    self::THURSDAY => 'Thursday',
-            -
                    self::FRIDAY => 'Friday',
-            -
                    self::SATURDAY => 'Saturday',
-            -
                );
-            -
-            -
                /**
-            -
                 * Terms used to detect if a time passed is a relative date.
-            -
                 *
-            -
                 * This is here for testing purposes.
-            -
                 *
-            -
                 * @var array
-            -
                 */
-            -
                protected static $relativeKeywords = array(
-            -
                    '+',
-            -
                    '-',
-            -
                    'ago',
-            -
                    'first',
-            -
                    'last',
-            -
                    'next',
-            -
                    'this',
-            -
                    'today',
-            -
                    'tomorrow',
-            -
                    'yesterday',
-            -
                );
-            -
-            -
                /**
-            -
                 * Number of X in Y.
-            -
                 */
-            -
                const YEARS_PER_CENTURY = 100;
-            -
                const YEARS_PER_DECADE = 10;
-            -
                const MONTHS_PER_YEAR = 12;
-            -
                const MONTHS_PER_QUARTER = 3;
-            -
                const WEEKS_PER_YEAR = 52;
-            -
                const DAYS_PER_WEEK = 7;
-            -
                const HOURS_PER_DAY = 24;
-            -
                const MINUTES_PER_HOUR = 60;
-            -
                const SECONDS_PER_MINUTE = 60;
-            -
-            -
                /**
-            -
                 * Default format to use for __toString method when type juggling occurs.
-            -
                 *
-            -
                 * @var string
-            -
                 */
-            -
                const DEFAULT_TO_STRING_FORMAT = 'Y-m-d H:i:s';
-            -
-            -
                /**
-            -
                 * Format to use for __toString method when type juggling occurs.
-            -
                 *
-            -
                 * @var string
-            -
                 */
-            -
                protected static $toStringFormat = self::DEFAULT_TO_STRING_FORMAT;
-            -
-            -
                /**
-            -
                 * First day of week.
-            -
                 *
-            -
                 * @var int
-            -
                 */
-            -
                protected static $weekStartsAt = self::MONDAY;
-            -
-            -
                /**
-            -
                 * Last day of week.
-            -
                 *
-            -
                 * @var int
-            -
                 */
-            -
                protected static $weekEndsAt = self::SUNDAY;
-            -
-            -
                /**
-            -
                 * Days of weekend.
-            -
                 *
-            -
                 * @var array
-            -
                 */
-            -
                protected static $weekendDays = array(
-            -
                    self::SATURDAY,
-            -
                    self::SUNDAY,
-            -
                );
-            -
-            -
                /**
-            -
                 * A test Carbon instance to be returned when now instances are created.
-            -
                 *
-            -
                 * @var \Carbon\Carbon
-            -
                 */
-            -
                protected static $testNow;
-            -
-            -
                /**
-            -
                 * A translator to ... er ... translate stuff.
-            -
                 *
-            -
                 * @var \Symfony\Component\Translation\TranslatorInterface
-            -
                 */
-            -
                protected static $translator;
-            -
-            -
                /**
-            -
                 * The errors that can occur.
-            -
                 *
-            -
                 * @var array
-            -
                 */
-            -
                protected static $lastErrors;
-            -
-            -
                /**
-            -
                 * Will UTF8 encoding be used to print localized date/time ?
-            -
                 *
-            -
                 * @var bool
-            -
                 */
-            -
                protected static $utf8 = false;
-            -
-            -
                /*
-            -
                 * Indicates if months should be calculated with overflow.
-            -
                 *
-            -
                 * @var bool
-            -
                 */
-            -
                protected static $monthsOverflow = true;
-            -
-            -
                /**
-            -
                 * Indicates if months should be calculated with overflow.
-            -
                 *
-            -
                 * @param bool $monthsOverflow
-            -
                 *
-            -
                 * @return void
-            -
                 */
-            -
                public static function useMonthsOverflow($monthsOverflow = true)
-            -
                {
-            -
                    static::$monthsOverflow = $monthsOverflow;
-            -
                }
-            -
-            -
                /**
-            -
                 * Reset the month overflow behavior.
-            -
                 *
-            -
                 * @return void
-            -
                 */
-            -
                public static function resetMonthsOverflow()
-            -
                {
-            -
                    static::$monthsOverflow = true;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the month overflow behavior.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public static function shouldOverflowMonths()
-            -
                {
-            -
                    return static::$monthsOverflow;
-            -
                }
-            -
-            -
                /**
-            -
                 * Creates a DateTimeZone from a string, DateTimeZone or integer offset.
-            -
                 *
-            -
                 * @param \DateTimeZone|string|int|null $object
-            -
                 *
-            -
                 * @throws \InvalidArgumentException
-            -
                 *
-            -
                 * @return \DateTimeZone
-            -
                 */
-            -
                protected static function safeCreateDateTimeZone($object)
-            -
                {
-            -
                    if ($object === null) {
-            -
                        // Don't return null... avoid Bug #52063 in PHP <5.3.6
-            -
                        return new DateTimeZone(date_default_timezone_get());
-            -
                    }
-            -
-            -
                    if ($object instanceof DateTimeZone) {
-            -
                        return $object;
-            -
                    }
-            -
-            -
                    if (is_numeric($object)) {
-            -
                        $tzName = timezone_name_from_abbr(null, $object * 3600, true);
-            -
-            -
                        if ($tzName === false) {
-            -
                            throw new InvalidArgumentException('Unknown or bad timezone ('.$object.')');
-            -
                        }
-            -
-            -
                        $object = $tzName;
-            -
                    }
-            -
-            -
                    $tz = @timezone_open((string) $object);
-            -
-            -
                    if ($tz === false) {
-            -
                        throw new InvalidArgumentException('Unknown or bad timezone ('.$object.')');
-            -
                    }
-            -
-            -
                    return $tz;
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                //////////////////////////// CONSTRUCTORS /////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Create a new Carbon instance.
-            -
                 *
-            -
                 * Please see the testing aids section (specifically static::setTestNow())
-            -
                 * for more on the possibility of this constructor returning a test instance.
-            -
                 *
-            -
                 * @param string|null               $time
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 */
-            -
                public function __construct($time = null, $tz = null)
-            -
                {
-            -
                    // If the class has a test now set and we are trying to create a now()
-            -
                    // instance then override as required
-            -
                    if (static::hasTestNow() && (empty($time) || $time === 'now' || static::hasRelativeKeywords($time))) {
-            -
                        $testInstance = clone static::getTestNow();
-            -
                        if (static::hasRelativeKeywords($time)) {
-            -
                            $testInstance->modify($time);
-            -
                        }
-            -
-            -
                        //shift the time according to the given time zone
-            -
                        if ($tz !== null && $tz !== static::getTestNow()->getTimezone()) {
-            -
                            $testInstance->setTimezone($tz);
-            -
                        } else {
-            -
                            $tz = $testInstance->getTimezone();
-            -
                        }
-            -
-            -
                        $time = $testInstance->toDateTimeString();
-            -
                    }
-            -
-            -
                    parent::__construct($time, static::safeCreateDateTimeZone($tz));
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance from a DateTime one.
-            -
                 *
-            -
                 * @param \DateTime $dt
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function instance(DateTime $dt)
-            -
                {
-            -
                    if ($dt instanceof static) {
-            -
                        return clone $dt;
-            -
                    }
-            -
-            -
                    return new static($dt->format('Y-m-d H:i:s.u'), $dt->getTimezone());
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a carbon instance from a string.
-            -
                 *
-            -
                 * This is an alias for the constructor that allows better fluent syntax
-            -
                 * as it allows you to do Carbon::parse('Monday next week')->fn() rather
-            -
                 * than (new Carbon('Monday next week'))->fn().
-            -
                 *
-            -
                 * @param string|null               $time
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function parse($time = null, $tz = null)
-            -
                {
-            -
                    return new static($time, $tz);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get a Carbon instance for the current date and time.
-            -
                 *
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function now($tz = null)
-            -
                {
-            -
                    return new static(null, $tz);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance for today.
-            -
                 *
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function today($tz = null)
-            -
                {
-            -
                    return static::now($tz)->startOfDay();
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance for tomorrow.
-            -
                 *
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function tomorrow($tz = null)
-            -
                {
-            -
                    return static::today($tz)->addDay();
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance for yesterday.
-            -
                 *
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function yesterday($tz = null)
-            -
                {
-            -
                    return static::today($tz)->subDay();
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance for the greatest supported date.
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function maxValue()
-            -
                {
-            -
                    if (PHP_INT_SIZE === 4) {
-            -
                        // 32 bit (and additionally Windows 64 bit)
-            -
                        return static::createFromTimestamp(PHP_INT_MAX);
-            -
                    }
-            -
-            -
                    // 64 bit
-            -
                    return static::create(9999, 12, 31, 23, 59, 59);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance for the lowest supported date.
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function minValue()
-            -
                {
-            -
                    if (PHP_INT_SIZE === 4) {
-            -
                        // 32 bit (and additionally Windows 64 bit)
-            -
                        return static::createFromTimestamp(~PHP_INT_MAX);
-            -
                    }
-            -
-            -
                    // 64 bit
-            -
                    return static::create(1, 1, 1, 0, 0, 0);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a new Carbon instance from a specific date and time.
-            -
                 *
-            -
                 * If any of $year, $month or $day are set to null their now() values will
-            -
                 * be used.
-            -
                 *
-            -
                 * If $hour is null it will be set to its now() value and the default
-            -
                 * values for $minute and $second will be their now() values.
-            -
                 *
-            -
                 * If $hour is not null then the default values for $minute and $second
-            -
                 * will be 0.
-            -
                 *
-            -
                 * @param int|null                  $year
-            -
                 * @param int|null                  $month
-            -
                 * @param int|null                  $day
-            -
                 * @param int|null                  $hour
-            -
                 * @param int|null                  $minute
-            -
                 * @param int|null                  $second
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function create($year = null, $month = null, $day = null, $hour = null, $minute = null, $second = null, $tz = null)
-            -
                {
-            -
                    $now = static::hasTestNow() ? static::getTestNow()->getTimestamp() : time();
-            -
-            -
                    $defaults = array_combine(array(
-            -
                        'year',
-            -
                        'month',
-            -
                        'day',
-            -
                        'hour',
-            -
                        'minute',
-            -
                        'second',
-            -
                    ), explode('-', date('Y-n-j-G-i-s', $now)));
-            -
-            -
                    $year = $year === null ? $defaults['year'] : $year;
-            -
                    $month = $month === null ? $defaults['month'] : $month;
-            -
                    $day = $day === null ? $defaults['day'] : $day;
-            -
-            -
                    if ($hour === null) {
-            -
                        $hour = $defaults['hour'];
-            -
                        $minute = $minute === null ? $defaults['minute'] : $minute;
-            -
                        $second = $second === null ? $defaults['second'] : $second;
-            -
                    } else {
-            -
                        $minute = $minute === null ? 0 : $minute;
-            -
                        $second = $second === null ? 0 : $second;
-            -
                    }
-            -
-            -
                    $fixYear = null;
-            -
-            -
                    if ($year < 0) {
-            -
                        $fixYear = $year;
-            -
                        $year = 0;
-            -
                    } elseif ($year > 9999) {
-            -
                        $fixYear = $year - 9999;
-            -
                        $year = 9999;
-            -
                    }
-            -
-            -
                    $instance = static::createFromFormat('Y-n-j G:i:s', sprintf('%s-%s-%s %s:%02s:%02s', $year, $month, $day, $hour, $minute, $second), $tz);
-            -
-            -
                    if ($fixYear !== null) {
-            -
                        $instance->addYears($fixYear);
-            -
                    }
-            -
-            -
                    return $instance;
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a new safe Carbon instance from a specific date and time.
-            -
                 *
-            -
                 * If any of $year, $month or $day are set to null their now() values will
-            -
                 * be used.
-            -
                 *
-            -
                 * If $hour is null it will be set to its now() value and the default
-            -
                 * values for $minute and $second will be their now() values.
-            -
                 *
-            -
                 * If $hour is not null then the default values for $minute and $second
-            -
                 * will be 0.
-            -
                 *
-            -
                 * If one of the set values is not valid, an \InvalidArgumentException
-            -
                 * will be thrown.
-            -
                 *
-            -
                 * @param int|null                  $year
-            -
                 * @param int|null                  $month
-            -
                 * @param int|null                  $day
-            -
                 * @param int|null                  $hour
-            -
                 * @param int|null                  $minute
-            -
                 * @param int|null                  $second
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @throws \Carbon\Exceptions\InvalidDateException
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function createSafe($year = null, $month = null, $day = null, $hour = null, $minute = null, $second = null, $tz = null)
-            -
                {
-            -
                    $fields = array(
-            -
                        'year' => array(0, 9999),
-            -
                        'month' => array(0, 12),
-            -
                        'day' => array(0, 31),
-            -
                        'hour' => array(0, 24),
-            -
                        'minute' => array(0, 59),
-            -
                        'second' => array(0, 59),
-            -
                    );
-            -
-            -
                    foreach ($fields as $field => $range) {
-            -
                        if ($$field !== null && (!is_int($$field) || $$field < $range[0] || $$field > $range[1])) {
-            -
                            throw new InvalidDateException($field, $$field);
-            -
                        }
-            -
                    }
-            -
-            -
                    $instance = static::create($year, $month, 1, $hour, $minute, $second, $tz);
-            -
-            -
                    if ($day !== null && $day > $instance->daysInMonth) {
-            -
                        throw new InvalidDateException('day', $day);
-            -
                    }
-            -
-            -
                    return $instance->day($day);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance from just a date. The time portion is set to now.
-            -
                 *
-            -
                 * @param int|null                  $year
-            -
                 * @param int|null                  $month
-            -
                 * @param int|null                  $day
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function createFromDate($year = null, $month = null, $day = null, $tz = null)
-            -
                {
-            -
                    return static::create($year, $month, $day, null, null, null, $tz);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance from just a time. The date portion is set to today.
-            -
                 *
-            -
                 * @param int|null                  $hour
-            -
                 * @param int|null                  $minute
-            -
                 * @param int|null                  $second
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function createFromTime($hour = null, $minute = null, $second = null, $tz = null)
-            -
                {
-            -
                    return static::create(null, null, null, $hour, $minute, $second, $tz);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance from a specific format.
-            -
                 *
-            -
                 * @param string                    $format
-            -
                 * @param string                    $time
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @throws \InvalidArgumentException
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function createFromFormat($format, $time, $tz = null)
-            -
                {
-            -
                    if ($tz !== null) {
-            -
                        $dt = parent::createFromFormat($format, $time, static::safeCreateDateTimeZone($tz));
-            -
                    } else {
-            -
                        $dt = parent::createFromFormat($format, $time);
-            -
                    }
-            -
-            -
                    static::setLastErrors($lastErrors = parent::getLastErrors());
-            -
-            -
                    if ($dt instanceof DateTime) {
-            -
                        return static::instance($dt);
-            -
                    }
-            -
-            -
                    throw new InvalidArgumentException(implode(PHP_EOL, $lastErrors['errors']));
-            -
                }
-            -
-            -
                /**
-            -
                 * Set last errors.
-            -
                 *
-            -
                 * @param array $lastErrors
-            -
                 *
-            -
                 * @return void
-            -
                 */
-            -
                private static function setLastErrors(array $lastErrors)
-            -
                {
-            -
                    static::$lastErrors = $lastErrors;
-            -
                }
-            -
-            -
                /**
-            -
                 * {@inheritdoc}
-            -
                 */
-            -
                public static function getLastErrors()
-            -
                {
-            -
                    return static::$lastErrors;
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance from a timestamp.
-            -
                 *
-            -
                 * @param int                       $timestamp
-            -
                 * @param \DateTimeZone|string|null $tz
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function createFromTimestamp($timestamp, $tz = null)
-            -
                {
-            -
                    return static::now($tz)->setTimestamp($timestamp);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a Carbon instance from an UTC timestamp.
-            -
                 *
-            -
                 * @param int $timestamp
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function createFromTimestampUTC($timestamp)
-            -
                {
-            -
                    return new static('@'.$timestamp);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get a copy of the instance.
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function copy()
-            -
                {
-            -
                    return clone $this;
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                ///////////////////////// GETTERS AND SETTERS /////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Get a part of the Carbon object
-            -
                 *
-            -
                 * @param string $name
-            -
                 *
-            -
                 * @throws \InvalidArgumentException
-            -
                 *
-            -
                 * @return string|int|\DateTimeZone
-            -
                 */
-            -
                public function __get($name)
-            -
                {
-            -
                    switch (true) {
-            -
                        case array_key_exists($name, $formats = array(
-            -
                            'year' => 'Y',
-            -
                            'yearIso' => 'o',
-            -
                            'month' => 'n',
-            -
                            'day' => 'j',
-            -
                            'hour' => 'G',
-            -
                            'minute' => 'i',
-            -
                            'second' => 's',
-            -
                            'micro' => 'u',
-            -
                            'dayOfWeek' => 'w',
-            -
                            'dayOfYear' => 'z',
-            -
                            'weekOfYear' => 'W',
-            -
                            'daysInMonth' => 't',
-            -
                            'timestamp' => 'U',
-            -
                        )):
-            -
                            return (int) $this->format($formats[$name]);
-            -
-            -
                        case $name === 'weekOfMonth':
-            -
                            return (int) ceil($this->day / static::DAYS_PER_WEEK);
-            -
-            -
                        case $name === 'age':
-            -
                            return $this->diffInYears();
-            -
-            -
                        case $name === 'quarter':
-            -
                            return (int) ceil($this->month / static::MONTHS_PER_QUARTER);
-            -
-            -
                        case $name === 'offset':
-            -
                            return $this->getOffset();
-            -
-            -
                        case $name === 'offsetHours':
-            -
                            return $this->getOffset() / static::SECONDS_PER_MINUTE / static::MINUTES_PER_HOUR;
-            -
-            -
                        case $name === 'dst':
-            -
                            return $this->format('I') === '1';
-            -
-            -
                        case $name === 'local':
-            -
                            return $this->getOffset() === $this->copy()->setTimezone(date_default_timezone_get())->getOffset();
-            -
-            -
                        case $name === 'utc':
-            -
                            return $this->getOffset() === 0;
-            -
-            -
                        case $name === 'timezone' || $name === 'tz':
-            -
                            return $this->getTimezone();
-            -
-            -
                        case $name === 'timezoneName' || $name === 'tzName':
-            -
                            return $this->getTimezone()->getName();
-            -
-            -
                        default:
-            -
                            throw new InvalidArgumentException(sprintf("Unknown getter '%s'", $name));
-            -
                    }
-            -
                }
-            -
-            -
                /**
-            -
                 * Check if an attribute exists on the object
-            -
                 *
-            -
                 * @param string $name
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function __isset($name)
-            -
                {
-            -
                    try {
-            -
                        $this->__get($name);
-            -
                    } catch (InvalidArgumentException $e) {
-            -
                        return false;
-            -
                    }
-            -
-            -
                    return true;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set a part of the Carbon object
-            -
                 *
-            -
                 * @param string                   $name
-            -
                 * @param string|int|\DateTimeZone $value
-            -
                 *
-            -
                 * @throws \InvalidArgumentException
-            -
                 */
-            -
                public function __set($name, $value)
-            -
                {
-            -
                    switch ($name) {
-            -
                        case 'year':
-            -
                        case 'month':
-            -
                        case 'day':
-            -
                        case 'hour':
-            -
                        case 'minute':
-            -
                        case 'second':
-            -
                            list($year, $month, $day, $hour, $minute, $second) = explode('-', $this->format('Y-n-j-G-i-s'));
-            -
                            $$name = $value;
-            -
                            $this->setDateTime($year, $month, $day, $hour, $minute, $second);
-            -
                            break;
-            -
-            -
                        case 'timestamp':
-            -
                            parent::setTimestamp($value);
-            -
                            break;
-            -
-            -
                        case 'timezone':
-            -
                        case 'tz':
-            -
                            $this->setTimezone($value);
-            -
                            break;
-            -
-            -
                        default:
-            -
                            throw new InvalidArgumentException(sprintf("Unknown setter '%s'", $name));
-            -
                    }
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the instance's year
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function year($value)
-            -
                {
-            -
                    $this->year = $value;
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the instance's month
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function month($value)
-            -
                {
-            -
                    $this->month = $value;
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the instance's day
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function day($value)
-            -
                {
-            -
                    $this->day = $value;
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the instance's hour
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function hour($value)
-            -
                {
-            -
                    $this->hour = $value;
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the instance's minute
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function minute($value)
-            -
                {
-            -
                    $this->minute = $value;
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the instance's second
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function second($value)
-            -
                {
-            -
                    $this->second = $value;
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Sets the current date of the DateTime object to a different date.
-            -
                 * Calls modify as a workaround for a php bug
-            -
                 *
-            -
                 * @param int $year
-            -
                 * @param int $month
-            -
                 * @param int $day
-            -
                 *
-            -
                 * @return static
-            -
                 *
-            -
                 * @see https://github.com/briannesbitt/Carbon/issues/539
-            -
                 * @see https://bugs.php.net/bug.php?id=63863
-            -
                 */
-            -
                public function setDate($year, $month, $day)
-            -
                {
-            -
                    $this->modify('+0 day');
-            -
-            -
                    return parent::setDate($year, $month, $day);
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the date and time all together
-            -
                 *
-            -
                 * @param int $year
-            -
                 * @param int $month
-            -
                 * @param int $day
-            -
                 * @param int $hour
-            -
                 * @param int $minute
-            -
                 * @param int $second
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function setDateTime($year, $month, $day, $hour, $minute, $second = 0)
-            -
                {
-            -
                    return $this->setDate($year, $month, $day)->setTime($hour, $minute, $second);
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the time by time string
-            -
                 *
-            -
                 * @param string $time
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function setTimeFromTimeString($time)
-            -
                {
-            -
                    $time = explode(':', $time);
-            -
-            -
                    $hour = $time[0];
-            -
                    $minute = isset($time[1]) ? $time[1] : 0;
-            -
                    $second = isset($time[2]) ? $time[2] : 0;
-            -
-            -
                    return $this->setTime($hour, $minute, $second);
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the instance's timestamp
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function timestamp($value)
-            -
                {
-            -
                    return $this->setTimestamp($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Alias for setTimezone()
-            -
                 *
-            -
                 * @param \DateTimeZone|string $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function timezone($value)
-            -
                {
-            -
                    return $this->setTimezone($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Alias for setTimezone()
-            -
                 *
-            -
                 * @param \DateTimeZone|string $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function tz($value)
-            -
                {
-            -
                    return $this->setTimezone($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the instance's timezone from a string or object
-            -
                 *
-            -
                 * @param \DateTimeZone|string $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function setTimezone($value)
-            -
                {
-            -
                    return parent::setTimezone(static::safeCreateDateTimeZone($value));
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                /////////////////////// WEEK SPECIAL DAYS /////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Get the first day of week
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public static function getWeekStartsAt()
-            -
                {
-            -
                    return static::$weekStartsAt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the first day of week
-            -
                 *
-            -
                 * @param int
-            -
                 */
-            -
                public static function setWeekStartsAt($day)
-            -
                {
-            -
                    static::$weekStartsAt = $day;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the last day of week
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public static function getWeekEndsAt()
-            -
                {
-            -
                    return static::$weekEndsAt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the last day of week
-            -
                 *
-            -
                 * @param int
-            -
                 */
-            -
                public static function setWeekEndsAt($day)
-            -
                {
-            -
                    static::$weekEndsAt = $day;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get weekend days
-            -
                 *
-            -
                 * @return array
-            -
                 */
-            -
                public static function getWeekendDays()
-            -
                {
-            -
                    return static::$weekendDays;
-            -
                }
-            -
-            -
                /**
-            -
                 * Set weekend days
-            -
                 *
-            -
                 * @param array
-            -
                 */
-            -
                public static function setWeekendDays($days)
-            -
                {
-            -
                    static::$weekendDays = $days;
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                ///////////////////////// TESTING AIDS ////////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Set a Carbon instance (real or mock) to be returned when a "now"
-            -
                 * instance is created.  The provided instance will be returned
-            -
                 * specifically under the following conditions:
-            -
                 *   - A call to the static now() method, ex. Carbon::now()
-            -
                 *   - When a null (or blank string) is passed to the constructor or parse(), ex. new Carbon(null)
-            -
                 *   - When the string "now" is passed to the constructor or parse(), ex. new Carbon('now')
-            -
                 *   - When a string containing the desired time is passed to Carbon::parse().
-            -
                 *
-            -
                 * Note the timezone parameter was left out of the examples above and
-            -
                 * has no affect as the mock value will be returned regardless of its value.
-            -
                 *
-            -
                 * To clear the test instance call this method using the default
-            -
                 * parameter of null.
-            -
                 *
-            -
                 * @param \Carbon\Carbon|string|null $testNow
-            -
                 */
-            -
                public static function setTestNow($testNow = null)
-            -
                {
-            -
                    static::$testNow = is_string($testNow) ? static::parse($testNow) : $testNow;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the Carbon instance (real or mock) to be returned when a "now"
-            -
                 * instance is created.
-            -
                 *
-            -
                 * @return static the current instance used for testing
-            -
                 */
-            -
                public static function getTestNow()
-            -
                {
-            -
                    return static::$testNow;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determine if there is a valid test instance set. A valid test instance
-            -
                 * is anything that is not null.
-            -
                 *
-            -
                 * @return bool true if there is a test instance, otherwise false
-            -
                 */
-            -
                public static function hasTestNow()
-            -
                {
-            -
                    return static::getTestNow() !== null;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determine if there is a relative keyword in the time string, this is to
-            -
                 * create dates relative to now for test instances. e.g.: next tuesday
-            -
                 *
-            -
                 * @param string $time
-            -
                 *
-            -
                 * @return bool true if there is a keyword, otherwise false
-            -
                 */
-            -
                public static function hasRelativeKeywords($time)
-            -
                {
-            -
                    // skip common format with a '-' in it
-            -
                    if (preg_match('/\d{4}-\d{1,2}-\d{1,2}/', $time) !== 1) {
-            -
                        foreach (static::$relativeKeywords as $keyword) {
-            -
                            if (stripos($time, $keyword) !== false) {
-            -
                                return true;
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
                    return false;
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                /////////////////////// LOCALIZATION //////////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Initialize the translator instance if necessary.
-            -
                 *
-            -
                 * @return \Symfony\Component\Translation\TranslatorInterface
-            -
                 */
-            -
                protected static function translator()
-            -
                {
-            -
                    if (static::$translator === null) {
-            -
                        static::$translator = new Translator('en');
-            -
                        static::$translator->addLoader('array', new ArrayLoader());
-            -
                        static::setLocale('en');
-            -
                    }
-            -
-            -
                    return static::$translator;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the translator instance in use
-            -
                 *
-            -
                 * @return \Symfony\Component\Translation\TranslatorInterface
-            -
                 */
-            -
                public static function getTranslator()
-            -
                {
-            -
                    return static::translator();
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the translator instance to use
-            -
                 *
-            -
                 * @param \Symfony\Component\Translation\TranslatorInterface $translator
-            -
                 */
-            -
                public static function setTranslator(TranslatorInterface $translator)
-            -
                {
-            -
                    static::$translator = $translator;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the current translator locale
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public static function getLocale()
-            -
                {
-            -
                    return static::translator()->getLocale();
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the current translator locale and indicate if the source locale file exists
-            -
                 *
-            -
                 * @param string $locale
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public static function setLocale($locale)
-            -
                {
-            -
                    $locale = preg_replace_callback('/\b([a-z]{2})[-_](?:([a-z]{4})[-_])?([a-z]{2})\b/', function ($matches) {
-            -
                        return $matches[1].'_'.(!empty($matches[2]) ? ucfirst($matches[2]).'_' : '').strtoupper($matches[3]);
-            -
                    }, strtolower($locale));
-            -
-            -
                    if (file_exists($filename = __DIR__.'/Lang/'.$locale.'.php')) {
-            -
                        static::translator()->setLocale($locale);
-            -
                        // Ensure the locale has been loaded.
-            -
                        static::translator()->addResource('array', require $filename, $locale);
-            -
-            -
                        return true;
-            -
                    }
-            -
-            -
                    return false;
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                /////////////////////// STRING FORMATTING /////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Set if UTF8 will be used for localized date/time
-            -
                 *
-            -
                 * @param bool $utf8
-            -
                 */
-            -
                public static function setUtf8($utf8)
-            -
                {
-            -
                    static::$utf8 = $utf8;
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance with the current locale.  You can set the current
-            -
                 * locale using setlocale() http://php.net/setlocale.
-            -
                 *
-            -
                 * @param string $format
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function formatLocalized($format)
-            -
                {
-            -
                    // Check for Windows to find and replace the %e
-            -
                    // modifier correctly
-            -
                    if (strtoupper(substr(PHP_OS, 0, 3)) === 'WIN') {
-            -
                        $format = preg_replace('#(?<!%)((?:%%)*)%e#', '\1%#d', $format);
-            -
                    }
-            -
-            -
                    $formatted = strftime($format, strtotime($this));
-            -
-            -
                    return static::$utf8 ? utf8_encode($formatted) : $formatted;
-            -
                }
-            -
-            -
                /**
-            -
                 * Reset the format used to the default when type juggling a Carbon instance to a string
-            -
                 */
-            -
                public static function resetToStringFormat()
-            -
                {
-            -
                    static::setToStringFormat(static::DEFAULT_TO_STRING_FORMAT);
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the default format used when type juggling a Carbon instance to a string
-            -
                 *
-            -
                 * @param string $format
-            -
                 */
-            -
                public static function setToStringFormat($format)
-            -
                {
-            -
                    static::$toStringFormat = $format;
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as a string using the set format
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function __toString()
-            -
                {
-            -
                    return $this->format(static::$toStringFormat);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as date
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toDateString()
-            -
                {
-            -
                    return $this->format('Y-m-d');
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as a readable date
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toFormattedDateString()
-            -
                {
-            -
                    return $this->format('M j, Y');
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as time
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toTimeString()
-            -
                {
-            -
                    return $this->format('H:i:s');
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as date and time
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toDateTimeString()
-            -
                {
-            -
                    return $this->format('Y-m-d H:i:s');
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance with day, date and time
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toDayDateTimeString()
-            -
                {
-            -
                    return $this->format('D, M j, Y g:i A');
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as ATOM
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toAtomString()
-            -
                {
-            -
                    return $this->format(static::ATOM);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as COOKIE
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toCookieString()
-            -
                {
-            -
                    return $this->format(static::COOKIE);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as ISO8601
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toIso8601String()
-            -
                {
-            -
                    return $this->toAtomString();
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as RFC822
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toRfc822String()
-            -
                {
-            -
                    return $this->format(static::RFC822);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as RFC850
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toRfc850String()
-            -
                {
-            -
                    return $this->format(static::RFC850);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as RFC1036
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toRfc1036String()
-            -
                {
-            -
                    return $this->format(static::RFC1036);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as RFC1123
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toRfc1123String()
-            -
                {
-            -
                    return $this->format(static::RFC1123);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as RFC2822
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toRfc2822String()
-            -
                {
-            -
                    return $this->format(static::RFC2822);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as RFC3339
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toRfc3339String()
-            -
                {
-            -
                    return $this->format(static::RFC3339);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as RSS
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toRssString()
-            -
                {
-            -
                    return $this->format(static::RSS);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as W3C
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function toW3cString()
-            -
                {
-            -
                    return $this->format(static::W3C);
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                ////////////////////////// COMPARISONS ////////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Determines if the instance is equal to another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function eq(Carbon $dt)
-            -
                {
-            -
                    return $this == $dt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is equal to another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @see eq()
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function equalTo(Carbon $dt)
-            -
                {
-            -
                    return $this->eq($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is not equal to another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function ne(Carbon $dt)
-            -
                {
-            -
                    return !$this->eq($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is not equal to another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @see ne()
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function notEqualTo(Carbon $dt)
-            -
                {
-            -
                    return $this->ne($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is greater (after) than another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function gt(Carbon $dt)
-            -
                {
-            -
                    return $this > $dt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is greater (after) than another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @see gt()
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function greaterThan(Carbon $dt)
-            -
                {
-            -
                    return $this->gt($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is greater (after) than or equal to another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function gte(Carbon $dt)
-            -
                {
-            -
                    return $this >= $dt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is greater (after) than or equal to another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @see gte()
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function greaterThanOrEqualTo(Carbon $dt)
-            -
                {
-            -
                    return $this->gte($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is less (before) than another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function lt(Carbon $dt)
-            -
                {
-            -
                    return $this < $dt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is less (before) than another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @see lt()
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function lessThan(Carbon $dt)
-            -
                {
-            -
                    return $this->lt($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is less (before) or equal to another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function lte(Carbon $dt)
-            -
                {
-            -
                    return $this <= $dt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is less (before) or equal to another
-            -
                 *
-            -
                 * @param Carbon $dt
-            -
                 *
-            -
                 * @see lte()
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function lessThanOrEqualTo(Carbon $dt)
-            -
                {
-            -
                    return $this->lte($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is between two others
-            -
                 *
-            -
                 * @param Carbon $dt1
-            -
                 * @param Carbon $dt2
-            -
                 * @param bool   $equal Indicates if a > and < comparison should be used or <= or >=
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function between(Carbon $dt1, Carbon $dt2, $equal = true)
-            -
                {
-            -
                    if ($dt1->gt($dt2)) {
-            -
                        $temp = $dt1;
-            -
                        $dt1 = $dt2;
-            -
                        $dt2 = $temp;
-            -
                    }
-            -
-            -
                    if ($equal) {
-            -
                        return $this->gte($dt1) && $this->lte($dt2);
-            -
                    }
-            -
-            -
                    return $this->gt($dt1) && $this->lt($dt2);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the closest date from the instance.
-            -
                 *
-            -
                 * @param Carbon $dt1
-            -
                 * @param Carbon $dt2
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function closest(Carbon $dt1, Carbon $dt2)
-            -
                {
-            -
                    return $this->diffInSeconds($dt1) < $this->diffInSeconds($dt2) ? $dt1 : $dt2;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the farthest date from the instance.
-            -
                 *
-            -
                 * @param Carbon $dt1
-            -
                 * @param Carbon $dt2
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function farthest(Carbon $dt1, Carbon $dt2)
-            -
                {
-            -
                    return $this->diffInSeconds($dt1) > $this->diffInSeconds($dt2) ? $dt1 : $dt2;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the minimum instance between a given instance (default now) and the current instance.
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function min(Carbon $dt = null)
-            -
                {
-            -
                    $dt = $dt ?: static::now($this->getTimezone());
-            -
-            -
                    return $this->lt($dt) ? $this : $dt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the minimum instance between a given instance (default now) and the current instance.
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 *
-            -
                 * @see min()
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function minimum(Carbon $dt = null)
-            -
                {
-            -
                    return $this->min($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the maximum instance between a given instance (default now) and the current instance.
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function max(Carbon $dt = null)
-            -
                {
-            -
                    $dt = $dt ?: static::now($this->getTimezone());
-            -
-            -
                    return $this->gt($dt) ? $this : $dt;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the maximum instance between a given instance (default now) and the current instance.
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 *
-            -
                 * @see max()
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function maximum(Carbon $dt = null)
-            -
                {
-            -
                    return $this->max($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is a weekday
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isWeekday()
-            -
                {
-            -
                    return !$this->isWeekend();
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is a weekend day
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isWeekend()
-            -
                {
-            -
                    return in_array($this->dayOfWeek, static::$weekendDays);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is yesterday
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isYesterday()
-            -
                {
-            -
                    return $this->toDateString() === static::yesterday($this->getTimezone())->toDateString();
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is today
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isToday()
-            -
                {
-            -
                    return $this->toDateString() === static::now($this->getTimezone())->toDateString();
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is tomorrow
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isTomorrow()
-            -
                {
-            -
                    return $this->toDateString() === static::tomorrow($this->getTimezone())->toDateString();
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is within the next week
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isNextWeek()
-            -
                {
-            -
                    return $this->weekOfYear === static::now($this->getTimezone())->addWeek()->weekOfYear;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is within the last week
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isLastWeek()
-            -
                {
-            -
                    return $this->weekOfYear === static::now($this->getTimezone())->subWeek()->weekOfYear;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is within the next month
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isNextMonth()
-            -
                {
-            -
                    return $this->month === static::now($this->getTimezone())->addMonthNoOverflow()->month;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is within the last month
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isLastMonth()
-            -
                {
-            -
                    return $this->month === static::now($this->getTimezone())->subMonthNoOverflow()->month;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is within next year
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isNextYear()
-            -
                {
-            -
                    return $this->year === static::now($this->getTimezone())->addYear()->year;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is within the previous year
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isLastYear()
-            -
                {
-            -
                    return $this->year === static::now($this->getTimezone())->subYear()->year;
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is in the future, ie. greater (after) than now
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isFuture()
-            -
                {
-            -
                    return $this->gt(static::now($this->getTimezone()));
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is in the past, ie. less (before) than now
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isPast()
-            -
                {
-            -
                    return $this->lt(static::now($this->getTimezone()));
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is a leap year
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isLeapYear()
-            -
                {
-            -
                    return $this->format('L') === '1';
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is a long year
-            -
                 *
-            -
                 * @see https://en.wikipedia.org/wiki/ISO_8601#Week_dates
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isLongYear()
-            -
                {
-            -
                    return static::create($this->year, 12, 28, 0, 0, 0, $this->tz)->weekOfYear === 53;
-            -
                }
-            -
-            -
                /*
-            -
                 * Compares the formatted values of the two dates.
-            -
                 *
-            -
                 * @param string              $format The date formats to compare.
-            -
                 * @param \Carbon\Carbon|null $dt     The instance to compare with or null to use current day.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isSameAs($format, Carbon $dt = null)
-            -
                {
-            -
                    $dt = $dt ?: static::now($this->tz);
-            -
-            -
                    return $this->format($format) === $dt->format($format);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is in the current year
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isCurrentYear()
-            -
                {
-            -
                    return $this->isSameYear();
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if the passed in date is in the same year as the instance year.
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt The instance to compare with or null to use current day.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isSameYear(Carbon $dt = null)
-            -
                {
-            -
                    return $this->isSameAs('Y', $dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Determines if the instance is in the current month
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isCurrentMonth()
-            -
                {
-            -
                    return $this->isSameMonth();
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if the passed in date is in the same month as the instance month (and year if needed).
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt         The instance to compare with or null to use current day.
-            -
                 * @param bool                $ofSameYear Check if it is the same month in the same year.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isSameMonth(Carbon $dt = null, $ofSameYear = false)
-            -
                {
-            -
                    $format = $ofSameYear ? 'Y-m' : 'm';
-            -
-            -
                    return $this->isSameAs($format, $dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if the passed in date is the same day as the instance current day.
-            -
                 *
-            -
                 * @param \Carbon\Carbon $dt
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isSameDay(Carbon $dt)
-            -
                {
-            -
                    return $this->toDateString() === $dt->toDateString();
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if this day is a Sunday.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isSunday()
-            -
                {
-            -
                    return $this->dayOfWeek === static::SUNDAY;
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if this day is a Monday.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isMonday()
-            -
                {
-            -
                    return $this->dayOfWeek === static::MONDAY;
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if this day is a Tuesday.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isTuesday()
-            -
                {
-            -
                    return $this->dayOfWeek === static::TUESDAY;
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if this day is a Wednesday.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isWednesday()
-            -
                {
-            -
                    return $this->dayOfWeek === static::WEDNESDAY;
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if this day is a Thursday.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isThursday()
-            -
                {
-            -
                    return $this->dayOfWeek === static::THURSDAY;
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if this day is a Friday.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isFriday()
-            -
                {
-            -
                    return $this->dayOfWeek === static::FRIDAY;
-            -
                }
-            -
-            -
                /**
-            -
                 * Checks if this day is a Saturday.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isSaturday()
-            -
                {
-            -
                    return $this->dayOfWeek === static::SATURDAY;
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                /////////////////// ADDITIONS AND SUBTRACTIONS ////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Add years to the instance. Positive $value travel forward while
-            -
                 * negative $value travel into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addYears($value)
-            -
                {
-            -
                    return $this->modify((int) $value.' year');
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a year to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addYear($value = 1)
-            -
                {
-            -
                    return $this->addYears($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a year from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subYear($value = 1)
-            -
                {
-            -
                    return $this->subYears($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove years from the instance.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subYears($value)
-            -
                {
-            -
                    return $this->addYears(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add quarters to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addQuarters($value)
-            -
                {
-            -
                    return $this->addMonths(static::MONTHS_PER_QUARTER * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a quarter to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addQuarter($value = 1)
-            -
                {
-            -
                    return $this->addQuarters($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a quarter from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subQuarter($value = 1)
-            -
                {
-            -
                    return $this->subQuarters($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove quarters from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subQuarters($value)
-            -
                {
-            -
                    return $this->addQuarters(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add centuries to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addCenturies($value)
-            -
                {
-            -
                    return $this->addYears(static::YEARS_PER_CENTURY * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a century to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addCentury($value = 1)
-            -
                {
-            -
                    return $this->addCenturies($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a century from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subCentury($value = 1)
-            -
                {
-            -
                    return $this->subCenturies($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove centuries from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subCenturies($value)
-            -
                {
-            -
                    return $this->addCenturies(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add months to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addMonths($value)
-            -
                {
-            -
                    if (static::shouldOverflowMonths()) {
-            -
                        return $this->addMonthsWithOverflow($value);
-            -
                    }
-            -
-            -
                    return $this->addMonthsNoOverflow($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a month to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addMonth($value = 1)
-            -
                {
-            -
                    return $this->addMonths($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a month from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subMonth($value = 1)
-            -
                {
-            -
                    return $this->subMonths($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove months from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subMonths($value)
-            -
                {
-            -
                    return $this->addMonths(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add months to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addMonthsWithOverflow($value)
-            -
                {
-            -
                    return $this->modify((int) $value.' month');
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a month to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addMonthWithOverflow($value = 1)
-            -
                {
-            -
                    return $this->addMonthsWithOverflow($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a month from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subMonthWithOverflow($value = 1)
-            -
                {
-            -
                    return $this->subMonthsWithOverflow($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove months from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subMonthsWithOverflow($value)
-            -
                {
-            -
                    return $this->addMonthsWithOverflow(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add months without overflowing to the instance. Positive $value
-            -
                 * travels forward while negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addMonthsNoOverflow($value)
-            -
                {
-            -
                    $day = $this->day;
-            -
-            -
                    $this->modify((int) $value.' month');
-            -
-            -
                    if ($day !== $this->day) {
-            -
                        $this->modify('last day of previous month');
-            -
                    }
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a month with no overflow to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addMonthNoOverflow($value = 1)
-            -
                {
-            -
                    return $this->addMonthsNoOverflow($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a month with no overflow from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subMonthNoOverflow($value = 1)
-            -
                {
-            -
                    return $this->subMonthsNoOverflow($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove months with no overflow from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subMonthsNoOverflow($value)
-            -
                {
-            -
                    return $this->addMonthsNoOverflow(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add days to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addDays($value)
-            -
                {
-            -
                    return $this->modify((int) $value.' day');
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a day to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addDay($value = 1)
-            -
                {
-            -
                    return $this->addDays($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a day from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subDay($value = 1)
-            -
                {
-            -
                    return $this->subDays($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove days from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subDays($value)
-            -
                {
-            -
                    return $this->addDays(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add weekdays to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addWeekdays($value)
-            -
                {
-            -
                    // fix for https://bugs.php.net/bug.php?id=54909
-            -
                    $t = $this->toTimeString();
-            -
                    $this->modify((int) $value.' weekday');
-            -
-            -
                    return $this->setTimeFromTimeString($t);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a weekday to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addWeekday($value = 1)
-            -
                {
-            -
                    return $this->addWeekdays($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a weekday from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subWeekday($value = 1)
-            -
                {
-            -
                    return $this->subWeekdays($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove weekdays from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subWeekdays($value)
-            -
                {
-            -
                    return $this->addWeekdays(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add weeks to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addWeeks($value)
-            -
                {
-            -
                    return $this->modify((int) $value.' week');
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a week to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addWeek($value = 1)
-            -
                {
-            -
                    return $this->addWeeks($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a week from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subWeek($value = 1)
-            -
                {
-            -
                    return $this->subWeeks($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove weeks to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subWeeks($value)
-            -
                {
-            -
                    return $this->addWeeks(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add hours to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addHours($value)
-            -
                {
-            -
                    return $this->modify((int) $value.' hour');
-            -
                }
-            -
-            -
                /**
-            -
                 * Add an hour to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addHour($value = 1)
-            -
                {
-            -
                    return $this->addHours($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove an hour from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subHour($value = 1)
-            -
                {
-            -
                    return $this->subHours($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove hours from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subHours($value)
-            -
                {
-            -
                    return $this->addHours(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add minutes to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addMinutes($value)
-            -
                {
-            -
                    return $this->modify((int) $value.' minute');
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a minute to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addMinute($value = 1)
-            -
                {
-            -
                    return $this->addMinutes($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a minute from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subMinute($value = 1)
-            -
                {
-            -
                    return $this->subMinutes($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove minutes from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subMinutes($value)
-            -
                {
-            -
                    return $this->addMinutes(-1 * $value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Add seconds to the instance. Positive $value travels forward while
-            -
                 * negative $value travels into the past.
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addSeconds($value)
-            -
                {
-            -
                    return $this->modify((int) $value.' second');
-            -
                }
-            -
-            -
                /**
-            -
                 * Add a second to the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function addSecond($value = 1)
-            -
                {
-            -
                    return $this->addSeconds($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove a second from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subSecond($value = 1)
-            -
                {
-            -
                    return $this->subSeconds($value);
-            -
                }
-            -
-            -
                /**
-            -
                 * Remove seconds from the instance
-            -
                 *
-            -
                 * @param int $value
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function subSeconds($value)
-            -
                {
-            -
                    return $this->addSeconds(-1 * $value);
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                /////////////////////////// DIFFERENCES ///////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Get the difference in years
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInYears(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    $dt = $dt ?: static::now($this->getTimezone());
-            -
-            -
                    return (int) $this->diff($dt, $abs)->format('%r%y');
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in months
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInMonths(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    $dt = $dt ?: static::now($this->getTimezone());
-            -
-            -
                    return $this->diffInYears($dt, $abs) * static::MONTHS_PER_YEAR + (int) $this->diff($dt, $abs)->format('%r%m');
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in weeks
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInWeeks(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    return (int) ($this->diffInDays($dt, $abs) / static::DAYS_PER_WEEK);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in days
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInDays(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    $dt = $dt ?: static::now($this->getTimezone());
-            -
-            -
                    return (int) $this->diff($dt, $abs)->format('%r%a');
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in days using a filter closure
-            -
                 *
-            -
                 * @param Closure             $callback
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs      Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInDaysFiltered(Closure $callback, Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    return $this->diffFiltered(CarbonInterval::day(), $callback, $dt, $abs);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in hours using a filter closure
-            -
                 *
-            -
                 * @param Closure             $callback
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs      Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInHoursFiltered(Closure $callback, Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    return $this->diffFiltered(CarbonInterval::hour(), $callback, $dt, $abs);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference by the given interval using a filter closure
-            -
                 *
-            -
                 * @param CarbonInterval $ci       An interval to traverse by
-            -
                 * @param Closure        $callback
-            -
                 * @param Carbon|null    $dt
-            -
                 * @param bool           $abs      Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffFiltered(CarbonInterval $ci, Closure $callback, Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    $start = $this;
-            -
                    $end = $dt ?: static::now($this->getTimezone());
-            -
                    $inverse = false;
-            -
-            -
                    if ($end < $start) {
-            -
                        $start = $end;
-            -
                        $end = $this;
-            -
                        $inverse = true;
-            -
                    }
-            -
-            -
                    $period = new DatePeriod($start, $ci, $end);
-            -
                    $vals = array_filter(iterator_to_array($period), function (DateTime $date) use ($callback) {
-            -
                        return call_user_func($callback, Carbon::instance($date));
-            -
                    });
-            -
-            -
                    $diff = count($vals);
-            -
-            -
                    return $inverse && !$abs ? -$diff : $diff;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in weekdays
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInWeekdays(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    return $this->diffInDaysFiltered(function (Carbon $date) {
-            -
                        return $date->isWeekday();
-            -
                    }, $dt, $abs);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in weekend days using a filter
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInWeekendDays(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    return $this->diffInDaysFiltered(function (Carbon $date) {
-            -
                        return $date->isWeekend();
-            -
                    }, $dt, $abs);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in hours
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInHours(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    return (int) ($this->diffInSeconds($dt, $abs) / static::SECONDS_PER_MINUTE / static::MINUTES_PER_HOUR);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in minutes
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInMinutes(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    return (int) ($this->diffInSeconds($dt, $abs) / static::SECONDS_PER_MINUTE);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in seconds
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 * @param bool                $abs Get the absolute of the difference
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function diffInSeconds(Carbon $dt = null, $abs = true)
-            -
                {
-            -
                    $dt = $dt ?: static::now($this->getTimezone());
-            -
                    $value = $dt->getTimestamp() - $this->getTimestamp();
-            -
-            -
                    return $abs ? abs($value) : $value;
-            -
                }
-            -
-            -
                /**
-            -
                 * The number of seconds since midnight.
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function secondsSinceMidnight()
-            -
                {
-            -
                    return $this->diffInSeconds($this->copy()->startOfDay());
-            -
                }
-            -
-            -
                /**
-            -
                 * The number of seconds until 23:23:59.
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function secondsUntilEndOfDay()
-            -
                {
-            -
                    return $this->diffInSeconds($this->copy()->endOfDay());
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the difference in a human readable format in the current locale.
-            -
                 *
-            -
                 * When comparing a value in the past to default now:
-            -
                 * 1 hour ago
-            -
                 * 5 months ago
-            -
                 *
-            -
                 * When comparing a value in the future to default now:
-            -
                 * 1 hour from now
-            -
                 * 5 months from now
-            -
                 *
-            -
                 * When comparing a value in the past to another value:
-            -
                 * 1 hour before
-            -
                 * 5 months before
-            -
                 *
-            -
                 * When comparing a value in the future to another value:
-            -
                 * 1 hour after
-            -
                 * 5 months after
-            -
                 *
-            -
                 * @param Carbon|null $other
-            -
                 * @param bool        $absolute removes time difference modifiers ago, after, etc
-            -
                 * @param bool        $short    displays short format of time units
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function diffForHumans(Carbon $other = null, $absolute = false, $short = false)
-            -
                {
-            -
                    $isNow = $other === null;
-            -
-            -
                    if ($isNow) {
-            -
                        $other = static::now($this->getTimezone());
-            -
                    }
-            -
-            -
                    $diffInterval = $this->diff($other);
-            -
-            -
                    switch (true) {
-            -
                        case $diffInterval->y > 0:
-            -
                            $unit = $short ? 'y' : 'year';
-            -
                            $count = $diffInterval->y;
-            -
                            break;
-            -
-            -
                        case $diffInterval->m > 0:
-            -
                            $unit = $short ? 'm' : 'month';
-            -
                            $count = $diffInterval->m;
-            -
                            break;
-            -
-            -
                        case $diffInterval->d > 0:
-            -
                            $unit = $short ? 'd' : 'day';
-            -
                            $count = $diffInterval->d;
-            -
-            -
                            if ($count >= static::DAYS_PER_WEEK) {
-            -
                                $unit = $short ? 'w' : 'week';
-            -
                                $count = (int) ($count / static::DAYS_PER_WEEK);
-            -
                            }
-            -
                            break;
-            -
-            -
                        case $diffInterval->h > 0:
-            -
                            $unit = $short ? 'h' : 'hour';
-            -
                            $count = $diffInterval->h;
-            -
                            break;
-            -
-            -
                        case $diffInterval->i > 0:
-            -
                            $unit = $short ? 'min' : 'minute';
-            -
                            $count = $diffInterval->i;
-            -
                            break;
-            -
-            -
                        default:
-            -
                            $count = $diffInterval->s;
-            -
                            $unit = $short ? 's' : 'second';
-            -
                            break;
-            -
                    }
-            -
-            -
                    if ($count === 0) {
-            -
                        $count = 1;
-            -
                    }
-            -
-            -
                    $time = static::translator()->transChoice($unit, $count, array(':count' => $count));
-            -
-            -
                    if ($absolute) {
-            -
                        return $time;
-            -
                    }
-            -
-            -
                    $isFuture = $diffInterval->invert === 1;
-            -
-            -
                    $transId = $isNow ? ($isFuture ? 'from_now' : 'ago') : ($isFuture ? 'after' : 'before');
-            -
-            -
                    // Some langs have special pluralization for past and future tense.
-            -
                    $tryKeyExists = $unit.'_'.$transId;
-            -
                    if ($tryKeyExists !== static::translator()->transChoice($tryKeyExists, $count)) {
-            -
                        $time = static::translator()->transChoice($tryKeyExists, $count, array(':count' => $count));
-            -
                    }
-            -
-            -
                    return static::translator()->trans($transId, array(':time' => $time));
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                //////////////////////////// MODIFIERS ////////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Resets the time to 00:00:00
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function startOfDay()
-            -
                {
-            -
                    return $this->setTime(0, 0, 0);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the time to 23:59:59
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function endOfDay()
-            -
                {
-            -
                    return $this->setTime(23, 59, 59);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to the first day of the month and the time to 00:00:00
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function startOfMonth()
-            -
                {
-            -
                    return $this->setDateTime($this->year, $this->month, 1, 0, 0, 0);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to end of the month and time to 23:59:59
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function endOfMonth()
-            -
                {
-            -
                    return $this->setDateTime($this->year, $this->month, $this->daysInMonth, 23, 59, 59);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to the first day of the quarter and the time to 00:00:00
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function startOfQuarter()
-            -
                {
-            -
                    $month = ($this->quarter - 1) * static::MONTHS_PER_QUARTER + 1;
-            -
-            -
                    return $this->setDateTime($this->year, $month, 1, 0, 0, 0);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to end of the quarter and time to 23:59:59
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function endOfQuarter()
-            -
                {
-            -
                    return $this->startOfQuarter()->addMonths(static::MONTHS_PER_QUARTER - 1)->endOfMonth();
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to the first day of the year and the time to 00:00:00
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function startOfYear()
-            -
                {
-            -
                    return $this->setDateTime($this->year, 1, 1, 0, 0, 0);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to end of the year and time to 23:59:59
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function endOfYear()
-            -
                {
-            -
                    return $this->setDateTime($this->year, 12, 31, 23, 59, 59);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to the first day of the decade and the time to 00:00:00
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function startOfDecade()
-            -
                {
-            -
                    $year = $this->year - $this->year % static::YEARS_PER_DECADE;
-            -
-            -
                    return $this->setDateTime($year, 1, 1, 0, 0, 0);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to end of the decade and time to 23:59:59
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function endOfDecade()
-            -
                {
-            -
                    $year = $this->year - $this->year % static::YEARS_PER_DECADE + static::YEARS_PER_DECADE - 1;
-            -
-            -
                    return $this->setDateTime($year, 12, 31, 23, 59, 59);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to the first day of the century and the time to 00:00:00
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function startOfCentury()
-            -
                {
-            -
                    $year = $this->year - ($this->year - 1) % static::YEARS_PER_CENTURY;
-            -
-            -
                    return $this->setDateTime($year, 1, 1, 0, 0, 0);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to end of the century and time to 23:59:59
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function endOfCentury()
-            -
                {
-            -
                    $year = $this->year - 1 - ($this->year - 1) % static::YEARS_PER_CENTURY + static::YEARS_PER_CENTURY;
-            -
-            -
                    return $this->setDateTime($year, 12, 31, 23, 59, 59);
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to the first day of week (defined in $weekStartsAt) and the time to 00:00:00
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function startOfWeek()
-            -
                {
-            -
                    while ($this->dayOfWeek !== static::$weekStartsAt) {
-            -
                        $this->subDay();
-            -
                    }
-            -
-            -
                    return $this->startOfDay();
-            -
                }
-            -
-            -
                /**
-            -
                 * Resets the date to end of week (defined in $weekEndsAt) and time to 23:59:59
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function endOfWeek()
-            -
                {
-            -
                    while ($this->dayOfWeek !== static::$weekEndsAt) {
-            -
                        $this->addDay();
-            -
                    }
-            -
-            -
                    return $this->endOfDay();
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the next occurrence of a given day of the week.
-            -
                 * If no dayOfWeek is provided, modify to the next occurrence
-            -
                 * of the current day of the week.  Use the supplied constants
-            -
                 * to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int|null $dayOfWeek
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function next($dayOfWeek = null)
-            -
                {
-            -
                    if ($dayOfWeek === null) {
-            -
                        $dayOfWeek = $this->dayOfWeek;
-            -
                    }
-            -
-            -
                    return $this->startOfDay()->modify('next '.static::$days[$dayOfWeek]);
-            -
                }
-            -
-            -
                /**
-            -
                 * Go forward or backward to the next week- or weekend-day.
-            -
                 *
-            -
                 * @param bool $weekday
-            -
                 * @param bool $forward
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                private function nextOrPreviousDay($weekday = true, $forward = true)
-            -
                {
-            -
                    $step = $forward ? 1 : -1;
-            -
-            -
                    do {
-            -
                        $this->addDay($step);
-            -
                    } while ($weekday ? $this->isWeekend() : $this->isWeekday());
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Go forward to the next weekday.
-            -
                 *
-            -
                 * @return $this
-            -
                 */
-            -
                public function nextWeekday()
-            -
                {
-            -
                    return $this->nextOrPreviousDay();
-            -
                }
-            -
-            -
                /**
-            -
                 * Go backward to the previous weekday.
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function previousWeekday()
-            -
                {
-            -
                    return $this->nextOrPreviousDay(true, false);
-            -
                }
-            -
-            -
                /**
-            -
                 * Go forward to the next weekend day.
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function nextWeekendDay()
-            -
                {
-            -
                    return $this->nextOrPreviousDay(false);
-            -
                }
-            -
-            -
                /**
-            -
                 * Go backward to the previous weekend day.
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function previousWeekendDay()
-            -
                {
-            -
                    return $this->nextOrPreviousDay(false, false);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the previous occurrence of a given day of the week.
-            -
                 * If no dayOfWeek is provided, modify to the previous occurrence
-            -
                 * of the current day of the week.  Use the supplied constants
-            -
                 * to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int|null $dayOfWeek
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function previous($dayOfWeek = null)
-            -
                {
-            -
                    if ($dayOfWeek === null) {
-            -
                        $dayOfWeek = $this->dayOfWeek;
-            -
                    }
-            -
-            -
                    return $this->startOfDay()->modify('last '.static::$days[$dayOfWeek]);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the first occurrence of a given day of the week
-            -
                 * in the current month. If no dayOfWeek is provided, modify to the
-            -
                 * first day of the current month.  Use the supplied constants
-            -
                 * to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int|null $dayOfWeek
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function firstOfMonth($dayOfWeek = null)
-            -
                {
-            -
                    $this->startOfDay();
-            -
-            -
                    if ($dayOfWeek === null) {
-            -
                        return $this->day(1);
-            -
                    }
-            -
-            -
                    return $this->modify('first '.static::$days[$dayOfWeek].' of '.$this->format('F').' '.$this->year);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the last occurrence of a given day of the week
-            -
                 * in the current month. If no dayOfWeek is provided, modify to the
-            -
                 * last day of the current month.  Use the supplied constants
-            -
                 * to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int|null $dayOfWeek
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function lastOfMonth($dayOfWeek = null)
-            -
                {
-            -
                    $this->startOfDay();
-            -
-            -
                    if ($dayOfWeek === null) {
-            -
                        return $this->day($this->daysInMonth);
-            -
                    }
-            -
-            -
                    return $this->modify('last '.static::$days[$dayOfWeek].' of '.$this->format('F').' '.$this->year);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the given occurrence of a given day of the week
-            -
                 * in the current month. If the calculated occurrence is outside the scope
-            -
                 * of the current month, then return false and no modifications are made.
-            -
                 * Use the supplied constants to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int $nth
-            -
                 * @param int $dayOfWeek
-            -
                 *
-            -
                 * @return mixed
-            -
                 */
-            -
                public function nthOfMonth($nth, $dayOfWeek)
-            -
                {
-            -
                    $dt = $this->copy()->firstOfMonth();
-            -
                    $check = $dt->format('Y-m');
-            -
                    $dt->modify('+'.$nth.' '.static::$days[$dayOfWeek]);
-            -
-            -
                    return $dt->format('Y-m') === $check ? $this->modify($dt) : false;
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the first occurrence of a given day of the week
-            -
                 * in the current quarter. If no dayOfWeek is provided, modify to the
-            -
                 * first day of the current quarter.  Use the supplied constants
-            -
                 * to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int|null $dayOfWeek
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function firstOfQuarter($dayOfWeek = null)
-            -
                {
-            -
                    return $this->setDate($this->year, $this->quarter * static::MONTHS_PER_QUARTER - 2, 1)->firstOfMonth($dayOfWeek);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the last occurrence of a given day of the week
-            -
                 * in the current quarter. If no dayOfWeek is provided, modify to the
-            -
                 * last day of the current quarter.  Use the supplied constants
-            -
                 * to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int|null $dayOfWeek
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function lastOfQuarter($dayOfWeek = null)
-            -
                {
-            -
                    return $this->setDate($this->year, $this->quarter * static::MONTHS_PER_QUARTER, 1)->lastOfMonth($dayOfWeek);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the given occurrence of a given day of the week
-            -
                 * in the current quarter. If the calculated occurrence is outside the scope
-            -
                 * of the current quarter, then return false and no modifications are made.
-            -
                 * Use the supplied constants to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int $nth
-            -
                 * @param int $dayOfWeek
-            -
                 *
-            -
                 * @return mixed
-            -
                 */
-            -
                public function nthOfQuarter($nth, $dayOfWeek)
-            -
                {
-            -
                    $dt = $this->copy()->day(1)->month($this->quarter * static::MONTHS_PER_QUARTER);
-            -
                    $lastMonth = $dt->month;
-            -
                    $year = $dt->year;
-            -
                    $dt->firstOfQuarter()->modify('+'.$nth.' '.static::$days[$dayOfWeek]);
-            -
-            -
                    return ($lastMonth < $dt->month || $year !== $dt->year) ? false : $this->modify($dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the first occurrence of a given day of the week
-            -
                 * in the current year. If no dayOfWeek is provided, modify to the
-            -
                 * first day of the current year.  Use the supplied constants
-            -
                 * to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int|null $dayOfWeek
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function firstOfYear($dayOfWeek = null)
-            -
                {
-            -
                    return $this->month(1)->firstOfMonth($dayOfWeek);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the last occurrence of a given day of the week
-            -
                 * in the current year. If no dayOfWeek is provided, modify to the
-            -
                 * last day of the current year.  Use the supplied constants
-            -
                 * to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int|null $dayOfWeek
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function lastOfYear($dayOfWeek = null)
-            -
                {
-            -
                    return $this->month(static::MONTHS_PER_YEAR)->lastOfMonth($dayOfWeek);
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify to the given occurrence of a given day of the week
-            -
                 * in the current year. If the calculated occurrence is outside the scope
-            -
                 * of the current year, then return false and no modifications are made.
-            -
                 * Use the supplied constants to indicate the desired dayOfWeek, ex. static::MONDAY.
-            -
                 *
-            -
                 * @param int $nth
-            -
                 * @param int $dayOfWeek
-            -
                 *
-            -
                 * @return mixed
-            -
                 */
-            -
                public function nthOfYear($nth, $dayOfWeek)
-            -
                {
-            -
                    $dt = $this->copy()->firstOfYear()->modify('+'.$nth.' '.static::$days[$dayOfWeek]);
-            -
-            -
                    return $this->year === $dt->year ? $this->modify($dt) : false;
-            -
                }
-            -
-            -
                /**
-            -
                 * Modify the current instance to the average of a given instance (default now) and the current instance.
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function average(Carbon $dt = null)
-            -
                {
-            -
                    $dt = $dt ?: static::now($this->getTimezone());
-            -
-            -
                    return $this->addSeconds((int) ($this->diffInSeconds($dt, false) / 2));
-            -
                }
-            -
-            -
                /**
-            -
                 * Check if its the birthday. Compares the date/month values of the two dates.
-            -
                 *
-            -
                 * @param \Carbon\Carbon|null $dt The instance to compare with or null to use current day.
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                public function isBirthday(Carbon $dt = null)
-            -
                {
-            -
                    return $this->isSameAs('md', $dt);
-            -
                }
-            -
-            -
                /**
-            -
                 * Consider the timezone when modifying the instance.
-            -
                 *
-            -
                 * @param string $modify
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function modify($modify)
-            -
                {
-            -
                    if ($this->local) {
-            -
                        return parent::modify($modify);
-            -
                    }
-            -
-            -
                    $timezone = $this->getTimezone();
-            -
                    $this->setTimezone('UTC');
-            -
                    $instance = parent::modify($modify);
-            -
                    $this->setTimezone($timezone);
-            -
-            -
                    return $instance;
-            -
                }
-            -
-            -
                /**
-            -
                 * Return a serialized string of the instance.
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function serialize()
-            -
                {
-            -
                    return serialize($this);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create an instance form a serialized string.
-            -
                 *
-            -
                 * @param string $value
-            -
                 *
-            -
                 * @throws \InvalidArgumentException
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function fromSerialized($value)
-            -
                {
-            -
                    $instance = @unserialize($value);
-            -
-            -
                    if (!$instance instanceof static) {
-            -
                        throw new InvalidArgumentException('Invalid serialized value.');
-            -
                    }
-            -
-            -
                    return $instance;
-            -
                }
-            -
            }


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Carbon;
13	+
14	+ use Carbon\Exceptions\InvalidDateException;
15	+ use Closure;
16	+ use DatePeriod;
17	+ use DateTime;
18	+ use DateTimeZone;
19	+ use InvalidArgumentException;
20	+ use Symfony\Component\Translation\Loader\ArrayLoader;
21	+ use Symfony\Component\Translation\Translator;
22	+ use Symfony\Component\Translation\TranslatorInterface;
23	+
24	+ /**
25	+ * A simple API extension for DateTime
26	+ *
27	+ * @property int $year
28	+ * @property int $yearIso
29	+ * @property int $month
30	+ * @property int $day
31	+ * @property int $hour
32	+ * @property int $minute
33	+ * @property int $second
34	+ * @property int $timestamp seconds since the Unix Epoch
35	+ * @property \DateTimeZone $timezone the current timezone
36	+ * @property \DateTimeZone $tz alias of timezone
37	+ * @property-read int $micro
38	+ * @property-read int $dayOfWeek 0 (for Sunday) through 6 (for Saturday)
39	+ * @property-read int $dayOfYear 0 through 365
40	+ * @property-read int $weekOfMonth 1 through 5
41	+ * @property-read int $weekOfYear ISO-8601 week number of year, weeks starting on Monday
42	+ * @property-read int $daysInMonth number of days in the given month
43	+ * @property-read int $age does a diffInYears() with default parameters
44	+ * @property-read int $quarter the quarter of this instance, 1 - 4
45	+ * @property-read int $offset the timezone offset in seconds from UTC
46	+ * @property-read int $offsetHours the timezone offset in hours from UTC
47	+ * @property-read bool $dst daylight savings time indicator, true if DST, false otherwise
48	+ * @property-read bool $local checks if the timezone is local, true if local, false otherwise
49	+ * @property-read bool $utc checks if the timezone is UTC, true if UTC, false otherwise
50	+ * @property-read string $timezoneName
51	+ * @property-read string $tzName
52	+ */
53	+ class Carbon extends DateTime
54	+ {
55	+ /**
56	+ * The day constants.
57	+ */
58	+ const SUNDAY = 0;
59	+ const MONDAY = 1;
60	+ const TUESDAY = 2;
61	+ const WEDNESDAY = 3;
62	+ const THURSDAY = 4;
63	+ const FRIDAY = 5;
64	+ const SATURDAY = 6;
65	+
66	+ /**
67	+ * Names of days of the week.
68	+ *
69	+ * @var array
70	+ */
71	+ protected static $days = array(
72	+ self::SUNDAY => 'Sunday',
73	+ self::MONDAY => 'Monday',
74	+ self::TUESDAY => 'Tuesday',
75	+ self::WEDNESDAY => 'Wednesday',
76	+ self::THURSDAY => 'Thursday',
77	+ self::FRIDAY => 'Friday',
78	+ self::SATURDAY => 'Saturday',
79	+ );
80	+
81	+ /**
82	+ * Terms used to detect if a time passed is a relative date.
83	+ *
84	+ * This is here for testing purposes.
85	+ *
86	+ * @var array
87	+ */
88	+ protected static $relativeKeywords = array(
89	+ '+',
90	+ '-',
91	+ 'ago',
92	+ 'first',
93	+ 'last',
94	+ 'next',
95	+ 'this',
96	+ 'today',
97	+ 'tomorrow',
98	+ 'yesterday',
99	+ );
100	+
101	+ /**
102	+ * Number of X in Y.
103	+ */
104	+ const YEARS_PER_CENTURY = 100;
105	+ const YEARS_PER_DECADE = 10;
106	+ const MONTHS_PER_YEAR = 12;
107	+ const MONTHS_PER_QUARTER = 3;
108	+ const WEEKS_PER_YEAR = 52;
109	+ const DAYS_PER_WEEK = 7;
110	+ const HOURS_PER_DAY = 24;
111	+ const MINUTES_PER_HOUR = 60;
112	+ const SECONDS_PER_MINUTE = 60;
113	+
114	+ /**
115	+ * Default format to use for __toString method when type juggling occurs.
116	+ *
117	+ * @var string
118	+ */
119	+ const DEFAULT_TO_STRING_FORMAT = 'Y-m-d H:i:s';
120	+
121	+ /**
122	+ * Format to use for __toString method when type juggling occurs.
123	+ *
124	+ * @var string
125	+ */
126	+ protected static $toStringFormat = self::DEFAULT_TO_STRING_FORMAT;
127	+
128	+ /**
129	+ * First day of week.
130	+ *
131	+ * @var int
132	+ */
133	+ protected static $weekStartsAt = self::MONDAY;
134	+
135	+ /**
136	+ * Last day of week.
137	+ *
138	+ * @var int
139	+ */
140	+ protected static $weekEndsAt = self::SUNDAY;
141	+
142	+ /**
143	+ * Days of weekend.
144	+ *
145	+ * @var array
146	+ */
147	+ protected static $weekendDays = array(
148	+ self::SATURDAY,
149	+ self::SUNDAY,
150	+ );
151	+
152	+ /**
153	+ * A test Carbon instance to be returned when now instances are created.
154	+ *
155	+ * @var \Carbon\Carbon
156	+ */
157	+ protected static $testNow;
158	+
159	+ /**
160	+ * A translator to ... er ... translate stuff.
161	+ *
162	+ * @var \Symfony\Component\Translation\TranslatorInterface
163	+ */
164	+ protected static $translator;
165	+
166	+ /**
167	+ * The errors that can occur.
168	+ *
169	+ * @var array
170	+ */
171	+ protected static $lastErrors;
172	+
173	+ /**
174	+ * Will UTF8 encoding be used to print localized date/time ?
175	+ *
176	+ * @var bool
177	+ */
178	+ protected static $utf8 = false;
179	+
180	+ /*
181	+ * Indicates if months should be calculated with overflow.
182	+ *
183	+ * @var bool
184	+ */
185	+ protected static $monthsOverflow = true;
186	+
187	+ /**
188	+ * Indicates if months should be calculated with overflow.
189	+ *
190	+ * @param bool $monthsOverflow
191	+ *
192	+ * @return void
193	+ */
194	+ public static function useMonthsOverflow($monthsOverflow = true)
195	+ {
196	+ static::$monthsOverflow = $monthsOverflow;
197	+ }
198	+
199	+ /**
200	+ * Reset the month overflow behavior.
201	+ *
202	+ * @return void
203	+ */
204	+ public static function resetMonthsOverflow()
205	+ {
206	+ static::$monthsOverflow = true;
207	+ }
208	+
209	+ /**
210	+ * Get the month overflow behavior.
211	+ *
212	+ * @return bool
213	+ */
214	+ public static function shouldOverflowMonths()
215	+ {
216	+ return static::$monthsOverflow;
217	+ }
218	+
219	+ /**
220	+ * Creates a DateTimeZone from a string, DateTimeZone or integer offset.
221	+ *
222	+ * @param \DateTimeZone\|string\|int\|null $object
223	+ *
224	+ * @throws \InvalidArgumentException
225	+ *
226	+ * @return \DateTimeZone
227	+ */
228	+ protected static function safeCreateDateTimeZone($object)
229	+ {
230	+ if ($object === null) {
231	+ // Don't return null... avoid Bug #52063 in PHP <5.3.6
232	+ return new DateTimeZone(date_default_timezone_get());
233	+ }
234	+
235	+ if ($object instanceof DateTimeZone) {
236	+ return $object;
237	+ }
238	+
239	+ if (is_numeric($object)) {
240	+ $tzName = timezone_name_from_abbr(null, $object * 3600, true);
241	+
242	+ if ($tzName === false) {
243	+ throw new InvalidArgumentException('Unknown or bad timezone ('.$object.')');
244	+ }
245	+
246	+ $object = $tzName;
247	+ }
248	+
249	+ $tz = @timezone_open((string) $object);
250	+
251	+ if ($tz === false) {
252	+ throw new InvalidArgumentException('Unknown or bad timezone ('.$object.')');
253	+ }
254	+
255	+ return $tz;
256	+ }
257	+
258	+ ///////////////////////////////////////////////////////////////////
259	+ //////////////////////////// CONSTRUCTORS /////////////////////////
260	+ ///////////////////////////////////////////////////////////////////
261	+
262	+ /**
263	+ * Create a new Carbon instance.
264	+ *
265	+ * Please see the testing aids section (specifically static::setTestNow())
266	+ * for more on the possibility of this constructor returning a test instance.
267	+ *
268	+ * @param string\|null $time
269	+ * @param \DateTimeZone\|string\|null $tz
270	+ */
271	+ public function __construct($time = null, $tz = null)
272	+ {
273	+ // If the class has a test now set and we are trying to create a now()
274	+ // instance then override as required
275	+ if (static::hasTestNow() && (empty($time) \|\| $time === 'now' \|\| static::hasRelativeKeywords($time))) {
276	+ $testInstance = clone static::getTestNow();
277	+ if (static::hasRelativeKeywords($time)) {
278	+ $testInstance->modify($time);
279	+ }
280	+
281	+ //shift the time according to the given time zone
282	+ if ($tz !== null && $tz !== static::getTestNow()->getTimezone()) {
283	+ $testInstance->setTimezone($tz);
284	+ } else {
285	+ $tz = $testInstance->getTimezone();
286	+ }
287	+
288	+ $time = $testInstance->toDateTimeString();
289	+ }
290	+
291	+ parent::__construct($time, static::safeCreateDateTimeZone($tz));
292	+ }
293	+
294	+ /**
295	+ * Create a Carbon instance from a DateTime one.
296	+ *
297	+ * @param \DateTime $dt
298	+ *
299	+ * @return static
300	+ */
301	+ public static function instance(DateTime $dt)
302	+ {
303	+ if ($dt instanceof static) {
304	+ return clone $dt;
305	+ }
306	+
307	+ return new static($dt->format('Y-m-d H:i:s.u'), $dt->getTimezone());
308	+ }
309	+
310	+ /**
311	+ * Create a carbon instance from a string.
312	+ *
313	+ * This is an alias for the constructor that allows better fluent syntax
314	+ * as it allows you to do Carbon::parse('Monday next week')->fn() rather
315	+ * than (new Carbon('Monday next week'))->fn().
316	+ *
317	+ * @param string\|null $time
318	+ * @param \DateTimeZone\|string\|null $tz
319	+ *
320	+ * @return static
321	+ */
322	+ public static function parse($time = null, $tz = null)
323	+ {
324	+ return new static($time, $tz);
325	+ }
326	+
327	+ /**
328	+ * Get a Carbon instance for the current date and time.
329	+ *
330	+ * @param \DateTimeZone\|string\|null $tz
331	+ *
332	+ * @return static
333	+ */
334	+ public static function now($tz = null)
335	+ {
336	+ return new static(null, $tz);
337	+ }
338	+
339	+ /**
340	+ * Create a Carbon instance for today.
341	+ *
342	+ * @param \DateTimeZone\|string\|null $tz
343	+ *
344	+ * @return static
345	+ */
346	+ public static function today($tz = null)
347	+ {
348	+ return static::now($tz)->startOfDay();
349	+ }
350	+
351	+ /**
352	+ * Create a Carbon instance for tomorrow.
353	+ *
354	+ * @param \DateTimeZone\|string\|null $tz
355	+ *
356	+ * @return static
357	+ */
358	+ public static function tomorrow($tz = null)
359	+ {
360	+ return static::today($tz)->addDay();
361	+ }
362	+
363	+ /**
364	+ * Create a Carbon instance for yesterday.
365	+ *
366	+ * @param \DateTimeZone\|string\|null $tz
367	+ *
368	+ * @return static
369	+ */
370	+ public static function yesterday($tz = null)
371	+ {
372	+ return static::today($tz)->subDay();
373	+ }
374	+
375	+ /**
376	+ * Create a Carbon instance for the greatest supported date.
377	+ *
378	+ * @return static
379	+ */
380	+ public static function maxValue()
381	+ {
382	+ if (PHP_INT_SIZE === 4) {
383	+ // 32 bit (and additionally Windows 64 bit)
384	+ return static::createFromTimestamp(PHP_INT_MAX);
385	+ }
386	+
387	+ // 64 bit
388	+ return static::create(9999, 12, 31, 23, 59, 59);
389	+ }
390	+
391	+ /**
392	+ * Create a Carbon instance for the lowest supported date.
393	+ *
394	+ * @return static
395	+ */
396	+ public static function minValue()
397	+ {
398	+ if (PHP_INT_SIZE === 4) {
399	+ // 32 bit (and additionally Windows 64 bit)
400	+ return static::createFromTimestamp(~PHP_INT_MAX);
401	+ }
402	+
403	+ // 64 bit
404	+ return static::create(1, 1, 1, 0, 0, 0);
405	+ }
406	+
407	+ /**
408	+ * Create a new Carbon instance from a specific date and time.
409	+ *
410	+ * If any of $year, $month or $day are set to null their now() values will
411	+ * be used.
412	+ *
413	+ * If $hour is null it will be set to its now() value and the default
414	+ * values for $minute and $second will be their now() values.
415	+ *
416	+ * If $hour is not null then the default values for $minute and $second
417	+ * will be 0.
418	+ *
419	+ * @param int\|null $year
420	+ * @param int\|null $month
421	+ * @param int\|null $day
422	+ * @param int\|null $hour
423	+ * @param int\|null $minute
424	+ * @param int\|null $second
425	+ * @param \DateTimeZone\|string\|null $tz
426	+ *
427	+ * @return static
428	+ */
429	+ public static function create($year = null, $month = null, $day = null, $hour = null, $minute = null, $second = null, $tz = null)
430	+ {
431	+ $now = static::hasTestNow() ? static::getTestNow()->getTimestamp() : time();
432	+
433	+ $defaults = array_combine(array(
434	+ 'year',
435	+ 'month',
436	+ 'day',
437	+ 'hour',
438	+ 'minute',
439	+ 'second',
440	+ ), explode('-', date('Y-n-j-G-i-s', $now)));
441	+
442	+ $year = $year === null ? $defaults['year'] : $year;
443	+ $month = $month === null ? $defaults['month'] : $month;
444	+ $day = $day === null ? $defaults['day'] : $day;
445	+
446	+ if ($hour === null) {
447	+ $hour = $defaults['hour'];
448	+ $minute = $minute === null ? $defaults['minute'] : $minute;
449	+ $second = $second === null ? $defaults['second'] : $second;
450	+ } else {
451	+ $minute = $minute === null ? 0 : $minute;
452	+ $second = $second === null ? 0 : $second;
453	+ }
454	+
455	+ $fixYear = null;
456	+
457	+ if ($year < 0) {
458	+ $fixYear = $year;
459	+ $year = 0;
460	+ } elseif ($year > 9999) {
461	+ $fixYear = $year - 9999;
462	+ $year = 9999;
463	+ }
464	+
465	+ $instance = static::createFromFormat('Y-n-j G:i:s', sprintf('%s-%s-%s %s:%02s:%02s', $year, $month, $day, $hour, $minute, $second), $tz);
466	+
467	+ if ($fixYear !== null) {
468	+ $instance->addYears($fixYear);
469	+ }
470	+
471	+ return $instance;
472	+ }
473	+
474	+ /**
475	+ * Create a new safe Carbon instance from a specific date and time.
476	+ *
477	+ * If any of $year, $month or $day are set to null their now() values will
478	+ * be used.
479	+ *
480	+ * If $hour is null it will be set to its now() value and the default
481	+ * values for $minute and $second will be their now() values.
482	+ *
483	+ * If $hour is not null then the default values for $minute and $second
484	+ * will be 0.
485	+ *
486	+ * If one of the set values is not valid, an \InvalidArgumentException
487	+ * will be thrown.
488	+ *
489	+ * @param int\|null $year
490	+ * @param int\|null $month
491	+ * @param int\|null $day
492	+ * @param int\|null $hour
493	+ * @param int\|null $minute
494	+ * @param int\|null $second
495	+ * @param \DateTimeZone\|string\|null $tz
496	+ *
497	+ * @throws \Carbon\Exceptions\InvalidDateException
498	+ *
499	+ * @return static
500	+ */
501	+ public static function createSafe($year = null, $month = null, $day = null, $hour = null, $minute = null, $second = null, $tz = null)
502	+ {
503	+ $fields = array(
504	+ 'year' => array(0, 9999),
505	+ 'month' => array(0, 12),
506	+ 'day' => array(0, 31),
507	+ 'hour' => array(0, 24),
508	+ 'minute' => array(0, 59),
509	+ 'second' => array(0, 59),
510	+ );
511	+
512	+ foreach ($fields as $field => $range) {
513	+ if ($$field !== null && (!is_int($$field) \|\| $$field < $range[0] \|\| $$field > $range[1])) {
514	+ throw new InvalidDateException($field, $$field);
515	+ }
516	+ }
517	+
518	+ $instance = static::create($year, $month, 1, $hour, $minute, $second, $tz);
519	+
520	+ if ($day !== null && $day > $instance->daysInMonth) {
521	+ throw new InvalidDateException('day', $day);
522	+ }
523	+
524	+ return $instance->day($day);
525	+ }
526	+
527	+ /**
528	+ * Create a Carbon instance from just a date. The time portion is set to now.
529	+ *
530	+ * @param int\|null $year
531	+ * @param int\|null $month
532	+ * @param int\|null $day
533	+ * @param \DateTimeZone\|string\|null $tz
534	+ *
535	+ * @return static
536	+ */
537	+ public static function createFromDate($year = null, $month = null, $day = null, $tz = null)
538	+ {
539	+ return static::create($year, $month, $day, null, null, null, $tz);
540	+ }
541	+
542	+ /**
543	+ * Create a Carbon instance from just a time. The date portion is set to today.
544	+ *
545	+ * @param int\|null $hour
546	+ * @param int\|null $minute
547	+ * @param int\|null $second
548	+ * @param \DateTimeZone\|string\|null $tz
549	+ *
550	+ * @return static
551	+ */
552	+ public static function createFromTime($hour = null, $minute = null, $second = null, $tz = null)
553	+ {
554	+ return static::create(null, null, null, $hour, $minute, $second, $tz);
555	+ }
556	+
557	+ /**
558	+ * Create a Carbon instance from a specific format.
559	+ *
560	+ * @param string $format
561	+ * @param string $time
562	+ * @param \DateTimeZone\|string\|null $tz
563	+ *
564	+ * @throws \InvalidArgumentException
565	+ *
566	+ * @return static
567	+ */
568	+ public static function createFromFormat($format, $time, $tz = null)
569	+ {
570	+ if ($tz !== null) {
571	+ $dt = parent::createFromFormat($format, $time, static::safeCreateDateTimeZone($tz));
572	+ } else {
573	+ $dt = parent::createFromFormat($format, $time);
574	+ }
575	+
576	+ static::setLastErrors($lastErrors = parent::getLastErrors());
577	+
578	+ if ($dt instanceof DateTime) {
579	+ return static::instance($dt);
580	+ }
581	+
582	+ throw new InvalidArgumentException(implode(PHP_EOL, $lastErrors['errors']));
583	+ }
584	+
585	+ /**
586	+ * Set last errors.
587	+ *
588	+ * @param array $lastErrors
589	+ *
590	+ * @return void
591	+ */
592	+ private static function setLastErrors(array $lastErrors)
593	+ {
594	+ static::$lastErrors = $lastErrors;
595	+ }
596	+
597	+ /**
598	+ * {@inheritdoc}
599	+ */
600	+ public static function getLastErrors()
601	+ {
602	+ return static::$lastErrors;
603	+ }
604	+
605	+ /**
606	+ * Create a Carbon instance from a timestamp.
607	+ *
608	+ * @param int $timestamp
609	+ * @param \DateTimeZone\|string\|null $tz
610	+ *
611	+ * @return static
612	+ */
613	+ public static function createFromTimestamp($timestamp, $tz = null)
614	+ {
615	+ return static::now($tz)->setTimestamp($timestamp);
616	+ }
617	+
618	+ /**
619	+ * Create a Carbon instance from an UTC timestamp.
620	+ *
621	+ * @param int $timestamp
622	+ *
623	+ * @return static
624	+ */
625	+ public static function createFromTimestampUTC($timestamp)
626	+ {
627	+ return new static('@'.$timestamp);
628	+ }
629	+
630	+ /**
631	+ * Get a copy of the instance.
632	+ *
633	+ * @return static
634	+ */
635	+ public function copy()
636	+ {
637	+ return clone $this;
638	+ }
639	+
640	+ ///////////////////////////////////////////////////////////////////
641	+ ///////////////////////// GETTERS AND SETTERS /////////////////////
642	+ ///////////////////////////////////////////////////////////////////
643	+
644	+ /**
645	+ * Get a part of the Carbon object
646	+ *
647	+ * @param string $name
648	+ *
649	+ * @throws \InvalidArgumentException
650	+ *
651	+ * @return string\|int\|\DateTimeZone
652	+ */
653	+ public function __get($name)
654	+ {
655	+ switch (true) {
656	+ case array_key_exists($name, $formats = array(
657	+ 'year' => 'Y',
658	+ 'yearIso' => 'o',
659	+ 'month' => 'n',
660	+ 'day' => 'j',
661	+ 'hour' => 'G',
662	+ 'minute' => 'i',
663	+ 'second' => 's',
664	+ 'micro' => 'u',
665	+ 'dayOfWeek' => 'w',
666	+ 'dayOfYear' => 'z',
667	+ 'weekOfYear' => 'W',
668	+ 'daysInMonth' => 't',
669	+ 'timestamp' => 'U',
670	+ )):
671	+ return (int) $this->format($formats[$name]);
672	+
673	+ case $name === 'weekOfMonth':
674	+ return (int) ceil($this->day / static::DAYS_PER_WEEK);
675	+
676	+ case $name === 'age':
677	+ return $this->diffInYears();
678	+
679	+ case $name === 'quarter':
680	+ return (int) ceil($this->month / static::MONTHS_PER_QUARTER);
681	+
682	+ case $name === 'offset':
683	+ return $this->getOffset();
684	+
685	+ case $name === 'offsetHours':
686	+ return $this->getOffset() / static::SECONDS_PER_MINUTE / static::MINUTES_PER_HOUR;
687	+
688	+ case $name === 'dst':
689	+ return $this->format('I') === '1';
690	+
691	+ case $name === 'local':
692	+ return $this->getOffset() === $this->copy()->setTimezone(date_default_timezone_get())->getOffset();
693	+
694	+ case $name === 'utc':
695	+ return $this->getOffset() === 0;
696	+
697	+ case $name === 'timezone' \|\| $name === 'tz':
698	+ return $this->getTimezone();
699	+
700	+ case $name === 'timezoneName' \|\| $name === 'tzName':
701	+ return $this->getTimezone()->getName();
702	+
703	+ default:
704	+ throw new InvalidArgumentException(sprintf("Unknown getter '%s'", $name));
705	+ }
706	+ }
707	+
708	+ /**
709	+ * Check if an attribute exists on the object
710	+ *
711	+ * @param string $name
712	+ *
713	+ * @return bool
714	+ */
715	+ public function __isset($name)
716	+ {
717	+ try {
718	+ $this->__get($name);
719	+ } catch (InvalidArgumentException $e) {
720	+ return false;
721	+ }
722	+
723	+ return true;
724	+ }
725	+
726	+ /**
727	+ * Set a part of the Carbon object
728	+ *
729	+ * @param string $name
730	+ * @param string\|int\|\DateTimeZone $value
731	+ *
732	+ * @throws \InvalidArgumentException
733	+ */
734	+ public function __set($name, $value)
735	+ {
736	+ switch ($name) {
737	+ case 'year':
738	+ case 'month':
739	+ case 'day':
740	+ case 'hour':
741	+ case 'minute':
742	+ case 'second':
743	+ list($year, $month, $day, $hour, $minute, $second) = explode('-', $this->format('Y-n-j-G-i-s'));
744	+ $$name = $value;
745	+ $this->setDateTime($year, $month, $day, $hour, $minute, $second);
746	+ break;
747	+
748	+ case 'timestamp':
749	+ parent::setTimestamp($value);
750	+ break;
751	+
752	+ case 'timezone':
753	+ case 'tz':
754	+ $this->setTimezone($value);
755	+ break;
756	+
757	+ default:
758	+ throw new InvalidArgumentException(sprintf("Unknown setter '%s'", $name));
759	+ }
760	+ }
761	+
762	+ /**
763	+ * Set the instance's year
764	+ *
765	+ * @param int $value
766	+ *
767	+ * @return static
768	+ */
769	+ public function year($value)
770	+ {
771	+ $this->year = $value;
772	+
773	+ return $this;
774	+ }
775	+
776	+ /**
777	+ * Set the instance's month
778	+ *
779	+ * @param int $value
780	+ *
781	+ * @return static
782	+ */
783	+ public function month($value)
784	+ {
785	+ $this->month = $value;
786	+
787	+ return $this;
788	+ }
789	+
790	+ /**
791	+ * Set the instance's day
792	+ *
793	+ * @param int $value
794	+ *
795	+ * @return static
796	+ */
797	+ public function day($value)
798	+ {
799	+ $this->day = $value;
800	+
801	+ return $this;
802	+ }
803	+
804	+ /**
805	+ * Set the instance's hour
806	+ *
807	+ * @param int $value
808	+ *
809	+ * @return static
810	+ */
811	+ public function hour($value)
812	+ {
813	+ $this->hour = $value;
814	+
815	+ return $this;
816	+ }
817	+
818	+ /**
819	+ * Set the instance's minute
820	+ *
821	+ * @param int $value
822	+ *
823	+ * @return static
824	+ */
825	+ public function minute($value)
826	+ {
827	+ $this->minute = $value;
828	+
829	+ return $this;
830	+ }
831	+
832	+ /**
833	+ * Set the instance's second
834	+ *
835	+ * @param int $value
836	+ *
837	+ * @return static
838	+ */
839	+ public function second($value)
840	+ {
841	+ $this->second = $value;
842	+
843	+ return $this;
844	+ }
845	+
846	+ /**
847	+ * Sets the current date of the DateTime object to a different date.
848	+ * Calls modify as a workaround for a php bug
849	+ *
850	+ * @param int $year
851	+ * @param int $month
852	+ * @param int $day
853	+ *
854	+ * @return static
855	+ *
856	+ * @see https://github.com/briannesbitt/Carbon/issues/539
857	+ * @see https://bugs.php.net/bug.php?id=63863
858	+ */
859	+ public function setDate($year, $month, $day)
860	+ {
861	+ $this->modify('+0 day');
862	+
863	+ return parent::setDate($year, $month, $day);
864	+ }
865	+
866	+ /**
867	+ * Set the date and time all together
868	+ *
869	+ * @param int $year
870	+ * @param int $month
871	+ * @param int $day
872	+ * @param int $hour
873	+ * @param int $minute
874	+ * @param int $second
875	+ *
876	+ * @return static
877	+ */
878	+ public function setDateTime($year, $month, $day, $hour, $minute, $second = 0)
879	+ {
880	+ return $this->setDate($year, $month, $day)->setTime($hour, $minute, $second);
881	+ }
882	+
883	+ /**
884	+ * Set the time by time string
885	+ *
886	+ * @param string $time
887	+ *
888	+ * @return static
889	+ */
890	+ public function setTimeFromTimeString($time)
891	+ {
892	+ $time = explode(':', $time);
893	+
894	+ $hour = $time[0];
895	+ $minute = isset($time[1]) ? $time[1] : 0;
896	+ $second = isset($time[2]) ? $time[2] : 0;
897	+
898	+ return $this->setTime($hour, $minute, $second);
899	+ }
900	+
901	+ /**
902	+ * Set the instance's timestamp
903	+ *
904	+ * @param int $value
905	+ *
906	+ * @return static
907	+ */
908	+ public function timestamp($value)
909	+ {
910	+ return $this->setTimestamp($value);
911	+ }
912	+
913	+ /**
914	+ * Alias for setTimezone()
915	+ *
916	+ * @param \DateTimeZone\|string $value
917	+ *
918	+ * @return static
919	+ */
920	+ public function timezone($value)
921	+ {
922	+ return $this->setTimezone($value);
923	+ }
924	+
925	+ /**
926	+ * Alias for setTimezone()
927	+ *
928	+ * @param \DateTimeZone\|string $value
929	+ *
930	+ * @return static
931	+ */
932	+ public function tz($value)
933	+ {
934	+ return $this->setTimezone($value);
935	+ }
936	+
937	+ /**
938	+ * Set the instance's timezone from a string or object
939	+ *
940	+ * @param \DateTimeZone\|string $value
941	+ *
942	+ * @return static
943	+ */
944	+ public function setTimezone($value)
945	+ {
946	+ return parent::setTimezone(static::safeCreateDateTimeZone($value));
947	+ }
948	+
949	+ ///////////////////////////////////////////////////////////////////
950	+ /////////////////////// WEEK SPECIAL DAYS /////////////////////////
951	+ ///////////////////////////////////////////////////////////////////
952	+
953	+ /**
954	+ * Get the first day of week
955	+ *
956	+ * @return int
957	+ */
958	+ public static function getWeekStartsAt()
959	+ {
960	+ return static::$weekStartsAt;
961	+ }
962	+
963	+ /**
964	+ * Set the first day of week
965	+ *
966	+ * @param int
967	+ */
968	+ public static function setWeekStartsAt($day)
969	+ {
970	+ static::$weekStartsAt = $day;
971	+ }
972	+
973	+ /**
974	+ * Get the last day of week
975	+ *
976	+ * @return int
977	+ */
978	+ public static function getWeekEndsAt()
979	+ {
980	+ return static::$weekEndsAt;
981	+ }
982	+
983	+ /**
984	+ * Set the last day of week
985	+ *
986	+ * @param int
987	+ */
988	+ public static function setWeekEndsAt($day)
989	+ {
990	+ static::$weekEndsAt = $day;
991	+ }
992	+
993	+ /**
994	+ * Get weekend days
995	+ *
996	+ * @return array
997	+ */
998	+ public static function getWeekendDays()
999	+ {
1000	+ return static::$weekendDays;
1001	+ }
1002	+
1003	+ /**
1004	+ * Set weekend days
1005	+ *
1006	+ * @param array
1007	+ */
1008	+ public static function setWeekendDays($days)
1009	+ {
1010	+ static::$weekendDays = $days;
1011	+ }
1012	+
1013	+ ///////////////////////////////////////////////////////////////////
1014	+ ///////////////////////// TESTING AIDS ////////////////////////////
1015	+ ///////////////////////////////////////////////////////////////////
1016	+
1017	+ /**
1018	+ * Set a Carbon instance (real or mock) to be returned when a "now"
1019	+ * instance is created. The provided instance will be returned
1020	+ * specifically under the following conditions:
1021	+ * - A call to the static now() method, ex. Carbon::now()
1022	+ * - When a null (or blank string) is passed to the constructor or parse(), ex. new Carbon(null)
1023	+ * - When the string "now" is passed to the constructor or parse(), ex. new Carbon('now')
1024	+ * - When a string containing the desired time is passed to Carbon::parse().
1025	+ *
1026	+ * Note the timezone parameter was left out of the examples above and
1027	+ * has no affect as the mock value will be returned regardless of its value.
1028	+ *
1029	+ * To clear the test instance call this method using the default
1030	+ * parameter of null.
1031	+ *
1032	+ * @param \Carbon\Carbon\|string\|null $testNow
1033	+ */
1034	+ public static function setTestNow($testNow = null)
1035	+ {
1036	+ static::$testNow = is_string($testNow) ? static::parse($testNow) : $testNow;
1037	+ }
1038	+
1039	+ /**
1040	+ * Get the Carbon instance (real or mock) to be returned when a "now"
1041	+ * instance is created.
1042	+ *
1043	+ * @return static the current instance used for testing
1044	+ */
1045	+ public static function getTestNow()
1046	+ {
1047	+ return static::$testNow;
1048	+ }
1049	+
1050	+ /**
1051	+ * Determine if there is a valid test instance set. A valid test instance
1052	+ * is anything that is not null.
1053	+ *
1054	+ * @return bool true if there is a test instance, otherwise false
1055	+ */
1056	+ public static function hasTestNow()
1057	+ {
1058	+ return static::getTestNow() !== null;
1059	+ }
1060	+
1061	+ /**
1062	+ * Determine if there is a relative keyword in the time string, this is to
1063	+ * create dates relative to now for test instances. e.g.: next tuesday
1064	+ *
1065	+ * @param string $time
1066	+ *
1067	+ * @return bool true if there is a keyword, otherwise false
1068	+ */
1069	+ public static function hasRelativeKeywords($time)
1070	+ {
1071	+ // skip common format with a '-' in it
1072	+ if (preg_match('/\d{4}-\d{1,2}-\d{1,2}/', $time) !== 1) {
1073	+ foreach (static::$relativeKeywords as $keyword) {
1074	+ if (stripos($time, $keyword) !== false) {
1075	+ return true;
1076	+ }
1077	+ }
1078	+ }
1079	+
1080	+ return false;
1081	+ }
1082	+
1083	+ ///////////////////////////////////////////////////////////////////
1084	+ /////////////////////// LOCALIZATION //////////////////////////////
1085	+ ///////////////////////////////////////////////////////////////////
1086	+
1087	+ /**
1088	+ * Initialize the translator instance if necessary.
1089	+ *
1090	+ * @return \Symfony\Component\Translation\TranslatorInterface
1091	+ */
1092	+ protected static function translator()
1093	+ {
1094	+ if (static::$translator === null) {
1095	+ static::$translator = new Translator('en');
1096	+ static::$translator->addLoader('array', new ArrayLoader());
1097	+ static::setLocale('en');
1098	+ }
1099	+
1100	+ return static::$translator;
1101	+ }
1102	+
1103	+ /**
1104	+ * Get the translator instance in use
1105	+ *
1106	+ * @return \Symfony\Component\Translation\TranslatorInterface
1107	+ */
1108	+ public static function getTranslator()
1109	+ {
1110	+ return static::translator();
1111	+ }
1112	+
1113	+ /**
1114	+ * Set the translator instance to use
1115	+ *
1116	+ * @param \Symfony\Component\Translation\TranslatorInterface $translator
1117	+ */
1118	+ public static function setTranslator(TranslatorInterface $translator)
1119	+ {
1120	+ static::$translator = $translator;
1121	+ }
1122	+
1123	+ /**
1124	+ * Get the current translator locale
1125	+ *
1126	+ * @return string
1127	+ */
1128	+ public static function getLocale()
1129	+ {
1130	+ return static::translator()->getLocale();
1131	+ }
1132	+
1133	+ /**
1134	+ * Set the current translator locale and indicate if the source locale file exists
1135	+ *
1136	+ * @param string $locale
1137	+ *
1138	+ * @return bool
1139	+ */
1140	+ public static function setLocale($locale)
1141	+ {
1142	+ $locale = preg_replace_callback('/\b([a-z]{2})[-_](?:([a-z]{4})[-_])?([a-z]{2})\b/', function ($matches) {
1143	+ return $matches[1].'_'.(!empty($matches[2]) ? ucfirst($matches[2]).'_' : '').strtoupper($matches[3]);
1144	+ }, strtolower($locale));
1145	+
1146	+ if (file_exists($filename = __DIR__.'/Lang/'.$locale.'.php')) {
1147	+ static::translator()->setLocale($locale);
1148	+ // Ensure the locale has been loaded.
1149	+ static::translator()->addResource('array', require $filename, $locale);
1150	+
1151	+ return true;
1152	+ }
1153	+
1154	+ return false;
1155	+ }
1156	+
1157	+ ///////////////////////////////////////////////////////////////////
1158	+ /////////////////////// STRING FORMATTING /////////////////////////
1159	+ ///////////////////////////////////////////////////////////////////
1160	+
1161	+ /**
1162	+ * Set if UTF8 will be used for localized date/time
1163	+ *
1164	+ * @param bool $utf8
1165	+ */
1166	+ public static function setUtf8($utf8)
1167	+ {
1168	+ static::$utf8 = $utf8;
1169	+ }
1170	+
1171	+ /**
1172	+ * Format the instance with the current locale. You can set the current
1173	+ * locale using setlocale() http://php.net/setlocale.
1174	+ *
1175	+ * @param string $format
1176	+ *
1177	+ * @return string
1178	+ */
1179	+ public function formatLocalized($format)
1180	+ {
1181	+ // Check for Windows to find and replace the %e
1182	+ // modifier correctly
1183	+ if (strtoupper(substr(PHP_OS, 0, 3)) === 'WIN') {
1184	+ $format = preg_replace('#(?<!%)((?:%%)*)%e#', '\1%#d', $format);
1185	+ }
1186	+
1187	+ $formatted = strftime($format, strtotime($this));
1188	+
1189	+ return static::$utf8 ? utf8_encode($formatted) : $formatted;
1190	+ }
1191	+
1192	+ /**
1193	+ * Reset the format used to the default when type juggling a Carbon instance to a string
1194	+ */
1195	+ public static function resetToStringFormat()
1196	+ {
1197	+ static::setToStringFormat(static::DEFAULT_TO_STRING_FORMAT);
1198	+ }
1199	+
1200	+ /**
1201	+ * Set the default format used when type juggling a Carbon instance to a string
1202	+ *
1203	+ * @param string $format
1204	+ */
1205	+ public static function setToStringFormat($format)
1206	+ {
1207	+ static::$toStringFormat = $format;
1208	+ }
1209	+
1210	+ /**
1211	+ * Format the instance as a string using the set format
1212	+ *
1213	+ * @return string
1214	+ */
1215	+ public function __toString()
1216	+ {
1217	+ return $this->format(static::$toStringFormat);
1218	+ }
1219	+
1220	+ /**
1221	+ * Format the instance as date
1222	+ *
1223	+ * @return string
1224	+ */
1225	+ public function toDateString()
1226	+ {
1227	+ return $this->format('Y-m-d');
1228	+ }
1229	+
1230	+ /**
1231	+ * Format the instance as a readable date
1232	+ *
1233	+ * @return string
1234	+ */
1235	+ public function toFormattedDateString()
1236	+ {
1237	+ return $this->format('M j, Y');
1238	+ }
1239	+
1240	+ /**
1241	+ * Format the instance as time
1242	+ *
1243	+ * @return string
1244	+ */
1245	+ public function toTimeString()
1246	+ {
1247	+ return $this->format('H:i:s');
1248	+ }
1249	+
1250	+ /**
1251	+ * Format the instance as date and time
1252	+ *
1253	+ * @return string
1254	+ */
1255	+ public function toDateTimeString()
1256	+ {
1257	+ return $this->format('Y-m-d H:i:s');
1258	+ }
1259	+
1260	+ /**
1261	+ * Format the instance with day, date and time
1262	+ *
1263	+ * @return string
1264	+ */
1265	+ public function toDayDateTimeString()
1266	+ {
1267	+ return $this->format('D, M j, Y g:i A');
1268	+ }
1269	+
1270	+ /**
1271	+ * Format the instance as ATOM
1272	+ *
1273	+ * @return string
1274	+ */
1275	+ public function toAtomString()
1276	+ {
1277	+ return $this->format(static::ATOM);
1278	+ }
1279	+
1280	+ /**
1281	+ * Format the instance as COOKIE
1282	+ *
1283	+ * @return string
1284	+ */
1285	+ public function toCookieString()
1286	+ {
1287	+ return $this->format(static::COOKIE);
1288	+ }
1289	+
1290	+ /**
1291	+ * Format the instance as ISO8601
1292	+ *
1293	+ * @return string
1294	+ */
1295	+ public function toIso8601String()
1296	+ {
1297	+ return $this->toAtomString();
1298	+ }
1299	+
1300	+ /**
1301	+ * Format the instance as RFC822
1302	+ *
1303	+ * @return string
1304	+ */
1305	+ public function toRfc822String()
1306	+ {
1307	+ return $this->format(static::RFC822);
1308	+ }
1309	+
1310	+ /**
1311	+ * Format the instance as RFC850
1312	+ *
1313	+ * @return string
1314	+ */
1315	+ public function toRfc850String()
1316	+ {
1317	+ return $this->format(static::RFC850);
1318	+ }
1319	+
1320	+ /**
1321	+ * Format the instance as RFC1036
1322	+ *
1323	+ * @return string
1324	+ */
1325	+ public function toRfc1036String()
1326	+ {
1327	+ return $this->format(static::RFC1036);
1328	+ }
1329	+
1330	+ /**
1331	+ * Format the instance as RFC1123
1332	+ *
1333	+ * @return string
1334	+ */
1335	+ public function toRfc1123String()
1336	+ {
1337	+ return $this->format(static::RFC1123);
1338	+ }
1339	+
1340	+ /**
1341	+ * Format the instance as RFC2822
1342	+ *
1343	+ * @return string
1344	+ */
1345	+ public function toRfc2822String()
1346	+ {
1347	+ return $this->format(static::RFC2822);
1348	+ }
1349	+
1350	+ /**
1351	+ * Format the instance as RFC3339
1352	+ *
1353	+ * @return string
1354	+ */
1355	+ public function toRfc3339String()
1356	+ {
1357	+ return $this->format(static::RFC3339);
1358	+ }
1359	+
1360	+ /**
1361	+ * Format the instance as RSS
1362	+ *
1363	+ * @return string
1364	+ */
1365	+ public function toRssString()
1366	+ {
1367	+ return $this->format(static::RSS);
1368	+ }
1369	+
1370	+ /**
1371	+ * Format the instance as W3C
1372	+ *
1373	+ * @return string
1374	+ */
1375	+ public function toW3cString()
1376	+ {
1377	+ return $this->format(static::W3C);
1378	+ }
1379	+
1380	+ ///////////////////////////////////////////////////////////////////
1381	+ ////////////////////////// COMPARISONS ////////////////////////////
1382	+ ///////////////////////////////////////////////////////////////////
1383	+
1384	+ /**
1385	+ * Determines if the instance is equal to another
1386	+ *
1387	+ * @param Carbon $dt
1388	+ *
1389	+ * @return bool
1390	+ */
1391	+ public function eq(Carbon $dt)
1392	+ {
1393	+ return $this == $dt;
1394	+ }
1395	+
1396	+ /**
1397	+ * Determines if the instance is equal to another
1398	+ *
1399	+ * @param Carbon $dt
1400	+ *
1401	+ * @see eq()
1402	+ *
1403	+ * @return bool
1404	+ */
1405	+ public function equalTo(Carbon $dt)
1406	+ {
1407	+ return $this->eq($dt);
1408	+ }
1409	+
1410	+ /**
1411	+ * Determines if the instance is not equal to another
1412	+ *
1413	+ * @param Carbon $dt
1414	+ *
1415	+ * @return bool
1416	+ */
1417	+ public function ne(Carbon $dt)
1418	+ {
1419	+ return !$this->eq($dt);
1420	+ }
1421	+
1422	+ /**
1423	+ * Determines if the instance is not equal to another
1424	+ *
1425	+ * @param Carbon $dt
1426	+ *
1427	+ * @see ne()
1428	+ *
1429	+ * @return bool
1430	+ */
1431	+ public function notEqualTo(Carbon $dt)
1432	+ {
1433	+ return $this->ne($dt);
1434	+ }
1435	+
1436	+ /**
1437	+ * Determines if the instance is greater (after) than another
1438	+ *
1439	+ * @param Carbon $dt
1440	+ *
1441	+ * @return bool
1442	+ */
1443	+ public function gt(Carbon $dt)
1444	+ {
1445	+ return $this > $dt;
1446	+ }
1447	+
1448	+ /**
1449	+ * Determines if the instance is greater (after) than another
1450	+ *
1451	+ * @param Carbon $dt
1452	+ *
1453	+ * @see gt()
1454	+ *
1455	+ * @return bool
1456	+ */
1457	+ public function greaterThan(Carbon $dt)
1458	+ {
1459	+ return $this->gt($dt);
1460	+ }
1461	+
1462	+ /**
1463	+ * Determines if the instance is greater (after) than or equal to another
1464	+ *
1465	+ * @param Carbon $dt
1466	+ *
1467	+ * @return bool
1468	+ */
1469	+ public function gte(Carbon $dt)
1470	+ {
1471	+ return $this >= $dt;
1472	+ }
1473	+
1474	+ /**
1475	+ * Determines if the instance is greater (after) than or equal to another
1476	+ *
1477	+ * @param Carbon $dt
1478	+ *
1479	+ * @see gte()
1480	+ *
1481	+ * @return bool
1482	+ */
1483	+ public function greaterThanOrEqualTo(Carbon $dt)
1484	+ {
1485	+ return $this->gte($dt);
1486	+ }
1487	+
1488	+ /**
1489	+ * Determines if the instance is less (before) than another
1490	+ *
1491	+ * @param Carbon $dt
1492	+ *
1493	+ * @return bool
1494	+ */
1495	+ public function lt(Carbon $dt)
1496	+ {
1497	+ return $this < $dt;
1498	+ }
1499	+
1500	+ /**
1501	+ * Determines if the instance is less (before) than another
1502	+ *
1503	+ * @param Carbon $dt
1504	+ *
1505	+ * @see lt()
1506	+ *
1507	+ * @return bool
1508	+ */
1509	+ public function lessThan(Carbon $dt)
1510	+ {
1511	+ return $this->lt($dt);
1512	+ }
1513	+
1514	+ /**
1515	+ * Determines if the instance is less (before) or equal to another
1516	+ *
1517	+ * @param Carbon $dt
1518	+ *
1519	+ * @return bool
1520	+ */
1521	+ public function lte(Carbon $dt)
1522	+ {
1523	+ return $this <= $dt;
1524	+ }
1525	+
1526	+ /**
1527	+ * Determines if the instance is less (before) or equal to another
1528	+ *
1529	+ * @param Carbon $dt
1530	+ *
1531	+ * @see lte()
1532	+ *
1533	+ * @return bool
1534	+ */
1535	+ public function lessThanOrEqualTo(Carbon $dt)
1536	+ {
1537	+ return $this->lte($dt);
1538	+ }
1539	+
1540	+ /**
1541	+ * Determines if the instance is between two others
1542	+ *
1543	+ * @param Carbon $dt1
1544	+ * @param Carbon $dt2
1545	+ * @param bool $equal Indicates if a > and < comparison should be used or <= or >=
1546	+ *
1547	+ * @return bool
1548	+ */
1549	+ public function between(Carbon $dt1, Carbon $dt2, $equal = true)
1550	+ {
1551	+ if ($dt1->gt($dt2)) {
1552	+ $temp = $dt1;
1553	+ $dt1 = $dt2;
1554	+ $dt2 = $temp;
1555	+ }
1556	+
1557	+ if ($equal) {
1558	+ return $this->gte($dt1) && $this->lte($dt2);
1559	+ }
1560	+
1561	+ return $this->gt($dt1) && $this->lt($dt2);
1562	+ }
1563	+
1564	+ /**
1565	+ * Get the closest date from the instance.
1566	+ *
1567	+ * @param Carbon $dt1
1568	+ * @param Carbon $dt2
1569	+ *
1570	+ * @return static
1571	+ */
1572	+ public function closest(Carbon $dt1, Carbon $dt2)
1573	+ {
1574	+ return $this->diffInSeconds($dt1) < $this->diffInSeconds($dt2) ? $dt1 : $dt2;
1575	+ }
1576	+
1577	+ /**
1578	+ * Get the farthest date from the instance.
1579	+ *
1580	+ * @param Carbon $dt1
1581	+ * @param Carbon $dt2
1582	+ *
1583	+ * @return static
1584	+ */
1585	+ public function farthest(Carbon $dt1, Carbon $dt2)
1586	+ {
1587	+ return $this->diffInSeconds($dt1) > $this->diffInSeconds($dt2) ? $dt1 : $dt2;
1588	+ }
1589	+
1590	+ /**
1591	+ * Get the minimum instance between a given instance (default now) and the current instance.
1592	+ *
1593	+ * @param \Carbon\Carbon\|null $dt
1594	+ *
1595	+ * @return static
1596	+ */
1597	+ public function min(Carbon $dt = null)
1598	+ {
1599	+ $dt = $dt ?: static::now($this->getTimezone());
1600	+
1601	+ return $this->lt($dt) ? $this : $dt;
1602	+ }
1603	+
1604	+ /**
1605	+ * Get the minimum instance between a given instance (default now) and the current instance.
1606	+ *
1607	+ * @param \Carbon\Carbon\|null $dt
1608	+ *
1609	+ * @see min()
1610	+ *
1611	+ * @return static
1612	+ */
1613	+ public function minimum(Carbon $dt = null)
1614	+ {
1615	+ return $this->min($dt);
1616	+ }
1617	+
1618	+ /**
1619	+ * Get the maximum instance between a given instance (default now) and the current instance.
1620	+ *
1621	+ * @param \Carbon\Carbon\|null $dt
1622	+ *
1623	+ * @return static
1624	+ */
1625	+ public function max(Carbon $dt = null)
1626	+ {
1627	+ $dt = $dt ?: static::now($this->getTimezone());
1628	+
1629	+ return $this->gt($dt) ? $this : $dt;
1630	+ }
1631	+
1632	+ /**
1633	+ * Get the maximum instance between a given instance (default now) and the current instance.
1634	+ *
1635	+ * @param \Carbon\Carbon\|null $dt
1636	+ *
1637	+ * @see max()
1638	+ *
1639	+ * @return static
1640	+ */
1641	+ public function maximum(Carbon $dt = null)
1642	+ {
1643	+ return $this->max($dt);
1644	+ }
1645	+
1646	+ /**
1647	+ * Determines if the instance is a weekday
1648	+ *
1649	+ * @return bool
1650	+ */
1651	+ public function isWeekday()
1652	+ {
1653	+ return !$this->isWeekend();
1654	+ }
1655	+
1656	+ /**
1657	+ * Determines if the instance is a weekend day
1658	+ *
1659	+ * @return bool
1660	+ */
1661	+ public function isWeekend()
1662	+ {
1663	+ return in_array($this->dayOfWeek, static::$weekendDays);
1664	+ }
1665	+
1666	+ /**
1667	+ * Determines if the instance is yesterday
1668	+ *
1669	+ * @return bool
1670	+ */
1671	+ public function isYesterday()
1672	+ {
1673	+ return $this->toDateString() === static::yesterday($this->getTimezone())->toDateString();
1674	+ }
1675	+
1676	+ /**
1677	+ * Determines if the instance is today
1678	+ *
1679	+ * @return bool
1680	+ */
1681	+ public function isToday()
1682	+ {
1683	+ return $this->toDateString() === static::now($this->getTimezone())->toDateString();
1684	+ }
1685	+
1686	+ /**
1687	+ * Determines if the instance is tomorrow
1688	+ *
1689	+ * @return bool
1690	+ */
1691	+ public function isTomorrow()
1692	+ {
1693	+ return $this->toDateString() === static::tomorrow($this->getTimezone())->toDateString();
1694	+ }
1695	+
1696	+ /**
1697	+ * Determines if the instance is within the next week
1698	+ *
1699	+ * @return bool
1700	+ */
1701	+ public function isNextWeek()
1702	+ {
1703	+ return $this->weekOfYear === static::now($this->getTimezone())->addWeek()->weekOfYear;
1704	+ }
1705	+
1706	+ /**
1707	+ * Determines if the instance is within the last week
1708	+ *
1709	+ * @return bool
1710	+ */
1711	+ public function isLastWeek()
1712	+ {
1713	+ return $this->weekOfYear === static::now($this->getTimezone())->subWeek()->weekOfYear;
1714	+ }
1715	+
1716	+ /**
1717	+ * Determines if the instance is within the next month
1718	+ *
1719	+ * @return bool
1720	+ */
1721	+ public function isNextMonth()
1722	+ {
1723	+ return $this->month === static::now($this->getTimezone())->addMonthNoOverflow()->month;
1724	+ }
1725	+
1726	+ /**
1727	+ * Determines if the instance is within the last month
1728	+ *
1729	+ * @return bool
1730	+ */
1731	+ public function isLastMonth()
1732	+ {
1733	+ return $this->month === static::now($this->getTimezone())->subMonthNoOverflow()->month;
1734	+ }
1735	+
1736	+ /**
1737	+ * Determines if the instance is within next year
1738	+ *
1739	+ * @return bool
1740	+ */
1741	+ public function isNextYear()
1742	+ {
1743	+ return $this->year === static::now($this->getTimezone())->addYear()->year;
1744	+ }
1745	+
1746	+ /**
1747	+ * Determines if the instance is within the previous year
1748	+ *
1749	+ * @return bool
1750	+ */
1751	+ public function isLastYear()
1752	+ {
1753	+ return $this->year === static::now($this->getTimezone())->subYear()->year;
1754	+ }
1755	+
1756	+ /**
1757	+ * Determines if the instance is in the future, ie. greater (after) than now
1758	+ *
1759	+ * @return bool
1760	+ */
1761	+ public function isFuture()
1762	+ {
1763	+ return $this->gt(static::now($this->getTimezone()));
1764	+ }
1765	+
1766	+ /**
1767	+ * Determines if the instance is in the past, ie. less (before) than now
1768	+ *
1769	+ * @return bool
1770	+ */
1771	+ public function isPast()
1772	+ {
1773	+ return $this->lt(static::now($this->getTimezone()));
1774	+ }
1775	+
1776	+ /**
1777	+ * Determines if the instance is a leap year
1778	+ *
1779	+ * @return bool
1780	+ */
1781	+ public function isLeapYear()
1782	+ {
1783	+ return $this->format('L') === '1';
1784	+ }
1785	+
1786	+ /**
1787	+ * Determines if the instance is a long year
1788	+ *
1789	+ * @see https://en.wikipedia.org/wiki/ISO_8601#Week_dates
1790	+ *
1791	+ * @return bool
1792	+ */
1793	+ public function isLongYear()
1794	+ {
1795	+ return static::create($this->year, 12, 28, 0, 0, 0, $this->tz)->weekOfYear === 53;
1796	+ }
1797	+
1798	+ /*
1799	+ * Compares the formatted values of the two dates.
1800	+ *
1801	+ * @param string $format The date formats to compare.
1802	+ * @param \Carbon\Carbon\|null $dt The instance to compare with or null to use current day.
1803	+ *
1804	+ * @return bool
1805	+ */
1806	+ public function isSameAs($format, Carbon $dt = null)
1807	+ {
1808	+ $dt = $dt ?: static::now($this->tz);
1809	+
1810	+ return $this->format($format) === $dt->format($format);
1811	+ }
1812	+
1813	+ /**
1814	+ * Determines if the instance is in the current year
1815	+ *
1816	+ * @return bool
1817	+ */
1818	+ public function isCurrentYear()
1819	+ {
1820	+ return $this->isSameYear();
1821	+ }
1822	+
1823	+ /**
1824	+ * Checks if the passed in date is in the same year as the instance year.
1825	+ *
1826	+ * @param \Carbon\Carbon\|null $dt The instance to compare with or null to use current day.
1827	+ *
1828	+ * @return bool
1829	+ */
1830	+ public function isSameYear(Carbon $dt = null)
1831	+ {
1832	+ return $this->isSameAs('Y', $dt);
1833	+ }
1834	+
1835	+ /**
1836	+ * Determines if the instance is in the current month
1837	+ *
1838	+ * @return bool
1839	+ */
1840	+ public function isCurrentMonth()
1841	+ {
1842	+ return $this->isSameMonth();
1843	+ }
1844	+
1845	+ /**
1846	+ * Checks if the passed in date is in the same month as the instance month (and year if needed).
1847	+ *
1848	+ * @param \Carbon\Carbon\|null $dt The instance to compare with or null to use current day.
1849	+ * @param bool $ofSameYear Check if it is the same month in the same year.
1850	+ *
1851	+ * @return bool
1852	+ */
1853	+ public function isSameMonth(Carbon $dt = null, $ofSameYear = false)
1854	+ {
1855	+ $format = $ofSameYear ? 'Y-m' : 'm';
1856	+
1857	+ return $this->isSameAs($format, $dt);
1858	+ }
1859	+
1860	+ /**
1861	+ * Checks if the passed in date is the same day as the instance current day.
1862	+ *
1863	+ * @param \Carbon\Carbon $dt
1864	+ *
1865	+ * @return bool
1866	+ */
1867	+ public function isSameDay(Carbon $dt)
1868	+ {
1869	+ return $this->toDateString() === $dt->toDateString();
1870	+ }
1871	+
1872	+ /**
1873	+ * Checks if this day is a Sunday.
1874	+ *
1875	+ * @return bool
1876	+ */
1877	+ public function isSunday()
1878	+ {
1879	+ return $this->dayOfWeek === static::SUNDAY;
1880	+ }
1881	+
1882	+ /**
1883	+ * Checks if this day is a Monday.
1884	+ *
1885	+ * @return bool
1886	+ */
1887	+ public function isMonday()
1888	+ {
1889	+ return $this->dayOfWeek === static::MONDAY;
1890	+ }
1891	+
1892	+ /**
1893	+ * Checks if this day is a Tuesday.
1894	+ *
1895	+ * @return bool
1896	+ */
1897	+ public function isTuesday()
1898	+ {
1899	+ return $this->dayOfWeek === static::TUESDAY;
1900	+ }
1901	+
1902	+ /**
1903	+ * Checks if this day is a Wednesday.
1904	+ *
1905	+ * @return bool
1906	+ */
1907	+ public function isWednesday()
1908	+ {
1909	+ return $this->dayOfWeek === static::WEDNESDAY;
1910	+ }
1911	+
1912	+ /**
1913	+ * Checks if this day is a Thursday.
1914	+ *
1915	+ * @return bool
1916	+ */
1917	+ public function isThursday()
1918	+ {
1919	+ return $this->dayOfWeek === static::THURSDAY;
1920	+ }
1921	+
1922	+ /**
1923	+ * Checks if this day is a Friday.
1924	+ *
1925	+ * @return bool
1926	+ */
1927	+ public function isFriday()
1928	+ {
1929	+ return $this->dayOfWeek === static::FRIDAY;
1930	+ }
1931	+
1932	+ /**
1933	+ * Checks if this day is a Saturday.
1934	+ *
1935	+ * @return bool
1936	+ */
1937	+ public function isSaturday()
1938	+ {
1939	+ return $this->dayOfWeek === static::SATURDAY;
1940	+ }
1941	+
1942	+ ///////////////////////////////////////////////////////////////////
1943	+ /////////////////// ADDITIONS AND SUBTRACTIONS ////////////////////
1944	+ ///////////////////////////////////////////////////////////////////
1945	+
1946	+ /**
1947	+ * Add years to the instance. Positive $value travel forward while
1948	+ * negative $value travel into the past.
1949	+ *
1950	+ * @param int $value
1951	+ *
1952	+ * @return static
1953	+ */
1954	+ public function addYears($value)
1955	+ {
1956	+ return $this->modify((int) $value.' year');
1957	+ }
1958	+
1959	+ /**
1960	+ * Add a year to the instance
1961	+ *
1962	+ * @param int $value
1963	+ *
1964	+ * @return static
1965	+ */
1966	+ public function addYear($value = 1)
1967	+ {
1968	+ return $this->addYears($value);
1969	+ }
1970	+
1971	+ /**
1972	+ * Remove a year from the instance
1973	+ *
1974	+ * @param int $value
1975	+ *
1976	+ * @return static
1977	+ */
1978	+ public function subYear($value = 1)
1979	+ {
1980	+ return $this->subYears($value);
1981	+ }
1982	+
1983	+ /**
1984	+ * Remove years from the instance.
1985	+ *
1986	+ * @param int $value
1987	+ *
1988	+ * @return static
1989	+ */
1990	+ public function subYears($value)
1991	+ {
1992	+ return $this->addYears(-1 * $value);
1993	+ }
1994	+
1995	+ /**
1996	+ * Add quarters to the instance. Positive $value travels forward while
1997	+ * negative $value travels into the past.
1998	+ *
1999	+ * @param int $value
2000	+ *
2001	+ * @return static
2002	+ */
2003	+ public function addQuarters($value)
2004	+ {
2005	+ return $this->addMonths(static::MONTHS_PER_QUARTER * $value);
2006	+ }
2007	+
2008	+ /**
2009	+ * Add a quarter to the instance
2010	+ *
2011	+ * @param int $value
2012	+ *
2013	+ * @return static
2014	+ */
2015	+ public function addQuarter($value = 1)
2016	+ {
2017	+ return $this->addQuarters($value);
2018	+ }
2019	+
2020	+ /**
2021	+ * Remove a quarter from the instance
2022	+ *
2023	+ * @param int $value
2024	+ *
2025	+ * @return static
2026	+ */
2027	+ public function subQuarter($value = 1)
2028	+ {
2029	+ return $this->subQuarters($value);
2030	+ }
2031	+
2032	+ /**
2033	+ * Remove quarters from the instance
2034	+ *
2035	+ * @param int $value
2036	+ *
2037	+ * @return static
2038	+ */
2039	+ public function subQuarters($value)
2040	+ {
2041	+ return $this->addQuarters(-1 * $value);
2042	+ }
2043	+
2044	+ /**
2045	+ * Add centuries to the instance. Positive $value travels forward while
2046	+ * negative $value travels into the past.
2047	+ *
2048	+ * @param int $value
2049	+ *
2050	+ * @return static
2051	+ */
2052	+ public function addCenturies($value)
2053	+ {
2054	+ return $this->addYears(static::YEARS_PER_CENTURY * $value);
2055	+ }
2056	+
2057	+ /**
2058	+ * Add a century to the instance
2059	+ *
2060	+ * @param int $value
2061	+ *
2062	+ * @return static
2063	+ */
2064	+ public function addCentury($value = 1)
2065	+ {
2066	+ return $this->addCenturies($value);
2067	+ }
2068	+
2069	+ /**
2070	+ * Remove a century from the instance
2071	+ *
2072	+ * @param int $value
2073	+ *
2074	+ * @return static
2075	+ */
2076	+ public function subCentury($value = 1)
2077	+ {
2078	+ return $this->subCenturies($value);
2079	+ }
2080	+
2081	+ /**
2082	+ * Remove centuries from the instance
2083	+ *
2084	+ * @param int $value
2085	+ *
2086	+ * @return static
2087	+ */
2088	+ public function subCenturies($value)
2089	+ {
2090	+ return $this->addCenturies(-1 * $value);
2091	+ }
2092	+
2093	+ /**
2094	+ * Add months to the instance. Positive $value travels forward while
2095	+ * negative $value travels into the past.
2096	+ *
2097	+ * @param int $value
2098	+ *
2099	+ * @return static
2100	+ */
2101	+ public function addMonths($value)
2102	+ {
2103	+ if (static::shouldOverflowMonths()) {
2104	+ return $this->addMonthsWithOverflow($value);
2105	+ }
2106	+
2107	+ return $this->addMonthsNoOverflow($value);
2108	+ }
2109	+
2110	+ /**
2111	+ * Add a month to the instance
2112	+ *
2113	+ * @param int $value
2114	+ *
2115	+ * @return static
2116	+ */
2117	+ public function addMonth($value = 1)
2118	+ {
2119	+ return $this->addMonths($value);
2120	+ }
2121	+
2122	+ /**
2123	+ * Remove a month from the instance
2124	+ *
2125	+ * @param int $value
2126	+ *
2127	+ * @return static
2128	+ */
2129	+ public function subMonth($value = 1)
2130	+ {
2131	+ return $this->subMonths($value);
2132	+ }
2133	+
2134	+ /**
2135	+ * Remove months from the instance
2136	+ *
2137	+ * @param int $value
2138	+ *
2139	+ * @return static
2140	+ */
2141	+ public function subMonths($value)
2142	+ {
2143	+ return $this->addMonths(-1 * $value);
2144	+ }
2145	+
2146	+ /**
2147	+ * Add months to the instance. Positive $value travels forward while
2148	+ * negative $value travels into the past.
2149	+ *
2150	+ * @param int $value
2151	+ *
2152	+ * @return static
2153	+ */
2154	+ public function addMonthsWithOverflow($value)
2155	+ {
2156	+ return $this->modify((int) $value.' month');
2157	+ }
2158	+
2159	+ /**
2160	+ * Add a month to the instance
2161	+ *
2162	+ * @param int $value
2163	+ *
2164	+ * @return static
2165	+ */
2166	+ public function addMonthWithOverflow($value = 1)
2167	+ {
2168	+ return $this->addMonthsWithOverflow($value);
2169	+ }
2170	+
2171	+ /**
2172	+ * Remove a month from the instance
2173	+ *
2174	+ * @param int $value
2175	+ *
2176	+ * @return static
2177	+ */
2178	+ public function subMonthWithOverflow($value = 1)
2179	+ {
2180	+ return $this->subMonthsWithOverflow($value);
2181	+ }
2182	+
2183	+ /**
2184	+ * Remove months from the instance
2185	+ *
2186	+ * @param int $value
2187	+ *
2188	+ * @return static
2189	+ */
2190	+ public function subMonthsWithOverflow($value)
2191	+ {
2192	+ return $this->addMonthsWithOverflow(-1 * $value);
2193	+ }
2194	+
2195	+ /**
2196	+ * Add months without overflowing to the instance. Positive $value
2197	+ * travels forward while negative $value travels into the past.
2198	+ *
2199	+ * @param int $value
2200	+ *
2201	+ * @return static
2202	+ */
2203	+ public function addMonthsNoOverflow($value)
2204	+ {
2205	+ $day = $this->day;
2206	+
2207	+ $this->modify((int) $value.' month');
2208	+
2209	+ if ($day !== $this->day) {
2210	+ $this->modify('last day of previous month');
2211	+ }
2212	+
2213	+ return $this;
2214	+ }
2215	+
2216	+ /**
2217	+ * Add a month with no overflow to the instance
2218	+ *
2219	+ * @param int $value
2220	+ *
2221	+ * @return static
2222	+ */
2223	+ public function addMonthNoOverflow($value = 1)
2224	+ {
2225	+ return $this->addMonthsNoOverflow($value);
2226	+ }
2227	+
2228	+ /**
2229	+ * Remove a month with no overflow from the instance
2230	+ *
2231	+ * @param int $value
2232	+ *
2233	+ * @return static
2234	+ */
2235	+ public function subMonthNoOverflow($value = 1)
2236	+ {
2237	+ return $this->subMonthsNoOverflow($value);
2238	+ }
2239	+
2240	+ /**
2241	+ * Remove months with no overflow from the instance
2242	+ *
2243	+ * @param int $value
2244	+ *
2245	+ * @return static
2246	+ */
2247	+ public function subMonthsNoOverflow($value)
2248	+ {
2249	+ return $this->addMonthsNoOverflow(-1 * $value);
2250	+ }
2251	+
2252	+ /**
2253	+ * Add days to the instance. Positive $value travels forward while
2254	+ * negative $value travels into the past.
2255	+ *
2256	+ * @param int $value
2257	+ *
2258	+ * @return static
2259	+ */
2260	+ public function addDays($value)
2261	+ {
2262	+ return $this->modify((int) $value.' day');
2263	+ }
2264	+
2265	+ /**
2266	+ * Add a day to the instance
2267	+ *
2268	+ * @param int $value
2269	+ *
2270	+ * @return static
2271	+ */
2272	+ public function addDay($value = 1)
2273	+ {
2274	+ return $this->addDays($value);
2275	+ }
2276	+
2277	+ /**
2278	+ * Remove a day from the instance
2279	+ *
2280	+ * @param int $value
2281	+ *
2282	+ * @return static
2283	+ */
2284	+ public function subDay($value = 1)
2285	+ {
2286	+ return $this->subDays($value);
2287	+ }
2288	+
2289	+ /**
2290	+ * Remove days from the instance
2291	+ *
2292	+ * @param int $value
2293	+ *
2294	+ * @return static
2295	+ */
2296	+ public function subDays($value)
2297	+ {
2298	+ return $this->addDays(-1 * $value);
2299	+ }
2300	+
2301	+ /**
2302	+ * Add weekdays to the instance. Positive $value travels forward while
2303	+ * negative $value travels into the past.
2304	+ *
2305	+ * @param int $value
2306	+ *
2307	+ * @return static
2308	+ */
2309	+ public function addWeekdays($value)
2310	+ {
2311	+ // fix for https://bugs.php.net/bug.php?id=54909
2312	+ $t = $this->toTimeString();
2313	+ $this->modify((int) $value.' weekday');
2314	+
2315	+ return $this->setTimeFromTimeString($t);
2316	+ }
2317	+
2318	+ /**
2319	+ * Add a weekday to the instance
2320	+ *
2321	+ * @param int $value
2322	+ *
2323	+ * @return static
2324	+ */
2325	+ public function addWeekday($value = 1)
2326	+ {
2327	+ return $this->addWeekdays($value);
2328	+ }
2329	+
2330	+ /**
2331	+ * Remove a weekday from the instance
2332	+ *
2333	+ * @param int $value
2334	+ *
2335	+ * @return static
2336	+ */
2337	+ public function subWeekday($value = 1)
2338	+ {
2339	+ return $this->subWeekdays($value);
2340	+ }
2341	+
2342	+ /**
2343	+ * Remove weekdays from the instance
2344	+ *
2345	+ * @param int $value
2346	+ *
2347	+ * @return static
2348	+ */
2349	+ public function subWeekdays($value)
2350	+ {
2351	+ return $this->addWeekdays(-1 * $value);
2352	+ }
2353	+
2354	+ /**
2355	+ * Add weeks to the instance. Positive $value travels forward while
2356	+ * negative $value travels into the past.
2357	+ *
2358	+ * @param int $value
2359	+ *
2360	+ * @return static
2361	+ */
2362	+ public function addWeeks($value)
2363	+ {
2364	+ return $this->modify((int) $value.' week');
2365	+ }
2366	+
2367	+ /**
2368	+ * Add a week to the instance
2369	+ *
2370	+ * @param int $value
2371	+ *
2372	+ * @return static
2373	+ */
2374	+ public function addWeek($value = 1)
2375	+ {
2376	+ return $this->addWeeks($value);
2377	+ }
2378	+
2379	+ /**
2380	+ * Remove a week from the instance
2381	+ *
2382	+ * @param int $value
2383	+ *
2384	+ * @return static
2385	+ */
2386	+ public function subWeek($value = 1)
2387	+ {
2388	+ return $this->subWeeks($value);
2389	+ }
2390	+
2391	+ /**
2392	+ * Remove weeks to the instance
2393	+ *
2394	+ * @param int $value
2395	+ *
2396	+ * @return static
2397	+ */
2398	+ public function subWeeks($value)
2399	+ {
2400	+ return $this->addWeeks(-1 * $value);
2401	+ }
2402	+
2403	+ /**
2404	+ * Add hours to the instance. Positive $value travels forward while
2405	+ * negative $value travels into the past.
2406	+ *
2407	+ * @param int $value
2408	+ *
2409	+ * @return static
2410	+ */
2411	+ public function addHours($value)
2412	+ {
2413	+ return $this->modify((int) $value.' hour');
2414	+ }
2415	+
2416	+ /**
2417	+ * Add an hour to the instance
2418	+ *
2419	+ * @param int $value
2420	+ *
2421	+ * @return static
2422	+ */
2423	+ public function addHour($value = 1)
2424	+ {
2425	+ return $this->addHours($value);
2426	+ }
2427	+
2428	+ /**
2429	+ * Remove an hour from the instance
2430	+ *
2431	+ * @param int $value
2432	+ *
2433	+ * @return static
2434	+ */
2435	+ public function subHour($value = 1)
2436	+ {
2437	+ return $this->subHours($value);
2438	+ }
2439	+
2440	+ /**
2441	+ * Remove hours from the instance
2442	+ *
2443	+ * @param int $value
2444	+ *
2445	+ * @return static
2446	+ */
2447	+ public function subHours($value)
2448	+ {
2449	+ return $this->addHours(-1 * $value);
2450	+ }
2451	+
2452	+ /**
2453	+ * Add minutes to the instance. Positive $value travels forward while
2454	+ * negative $value travels into the past.
2455	+ *
2456	+ * @param int $value
2457	+ *
2458	+ * @return static
2459	+ */
2460	+ public function addMinutes($value)
2461	+ {
2462	+ return $this->modify((int) $value.' minute');
2463	+ }
2464	+
2465	+ /**
2466	+ * Add a minute to the instance
2467	+ *
2468	+ * @param int $value
2469	+ *
2470	+ * @return static
2471	+ */
2472	+ public function addMinute($value = 1)
2473	+ {
2474	+ return $this->addMinutes($value);
2475	+ }
2476	+
2477	+ /**
2478	+ * Remove a minute from the instance
2479	+ *
2480	+ * @param int $value
2481	+ *
2482	+ * @return static
2483	+ */
2484	+ public function subMinute($value = 1)
2485	+ {
2486	+ return $this->subMinutes($value);
2487	+ }
2488	+
2489	+ /**
2490	+ * Remove minutes from the instance
2491	+ *
2492	+ * @param int $value
2493	+ *
2494	+ * @return static
2495	+ */
2496	+ public function subMinutes($value)
2497	+ {
2498	+ return $this->addMinutes(-1 * $value);
2499	+ }
2500	+
2501	+ /**
2502	+ * Add seconds to the instance. Positive $value travels forward while
2503	+ * negative $value travels into the past.
2504	+ *
2505	+ * @param int $value
2506	+ *
2507	+ * @return static
2508	+ */
2509	+ public function addSeconds($value)
2510	+ {
2511	+ return $this->modify((int) $value.' second');
2512	+ }
2513	+
2514	+ /**
2515	+ * Add a second to the instance
2516	+ *
2517	+ * @param int $value
2518	+ *
2519	+ * @return static
2520	+ */
2521	+ public function addSecond($value = 1)
2522	+ {
2523	+ return $this->addSeconds($value);
2524	+ }
2525	+
2526	+ /**
2527	+ * Remove a second from the instance
2528	+ *
2529	+ * @param int $value
2530	+ *
2531	+ * @return static
2532	+ */
2533	+ public function subSecond($value = 1)
2534	+ {
2535	+ return $this->subSeconds($value);
2536	+ }
2537	+
2538	+ /**
2539	+ * Remove seconds from the instance
2540	+ *
2541	+ * @param int $value
2542	+ *
2543	+ * @return static
2544	+ */
2545	+ public function subSeconds($value)
2546	+ {
2547	+ return $this->addSeconds(-1 * $value);
2548	+ }
2549	+
2550	+ ///////////////////////////////////////////////////////////////////
2551	+ /////////////////////////// DIFFERENCES ///////////////////////////
2552	+ ///////////////////////////////////////////////////////////////////
2553	+
2554	+ /**
2555	+ * Get the difference in years
2556	+ *
2557	+ * @param \Carbon\Carbon\|null $dt
2558	+ * @param bool $abs Get the absolute of the difference
2559	+ *
2560	+ * @return int
2561	+ */
2562	+ public function diffInYears(Carbon $dt = null, $abs = true)
2563	+ {
2564	+ $dt = $dt ?: static::now($this->getTimezone());
2565	+
2566	+ return (int) $this->diff($dt, $abs)->format('%r%y');
2567	+ }
2568	+
2569	+ /**
2570	+ * Get the difference in months
2571	+ *
2572	+ * @param \Carbon\Carbon\|null $dt
2573	+ * @param bool $abs Get the absolute of the difference
2574	+ *
2575	+ * @return int
2576	+ */
2577	+ public function diffInMonths(Carbon $dt = null, $abs = true)
2578	+ {
2579	+ $dt = $dt ?: static::now($this->getTimezone());
2580	+
2581	+ return $this->diffInYears($dt, $abs) * static::MONTHS_PER_YEAR + (int) $this->diff($dt, $abs)->format('%r%m');
2582	+ }
2583	+
2584	+ /**
2585	+ * Get the difference in weeks
2586	+ *
2587	+ * @param \Carbon\Carbon\|null $dt
2588	+ * @param bool $abs Get the absolute of the difference
2589	+ *
2590	+ * @return int
2591	+ */
2592	+ public function diffInWeeks(Carbon $dt = null, $abs = true)
2593	+ {
2594	+ return (int) ($this->diffInDays($dt, $abs) / static::DAYS_PER_WEEK);
2595	+ }
2596	+
2597	+ /**
2598	+ * Get the difference in days
2599	+ *
2600	+ * @param \Carbon\Carbon\|null $dt
2601	+ * @param bool $abs Get the absolute of the difference
2602	+ *
2603	+ * @return int
2604	+ */
2605	+ public function diffInDays(Carbon $dt = null, $abs = true)
2606	+ {
2607	+ $dt = $dt ?: static::now($this->getTimezone());
2608	+
2609	+ return (int) $this->diff($dt, $abs)->format('%r%a');
2610	+ }
2611	+
2612	+ /**
2613	+ * Get the difference in days using a filter closure
2614	+ *
2615	+ * @param Closure $callback
2616	+ * @param \Carbon\Carbon\|null $dt
2617	+ * @param bool $abs Get the absolute of the difference
2618	+ *
2619	+ * @return int
2620	+ */
2621	+ public function diffInDaysFiltered(Closure $callback, Carbon $dt = null, $abs = true)
2622	+ {
2623	+ return $this->diffFiltered(CarbonInterval::day(), $callback, $dt, $abs);
2624	+ }
2625	+
2626	+ /**
2627	+ * Get the difference in hours using a filter closure
2628	+ *
2629	+ * @param Closure $callback
2630	+ * @param \Carbon\Carbon\|null $dt
2631	+ * @param bool $abs Get the absolute of the difference
2632	+ *
2633	+ * @return int
2634	+ */
2635	+ public function diffInHoursFiltered(Closure $callback, Carbon $dt = null, $abs = true)
2636	+ {
2637	+ return $this->diffFiltered(CarbonInterval::hour(), $callback, $dt, $abs);
2638	+ }
2639	+
2640	+ /**
2641	+ * Get the difference by the given interval using a filter closure
2642	+ *
2643	+ * @param CarbonInterval $ci An interval to traverse by
2644	+ * @param Closure $callback
2645	+ * @param Carbon\|null $dt
2646	+ * @param bool $abs Get the absolute of the difference
2647	+ *
2648	+ * @return int
2649	+ */
2650	+ public function diffFiltered(CarbonInterval $ci, Closure $callback, Carbon $dt = null, $abs = true)
2651	+ {
2652	+ $start = $this;
2653	+ $end = $dt ?: static::now($this->getTimezone());
2654	+ $inverse = false;
2655	+
2656	+ if ($end < $start) {
2657	+ $start = $end;
2658	+ $end = $this;
2659	+ $inverse = true;
2660	+ }
2661	+
2662	+ $period = new DatePeriod($start, $ci, $end);
2663	+ $vals = array_filter(iterator_to_array($period), function (DateTime $date) use ($callback) {
2664	+ return call_user_func($callback, Carbon::instance($date));
2665	+ });
2666	+
2667	+ $diff = count($vals);
2668	+
2669	+ return $inverse && !$abs ? -$diff : $diff;
2670	+ }
2671	+
2672	+ /**
2673	+ * Get the difference in weekdays
2674	+ *
2675	+ * @param \Carbon\Carbon\|null $dt
2676	+ * @param bool $abs Get the absolute of the difference
2677	+ *
2678	+ * @return int
2679	+ */
2680	+ public function diffInWeekdays(Carbon $dt = null, $abs = true)
2681	+ {
2682	+ return $this->diffInDaysFiltered(function (Carbon $date) {
2683	+ return $date->isWeekday();
2684	+ }, $dt, $abs);
2685	+ }
2686	+
2687	+ /**
2688	+ * Get the difference in weekend days using a filter
2689	+ *
2690	+ * @param \Carbon\Carbon\|null $dt
2691	+ * @param bool $abs Get the absolute of the difference
2692	+ *
2693	+ * @return int
2694	+ */
2695	+ public function diffInWeekendDays(Carbon $dt = null, $abs = true)
2696	+ {
2697	+ return $this->diffInDaysFiltered(function (Carbon $date) {
2698	+ return $date->isWeekend();
2699	+ }, $dt, $abs);
2700	+ }
2701	+
2702	+ /**
2703	+ * Get the difference in hours
2704	+ *
2705	+ * @param \Carbon\Carbon\|null $dt
2706	+ * @param bool $abs Get the absolute of the difference
2707	+ *
2708	+ * @return int
2709	+ */
2710	+ public function diffInHours(Carbon $dt = null, $abs = true)
2711	+ {
2712	+ return (int) ($this->diffInSeconds($dt, $abs) / static::SECONDS_PER_MINUTE / static::MINUTES_PER_HOUR);
2713	+ }
2714	+
2715	+ /**
2716	+ * Get the difference in minutes
2717	+ *
2718	+ * @param \Carbon\Carbon\|null $dt
2719	+ * @param bool $abs Get the absolute of the difference
2720	+ *
2721	+ * @return int
2722	+ */
2723	+ public function diffInMinutes(Carbon $dt = null, $abs = true)
2724	+ {
2725	+ return (int) ($this->diffInSeconds($dt, $abs) / static::SECONDS_PER_MINUTE);
2726	+ }
2727	+
2728	+ /**
2729	+ * Get the difference in seconds
2730	+ *
2731	+ * @param \Carbon\Carbon\|null $dt
2732	+ * @param bool $abs Get the absolute of the difference
2733	+ *
2734	+ * @return int
2735	+ */
2736	+ public function diffInSeconds(Carbon $dt = null, $abs = true)
2737	+ {
2738	+ $dt = $dt ?: static::now($this->getTimezone());
2739	+ $value = $dt->getTimestamp() - $this->getTimestamp();
2740	+
2741	+ return $abs ? abs($value) : $value;
2742	+ }
2743	+
2744	+ /**
2745	+ * The number of seconds since midnight.
2746	+ *
2747	+ * @return int
2748	+ */
2749	+ public function secondsSinceMidnight()
2750	+ {
2751	+ return $this->diffInSeconds($this->copy()->startOfDay());
2752	+ }
2753	+
2754	+ /**
2755	+ * The number of seconds until 23:23:59.
2756	+ *
2757	+ * @return int
2758	+ */
2759	+ public function secondsUntilEndOfDay()
2760	+ {
2761	+ return $this->diffInSeconds($this->copy()->endOfDay());
2762	+ }
2763	+
2764	+ /**
2765	+ * Get the difference in a human readable format in the current locale.
2766	+ *
2767	+ * When comparing a value in the past to default now:
2768	+ * 1 hour ago
2769	+ * 5 months ago
2770	+ *
2771	+ * When comparing a value in the future to default now:
2772	+ * 1 hour from now
2773	+ * 5 months from now
2774	+ *
2775	+ * When comparing a value in the past to another value:
2776	+ * 1 hour before
2777	+ * 5 months before
2778	+ *
2779	+ * When comparing a value in the future to another value:
2780	+ * 1 hour after
2781	+ * 5 months after
2782	+ *
2783	+ * @param Carbon\|null $other
2784	+ * @param bool $absolute removes time difference modifiers ago, after, etc
2785	+ * @param bool $short displays short format of time units
2786	+ *
2787	+ * @return string
2788	+ */
2789	+ public function diffForHumans(Carbon $other = null, $absolute = false, $short = false)
2790	+ {
2791	+ $isNow = $other === null;
2792	+
2793	+ if ($isNow) {
2794	+ $other = static::now($this->getTimezone());
2795	+ }
2796	+
2797	+ $diffInterval = $this->diff($other);
2798	+
2799	+ switch (true) {
2800	+ case $diffInterval->y > 0:
2801	+ $unit = $short ? 'y' : 'year';
2802	+ $count = $diffInterval->y;
2803	+ break;
2804	+
2805	+ case $diffInterval->m > 0:
2806	+ $unit = $short ? 'm' : 'month';
2807	+ $count = $diffInterval->m;
2808	+ break;
2809	+
2810	+ case $diffInterval->d > 0:
2811	+ $unit = $short ? 'd' : 'day';
2812	+ $count = $diffInterval->d;
2813	+
2814	+ if ($count >= static::DAYS_PER_WEEK) {
2815	+ $unit = $short ? 'w' : 'week';
2816	+ $count = (int) ($count / static::DAYS_PER_WEEK);
2817	+ }
2818	+ break;
2819	+
2820	+ case $diffInterval->h > 0:
2821	+ $unit = $short ? 'h' : 'hour';
2822	+ $count = $diffInterval->h;
2823	+ break;
2824	+
2825	+ case $diffInterval->i > 0:
2826	+ $unit = $short ? 'min' : 'minute';
2827	+ $count = $diffInterval->i;
2828	+ break;
2829	+
2830	+ default:
2831	+ $count = $diffInterval->s;
2832	+ $unit = $short ? 's' : 'second';
2833	+ break;
2834	+ }
2835	+
2836	+ if ($count === 0) {
2837	+ $count = 1;
2838	+ }
2839	+
2840	+ $time = static::translator()->transChoice($unit, $count, array(':count' => $count));
2841	+
2842	+ if ($absolute) {
2843	+ return $time;
2844	+ }
2845	+
2846	+ $isFuture = $diffInterval->invert === 1;
2847	+
2848	+ $transId = $isNow ? ($isFuture ? 'from_now' : 'ago') : ($isFuture ? 'after' : 'before');
2849	+
2850	+ // Some langs have special pluralization for past and future tense.
2851	+ $tryKeyExists = $unit.'_'.$transId;
2852	+ if ($tryKeyExists !== static::translator()->transChoice($tryKeyExists, $count)) {
2853	+ $time = static::translator()->transChoice($tryKeyExists, $count, array(':count' => $count));
2854	+ }
2855	+
2856	+ return static::translator()->trans($transId, array(':time' => $time));
2857	+ }
2858	+
2859	+ ///////////////////////////////////////////////////////////////////
2860	+ //////////////////////////// MODIFIERS ////////////////////////////
2861	+ ///////////////////////////////////////////////////////////////////
2862	+
2863	+ /**
2864	+ * Resets the time to 00:00:00
2865	+ *
2866	+ * @return static
2867	+ */
2868	+ public function startOfDay()
2869	+ {
2870	+ return $this->setTime(0, 0, 0);
2871	+ }
2872	+
2873	+ /**
2874	+ * Resets the time to 23:59:59
2875	+ *
2876	+ * @return static
2877	+ */
2878	+ public function endOfDay()
2879	+ {
2880	+ return $this->setTime(23, 59, 59);
2881	+ }
2882	+
2883	+ /**
2884	+ * Resets the date to the first day of the month and the time to 00:00:00
2885	+ *
2886	+ * @return static
2887	+ */
2888	+ public function startOfMonth()
2889	+ {
2890	+ return $this->setDateTime($this->year, $this->month, 1, 0, 0, 0);
2891	+ }
2892	+
2893	+ /**
2894	+ * Resets the date to end of the month and time to 23:59:59
2895	+ *
2896	+ * @return static
2897	+ */
2898	+ public function endOfMonth()
2899	+ {
2900	+ return $this->setDateTime($this->year, $this->month, $this->daysInMonth, 23, 59, 59);
2901	+ }
2902	+
2903	+ /**
2904	+ * Resets the date to the first day of the quarter and the time to 00:00:00
2905	+ *
2906	+ * @return static
2907	+ */
2908	+ public function startOfQuarter()
2909	+ {
2910	+ $month = ($this->quarter - 1) * static::MONTHS_PER_QUARTER + 1;
2911	+
2912	+ return $this->setDateTime($this->year, $month, 1, 0, 0, 0);
2913	+ }
2914	+
2915	+ /**
2916	+ * Resets the date to end of the quarter and time to 23:59:59
2917	+ *
2918	+ * @return static
2919	+ */
2920	+ public function endOfQuarter()
2921	+ {
2922	+ return $this->startOfQuarter()->addMonths(static::MONTHS_PER_QUARTER - 1)->endOfMonth();
2923	+ }
2924	+
2925	+ /**
2926	+ * Resets the date to the first day of the year and the time to 00:00:00
2927	+ *
2928	+ * @return static
2929	+ */
2930	+ public function startOfYear()
2931	+ {
2932	+ return $this->setDateTime($this->year, 1, 1, 0, 0, 0);
2933	+ }
2934	+
2935	+ /**
2936	+ * Resets the date to end of the year and time to 23:59:59
2937	+ *
2938	+ * @return static
2939	+ */
2940	+ public function endOfYear()
2941	+ {
2942	+ return $this->setDateTime($this->year, 12, 31, 23, 59, 59);
2943	+ }
2944	+
2945	+ /**
2946	+ * Resets the date to the first day of the decade and the time to 00:00:00
2947	+ *
2948	+ * @return static
2949	+ */
2950	+ public function startOfDecade()
2951	+ {
2952	+ $year = $this->year - $this->year % static::YEARS_PER_DECADE;
2953	+
2954	+ return $this->setDateTime($year, 1, 1, 0, 0, 0);
2955	+ }
2956	+
2957	+ /**
2958	+ * Resets the date to end of the decade and time to 23:59:59
2959	+ *
2960	+ * @return static
2961	+ */
2962	+ public function endOfDecade()
2963	+ {
2964	+ $year = $this->year - $this->year % static::YEARS_PER_DECADE + static::YEARS_PER_DECADE - 1;
2965	+
2966	+ return $this->setDateTime($year, 12, 31, 23, 59, 59);
2967	+ }
2968	+
2969	+ /**
2970	+ * Resets the date to the first day of the century and the time to 00:00:00
2971	+ *
2972	+ * @return static
2973	+ */
2974	+ public function startOfCentury()
2975	+ {
2976	+ $year = $this->year - ($this->year - 1) % static::YEARS_PER_CENTURY;
2977	+
2978	+ return $this->setDateTime($year, 1, 1, 0, 0, 0);
2979	+ }
2980	+
2981	+ /**
2982	+ * Resets the date to end of the century and time to 23:59:59
2983	+ *
2984	+ * @return static
2985	+ */
2986	+ public function endOfCentury()
2987	+ {
2988	+ $year = $this->year - 1 - ($this->year - 1) % static::YEARS_PER_CENTURY + static::YEARS_PER_CENTURY;
2989	+
2990	+ return $this->setDateTime($year, 12, 31, 23, 59, 59);
2991	+ }
2992	+
2993	+ /**
2994	+ * Resets the date to the first day of week (defined in $weekStartsAt) and the time to 00:00:00
2995	+ *
2996	+ * @return static
2997	+ */
2998	+ public function startOfWeek()
2999	+ {
3000	+ while ($this->dayOfWeek !== static::$weekStartsAt) {
3001	+ $this->subDay();
3002	+ }
3003	+
3004	+ return $this->startOfDay();
3005	+ }
3006	+
3007	+ /**
3008	+ * Resets the date to end of week (defined in $weekEndsAt) and time to 23:59:59
3009	+ *
3010	+ * @return static
3011	+ */
3012	+ public function endOfWeek()
3013	+ {
3014	+ while ($this->dayOfWeek !== static::$weekEndsAt) {
3015	+ $this->addDay();
3016	+ }
3017	+
3018	+ return $this->endOfDay();
3019	+ }
3020	+
3021	+ /**
3022	+ * Modify to the next occurrence of a given day of the week.
3023	+ * If no dayOfWeek is provided, modify to the next occurrence
3024	+ * of the current day of the week. Use the supplied constants
3025	+ * to indicate the desired dayOfWeek, ex. static::MONDAY.
3026	+ *
3027	+ * @param int\|null $dayOfWeek
3028	+ *
3029	+ * @return static
3030	+ */
3031	+ public function next($dayOfWeek = null)
3032	+ {
3033	+ if ($dayOfWeek === null) {
3034	+ $dayOfWeek = $this->dayOfWeek;
3035	+ }
3036	+
3037	+ return $this->startOfDay()->modify('next '.static::$days[$dayOfWeek]);
3038	+ }
3039	+
3040	+ /**
3041	+ * Go forward or backward to the next week- or weekend-day.
3042	+ *
3043	+ * @param bool $weekday
3044	+ * @param bool $forward
3045	+ *
3046	+ * @return static
3047	+ */
3048	+ private function nextOrPreviousDay($weekday = true, $forward = true)
3049	+ {
3050	+ $step = $forward ? 1 : -1;
3051	+
3052	+ do {
3053	+ $this->addDay($step);
3054	+ } while ($weekday ? $this->isWeekend() : $this->isWeekday());
3055	+
3056	+ return $this;
3057	+ }
3058	+
3059	+ /**
3060	+ * Go forward to the next weekday.
3061	+ *
3062	+ * @return $this
3063	+ */
3064	+ public function nextWeekday()
3065	+ {
3066	+ return $this->nextOrPreviousDay();
3067	+ }
3068	+
3069	+ /**
3070	+ * Go backward to the previous weekday.
3071	+ *
3072	+ * @return static
3073	+ */
3074	+ public function previousWeekday()
3075	+ {
3076	+ return $this->nextOrPreviousDay(true, false);
3077	+ }
3078	+
3079	+ /**
3080	+ * Go forward to the next weekend day.
3081	+ *
3082	+ * @return static
3083	+ */
3084	+ public function nextWeekendDay()
3085	+ {
3086	+ return $this->nextOrPreviousDay(false);
3087	+ }
3088	+
3089	+ /**
3090	+ * Go backward to the previous weekend day.
3091	+ *
3092	+ * @return static
3093	+ */
3094	+ public function previousWeekendDay()
3095	+ {
3096	+ return $this->nextOrPreviousDay(false, false);
3097	+ }
3098	+
3099	+ /**
3100	+ * Modify to the previous occurrence of a given day of the week.
3101	+ * If no dayOfWeek is provided, modify to the previous occurrence
3102	+ * of the current day of the week. Use the supplied constants
3103	+ * to indicate the desired dayOfWeek, ex. static::MONDAY.
3104	+ *
3105	+ * @param int\|null $dayOfWeek
3106	+ *
3107	+ * @return static
3108	+ */
3109	+ public function previous($dayOfWeek = null)
3110	+ {
3111	+ if ($dayOfWeek === null) {
3112	+ $dayOfWeek = $this->dayOfWeek;
3113	+ }
3114	+
3115	+ return $this->startOfDay()->modify('last '.static::$days[$dayOfWeek]);
3116	+ }
3117	+
3118	+ /**
3119	+ * Modify to the first occurrence of a given day of the week
3120	+ * in the current month. If no dayOfWeek is provided, modify to the
3121	+ * first day of the current month. Use the supplied constants
3122	+ * to indicate the desired dayOfWeek, ex. static::MONDAY.
3123	+ *
3124	+ * @param int\|null $dayOfWeek
3125	+ *
3126	+ * @return static
3127	+ */
3128	+ public function firstOfMonth($dayOfWeek = null)
3129	+ {
3130	+ $this->startOfDay();
3131	+
3132	+ if ($dayOfWeek === null) {
3133	+ return $this->day(1);
3134	+ }
3135	+
3136	+ return $this->modify('first '.static::$days[$dayOfWeek].' of '.$this->format('F').' '.$this->year);
3137	+ }
3138	+
3139	+ /**
3140	+ * Modify to the last occurrence of a given day of the week
3141	+ * in the current month. If no dayOfWeek is provided, modify to the
3142	+ * last day of the current month. Use the supplied constants
3143	+ * to indicate the desired dayOfWeek, ex. static::MONDAY.
3144	+ *
3145	+ * @param int\|null $dayOfWeek
3146	+ *
3147	+ * @return static
3148	+ */
3149	+ public function lastOfMonth($dayOfWeek = null)
3150	+ {
3151	+ $this->startOfDay();
3152	+
3153	+ if ($dayOfWeek === null) {
3154	+ return $this->day($this->daysInMonth);
3155	+ }
3156	+
3157	+ return $this->modify('last '.static::$days[$dayOfWeek].' of '.$this->format('F').' '.$this->year);
3158	+ }
3159	+
3160	+ /**
3161	+ * Modify to the given occurrence of a given day of the week
3162	+ * in the current month. If the calculated occurrence is outside the scope
3163	+ * of the current month, then return false and no modifications are made.
3164	+ * Use the supplied constants to indicate the desired dayOfWeek, ex. static::MONDAY.
3165	+ *
3166	+ * @param int $nth
3167	+ * @param int $dayOfWeek
3168	+ *
3169	+ * @return mixed
3170	+ */
3171	+ public function nthOfMonth($nth, $dayOfWeek)
3172	+ {
3173	+ $dt = $this->copy()->firstOfMonth();
3174	+ $check = $dt->format('Y-m');
3175	+ $dt->modify('+'.$nth.' '.static::$days[$dayOfWeek]);
3176	+
3177	+ return $dt->format('Y-m') === $check ? $this->modify($dt) : false;
3178	+ }
3179	+
3180	+ /**
3181	+ * Modify to the first occurrence of a given day of the week
3182	+ * in the current quarter. If no dayOfWeek is provided, modify to the
3183	+ * first day of the current quarter. Use the supplied constants
3184	+ * to indicate the desired dayOfWeek, ex. static::MONDAY.
3185	+ *
3186	+ * @param int\|null $dayOfWeek
3187	+ *
3188	+ * @return static
3189	+ */
3190	+ public function firstOfQuarter($dayOfWeek = null)
3191	+ {
3192	+ return $this->setDate($this->year, $this->quarter * static::MONTHS_PER_QUARTER - 2, 1)->firstOfMonth($dayOfWeek);
3193	+ }
3194	+
3195	+ /**
3196	+ * Modify to the last occurrence of a given day of the week
3197	+ * in the current quarter. If no dayOfWeek is provided, modify to the
3198	+ * last day of the current quarter. Use the supplied constants
3199	+ * to indicate the desired dayOfWeek, ex. static::MONDAY.
3200	+ *
3201	+ * @param int\|null $dayOfWeek
3202	+ *
3203	+ * @return static
3204	+ */
3205	+ public function lastOfQuarter($dayOfWeek = null)
3206	+ {
3207	+ return $this->setDate($this->year, $this->quarter * static::MONTHS_PER_QUARTER, 1)->lastOfMonth($dayOfWeek);
3208	+ }
3209	+
3210	+ /**
3211	+ * Modify to the given occurrence of a given day of the week
3212	+ * in the current quarter. If the calculated occurrence is outside the scope
3213	+ * of the current quarter, then return false and no modifications are made.
3214	+ * Use the supplied constants to indicate the desired dayOfWeek, ex. static::MONDAY.
3215	+ *
3216	+ * @param int $nth
3217	+ * @param int $dayOfWeek
3218	+ *
3219	+ * @return mixed
3220	+ */
3221	+ public function nthOfQuarter($nth, $dayOfWeek)
3222	+ {
3223	+ $dt = $this->copy()->day(1)->month($this->quarter * static::MONTHS_PER_QUARTER);
3224	+ $lastMonth = $dt->month;
3225	+ $year = $dt->year;
3226	+ $dt->firstOfQuarter()->modify('+'.$nth.' '.static::$days[$dayOfWeek]);
3227	+
3228	+ return ($lastMonth < $dt->month \|\| $year !== $dt->year) ? false : $this->modify($dt);
3229	+ }
3230	+
3231	+ /**
3232	+ * Modify to the first occurrence of a given day of the week
3233	+ * in the current year. If no dayOfWeek is provided, modify to the
3234	+ * first day of the current year. Use the supplied constants
3235	+ * to indicate the desired dayOfWeek, ex. static::MONDAY.
3236	+ *
3237	+ * @param int\|null $dayOfWeek
3238	+ *
3239	+ * @return static
3240	+ */
3241	+ public function firstOfYear($dayOfWeek = null)
3242	+ {
3243	+ return $this->month(1)->firstOfMonth($dayOfWeek);
3244	+ }
3245	+
3246	+ /**
3247	+ * Modify to the last occurrence of a given day of the week
3248	+ * in the current year. If no dayOfWeek is provided, modify to the
3249	+ * last day of the current year. Use the supplied constants
3250	+ * to indicate the desired dayOfWeek, ex. static::MONDAY.
3251	+ *
3252	+ * @param int\|null $dayOfWeek
3253	+ *
3254	+ * @return static
3255	+ */
3256	+ public function lastOfYear($dayOfWeek = null)
3257	+ {
3258	+ return $this->month(static::MONTHS_PER_YEAR)->lastOfMonth($dayOfWeek);
3259	+ }
3260	+
3261	+ /**
3262	+ * Modify to the given occurrence of a given day of the week
3263	+ * in the current year. If the calculated occurrence is outside the scope
3264	+ * of the current year, then return false and no modifications are made.
3265	+ * Use the supplied constants to indicate the desired dayOfWeek, ex. static::MONDAY.
3266	+ *
3267	+ * @param int $nth
3268	+ * @param int $dayOfWeek
3269	+ *
3270	+ * @return mixed
3271	+ */
3272	+ public function nthOfYear($nth, $dayOfWeek)
3273	+ {
3274	+ $dt = $this->copy()->firstOfYear()->modify('+'.$nth.' '.static::$days[$dayOfWeek]);
3275	+
3276	+ return $this->year === $dt->year ? $this->modify($dt) : false;
3277	+ }
3278	+
3279	+ /**
3280	+ * Modify the current instance to the average of a given instance (default now) and the current instance.
3281	+ *
3282	+ * @param \Carbon\Carbon\|null $dt
3283	+ *
3284	+ * @return static
3285	+ */
3286	+ public function average(Carbon $dt = null)
3287	+ {
3288	+ $dt = $dt ?: static::now($this->getTimezone());
3289	+
3290	+ return $this->addSeconds((int) ($this->diffInSeconds($dt, false) / 2));
3291	+ }
3292	+
3293	+ /**
3294	+ * Check if its the birthday. Compares the date/month values of the two dates.
3295	+ *
3296	+ * @param \Carbon\Carbon\|null $dt The instance to compare with or null to use current day.
3297	+ *
3298	+ * @return bool
3299	+ */
3300	+ public function isBirthday(Carbon $dt = null)
3301	+ {
3302	+ return $this->isSameAs('md', $dt);
3303	+ }
3304	+
3305	+ /**
3306	+ * Consider the timezone when modifying the instance.
3307	+ *
3308	+ * @param string $modify
3309	+ *
3310	+ * @return static
3311	+ */
3312	+ public function modify($modify)
3313	+ {
3314	+ if ($this->local) {
3315	+ return parent::modify($modify);
3316	+ }
3317	+
3318	+ $timezone = $this->getTimezone();
3319	+ $this->setTimezone('UTC');
3320	+ $instance = parent::modify($modify);
3321	+ $this->setTimezone($timezone);
3322	+
3323	+ return $instance;
3324	+ }
3325	+
3326	+ /**
3327	+ * Return a serialized string of the instance.
3328	+ *
3329	+ * @return string
3330	+ */
3331	+ public function serialize()
3332	+ {
3333	+ return serialize($this);
3334	+ }
3335	+
3336	+ /**
3337	+ * Create an instance form a serialized string.
3338	+ *
3339	+ * @param string $value
3340	+ *
3341	+ * @throws \InvalidArgumentException
3342	+ *
3343	+ * @return static
3344	+ */
3345	+ public static function fromSerialized($value)
3346	+ {
3347	+ $instance = @unserialize($value);
3348	+
3349	+ if (!$instance instanceof static) {
3350	+ throw new InvalidArgumentException('Invalid serialized value.');
3351	+ }
3352	+
3353	+ return $instance;
3354	+ }
3355	+ }

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/CarbonInterval.php RENAMED Viewed

@@ -1,557 +1,557 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            namespace Carbon;
-            -
-            -
            use DateInterval;
-            -
            use InvalidArgumentException;
-            -
            use Symfony\Component\Translation\Loader\ArrayLoader;
-            -
            use Symfony\Component\Translation\Translator;
-            -
            use Symfony\Component\Translation\TranslatorInterface;
-            -
-            -
            /**
-            -
             * A simple API extension for DateInterval.
-            -
             * The implementation provides helpers to handle weeks but only days are saved.
-            -
             * Weeks are calculated based on the total days of the current instance.
-            -
             *
-            -
             * @property int $years Total years of the current interval.
-            -
             * @property int $months Total months of the current interval.
-            -
             * @property int $weeks Total weeks of the current interval calculated from the days.
-            -
             * @property int $dayz Total days of the current interval (weeks * 7 + days).
-            -
             * @property int $hours Total hours of the current interval.
-            -
             * @property int $minutes Total minutes of the current interval.
-            -
             * @property int $seconds Total seconds of the current interval.
-            -
             * @property-read int $dayzExcludeWeeks Total days remaining in the final week of the current instance (days % 7).
-            -
             * @property-read int $daysExcludeWeeks alias of dayzExcludeWeeks
-            -
             *
-            -
             * @method static CarbonInterval years($years = 1) Create instance specifying a number of years.
-            -
             * @method static CarbonInterval year($years = 1) Alias for years()
-            -
             * @method static CarbonInterval months($months = 1) Create instance specifying a number of months.
-            -
             * @method static CarbonInterval month($months = 1) Alias for months()
-            -
             * @method static CarbonInterval weeks($weeks = 1) Create instance specifying a number of weeks.
-            -
             * @method static CarbonInterval week($weeks = 1) Alias for weeks()
-            -
             * @method static CarbonInterval days($days = 1) Create instance specifying a number of days.
-            -
             * @method static CarbonInterval dayz($days = 1) Alias for days()
-            -
             * @method static CarbonInterval day($days = 1) Alias for days()
-            -
             * @method static CarbonInterval hours($hours = 1) Create instance specifying a number of hours.
-            -
             * @method static CarbonInterval hour($hours = 1) Alias for hours()
-            -
             * @method static CarbonInterval minutes($minutes = 1) Create instance specifying a number of minutes.
-            -
             * @method static CarbonInterval minute($minutes = 1) Alias for minutes()
-            -
             * @method static CarbonInterval seconds($seconds = 1) Create instance specifying a number of seconds.
-            -
             * @method static CarbonInterval second($seconds = 1) Alias for seconds()
-            -
             * @method CarbonInterval years() years($years = 1) Set the years portion of the current interval.
-            -
             * @method CarbonInterval year() year($years = 1) Alias for years().
-            -
             * @method CarbonInterval months() months($months = 1) Set the months portion of the current interval.
-            -
             * @method CarbonInterval month() month($months = 1) Alias for months().
-            -
             * @method CarbonInterval weeks() weeks($weeks = 1) Set the weeks portion of the current interval.  Will overwrite dayz value.
-            -
             * @method CarbonInterval week() week($weeks = 1) Alias for weeks().
-            -
             * @method CarbonInterval days() days($days = 1) Set the days portion of the current interval.
-            -
             * @method CarbonInterval dayz() dayz($days = 1) Alias for days().
-            -
             * @method CarbonInterval day() day($days = 1) Alias for days().
-            -
             * @method CarbonInterval hours() hours($hours = 1) Set the hours portion of the current interval.
-            -
             * @method CarbonInterval hour() hour($hours = 1) Alias for hours().
-            -
             * @method CarbonInterval minutes() minutes($minutes = 1) Set the minutes portion of the current interval.
-            -
             * @method CarbonInterval minute() minute($minutes = 1) Alias for minutes().
-            -
             * @method CarbonInterval seconds() seconds($seconds = 1) Set the seconds portion of the current interval.
-            -
             * @method CarbonInterval second() second($seconds = 1) Alias for seconds().
-            -
             */
-            -
            class CarbonInterval extends DateInterval
-            -
            {
-            -
                /**
-            -
                 * Interval spec period designators
-            -
                 */
-            -
                const PERIOD_PREFIX = 'P';
-            -
                const PERIOD_YEARS = 'Y';
-            -
                const PERIOD_MONTHS = 'M';
-            -
                const PERIOD_DAYS = 'D';
-            -
                const PERIOD_TIME_PREFIX = 'T';
-            -
                const PERIOD_HOURS = 'H';
-            -
                const PERIOD_MINUTES = 'M';
-            -
                const PERIOD_SECONDS = 'S';
-            -
-            -
                /**
-            -
                 * A translator to ... er ... translate stuff
-            -
                 *
-            -
                 * @var \Symfony\Component\Translation\TranslatorInterface
-            -
                 */
-            -
                protected static $translator;
-            -
-            -
                /**
-            -
                 * Before PHP 5.4.20/5.5.4 instead of FALSE days will be set to -99999 when the interval instance
-            -
                 * was created by DateTime:diff().
-            -
                 */
-            -
                const PHP_DAYS_FALSE = -99999;
-            -
-            -
                /**
-            -
                 * Determine if the interval was created via DateTime:diff() or not.
-            -
                 *
-            -
                 * @param DateInterval $interval
-            -
                 *
-            -
                 * @return bool
-            -
                 */
-            -
                private static function wasCreatedFromDiff(DateInterval $interval)
-            -
                {
-            -
                    return $interval->days !== false && $interval->days !== static::PHP_DAYS_FALSE;
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                //////////////////////////// CONSTRUCTORS /////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Create a new CarbonInterval instance.
-            -
                 *
-            -
                 * @param int $years
-            -
                 * @param int $months
-            -
                 * @param int $weeks
-            -
                 * @param int $days
-            -
                 * @param int $hours
-            -
                 * @param int $minutes
-            -
                 * @param int $seconds
-            -
                 */
-            -
                public function __construct($years = 1, $months = null, $weeks = null, $days = null, $hours = null, $minutes = null, $seconds = null)
-            -
                {
-            -
                    $spec = static::PERIOD_PREFIX;
-            -
-            -
                    $spec .= $years > 0 ? $years.static::PERIOD_YEARS : '';
-            -
                    $spec .= $months > 0 ? $months.static::PERIOD_MONTHS : '';
-            -
-            -
                    $specDays = 0;
-            -
                    $specDays += $weeks > 0 ? $weeks * Carbon::DAYS_PER_WEEK : 0;
-            -
                    $specDays += $days > 0 ? $days : 0;
-            -
-            -
                    $spec .= $specDays > 0 ? $specDays.static::PERIOD_DAYS : '';
-            -
-            -
                    if ($hours > 0 || $minutes > 0 || $seconds > 0) {
-            -
                        $spec .= static::PERIOD_TIME_PREFIX;
-            -
                        $spec .= $hours > 0 ? $hours.static::PERIOD_HOURS : '';
-            -
                        $spec .= $minutes > 0 ? $minutes.static::PERIOD_MINUTES : '';
-            -
                        $spec .= $seconds > 0 ? $seconds.static::PERIOD_SECONDS : '';
-            -
                    }
-            -
-            -
                    if ($spec === static::PERIOD_PREFIX) {
-            -
                        // Allow the zero interval.
-            -
                        $spec .= '0'.static::PERIOD_YEARS;
-            -
                    }
-            -
-            -
                    parent::__construct($spec);
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a new CarbonInterval instance from specific values.
-            -
                 * This is an alias for the constructor that allows better fluent
-            -
                 * syntax as it allows you to do CarbonInterval::create(1)->fn() rather than
-            -
                 * (new CarbonInterval(1))->fn().
-            -
                 *
-            -
                 * @param int $years
-            -
                 * @param int $months
-            -
                 * @param int $weeks
-            -
                 * @param int $days
-            -
                 * @param int $hours
-            -
                 * @param int $minutes
-            -
                 * @param int $seconds
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function create($years = 1, $months = null, $weeks = null, $days = null, $hours = null, $minutes = null, $seconds = null)
-            -
                {
-            -
                    return new static($years, $months, $weeks, $days, $hours, $minutes, $seconds);
-            -
                }
-            -
-            -
                /**
-            -
                 * Provide static helpers to create instances.  Allows CarbonInterval::years(3).
-            -
                 *
-            -
                 * Note: This is done using the magic method to allow static and instance methods to
-            -
                 *       have the same names.
-            -
                 *
-            -
                 * @param string $name
-            -
                 * @param array  $args
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function __callStatic($name, $args)
-            -
                {
-            -
                    $arg = count($args) === 0 ? 1 : $args[0];
-            -
-            -
                    switch ($name) {
-            -
                        case 'years':
-            -
                        case 'year':
-            -
                            return new static($arg);
-            -
-            -
                        case 'months':
-            -
                        case 'month':
-            -
                            return new static(null, $arg);
-            -
-            -
                        case 'weeks':
-            -
                        case 'week':
-            -
                            return new static(null, null, $arg);
-            -
-            -
                        case 'days':
-            -
                        case 'dayz':
-            -
                        case 'day':
-            -
                            return new static(null, null, null, $arg);
-            -
-            -
                        case 'hours':
-            -
                        case 'hour':
-            -
                            return new static(null, null, null, null, $arg);
-            -
-            -
                        case 'minutes':
-            -
                        case 'minute':
-            -
                            return new static(null, null, null, null, null, $arg);
-            -
-            -
                        case 'seconds':
-            -
                        case 'second':
-            -
                            return new static(null, null, null, null, null, null, $arg);
-            -
                    }
-            -
                }
-            -
-            -
                /**
-            -
                 * Create a CarbonInterval instance from a DateInterval one.  Can not instance
-            -
                 * DateInterval objects created from DateTime::diff() as you can't externally
-            -
                 * set the $days field.
-            -
                 *
-            -
                 * @param DateInterval $di
-            -
                 *
-            -
                 * @throws \InvalidArgumentException
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public static function instance(DateInterval $di)
-            -
                {
-            -
                    if (static::wasCreatedFromDiff($di)) {
-            -
                        throw new InvalidArgumentException('Can not instance a DateInterval object created from DateTime::diff().');
-            -
                    }
-            -
-            -
                    $instance = new static($di->y, $di->m, 0, $di->d, $di->h, $di->i, $di->s);
-            -
                    $instance->invert = $di->invert;
-            -
                    $instance->days = $di->days;
-            -
-            -
                    return $instance;
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                /////////////////////// LOCALIZATION //////////////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Initialize the translator instance if necessary.
-            -
                 *
-            -
                 * @return \Symfony\Component\Translation\TranslatorInterface
-            -
                 */
-            -
                protected static function translator()
-            -
                {
-            -
                    if (static::$translator === null) {
-            -
                        static::$translator = new Translator('en');
-            -
                        static::$translator->addLoader('array', new ArrayLoader());
-            -
                        static::setLocale('en');
-            -
                    }
-            -
-            -
                    return static::$translator;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the translator instance in use
-            -
                 *
-            -
                 * @return \Symfony\Component\Translation\TranslatorInterface
-            -
                 */
-            -
                public static function getTranslator()
-            -
                {
-            -
                    return static::translator();
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the translator instance to use
-            -
                 *
-            -
                 * @param TranslatorInterface $translator
-            -
                 */
-            -
                public static function setTranslator(TranslatorInterface $translator)
-            -
                {
-            -
                    static::$translator = $translator;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the current translator locale
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public static function getLocale()
-            -
                {
-            -
                    return static::translator()->getLocale();
-            -
                }
-            -
-            -
                /**
-            -
                 * Set the current translator locale
-            -
                 *
-            -
                 * @param string $locale
-            -
                 */
-            -
                public static function setLocale($locale)
-            -
                {
-            -
                    static::translator()->setLocale($locale);
-            -
-            -
                    // Ensure the locale has been loaded.
-            -
                    static::translator()->addResource('array', require __DIR__.'/Lang/'.$locale.'.php', $locale);
-            -
                }
-            -
-            -
                ///////////////////////////////////////////////////////////////////
-            -
                ///////////////////////// GETTERS AND SETTERS /////////////////////
-            -
                ///////////////////////////////////////////////////////////////////
-            -
-            -
                /**
-            -
                 * Get a part of the CarbonInterval object
-            -
                 *
-            -
                 * @param string $name
-            -
                 *
-            -
                 * @throws \InvalidArgumentException
-            -
                 *
-            -
                 * @return int
-            -
                 */
-            -
                public function __get($name)
-            -
                {
-            -
                    switch ($name) {
-            -
                        case 'years':
-            -
                            return $this->y;
-            -
-            -
                        case 'months':
-            -
                            return $this->m;
-            -
-            -
                        case 'dayz':
-            -
                            return $this->d;
-            -
-            -
                        case 'hours':
-            -
                            return $this->h;
-            -
-            -
                        case 'minutes':
-            -
                            return $this->i;
-            -
-            -
                        case 'seconds':
-            -
                            return $this->s;
-            -
-            -
                        case 'weeks':
-            -
                            return (int) floor($this->d / Carbon::DAYS_PER_WEEK);
-            -
-            -
                        case 'daysExcludeWeeks':
-            -
                        case 'dayzExcludeWeeks':
-            -
                            return $this->d % Carbon::DAYS_PER_WEEK;
-            -
-            -
                        default:
-            -
                            throw new InvalidArgumentException(sprintf("Unknown getter '%s'", $name));
-            -
                    }
-            -
                }
-            -
-            -
                /**
-            -
                 * Set a part of the CarbonInterval object
-            -
                 *
-            -
                 * @param string $name
-            -
                 * @param int    $val
-            -
                 *
-            -
                 * @throws \InvalidArgumentException
-            -
                 */
-            -
                public function __set($name, $val)
-            -
                {
-            -
                    switch ($name) {
-            -
                        case 'years':
-            -
                            $this->y = $val;
-            -
                            break;
-            -
-            -
                        case 'months':
-            -
                            $this->m = $val;
-            -
                            break;
-            -
-            -
                        case 'weeks':
-            -
                            $this->d = $val * Carbon::DAYS_PER_WEEK;
-            -
                            break;
-            -
-            -
                        case 'dayz':
-            -
                            $this->d = $val;
-            -
                            break;
-            -
-            -
                        case 'hours':
-            -
                            $this->h = $val;
-            -
                            break;
-            -
-            -
                        case 'minutes':
-            -
                            $this->i = $val;
-            -
                            break;
-            -
-            -
                        case 'seconds':
-            -
                            $this->s = $val;
-            -
                            break;
-            -
                    }
-            -
                }
-            -
-            -
                /**
-            -
                 * Allow setting of weeks and days to be cumulative.
-            -
                 *
-            -
                 * @param int $weeks Number of weeks to set
-            -
                 * @param int $days  Number of days to set
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function weeksAndDays($weeks, $days)
-            -
                {
-            -
                    $this->dayz = ($weeks * Carbon::DAYS_PER_WEEK) + $days;
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Allow fluent calls on the setters... CarbonInterval::years(3)->months(5)->day().
-            -
                 *
-            -
                 * Note: This is done using the magic method to allow static and instance methods to
-            -
                 *       have the same names.
-            -
                 *
-            -
                 * @param string $name
-            -
                 * @param array  $args
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function __call($name, $args)
-            -
                {
-            -
                    $arg = count($args) === 0 ? 1 : $args[0];
-            -
-            -
                    switch ($name) {
-            -
                        case 'years':
-            -
                        case 'year':
-            -
                            $this->years = $arg;
-            -
                            break;
-            -
-            -
                        case 'months':
-            -
                        case 'month':
-            -
                            $this->months = $arg;
-            -
                            break;
-            -
-            -
                        case 'weeks':
-            -
                        case 'week':
-            -
                            $this->dayz = $arg * Carbon::DAYS_PER_WEEK;
-            -
                            break;
-            -
-            -
                        case 'days':
-            -
                        case 'dayz':
-            -
                        case 'day':
-            -
                            $this->dayz = $arg;
-            -
                            break;
-            -
-            -
                        case 'hours':
-            -
                        case 'hour':
-            -
                            $this->hours = $arg;
-            -
                            break;
-            -
-            -
                        case 'minutes':
-            -
                        case 'minute':
-            -
                            $this->minutes = $arg;
-            -
                            break;
-            -
-            -
                        case 'seconds':
-            -
                        case 'second':
-            -
                            $this->seconds = $arg;
-            -
                            break;
-            -
                    }
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the current interval in a human readable format in the current locale.
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function forHumans()
-            -
                {
-            -
                    $periods = array(
-            -
                        'year' => $this->years,
-            -
                        'month' => $this->months,
-            -
                        'week' => $this->weeks,
-            -
                        'day' => $this->daysExcludeWeeks,
-            -
                        'hour' => $this->hours,
-            -
                        'minute' => $this->minutes,
-            -
                        'second' => $this->seconds,
-            -
                    );
-            -
-            -
                    $parts = array();
-            -
                    foreach ($periods as $unit => $count) {
-            -
                        if ($count > 0) {
-            -
                            array_push($parts, static::translator()->transChoice($unit, $count, array(':count' => $count)));
-            -
                        }
-            -
                    }
-            -
-            -
                    return implode(' ', $parts);
-            -
                }
-            -
-            -
                /**
-            -
                 * Format the instance as a string using the forHumans() function.
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function __toString()
-            -
                {
-            -
                    return $this->forHumans();
-            -
                }
-            -
-            -
                /**
-            -
                 * Add the passed interval to the current instance
-            -
                 *
-            -
                 * @param DateInterval $interval
-            -
                 *
-            -
                 * @return static
-            -
                 */
-            -
                public function add(DateInterval $interval)
-            -
                {
-            -
                    $sign = $interval->invert === 1 ? -1 : 1;
-            -
-            -
                    if (static::wasCreatedFromDiff($interval)) {
-            -
                        $this->dayz += $interval->days * $sign;
-            -
                    } else {
-            -
                        $this->years += $interval->y * $sign;
-            -
                        $this->months += $interval->m * $sign;
-            -
                        $this->dayz += $interval->d * $sign;
-            -
                        $this->hours += $interval->h * $sign;
-            -
                        $this->minutes += $interval->i * $sign;
-            -
                        $this->seconds += $interval->s * $sign;
-            -
                    }
-            -
-            -
                    return $this;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the interval_spec string
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function spec()
-            -
                {
-            -
                    $date = array_filter(array(
-            -
                        static::PERIOD_YEARS => $this->y,
-            -
                        static::PERIOD_MONTHS => $this->m,
-            -
                        static::PERIOD_DAYS => $this->d,
-            -
                    ));
-            -
-            -
                    $time = array_filter(array(
-            -
                        static::PERIOD_HOURS => $this->h,
-            -
                        static::PERIOD_MINUTES => $this->i,
-            -
                        static::PERIOD_SECONDS => $this->s,
-            -
                    ));
-            -
-            -
                    $specString = static::PERIOD_PREFIX;
-            -
-            -
                    foreach ($date as $key => $value) {
-            -
                        $specString .= $value.$key;
-            -
                    }
-            -
-            -
                    if (count($time) > 0) {
-            -
                        $specString .= static::PERIOD_TIME_PREFIX;
-            -
                        foreach ($time as $key => $value) {
-            -
                            $specString .= $value.$key;
-            -
                        }
-            -
                    }
-            -
-            -
                    return $specString === static::PERIOD_PREFIX ? 'PT0S' : $specString;
-            -
                }
-            -
            }


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Carbon;
13	+
14	+ use DateInterval;
15	+ use InvalidArgumentException;
16	+ use Symfony\Component\Translation\Loader\ArrayLoader;
17	+ use Symfony\Component\Translation\Translator;
18	+ use Symfony\Component\Translation\TranslatorInterface;
19	+
20	+ /**
21	+ * A simple API extension for DateInterval.
22	+ * The implementation provides helpers to handle weeks but only days are saved.
23	+ * Weeks are calculated based on the total days of the current instance.
24	+ *
25	+ * @property int $years Total years of the current interval.
26	+ * @property int $months Total months of the current interval.
27	+ * @property int $weeks Total weeks of the current interval calculated from the days.
28	+ * @property int $dayz Total days of the current interval (weeks * 7 + days).
29	+ * @property int $hours Total hours of the current interval.
30	+ * @property int $minutes Total minutes of the current interval.
31	+ * @property int $seconds Total seconds of the current interval.
32	+ * @property-read int $dayzExcludeWeeks Total days remaining in the final week of the current instance (days % 7).
33	+ * @property-read int $daysExcludeWeeks alias of dayzExcludeWeeks
34	+ *
35	+ * @method static CarbonInterval years($years = 1) Create instance specifying a number of years.
36	+ * @method static CarbonInterval year($years = 1) Alias for years()
37	+ * @method static CarbonInterval months($months = 1) Create instance specifying a number of months.
38	+ * @method static CarbonInterval month($months = 1) Alias for months()
39	+ * @method static CarbonInterval weeks($weeks = 1) Create instance specifying a number of weeks.
40	+ * @method static CarbonInterval week($weeks = 1) Alias for weeks()
41	+ * @method static CarbonInterval days($days = 1) Create instance specifying a number of days.
42	+ * @method static CarbonInterval dayz($days = 1) Alias for days()
43	+ * @method static CarbonInterval day($days = 1) Alias for days()
44	+ * @method static CarbonInterval hours($hours = 1) Create instance specifying a number of hours.
45	+ * @method static CarbonInterval hour($hours = 1) Alias for hours()
46	+ * @method static CarbonInterval minutes($minutes = 1) Create instance specifying a number of minutes.
47	+ * @method static CarbonInterval minute($minutes = 1) Alias for minutes()
48	+ * @method static CarbonInterval seconds($seconds = 1) Create instance specifying a number of seconds.
49	+ * @method static CarbonInterval second($seconds = 1) Alias for seconds()
50	+ * @method CarbonInterval years() years($years = 1) Set the years portion of the current interval.
51	+ * @method CarbonInterval year() year($years = 1) Alias for years().
52	+ * @method CarbonInterval months() months($months = 1) Set the months portion of the current interval.
53	+ * @method CarbonInterval month() month($months = 1) Alias for months().
54	+ * @method CarbonInterval weeks() weeks($weeks = 1) Set the weeks portion of the current interval. Will overwrite dayz value.
55	+ * @method CarbonInterval week() week($weeks = 1) Alias for weeks().
56	+ * @method CarbonInterval days() days($days = 1) Set the days portion of the current interval.
57	+ * @method CarbonInterval dayz() dayz($days = 1) Alias for days().
58	+ * @method CarbonInterval day() day($days = 1) Alias for days().
59	+ * @method CarbonInterval hours() hours($hours = 1) Set the hours portion of the current interval.
60	+ * @method CarbonInterval hour() hour($hours = 1) Alias for hours().
61	+ * @method CarbonInterval minutes() minutes($minutes = 1) Set the minutes portion of the current interval.
62	+ * @method CarbonInterval minute() minute($minutes = 1) Alias for minutes().
63	+ * @method CarbonInterval seconds() seconds($seconds = 1) Set the seconds portion of the current interval.
64	+ * @method CarbonInterval second() second($seconds = 1) Alias for seconds().
65	+ */
66	+ class CarbonInterval extends DateInterval
67	+ {
68	+ /**
69	+ * Interval spec period designators
70	+ */
71	+ const PERIOD_PREFIX = 'P';
72	+ const PERIOD_YEARS = 'Y';
73	+ const PERIOD_MONTHS = 'M';
74	+ const PERIOD_DAYS = 'D';
75	+ const PERIOD_TIME_PREFIX = 'T';
76	+ const PERIOD_HOURS = 'H';
77	+ const PERIOD_MINUTES = 'M';
78	+ const PERIOD_SECONDS = 'S';
79	+
80	+ /**
81	+ * A translator to ... er ... translate stuff
82	+ *
83	+ * @var \Symfony\Component\Translation\TranslatorInterface
84	+ */
85	+ protected static $translator;
86	+
87	+ /**
88	+ * Before PHP 5.4.20/5.5.4 instead of FALSE days will be set to -99999 when the interval instance
89	+ * was created by DateTime:diff().
90	+ */
91	+ const PHP_DAYS_FALSE = -99999;
92	+
93	+ /**
94	+ * Determine if the interval was created via DateTime:diff() or not.
95	+ *
96	+ * @param DateInterval $interval
97	+ *
98	+ * @return bool
99	+ */
100	+ private static function wasCreatedFromDiff(DateInterval $interval)
101	+ {
102	+ return $interval->days !== false && $interval->days !== static::PHP_DAYS_FALSE;
103	+ }
104	+
105	+ ///////////////////////////////////////////////////////////////////
106	+ //////////////////////////// CONSTRUCTORS /////////////////////////
107	+ ///////////////////////////////////////////////////////////////////
108	+
109	+ /**
110	+ * Create a new CarbonInterval instance.
111	+ *
112	+ * @param int $years
113	+ * @param int $months
114	+ * @param int $weeks
115	+ * @param int $days
116	+ * @param int $hours
117	+ * @param int $minutes
118	+ * @param int $seconds
119	+ */
120	+ public function __construct($years = 1, $months = null, $weeks = null, $days = null, $hours = null, $minutes = null, $seconds = null)
121	+ {
122	+ $spec = static::PERIOD_PREFIX;
123	+
124	+ $spec .= $years > 0 ? $years.static::PERIOD_YEARS : '';
125	+ $spec .= $months > 0 ? $months.static::PERIOD_MONTHS : '';
126	+
127	+ $specDays = 0;
128	+ $specDays += $weeks > 0 ? $weeks * Carbon::DAYS_PER_WEEK : 0;
129	+ $specDays += $days > 0 ? $days : 0;
130	+
131	+ $spec .= $specDays > 0 ? $specDays.static::PERIOD_DAYS : '';
132	+
133	+ if ($hours > 0 \|\| $minutes > 0 \|\| $seconds > 0) {
134	+ $spec .= static::PERIOD_TIME_PREFIX;
135	+ $spec .= $hours > 0 ? $hours.static::PERIOD_HOURS : '';
136	+ $spec .= $minutes > 0 ? $minutes.static::PERIOD_MINUTES : '';
137	+ $spec .= $seconds > 0 ? $seconds.static::PERIOD_SECONDS : '';
138	+ }
139	+
140	+ if ($spec === static::PERIOD_PREFIX) {
141	+ // Allow the zero interval.
142	+ $spec .= '0'.static::PERIOD_YEARS;
143	+ }
144	+
145	+ parent::__construct($spec);
146	+ }
147	+
148	+ /**
149	+ * Create a new CarbonInterval instance from specific values.
150	+ * This is an alias for the constructor that allows better fluent
151	+ * syntax as it allows you to do CarbonInterval::create(1)->fn() rather than
152	+ * (new CarbonInterval(1))->fn().
153	+ *
154	+ * @param int $years
155	+ * @param int $months
156	+ * @param int $weeks
157	+ * @param int $days
158	+ * @param int $hours
159	+ * @param int $minutes
160	+ * @param int $seconds
161	+ *
162	+ * @return static
163	+ */
164	+ public static function create($years = 1, $months = null, $weeks = null, $days = null, $hours = null, $minutes = null, $seconds = null)
165	+ {
166	+ return new static($years, $months, $weeks, $days, $hours, $minutes, $seconds);
167	+ }
168	+
169	+ /**
170	+ * Provide static helpers to create instances. Allows CarbonInterval::years(3).
171	+ *
172	+ * Note: This is done using the magic method to allow static and instance methods to
173	+ * have the same names.
174	+ *
175	+ * @param string $name
176	+ * @param array $args
177	+ *
178	+ * @return static
179	+ */
180	+ public static function __callStatic($name, $args)
181	+ {
182	+ $arg = count($args) === 0 ? 1 : $args[0];
183	+
184	+ switch ($name) {
185	+ case 'years':
186	+ case 'year':
187	+ return new static($arg);
188	+
189	+ case 'months':
190	+ case 'month':
191	+ return new static(null, $arg);
192	+
193	+ case 'weeks':
194	+ case 'week':
195	+ return new static(null, null, $arg);
196	+
197	+ case 'days':
198	+ case 'dayz':
199	+ case 'day':
200	+ return new static(null, null, null, $arg);
201	+
202	+ case 'hours':
203	+ case 'hour':
204	+ return new static(null, null, null, null, $arg);
205	+
206	+ case 'minutes':
207	+ case 'minute':
208	+ return new static(null, null, null, null, null, $arg);
209	+
210	+ case 'seconds':
211	+ case 'second':
212	+ return new static(null, null, null, null, null, null, $arg);
213	+ }
214	+ }
215	+
216	+ /**
217	+ * Create a CarbonInterval instance from a DateInterval one. Can not instance
218	+ * DateInterval objects created from DateTime::diff() as you can't externally
219	+ * set the $days field.
220	+ *
221	+ * @param DateInterval $di
222	+ *
223	+ * @throws \InvalidArgumentException
224	+ *
225	+ * @return static
226	+ */
227	+ public static function instance(DateInterval $di)
228	+ {
229	+ if (static::wasCreatedFromDiff($di)) {
230	+ throw new InvalidArgumentException('Can not instance a DateInterval object created from DateTime::diff().');
231	+ }
232	+
233	+ $instance = new static($di->y, $di->m, 0, $di->d, $di->h, $di->i, $di->s);
234	+ $instance->invert = $di->invert;
235	+ $instance->days = $di->days;
236	+
237	+ return $instance;
238	+ }
239	+
240	+ ///////////////////////////////////////////////////////////////////
241	+ /////////////////////// LOCALIZATION //////////////////////////////
242	+ ///////////////////////////////////////////////////////////////////
243	+
244	+ /**
245	+ * Initialize the translator instance if necessary.
246	+ *
247	+ * @return \Symfony\Component\Translation\TranslatorInterface
248	+ */
249	+ protected static function translator()
250	+ {
251	+ if (static::$translator === null) {
252	+ static::$translator = new Translator('en');
253	+ static::$translator->addLoader('array', new ArrayLoader());
254	+ static::setLocale('en');
255	+ }
256	+
257	+ return static::$translator;
258	+ }
259	+
260	+ /**
261	+ * Get the translator instance in use
262	+ *
263	+ * @return \Symfony\Component\Translation\TranslatorInterface
264	+ */
265	+ public static function getTranslator()
266	+ {
267	+ return static::translator();
268	+ }
269	+
270	+ /**
271	+ * Set the translator instance to use
272	+ *
273	+ * @param TranslatorInterface $translator
274	+ */
275	+ public static function setTranslator(TranslatorInterface $translator)
276	+ {
277	+ static::$translator = $translator;
278	+ }
279	+
280	+ /**
281	+ * Get the current translator locale
282	+ *
283	+ * @return string
284	+ */
285	+ public static function getLocale()
286	+ {
287	+ return static::translator()->getLocale();
288	+ }
289	+
290	+ /**
291	+ * Set the current translator locale
292	+ *
293	+ * @param string $locale
294	+ */
295	+ public static function setLocale($locale)
296	+ {
297	+ static::translator()->setLocale($locale);
298	+
299	+ // Ensure the locale has been loaded.
300	+ static::translator()->addResource('array', require __DIR__.'/Lang/'.$locale.'.php', $locale);
301	+ }
302	+
303	+ ///////////////////////////////////////////////////////////////////
304	+ ///////////////////////// GETTERS AND SETTERS /////////////////////
305	+ ///////////////////////////////////////////////////////////////////
306	+
307	+ /**
308	+ * Get a part of the CarbonInterval object
309	+ *
310	+ * @param string $name
311	+ *
312	+ * @throws \InvalidArgumentException
313	+ *
314	+ * @return int
315	+ */
316	+ public function __get($name)
317	+ {
318	+ switch ($name) {
319	+ case 'years':
320	+ return $this->y;
321	+
322	+ case 'months':
323	+ return $this->m;
324	+
325	+ case 'dayz':
326	+ return $this->d;
327	+
328	+ case 'hours':
329	+ return $this->h;
330	+
331	+ case 'minutes':
332	+ return $this->i;
333	+
334	+ case 'seconds':
335	+ return $this->s;
336	+
337	+ case 'weeks':
338	+ return (int) floor($this->d / Carbon::DAYS_PER_WEEK);
339	+
340	+ case 'daysExcludeWeeks':
341	+ case 'dayzExcludeWeeks':
342	+ return $this->d % Carbon::DAYS_PER_WEEK;
343	+
344	+ default:
345	+ throw new InvalidArgumentException(sprintf("Unknown getter '%s'", $name));
346	+ }
347	+ }
348	+
349	+ /**
350	+ * Set a part of the CarbonInterval object
351	+ *
352	+ * @param string $name
353	+ * @param int $val
354	+ *
355	+ * @throws \InvalidArgumentException
356	+ */
357	+ public function __set($name, $val)
358	+ {
359	+ switch ($name) {
360	+ case 'years':
361	+ $this->y = $val;
362	+ break;
363	+
364	+ case 'months':
365	+ $this->m = $val;
366	+ break;
367	+
368	+ case 'weeks':
369	+ $this->d = $val * Carbon::DAYS_PER_WEEK;
370	+ break;
371	+
372	+ case 'dayz':
373	+ $this->d = $val;
374	+ break;
375	+
376	+ case 'hours':
377	+ $this->h = $val;
378	+ break;
379	+
380	+ case 'minutes':
381	+ $this->i = $val;
382	+ break;
383	+
384	+ case 'seconds':
385	+ $this->s = $val;
386	+ break;
387	+ }
388	+ }
389	+
390	+ /**
391	+ * Allow setting of weeks and days to be cumulative.
392	+ *
393	+ * @param int $weeks Number of weeks to set
394	+ * @param int $days Number of days to set
395	+ *
396	+ * @return static
397	+ */
398	+ public function weeksAndDays($weeks, $days)
399	+ {
400	+ $this->dayz = ($weeks * Carbon::DAYS_PER_WEEK) + $days;
401	+
402	+ return $this;
403	+ }
404	+
405	+ /**
406	+ * Allow fluent calls on the setters... CarbonInterval::years(3)->months(5)->day().
407	+ *
408	+ * Note: This is done using the magic method to allow static and instance methods to
409	+ * have the same names.
410	+ *
411	+ * @param string $name
412	+ * @param array $args
413	+ *
414	+ * @return static
415	+ */
416	+ public function __call($name, $args)
417	+ {
418	+ $arg = count($args) === 0 ? 1 : $args[0];
419	+
420	+ switch ($name) {
421	+ case 'years':
422	+ case 'year':
423	+ $this->years = $arg;
424	+ break;
425	+
426	+ case 'months':
427	+ case 'month':
428	+ $this->months = $arg;
429	+ break;
430	+
431	+ case 'weeks':
432	+ case 'week':
433	+ $this->dayz = $arg * Carbon::DAYS_PER_WEEK;
434	+ break;
435	+
436	+ case 'days':
437	+ case 'dayz':
438	+ case 'day':
439	+ $this->dayz = $arg;
440	+ break;
441	+
442	+ case 'hours':
443	+ case 'hour':
444	+ $this->hours = $arg;
445	+ break;
446	+
447	+ case 'minutes':
448	+ case 'minute':
449	+ $this->minutes = $arg;
450	+ break;
451	+
452	+ case 'seconds':
453	+ case 'second':
454	+ $this->seconds = $arg;
455	+ break;
456	+ }
457	+
458	+ return $this;
459	+ }
460	+
461	+ /**
462	+ * Get the current interval in a human readable format in the current locale.
463	+ *
464	+ * @return string
465	+ */
466	+ public function forHumans()
467	+ {
468	+ $periods = array(
469	+ 'year' => $this->years,
470	+ 'month' => $this->months,
471	+ 'week' => $this->weeks,
472	+ 'day' => $this->daysExcludeWeeks,
473	+ 'hour' => $this->hours,
474	+ 'minute' => $this->minutes,
475	+ 'second' => $this->seconds,
476	+ );
477	+
478	+ $parts = array();
479	+ foreach ($periods as $unit => $count) {
480	+ if ($count > 0) {
481	+ array_push($parts, static::translator()->transChoice($unit, $count, array(':count' => $count)));
482	+ }
483	+ }
484	+
485	+ return implode(' ', $parts);
486	+ }
487	+
488	+ /**
489	+ * Format the instance as a string using the forHumans() function.
490	+ *
491	+ * @return string
492	+ */
493	+ public function __toString()
494	+ {
495	+ return $this->forHumans();
496	+ }
497	+
498	+ /**
499	+ * Add the passed interval to the current instance
500	+ *
501	+ * @param DateInterval $interval
502	+ *
503	+ * @return static
504	+ */
505	+ public function add(DateInterval $interval)
506	+ {
507	+ $sign = $interval->invert === 1 ? -1 : 1;
508	+
509	+ if (static::wasCreatedFromDiff($interval)) {
510	+ $this->dayz += $interval->days * $sign;
511	+ } else {
512	+ $this->years += $interval->y * $sign;
513	+ $this->months += $interval->m * $sign;
514	+ $this->dayz += $interval->d * $sign;
515	+ $this->hours += $interval->h * $sign;
516	+ $this->minutes += $interval->i * $sign;
517	+ $this->seconds += $interval->s * $sign;
518	+ }
519	+
520	+ return $this;
521	+ }
522	+
523	+ /**
524	+ * Get the interval_spec string
525	+ *
526	+ * @return string
527	+ */
528	+ public function spec()
529	+ {
530	+ $date = array_filter(array(
531	+ static::PERIOD_YEARS => $this->y,
532	+ static::PERIOD_MONTHS => $this->m,
533	+ static::PERIOD_DAYS => $this->d,
534	+ ));
535	+
536	+ $time = array_filter(array(
537	+ static::PERIOD_HOURS => $this->h,
538	+ static::PERIOD_MINUTES => $this->i,
539	+ static::PERIOD_SECONDS => $this->s,
540	+ ));
541	+
542	+ $specString = static::PERIOD_PREFIX;
543	+
544	+ foreach ($date as $key => $value) {
545	+ $specString .= $value.$key;
546	+ }
547	+
548	+ if (count($time) > 0) {
549	+ $specString .= static::PERIOD_TIME_PREFIX;
550	+ foreach ($time as $key => $value) {
551	+ $specString .= $value.$key;
552	+ }
553	+ }
554	+
555	+ return $specString === static::PERIOD_PREFIX ? 'PT0S' : $specString;
556	+ }
557	+ }

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Exceptions/InvalidDateException.php RENAMED Viewed

@@ -1,67 +1,67 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            namespace Carbon\Exceptions;
-            -
-            -
            use Exception;
-            -
            use InvalidArgumentException;
-            -
-            -
            class InvalidDateException extends InvalidArgumentException
-            -
            {
-            -
                /**
-            -
                 * The invalid field.
-            -
                 *
-            -
                 * @var string
-            -
                 */
-            -
                private $field;
-            -
-            -
                /**
-            -
                 * The invalid value.
-            -
                 *
-            -
                 * @var mixed
-            -
                 */
-            -
                private $value;
-            -
-            -
                /**
-            -
                 * Constructor.
-            -
                 *
-            -
                 * @param string          $field
-            -
                 * @param mixed           $value
-            -
                 * @param int             $code
-            -
                 * @param \Exception|null $previous
-            -
                 */
-            -
                public function __construct($field, $value, $code = 0, Exception $previous = null)
-            -
                {
-            -
                    $this->field = $field;
-            -
                    $this->value = $value;
-            -
                    parent::__construct($field.' : '.$value.' is not a valid value.', $code, $previous);
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the invalid field.
-            -
                 *
-            -
                 * @return string
-            -
                 */
-            -
                public function getField()
-            -
                {
-            -
                    return $this->field;
-            -
                }
-            -
-            -
                /**
-            -
                 * Get the invalid value.
-            -
                 *
-            -
                 * @return mixed
-            -
                 */
-            -
                public function getValue()
-            -
                {
-            -
                    return $this->value;
-            -
                }
-            -
            }


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Carbon\Exceptions;
13	+
14	+ use Exception;
15	+ use InvalidArgumentException;
16	+
17	+ class InvalidDateException extends InvalidArgumentException
18	+ {
19	+ /**
20	+ * The invalid field.
21	+ *
22	+ * @var string
23	+ */
24	+ private $field;
25	+
26	+ /**
27	+ * The invalid value.
28	+ *
29	+ * @var mixed
30	+ */
31	+ private $value;
32	+
33	+ /**
34	+ * Constructor.
35	+ *
36	+ * @param string $field
37	+ * @param mixed $value
38	+ * @param int $code
39	+ * @param \Exception\|null $previous
40	+ */
41	+ public function __construct($field, $value, $code = 0, Exception $previous = null)
42	+ {
43	+ $this->field = $field;
44	+ $this->value = $value;
45	+ parent::__construct($field.' : '.$value.' is not a valid value.', $code, $previous);
46	+ }
47	+
48	+ /**
49	+ * Get the invalid field.
50	+ *
51	+ * @return string
52	+ */
53	+ public function getField()
54	+ {
55	+ return $this->field;
56	+ }
57	+
58	+ /**
59	+ * Get the invalid value.
60	+ *
61	+ * @return mixed
62	+ */
63	+ public function getValue()
64	+ {
65	+ return $this->value;
66	+ }
67	+ }

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/af.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 jaar|:count jare',
-            -
                'y' => '1 jaar|:count jare',
-            -
                'month' => '1 maand|:count maande',
-            -
                'm' => '1 maand|:count maande',
-            -
                'week' => '1 week|:count weke',
-            -
                'w' => '1 week|:count weke',
-            -
                'day' => '1 dag|:count dae',
-            -
                'd' => '1 dag|:count dae',
-            -
                'hour' => '1 uur|:count ure',
-            -
                'h' => '1 uur|:count ure',
-            -
                'minute' => '1 minuut|:count minute',
-            -
                'min' => '1 minuut|:count minute',
-            -
                'second' => '1 sekond|:count sekondes',
-            -
                's' => '1 sekond|:count sekondes',
-            -
                'ago' => ':time terug',
-            -
                'from_now' => ':time van nou af',
-            -
                'after' => ':time na',
-            -
                'before' => ':time voor',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 jaar\|:count jare',
14	+ 'y' => '1 jaar\|:count jare',
15	+ 'month' => '1 maand\|:count maande',
16	+ 'm' => '1 maand\|:count maande',
17	+ 'week' => '1 week\|:count weke',
18	+ 'w' => '1 week\|:count weke',
19	+ 'day' => '1 dag\|:count dae',
20	+ 'd' => '1 dag\|:count dae',
21	+ 'hour' => '1 uur\|:count ure',
22	+ 'h' => '1 uur\|:count ure',
23	+ 'minute' => '1 minuut\|:count minute',
24	+ 'min' => '1 minuut\|:count minute',
25	+ 'second' => '1 sekond\|:count sekondes',
26	+ 's' => '1 sekond\|:count sekondes',
27	+ 'ago' => ':time terug',
28	+ 'from_now' => ':time van nou af',
29	+ 'after' => ':time na',
30	+ 'before' => ':time voor',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ar.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '{0}سنة|{1}سنة|{2}سنتين|[3,10]:count سنوات|[11,Inf]:count سنة',
-            -
                'y' => '{0}سنة|{1}سنة|{2}سنتين|[3,10]:count سنوات|[11,Inf]:count سنة',
-            -
                'month' => '{0}شهر|{1} شهر|{2}شهرين|[3,10]:count أشهر|[11,Inf]:count شهر',
-            -
                'm' => '{0}شهر|{1} شهر|{2}شهرين|[3,10]:count أشهر|[11,Inf]:count شهر',
-            -
                'week' => '{0}إسبوع|{1}إسبوع|{2}إسبوعين|[3,10]:count أسابيع|[11,Inf]:count إسبوع',
-            -
                'w' => '{0}إسبوع|{1}إسبوع|{2}إسبوعين|[3,10]:count أسابيع|[11,Inf]:count إسبوع',
-            -
                'day' => '{0}يوم|{1}يوم|{2}يومين|[3,10]:count أيام|[11,Inf] يوم',
-            -
                'd' => '{0}يوم|{1}يوم|{2}يومين|[3,10]:count أيام|[11,Inf] يوم',
-            -
                'hour' => '{0}ساعة|{1}ساعة|{2}ساعتين|[3,10]:count ساعات|[11,Inf]:count ساعة',
-            -
                'h' => '{0}ساعة|{1}ساعة|{2}ساعتين|[3,10]:count ساعات|[11,Inf]:count ساعة',
-            -
                'minute' => '{0}دقيقة|{1}دقيقة|{2}دقيقتين|[3,10]:count دقائق|[11,Inf]:count دقيقة',
-            -
                'min' => '{0}دقيقة|{1}دقيقة|{2}دقيقتين|[3,10]:count دقائق|[11,Inf]:count دقيقة',
-            -
                'second' => '{0}ثانية|{1}ثانية|{2}ثانيتين|[3,10]:count ثوان|[11,Inf]:count ثانية',
-            -
                's' => '{0}ثانية|{1}ثانية|{2}ثانيتين|[3,10]:count ثوان|[11,Inf]:count ثانية',
-            -
                'ago' => 'منذ :time',
-            -
                'from_now' => 'من الآن :time',
-            -
                'after' => 'بعد :time',
-            -
                'before' => 'قبل :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '{0}سنة\|{1}سنة\|{2}سنتين\|[3,10]:count سنوات\|[11,Inf]:count سنة',
14	+ 'y' => '{0}سنة\|{1}سنة\|{2}سنتين\|[3,10]:count سنوات\|[11,Inf]:count سنة',
15	+ 'month' => '{0}شهر\|{1} شهر\|{2}شهرين\|[3,10]:count أشهر\|[11,Inf]:count شهر',
16	+ 'm' => '{0}شهر\|{1} شهر\|{2}شهرين\|[3,10]:count أشهر\|[11,Inf]:count شهر',
17	+ 'week' => '{0}إسبوع\|{1}إسبوع\|{2}إسبوعين\|[3,10]:count أسابيع\|[11,Inf]:count إسبوع',
18	+ 'w' => '{0}إسبوع\|{1}إسبوع\|{2}إسبوعين\|[3,10]:count أسابيع\|[11,Inf]:count إسبوع',
19	+ 'day' => '{0}يوم\|{1}يوم\|{2}يومين\|[3,10]:count أيام\|[11,Inf] يوم',
20	+ 'd' => '{0}يوم\|{1}يوم\|{2}يومين\|[3,10]:count أيام\|[11,Inf] يوم',
21	+ 'hour' => '{0}ساعة\|{1}ساعة\|{2}ساعتين\|[3,10]:count ساعات\|[11,Inf]:count ساعة',
22	+ 'h' => '{0}ساعة\|{1}ساعة\|{2}ساعتين\|[3,10]:count ساعات\|[11,Inf]:count ساعة',
23	+ 'minute' => '{0}دقيقة\|{1}دقيقة\|{2}دقيقتين\|[3,10]:count دقائق\|[11,Inf]:count دقيقة',
24	+ 'min' => '{0}دقيقة\|{1}دقيقة\|{2}دقيقتين\|[3,10]:count دقائق\|[11,Inf]:count دقيقة',
25	+ 'second' => '{0}ثانية\|{1}ثانية\|{2}ثانيتين\|[3,10]:count ثوان\|[11,Inf]:count ثانية',
26	+ 's' => '{0}ثانية\|{1}ثانية\|{2}ثانيتين\|[3,10]:count ثوان\|[11,Inf]:count ثانية',
27	+ 'ago' => 'منذ :time',
28	+ 'from_now' => 'من الآن :time',
29	+ 'after' => 'بعد :time',
30	+ 'before' => 'قبل :time',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/az.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count il',
-            -
                'y' => ':count il',
-            -
                'month' => ':count ay',
-            -
                'm' => ':count ay',
-            -
                'week' => ':count həftə',
-            -
                'w' => ':count həftə',
-            -
                'day' => ':count gün',
-            -
                'd' => ':count gün',
-            -
                'hour' => ':count saat',
-            -
                'h' => ':count saat',
-            -
                'minute' => ':count dəqiqə',
-            -
                'min' => ':count dəqiqə',
-            -
                'second' => ':count saniyə',
-            -
                's' => ':count saniyə',
-            -
                'ago' => ':time öncə',
-            -
                'from_now' => ':time sonra',
-            -
                'after' => ':time sonra',
-            -
                'before' => ':time öncə',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count il',
14	+ 'y' => ':count il',
15	+ 'month' => ':count ay',
16	+ 'm' => ':count ay',
17	+ 'week' => ':count həftə',
18	+ 'w' => ':count həftə',
19	+ 'day' => ':count gün',
20	+ 'd' => ':count gün',
21	+ 'hour' => ':count saat',
22	+ 'h' => ':count saat',
23	+ 'minute' => ':count dəqiqə',
24	+ 'min' => ':count dəqiqə',
25	+ 'second' => ':count saniyə',
26	+ 's' => ':count saniyə',
27	+ 'ago' => ':time öncə',
28	+ 'from_now' => ':time sonra',
29	+ 'after' => ':time sonra',
30	+ 'before' => ':time öncə',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/bg.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 година|:count години',
-            -
                'y' => '1 година|:count години',
-            -
                'month' => '1 месец|:count месеца',
-            -
                'm' => '1 месец|:count месеца',
-            -
                'week' => '1 седмица|:count седмици',
-            -
                'w' => '1 седмица|:count седмици',
-            -
                'day' => '1 ден|:count дни',
-            -
                'd' => '1 ден|:count дни',
-            -
                'hour' => '1 час|:count часа',
-            -
                'h' => '1 час|:count часа',
-            -
                'minute' => '1 минута|:count минути',
-            -
                'm' => '1 минута|:count минути',
-            -
                'second' => '1 секунда|:count секунди',
-            -
                's' => '1 секунда|:count секунди',
-            -
                'ago' => 'преди :time',
-            -
                'from_now' => ':time от сега',
-            -
                'after' => 'след :time',
-            -
                'before' => 'преди :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 година\|:count години',
14	+ 'y' => '1 година\|:count години',
15	+ 'month' => '1 месец\|:count месеца',
16	+ 'm' => '1 месец\|:count месеца',
17	+ 'week' => '1 седмица\|:count седмици',
18	+ 'w' => '1 седмица\|:count седмици',
19	+ 'day' => '1 ден\|:count дни',
20	+ 'd' => '1 ден\|:count дни',
21	+ 'hour' => '1 час\|:count часа',
22	+ 'h' => '1 час\|:count часа',
23	+ 'minute' => '1 минута\|:count минути',
24	+ 'm' => '1 минута\|:count минути',
25	+ 'second' => '1 секунда\|:count секунди',
26	+ 's' => '1 секунда\|:count секунди',
27	+ 'ago' => 'преди :time',
28	+ 'from_now' => ':time от сега',
29	+ 'after' => 'след :time',
30	+ 'before' => 'преди :time',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/bn.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                 'year' => '১ বছর|:count বছর',
-            -
                 'y' => '১ বছর|:count বছর',
-            -
                 'month' => '১ মাস|:count মাস',
-            -
                 'm' => '১ মাস|:count মাস',
-            -
                 'week' => '১ সপ্তাহ|:count সপ্তাহ',
-            -
                 'w' => '১ সপ্তাহ|:count সপ্তাহ',
-            -
                 'day' => '১ দিন|:count দিন',
-            -
                 'd' => '১ দিন|:count দিন',
-            -
                 'hour' => '১ ঘন্টা|:count ঘন্টা',
-            -
                 'h' => '১ ঘন্টা|:count ঘন্টা',
-            -
                 'minute' => '১ মিনিট|:count মিনিট',
-            -
                 'min' => '১ মিনিট|:count মিনিট',
-            -
                 'second' => '১ সেকেন্ড|:count সেকেন্ড',
-            -
                 's' => '১ সেকেন্ড|:count সেকেন্ড',
-            -
                 'ago' => ':time পূর্বে',
-            -
                 'from_now' => 'এখন থেকে :time',
-            -
                 'after' => ':time পরে',
-            -
                 'before' => ':time আগে',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '১ বছর\|:count বছর',
14	+ 'y' => '১ বছর\|:count বছর',
15	+ 'month' => '১ মাস\|:count মাস',
16	+ 'm' => '১ মাস\|:count মাস',
17	+ 'week' => '১ সপ্তাহ\|:count সপ্তাহ',
18	+ 'w' => '১ সপ্তাহ\|:count সপ্তাহ',
19	+ 'day' => '১ দিন\|:count দিন',
20	+ 'd' => '১ দিন\|:count দিন',
21	+ 'hour' => '১ ঘন্টা\|:count ঘন্টা',
22	+ 'h' => '১ ঘন্টা\|:count ঘন্টা',
23	+ 'minute' => '১ মিনিট\|:count মিনিট',
24	+ 'min' => '১ মিনিট\|:count মিনিট',
25	+ 'second' => '১ সেকেন্ড\|:count সেকেন্ড',
26	+ 's' => '১ সেকেন্ড\|:count সেকেন্ড',
27	+ 'ago' => ':time পূর্বে',
28	+ 'from_now' => 'এখন থেকে :time',
29	+ 'after' => ':time পরে',
30	+ 'before' => ':time আগে',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ca.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 any|:count anys',
-            -
                'y' => '1 any|:count anys',
-            -
                'month' => '1 mes|:count mesos',
-            -
                'm' => '1 mes|:count mesos',
-            -
                'week' => '1 setmana|:count setmanes',
-            -
                'w' => '1 setmana|:count setmanes',
-            -
                'day' => '1 dia|:count dies',
-            -
                'd' => '1 dia|:count dies',
-            -
                'hour' => '1 hora|:count hores',
-            -
                'h' => '1 hora|:count hores',
-            -
                'minute' => '1 minut|:count minuts',
-            -
                'min' => '1 minut|:count minuts',
-            -
                'second' => '1 segon|:count segons',
-            -
                's' => '1 segon|:count segons',
-            -
                'ago' => 'fa :time',
-            -
                'from_now' => 'dins de :time',
-            -
                'after' => ':time després',
-            -
                'before' => ':time abans',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 any\|:count anys',
14	+ 'y' => '1 any\|:count anys',
15	+ 'month' => '1 mes\|:count mesos',
16	+ 'm' => '1 mes\|:count mesos',
17	+ 'week' => '1 setmana\|:count setmanes',
18	+ 'w' => '1 setmana\|:count setmanes',
19	+ 'day' => '1 dia\|:count dies',
20	+ 'd' => '1 dia\|:count dies',
21	+ 'hour' => '1 hora\|:count hores',
22	+ 'h' => '1 hora\|:count hores',
23	+ 'minute' => '1 minut\|:count minuts',
24	+ 'min' => '1 minut\|:count minuts',
25	+ 'second' => '1 segon\|:count segons',
26	+ 's' => '1 segon\|:count segons',
27	+ 'ago' => 'fa :time',
28	+ 'from_now' => 'dins de :time',
29	+ 'after' => ':time després',
30	+ 'before' => ':time abans',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/cs.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 rok|:count roky|:count let',
-            -
                'y' => '1 rok|:count roky|:count let',
-            -
                'month' => '1 měsíc|:count měsíce|:count měsíců',
-            -
                'm' => '1 měsíc|:count měsíce|:count měsíců',
-            -
                'week' => '1 týden|:count týdny|:count týdnů',
-            -
                'w' => '1 týden|:count týdny|:count týdnů',
-            -
                'day' => '1 den|:count dny|:count dní',
-            -
                'd' => '1 den|:count dny|:count dní',
-            -
                'hour' => '1 hodinu|:count hodiny|:count hodin',
-            -
                'h' => '1 hodinu|:count hodiny|:count hodin',
-            -
                'minute' => '1 minutu|:count minuty|:count minut',
-            -
                'min' => '1 minutu|:count minuty|:count minut',
-            -
                'second' => '1 sekundu|:count sekundy|:count sekund',
-            -
                's' => '1 sekundu|:count sekundy|:count sekund',
-            -
                'ago' => ':time nazpět',
-            -
                'from_now' => 'za :time',
-            -
                'after' => ':time později',
-            -
                'before' => ':time předtím',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 rok\|:count roky\|:count let',
14	+ 'y' => '1 rok\|:count roky\|:count let',
15	+ 'month' => '1 měsíc\|:count měsíce\|:count měsíců',
16	+ 'm' => '1 měsíc\|:count měsíce\|:count měsíců',
17	+ 'week' => '1 týden\|:count týdny\|:count týdnů',
18	+ 'w' => '1 týden\|:count týdny\|:count týdnů',
19	+ 'day' => '1 den\|:count dny\|:count dní',
20	+ 'd' => '1 den\|:count dny\|:count dní',
21	+ 'hour' => '1 hodinu\|:count hodiny\|:count hodin',
22	+ 'h' => '1 hodinu\|:count hodiny\|:count hodin',
23	+ 'minute' => '1 minutu\|:count minuty\|:count minut',
24	+ 'min' => '1 minutu\|:count minuty\|:count minut',
25	+ 'second' => '1 sekundu\|:count sekundy\|:count sekund',
26	+ 's' => '1 sekundu\|:count sekundy\|:count sekund',
27	+ 'ago' => ':time nazpět',
28	+ 'from_now' => 'za :time',
29	+ 'after' => ':time později',
30	+ 'before' => ':time předtím',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/da.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 år|:count år',
-            -
                'y' => '1 år|:count år',
-            -
                'month' => '1 måned|:count måneder',
-            -
                'm' => '1 måned|:count måneder',
-            -
                'week' => '1 uge|:count uger',
-            -
                'w' => '1 uge|:count uger',
-            -
                'day' => '1 dag|:count dage',
-            -
                'd' => '1 dag|:count dage',
-            -
                'hour' => '1 time|:count timer',
-            -
                'h' => '1 time|:count timer',
-            -
                'minute' => '1 minut|:count minutter',
-            -
                'min' => '1 minut|:count minutter',
-            -
                'second' => '1 sekund|:count sekunder',
-            -
                's' => '1 sekund|:count sekunder',
-            -
                'ago' => ':time siden',
-            -
                'from_now' => 'om :time',
-            -
                'after' => ':time efter',
-            -
                'before' => ':time før',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 år\|:count år',
14	+ 'y' => '1 år\|:count år',
15	+ 'month' => '1 måned\|:count måneder',
16	+ 'm' => '1 måned\|:count måneder',
17	+ 'week' => '1 uge\|:count uger',
18	+ 'w' => '1 uge\|:count uger',
19	+ 'day' => '1 dag\|:count dage',
20	+ 'd' => '1 dag\|:count dage',
21	+ 'hour' => '1 time\|:count timer',
22	+ 'h' => '1 time\|:count timer',
23	+ 'minute' => '1 minut\|:count minutter',
24	+ 'min' => '1 minut\|:count minutter',
25	+ 'second' => '1 sekund\|:count sekunder',
26	+ 's' => '1 sekund\|:count sekunder',
27	+ 'ago' => ':time siden',
28	+ 'from_now' => 'om :time',
29	+ 'after' => ':time efter',
30	+ 'before' => ':time før',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/de.php RENAMED Viewed

@@ -1,40 +1,40 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 Jahr|:count Jahre',
-            -
                'y' => '1J|:countJ',
-            -
                'month' => '1 Monat|:count Monate',
-            -
                'm' => '1Mon|:countMon',
-            -
                'week' => '1 Woche|:count Wochen',
-            -
                'w' => '1Wo|:countWo',
-            -
                'day' => '1 Tag|:count Tage',
-            -
                'd' => '1Tg|:countTg',
-            -
                'hour' => '1 Stunde|:count Stunden',
-            -
                'h' => '1Std|:countStd',
-            -
                'minute' => '1 Minute|:count Minuten',
-            -
                'min' => '1Min|:countMin',
-            -
                'second' => '1 Sekunde|:count Sekunden',
-            -
                's' => '1Sek|:countSek',
-            -
                'ago' => 'vor :time',
-            -
                'from_now' => 'in :time',
-            -
                'after' => ':time später',
-            -
                'before' => ':time zuvor',
-            -
-            -
                'year_from_now' => '1 Jahr|:count Jahren',
-            -
                'month_from_now' => '1 Monat|:count Monaten',
-            -
                'week_from_now' => '1 Woche|:count Wochen',
-            -
                'day_from_now' => '1 Tag|:count Tagen',
-            -
                'year_ago' => '1 Jahr|:count Jahren',
-            -
                'month_ago' => '1 Monat|:count Monaten',
-            -
                'week_ago' => '1 Woche|:count Wochen',
-            -
                'day_ago' => '1 Tag|:count Tagen',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 Jahr\|:count Jahre',
14	+ 'y' => '1J\|:countJ',
15	+ 'month' => '1 Monat\|:count Monate',
16	+ 'm' => '1Mon\|:countMon',
17	+ 'week' => '1 Woche\|:count Wochen',
18	+ 'w' => '1Wo\|:countWo',
19	+ 'day' => '1 Tag\|:count Tage',
20	+ 'd' => '1Tg\|:countTg',
21	+ 'hour' => '1 Stunde\|:count Stunden',
22	+ 'h' => '1Std\|:countStd',
23	+ 'minute' => '1 Minute\|:count Minuten',
24	+ 'min' => '1Min\|:countMin',
25	+ 'second' => '1 Sekunde\|:count Sekunden',
26	+ 's' => '1Sek\|:countSek',
27	+ 'ago' => 'vor :time',
28	+ 'from_now' => 'in :time',
29	+ 'after' => ':time später',
30	+ 'before' => ':time zuvor',
31	+
32	+ 'year_from_now' => '1 Jahr\|:count Jahren',
33	+ 'month_from_now' => '1 Monat\|:count Monaten',
34	+ 'week_from_now' => '1 Woche\|:count Wochen',
35	+ 'day_from_now' => '1 Tag\|:count Tagen',
36	+ 'year_ago' => '1 Jahr\|:count Jahren',
37	+ 'month_ago' => '1 Monat\|:count Monaten',
38	+ 'week_ago' => '1 Woche\|:count Wochen',
39	+ 'day_ago' => '1 Tag\|:count Tagen',
40	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/el.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 χρόνος|:count χρόνια',
-            -
                'y' => '1 χρόνος|:count χρόνια',
-            -
                'month' => '1 μήνας|:count μήνες',
-            -
                'm' => '1 μήνας|:count μήνες',
-            -
                'week' => '1 εβδομάδα|:count εβδομάδες',
-            -
                'w' => '1 εβδομάδα|:count εβδομάδες',
-            -
                'day' => '1 μέρα|:count μέρες',
-            -
                'd' => '1 μέρα|:count μέρες',
-            -
                'hour' => '1 ώρα|:count ώρες',
-            -
                'h' => '1 ώρα|:count ώρες',
-            -
                'minute' => '1 λεπτό|:count λεπτά',
-            -
                'min' => '1 λεπτό|:count λεπτά',
-            -
                'second' => '1 δευτερόλεπτο|:count δευτερόλεπτα',
-            -
                's' => '1 δευτερόλεπτο|:count δευτερόλεπτα',
-            -
                'ago' => 'πρίν απο :time',
-            -
                'from_now' => 'σε :time απο τώρα',
-            -
                'after' => ':time μετά',
-            -
                'before' => ':time πρίν',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 χρόνος\|:count χρόνια',
14	+ 'y' => '1 χρόνος\|:count χρόνια',
15	+ 'month' => '1 μήνας\|:count μήνες',
16	+ 'm' => '1 μήνας\|:count μήνες',
17	+ 'week' => '1 εβδομάδα\|:count εβδομάδες',
18	+ 'w' => '1 εβδομάδα\|:count εβδομάδες',
19	+ 'day' => '1 μέρα\|:count μέρες',
20	+ 'd' => '1 μέρα\|:count μέρες',
21	+ 'hour' => '1 ώρα\|:count ώρες',
22	+ 'h' => '1 ώρα\|:count ώρες',
23	+ 'minute' => '1 λεπτό\|:count λεπτά',
24	+ 'min' => '1 λεπτό\|:count λεπτά',
25	+ 'second' => '1 δευτερόλεπτο\|:count δευτερόλεπτα',
26	+ 's' => '1 δευτερόλεπτο\|:count δευτερόλεπτα',
27	+ 'ago' => 'πρίν απο :time',
28	+ 'from_now' => 'σε :time απο τώρα',
29	+ 'after' => ':time μετά',
30	+ 'before' => ':time πρίν',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/en.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 year|:count years',
-            -
                'y' => '1yr|:countyrs',
-            -
                'month' => '1 month|:count months',
-            -
                'm' => '1mo|:countmos',
-            -
                'week' => '1 week|:count weeks',
-            -
                'w' => '1w|:countw',
-            -
                'day' => '1 day|:count days',
-            -
                'd' => '1d|:countd',
-            -
                'hour' => '1 hour|:count hours',
-            -
                'h' => '1h|:counth',
-            -
                'minute' => '1 minute|:count minutes',
-            -
                'min' => '1m|:countm',
-            -
                'second' => '1 second|:count seconds',
-            -
                's' => '1s|:counts',
-            -
                'ago' => ':time ago',
-            -
                'from_now' => ':time from now',
-            -
                'after' => ':time after',
-            -
                'before' => ':time before',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 year\|:count years',
14	+ 'y' => '1yr\|:countyrs',
15	+ 'month' => '1 month\|:count months',
16	+ 'm' => '1mo\|:countmos',
17	+ 'week' => '1 week\|:count weeks',
18	+ 'w' => '1w\|:countw',
19	+ 'day' => '1 day\|:count days',
20	+ 'd' => '1d\|:countd',
21	+ 'hour' => '1 hour\|:count hours',
22	+ 'h' => '1h\|:counth',
23	+ 'minute' => '1 minute\|:count minutes',
24	+ 'min' => '1m\|:countm',
25	+ 'second' => '1 second\|:count seconds',
26	+ 's' => '1s\|:counts',
27	+ 'ago' => ':time ago',
28	+ 'from_now' => ':time from now',
29	+ 'after' => ':time after',
30	+ 'before' => ':time before',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/eo.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 jaro|:count jaroj',
-            -
                'y' => '1 jaro|:count jaroj',
-            -
                'month' => '1 monato|:count monatoj',
-            -
                'm' => '1 monato|:count monatoj',
-            -
                'week' => '1 semajno|:count semajnoj',
-            -
                'w' => '1 semajno|:count semajnoj',
-            -
                'day' => '1 tago|:count tagoj',
-            -
                'd' => '1 tago|:count tagoj',
-            -
                'hour' => '1 horo|:count horoj',
-            -
                'h' => '1 horo|:count horoj',
-            -
                'minute' => '1 minuto|:count minutoj',
-            -
                'min' => '1 minuto|:count minutoj',
-            -
                'second' => '1 sekundo|:count sekundoj',
-            -
                's' => '1 sekundo|:count sekundoj',
-            -
                'ago' => 'antaŭ :time',
-            -
                'from_now' => 'je :time',
-            -
                'after' => ':time poste',
-            -
                'before' => ':time antaŭe',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 jaro\|:count jaroj',
14	+ 'y' => '1 jaro\|:count jaroj',
15	+ 'month' => '1 monato\|:count monatoj',
16	+ 'm' => '1 monato\|:count monatoj',
17	+ 'week' => '1 semajno\|:count semajnoj',
18	+ 'w' => '1 semajno\|:count semajnoj',
19	+ 'day' => '1 tago\|:count tagoj',
20	+ 'd' => '1 tago\|:count tagoj',
21	+ 'hour' => '1 horo\|:count horoj',
22	+ 'h' => '1 horo\|:count horoj',
23	+ 'minute' => '1 minuto\|:count minutoj',
24	+ 'min' => '1 minuto\|:count minutoj',
25	+ 'second' => '1 sekundo\|:count sekundoj',
26	+ 's' => '1 sekundo\|:count sekundoj',
27	+ 'ago' => 'antaŭ :time',
28	+ 'from_now' => 'je :time',
29	+ 'after' => ':time poste',
30	+ 'before' => ':time antaŭe',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/es.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 año|:count años',
-            -
                'y' => '1 año|:count años',
-            -
                'month' => '1 mes|:count meses',
-            -
                'm' => '1 mes|:count meses',
-            -
                'week' => '1 semana|:count semanas',
-            -
                'w' => '1 semana|:count semanas',
-            -
                'day' => '1 día|:count días',
-            -
                'd' => '1 día|:count días',
-            -
                'hour' => '1 hora|:count horas',
-            -
                'h' => '1 hora|:count horas',
-            -
                'minute' => '1 minuto|:count minutos',
-            -
                'min' => '1 minuto|:count minutos',
-            -
                'second' => '1 segundo|:count segundos',
-            -
                's' => '1 segundo|:count segundos',
-            -
                'ago' => 'hace :time',
-            -
                'from_now' => 'dentro de :time',
-            -
                'after' => ':time después',
-            -
                'before' => ':time antes',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 año\|:count años',
14	+ 'y' => '1 año\|:count años',
15	+ 'month' => '1 mes\|:count meses',
16	+ 'm' => '1 mes\|:count meses',
17	+ 'week' => '1 semana\|:count semanas',
18	+ 'w' => '1 semana\|:count semanas',
19	+ 'day' => '1 día\|:count días',
20	+ 'd' => '1 día\|:count días',
21	+ 'hour' => '1 hora\|:count horas',
22	+ 'h' => '1 hora\|:count horas',
23	+ 'minute' => '1 minuto\|:count minutos',
24	+ 'min' => '1 minuto\|:count minutos',
25	+ 'second' => '1 segundo\|:count segundos',
26	+ 's' => '1 segundo\|:count segundos',
27	+ 'ago' => 'hace :time',
28	+ 'from_now' => 'dentro de :time',
29	+ 'after' => ':time después',
30	+ 'before' => ':time antes',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/et.php RENAMED Viewed

@@ -1,38 +1,38 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 aasta|:count aastat',
-            -
                'y' => '1 aasta|:count aastat',
-            -
                'month' => '1 kuu|:count kuud',
-            -
                'm' => '1 kuu|:count kuud',
-            -
                'week' => '1 nädal|:count nädalat',
-            -
                'w' => '1 nädal|:count nädalat',
-            -
                'day' => '1 päev|:count päeva',
-            -
                'd' => '1 päev|:count päeva',
-            -
                'hour' => '1 tund|:count tundi',
-            -
                'h' => '1 tund|:count tundi',
-            -
                'minute' => '1 minut|:count minutit',
-            -
                'min' => '1 minut|:count minutit',
-            -
                'second' => '1 sekund|:count sekundit',
-            -
                's' => '1 sekund|:count sekundit',
-            -
                'ago' => ':time tagasi',
-            -
                'from_now' => ':time pärast',
-            -
                'after' => ':time pärast',
-            -
                'before' => ':time enne',
-            -
                'year_from_now' => ':count aasta',
-            -
                'month_from_now' => ':count kuu',
-            -
                'week_from_now' => ':count nädala',
-            -
                'day_from_now' => ':count päeva',
-            -
                'hour_from_now' => ':count tunni',
-            -
                'minute_from_now' => ':count minuti',
-            -
                'second_from_now' => ':count sekundi',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 aasta\|:count aastat',
14	+ 'y' => '1 aasta\|:count aastat',
15	+ 'month' => '1 kuu\|:count kuud',
16	+ 'm' => '1 kuu\|:count kuud',
17	+ 'week' => '1 nädal\|:count nädalat',
18	+ 'w' => '1 nädal\|:count nädalat',
19	+ 'day' => '1 päev\|:count päeva',
20	+ 'd' => '1 päev\|:count päeva',
21	+ 'hour' => '1 tund\|:count tundi',
22	+ 'h' => '1 tund\|:count tundi',
23	+ 'minute' => '1 minut\|:count minutit',
24	+ 'min' => '1 minut\|:count minutit',
25	+ 'second' => '1 sekund\|:count sekundit',
26	+ 's' => '1 sekund\|:count sekundit',
27	+ 'ago' => ':time tagasi',
28	+ 'from_now' => ':time pärast',
29	+ 'after' => ':time pärast',
30	+ 'before' => ':time enne',
31	+ 'year_from_now' => ':count aasta',
32	+ 'month_from_now' => ':count kuu',
33	+ 'week_from_now' => ':count nädala',
34	+ 'day_from_now' => ':count päeva',
35	+ 'hour_from_now' => ':count tunni',
36	+ 'minute_from_now' => ':count minuti',
37	+ 'second_from_now' => ':count sekundi',
38	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/eu.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => 'Urte 1|:count urte',
-            -
                'y' => 'Urte 1|:count urte',
-            -
                'month' => 'Hile 1|:count hile',
-            -
                'm' => 'Hile 1|:count hile',
-            -
                'week' => 'Aste 1|:count aste',
-            -
                'w' => 'Aste 1|:count aste',
-            -
                'day' => 'Egun 1|:count egun',
-            -
                'd' => 'Egun 1|:count egun',
-            -
                'hour' => 'Ordu 1|:count ordu',
-            -
                'h' => 'Ordu 1|:count ordu',
-            -
                'minute' => 'Minutu 1|:count minutu',
-            -
                'min' => 'Minutu 1|:count minutu',
-            -
                'second' => 'Segundu 1|:count segundu',
-            -
                's' => 'Segundu 1|:count segundu',
-            -
                'ago' => 'Orain dela :time',
-            -
                'from_now' => ':time barru',
-            -
                'after' => ':time geroago',
-            -
                'before' => ':time lehenago',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => 'Urte 1\|:count urte',
14	+ 'y' => 'Urte 1\|:count urte',
15	+ 'month' => 'Hile 1\|:count hile',
16	+ 'm' => 'Hile 1\|:count hile',
17	+ 'week' => 'Aste 1\|:count aste',
18	+ 'w' => 'Aste 1\|:count aste',
19	+ 'day' => 'Egun 1\|:count egun',
20	+ 'd' => 'Egun 1\|:count egun',
21	+ 'hour' => 'Ordu 1\|:count ordu',
22	+ 'h' => 'Ordu 1\|:count ordu',
23	+ 'minute' => 'Minutu 1\|:count minutu',
24	+ 'min' => 'Minutu 1\|:count minutu',
25	+ 'second' => 'Segundu 1\|:count segundu',
26	+ 's' => 'Segundu 1\|:count segundu',
27	+ 'ago' => 'Orain dela :time',
28	+ 'from_now' => ':time barru',
29	+ 'after' => ':time geroago',
30	+ 'before' => ':time lehenago',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/fa.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count سال',
-            -
                'y' => ':count سال',
-            -
                'month' => ':count ماه',
-            -
                'm' => ':count ماه',
-            -
                'week' => ':count هفته',
-            -
                'w' => ':count هفته',
-            -
                'day' => ':count روز',
-            -
                'd' => ':count روز',
-            -
                'hour' => ':count ساعت',
-            -
                'h' => ':count ساعت',
-            -
                'minute' => ':count دقیقه',
-            -
                'min' => ':count دقیقه',
-            -
                'second' => ':count ثانیه',
-            -
                's' => ':count ثانیه',
-            -
                'ago' => ':time پیش',
-            -
                'from_now' => ':time بعد',
-            -
                'after' => ':time پس از',
-            -
                'before' => ':time پیش از',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count سال',
14	+ 'y' => ':count سال',
15	+ 'month' => ':count ماه',
16	+ 'm' => ':count ماه',
17	+ 'week' => ':count هفته',
18	+ 'w' => ':count هفته',
19	+ 'day' => ':count روز',
20	+ 'd' => ':count روز',
21	+ 'hour' => ':count ساعت',
22	+ 'h' => ':count ساعت',
23	+ 'minute' => ':count دقیقه',
24	+ 'min' => ':count دقیقه',
25	+ 'second' => ':count ثانیه',
26	+ 's' => ':count ثانیه',
27	+ 'ago' => ':time پیش',
28	+ 'from_now' => ':time بعد',
29	+ 'after' => ':time پس از',
30	+ 'before' => ':time پیش از',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/fi.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 vuosi|:count vuotta',
-            -
                'y' => '1 vuosi|:count vuotta',
-            -
                'month' => '1 kuukausi|:count kuukautta',
-            -
                'm' => '1 kuukausi|:count kuukautta',
-            -
                'week' => '1 viikko|:count viikkoa',
-            -
                'w' => '1 viikko|:count viikkoa',
-            -
                'day' => '1 päivä|:count päivää',
-            -
                'd' => '1 päivä|:count päivää',
-            -
                'hour' => '1 tunti|:count tuntia',
-            -
                'h' => '1 tunti|:count tuntia',
-            -
                'minute' => '1 minuutti|:count minuuttia',
-            -
                'min' => '1 minuutti|:count minuuttia',
-            -
                'second' => '1 sekunti|:count sekuntia',
-            -
                's' => '1 sekunti|:count sekuntia',
-            -
                'ago' => ':time sitten',
-            -
                'from_now' => ':time tästä hetkestä',
-            -
                'after' => ':time sen jälkeen',
-            -
                'before' => ':time ennen',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 vuosi\|:count vuotta',
14	+ 'y' => '1 vuosi\|:count vuotta',
15	+ 'month' => '1 kuukausi\|:count kuukautta',
16	+ 'm' => '1 kuukausi\|:count kuukautta',
17	+ 'week' => '1 viikko\|:count viikkoa',
18	+ 'w' => '1 viikko\|:count viikkoa',
19	+ 'day' => '1 päivä\|:count päivää',
20	+ 'd' => '1 päivä\|:count päivää',
21	+ 'hour' => '1 tunti\|:count tuntia',
22	+ 'h' => '1 tunti\|:count tuntia',
23	+ 'minute' => '1 minuutti\|:count minuuttia',
24	+ 'min' => '1 minuutti\|:count minuuttia',
25	+ 'second' => '1 sekunti\|:count sekuntia',
26	+ 's' => '1 sekunti\|:count sekuntia',
27	+ 'ago' => ':time sitten',
28	+ 'from_now' => ':time tästä hetkestä',
29	+ 'after' => ':time sen jälkeen',
30	+ 'before' => ':time ennen',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/fo.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 ár|:count ár',
-            -
                'y' => '1 ár|:count ár',
-            -
                'month' => '1 mánaður|:count mánaðir',
-            -
                'm' => '1 mánaður|:count mánaðir',
-            -
                'week' => '1 vika|:count vikur',
-            -
                'w' => '1 vika|:count vikur',
-            -
                'day' => '1 dag|:count dagar',
-            -
                'd' => '1 dag|:count dagar',
-            -
                'hour' => '1 tími|:count tímar',
-            -
                'h' => '1 tími|:count tímar',
-            -
                'minute' => '1 minutt|:count minuttir',
-            -
                'min' => '1 minutt|:count minuttir',
-            -
                'second' => '1 sekund|:count sekundir',
-            -
                's' => '1 sekund|:count sekundir',
-            -
                'ago' => ':time síðan',
-            -
                'from_now' => 'um :time',
-            -
                'after' => ':time aftaná',
-            -
                'before' => ':time áðrenn',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 ár\|:count ár',
14	+ 'y' => '1 ár\|:count ár',
15	+ 'month' => '1 mánaður\|:count mánaðir',
16	+ 'm' => '1 mánaður\|:count mánaðir',
17	+ 'week' => '1 vika\|:count vikur',
18	+ 'w' => '1 vika\|:count vikur',
19	+ 'day' => '1 dag\|:count dagar',
20	+ 'd' => '1 dag\|:count dagar',
21	+ 'hour' => '1 tími\|:count tímar',
22	+ 'h' => '1 tími\|:count tímar',
23	+ 'minute' => '1 minutt\|:count minuttir',
24	+ 'min' => '1 minutt\|:count minuttir',
25	+ 'second' => '1 sekund\|:count sekundir',
26	+ 's' => '1 sekund\|:count sekundir',
27	+ 'ago' => ':time síðan',
28	+ 'from_now' => 'um :time',
29	+ 'after' => ':time aftaná',
30	+ 'before' => ':time áðrenn',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/fr.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 an|:count ans',
-            -
                'y' => '1 an|:count ans',
-            -
                'month' => ':count mois',
-            -
                'm' => ':count mois',
-            -
                'week' => '1 semaine|:count semaines',
-            -
                'w' => '1 semaine|:count semaines',
-            -
                'day' => '1 jour|:count jours',
-            -
                'd' => '1 jour|:count jours',
-            -
                'hour' => '1 heure|:count heures',
-            -
                'h' => '1 heure|:count heures',
-            -
                'minute' => '1 minute|:count minutes',
-            -
                'min' => '1 minute|:count minutes',
-            -
                'second' => '1 seconde|:count secondes',
-            -
                's' => '1 seconde|:count secondes',
-            -
                'ago' => 'il y a :time',
-            -
                'from_now' => 'dans :time',
-            -
                'after' => ':time après',
-            -
                'before' => ':time avant',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 an\|:count ans',
14	+ 'y' => '1 an\|:count ans',
15	+ 'month' => ':count mois',
16	+ 'm' => ':count mois',
17	+ 'week' => '1 semaine\|:count semaines',
18	+ 'w' => '1 semaine\|:count semaines',
19	+ 'day' => '1 jour\|:count jours',
20	+ 'd' => '1 jour\|:count jours',
21	+ 'hour' => '1 heure\|:count heures',
22	+ 'h' => '1 heure\|:count heures',
23	+ 'minute' => '1 minute\|:count minutes',
24	+ 'min' => '1 minute\|:count minutes',
25	+ 'second' => '1 seconde\|:count secondes',
26	+ 's' => '1 seconde\|:count secondes',
27	+ 'ago' => 'il y a :time',
28	+ 'from_now' => 'dans :time',
29	+ 'after' => ':time après',
30	+ 'before' => ':time avant',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/gl.php RENAMED Viewed

@@ -1,24 +1,24 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 ano|:count anos',
-            -
                'month' => '1 mes|:count meses',
-            -
                'week' => '1 semana|:count semanas',
-            -
                'day' => '1 día|:count días',
-            -
                'hour' => '1 hora|:count horas',
-            -
                'minute' => '1 minuto|:count minutos',
-            -
                'second' => '1 segundo|:count segundos',
-            -
                'ago' => 'fai :time',
-            -
                'from_now' => 'dentro de :time',
-            -
                'after' => ':time despois',
-            -
                'before' => ':time antes',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 ano\|:count anos',
14	+ 'month' => '1 mes\|:count meses',
15	+ 'week' => '1 semana\|:count semanas',
16	+ 'day' => '1 día\|:count días',
17	+ 'hour' => '1 hora\|:count horas',
18	+ 'minute' => '1 minuto\|:count minutos',
19	+ 'second' => '1 segundo\|:count segundos',
20	+ 'ago' => 'fai :time',
21	+ 'from_now' => 'dentro de :time',
22	+ 'after' => ':time despois',
23	+ 'before' => ':time antes',
24	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/he.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => 'שנה|{2}שנתיים|:count שנים',
-            -
                'y' => 'שנה|{2}שנתיים|:count שנים',
-            -
                'month' => 'חודש|{2}חודשיים|:count חודשים',
-            -
                'm' => 'חודש|{2}חודשיים|:count חודשים',
-            -
                'week' => 'שבוע|{2}שבועיים|:count שבועות',
-            -
                'w' => 'שבוע|{2}שבועיים|:count שבועות',
-            -
                'day' => 'יום|{2}יומיים|:count ימים',
-            -
                'd' => 'יום|{2}יומיים|:count ימים',
-            -
                'hour' => 'שעה|{2}שעתיים|:count שעות',
-            -
                'h' => 'שעה|{2}שעתיים|:count שעות',
-            -
                'minute' => 'דקה|{2}דקותיים|:count דקות',
-            -
                'min' => 'דקה|{2}דקותיים|:count דקות',
-            -
                'second' => 'שניה|:count שניות',
-            -
                's' => 'שניה|:count שניות',
-            -
                'ago' => 'לפני :time',
-            -
                'from_now' => 'בעוד :time',
-            -
                'after' => 'אחרי :time',
-            -
                'before' => 'לפני :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => 'שנה\|{2}שנתיים\|:count שנים',
14	+ 'y' => 'שנה\|{2}שנתיים\|:count שנים',
15	+ 'month' => 'חודש\|{2}חודשיים\|:count חודשים',
16	+ 'm' => 'חודש\|{2}חודשיים\|:count חודשים',
17	+ 'week' => 'שבוע\|{2}שבועיים\|:count שבועות',
18	+ 'w' => 'שבוע\|{2}שבועיים\|:count שבועות',
19	+ 'day' => 'יום\|{2}יומיים\|:count ימים',
20	+ 'd' => 'יום\|{2}יומיים\|:count ימים',
21	+ 'hour' => 'שעה\|{2}שעתיים\|:count שעות',
22	+ 'h' => 'שעה\|{2}שעתיים\|:count שעות',
23	+ 'minute' => 'דקה\|{2}דקותיים\|:count דקות',
24	+ 'min' => 'דקה\|{2}דקותיים\|:count דקות',
25	+ 'second' => 'שניה\|:count שניות',
26	+ 's' => 'שניה\|:count שניות',
27	+ 'ago' => 'לפני :time',
28	+ 'from_now' => 'בעוד :time',
29	+ 'after' => 'אחרי :time',
30	+ 'before' => 'לפני :time',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/hr.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count godinu|:count godine|:count godina',
-            -
                'y' => ':count godinu|:count godine|:count godina',
-            -
                'month' => ':count mjesec|:count mjeseca|:count mjeseci',
-            -
                'm' => ':count mjesec|:count mjeseca|:count mjeseci',
-            -
                'week' => ':count tjedan|:count tjedna|:count tjedana',
-            -
                'w' => ':count tjedan|:count tjedna|:count tjedana',
-            -
                'day' => ':count dan|:count dana|:count dana',
-            -
                'd' => ':count dan|:count dana|:count dana',
-            -
                'hour' => ':count sat|:count sata|:count sati',
-            -
                'h' => ':count sat|:count sata|:count sati',
-            -
                'minute' => ':count minutu|:count minute |:count minuta',
-            -
                'min' => ':count minutu|:count minute |:count minuta',
-            -
                'second' => ':count sekundu|:count sekunde|:count sekundi',
-            -
                's' => ':count sekundu|:count sekunde|:count sekundi',
-            -
                'ago' => 'prije :time',
-            -
                'from_now' => 'za :time',
-            -
                'after' => 'za :time',
-            -
                'before' => 'prije :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count godinu\|:count godine\|:count godina',
14	+ 'y' => ':count godinu\|:count godine\|:count godina',
15	+ 'month' => ':count mjesec\|:count mjeseca\|:count mjeseci',
16	+ 'm' => ':count mjesec\|:count mjeseca\|:count mjeseci',
17	+ 'week' => ':count tjedan\|:count tjedna\|:count tjedana',
18	+ 'w' => ':count tjedan\|:count tjedna\|:count tjedana',
19	+ 'day' => ':count dan\|:count dana\|:count dana',
20	+ 'd' => ':count dan\|:count dana\|:count dana',
21	+ 'hour' => ':count sat\|:count sata\|:count sati',
22	+ 'h' => ':count sat\|:count sata\|:count sati',
23	+ 'minute' => ':count minutu\|:count minute \|:count minuta',
24	+ 'min' => ':count minutu\|:count minute \|:count minuta',
25	+ 'second' => ':count sekundu\|:count sekunde\|:count sekundi',
26	+ 's' => ':count sekundu\|:count sekunde\|:count sekundi',
27	+ 'ago' => 'prije :time',
28	+ 'from_now' => 'za :time',
29	+ 'after' => 'za :time',
30	+ 'before' => 'prije :time',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/hu.php RENAMED Viewed

@@ -1,52 +1,52 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count év',
-            -
                'y' => ':count év',
-            -
                'month' => ':count hónap',
-            -
                'm' => ':count hónap',
-            -
                'week' => ':count hét',
-            -
                'w' => ':count hét',
-            -
                'day' => ':count nap',
-            -
                'd' => ':count nap',
-            -
                'hour' => ':count óra',
-            -
                'h' => ':count óra',
-            -
                'minute' => ':count perc',
-            -
                'min' => ':count perc',
-            -
                'second' => ':count másodperc',
-            -
                's' => ':count másodperc',
-            -
                'ago' => ':time',
-            -
                'from_now' => ':time múlva',
-            -
                'after' => ':time később',
-            -
                'before' => ':time korábban',
-            -
                'year_ago' => ':count éve',
-            -
                'month_ago' => ':count hónapja',
-            -
                'week_ago' => ':count hete',
-            -
                'day_ago' => ':count napja',
-            -
                'hour_ago' => ':count órája',
-            -
                'minute_ago' => ':count perce',
-            -
                'second_ago' => ':count másodperce',
-            -
                'year_after' => ':count évvel',
-            -
                'month_after' => ':count hónappal',
-            -
                'week_after' => ':count héttel',
-            -
                'day_after' => ':count nappal',
-            -
                'hour_after' => ':count órával',
-            -
                'minute_after' => ':count perccel',
-            -
                'second_after' => ':count másodperccel',
-            -
                'year_before' => ':count évvel',
-            -
                'month_before' => ':count hónappal',
-            -
                'week_before' => ':count héttel',
-            -
                'day_before' => ':count nappal',
-            -
                'hour_before' => ':count órával',
-            -
                'minute_before' => ':count perccel',
-            -
                'second_before' => ':count másodperccel',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count év',
14	+ 'y' => ':count év',
15	+ 'month' => ':count hónap',
16	+ 'm' => ':count hónap',
17	+ 'week' => ':count hét',
18	+ 'w' => ':count hét',
19	+ 'day' => ':count nap',
20	+ 'd' => ':count nap',
21	+ 'hour' => ':count óra',
22	+ 'h' => ':count óra',
23	+ 'minute' => ':count perc',
24	+ 'min' => ':count perc',
25	+ 'second' => ':count másodperc',
26	+ 's' => ':count másodperc',
27	+ 'ago' => ':time',
28	+ 'from_now' => ':time múlva',
29	+ 'after' => ':time később',
30	+ 'before' => ':time korábban',
31	+ 'year_ago' => ':count éve',
32	+ 'month_ago' => ':count hónapja',
33	+ 'week_ago' => ':count hete',
34	+ 'day_ago' => ':count napja',
35	+ 'hour_ago' => ':count órája',
36	+ 'minute_ago' => ':count perce',
37	+ 'second_ago' => ':count másodperce',
38	+ 'year_after' => ':count évvel',
39	+ 'month_after' => ':count hónappal',
40	+ 'week_after' => ':count héttel',
41	+ 'day_after' => ':count nappal',
42	+ 'hour_after' => ':count órával',
43	+ 'minute_after' => ':count perccel',
44	+ 'second_after' => ':count másodperccel',
45	+ 'year_before' => ':count évvel',
46	+ 'month_before' => ':count hónappal',
47	+ 'week_before' => ':count héttel',
48	+ 'day_before' => ':count nappal',
49	+ 'hour_before' => ':count órával',
50	+ 'minute_before' => ':count perccel',
51	+ 'second_before' => ':count másodperccel',
52	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/hy.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count տարի',
-            -
                'y' => ':count տարի',
-            -
                'month' => ':count ամիս',
-            -
                'm' => ':count ամիս',
-            -
                'week' => ':count շաբաթ',
-            -
                'w' => ':count շաբաթ',
-            -
                'day' => ':count օր',
-            -
                'd' => ':count օր',
-            -
                'hour' => ':count ժամ',
-            -
                'h' => ':count ժամ',
-            -
                'minute' => ':count րոպե',
-            -
                'min' => ':count րոպե',
-            -
                'second' => ':count վայրկյան',
-            -
                's' => ':count վայրկյան',
-            -
                'ago' => ':time առաջ',
-            -
                'from_now' => ':time հետո',
-            -
                'after' => ':time հետո',
-            -
                'before' => ':time առաջ',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count տարի',
14	+ 'y' => ':count տարի',
15	+ 'month' => ':count ամիս',
16	+ 'm' => ':count ամիս',
17	+ 'week' => ':count շաբաթ',
18	+ 'w' => ':count շաբաթ',
19	+ 'day' => ':count օր',
20	+ 'd' => ':count օր',
21	+ 'hour' => ':count ժամ',
22	+ 'h' => ':count ժամ',
23	+ 'minute' => ':count րոպե',
24	+ 'min' => ':count րոպե',
25	+ 'second' => ':count վայրկյան',
26	+ 's' => ':count վայրկյան',
27	+ 'ago' => ':time առաջ',
28	+ 'from_now' => ':time հետո',
29	+ 'after' => ':time հետո',
30	+ 'before' => ':time առաջ',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/id.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count tahun',
-            -
                'y' => ':count tahun',
-            -
                'month' => ':count bulan',
-            -
                'm' => ':count bulan',
-            -
                'week' => ':count minggu',
-            -
                'w' => ':count minggu',
-            -
                'day' => ':count hari',
-            -
                'd' => ':count hari',
-            -
                'hour' => ':count jam',
-            -
                'h' => ':count jam',
-            -
                'minute' => ':count menit',
-            -
                'min' => ':count menit',
-            -
                'second' => ':count detik',
-            -
                's' => ':count detik',
-            -
                'ago' => ':time yang lalu',
-            -
                'from_now' => ':time dari sekarang',
-            -
                'after' => ':time setelah',
-            -
                'before' => ':time sebelum',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count tahun',
14	+ 'y' => ':count tahun',
15	+ 'month' => ':count bulan',
16	+ 'm' => ':count bulan',
17	+ 'week' => ':count minggu',
18	+ 'w' => ':count minggu',
19	+ 'day' => ':count hari',
20	+ 'd' => ':count hari',
21	+ 'hour' => ':count jam',
22	+ 'h' => ':count jam',
23	+ 'minute' => ':count menit',
24	+ 'min' => ':count menit',
25	+ 'second' => ':count detik',
26	+ 's' => ':count detik',
27	+ 'ago' => ':time yang lalu',
28	+ 'from_now' => ':time dari sekarang',
29	+ 'after' => ':time setelah',
30	+ 'before' => ':time sebelum',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/it.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 anno|:count anni',
-            -
                'y' => '1 anno|:count anni',
-            -
                'month' => '1 mese|:count mesi',
-            -
                'm' => '1 mese|:count mesi',
-            -
                'week' => '1 settimana|:count settimane',
-            -
                'w' => '1 settimana|:count settimane',
-            -
                'day' => '1 giorno|:count giorni',
-            -
                'd' => '1 giorno|:count giorni',
-            -
                'hour' => '1 ora|:count ore',
-            -
                'h' => '1 ora|:count ore',
-            -
                'minute' => '1 minuto|:count minuti',
-            -
                'min' => '1 minuto|:count minuti',
-            -
                'second' => '1 secondo|:count secondi',
-            -
                's' => '1 secondo|:count secondi',
-            -
                'ago' => ':time fa',
-            -
                'from_now' => ':time da adesso',
-            -
                'after' => ':time dopo',
-            -
                'before' => ':time prima',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 anno\|:count anni',
14	+ 'y' => '1 anno\|:count anni',
15	+ 'month' => '1 mese\|:count mesi',
16	+ 'm' => '1 mese\|:count mesi',
17	+ 'week' => '1 settimana\|:count settimane',
18	+ 'w' => '1 settimana\|:count settimane',
19	+ 'day' => '1 giorno\|:count giorni',
20	+ 'd' => '1 giorno\|:count giorni',
21	+ 'hour' => '1 ora\|:count ore',
22	+ 'h' => '1 ora\|:count ore',
23	+ 'minute' => '1 minuto\|:count minuti',
24	+ 'min' => '1 minuto\|:count minuti',
25	+ 'second' => '1 secondo\|:count secondi',
26	+ 's' => '1 secondo\|:count secondi',
27	+ 'ago' => ':time fa',
28	+ 'from_now' => ':time da adesso',
29	+ 'after' => ':time dopo',
30	+ 'before' => ':time prima',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ja.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count 年',
-            -
                'y' => ':count 年',
-            -
                'month' => ':count ヶ月',
-            -
                'm' => ':count ヶ月',
-            -
                'week' => ':count 週間',
-            -
                'w' => ':count 週間',
-            -
                'day' => ':count 日',
-            -
                'd' => ':count 日',
-            -
                'hour' => ':count 時間',
-            -
                'h' => ':count 時間',
-            -
                'minute' => ':count 分',
-            -
                'min' => ':count 分',
-            -
                'second' => ':count 秒',
-            -
                's' => ':count 秒',
-            -
                'ago' => ':time 前',
-            -
                'from_now' => '今から :time',
-            -
                'after' => ':time 後',
-            -
                'before' => ':time 前',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count 年',
14	+ 'y' => ':count 年',
15	+ 'month' => ':count ヶ月',
16	+ 'm' => ':count ヶ月',
17	+ 'week' => ':count 週間',
18	+ 'w' => ':count 週間',
19	+ 'day' => ':count 日',
20	+ 'd' => ':count 日',
21	+ 'hour' => ':count 時間',
22	+ 'h' => ':count 時間',
23	+ 'minute' => ':count 分',
24	+ 'min' => ':count 分',
25	+ 'second' => ':count 秒',
26	+ 's' => ':count 秒',
27	+ 'ago' => ':time 前',
28	+ 'from_now' => '今から :time',
29	+ 'after' => ':time 後',
30	+ 'before' => ':time 前',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ka.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count წლის',
-            -
                'y' => ':count წლის',
-            -
                'month' => ':count თვის',
-            -
                'm' => ':count თვის',
-            -
                'week' => ':count კვირის',
-            -
                'w' => ':count კვირის',
-            -
                'day' => ':count დღის',
-            -
                'd' => ':count დღის',
-            -
                'hour' => ':count საათის',
-            -
                'h' => ':count საათის',
-            -
                'minute' => ':count წუთის',
-            -
                'min' => ':count წუთის',
-            -
                'second' => ':count წამის',
-            -
                's' => ':count წამის',
-            -
                'ago' => ':time უკან',
-            -
                'from_now' => ':time შემდეგ',
-            -
                'after' => ':time შემდეგ',
-            -
                'before' => ':time უკან',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count წლის',
14	+ 'y' => ':count წლის',
15	+ 'month' => ':count თვის',
16	+ 'm' => ':count თვის',
17	+ 'week' => ':count კვირის',
18	+ 'w' => ':count კვირის',
19	+ 'day' => ':count დღის',
20	+ 'd' => ':count დღის',
21	+ 'hour' => ':count საათის',
22	+ 'h' => ':count საათის',
23	+ 'minute' => ':count წუთის',
24	+ 'min' => ':count წუთის',
25	+ 'second' => ':count წამის',
26	+ 's' => ':count წამის',
27	+ 'ago' => ':time უკან',
28	+ 'from_now' => ':time შემდეგ',
29	+ 'after' => ':time შემდეგ',
30	+ 'before' => ':time უკან',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/km.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count ឆ្នាំ',
-            -
                'y' => ':count ឆ្នាំ',
-            -
                'month' => ':count ខែ',
-            -
                'm' => ':count ខែ',
-            -
                'week' => ':count សប្ដាហ៍',
-            -
                'w' => ':count សប្ដាហ៍',
-            -
                'day' => ':count ថ្ងៃ',
-            -
                'd' => ':count ថ្ងៃ',
-            -
                'hour' => ':count ម៉ោង',
-            -
                'h' => ':count ម៉ោង',
-            -
                'minute' => ':count នាទី',
-            -
                'min' => ':count នាទី',
-            -
                'second' => ':count វិនាទី',
-            -
                's' => ':count វិនាទី',
-            -
                'ago' => ':timeមុន',
-            -
                'from_now' => ':timeពីឥឡូវ',
-            -
                'after' => 'នៅក្រោយ :time',
-            -
                'before' => 'នៅមុន :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count ឆ្នាំ',
14	+ 'y' => ':count ឆ្នាំ',
15	+ 'month' => ':count ខែ',
16	+ 'm' => ':count ខែ',
17	+ 'week' => ':count សប្ដាហ៍',
18	+ 'w' => ':count សប្ដាហ៍',
19	+ 'day' => ':count ថ្ងៃ',
20	+ 'd' => ':count ថ្ងៃ',
21	+ 'hour' => ':count ម៉ោង',
22	+ 'h' => ':count ម៉ោង',
23	+ 'minute' => ':count នាទី',
24	+ 'min' => ':count នាទី',
25	+ 'second' => ':count វិនាទី',
26	+ 's' => ':count វិនាទី',
27	+ 'ago' => ':timeមុន',
28	+ 'from_now' => ':timeពីឥឡូវ',
29	+ 'after' => 'នៅក្រោយ :time',
30	+ 'before' => 'នៅមុន :time',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ko.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count 년',
-            -
                'y' => ':count 년',
-            -
                'month' => ':count 개월',
-            -
                'm' => ':count 개월',
-            -
                'week' => ':count 주일',
-            -
                'w' => ':count 주일',
-            -
                'day' => ':count 일',
-            -
                'd' => ':count 일',
-            -
                'hour' => ':count 시간',
-            -
                'h' => ':count 시간',
-            -
                'minute' => ':count 분',
-            -
                'min' => ':count 분',
-            -
                'second' => ':count 초',
-            -
                's' => ':count 초',
-            -
                'ago' => ':time 전',
-            -
                'from_now' => ':time 후',
-            -
                'after' => ':time 뒤',
-            -
                'before' => ':time 앞',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count 년',
14	+ 'y' => ':count 년',
15	+ 'month' => ':count 개월',
16	+ 'm' => ':count 개월',
17	+ 'week' => ':count 주일',
18	+ 'w' => ':count 주일',
19	+ 'day' => ':count 일',
20	+ 'd' => ':count 일',
21	+ 'hour' => ':count 시간',
22	+ 'h' => ':count 시간',
23	+ 'minute' => ':count 분',
24	+ 'min' => ':count 분',
25	+ 'second' => ':count 초',
26	+ 's' => ':count 초',
27	+ 'ago' => ':time 전',
28	+ 'from_now' => ':time 후',
29	+ 'after' => ':time 뒤',
30	+ 'before' => ':time 앞',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/lt.php RENAMED Viewed

@@ -1,38 +1,38 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count metus|:count metus|:count metų',
-            -
                'y' => ':count metus|:count metus|:count metų',
-            -
                'month' => ':count mėnesį|:count mėnesius|:count mėnesių',
-            -
                'm' => ':count mėnesį|:count mėnesius|:count mėnesių',
-            -
                'week' => ':count savaitę|:count savaites|:count savaičių',
-            -
                'w' => ':count savaitę|:count savaites|:count savaičių',
-            -
                'day' => ':count dieną|:count dienas|:count dienų',
-            -
                'd' => ':count dieną|:count dienas|:count dienų',
-            -
                'hour' => ':count valandą|:count valandas|:count valandų',
-            -
                'h' => ':count valandą|:count valandas|:count valandų',
-            -
                'minute' => ':count minutę|:count minutes|:count minučių',
-            -
                'min' => ':count minutę|:count minutes|:count minučių',
-            -
                'second' => ':count sekundę|:count sekundes|:count sekundžių',
-            -
                's' => ':count sekundę|:count sekundes|:count sekundžių',
-            -
                'second_from_now' => ':count sekundės|:count sekundžių|:count sekundžių',
-            -
                'minute_from_now' => ':count minutės|:count minučių|:count minučių',
-            -
                'hour_from_now' => ':count valandos|:count valandų|:count valandų',
-            -
                'day_from_now' => ':count dienos|:count dienų|:count dienų',
-            -
                'week_from_now' => ':count savaitės|:count savaičių|:count savaičių',
-            -
                'month_from_now' => ':count mėnesio|:count mėnesių|:count mėnesių',
-            -
                'year_from_now' => ':count metų',
-            -
                'ago' => 'prieš :time',
-            -
                'from_now' => 'už :time',
-            -
                'after' => 'po :time',
-            -
                'before' => ':time nuo dabar',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count metus\|:count metus\|:count metų',
14	+ 'y' => ':count metus\|:count metus\|:count metų',
15	+ 'month' => ':count mėnesį\|:count mėnesius\|:count mėnesių',
16	+ 'm' => ':count mėnesį\|:count mėnesius\|:count mėnesių',
17	+ 'week' => ':count savaitę\|:count savaites\|:count savaičių',
18	+ 'w' => ':count savaitę\|:count savaites\|:count savaičių',
19	+ 'day' => ':count dieną\|:count dienas\|:count dienų',
20	+ 'd' => ':count dieną\|:count dienas\|:count dienų',
21	+ 'hour' => ':count valandą\|:count valandas\|:count valandų',
22	+ 'h' => ':count valandą\|:count valandas\|:count valandų',
23	+ 'minute' => ':count minutę\|:count minutes\|:count minučių',
24	+ 'min' => ':count minutę\|:count minutes\|:count minučių',
25	+ 'second' => ':count sekundę\|:count sekundes\|:count sekundžių',
26	+ 's' => ':count sekundę\|:count sekundes\|:count sekundžių',
27	+ 'second_from_now' => ':count sekundės\|:count sekundžių\|:count sekundžių',
28	+ 'minute_from_now' => ':count minutės\|:count minučių\|:count minučių',
29	+ 'hour_from_now' => ':count valandos\|:count valandų\|:count valandų',
30	+ 'day_from_now' => ':count dienos\|:count dienų\|:count dienų',
31	+ 'week_from_now' => ':count savaitės\|:count savaičių\|:count savaičių',
32	+ 'month_from_now' => ':count mėnesio\|:count mėnesių\|:count mėnesių',
33	+ 'year_from_now' => ':count metų',
34	+ 'ago' => 'prieš :time',
35	+ 'from_now' => 'už :time',
36	+ 'after' => 'po :time',
37	+ 'before' => ':time nuo dabar',
38	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/lv.php RENAMED Viewed

@@ -1,47 +1,47 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '0 gadiem|:count gada|:count gadiem',
-            -
                'y' => '0 gadiem|:count gada|:count gadiem',
-            -
                'month' => '0 mēnešiem|:count mēneša|:count mēnešiem',
-            -
                'm' => '0 mēnešiem|:count mēneša|:count mēnešiem',
-            -
                'week' => '0 nedēļām|:count nedēļas|:count nedēļām',
-            -
                'w' => '0 nedēļām|:count nedēļas|:count nedēļām',
-            -
                'day' => '0 dienām|:count dienas|:count dienām',
-            -
                'd' => '0 dienām|:count dienas|:count dienām',
-            -
                'hour' => '0 stundām|:count stundas|:count stundām',
-            -
                'h' => '0 stundām|:count stundas|:count stundām',
-            -
                'minute' => '0 minūtēm|:count minūtes|:count minūtēm',
-            -
                'min' => '0 minūtēm|:count minūtes|:count minūtēm',
-            -
                'second' => '0 sekundēm|:count sekundes|:count sekundēm',
-            -
                's' => '0 sekundēm|:count sekundes|:count sekundēm',
-            -
                'ago' => 'pirms :time',
-            -
                'from_now' => 'pēc :time',
-            -
                'after' => ':time vēlāk',
-            -
                'before' => ':time pirms',
-            -
-            -
                'year_after' => '0 gadus|:count gadu|:count gadus',
-            -
                'month_after' => '0 mēnešus|:count mēnesi|:count mēnešus',
-            -
                'week_after' => '0 nedēļas|:count nedēļu|:count nedēļas',
-            -
                'day_after' => '0 dienas|:count dienu|:count dienas',
-            -
                'hour_after' => '0 stundas|:count stundu|:count stundas',
-            -
                'minute_after' => '0 minūtes|:count minūti|:count minūtes',
-            -
                'second_after' => '0 sekundes|:count sekundi|:count sekundes',
-            -
-            -
                'year_before' => '0 gadus|:count gadu|:count gadus',
-            -
                'month_before' => '0 mēnešus|:count mēnesi|:count mēnešus',
-            -
                'week_before' => '0 nedēļas|:count nedēļu|:count nedēļas',
-            -
                'day_before' => '0 dienas|:count dienu|:count dienas',
-            -
                'hour_before' => '0 stundas|:count stundu|:count stundas',
-            -
                'minute_before' => '0 minūtes|:count minūti|:count minūtes',
-            -
                'second_before' => '0 sekundes|:count sekundi|:count sekundes',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '0 gadiem\|:count gada\|:count gadiem',
14	+ 'y' => '0 gadiem\|:count gada\|:count gadiem',
15	+ 'month' => '0 mēnešiem\|:count mēneša\|:count mēnešiem',
16	+ 'm' => '0 mēnešiem\|:count mēneša\|:count mēnešiem',
17	+ 'week' => '0 nedēļām\|:count nedēļas\|:count nedēļām',
18	+ 'w' => '0 nedēļām\|:count nedēļas\|:count nedēļām',
19	+ 'day' => '0 dienām\|:count dienas\|:count dienām',
20	+ 'd' => '0 dienām\|:count dienas\|:count dienām',
21	+ 'hour' => '0 stundām\|:count stundas\|:count stundām',
22	+ 'h' => '0 stundām\|:count stundas\|:count stundām',
23	+ 'minute' => '0 minūtēm\|:count minūtes\|:count minūtēm',
24	+ 'min' => '0 minūtēm\|:count minūtes\|:count minūtēm',
25	+ 'second' => '0 sekundēm\|:count sekundes\|:count sekundēm',
26	+ 's' => '0 sekundēm\|:count sekundes\|:count sekundēm',
27	+ 'ago' => 'pirms :time',
28	+ 'from_now' => 'pēc :time',
29	+ 'after' => ':time vēlāk',
30	+ 'before' => ':time pirms',
31	+
32	+ 'year_after' => '0 gadus\|:count gadu\|:count gadus',
33	+ 'month_after' => '0 mēnešus\|:count mēnesi\|:count mēnešus',
34	+ 'week_after' => '0 nedēļas\|:count nedēļu\|:count nedēļas',
35	+ 'day_after' => '0 dienas\|:count dienu\|:count dienas',
36	+ 'hour_after' => '0 stundas\|:count stundu\|:count stundas',
37	+ 'minute_after' => '0 minūtes\|:count minūti\|:count minūtes',
38	+ 'second_after' => '0 sekundes\|:count sekundi\|:count sekundes',
39	+
40	+ 'year_before' => '0 gadus\|:count gadu\|:count gadus',
41	+ 'month_before' => '0 mēnešus\|:count mēnesi\|:count mēnešus',
42	+ 'week_before' => '0 nedēļas\|:count nedēļu\|:count nedēļas',
43	+ 'day_before' => '0 dienas\|:count dienu\|:count dienas',
44	+ 'hour_before' => '0 stundas\|:count stundu\|:count stundas',
45	+ 'minute_before' => '0 minūtes\|:count minūti\|:count minūtes',
46	+ 'second_before' => '0 sekundes\|:count sekundi\|:count sekundes',
47	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/mk.php RENAMED Viewed

@@ -1,24 +1,24 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 година|:count години',
-            -
                'month' => '1 месец|:count месеци',
-            -
                'week' => '1 седмица|:count седмици',
-            -
                'day' => '1 ден|:count дена',
-            -
                'hour' => '1 час|:count часа',
-            -
                'minute' => '1 минута|:count минути',
-            -
                'second' => '1 секунда|:count секунди',
-            -
                'ago' => 'пред :time',
-            -
                'from_now' => ':time од сега',
-            -
                'after' => 'по :time',
-            -
                'before' => 'пред :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 година\|:count години',
14	+ 'month' => '1 месец\|:count месеци',
15	+ 'week' => '1 седмица\|:count седмици',
16	+ 'day' => '1 ден\|:count дена',
17	+ 'hour' => '1 час\|:count часа',
18	+ 'minute' => '1 минута\|:count минути',
19	+ 'second' => '1 секунда\|:count секунди',
20	+ 'ago' => 'пред :time',
21	+ 'from_now' => ':time од сега',
22	+ 'after' => 'по :time',
23	+ 'before' => 'пред :time',
24	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ms.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count tahun',
-            -
                'y' => ':count tahun',
-            -
                'month' => ':count bulan',
-            -
                'm' => ':count bulan',
-            -
                'week' => ':count minggu',
-            -
                'w' => ':count minggu',
-            -
                'day' => ':count hari',
-            -
                'd' => ':count hari',
-            -
                'hour' => ':count jam',
-            -
                'h' => ':count jam',
-            -
                'minute' => ':count minit',
-            -
                'min' => ':count minit',
-            -
                'second' => ':count saat',
-            -
                's' => ':count saat',
-            -
                'ago' => ':time yang lalu',
-            -
                'from_now' => ':time dari sekarang',
-            -
                'after' => ':time selepas',
-            -
                'before' => ':time sebelum',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count tahun',
14	+ 'y' => ':count tahun',
15	+ 'month' => ':count bulan',
16	+ 'm' => ':count bulan',
17	+ 'week' => ':count minggu',
18	+ 'w' => ':count minggu',
19	+ 'day' => ':count hari',
20	+ 'd' => ':count hari',
21	+ 'hour' => ':count jam',
22	+ 'h' => ':count jam',
23	+ 'minute' => ':count minit',
24	+ 'min' => ':count minit',
25	+ 'second' => ':count saat',
26	+ 's' => ':count saat',
27	+ 'ago' => ':time yang lalu',
28	+ 'from_now' => ':time dari sekarang',
29	+ 'after' => ':time selepas',
30	+ 'before' => ':time sebelum',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/nl.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count jaar',
-            -
                'y' => ':count jaar',
-            -
                'month' => '1 maand|:count maanden',
-            -
                'm' => '1 maand|:count maanden',
-            -
                'week' => '1 week|:count weken',
-            -
                'w' => '1 week|:count weken',
-            -
                'day' => '1 dag|:count dagen',
-            -
                'd' => '1 dag|:count dagen',
-            -
                'hour' => ':count uur',
-            -
                'h' => ':count uur',
-            -
                'minute' => '1 minuut|:count minuten',
-            -
                'min' => '1 minuut|:count minuten',
-            -
                'second' => '1 seconde|:count seconden',
-            -
                's' => '1 seconde|:count seconden',
-            -
                'ago' => ':time geleden',
-            -
                'from_now' => 'over :time',
-            -
                'after' => ':time later',
-            -
                'before' => ':time eerder',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count jaar',
14	+ 'y' => ':count jaar',
15	+ 'month' => '1 maand\|:count maanden',
16	+ 'm' => '1 maand\|:count maanden',
17	+ 'week' => '1 week\|:count weken',
18	+ 'w' => '1 week\|:count weken',
19	+ 'day' => '1 dag\|:count dagen',
20	+ 'd' => '1 dag\|:count dagen',
21	+ 'hour' => ':count uur',
22	+ 'h' => ':count uur',
23	+ 'minute' => '1 minuut\|:count minuten',
24	+ 'min' => '1 minuut\|:count minuten',
25	+ 'second' => '1 seconde\|:count seconden',
26	+ 's' => '1 seconde\|:count seconden',
27	+ 'ago' => ':time geleden',
28	+ 'from_now' => 'over :time',
29	+ 'after' => ':time later',
30	+ 'before' => ':time eerder',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/no.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 år|:count år',
-            -
                'y' => '1 år|:count år',
-            -
                'month' => '1 måned|:count måneder',
-            -
                'm' => '1 måned|:count måneder',
-            -
                'week' => '1 uke|:count uker',
-            -
                'w' => '1 uke|:count uker',
-            -
                'day' => '1 dag|:count dager',
-            -
                'd' => '1 dag|:count dager',
-            -
                'hour' => '1 time|:count timer',
-            -
                'h' => '1 time|:count timer',
-            -
                'minute' => '1 minutt|:count minutter',
-            -
                'min' => '1 minutt|:count minutter',
-            -
                'second' => '1 sekund|:count sekunder',
-            -
                's' => '1 sekund|:count sekunder',
-            -
                'ago' => ':time siden',
-            -
                'from_now' => 'om :time',
-            -
                'after' => ':time etter',
-            -
                'before' => ':time før',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 år\|:count år',
14	+ 'y' => '1 år\|:count år',
15	+ 'month' => '1 måned\|:count måneder',
16	+ 'm' => '1 måned\|:count måneder',
17	+ 'week' => '1 uke\|:count uker',
18	+ 'w' => '1 uke\|:count uker',
19	+ 'day' => '1 dag\|:count dager',
20	+ 'd' => '1 dag\|:count dager',
21	+ 'hour' => '1 time\|:count timer',
22	+ 'h' => '1 time\|:count timer',
23	+ 'minute' => '1 minutt\|:count minutter',
24	+ 'min' => '1 minutt\|:count minutter',
25	+ 'second' => '1 sekund\|:count sekunder',
26	+ 's' => '1 sekund\|:count sekunder',
27	+ 'ago' => ':time siden',
28	+ 'from_now' => 'om :time',
29	+ 'after' => ':time etter',
30	+ 'before' => ':time før',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/pl.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 rok|:count lata|:count lat',
-            -
                'y' => '1 rok|:count lata|:count lat',
-            -
                'month' => '1 miesiąc|:count miesiące|:count miesięcy',
-            -
                'm' => '1 miesiąc|:count miesiące|:count miesięcy',
-            -
                'week' => '1 tydzień|:count tygodnie|:count tygodni',
-            -
                'w' => '1 tydzień|:count tygodnie|:count tygodni',
-            -
                'day' => '1 dzień|:count dni|:count dni',
-            -
                'd' => '1 dzień|:count dni|:count dni',
-            -
                'hour' => '1 godzina|:count godziny|:count godzin',
-            -
                'h' => '1 godzina|:count godziny|:count godzin',
-            -
                'minute' => '1 minuta|:count minuty|:count minut',
-            -
                'min' => '1 minuta|:count minuty|:count minut',
-            -
                'second' => '1 sekunda|:count sekundy|:count sekund',
-            -
                's' => '1 sekunda|:count sekundy|:count sekund',
-            -
                'ago' => ':time temu',
-            -
                'from_now' => ':time od teraz',
-            -
                'after' => ':time przed',
-            -
                'before' => ':time po',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 rok\|:count lata\|:count lat',
14	+ 'y' => '1 rok\|:count lata\|:count lat',
15	+ 'month' => '1 miesiąc\|:count miesiące\|:count miesięcy',
16	+ 'm' => '1 miesiąc\|:count miesiące\|:count miesięcy',
17	+ 'week' => '1 tydzień\|:count tygodnie\|:count tygodni',
18	+ 'w' => '1 tydzień\|:count tygodnie\|:count tygodni',
19	+ 'day' => '1 dzień\|:count dni\|:count dni',
20	+ 'd' => '1 dzień\|:count dni\|:count dni',
21	+ 'hour' => '1 godzina\|:count godziny\|:count godzin',
22	+ 'h' => '1 godzina\|:count godziny\|:count godzin',
23	+ 'minute' => '1 minuta\|:count minuty\|:count minut',
24	+ 'min' => '1 minuta\|:count minuty\|:count minut',
25	+ 'second' => '1 sekunda\|:count sekundy\|:count sekund',
26	+ 's' => '1 sekunda\|:count sekundy\|:count sekund',
27	+ 'ago' => ':time temu',
28	+ 'from_now' => ':time od teraz',
29	+ 'after' => ':time przed',
30	+ 'before' => ':time po',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/pt.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 ano|:count anos',
-            -
                'y' => '1 ano|:count anos',
-            -
                'month' => '1 mês|:count meses',
-            -
                'm' => '1 mês|:count meses',
-            -
                'week' => '1 semana|:count semanas',
-            -
                'w' => '1 semana|:count semanas',
-            -
                'day' => '1 dia|:count dias',
-            -
                'd' => '1 dia|:count dias',
-            -
                'hour' => '1 hora|:count horas',
-            -
                'h' => '1 hora|:count horas',
-            -
                'minute' => '1 minuto|:count minutos',
-            -
                'min' => '1 minuto|:count minutos',
-            -
                'second' => '1 segundo|:count segundos',
-            -
                's' => '1 segundo|:count segundos',
-            -
                'ago' => ':time atrás',
-            -
                'from_now' => 'em :time',
-            -
                'after' => ':time depois',
-            -
                'before' => ':time antes',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 ano\|:count anos',
14	+ 'y' => '1 ano\|:count anos',
15	+ 'month' => '1 mês\|:count meses',
16	+ 'm' => '1 mês\|:count meses',
17	+ 'week' => '1 semana\|:count semanas',
18	+ 'w' => '1 semana\|:count semanas',
19	+ 'day' => '1 dia\|:count dias',
20	+ 'd' => '1 dia\|:count dias',
21	+ 'hour' => '1 hora\|:count horas',
22	+ 'h' => '1 hora\|:count horas',
23	+ 'minute' => '1 minuto\|:count minutos',
24	+ 'min' => '1 minuto\|:count minutos',
25	+ 'second' => '1 segundo\|:count segundos',
26	+ 's' => '1 segundo\|:count segundos',
27	+ 'ago' => ':time atrás',
28	+ 'from_now' => 'em :time',
29	+ 'after' => ':time depois',
30	+ 'before' => ':time antes',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/pt_BR.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 ano|:count anos',
-            -
                'y' => '1 ano|:count anos',
-            -
                'month' => '1 mês|:count meses',
-            -
                'm' => '1 mês|:count meses',
-            -
                'week' => '1 semana|:count semanas',
-            -
                'w' => '1 semana|:count semanas',
-            -
                'day' => '1 dia|:count dias',
-            -
                'd' => '1 dia|:count dias',
-            -
                'hour' => '1 hora|:count horas',
-            -
                'h' => '1 hora|:count horas',
-            -
                'minute' => '1 minuto|:count minutos',
-            -
                'min' => '1 minuto|:count minutos',
-            -
                'second' => '1 segundo|:count segundos',
-            -
                's' => '1 segundo|:count segundos',
-            -
                'ago' => 'há :time',
-            -
                'from_now' => 'em :time',
-            -
                'after' => 'após :time',
-            -
                'before' => ':time atrás',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 ano\|:count anos',
14	+ 'y' => '1 ano\|:count anos',
15	+ 'month' => '1 mês\|:count meses',
16	+ 'm' => '1 mês\|:count meses',
17	+ 'week' => '1 semana\|:count semanas',
18	+ 'w' => '1 semana\|:count semanas',
19	+ 'day' => '1 dia\|:count dias',
20	+ 'd' => '1 dia\|:count dias',
21	+ 'hour' => '1 hora\|:count horas',
22	+ 'h' => '1 hora\|:count horas',
23	+ 'minute' => '1 minuto\|:count minutos',
24	+ 'min' => '1 minuto\|:count minutos',
25	+ 'second' => '1 segundo\|:count segundos',
26	+ 's' => '1 segundo\|:count segundos',
27	+ 'ago' => 'há :time',
28	+ 'from_now' => 'em :time',
29	+ 'after' => 'após :time',
30	+ 'before' => ':time atrás',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ro.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => 'un an|:count ani|:count ani',
-            -
                'y' => 'un an|:count ani|:count ani',
-            -
                'month' => 'o lună|:count luni|:count luni',
-            -
                'm' => 'o lună|:count luni|:count luni',
-            -
                'week' => 'o săptămână|:count săptămâni|:count săptămâni',
-            -
                'w' => 'o săptămână|:count săptămâni|:count săptămâni',
-            -
                'day' => 'o zi|:count zile|:count zile',
-            -
                'd' => 'o zi|:count zile|:count zile',
-            -
                'hour' => 'o oră|:count ore|:count ore',
-            -
                'h' => 'o oră|:count ore|:count ore',
-            -
                'minute' => 'un minut|:count minute|:count minute',
-            -
                'min' => 'un minut|:count minute|:count minute',
-            -
                'second' => 'o secundă|:count secunde|:count secunde',
-            -
                's' => 'o secundă|:count secunde|:count secunde',
-            -
                'ago' => 'acum :time',
-            -
                'from_now' => ':time de acum',
-            -
                'after' => 'peste :time',
-            -
                'before' => 'acum :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => 'un an\|:count ani\|:count ani',
14	+ 'y' => 'un an\|:count ani\|:count ani',
15	+ 'month' => 'o lună\|:count luni\|:count luni',
16	+ 'm' => 'o lună\|:count luni\|:count luni',
17	+ 'week' => 'o săptămână\|:count săptămâni\|:count săptămâni',
18	+ 'w' => 'o săptămână\|:count săptămâni\|:count săptămâni',
19	+ 'day' => 'o zi\|:count zile\|:count zile',
20	+ 'd' => 'o zi\|:count zile\|:count zile',
21	+ 'hour' => 'o oră\|:count ore\|:count ore',
22	+ 'h' => 'o oră\|:count ore\|:count ore',
23	+ 'minute' => 'un minut\|:count minute\|:count minute',
24	+ 'min' => 'un minut\|:count minute\|:count minute',
25	+ 'second' => 'o secundă\|:count secunde\|:count secunde',
26	+ 's' => 'o secundă\|:count secunde\|:count secunde',
27	+ 'ago' => 'acum :time',
28	+ 'from_now' => ':time de acum',
29	+ 'after' => 'peste :time',
30	+ 'before' => 'acum :time',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ru.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count год|:count года|:count лет',
-            -
                'y' => ':count год|:count года|:count лет',
-            -
                'month' => ':count месяц|:count месяца|:count месяцев',
-            -
                'm' => ':count месяц|:count месяца|:count месяцев',
-            -
                'week' => ':count неделю|:count недели|:count недель',
-            -
                'w' => ':count неделю|:count недели|:count недель',
-            -
                'day' => ':count день|:count дня|:count дней',
-            -
                'd' => ':count день|:count дня|:count дней',
-            -
                'hour' => ':count час|:count часа|:count часов',
-            -
                'h' => ':count час|:count часа|:count часов',
-            -
                'minute' => ':count минуту|:count минуты|:count минут',
-            -
                'min' => ':count минуту|:count минуты|:count минут',
-            -
                'second' => ':count секунду|:count секунды|:count секунд',
-            -
                's' => ':count секунду|:count секунды|:count секунд',
-            -
                'ago' => ':time назад',
-            -
                'from_now' => 'через :time',
-            -
                'after' => ':time после',
-            -
                'before' => ':time до',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count год\|:count года\|:count лет',
14	+ 'y' => ':count год\|:count года\|:count лет',
15	+ 'month' => ':count месяц\|:count месяца\|:count месяцев',
16	+ 'm' => ':count месяц\|:count месяца\|:count месяцев',
17	+ 'week' => ':count неделю\|:count недели\|:count недель',
18	+ 'w' => ':count неделю\|:count недели\|:count недель',
19	+ 'day' => ':count день\|:count дня\|:count дней',
20	+ 'd' => ':count день\|:count дня\|:count дней',
21	+ 'hour' => ':count час\|:count часа\|:count часов',
22	+ 'h' => ':count час\|:count часа\|:count часов',
23	+ 'minute' => ':count минуту\|:count минуты\|:count минут',
24	+ 'min' => ':count минуту\|:count минуты\|:count минут',
25	+ 'second' => ':count секунду\|:count секунды\|:count секунд',
26	+ 's' => ':count секунду\|:count секунды\|:count секунд',
27	+ 'ago' => ':time назад',
28	+ 'from_now' => 'через :time',
29	+ 'after' => ':time после',
30	+ 'before' => ':time до',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sk.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => 'rok|:count roky|:count rokov',
-            -
                'y' => 'rok|:count roky|:count rokov',
-            -
                'month' => 'mesiac|:count mesiace|:count mesiacov',
-            -
                'm' => 'mesiac|:count mesiace|:count mesiacov',
-            -
                'week' => 'týždeň|:count týždne|:count týždňov',
-            -
                'w' => 'týždeň|:count týždne|:count týždňov',
-            -
                'day' => 'deň|:count dni|:count dní',
-            -
                'd' => 'deň|:count dni|:count dní',
-            -
                'hour' => 'hodinu|:count hodiny|:count hodín',
-            -
                'h' => 'hodinu|:count hodiny|:count hodín',
-            -
                'minute' => 'minútu|:count minúty|:count minút',
-            -
                'min' => 'minútu|:count minúty|:count minút',
-            -
                'second' => 'sekundu|:count sekundy|:count sekúnd',
-            -
                's' => 'sekundu|:count sekundy|:count sekúnd',
-            -
                'ago' => 'pred :time',
-            -
                'from_now' => 'za :time',
-            -
                'after' => ':time neskôr',
-            -
                'before' => ':time predtým',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => 'rok\|:count roky\|:count rokov',
14	+ 'y' => 'rok\|:count roky\|:count rokov',
15	+ 'month' => 'mesiac\|:count mesiace\|:count mesiacov',
16	+ 'm' => 'mesiac\|:count mesiace\|:count mesiacov',
17	+ 'week' => 'týždeň\|:count týždne\|:count týždňov',
18	+ 'w' => 'týždeň\|:count týždne\|:count týždňov',
19	+ 'day' => 'deň\|:count dni\|:count dní',
20	+ 'd' => 'deň\|:count dni\|:count dní',
21	+ 'hour' => 'hodinu\|:count hodiny\|:count hodín',
22	+ 'h' => 'hodinu\|:count hodiny\|:count hodín',
23	+ 'minute' => 'minútu\|:count minúty\|:count minút',
24	+ 'min' => 'minútu\|:count minúty\|:count minút',
25	+ 'second' => 'sekundu\|:count sekundy\|:count sekúnd',
26	+ 's' => 'sekundu\|:count sekundy\|:count sekúnd',
27	+ 'ago' => 'pred :time',
28	+ 'from_now' => 'za :time',
29	+ 'after' => ':time neskôr',
30	+ 'before' => ':time predtým',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sl.php RENAMED Viewed

@@ -1,38 +1,38 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count leto|:count leti|:count leta|:count let',
-            -
                'y' => ':count leto|:count leti|:count leta|:count let',
-            -
                'month' => ':count mesec|:count meseca|:count mesece|:count mesecev',
-            -
                'm' => ':count mesec|:count meseca|:count mesece|:count mesecev',
-            -
                'week' => ':count teden|:count tedna|:count tedne|:count tednov',
-            -
                'w' => ':count teden|:count tedna|:count tedne|:count tednov',
-            -
                'day' => ':count dan|:count dni|:count dni|:count dni',
-            -
                'd' => ':count dan|:count dni|:count dni|:count dni',
-            -
                'hour' => ':count uro|:count uri|:count ure|:count ur',
-            -
                'h' => ':count uro|:count uri|:count ure|:count ur',
-            -
                'minute' => ':count minuto|:count minuti|:count minute|:count minut',
-            -
                'min' => ':count minuto|:count minuti|:count minute|:count minut',
-            -
                'second' => ':count sekundo|:count sekundi|:count sekunde|:count sekund',
-            -
                's' => ':count sekundo|:count sekundi|:count sekunde|:count sekund',
-            -
                'year_ago' => ':count letom|:count leti|:count leti|:count leti',
-            -
                'month_ago' => ':count mesecem|:count meseci|:count meseci|:count meseci',
-            -
                'week_ago' => ':count tednom|:count tednoma|:count tedni|:count tedni',
-            -
                'day_ago' => ':count dnem|:count dnevoma|:count dnevi|:count dnevi',
-            -
                'hour_ago' => ':count uro|:count urama|:count urami|:count urami',
-            -
                'minute_ago' => ':count minuto|:count minutama|:count minutami|:count minutami',
-            -
                'second_ago' => ':count sekundo|:count sekundama|:count sekundami|:count sekundami',
-            -
                'ago' => 'pred :time',
-            -
                'from_now' => 'čez :time',
-            -
                'after' => 'čez :time',
-            -
                'before' => 'pred :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count leto\|:count leti\|:count leta\|:count let',
14	+ 'y' => ':count leto\|:count leti\|:count leta\|:count let',
15	+ 'month' => ':count mesec\|:count meseca\|:count mesece\|:count mesecev',
16	+ 'm' => ':count mesec\|:count meseca\|:count mesece\|:count mesecev',
17	+ 'week' => ':count teden\|:count tedna\|:count tedne\|:count tednov',
18	+ 'w' => ':count teden\|:count tedna\|:count tedne\|:count tednov',
19	+ 'day' => ':count dan\|:count dni\|:count dni\|:count dni',
20	+ 'd' => ':count dan\|:count dni\|:count dni\|:count dni',
21	+ 'hour' => ':count uro\|:count uri\|:count ure\|:count ur',
22	+ 'h' => ':count uro\|:count uri\|:count ure\|:count ur',
23	+ 'minute' => ':count minuto\|:count minuti\|:count minute\|:count minut',
24	+ 'min' => ':count minuto\|:count minuti\|:count minute\|:count minut',
25	+ 'second' => ':count sekundo\|:count sekundi\|:count sekunde\|:count sekund',
26	+ 's' => ':count sekundo\|:count sekundi\|:count sekunde\|:count sekund',
27	+ 'year_ago' => ':count letom\|:count leti\|:count leti\|:count leti',
28	+ 'month_ago' => ':count mesecem\|:count meseci\|:count meseci\|:count meseci',
29	+ 'week_ago' => ':count tednom\|:count tednoma\|:count tedni\|:count tedni',
30	+ 'day_ago' => ':count dnem\|:count dnevoma\|:count dnevi\|:count dnevi',
31	+ 'hour_ago' => ':count uro\|:count urama\|:count urami\|:count urami',
32	+ 'minute_ago' => ':count minuto\|:count minutama\|:count minutami\|:count minutami',
33	+ 'second_ago' => ':count sekundo\|:count sekundama\|:count sekundami\|:count sekundami',
34	+ 'ago' => 'pred :time',
35	+ 'from_now' => 'čez :time',
36	+ 'after' => 'čez :time',
37	+ 'before' => 'pred :time',
38	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sq.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 vit|:count vjet',
-            -
                'y' => '1 vit|:count vjet',
-            -
                'month' => '1 muaj|:count muaj',
-            -
                'm' => '1 muaj|:count muaj',
-            -
                'week' => '1 javë|:count javë',
-            -
                'w' => '1 javë|:count javë',
-            -
                'day' => '1 ditë|:count ditë',
-            -
                'd' => '1 ditë|:count ditë',
-            -
                'hour' => '1 orë|:count orë',
-            -
                'h' => '1 orë|:count orë',
-            -
                'minute' => '1 minutë|:count minuta',
-            -
                'min' => '1 minutë|:count minuta',
-            -
                'second' => '1 sekondë|:count sekonda',
-            -
                's' => '1 sekondë|:count sekonda',
-            -
                'ago' => ':time më parë',
-            -
                'from_now' => ':time nga tani',
-            -
                'after' => ':time pas',
-            -
                'before' => ':time para',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 vit\|:count vjet',
14	+ 'y' => '1 vit\|:count vjet',
15	+ 'month' => '1 muaj\|:count muaj',
16	+ 'm' => '1 muaj\|:count muaj',
17	+ 'week' => '1 javë\|:count javë',
18	+ 'w' => '1 javë\|:count javë',
19	+ 'day' => '1 ditë\|:count ditë',
20	+ 'd' => '1 ditë\|:count ditë',
21	+ 'hour' => '1 orë\|:count orë',
22	+ 'h' => '1 orë\|:count orë',
23	+ 'minute' => '1 minutë\|:count minuta',
24	+ 'min' => '1 minutë\|:count minuta',
25	+ 'second' => '1 sekondë\|:count sekonda',
26	+ 's' => '1 sekondë\|:count sekonda',
27	+ 'ago' => ':time më parë',
28	+ 'from_now' => ':time nga tani',
29	+ 'after' => ':time pas',
30	+ 'before' => ':time para',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sr.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count godina|:count godine|:count godina',
-            -
                'y' => ':count godina|:count godine|:count godina',
-            -
                'month' => ':count mesec|:count meseca|:count meseci',
-            -
                'm' => ':count mesec|:count meseca|:count meseci',
-            -
                'week' => ':count nedelja|:count nedelje|:count nedelja',
-            -
                'w' => ':count nedelja|:count nedelje|:count nedelja',
-            -
                'day' => ':count dan|:count dana|:count dana',
-            -
                'd' => ':count dan|:count dana|:count dana',
-            -
                'hour' => ':count sat|:count sata|:count sati',
-            -
                'h' => ':count sat|:count sata|:count sati',
-            -
                'minute' => ':count minut|:count minuta |:count minuta',
-            -
                'min' => ':count minut|:count minuta |:count minuta',
-            -
                'second' => ':count sekund|:count sekunde|:count sekunde',
-            -
                's' => ':count sekund|:count sekunde|:count sekunde',
-            -
                'ago' => 'pre :time',
-            -
                'from_now' => ':time od sada',
-            -
                'after' => 'nakon :time',
-            -
                'before' => 'pre :time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count godina\|:count godine\|:count godina',
14	+ 'y' => ':count godina\|:count godine\|:count godina',
15	+ 'month' => ':count mesec\|:count meseca\|:count meseci',
16	+ 'm' => ':count mesec\|:count meseca\|:count meseci',
17	+ 'week' => ':count nedelja\|:count nedelje\|:count nedelja',
18	+ 'w' => ':count nedelja\|:count nedelje\|:count nedelja',
19	+ 'day' => ':count dan\|:count dana\|:count dana',
20	+ 'd' => ':count dan\|:count dana\|:count dana',
21	+ 'hour' => ':count sat\|:count sata\|:count sati',
22	+ 'h' => ':count sat\|:count sata\|:count sati',
23	+ 'minute' => ':count minut\|:count minuta \|:count minuta',
24	+ 'min' => ':count minut\|:count minuta \|:count minuta',
25	+ 'second' => ':count sekund\|:count sekunde\|:count sekunde',
26	+ 's' => ':count sekund\|:count sekunde\|:count sekunde',
27	+ 'ago' => 'pre :time',
28	+ 'from_now' => ':time od sada',
29	+ 'after' => 'nakon :time',
30	+ 'before' => 'pre :time',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sr_Cyrl_ME.php RENAMED Viewed

@@ -1,38 +1,38 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count године|[0,Inf[ :count година',
-            -
                'y' => ':count г.',
-            -
                'month' => '{1} :count мјесец|{2,3,4}:count мјесеца|[5,Inf[ :count мјесеци',
-            -
                'm' => ':count мј.',
-            -
                'week' => '{1} :count недјеља|{2,3,4}:count недјеље|[5,Inf[ :count недјеља',
-            -
                'w' => ':count нед.',
-            -
                'day' => '{1,21,31} :count дан|[2,Inf[ :count дана',
-            -
                'd' => ':count д.',
-            -
                'hour' => '{1,21} :count сат|{2,3,4,22,23,24}:count сата|[5,Inf[ :count сати',
-            -
                'h' => ':count ч.',
-            -
                'minute' => '{1,21,31,41,51} :count минут|[2,Inf[ :count минута',
-            -
                'min' => ':count мин.',
-            -
                'second' => '{1,21,31,41,51} :count секунд|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count секунде|[5,Inf[:count секунди',
-            -
                's' => ':count сек.',
-            -
                'ago' => 'прије :time',
-            -
                'from_now' => 'за :time',
-            -
                'after' => ':time након',
-            -
                'before' => ':time прије',
-            -
-            -
                'year_from_now' => '{1,21,31,41,51} :count годину|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count године|[5,Inf[ :count година',
-            -
                'year_ago' => '{1,21,31,41,51} :count годину|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count године|[5,Inf[ :count година',
-            -
-            -
                'week_from_now' => '{1} :count недјељу|{2,3,4} :count недјеље|[5,Inf[ :count недјеља',
-            -
                'week_ago' => '{1} :count недјељу|{2,3,4} :count недјеље|[5,Inf[ :count недјеља',
-            -
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count године\|[0,Inf[ :count година',
14	+ 'y' => ':count г.',
15	+ 'month' => '{1} :count мјесец\|{2,3,4}:count мјесеца\|[5,Inf[ :count мјесеци',
16	+ 'm' => ':count мј.',
17	+ 'week' => '{1} :count недјеља\|{2,3,4}:count недјеље\|[5,Inf[ :count недјеља',
18	+ 'w' => ':count нед.',
19	+ 'day' => '{1,21,31} :count дан\|[2,Inf[ :count дана',
20	+ 'd' => ':count д.',
21	+ 'hour' => '{1,21} :count сат\|{2,3,4,22,23,24}:count сата\|[5,Inf[ :count сати',
22	+ 'h' => ':count ч.',
23	+ 'minute' => '{1,21,31,41,51} :count минут\|[2,Inf[ :count минута',
24	+ 'min' => ':count мин.',
25	+ 'second' => '{1,21,31,41,51} :count секунд\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count секунде\|[5,Inf[:count секунди',
26	+ 's' => ':count сек.',
27	+ 'ago' => 'прије :time',
28	+ 'from_now' => 'за :time',
29	+ 'after' => ':time након',
30	+ 'before' => ':time прије',
31	+
32	+ 'year_from_now' => '{1,21,31,41,51} :count годину\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count године\|[5,Inf[ :count година',
33	+ 'year_ago' => '{1,21,31,41,51} :count годину\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count године\|[5,Inf[ :count година',
34	+
35	+ 'week_from_now' => '{1} :count недјељу\|{2,3,4} :count недјеље\|[5,Inf[ :count недјеља',
36	+ 'week_ago' => '{1} :count недјељу\|{2,3,4} :count недјеље\|[5,Inf[ :count недјеља',
37	+
38	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sr_Latn_ME.php RENAMED Viewed

@@ -1,38 +1,38 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count godine|[0,Inf[ :count godina',
-            -
                'y' => ':count g.',
-            -
                'month' => '{1} :count mjesec|{2,3,4}:count mjeseca|[5,Inf[ :count mjeseci',
-            -
                'm' => ':count mj.',
-            -
                'week' => '{1} :count nedjelja|{2,3,4}:count nedjelje|[5,Inf[ :count nedjelja',
-            -
                'w' => ':count ned.',
-            -
                'day' => '{1,21,31} :count dan|[2,Inf[ :count dana',
-            -
                'd' => ':count d.',
-            -
                'hour' => '{1,21} :count sat|{2,3,4,22,23,24}:count sata|[5,Inf[ :count sati',
-            -
                'h' => ':count č.',
-            -
                'minute' => '{1,21,31,41,51} :count minut|[2,Inf[ :count minuta',
-            -
                'min' => ':count min.',
-            -
                'second' => '{1,21,31,41,51} :count sekund|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count sekunde|[5,Inf[:count sekundi',
-            -
                's' => ':count sek.',
-            -
                'ago' => 'prije :time',
-            -
                'from_now' => 'za :time',
-            -
                'after' => ':time nakon',
-            -
                'before' => ':time prije',
-            -
-            -
                'year_from_now' => '{1,21,31,41,51} :count godinu|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count godine|[5,Inf[ :count godina',
-            -
                'year_ago' => '{1,21,31,41,51} :count godinu|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count godine|[5,Inf[ :count godina',
-            -
-            -
                'week_from_now' => '{1} :count nedjelju|{2,3,4} :count nedjelje|[5,Inf[ :count nedjelja',
-            -
                'week_ago' => '{1} :count nedjelju|{2,3,4} :count nedjelje|[5,Inf[ :count nedjelja',
-            -
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count godine\|[0,Inf[ :count godina',
14	+ 'y' => ':count g.',
15	+ 'month' => '{1} :count mjesec\|{2,3,4}:count mjeseca\|[5,Inf[ :count mjeseci',
16	+ 'm' => ':count mj.',
17	+ 'week' => '{1} :count nedjelja\|{2,3,4}:count nedjelje\|[5,Inf[ :count nedjelja',
18	+ 'w' => ':count ned.',
19	+ 'day' => '{1,21,31} :count dan\|[2,Inf[ :count dana',
20	+ 'd' => ':count d.',
21	+ 'hour' => '{1,21} :count sat\|{2,3,4,22,23,24}:count sata\|[5,Inf[ :count sati',
22	+ 'h' => ':count č.',
23	+ 'minute' => '{1,21,31,41,51} :count minut\|[2,Inf[ :count minuta',
24	+ 'min' => ':count min.',
25	+ 'second' => '{1,21,31,41,51} :count sekund\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count sekunde\|[5,Inf[:count sekundi',
26	+ 's' => ':count sek.',
27	+ 'ago' => 'prije :time',
28	+ 'from_now' => 'za :time',
29	+ 'after' => ':time nakon',
30	+ 'before' => ':time prije',
31	+
32	+ 'year_from_now' => '{1,21,31,41,51} :count godinu\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count godine\|[5,Inf[ :count godina',
33	+ 'year_ago' => '{1,21,31,41,51} :count godinu\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count godine\|[5,Inf[ :count godina',
34	+
35	+ 'week_from_now' => '{1} :count nedjelju\|{2,3,4} :count nedjelje\|[5,Inf[ :count nedjelja',
36	+ 'week_ago' => '{1} :count nedjelju\|{2,3,4} :count nedjelje\|[5,Inf[ :count nedjelja',
37	+
38	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sr_ME.php RENAMED Viewed

@@ -1,38 +1,38 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count godine|[0,Inf[ :count godina',
-            -
                'y' => ':count g.',
-            -
                'month' => '{1} :count mjesec|{2,3,4}:count mjeseca|[5,Inf[ :count mjeseci',
-            -
                'm' => ':count mj.',
-            -
                'week' => '{1} :count nedjelja|{2,3,4}:count nedjelje|[5,Inf[ :count nedjelja',
-            -
                'w' => ':count ned.',
-            -
                'day' => '{1,21,31} :count dan|[2,Inf[ :count dana',
-            -
                'd' => ':count d.',
-            -
                'hour' => '{1,21} :count sat|{2,3,4,22,23,24}:count sata|[5,Inf[ :count sati',
-            -
                'h' => ':count č.',
-            -
                'minute' => '{1,21,31,41,51} :count minut|[2,Inf[ :count minuta',
-            -
                'min' => ':count min.',
-            -
                'second' => '{1,21,31,41,51} :count sekund|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count sekunde|[5,Inf[:count sekundi',
-            -
                's' => ':count sek.',
-            -
                'ago' => 'prije :time',
-            -
                'from_now' => 'za :time',
-            -
                'after' => ':time nakon',
-            -
                'before' => ':time prije',
-            -
-            -
                'year_from_now' => '{1,21,31,41,51} :count godinu|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count godine|[5,Inf[ :count godina',
-            -
                'year_ago' => '{1,21,31,41,51} :count godinu|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count godine|[5,Inf[ :count godina',
-            -
-            -
                'week_from_now' => '{1} :count nedjelju|{2,3,4} :count nedjelje|[5,Inf[ :count nedjelja',
-            -
                'week_ago' => '{1} :count nedjelju|{2,3,4} :count nedjelje|[5,Inf[ :count nedjelja',
-            -
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count godine\|[0,Inf[ :count godina',
14	+ 'y' => ':count g.',
15	+ 'month' => '{1} :count mjesec\|{2,3,4}:count mjeseca\|[5,Inf[ :count mjeseci',
16	+ 'm' => ':count mj.',
17	+ 'week' => '{1} :count nedjelja\|{2,3,4}:count nedjelje\|[5,Inf[ :count nedjelja',
18	+ 'w' => ':count ned.',
19	+ 'day' => '{1,21,31} :count dan\|[2,Inf[ :count dana',
20	+ 'd' => ':count d.',
21	+ 'hour' => '{1,21} :count sat\|{2,3,4,22,23,24}:count sata\|[5,Inf[ :count sati',
22	+ 'h' => ':count č.',
23	+ 'minute' => '{1,21,31,41,51} :count minut\|[2,Inf[ :count minuta',
24	+ 'min' => ':count min.',
25	+ 'second' => '{1,21,31,41,51} :count sekund\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54}:count sekunde\|[5,Inf[:count sekundi',
26	+ 's' => ':count sek.',
27	+ 'ago' => 'prije :time',
28	+ 'from_now' => 'za :time',
29	+ 'after' => ':time nakon',
30	+ 'before' => ':time prije',
31	+
32	+ 'year_from_now' => '{1,21,31,41,51} :count godinu\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count godine\|[5,Inf[ :count godina',
33	+ 'year_ago' => '{1,21,31,41,51} :count godinu\|{2,3,4,22,23,24,32,33,34,42,43,44,52,53,54} :count godine\|[5,Inf[ :count godina',
34	+
35	+ 'week_from_now' => '{1} :count nedjelju\|{2,3,4} :count nedjelje\|[5,Inf[ :count nedjelja',
36	+ 'week_ago' => '{1} :count nedjelju\|{2,3,4} :count nedjelje\|[5,Inf[ :count nedjelja',
37	+
38	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/sv.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 år|:count år',
-            -
                'y' => '1 år|:count år',
-            -
                'month' => '1 månad|:count månader',
-            -
                'm' => '1 månad|:count månader',
-            -
                'week' => '1 vecka|:count veckor',
-            -
                'w' => '1 vecka|:count veckor',
-            -
                'day' => '1 dag|:count dagar',
-            -
                'd' => '1 dag|:count dagar',
-            -
                'hour' => '1 timme|:count timmar',
-            -
                'h' => '1 timme|:count timmar',
-            -
                'minute' => '1 minut|:count minuter',
-            -
                'min' => '1 minut|:count minuter',
-            -
                'second' => '1 sekund|:count sekunder',
-            -
                's' => '1 sekund|:count sekunder',
-            -
                'ago' => ':time sedan',
-            -
                'from_now' => 'om :time',
-            -
                'after' => ':time efter',
-            -
                'before' => ':time före',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 år\|:count år',
14	+ 'y' => '1 år\|:count år',
15	+ 'month' => '1 månad\|:count månader',
16	+ 'm' => '1 månad\|:count månader',
17	+ 'week' => '1 vecka\|:count veckor',
18	+ 'w' => '1 vecka\|:count veckor',
19	+ 'day' => '1 dag\|:count dagar',
20	+ 'd' => '1 dag\|:count dagar',
21	+ 'hour' => '1 timme\|:count timmar',
22	+ 'h' => '1 timme\|:count timmar',
23	+ 'minute' => '1 minut\|:count minuter',
24	+ 'min' => '1 minut\|:count minuter',
25	+ 'second' => '1 sekund\|:count sekunder',
26	+ 's' => '1 sekund\|:count sekunder',
27	+ 'ago' => ':time sedan',
28	+ 'from_now' => 'om :time',
29	+ 'after' => ':time efter',
30	+ 'before' => ':time före',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/th.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => '1 ปี|:count ปี',
-            -
                'y' => '1 ปี|:count ปี',
-            -
                'month' => '1 เดือน|:count เดือน',
-            -
                'm' => '1 เดือน|:count เดือน',
-            -
                'week' => '1 สัปดาห์|:count สัปดาห์',
-            -
                'w' => '1 สัปดาห์|:count สัปดาห์',
-            -
                'day' => '1 วัน|:count วัน',
-            -
                'd' => '1 วัน|:count วัน',
-            -
                'hour' => '1 ชั่วโมง|:count ชั่วโมง',
-            -
                'h' => '1 ชั่วโมง|:count ชั่วโมง',
-            -
                'minute' => '1 นาที|:count นาที',
-            -
                'min' => '1 นาที|:count นาที',
-            -
                'second' => '1 วินาที|:count วินาที',
-            -
                's' => '1 วินาที|:count วินาที',
-            -
                'ago' => ':time ที่แล้ว',
-            -
                'from_now' => ':time จากนี้',
-            -
                'after' => 'หลัง:time',
-            -
                'before' => 'ก่อน:time',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => '1 ปี\|:count ปี',
14	+ 'y' => '1 ปี\|:count ปี',
15	+ 'month' => '1 เดือน\|:count เดือน',
16	+ 'm' => '1 เดือน\|:count เดือน',
17	+ 'week' => '1 สัปดาห์\|:count สัปดาห์',
18	+ 'w' => '1 สัปดาห์\|:count สัปดาห์',
19	+ 'day' => '1 วัน\|:count วัน',
20	+ 'd' => '1 วัน\|:count วัน',
21	+ 'hour' => '1 ชั่วโมง\|:count ชั่วโมง',
22	+ 'h' => '1 ชั่วโมง\|:count ชั่วโมง',
23	+ 'minute' => '1 นาที\|:count นาที',
24	+ 'min' => '1 นาที\|:count นาที',
25	+ 'second' => '1 วินาที\|:count วินาที',
26	+ 's' => '1 วินาที\|:count วินาที',
27	+ 'ago' => ':time ที่แล้ว',
28	+ 'from_now' => ':time จากนี้',
29	+ 'after' => 'หลัง:time',
30	+ 'before' => 'ก่อน:time',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/tr.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count yıl',
-            -
                'y' => ':count yıl',
-            -
                'month' => ':count ay',
-            -
                'm' => ':count ay',
-            -
                'week' => ':count hafta',
-            -
                'w' => ':count hafta',
-            -
                'day' => ':count gün',
-            -
                'd' => ':count gün',
-            -
                'hour' => ':count saat',
-            -
                'h' => ':count saat',
-            -
                'minute' => ':count dakika',
-            -
                'min' => ':count dakika',
-            -
                'second' => ':count saniye',
-            -
                's' => ':count saniye',
-            -
                'ago' => ':time önce',
-            -
                'from_now' => ':time sonra',
-            -
                'after' => ':time sonra',
-            -
                'before' => ':time önce',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count yıl',
14	+ 'y' => ':count yıl',
15	+ 'month' => ':count ay',
16	+ 'm' => ':count ay',
17	+ 'week' => ':count hafta',
18	+ 'w' => ':count hafta',
19	+ 'day' => ':count gün',
20	+ 'd' => ':count gün',
21	+ 'hour' => ':count saat',
22	+ 'h' => ':count saat',
23	+ 'minute' => ':count dakika',
24	+ 'min' => ':count dakika',
25	+ 'second' => ':count saniye',
26	+ 's' => ':count saniye',
27	+ 'ago' => ':time önce',
28	+ 'from_now' => ':time sonra',
29	+ 'after' => ':time sonra',
30	+ 'before' => ':time önce',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/uk.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count рік|:count роки|:count років',
-            -
                'y' => ':count рік|:count роки|:count років',
-            -
                'month' => ':count місяць|:count місяці|:count місяців',
-            -
                'm' => ':count місяць|:count місяці|:count місяців',
-            -
                'week' => ':count тиждень|:count тижні|:count тижнів',
-            -
                'w' => ':count тиждень|:count тижні|:count тижнів',
-            -
                'day' => ':count день|:count дні|:count днів',
-            -
                'd' => ':count день|:count дні|:count днів',
-            -
                'hour' => ':count година|:count години|:count годин',
-            -
                'h' => ':count година|:count години|:count годин',
-            -
                'minute' => ':count хвилину|:count хвилини|:count хвилин',
-            -
                'min' => ':count хвилину|:count хвилини|:count хвилин',
-            -
                'second' => ':count секунду|:count секунди|:count секунд',
-            -
                's' => ':count секунду|:count секунди|:count секунд',
-            -
                'ago' => ':time назад',
-            -
                'from_now' => 'через :time',
-            -
                'after' => ':time після',
-            -
                'before' => ':time до',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count рік\|:count роки\|:count років',
14	+ 'y' => ':count рік\|:count роки\|:count років',
15	+ 'month' => ':count місяць\|:count місяці\|:count місяців',
16	+ 'm' => ':count місяць\|:count місяці\|:count місяців',
17	+ 'week' => ':count тиждень\|:count тижні\|:count тижнів',
18	+ 'w' => ':count тиждень\|:count тижні\|:count тижнів',
19	+ 'day' => ':count день\|:count дні\|:count днів',
20	+ 'd' => ':count день\|:count дні\|:count днів',
21	+ 'hour' => ':count година\|:count години\|:count годин',
22	+ 'h' => ':count година\|:count години\|:count годин',
23	+ 'minute' => ':count хвилину\|:count хвилини\|:count хвилин',
24	+ 'min' => ':count хвилину\|:count хвилини\|:count хвилин',
25	+ 'second' => ':count секунду\|:count секунди\|:count секунд',
26	+ 's' => ':count секунду\|:count секунди\|:count секунд',
27	+ 'ago' => ':time назад',
28	+ 'from_now' => 'через :time',
29	+ 'after' => ':time після',
30	+ 'before' => ':time до',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/ur.php RENAMED Viewed

@@ -1,24 +1,24 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count سال',
-            -
                'month' => ':count ماه',
-            -
                'week' => ':count ہفتے',
-            -
                'day' => ':count روز',
-            -
                'hour' => ':count گھنٹے',
-            -
                'minute' => ':count منٹ',
-            -
                'second' => ':count سیکنڈ',
-            -
                'ago' => ':time پہلے',
-            -
                'from_now' => ':time بعد',
-            -
                'after' => ':time بعد',
-            -
                'before' => ':time پہلے',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count سال',
14	+ 'month' => ':count ماه',
15	+ 'week' => ':count ہفتے',
16	+ 'day' => ':count روز',
17	+ 'hour' => ':count گھنٹے',
18	+ 'minute' => ':count منٹ',
19	+ 'second' => ':count سیکنڈ',
20	+ 'ago' => ':time پہلے',
21	+ 'from_now' => ':time بعد',
22	+ 'after' => ':time بعد',
23	+ 'before' => ':time پہلے',
24	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/uz.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count yil|:count yil|:count yil',
-            -
                'y' => ':count yil|:count yil|:count yil',
-            -
                'month' => ':count oy|:count oy|:count oylar',
-            -
                'm' => ':count oy|:count oy|:count oylar',
-            -
                'week' => ':count hafta|:count hafta|:count hafta',
-            -
                'w' => ':count hafta|:count hafta|:count hafta',
-            -
                'day' => ':count kun|:count kun|:count kun',
-            -
                'd' => ':count kun|:count kun|:count kun',
-            -
                'hour' => ':count soat|:count soat|:count soat',
-            -
                'h' => ':count soat|:count soat|:count soat',
-            -
                'minute' => ':count minut|:count minut|:count minut',
-            -
                'min' => ':count minut|:count minut|:count minut',
-            -
                'second' => ':count sekund|:count sekund|:count sekund',
-            -
                's' => ':count sekund|:count sekund|:count sekund',
-            -
                'ago' => ':time avval',
-            -
                'from_now' => ':time keyin',
-            -
                'after' => ':time keyin',
-            -
                'before' => ':time oldin',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count yil\|:count yil\|:count yil',
14	+ 'y' => ':count yil\|:count yil\|:count yil',
15	+ 'month' => ':count oy\|:count oy\|:count oylar',
16	+ 'm' => ':count oy\|:count oy\|:count oylar',
17	+ 'week' => ':count hafta\|:count hafta\|:count hafta',
18	+ 'w' => ':count hafta\|:count hafta\|:count hafta',
19	+ 'day' => ':count kun\|:count kun\|:count kun',
20	+ 'd' => ':count kun\|:count kun\|:count kun',
21	+ 'hour' => ':count soat\|:count soat\|:count soat',
22	+ 'h' => ':count soat\|:count soat\|:count soat',
23	+ 'minute' => ':count minut\|:count minut\|:count minut',
24	+ 'min' => ':count minut\|:count minut\|:count minut',
25	+ 'second' => ':count sekund\|:count sekund\|:count sekund',
26	+ 's' => ':count sekund\|:count sekund\|:count sekund',
27	+ 'ago' => ':time avval',
28	+ 'from_now' => ':time keyin',
29	+ 'after' => ':time keyin',
30	+ 'before' => ':time oldin',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/vi.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count năm',
-            -
                'y' => ':count năm',
-            -
                'month' => ':count tháng',
-            -
                'm' => ':count tháng',
-            -
                'week' => ':count tuần',
-            -
                'w' => ':count tuần',
-            -
                'day' => ':count ngày',
-            -
                'd' => ':count ngày',
-            -
                'hour' => ':count giờ',
-            -
                'h' => ':count giờ',
-            -
                'minute' => ':count phút',
-            -
                'min' => ':count phút',
-            -
                'second' => ':count giây',
-            -
                's' => ':count giây',
-            -
                'ago' => ':time trước',
-            -
                'from_now' => ':time từ bây giờ',
-            -
                'after' => ':time sau',
-            -
                'before' => ':time trước',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count năm',
14	+ 'y' => ':count năm',
15	+ 'month' => ':count tháng',
16	+ 'm' => ':count tháng',
17	+ 'week' => ':count tuần',
18	+ 'w' => ':count tuần',
19	+ 'day' => ':count ngày',
20	+ 'd' => ':count ngày',
21	+ 'hour' => ':count giờ',
22	+ 'h' => ':count giờ',
23	+ 'minute' => ':count phút',
24	+ 'min' => ':count phút',
25	+ 'second' => ':count giây',
26	+ 's' => ':count giây',
27	+ 'ago' => ':time trước',
28	+ 'from_now' => ':time từ bây giờ',
29	+ 'after' => ':time sau',
30	+ 'before' => ':time trước',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/zh.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count年',
-            -
                'y' => ':count年',
-            -
                'month' => ':count个月',
-            -
                'm' => ':count个月',
-            -
                'week' => ':count周',
-            -
                'w' => ':count周',
-            -
                'day' => ':count天',
-            -
                'd' => ':count天',
-            -
                'hour' => ':count小时',
-            -
                'h' => ':count小时',
-            -
                'minute' => ':count分钟',
-            -
                'min' => ':count分钟',
-            -
                'second' => ':count秒',
-            -
                's' => ':count秒',
-            -
                'ago' => ':time前',
-            -
                'from_now' => '距现在:time',
-            -
                'after' => ':time后',
-            -
                'before' => ':time前',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count年',
14	+ 'y' => ':count年',
15	+ 'month' => ':count个月',
16	+ 'm' => ':count个月',
17	+ 'week' => ':count周',
18	+ 'w' => ':count周',
19	+ 'day' => ':count天',
20	+ 'd' => ':count天',
21	+ 'hour' => ':count小时',
22	+ 'h' => ':count小时',
23	+ 'minute' => ':count分钟',
24	+ 'min' => ':count分钟',
25	+ 'second' => ':count秒',
26	+ 's' => ':count秒',
27	+ 'ago' => ':time前',
28	+ 'from_now' => '距现在:time',
29	+ 'after' => ':time后',
30	+ 'before' => ':time前',
31	+ );

src/common/lib/{Carbon → vendor/nesbot/carbon/src/Carbon}/Lang/zh_TW.php RENAMED Viewed

@@ -1,31 +1,31 @@
-            -
            <?php
-            -
-            -
            /*
-            -
             * This file is part of the Carbon package.
-            -
             *
-            -
             * (c) Brian Nesbitt <brian@nesbot.com>
-            -
             *
-            -
             * For the full copyright and license information, please view the LICENSE
-            -
             * file that was distributed with this source code.
-            -
             */
-            -
-            -
            return array(
-            -
                'year' => ':count 年',
-            -
                'y' => ':count 年',
-            -
                'month' => ':count 月',
-            -
                'm' => ':count 月',
-            -
                'week' => ':count 周',
-            -
                'w' => ':count 周',
-            -
                'day' => ':count 天',
-            -
                'd' => ':count 天',
-            -
                'hour' => ':count 小時',
-            -
                'h' => ':count 小時',
-            -
                'minute' => ':count 分鐘',
-            -
                'min' => ':count 分鐘',
-            -
                'second' => ':count 秒',
-            -
                's' => ':count 秒',
-            -
                'ago' => ':time前',
-            -
                'from_now' => '距現在 :time',
-            -
                'after' => ':time後',
-            -
                'before' => ':time前',
-            -
            );


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Carbon package.
5	+ *
6	+ * (c) Brian Nesbitt <brian@nesbot.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ return array(
13	+ 'year' => ':count 年',
14	+ 'y' => ':count 年',
15	+ 'month' => ':count 月',
16	+ 'm' => ':count 月',
17	+ 'week' => ':count 周',
18	+ 'w' => ':count 周',
19	+ 'day' => ':count 天',
20	+ 'd' => ':count 天',
21	+ 'hour' => ':count 小時',
22	+ 'h' => ':count 小時',
23	+ 'minute' => ':count 分鐘',
24	+ 'min' => ':count 分鐘',
25	+ 'second' => ':count 秒',
26	+ 's' => ':count 秒',
27	+ 'ago' => ':time前',
28	+ 'from_now' => '距現在 :time',
29	+ 'after' => ':time後',
30	+ 'before' => ':time前',
31	+ );

src/common/lib/vendor/symfony/polyfill-mbstring/LICENSE ADDED Viewed

	@@ -0,0 +1,19 @@


1	+ Copyright (c) 2014-2016 Fabien Potencier
2	+
3	+ Permission is hereby granted, free of charge, to any person obtaining a copy
4	+ of this software and associated documentation files (the "Software"), to deal
5	+ in the Software without restriction, including without limitation the rights
6	+ to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
7	+ copies of the Software, and to permit persons to whom the Software is furnished
8	+ to do so, subject to the following conditions:
9	+
10	+ The above copyright notice and this permission notice shall be included in all
11	+ copies or substantial portions of the Software.
12	+
13	+ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
14	+ IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
15	+ FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
16	+ AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
17	+ LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
18	+ OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
19	+ THE SOFTWARE.

src/common/lib/vendor/symfony/polyfill-mbstring/Mbstring.php ADDED Viewed

	@@ -0,0 +1,664 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Polyfill\Mbstring;
13	+
14	+ /**
15	+ * Partial mbstring implementation in PHP, iconv based, UTF-8 centric.
16	+ *
17	+ * Implemented:
18	+ * - mb_chr - Returns a specific character from its Unicode code point
19	+ * - mb_convert_encoding - Convert character encoding
20	+ * - mb_convert_variables - Convert character code in variable(s)
21	+ * - mb_decode_mimeheader - Decode string in MIME header field
22	+ * - mb_encode_mimeheader - Encode string for MIME header XXX NATIVE IMPLEMENTATION IS REALLY BUGGED
23	+ * - mb_convert_case - Perform case folding on a string
24	+ * - mb_get_info - Get internal settings of mbstring
25	+ * - mb_http_input - Detect HTTP input character encoding
26	+ * - mb_http_output - Set/Get HTTP output character encoding
27	+ * - mb_internal_encoding - Set/Get internal character encoding
28	+ * - mb_list_encodings - Returns an array of all supported encodings
29	+ * - mb_ord - Returns the Unicode code point of a character
30	+ * - mb_output_handler - Callback function converts character encoding in output buffer
31	+ * - mb_scrub - Replaces ill-formed byte sequences with substitute characters
32	+ * - mb_strlen - Get string length
33	+ * - mb_strpos - Find position of first occurrence of string in a string
34	+ * - mb_strrpos - Find position of last occurrence of a string in a string
35	+ * - mb_strtolower - Make a string lowercase
36	+ * - mb_strtoupper - Make a string uppercase
37	+ * - mb_substitute_character - Set/Get substitution character
38	+ * - mb_substr - Get part of string
39	+ * - mb_stripos - Finds position of first occurrence of a string within another, case insensitive
40	+ * - mb_stristr - Finds first occurrence of a string within another, case insensitive
41	+ * - mb_strrchr - Finds the last occurrence of a character in a string within another
42	+ * - mb_strrichr - Finds the last occurrence of a character in a string within another, case insensitive
43	+ * - mb_strripos - Finds position of last occurrence of a string within another, case insensitive
44	+ * - mb_strstr - Finds first occurrence of a string within anothers
45	+ * - mb_strwidth - Return width of string
46	+ * - mb_substr_count - Count the number of substring occurrences
47	+ *
48	+ * Not implemented:
49	+ * - mb_convert_kana - Convert "kana" one from another ("zen-kaku", "han-kaku" and more)
50	+ * - mb_decode_numericentity - Decode HTML numeric string reference to character
51	+ * - mb_encode_numericentity - Encode character to HTML numeric string reference
52	+ * - mb_ereg_* - Regular expression with multibyte support
53	+ * - mb_parse_str - Parse GET/POST/COOKIE data and set global variable
54	+ * - mb_preferred_mime_name - Get MIME charset string
55	+ * - mb_regex_encoding - Returns current encoding for multibyte regex as string
56	+ * - mb_regex_set_options - Set/Get the default options for mbregex functions
57	+ * - mb_send_mail - Send encoded mail
58	+ * - mb_split - Split multibyte string using regular expression
59	+ * - mb_strcut - Get part of string
60	+ * - mb_strimwidth - Get truncated string with specified width
61	+ *
62	+ * @author Nicolas Grekas <p@tchwork.com>
63	+ *
64	+ * @internal
65	+ */
66	+ final class Mbstring
67	+ {
68	+ const MB_CASE_FOLD = PHP_INT_MAX;
69	+
70	+ private static $encodingList = array('ASCII', 'UTF-8');
71	+ private static $language = 'neutral';
72	+ private static $internalEncoding = 'UTF-8';
73	+ private static $caseFold = array(
74	+ array('µ','ſ',"\xCD\x85",'ς',"\xCF\x90","\xCF\x91","\xCF\x95","\xCF\x96","\xCF\xB0","\xCF\xB1","\xCF\xB5","\xE1\xBA\x9B","\xE1\xBE\xBE"),
75	+ array('μ','s','ι', 'σ','β', 'θ', 'φ', 'π', 'κ', 'ρ', 'ε', "\xE1\xB9\xA1",'ι'),
76	+ );
77	+
78	+ public static function mb_convert_encoding($s, $toEncoding, $fromEncoding = null)
79	+ {
80	+ if (is_array($fromEncoding) \|\| false !== strpos($fromEncoding, ',')) {
81	+ $fromEncoding = self::mb_detect_encoding($s, $fromEncoding);
82	+ } else {
83	+ $fromEncoding = self::getEncoding($fromEncoding);
84	+ }
85	+
86	+ $toEncoding = self::getEncoding($toEncoding);
87	+
88	+ if ('BASE64' === $fromEncoding) {
89	+ $s = base64_decode($s);
90	+ $fromEncoding = $toEncoding;
91	+ }
92	+
93	+ if ('BASE64' === $toEncoding) {
94	+ return base64_encode($s);
95	+ }
96	+
97	+ if ('HTML-ENTITIES' === $toEncoding \|\| 'HTML' === $toEncoding) {
98	+ if ('HTML-ENTITIES' === $fromEncoding \|\| 'HTML' === $fromEncoding) {
99	+ $fromEncoding = 'Windows-1252';
100	+ }
101	+ if ('UTF-8' !== $fromEncoding) {
102	+ $s = iconv($fromEncoding, 'UTF-8//IGNORE', $s);
103	+ }
104	+
105	+ return preg_replace_callback('/[\x80-\xFF]+/', array(__CLASS__, 'html_encoding_callback'), $s);
106	+ }
107	+
108	+ if ('HTML-ENTITIES' === $fromEncoding) {
109	+ $s = html_entity_decode($s, ENT_COMPAT, 'UTF-8');
110	+ $fromEncoding = 'UTF-8';
111	+ }
112	+
113	+ return iconv($fromEncoding, $toEncoding.'//IGNORE', $s);
114	+ }
115	+
116	+ public static function mb_convert_variables($toEncoding, $fromEncoding, &$a = null, &$b = null, &$c = null, &$d = null, &$e = null, &$f = null)
117	+ {
118	+ $vars = array(&$a, &$b, &$c, &$d, &$e, &$f);
119	+
120	+ $ok = true;
121	+ array_walk_recursive($vars, function (&$v) use (&$ok, $toEncoding, $fromEncoding) {
122	+ if (false === $v = Mbstring::mb_convert_encoding($v, $toEncoding, $fromEncoding)) {
123	+ $ok = false;
124	+ }
125	+ });
126	+
127	+ return $ok ? $fromEncoding : false;
128	+ }
129	+
130	+ public static function mb_decode_mimeheader($s)
131	+ {
132	+ return iconv_mime_decode($s, 2, self::$internalEncoding);
133	+ }
134	+
135	+ public static function mb_encode_mimeheader($s, $charset = null, $transferEncoding = null, $linefeed = null, $indent = null)
136	+ {
137	+ trigger_error('mb_encode_mimeheader() is bugged. Please use iconv_mime_encode() instead', E_USER_WARNING);
138	+ }
139	+
140	+ public static function mb_convert_case($s, $mode, $encoding = null)
141	+ {
142	+ if ('' === $s .= '') {
143	+ return '';
144	+ }
145	+
146	+ $encoding = self::getEncoding($encoding);
147	+
148	+ if ('UTF-8' === $encoding) {
149	+ $encoding = null;
150	+ if (!preg_match('//u', $s)) {
151	+ $s = @iconv('UTF-8', 'UTF-8//IGNORE', $s);
152	+ }
153	+ } else {
154	+ $s = iconv($encoding, 'UTF-8//IGNORE', $s);
155	+ }
156	+
157	+ if (MB_CASE_TITLE == $mode) {
158	+ $s = preg_replace_callback('/\b\p{Ll}/u', array(__CLASS__, 'title_case_upper'), $s);
159	+ $s = preg_replace_callback('/\B[\p{Lu}\p{Lt}]+/u', array(__CLASS__, 'title_case_lower'), $s);
160	+ } else {
161	+ if (MB_CASE_UPPER == $mode) {
162	+ static $upper = null;
163	+ if (null === $upper) {
164	+ $upper = self::getData('upperCase');
165	+ }
166	+ $map = $upper;
167	+ } else {
168	+ if (self::MB_CASE_FOLD === $mode) {
169	+ $s = str_replace(self::$caseFold[0], self::$caseFold[1], $s);
170	+ }
171	+
172	+ static $lower = null;
173	+ if (null === $lower) {
174	+ $lower = self::getData('lowerCase');
175	+ }
176	+ $map = $lower;
177	+ }
178	+
179	+ static $ulenMask = array("\xC0" => 2, "\xD0" => 2, "\xE0" => 3, "\xF0" => 4);
180	+
181	+ $i = 0;
182	+ $len = strlen($s);
183	+
184	+ while ($i < $len) {
185	+ $ulen = $s[$i] < "\x80" ? 1 : $ulenMask[$s[$i] & "\xF0"];
186	+ $uchr = substr($s, $i, $ulen);
187	+ $i += $ulen;
188	+
189	+ if (isset($map[$uchr])) {
190	+ $uchr = $map[$uchr];
191	+ $nlen = strlen($uchr);
192	+
193	+ if ($nlen == $ulen) {
194	+ $nlen = $i;
195	+ do {
196	+ $s[--$nlen] = $uchr[--$ulen];
197	+ } while ($ulen);
198	+ } else {
199	+ $s = substr_replace($s, $uchr, $i - $ulen, $ulen);
200	+ $len += $nlen - $ulen;
201	+ $i += $nlen - $ulen;
202	+ }
203	+ }
204	+ }
205	+ }
206	+
207	+ if (null === $encoding) {
208	+ return $s;
209	+ }
210	+
211	+ return iconv('UTF-8', $encoding.'//IGNORE', $s);
212	+ }
213	+
214	+ public static function mb_internal_encoding($encoding = null)
215	+ {
216	+ if (null === $encoding) {
217	+ return self::$internalEncoding;
218	+ }
219	+
220	+ $encoding = self::getEncoding($encoding);
221	+
222	+ if ('UTF-8' === $encoding \|\| false !== @iconv($encoding, $encoding, ' ')) {
223	+ self::$internalEncoding = $encoding;
224	+
225	+ return true;
226	+ }
227	+
228	+ return false;
229	+ }
230	+
231	+ public static function mb_language($lang = null)
232	+ {
233	+ if (null === $lang) {
234	+ return self::$language;
235	+ }
236	+
237	+ switch ($lang = strtolower($lang)) {
238	+ case 'uni':
239	+ case 'neutral':
240	+ self::$language = $lang;
241	+
242	+ return true;
243	+ }
244	+
245	+ return false;
246	+ }
247	+
248	+ public static function mb_list_encodings()
249	+ {
250	+ return array('UTF-8');
251	+ }
252	+
253	+ public static function mb_encoding_aliases($encoding)
254	+ {
255	+ switch (strtoupper($encoding)) {
256	+ case 'UTF8':
257	+ case 'UTF-8':
258	+ return array('utf8');
259	+ }
260	+
261	+ return false;
262	+ }
263	+
264	+ public static function mb_check_encoding($var = null, $encoding = null)
265	+ {
266	+ if (null === $encoding) {
267	+ if (null === $var) {
268	+ return false;
269	+ }
270	+ $encoding = self::$internalEncoding;
271	+ }
272	+
273	+ return self::mb_detect_encoding($var, array($encoding)) \|\| false !== @iconv($encoding, $encoding, $var);
274	+ }
275	+
276	+ public static function mb_detect_encoding($str, $encodingList = null, $strict = false)
277	+ {
278	+ if (null === $encodingList) {
279	+ $encodingList = self::$encodingList;
280	+ } else {
281	+ if (!is_array($encodingList)) {
282	+ $encodingList = array_map('trim', explode(',', $encodingList));
283	+ }
284	+ $encodingList = array_map('strtoupper', $encodingList);
285	+ }
286	+
287	+ foreach ($encodingList as $enc) {
288	+ switch ($enc) {
289	+ case 'ASCII':
290	+ if (!preg_match('/[\x80-\xFF]/', $str)) {
291	+ return $enc;
292	+ }
293	+ break;
294	+
295	+ case 'UTF8':
296	+ case 'UTF-8':
297	+ if (preg_match('//u', $str)) {
298	+ return 'UTF-8';
299	+ }
300	+ break;
301	+
302	+ default:
303	+ if (0 === strncmp($enc, 'ISO-8859-', 9)) {
304	+ return $enc;
305	+ }
306	+ }
307	+ }
308	+
309	+ return false;
310	+ }
311	+
312	+ public static function mb_detect_order($encodingList = null)
313	+ {
314	+ if (null === $encodingList) {
315	+ return self::$encodingList;
316	+ }
317	+
318	+ if (!is_array($encodingList)) {
319	+ $encodingList = array_map('trim', explode(',', $encodingList));
320	+ }
321	+ $encodingList = array_map('strtoupper', $encodingList);
322	+
323	+ foreach ($encodingList as $enc) {
324	+ switch ($enc) {
325	+ default:
326	+ if (strncmp($enc, 'ISO-8859-', 9)) {
327	+ return false;
328	+ }
329	+ case 'ASCII':
330	+ case 'UTF8':
331	+ case 'UTF-8':
332	+ }
333	+ }
334	+
335	+ self::$encodingList = $encodingList;
336	+
337	+ return true;
338	+ }
339	+
340	+ public static function mb_strlen($s, $encoding = null)
341	+ {
342	+ $encoding = self::getEncoding($encoding);
343	+ if ('CP850' === $encoding \|\| 'ASCII' === $encoding) {
344	+ return strlen($s);
345	+ }
346	+
347	+ return @iconv_strlen($s, $encoding);
348	+ }
349	+
350	+ public static function mb_strpos($haystack, $needle, $offset = 0, $encoding = null)
351	+ {
352	+ $encoding = self::getEncoding($encoding);
353	+ if ('CP850' === $encoding \|\| 'ASCII' === $encoding) {
354	+ return strpos($haystack, $needle, $offset);
355	+ }
356	+
357	+ if ('' === $needle .= '') {
358	+ trigger_error(__METHOD__.': Empty delimiter', E_USER_WARNING);
359	+
360	+ return false;
361	+ }
362	+
363	+ return iconv_strpos($haystack, $needle, $offset, $encoding);
364	+ }
365	+
366	+ public static function mb_strrpos($haystack, $needle, $offset = 0, $encoding = null)
367	+ {
368	+ $encoding = self::getEncoding($encoding);
369	+ if ('CP850' === $encoding \|\| 'ASCII' === $encoding) {
370	+ return strrpos($haystack, $needle, $offset);
371	+ }
372	+
373	+ if ($offset != (int) $offset) {
374	+ $offset = 0;
375	+ } elseif ($offset = (int) $offset) {
376	+ if ($offset < 0) {
377	+ $haystack = self::mb_substr($haystack, 0, $offset, $encoding);
378	+ $offset = 0;
379	+ } else {
380	+ $haystack = self::mb_substr($haystack, $offset, 2147483647, $encoding);
381	+ }
382	+ }
383	+
384	+ $pos = iconv_strrpos($haystack, $needle, $encoding);
385	+
386	+ return false !== $pos ? $offset + $pos : false;
387	+ }
388	+
389	+ public static function mb_strtolower($s, $encoding = null)
390	+ {
391	+ return self::mb_convert_case($s, MB_CASE_LOWER, $encoding);
392	+ }
393	+
394	+ public static function mb_strtoupper($s, $encoding = null)
395	+ {
396	+ return self::mb_convert_case($s, MB_CASE_UPPER, $encoding);
397	+ }
398	+
399	+ public static function mb_substitute_character($c = null)
400	+ {
401	+ if (0 === strcasecmp($c, 'none')) {
402	+ return true;
403	+ }
404	+
405	+ return null !== $c ? false : 'none';
406	+ }
407	+
408	+ public static function mb_substr($s, $start, $length = null, $encoding = null)
409	+ {
410	+ $encoding = self::getEncoding($encoding);
411	+ if ('CP850' === $encoding \|\| 'ASCII' === $encoding) {
412	+ return substr($s, $start, null === $length ? 2147483647 : $length);
413	+ }
414	+
415	+ if ($start < 0) {
416	+ $start = iconv_strlen($s, $encoding) + $start;
417	+ if ($start < 0) {
418	+ $start = 0;
419	+ }
420	+ }
421	+
422	+ if (null === $length) {
423	+ $length = 2147483647;
424	+ } elseif ($length < 0) {
425	+ $length = iconv_strlen($s, $encoding) + $length - $start;
426	+ if ($length < 0) {
427	+ return '';
428	+ }
429	+ }
430	+
431	+ return iconv_substr($s, $start, $length, $encoding).'';
432	+ }
433	+
434	+ public static function mb_stripos($haystack, $needle, $offset = 0, $encoding = null)
435	+ {
436	+ $haystack = self::mb_convert_case($haystack, self::MB_CASE_FOLD, $encoding);
437	+ $needle = self::mb_convert_case($needle, self::MB_CASE_FOLD, $encoding);
438	+
439	+ return self::mb_strpos($haystack, $needle, $offset, $encoding);
440	+ }
441	+
442	+ public static function mb_stristr($haystack, $needle, $part = false, $encoding = null)
443	+ {
444	+ $pos = self::mb_stripos($haystack, $needle, 0, $encoding);
445	+
446	+ return self::getSubpart($pos, $part, $haystack, $encoding);
447	+ }
448	+
449	+ public static function mb_strrchr($haystack, $needle, $part = false, $encoding = null)
450	+ {
451	+ $encoding = self::getEncoding($encoding);
452	+ if ('CP850' === $encoding \|\| 'ASCII' === $encoding) {
453	+ return strrchr($haystack, $needle, $part);
454	+ }
455	+ $needle = self::mb_substr($needle, 0, 1, $encoding);
456	+ $pos = iconv_strrpos($haystack, $needle, $encoding);
457	+
458	+ return self::getSubpart($pos, $part, $haystack, $encoding);
459	+ }
460	+
461	+ public static function mb_strrichr($haystack, $needle, $part = false, $encoding = null)
462	+ {
463	+ $needle = self::mb_substr($needle, 0, 1, $encoding);
464	+ $pos = self::mb_strripos($haystack, $needle, $encoding);
465	+
466	+ return self::getSubpart($pos, $part, $haystack, $encoding);
467	+ }
468	+
469	+ public static function mb_strripos($haystack, $needle, $offset = 0, $encoding = null)
470	+ {
471	+ $haystack = self::mb_convert_case($haystack, self::MB_CASE_FOLD, $encoding);
472	+ $needle = self::mb_convert_case($needle, self::MB_CASE_FOLD, $encoding);
473	+
474	+ return self::mb_strrpos($haystack, $needle, $offset, $encoding);
475	+ }
476	+
477	+ public static function mb_strstr($haystack, $needle, $part = false, $encoding = null)
478	+ {
479	+ $pos = strpos($haystack, $needle);
480	+ if (false === $pos) {
481	+ return false;
482	+ }
483	+ if ($part) {
484	+ return substr($haystack, 0, $pos);
485	+ }
486	+
487	+ return substr($haystack, $pos);
488	+ }
489	+
490	+ public static function mb_get_info($type = 'all')
491	+ {
492	+ $info = array(
493	+ 'internal_encoding' => self::$internalEncoding,
494	+ 'http_output' => 'pass',
495	+ 'http_output_conv_mimetypes' => '^(text/\|application/xhtml\+xml)',
496	+ 'func_overload' => 0,
497	+ 'func_overload_list' => 'no overload',
498	+ 'mail_charset' => 'UTF-8',
499	+ 'mail_header_encoding' => 'BASE64',
500	+ 'mail_body_encoding' => 'BASE64',
501	+ 'illegal_chars' => 0,
502	+ 'encoding_translation' => 'Off',
503	+ 'language' => self::$language,
504	+ 'detect_order' => self::$encodingList,
505	+ 'substitute_character' => 'none',
506	+ 'strict_detection' => 'Off',
507	+ );
508	+
509	+ if ('all' === $type) {
510	+ return $info;
511	+ }
512	+ if (isset($info[$type])) {
513	+ return $info[$type];
514	+ }
515	+
516	+ return false;
517	+ }
518	+
519	+ public static function mb_http_input($type = '')
520	+ {
521	+ return false;
522	+ }
523	+
524	+ public static function mb_http_output($encoding = null)
525	+ {
526	+ return null !== $encoding ? 'pass' === $encoding : 'pass';
527	+ }
528	+
529	+ public static function mb_strwidth($s, $encoding = null)
530	+ {
531	+ $encoding = self::getEncoding($encoding);
532	+
533	+ if ('UTF-8' !== $encoding) {
534	+ $s = iconv($encoding, 'UTF-8//IGNORE', $s);
535	+ }
536	+
537	+ $s = preg_replace('/[\x{1100}-\x{115F}\x{2329}\x{232A}\x{2E80}-\x{303E}\x{3040}-\x{A4CF}\x{AC00}-\x{D7A3}\x{F900}-\x{FAFF}\x{FE10}-\x{FE19}\x{FE30}-\x{FE6F}\x{FF00}-\x{FF60}\x{FFE0}-\x{FFE6}\x{20000}-\x{2FFFD}\x{30000}-\x{3FFFD}]/u', '', $s, -1, $wide);
538	+
539	+ return ($wide << 1) + iconv_strlen($s, 'UTF-8');
540	+ }
541	+
542	+ public static function mb_substr_count($haystack, $needle, $encoding = null)
543	+ {
544	+ return substr_count($haystack, $needle);
545	+ }
546	+
547	+ public static function mb_output_handler($contents, $status)
548	+ {
549	+ return $contents;
550	+ }
551	+
552	+ public static function mb_chr($code, $encoding = null)
553	+ {
554	+ if (0x80 > $code %= 0x200000) {
555	+ $s = chr($code);
556	+ } elseif (0x800 > $code) {
557	+ $s = chr(0xC0 \| $code >> 6).chr(0x80 \| $code & 0x3F);
558	+ } elseif (0x10000 > $code) {
559	+ $s = chr(0xE0 \| $code >> 12).chr(0x80 \| $code >> 6 & 0x3F).chr(0x80 \| $code & 0x3F);
560	+ } else {
561	+ $s = chr(0xF0 \| $code >> 18).chr(0x80 \| $code >> 12 & 0x3F).chr(0x80 \| $code >> 6 & 0x3F).chr(0x80 \| $code & 0x3F);
562	+ }
563	+
564	+ if ('UTF-8' !== $encoding = self::getEncoding($encoding)) {
565	+ $s = mb_convert_encoding($s, $encoding, 'UTF-8');
566	+ }
567	+
568	+ return $s;
569	+ }
570	+
571	+ public static function mb_ord($s, $encoding = null)
572	+ {
573	+ if ('UTF-8' !== $encoding = self::getEncoding($encoding)) {
574	+ $s = mb_convert_encoding($s, 'UTF-8', $encoding);
575	+ }
576	+
577	+ $code = ($s = unpack('C*', substr($s, 0, 4))) ? $s[1] : 0;
578	+ if (0xF0 <= $code) {
579	+ return (($code - 0xF0) << 18) + (($s[2] - 0x80) << 12) + (($s[3] - 0x80) << 6) + $s[4] - 0x80;
580	+ }
581	+ if (0xE0 <= $code) {
582	+ return (($code - 0xE0) << 12) + (($s[2] - 0x80) << 6) + $s[3] - 0x80;
583	+ }
584	+ if (0xC0 <= $code) {
585	+ return (($code - 0xC0) << 6) + $s[2] - 0x80;
586	+ }
587	+
588	+ return $code;
589	+ }
590	+
591	+ private static function getSubpart($pos, $part, $haystack, $encoding)
592	+ {
593	+ if (false === $pos) {
594	+ return false;
595	+ }
596	+ if ($part) {
597	+ return self::mb_substr($haystack, 0, $pos, $encoding);
598	+ }
599	+
600	+ return self::mb_substr($haystack, $pos, null, $encoding);
601	+ }
602	+
603	+ private static function html_encoding_callback($m)
604	+ {
605	+ $i = 1;
606	+ $entities = '';
607	+ $m = unpack('C*', htmlentities($m[0], ENT_COMPAT, 'UTF-8'));
608	+
609	+ while (isset($m[$i])) {
610	+ if (0x80 > $m[$i]) {
611	+ $entities .= chr($m[$i++]);
612	+ continue;
613	+ }
614	+ if (0xF0 <= $m[$i]) {
615	+ $c = (($m[$i++] - 0xF0) << 18) + (($m[$i++] - 0x80) << 12) + (($m[$i++] - 0x80) << 6) + $m[$i++] - 0x80;
616	+ } elseif (0xE0 <= $m[$i]) {
617	+ $c = (($m[$i++] - 0xE0) << 12) + (($m[$i++] - 0x80) << 6) + $m[$i++] - 0x80;
618	+ } else {
619	+ $c = (($m[$i++] - 0xC0) << 6) + $m[$i++] - 0x80;
620	+ }
621	+
622	+ $entities .= '&#'.$c.';';
623	+ }
624	+
625	+ return $entities;
626	+ }
627	+
628	+ private static function title_case_lower($s)
629	+ {
630	+ return self::mb_convert_case($s[0], MB_CASE_LOWER, 'UTF-8');
631	+ }
632	+
633	+ private static function title_case_upper($s)
634	+ {
635	+ return self::mb_convert_case($s[0], MB_CASE_UPPER, 'UTF-8');
636	+ }
637	+
638	+ private static function getData($file)
639	+ {
640	+ if (file_exists($file = __DIR__.'/Resources/unidata/'.$file.'.php')) {
641	+ return require $file;
642	+ }
643	+
644	+ return false;
645	+ }
646	+
647	+ private static function getEncoding($encoding)
648	+ {
649	+ if (null === $encoding) {
650	+ return self::$internalEncoding;
651	+ }
652	+
653	+ $encoding = strtoupper($encoding);
654	+
655	+ if ('8BIT' === $encoding \|\| 'BINARY' === $encoding) {
656	+ return 'CP850';
657	+ }
658	+ if ('UTF8' === $encoding) {
659	+ return 'UTF-8';
660	+ }
661	+
662	+ return $encoding;
663	+ }
664	+ }

src/common/lib/vendor/symfony/polyfill-mbstring/Resources/unidata/lowerCase.php ADDED Viewed

	@@ -0,0 +1,1101 @@


1	+ <?php
2	+
3	+ static $data = array (
4	+ 'A' => 'a',
5	+ 'B' => 'b',
6	+ 'C' => 'c',
7	+ 'D' => 'd',
8	+ 'E' => 'e',
9	+ 'F' => 'f',
10	+ 'G' => 'g',
11	+ 'H' => 'h',
12	+ 'I' => 'i',
13	+ 'J' => 'j',
14	+ 'K' => 'k',
15	+ 'L' => 'l',
16	+ 'M' => 'm',
17	+ 'N' => 'n',
18	+ 'O' => 'o',
19	+ 'P' => 'p',
20	+ 'Q' => 'q',
21	+ 'R' => 'r',
22	+ 'S' => 's',
23	+ 'T' => 't',
24	+ 'U' => 'u',
25	+ 'V' => 'v',
26	+ 'W' => 'w',
27	+ 'X' => 'x',
28	+ 'Y' => 'y',
29	+ 'Z' => 'z',
30	+ 'À' => 'à',
31	+ 'Á' => 'á',
32	+ 'Â' => 'â',
33	+ 'Ã' => 'ã',
34	+ 'Ä' => 'ä',
35	+ 'Å' => 'å',
36	+ 'Æ' => 'æ',
37	+ 'Ç' => 'ç',
38	+ 'È' => 'è',
39	+ 'É' => 'é',
40	+ 'Ê' => 'ê',
41	+ 'Ë' => 'ë',
42	+ 'Ì' => 'ì',
43	+ 'Í' => 'í',
44	+ 'Î' => 'î',
45	+ 'Ï' => 'ï',
46	+ 'Ð' => 'ð',
47	+ 'Ñ' => 'ñ',
48	+ 'Ò' => 'ò',
49	+ 'Ó' => 'ó',
50	+ 'Ô' => 'ô',
51	+ 'Õ' => 'õ',
52	+ 'Ö' => 'ö',
53	+ 'Ø' => 'ø',
54	+ 'Ù' => 'ù',
55	+ 'Ú' => 'ú',
56	+ 'Û' => 'û',
57	+ 'Ü' => 'ü',
58	+ 'Ý' => 'ý',
59	+ 'Þ' => 'þ',
60	+ 'Ā' => 'ā',
61	+ 'Ă' => 'ă',
62	+ 'Ą' => 'ą',
63	+ 'Ć' => 'ć',
64	+ 'Ĉ' => 'ĉ',
65	+ 'Ċ' => 'ċ',
66	+ 'Č' => 'č',
67	+ 'Ď' => 'ď',
68	+ 'Đ' => 'đ',
69	+ 'Ē' => 'ē',
70	+ 'Ĕ' => 'ĕ',
71	+ 'Ė' => 'ė',
72	+ 'Ę' => 'ę',
73	+ 'Ě' => 'ě',
74	+ 'Ĝ' => 'ĝ',
75	+ 'Ğ' => 'ğ',
76	+ 'Ġ' => 'ġ',
77	+ 'Ģ' => 'ģ',
78	+ 'Ĥ' => 'ĥ',
79	+ 'Ħ' => 'ħ',
80	+ 'Ĩ' => 'ĩ',
81	+ 'Ī' => 'ī',
82	+ 'Ĭ' => 'ĭ',
83	+ 'Į' => 'į',
84	+ 'İ' => 'i',
85	+ 'Ĳ' => 'ĳ',
86	+ 'Ĵ' => 'ĵ',
87	+ 'Ķ' => 'ķ',
88	+ 'Ĺ' => 'ĺ',
89	+ 'Ļ' => 'ļ',
90	+ 'Ľ' => 'ľ',
91	+ 'Ŀ' => 'ŀ',
92	+ 'Ł' => 'ł',
93	+ 'Ń' => 'ń',
94	+ 'Ņ' => 'ņ',
95	+ 'Ň' => 'ň',
96	+ 'Ŋ' => 'ŋ',
97	+ 'Ō' => 'ō',
98	+ 'Ŏ' => 'ŏ',
99	+ 'Ő' => 'ő',
100	+ 'Œ' => 'œ',
101	+ 'Ŕ' => 'ŕ',
102	+ 'Ŗ' => 'ŗ',
103	+ 'Ř' => 'ř',
104	+ 'Ś' => 'ś',
105	+ 'Ŝ' => 'ŝ',
106	+ 'Ş' => 'ş',
107	+ 'Š' => 'š',
108	+ 'Ţ' => 'ţ',
109	+ 'Ť' => 'ť',
110	+ 'Ŧ' => 'ŧ',
111	+ 'Ũ' => 'ũ',
112	+ 'Ū' => 'ū',
113	+ 'Ŭ' => 'ŭ',
114	+ 'Ů' => 'ů',
115	+ 'Ű' => 'ű',
116	+ 'Ų' => 'ų',
117	+ 'Ŵ' => 'ŵ',
118	+ 'Ŷ' => 'ŷ',
119	+ 'Ÿ' => 'ÿ',
120	+ 'Ź' => 'ź',
121	+ 'Ż' => 'ż',
122	+ 'Ž' => 'ž',
123	+ 'Ɓ' => 'ɓ',
124	+ 'Ƃ' => 'ƃ',
125	+ 'Ƅ' => 'ƅ',
126	+ 'Ɔ' => 'ɔ',
127	+ 'Ƈ' => 'ƈ',
128	+ 'Ɖ' => 'ɖ',
129	+ 'Ɗ' => 'ɗ',
130	+ 'Ƌ' => 'ƌ',
131	+ 'Ǝ' => 'ǝ',
132	+ 'Ə' => 'ə',
133	+ 'Ɛ' => 'ɛ',
134	+ 'Ƒ' => 'ƒ',
135	+ 'Ɠ' => 'ɠ',
136	+ 'Ɣ' => 'ɣ',
137	+ 'Ɩ' => 'ɩ',
138	+ 'Ɨ' => 'ɨ',
139	+ 'Ƙ' => 'ƙ',
140	+ 'Ɯ' => 'ɯ',
141	+ 'Ɲ' => 'ɲ',
142	+ 'Ɵ' => 'ɵ',
143	+ 'Ơ' => 'ơ',
144	+ 'Ƣ' => 'ƣ',
145	+ 'Ƥ' => 'ƥ',
146	+ 'Ʀ' => 'ʀ',
147	+ 'Ƨ' => 'ƨ',
148	+ 'Ʃ' => 'ʃ',
149	+ 'Ƭ' => 'ƭ',
150	+ 'Ʈ' => 'ʈ',
151	+ 'Ư' => 'ư',
152	+ 'Ʊ' => 'ʊ',
153	+ 'Ʋ' => 'ʋ',
154	+ 'Ƴ' => 'ƴ',
155	+ 'Ƶ' => 'ƶ',
156	+ 'Ʒ' => 'ʒ',
157	+ 'Ƹ' => 'ƹ',
158	+ 'Ƽ' => 'ƽ',
159	+ 'Ǆ' => 'ǆ',
160	+ 'ǅ' => 'ǆ',
161	+ 'Ǉ' => 'ǉ',
162	+ 'ǈ' => 'ǉ',
163	+ 'Ǌ' => 'ǌ',
164	+ 'ǋ' => 'ǌ',
165	+ 'Ǎ' => 'ǎ',
166	+ 'Ǐ' => 'ǐ',
167	+ 'Ǒ' => 'ǒ',
168	+ 'Ǔ' => 'ǔ',
169	+ 'Ǖ' => 'ǖ',
170	+ 'Ǘ' => 'ǘ',
171	+ 'Ǚ' => 'ǚ',
172	+ 'Ǜ' => 'ǜ',
173	+ 'Ǟ' => 'ǟ',
174	+ 'Ǡ' => 'ǡ',
175	+ 'Ǣ' => 'ǣ',
176	+ 'Ǥ' => 'ǥ',
177	+ 'Ǧ' => 'ǧ',
178	+ 'Ǩ' => 'ǩ',
179	+ 'Ǫ' => 'ǫ',
180	+ 'Ǭ' => 'ǭ',
181	+ 'Ǯ' => 'ǯ',
182	+ 'Ǳ' => 'ǳ',
183	+ 'ǲ' => 'ǳ',
184	+ 'Ǵ' => 'ǵ',
185	+ 'Ƕ' => 'ƕ',
186	+ 'Ƿ' => 'ƿ',
187	+ 'Ǹ' => 'ǹ',
188	+ 'Ǻ' => 'ǻ',
189	+ 'Ǽ' => 'ǽ',
190	+ 'Ǿ' => 'ǿ',
191	+ 'Ȁ' => 'ȁ',
192	+ 'Ȃ' => 'ȃ',
193	+ 'Ȅ' => 'ȅ',
194	+ 'Ȇ' => 'ȇ',
195	+ 'Ȉ' => 'ȉ',
196	+ 'Ȋ' => 'ȋ',
197	+ 'Ȍ' => 'ȍ',
198	+ 'Ȏ' => 'ȏ',
199	+ 'Ȑ' => 'ȑ',
200	+ 'Ȓ' => 'ȓ',
201	+ 'Ȕ' => 'ȕ',
202	+ 'Ȗ' => 'ȗ',
203	+ 'Ș' => 'ș',
204	+ 'Ț' => 'ț',
205	+ 'Ȝ' => 'ȝ',
206	+ 'Ȟ' => 'ȟ',
207	+ 'Ƞ' => 'ƞ',
208	+ 'Ȣ' => 'ȣ',
209	+ 'Ȥ' => 'ȥ',
210	+ 'Ȧ' => 'ȧ',
211	+ 'Ȩ' => 'ȩ',
212	+ 'Ȫ' => 'ȫ',
213	+ 'Ȭ' => 'ȭ',
214	+ 'Ȯ' => 'ȯ',
215	+ 'Ȱ' => 'ȱ',
216	+ 'Ȳ' => 'ȳ',
217	+ 'Ⱥ' => 'ⱥ',
218	+ 'Ȼ' => 'ȼ',
219	+ 'Ƚ' => 'ƚ',
220	+ 'Ⱦ' => 'ⱦ',
221	+ 'Ɂ' => 'ɂ',
222	+ 'Ƀ' => 'ƀ',
223	+ 'Ʉ' => 'ʉ',
224	+ 'Ʌ' => 'ʌ',
225	+ 'Ɇ' => 'ɇ',
226	+ 'Ɉ' => 'ɉ',
227	+ 'Ɋ' => 'ɋ',
228	+ 'Ɍ' => 'ɍ',
229	+ 'Ɏ' => 'ɏ',
230	+ 'Ͱ' => 'ͱ',
231	+ 'Ͳ' => 'ͳ',
232	+ 'Ͷ' => 'ͷ',
233	+ 'Ϳ' => 'ϳ',
234	+ 'Ά' => 'ά',
235	+ 'Έ' => 'έ',
236	+ 'Ή' => 'ή',
237	+ 'Ί' => 'ί',
238	+ 'Ό' => 'ό',
239	+ 'Ύ' => 'ύ',
240	+ 'Ώ' => 'ώ',
241	+ 'Α' => 'α',
242	+ 'Β' => 'β',
243	+ 'Γ' => 'γ',
244	+ 'Δ' => 'δ',
245	+ 'Ε' => 'ε',
246	+ 'Ζ' => 'ζ',
247	+ 'Η' => 'η',
248	+ 'Θ' => 'θ',
249	+ 'Ι' => 'ι',
250	+ 'Κ' => 'κ',
251	+ 'Λ' => 'λ',
252	+ 'Μ' => 'μ',
253	+ 'Ν' => 'ν',
254	+ 'Ξ' => 'ξ',
255	+ 'Ο' => 'ο',
256	+ 'Π' => 'π',
257	+ 'Ρ' => 'ρ',
258	+ 'Σ' => 'σ',
259	+ 'Τ' => 'τ',
260	+ 'Υ' => 'υ',
261	+ 'Φ' => 'φ',
262	+ 'Χ' => 'χ',
263	+ 'Ψ' => 'ψ',
264	+ 'Ω' => 'ω',
265	+ 'Ϊ' => 'ϊ',
266	+ 'Ϋ' => 'ϋ',
267	+ 'Ϗ' => 'ϗ',
268	+ 'Ϙ' => 'ϙ',
269	+ 'Ϛ' => 'ϛ',
270	+ 'Ϝ' => 'ϝ',
271	+ 'Ϟ' => 'ϟ',
272	+ 'Ϡ' => 'ϡ',
273	+ 'Ϣ' => 'ϣ',
274	+ 'Ϥ' => 'ϥ',
275	+ 'Ϧ' => 'ϧ',
276	+ 'Ϩ' => 'ϩ',
277	+ 'Ϫ' => 'ϫ',
278	+ 'Ϭ' => 'ϭ',
279	+ 'Ϯ' => 'ϯ',
280	+ 'ϴ' => 'θ',
281	+ 'Ϸ' => 'ϸ',
282	+ 'Ϲ' => 'ϲ',
283	+ 'Ϻ' => 'ϻ',
284	+ 'Ͻ' => 'ͻ',
285	+ 'Ͼ' => 'ͼ',
286	+ 'Ͽ' => 'ͽ',
287	+ 'Ѐ' => 'ѐ',
288	+ 'Ё' => 'ё',
289	+ 'Ђ' => 'ђ',
290	+ 'Ѓ' => 'ѓ',
291	+ 'Є' => 'є',
292	+ 'Ѕ' => 'ѕ',
293	+ 'І' => 'і',
294	+ 'Ї' => 'ї',
295	+ 'Ј' => 'ј',
296	+ 'Љ' => 'љ',
297	+ 'Њ' => 'њ',
298	+ 'Ћ' => 'ћ',
299	+ 'Ќ' => 'ќ',
300	+ 'Ѝ' => 'ѝ',
301	+ 'Ў' => 'ў',
302	+ 'Џ' => 'џ',
303	+ 'А' => 'а',
304	+ 'Б' => 'б',
305	+ 'В' => 'в',
306	+ 'Г' => 'г',
307	+ 'Д' => 'д',
308	+ 'Е' => 'е',
309	+ 'Ж' => 'ж',
310	+ 'З' => 'з',
311	+ 'И' => 'и',
312	+ 'Й' => 'й',
313	+ 'К' => 'к',
314	+ 'Л' => 'л',
315	+ 'М' => 'м',
316	+ 'Н' => 'н',
317	+ 'О' => 'о',
318	+ 'П' => 'п',
319	+ 'Р' => 'р',
320	+ 'С' => 'с',
321	+ 'Т' => 'т',
322	+ 'У' => 'у',
323	+ 'Ф' => 'ф',
324	+ 'Х' => 'х',
325	+ 'Ц' => 'ц',
326	+ 'Ч' => 'ч',
327	+ 'Ш' => 'ш',
328	+ 'Щ' => 'щ',
329	+ 'Ъ' => 'ъ',
330	+ 'Ы' => 'ы',
331	+ 'Ь' => 'ь',
332	+ 'Э' => 'э',
333	+ 'Ю' => 'ю',
334	+ 'Я' => 'я',
335	+ 'Ѡ' => 'ѡ',
336	+ 'Ѣ' => 'ѣ',
337	+ 'Ѥ' => 'ѥ',
338	+ 'Ѧ' => 'ѧ',
339	+ 'Ѩ' => 'ѩ',
340	+ 'Ѫ' => 'ѫ',
341	+ 'Ѭ' => 'ѭ',
342	+ 'Ѯ' => 'ѯ',
343	+ 'Ѱ' => 'ѱ',
344	+ 'Ѳ' => 'ѳ',
345	+ 'Ѵ' => 'ѵ',
346	+ 'Ѷ' => 'ѷ',
347	+ 'Ѹ' => 'ѹ',
348	+ 'Ѻ' => 'ѻ',
349	+ 'Ѽ' => 'ѽ',
350	+ 'Ѿ' => 'ѿ',
351	+ 'Ҁ' => 'ҁ',
352	+ 'Ҋ' => 'ҋ',
353	+ 'Ҍ' => 'ҍ',
354	+ 'Ҏ' => 'ҏ',
355	+ 'Ґ' => 'ґ',
356	+ 'Ғ' => 'ғ',
357	+ 'Ҕ' => 'ҕ',
358	+ 'Җ' => 'җ',
359	+ 'Ҙ' => 'ҙ',
360	+ 'Қ' => 'қ',
361	+ 'Ҝ' => 'ҝ',
362	+ 'Ҟ' => 'ҟ',
363	+ 'Ҡ' => 'ҡ',
364	+ 'Ң' => 'ң',
365	+ 'Ҥ' => 'ҥ',
366	+ 'Ҧ' => 'ҧ',
367	+ 'Ҩ' => 'ҩ',
368	+ 'Ҫ' => 'ҫ',
369	+ 'Ҭ' => 'ҭ',
370	+ 'Ү' => 'ү',
371	+ 'Ұ' => 'ұ',
372	+ 'Ҳ' => 'ҳ',
373	+ 'Ҵ' => 'ҵ',
374	+ 'Ҷ' => 'ҷ',
375	+ 'Ҹ' => 'ҹ',
376	+ 'Һ' => 'һ',
377	+ 'Ҽ' => 'ҽ',
378	+ 'Ҿ' => 'ҿ',
379	+ 'Ӏ' => 'ӏ',
380	+ 'Ӂ' => 'ӂ',
381	+ 'Ӄ' => 'ӄ',
382	+ 'Ӆ' => 'ӆ',
383	+ 'Ӈ' => 'ӈ',
384	+ 'Ӊ' => 'ӊ',
385	+ 'Ӌ' => 'ӌ',
386	+ 'Ӎ' => 'ӎ',
387	+ 'Ӑ' => 'ӑ',
388	+ 'Ӓ' => 'ӓ',
389	+ 'Ӕ' => 'ӕ',
390	+ 'Ӗ' => 'ӗ',
391	+ 'Ә' => 'ә',
392	+ 'Ӛ' => 'ӛ',
393	+ 'Ӝ' => 'ӝ',
394	+ 'Ӟ' => 'ӟ',
395	+ 'Ӡ' => 'ӡ',
396	+ 'Ӣ' => 'ӣ',
397	+ 'Ӥ' => 'ӥ',
398	+ 'Ӧ' => 'ӧ',
399	+ 'Ө' => 'ө',
400	+ 'Ӫ' => 'ӫ',
401	+ 'Ӭ' => 'ӭ',
402	+ 'Ӯ' => 'ӯ',
403	+ 'Ӱ' => 'ӱ',
404	+ 'Ӳ' => 'ӳ',
405	+ 'Ӵ' => 'ӵ',
406	+ 'Ӷ' => 'ӷ',
407	+ 'Ӹ' => 'ӹ',
408	+ 'Ӻ' => 'ӻ',
409	+ 'Ӽ' => 'ӽ',
410	+ 'Ӿ' => 'ӿ',
411	+ 'Ԁ' => 'ԁ',
412	+ 'Ԃ' => 'ԃ',
413	+ 'Ԅ' => 'ԅ',
414	+ 'Ԇ' => 'ԇ',
415	+ 'Ԉ' => 'ԉ',
416	+ 'Ԋ' => 'ԋ',
417	+ 'Ԍ' => 'ԍ',
418	+ 'Ԏ' => 'ԏ',
419	+ 'Ԑ' => 'ԑ',
420	+ 'Ԓ' => 'ԓ',
421	+ 'Ԕ' => 'ԕ',
422	+ 'Ԗ' => 'ԗ',
423	+ 'Ԙ' => 'ԙ',
424	+ 'Ԛ' => 'ԛ',
425	+ 'Ԝ' => 'ԝ',
426	+ 'Ԟ' => 'ԟ',
427	+ 'Ԡ' => 'ԡ',
428	+ 'Ԣ' => 'ԣ',
429	+ 'Ԥ' => 'ԥ',
430	+ 'Ԧ' => 'ԧ',
431	+ 'Ԩ' => 'ԩ',
432	+ 'Ԫ' => 'ԫ',
433	+ 'Ԭ' => 'ԭ',
434	+ 'Ԯ' => 'ԯ',
435	+ 'Ա' => 'ա',
436	+ 'Բ' => 'բ',
437	+ 'Գ' => 'գ',
438	+ 'Դ' => 'դ',
439	+ 'Ե' => 'ե',
440	+ 'Զ' => 'զ',
441	+ 'Է' => 'է',
442	+ 'Ը' => 'ը',
443	+ 'Թ' => 'թ',
444	+ 'Ժ' => 'ժ',
445	+ 'Ի' => 'ի',
446	+ 'Լ' => 'լ',
447	+ 'Խ' => 'խ',
448	+ 'Ծ' => 'ծ',
449	+ 'Կ' => 'կ',
450	+ 'Հ' => 'հ',
451	+ 'Ձ' => 'ձ',
452	+ 'Ղ' => 'ղ',
453	+ 'Ճ' => 'ճ',
454	+ 'Մ' => 'մ',
455	+ 'Յ' => 'յ',
456	+ 'Ն' => 'ն',
457	+ 'Շ' => 'շ',
458	+ 'Ո' => 'ո',
459	+ 'Չ' => 'չ',
460	+ 'Պ' => 'պ',
461	+ 'Ջ' => 'ջ',
462	+ 'Ռ' => 'ռ',
463	+ 'Ս' => 'ս',
464	+ 'Վ' => 'վ',
465	+ 'Տ' => 'տ',
466	+ 'Ր' => 'ր',
467	+ 'Ց' => 'ց',
468	+ 'Ւ' => 'ւ',
469	+ 'Փ' => 'փ',
470	+ 'Ք' => 'ք',
471	+ 'Օ' => 'օ',
472	+ 'Ֆ' => 'ֆ',
473	+ 'Ⴀ' => 'ⴀ',
474	+ 'Ⴁ' => 'ⴁ',
475	+ 'Ⴂ' => 'ⴂ',
476	+ 'Ⴃ' => 'ⴃ',
477	+ 'Ⴄ' => 'ⴄ',
478	+ 'Ⴅ' => 'ⴅ',
479	+ 'Ⴆ' => 'ⴆ',
480	+ 'Ⴇ' => 'ⴇ',
481	+ 'Ⴈ' => 'ⴈ',
482	+ 'Ⴉ' => 'ⴉ',
483	+ 'Ⴊ' => 'ⴊ',
484	+ 'Ⴋ' => 'ⴋ',
485	+ 'Ⴌ' => 'ⴌ',
486	+ 'Ⴍ' => 'ⴍ',
487	+ 'Ⴎ' => 'ⴎ',
488	+ 'Ⴏ' => 'ⴏ',
489	+ 'Ⴐ' => 'ⴐ',
490	+ 'Ⴑ' => 'ⴑ',
491	+ 'Ⴒ' => 'ⴒ',
492	+ 'Ⴓ' => 'ⴓ',
493	+ 'Ⴔ' => 'ⴔ',
494	+ 'Ⴕ' => 'ⴕ',
495	+ 'Ⴖ' => 'ⴖ',
496	+ 'Ⴗ' => 'ⴗ',
497	+ 'Ⴘ' => 'ⴘ',
498	+ 'Ⴙ' => 'ⴙ',
499	+ 'Ⴚ' => 'ⴚ',
500	+ 'Ⴛ' => 'ⴛ',
501	+ 'Ⴜ' => 'ⴜ',
502	+ 'Ⴝ' => 'ⴝ',
503	+ 'Ⴞ' => 'ⴞ',
504	+ 'Ⴟ' => 'ⴟ',
505	+ 'Ⴠ' => 'ⴠ',
506	+ 'Ⴡ' => 'ⴡ',
507	+ 'Ⴢ' => 'ⴢ',
508	+ 'Ⴣ' => 'ⴣ',
509	+ 'Ⴤ' => 'ⴤ',
510	+ 'Ⴥ' => 'ⴥ',
511	+ 'Ⴧ' => 'ⴧ',
512	+ 'Ⴭ' => 'ⴭ',
513	+ 'Ḁ' => 'ḁ',
514	+ 'Ḃ' => 'ḃ',
515	+ 'Ḅ' => 'ḅ',
516	+ 'Ḇ' => 'ḇ',
517	+ 'Ḉ' => 'ḉ',
518	+ 'Ḋ' => 'ḋ',
519	+ 'Ḍ' => 'ḍ',
520	+ 'Ḏ' => 'ḏ',
521	+ 'Ḑ' => 'ḑ',
522	+ 'Ḓ' => 'ḓ',
523	+ 'Ḕ' => 'ḕ',
524	+ 'Ḗ' => 'ḗ',
525	+ 'Ḙ' => 'ḙ',
526	+ 'Ḛ' => 'ḛ',
527	+ 'Ḝ' => 'ḝ',
528	+ 'Ḟ' => 'ḟ',
529	+ 'Ḡ' => 'ḡ',
530	+ 'Ḣ' => 'ḣ',
531	+ 'Ḥ' => 'ḥ',
532	+ 'Ḧ' => 'ḧ',
533	+ 'Ḩ' => 'ḩ',
534	+ 'Ḫ' => 'ḫ',
535	+ 'Ḭ' => 'ḭ',
536	+ 'Ḯ' => 'ḯ',
537	+ 'Ḱ' => 'ḱ',
538	+ 'Ḳ' => 'ḳ',
539	+ 'Ḵ' => 'ḵ',
540	+ 'Ḷ' => 'ḷ',
541	+ 'Ḹ' => 'ḹ',
542	+ 'Ḻ' => 'ḻ',
543	+ 'Ḽ' => 'ḽ',
544	+ 'Ḿ' => 'ḿ',
545	+ 'Ṁ' => 'ṁ',
546	+ 'Ṃ' => 'ṃ',
547	+ 'Ṅ' => 'ṅ',
548	+ 'Ṇ' => 'ṇ',
549	+ 'Ṉ' => 'ṉ',
550	+ 'Ṋ' => 'ṋ',
551	+ 'Ṍ' => 'ṍ',
552	+ 'Ṏ' => 'ṏ',
553	+ 'Ṑ' => 'ṑ',
554	+ 'Ṓ' => 'ṓ',
555	+ 'Ṕ' => 'ṕ',
556	+ 'Ṗ' => 'ṗ',
557	+ 'Ṙ' => 'ṙ',
558	+ 'Ṛ' => 'ṛ',
559	+ 'Ṝ' => 'ṝ',
560	+ 'Ṟ' => 'ṟ',
561	+ 'Ṡ' => 'ṡ',
562	+ 'Ṣ' => 'ṣ',
563	+ 'Ṥ' => 'ṥ',
564	+ 'Ṧ' => 'ṧ',
565	+ 'Ṩ' => 'ṩ',
566	+ 'Ṫ' => 'ṫ',
567	+ 'Ṭ' => 'ṭ',
568	+ 'Ṯ' => 'ṯ',
569	+ 'Ṱ' => 'ṱ',
570	+ 'Ṳ' => 'ṳ',
571	+ 'Ṵ' => 'ṵ',
572	+ 'Ṷ' => 'ṷ',
573	+ 'Ṹ' => 'ṹ',
574	+ 'Ṻ' => 'ṻ',
575	+ 'Ṽ' => 'ṽ',
576	+ 'Ṿ' => 'ṿ',
577	+ 'Ẁ' => 'ẁ',
578	+ 'Ẃ' => 'ẃ',
579	+ 'Ẅ' => 'ẅ',
580	+ 'Ẇ' => 'ẇ',
581	+ 'Ẉ' => 'ẉ',
582	+ 'Ẋ' => 'ẋ',
583	+ 'Ẍ' => 'ẍ',
584	+ 'Ẏ' => 'ẏ',
585	+ 'Ẑ' => 'ẑ',
586	+ 'Ẓ' => 'ẓ',
587	+ 'Ẕ' => 'ẕ',
588	+ 'ẞ' => 'ß',
589	+ 'Ạ' => 'ạ',
590	+ 'Ả' => 'ả',
591	+ 'Ấ' => 'ấ',
592	+ 'Ầ' => 'ầ',
593	+ 'Ẩ' => 'ẩ',
594	+ 'Ẫ' => 'ẫ',
595	+ 'Ậ' => 'ậ',
596	+ 'Ắ' => 'ắ',
597	+ 'Ằ' => 'ằ',
598	+ 'Ẳ' => 'ẳ',
599	+ 'Ẵ' => 'ẵ',
600	+ 'Ặ' => 'ặ',
601	+ 'Ẹ' => 'ẹ',
602	+ 'Ẻ' => 'ẻ',
603	+ 'Ẽ' => 'ẽ',
604	+ 'Ế' => 'ế',
605	+ 'Ề' => 'ề',
606	+ 'Ể' => 'ể',
607	+ 'Ễ' => 'ễ',
608	+ 'Ệ' => 'ệ',
609	+ 'Ỉ' => 'ỉ',
610	+ 'Ị' => 'ị',
611	+ 'Ọ' => 'ọ',
612	+ 'Ỏ' => 'ỏ',
613	+ 'Ố' => 'ố',
614	+ 'Ồ' => 'ồ',
615	+ 'Ổ' => 'ổ',
616	+ 'Ỗ' => 'ỗ',
617	+ 'Ộ' => 'ộ',
618	+ 'Ớ' => 'ớ',
619	+ 'Ờ' => 'ờ',
620	+ 'Ở' => 'ở',
621	+ 'Ỡ' => 'ỡ',
622	+ 'Ợ' => 'ợ',
623	+ 'Ụ' => 'ụ',
624	+ 'Ủ' => 'ủ',
625	+ 'Ứ' => 'ứ',
626	+ 'Ừ' => 'ừ',
627	+ 'Ử' => 'ử',
628	+ 'Ữ' => 'ữ',
629	+ 'Ự' => 'ự',
630	+ 'Ỳ' => 'ỳ',
631	+ 'Ỵ' => 'ỵ',
632	+ 'Ỷ' => 'ỷ',
633	+ 'Ỹ' => 'ỹ',
634	+ 'Ỻ' => 'ỻ',
635	+ 'Ỽ' => 'ỽ',
636	+ 'Ỿ' => 'ỿ',
637	+ 'Ἀ' => 'ἀ',
638	+ 'Ἁ' => 'ἁ',
639	+ 'Ἂ' => 'ἂ',
640	+ 'Ἃ' => 'ἃ',
641	+ 'Ἄ' => 'ἄ',
642	+ 'Ἅ' => 'ἅ',
643	+ 'Ἆ' => 'ἆ',
644	+ 'Ἇ' => 'ἇ',
645	+ 'Ἐ' => 'ἐ',
646	+ 'Ἑ' => 'ἑ',
647	+ 'Ἒ' => 'ἒ',
648	+ 'Ἓ' => 'ἓ',
649	+ 'Ἔ' => 'ἔ',
650	+ 'Ἕ' => 'ἕ',
651	+ 'Ἠ' => 'ἠ',
652	+ 'Ἡ' => 'ἡ',
653	+ 'Ἢ' => 'ἢ',
654	+ 'Ἣ' => 'ἣ',
655	+ 'Ἤ' => 'ἤ',
656	+ 'Ἥ' => 'ἥ',
657	+ 'Ἦ' => 'ἦ',
658	+ 'Ἧ' => 'ἧ',
659	+ 'Ἰ' => 'ἰ',
660	+ 'Ἱ' => 'ἱ',
661	+ 'Ἲ' => 'ἲ',
662	+ 'Ἳ' => 'ἳ',
663	+ 'Ἴ' => 'ἴ',
664	+ 'Ἵ' => 'ἵ',
665	+ 'Ἶ' => 'ἶ',
666	+ 'Ἷ' => 'ἷ',
667	+ 'Ὀ' => 'ὀ',
668	+ 'Ὁ' => 'ὁ',
669	+ 'Ὂ' => 'ὂ',
670	+ 'Ὃ' => 'ὃ',
671	+ 'Ὄ' => 'ὄ',
672	+ 'Ὅ' => 'ὅ',
673	+ 'Ὑ' => 'ὑ',
674	+ 'Ὓ' => 'ὓ',
675	+ 'Ὕ' => 'ὕ',
676	+ 'Ὗ' => 'ὗ',
677	+ 'Ὠ' => 'ὠ',
678	+ 'Ὡ' => 'ὡ',
679	+ 'Ὢ' => 'ὢ',
680	+ 'Ὣ' => 'ὣ',
681	+ 'Ὤ' => 'ὤ',
682	+ 'Ὥ' => 'ὥ',
683	+ 'Ὦ' => 'ὦ',
684	+ 'Ὧ' => 'ὧ',
685	+ 'ᾈ' => 'ᾀ',
686	+ 'ᾉ' => 'ᾁ',
687	+ 'ᾊ' => 'ᾂ',
688	+ 'ᾋ' => 'ᾃ',
689	+ 'ᾌ' => 'ᾄ',
690	+ 'ᾍ' => 'ᾅ',
691	+ 'ᾎ' => 'ᾆ',
692	+ 'ᾏ' => 'ᾇ',
693	+ 'ᾘ' => 'ᾐ',
694	+ 'ᾙ' => 'ᾑ',
695	+ 'ᾚ' => 'ᾒ',
696	+ 'ᾛ' => 'ᾓ',
697	+ 'ᾜ' => 'ᾔ',
698	+ 'ᾝ' => 'ᾕ',
699	+ 'ᾞ' => 'ᾖ',
700	+ 'ᾟ' => 'ᾗ',
701	+ 'ᾨ' => 'ᾠ',
702	+ 'ᾩ' => 'ᾡ',
703	+ 'ᾪ' => 'ᾢ',
704	+ 'ᾫ' => 'ᾣ',
705	+ 'ᾬ' => 'ᾤ',
706	+ 'ᾭ' => 'ᾥ',
707	+ 'ᾮ' => 'ᾦ',
708	+ 'ᾯ' => 'ᾧ',
709	+ 'Ᾰ' => 'ᾰ',
710	+ 'Ᾱ' => 'ᾱ',
711	+ 'Ὰ' => 'ὰ',
712	+ 'Ά' => 'ά',
713	+ 'ᾼ' => 'ᾳ',
714	+ 'Ὲ' => 'ὲ',
715	+ 'Έ' => 'έ',
716	+ 'Ὴ' => 'ὴ',
717	+ 'Ή' => 'ή',
718	+ 'ῌ' => 'ῃ',
719	+ 'Ῐ' => 'ῐ',
720	+ 'Ῑ' => 'ῑ',
721	+ 'Ὶ' => 'ὶ',
722	+ 'Ί' => 'ί',
723	+ 'Ῠ' => 'ῠ',
724	+ 'Ῡ' => 'ῡ',
725	+ 'Ὺ' => 'ὺ',
726	+ 'Ύ' => 'ύ',
727	+ 'Ῥ' => 'ῥ',
728	+ 'Ὸ' => 'ὸ',
729	+ 'Ό' => 'ό',
730	+ 'Ὼ' => 'ὼ',
731	+ 'Ώ' => 'ώ',
732	+ 'ῼ' => 'ῳ',
733	+ 'Ω' => 'ω',
734	+ 'K' => 'k',
735	+ 'Å' => 'å',
736	+ 'Ⅎ' => 'ⅎ',
737	+ 'Ⅰ' => 'ⅰ',
738	+ 'Ⅱ' => 'ⅱ',
739	+ 'Ⅲ' => 'ⅲ',
740	+ 'Ⅳ' => 'ⅳ',
741	+ 'Ⅴ' => 'ⅴ',
742	+ 'Ⅵ' => 'ⅵ',
743	+ 'Ⅶ' => 'ⅶ',
744	+ 'Ⅷ' => 'ⅷ',
745	+ 'Ⅸ' => 'ⅸ',
746	+ 'Ⅹ' => 'ⅹ',
747	+ 'Ⅺ' => 'ⅺ',
748	+ 'Ⅻ' => 'ⅻ',
749	+ 'Ⅼ' => 'ⅼ',
750	+ 'Ⅽ' => 'ⅽ',
751	+ 'Ⅾ' => 'ⅾ',
752	+ 'Ⅿ' => 'ⅿ',
753	+ 'Ↄ' => 'ↄ',
754	+ 'Ⓐ' => 'ⓐ',
755	+ 'Ⓑ' => 'ⓑ',
756	+ 'Ⓒ' => 'ⓒ',
757	+ 'Ⓓ' => 'ⓓ',
758	+ 'Ⓔ' => 'ⓔ',
759	+ 'Ⓕ' => 'ⓕ',
760	+ 'Ⓖ' => 'ⓖ',
761	+ 'Ⓗ' => 'ⓗ',
762	+ 'Ⓘ' => 'ⓘ',
763	+ 'Ⓙ' => 'ⓙ',
764	+ 'Ⓚ' => 'ⓚ',
765	+ 'Ⓛ' => 'ⓛ',
766	+ 'Ⓜ' => 'ⓜ',
767	+ 'Ⓝ' => 'ⓝ',
768	+ 'Ⓞ' => 'ⓞ',
769	+ 'Ⓟ' => 'ⓟ',
770	+ 'Ⓠ' => 'ⓠ',
771	+ 'Ⓡ' => 'ⓡ',
772	+ 'Ⓢ' => 'ⓢ',
773	+ 'Ⓣ' => 'ⓣ',
774	+ 'Ⓤ' => 'ⓤ',
775	+ 'Ⓥ' => 'ⓥ',
776	+ 'Ⓦ' => 'ⓦ',
777	+ 'Ⓧ' => 'ⓧ',
778	+ 'Ⓨ' => 'ⓨ',
779	+ 'Ⓩ' => 'ⓩ',
780	+ 'Ⰰ' => 'ⰰ',
781	+ 'Ⰱ' => 'ⰱ',
782	+ 'Ⰲ' => 'ⰲ',
783	+ 'Ⰳ' => 'ⰳ',
784	+ 'Ⰴ' => 'ⰴ',
785	+ 'Ⰵ' => 'ⰵ',
786	+ 'Ⰶ' => 'ⰶ',
787	+ 'Ⰷ' => 'ⰷ',
788	+ 'Ⰸ' => 'ⰸ',
789	+ 'Ⰹ' => 'ⰹ',
790	+ 'Ⰺ' => 'ⰺ',
791	+ 'Ⰻ' => 'ⰻ',
792	+ 'Ⰼ' => 'ⰼ',
793	+ 'Ⰽ' => 'ⰽ',
794	+ 'Ⰾ' => 'ⰾ',
795	+ 'Ⰿ' => 'ⰿ',
796	+ 'Ⱀ' => 'ⱀ',
797	+ 'Ⱁ' => 'ⱁ',
798	+ 'Ⱂ' => 'ⱂ',
799	+ 'Ⱃ' => 'ⱃ',
800	+ 'Ⱄ' => 'ⱄ',
801	+ 'Ⱅ' => 'ⱅ',
802	+ 'Ⱆ' => 'ⱆ',
803	+ 'Ⱇ' => 'ⱇ',
804	+ 'Ⱈ' => 'ⱈ',
805	+ 'Ⱉ' => 'ⱉ',
806	+ 'Ⱊ' => 'ⱊ',
807	+ 'Ⱋ' => 'ⱋ',
808	+ 'Ⱌ' => 'ⱌ',
809	+ 'Ⱍ' => 'ⱍ',
810	+ 'Ⱎ' => 'ⱎ',
811	+ 'Ⱏ' => 'ⱏ',
812	+ 'Ⱐ' => 'ⱐ',
813	+ 'Ⱑ' => 'ⱑ',
814	+ 'Ⱒ' => 'ⱒ',
815	+ 'Ⱓ' => 'ⱓ',
816	+ 'Ⱔ' => 'ⱔ',
817	+ 'Ⱕ' => 'ⱕ',
818	+ 'Ⱖ' => 'ⱖ',
819	+ 'Ⱗ' => 'ⱗ',
820	+ 'Ⱘ' => 'ⱘ',
821	+ 'Ⱙ' => 'ⱙ',
822	+ 'Ⱚ' => 'ⱚ',
823	+ 'Ⱛ' => 'ⱛ',
824	+ 'Ⱜ' => 'ⱜ',
825	+ 'Ⱝ' => 'ⱝ',
826	+ 'Ⱞ' => 'ⱞ',
827	+ 'Ⱡ' => 'ⱡ',
828	+ 'Ɫ' => 'ɫ',
829	+ 'Ᵽ' => 'ᵽ',
830	+ 'Ɽ' => 'ɽ',
831	+ 'Ⱨ' => 'ⱨ',
832	+ 'Ⱪ' => 'ⱪ',
833	+ 'Ⱬ' => 'ⱬ',
834	+ 'Ɑ' => 'ɑ',
835	+ 'Ɱ' => 'ɱ',
836	+ 'Ɐ' => 'ɐ',
837	+ 'Ɒ' => 'ɒ',
838	+ 'Ⱳ' => 'ⱳ',
839	+ 'Ⱶ' => 'ⱶ',
840	+ 'Ȿ' => 'ȿ',
841	+ 'Ɀ' => 'ɀ',
842	+ 'Ⲁ' => 'ⲁ',
843	+ 'Ⲃ' => 'ⲃ',
844	+ 'Ⲅ' => 'ⲅ',
845	+ 'Ⲇ' => 'ⲇ',
846	+ 'Ⲉ' => 'ⲉ',
847	+ 'Ⲋ' => 'ⲋ',
848	+ 'Ⲍ' => 'ⲍ',
849	+ 'Ⲏ' => 'ⲏ',
850	+ 'Ⲑ' => 'ⲑ',
851	+ 'Ⲓ' => 'ⲓ',
852	+ 'Ⲕ' => 'ⲕ',
853	+ 'Ⲗ' => 'ⲗ',
854	+ 'Ⲙ' => 'ⲙ',
855	+ 'Ⲛ' => 'ⲛ',
856	+ 'Ⲝ' => 'ⲝ',
857	+ 'Ⲟ' => 'ⲟ',
858	+ 'Ⲡ' => 'ⲡ',
859	+ 'Ⲣ' => 'ⲣ',
860	+ 'Ⲥ' => 'ⲥ',
861	+ 'Ⲧ' => 'ⲧ',
862	+ 'Ⲩ' => 'ⲩ',
863	+ 'Ⲫ' => 'ⲫ',
864	+ 'Ⲭ' => 'ⲭ',
865	+ 'Ⲯ' => 'ⲯ',
866	+ 'Ⲱ' => 'ⲱ',
867	+ 'Ⲳ' => 'ⲳ',
868	+ 'Ⲵ' => 'ⲵ',
869	+ 'Ⲷ' => 'ⲷ',
870	+ 'Ⲹ' => 'ⲹ',
871	+ 'Ⲻ' => 'ⲻ',
872	+ 'Ⲽ' => 'ⲽ',
873	+ 'Ⲿ' => 'ⲿ',
874	+ 'Ⳁ' => 'ⳁ',
875	+ 'Ⳃ' => 'ⳃ',
876	+ 'Ⳅ' => 'ⳅ',
877	+ 'Ⳇ' => 'ⳇ',
878	+ 'Ⳉ' => 'ⳉ',
879	+ 'Ⳋ' => 'ⳋ',
880	+ 'Ⳍ' => 'ⳍ',
881	+ 'Ⳏ' => 'ⳏ',
882	+ 'Ⳑ' => 'ⳑ',
883	+ 'Ⳓ' => 'ⳓ',
884	+ 'Ⳕ' => 'ⳕ',
885	+ 'Ⳗ' => 'ⳗ',
886	+ 'Ⳙ' => 'ⳙ',
887	+ 'Ⳛ' => 'ⳛ',
888	+ 'Ⳝ' => 'ⳝ',
889	+ 'Ⳟ' => 'ⳟ',
890	+ 'Ⳡ' => 'ⳡ',
891	+ 'Ⳣ' => 'ⳣ',
892	+ 'Ⳬ' => 'ⳬ',
893	+ 'Ⳮ' => 'ⳮ',
894	+ 'Ⳳ' => 'ⳳ',
895	+ 'Ꙁ' => 'ꙁ',
896	+ 'Ꙃ' => 'ꙃ',
897	+ 'Ꙅ' => 'ꙅ',
898	+ 'Ꙇ' => 'ꙇ',
899	+ 'Ꙉ' => 'ꙉ',
900	+ 'Ꙋ' => 'ꙋ',
901	+ 'Ꙍ' => 'ꙍ',
902	+ 'Ꙏ' => 'ꙏ',
903	+ 'Ꙑ' => 'ꙑ',
904	+ 'Ꙓ' => 'ꙓ',
905	+ 'Ꙕ' => 'ꙕ',
906	+ 'Ꙗ' => 'ꙗ',
907	+ 'Ꙙ' => 'ꙙ',
908	+ 'Ꙛ' => 'ꙛ',
909	+ 'Ꙝ' => 'ꙝ',
910	+ 'Ꙟ' => 'ꙟ',
911	+ 'Ꙡ' => 'ꙡ',
912	+ 'Ꙣ' => 'ꙣ',
913	+ 'Ꙥ' => 'ꙥ',
914	+ 'Ꙧ' => 'ꙧ',
915	+ 'Ꙩ' => 'ꙩ',
916	+ 'Ꙫ' => 'ꙫ',
917	+ 'Ꙭ' => 'ꙭ',
918	+ 'Ꚁ' => 'ꚁ',
919	+ 'Ꚃ' => 'ꚃ',
920	+ 'Ꚅ' => 'ꚅ',
921	+ 'Ꚇ' => 'ꚇ',
922	+ 'Ꚉ' => 'ꚉ',
923	+ 'Ꚋ' => 'ꚋ',
924	+ 'Ꚍ' => 'ꚍ',
925	+ 'Ꚏ' => 'ꚏ',
926	+ 'Ꚑ' => 'ꚑ',
927	+ 'Ꚓ' => 'ꚓ',
928	+ 'Ꚕ' => 'ꚕ',
929	+ 'Ꚗ' => 'ꚗ',
930	+ 'Ꚙ' => 'ꚙ',
931	+ 'Ꚛ' => 'ꚛ',
932	+ 'Ꜣ' => 'ꜣ',
933	+ 'Ꜥ' => 'ꜥ',
934	+ 'Ꜧ' => 'ꜧ',
935	+ 'Ꜩ' => 'ꜩ',
936	+ 'Ꜫ' => 'ꜫ',
937	+ 'Ꜭ' => 'ꜭ',
938	+ 'Ꜯ' => 'ꜯ',
939	+ 'Ꜳ' => 'ꜳ',
940	+ 'Ꜵ' => 'ꜵ',
941	+ 'Ꜷ' => 'ꜷ',
942	+ 'Ꜹ' => 'ꜹ',
943	+ 'Ꜻ' => 'ꜻ',
944	+ 'Ꜽ' => 'ꜽ',
945	+ 'Ꜿ' => 'ꜿ',
946	+ 'Ꝁ' => 'ꝁ',
947	+ 'Ꝃ' => 'ꝃ',
948	+ 'Ꝅ' => 'ꝅ',
949	+ 'Ꝇ' => 'ꝇ',
950	+ 'Ꝉ' => 'ꝉ',
951	+ 'Ꝋ' => 'ꝋ',
952	+ 'Ꝍ' => 'ꝍ',
953	+ 'Ꝏ' => 'ꝏ',
954	+ 'Ꝑ' => 'ꝑ',
955	+ 'Ꝓ' => 'ꝓ',
956	+ 'Ꝕ' => 'ꝕ',
957	+ 'Ꝗ' => 'ꝗ',
958	+ 'Ꝙ' => 'ꝙ',
959	+ 'Ꝛ' => 'ꝛ',
960	+ 'Ꝝ' => 'ꝝ',
961	+ 'Ꝟ' => 'ꝟ',
962	+ 'Ꝡ' => 'ꝡ',
963	+ 'Ꝣ' => 'ꝣ',
964	+ 'Ꝥ' => 'ꝥ',
965	+ 'Ꝧ' => 'ꝧ',
966	+ 'Ꝩ' => 'ꝩ',
967	+ 'Ꝫ' => 'ꝫ',
968	+ 'Ꝭ' => 'ꝭ',
969	+ 'Ꝯ' => 'ꝯ',
970	+ 'Ꝺ' => 'ꝺ',
971	+ 'Ꝼ' => 'ꝼ',
972	+ 'Ᵹ' => 'ᵹ',
973	+ 'Ꝿ' => 'ꝿ',
974	+ 'Ꞁ' => 'ꞁ',
975	+ 'Ꞃ' => 'ꞃ',
976	+ 'Ꞅ' => 'ꞅ',
977	+ 'Ꞇ' => 'ꞇ',
978	+ 'Ꞌ' => 'ꞌ',
979	+ 'Ɥ' => 'ɥ',
980	+ 'Ꞑ' => 'ꞑ',
981	+ 'Ꞓ' => 'ꞓ',
982	+ 'Ꞗ' => 'ꞗ',
983	+ 'Ꞙ' => 'ꞙ',
984	+ 'Ꞛ' => 'ꞛ',
985	+ 'Ꞝ' => 'ꞝ',
986	+ 'Ꞟ' => 'ꞟ',
987	+ 'Ꞡ' => 'ꞡ',
988	+ 'Ꞣ' => 'ꞣ',
989	+ 'Ꞥ' => 'ꞥ',
990	+ 'Ꞧ' => 'ꞧ',
991	+ 'Ꞩ' => 'ꞩ',
992	+ 'Ɦ' => 'ɦ',
993	+ 'Ɜ' => 'ɜ',
994	+ 'Ɡ' => 'ɡ',
995	+ 'Ɬ' => 'ɬ',
996	+ 'Ʞ' => 'ʞ',
997	+ 'Ʇ' => 'ʇ',
998	+ 'Ａ' => 'ａ',
999	+ 'Ｂ' => 'ｂ',
1000	+ 'Ｃ' => 'ｃ',
1001	+ 'Ｄ' => 'ｄ',
1002	+ 'Ｅ' => 'ｅ',
1003	+ 'Ｆ' => 'ｆ',
1004	+ 'Ｇ' => 'ｇ',
1005	+ 'Ｈ' => 'ｈ',
1006	+ 'Ｉ' => 'ｉ',
1007	+ 'Ｊ' => 'ｊ',
1008	+ 'Ｋ' => 'ｋ',
1009	+ 'Ｌ' => 'ｌ',
1010	+ 'Ｍ' => 'ｍ',
1011	+ 'Ｎ' => 'ｎ',
1012	+ 'Ｏ' => 'ｏ',
1013	+ 'Ｐ' => 'ｐ',
1014	+ 'Ｑ' => 'ｑ',
1015	+ 'Ｒ' => 'ｒ',
1016	+ 'Ｓ' => 'ｓ',
1017	+ 'Ｔ' => 'ｔ',
1018	+ 'Ｕ' => 'ｕ',
1019	+ 'Ｖ' => 'ｖ',
1020	+ 'Ｗ' => 'ｗ',
1021	+ 'Ｘ' => 'ｘ',
1022	+ 'Ｙ' => 'ｙ',
1023	+ 'Ｚ' => 'ｚ',
1024	+ '𐐀' => '𐐨',
1025	+ '𐐁' => '𐐩',
1026	+ '𐐂' => '𐐪',
1027	+ '𐐃' => '𐐫',
1028	+ '𐐄' => '𐐬',
1029	+ '𐐅' => '𐐭',
1030	+ '𐐆' => '𐐮',
1031	+ '𐐇' => '𐐯',
1032	+ '𐐈' => '𐐰',
1033	+ '𐐉' => '𐐱',
1034	+ '𐐊' => '𐐲',
1035	+ '𐐋' => '𐐳',
1036	+ '𐐌' => '𐐴',
1037	+ '𐐍' => '𐐵',
1038	+ '𐐎' => '𐐶',
1039	+ '𐐏' => '𐐷',
1040	+ '𐐐' => '𐐸',
1041	+ '𐐑' => '𐐹',
1042	+ '𐐒' => '𐐺',
1043	+ '𐐓' => '𐐻',
1044	+ '𐐔' => '𐐼',
1045	+ '𐐕' => '𐐽',
1046	+ '𐐖' => '𐐾',
1047	+ '𐐗' => '𐐿',
1048	+ '𐐘' => '𐑀',
1049	+ '𐐙' => '𐑁',
1050	+ '𐐚' => '𐑂',
1051	+ '𐐛' => '𐑃',
1052	+ '𐐜' => '𐑄',
1053	+ '𐐝' => '𐑅',
1054	+ '𐐞' => '𐑆',
1055	+ '𐐟' => '𐑇',
1056	+ '𐐠' => '𐑈',
1057	+ '𐐡' => '𐑉',
1058	+ '𐐢' => '𐑊',
1059	+ '𐐣' => '𐑋',
1060	+ '𐐤' => '𐑌',
1061	+ '𐐥' => '𐑍',
1062	+ '𐐦' => '𐑎',
1063	+ '𐐧' => '𐑏',
1064	+ '𑢠' => '𑣀',
1065	+ '𑢡' => '𑣁',
1066	+ '𑢢' => '𑣂',
1067	+ '𑢣' => '𑣃',
1068	+ '𑢤' => '𑣄',
1069	+ '𑢥' => '𑣅',
1070	+ '𑢦' => '𑣆',
1071	+ '𑢧' => '𑣇',
1072	+ '𑢨' => '𑣈',
1073	+ '𑢩' => '𑣉',
1074	+ '𑢪' => '𑣊',
1075	+ '𑢫' => '𑣋',
1076	+ '𑢬' => '𑣌',
1077	+ '𑢭' => '𑣍',
1078	+ '𑢮' => '𑣎',
1079	+ '𑢯' => '𑣏',
1080	+ '𑢰' => '𑣐',
1081	+ '𑢱' => '𑣑',
1082	+ '𑢲' => '𑣒',
1083	+ '𑢳' => '𑣓',
1084	+ '𑢴' => '𑣔',
1085	+ '𑢵' => '𑣕',
1086	+ '𑢶' => '𑣖',
1087	+ '𑢷' => '𑣗',
1088	+ '𑢸' => '𑣘',
1089	+ '𑢹' => '𑣙',
1090	+ '𑢺' => '𑣚',
1091	+ '𑢻' => '𑣛',
1092	+ '𑢼' => '𑣜',
1093	+ '𑢽' => '𑣝',
1094	+ '𑢾' => '𑣞',
1095	+ '𑢿' => '𑣟',
1096	+ );
1097	+
1098	+ $result =& $data;
1099	+ unset($data);
1100	+
1101	+ return $result;

src/common/lib/vendor/symfony/polyfill-mbstring/Resources/unidata/upperCase.php ADDED Viewed

	@@ -0,0 +1,1109 @@


1	+ <?php
2	+
3	+ static $data = array (
4	+ 'a' => 'A',
5	+ 'b' => 'B',
6	+ 'c' => 'C',
7	+ 'd' => 'D',
8	+ 'e' => 'E',
9	+ 'f' => 'F',
10	+ 'g' => 'G',
11	+ 'h' => 'H',
12	+ 'i' => 'I',
13	+ 'j' => 'J',
14	+ 'k' => 'K',
15	+ 'l' => 'L',
16	+ 'm' => 'M',
17	+ 'n' => 'N',
18	+ 'o' => 'O',
19	+ 'p' => 'P',
20	+ 'q' => 'Q',
21	+ 'r' => 'R',
22	+ 's' => 'S',
23	+ 't' => 'T',
24	+ 'u' => 'U',
25	+ 'v' => 'V',
26	+ 'w' => 'W',
27	+ 'x' => 'X',
28	+ 'y' => 'Y',
29	+ 'z' => 'Z',
30	+ 'µ' => 'Μ',
31	+ 'à' => 'À',
32	+ 'á' => 'Á',
33	+ 'â' => 'Â',
34	+ 'ã' => 'Ã',
35	+ 'ä' => 'Ä',
36	+ 'å' => 'Å',
37	+ 'æ' => 'Æ',
38	+ 'ç' => 'Ç',
39	+ 'è' => 'È',
40	+ 'é' => 'É',
41	+ 'ê' => 'Ê',
42	+ 'ë' => 'Ë',
43	+ 'ì' => 'Ì',
44	+ 'í' => 'Í',
45	+ 'î' => 'Î',
46	+ 'ï' => 'Ï',
47	+ 'ð' => 'Ð',
48	+ 'ñ' => 'Ñ',
49	+ 'ò' => 'Ò',
50	+ 'ó' => 'Ó',
51	+ 'ô' => 'Ô',
52	+ 'õ' => 'Õ',
53	+ 'ö' => 'Ö',
54	+ 'ø' => 'Ø',
55	+ 'ù' => 'Ù',
56	+ 'ú' => 'Ú',
57	+ 'û' => 'Û',
58	+ 'ü' => 'Ü',
59	+ 'ý' => 'Ý',
60	+ 'þ' => 'Þ',
61	+ 'ÿ' => 'Ÿ',
62	+ 'ā' => 'Ā',
63	+ 'ă' => 'Ă',
64	+ 'ą' => 'Ą',
65	+ 'ć' => 'Ć',
66	+ 'ĉ' => 'Ĉ',
67	+ 'ċ' => 'Ċ',
68	+ 'č' => 'Č',
69	+ 'ď' => 'Ď',
70	+ 'đ' => 'Đ',
71	+ 'ē' => 'Ē',
72	+ 'ĕ' => 'Ĕ',
73	+ 'ė' => 'Ė',
74	+ 'ę' => 'Ę',
75	+ 'ě' => 'Ě',
76	+ 'ĝ' => 'Ĝ',
77	+ 'ğ' => 'Ğ',
78	+ 'ġ' => 'Ġ',
79	+ 'ģ' => 'Ģ',
80	+ 'ĥ' => 'Ĥ',
81	+ 'ħ' => 'Ħ',
82	+ 'ĩ' => 'Ĩ',
83	+ 'ī' => 'Ī',
84	+ 'ĭ' => 'Ĭ',
85	+ 'į' => 'Į',
86	+ 'ı' => 'I',
87	+ 'ĳ' => 'Ĳ',
88	+ 'ĵ' => 'Ĵ',
89	+ 'ķ' => 'Ķ',
90	+ 'ĺ' => 'Ĺ',
91	+ 'ļ' => 'Ļ',
92	+ 'ľ' => 'Ľ',
93	+ 'ŀ' => 'Ŀ',
94	+ 'ł' => 'Ł',
95	+ 'ń' => 'Ń',
96	+ 'ņ' => 'Ņ',
97	+ 'ň' => 'Ň',
98	+ 'ŋ' => 'Ŋ',
99	+ 'ō' => 'Ō',
100	+ 'ŏ' => 'Ŏ',
101	+ 'ő' => 'Ő',
102	+ 'œ' => 'Œ',
103	+ 'ŕ' => 'Ŕ',
104	+ 'ŗ' => 'Ŗ',
105	+ 'ř' => 'Ř',
106	+ 'ś' => 'Ś',
107	+ 'ŝ' => 'Ŝ',
108	+ 'ş' => 'Ş',
109	+ 'š' => 'Š',
110	+ 'ţ' => 'Ţ',
111	+ 'ť' => 'Ť',
112	+ 'ŧ' => 'Ŧ',
113	+ 'ũ' => 'Ũ',
114	+ 'ū' => 'Ū',
115	+ 'ŭ' => 'Ŭ',
116	+ 'ů' => 'Ů',
117	+ 'ű' => 'Ű',
118	+ 'ų' => 'Ų',
119	+ 'ŵ' => 'Ŵ',
120	+ 'ŷ' => 'Ŷ',
121	+ 'ź' => 'Ź',
122	+ 'ż' => 'Ż',
123	+ 'ž' => 'Ž',
124	+ 'ſ' => 'S',
125	+ 'ƀ' => 'Ƀ',
126	+ 'ƃ' => 'Ƃ',
127	+ 'ƅ' => 'Ƅ',
128	+ 'ƈ' => 'Ƈ',
129	+ 'ƌ' => 'Ƌ',
130	+ 'ƒ' => 'Ƒ',
131	+ 'ƕ' => 'Ƕ',
132	+ 'ƙ' => 'Ƙ',
133	+ 'ƚ' => 'Ƚ',
134	+ 'ƞ' => 'Ƞ',
135	+ 'ơ' => 'Ơ',
136	+ 'ƣ' => 'Ƣ',
137	+ 'ƥ' => 'Ƥ',
138	+ 'ƨ' => 'Ƨ',
139	+ 'ƭ' => 'Ƭ',
140	+ 'ư' => 'Ư',
141	+ 'ƴ' => 'Ƴ',
142	+ 'ƶ' => 'Ƶ',
143	+ 'ƹ' => 'Ƹ',
144	+ 'ƽ' => 'Ƽ',
145	+ 'ƿ' => 'Ƿ',
146	+ 'ǅ' => 'Ǆ',
147	+ 'ǆ' => 'Ǆ',
148	+ 'ǈ' => 'Ǉ',
149	+ 'ǉ' => 'Ǉ',
150	+ 'ǋ' => 'Ǌ',
151	+ 'ǌ' => 'Ǌ',
152	+ 'ǎ' => 'Ǎ',
153	+ 'ǐ' => 'Ǐ',
154	+ 'ǒ' => 'Ǒ',
155	+ 'ǔ' => 'Ǔ',
156	+ 'ǖ' => 'Ǖ',
157	+ 'ǘ' => 'Ǘ',
158	+ 'ǚ' => 'Ǚ',
159	+ 'ǜ' => 'Ǜ',
160	+ 'ǝ' => 'Ǝ',
161	+ 'ǟ' => 'Ǟ',
162	+ 'ǡ' => 'Ǡ',
163	+ 'ǣ' => 'Ǣ',
164	+ 'ǥ' => 'Ǥ',
165	+ 'ǧ' => 'Ǧ',
166	+ 'ǩ' => 'Ǩ',
167	+ 'ǫ' => 'Ǫ',
168	+ 'ǭ' => 'Ǭ',
169	+ 'ǯ' => 'Ǯ',
170	+ 'ǲ' => 'Ǳ',
171	+ 'ǳ' => 'Ǳ',
172	+ 'ǵ' => 'Ǵ',
173	+ 'ǹ' => 'Ǹ',
174	+ 'ǻ' => 'Ǻ',
175	+ 'ǽ' => 'Ǽ',
176	+ 'ǿ' => 'Ǿ',
177	+ 'ȁ' => 'Ȁ',
178	+ 'ȃ' => 'Ȃ',
179	+ 'ȅ' => 'Ȅ',
180	+ 'ȇ' => 'Ȇ',
181	+ 'ȉ' => 'Ȉ',
182	+ 'ȋ' => 'Ȋ',
183	+ 'ȍ' => 'Ȍ',
184	+ 'ȏ' => 'Ȏ',
185	+ 'ȑ' => 'Ȑ',
186	+ 'ȓ' => 'Ȓ',
187	+ 'ȕ' => 'Ȕ',
188	+ 'ȗ' => 'Ȗ',
189	+ 'ș' => 'Ș',
190	+ 'ț' => 'Ț',
191	+ 'ȝ' => 'Ȝ',
192	+ 'ȟ' => 'Ȟ',
193	+ 'ȣ' => 'Ȣ',
194	+ 'ȥ' => 'Ȥ',
195	+ 'ȧ' => 'Ȧ',
196	+ 'ȩ' => 'Ȩ',
197	+ 'ȫ' => 'Ȫ',
198	+ 'ȭ' => 'Ȭ',
199	+ 'ȯ' => 'Ȯ',
200	+ 'ȱ' => 'Ȱ',
201	+ 'ȳ' => 'Ȳ',
202	+ 'ȼ' => 'Ȼ',
203	+ 'ȿ' => 'Ȿ',
204	+ 'ɀ' => 'Ɀ',
205	+ 'ɂ' => 'Ɂ',
206	+ 'ɇ' => 'Ɇ',
207	+ 'ɉ' => 'Ɉ',
208	+ 'ɋ' => 'Ɋ',
209	+ 'ɍ' => 'Ɍ',
210	+ 'ɏ' => 'Ɏ',
211	+ 'ɐ' => 'Ɐ',
212	+ 'ɑ' => 'Ɑ',
213	+ 'ɒ' => 'Ɒ',
214	+ 'ɓ' => 'Ɓ',
215	+ 'ɔ' => 'Ɔ',
216	+ 'ɖ' => 'Ɖ',
217	+ 'ɗ' => 'Ɗ',
218	+ 'ə' => 'Ə',
219	+ 'ɛ' => 'Ɛ',
220	+ 'ɜ' => 'Ɜ',
221	+ 'ɠ' => 'Ɠ',
222	+ 'ɡ' => 'Ɡ',
223	+ 'ɣ' => 'Ɣ',
224	+ 'ɥ' => 'Ɥ',
225	+ 'ɦ' => 'Ɦ',
226	+ 'ɨ' => 'Ɨ',
227	+ 'ɩ' => 'Ɩ',
228	+ 'ɫ' => 'Ɫ',
229	+ 'ɬ' => 'Ɬ',
230	+ 'ɯ' => 'Ɯ',
231	+ 'ɱ' => 'Ɱ',
232	+ 'ɲ' => 'Ɲ',
233	+ 'ɵ' => 'Ɵ',
234	+ 'ɽ' => 'Ɽ',
235	+ 'ʀ' => 'Ʀ',
236	+ 'ʃ' => 'Ʃ',
237	+ 'ʇ' => 'Ʇ',
238	+ 'ʈ' => 'Ʈ',
239	+ 'ʉ' => 'Ʉ',
240	+ 'ʊ' => 'Ʊ',
241	+ 'ʋ' => 'Ʋ',
242	+ 'ʌ' => 'Ʌ',
243	+ 'ʒ' => 'Ʒ',
244	+ 'ʞ' => 'Ʞ',
245	+ 'ͅ' => 'Ι',
246	+ 'ͱ' => 'Ͱ',
247	+ 'ͳ' => 'Ͳ',
248	+ 'ͷ' => 'Ͷ',
249	+ 'ͻ' => 'Ͻ',
250	+ 'ͼ' => 'Ͼ',
251	+ 'ͽ' => 'Ͽ',
252	+ 'ά' => 'Ά',
253	+ 'έ' => 'Έ',
254	+ 'ή' => 'Ή',
255	+ 'ί' => 'Ί',
256	+ 'α' => 'Α',
257	+ 'β' => 'Β',
258	+ 'γ' => 'Γ',
259	+ 'δ' => 'Δ',
260	+ 'ε' => 'Ε',
261	+ 'ζ' => 'Ζ',
262	+ 'η' => 'Η',
263	+ 'θ' => 'Θ',
264	+ 'ι' => 'Ι',
265	+ 'κ' => 'Κ',
266	+ 'λ' => 'Λ',
267	+ 'μ' => 'Μ',
268	+ 'ν' => 'Ν',
269	+ 'ξ' => 'Ξ',
270	+ 'ο' => 'Ο',
271	+ 'π' => 'Π',
272	+ 'ρ' => 'Ρ',
273	+ 'ς' => 'Σ',
274	+ 'σ' => 'Σ',
275	+ 'τ' => 'Τ',
276	+ 'υ' => 'Υ',
277	+ 'φ' => 'Φ',
278	+ 'χ' => 'Χ',
279	+ 'ψ' => 'Ψ',
280	+ 'ω' => 'Ω',
281	+ 'ϊ' => 'Ϊ',
282	+ 'ϋ' => 'Ϋ',
283	+ 'ό' => 'Ό',
284	+ 'ύ' => 'Ύ',
285	+ 'ώ' => 'Ώ',
286	+ 'ϐ' => 'Β',
287	+ 'ϑ' => 'Θ',
288	+ 'ϕ' => 'Φ',
289	+ 'ϖ' => 'Π',
290	+ 'ϗ' => 'Ϗ',
291	+ 'ϙ' => 'Ϙ',
292	+ 'ϛ' => 'Ϛ',
293	+ 'ϝ' => 'Ϝ',
294	+ 'ϟ' => 'Ϟ',
295	+ 'ϡ' => 'Ϡ',
296	+ 'ϣ' => 'Ϣ',
297	+ 'ϥ' => 'Ϥ',
298	+ 'ϧ' => 'Ϧ',
299	+ 'ϩ' => 'Ϩ',
300	+ 'ϫ' => 'Ϫ',
301	+ 'ϭ' => 'Ϭ',
302	+ 'ϯ' => 'Ϯ',
303	+ 'ϰ' => 'Κ',
304	+ 'ϱ' => 'Ρ',
305	+ 'ϲ' => 'Ϲ',
306	+ 'ϳ' => 'Ϳ',
307	+ 'ϵ' => 'Ε',
308	+ 'ϸ' => 'Ϸ',
309	+ 'ϻ' => 'Ϻ',
310	+ 'а' => 'А',
311	+ 'б' => 'Б',
312	+ 'в' => 'В',
313	+ 'г' => 'Г',
314	+ 'д' => 'Д',
315	+ 'е' => 'Е',
316	+ 'ж' => 'Ж',
317	+ 'з' => 'З',
318	+ 'и' => 'И',
319	+ 'й' => 'Й',
320	+ 'к' => 'К',
321	+ 'л' => 'Л',
322	+ 'м' => 'М',
323	+ 'н' => 'Н',
324	+ 'о' => 'О',
325	+ 'п' => 'П',
326	+ 'р' => 'Р',
327	+ 'с' => 'С',
328	+ 'т' => 'Т',
329	+ 'у' => 'У',
330	+ 'ф' => 'Ф',
331	+ 'х' => 'Х',
332	+ 'ц' => 'Ц',
333	+ 'ч' => 'Ч',
334	+ 'ш' => 'Ш',
335	+ 'щ' => 'Щ',
336	+ 'ъ' => 'Ъ',
337	+ 'ы' => 'Ы',
338	+ 'ь' => 'Ь',
339	+ 'э' => 'Э',
340	+ 'ю' => 'Ю',
341	+ 'я' => 'Я',
342	+ 'ѐ' => 'Ѐ',
343	+ 'ё' => 'Ё',
344	+ 'ђ' => 'Ђ',
345	+ 'ѓ' => 'Ѓ',
346	+ 'є' => 'Є',
347	+ 'ѕ' => 'Ѕ',
348	+ 'і' => 'І',
349	+ 'ї' => 'Ї',
350	+ 'ј' => 'Ј',
351	+ 'љ' => 'Љ',
352	+ 'њ' => 'Њ',
353	+ 'ћ' => 'Ћ',
354	+ 'ќ' => 'Ќ',
355	+ 'ѝ' => 'Ѝ',
356	+ 'ў' => 'Ў',
357	+ 'џ' => 'Џ',
358	+ 'ѡ' => 'Ѡ',
359	+ 'ѣ' => 'Ѣ',
360	+ 'ѥ' => 'Ѥ',
361	+ 'ѧ' => 'Ѧ',
362	+ 'ѩ' => 'Ѩ',
363	+ 'ѫ' => 'Ѫ',
364	+ 'ѭ' => 'Ѭ',
365	+ 'ѯ' => 'Ѯ',
366	+ 'ѱ' => 'Ѱ',
367	+ 'ѳ' => 'Ѳ',
368	+ 'ѵ' => 'Ѵ',
369	+ 'ѷ' => 'Ѷ',
370	+ 'ѹ' => 'Ѹ',
371	+ 'ѻ' => 'Ѻ',
372	+ 'ѽ' => 'Ѽ',
373	+ 'ѿ' => 'Ѿ',
374	+ 'ҁ' => 'Ҁ',
375	+ 'ҋ' => 'Ҋ',
376	+ 'ҍ' => 'Ҍ',
377	+ 'ҏ' => 'Ҏ',
378	+ 'ґ' => 'Ґ',
379	+ 'ғ' => 'Ғ',
380	+ 'ҕ' => 'Ҕ',
381	+ 'җ' => 'Җ',
382	+ 'ҙ' => 'Ҙ',
383	+ 'қ' => 'Қ',
384	+ 'ҝ' => 'Ҝ',
385	+ 'ҟ' => 'Ҟ',
386	+ 'ҡ' => 'Ҡ',
387	+ 'ң' => 'Ң',
388	+ 'ҥ' => 'Ҥ',
389	+ 'ҧ' => 'Ҧ',
390	+ 'ҩ' => 'Ҩ',
391	+ 'ҫ' => 'Ҫ',
392	+ 'ҭ' => 'Ҭ',
393	+ 'ү' => 'Ү',
394	+ 'ұ' => 'Ұ',
395	+ 'ҳ' => 'Ҳ',
396	+ 'ҵ' => 'Ҵ',
397	+ 'ҷ' => 'Ҷ',
398	+ 'ҹ' => 'Ҹ',
399	+ 'һ' => 'Һ',
400	+ 'ҽ' => 'Ҽ',
401	+ 'ҿ' => 'Ҿ',
402	+ 'ӂ' => 'Ӂ',
403	+ 'ӄ' => 'Ӄ',
404	+ 'ӆ' => 'Ӆ',
405	+ 'ӈ' => 'Ӈ',
406	+ 'ӊ' => 'Ӊ',
407	+ 'ӌ' => 'Ӌ',
408	+ 'ӎ' => 'Ӎ',
409	+ 'ӏ' => 'Ӏ',
410	+ 'ӑ' => 'Ӑ',
411	+ 'ӓ' => 'Ӓ',
412	+ 'ӕ' => 'Ӕ',
413	+ 'ӗ' => 'Ӗ',
414	+ 'ә' => 'Ә',
415	+ 'ӛ' => 'Ӛ',
416	+ 'ӝ' => 'Ӝ',
417	+ 'ӟ' => 'Ӟ',
418	+ 'ӡ' => 'Ӡ',
419	+ 'ӣ' => 'Ӣ',
420	+ 'ӥ' => 'Ӥ',
421	+ 'ӧ' => 'Ӧ',
422	+ 'ө' => 'Ө',
423	+ 'ӫ' => 'Ӫ',
424	+ 'ӭ' => 'Ӭ',
425	+ 'ӯ' => 'Ӯ',
426	+ 'ӱ' => 'Ӱ',
427	+ 'ӳ' => 'Ӳ',
428	+ 'ӵ' => 'Ӵ',
429	+ 'ӷ' => 'Ӷ',
430	+ 'ӹ' => 'Ӹ',
431	+ 'ӻ' => 'Ӻ',
432	+ 'ӽ' => 'Ӽ',
433	+ 'ӿ' => 'Ӿ',
434	+ 'ԁ' => 'Ԁ',
435	+ 'ԃ' => 'Ԃ',
436	+ 'ԅ' => 'Ԅ',
437	+ 'ԇ' => 'Ԇ',
438	+ 'ԉ' => 'Ԉ',
439	+ 'ԋ' => 'Ԋ',
440	+ 'ԍ' => 'Ԍ',
441	+ 'ԏ' => 'Ԏ',
442	+ 'ԑ' => 'Ԑ',
443	+ 'ԓ' => 'Ԓ',
444	+ 'ԕ' => 'Ԕ',
445	+ 'ԗ' => 'Ԗ',
446	+ 'ԙ' => 'Ԙ',
447	+ 'ԛ' => 'Ԛ',
448	+ 'ԝ' => 'Ԝ',
449	+ 'ԟ' => 'Ԟ',
450	+ 'ԡ' => 'Ԡ',
451	+ 'ԣ' => 'Ԣ',
452	+ 'ԥ' => 'Ԥ',
453	+ 'ԧ' => 'Ԧ',
454	+ 'ԩ' => 'Ԩ',
455	+ 'ԫ' => 'Ԫ',
456	+ 'ԭ' => 'Ԭ',
457	+ 'ԯ' => 'Ԯ',
458	+ 'ա' => 'Ա',
459	+ 'բ' => 'Բ',
460	+ 'գ' => 'Գ',
461	+ 'դ' => 'Դ',
462	+ 'ե' => 'Ե',
463	+ 'զ' => 'Զ',
464	+ 'է' => 'Է',
465	+ 'ը' => 'Ը',
466	+ 'թ' => 'Թ',
467	+ 'ժ' => 'Ժ',
468	+ 'ի' => 'Ի',
469	+ 'լ' => 'Լ',
470	+ 'խ' => 'Խ',
471	+ 'ծ' => 'Ծ',
472	+ 'կ' => 'Կ',
473	+ 'հ' => 'Հ',
474	+ 'ձ' => 'Ձ',
475	+ 'ղ' => 'Ղ',
476	+ 'ճ' => 'Ճ',
477	+ 'մ' => 'Մ',
478	+ 'յ' => 'Յ',
479	+ 'ն' => 'Ն',
480	+ 'շ' => 'Շ',
481	+ 'ո' => 'Ո',
482	+ 'չ' => 'Չ',
483	+ 'պ' => 'Պ',
484	+ 'ջ' => 'Ջ',
485	+ 'ռ' => 'Ռ',
486	+ 'ս' => 'Ս',
487	+ 'վ' => 'Վ',
488	+ 'տ' => 'Տ',
489	+ 'ր' => 'Ր',
490	+ 'ց' => 'Ց',
491	+ 'ւ' => 'Ւ',
492	+ 'փ' => 'Փ',
493	+ 'ք' => 'Ք',
494	+ 'օ' => 'Օ',
495	+ 'ֆ' => 'Ֆ',
496	+ 'ᵹ' => 'Ᵹ',
497	+ 'ᵽ' => 'Ᵽ',
498	+ 'ḁ' => 'Ḁ',
499	+ 'ḃ' => 'Ḃ',
500	+ 'ḅ' => 'Ḅ',
501	+ 'ḇ' => 'Ḇ',
502	+ 'ḉ' => 'Ḉ',
503	+ 'ḋ' => 'Ḋ',
504	+ 'ḍ' => 'Ḍ',
505	+ 'ḏ' => 'Ḏ',
506	+ 'ḑ' => 'Ḑ',
507	+ 'ḓ' => 'Ḓ',
508	+ 'ḕ' => 'Ḕ',
509	+ 'ḗ' => 'Ḗ',
510	+ 'ḙ' => 'Ḙ',
511	+ 'ḛ' => 'Ḛ',
512	+ 'ḝ' => 'Ḝ',
513	+ 'ḟ' => 'Ḟ',
514	+ 'ḡ' => 'Ḡ',
515	+ 'ḣ' => 'Ḣ',
516	+ 'ḥ' => 'Ḥ',
517	+ 'ḧ' => 'Ḧ',
518	+ 'ḩ' => 'Ḩ',
519	+ 'ḫ' => 'Ḫ',
520	+ 'ḭ' => 'Ḭ',
521	+ 'ḯ' => 'Ḯ',
522	+ 'ḱ' => 'Ḱ',
523	+ 'ḳ' => 'Ḳ',
524	+ 'ḵ' => 'Ḵ',
525	+ 'ḷ' => 'Ḷ',
526	+ 'ḹ' => 'Ḹ',
527	+ 'ḻ' => 'Ḻ',
528	+ 'ḽ' => 'Ḽ',
529	+ 'ḿ' => 'Ḿ',
530	+ 'ṁ' => 'Ṁ',
531	+ 'ṃ' => 'Ṃ',
532	+ 'ṅ' => 'Ṅ',
533	+ 'ṇ' => 'Ṇ',
534	+ 'ṉ' => 'Ṉ',
535	+ 'ṋ' => 'Ṋ',
536	+ 'ṍ' => 'Ṍ',
537	+ 'ṏ' => 'Ṏ',
538	+ 'ṑ' => 'Ṑ',
539	+ 'ṓ' => 'Ṓ',
540	+ 'ṕ' => 'Ṕ',
541	+ 'ṗ' => 'Ṗ',
542	+ 'ṙ' => 'Ṙ',
543	+ 'ṛ' => 'Ṛ',
544	+ 'ṝ' => 'Ṝ',
545	+ 'ṟ' => 'Ṟ',
546	+ 'ṡ' => 'Ṡ',
547	+ 'ṣ' => 'Ṣ',
548	+ 'ṥ' => 'Ṥ',
549	+ 'ṧ' => 'Ṧ',
550	+ 'ṩ' => 'Ṩ',
551	+ 'ṫ' => 'Ṫ',
552	+ 'ṭ' => 'Ṭ',
553	+ 'ṯ' => 'Ṯ',
554	+ 'ṱ' => 'Ṱ',
555	+ 'ṳ' => 'Ṳ',
556	+ 'ṵ' => 'Ṵ',
557	+ 'ṷ' => 'Ṷ',
558	+ 'ṹ' => 'Ṹ',
559	+ 'ṻ' => 'Ṻ',
560	+ 'ṽ' => 'Ṽ',
561	+ 'ṿ' => 'Ṿ',
562	+ 'ẁ' => 'Ẁ',
563	+ 'ẃ' => 'Ẃ',
564	+ 'ẅ' => 'Ẅ',
565	+ 'ẇ' => 'Ẇ',
566	+ 'ẉ' => 'Ẉ',
567	+ 'ẋ' => 'Ẋ',
568	+ 'ẍ' => 'Ẍ',
569	+ 'ẏ' => 'Ẏ',
570	+ 'ẑ' => 'Ẑ',
571	+ 'ẓ' => 'Ẓ',
572	+ 'ẕ' => 'Ẕ',
573	+ 'ẛ' => 'Ṡ',
574	+ 'ạ' => 'Ạ',
575	+ 'ả' => 'Ả',
576	+ 'ấ' => 'Ấ',
577	+ 'ầ' => 'Ầ',
578	+ 'ẩ' => 'Ẩ',
579	+ 'ẫ' => 'Ẫ',
580	+ 'ậ' => 'Ậ',
581	+ 'ắ' => 'Ắ',
582	+ 'ằ' => 'Ằ',
583	+ 'ẳ' => 'Ẳ',
584	+ 'ẵ' => 'Ẵ',
585	+ 'ặ' => 'Ặ',
586	+ 'ẹ' => 'Ẹ',
587	+ 'ẻ' => 'Ẻ',
588	+ 'ẽ' => 'Ẽ',
589	+ 'ế' => 'Ế',
590	+ 'ề' => 'Ề',
591	+ 'ể' => 'Ể',
592	+ 'ễ' => 'Ễ',
593	+ 'ệ' => 'Ệ',
594	+ 'ỉ' => 'Ỉ',
595	+ 'ị' => 'Ị',
596	+ 'ọ' => 'Ọ',
597	+ 'ỏ' => 'Ỏ',
598	+ 'ố' => 'Ố',
599	+ 'ồ' => 'Ồ',
600	+ 'ổ' => 'Ổ',
601	+ 'ỗ' => 'Ỗ',
602	+ 'ộ' => 'Ộ',
603	+ 'ớ' => 'Ớ',
604	+ 'ờ' => 'Ờ',
605	+ 'ở' => 'Ở',
606	+ 'ỡ' => 'Ỡ',
607	+ 'ợ' => 'Ợ',
608	+ 'ụ' => 'Ụ',
609	+ 'ủ' => 'Ủ',
610	+ 'ứ' => 'Ứ',
611	+ 'ừ' => 'Ừ',
612	+ 'ử' => 'Ử',
613	+ 'ữ' => 'Ữ',
614	+ 'ự' => 'Ự',
615	+ 'ỳ' => 'Ỳ',
616	+ 'ỵ' => 'Ỵ',
617	+ 'ỷ' => 'Ỷ',
618	+ 'ỹ' => 'Ỹ',
619	+ 'ỻ' => 'Ỻ',
620	+ 'ỽ' => 'Ỽ',
621	+ 'ỿ' => 'Ỿ',
622	+ 'ἀ' => 'Ἀ',
623	+ 'ἁ' => 'Ἁ',
624	+ 'ἂ' => 'Ἂ',
625	+ 'ἃ' => 'Ἃ',
626	+ 'ἄ' => 'Ἄ',
627	+ 'ἅ' => 'Ἅ',
628	+ 'ἆ' => 'Ἆ',
629	+ 'ἇ' => 'Ἇ',
630	+ 'ἐ' => 'Ἐ',
631	+ 'ἑ' => 'Ἑ',
632	+ 'ἒ' => 'Ἒ',
633	+ 'ἓ' => 'Ἓ',
634	+ 'ἔ' => 'Ἔ',
635	+ 'ἕ' => 'Ἕ',
636	+ 'ἠ' => 'Ἠ',
637	+ 'ἡ' => 'Ἡ',
638	+ 'ἢ' => 'Ἢ',
639	+ 'ἣ' => 'Ἣ',
640	+ 'ἤ' => 'Ἤ',
641	+ 'ἥ' => 'Ἥ',
642	+ 'ἦ' => 'Ἦ',
643	+ 'ἧ' => 'Ἧ',
644	+ 'ἰ' => 'Ἰ',
645	+ 'ἱ' => 'Ἱ',
646	+ 'ἲ' => 'Ἲ',
647	+ 'ἳ' => 'Ἳ',
648	+ 'ἴ' => 'Ἴ',
649	+ 'ἵ' => 'Ἵ',
650	+ 'ἶ' => 'Ἶ',
651	+ 'ἷ' => 'Ἷ',
652	+ 'ὀ' => 'Ὀ',
653	+ 'ὁ' => 'Ὁ',
654	+ 'ὂ' => 'Ὂ',
655	+ 'ὃ' => 'Ὃ',
656	+ 'ὄ' => 'Ὄ',
657	+ 'ὅ' => 'Ὅ',
658	+ 'ὑ' => 'Ὑ',
659	+ 'ὓ' => 'Ὓ',
660	+ 'ὕ' => 'Ὕ',
661	+ 'ὗ' => 'Ὗ',
662	+ 'ὠ' => 'Ὠ',
663	+ 'ὡ' => 'Ὡ',
664	+ 'ὢ' => 'Ὢ',
665	+ 'ὣ' => 'Ὣ',
666	+ 'ὤ' => 'Ὤ',
667	+ 'ὥ' => 'Ὥ',
668	+ 'ὦ' => 'Ὦ',
669	+ 'ὧ' => 'Ὧ',
670	+ 'ὰ' => 'Ὰ',
671	+ 'ά' => 'Ά',
672	+ 'ὲ' => 'Ὲ',
673	+ 'έ' => 'Έ',
674	+ 'ὴ' => 'Ὴ',
675	+ 'ή' => 'Ή',
676	+ 'ὶ' => 'Ὶ',
677	+ 'ί' => 'Ί',
678	+ 'ὸ' => 'Ὸ',
679	+ 'ό' => 'Ό',
680	+ 'ὺ' => 'Ὺ',
681	+ 'ύ' => 'Ύ',
682	+ 'ὼ' => 'Ὼ',
683	+ 'ώ' => 'Ώ',
684	+ 'ᾀ' => 'ᾈ',
685	+ 'ᾁ' => 'ᾉ',
686	+ 'ᾂ' => 'ᾊ',
687	+ 'ᾃ' => 'ᾋ',
688	+ 'ᾄ' => 'ᾌ',
689	+ 'ᾅ' => 'ᾍ',
690	+ 'ᾆ' => 'ᾎ',
691	+ 'ᾇ' => 'ᾏ',
692	+ 'ᾐ' => 'ᾘ',
693	+ 'ᾑ' => 'ᾙ',
694	+ 'ᾒ' => 'ᾚ',
695	+ 'ᾓ' => 'ᾛ',
696	+ 'ᾔ' => 'ᾜ',
697	+ 'ᾕ' => 'ᾝ',
698	+ 'ᾖ' => 'ᾞ',
699	+ 'ᾗ' => 'ᾟ',
700	+ 'ᾠ' => 'ᾨ',
701	+ 'ᾡ' => 'ᾩ',
702	+ 'ᾢ' => 'ᾪ',
703	+ 'ᾣ' => 'ᾫ',
704	+ 'ᾤ' => 'ᾬ',
705	+ 'ᾥ' => 'ᾭ',
706	+ 'ᾦ' => 'ᾮ',
707	+ 'ᾧ' => 'ᾯ',
708	+ 'ᾰ' => 'Ᾰ',
709	+ 'ᾱ' => 'Ᾱ',
710	+ 'ᾳ' => 'ᾼ',
711	+ 'ι' => 'Ι',
712	+ 'ῃ' => 'ῌ',
713	+ 'ῐ' => 'Ῐ',
714	+ 'ῑ' => 'Ῑ',
715	+ 'ῠ' => 'Ῠ',
716	+ 'ῡ' => 'Ῡ',
717	+ 'ῥ' => 'Ῥ',
718	+ 'ῳ' => 'ῼ',
719	+ 'ⅎ' => 'Ⅎ',
720	+ 'ⅰ' => 'Ⅰ',
721	+ 'ⅱ' => 'Ⅱ',
722	+ 'ⅲ' => 'Ⅲ',
723	+ 'ⅳ' => 'Ⅳ',
724	+ 'ⅴ' => 'Ⅴ',
725	+ 'ⅵ' => 'Ⅵ',
726	+ 'ⅶ' => 'Ⅶ',
727	+ 'ⅷ' => 'Ⅷ',
728	+ 'ⅸ' => 'Ⅸ',
729	+ 'ⅹ' => 'Ⅹ',
730	+ 'ⅺ' => 'Ⅺ',
731	+ 'ⅻ' => 'Ⅻ',
732	+ 'ⅼ' => 'Ⅼ',
733	+ 'ⅽ' => 'Ⅽ',
734	+ 'ⅾ' => 'Ⅾ',
735	+ 'ⅿ' => 'Ⅿ',
736	+ 'ↄ' => 'Ↄ',
737	+ 'ⓐ' => 'Ⓐ',
738	+ 'ⓑ' => 'Ⓑ',
739	+ 'ⓒ' => 'Ⓒ',
740	+ 'ⓓ' => 'Ⓓ',
741	+ 'ⓔ' => 'Ⓔ',
742	+ 'ⓕ' => 'Ⓕ',
743	+ 'ⓖ' => 'Ⓖ',
744	+ 'ⓗ' => 'Ⓗ',
745	+ 'ⓘ' => 'Ⓘ',
746	+ 'ⓙ' => 'Ⓙ',
747	+ 'ⓚ' => 'Ⓚ',
748	+ 'ⓛ' => 'Ⓛ',
749	+ 'ⓜ' => 'Ⓜ',
750	+ 'ⓝ' => 'Ⓝ',
751	+ 'ⓞ' => 'Ⓞ',
752	+ 'ⓟ' => 'Ⓟ',
753	+ 'ⓠ' => 'Ⓠ',
754	+ 'ⓡ' => 'Ⓡ',
755	+ 'ⓢ' => 'Ⓢ',
756	+ 'ⓣ' => 'Ⓣ',
757	+ 'ⓤ' => 'Ⓤ',
758	+ 'ⓥ' => 'Ⓥ',
759	+ 'ⓦ' => 'Ⓦ',
760	+ 'ⓧ' => 'Ⓧ',
761	+ 'ⓨ' => 'Ⓨ',
762	+ 'ⓩ' => 'Ⓩ',
763	+ 'ⰰ' => 'Ⰰ',
764	+ 'ⰱ' => 'Ⰱ',
765	+ 'ⰲ' => 'Ⰲ',
766	+ 'ⰳ' => 'Ⰳ',
767	+ 'ⰴ' => 'Ⰴ',
768	+ 'ⰵ' => 'Ⰵ',
769	+ 'ⰶ' => 'Ⰶ',
770	+ 'ⰷ' => 'Ⰷ',
771	+ 'ⰸ' => 'Ⰸ',
772	+ 'ⰹ' => 'Ⰹ',
773	+ 'ⰺ' => 'Ⰺ',
774	+ 'ⰻ' => 'Ⰻ',
775	+ 'ⰼ' => 'Ⰼ',
776	+ 'ⰽ' => 'Ⰽ',
777	+ 'ⰾ' => 'Ⰾ',
778	+ 'ⰿ' => 'Ⰿ',
779	+ 'ⱀ' => 'Ⱀ',
780	+ 'ⱁ' => 'Ⱁ',
781	+ 'ⱂ' => 'Ⱂ',
782	+ 'ⱃ' => 'Ⱃ',
783	+ 'ⱄ' => 'Ⱄ',
784	+ 'ⱅ' => 'Ⱅ',
785	+ 'ⱆ' => 'Ⱆ',
786	+ 'ⱇ' => 'Ⱇ',
787	+ 'ⱈ' => 'Ⱈ',
788	+ 'ⱉ' => 'Ⱉ',
789	+ 'ⱊ' => 'Ⱊ',
790	+ 'ⱋ' => 'Ⱋ',
791	+ 'ⱌ' => 'Ⱌ',
792	+ 'ⱍ' => 'Ⱍ',
793	+ 'ⱎ' => 'Ⱎ',
794	+ 'ⱏ' => 'Ⱏ',
795	+ 'ⱐ' => 'Ⱐ',
796	+ 'ⱑ' => 'Ⱑ',
797	+ 'ⱒ' => 'Ⱒ',
798	+ 'ⱓ' => 'Ⱓ',
799	+ 'ⱔ' => 'Ⱔ',
800	+ 'ⱕ' => 'Ⱕ',
801	+ 'ⱖ' => 'Ⱖ',
802	+ 'ⱗ' => 'Ⱗ',
803	+ 'ⱘ' => 'Ⱘ',
804	+ 'ⱙ' => 'Ⱙ',
805	+ 'ⱚ' => 'Ⱚ',
806	+ 'ⱛ' => 'Ⱛ',
807	+ 'ⱜ' => 'Ⱜ',
808	+ 'ⱝ' => 'Ⱝ',
809	+ 'ⱞ' => 'Ⱞ',
810	+ 'ⱡ' => 'Ⱡ',
811	+ 'ⱥ' => 'Ⱥ',
812	+ 'ⱦ' => 'Ⱦ',
813	+ 'ⱨ' => 'Ⱨ',
814	+ 'ⱪ' => 'Ⱪ',
815	+ 'ⱬ' => 'Ⱬ',
816	+ 'ⱳ' => 'Ⱳ',
817	+ 'ⱶ' => 'Ⱶ',
818	+ 'ⲁ' => 'Ⲁ',
819	+ 'ⲃ' => 'Ⲃ',
820	+ 'ⲅ' => 'Ⲅ',
821	+ 'ⲇ' => 'Ⲇ',
822	+ 'ⲉ' => 'Ⲉ',
823	+ 'ⲋ' => 'Ⲋ',
824	+ 'ⲍ' => 'Ⲍ',
825	+ 'ⲏ' => 'Ⲏ',
826	+ 'ⲑ' => 'Ⲑ',
827	+ 'ⲓ' => 'Ⲓ',
828	+ 'ⲕ' => 'Ⲕ',
829	+ 'ⲗ' => 'Ⲗ',
830	+ 'ⲙ' => 'Ⲙ',
831	+ 'ⲛ' => 'Ⲛ',
832	+ 'ⲝ' => 'Ⲝ',
833	+ 'ⲟ' => 'Ⲟ',
834	+ 'ⲡ' => 'Ⲡ',
835	+ 'ⲣ' => 'Ⲣ',
836	+ 'ⲥ' => 'Ⲥ',
837	+ 'ⲧ' => 'Ⲧ',
838	+ 'ⲩ' => 'Ⲩ',
839	+ 'ⲫ' => 'Ⲫ',
840	+ 'ⲭ' => 'Ⲭ',
841	+ 'ⲯ' => 'Ⲯ',
842	+ 'ⲱ' => 'Ⲱ',
843	+ 'ⲳ' => 'Ⲳ',
844	+ 'ⲵ' => 'Ⲵ',
845	+ 'ⲷ' => 'Ⲷ',
846	+ 'ⲹ' => 'Ⲹ',
847	+ 'ⲻ' => 'Ⲻ',
848	+ 'ⲽ' => 'Ⲽ',
849	+ 'ⲿ' => 'Ⲿ',
850	+ 'ⳁ' => 'Ⳁ',
851	+ 'ⳃ' => 'Ⳃ',
852	+ 'ⳅ' => 'Ⳅ',
853	+ 'ⳇ' => 'Ⳇ',
854	+ 'ⳉ' => 'Ⳉ',
855	+ 'ⳋ' => 'Ⳋ',
856	+ 'ⳍ' => 'Ⳍ',
857	+ 'ⳏ' => 'Ⳏ',
858	+ 'ⳑ' => 'Ⳑ',
859	+ 'ⳓ' => 'Ⳓ',
860	+ 'ⳕ' => 'Ⳕ',
861	+ 'ⳗ' => 'Ⳗ',
862	+ 'ⳙ' => 'Ⳙ',
863	+ 'ⳛ' => 'Ⳛ',
864	+ 'ⳝ' => 'Ⳝ',
865	+ 'ⳟ' => 'Ⳟ',
866	+ 'ⳡ' => 'Ⳡ',
867	+ 'ⳣ' => 'Ⳣ',
868	+ 'ⳬ' => 'Ⳬ',
869	+ 'ⳮ' => 'Ⳮ',
870	+ 'ⳳ' => 'Ⳳ',
871	+ 'ⴀ' => 'Ⴀ',
872	+ 'ⴁ' => 'Ⴁ',
873	+ 'ⴂ' => 'Ⴂ',
874	+ 'ⴃ' => 'Ⴃ',
875	+ 'ⴄ' => 'Ⴄ',
876	+ 'ⴅ' => 'Ⴅ',
877	+ 'ⴆ' => 'Ⴆ',
878	+ 'ⴇ' => 'Ⴇ',
879	+ 'ⴈ' => 'Ⴈ',
880	+ 'ⴉ' => 'Ⴉ',
881	+ 'ⴊ' => 'Ⴊ',
882	+ 'ⴋ' => 'Ⴋ',
883	+ 'ⴌ' => 'Ⴌ',
884	+ 'ⴍ' => 'Ⴍ',
885	+ 'ⴎ' => 'Ⴎ',
886	+ 'ⴏ' => 'Ⴏ',
887	+ 'ⴐ' => 'Ⴐ',
888	+ 'ⴑ' => 'Ⴑ',
889	+ 'ⴒ' => 'Ⴒ',
890	+ 'ⴓ' => 'Ⴓ',
891	+ 'ⴔ' => 'Ⴔ',
892	+ 'ⴕ' => 'Ⴕ',
893	+ 'ⴖ' => 'Ⴖ',
894	+ 'ⴗ' => 'Ⴗ',
895	+ 'ⴘ' => 'Ⴘ',
896	+ 'ⴙ' => 'Ⴙ',
897	+ 'ⴚ' => 'Ⴚ',
898	+ 'ⴛ' => 'Ⴛ',
899	+ 'ⴜ' => 'Ⴜ',
900	+ 'ⴝ' => 'Ⴝ',
901	+ 'ⴞ' => 'Ⴞ',
902	+ 'ⴟ' => 'Ⴟ',
903	+ 'ⴠ' => 'Ⴠ',
904	+ 'ⴡ' => 'Ⴡ',
905	+ 'ⴢ' => 'Ⴢ',
906	+ 'ⴣ' => 'Ⴣ',
907	+ 'ⴤ' => 'Ⴤ',
908	+ 'ⴥ' => 'Ⴥ',
909	+ 'ⴧ' => 'Ⴧ',
910	+ 'ⴭ' => 'Ⴭ',
911	+ 'ꙁ' => 'Ꙁ',
912	+ 'ꙃ' => 'Ꙃ',
913	+ 'ꙅ' => 'Ꙅ',
914	+ 'ꙇ' => 'Ꙇ',
915	+ 'ꙉ' => 'Ꙉ',
916	+ 'ꙋ' => 'Ꙋ',
917	+ 'ꙍ' => 'Ꙍ',
918	+ 'ꙏ' => 'Ꙏ',
919	+ 'ꙑ' => 'Ꙑ',
920	+ 'ꙓ' => 'Ꙓ',
921	+ 'ꙕ' => 'Ꙕ',
922	+ 'ꙗ' => 'Ꙗ',
923	+ 'ꙙ' => 'Ꙙ',
924	+ 'ꙛ' => 'Ꙛ',
925	+ 'ꙝ' => 'Ꙝ',
926	+ 'ꙟ' => 'Ꙟ',
927	+ 'ꙡ' => 'Ꙡ',
928	+ 'ꙣ' => 'Ꙣ',
929	+ 'ꙥ' => 'Ꙥ',
930	+ 'ꙧ' => 'Ꙧ',
931	+ 'ꙩ' => 'Ꙩ',
932	+ 'ꙫ' => 'Ꙫ',
933	+ 'ꙭ' => 'Ꙭ',
934	+ 'ꚁ' => 'Ꚁ',
935	+ 'ꚃ' => 'Ꚃ',
936	+ 'ꚅ' => 'Ꚅ',
937	+ 'ꚇ' => 'Ꚇ',
938	+ 'ꚉ' => 'Ꚉ',
939	+ 'ꚋ' => 'Ꚋ',
940	+ 'ꚍ' => 'Ꚍ',
941	+ 'ꚏ' => 'Ꚏ',
942	+ 'ꚑ' => 'Ꚑ',
943	+ 'ꚓ' => 'Ꚓ',
944	+ 'ꚕ' => 'Ꚕ',
945	+ 'ꚗ' => 'Ꚗ',
946	+ 'ꚙ' => 'Ꚙ',
947	+ 'ꚛ' => 'Ꚛ',
948	+ 'ꜣ' => 'Ꜣ',
949	+ 'ꜥ' => 'Ꜥ',
950	+ 'ꜧ' => 'Ꜧ',
951	+ 'ꜩ' => 'Ꜩ',
952	+ 'ꜫ' => 'Ꜫ',
953	+ 'ꜭ' => 'Ꜭ',
954	+ 'ꜯ' => 'Ꜯ',
955	+ 'ꜳ' => 'Ꜳ',
956	+ 'ꜵ' => 'Ꜵ',
957	+ 'ꜷ' => 'Ꜷ',
958	+ 'ꜹ' => 'Ꜹ',
959	+ 'ꜻ' => 'Ꜻ',
960	+ 'ꜽ' => 'Ꜽ',
961	+ 'ꜿ' => 'Ꜿ',
962	+ 'ꝁ' => 'Ꝁ',
963	+ 'ꝃ' => 'Ꝃ',
964	+ 'ꝅ' => 'Ꝅ',
965	+ 'ꝇ' => 'Ꝇ',
966	+ 'ꝉ' => 'Ꝉ',
967	+ 'ꝋ' => 'Ꝋ',
968	+ 'ꝍ' => 'Ꝍ',
969	+ 'ꝏ' => 'Ꝏ',
970	+ 'ꝑ' => 'Ꝑ',
971	+ 'ꝓ' => 'Ꝓ',
972	+ 'ꝕ' => 'Ꝕ',
973	+ 'ꝗ' => 'Ꝗ',
974	+ 'ꝙ' => 'Ꝙ',
975	+ 'ꝛ' => 'Ꝛ',
976	+ 'ꝝ' => 'Ꝝ',
977	+ 'ꝟ' => 'Ꝟ',
978	+ 'ꝡ' => 'Ꝡ',
979	+ 'ꝣ' => 'Ꝣ',
980	+ 'ꝥ' => 'Ꝥ',
981	+ 'ꝧ' => 'Ꝧ',
982	+ 'ꝩ' => 'Ꝩ',
983	+ 'ꝫ' => 'Ꝫ',
984	+ 'ꝭ' => 'Ꝭ',
985	+ 'ꝯ' => 'Ꝯ',
986	+ 'ꝺ' => 'Ꝺ',
987	+ 'ꝼ' => 'Ꝼ',
988	+ 'ꝿ' => 'Ꝿ',
989	+ 'ꞁ' => 'Ꞁ',
990	+ 'ꞃ' => 'Ꞃ',
991	+ 'ꞅ' => 'Ꞅ',
992	+ 'ꞇ' => 'Ꞇ',
993	+ 'ꞌ' => 'Ꞌ',
994	+ 'ꞑ' => 'Ꞑ',
995	+ 'ꞓ' => 'Ꞓ',
996	+ 'ꞗ' => 'Ꞗ',
997	+ 'ꞙ' => 'Ꞙ',
998	+ 'ꞛ' => 'Ꞛ',
999	+ 'ꞝ' => 'Ꞝ',
1000	+ 'ꞟ' => 'Ꞟ',
1001	+ 'ꞡ' => 'Ꞡ',
1002	+ 'ꞣ' => 'Ꞣ',
1003	+ 'ꞥ' => 'Ꞥ',
1004	+ 'ꞧ' => 'Ꞧ',
1005	+ 'ꞩ' => 'Ꞩ',
1006	+ 'ａ' => 'Ａ',
1007	+ 'ｂ' => 'Ｂ',
1008	+ 'ｃ' => 'Ｃ',
1009	+ 'ｄ' => 'Ｄ',
1010	+ 'ｅ' => 'Ｅ',
1011	+ 'ｆ' => 'Ｆ',
1012	+ 'ｇ' => 'Ｇ',
1013	+ 'ｈ' => 'Ｈ',
1014	+ 'ｉ' => 'Ｉ',
1015	+ 'ｊ' => 'Ｊ',
1016	+ 'ｋ' => 'Ｋ',
1017	+ 'ｌ' => 'Ｌ',
1018	+ 'ｍ' => 'Ｍ',
1019	+ 'ｎ' => 'Ｎ',
1020	+ 'ｏ' => 'Ｏ',
1021	+ 'ｐ' => 'Ｐ',
1022	+ 'ｑ' => 'Ｑ',
1023	+ 'ｒ' => 'Ｒ',
1024	+ 'ｓ' => 'Ｓ',
1025	+ 'ｔ' => 'Ｔ',
1026	+ 'ｕ' => 'Ｕ',
1027	+ 'ｖ' => 'Ｖ',
1028	+ 'ｗ' => 'Ｗ',
1029	+ 'ｘ' => 'Ｘ',
1030	+ 'ｙ' => 'Ｙ',
1031	+ 'ｚ' => 'Ｚ',
1032	+ '𐐨' => '𐐀',
1033	+ '𐐩' => '𐐁',
1034	+ '𐐪' => '𐐂',
1035	+ '𐐫' => '𐐃',
1036	+ '𐐬' => '𐐄',
1037	+ '𐐭' => '𐐅',
1038	+ '𐐮' => '𐐆',
1039	+ '𐐯' => '𐐇',
1040	+ '𐐰' => '𐐈',
1041	+ '𐐱' => '𐐉',
1042	+ '𐐲' => '𐐊',
1043	+ '𐐳' => '𐐋',
1044	+ '𐐴' => '𐐌',
1045	+ '𐐵' => '𐐍',
1046	+ '𐐶' => '𐐎',
1047	+ '𐐷' => '𐐏',
1048	+ '𐐸' => '𐐐',
1049	+ '𐐹' => '𐐑',
1050	+ '𐐺' => '𐐒',
1051	+ '𐐻' => '𐐓',
1052	+ '𐐼' => '𐐔',
1053	+ '𐐽' => '𐐕',
1054	+ '𐐾' => '𐐖',
1055	+ '𐐿' => '𐐗',
1056	+ '𐑀' => '𐐘',
1057	+ '𐑁' => '𐐙',
1058	+ '𐑂' => '𐐚',
1059	+ '𐑃' => '𐐛',
1060	+ '𐑄' => '𐐜',
1061	+ '𐑅' => '𐐝',
1062	+ '𐑆' => '𐐞',
1063	+ '𐑇' => '𐐟',
1064	+ '𐑈' => '𐐠',
1065	+ '𐑉' => '𐐡',
1066	+ '𐑊' => '𐐢',
1067	+ '𐑋' => '𐐣',
1068	+ '𐑌' => '𐐤',
1069	+ '𐑍' => '𐐥',
1070	+ '𐑎' => '𐐦',
1071	+ '𐑏' => '𐐧',
1072	+ '𑣀' => '𑢠',
1073	+ '𑣁' => '𑢡',
1074	+ '𑣂' => '𑢢',
1075	+ '𑣃' => '𑢣',
1076	+ '𑣄' => '𑢤',
1077	+ '𑣅' => '𑢥',
1078	+ '𑣆' => '𑢦',
1079	+ '𑣇' => '𑢧',
1080	+ '𑣈' => '𑢨',
1081	+ '𑣉' => '𑢩',
1082	+ '𑣊' => '𑢪',
1083	+ '𑣋' => '𑢫',
1084	+ '𑣌' => '𑢬',
1085	+ '𑣍' => '𑢭',
1086	+ '𑣎' => '𑢮',
1087	+ '𑣏' => '𑢯',
1088	+ '𑣐' => '𑢰',
1089	+ '𑣑' => '𑢱',
1090	+ '𑣒' => '𑢲',
1091	+ '𑣓' => '𑢳',
1092	+ '𑣔' => '𑢴',
1093	+ '𑣕' => '𑢵',
1094	+ '𑣖' => '𑢶',
1095	+ '𑣗' => '𑢷',
1096	+ '𑣘' => '𑢸',
1097	+ '𑣙' => '𑢹',
1098	+ '𑣚' => '𑢺',
1099	+ '𑣛' => '𑢻',
1100	+ '𑣜' => '𑢼',
1101	+ '𑣝' => '𑢽',
1102	+ '𑣞' => '𑢾',
1103	+ '𑣟' => '𑢿',
1104	+ );
1105	+
1106	+ $result =& $data;
1107	+ unset($data);
1108	+
1109	+ return $result;

src/common/lib/vendor/symfony/polyfill-mbstring/bootstrap.php ADDED Viewed

	@@ -0,0 +1,56 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ use Symfony\Polyfill\Mbstring as p;
13	+
14	+ if (!function_exists('mb_strlen')) {
15	+ define('MB_CASE_UPPER', 0);
16	+ define('MB_CASE_LOWER', 1);
17	+ define('MB_CASE_TITLE', 2);
18	+
19	+ function mb_convert_encoding($s, $to, $from = null) { return p\Mbstring::mb_convert_encoding($s, $to, $from); }
20	+ function mb_decode_mimeheader($s) { return p\Mbstring::mb_decode_mimeheader($s); }
21	+ function mb_encode_mimeheader($s, $charset = null, $transferEnc = null, $lf = null, $indent = null) { return p\Mbstring::mb_encode_mimeheader($s, $charset, $transferEnc, $lf, $indent); }
22	+ function mb_convert_case($s, $mode, $enc = null) { return p\Mbstring::mb_convert_case($s, $mode, $enc); }
23	+ function mb_internal_encoding($enc = null) { return p\Mbstring::mb_internal_encoding($enc); }
24	+ function mb_language($lang = null) { return p\Mbstring::mb_language($lang); }
25	+ function mb_list_encodings() { return p\Mbstring::mb_list_encodings(); }
26	+ function mb_encoding_aliases($encoding) { return p\Mbstring::mb_encoding_aliases($encoding); }
27	+ function mb_check_encoding($var = null, $encoding = null) { return p\Mbstring::mb_check_encoding($var, $encoding); }
28	+ function mb_detect_encoding($str, $encodingList = null, $strict = false) { return p\Mbstring::mb_detect_encoding($str, $encodingList, $strict); }
29	+ function mb_detect_order($encodingList = null) { return p\Mbstring::mb_detect_order($encodingList); }
30	+ function mb_parse_str($s, &$result = array()) { parse_str($s, $result); }
31	+ function mb_strlen($s, $enc = null) { return p\Mbstring::mb_strlen($s, $enc); }
32	+ function mb_strpos($s, $needle, $offset = 0, $enc = null) { return p\Mbstring::mb_strpos($s, $needle, $offset, $enc); }
33	+ function mb_strtolower($s, $enc = null) { return p\Mbstring::mb_strtolower($s, $enc); }
34	+ function mb_strtoupper($s, $enc = null) { return p\Mbstring::mb_strtoupper($s, $enc); }
35	+ function mb_substitute_character($char = null) { return p\Mbstring::mb_substitute_character($char); }
36	+ function mb_substr($s, $start, $length = 2147483647, $enc = null) { return p\Mbstring::mb_substr($s, $start, $length, $enc); }
37	+ function mb_stripos($s, $needle, $offset = 0, $enc = null) { return p\Mbstring::mb_stripos($s, $needle, $offset, $enc); }
38	+ function mb_stristr($s, $needle, $part = false, $enc = null) { return p\Mbstring::mb_stristr($s, $needle, $part, $enc); }
39	+ function mb_strrchr($s, $needle, $part = false, $enc = null) { return p\Mbstring::mb_strrchr($s, $needle, $part, $enc); }
40	+ function mb_strrichr($s, $needle, $part = false, $enc = null) { return p\Mbstring::mb_strrichr($s, $needle, $part, $enc); }
41	+ function mb_strripos($s, $needle, $offset = 0, $enc = null) { return p\Mbstring::mb_strripos($s, $needle, $offset, $enc); }
42	+ function mb_strrpos($s, $needle, $offset = 0, $enc = null) { return p\Mbstring::mb_strrpos($s, $needle, $offset, $enc); }
43	+ function mb_strstr($s, $needle, $part = false, $enc = null) { return p\Mbstring::mb_strstr($s, $needle, $part, $enc); }
44	+ function mb_get_info($type = 'all') { return p\Mbstring::mb_get_info($type); }
45	+ function mb_http_output($enc = null) { return p\Mbstring::mb_http_output($enc); }
46	+ function mb_strwidth($s, $enc = null) { return p\Mbstring::mb_strwidth($s, $enc); }
47	+ function mb_substr_count($haystack, $needle, $enc = null) { return p\Mbstring::mb_substr_count($haystack, $needle, $enc); }
48	+ function mb_output_handler($contents, $status) { return p\Mbstring::mb_output_handler($contents, $status); }
49	+ function mb_http_input($type = '') { return p\Mbstring::mb_http_input($type); }
50	+ function mb_convert_variables($toEncoding, $fromEncoding, &$a = null, &$b = null, &$c = null, &$d = null, &$e = null, &$f = null) { return p\Mbstring::mb_convert_variables($toEncoding, $fromEncoding, $a, $b, $c, $d, $e, $f); }
51	+ }
52	+ if (!function_exists('mb_chr')) {
53	+ function mb_ord($s, $enc = null) { return p\Mbstring::mb_ord($s, $enc); }
54	+ function mb_chr($code, $enc = null) { return p\Mbstring::mb_chr($code, $enc); }
55	+ function mb_scrub($s, $enc = null) { $enc = null === $enc ? mb_internal_encoding() : $enc; return mb_convert_encoding($s, $enc, $enc); }
56	+ }

src/common/lib/vendor/symfony/translation/CHANGELOG.md ADDED Viewed

	@@ -0,0 +1,94 @@


1	+ CHANGELOG
2	+ =========
3	+
4	+ 3.4.0
5	+ -----
6	+
7	+ * Added `TranslationDumperPass`
8	+ * Added `TranslationExtractorPass`
9	+ * Added `TranslatorPass`
10	+ * Added `TranslationReader` and `TranslationReaderInterface`
11	+ * Added `<notes>` section to the Xliff 2.0 dumper.
12	+ * Improved Xliff 2.0 loader to load `<notes>` section.
13	+ * Added `TranslationWriterInterface`
14	+ * Deprecated `TranslationWriter::writeTranslations` in favor of `TranslationWriter::write`
15	+ * added support for adding custom message formatter and decoupling the default one.
16	+ * Added `PhpExtractor`
17	+ * Added `PhpStringTokenParser`
18	+
19	+ 3.2.0
20	+ -----
21	+
22	+ * Added support for escaping `\|` in plural translations with double pipe.
23	+
24	+ 3.1.0
25	+ -----
26	+
27	+ * Deprecated the backup feature of the file dumper classes.
28	+
29	+ 3.0.0
30	+ -----
31	+
32	+ * removed `FileDumper::format()` method.
33	+ * Changed the visibility of the locale property in `Translator` from protected to private.
34	+
35	+ 2.8.0
36	+ -----
37	+
38	+ * deprecated FileDumper::format(), overwrite FileDumper::formatCatalogue() instead.
39	+ * deprecated Translator::getMessages(), rely on TranslatorBagInterface::getCatalogue() instead.
40	+ * added `FileDumper::formatCatalogue` which allows format the catalogue without dumping it into file.
41	+ * added option `json_encoding` to JsonFileDumper
42	+ * added options `as_tree`, `inline` to YamlFileDumper
43	+ * added support for XLIFF 2.0.
44	+ * added support for XLIFF target and tool attributes.
45	+ * added message parameters to DataCollectorTranslator.
46	+ * [DEPRECATION] The `DiffOperation` class has been deprecated and
47	+ will be removed in Symfony 3.0, since its operation has nothing to do with 'diff',
48	+ so the class name is misleading. The `TargetOperation` class should be used for
49	+ this use-case instead.
50	+
51	+ 2.7.0
52	+ -----
53	+
54	+ * added DataCollectorTranslator for collecting the translated messages.
55	+
56	+ 2.6.0
57	+ -----
58	+
59	+ * added possibility to cache catalogues
60	+ * added TranslatorBagInterface
61	+ * added LoggingTranslator
62	+ * added Translator::getMessages() for retrieving the message catalogue as an array
63	+
64	+ 2.5.0
65	+ -----
66	+
67	+ * added relative file path template to the file dumpers
68	+ * added optional backup to the file dumpers
69	+ * changed IcuResFileDumper to extend FileDumper
70	+
71	+ 2.3.0
72	+ -----
73	+
74	+ * added classes to make operations on catalogues (like making a diff or a merge on 2 catalogues)
75	+ * added Translator::getFallbackLocales()
76	+ * deprecated Translator::setFallbackLocale() in favor of the new Translator::setFallbackLocales() method
77	+
78	+ 2.2.0
79	+ -----
80	+
81	+ * QtTranslationsLoader class renamed to QtFileLoader. QtTranslationsLoader is deprecated and will be removed in 2.3.
82	+ * [BC BREAK] uniformized the exception thrown by the load() method when an error occurs. The load() method now
83	+ throws Symfony\Component\Translation\Exception\NotFoundResourceException when a resource cannot be found
84	+ and Symfony\Component\Translation\Exception\InvalidResourceException when a resource is invalid.
85	+ * changed the exception class thrown by some load() methods from \RuntimeException to \InvalidArgumentException
86	+ (IcuDatFileLoader, IcuResFileLoader and QtFileLoader)
87	+
88	+ 2.1.0
89	+ -----
90	+
91	+ * added support for more than one fallback locale
92	+ * added support for extracting translation messages from templates (Twig and PHP)
93	+ * added dumpers for translation catalogs
94	+ * added support for QT, gettext, and ResourceBundles

src/common/lib/vendor/symfony/translation/Catalogue/AbstractOperation.php ADDED Viewed

	@@ -0,0 +1,158 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Catalogue;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+ use Symfony\Component\Translation\MessageCatalogueInterface;
16	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
17	+ use Symfony\Component\Translation\Exception\LogicException;
18	+
19	+ /**
20	+ * Base catalogues binary operation class.
21	+ *
22	+ * A catalogue binary operation performs operation on
23	+ * source (the left argument) and target (the right argument) catalogues.
24	+ *
25	+ * @author Jean-François Simon <contact@jfsimon.fr>
26	+ */
27	+ abstract class AbstractOperation implements OperationInterface
28	+ {
29	+ protected $source;
30	+ protected $target;
31	+ protected $result;
32	+
33	+ /**
34	+ * @var null\|array The domains affected by this operation
35	+ */
36	+ private $domains;
37	+
38	+ /**
39	+ * This array stores 'all', 'new' and 'obsolete' messages for all valid domains.
40	+ *
41	+ * The data structure of this array is as follows:
42	+ * ```php
43	+ * array(
44	+ * 'domain 1' => array(
45	+ * 'all' => array(...),
46	+ * 'new' => array(...),
47	+ * 'obsolete' => array(...)
48	+ * ),
49	+ * 'domain 2' => array(
50	+ * 'all' => array(...),
51	+ * 'new' => array(...),
52	+ * 'obsolete' => array(...)
53	+ * ),
54	+ * ...
55	+ * )
56	+ * ```
57	+ *
58	+ * @var array The array that stores 'all', 'new' and 'obsolete' messages
59	+ */
60	+ protected $messages;
61	+
62	+ /**
63	+ * @throws LogicException
64	+ */
65	+ public function __construct(MessageCatalogueInterface $source, MessageCatalogueInterface $target)
66	+ {
67	+ if ($source->getLocale() !== $target->getLocale()) {
68	+ throw new LogicException('Operated catalogues must belong to the same locale.');
69	+ }
70	+
71	+ $this->source = $source;
72	+ $this->target = $target;
73	+ $this->result = new MessageCatalogue($source->getLocale());
74	+ $this->messages = array();
75	+ }
76	+
77	+ /**
78	+ * {@inheritdoc}
79	+ */
80	+ public function getDomains()
81	+ {
82	+ if (null === $this->domains) {
83	+ $this->domains = array_values(array_unique(array_merge($this->source->getDomains(), $this->target->getDomains())));
84	+ }
85	+
86	+ return $this->domains;
87	+ }
88	+
89	+ /**
90	+ * {@inheritdoc}
91	+ */
92	+ public function getMessages($domain)
93	+ {
94	+ if (!in_array($domain, $this->getDomains())) {
95	+ throw new InvalidArgumentException(sprintf('Invalid domain: %s.', $domain));
96	+ }
97	+
98	+ if (!isset($this->messages[$domain]['all'])) {
99	+ $this->processDomain($domain);
100	+ }
101	+
102	+ return $this->messages[$domain]['all'];
103	+ }
104	+
105	+ /**
106	+ * {@inheritdoc}
107	+ */
108	+ public function getNewMessages($domain)
109	+ {
110	+ if (!in_array($domain, $this->getDomains())) {
111	+ throw new InvalidArgumentException(sprintf('Invalid domain: %s.', $domain));
112	+ }
113	+
114	+ if (!isset($this->messages[$domain]['new'])) {
115	+ $this->processDomain($domain);
116	+ }
117	+
118	+ return $this->messages[$domain]['new'];
119	+ }
120	+
121	+ /**
122	+ * {@inheritdoc}
123	+ */
124	+ public function getObsoleteMessages($domain)
125	+ {
126	+ if (!in_array($domain, $this->getDomains())) {
127	+ throw new InvalidArgumentException(sprintf('Invalid domain: %s.', $domain));
128	+ }
129	+
130	+ if (!isset($this->messages[$domain]['obsolete'])) {
131	+ $this->processDomain($domain);
132	+ }
133	+
134	+ return $this->messages[$domain]['obsolete'];
135	+ }
136	+
137	+ /**
138	+ * {@inheritdoc}
139	+ */
140	+ public function getResult()
141	+ {
142	+ foreach ($this->getDomains() as $domain) {
143	+ if (!isset($this->messages[$domain])) {
144	+ $this->processDomain($domain);
145	+ }
146	+ }
147	+
148	+ return $this->result;
149	+ }
150	+
151	+ /**
152	+ * Performs operation on source and target catalogues for the given domain and
153	+ * stores the results.
154	+ *
155	+ * @param string $domain The domain which the operation will be performed for
156	+ */
157	+ abstract protected function processDomain($domain);
158	+ }

src/common/lib/vendor/symfony/translation/Catalogue/MergeOperation.php ADDED Viewed

	@@ -0,0 +1,55 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Catalogue;
13	+
14	+ /**
15	+ * Merge operation between two catalogues as follows:
16	+ * all = source ∪ target = {x: x ∈ source ∨ x ∈ target}
17	+ * new = all ∖ source = {x: x ∈ target ∧ x ∉ source}
18	+ * obsolete = source ∖ all = {x: x ∈ source ∧ x ∉ source ∧ x ∉ target} = ∅
19	+ * Basically, the result contains messages from both catalogues.
20	+ *
21	+ * @author Jean-François Simon <contact@jfsimon.fr>
22	+ */
23	+ class MergeOperation extends AbstractOperation
24	+ {
25	+ /**
26	+ * {@inheritdoc}
27	+ */
28	+ protected function processDomain($domain)
29	+ {
30	+ $this->messages[$domain] = array(
31	+ 'all' => array(),
32	+ 'new' => array(),
33	+ 'obsolete' => array(),
34	+ );
35	+
36	+ foreach ($this->source->all($domain) as $id => $message) {
37	+ $this->messages[$domain]['all'][$id] = $message;
38	+ $this->result->add(array($id => $message), $domain);
39	+ if (null !== $keyMetadata = $this->source->getMetadata($id, $domain)) {
40	+ $this->result->setMetadata($id, $keyMetadata, $domain);
41	+ }
42	+ }
43	+
44	+ foreach ($this->target->all($domain) as $id => $message) {
45	+ if (!$this->source->has($id, $domain)) {
46	+ $this->messages[$domain]['all'][$id] = $message;
47	+ $this->messages[$domain]['new'][$id] = $message;
48	+ $this->result->add(array($id => $message), $domain);
49	+ if (null !== $keyMetadata = $this->target->getMetadata($id, $domain)) {
50	+ $this->result->setMetadata($id, $keyMetadata, $domain);
51	+ }
52	+ }
53	+ }
54	+ }
55	+ }

src/common/lib/vendor/symfony/translation/Catalogue/OperationInterface.php ADDED Viewed

	@@ -0,0 +1,77 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Catalogue;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogueInterface;
15	+
16	+ /**
17	+ * Represents an operation on catalogue(s).
18	+ *
19	+ * An instance of this interface performs an operation on one or more catalogues and
20	+ * stores intermediate and final results of the operation.
21	+ *
22	+ * The first catalogue in its argument(s) is called the 'source catalogue' or 'source' and
23	+ * the following results are stored:
24	+ *
25	+ * Messages: also called 'all', are valid messages for the given domain after the operation is performed.
26	+ *
27	+ * New Messages: also called 'new' (new = all ∖ source = {x: x ∈ all ∧ x ∉ source}).
28	+ *
29	+ * Obsolete Messages: also called 'obsolete' (obsolete = source ∖ all = {x: x ∈ source ∧ x ∉ all}).
30	+ *
31	+ * Result: also called 'result', is the resulting catalogue for the given domain that holds the same messages as 'all'.
32	+ *
33	+ * @author Jean-François Simon <jeanfrancois.simon@sensiolabs.com>
34	+ */
35	+ interface OperationInterface
36	+ {
37	+ /**
38	+ * Returns domains affected by operation.
39	+ *
40	+ * @return array
41	+ */
42	+ public function getDomains();
43	+
44	+ /**
45	+ * Returns all valid messages ('all') after operation.
46	+ *
47	+ * @param string $domain
48	+ *
49	+ * @return array
50	+ */
51	+ public function getMessages($domain);
52	+
53	+ /**
54	+ * Returns new messages ('new') after operation.
55	+ *
56	+ * @param string $domain
57	+ *
58	+ * @return array
59	+ */
60	+ public function getNewMessages($domain);
61	+
62	+ /**
63	+ * Returns obsolete messages ('obsolete') after operation.
64	+ *
65	+ * @param string $domain
66	+ *
67	+ * @return array
68	+ */
69	+ public function getObsoleteMessages($domain);
70	+
71	+ /**
72	+ * Returns resulting catalogue ('result').
73	+ *
74	+ * @return MessageCatalogueInterface
75	+ */
76	+ public function getResult();
77	+ }

src/common/lib/vendor/symfony/translation/Catalogue/TargetOperation.php ADDED Viewed

	@@ -0,0 +1,69 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Catalogue;
13	+
14	+ /**
15	+ * Target operation between two catalogues:
16	+ * intersection = source ∩ target = {x: x ∈ source ∧ x ∈ target}
17	+ * all = intersection ∪ (target ∖ intersection) = target
18	+ * new = all ∖ source = {x: x ∈ target ∧ x ∉ source}
19	+ * obsolete = source ∖ all = source ∖ target = {x: x ∈ source ∧ x ∉ target}
20	+ * Basically, the result contains messages from the target catalogue.
21	+ *
22	+ * @author Michael Lee <michael.lee@zerustech.com>
23	+ */
24	+ class TargetOperation extends AbstractOperation
25	+ {
26	+ /**
27	+ * {@inheritdoc}
28	+ */
29	+ protected function processDomain($domain)
30	+ {
31	+ $this->messages[$domain] = array(
32	+ 'all' => array(),
33	+ 'new' => array(),
34	+ 'obsolete' => array(),
35	+ );
36	+
37	+ // For 'all' messages, the code can't be simplified as ``$this->messages[$domain]['all'] = $target->all($domain);``,
38	+ // because doing so will drop messages like {x: x ∈ source ∧ x ∉ target.all ∧ x ∈ target.fallback}
39	+ //
40	+ // For 'new' messages, the code can't be simplied as ``array_diff_assoc($this->target->all($domain), $this->source->all($domain));``
41	+ // because doing so will not exclude messages like {x: x ∈ target ∧ x ∉ source.all ∧ x ∈ source.fallback}
42	+ //
43	+ // For 'obsolete' messages, the code can't be simplifed as ``array_diff_assoc($this->source->all($domain), $this->target->all($domain))``
44	+ // because doing so will not exclude messages like {x: x ∈ source ∧ x ∉ target.all ∧ x ∈ target.fallback}
45	+
46	+ foreach ($this->source->all($domain) as $id => $message) {
47	+ if ($this->target->has($id, $domain)) {
48	+ $this->messages[$domain]['all'][$id] = $message;
49	+ $this->result->add(array($id => $message), $domain);
50	+ if (null !== $keyMetadata = $this->source->getMetadata($id, $domain)) {
51	+ $this->result->setMetadata($id, $keyMetadata, $domain);
52	+ }
53	+ } else {
54	+ $this->messages[$domain]['obsolete'][$id] = $message;
55	+ }
56	+ }
57	+
58	+ foreach ($this->target->all($domain) as $id => $message) {
59	+ if (!$this->source->has($id, $domain)) {
60	+ $this->messages[$domain]['all'][$id] = $message;
61	+ $this->messages[$domain]['new'][$id] = $message;
62	+ $this->result->add(array($id => $message), $domain);
63	+ if (null !== $keyMetadata = $this->target->getMetadata($id, $domain)) {
64	+ $this->result->setMetadata($id, $keyMetadata, $domain);
65	+ }
66	+ }
67	+ }
68	+ }
69	+ }

src/common/lib/vendor/symfony/translation/Command/XliffLintCommand.php ADDED Viewed

	@@ -0,0 +1,245 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Command;
13	+
14	+ use Symfony\Component\Console\Command\Command;
15	+ use Symfony\Component\Console\Input\InputInterface;
16	+ use Symfony\Component\Console\Input\InputOption;
17	+ use Symfony\Component\Console\Output\OutputInterface;
18	+ use Symfony\Component\Console\Style\SymfonyStyle;
19	+
20	+ /**
21	+ * Validates XLIFF files syntax and outputs encountered errors.
22	+ *
23	+ * @author Grégoire Pineau <lyrixx@lyrixx.info>
24	+ * @author Robin Chalas <robin.chalas@gmail.com>
25	+ * @author Javier Eguiluz <javier.eguiluz@gmail.com>
26	+ */
27	+ class XliffLintCommand extends Command
28	+ {
29	+ protected static $defaultName = 'lint:xliff';
30	+
31	+ private $format;
32	+ private $displayCorrectFiles;
33	+ private $directoryIteratorProvider;
34	+ private $isReadableProvider;
35	+
36	+ public function __construct($name = null, $directoryIteratorProvider = null, $isReadableProvider = null)
37	+ {
38	+ parent::__construct($name);
39	+
40	+ $this->directoryIteratorProvider = $directoryIteratorProvider;
41	+ $this->isReadableProvider = $isReadableProvider;
42	+ }
43	+
44	+ /**
45	+ * {@inheritdoc}
46	+ */
47	+ protected function configure()
48	+ {
49	+ $this
50	+ ->setDescription('Lints a XLIFF file and outputs encountered errors')
51	+ ->addArgument('filename', null, 'A file or a directory or STDIN')
52	+ ->addOption('format', null, InputOption::VALUE_REQUIRED, 'The output format', 'txt')
53	+ ->setHelp(<<<EOF
54	+ The <info>%command.name%</info> command lints a XLIFF file and outputs to STDOUT
55	+ the first encountered syntax error.
56	+
57	+ You can validates XLIFF contents passed from STDIN:
58	+
59	+ <info>cat filename \| php %command.full_name%</info>
60	+
61	+ You can also validate the syntax of a file:
62	+
63	+ <info>php %command.full_name% filename</info>
64	+
65	+ Or of a whole directory:
66	+
67	+ <info>php %command.full_name% dirname</info>
68	+ <info>php %command.full_name% dirname --format=json</info>
69	+
70	+ EOF
71	+ )
72	+ ;
73	+ }
74	+
75	+ protected function execute(InputInterface $input, OutputInterface $output)
76	+ {
77	+ $io = new SymfonyStyle($input, $output);
78	+ $filename = $input->getArgument('filename');
79	+ $this->format = $input->getOption('format');
80	+ $this->displayCorrectFiles = $output->isVerbose();
81	+
82	+ if (!$filename) {
83	+ if (!$stdin = $this->getStdin()) {
84	+ throw new \RuntimeException('Please provide a filename or pipe file content to STDIN.');
85	+ }
86	+
87	+ return $this->display($io, array($this->validate($stdin)));
88	+ }
89	+
90	+ if (!$this->isReadable($filename)) {
91	+ throw new \RuntimeException(sprintf('File or directory "%s" is not readable.', $filename));
92	+ }
93	+
94	+ $filesInfo = array();
95	+ foreach ($this->getFiles($filename) as $file) {
96	+ $filesInfo[] = $this->validate(file_get_contents($file), $file);
97	+ }
98	+
99	+ return $this->display($io, $filesInfo);
100	+ }
101	+
102	+ private function validate($content, $file = null)
103	+ {
104	+ // Avoid: Warning DOMDocument::loadXML(): Empty string supplied as input
105	+ if ('' === trim($content)) {
106	+ return array('file' => $file, 'valid' => true);
107	+ }
108	+
109	+ libxml_use_internal_errors(true);
110	+
111	+ $document = new \DOMDocument();
112	+ $document->loadXML($content);
113	+ if ($document->schemaValidate(__DIR__.'/../Resources/schemas/xliff-core-1.2-strict.xsd')) {
114	+ return array('file' => $file, 'valid' => true);
115	+ }
116	+
117	+ $errorMessages = array_map(function ($error) {
118	+ return array(
119	+ 'line' => $error->line,
120	+ 'column' => $error->column,
121	+ 'message' => trim($error->message),
122	+ );
123	+ }, libxml_get_errors());
124	+
125	+ libxml_clear_errors();
126	+ libxml_use_internal_errors(false);
127	+
128	+ return array('file' => $file, 'valid' => false, 'messages' => $errorMessages);
129	+ }
130	+
131	+ private function display(SymfonyStyle $io, array $files)
132	+ {
133	+ switch ($this->format) {
134	+ case 'txt':
135	+ return $this->displayTxt($io, $files);
136	+ case 'json':
137	+ return $this->displayJson($io, $files);
138	+ default:
139	+ throw new \InvalidArgumentException(sprintf('The format "%s" is not supported.', $this->format));
140	+ }
141	+ }
142	+
143	+ private function displayTxt(SymfonyStyle $io, array $filesInfo)
144	+ {
145	+ $countFiles = count($filesInfo);
146	+ $erroredFiles = 0;
147	+
148	+ foreach ($filesInfo as $info) {
149	+ if ($info['valid'] && $this->displayCorrectFiles) {
150	+ $io->comment('<info>OK</info>'.($info['file'] ? sprintf(' in %s', $info['file']) : ''));
151	+ } elseif (!$info['valid']) {
152	+ ++$erroredFiles;
153	+ $io->text('<error> ERROR </error>'.($info['file'] ? sprintf(' in %s', $info['file']) : ''));
154	+ $io->listing(array_map(function ($error) {
155	+ // general document errors have a '-1' line number
156	+ return -1 === $error['line'] ? $error['message'] : sprintf('Line %d, Column %d: %s', $error['line'], $error['column'], $error['message']);
157	+ }, $info['messages']));
158	+ }
159	+ }
160	+
161	+ if (0 === $erroredFiles) {
162	+ $io->success(sprintf('All %d XLIFF files contain valid syntax.', $countFiles));
163	+ } else {
164	+ $io->warning(sprintf('%d XLIFF files have valid syntax and %d contain errors.', $countFiles - $erroredFiles, $erroredFiles));
165	+ }
166	+
167	+ return min($erroredFiles, 1);
168	+ }
169	+
170	+ private function displayJson(SymfonyStyle $io, array $filesInfo)
171	+ {
172	+ $errors = 0;
173	+
174	+ array_walk($filesInfo, function (&$v) use (&$errors) {
175	+ $v['file'] = (string) $v['file'];
176	+ if (!$v['valid']) {
177	+ ++$errors;
178	+ }
179	+ });
180	+
181	+ $io->writeln(json_encode($filesInfo, JSON_PRETTY_PRINT \| JSON_UNESCAPED_SLASHES));
182	+
183	+ return min($errors, 1);
184	+ }
185	+
186	+ private function getFiles($fileOrDirectory)
187	+ {
188	+ if (is_file($fileOrDirectory)) {
189	+ yield new \SplFileInfo($fileOrDirectory);
190	+
191	+ return;
192	+ }
193	+
194	+ foreach ($this->getDirectoryIterator($fileOrDirectory) as $file) {
195	+ if (!in_array($file->getExtension(), array('xlf', 'xliff'))) {
196	+ continue;
197	+ }
198	+
199	+ yield $file;
200	+ }
201	+ }
202	+
203	+ private function getStdin()
204	+ {
205	+ if (0 !== ftell(STDIN)) {
206	+ return;
207	+ }
208	+
209	+ $inputs = '';
210	+ while (!feof(STDIN)) {
211	+ $inputs .= fread(STDIN, 1024);
212	+ }
213	+
214	+ return $inputs;
215	+ }
216	+
217	+ private function getDirectoryIterator($directory)
218	+ {
219	+ $default = function ($directory) {
220	+ return new \RecursiveIteratorIterator(
221	+ new \RecursiveDirectoryIterator($directory, \FilesystemIterator::SKIP_DOTS \| \FilesystemIterator::FOLLOW_SYMLINKS),
222	+ \RecursiveIteratorIterator::LEAVES_ONLY
223	+ );
224	+ };
225	+
226	+ if (null !== $this->directoryIteratorProvider) {
227	+ return call_user_func($this->directoryIteratorProvider, $directory, $default);
228	+ }
229	+
230	+ return $default($directory);
231	+ }
232	+
233	+ private function isReadable($fileOrDirectory)
234	+ {
235	+ $default = function ($fileOrDirectory) {
236	+ return is_readable($fileOrDirectory);
237	+ };
238	+
239	+ if (null !== $this->isReadableProvider) {
240	+ return call_user_func($this->isReadableProvider, $fileOrDirectory, $default);
241	+ }
242	+
243	+ return $default($fileOrDirectory);
244	+ }
245	+ }

src/common/lib/vendor/symfony/translation/DataCollector/TranslationDataCollector.php ADDED Viewed

	@@ -0,0 +1,167 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\DataCollector;
13	+
14	+ use Symfony\Component\HttpFoundation\Request;
15	+ use Symfony\Component\HttpFoundation\Response;
16	+ use Symfony\Component\HttpKernel\DataCollector\DataCollector;
17	+ use Symfony\Component\HttpKernel\DataCollector\LateDataCollectorInterface;
18	+ use Symfony\Component\Translation\DataCollectorTranslator;
19	+
20	+ /**
21	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
22	+ */
23	+ class TranslationDataCollector extends DataCollector implements LateDataCollectorInterface
24	+ {
25	+ private $translator;
26	+
27	+ public function __construct(DataCollectorTranslator $translator)
28	+ {
29	+ $this->translator = $translator;
30	+ }
31	+
32	+ /**
33	+ * {@inheritdoc}
34	+ */
35	+ public function lateCollect()
36	+ {
37	+ $messages = $this->sanitizeCollectedMessages($this->translator->getCollectedMessages());
38	+
39	+ $this->data = $this->computeCount($messages);
40	+ $this->data['messages'] = $messages;
41	+
42	+ $this->data['locale'] = $this->translator->getLocale();
43	+ $this->data['fallback_locales'] = $this->translator->getFallbackLocales();
44	+
45	+ $this->data = $this->cloneVar($this->data);
46	+ }
47	+
48	+ /**
49	+ * {@inheritdoc}
50	+ */
51	+ public function collect(Request $request, Response $response, \Exception $exception = null)
52	+ {
53	+ }
54	+
55	+ /**
56	+ * {@inheritdoc}
57	+ */
58	+ public function reset()
59	+ {
60	+ $this->data = array();
61	+ }
62	+
63	+ /**
64	+ * @return array
65	+ */
66	+ public function getMessages()
67	+ {
68	+ return isset($this->data['messages']) ? $this->data['messages'] : array();
69	+ }
70	+
71	+ /**
72	+ * @return int
73	+ */
74	+ public function getCountMissings()
75	+ {
76	+ return isset($this->data[DataCollectorTranslator::MESSAGE_MISSING]) ? $this->data[DataCollectorTranslator::MESSAGE_MISSING] : 0;
77	+ }
78	+
79	+ /**
80	+ * @return int
81	+ */
82	+ public function getCountFallbacks()
83	+ {
84	+ return isset($this->data[DataCollectorTranslator::MESSAGE_EQUALS_FALLBACK]) ? $this->data[DataCollectorTranslator::MESSAGE_EQUALS_FALLBACK] : 0;
85	+ }
86	+
87	+ /**
88	+ * @return int
89	+ */
90	+ public function getCountDefines()
91	+ {
92	+ return isset($this->data[DataCollectorTranslator::MESSAGE_DEFINED]) ? $this->data[DataCollectorTranslator::MESSAGE_DEFINED] : 0;
93	+ }
94	+
95	+ public function getLocale()
96	+ {
97	+ return !empty($this->data['locale']) ? $this->data['locale'] : null;
98	+ }
99	+
100	+ public function getFallbackLocales()
101	+ {
102	+ return (isset($this->data['fallback_locales']) && count($this->data['fallback_locales']) > 0) ? $this->data['fallback_locales'] : array();
103	+ }
104	+
105	+ /**
106	+ * {@inheritdoc}
107	+ */
108	+ public function getName()
109	+ {
110	+ return 'translation';
111	+ }
112	+
113	+ private function sanitizeCollectedMessages($messages)
114	+ {
115	+ $result = array();
116	+ foreach ($messages as $key => $message) {
117	+ $messageId = $message['locale'].$message['domain'].$message['id'];
118	+
119	+ if (!isset($result[$messageId])) {
120	+ $message['count'] = 1;
121	+ $message['parameters'] = !empty($message['parameters']) ? array($message['parameters']) : array();
122	+ $messages[$key]['translation'] = $this->sanitizeString($message['translation']);
123	+ $result[$messageId] = $message;
124	+ } else {
125	+ if (!empty($message['parameters'])) {
126	+ $result[$messageId]['parameters'][] = $message['parameters'];
127	+ }
128	+
129	+ ++$result[$messageId]['count'];
130	+ }
131	+
132	+ unset($messages[$key]);
133	+ }
134	+
135	+ return $result;
136	+ }
137	+
138	+ private function computeCount($messages)
139	+ {
140	+ $count = array(
141	+ DataCollectorTranslator::MESSAGE_DEFINED => 0,
142	+ DataCollectorTranslator::MESSAGE_MISSING => 0,
143	+ DataCollectorTranslator::MESSAGE_EQUALS_FALLBACK => 0,
144	+ );
145	+
146	+ foreach ($messages as $message) {
147	+ ++$count[$message['state']];
148	+ }
149	+
150	+ return $count;
151	+ }
152	+
153	+ private function sanitizeString($string, $length = 80)
154	+ {
155	+ $string = trim(preg_replace('/\s+/', ' ', $string));
156	+
157	+ if (false !== $encoding = mb_detect_encoding($string, null, true)) {
158	+ if (mb_strlen($string, $encoding) > $length) {
159	+ return mb_substr($string, 0, $length - 3, $encoding).'...';
160	+ }
161	+ } elseif (strlen($string) > $length) {
162	+ return substr($string, 0, $length - 3).'...';
163	+ }
164	+
165	+ return $string;
166	+ }
167	+ }

src/common/lib/vendor/symfony/translation/DataCollectorTranslator.php ADDED Viewed

	@@ -0,0 +1,165 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
15	+
16	+ /**
17	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
18	+ */
19	+ class DataCollectorTranslator implements TranslatorInterface, TranslatorBagInterface
20	+ {
21	+ const MESSAGE_DEFINED = 0;
22	+ const MESSAGE_MISSING = 1;
23	+ const MESSAGE_EQUALS_FALLBACK = 2;
24	+
25	+ /**
26	+ * @var TranslatorInterface\|TranslatorBagInterface
27	+ */
28	+ private $translator;
29	+
30	+ private $messages = array();
31	+
32	+ /**
33	+ * @param TranslatorInterface $translator The translator must implement TranslatorBagInterface
34	+ */
35	+ public function __construct(TranslatorInterface $translator)
36	+ {
37	+ if (!$translator instanceof TranslatorBagInterface) {
38	+ throw new InvalidArgumentException(sprintf('The Translator "%s" must implement TranslatorInterface and TranslatorBagInterface.', get_class($translator)));
39	+ }
40	+
41	+ $this->translator = $translator;
42	+ }
43	+
44	+ /**
45	+ * {@inheritdoc}
46	+ */
47	+ public function trans($id, array $parameters = array(), $domain = null, $locale = null)
48	+ {
49	+ $trans = $this->translator->trans($id, $parameters, $domain, $locale);
50	+ $this->collectMessage($locale, $domain, $id, $trans, $parameters);
51	+
52	+ return $trans;
53	+ }
54	+
55	+ /**
56	+ * {@inheritdoc}
57	+ */
58	+ public function transChoice($id, $number, array $parameters = array(), $domain = null, $locale = null)
59	+ {
60	+ $trans = $this->translator->transChoice($id, $number, $parameters, $domain, $locale);
61	+ $this->collectMessage($locale, $domain, $id, $trans, $parameters, $number);
62	+
63	+ return $trans;
64	+ }
65	+
66	+ /**
67	+ * {@inheritdoc}
68	+ */
69	+ public function setLocale($locale)
70	+ {
71	+ $this->translator->setLocale($locale);
72	+ }
73	+
74	+ /**
75	+ * {@inheritdoc}
76	+ */
77	+ public function getLocale()
78	+ {
79	+ return $this->translator->getLocale();
80	+ }
81	+
82	+ /**
83	+ * {@inheritdoc}
84	+ */
85	+ public function getCatalogue($locale = null)
86	+ {
87	+ return $this->translator->getCatalogue($locale);
88	+ }
89	+
90	+ /**
91	+ * Gets the fallback locales.
92	+ *
93	+ * @return array $locales The fallback locales
94	+ */
95	+ public function getFallbackLocales()
96	+ {
97	+ if ($this->translator instanceof Translator \|\| method_exists($this->translator, 'getFallbackLocales')) {
98	+ return $this->translator->getFallbackLocales();
99	+ }
100	+
101	+ return array();
102	+ }
103	+
104	+ /**
105	+ * Passes through all unknown calls onto the translator object.
106	+ */
107	+ public function __call($method, $args)
108	+ {
109	+ return call_user_func_array(array($this->translator, $method), $args);
110	+ }
111	+
112	+ /**
113	+ * @return array
114	+ */
115	+ public function getCollectedMessages()
116	+ {
117	+ return $this->messages;
118	+ }
119	+
120	+ /**
121	+ * @param string\|null $locale
122	+ * @param string\|null $domain
123	+ * @param string $id
124	+ * @param string $translation
125	+ * @param array\|null $parameters
126	+ * @param int\|null $number
127	+ */
128	+ private function collectMessage($locale, $domain, $id, $translation, $parameters = array(), $number = null)
129	+ {
130	+ if (null === $domain) {
131	+ $domain = 'messages';
132	+ }
133	+
134	+ $id = (string) $id;
135	+ $catalogue = $this->translator->getCatalogue($locale);
136	+ $locale = $catalogue->getLocale();
137	+ if ($catalogue->defines($id, $domain)) {
138	+ $state = self::MESSAGE_DEFINED;
139	+ } elseif ($catalogue->has($id, $domain)) {
140	+ $state = self::MESSAGE_EQUALS_FALLBACK;
141	+
142	+ $fallbackCatalogue = $catalogue->getFallbackCatalogue();
143	+ while ($fallbackCatalogue) {
144	+ if ($fallbackCatalogue->defines($id, $domain)) {
145	+ $locale = $fallbackCatalogue->getLocale();
146	+ break;
147	+ }
148	+
149	+ $fallbackCatalogue = $fallbackCatalogue->getFallbackCatalogue();
150	+ }
151	+ } else {
152	+ $state = self::MESSAGE_MISSING;
153	+ }
154	+
155	+ $this->messages[] = array(
156	+ 'locale' => $locale,
157	+ 'domain' => $domain,
158	+ 'id' => $id,
159	+ 'translation' => $translation,
160	+ 'parameters' => $parameters,
161	+ 'transChoiceNumber' => $number,
162	+ 'state' => $state,
163	+ );
164	+ }
165	+ }

src/common/lib/vendor/symfony/translation/DependencyInjection/TranslationDumperPass.php ADDED Viewed

	@@ -0,0 +1,44 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\DependencyInjection;
13	+
14	+ use Symfony\Component\DependencyInjection\Reference;
15	+ use Symfony\Component\DependencyInjection\ContainerBuilder;
16	+ use Symfony\Component\DependencyInjection\Compiler\CompilerPassInterface;
17	+
18	+ /**
19	+ * Adds tagged translation.formatter services to translation writer.
20	+ */
21	+ class TranslationDumperPass implements CompilerPassInterface
22	+ {
23	+ private $writerServiceId;
24	+ private $dumperTag;
25	+
26	+ public function __construct($writerServiceId = 'translation.writer', $dumperTag = 'translation.dumper')
27	+ {
28	+ $this->writerServiceId = $writerServiceId;
29	+ $this->dumperTag = $dumperTag;
30	+ }
31	+
32	+ public function process(ContainerBuilder $container)
33	+ {
34	+ if (!$container->hasDefinition($this->writerServiceId)) {
35	+ return;
36	+ }
37	+
38	+ $definition = $container->getDefinition($this->writerServiceId);
39	+
40	+ foreach ($container->findTaggedServiceIds($this->dumperTag, true) as $id => $attributes) {
41	+ $definition->addMethodCall('addDumper', array($attributes[0]['alias'], new Reference($id)));
42	+ }
43	+ }
44	+ }

src/common/lib/vendor/symfony/translation/DependencyInjection/TranslationExtractorPass.php ADDED Viewed

	@@ -0,0 +1,49 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\DependencyInjection;
13	+
14	+ use Symfony\Component\DependencyInjection\Reference;
15	+ use Symfony\Component\DependencyInjection\ContainerBuilder;
16	+ use Symfony\Component\DependencyInjection\Compiler\CompilerPassInterface;
17	+ use Symfony\Component\DependencyInjection\Exception\RuntimeException;
18	+
19	+ /**
20	+ * Adds tagged translation.extractor services to translation extractor.
21	+ */
22	+ class TranslationExtractorPass implements CompilerPassInterface
23	+ {
24	+ private $extractorServiceId;
25	+ private $extractorTag;
26	+
27	+ public function __construct($extractorServiceId = 'translation.extractor', $extractorTag = 'translation.extractor')
28	+ {
29	+ $this->extractorServiceId = $extractorServiceId;
30	+ $this->extractorTag = $extractorTag;
31	+ }
32	+
33	+ public function process(ContainerBuilder $container)
34	+ {
35	+ if (!$container->hasDefinition($this->extractorServiceId)) {
36	+ return;
37	+ }
38	+
39	+ $definition = $container->getDefinition($this->extractorServiceId);
40	+
41	+ foreach ($container->findTaggedServiceIds($this->extractorTag, true) as $id => $attributes) {
42	+ if (!isset($attributes[0]['alias'])) {
43	+ throw new RuntimeException(sprintf('The alias for the tag "translation.extractor" of service "%s" must be set.', $id));
44	+ }
45	+
46	+ $definition->addMethodCall('addExtractor', array($attributes[0]['alias'], new Reference($id)));
47	+ }
48	+ }
49	+ }

src/common/lib/vendor/symfony/translation/DependencyInjection/TranslatorPass.php ADDED Viewed

	@@ -0,0 +1,95 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\DependencyInjection;
13	+
14	+ use Symfony\Component\DependencyInjection\Reference;
15	+ use Symfony\Component\DependencyInjection\ContainerBuilder;
16	+ use Symfony\Component\DependencyInjection\Compiler\CompilerPassInterface;
17	+ use Symfony\Component\DependencyInjection\Compiler\ServiceLocatorTagPass;
18	+
19	+ class TranslatorPass implements CompilerPassInterface
20	+ {
21	+ private $translatorServiceId;
22	+ private $readerServiceId;
23	+ private $loaderTag;
24	+ private $debugCommandServiceId;
25	+ private $updateCommandServiceId;
26	+
27	+ public function __construct($translatorServiceId = 'translator.default', $readerServiceId = 'translation.loader', $loaderTag = 'translation.loader', $debugCommandServiceId = 'console.command.translation_debug', $updateCommandServiceId = 'console.command.translation_update')
28	+ {
29	+ if ('translation.loader' === $readerServiceId && 2 > func_num_args()) {
30	+ @trigger_error('The default value for $readerServiceId will change in 4.0 to "translation.reader".', E_USER_DEPRECATED);
31	+ }
32	+
33	+ $this->translatorServiceId = $translatorServiceId;
34	+ $this->readerServiceId = $readerServiceId;
35	+ $this->loaderTag = $loaderTag;
36	+ $this->debugCommandServiceId = $debugCommandServiceId;
37	+ $this->updateCommandServiceId = $updateCommandServiceId;
38	+ }
39	+
40	+ public function process(ContainerBuilder $container)
41	+ {
42	+ if (!$container->hasDefinition($this->translatorServiceId)) {
43	+ return;
44	+ }
45	+
46	+ $loaders = array();
47	+ $loaderRefs = array();
48	+ foreach ($container->findTaggedServiceIds($this->loaderTag, true) as $id => $attributes) {
49	+ $loaderRefs[$id] = new Reference($id);
50	+ $loaders[$id][] = $attributes[0]['alias'];
51	+ if (isset($attributes[0]['legacy-alias'])) {
52	+ $loaders[$id][] = $attributes[0]['legacy-alias'];
53	+ }
54	+ }
55	+
56	+ if ($container->hasDefinition($this->readerServiceId)) {
57	+ $definition = $container->getDefinition($this->readerServiceId);
58	+ foreach ($loaders as $id => $formats) {
59	+ foreach ($formats as $format) {
60	+ $definition->addMethodCall('addLoader', array($format, $loaderRefs[$id]));
61	+ }
62	+ }
63	+ }
64	+
65	+ // Duplicated code to support "translation.reader", to be removed in 4.0
66	+ if ('translation.reader' !== $this->readerServiceId) {
67	+ if ($container->hasDefinition('translation.reader')) {
68	+ $definition = $container->getDefinition('translation.reader');
69	+ foreach ($loaders as $id => $formats) {
70	+ foreach ($formats as $format) {
71	+ $definition->addMethodCall('addLoader', array($format, $loaderRefs[$id]));
72	+ }
73	+ }
74	+ }
75	+ }
76	+
77	+ $container
78	+ ->findDefinition($this->translatorServiceId)
79	+ ->replaceArgument(0, ServiceLocatorTagPass::register($container, $loaderRefs))
80	+ ->replaceArgument(3, $loaders)
81	+ ;
82	+
83	+ if (!$container->hasParameter('twig.default_path')) {
84	+ return;
85	+ }
86	+
87	+ if ($container->hasDefinition($this->debugCommandServiceId)) {
88	+ $container->getDefinition($this->debugCommandServiceId)->replaceArgument(4, $container->getParameter('twig.default_path'));
89	+ }
90	+
91	+ if ($container->hasDefinition($this->updateCommandServiceId)) {
92	+ $container->getDefinition($this->updateCommandServiceId)->replaceArgument(5, $container->getParameter('twig.default_path'));
93	+ }
94	+ }
95	+ }

src/common/lib/vendor/symfony/translation/Dumper/CsvFileDumper.php ADDED Viewed

	@@ -0,0 +1,63 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * CsvFileDumper generates a csv formatted string representation of a message catalogue.
18	+ *
19	+ * @author Stealth35
20	+ */
21	+ class CsvFileDumper extends FileDumper
22	+ {
23	+ private $delimiter = ';';
24	+ private $enclosure = '"';
25	+
26	+ /**
27	+ * {@inheritdoc}
28	+ */
29	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
30	+ {
31	+ $handle = fopen('php://memory', 'rb+');
32	+
33	+ foreach ($messages->all($domain) as $source => $target) {
34	+ fputcsv($handle, array($source, $target), $this->delimiter, $this->enclosure);
35	+ }
36	+
37	+ rewind($handle);
38	+ $output = stream_get_contents($handle);
39	+ fclose($handle);
40	+
41	+ return $output;
42	+ }
43	+
44	+ /**
45	+ * Sets the delimiter and escape character for CSV.
46	+ *
47	+ * @param string $delimiter Delimiter character
48	+ * @param string $enclosure Enclosure character
49	+ */
50	+ public function setCsvControl($delimiter = ';', $enclosure = '"')
51	+ {
52	+ $this->delimiter = $delimiter;
53	+ $this->enclosure = $enclosure;
54	+ }
55	+
56	+ /**
57	+ * {@inheritdoc}
58	+ */
59	+ protected function getExtension()
60	+ {
61	+ return 'csv';
62	+ }
63	+ }

src/common/lib/vendor/symfony/translation/Dumper/DumperInterface.php ADDED Viewed

	@@ -0,0 +1,31 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * DumperInterface is the interface implemented by all translation dumpers.
18	+ * There is no common option.
19	+ *
20	+ * @author Michel Salib <michelsalib@hotmail.com>
21	+ */
22	+ interface DumperInterface
23	+ {
24	+ /**
25	+ * Dumps the message catalogue.
26	+ *
27	+ * @param MessageCatalogue $messages The message catalogue
28	+ * @param array $options Options that are used by the dumper
29	+ */
30	+ public function dump(MessageCatalogue $messages, $options = array());
31	+ }

src/common/lib/vendor/symfony/translation/Dumper/FileDumper.php ADDED Viewed

	@@ -0,0 +1,126 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
16	+ use Symfony\Component\Translation\Exception\RuntimeException;
17	+
18	+ /**
19	+ * FileDumper is an implementation of DumperInterface that dump a message catalogue to file(s).
20	+ * Performs backup of already existing files.
21	+ *
22	+ * Options:
23	+ * - path (mandatory): the directory where the files should be saved
24	+ *
25	+ * @author Michel Salib <michelsalib@hotmail.com>
26	+ */
27	+ abstract class FileDumper implements DumperInterface
28	+ {
29	+ /**
30	+ * A template for the relative paths to files.
31	+ *
32	+ * @var string
33	+ */
34	+ protected $relativePathTemplate = '%domain%.%locale%.%extension%';
35	+
36	+ /**
37	+ * Make file backup before the dump.
38	+ *
39	+ * @var bool
40	+ */
41	+ private $backup = true;
42	+
43	+ /**
44	+ * Sets the template for the relative paths to files.
45	+ *
46	+ * @param string $relativePathTemplate A template for the relative paths to files
47	+ */
48	+ public function setRelativePathTemplate($relativePathTemplate)
49	+ {
50	+ $this->relativePathTemplate = $relativePathTemplate;
51	+ }
52	+
53	+ /**
54	+ * Sets backup flag.
55	+ *
56	+ * @param bool
57	+ */
58	+ public function setBackup($backup)
59	+ {
60	+ $this->backup = $backup;
61	+ }
62	+
63	+ /**
64	+ * {@inheritdoc}
65	+ */
66	+ public function dump(MessageCatalogue $messages, $options = array())
67	+ {
68	+ if (!array_key_exists('path', $options)) {
69	+ throw new InvalidArgumentException('The file dumper needs a path option.');
70	+ }
71	+
72	+ // save a file for each domain
73	+ foreach ($messages->getDomains() as $domain) {
74	+ // backup
75	+ $fullpath = $options['path'].'/'.$this->getRelativePath($domain, $messages->getLocale());
76	+ if (file_exists($fullpath)) {
77	+ if ($this->backup) {
78	+ @trigger_error('Creating a backup while dumping a message catalogue is deprecated since version 3.1 and will be removed in 4.0. Use TranslationWriter::disableBackup() to disable the backup.', E_USER_DEPRECATED);
79	+ copy($fullpath, $fullpath.'~');
80	+ }
81	+ } else {
82	+ $directory = dirname($fullpath);
83	+ if (!file_exists($directory) && !@mkdir($directory, 0777, true)) {
84	+ throw new RuntimeException(sprintf('Unable to create directory "%s".', $directory));
85	+ }
86	+ }
87	+ // save file
88	+ file_put_contents($fullpath, $this->formatCatalogue($messages, $domain, $options));
89	+ }
90	+ }
91	+
92	+ /**
93	+ * Transforms a domain of a message catalogue to its string representation.
94	+ *
95	+ * @param MessageCatalogue $messages
96	+ * @param string $domain
97	+ * @param array $options
98	+ *
99	+ * @return string representation
100	+ */
101	+ abstract public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array());
102	+
103	+ /**
104	+ * Gets the file extension of the dumper.
105	+ *
106	+ * @return string file extension
107	+ */
108	+ abstract protected function getExtension();
109	+
110	+ /**
111	+ * Gets the relative file path using the template.
112	+ *
113	+ * @param string $domain The domain
114	+ * @param string $locale The locale
115	+ *
116	+ * @return string The relative file path
117	+ */
118	+ private function getRelativePath($domain, $locale)
119	+ {
120	+ return strtr($this->relativePathTemplate, array(
121	+ '%domain%' => $domain,
122	+ '%locale%' => $locale,
123	+ '%extension%' => $this->getExtension(),
124	+ ));
125	+ }
126	+ }

src/common/lib/vendor/symfony/translation/Dumper/IcuResFileDumper.php ADDED Viewed

	@@ -0,0 +1,106 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * IcuResDumper generates an ICU ResourceBundle formatted string representation of a message catalogue.
18	+ *
19	+ * @author Stealth35
20	+ */
21	+ class IcuResFileDumper extends FileDumper
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ protected $relativePathTemplate = '%domain%/%locale%.%extension%';
27	+
28	+ /**
29	+ * {@inheritdoc}
30	+ */
31	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
32	+ {
33	+ $data = $indexes = $resources = '';
34	+
35	+ foreach ($messages->all($domain) as $source => $target) {
36	+ $indexes .= pack('v', strlen($data) + 28);
37	+ $data .= $source."\0";
38	+ }
39	+
40	+ $data .= $this->writePadding($data);
41	+
42	+ $keyTop = $this->getPosition($data);
43	+
44	+ foreach ($messages->all($domain) as $source => $target) {
45	+ $resources .= pack('V', $this->getPosition($data));
46	+
47	+ $data .= pack('V', strlen($target))
48	+ .mb_convert_encoding($target."\0", 'UTF-16LE', 'UTF-8')
49	+ .$this->writePadding($data)
50	+ ;
51	+ }
52	+
53	+ $resOffset = $this->getPosition($data);
54	+
55	+ $data .= pack('v', count($messages->all($domain)))
56	+ .$indexes
57	+ .$this->writePadding($data)
58	+ .$resources
59	+ ;
60	+
61	+ $bundleTop = $this->getPosition($data);
62	+
63	+ $root = pack('V7',
64	+ $resOffset + (2 << 28), // Resource Offset + Resource Type
65	+ 6, // Index length
66	+ $keyTop, // Index keys top
67	+ $bundleTop, // Index resources top
68	+ $bundleTop, // Index bundle top
69	+ count($messages->all($domain)), // Index max table length
70	+ 0 // Index attributes
71	+ );
72	+
73	+ $header = pack('vC2v4C12@32',
74	+ 32, // Header size
75	+ 0xDA, 0x27, // Magic number 1 and 2
76	+ 20, 0, 0, 2, // Rest of the header, ..., Size of a char
77	+ 0x52, 0x65, 0x73, 0x42, // Data format identifier
78	+ 1, 2, 0, 0, // Data version
79	+ 1, 4, 0, 0 // Unicode version
80	+ );
81	+
82	+ return $header.$root.$data;
83	+ }
84	+
85	+ private function writePadding($data)
86	+ {
87	+ $padding = strlen($data) % 4;
88	+
89	+ if ($padding) {
90	+ return str_repeat("\xAA", 4 - $padding);
91	+ }
92	+ }
93	+
94	+ private function getPosition($data)
95	+ {
96	+ return (strlen($data) + 28) / 4;
97	+ }
98	+
99	+ /**
100	+ * {@inheritdoc}
101	+ */
102	+ protected function getExtension()
103	+ {
104	+ return 'res';
105	+ }
106	+ }

src/common/lib/vendor/symfony/translation/Dumper/IniFileDumper.php ADDED Viewed

	@@ -0,0 +1,45 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * IniFileDumper generates an ini formatted string representation of a message catalogue.
18	+ *
19	+ * @author Stealth35
20	+ */
21	+ class IniFileDumper extends FileDumper
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
27	+ {
28	+ $output = '';
29	+
30	+ foreach ($messages->all($domain) as $source => $target) {
31	+ $escapeTarget = str_replace('"', '\"', $target);
32	+ $output .= $source.'="'.$escapeTarget."\"\n";
33	+ }
34	+
35	+ return $output;
36	+ }
37	+
38	+ /**
39	+ * {@inheritdoc}
40	+ */
41	+ protected function getExtension()
42	+ {
43	+ return 'ini';
44	+ }
45	+ }

src/common/lib/vendor/symfony/translation/Dumper/JsonFileDumper.php ADDED Viewed

	@@ -0,0 +1,44 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * JsonFileDumper generates an json formatted string representation of a message catalogue.
18	+ *
19	+ * @author singles
20	+ */
21	+ class JsonFileDumper extends FileDumper
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
27	+ {
28	+ if (isset($options['json_encoding'])) {
29	+ $flags = $options['json_encoding'];
30	+ } else {
31	+ $flags = defined('JSON_PRETTY_PRINT') ? JSON_PRETTY_PRINT : 0;
32	+ }
33	+
34	+ return json_encode($messages->all($domain), $flags);
35	+ }
36	+
37	+ /**
38	+ * {@inheritdoc}
39	+ */
40	+ protected function getExtension()
41	+ {
42	+ return 'json';
43	+ }
44	+ }

src/common/lib/vendor/symfony/translation/Dumper/MoFileDumper.php ADDED Viewed

	@@ -0,0 +1,82 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+ use Symfony\Component\Translation\Loader\MoFileLoader;
16	+
17	+ /**
18	+ * MoFileDumper generates a gettext formatted string representation of a message catalogue.
19	+ *
20	+ * @author Stealth35
21	+ */
22	+ class MoFileDumper extends FileDumper
23	+ {
24	+ /**
25	+ * {@inheritdoc}
26	+ */
27	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
28	+ {
29	+ $sources = $targets = $sourceOffsets = $targetOffsets = '';
30	+ $offsets = array();
31	+ $size = 0;
32	+
33	+ foreach ($messages->all($domain) as $source => $target) {
34	+ $offsets[] = array_map('strlen', array($sources, $source, $targets, $target));
35	+ $sources .= "\0".$source;
36	+ $targets .= "\0".$target;
37	+ ++$size;
38	+ }
39	+
40	+ $header = array(
41	+ 'magicNumber' => MoFileLoader::MO_LITTLE_ENDIAN_MAGIC,
42	+ 'formatRevision' => 0,
43	+ 'count' => $size,
44	+ 'offsetId' => MoFileLoader::MO_HEADER_SIZE,
45	+ 'offsetTranslated' => MoFileLoader::MO_HEADER_SIZE + (8 * $size),
46	+ 'sizeHashes' => 0,
47	+ 'offsetHashes' => MoFileLoader::MO_HEADER_SIZE + (16 * $size),
48	+ );
49	+
50	+ $sourcesSize = strlen($sources);
51	+ $sourcesStart = $header['offsetHashes'] + 1;
52	+
53	+ foreach ($offsets as $offset) {
54	+ $sourceOffsets .= $this->writeLong($offset[1])
55	+ .$this->writeLong($offset[0] + $sourcesStart);
56	+ $targetOffsets .= $this->writeLong($offset[3])
57	+ .$this->writeLong($offset[2] + $sourcesStart + $sourcesSize);
58	+ }
59	+
60	+ $output = implode(array_map(array($this, 'writeLong'), $header))
61	+ .$sourceOffsets
62	+ .$targetOffsets
63	+ .$sources
64	+ .$targets
65	+ ;
66	+
67	+ return $output;
68	+ }
69	+
70	+ /**
71	+ * {@inheritdoc}
72	+ */
73	+ protected function getExtension()
74	+ {
75	+ return 'mo';
76	+ }
77	+
78	+ private function writeLong($str)
79	+ {
80	+ return pack('V*', $str);
81	+ }
82	+ }

src/common/lib/vendor/symfony/translation/Dumper/PhpFileDumper.php ADDED Viewed

	@@ -0,0 +1,38 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * PhpFileDumper generates PHP files from a message catalogue.
18	+ *
19	+ * @author Michel Salib <michelsalib@hotmail.com>
20	+ */
21	+ class PhpFileDumper extends FileDumper
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
27	+ {
28	+ return "<?php\n\nreturn ".var_export($messages->all($domain), true).";\n";
29	+ }
30	+
31	+ /**
32	+ * {@inheritdoc}
33	+ */
34	+ protected function getExtension()
35	+ {
36	+ return 'php';
37	+ }
38	+ }

src/common/lib/vendor/symfony/translation/Dumper/PoFileDumper.php ADDED Viewed

	@@ -0,0 +1,61 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * PoFileDumper generates a gettext formatted string representation of a message catalogue.
18	+ *
19	+ * @author Stealth35
20	+ */
21	+ class PoFileDumper extends FileDumper
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
27	+ {
28	+ $output = 'msgid ""'."\n";
29	+ $output .= 'msgstr ""'."\n";
30	+ $output .= '"Content-Type: text/plain; charset=UTF-8\n"'."\n";
31	+ $output .= '"Content-Transfer-Encoding: 8bit\n"'."\n";
32	+ $output .= '"Language: '.$messages->getLocale().'\n"'."\n";
33	+ $output .= "\n";
34	+
35	+ $newLine = false;
36	+ foreach ($messages->all($domain) as $source => $target) {
37	+ if ($newLine) {
38	+ $output .= "\n";
39	+ } else {
40	+ $newLine = true;
41	+ }
42	+ $output .= sprintf('msgid "%s"'."\n", $this->escape($source));
43	+ $output .= sprintf('msgstr "%s"', $this->escape($target));
44	+ }
45	+
46	+ return $output;
47	+ }
48	+
49	+ /**
50	+ * {@inheritdoc}
51	+ */
52	+ protected function getExtension()
53	+ {
54	+ return 'po';
55	+ }
56	+
57	+ private function escape($str)
58	+ {
59	+ return addcslashes($str, "\0..\37\42\134");
60	+ }
61	+ }

src/common/lib/vendor/symfony/translation/Dumper/QtFileDumper.php ADDED Viewed

	@@ -0,0 +1,50 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * QtFileDumper generates ts files from a message catalogue.
18	+ *
19	+ * @author Benjamin Eberlei <kontakt@beberlei.de>
20	+ */
21	+ class QtFileDumper extends FileDumper
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
27	+ {
28	+ $dom = new \DOMDocument('1.0', 'utf-8');
29	+ $dom->formatOutput = true;
30	+ $ts = $dom->appendChild($dom->createElement('TS'));
31	+ $context = $ts->appendChild($dom->createElement('context'));
32	+ $context->appendChild($dom->createElement('name', $domain));
33	+
34	+ foreach ($messages->all($domain) as $source => $target) {
35	+ $message = $context->appendChild($dom->createElement('message'));
36	+ $message->appendChild($dom->createElement('source', $source));
37	+ $message->appendChild($dom->createElement('translation', $target));
38	+ }
39	+
40	+ return $dom->saveXML();
41	+ }
42	+
43	+ /**
44	+ * {@inheritdoc}
45	+ */
46	+ protected function getExtension()
47	+ {
48	+ return 'ts';
49	+ }
50	+ }

src/common/lib/vendor/symfony/translation/Dumper/XliffFileDumper.php ADDED Viewed

	@@ -0,0 +1,200 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
16	+
17	+ /**
18	+ * XliffFileDumper generates xliff files from a message catalogue.
19	+ *
20	+ * @author Michel Salib <michelsalib@hotmail.com>
21	+ */
22	+ class XliffFileDumper extends FileDumper
23	+ {
24	+ /**
25	+ * {@inheritdoc}
26	+ */
27	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
28	+ {
29	+ $xliffVersion = '1.2';
30	+ if (array_key_exists('xliff_version', $options)) {
31	+ $xliffVersion = $options['xliff_version'];
32	+ }
33	+
34	+ if (array_key_exists('default_locale', $options)) {
35	+ $defaultLocale = $options['default_locale'];
36	+ } else {
37	+ $defaultLocale = \Locale::getDefault();
38	+ }
39	+
40	+ if ('1.2' === $xliffVersion) {
41	+ return $this->dumpXliff1($defaultLocale, $messages, $domain, $options);
42	+ }
43	+ if ('2.0' === $xliffVersion) {
44	+ return $this->dumpXliff2($defaultLocale, $messages, $domain, $options);
45	+ }
46	+
47	+ throw new InvalidArgumentException(sprintf('No support implemented for dumping XLIFF version "%s".', $xliffVersion));
48	+ }
49	+
50	+ /**
51	+ * {@inheritdoc}
52	+ */
53	+ protected function getExtension()
54	+ {
55	+ return 'xlf';
56	+ }
57	+
58	+ private function dumpXliff1($defaultLocale, MessageCatalogue $messages, $domain, array $options = array())
59	+ {
60	+ $toolInfo = array('tool-id' => 'symfony', 'tool-name' => 'Symfony');
61	+ if (array_key_exists('tool_info', $options)) {
62	+ $toolInfo = array_merge($toolInfo, $options['tool_info']);
63	+ }
64	+
65	+ $dom = new \DOMDocument('1.0', 'utf-8');
66	+ $dom->formatOutput = true;
67	+
68	+ $xliff = $dom->appendChild($dom->createElement('xliff'));
69	+ $xliff->setAttribute('version', '1.2');
70	+ $xliff->setAttribute('xmlns', 'urn:oasis:names:tc:xliff:document:1.2');
71	+
72	+ $xliffFile = $xliff->appendChild($dom->createElement('file'));
73	+ $xliffFile->setAttribute('source-language', str_replace('_', '-', $defaultLocale));
74	+ $xliffFile->setAttribute('target-language', str_replace('_', '-', $messages->getLocale()));
75	+ $xliffFile->setAttribute('datatype', 'plaintext');
76	+ $xliffFile->setAttribute('original', 'file.ext');
77	+
78	+ $xliffHead = $xliffFile->appendChild($dom->createElement('header'));
79	+ $xliffTool = $xliffHead->appendChild($dom->createElement('tool'));
80	+ foreach ($toolInfo as $id => $value) {
81	+ $xliffTool->setAttribute($id, $value);
82	+ }
83	+
84	+ $xliffBody = $xliffFile->appendChild($dom->createElement('body'));
85	+ foreach ($messages->all($domain) as $source => $target) {
86	+ $translation = $dom->createElement('trans-unit');
87	+
88	+ $translation->setAttribute('id', strtr(substr(base64_encode(hash('sha256', $source, true)), 0, 7), '/+', '._'));
89	+ $translation->setAttribute('resname', $source);
90	+
91	+ $s = $translation->appendChild($dom->createElement('source'));
92	+ $s->appendChild($dom->createTextNode($source));
93	+
94	+ // Does the target contain characters requiring a CDATA section?
95	+ $text = 1 === preg_match('/[&<>]/', $target) ? $dom->createCDATASection($target) : $dom->createTextNode($target);
96	+
97	+ $targetElement = $dom->createElement('target');
98	+ $metadata = $messages->getMetadata($source, $domain);
99	+ if ($this->hasMetadataArrayInfo('target-attributes', $metadata)) {
100	+ foreach ($metadata['target-attributes'] as $name => $value) {
101	+ $targetElement->setAttribute($name, $value);
102	+ }
103	+ }
104	+ $t = $translation->appendChild($targetElement);
105	+ $t->appendChild($text);
106	+
107	+ if ($this->hasMetadataArrayInfo('notes', $metadata)) {
108	+ foreach ($metadata['notes'] as $note) {
109	+ if (!isset($note['content'])) {
110	+ continue;
111	+ }
112	+
113	+ $n = $translation->appendChild($dom->createElement('note'));
114	+ $n->appendChild($dom->createTextNode($note['content']));
115	+
116	+ if (isset($note['priority'])) {
117	+ $n->setAttribute('priority', $note['priority']);
118	+ }
119	+
120	+ if (isset($note['from'])) {
121	+ $n->setAttribute('from', $note['from']);
122	+ }
123	+ }
124	+ }
125	+
126	+ $xliffBody->appendChild($translation);
127	+ }
128	+
129	+ return $dom->saveXML();
130	+ }
131	+
132	+ private function dumpXliff2($defaultLocale, MessageCatalogue $messages, $domain, array $options = array())
133	+ {
134	+ $dom = new \DOMDocument('1.0', 'utf-8');
135	+ $dom->formatOutput = true;
136	+
137	+ $xliff = $dom->appendChild($dom->createElement('xliff'));
138	+ $xliff->setAttribute('xmlns', 'urn:oasis:names:tc:xliff:document:2.0');
139	+ $xliff->setAttribute('version', '2.0');
140	+ $xliff->setAttribute('srcLang', str_replace('_', '-', $defaultLocale));
141	+ $xliff->setAttribute('trgLang', str_replace('_', '-', $messages->getLocale()));
142	+
143	+ $xliffFile = $xliff->appendChild($dom->createElement('file'));
144	+ $xliffFile->setAttribute('id', $domain.'.'.$messages->getLocale());
145	+
146	+ foreach ($messages->all($domain) as $source => $target) {
147	+ $translation = $dom->createElement('unit');
148	+ $translation->setAttribute('id', strtr(substr(base64_encode(hash('sha256', $source, true)), 0, 7), '/+', '._'));
149	+ $metadata = $messages->getMetadata($source, $domain);
150	+
151	+ // Add notes section
152	+ if ($this->hasMetadataArrayInfo('notes', $metadata)) {
153	+ $notesElement = $dom->createElement('notes');
154	+ foreach ($metadata['notes'] as $note) {
155	+ $n = $dom->createElement('note');
156	+ $n->appendChild($dom->createTextNode(isset($note['content']) ? $note['content'] : ''));
157	+ unset($note['content']);
158	+
159	+ foreach ($note as $name => $value) {
160	+ $n->setAttribute($name, $value);
161	+ }
162	+ $notesElement->appendChild($n);
163	+ }
164	+ $translation->appendChild($notesElement);
165	+ }
166	+
167	+ $segment = $translation->appendChild($dom->createElement('segment'));
168	+
169	+ $s = $segment->appendChild($dom->createElement('source'));
170	+ $s->appendChild($dom->createTextNode($source));
171	+
172	+ // Does the target contain characters requiring a CDATA section?
173	+ $text = 1 === preg_match('/[&<>]/', $target) ? $dom->createCDATASection($target) : $dom->createTextNode($target);
174	+
175	+ $targetElement = $dom->createElement('target');
176	+ if ($this->hasMetadataArrayInfo('target-attributes', $metadata)) {
177	+ foreach ($metadata['target-attributes'] as $name => $value) {
178	+ $targetElement->setAttribute($name, $value);
179	+ }
180	+ }
181	+ $t = $segment->appendChild($targetElement);
182	+ $t->appendChild($text);
183	+
184	+ $xliffFile->appendChild($translation);
185	+ }
186	+
187	+ return $dom->saveXML();
188	+ }
189	+
190	+ /**
191	+ * @param string $key
192	+ * @param array\|null $metadata
193	+ *
194	+ * @return bool
195	+ */
196	+ private function hasMetadataArrayInfo($key, $metadata = null)
197	+ {
198	+ return null !== $metadata && array_key_exists($key, $metadata) && ($metadata[$key] instanceof \Traversable \|\| is_array($metadata[$key]));
199	+ }
200	+ }

src/common/lib/vendor/symfony/translation/Dumper/YamlFileDumper.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Dumper;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+ use Symfony\Component\Translation\Util\ArrayConverter;
16	+ use Symfony\Component\Yaml\Yaml;
17	+ use Symfony\Component\Translation\Exception\LogicException;
18	+
19	+ /**
20	+ * YamlFileDumper generates yaml files from a message catalogue.
21	+ *
22	+ * @author Michel Salib <michelsalib@hotmail.com>
23	+ */
24	+ class YamlFileDumper extends FileDumper
25	+ {
26	+ private $extension;
27	+
28	+ public function __construct(/*string /$extension = 'yml')
29	+ {
30	+ $this->extension = $extension;
31	+ }
32	+
33	+ /**
34	+ * {@inheritdoc}
35	+ */
36	+ public function formatCatalogue(MessageCatalogue $messages, $domain, array $options = array())
37	+ {
38	+ if (!class_exists('Symfony\Component\Yaml\Yaml')) {
39	+ throw new LogicException('Dumping translations in the YAML format requires the Symfony Yaml component.');
40	+ }
41	+
42	+ $data = $messages->all($domain);
43	+
44	+ if (isset($options['as_tree']) && $options['as_tree']) {
45	+ $data = ArrayConverter::expandToTree($data);
46	+ }
47	+
48	+ if (isset($options['inline']) && ($inline = (int) $options['inline']) > 0) {
49	+ return Yaml::dump($data, $inline);
50	+ }
51	+
52	+ return Yaml::dump($data);
53	+ }
54	+
55	+ /**
56	+ * {@inheritdoc}
57	+ */
58	+ protected function getExtension()
59	+ {
60	+ return $this->extension;
61	+ }
62	+ }

src/common/lib/vendor/symfony/translation/Exception/ExceptionInterface.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Exception;
13	+
14	+ /**
15	+ * Exception interface for all exceptions thrown by the component.
16	+ *
17	+ * @author Fabien Potencier <fabien@symfony.com>
18	+ */
19	+ interface ExceptionInterface
20	+ {
21	+ }

src/common/lib/vendor/symfony/translation/Exception/InvalidArgumentException.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Exception;
13	+
14	+ /**
15	+ * Base InvalidArgumentException for the Translation component.
16	+ *
17	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
18	+ */
19	+ class InvalidArgumentException extends \InvalidArgumentException implements ExceptionInterface
20	+ {
21	+ }

src/common/lib/vendor/symfony/translation/Exception/InvalidResourceException.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Exception;
13	+
14	+ /**
15	+ * Thrown when a resource cannot be loaded.
16	+ *
17	+ * @author Fabien Potencier <fabien@symfony.com>
18	+ */
19	+ class InvalidResourceException extends \InvalidArgumentException implements ExceptionInterface
20	+ {
21	+ }

src/common/lib/vendor/symfony/translation/Exception/LogicException.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Exception;
13	+
14	+ /**
15	+ * Base LogicException for Translation component.
16	+ *
17	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
18	+ */
19	+ class LogicException extends \LogicException implements ExceptionInterface
20	+ {
21	+ }

src/common/lib/vendor/symfony/translation/Exception/NotFoundResourceException.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Exception;
13	+
14	+ /**
15	+ * Thrown when a resource does not exist.
16	+ *
17	+ * @author Fabien Potencier <fabien@symfony.com>
18	+ */
19	+ class NotFoundResourceException extends \InvalidArgumentException implements ExceptionInterface
20	+ {
21	+ }

src/common/lib/vendor/symfony/translation/Exception/RuntimeException.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Exception;
13	+
14	+ /**
15	+ * Base RuntimeException for the Translation component.
16	+ *
17	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
18	+ */
19	+ class RuntimeException extends \RuntimeException implements ExceptionInterface
20	+ {
21	+ }

src/common/lib/vendor/symfony/translation/Extractor/AbstractFileExtractor.php ADDED Viewed

	@@ -0,0 +1,85 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Extractor;
13	+
14	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
15	+
16	+ /**
17	+ * Base class used by classes that extract translation messages from files.
18	+ *
19	+ * @author Marcos D. Sánchez <marcosdsanchez@gmail.com>
20	+ */
21	+ abstract class AbstractFileExtractor
22	+ {
23	+ /**
24	+ * @param string\|array $resource Files, a file or a directory
25	+ *
26	+ * @return array
27	+ */
28	+ protected function extractFiles($resource)
29	+ {
30	+ if (is_array($resource) \|\| $resource instanceof \Traversable) {
31	+ $files = array();
32	+ foreach ($resource as $file) {
33	+ if ($this->canBeExtracted($file)) {
34	+ $files[] = $this->toSplFileInfo($file);
35	+ }
36	+ }
37	+ } elseif (is_file($resource)) {
38	+ $files = $this->canBeExtracted($resource) ? array($this->toSplFileInfo($resource)) : array();
39	+ } else {
40	+ $files = $this->extractFromDirectory($resource);
41	+ }
42	+
43	+ return $files;
44	+ }
45	+
46	+ /**
47	+ * @param string $file
48	+ *
49	+ * @return \SplFileInfo
50	+ */
51	+ private function toSplFileInfo($file)
52	+ {
53	+ return ($file instanceof \SplFileInfo) ? $file : new \SplFileInfo($file);
54	+ }
55	+
56	+ /**
57	+ * @param string $file
58	+ *
59	+ * @return bool
60	+ *
61	+ * @throws InvalidArgumentException
62	+ */
63	+ protected function isFile($file)
64	+ {
65	+ if (!is_file($file)) {
66	+ throw new InvalidArgumentException(sprintf('The "%s" file does not exist.', $file));
67	+ }
68	+
69	+ return true;
70	+ }
71	+
72	+ /**
73	+ * @param string $file
74	+ *
75	+ * @return bool
76	+ */
77	+ abstract protected function canBeExtracted($file);
78	+
79	+ /**
80	+ * @param string\|array $resource Files, a file or a directory
81	+ *
82	+ * @return array files to be extracted
83	+ */
84	+ abstract protected function extractFromDirectory($resource);
85	+ }

src/common/lib/vendor/symfony/translation/Extractor/ChainExtractor.php ADDED Viewed

	@@ -0,0 +1,60 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Extractor;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * ChainExtractor extracts translation messages from template files.
18	+ *
19	+ * @author Michel Salib <michelsalib@hotmail.com>
20	+ */
21	+ class ChainExtractor implements ExtractorInterface
22	+ {
23	+ /**
24	+ * The extractors.
25	+ *
26	+ * @var ExtractorInterface[]
27	+ */
28	+ private $extractors = array();
29	+
30	+ /**
31	+ * Adds a loader to the translation extractor.
32	+ *
33	+ * @param string $format The format of the loader
34	+ * @param ExtractorInterface $extractor The loader
35	+ */
36	+ public function addExtractor($format, ExtractorInterface $extractor)
37	+ {
38	+ $this->extractors[$format] = $extractor;
39	+ }
40	+
41	+ /**
42	+ * {@inheritdoc}
43	+ */
44	+ public function setPrefix($prefix)
45	+ {
46	+ foreach ($this->extractors as $extractor) {
47	+ $extractor->setPrefix($prefix);
48	+ }
49	+ }
50	+
51	+ /**
52	+ * {@inheritdoc}
53	+ */
54	+ public function extract($directory, MessageCatalogue $catalogue)
55	+ {
56	+ foreach ($this->extractors as $extractor) {
57	+ $extractor->extract($directory, $catalogue);
58	+ }
59	+ }
60	+ }

src/common/lib/vendor/symfony/translation/Extractor/ExtractorInterface.php ADDED Viewed

	@@ -0,0 +1,38 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Extractor;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * Extracts translation messages from a directory or files to the catalogue.
18	+ * New found messages are injected to the catalogue using the prefix.
19	+ *
20	+ * @author Michel Salib <michelsalib@hotmail.com>
21	+ */
22	+ interface ExtractorInterface
23	+ {
24	+ /**
25	+ * Extracts translation messages from files, a file or a directory to the catalogue.
26	+ *
27	+ * @param string\|array $resource Files, a file or a directory
28	+ * @param MessageCatalogue $catalogue The catalogue
29	+ */
30	+ public function extract($resource, MessageCatalogue $catalogue);
31	+
32	+ /**
33	+ * Sets the prefix that should be used for new found messages.
34	+ *
35	+ * @param string $prefix The prefix
36	+ */
37	+ public function setPrefix($prefix);
38	+ }

src/common/lib/vendor/symfony/translation/Extractor/PhpExtractor.php ADDED Viewed

	@@ -0,0 +1,258 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Extractor;
13	+
14	+ use Symfony\Component\Finder\Finder;
15	+ use Symfony\Component\Translation\MessageCatalogue;
16	+
17	+ /**
18	+ * PhpExtractor extracts translation messages from a PHP template.
19	+ *
20	+ * @author Michel Salib <michelsalib@hotmail.com>
21	+ */
22	+ class PhpExtractor extends AbstractFileExtractor implements ExtractorInterface
23	+ {
24	+ const MESSAGE_TOKEN = 300;
25	+ const METHOD_ARGUMENTS_TOKEN = 1000;
26	+ const DOMAIN_TOKEN = 1001;
27	+
28	+ /**
29	+ * Prefix for new found message.
30	+ *
31	+ * @var string
32	+ */
33	+ private $prefix = '';
34	+
35	+ /**
36	+ * The sequence that captures translation messages.
37	+ *
38	+ * @var array
39	+ */
40	+ protected $sequences = array(
41	+ array(
42	+ '->',
43	+ 'trans',
44	+ '(',
45	+ self::MESSAGE_TOKEN,
46	+ ',',
47	+ self::METHOD_ARGUMENTS_TOKEN,
48	+ ',',
49	+ self::DOMAIN_TOKEN,
50	+ ),
51	+ array(
52	+ '->',
53	+ 'transChoice',
54	+ '(',
55	+ self::MESSAGE_TOKEN,
56	+ ',',
57	+ self::METHOD_ARGUMENTS_TOKEN,
58	+ ',',
59	+ self::METHOD_ARGUMENTS_TOKEN,
60	+ ',',
61	+ self::DOMAIN_TOKEN,
62	+ ),
63	+ array(
64	+ '->',
65	+ 'trans',
66	+ '(',
67	+ self::MESSAGE_TOKEN,
68	+ ),
69	+ array(
70	+ '->',
71	+ 'transChoice',
72	+ '(',
73	+ self::MESSAGE_TOKEN,
74	+ ),
75	+ );
76	+
77	+ /**
78	+ * {@inheritdoc}
79	+ */
80	+ public function extract($resource, MessageCatalogue $catalog)
81	+ {
82	+ $files = $this->extractFiles($resource);
83	+ foreach ($files as $file) {
84	+ $this->parseTokens(token_get_all(file_get_contents($file)), $catalog);
85	+
86	+ if (\PHP_VERSION_ID >= 70000) {
87	+ // PHP 7 memory manager will not release after token_get_all(), see https://bugs.php.net/70098
88	+ gc_mem_caches();
89	+ }
90	+ }
91	+ }
92	+
93	+ /**
94	+ * {@inheritdoc}
95	+ */
96	+ public function setPrefix($prefix)
97	+ {
98	+ $this->prefix = $prefix;
99	+ }
100	+
101	+ /**
102	+ * Normalizes a token.
103	+ *
104	+ * @param mixed $token
105	+ *
106	+ * @return string
107	+ */
108	+ protected function normalizeToken($token)
109	+ {
110	+ if (isset($token[1]) && 'b"' !== $token) {
111	+ return $token[1];
112	+ }
113	+
114	+ return $token;
115	+ }
116	+
117	+ /**
118	+ * Seeks to a non-whitespace token.
119	+ */
120	+ private function seekToNextRelevantToken(\Iterator $tokenIterator)
121	+ {
122	+ for (; $tokenIterator->valid(); $tokenIterator->next()) {
123	+ $t = $tokenIterator->current();
124	+ if (T_WHITESPACE !== $t[0]) {
125	+ break;
126	+ }
127	+ }
128	+ }
129	+
130	+ private function skipMethodArgument(\Iterator $tokenIterator)
131	+ {
132	+ $openBraces = 0;
133	+
134	+ for (; $tokenIterator->valid(); $tokenIterator->next()) {
135	+ $t = $tokenIterator->current();
136	+
137	+ if ('[' === $t[0] \|\| '(' === $t[0]) {
138	+ ++$openBraces;
139	+ }
140	+
141	+ if (']' === $t[0] \|\| ')' === $t[0]) {
142	+ --$openBraces;
143	+ }
144	+
145	+ if ((0 === $openBraces && ',' === $t[0]) \|\| (-1 === $openBraces && ')' === $t[0])) {
146	+ break;
147	+ }
148	+ }
149	+ }
150	+
151	+ /**
152	+ * Extracts the message from the iterator while the tokens
153	+ * match allowed message tokens.
154	+ */
155	+ private function getValue(\Iterator $tokenIterator)
156	+ {
157	+ $message = '';
158	+ $docToken = '';
159	+
160	+ for (; $tokenIterator->valid(); $tokenIterator->next()) {
161	+ $t = $tokenIterator->current();
162	+ if (!isset($t[1])) {
163	+ break;
164	+ }
165	+
166	+ switch ($t[0]) {
167	+ case T_START_HEREDOC:
168	+ $docToken = $t[1];
169	+ break;
170	+ case T_ENCAPSED_AND_WHITESPACE:
171	+ case T_CONSTANT_ENCAPSED_STRING:
172	+ $message .= $t[1];
173	+ break;
174	+ case T_END_HEREDOC:
175	+ return PhpStringTokenParser::parseDocString($docToken, $message);
176	+ default:
177	+ break 2;
178	+ }
179	+ }
180	+
181	+ if ($message) {
182	+ $message = PhpStringTokenParser::parse($message);
183	+ }
184	+
185	+ return $message;
186	+ }
187	+
188	+ /**
189	+ * Extracts trans message from PHP tokens.
190	+ *
191	+ * @param array $tokens
192	+ * @param MessageCatalogue $catalog
193	+ */
194	+ protected function parseTokens($tokens, MessageCatalogue $catalog)
195	+ {
196	+ $tokenIterator = new \ArrayIterator($tokens);
197	+
198	+ for ($key = 0; $key < $tokenIterator->count(); ++$key) {
199	+ foreach ($this->sequences as $sequence) {
200	+ $message = '';
201	+ $domain = 'messages';
202	+ $tokenIterator->seek($key);
203	+
204	+ foreach ($sequence as $sequenceKey => $item) {
205	+ $this->seekToNextRelevantToken($tokenIterator);
206	+
207	+ if ($this->normalizeToken($tokenIterator->current()) === $item) {
208	+ $tokenIterator->next();
209	+ continue;
210	+ } elseif (self::MESSAGE_TOKEN === $item) {
211	+ $message = $this->getValue($tokenIterator);
212	+
213	+ if (count($sequence) === ($sequenceKey + 1)) {
214	+ break;
215	+ }
216	+ } elseif (self::METHOD_ARGUMENTS_TOKEN === $item) {
217	+ $this->skipMethodArgument($tokenIterator);
218	+ } elseif (self::DOMAIN_TOKEN === $item) {
219	+ $domain = $this->getValue($tokenIterator);
220	+
221	+ break;
222	+ } else {
223	+ break;
224	+ }
225	+ }
226	+
227	+ if ($message) {
228	+ $catalog->set($message, $this->prefix.$message, $domain);
229	+ break;
230	+ }
231	+ }
232	+ }
233	+ }
234	+
235	+ /**
236	+ * @param string $file
237	+ *
238	+ * @return bool
239	+ *
240	+ * @throws \InvalidArgumentException
241	+ */
242	+ protected function canBeExtracted($file)
243	+ {
244	+ return $this->isFile($file) && 'php' === pathinfo($file, PATHINFO_EXTENSION);
245	+ }
246	+
247	+ /**
248	+ * @param string\|array $directory
249	+ *
250	+ * @return array
251	+ */
252	+ protected function extractFromDirectory($directory)
253	+ {
254	+ $finder = new Finder();
255	+
256	+ return $finder->files()->name('*.php')->in($directory);
257	+ }
258	+ }

src/common/lib/vendor/symfony/translation/Extractor/PhpStringTokenParser.php ADDED Viewed

	@@ -0,0 +1,142 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Extractor;
13	+
14	+ /*
15	+ * The following is derived from code at http://github.com/nikic/PHP-Parser
16	+ *
17	+ * Copyright (c) 2011 by Nikita Popov
18	+ *
19	+ * Some rights reserved.
20	+ *
21	+ * Redistribution and use in source and binary forms, with or without
22	+ * modification, are permitted provided that the following conditions are
23	+ * met:
24	+ *
25	+ * * Redistributions of source code must retain the above copyright
26	+ * notice, this list of conditions and the following disclaimer.
27	+ *
28	+ * * Redistributions in binary form must reproduce the above
29	+ * copyright notice, this list of conditions and the following
30	+ * disclaimer in the documentation and/or other materials provided
31	+ * with the distribution.
32	+ *
33	+ * * The names of the contributors may not be used to endorse or
34	+ * promote products derived from this software without specific
35	+ * prior written permission.
36	+ *
37	+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
38	+ * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
39	+ * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
40	+ * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
41	+ * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
42	+ * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
43	+ * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
44	+ * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
45	+ * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
46	+ * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
47	+ * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
48	+ */
49	+
50	+ class PhpStringTokenParser
51	+ {
52	+ protected static $replacements = array(
53	+ '\\' => '\\',
54	+ '$' => '$',
55	+ 'n' => "\n",
56	+ 'r' => "\r",
57	+ 't' => "\t",
58	+ 'f' => "\f",
59	+ 'v' => "\v",
60	+ 'e' => "\x1B",
61	+ );
62	+
63	+ /**
64	+ * Parses a string token.
65	+ *
66	+ * @param string $str String token content
67	+ *
68	+ * @return string The parsed string
69	+ */
70	+ public static function parse($str)
71	+ {
72	+ $bLength = 0;
73	+ if ('b' === $str[0]) {
74	+ $bLength = 1;
75	+ }
76	+
77	+ if ('\'' === $str[$bLength]) {
78	+ return str_replace(
79	+ array('\\\\', '\\\''),
80	+ array('\\', '\''),
81	+ substr($str, $bLength + 1, -1)
82	+ );
83	+ } else {
84	+ return self::parseEscapeSequences(substr($str, $bLength + 1, -1), '"');
85	+ }
86	+ }
87	+
88	+ /**
89	+ * Parses escape sequences in strings (all string types apart from single quoted).
90	+ *
91	+ * @param string $str String without quotes
92	+ * @param null\|string $quote Quote type
93	+ *
94	+ * @return string String with escape sequences parsed
95	+ */
96	+ public static function parseEscapeSequences($str, $quote)
97	+ {
98	+ if (null !== $quote) {
99	+ $str = str_replace('\\'.$quote, $quote, $str);
100	+ }
101	+
102	+ return preg_replace_callback(
103	+ '~\\\\([\\\\$nrtfve]\|[xX][0-9a-fA-F]{1,2}\|[0-7]{1,3})~',
104	+ array(__CLASS__, 'parseCallback'),
105	+ $str
106	+ );
107	+ }
108	+
109	+ private static function parseCallback($matches)
110	+ {
111	+ $str = $matches[1];
112	+
113	+ if (isset(self::$replacements[$str])) {
114	+ return self::$replacements[$str];
115	+ } elseif ('x' === $str[0] \|\| 'X' === $str[0]) {
116	+ return chr(hexdec($str));
117	+ } else {
118	+ return chr(octdec($str));
119	+ }
120	+ }
121	+
122	+ /**
123	+ * Parses a constant doc string.
124	+ *
125	+ * @param string $startToken Doc string start token content (<<<SMTHG)
126	+ * @param string $str String token content
127	+ *
128	+ * @return string Parsed string
129	+ */
130	+ public static function parseDocString($startToken, $str)
131	+ {
132	+ // strip last newline (thanks tokenizer for sticking it into the string!)
133	+ $str = preg_replace('~(\r\n\|\n\|\r)$~', '', $str);
134	+
135	+ // nowdoc string
136	+ if (false !== strpos($startToken, '\'')) {
137	+ return $str;
138	+ }
139	+
140	+ return self::parseEscapeSequences($str, null);
141	+ }
142	+ }

src/common/lib/vendor/symfony/translation/Formatter/ChoiceMessageFormatterInterface.php ADDED Viewed

	@@ -0,0 +1,30 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Formatter;
13	+
14	+ /**
15	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
16	+ */
17	+ interface ChoiceMessageFormatterInterface
18	+ {
19	+ /**
20	+ * Formats a localized message pattern with given arguments.
21	+ *
22	+ * @param string $message The message (may also be an object that can be cast to string)
23	+ * @param int $number The number to use to find the indice of the message
24	+ * @param string $locale The message locale
25	+ * @param array $parameters An array of parameters for the message
26	+ *
27	+ * @return string
28	+ */
29	+ public function choiceFormat($message, $number, $locale, array $parameters = array());
30	+ }

src/common/lib/vendor/symfony/translation/Formatter/MessageFormatter.php ADDED Viewed

	@@ -0,0 +1,48 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Formatter;
13	+
14	+ use Symfony\Component\Translation\MessageSelector;
15	+
16	+ /**
17	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
18	+ */
19	+ class MessageFormatter implements MessageFormatterInterface, ChoiceMessageFormatterInterface
20	+ {
21	+ private $selector;
22	+
23	+ /**
24	+ * @param MessageSelector\|null $selector The message selector for pluralization
25	+ */
26	+ public function __construct(MessageSelector $selector = null)
27	+ {
28	+ $this->selector = $selector ?: new MessageSelector();
29	+ }
30	+
31	+ /**
32	+ * {@inheritdoc}
33	+ */
34	+ public function format($message, $locale, array $parameters = array())
35	+ {
36	+ return strtr($message, $parameters);
37	+ }
38	+
39	+ /**
40	+ * {@inheritdoc}
41	+ */
42	+ public function choiceFormat($message, $number, $locale, array $parameters = array())
43	+ {
44	+ $parameters = array_merge(array('%count%' => $number), $parameters);
45	+
46	+ return $this->format($this->selector->choose($message, (int) $number, $locale), $locale, $parameters);
47	+ }
48	+ }

src/common/lib/vendor/symfony/translation/Formatter/MessageFormatterInterface.php ADDED Viewed

	@@ -0,0 +1,30 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Formatter;
13	+
14	+ /**
15	+ * @author Guilherme Blanco <guilhermeblanco@hotmail.com>
16	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
17	+ */
18	+ interface MessageFormatterInterface
19	+ {
20	+ /**
21	+ * Formats a localized message pattern with given arguments.
22	+ *
23	+ * @param string $message The message (may also be an object that can be cast to string)
24	+ * @param string $locale The message locale
25	+ * @param array $parameters An array of parameters for the message
26	+ *
27	+ * @return string
28	+ */
29	+ public function format($message, $locale, array $parameters = array());
30	+ }

src/common/lib/vendor/symfony/translation/IdentityTranslator.php ADDED Viewed

	@@ -0,0 +1,63 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ /**
15	+ * IdentityTranslator does not translate anything.
16	+ *
17	+ * @author Fabien Potencier <fabien@symfony.com>
18	+ */
19	+ class IdentityTranslator implements TranslatorInterface
20	+ {
21	+ private $selector;
22	+ private $locale;
23	+
24	+ /**
25	+ * @param MessageSelector\|null $selector The message selector for pluralization
26	+ */
27	+ public function __construct(MessageSelector $selector = null)
28	+ {
29	+ $this->selector = $selector ?: new MessageSelector();
30	+ }
31	+
32	+ /**
33	+ * {@inheritdoc}
34	+ */
35	+ public function setLocale($locale)
36	+ {
37	+ $this->locale = $locale;
38	+ }
39	+
40	+ /**
41	+ * {@inheritdoc}
42	+ */
43	+ public function getLocale()
44	+ {
45	+ return $this->locale ?: \Locale::getDefault();
46	+ }
47	+
48	+ /**
49	+ * {@inheritdoc}
50	+ */
51	+ public function trans($id, array $parameters = array(), $domain = null, $locale = null)
52	+ {
53	+ return strtr((string) $id, $parameters);
54	+ }
55	+
56	+ /**
57	+ * {@inheritdoc}
58	+ */
59	+ public function transChoice($id, $number, array $parameters = array(), $domain = null, $locale = null)
60	+ {
61	+ return strtr($this->selector->choose((string) $id, (int) $number, $locale ?: $this->getLocale()), $parameters);
62	+ }
63	+ }

src/common/lib/vendor/symfony/translation/Interval.php ADDED Viewed

	@@ -0,0 +1,109 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
15	+
16	+ /**
17	+ * Tests if a given number belongs to a given math interval.
18	+ *
19	+ * An interval can represent a finite set of numbers:
20	+ *
21	+ * {1,2,3,4}
22	+ *
23	+ * An interval can represent numbers between two numbers:
24	+ *
25	+ * [1, +Inf]
26	+ * ]-1,2[
27	+ *
28	+ * The left delimiter can be [ (inclusive) or ] (exclusive).
29	+ * The right delimiter can be [ (exclusive) or ] (inclusive).
30	+ * Beside numbers, you can use -Inf and +Inf for the infinite.
31	+ *
32	+ * @author Fabien Potencier <fabien@symfony.com>
33	+ *
34	+ * @see http://en.wikipedia.org/wiki/Interval_%28mathematics%29#The_ISO_notation
35	+ */
36	+ class Interval
37	+ {
38	+ /**
39	+ * Tests if the given number is in the math interval.
40	+ *
41	+ * @param int $number A number
42	+ * @param string $interval An interval
43	+ *
44	+ * @return bool
45	+ *
46	+ * @throws InvalidArgumentException
47	+ */
48	+ public static function test($number, $interval)
49	+ {
50	+ $interval = trim($interval);
51	+
52	+ if (!preg_match('/^'.self::getIntervalRegexp().'$/x', $interval, $matches)) {
53	+ throw new InvalidArgumentException(sprintf('"%s" is not a valid interval.', $interval));
54	+ }
55	+
56	+ if ($matches[1]) {
57	+ foreach (explode(',', $matches[2]) as $n) {
58	+ if ($number == $n) {
59	+ return true;
60	+ }
61	+ }
62	+ } else {
63	+ $leftNumber = self::convertNumber($matches['left']);
64	+ $rightNumber = self::convertNumber($matches['right']);
65	+
66	+ return
67	+ ('[' === $matches['left_delimiter'] ? $number >= $leftNumber : $number > $leftNumber)
68	+ && (']' === $matches['right_delimiter'] ? $number <= $rightNumber : $number < $rightNumber)
69	+ ;
70	+ }
71	+
72	+ return false;
73	+ }
74	+
75	+ /**
76	+ * Returns a Regexp that matches valid intervals.
77	+ *
78	+ * @return string A Regexp (without the delimiters)
79	+ */
80	+ public static function getIntervalRegexp()
81	+ {
82	+ return <<<EOF
83	+ ({\s*
84	+ (\-?\d+(\.\d+)?[\s,\s\-?\d+(\.\d+)?]*)
85	+ \s*})
86	+
87	+ \|
88	+
89	+ (?P<left_delimiter>[\[\]])
90	+ \s*
91	+ (?P<left>-Inf\|\-?\d+(\.\d+)?)
92	+ \s,\s
93	+ (?P<right>\+?Inf\|\-?\d+(\.\d+)?)
94	+ \s*
95	+ (?P<right_delimiter>[\[\]])
96	+ EOF;
97	+ }
98	+
99	+ private static function convertNumber($number)
100	+ {
101	+ if ('-Inf' === $number) {
102	+ return log(0);
103	+ } elseif ('+Inf' === $number \|\| 'Inf' === $number) {
104	+ return -log(0);
105	+ }
106	+
107	+ return (float) $number;
108	+ }
109	+ }

src/common/lib/vendor/symfony/translation/LICENSE ADDED Viewed

	@@ -0,0 +1,19 @@


1	+ Copyright (c) 2004-2017 Fabien Potencier
2	+
3	+ Permission is hereby granted, free of charge, to any person obtaining a copy
4	+ of this software and associated documentation files (the "Software"), to deal
5	+ in the Software without restriction, including without limitation the rights
6	+ to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
7	+ copies of the Software, and to permit persons to whom the Software is furnished
8	+ to do so, subject to the following conditions:
9	+
10	+ The above copyright notice and this permission notice shall be included in all
11	+ copies or substantial portions of the Software.
12	+
13	+ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
14	+ IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
15	+ FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
16	+ AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
17	+ LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
18	+ OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
19	+ THE SOFTWARE.

src/common/lib/vendor/symfony/translation/Loader/ArrayLoader.php ADDED Viewed

	@@ -0,0 +1,66 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * ArrayLoader loads translations from a PHP array.
18	+ *
19	+ * @author Fabien Potencier <fabien@symfony.com>
20	+ */
21	+ class ArrayLoader implements LoaderInterface
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ public function load($resource, $locale, $domain = 'messages')
27	+ {
28	+ $this->flatten($resource);
29	+ $catalogue = new MessageCatalogue($locale);
30	+ $catalogue->add($resource, $domain);
31	+
32	+ return $catalogue;
33	+ }
34	+
35	+ /**
36	+ * Flattens an nested array of translations.
37	+ *
38	+ * The scheme used is:
39	+ * 'key' => array('key2' => array('key3' => 'value'))
40	+ * Becomes:
41	+ * 'key.key2.key3' => 'value'
42	+ *
43	+ * This function takes an array by reference and will modify it
44	+ *
45	+ * @param array &$messages The array that will be flattened
46	+ * @param array $subnode Current subnode being parsed, used internally for recursive calls
47	+ * @param string $path Current path being parsed, used internally for recursive calls
48	+ */
49	+ private function flatten(array &$messages, array $subnode = null, $path = null)
50	+ {
51	+ if (null === $subnode) {
52	+ $subnode = &$messages;
53	+ }
54	+ foreach ($subnode as $key => $value) {
55	+ if (is_array($value)) {
56	+ $nodePath = $path ? $path.'.'.$key : $key;
57	+ $this->flatten($messages, $value, $nodePath);
58	+ if (null === $path) {
59	+ unset($messages[$key]);
60	+ }
61	+ } elseif (null !== $path) {
62	+ $messages[$path.'.'.$key] = $value;
63	+ }
64	+ }
65	+ }
66	+ }

src/common/lib/vendor/symfony/translation/Loader/CsvFileLoader.php ADDED Viewed

	@@ -0,0 +1,65 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\Exception\NotFoundResourceException;
15	+
16	+ /**
17	+ * CsvFileLoader loads translations from CSV files.
18	+ *
19	+ * @author Saša Stamenković <umpirsky@gmail.com>
20	+ */
21	+ class CsvFileLoader extends FileLoader
22	+ {
23	+ private $delimiter = ';';
24	+ private $enclosure = '"';
25	+ private $escape = '\\';
26	+
27	+ /**
28	+ * {@inheritdoc}
29	+ */
30	+ protected function loadResource($resource)
31	+ {
32	+ $messages = array();
33	+
34	+ try {
35	+ $file = new \SplFileObject($resource, 'rb');
36	+ } catch (\RuntimeException $e) {
37	+ throw new NotFoundResourceException(sprintf('Error opening file "%s".', $resource), 0, $e);
38	+ }
39	+
40	+ $file->setFlags(\SplFileObject::READ_CSV \| \SplFileObject::SKIP_EMPTY);
41	+ $file->setCsvControl($this->delimiter, $this->enclosure, $this->escape);
42	+
43	+ foreach ($file as $data) {
44	+ if ('#' !== substr($data[0], 0, 1) && isset($data[1]) && 2 === count($data)) {
45	+ $messages[$data[0]] = $data[1];
46	+ }
47	+ }
48	+
49	+ return $messages;
50	+ }
51	+
52	+ /**
53	+ * Sets the delimiter, enclosure, and escape character for CSV.
54	+ *
55	+ * @param string $delimiter Delimiter character
56	+ * @param string $enclosure Enclosure character
57	+ * @param string $escape Escape character
58	+ */
59	+ public function setCsvControl($delimiter = ';', $enclosure = '"', $escape = '\\')
60	+ {
61	+ $this->delimiter = $delimiter;
62	+ $this->enclosure = $enclosure;
63	+ $this->escape = $escape;
64	+ }
65	+ }

src/common/lib/vendor/symfony/translation/Loader/FileLoader.php ADDED Viewed

	@@ -0,0 +1,65 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
15	+ use Symfony\Component\Translation\Exception\NotFoundResourceException;
16	+ use Symfony\Component\Config\Resource\FileResource;
17	+
18	+ /**
19	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
20	+ */
21	+ abstract class FileLoader extends ArrayLoader
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ public function load($resource, $locale, $domain = 'messages')
27	+ {
28	+ if (!stream_is_local($resource)) {
29	+ throw new InvalidResourceException(sprintf('This is not a local file "%s".', $resource));
30	+ }
31	+
32	+ if (!file_exists($resource)) {
33	+ throw new NotFoundResourceException(sprintf('File "%s" not found.', $resource));
34	+ }
35	+
36	+ $messages = $this->loadResource($resource);
37	+
38	+ // empty resource
39	+ if (null === $messages) {
40	+ $messages = array();
41	+ }
42	+
43	+ // not an array
44	+ if (!is_array($messages)) {
45	+ throw new InvalidResourceException(sprintf('Unable to load file "%s".', $resource));
46	+ }
47	+
48	+ $catalogue = parent::load($messages, $locale, $domain);
49	+
50	+ if (class_exists('Symfony\Component\Config\Resource\FileResource')) {
51	+ $catalogue->addResource(new FileResource($resource));
52	+ }
53	+
54	+ return $catalogue;
55	+ }
56	+
57	+ /**
58	+ * @param string $resource
59	+ *
60	+ * @return array
61	+ *
62	+ * @throws InvalidResourceException if stream content has an invalid format
63	+ */
64	+ abstract protected function loadResource($resource);
65	+ }

src/common/lib/vendor/symfony/translation/Loader/IcuDatFileLoader.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
16	+ use Symfony\Component\Translation\Exception\NotFoundResourceException;
17	+ use Symfony\Component\Config\Resource\FileResource;
18	+
19	+ /**
20	+ * IcuResFileLoader loads translations from a resource bundle.
21	+ *
22	+ * @author stealth35
23	+ */
24	+ class IcuDatFileLoader extends IcuResFileLoader
25	+ {
26	+ /**
27	+ * {@inheritdoc}
28	+ */
29	+ public function load($resource, $locale, $domain = 'messages')
30	+ {
31	+ if (!stream_is_local($resource.'.dat')) {
32	+ throw new InvalidResourceException(sprintf('This is not a local file "%s".', $resource));
33	+ }
34	+
35	+ if (!file_exists($resource.'.dat')) {
36	+ throw new NotFoundResourceException(sprintf('File "%s" not found.', $resource));
37	+ }
38	+
39	+ try {
40	+ $rb = new \ResourceBundle($locale, $resource);
41	+ } catch (\Exception $e) {
42	+ // HHVM compatibility: constructor throws on invalid resource
43	+ $rb = null;
44	+ }
45	+
46	+ if (!$rb) {
47	+ throw new InvalidResourceException(sprintf('Cannot load resource "%s"', $resource));
48	+ } elseif (intl_is_failure($rb->getErrorCode())) {
49	+ throw new InvalidResourceException($rb->getErrorMessage(), $rb->getErrorCode());
50	+ }
51	+
52	+ $messages = $this->flatten($rb);
53	+ $catalogue = new MessageCatalogue($locale);
54	+ $catalogue->add($messages, $domain);
55	+
56	+ if (class_exists('Symfony\Component\Config\Resource\FileResource')) {
57	+ $catalogue->addResource(new FileResource($resource.'.dat'));
58	+ }
59	+
60	+ return $catalogue;
61	+ }
62	+ }

src/common/lib/vendor/symfony/translation/Loader/IcuResFileLoader.php ADDED Viewed

	@@ -0,0 +1,92 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
16	+ use Symfony\Component\Translation\Exception\NotFoundResourceException;
17	+ use Symfony\Component\Config\Resource\DirectoryResource;
18	+
19	+ /**
20	+ * IcuResFileLoader loads translations from a resource bundle.
21	+ *
22	+ * @author stealth35
23	+ */
24	+ class IcuResFileLoader implements LoaderInterface
25	+ {
26	+ /**
27	+ * {@inheritdoc}
28	+ */
29	+ public function load($resource, $locale, $domain = 'messages')
30	+ {
31	+ if (!stream_is_local($resource)) {
32	+ throw new InvalidResourceException(sprintf('This is not a local file "%s".', $resource));
33	+ }
34	+
35	+ if (!is_dir($resource)) {
36	+ throw new NotFoundResourceException(sprintf('File "%s" not found.', $resource));
37	+ }
38	+
39	+ try {
40	+ $rb = new \ResourceBundle($locale, $resource);
41	+ } catch (\Exception $e) {
42	+ // HHVM compatibility: constructor throws on invalid resource
43	+ $rb = null;
44	+ }
45	+
46	+ if (!$rb) {
47	+ throw new InvalidResourceException(sprintf('Cannot load resource "%s"', $resource));
48	+ } elseif (intl_is_failure($rb->getErrorCode())) {
49	+ throw new InvalidResourceException($rb->getErrorMessage(), $rb->getErrorCode());
50	+ }
51	+
52	+ $messages = $this->flatten($rb);
53	+ $catalogue = new MessageCatalogue($locale);
54	+ $catalogue->add($messages, $domain);
55	+
56	+ if (class_exists('Symfony\Component\Config\Resource\DirectoryResource')) {
57	+ $catalogue->addResource(new DirectoryResource($resource));
58	+ }
59	+
60	+ return $catalogue;
61	+ }
62	+
63	+ /**
64	+ * Flattens an ResourceBundle.
65	+ *
66	+ * The scheme used is:
67	+ * key { key2 { key3 { "value" } } }
68	+ * Becomes:
69	+ * 'key.key2.key3' => 'value'
70	+ *
71	+ * This function takes an array by reference and will modify it
72	+ *
73	+ * @param \ResourceBundle $rb The ResourceBundle that will be flattened
74	+ * @param array $messages Used internally for recursive calls
75	+ * @param string $path Current path being parsed, used internally for recursive calls
76	+ *
77	+ * @return array the flattened ResourceBundle
78	+ */
79	+ protected function flatten(\ResourceBundle $rb, array &$messages = array(), $path = null)
80	+ {
81	+ foreach ($rb as $key => $value) {
82	+ $nodePath = $path ? $path.'.'.$key : $key;
83	+ if ($value instanceof \ResourceBundle) {
84	+ $this->flatten($value, $messages, $nodePath);
85	+ } else {
86	+ $messages[$nodePath] = $value;
87	+ }
88	+ }
89	+
90	+ return $messages;
91	+ }
92	+ }

src/common/lib/vendor/symfony/translation/Loader/IniFileLoader.php ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ /**
15	+ * IniFileLoader loads translations from an ini file.
16	+ *
17	+ * @author stealth35
18	+ */
19	+ class IniFileLoader extends FileLoader
20	+ {
21	+ /**
22	+ * {@inheritdoc}
23	+ */
24	+ protected function loadResource($resource)
25	+ {
26	+ return parse_ini_file($resource, true);
27	+ }
28	+ }

src/common/lib/vendor/symfony/translation/Loader/JsonFileLoader.php ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
15	+
16	+ /**
17	+ * JsonFileLoader loads translations from an json file.
18	+ *
19	+ * @author singles
20	+ */
21	+ class JsonFileLoader extends FileLoader
22	+ {
23	+ /**
24	+ * {@inheritdoc}
25	+ */
26	+ protected function loadResource($resource)
27	+ {
28	+ $messages = array();
29	+ if ($data = file_get_contents($resource)) {
30	+ $messages = json_decode($data, true);
31	+
32	+ if (0 < $errorCode = json_last_error()) {
33	+ throw new InvalidResourceException(sprintf('Error parsing JSON - %s', $this->getJSONErrorMessage($errorCode)));
34	+ }
35	+ }
36	+
37	+ return $messages;
38	+ }
39	+
40	+ /**
41	+ * Translates JSON_ERROR_* constant into meaningful message.
42	+ *
43	+ * @param int $errorCode Error code returned by json_last_error() call
44	+ *
45	+ * @return string Message string
46	+ */
47	+ private function getJSONErrorMessage($errorCode)
48	+ {
49	+ switch ($errorCode) {
50	+ case JSON_ERROR_DEPTH:
51	+ return 'Maximum stack depth exceeded';
52	+ case JSON_ERROR_STATE_MISMATCH:
53	+ return 'Underflow or the modes mismatch';
54	+ case JSON_ERROR_CTRL_CHAR:
55	+ return 'Unexpected control character found';
56	+ case JSON_ERROR_SYNTAX:
57	+ return 'Syntax error, malformed JSON';
58	+ case JSON_ERROR_UTF8:
59	+ return 'Malformed UTF-8 characters, possibly incorrectly encoded';
60	+ default:
61	+ return 'Unknown error';
62	+ }
63	+ }
64	+ }

src/common/lib/vendor/symfony/translation/Loader/LoaderInterface.php ADDED Viewed

	@@ -0,0 +1,38 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
16	+ use Symfony\Component\Translation\Exception\NotFoundResourceException;
17	+
18	+ /**
19	+ * LoaderInterface is the interface implemented by all translation loaders.
20	+ *
21	+ * @author Fabien Potencier <fabien@symfony.com>
22	+ */
23	+ interface LoaderInterface
24	+ {
25	+ /**
26	+ * Loads a locale.
27	+ *
28	+ * @param mixed $resource A resource
29	+ * @param string $locale A locale
30	+ * @param string $domain The domain
31	+ *
32	+ * @return MessageCatalogue A MessageCatalogue instance
33	+ *
34	+ * @throws NotFoundResourceException when the resource cannot be found
35	+ * @throws InvalidResourceException when the resource cannot be loaded
36	+ */
37	+ public function load($resource, $locale, $domain = 'messages');
38	+ }

src/common/lib/vendor/symfony/translation/Loader/MoFileLoader.php ADDED Viewed

	@@ -0,0 +1,148 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
15	+
16	+ /**
17	+ * @copyright Copyright (c) 2010, Union of RAD http://union-of-rad.org (http://lithify.me/)
18	+ */
19	+ class MoFileLoader extends FileLoader
20	+ {
21	+ /**
22	+ * Magic used for validating the format of a MO file as well as
23	+ * detecting if the machine used to create that file was little endian.
24	+ */
25	+ const MO_LITTLE_ENDIAN_MAGIC = 0x950412de;
26	+
27	+ /**
28	+ * Magic used for validating the format of a MO file as well as
29	+ * detecting if the machine used to create that file was big endian.
30	+ */
31	+ const MO_BIG_ENDIAN_MAGIC = 0xde120495;
32	+
33	+ /**
34	+ * The size of the header of a MO file in bytes.
35	+ */
36	+ const MO_HEADER_SIZE = 28;
37	+
38	+ /**
39	+ * Parses machine object (MO) format, independent of the machine's endian it
40	+ * was created on. Both 32bit and 64bit systems are supported.
41	+ *
42	+ * {@inheritdoc}
43	+ */
44	+ protected function loadResource($resource)
45	+ {
46	+ $stream = fopen($resource, 'r');
47	+
48	+ $stat = fstat($stream);
49	+
50	+ if ($stat['size'] < self::MO_HEADER_SIZE) {
51	+ throw new InvalidResourceException('MO stream content has an invalid format.');
52	+ }
53	+ $magic = unpack('V1', fread($stream, 4));
54	+ $magic = hexdec(substr(dechex(current($magic)), -8));
55	+
56	+ if (self::MO_LITTLE_ENDIAN_MAGIC == $magic) {
57	+ $isBigEndian = false;
58	+ } elseif (self::MO_BIG_ENDIAN_MAGIC == $magic) {
59	+ $isBigEndian = true;
60	+ } else {
61	+ throw new InvalidResourceException('MO stream content has an invalid format.');
62	+ }
63	+
64	+ // formatRevision
65	+ $this->readLong($stream, $isBigEndian);
66	+ $count = $this->readLong($stream, $isBigEndian);
67	+ $offsetId = $this->readLong($stream, $isBigEndian);
68	+ $offsetTranslated = $this->readLong($stream, $isBigEndian);
69	+ // sizeHashes
70	+ $this->readLong($stream, $isBigEndian);
71	+ // offsetHashes
72	+ $this->readLong($stream, $isBigEndian);
73	+
74	+ $messages = array();
75	+
76	+ for ($i = 0; $i < $count; ++$i) {
77	+ $pluralId = null;
78	+ $translated = null;
79	+
80	+ fseek($stream, $offsetId + $i * 8);
81	+
82	+ $length = $this->readLong($stream, $isBigEndian);
83	+ $offset = $this->readLong($stream, $isBigEndian);
84	+
85	+ if ($length < 1) {
86	+ continue;
87	+ }
88	+
89	+ fseek($stream, $offset);
90	+ $singularId = fread($stream, $length);
91	+
92	+ if (false !== strpos($singularId, "\000")) {
93	+ list($singularId, $pluralId) = explode("\000", $singularId);
94	+ }
95	+
96	+ fseek($stream, $offsetTranslated + $i * 8);
97	+ $length = $this->readLong($stream, $isBigEndian);
98	+ $offset = $this->readLong($stream, $isBigEndian);
99	+
100	+ if ($length < 1) {
101	+ continue;
102	+ }
103	+
104	+ fseek($stream, $offset);
105	+ $translated = fread($stream, $length);
106	+
107	+ if (false !== strpos($translated, "\000")) {
108	+ $translated = explode("\000", $translated);
109	+ }
110	+
111	+ $ids = array('singular' => $singularId, 'plural' => $pluralId);
112	+ $item = compact('ids', 'translated');
113	+
114	+ if (is_array($item['translated'])) {
115	+ $messages[$item['ids']['singular']] = stripcslashes($item['translated'][0]);
116	+ if (isset($item['ids']['plural'])) {
117	+ $plurals = array();
118	+ foreach ($item['translated'] as $plural => $translated) {
119	+ $plurals[] = sprintf('{%d} %s', $plural, $translated);
120	+ }
121	+ $messages[$item['ids']['plural']] = stripcslashes(implode('\|', $plurals));
122	+ }
123	+ } elseif (!empty($item['ids']['singular'])) {
124	+ $messages[$item['ids']['singular']] = stripcslashes($item['translated']);
125	+ }
126	+ }
127	+
128	+ fclose($stream);
129	+
130	+ return array_filter($messages);
131	+ }
132	+
133	+ /**
134	+ * Reads an unsigned long from stream respecting endianness.
135	+ *
136	+ * @param resource $stream
137	+ * @param bool $isBigEndian
138	+ *
139	+ * @return int
140	+ */
141	+ private function readLong($stream, $isBigEndian)
142	+ {
143	+ $result = unpack($isBigEndian ? 'N1' : 'V1', fread($stream, 4));
144	+ $result = current($result);
145	+
146	+ return (int) substr($result, -8);
147	+ }
148	+ }

src/common/lib/vendor/symfony/translation/Loader/PhpFileLoader.php ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ /**
15	+ * PhpFileLoader loads translations from PHP files returning an array of translations.
16	+ *
17	+ * @author Fabien Potencier <fabien@symfony.com>
18	+ */
19	+ class PhpFileLoader extends FileLoader
20	+ {
21	+ /**
22	+ * {@inheritdoc}
23	+ */
24	+ protected function loadResource($resource)
25	+ {
26	+ return require $resource;
27	+ }
28	+ }

src/common/lib/vendor/symfony/translation/Loader/PoFileLoader.php ADDED Viewed

	@@ -0,0 +1,148 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ /**
15	+ * @copyright Copyright (c) 2010, Union of RAD http://union-of-rad.org (http://lithify.me/)
16	+ * @copyright Copyright (c) 2012, Clemens Tolboom
17	+ */
18	+ class PoFileLoader extends FileLoader
19	+ {
20	+ /**
21	+ * Parses portable object (PO) format.
22	+ *
23	+ * From http://www.gnu.org/software/gettext/manual/gettext.html#PO-Files
24	+ * we should be able to parse files having:
25	+ *
26	+ * white-space
27	+ * # translator-comments
28	+ * #. extracted-comments
29	+ * #: reference...
30	+ * #, flag...
31	+ * #\| msgid previous-untranslated-string
32	+ * msgid untranslated-string
33	+ * msgstr translated-string
34	+ *
35	+ * extra or different lines are:
36	+ *
37	+ * #\| msgctxt previous-context
38	+ * #\| msgid previous-untranslated-string
39	+ * msgctxt context
40	+ *
41	+ * #\| msgid previous-untranslated-string-singular
42	+ * #\| msgid_plural previous-untranslated-string-plural
43	+ * msgid untranslated-string-singular
44	+ * msgid_plural untranslated-string-plural
45	+ * msgstr[0] translated-string-case-0
46	+ * ...
47	+ * msgstr[N] translated-string-case-n
48	+ *
49	+ * The definition states:
50	+ * - white-space and comments are optional.
51	+ * - msgid "" that an empty singleline defines a header.
52	+ *
53	+ * This parser sacrifices some features of the reference implementation the
54	+ * differences to that implementation are as follows.
55	+ * - No support for comments spanning multiple lines.
56	+ * - Translator and extracted comments are treated as being the same type.
57	+ * - Message IDs are allowed to have other encodings as just US-ASCII.
58	+ *
59	+ * Items with an empty id are ignored.
60	+ *
61	+ * {@inheritdoc}
62	+ */
63	+ protected function loadResource($resource)
64	+ {
65	+ $stream = fopen($resource, 'r');
66	+
67	+ $defaults = array(
68	+ 'ids' => array(),
69	+ 'translated' => null,
70	+ );
71	+
72	+ $messages = array();
73	+ $item = $defaults;
74	+ $flags = array();
75	+
76	+ while ($line = fgets($stream)) {
77	+ $line = trim($line);
78	+
79	+ if ('' === $line) {
80	+ // Whitespace indicated current item is done
81	+ if (!in_array('fuzzy', $flags)) {
82	+ $this->addMessage($messages, $item);
83	+ }
84	+ $item = $defaults;
85	+ $flags = array();
86	+ } elseif ('#,' === substr($line, 0, 2)) {
87	+ $flags = array_map('trim', explode(',', substr($line, 2)));
88	+ } elseif ('msgid "' === substr($line, 0, 7)) {
89	+ // We start a new msg so save previous
90	+ // TODO: this fails when comments or contexts are added
91	+ $this->addMessage($messages, $item);
92	+ $item = $defaults;
93	+ $item['ids']['singular'] = substr($line, 7, -1);
94	+ } elseif ('msgstr "' === substr($line, 0, 8)) {
95	+ $item['translated'] = substr($line, 8, -1);
96	+ } elseif ('"' === $line[0]) {
97	+ $continues = isset($item['translated']) ? 'translated' : 'ids';
98	+
99	+ if (is_array($item[$continues])) {
100	+ end($item[$continues]);
101	+ $item[$continues][key($item[$continues])] .= substr($line, 1, -1);
102	+ } else {
103	+ $item[$continues] .= substr($line, 1, -1);
104	+ }
105	+ } elseif ('msgid_plural "' === substr($line, 0, 14)) {
106	+ $item['ids']['plural'] = substr($line, 14, -1);
107	+ } elseif ('msgstr[' === substr($line, 0, 7)) {
108	+ $size = strpos($line, ']');
109	+ $item['translated'][(int) substr($line, 7, 1)] = substr($line, $size + 3, -1);
110	+ }
111	+ }
112	+ // save last item
113	+ if (!in_array('fuzzy', $flags)) {
114	+ $this->addMessage($messages, $item);
115	+ }
116	+ fclose($stream);
117	+
118	+ return $messages;
119	+ }
120	+
121	+ /**
122	+ * Save a translation item to the messages.
123	+ *
124	+ * A .po file could contain by error missing plural indexes. We need to
125	+ * fix these before saving them.
126	+ */
127	+ private function addMessage(array &$messages, array $item)
128	+ {
129	+ if (is_array($item['translated'])) {
130	+ $messages[stripcslashes($item['ids']['singular'])] = stripcslashes($item['translated'][0]);
131	+ if (isset($item['ids']['plural'])) {
132	+ $plurals = $item['translated'];
133	+ // PO are by definition indexed so sort by index.
134	+ ksort($plurals);
135	+ // Make sure every index is filled.
136	+ end($plurals);
137	+ $count = key($plurals);
138	+ // Fill missing spots with '-'.
139	+ $empties = array_fill(0, $count + 1, '-');
140	+ $plurals += $empties;
141	+ ksort($plurals);
142	+ $messages[stripcslashes($item['ids']['plural'])] = stripcslashes(implode('\|', $plurals));
143	+ }
144	+ } elseif (!empty($item['ids']['singular'])) {
145	+ $messages[stripcslashes($item['ids']['singular'])] = stripcslashes($item['translated']);
146	+ }
147	+ }
148	+ }

src/common/lib/vendor/symfony/translation/Loader/QtFileLoader.php ADDED Viewed

	@@ -0,0 +1,77 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Config\Util\XmlUtils;
15	+ use Symfony\Component\Translation\MessageCatalogue;
16	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
17	+ use Symfony\Component\Translation\Exception\NotFoundResourceException;
18	+ use Symfony\Component\Config\Resource\FileResource;
19	+
20	+ /**
21	+ * QtFileLoader loads translations from QT Translations XML files.
22	+ *
23	+ * @author Benjamin Eberlei <kontakt@beberlei.de>
24	+ */
25	+ class QtFileLoader implements LoaderInterface
26	+ {
27	+ /**
28	+ * {@inheritdoc}
29	+ */
30	+ public function load($resource, $locale, $domain = 'messages')
31	+ {
32	+ if (!stream_is_local($resource)) {
33	+ throw new InvalidResourceException(sprintf('This is not a local file "%s".', $resource));
34	+ }
35	+
36	+ if (!file_exists($resource)) {
37	+ throw new NotFoundResourceException(sprintf('File "%s" not found.', $resource));
38	+ }
39	+
40	+ try {
41	+ $dom = XmlUtils::loadFile($resource);
42	+ } catch (\InvalidArgumentException $e) {
43	+ throw new InvalidResourceException(sprintf('Unable to load "%s".', $resource), $e->getCode(), $e);
44	+ }
45	+
46	+ $internalErrors = libxml_use_internal_errors(true);
47	+ libxml_clear_errors();
48	+
49	+ $xpath = new \DOMXPath($dom);
50	+ $nodes = $xpath->evaluate('//TS/context/name[text()="'.$domain.'"]');
51	+
52	+ $catalogue = new MessageCatalogue($locale);
53	+ if (1 == $nodes->length) {
54	+ $translations = $nodes->item(0)->nextSibling->parentNode->parentNode->getElementsByTagName('message');
55	+ foreach ($translations as $translation) {
56	+ $translationValue = (string) $translation->getElementsByTagName('translation')->item(0)->nodeValue;
57	+
58	+ if (!empty($translationValue)) {
59	+ $catalogue->set(
60	+ (string) $translation->getElementsByTagName('source')->item(0)->nodeValue,
61	+ $translationValue,
62	+ $domain
63	+ );
64	+ }
65	+ $translation = $translation->nextSibling;
66	+ }
67	+
68	+ if (class_exists('Symfony\Component\Config\Resource\FileResource')) {
69	+ $catalogue->addResource(new FileResource($resource));
70	+ }
71	+ }
72	+
73	+ libxml_use_internal_errors($internalErrors);
74	+
75	+ return $catalogue;
76	+ }
77	+ }

src/common/lib/vendor/symfony/translation/Loader/XliffFileLoader.php ADDED Viewed

	@@ -0,0 +1,342 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Config\Util\XmlUtils;
15	+ use Symfony\Component\Translation\MessageCatalogue;
16	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
17	+ use Symfony\Component\Translation\Exception\NotFoundResourceException;
18	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
19	+ use Symfony\Component\Config\Resource\FileResource;
20	+
21	+ /**
22	+ * XliffFileLoader loads translations from XLIFF files.
23	+ *
24	+ * @author Fabien Potencier <fabien@symfony.com>
25	+ */
26	+ class XliffFileLoader implements LoaderInterface
27	+ {
28	+ /**
29	+ * {@inheritdoc}
30	+ */
31	+ public function load($resource, $locale, $domain = 'messages')
32	+ {
33	+ if (!stream_is_local($resource)) {
34	+ throw new InvalidResourceException(sprintf('This is not a local file "%s".', $resource));
35	+ }
36	+
37	+ if (!file_exists($resource)) {
38	+ throw new NotFoundResourceException(sprintf('File "%s" not found.', $resource));
39	+ }
40	+
41	+ $catalogue = new MessageCatalogue($locale);
42	+ $this->extract($resource, $catalogue, $domain);
43	+
44	+ if (class_exists('Symfony\Component\Config\Resource\FileResource')) {
45	+ $catalogue->addResource(new FileResource($resource));
46	+ }
47	+
48	+ return $catalogue;
49	+ }
50	+
51	+ private function extract($resource, MessageCatalogue $catalogue, $domain)
52	+ {
53	+ try {
54	+ $dom = XmlUtils::loadFile($resource);
55	+ } catch (\InvalidArgumentException $e) {
56	+ throw new InvalidResourceException(sprintf('Unable to load "%s": %s', $resource, $e->getMessage()), $e->getCode(), $e);
57	+ }
58	+
59	+ $xliffVersion = $this->getVersionNumber($dom);
60	+ $this->validateSchema($xliffVersion, $dom, $this->getSchema($xliffVersion));
61	+
62	+ if ('1.2' === $xliffVersion) {
63	+ $this->extractXliff1($dom, $catalogue, $domain);
64	+ }
65	+
66	+ if ('2.0' === $xliffVersion) {
67	+ $this->extractXliff2($dom, $catalogue, $domain);
68	+ }
69	+ }
70	+
71	+ /**
72	+ * Extract messages and metadata from DOMDocument into a MessageCatalogue.
73	+ *
74	+ * @param \DOMDocument $dom Source to extract messages and metadata
75	+ * @param MessageCatalogue $catalogue Catalogue where we'll collect messages and metadata
76	+ * @param string $domain The domain
77	+ */
78	+ private function extractXliff1(\DOMDocument $dom, MessageCatalogue $catalogue, $domain)
79	+ {
80	+ $xml = simplexml_import_dom($dom);
81	+ $encoding = strtoupper($dom->encoding);
82	+
83	+ $xml->registerXPathNamespace('xliff', 'urn:oasis:names:tc:xliff:document:1.2');
84	+ foreach ($xml->xpath('//xliff:trans-unit') as $translation) {
85	+ $attributes = $translation->attributes();
86	+
87	+ if (!(isset($attributes['resname']) \|\| isset($translation->source))) {
88	+ continue;
89	+ }
90	+
91	+ $source = isset($attributes['resname']) && $attributes['resname'] ? $attributes['resname'] : $translation->source;
92	+ // If the xlf file has another encoding specified, try to convert it because
93	+ // simple_xml will always return utf-8 encoded values
94	+ $target = $this->utf8ToCharset((string) (isset($translation->target) ? $translation->target : $source), $encoding);
95	+
96	+ $catalogue->set((string) $source, $target, $domain);
97	+
98	+ $metadata = array();
99	+ if ($notes = $this->parseNotesMetadata($translation->note, $encoding)) {
100	+ $metadata['notes'] = $notes;
101	+ }
102	+
103	+ if (isset($translation->target) && $translation->target->attributes()) {
104	+ $metadata['target-attributes'] = array();
105	+ foreach ($translation->target->attributes() as $key => $value) {
106	+ $metadata['target-attributes'][$key] = (string) $value;
107	+ }
108	+ }
109	+
110	+ if (isset($attributes['id'])) {
111	+ $metadata['id'] = (string) $attributes['id'];
112	+ }
113	+
114	+ $catalogue->setMetadata((string) $source, $metadata, $domain);
115	+ }
116	+ }
117	+
118	+ /**
119	+ * @param \DOMDocument $dom
120	+ * @param MessageCatalogue $catalogue
121	+ * @param string $domain
122	+ */
123	+ private function extractXliff2(\DOMDocument $dom, MessageCatalogue $catalogue, $domain)
124	+ {
125	+ $xml = simplexml_import_dom($dom);
126	+ $encoding = strtoupper($dom->encoding);
127	+
128	+ $xml->registerXPathNamespace('xliff', 'urn:oasis:names:tc:xliff:document:2.0');
129	+
130	+ foreach ($xml->xpath('//xliff:unit') as $unit) {
131	+ $segment = $unit->segment;
132	+ $source = $segment->source;
133	+
134	+ // If the xlf file has another encoding specified, try to convert it because
135	+ // simple_xml will always return utf-8 encoded values
136	+ $target = $this->utf8ToCharset((string) (isset($segment->target) ? $segment->target : $source), $encoding);
137	+
138	+ $catalogue->set((string) $source, $target, $domain);
139	+
140	+ $metadata = array();
141	+ if (isset($segment->target) && $segment->target->attributes()) {
142	+ $metadata['target-attributes'] = array();
143	+ foreach ($segment->target->attributes() as $key => $value) {
144	+ $metadata['target-attributes'][$key] = (string) $value;
145	+ }
146	+ }
147	+
148	+ if (isset($unit->notes)) {
149	+ $metadata['notes'] = array();
150	+ foreach ($unit->notes->note as $noteNode) {
151	+ $note = array();
152	+ foreach ($noteNode->attributes() as $key => $value) {
153	+ $note[$key] = (string) $value;
154	+ }
155	+ $note['content'] = (string) $noteNode;
156	+ $metadata['notes'][] = $note;
157	+ }
158	+ }
159	+
160	+ $catalogue->setMetadata((string) $source, $metadata, $domain);
161	+ }
162	+ }
163	+
164	+ /**
165	+ * Convert a UTF8 string to the specified encoding.
166	+ *
167	+ * @param string $content String to decode
168	+ * @param string $encoding Target encoding
169	+ *
170	+ * @return string
171	+ */
172	+ private function utf8ToCharset($content, $encoding = null)
173	+ {
174	+ if ('UTF-8' !== $encoding && !empty($encoding)) {
175	+ return mb_convert_encoding($content, $encoding, 'UTF-8');
176	+ }
177	+
178	+ return $content;
179	+ }
180	+
181	+ /**
182	+ * Validates and parses the given file into a DOMDocument.
183	+ *
184	+ * @param string $file
185	+ * @param \DOMDocument $dom
186	+ * @param string $schema source of the schema
187	+ *
188	+ * @throws InvalidResourceException
189	+ */
190	+ private function validateSchema($file, \DOMDocument $dom, $schema)
191	+ {
192	+ $internalErrors = libxml_use_internal_errors(true);
193	+
194	+ $disableEntities = libxml_disable_entity_loader(false);
195	+
196	+ if (!@$dom->schemaValidateSource($schema)) {
197	+ libxml_disable_entity_loader($disableEntities);
198	+
199	+ throw new InvalidResourceException(sprintf('Invalid resource provided: "%s"; Errors: %s', $file, implode("\n", $this->getXmlErrors($internalErrors))));
200	+ }
201	+
202	+ libxml_disable_entity_loader($disableEntities);
203	+
204	+ $dom->normalizeDocument();
205	+
206	+ libxml_clear_errors();
207	+ libxml_use_internal_errors($internalErrors);
208	+ }
209	+
210	+ private function getSchema($xliffVersion)
211	+ {
212	+ if ('1.2' === $xliffVersion) {
213	+ $schemaSource = file_get_contents(__DIR__.'/schema/dic/xliff-core/xliff-core-1.2-strict.xsd');
214	+ $xmlUri = 'http://www.w3.org/2001/xml.xsd';
215	+ } elseif ('2.0' === $xliffVersion) {
216	+ $schemaSource = file_get_contents(__DIR__.'/schema/dic/xliff-core/xliff-core-2.0.xsd');
217	+ $xmlUri = 'informativeCopiesOf3rdPartySchemas/w3c/xml.xsd';
218	+ } else {
219	+ throw new InvalidArgumentException(sprintf('No support implemented for loading XLIFF version "%s".', $xliffVersion));
220	+ }
221	+
222	+ return $this->fixXmlLocation($schemaSource, $xmlUri);
223	+ }
224	+
225	+ /**
226	+ * Internally changes the URI of a dependent xsd to be loaded locally.
227	+ *
228	+ * @param string $schemaSource Current content of schema file
229	+ * @param string $xmlUri External URI of XML to convert to local
230	+ *
231	+ * @return string
232	+ */
233	+ private function fixXmlLocation($schemaSource, $xmlUri)
234	+ {
235	+ $newPath = str_replace('\\', '/', __DIR__).'/schema/dic/xliff-core/xml.xsd';
236	+ $parts = explode('/', $newPath);
237	+ if (0 === stripos($newPath, 'phar://')) {
238	+ $tmpfile = tempnam(sys_get_temp_dir(), 'symfony');
239	+ if ($tmpfile) {
240	+ copy($newPath, $tmpfile);
241	+ $parts = explode('/', str_replace('\\', '/', $tmpfile));
242	+ }
243	+ }
244	+
245	+ $drive = '\\' === DIRECTORY_SEPARATOR ? array_shift($parts).'/' : '';
246	+ $newPath = 'file:///'.$drive.implode('/', array_map('rawurlencode', $parts));
247	+
248	+ return str_replace($xmlUri, $newPath, $schemaSource);
249	+ }
250	+
251	+ /**
252	+ * Returns the XML errors of the internal XML parser.
253	+ *
254	+ * @param bool $internalErrors
255	+ *
256	+ * @return array An array of errors
257	+ */
258	+ private function getXmlErrors($internalErrors)
259	+ {
260	+ $errors = array();
261	+ foreach (libxml_get_errors() as $error) {
262	+ $errors[] = sprintf('[%s %s] %s (in %s - line %d, column %d)',
263	+ LIBXML_ERR_WARNING == $error->level ? 'WARNING' : 'ERROR',
264	+ $error->code,
265	+ trim($error->message),
266	+ $error->file ?: 'n/a',
267	+ $error->line,
268	+ $error->column
269	+ );
270	+ }
271	+
272	+ libxml_clear_errors();
273	+ libxml_use_internal_errors($internalErrors);
274	+
275	+ return $errors;
276	+ }
277	+
278	+ /**
279	+ * Gets xliff file version based on the root "version" attribute.
280	+ * Defaults to 1.2 for backwards compatibility.
281	+ *
282	+ * @param \DOMDocument $dom
283	+ *
284	+ * @throws InvalidArgumentException
285	+ *
286	+ * @return string
287	+ */
288	+ private function getVersionNumber(\DOMDocument $dom)
289	+ {
290	+ /** @var \DOMNode $xliff */
291	+ foreach ($dom->getElementsByTagName('xliff') as $xliff) {
292	+ $version = $xliff->attributes->getNamedItem('version');
293	+ if ($version) {
294	+ return $version->nodeValue;
295	+ }
296	+
297	+ $namespace = $xliff->attributes->getNamedItem('xmlns');
298	+ if ($namespace) {
299	+ if (0 !== substr_compare('urn:oasis:names:tc:xliff:document:', $namespace->nodeValue, 0, 34)) {
300	+ throw new InvalidArgumentException(sprintf('Not a valid XLIFF namespace "%s"', $namespace));
301	+ }
302	+
303	+ return substr($namespace, 34);
304	+ }
305	+ }
306	+
307	+ // Falls back to v1.2
308	+ return '1.2';
309	+ }
310	+
311	+ /**
312	+ * @param \SimpleXMLElement\|null $noteElement
313	+ * @param string\|null $encoding
314	+ *
315	+ * @return array
316	+ */
317	+ private function parseNotesMetadata(\SimpleXMLElement $noteElement = null, $encoding = null)
318	+ {
319	+ $notes = array();
320	+
321	+ if (null === $noteElement) {
322	+ return $notes;
323	+ }
324	+
325	+ /** @var \SimpleXMLElement $xmlNote */
326	+ foreach ($noteElement as $xmlNote) {
327	+ $noteAttributes = $xmlNote->attributes();
328	+ $note = array('content' => $this->utf8ToCharset((string) $xmlNote, $encoding));
329	+ if (isset($noteAttributes['priority'])) {
330	+ $note['priority'] = (int) $noteAttributes['priority'];
331	+ }
332	+
333	+ if (isset($noteAttributes['from'])) {
334	+ $note['from'] = (string) $noteAttributes['from'];
335	+ }
336	+
337	+ $notes[] = $note;
338	+ }
339	+
340	+ return $notes;
341	+ }
342	+ }

src/common/lib/vendor/symfony/translation/Loader/YamlFileLoader.php ADDED Viewed

	@@ -0,0 +1,57 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Loader;
13	+
14	+ use Symfony\Component\Translation\Exception\InvalidResourceException;
15	+ use Symfony\Component\Translation\Exception\LogicException;
16	+ use Symfony\Component\Yaml\Parser as YamlParser;
17	+ use Symfony\Component\Yaml\Exception\ParseException;
18	+
19	+ /**
20	+ * YamlFileLoader loads translations from Yaml files.
21	+ *
22	+ * @author Fabien Potencier <fabien@symfony.com>
23	+ */
24	+ class YamlFileLoader extends FileLoader
25	+ {
26	+ private $yamlParser;
27	+
28	+ /**
29	+ * {@inheritdoc}
30	+ */
31	+ protected function loadResource($resource)
32	+ {
33	+ if (null === $this->yamlParser) {
34	+ if (!class_exists('Symfony\Component\Yaml\Parser')) {
35	+ throw new LogicException('Loading translations from the YAML format requires the Symfony Yaml component.');
36	+ }
37	+
38	+ $this->yamlParser = new YamlParser();
39	+ }
40	+
41	+ $prevErrorHandler = set_error_handler(function ($level, $message, $script, $line) use ($resource, &$prevErrorHandler) {
42	+ $message = E_USER_DEPRECATED === $level ? preg_replace('/ on line \d+/', ' in "'.$resource.'"$0', $message) : $message;
43	+
44	+ return $prevErrorHandler ? $prevErrorHandler($level, $message, $script, $line) : false;
45	+ });
46	+
47	+ try {
48	+ $messages = $this->yamlParser->parseFile($resource);
49	+ } catch (ParseException $e) {
50	+ throw new InvalidResourceException(sprintf('Error parsing YAML, invalid file "%s"', $resource), 0, $e);
51	+ } finally {
52	+ restore_error_handler();
53	+ }
54	+
55	+ return $messages;
56	+ }
57	+ }

src/common/lib/vendor/symfony/translation/Loader/schema/dic/xliff-core/xliff-core-1.2-strict.xsd ADDED Viewed

	@@ -0,0 +1,2223 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+
3	+ <!--
4	+
5	+ May-19-2004:
6	+ - Changed the <choice> for ElemType_header, moving minOccurs="0" maxOccurs="unbounded" from its elements
7	+ to <choice> itself.
8	+ - Added <choice> for ElemType_trans-unit to allow "any order" for <context-group>, <count-group>, <prop-group>, <note>, and
9	+ <alt-trans>.
10	+
11	+ Oct-2005
12	+ - updated version info to 1.2
13	+ - equiv-trans attribute to <trans-unit> element
14	+ - merged-trans attribute for <group> element
15	+ - Add the <seg-source> element as optional in the <trans-unit> and <alt-trans> content models, at the same level as <source>
16	+ - Create a new value "seg" for the mtype attribute of the <mrk> element
17	+ - Add mid as an optional attribute for the <alt-trans> element
18	+
19	+ Nov-14-2005
20	+ - Changed name attribute for <context-group> from required to optional
21	+ - Added extension point at <xliff>
22	+
23	+ Jan-9-2006
24	+ - Added alttranstype type attribute to <alt-trans>, and values
25	+
26	+ Jan-10-2006
27	+ - Corrected error with overwritten purposeValueList
28	+ - Corrected name="AttrType_Version", attribute should have been "name"
29	+
30	+ -->
31	+ <xsd:schema xmlns:xlf="urn:oasis:names:tc:xliff:document:1.2" xmlns:xsd="http://www.w3.org/2001/XMLSchema" elementFormDefault="qualified" targetNamespace="urn:oasis:names:tc:xliff:document:1.2" xml:lang="en">
32	+ <!-- Import for xml:lang and xml:space -->
33	+ <xsd:import namespace="http://www.w3.org/XML/1998/namespace" schemaLocation="http://www.w3.org/2001/xml.xsd"/>
34	+ <!-- Attributes Lists -->
35	+ <xsd:simpleType name="XTend">
36	+ <xsd:restriction base="xsd:string">
37	+ <xsd:pattern value="x-[^\s]+"/>
38	+ </xsd:restriction>
39	+ </xsd:simpleType>
40	+ <xsd:simpleType name="context-typeValueList">
41	+ <xsd:annotation>
42	+ <xsd:documentation>Values for the attribute 'context-type'.</xsd:documentation>
43	+ </xsd:annotation>
44	+ <xsd:restriction base="xsd:string">
45	+ <xsd:enumeration value="database">
46	+ <xsd:annotation>
47	+ <xsd:documentation>Indicates a database content.</xsd:documentation>
48	+ </xsd:annotation>
49	+ </xsd:enumeration>
50	+ <xsd:enumeration value="element">
51	+ <xsd:annotation>
52	+ <xsd:documentation>Indicates the content of an element within an XML document.</xsd:documentation>
53	+ </xsd:annotation>
54	+ </xsd:enumeration>
55	+ <xsd:enumeration value="elementtitle">
56	+ <xsd:annotation>
57	+ <xsd:documentation>Indicates the name of an element within an XML document.</xsd:documentation>
58	+ </xsd:annotation>
59	+ </xsd:enumeration>
60	+ <xsd:enumeration value="linenumber">
61	+ <xsd:annotation>
62	+ <xsd:documentation>Indicates the line number from the sourcefile (see context-type="sourcefile") where the <source> is found.</xsd:documentation>
63	+ </xsd:annotation>
64	+ </xsd:enumeration>
65	+ <xsd:enumeration value="numparams">
66	+ <xsd:annotation>
67	+ <xsd:documentation>Indicates a the number of parameters contained within the <source>.</xsd:documentation>
68	+ </xsd:annotation>
69	+ </xsd:enumeration>
70	+ <xsd:enumeration value="paramnotes">
71	+ <xsd:annotation>
72	+ <xsd:documentation>Indicates notes pertaining to the parameters in the <source>.</xsd:documentation>
73	+ </xsd:annotation>
74	+ </xsd:enumeration>
75	+ <xsd:enumeration value="record">
76	+ <xsd:annotation>
77	+ <xsd:documentation>Indicates the content of a record within a database.</xsd:documentation>
78	+ </xsd:annotation>
79	+ </xsd:enumeration>
80	+ <xsd:enumeration value="recordtitle">
81	+ <xsd:annotation>
82	+ <xsd:documentation>Indicates the name of a record within a database.</xsd:documentation>
83	+ </xsd:annotation>
84	+ </xsd:enumeration>
85	+ <xsd:enumeration value="sourcefile">
86	+ <xsd:annotation>
87	+ <xsd:documentation>Indicates the original source file in the case that multiple files are merged to form the original file from which the XLIFF file is created. This differs from the original <file> attribute in that this sourcefile is one of many that make up that file.</xsd:documentation>
88	+ </xsd:annotation>
89	+ </xsd:enumeration>
90	+ </xsd:restriction>
91	+ </xsd:simpleType>
92	+ <xsd:simpleType name="count-typeValueList">
93	+ <xsd:annotation>
94	+ <xsd:documentation>Values for the attribute 'count-type'.</xsd:documentation>
95	+ </xsd:annotation>
96	+ <xsd:restriction base="xsd:NMTOKEN">
97	+ <xsd:enumeration value="num-usages">
98	+ <xsd:annotation>
99	+ <xsd:documentation>Indicates the count units are items that are used X times in a certain context; example: this is a reusable text unit which is used 42 times in other texts.</xsd:documentation>
100	+ </xsd:annotation>
101	+ </xsd:enumeration>
102	+ <xsd:enumeration value="repetition">
103	+ <xsd:annotation>
104	+ <xsd:documentation>Indicates the count units are translation units existing already in the same document.</xsd:documentation>
105	+ </xsd:annotation>
106	+ </xsd:enumeration>
107	+ <xsd:enumeration value="total">
108	+ <xsd:annotation>
109	+ <xsd:documentation>Indicates a total count.</xsd:documentation>
110	+ </xsd:annotation>
111	+ </xsd:enumeration>
112	+ </xsd:restriction>
113	+ </xsd:simpleType>
114	+ <xsd:simpleType name="InlineDelimitersValueList">
115	+ <xsd:annotation>
116	+ <xsd:documentation>Values for the attribute 'ctype' when used other elements than <ph> or <x>.</xsd:documentation>
117	+ </xsd:annotation>
118	+ <xsd:restriction base="xsd:NMTOKEN">
119	+ <xsd:enumeration value="bold">
120	+ <xsd:annotation>
121	+ <xsd:documentation>Indicates a run of bolded text.</xsd:documentation>
122	+ </xsd:annotation>
123	+ </xsd:enumeration>
124	+ <xsd:enumeration value="italic">
125	+ <xsd:annotation>
126	+ <xsd:documentation>Indicates a run of text in italics.</xsd:documentation>
127	+ </xsd:annotation>
128	+ </xsd:enumeration>
129	+ <xsd:enumeration value="underlined">
130	+ <xsd:annotation>
131	+ <xsd:documentation>Indicates a run of underlined text.</xsd:documentation>
132	+ </xsd:annotation>
133	+ </xsd:enumeration>
134	+ <xsd:enumeration value="link">
135	+ <xsd:annotation>
136	+ <xsd:documentation>Indicates a run of hyper-text.</xsd:documentation>
137	+ </xsd:annotation>
138	+ </xsd:enumeration>
139	+ </xsd:restriction>
140	+ </xsd:simpleType>
141	+ <xsd:simpleType name="InlinePlaceholdersValueList">
142	+ <xsd:annotation>
143	+ <xsd:documentation>Values for the attribute 'ctype' when used with <ph> or <x>.</xsd:documentation>
144	+ </xsd:annotation>
145	+ <xsd:restriction base="xsd:NMTOKEN">
146	+ <xsd:enumeration value="image">
147	+ <xsd:annotation>
148	+ <xsd:documentation>Indicates a inline image.</xsd:documentation>
149	+ </xsd:annotation>
150	+ </xsd:enumeration>
151	+ <xsd:enumeration value="pb">
152	+ <xsd:annotation>
153	+ <xsd:documentation>Indicates a page break.</xsd:documentation>
154	+ </xsd:annotation>
155	+ </xsd:enumeration>
156	+ <xsd:enumeration value="lb">
157	+ <xsd:annotation>
158	+ <xsd:documentation>Indicates a line break.</xsd:documentation>
159	+ </xsd:annotation>
160	+ </xsd:enumeration>
161	+ </xsd:restriction>
162	+ </xsd:simpleType>
163	+ <xsd:simpleType name="mime-typeValueList">
164	+ <xsd:restriction base="xsd:string">
165	+ <xsd:pattern value="(text\|multipart\|message\|application\|image\|audio\|video\|model)(/.+)*"/>
166	+ </xsd:restriction>
167	+ </xsd:simpleType>
168	+ <xsd:simpleType name="datatypeValueList">
169	+ <xsd:annotation>
170	+ <xsd:documentation>Values for the attribute 'datatype'.</xsd:documentation>
171	+ </xsd:annotation>
172	+ <xsd:restriction base="xsd:NMTOKEN">
173	+ <xsd:enumeration value="asp">
174	+ <xsd:annotation>
175	+ <xsd:documentation>Indicates Active Server Page data.</xsd:documentation>
176	+ </xsd:annotation>
177	+ </xsd:enumeration>
178	+ <xsd:enumeration value="c">
179	+ <xsd:annotation>
180	+ <xsd:documentation>Indicates C source file data.</xsd:documentation>
181	+ </xsd:annotation>
182	+ </xsd:enumeration>
183	+ <xsd:enumeration value="cdf">
184	+ <xsd:annotation>
185	+ <xsd:documentation>Indicates Channel Definition Format (CDF) data.</xsd:documentation>
186	+ </xsd:annotation>
187	+ </xsd:enumeration>
188	+ <xsd:enumeration value="cfm">
189	+ <xsd:annotation>
190	+ <xsd:documentation>Indicates ColdFusion data.</xsd:documentation>
191	+ </xsd:annotation>
192	+ </xsd:enumeration>
193	+ <xsd:enumeration value="cpp">
194	+ <xsd:annotation>
195	+ <xsd:documentation>Indicates C++ source file data.</xsd:documentation>
196	+ </xsd:annotation>
197	+ </xsd:enumeration>
198	+ <xsd:enumeration value="csharp">
199	+ <xsd:annotation>
200	+ <xsd:documentation>Indicates C-Sharp data.</xsd:documentation>
201	+ </xsd:annotation>
202	+ </xsd:enumeration>
203	+ <xsd:enumeration value="cstring">
204	+ <xsd:annotation>
205	+ <xsd:documentation>Indicates strings from C, ASM, and driver files data.</xsd:documentation>
206	+ </xsd:annotation>
207	+ </xsd:enumeration>
208	+ <xsd:enumeration value="csv">
209	+ <xsd:annotation>
210	+ <xsd:documentation>Indicates comma-separated values data.</xsd:documentation>
211	+ </xsd:annotation>
212	+ </xsd:enumeration>
213	+ <xsd:enumeration value="database">
214	+ <xsd:annotation>
215	+ <xsd:documentation>Indicates database data.</xsd:documentation>
216	+ </xsd:annotation>
217	+ </xsd:enumeration>
218	+ <xsd:enumeration value="documentfooter">
219	+ <xsd:annotation>
220	+ <xsd:documentation>Indicates portions of document that follows data and contains metadata.</xsd:documentation>
221	+ </xsd:annotation>
222	+ </xsd:enumeration>
223	+ <xsd:enumeration value="documentheader">
224	+ <xsd:annotation>
225	+ <xsd:documentation>Indicates portions of document that precedes data and contains metadata.</xsd:documentation>
226	+ </xsd:annotation>
227	+ </xsd:enumeration>
228	+ <xsd:enumeration value="filedialog">
229	+ <xsd:annotation>
230	+ <xsd:documentation>Indicates data from standard UI file operations dialogs (e.g., Open, Save, Save As, Export, Import).</xsd:documentation>
231	+ </xsd:annotation>
232	+ </xsd:enumeration>
233	+ <xsd:enumeration value="form">
234	+ <xsd:annotation>
235	+ <xsd:documentation>Indicates standard user input screen data.</xsd:documentation>
236	+ </xsd:annotation>
237	+ </xsd:enumeration>
238	+ <xsd:enumeration value="html">
239	+ <xsd:annotation>
240	+ <xsd:documentation>Indicates HyperText Markup Language (HTML) data - document instance.</xsd:documentation>
241	+ </xsd:annotation>
242	+ </xsd:enumeration>
243	+ <xsd:enumeration value="htmlbody">
244	+ <xsd:annotation>
245	+ <xsd:documentation>Indicates content within an HTML document’s <body> element.</xsd:documentation>
246	+ </xsd:annotation>
247	+ </xsd:enumeration>
248	+ <xsd:enumeration value="ini">
249	+ <xsd:annotation>
250	+ <xsd:documentation>Indicates Windows INI file data.</xsd:documentation>
251	+ </xsd:annotation>
252	+ </xsd:enumeration>
253	+ <xsd:enumeration value="interleaf">
254	+ <xsd:annotation>
255	+ <xsd:documentation>Indicates Interleaf data.</xsd:documentation>
256	+ </xsd:annotation>
257	+ </xsd:enumeration>
258	+ <xsd:enumeration value="javaclass">
259	+ <xsd:annotation>
260	+ <xsd:documentation>Indicates Java source file data (extension '.java').</xsd:documentation>
261	+ </xsd:annotation>
262	+ </xsd:enumeration>
263	+ <xsd:enumeration value="javapropertyresourcebundle">
264	+ <xsd:annotation>
265	+ <xsd:documentation>Indicates Java property resource bundle data.</xsd:documentation>
266	+ </xsd:annotation>
267	+ </xsd:enumeration>
268	+ <xsd:enumeration value="javalistresourcebundle">
269	+ <xsd:annotation>
270	+ <xsd:documentation>Indicates Java list resource bundle data.</xsd:documentation>
271	+ </xsd:annotation>
272	+ </xsd:enumeration>
273	+ <xsd:enumeration value="javascript">
274	+ <xsd:annotation>
275	+ <xsd:documentation>Indicates JavaScript source file data.</xsd:documentation>
276	+ </xsd:annotation>
277	+ </xsd:enumeration>
278	+ <xsd:enumeration value="jscript">
279	+ <xsd:annotation>
280	+ <xsd:documentation>Indicates JScript source file data.</xsd:documentation>
281	+ </xsd:annotation>
282	+ </xsd:enumeration>
283	+ <xsd:enumeration value="layout">
284	+ <xsd:annotation>
285	+ <xsd:documentation>Indicates information relating to formatting.</xsd:documentation>
286	+ </xsd:annotation>
287	+ </xsd:enumeration>
288	+ <xsd:enumeration value="lisp">
289	+ <xsd:annotation>
290	+ <xsd:documentation>Indicates LISP source file data.</xsd:documentation>
291	+ </xsd:annotation>
292	+ </xsd:enumeration>
293	+ <xsd:enumeration value="margin">
294	+ <xsd:annotation>
295	+ <xsd:documentation>Indicates information relating to margin formats.</xsd:documentation>
296	+ </xsd:annotation>
297	+ </xsd:enumeration>
298	+ <xsd:enumeration value="menufile">
299	+ <xsd:annotation>
300	+ <xsd:documentation>Indicates a file containing menu.</xsd:documentation>
301	+ </xsd:annotation>
302	+ </xsd:enumeration>
303	+ <xsd:enumeration value="messagefile">
304	+ <xsd:annotation>
305	+ <xsd:documentation>Indicates numerically identified string table.</xsd:documentation>
306	+ </xsd:annotation>
307	+ </xsd:enumeration>
308	+ <xsd:enumeration value="mif">
309	+ <xsd:annotation>
310	+ <xsd:documentation>Indicates Maker Interchange Format (MIF) data.</xsd:documentation>
311	+ </xsd:annotation>
312	+ </xsd:enumeration>
313	+ <xsd:enumeration value="mimetype">
314	+ <xsd:annotation>
315	+ <xsd:documentation>Indicates that the datatype attribute value is a MIME Type value and is defined in the mime-type attribute.</xsd:documentation>
316	+ </xsd:annotation>
317	+ </xsd:enumeration>
318	+ <xsd:enumeration value="mo">
319	+ <xsd:annotation>
320	+ <xsd:documentation>Indicates GNU Machine Object data.</xsd:documentation>
321	+ </xsd:annotation>
322	+ </xsd:enumeration>
323	+ <xsd:enumeration value="msglib">
324	+ <xsd:annotation>
325	+ <xsd:documentation>Indicates Message Librarian strings created by Novell's Message Librarian Tool.</xsd:documentation>
326	+ </xsd:annotation>
327	+ </xsd:enumeration>
328	+ <xsd:enumeration value="pagefooter">
329	+ <xsd:annotation>
330	+ <xsd:documentation>Indicates information to be displayed at the bottom of each page of a document.</xsd:documentation>
331	+ </xsd:annotation>
332	+ </xsd:enumeration>
333	+ <xsd:enumeration value="pageheader">
334	+ <xsd:annotation>
335	+ <xsd:documentation>Indicates information to be displayed at the top of each page of a document.</xsd:documentation>
336	+ </xsd:annotation>
337	+ </xsd:enumeration>
338	+ <xsd:enumeration value="parameters">
339	+ <xsd:annotation>
340	+ <xsd:documentation>Indicates a list of property values (e.g., settings within INI files or preferences dialog).</xsd:documentation>
341	+ </xsd:annotation>
342	+ </xsd:enumeration>
343	+ <xsd:enumeration value="pascal">
344	+ <xsd:annotation>
345	+ <xsd:documentation>Indicates Pascal source file data.</xsd:documentation>
346	+ </xsd:annotation>
347	+ </xsd:enumeration>
348	+ <xsd:enumeration value="php">
349	+ <xsd:annotation>
350	+ <xsd:documentation>Indicates Hypertext Preprocessor data.</xsd:documentation>
351	+ </xsd:annotation>
352	+ </xsd:enumeration>
353	+ <xsd:enumeration value="plaintext">
354	+ <xsd:annotation>
355	+ <xsd:documentation>Indicates plain text file (no formatting other than, possibly, wrapping).</xsd:documentation>
356	+ </xsd:annotation>
357	+ </xsd:enumeration>
358	+ <xsd:enumeration value="po">
359	+ <xsd:annotation>
360	+ <xsd:documentation>Indicates GNU Portable Object file.</xsd:documentation>
361	+ </xsd:annotation>
362	+ </xsd:enumeration>
363	+ <xsd:enumeration value="report">
364	+ <xsd:annotation>
365	+ <xsd:documentation>Indicates dynamically generated user defined document. e.g. Oracle Report, Crystal Report, etc.</xsd:documentation>
366	+ </xsd:annotation>
367	+ </xsd:enumeration>
368	+ <xsd:enumeration value="resources">
369	+ <xsd:annotation>
370	+ <xsd:documentation>Indicates Windows .NET binary resources.</xsd:documentation>
371	+ </xsd:annotation>
372	+ </xsd:enumeration>
373	+ <xsd:enumeration value="resx">
374	+ <xsd:annotation>
375	+ <xsd:documentation>Indicates Windows .NET Resources.</xsd:documentation>
376	+ </xsd:annotation>
377	+ </xsd:enumeration>
378	+ <xsd:enumeration value="rtf">
379	+ <xsd:annotation>
380	+ <xsd:documentation>Indicates Rich Text Format (RTF) data.</xsd:documentation>
381	+ </xsd:annotation>
382	+ </xsd:enumeration>
383	+ <xsd:enumeration value="sgml">
384	+ <xsd:annotation>
385	+ <xsd:documentation>Indicates Standard Generalized Markup Language (SGML) data - document instance.</xsd:documentation>
386	+ </xsd:annotation>
387	+ </xsd:enumeration>
388	+ <xsd:enumeration value="sgmldtd">
389	+ <xsd:annotation>
390	+ <xsd:documentation>Indicates Standard Generalized Markup Language (SGML) data - Document Type Definition (DTD).</xsd:documentation>
391	+ </xsd:annotation>
392	+ </xsd:enumeration>
393	+ <xsd:enumeration value="svg">
394	+ <xsd:annotation>
395	+ <xsd:documentation>Indicates Scalable Vector Graphic (SVG) data.</xsd:documentation>
396	+ </xsd:annotation>
397	+ </xsd:enumeration>
398	+ <xsd:enumeration value="vbscript">
399	+ <xsd:annotation>
400	+ <xsd:documentation>Indicates VisualBasic Script source file.</xsd:documentation>
401	+ </xsd:annotation>
402	+ </xsd:enumeration>
403	+ <xsd:enumeration value="warning">
404	+ <xsd:annotation>
405	+ <xsd:documentation>Indicates warning message.</xsd:documentation>
406	+ </xsd:annotation>
407	+ </xsd:enumeration>
408	+ <xsd:enumeration value="winres">
409	+ <xsd:annotation>
410	+ <xsd:documentation>Indicates Windows (Win32) resources (i.e. resources extracted from an RC script, a message file, or a compiled file).</xsd:documentation>
411	+ </xsd:annotation>
412	+ </xsd:enumeration>
413	+ <xsd:enumeration value="xhtml">
414	+ <xsd:annotation>
415	+ <xsd:documentation>Indicates Extensible HyperText Markup Language (XHTML) data - document instance.</xsd:documentation>
416	+ </xsd:annotation>
417	+ </xsd:enumeration>
418	+ <xsd:enumeration value="xml">
419	+ <xsd:annotation>
420	+ <xsd:documentation>Indicates Extensible Markup Language (XML) data - document instance.</xsd:documentation>
421	+ </xsd:annotation>
422	+ </xsd:enumeration>
423	+ <xsd:enumeration value="xmldtd">
424	+ <xsd:annotation>
425	+ <xsd:documentation>Indicates Extensible Markup Language (XML) data - Document Type Definition (DTD).</xsd:documentation>
426	+ </xsd:annotation>
427	+ </xsd:enumeration>
428	+ <xsd:enumeration value="xsl">
429	+ <xsd:annotation>
430	+ <xsd:documentation>Indicates Extensible Stylesheet Language (XSL) data.</xsd:documentation>
431	+ </xsd:annotation>
432	+ </xsd:enumeration>
433	+ <xsd:enumeration value="xul">
434	+ <xsd:annotation>
435	+ <xsd:documentation>Indicates XUL elements.</xsd:documentation>
436	+ </xsd:annotation>
437	+ </xsd:enumeration>
438	+ </xsd:restriction>
439	+ </xsd:simpleType>
440	+ <xsd:simpleType name="mtypeValueList">
441	+ <xsd:annotation>
442	+ <xsd:documentation>Values for the attribute 'mtype'.</xsd:documentation>
443	+ </xsd:annotation>
444	+ <xsd:restriction base="xsd:NMTOKEN">
445	+ <xsd:enumeration value="abbrev">
446	+ <xsd:annotation>
447	+ <xsd:documentation>Indicates the marked text is an abbreviation.</xsd:documentation>
448	+ </xsd:annotation>
449	+ </xsd:enumeration>
450	+ <xsd:enumeration value="abbreviated-form">
451	+ <xsd:annotation>
452	+ <xsd:documentation>ISO-12620 2.1.8: A term resulting from the omission of any part of the full term while designating the same concept.</xsd:documentation>
453	+ </xsd:annotation>
454	+ </xsd:enumeration>
455	+ <xsd:enumeration value="abbreviation">
456	+ <xsd:annotation>
457	+ <xsd:documentation>ISO-12620 2.1.8.1: An abbreviated form of a simple term resulting from the omission of some of its letters (e.g. 'adj.' for 'adjective').</xsd:documentation>
458	+ </xsd:annotation>
459	+ </xsd:enumeration>
460	+ <xsd:enumeration value="acronym">
461	+ <xsd:annotation>
462	+ <xsd:documentation>ISO-12620 2.1.8.4: An abbreviated form of a term made up of letters from the full form of a multiword term strung together into a sequence pronounced only syllabically (e.g. 'radar' for 'radio detecting and ranging').</xsd:documentation>
463	+ </xsd:annotation>
464	+ </xsd:enumeration>
465	+ <xsd:enumeration value="appellation">
466	+ <xsd:annotation>
467	+ <xsd:documentation>ISO-12620: A proper-name term, such as the name of an agency or other proper entity.</xsd:documentation>
468	+ </xsd:annotation>
469	+ </xsd:enumeration>
470	+ <xsd:enumeration value="collocation">
471	+ <xsd:annotation>
472	+ <xsd:documentation>ISO-12620 2.1.18.1: A recurrent word combination characterized by cohesion in that the components of the collocation must co-occur within an utterance or series of utterances, even though they do not necessarily have to maintain immediate proximity to one another.</xsd:documentation>
473	+ </xsd:annotation>
474	+ </xsd:enumeration>
475	+ <xsd:enumeration value="common-name">
476	+ <xsd:annotation>
477	+ <xsd:documentation>ISO-12620 2.1.5: A synonym for an international scientific term that is used in general discourse in a given language.</xsd:documentation>
478	+ </xsd:annotation>
479	+ </xsd:enumeration>
480	+ <xsd:enumeration value="datetime">
481	+ <xsd:annotation>
482	+ <xsd:documentation>Indicates the marked text is a date and/or time.</xsd:documentation>
483	+ </xsd:annotation>
484	+ </xsd:enumeration>
485	+ <xsd:enumeration value="equation">
486	+ <xsd:annotation>
487	+ <xsd:documentation>ISO-12620 2.1.15: An expression used to represent a concept based on a statement that two mathematical expressions are, for instance, equal as identified by the equal sign (=), or assigned to one another by a similar sign.</xsd:documentation>
488	+ </xsd:annotation>
489	+ </xsd:enumeration>
490	+ <xsd:enumeration value="expanded-form">
491	+ <xsd:annotation>
492	+ <xsd:documentation>ISO-12620 2.1.7: The complete representation of a term for which there is an abbreviated form.</xsd:documentation>
493	+ </xsd:annotation>
494	+ </xsd:enumeration>
495	+ <xsd:enumeration value="formula">
496	+ <xsd:annotation>
497	+ <xsd:documentation>ISO-12620 2.1.14: Figures, symbols or the like used to express a concept briefly, such as a mathematical or chemical formula.</xsd:documentation>
498	+ </xsd:annotation>
499	+ </xsd:enumeration>
500	+ <xsd:enumeration value="head-term">
501	+ <xsd:annotation>
502	+ <xsd:documentation>ISO-12620 2.1.1: The concept designation that has been chosen to head a terminological record.</xsd:documentation>
503	+ </xsd:annotation>
504	+ </xsd:enumeration>
505	+ <xsd:enumeration value="initialism">
506	+ <xsd:annotation>
507	+ <xsd:documentation>ISO-12620 2.1.8.3: An abbreviated form of a term consisting of some of the initial letters of the words making up a multiword term or the term elements making up a compound term when these letters are pronounced individually (e.g. 'BSE' for 'bovine spongiform encephalopathy').</xsd:documentation>
508	+ </xsd:annotation>
509	+ </xsd:enumeration>
510	+ <xsd:enumeration value="international-scientific-term">
511	+ <xsd:annotation>
512	+ <xsd:documentation>ISO-12620 2.1.4: A term that is part of an international scientific nomenclature as adopted by an appropriate scientific body.</xsd:documentation>
513	+ </xsd:annotation>
514	+ </xsd:enumeration>
515	+ <xsd:enumeration value="internationalism">
516	+ <xsd:annotation>
517	+ <xsd:documentation>ISO-12620 2.1.6: A term that has the same or nearly identical orthographic or phonemic form in many languages.</xsd:documentation>
518	+ </xsd:annotation>
519	+ </xsd:enumeration>
520	+ <xsd:enumeration value="logical-expression">
521	+ <xsd:annotation>
522	+ <xsd:documentation>ISO-12620 2.1.16: An expression used to represent a concept based on mathematical or logical relations, such as statements of inequality, set relationships, Boolean operations, and the like.</xsd:documentation>
523	+ </xsd:annotation>
524	+ </xsd:enumeration>
525	+ <xsd:enumeration value="materials-management-unit">
526	+ <xsd:annotation>
527	+ <xsd:documentation>ISO-12620 2.1.17: A unit to track object.</xsd:documentation>
528	+ </xsd:annotation>
529	+ </xsd:enumeration>
530	+ <xsd:enumeration value="name">
531	+ <xsd:annotation>
532	+ <xsd:documentation>Indicates the marked text is a name.</xsd:documentation>
533	+ </xsd:annotation>
534	+ </xsd:enumeration>
535	+ <xsd:enumeration value="near-synonym">
536	+ <xsd:annotation>
537	+ <xsd:documentation>ISO-12620 2.1.3: A term that represents the same or a very similar concept as another term in the same language, but for which interchangeability is limited to some contexts and inapplicable in others.</xsd:documentation>
538	+ </xsd:annotation>
539	+ </xsd:enumeration>
540	+ <xsd:enumeration value="part-number">
541	+ <xsd:annotation>
542	+ <xsd:documentation>ISO-12620 2.1.17.2: A unique alphanumeric designation assigned to an object in a manufacturing system.</xsd:documentation>
543	+ </xsd:annotation>
544	+ </xsd:enumeration>
545	+ <xsd:enumeration value="phrase">
546	+ <xsd:annotation>
547	+ <xsd:documentation>Indicates the marked text is a phrase.</xsd:documentation>
548	+ </xsd:annotation>
549	+ </xsd:enumeration>
550	+ <xsd:enumeration value="phraseological-unit">
551	+ <xsd:annotation>
552	+ <xsd:documentation>ISO-12620 2.1.18: Any group of two or more words that form a unit, the meaning of which frequently cannot be deduced based on the combined sense of the words making up the phrase.</xsd:documentation>
553	+ </xsd:annotation>
554	+ </xsd:enumeration>
555	+ <xsd:enumeration value="protected">
556	+ <xsd:annotation>
557	+ <xsd:documentation>Indicates the marked text should not be translated.</xsd:documentation>
558	+ </xsd:annotation>
559	+ </xsd:enumeration>
560	+ <xsd:enumeration value="romanized-form">
561	+ <xsd:annotation>
562	+ <xsd:documentation>ISO-12620 2.1.12: A form of a term resulting from an operation whereby non-Latin writing systems are converted to the Latin alphabet.</xsd:documentation>
563	+ </xsd:annotation>
564	+ </xsd:enumeration>
565	+ <xsd:enumeration value="seg">
566	+ <xsd:annotation>
567	+ <xsd:documentation>Indicates that the marked text represents a segment.</xsd:documentation>
568	+ </xsd:annotation>
569	+ </xsd:enumeration>
570	+ <xsd:enumeration value="set-phrase">
571	+ <xsd:annotation>
572	+ <xsd:documentation>ISO-12620 2.1.18.2: A fixed, lexicalized phrase.</xsd:documentation>
573	+ </xsd:annotation>
574	+ </xsd:enumeration>
575	+ <xsd:enumeration value="short-form">
576	+ <xsd:annotation>
577	+ <xsd:documentation>ISO-12620 2.1.8.2: A variant of a multiword term that includes fewer words than the full form of the term (e.g. 'Group of Twenty-four' for 'Intergovernmental Group of Twenty-four on International Monetary Affairs').</xsd:documentation>
578	+ </xsd:annotation>
579	+ </xsd:enumeration>
580	+ <xsd:enumeration value="sku">
581	+ <xsd:annotation>
582	+ <xsd:documentation>ISO-12620 2.1.17.1: Stock keeping unit, an inventory item identified by a unique alphanumeric designation assigned to an object in an inventory control system.</xsd:documentation>
583	+ </xsd:annotation>
584	+ </xsd:enumeration>
585	+ <xsd:enumeration value="standard-text">
586	+ <xsd:annotation>
587	+ <xsd:documentation>ISO-12620 2.1.19: A fixed chunk of recurring text.</xsd:documentation>
588	+ </xsd:annotation>
589	+ </xsd:enumeration>
590	+ <xsd:enumeration value="symbol">
591	+ <xsd:annotation>
592	+ <xsd:documentation>ISO-12620 2.1.13: A designation of a concept by letters, numerals, pictograms or any combination thereof.</xsd:documentation>
593	+ </xsd:annotation>
594	+ </xsd:enumeration>
595	+ <xsd:enumeration value="synonym">
596	+ <xsd:annotation>
597	+ <xsd:documentation>ISO-12620 2.1.2: Any term that represents the same or a very similar concept as the main entry term in a term entry.</xsd:documentation>
598	+ </xsd:annotation>
599	+ </xsd:enumeration>
600	+ <xsd:enumeration value="synonymous-phrase">
601	+ <xsd:annotation>
602	+ <xsd:documentation>ISO-12620 2.1.18.3: Phraseological unit in a language that expresses the same semantic content as another phrase in that same language.</xsd:documentation>
603	+ </xsd:annotation>
604	+ </xsd:enumeration>
605	+ <xsd:enumeration value="term">
606	+ <xsd:annotation>
607	+ <xsd:documentation>Indicates the marked text is a term.</xsd:documentation>
608	+ </xsd:annotation>
609	+ </xsd:enumeration>
610	+ <xsd:enumeration value="transcribed-form">
611	+ <xsd:annotation>
612	+ <xsd:documentation>ISO-12620 2.1.11: A form of a term resulting from an operation whereby the characters of one writing system are represented by characters from another writing system, taking into account the pronunciation of the characters converted.</xsd:documentation>
613	+ </xsd:annotation>
614	+ </xsd:enumeration>
615	+ <xsd:enumeration value="transliterated-form">
616	+ <xsd:annotation>
617	+ <xsd:documentation>ISO-12620 2.1.10: A form of a term resulting from an operation whereby the characters of an alphabetic writing system are represented by characters from another alphabetic writing system.</xsd:documentation>
618	+ </xsd:annotation>
619	+ </xsd:enumeration>
620	+ <xsd:enumeration value="truncated-term">
621	+ <xsd:annotation>
622	+ <xsd:documentation>ISO-12620 2.1.8.5: An abbreviated form of a term resulting from the omission of one or more term elements or syllables (e.g. 'flu' for 'influenza').</xsd:documentation>
623	+ </xsd:annotation>
624	+ </xsd:enumeration>
625	+ <xsd:enumeration value="variant">
626	+ <xsd:annotation>
627	+ <xsd:documentation>ISO-12620 2.1.9: One of the alternate forms of a term.</xsd:documentation>
628	+ </xsd:annotation>
629	+ </xsd:enumeration>
630	+ </xsd:restriction>
631	+ </xsd:simpleType>
632	+ <xsd:simpleType name="restypeValueList">
633	+ <xsd:annotation>
634	+ <xsd:documentation>Values for the attribute 'restype'.</xsd:documentation>
635	+ </xsd:annotation>
636	+ <xsd:restriction base="xsd:NMTOKEN">
637	+ <xsd:enumeration value="auto3state">
638	+ <xsd:annotation>
639	+ <xsd:documentation>Indicates a Windows RC AUTO3STATE control.</xsd:documentation>
640	+ </xsd:annotation>
641	+ </xsd:enumeration>
642	+ <xsd:enumeration value="autocheckbox">
643	+ <xsd:annotation>
644	+ <xsd:documentation>Indicates a Windows RC AUTOCHECKBOX control.</xsd:documentation>
645	+ </xsd:annotation>
646	+ </xsd:enumeration>
647	+ <xsd:enumeration value="autoradiobutton">
648	+ <xsd:annotation>
649	+ <xsd:documentation>Indicates a Windows RC AUTORADIOBUTTON control.</xsd:documentation>
650	+ </xsd:annotation>
651	+ </xsd:enumeration>
652	+ <xsd:enumeration value="bedit">
653	+ <xsd:annotation>
654	+ <xsd:documentation>Indicates a Windows RC BEDIT control.</xsd:documentation>
655	+ </xsd:annotation>
656	+ </xsd:enumeration>
657	+ <xsd:enumeration value="bitmap">
658	+ <xsd:annotation>
659	+ <xsd:documentation>Indicates a bitmap, for example a BITMAP resource in Windows.</xsd:documentation>
660	+ </xsd:annotation>
661	+ </xsd:enumeration>
662	+ <xsd:enumeration value="button">
663	+ <xsd:annotation>
664	+ <xsd:documentation>Indicates a button object, for example a BUTTON control Windows.</xsd:documentation>
665	+ </xsd:annotation>
666	+ </xsd:enumeration>
667	+ <xsd:enumeration value="caption">
668	+ <xsd:annotation>
669	+ <xsd:documentation>Indicates a caption, such as the caption of a dialog box.</xsd:documentation>
670	+ </xsd:annotation>
671	+ </xsd:enumeration>
672	+ <xsd:enumeration value="cell">
673	+ <xsd:annotation>
674	+ <xsd:documentation>Indicates the cell in a table, for example the content of the <td> element in HTML.</xsd:documentation>
675	+ </xsd:annotation>
676	+ </xsd:enumeration>
677	+ <xsd:enumeration value="checkbox">
678	+ <xsd:annotation>
679	+ <xsd:documentation>Indicates check box object, for example a CHECKBOX control in Windows.</xsd:documentation>
680	+ </xsd:annotation>
681	+ </xsd:enumeration>
682	+ <xsd:enumeration value="checkboxmenuitem">
683	+ <xsd:annotation>
684	+ <xsd:documentation>Indicates a menu item with an associated checkbox.</xsd:documentation>
685	+ </xsd:annotation>
686	+ </xsd:enumeration>
687	+ <xsd:enumeration value="checkedlistbox">
688	+ <xsd:annotation>
689	+ <xsd:documentation>Indicates a list box, but with a check-box for each item.</xsd:documentation>
690	+ </xsd:annotation>
691	+ </xsd:enumeration>
692	+ <xsd:enumeration value="colorchooser">
693	+ <xsd:annotation>
694	+ <xsd:documentation>Indicates a color selection dialog.</xsd:documentation>
695	+ </xsd:annotation>
696	+ </xsd:enumeration>
697	+ <xsd:enumeration value="combobox">
698	+ <xsd:annotation>
699	+ <xsd:documentation>Indicates a combination of edit box and listbox object, for example a COMBOBOX control in Windows.</xsd:documentation>
700	+ </xsd:annotation>
701	+ </xsd:enumeration>
702	+ <xsd:enumeration value="comboboxexitem">
703	+ <xsd:annotation>
704	+ <xsd:documentation>Indicates an initialization entry of an extended combobox DLGINIT resource block. (code 0x1234).</xsd:documentation>
705	+ </xsd:annotation>
706	+ </xsd:enumeration>
707	+ <xsd:enumeration value="comboboxitem">
708	+ <xsd:annotation>
709	+ <xsd:documentation>Indicates an initialization entry of a combobox DLGINIT resource block (code 0x0403).</xsd:documentation>
710	+ </xsd:annotation>
711	+ </xsd:enumeration>
712	+ <xsd:enumeration value="component">
713	+ <xsd:annotation>
714	+ <xsd:documentation>Indicates a UI base class element that cannot be represented by any other element.</xsd:documentation>
715	+ </xsd:annotation>
716	+ </xsd:enumeration>
717	+ <xsd:enumeration value="contextmenu">
718	+ <xsd:annotation>
719	+ <xsd:documentation>Indicates a context menu.</xsd:documentation>
720	+ </xsd:annotation>
721	+ </xsd:enumeration>
722	+ <xsd:enumeration value="ctext">
723	+ <xsd:annotation>
724	+ <xsd:documentation>Indicates a Windows RC CTEXT control.</xsd:documentation>
725	+ </xsd:annotation>
726	+ </xsd:enumeration>
727	+ <xsd:enumeration value="cursor">
728	+ <xsd:annotation>
729	+ <xsd:documentation>Indicates a cursor, for example a CURSOR resource in Windows.</xsd:documentation>
730	+ </xsd:annotation>
731	+ </xsd:enumeration>
732	+ <xsd:enumeration value="datetimepicker">
733	+ <xsd:annotation>
734	+ <xsd:documentation>Indicates a date/time picker.</xsd:documentation>
735	+ </xsd:annotation>
736	+ </xsd:enumeration>
737	+ <xsd:enumeration value="defpushbutton">
738	+ <xsd:annotation>
739	+ <xsd:documentation>Indicates a Windows RC DEFPUSHBUTTON control.</xsd:documentation>
740	+ </xsd:annotation>
741	+ </xsd:enumeration>
742	+ <xsd:enumeration value="dialog">
743	+ <xsd:annotation>
744	+ <xsd:documentation>Indicates a dialog box.</xsd:documentation>
745	+ </xsd:annotation>
746	+ </xsd:enumeration>
747	+ <xsd:enumeration value="dlginit">
748	+ <xsd:annotation>
749	+ <xsd:documentation>Indicates a Windows RC DLGINIT resource block.</xsd:documentation>
750	+ </xsd:annotation>
751	+ </xsd:enumeration>
752	+ <xsd:enumeration value="edit">
753	+ <xsd:annotation>
754	+ <xsd:documentation>Indicates an edit box object, for example an EDIT control in Windows.</xsd:documentation>
755	+ </xsd:annotation>
756	+ </xsd:enumeration>
757	+ <xsd:enumeration value="file">
758	+ <xsd:annotation>
759	+ <xsd:documentation>Indicates a filename.</xsd:documentation>
760	+ </xsd:annotation>
761	+ </xsd:enumeration>
762	+ <xsd:enumeration value="filechooser">
763	+ <xsd:annotation>
764	+ <xsd:documentation>Indicates a file dialog.</xsd:documentation>
765	+ </xsd:annotation>
766	+ </xsd:enumeration>
767	+ <xsd:enumeration value="fn">
768	+ <xsd:annotation>
769	+ <xsd:documentation>Indicates a footnote.</xsd:documentation>
770	+ </xsd:annotation>
771	+ </xsd:enumeration>
772	+ <xsd:enumeration value="font">
773	+ <xsd:annotation>
774	+ <xsd:documentation>Indicates a font name.</xsd:documentation>
775	+ </xsd:annotation>
776	+ </xsd:enumeration>
777	+ <xsd:enumeration value="footer">
778	+ <xsd:annotation>
779	+ <xsd:documentation>Indicates a footer.</xsd:documentation>
780	+ </xsd:annotation>
781	+ </xsd:enumeration>
782	+ <xsd:enumeration value="frame">
783	+ <xsd:annotation>
784	+ <xsd:documentation>Indicates a frame object.</xsd:documentation>
785	+ </xsd:annotation>
786	+ </xsd:enumeration>
787	+ <xsd:enumeration value="grid">
788	+ <xsd:annotation>
789	+ <xsd:documentation>Indicates a XUL grid element.</xsd:documentation>
790	+ </xsd:annotation>
791	+ </xsd:enumeration>
792	+ <xsd:enumeration value="groupbox">
793	+ <xsd:annotation>
794	+ <xsd:documentation>Indicates a groupbox object, for example a GROUPBOX control in Windows.</xsd:documentation>
795	+ </xsd:annotation>
796	+ </xsd:enumeration>
797	+ <xsd:enumeration value="header">
798	+ <xsd:annotation>
799	+ <xsd:documentation>Indicates a header item.</xsd:documentation>
800	+ </xsd:annotation>
801	+ </xsd:enumeration>
802	+ <xsd:enumeration value="heading">
803	+ <xsd:annotation>
804	+ <xsd:documentation>Indicates a heading, such has the content of <h1>, <h2>, etc. in HTML.</xsd:documentation>
805	+ </xsd:annotation>
806	+ </xsd:enumeration>
807	+ <xsd:enumeration value="hedit">
808	+ <xsd:annotation>
809	+ <xsd:documentation>Indicates a Windows RC HEDIT control.</xsd:documentation>
810	+ </xsd:annotation>
811	+ </xsd:enumeration>
812	+ <xsd:enumeration value="hscrollbar">
813	+ <xsd:annotation>
814	+ <xsd:documentation>Indicates a horizontal scrollbar.</xsd:documentation>
815	+ </xsd:annotation>
816	+ </xsd:enumeration>
817	+ <xsd:enumeration value="icon">
818	+ <xsd:annotation>
819	+ <xsd:documentation>Indicates an icon, for example an ICON resource in Windows.</xsd:documentation>
820	+ </xsd:annotation>
821	+ </xsd:enumeration>
822	+ <xsd:enumeration value="iedit">
823	+ <xsd:annotation>
824	+ <xsd:documentation>Indicates a Windows RC IEDIT control.</xsd:documentation>
825	+ </xsd:annotation>
826	+ </xsd:enumeration>
827	+ <xsd:enumeration value="keywords">
828	+ <xsd:annotation>
829	+ <xsd:documentation>Indicates keyword list, such as the content of the Keywords meta-data in HTML, or a K footnote in WinHelp RTF.</xsd:documentation>
830	+ </xsd:annotation>
831	+ </xsd:enumeration>
832	+ <xsd:enumeration value="label">
833	+ <xsd:annotation>
834	+ <xsd:documentation>Indicates a label object.</xsd:documentation>
835	+ </xsd:annotation>
836	+ </xsd:enumeration>
837	+ <xsd:enumeration value="linklabel">
838	+ <xsd:annotation>
839	+ <xsd:documentation>Indicates a label that is also a HTML link (not necessarily a URL).</xsd:documentation>
840	+ </xsd:annotation>
841	+ </xsd:enumeration>
842	+ <xsd:enumeration value="list">
843	+ <xsd:annotation>
844	+ <xsd:documentation>Indicates a list (a group of list-items, for example an <ol> or <ul> element in HTML).</xsd:documentation>
845	+ </xsd:annotation>
846	+ </xsd:enumeration>
847	+ <xsd:enumeration value="listbox">
848	+ <xsd:annotation>
849	+ <xsd:documentation>Indicates a listbox object, for example an LISTBOX control in Windows.</xsd:documentation>
850	+ </xsd:annotation>
851	+ </xsd:enumeration>
852	+ <xsd:enumeration value="listitem">
853	+ <xsd:annotation>
854	+ <xsd:documentation>Indicates an list item (an entry in a list).</xsd:documentation>
855	+ </xsd:annotation>
856	+ </xsd:enumeration>
857	+ <xsd:enumeration value="ltext">
858	+ <xsd:annotation>
859	+ <xsd:documentation>Indicates a Windows RC LTEXT control.</xsd:documentation>
860	+ </xsd:annotation>
861	+ </xsd:enumeration>
862	+ <xsd:enumeration value="menu">
863	+ <xsd:annotation>
864	+ <xsd:documentation>Indicates a menu (a group of menu-items).</xsd:documentation>
865	+ </xsd:annotation>
866	+ </xsd:enumeration>
867	+ <xsd:enumeration value="menubar">
868	+ <xsd:annotation>
869	+ <xsd:documentation>Indicates a toolbar containing one or more tope level menus.</xsd:documentation>
870	+ </xsd:annotation>
871	+ </xsd:enumeration>
872	+ <xsd:enumeration value="menuitem">
873	+ <xsd:annotation>
874	+ <xsd:documentation>Indicates a menu item (an entry in a menu).</xsd:documentation>
875	+ </xsd:annotation>
876	+ </xsd:enumeration>
877	+ <xsd:enumeration value="menuseparator">
878	+ <xsd:annotation>
879	+ <xsd:documentation>Indicates a XUL menuseparator element.</xsd:documentation>
880	+ </xsd:annotation>
881	+ </xsd:enumeration>
882	+ <xsd:enumeration value="message">
883	+ <xsd:annotation>
884	+ <xsd:documentation>Indicates a message, for example an entry in a MESSAGETABLE resource in Windows.</xsd:documentation>
885	+ </xsd:annotation>
886	+ </xsd:enumeration>
887	+ <xsd:enumeration value="monthcalendar">
888	+ <xsd:annotation>
889	+ <xsd:documentation>Indicates a calendar control.</xsd:documentation>
890	+ </xsd:annotation>
891	+ </xsd:enumeration>
892	+ <xsd:enumeration value="numericupdown">
893	+ <xsd:annotation>
894	+ <xsd:documentation>Indicates an edit box beside a spin control.</xsd:documentation>
895	+ </xsd:annotation>
896	+ </xsd:enumeration>
897	+ <xsd:enumeration value="panel">
898	+ <xsd:annotation>
899	+ <xsd:documentation>Indicates a catch all for rectangular areas.</xsd:documentation>
900	+ </xsd:annotation>
901	+ </xsd:enumeration>
902	+ <xsd:enumeration value="popupmenu">
903	+ <xsd:annotation>
904	+ <xsd:documentation>Indicates a standalone menu not necessarily associated with a menubar.</xsd:documentation>
905	+ </xsd:annotation>
906	+ </xsd:enumeration>
907	+ <xsd:enumeration value="pushbox">
908	+ <xsd:annotation>
909	+ <xsd:documentation>Indicates a pushbox object, for example a PUSHBOX control in Windows.</xsd:documentation>
910	+ </xsd:annotation>
911	+ </xsd:enumeration>
912	+ <xsd:enumeration value="pushbutton">
913	+ <xsd:annotation>
914	+ <xsd:documentation>Indicates a Windows RC PUSHBUTTON control.</xsd:documentation>
915	+ </xsd:annotation>
916	+ </xsd:enumeration>
917	+ <xsd:enumeration value="radio">
918	+ <xsd:annotation>
919	+ <xsd:documentation>Indicates a radio button object.</xsd:documentation>
920	+ </xsd:annotation>
921	+ </xsd:enumeration>
922	+ <xsd:enumeration value="radiobuttonmenuitem">
923	+ <xsd:annotation>
924	+ <xsd:documentation>Indicates a menuitem with associated radio button.</xsd:documentation>
925	+ </xsd:annotation>
926	+ </xsd:enumeration>
927	+ <xsd:enumeration value="rcdata">
928	+ <xsd:annotation>
929	+ <xsd:documentation>Indicates raw data resources for an application.</xsd:documentation>
930	+ </xsd:annotation>
931	+ </xsd:enumeration>
932	+ <xsd:enumeration value="row">
933	+ <xsd:annotation>
934	+ <xsd:documentation>Indicates a row in a table.</xsd:documentation>
935	+ </xsd:annotation>
936	+ </xsd:enumeration>
937	+ <xsd:enumeration value="rtext">
938	+ <xsd:annotation>
939	+ <xsd:documentation>Indicates a Windows RC RTEXT control.</xsd:documentation>
940	+ </xsd:annotation>
941	+ </xsd:enumeration>
942	+ <xsd:enumeration value="scrollpane">
943	+ <xsd:annotation>
944	+ <xsd:documentation>Indicates a user navigable container used to show a portion of a document.</xsd:documentation>
945	+ </xsd:annotation>
946	+ </xsd:enumeration>
947	+ <xsd:enumeration value="separator">
948	+ <xsd:annotation>
949	+ <xsd:documentation>Indicates a generic divider object (e.g. menu group separator).</xsd:documentation>
950	+ </xsd:annotation>
951	+ </xsd:enumeration>
952	+ <xsd:enumeration value="shortcut">
953	+ <xsd:annotation>
954	+ <xsd:documentation>Windows accelerators, shortcuts in resource or property files.</xsd:documentation>
955	+ </xsd:annotation>
956	+ </xsd:enumeration>
957	+ <xsd:enumeration value="spinner">
958	+ <xsd:annotation>
959	+ <xsd:documentation>Indicates a UI control to indicate process activity but not progress.</xsd:documentation>
960	+ </xsd:annotation>
961	+ </xsd:enumeration>
962	+ <xsd:enumeration value="splitter">
963	+ <xsd:annotation>
964	+ <xsd:documentation>Indicates a splitter bar.</xsd:documentation>
965	+ </xsd:annotation>
966	+ </xsd:enumeration>
967	+ <xsd:enumeration value="state3">
968	+ <xsd:annotation>
969	+ <xsd:documentation>Indicates a Windows RC STATE3 control.</xsd:documentation>
970	+ </xsd:annotation>
971	+ </xsd:enumeration>
972	+ <xsd:enumeration value="statusbar">
973	+ <xsd:annotation>
974	+ <xsd:documentation>Indicates a window for providing feedback to the users, like 'read-only', etc.</xsd:documentation>
975	+ </xsd:annotation>
976	+ </xsd:enumeration>
977	+ <xsd:enumeration value="string">
978	+ <xsd:annotation>
979	+ <xsd:documentation>Indicates a string, for example an entry in a STRINGTABLE resource in Windows.</xsd:documentation>
980	+ </xsd:annotation>
981	+ </xsd:enumeration>
982	+ <xsd:enumeration value="tabcontrol">
983	+ <xsd:annotation>
984	+ <xsd:documentation>Indicates a layers of controls with a tab to select layers.</xsd:documentation>
985	+ </xsd:annotation>
986	+ </xsd:enumeration>
987	+ <xsd:enumeration value="table">
988	+ <xsd:annotation>
989	+ <xsd:documentation>Indicates a display and edits regular two-dimensional tables of cells.</xsd:documentation>
990	+ </xsd:annotation>
991	+ </xsd:enumeration>
992	+ <xsd:enumeration value="textbox">
993	+ <xsd:annotation>
994	+ <xsd:documentation>Indicates a XUL textbox element.</xsd:documentation>
995	+ </xsd:annotation>
996	+ </xsd:enumeration>
997	+ <xsd:enumeration value="togglebutton">
998	+ <xsd:annotation>
999	+ <xsd:documentation>Indicates a UI button that can be toggled to on or off state.</xsd:documentation>
1000	+ </xsd:annotation>
1001	+ </xsd:enumeration>
1002	+ <xsd:enumeration value="toolbar">
1003	+ <xsd:annotation>
1004	+ <xsd:documentation>Indicates an array of controls, usually buttons.</xsd:documentation>
1005	+ </xsd:annotation>
1006	+ </xsd:enumeration>
1007	+ <xsd:enumeration value="tooltip">
1008	+ <xsd:annotation>
1009	+ <xsd:documentation>Indicates a pop up tool tip text.</xsd:documentation>
1010	+ </xsd:annotation>
1011	+ </xsd:enumeration>
1012	+ <xsd:enumeration value="trackbar">
1013	+ <xsd:annotation>
1014	+ <xsd:documentation>Indicates a bar with a pointer indicating a position within a certain range.</xsd:documentation>
1015	+ </xsd:annotation>
1016	+ </xsd:enumeration>
1017	+ <xsd:enumeration value="tree">
1018	+ <xsd:annotation>
1019	+ <xsd:documentation>Indicates a control that displays a set of hierarchical data.</xsd:documentation>
1020	+ </xsd:annotation>
1021	+ </xsd:enumeration>
1022	+ <xsd:enumeration value="uri">
1023	+ <xsd:annotation>
1024	+ <xsd:documentation>Indicates a URI (URN or URL).</xsd:documentation>
1025	+ </xsd:annotation>
1026	+ </xsd:enumeration>
1027	+ <xsd:enumeration value="userbutton">
1028	+ <xsd:annotation>
1029	+ <xsd:documentation>Indicates a Windows RC USERBUTTON control.</xsd:documentation>
1030	+ </xsd:annotation>
1031	+ </xsd:enumeration>
1032	+ <xsd:enumeration value="usercontrol">
1033	+ <xsd:annotation>
1034	+ <xsd:documentation>Indicates a user-defined control like CONTROL control in Windows.</xsd:documentation>
1035	+ </xsd:annotation>
1036	+ </xsd:enumeration>
1037	+ <xsd:enumeration value="var">
1038	+ <xsd:annotation>
1039	+ <xsd:documentation>Indicates the text of a variable.</xsd:documentation>
1040	+ </xsd:annotation>
1041	+ </xsd:enumeration>
1042	+ <xsd:enumeration value="versioninfo">
1043	+ <xsd:annotation>
1044	+ <xsd:documentation>Indicates version information about a resource like VERSIONINFO in Windows.</xsd:documentation>
1045	+ </xsd:annotation>
1046	+ </xsd:enumeration>
1047	+ <xsd:enumeration value="vscrollbar">
1048	+ <xsd:annotation>
1049	+ <xsd:documentation>Indicates a vertical scrollbar.</xsd:documentation>
1050	+ </xsd:annotation>
1051	+ </xsd:enumeration>
1052	+ <xsd:enumeration value="window">
1053	+ <xsd:annotation>
1054	+ <xsd:documentation>Indicates a graphical window.</xsd:documentation>
1055	+ </xsd:annotation>
1056	+ </xsd:enumeration>
1057	+ </xsd:restriction>
1058	+ </xsd:simpleType>
1059	+ <xsd:simpleType name="size-unitValueList">
1060	+ <xsd:annotation>
1061	+ <xsd:documentation>Values for the attribute 'size-unit'.</xsd:documentation>
1062	+ </xsd:annotation>
1063	+ <xsd:restriction base="xsd:NMTOKEN">
1064	+ <xsd:enumeration value="byte">
1065	+ <xsd:annotation>
1066	+ <xsd:documentation>Indicates a size in 8-bit bytes.</xsd:documentation>
1067	+ </xsd:annotation>
1068	+ </xsd:enumeration>
1069	+ <xsd:enumeration value="char">
1070	+ <xsd:annotation>
1071	+ <xsd:documentation>Indicates a size in Unicode characters.</xsd:documentation>
1072	+ </xsd:annotation>
1073	+ </xsd:enumeration>
1074	+ <xsd:enumeration value="col">
1075	+ <xsd:annotation>
1076	+ <xsd:documentation>Indicates a size in columns. Used for HTML text area.</xsd:documentation>
1077	+ </xsd:annotation>
1078	+ </xsd:enumeration>
1079	+ <xsd:enumeration value="cm">
1080	+ <xsd:annotation>
1081	+ <xsd:documentation>Indicates a size in centimeters.</xsd:documentation>
1082	+ </xsd:annotation>
1083	+ </xsd:enumeration>
1084	+ <xsd:enumeration value="dlgunit">
1085	+ <xsd:annotation>
1086	+ <xsd:documentation>Indicates a size in dialog units, as defined in Windows resources.</xsd:documentation>
1087	+ </xsd:annotation>
1088	+ </xsd:enumeration>
1089	+ <xsd:enumeration value="em">
1090	+ <xsd:annotation>
1091	+ <xsd:documentation>Indicates a size in 'font-size' units (as defined in CSS).</xsd:documentation>
1092	+ </xsd:annotation>
1093	+ </xsd:enumeration>
1094	+ <xsd:enumeration value="ex">
1095	+ <xsd:annotation>
1096	+ <xsd:documentation>Indicates a size in 'x-height' units (as defined in CSS).</xsd:documentation>
1097	+ </xsd:annotation>
1098	+ </xsd:enumeration>
1099	+ <xsd:enumeration value="glyph">
1100	+ <xsd:annotation>
1101	+ <xsd:documentation>Indicates a size in glyphs. A glyph is considered to be one or more combined Unicode characters that represent a single displayable text character. Sometimes referred to as a 'grapheme cluster'</xsd:documentation>
1102	+ </xsd:annotation>
1103	+ </xsd:enumeration>
1104	+ <xsd:enumeration value="in">
1105	+ <xsd:annotation>
1106	+ <xsd:documentation>Indicates a size in inches.</xsd:documentation>
1107	+ </xsd:annotation>
1108	+ </xsd:enumeration>
1109	+ <xsd:enumeration value="mm">
1110	+ <xsd:annotation>
1111	+ <xsd:documentation>Indicates a size in millimeters.</xsd:documentation>
1112	+ </xsd:annotation>
1113	+ </xsd:enumeration>
1114	+ <xsd:enumeration value="percent">
1115	+ <xsd:annotation>
1116	+ <xsd:documentation>Indicates a size in percentage.</xsd:documentation>
1117	+ </xsd:annotation>
1118	+ </xsd:enumeration>
1119	+ <xsd:enumeration value="pixel">
1120	+ <xsd:annotation>
1121	+ <xsd:documentation>Indicates a size in pixels.</xsd:documentation>
1122	+ </xsd:annotation>
1123	+ </xsd:enumeration>
1124	+ <xsd:enumeration value="point">
1125	+ <xsd:annotation>
1126	+ <xsd:documentation>Indicates a size in point.</xsd:documentation>
1127	+ </xsd:annotation>
1128	+ </xsd:enumeration>
1129	+ <xsd:enumeration value="row">
1130	+ <xsd:annotation>
1131	+ <xsd:documentation>Indicates a size in rows. Used for HTML text area.</xsd:documentation>
1132	+ </xsd:annotation>
1133	+ </xsd:enumeration>
1134	+ </xsd:restriction>
1135	+ </xsd:simpleType>
1136	+ <xsd:simpleType name="stateValueList">
1137	+ <xsd:annotation>
1138	+ <xsd:documentation>Values for the attribute 'state'.</xsd:documentation>
1139	+ </xsd:annotation>
1140	+ <xsd:restriction base="xsd:NMTOKEN">
1141	+ <xsd:enumeration value="final">
1142	+ <xsd:annotation>
1143	+ <xsd:documentation>Indicates the terminating state.</xsd:documentation>
1144	+ </xsd:annotation>
1145	+ </xsd:enumeration>
1146	+ <xsd:enumeration value="needs-adaptation">
1147	+ <xsd:annotation>
1148	+ <xsd:documentation>Indicates only non-textual information needs adaptation.</xsd:documentation>
1149	+ </xsd:annotation>
1150	+ </xsd:enumeration>
1151	+ <xsd:enumeration value="needs-l10n">
1152	+ <xsd:annotation>
1153	+ <xsd:documentation>Indicates both text and non-textual information needs adaptation.</xsd:documentation>
1154	+ </xsd:annotation>
1155	+ </xsd:enumeration>
1156	+ <xsd:enumeration value="needs-review-adaptation">
1157	+ <xsd:annotation>
1158	+ <xsd:documentation>Indicates only non-textual information needs review.</xsd:documentation>
1159	+ </xsd:annotation>
1160	+ </xsd:enumeration>
1161	+ <xsd:enumeration value="needs-review-l10n">
1162	+ <xsd:annotation>
1163	+ <xsd:documentation>Indicates both text and non-textual information needs review.</xsd:documentation>
1164	+ </xsd:annotation>
1165	+ </xsd:enumeration>
1166	+ <xsd:enumeration value="needs-review-translation">
1167	+ <xsd:annotation>
1168	+ <xsd:documentation>Indicates that only the text of the item needs to be reviewed.</xsd:documentation>
1169	+ </xsd:annotation>
1170	+ </xsd:enumeration>
1171	+ <xsd:enumeration value="needs-translation">
1172	+ <xsd:annotation>
1173	+ <xsd:documentation>Indicates that the item needs to be translated.</xsd:documentation>
1174	+ </xsd:annotation>
1175	+ </xsd:enumeration>
1176	+ <xsd:enumeration value="new">
1177	+ <xsd:annotation>
1178	+ <xsd:documentation>Indicates that the item is new. For example, translation units that were not in a previous version of the document.</xsd:documentation>
1179	+ </xsd:annotation>
1180	+ </xsd:enumeration>
1181	+ <xsd:enumeration value="signed-off">
1182	+ <xsd:annotation>
1183	+ <xsd:documentation>Indicates that changes are reviewed and approved.</xsd:documentation>
1184	+ </xsd:annotation>
1185	+ </xsd:enumeration>
1186	+ <xsd:enumeration value="translated">
1187	+ <xsd:annotation>
1188	+ <xsd:documentation>Indicates that the item has been translated.</xsd:documentation>
1189	+ </xsd:annotation>
1190	+ </xsd:enumeration>
1191	+ </xsd:restriction>
1192	+ </xsd:simpleType>
1193	+ <xsd:simpleType name="state-qualifierValueList">
1194	+ <xsd:annotation>
1195	+ <xsd:documentation>Values for the attribute 'state-qualifier'.</xsd:documentation>
1196	+ </xsd:annotation>
1197	+ <xsd:restriction base="xsd:NMTOKEN">
1198	+ <xsd:enumeration value="exact-match">
1199	+ <xsd:annotation>
1200	+ <xsd:documentation>Indicates an exact match. An exact match occurs when a source text of a segment is exactly the same as the source text of a segment that was translated previously.</xsd:documentation>
1201	+ </xsd:annotation>
1202	+ </xsd:enumeration>
1203	+ <xsd:enumeration value="fuzzy-match">
1204	+ <xsd:annotation>
1205	+ <xsd:documentation>Indicates a fuzzy match. A fuzzy match occurs when a source text of a segment is very similar to the source text of a segment that was translated previously (e.g. when the difference is casing, a few changed words, white-space discripancy, etc.).</xsd:documentation>
1206	+ </xsd:annotation>
1207	+ </xsd:enumeration>
1208	+ <xsd:enumeration value="id-match">
1209	+ <xsd:annotation>
1210	+ <xsd:documentation>Indicates a match based on matching IDs (in addition to matching text).</xsd:documentation>
1211	+ </xsd:annotation>
1212	+ </xsd:enumeration>
1213	+ <xsd:enumeration value="leveraged-glossary">
1214	+ <xsd:annotation>
1215	+ <xsd:documentation>Indicates a translation derived from a glossary.</xsd:documentation>
1216	+ </xsd:annotation>
1217	+ </xsd:enumeration>
1218	+ <xsd:enumeration value="leveraged-inherited">
1219	+ <xsd:annotation>
1220	+ <xsd:documentation>Indicates a translation derived from existing translation.</xsd:documentation>
1221	+ </xsd:annotation>
1222	+ </xsd:enumeration>
1223	+ <xsd:enumeration value="leveraged-mt">
1224	+ <xsd:annotation>
1225	+ <xsd:documentation>Indicates a translation derived from machine translation.</xsd:documentation>
1226	+ </xsd:annotation>
1227	+ </xsd:enumeration>
1228	+ <xsd:enumeration value="leveraged-repository">
1229	+ <xsd:annotation>
1230	+ <xsd:documentation>Indicates a translation derived from a translation repository.</xsd:documentation>
1231	+ </xsd:annotation>
1232	+ </xsd:enumeration>
1233	+ <xsd:enumeration value="leveraged-tm">
1234	+ <xsd:annotation>
1235	+ <xsd:documentation>Indicates a translation derived from a translation memory.</xsd:documentation>
1236	+ </xsd:annotation>
1237	+ </xsd:enumeration>
1238	+ <xsd:enumeration value="mt-suggestion">
1239	+ <xsd:annotation>
1240	+ <xsd:documentation>Indicates the translation is suggested by machine translation.</xsd:documentation>
1241	+ </xsd:annotation>
1242	+ </xsd:enumeration>
1243	+ <xsd:enumeration value="rejected-grammar">
1244	+ <xsd:annotation>
1245	+ <xsd:documentation>Indicates that the item has been rejected because of incorrect grammar.</xsd:documentation>
1246	+ </xsd:annotation>
1247	+ </xsd:enumeration>
1248	+ <xsd:enumeration value="rejected-inaccurate">
1249	+ <xsd:annotation>
1250	+ <xsd:documentation>Indicates that the item has been rejected because it is incorrect.</xsd:documentation>
1251	+ </xsd:annotation>
1252	+ </xsd:enumeration>
1253	+ <xsd:enumeration value="rejected-length">
1254	+ <xsd:annotation>
1255	+ <xsd:documentation>Indicates that the item has been rejected because it is too long or too short.</xsd:documentation>
1256	+ </xsd:annotation>
1257	+ </xsd:enumeration>
1258	+ <xsd:enumeration value="rejected-spelling">
1259	+ <xsd:annotation>
1260	+ <xsd:documentation>Indicates that the item has been rejected because of incorrect spelling.</xsd:documentation>
1261	+ </xsd:annotation>
1262	+ </xsd:enumeration>
1263	+ <xsd:enumeration value="tm-suggestion">
1264	+ <xsd:annotation>
1265	+ <xsd:documentation>Indicates the translation is suggested by translation memory.</xsd:documentation>
1266	+ </xsd:annotation>
1267	+ </xsd:enumeration>
1268	+ </xsd:restriction>
1269	+ </xsd:simpleType>
1270	+ <xsd:simpleType name="unitValueList">
1271	+ <xsd:annotation>
1272	+ <xsd:documentation>Values for the attribute 'unit'.</xsd:documentation>
1273	+ </xsd:annotation>
1274	+ <xsd:restriction base="xsd:NMTOKEN">
1275	+ <xsd:enumeration value="word">
1276	+ <xsd:annotation>
1277	+ <xsd:documentation>Refers to words.</xsd:documentation>
1278	+ </xsd:annotation>
1279	+ </xsd:enumeration>
1280	+ <xsd:enumeration value="page">
1281	+ <xsd:annotation>
1282	+ <xsd:documentation>Refers to pages.</xsd:documentation>
1283	+ </xsd:annotation>
1284	+ </xsd:enumeration>
1285	+ <xsd:enumeration value="trans-unit">
1286	+ <xsd:annotation>
1287	+ <xsd:documentation>Refers to <trans-unit> elements.</xsd:documentation>
1288	+ </xsd:annotation>
1289	+ </xsd:enumeration>
1290	+ <xsd:enumeration value="bin-unit">
1291	+ <xsd:annotation>
1292	+ <xsd:documentation>Refers to <bin-unit> elements.</xsd:documentation>
1293	+ </xsd:annotation>
1294	+ </xsd:enumeration>
1295	+ <xsd:enumeration value="glyph">
1296	+ <xsd:annotation>
1297	+ <xsd:documentation>Refers to glyphs.</xsd:documentation>
1298	+ </xsd:annotation>
1299	+ </xsd:enumeration>
1300	+ <xsd:enumeration value="item">
1301	+ <xsd:annotation>
1302	+ <xsd:documentation>Refers to <trans-unit> and/or <bin-unit> elements.</xsd:documentation>
1303	+ </xsd:annotation>
1304	+ </xsd:enumeration>
1305	+ <xsd:enumeration value="instance">
1306	+ <xsd:annotation>
1307	+ <xsd:documentation>Refers to the occurrences of instances defined by the count-type value.</xsd:documentation>
1308	+ </xsd:annotation>
1309	+ </xsd:enumeration>
1310	+ <xsd:enumeration value="character">
1311	+ <xsd:annotation>
1312	+ <xsd:documentation>Refers to characters.</xsd:documentation>
1313	+ </xsd:annotation>
1314	+ </xsd:enumeration>
1315	+ <xsd:enumeration value="line">
1316	+ <xsd:annotation>
1317	+ <xsd:documentation>Refers to lines.</xsd:documentation>
1318	+ </xsd:annotation>
1319	+ </xsd:enumeration>
1320	+ <xsd:enumeration value="sentence">
1321	+ <xsd:annotation>
1322	+ <xsd:documentation>Refers to sentences.</xsd:documentation>
1323	+ </xsd:annotation>
1324	+ </xsd:enumeration>
1325	+ <xsd:enumeration value="paragraph">
1326	+ <xsd:annotation>
1327	+ <xsd:documentation>Refers to paragraphs.</xsd:documentation>
1328	+ </xsd:annotation>
1329	+ </xsd:enumeration>
1330	+ <xsd:enumeration value="segment">
1331	+ <xsd:annotation>
1332	+ <xsd:documentation>Refers to segments.</xsd:documentation>
1333	+ </xsd:annotation>
1334	+ </xsd:enumeration>
1335	+ <xsd:enumeration value="placeable">
1336	+ <xsd:annotation>
1337	+ <xsd:documentation>Refers to placeables (inline elements).</xsd:documentation>
1338	+ </xsd:annotation>
1339	+ </xsd:enumeration>
1340	+ </xsd:restriction>
1341	+ </xsd:simpleType>
1342	+ <xsd:simpleType name="priorityValueList">
1343	+ <xsd:annotation>
1344	+ <xsd:documentation>Values for the attribute 'priority'.</xsd:documentation>
1345	+ </xsd:annotation>
1346	+ <xsd:restriction base="xsd:positiveInteger">
1347	+ <xsd:enumeration value="1">
1348	+ <xsd:annotation>
1349	+ <xsd:documentation>Highest priority.</xsd:documentation>
1350	+ </xsd:annotation>
1351	+ </xsd:enumeration>
1352	+ <xsd:enumeration value="2">
1353	+ <xsd:annotation>
1354	+ <xsd:documentation>High priority.</xsd:documentation>
1355	+ </xsd:annotation>
1356	+ </xsd:enumeration>
1357	+ <xsd:enumeration value="3">
1358	+ <xsd:annotation>
1359	+ <xsd:documentation>High priority, but not as important as 2.</xsd:documentation>
1360	+ </xsd:annotation>
1361	+ </xsd:enumeration>
1362	+ <xsd:enumeration value="4">
1363	+ <xsd:annotation>
1364	+ <xsd:documentation>High priority, but not as important as 3.</xsd:documentation>
1365	+ </xsd:annotation>
1366	+ </xsd:enumeration>
1367	+ <xsd:enumeration value="5">
1368	+ <xsd:annotation>
1369	+ <xsd:documentation>Medium priority, but more important than 6.</xsd:documentation>
1370	+ </xsd:annotation>
1371	+ </xsd:enumeration>
1372	+ <xsd:enumeration value="6">
1373	+ <xsd:annotation>
1374	+ <xsd:documentation>Medium priority, but less important than 5.</xsd:documentation>
1375	+ </xsd:annotation>
1376	+ </xsd:enumeration>
1377	+ <xsd:enumeration value="7">
1378	+ <xsd:annotation>
1379	+ <xsd:documentation>Low priority, but more important than 8.</xsd:documentation>
1380	+ </xsd:annotation>
1381	+ </xsd:enumeration>
1382	+ <xsd:enumeration value="8">
1383	+ <xsd:annotation>
1384	+ <xsd:documentation>Low priority, but more important than 9.</xsd:documentation>
1385	+ </xsd:annotation>
1386	+ </xsd:enumeration>
1387	+ <xsd:enumeration value="9">
1388	+ <xsd:annotation>
1389	+ <xsd:documentation>Low priority.</xsd:documentation>
1390	+ </xsd:annotation>
1391	+ </xsd:enumeration>
1392	+ <xsd:enumeration value="10">
1393	+ <xsd:annotation>
1394	+ <xsd:documentation>Lowest priority.</xsd:documentation>
1395	+ </xsd:annotation>
1396	+ </xsd:enumeration>
1397	+ </xsd:restriction>
1398	+ </xsd:simpleType>
1399	+ <xsd:simpleType name="reformatValueYesNo">
1400	+ <xsd:restriction base="xsd:string">
1401	+ <xsd:enumeration value="yes">
1402	+ <xsd:annotation>
1403	+ <xsd:documentation>This value indicates that all properties can be reformatted. This value must be used alone.</xsd:documentation>
1404	+ </xsd:annotation>
1405	+ </xsd:enumeration>
1406	+ <xsd:enumeration value="no">
1407	+ <xsd:annotation>
1408	+ <xsd:documentation>This value indicates that no properties should be reformatted. This value must be used alone.</xsd:documentation>
1409	+ </xsd:annotation>
1410	+ </xsd:enumeration>
1411	+ </xsd:restriction>
1412	+ </xsd:simpleType>
1413	+ <xsd:simpleType name="reformatValueList">
1414	+ <xsd:list>
1415	+ <xsd:simpleType>
1416	+ <xsd:union memberTypes="xlf:XTend">
1417	+ <xsd:simpleType>
1418	+ <xsd:restriction base="xsd:string">
1419	+ <xsd:enumeration value="coord">
1420	+ <xsd:annotation>
1421	+ <xsd:documentation>This value indicates that all information in the coord attribute can be modified.</xsd:documentation>
1422	+ </xsd:annotation>
1423	+ </xsd:enumeration>
1424	+ <xsd:enumeration value="coord-x">
1425	+ <xsd:annotation>
1426	+ <xsd:documentation>This value indicates that the x information in the coord attribute can be modified.</xsd:documentation>
1427	+ </xsd:annotation>
1428	+ </xsd:enumeration>
1429	+ <xsd:enumeration value="coord-y">
1430	+ <xsd:annotation>
1431	+ <xsd:documentation>This value indicates that the y information in the coord attribute can be modified.</xsd:documentation>
1432	+ </xsd:annotation>
1433	+ </xsd:enumeration>
1434	+ <xsd:enumeration value="coord-cx">
1435	+ <xsd:annotation>
1436	+ <xsd:documentation>This value indicates that the cx information in the coord attribute can be modified.</xsd:documentation>
1437	+ </xsd:annotation>
1438	+ </xsd:enumeration>
1439	+ <xsd:enumeration value="coord-cy">
1440	+ <xsd:annotation>
1441	+ <xsd:documentation>This value indicates that the cy information in the coord attribute can be modified.</xsd:documentation>
1442	+ </xsd:annotation>
1443	+ </xsd:enumeration>
1444	+ <xsd:enumeration value="font">
1445	+ <xsd:annotation>
1446	+ <xsd:documentation>This value indicates that all the information in the font attribute can be modified.</xsd:documentation>
1447	+ </xsd:annotation>
1448	+ </xsd:enumeration>
1449	+ <xsd:enumeration value="font-name">
1450	+ <xsd:annotation>
1451	+ <xsd:documentation>This value indicates that the name information in the font attribute can be modified.</xsd:documentation>
1452	+ </xsd:annotation>
1453	+ </xsd:enumeration>
1454	+ <xsd:enumeration value="font-size">
1455	+ <xsd:annotation>
1456	+ <xsd:documentation>This value indicates that the size information in the font attribute can be modified.</xsd:documentation>
1457	+ </xsd:annotation>
1458	+ </xsd:enumeration>
1459	+ <xsd:enumeration value="font-weight">
1460	+ <xsd:annotation>
1461	+ <xsd:documentation>This value indicates that the weight information in the font attribute can be modified.</xsd:documentation>
1462	+ </xsd:annotation>
1463	+ </xsd:enumeration>
1464	+ <xsd:enumeration value="css-style">
1465	+ <xsd:annotation>
1466	+ <xsd:documentation>This value indicates that the information in the css-style attribute can be modified.</xsd:documentation>
1467	+ </xsd:annotation>
1468	+ </xsd:enumeration>
1469	+ <xsd:enumeration value="style">
1470	+ <xsd:annotation>
1471	+ <xsd:documentation>This value indicates that the information in the style attribute can be modified.</xsd:documentation>
1472	+ </xsd:annotation>
1473	+ </xsd:enumeration>
1474	+ <xsd:enumeration value="ex-style">
1475	+ <xsd:annotation>
1476	+ <xsd:documentation>This value indicates that the information in the exstyle attribute can be modified.</xsd:documentation>
1477	+ </xsd:annotation>
1478	+ </xsd:enumeration>
1479	+ </xsd:restriction>
1480	+ </xsd:simpleType>
1481	+ </xsd:union>
1482	+ </xsd:simpleType>
1483	+ </xsd:list>
1484	+ </xsd:simpleType>
1485	+ <xsd:simpleType name="purposeValueList">
1486	+ <xsd:restriction base="xsd:string">
1487	+ <xsd:enumeration value="information">
1488	+ <xsd:annotation>
1489	+ <xsd:documentation>Indicates that the context is informational in nature, specifying for example, how a term should be translated. Thus, should be displayed to anyone editing the XLIFF document.</xsd:documentation>
1490	+ </xsd:annotation>
1491	+ </xsd:enumeration>
1492	+ <xsd:enumeration value="location">
1493	+ <xsd:annotation>
1494	+ <xsd:documentation>Indicates that the context-group is used to specify where the term was found in the translatable source. Thus, it is not displayed.</xsd:documentation>
1495	+ </xsd:annotation>
1496	+ </xsd:enumeration>
1497	+ <xsd:enumeration value="match">
1498	+ <xsd:annotation>
1499	+ <xsd:documentation>Indicates that the context information should be used during translation memory lookups. Thus, it is not displayed.</xsd:documentation>
1500	+ </xsd:annotation>
1501	+ </xsd:enumeration>
1502	+ </xsd:restriction>
1503	+ </xsd:simpleType>
1504	+ <xsd:simpleType name="alttranstypeValueList">
1505	+ <xsd:restriction base="xsd:string">
1506	+ <xsd:enumeration value="proposal">
1507	+ <xsd:annotation>
1508	+ <xsd:documentation>Represents a translation proposal from a translation memory or other resource.</xsd:documentation>
1509	+ </xsd:annotation>
1510	+ </xsd:enumeration>
1511	+ <xsd:enumeration value="previous-version">
1512	+ <xsd:annotation>
1513	+ <xsd:documentation>Represents a previous version of the target element.</xsd:documentation>
1514	+ </xsd:annotation>
1515	+ </xsd:enumeration>
1516	+ <xsd:enumeration value="rejected">
1517	+ <xsd:annotation>
1518	+ <xsd:documentation>Represents a rejected version of the target element.</xsd:documentation>
1519	+ </xsd:annotation>
1520	+ </xsd:enumeration>
1521	+ <xsd:enumeration value="reference">
1522	+ <xsd:annotation>
1523	+ <xsd:documentation>Represents a translation to be used for reference purposes only, for example from a related product or a different language.</xsd:documentation>
1524	+ </xsd:annotation>
1525	+ </xsd:enumeration>
1526	+ <xsd:enumeration value="accepted">
1527	+ <xsd:annotation>
1528	+ <xsd:documentation>Represents a proposed translation that was used for the translation of the trans-unit, possibly modified.</xsd:documentation>
1529	+ </xsd:annotation>
1530	+ </xsd:enumeration>
1531	+ </xsd:restriction>
1532	+ </xsd:simpleType>
1533	+ <!-- Other Types -->
1534	+ <xsd:complexType name="ElemType_ExternalReference">
1535	+ <xsd:choice>
1536	+ <xsd:element ref="xlf:internal-file"/>
1537	+ <xsd:element ref="xlf:external-file"/>
1538	+ </xsd:choice>
1539	+ </xsd:complexType>
1540	+ <xsd:simpleType name="AttrType_purpose">
1541	+ <xsd:list>
1542	+ <xsd:simpleType>
1543	+ <xsd:union memberTypes="xlf:purposeValueList xlf:XTend"/>
1544	+ </xsd:simpleType>
1545	+ </xsd:list>
1546	+ </xsd:simpleType>
1547	+ <xsd:simpleType name="AttrType_datatype">
1548	+ <xsd:union memberTypes="xlf:datatypeValueList xlf:XTend"/>
1549	+ </xsd:simpleType>
1550	+ <xsd:simpleType name="AttrType_restype">
1551	+ <xsd:union memberTypes="xlf:restypeValueList xlf:XTend"/>
1552	+ </xsd:simpleType>
1553	+ <xsd:simpleType name="AttrType_alttranstype">
1554	+ <xsd:union memberTypes="xlf:alttranstypeValueList xlf:XTend"/>
1555	+ </xsd:simpleType>
1556	+ <xsd:simpleType name="AttrType_context-type">
1557	+ <xsd:union memberTypes="xlf:context-typeValueList xlf:XTend"/>
1558	+ </xsd:simpleType>
1559	+ <xsd:simpleType name="AttrType_state">
1560	+ <xsd:union memberTypes="xlf:stateValueList xlf:XTend"/>
1561	+ </xsd:simpleType>
1562	+ <xsd:simpleType name="AttrType_state-qualifier">
1563	+ <xsd:union memberTypes="xlf:state-qualifierValueList xlf:XTend"/>
1564	+ </xsd:simpleType>
1565	+ <xsd:simpleType name="AttrType_count-type">
1566	+ <xsd:union memberTypes="xlf:restypeValueList xlf:count-typeValueList xlf:datatypeValueList xlf:stateValueList xlf:state-qualifierValueList xlf:XTend"/>
1567	+ </xsd:simpleType>
1568	+ <xsd:simpleType name="AttrType_InlineDelimiters">
1569	+ <xsd:union memberTypes="xlf:InlineDelimitersValueList xlf:XTend"/>
1570	+ </xsd:simpleType>
1571	+ <xsd:simpleType name="AttrType_InlinePlaceholders">
1572	+ <xsd:union memberTypes="xlf:InlinePlaceholdersValueList xlf:XTend"/>
1573	+ </xsd:simpleType>
1574	+ <xsd:simpleType name="AttrType_size-unit">
1575	+ <xsd:union memberTypes="xlf:size-unitValueList xlf:XTend"/>
1576	+ </xsd:simpleType>
1577	+ <xsd:simpleType name="AttrType_mtype">
1578	+ <xsd:union memberTypes="xlf:mtypeValueList xlf:XTend"/>
1579	+ </xsd:simpleType>
1580	+ <xsd:simpleType name="AttrType_unit">
1581	+ <xsd:union memberTypes="xlf:unitValueList xlf:XTend"/>
1582	+ </xsd:simpleType>
1583	+ <xsd:simpleType name="AttrType_priority">
1584	+ <xsd:union memberTypes="xlf:priorityValueList"/>
1585	+ </xsd:simpleType>
1586	+ <xsd:simpleType name="AttrType_reformat">
1587	+ <xsd:union memberTypes="xlf:reformatValueYesNo xlf:reformatValueList"/>
1588	+ </xsd:simpleType>
1589	+ <xsd:simpleType name="AttrType_YesNo">
1590	+ <xsd:restriction base="xsd:NMTOKEN">
1591	+ <xsd:enumeration value="yes"/>
1592	+ <xsd:enumeration value="no"/>
1593	+ </xsd:restriction>
1594	+ </xsd:simpleType>
1595	+ <xsd:simpleType name="AttrType_Position">
1596	+ <xsd:restriction base="xsd:NMTOKEN">
1597	+ <xsd:enumeration value="open"/>
1598	+ <xsd:enumeration value="close"/>
1599	+ </xsd:restriction>
1600	+ </xsd:simpleType>
1601	+ <xsd:simpleType name="AttrType_assoc">
1602	+ <xsd:restriction base="xsd:NMTOKEN">
1603	+ <xsd:enumeration value="preceding"/>
1604	+ <xsd:enumeration value="following"/>
1605	+ <xsd:enumeration value="both"/>
1606	+ </xsd:restriction>
1607	+ </xsd:simpleType>
1608	+ <xsd:simpleType name="AttrType_annotates">
1609	+ <xsd:restriction base="xsd:NMTOKEN">
1610	+ <xsd:enumeration value="source"/>
1611	+ <xsd:enumeration value="target"/>
1612	+ <xsd:enumeration value="general"/>
1613	+ </xsd:restriction>
1614	+ </xsd:simpleType>
1615	+ <xsd:simpleType name="AttrType_Coordinates">
1616	+ <xsd:annotation>
1617	+ <xsd:documentation>Values for the attribute 'coord'.</xsd:documentation>
1618	+ </xsd:annotation>
1619	+ <xsd:restriction base="xsd:string">
1620	+ <xsd:pattern value="(-?\d+\|#);(-?\d+\|#);(-?\d+\|#);(-?\d+\|#)"/>
1621	+ </xsd:restriction>
1622	+ </xsd:simpleType>
1623	+ <xsd:simpleType name="AttrType_Version">
1624	+ <xsd:annotation>
1625	+ <xsd:documentation>Version values: 1.0 and 1.1 are allowed for backward compatibility.</xsd:documentation>
1626	+ </xsd:annotation>
1627	+ <xsd:restriction base="xsd:string">
1628	+ <xsd:enumeration value="1.2"/>
1629	+ <xsd:enumeration value="1.1"/>
1630	+ <xsd:enumeration value="1.0"/>
1631	+ </xsd:restriction>
1632	+ </xsd:simpleType>
1633	+ <!-- Groups -->
1634	+ <xsd:group name="ElemGroup_TextContent">
1635	+ <xsd:choice>
1636	+ <xsd:element ref="xlf:g"/>
1637	+ <xsd:element ref="xlf:bpt"/>
1638	+ <xsd:element ref="xlf:ept"/>
1639	+ <xsd:element ref="xlf:ph"/>
1640	+ <xsd:element ref="xlf:it"/>
1641	+ <xsd:element ref="xlf:mrk"/>
1642	+ <xsd:element ref="xlf:x"/>
1643	+ <xsd:element ref="xlf:bx"/>
1644	+ <xsd:element ref="xlf:ex"/>
1645	+ </xsd:choice>
1646	+ </xsd:group>
1647	+ <xsd:attributeGroup name="AttrGroup_TextContent">
1648	+ <xsd:attribute name="id" type="xsd:string" use="required"/>
1649	+ <xsd:attribute name="xid" type="xsd:string" use="optional"/>
1650	+ <xsd:attribute name="equiv-text" type="xsd:string" use="optional"/>
1651	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
1652	+ </xsd:attributeGroup>
1653	+ <!-- XLIFF Structure -->
1654	+ <xsd:element name="xliff">
1655	+ <xsd:complexType>
1656	+ <xsd:sequence maxOccurs="unbounded">
1657	+ <xsd:any maxOccurs="unbounded" minOccurs="0" namespace="##other" processContents="strict"/>
1658	+ <xsd:element ref="xlf:file"/>
1659	+ </xsd:sequence>
1660	+ <xsd:attribute name="version" type="xlf:AttrType_Version" use="required"/>
1661	+ <xsd:attribute ref="xml:lang" use="optional"/>
1662	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
1663	+ </xsd:complexType>
1664	+ </xsd:element>
1665	+ <xsd:element name="file">
1666	+ <xsd:complexType>
1667	+ <xsd:sequence>
1668	+ <xsd:element minOccurs="0" ref="xlf:header"/>
1669	+ <xsd:element ref="xlf:body"/>
1670	+ </xsd:sequence>
1671	+ <xsd:attribute name="original" type="xsd:string" use="required"/>
1672	+ <xsd:attribute name="source-language" type="xsd:language" use="required"/>
1673	+ <xsd:attribute name="datatype" type="xlf:AttrType_datatype" use="required"/>
1674	+ <xsd:attribute name="tool-id" type="xsd:string" use="optional"/>
1675	+ <xsd:attribute name="date" type="xsd:dateTime" use="optional"/>
1676	+ <xsd:attribute ref="xml:space" use="optional"/>
1677	+ <xsd:attribute name="category" type="xsd:string" use="optional"/>
1678	+ <xsd:attribute name="target-language" type="xsd:language" use="optional"/>
1679	+ <xsd:attribute name="product-name" type="xsd:string" use="optional"/>
1680	+ <xsd:attribute name="product-version" type="xsd:string" use="optional"/>
1681	+ <xsd:attribute name="build-num" type="xsd:string" use="optional"/>
1682	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
1683	+ </xsd:complexType>
1684	+ <xsd:unique name="U_group_id">
1685	+ <xsd:selector xpath=".//xlf:group"/>
1686	+ <xsd:field xpath="@id"/>
1687	+ </xsd:unique>
1688	+ <xsd:key name="K_unit_id">
1689	+ <xsd:selector xpath=".//xlf:trans-unit\|.//xlf:bin-unit"/>
1690	+ <xsd:field xpath="@id"/>
1691	+ </xsd:key>
1692	+ <xsd:keyref name="KR_unit_id" refer="xlf:K_unit_id">
1693	+ <xsd:selector xpath=".//bpt\|.//ept\|.//it\|.//ph\|.//g\|.//x\|.//bx\|.//ex\|.//sub"/>
1694	+ <xsd:field xpath="@xid"/>
1695	+ </xsd:keyref>
1696	+ <xsd:key name="K_tool-id">
1697	+ <xsd:selector xpath="xlf:header/xlf:tool"/>
1698	+ <xsd:field xpath="@tool-id"/>
1699	+ </xsd:key>
1700	+ <xsd:keyref name="KR_file_tool-id" refer="xlf:K_tool-id">
1701	+ <xsd:selector xpath="."/>
1702	+ <xsd:field xpath="@tool-id"/>
1703	+ </xsd:keyref>
1704	+ <xsd:keyref name="KR_phase_tool-id" refer="xlf:K_tool-id">
1705	+ <xsd:selector xpath="xlf:header/xlf:phase-group/xlf:phase"/>
1706	+ <xsd:field xpath="@tool-id"/>
1707	+ </xsd:keyref>
1708	+ <xsd:keyref name="KR_alt-trans_tool-id" refer="xlf:K_tool-id">
1709	+ <xsd:selector xpath=".//xlf:trans-unit/xlf:alt-trans"/>
1710	+ <xsd:field xpath="@tool-id"/>
1711	+ </xsd:keyref>
1712	+ <xsd:key name="K_count-group_name">
1713	+ <xsd:selector xpath=".//xlf:count-group"/>
1714	+ <xsd:field xpath="@name"/>
1715	+ </xsd:key>
1716	+ <xsd:unique name="U_context-group_name">
1717	+ <xsd:selector xpath=".//xlf:context-group"/>
1718	+ <xsd:field xpath="@name"/>
1719	+ </xsd:unique>
1720	+ <xsd:key name="K_phase-name">
1721	+ <xsd:selector xpath="xlf:header/xlf:phase-group/xlf:phase"/>
1722	+ <xsd:field xpath="@phase-name"/>
1723	+ </xsd:key>
1724	+ <xsd:keyref name="KR_phase-name" refer="xlf:K_phase-name">
1725	+ <xsd:selector xpath=".//xlf:count\|.//xlf:trans-unit\|.//xlf:target\|.//bin-unit\|.//bin-target"/>
1726	+ <xsd:field xpath="@phase-name"/>
1727	+ </xsd:keyref>
1728	+ <xsd:unique name="U_uid">
1729	+ <xsd:selector xpath=".//xlf:external-file"/>
1730	+ <xsd:field xpath="@uid"/>
1731	+ </xsd:unique>
1732	+ </xsd:element>
1733	+ <xsd:element name="header">
1734	+ <xsd:complexType>
1735	+ <xsd:sequence>
1736	+ <xsd:element minOccurs="0" name="skl" type="xlf:ElemType_ExternalReference"/>
1737	+ <xsd:element minOccurs="0" ref="xlf:phase-group"/>
1738	+ <xsd:choice maxOccurs="unbounded" minOccurs="0">
1739	+ <xsd:element name="glossary" type="xlf:ElemType_ExternalReference"/>
1740	+ <xsd:element name="reference" type="xlf:ElemType_ExternalReference"/>
1741	+ <xsd:element ref="xlf:count-group"/>
1742	+ <xsd:element ref="xlf:note"/>
1743	+ <xsd:element ref="xlf:tool"/>
1744	+ </xsd:choice>
1745	+ <xsd:any maxOccurs="unbounded" minOccurs="0" namespace="##other" processContents="strict"/>
1746	+ </xsd:sequence>
1747	+ </xsd:complexType>
1748	+ </xsd:element>
1749	+ <xsd:element name="internal-file">
1750	+ <xsd:complexType>
1751	+ <xsd:simpleContent>
1752	+ <xsd:extension base="xsd:string">
1753	+ <xsd:attribute name="form" type="xsd:string"/>
1754	+ <xsd:attribute name="crc" type="xsd:NMTOKEN"/>
1755	+ </xsd:extension>
1756	+ </xsd:simpleContent>
1757	+ </xsd:complexType>
1758	+ </xsd:element>
1759	+ <xsd:element name="external-file">
1760	+ <xsd:complexType>
1761	+ <xsd:attribute name="href" type="xsd:string" use="required"/>
1762	+ <xsd:attribute name="crc" type="xsd:NMTOKEN"/>
1763	+ <xsd:attribute name="uid" type="xsd:NMTOKEN"/>
1764	+ </xsd:complexType>
1765	+ </xsd:element>
1766	+ <xsd:element name="note">
1767	+ <xsd:complexType>
1768	+ <xsd:simpleContent>
1769	+ <xsd:extension base="xsd:string">
1770	+ <xsd:attribute ref="xml:lang" use="optional"/>
1771	+ <xsd:attribute default="1" name="priority" type="xlf:AttrType_priority" use="optional"/>
1772	+ <xsd:attribute name="from" type="xsd:string" use="optional"/>
1773	+ <xsd:attribute default="general" name="annotates" type="xlf:AttrType_annotates" use="optional"/>
1774	+ </xsd:extension>
1775	+ </xsd:simpleContent>
1776	+ </xsd:complexType>
1777	+ </xsd:element>
1778	+ <xsd:element name="phase-group">
1779	+ <xsd:complexType>
1780	+ <xsd:sequence maxOccurs="unbounded">
1781	+ <xsd:element ref="xlf:phase"/>
1782	+ </xsd:sequence>
1783	+ </xsd:complexType>
1784	+ </xsd:element>
1785	+ <xsd:element name="phase">
1786	+ <xsd:complexType>
1787	+ <xsd:sequence maxOccurs="unbounded" minOccurs="0">
1788	+ <xsd:element ref="xlf:note"/>
1789	+ </xsd:sequence>
1790	+ <xsd:attribute name="phase-name" type="xsd:string" use="required"/>
1791	+ <xsd:attribute name="process-name" type="xsd:string" use="required"/>
1792	+ <xsd:attribute name="company-name" type="xsd:string" use="optional"/>
1793	+ <xsd:attribute name="tool-id" type="xsd:string" use="optional"/>
1794	+ <xsd:attribute name="date" type="xsd:dateTime" use="optional"/>
1795	+ <xsd:attribute name="job-id" type="xsd:string" use="optional"/>
1796	+ <xsd:attribute name="contact-name" type="xsd:string" use="optional"/>
1797	+ <xsd:attribute name="contact-email" type="xsd:string" use="optional"/>
1798	+ <xsd:attribute name="contact-phone" type="xsd:string" use="optional"/>
1799	+ </xsd:complexType>
1800	+ </xsd:element>
1801	+ <xsd:element name="count-group">
1802	+ <xsd:complexType>
1803	+ <xsd:sequence maxOccurs="unbounded" minOccurs="0">
1804	+ <xsd:element ref="xlf:count"/>
1805	+ </xsd:sequence>
1806	+ <xsd:attribute name="name" type="xsd:string" use="required"/>
1807	+ </xsd:complexType>
1808	+ </xsd:element>
1809	+ <xsd:element name="count">
1810	+ <xsd:complexType>
1811	+ <xsd:simpleContent>
1812	+ <xsd:extension base="xsd:string">
1813	+ <xsd:attribute name="count-type" type="xlf:AttrType_count-type" use="optional"/>
1814	+ <xsd:attribute name="phase-name" type="xsd:string" use="optional"/>
1815	+ <xsd:attribute default="word" name="unit" type="xlf:AttrType_unit" use="optional"/>
1816	+ </xsd:extension>
1817	+ </xsd:simpleContent>
1818	+ </xsd:complexType>
1819	+ </xsd:element>
1820	+ <xsd:element name="context-group">
1821	+ <xsd:complexType>
1822	+ <xsd:sequence maxOccurs="unbounded">
1823	+ <xsd:element ref="xlf:context"/>
1824	+ </xsd:sequence>
1825	+ <xsd:attribute name="name" type="xsd:string" use="optional"/>
1826	+ <xsd:attribute name="crc" type="xsd:NMTOKEN" use="optional"/>
1827	+ <xsd:attribute name="purpose" type="xlf:AttrType_purpose" use="optional"/>
1828	+ </xsd:complexType>
1829	+ </xsd:element>
1830	+ <xsd:element name="context">
1831	+ <xsd:complexType>
1832	+ <xsd:simpleContent>
1833	+ <xsd:extension base="xsd:string">
1834	+ <xsd:attribute name="context-type" type="xlf:AttrType_context-type" use="required"/>
1835	+ <xsd:attribute default="no" name="match-mandatory" type="xlf:AttrType_YesNo" use="optional"/>
1836	+ <xsd:attribute name="crc" type="xsd:NMTOKEN" use="optional"/>
1837	+ </xsd:extension>
1838	+ </xsd:simpleContent>
1839	+ </xsd:complexType>
1840	+ </xsd:element>
1841	+ <xsd:element name="tool">
1842	+ <xsd:complexType mixed="true">
1843	+ <xsd:sequence>
1844	+ <xsd:any namespace="##any" processContents="strict" minOccurs="0" maxOccurs="unbounded"/>
1845	+ </xsd:sequence>
1846	+ <xsd:attribute name="tool-id" type="xsd:string" use="required"/>
1847	+ <xsd:attribute name="tool-name" type="xsd:string" use="required"/>
1848	+ <xsd:attribute name="tool-version" type="xsd:string" use="optional"/>
1849	+ <xsd:attribute name="tool-company" type="xsd:string" use="optional"/>
1850	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
1851	+ </xsd:complexType>
1852	+ </xsd:element>
1853	+ <xsd:element name="body">
1854	+ <xsd:complexType>
1855	+ <xsd:choice maxOccurs="unbounded" minOccurs="0">
1856	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:group"/>
1857	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:trans-unit"/>
1858	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:bin-unit"/>
1859	+ </xsd:choice>
1860	+ </xsd:complexType>
1861	+ </xsd:element>
1862	+ <xsd:element name="group">
1863	+ <xsd:complexType>
1864	+ <xsd:sequence>
1865	+ <xsd:sequence>
1866	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:context-group"/>
1867	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:count-group"/>
1868	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:note"/>
1869	+ <xsd:any maxOccurs="unbounded" minOccurs="0" namespace="##other" processContents="strict"/>
1870	+ </xsd:sequence>
1871	+ <xsd:choice maxOccurs="unbounded">
1872	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:group"/>
1873	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:trans-unit"/>
1874	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:bin-unit"/>
1875	+ </xsd:choice>
1876	+ </xsd:sequence>
1877	+ <xsd:attribute name="id" type="xsd:string" use="optional"/>
1878	+ <xsd:attribute name="datatype" type="xlf:AttrType_datatype" use="optional"/>
1879	+ <xsd:attribute default="default" ref="xml:space" use="optional"/>
1880	+ <xsd:attribute name="restype" type="xlf:AttrType_restype" use="optional"/>
1881	+ <xsd:attribute name="resname" type="xsd:string" use="optional"/>
1882	+ <xsd:attribute name="extradata" type="xsd:string" use="optional"/>
1883	+ <xsd:attribute name="extype" type="xsd:string" use="optional"/>
1884	+ <xsd:attribute name="help-id" type="xsd:NMTOKEN" use="optional"/>
1885	+ <xsd:attribute name="menu" type="xsd:string" use="optional"/>
1886	+ <xsd:attribute name="menu-option" type="xsd:string" use="optional"/>
1887	+ <xsd:attribute name="menu-name" type="xsd:string" use="optional"/>
1888	+ <xsd:attribute name="coord" type="xlf:AttrType_Coordinates" use="optional"/>
1889	+ <xsd:attribute name="font" type="xsd:string" use="optional"/>
1890	+ <xsd:attribute name="css-style" type="xsd:string" use="optional"/>
1891	+ <xsd:attribute name="style" type="xsd:NMTOKEN" use="optional"/>
1892	+ <xsd:attribute name="exstyle" type="xsd:NMTOKEN" use="optional"/>
1893	+ <xsd:attribute default="yes" name="translate" type="xlf:AttrType_YesNo" use="optional"/>
1894	+ <xsd:attribute default="yes" name="reformat" type="xlf:AttrType_reformat" use="optional"/>
1895	+ <xsd:attribute default="pixel" name="size-unit" type="xlf:AttrType_size-unit" use="optional"/>
1896	+ <xsd:attribute name="maxwidth" type="xsd:NMTOKEN" use="optional"/>
1897	+ <xsd:attribute name="minwidth" type="xsd:NMTOKEN" use="optional"/>
1898	+ <xsd:attribute name="maxheight" type="xsd:NMTOKEN" use="optional"/>
1899	+ <xsd:attribute name="minheight" type="xsd:NMTOKEN" use="optional"/>
1900	+ <xsd:attribute name="maxbytes" type="xsd:NMTOKEN" use="optional"/>
1901	+ <xsd:attribute name="minbytes" type="xsd:NMTOKEN" use="optional"/>
1902	+ <xsd:attribute name="charclass" type="xsd:string" use="optional"/>
1903	+ <xsd:attribute default="no" name="merged-trans" type="xlf:AttrType_YesNo" use="optional"/>
1904	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
1905	+ </xsd:complexType>
1906	+ </xsd:element>
1907	+ <xsd:element name="trans-unit">
1908	+ <xsd:complexType>
1909	+ <xsd:sequence>
1910	+ <xsd:element ref="xlf:source"/>
1911	+ <xsd:element minOccurs="0" ref="xlf:seg-source"/>
1912	+ <xsd:element minOccurs="0" ref="xlf:target"/>
1913	+ <xsd:choice maxOccurs="unbounded" minOccurs="0">
1914	+ <xsd:element ref="xlf:context-group"/>
1915	+ <xsd:element ref="xlf:count-group"/>
1916	+ <xsd:element ref="xlf:note"/>
1917	+ <xsd:element ref="xlf:alt-trans"/>
1918	+ </xsd:choice>
1919	+ <xsd:any maxOccurs="unbounded" minOccurs="0" namespace="##other" processContents="strict"/>
1920	+ </xsd:sequence>
1921	+ <xsd:attribute name="id" type="xsd:string" use="required"/>
1922	+ <xsd:attribute name="approved" type="xlf:AttrType_YesNo" use="optional"/>
1923	+ <xsd:attribute default="yes" name="translate" type="xlf:AttrType_YesNo" use="optional"/>
1924	+ <xsd:attribute default="yes" name="reformat" type="xlf:AttrType_reformat" use="optional"/>
1925	+ <xsd:attribute default="default" ref="xml:space" use="optional"/>
1926	+ <xsd:attribute name="datatype" type="xlf:AttrType_datatype" use="optional"/>
1927	+ <xsd:attribute name="phase-name" type="xsd:string" use="optional"/>
1928	+ <xsd:attribute name="restype" type="xlf:AttrType_restype" use="optional"/>
1929	+ <xsd:attribute name="resname" type="xsd:string" use="optional"/>
1930	+ <xsd:attribute name="extradata" type="xsd:string" use="optional"/>
1931	+ <xsd:attribute name="extype" type="xsd:string" use="optional"/>
1932	+ <xsd:attribute name="help-id" type="xsd:NMTOKEN" use="optional"/>
1933	+ <xsd:attribute name="menu" type="xsd:string" use="optional"/>
1934	+ <xsd:attribute name="menu-option" type="xsd:string" use="optional"/>
1935	+ <xsd:attribute name="menu-name" type="xsd:string" use="optional"/>
1936	+ <xsd:attribute name="coord" type="xlf:AttrType_Coordinates" use="optional"/>
1937	+ <xsd:attribute name="font" type="xsd:string" use="optional"/>
1938	+ <xsd:attribute name="css-style" type="xsd:string" use="optional"/>
1939	+ <xsd:attribute name="style" type="xsd:NMTOKEN" use="optional"/>
1940	+ <xsd:attribute name="exstyle" type="xsd:NMTOKEN" use="optional"/>
1941	+ <xsd:attribute default="pixel" name="size-unit" type="xlf:AttrType_size-unit" use="optional"/>
1942	+ <xsd:attribute name="maxwidth" type="xsd:NMTOKEN" use="optional"/>
1943	+ <xsd:attribute name="minwidth" type="xsd:NMTOKEN" use="optional"/>
1944	+ <xsd:attribute name="maxheight" type="xsd:NMTOKEN" use="optional"/>
1945	+ <xsd:attribute name="minheight" type="xsd:NMTOKEN" use="optional"/>
1946	+ <xsd:attribute name="maxbytes" type="xsd:NMTOKEN" use="optional"/>
1947	+ <xsd:attribute name="minbytes" type="xsd:NMTOKEN" use="optional"/>
1948	+ <xsd:attribute name="charclass" type="xsd:string" use="optional"/>
1949	+ <xsd:attribute default="yes" name="merged-trans" type="xlf:AttrType_YesNo" use="optional"/>
1950	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
1951	+ </xsd:complexType>
1952	+ <xsd:unique name="U_tu_segsrc_mid">
1953	+ <xsd:selector xpath="./xlf:seg-source/xlf:mrk"/>
1954	+ <xsd:field xpath="@mid"/>
1955	+ </xsd:unique>
1956	+ <xsd:keyref name="KR_tu_segsrc_mid" refer="xlf:U_tu_segsrc_mid">
1957	+ <xsd:selector xpath="./xlf:target/xlf:mrk\|./xlf:alt-trans"/>
1958	+ <xsd:field xpath="@mid"/>
1959	+ </xsd:keyref>
1960	+ </xsd:element>
1961	+ <xsd:element name="source">
1962	+ <xsd:complexType mixed="true">
1963	+ <xsd:group maxOccurs="unbounded" minOccurs="0" ref="xlf:ElemGroup_TextContent"/>
1964	+ <xsd:attribute ref="xml:lang" use="optional"/>
1965	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
1966	+ </xsd:complexType>
1967	+ <xsd:unique name="U_source_bpt_rid">
1968	+ <xsd:selector xpath=".//xlf:bpt"/>
1969	+ <xsd:field xpath="@rid"/>
1970	+ </xsd:unique>
1971	+ <xsd:keyref name="KR_source_ept_rid" refer="xlf:U_source_bpt_rid">
1972	+ <xsd:selector xpath=".//xlf:ept"/>
1973	+ <xsd:field xpath="@rid"/>
1974	+ </xsd:keyref>
1975	+ <xsd:unique name="U_source_bx_rid">
1976	+ <xsd:selector xpath=".//xlf:bx"/>
1977	+ <xsd:field xpath="@rid"/>
1978	+ </xsd:unique>
1979	+ <xsd:keyref name="KR_source_ex_rid" refer="xlf:U_source_bx_rid">
1980	+ <xsd:selector xpath=".//xlf:ex"/>
1981	+ <xsd:field xpath="@rid"/>
1982	+ </xsd:keyref>
1983	+ </xsd:element>
1984	+ <xsd:element name="seg-source">
1985	+ <xsd:complexType mixed="true">
1986	+ <xsd:group maxOccurs="unbounded" minOccurs="0" ref="xlf:ElemGroup_TextContent"/>
1987	+ <xsd:attribute ref="xml:lang" use="optional"/>
1988	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
1989	+ </xsd:complexType>
1990	+ <xsd:unique name="U_segsrc_bpt_rid">
1991	+ <xsd:selector xpath=".//xlf:bpt"/>
1992	+ <xsd:field xpath="@rid"/>
1993	+ </xsd:unique>
1994	+ <xsd:keyref name="KR_segsrc_ept_rid" refer="xlf:U_segsrc_bpt_rid">
1995	+ <xsd:selector xpath=".//xlf:ept"/>
1996	+ <xsd:field xpath="@rid"/>
1997	+ </xsd:keyref>
1998	+ <xsd:unique name="U_segsrc_bx_rid">
1999	+ <xsd:selector xpath=".//xlf:bx"/>
2000	+ <xsd:field xpath="@rid"/>
2001	+ </xsd:unique>
2002	+ <xsd:keyref name="KR_segsrc_ex_rid" refer="xlf:U_segsrc_bx_rid">
2003	+ <xsd:selector xpath=".//xlf:ex"/>
2004	+ <xsd:field xpath="@rid"/>
2005	+ </xsd:keyref>
2006	+ </xsd:element>
2007	+ <xsd:element name="target">
2008	+ <xsd:complexType mixed="true">
2009	+ <xsd:group maxOccurs="unbounded" minOccurs="0" ref="xlf:ElemGroup_TextContent"/>
2010	+ <xsd:attribute name="state" type="xlf:AttrType_state" use="optional"/>
2011	+ <xsd:attribute name="state-qualifier" type="xlf:AttrType_state-qualifier" use="optional"/>
2012	+ <xsd:attribute name="phase-name" type="xsd:NMTOKEN" use="optional"/>
2013	+ <xsd:attribute ref="xml:lang" use="optional"/>
2014	+ <xsd:attribute name="resname" type="xsd:string" use="optional"/>
2015	+ <xsd:attribute name="coord" type="xlf:AttrType_Coordinates" use="optional"/>
2016	+ <xsd:attribute name="font" type="xsd:string" use="optional"/>
2017	+ <xsd:attribute name="css-style" type="xsd:string" use="optional"/>
2018	+ <xsd:attribute name="style" type="xsd:NMTOKEN" use="optional"/>
2019	+ <xsd:attribute name="exstyle" type="xsd:NMTOKEN" use="optional"/>
2020	+ <xsd:attribute default="yes" name="equiv-trans" type="xlf:AttrType_YesNo" use="optional"/>
2021	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
2022	+ </xsd:complexType>
2023	+ <xsd:unique name="U_target_bpt_rid">
2024	+ <xsd:selector xpath=".//xlf:bpt"/>
2025	+ <xsd:field xpath="@rid"/>
2026	+ </xsd:unique>
2027	+ <xsd:keyref name="KR_target_ept_rid" refer="xlf:U_target_bpt_rid">
2028	+ <xsd:selector xpath=".//xlf:ept"/>
2029	+ <xsd:field xpath="@rid"/>
2030	+ </xsd:keyref>
2031	+ <xsd:unique name="U_target_bx_rid">
2032	+ <xsd:selector xpath=".//xlf:bx"/>
2033	+ <xsd:field xpath="@rid"/>
2034	+ </xsd:unique>
2035	+ <xsd:keyref name="KR_target_ex_rid" refer="xlf:U_target_bx_rid">
2036	+ <xsd:selector xpath=".//xlf:ex"/>
2037	+ <xsd:field xpath="@rid"/>
2038	+ </xsd:keyref>
2039	+ </xsd:element>
2040	+ <xsd:element name="alt-trans">
2041	+ <xsd:complexType>
2042	+ <xsd:sequence>
2043	+ <xsd:element minOccurs="0" ref="xlf:source"/>
2044	+ <xsd:element minOccurs="0" ref="xlf:seg-source"/>
2045	+ <xsd:element maxOccurs="1" ref="xlf:target"/>
2046	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:context-group"/>
2047	+ <xsd:element maxOccurs="unbounded" minOccurs="0" ref="xlf:note"/>
2048	+ <xsd:any maxOccurs="unbounded" minOccurs="0" namespace="##other" processContents="strict"/>
2049	+ </xsd:sequence>
2050	+ <xsd:attribute name="match-quality" type="xsd:string" use="optional"/>
2051	+ <xsd:attribute name="tool-id" type="xsd:string" use="optional"/>
2052	+ <xsd:attribute name="crc" type="xsd:NMTOKEN" use="optional"/>
2053	+ <xsd:attribute ref="xml:lang" use="optional"/>
2054	+ <xsd:attribute name="origin" type="xsd:string" use="optional"/>
2055	+ <xsd:attribute name="datatype" type="xlf:AttrType_datatype" use="optional"/>
2056	+ <xsd:attribute default="default" ref="xml:space" use="optional"/>
2057	+ <xsd:attribute name="restype" type="xlf:AttrType_restype" use="optional"/>
2058	+ <xsd:attribute name="resname" type="xsd:string" use="optional"/>
2059	+ <xsd:attribute name="extradata" type="xsd:string" use="optional"/>
2060	+ <xsd:attribute name="extype" type="xsd:string" use="optional"/>
2061	+ <xsd:attribute name="help-id" type="xsd:NMTOKEN" use="optional"/>
2062	+ <xsd:attribute name="menu" type="xsd:string" use="optional"/>
2063	+ <xsd:attribute name="menu-option" type="xsd:string" use="optional"/>
2064	+ <xsd:attribute name="menu-name" type="xsd:string" use="optional"/>
2065	+ <xsd:attribute name="mid" type="xsd:NMTOKEN" use="optional"/>
2066	+ <xsd:attribute name="coord" type="xlf:AttrType_Coordinates" use="optional"/>
2067	+ <xsd:attribute name="font" type="xsd:string" use="optional"/>
2068	+ <xsd:attribute name="css-style" type="xsd:string" use="optional"/>
2069	+ <xsd:attribute name="style" type="xsd:NMTOKEN" use="optional"/>
2070	+ <xsd:attribute name="exstyle" type="xsd:NMTOKEN" use="optional"/>
2071	+ <xsd:attribute name="phase-name" type="xsd:NMTOKEN" use="optional"/>
2072	+ <xsd:attribute default="proposal" name="alttranstype" type="xlf:AttrType_alttranstype" use="optional"/>
2073	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
2074	+ </xsd:complexType>
2075	+ <xsd:unique name="U_at_segsrc_mid">
2076	+ <xsd:selector xpath="./xlf:seg-source/xlf:mrk"/>
2077	+ <xsd:field xpath="@mid"/>
2078	+ </xsd:unique>
2079	+ <xsd:keyref name="KR_at_segsrc_mid" refer="xlf:U_at_segsrc_mid">
2080	+ <xsd:selector xpath="./xlf:target/xlf:mrk"/>
2081	+ <xsd:field xpath="@mid"/>
2082	+ </xsd:keyref>
2083	+ </xsd:element>
2084	+ <xsd:element name="bin-unit">
2085	+ <xsd:complexType>
2086	+ <xsd:sequence>
2087	+ <xsd:element ref="xlf:bin-source"/>
2088	+ <xsd:element minOccurs="0" ref="xlf:bin-target"/>
2089	+ <xsd:choice maxOccurs="unbounded" minOccurs="0">
2090	+ <xsd:element ref="xlf:context-group"/>
2091	+ <xsd:element ref="xlf:count-group"/>
2092	+ <xsd:element ref="xlf:note"/>
2093	+ <xsd:element ref="xlf:trans-unit"/>
2094	+ </xsd:choice>
2095	+ <xsd:any maxOccurs="unbounded" minOccurs="0" namespace="##other" processContents="strict"/>
2096	+ </xsd:sequence>
2097	+ <xsd:attribute name="id" type="xsd:string" use="required"/>
2098	+ <xsd:attribute name="mime-type" type="xlf:mime-typeValueList" use="required"/>
2099	+ <xsd:attribute name="approved" type="xlf:AttrType_YesNo" use="optional"/>
2100	+ <xsd:attribute default="yes" name="translate" type="xlf:AttrType_YesNo" use="optional"/>
2101	+ <xsd:attribute default="yes" name="reformat" type="xlf:AttrType_reformat" use="optional"/>
2102	+ <xsd:attribute name="restype" type="xlf:AttrType_restype" use="optional"/>
2103	+ <xsd:attribute name="resname" type="xsd:string" use="optional"/>
2104	+ <xsd:attribute name="phase-name" type="xsd:string" use="optional"/>
2105	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
2106	+ </xsd:complexType>
2107	+ </xsd:element>
2108	+ <xsd:element name="bin-source">
2109	+ <xsd:complexType>
2110	+ <xsd:choice>
2111	+ <xsd:element ref="xlf:internal-file"/>
2112	+ <xsd:element ref="xlf:external-file"/>
2113	+ </xsd:choice>
2114	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
2115	+ </xsd:complexType>
2116	+ </xsd:element>
2117	+ <xsd:element name="bin-target">
2118	+ <xsd:complexType>
2119	+ <xsd:choice>
2120	+ <xsd:element ref="xlf:internal-file"/>
2121	+ <xsd:element ref="xlf:external-file"/>
2122	+ </xsd:choice>
2123	+ <xsd:attribute name="mime-type" type="xlf:mime-typeValueList" use="optional"/>
2124	+ <xsd:attribute name="state" type="xlf:AttrType_state" use="optional"/>
2125	+ <xsd:attribute name="state-qualifier" type="xlf:AttrType_state-qualifier" use="optional"/>
2126	+ <xsd:attribute name="phase-name" type="xsd:NMTOKEN" use="optional"/>
2127	+ <xsd:attribute name="restype" type="xlf:AttrType_restype" use="optional"/>
2128	+ <xsd:attribute name="resname" type="xsd:string" use="optional"/>
2129	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
2130	+ </xsd:complexType>
2131	+ </xsd:element>
2132	+ <!-- Element for inline codes -->
2133	+ <xsd:element name="g">
2134	+ <xsd:complexType mixed="true">
2135	+ <xsd:group maxOccurs="unbounded" minOccurs="0" ref="xlf:ElemGroup_TextContent"/>
2136	+ <xsd:attribute name="ctype" type="xlf:AttrType_InlineDelimiters" use="optional"/>
2137	+ <xsd:attribute default="yes" name="clone" type="xlf:AttrType_YesNo" use="optional"/>
2138	+ <xsd:attributeGroup ref="xlf:AttrGroup_TextContent"/>
2139	+ </xsd:complexType>
2140	+ </xsd:element>
2141	+ <xsd:element name="x">
2142	+ <xsd:complexType>
2143	+ <xsd:attribute name="ctype" type="xlf:AttrType_InlinePlaceholders" use="optional"/>
2144	+ <xsd:attribute default="yes" name="clone" type="xlf:AttrType_YesNo" use="optional"/>
2145	+ <xsd:attributeGroup ref="xlf:AttrGroup_TextContent"/>
2146	+ </xsd:complexType>
2147	+ </xsd:element>
2148	+ <xsd:element name="bx">
2149	+ <xsd:complexType>
2150	+ <xsd:attribute name="rid" type="xsd:NMTOKEN" use="optional"/>
2151	+ <xsd:attribute name="ctype" type="xlf:AttrType_InlineDelimiters" use="optional"/>
2152	+ <xsd:attribute default="yes" name="clone" type="xlf:AttrType_YesNo" use="optional"/>
2153	+ <xsd:attributeGroup ref="xlf:AttrGroup_TextContent"/>
2154	+ </xsd:complexType>
2155	+ </xsd:element>
2156	+ <xsd:element name="ex">
2157	+ <xsd:complexType>
2158	+ <xsd:attribute name="rid" type="xsd:NMTOKEN" use="optional"/>
2159	+ <xsd:attributeGroup ref="xlf:AttrGroup_TextContent"/>
2160	+ </xsd:complexType>
2161	+ </xsd:element>
2162	+ <xsd:element name="ph">
2163	+ <xsd:complexType mixed="true">
2164	+ <xsd:sequence maxOccurs="unbounded" minOccurs="0">
2165	+ <xsd:element ref="xlf:sub"/>
2166	+ </xsd:sequence>
2167	+ <xsd:attribute name="ctype" type="xlf:AttrType_InlinePlaceholders" use="optional"/>
2168	+ <xsd:attribute name="crc" type="xsd:string" use="optional"/>
2169	+ <xsd:attribute name="assoc" type="xlf:AttrType_assoc" use="optional"/>
2170	+ <xsd:attributeGroup ref="xlf:AttrGroup_TextContent"/>
2171	+ </xsd:complexType>
2172	+ </xsd:element>
2173	+ <xsd:element name="bpt">
2174	+ <xsd:complexType mixed="true">
2175	+ <xsd:sequence maxOccurs="unbounded" minOccurs="0">
2176	+ <xsd:element ref="xlf:sub"/>
2177	+ </xsd:sequence>
2178	+ <xsd:attribute name="rid" type="xsd:NMTOKEN" use="optional"/>
2179	+ <xsd:attribute name="ctype" type="xlf:AttrType_InlineDelimiters" use="optional"/>
2180	+ <xsd:attribute name="crc" type="xsd:string" use="optional"/>
2181	+ <xsd:attributeGroup ref="xlf:AttrGroup_TextContent"/>
2182	+ </xsd:complexType>
2183	+ </xsd:element>
2184	+ <xsd:element name="ept">
2185	+ <xsd:complexType mixed="true">
2186	+ <xsd:sequence maxOccurs="unbounded" minOccurs="0">
2187	+ <xsd:element ref="xlf:sub"/>
2188	+ </xsd:sequence>
2189	+ <xsd:attribute name="rid" type="xsd:NMTOKEN" use="optional"/>
2190	+ <xsd:attribute name="crc" type="xsd:string" use="optional"/>
2191	+ <xsd:attributeGroup ref="xlf:AttrGroup_TextContent"/>
2192	+ </xsd:complexType>
2193	+ </xsd:element>
2194	+ <xsd:element name="it">
2195	+ <xsd:complexType mixed="true">
2196	+ <xsd:sequence maxOccurs="unbounded" minOccurs="0">
2197	+ <xsd:element ref="xlf:sub"/>
2198	+ </xsd:sequence>
2199	+ <xsd:attribute name="pos" type="xlf:AttrType_Position" use="required"/>
2200	+ <xsd:attribute name="rid" type="xsd:NMTOKEN" use="optional"/>
2201	+ <xsd:attribute name="ctype" type="xlf:AttrType_InlineDelimiters" use="optional"/>
2202	+ <xsd:attribute name="crc" type="xsd:string" use="optional"/>
2203	+ <xsd:attributeGroup ref="xlf:AttrGroup_TextContent"/>
2204	+ </xsd:complexType>
2205	+ </xsd:element>
2206	+ <xsd:element name="sub">
2207	+ <xsd:complexType mixed="true">
2208	+ <xsd:group maxOccurs="unbounded" minOccurs="0" ref="xlf:ElemGroup_TextContent"/>
2209	+ <xsd:attribute name="datatype" type="xlf:AttrType_datatype" use="optional"/>
2210	+ <xsd:attribute name="ctype" type="xlf:AttrType_InlineDelimiters" use="optional"/>
2211	+ <xsd:attribute name="xid" type="xsd:string" use="optional"/>
2212	+ </xsd:complexType>
2213	+ </xsd:element>
2214	+ <xsd:element name="mrk">
2215	+ <xsd:complexType mixed="true">
2216	+ <xsd:group maxOccurs="unbounded" minOccurs="0" ref="xlf:ElemGroup_TextContent"/>
2217	+ <xsd:attribute name="mtype" type="xlf:AttrType_mtype" use="required"/>
2218	+ <xsd:attribute name="mid" type="xsd:NMTOKEN" use="optional"/>
2219	+ <xsd:attribute name="comment" type="xsd:string" use="optional"/>
2220	+ <xsd:anyAttribute namespace="##other" processContents="strict"/>
2221	+ </xsd:complexType>
2222	+ </xsd:element>
2223	+ </xsd:schema>

src/common/lib/vendor/symfony/translation/Loader/schema/dic/xliff-core/xliff-core-2.0.xsd ADDED Viewed

	@@ -0,0 +1,411 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+ <!--
3	+
4	+ XLIFF Version 2.0
5	+ OASIS Standard
6	+ 05 August 2014
7	+ Copyright (c) OASIS Open 2014. All rights reserved.
8	+ Source: http://docs.oasis-open.org/xliff/xliff-core/v2.0/os/schemas/
9	+ -->
10	+ <xs:schema xmlns:xs="http://www.w3.org/2001/XMLSchema"
11	+ elementFormDefault="qualified"
12	+ xmlns:xlf="urn:oasis:names:tc:xliff:document:2.0"
13	+ targetNamespace="urn:oasis:names:tc:xliff:document:2.0">
14	+
15	+ <!-- Import -->
16	+
17	+ <xs:import namespace="http://www.w3.org/XML/1998/namespace"
18	+ schemaLocation="informativeCopiesOf3rdPartySchemas/w3c/xml.xsd"/>
19	+
20	+ <!-- Element Group -->
21	+
22	+ <xs:group name="inline">
23	+ <xs:choice>
24	+ <xs:element ref="xlf:cp"/>
25	+ <xs:element ref="xlf:ph"/>
26	+ <xs:element ref="xlf:pc"/>
27	+ <xs:element ref="xlf:sc"/>
28	+ <xs:element ref="xlf:ec"/>
29	+ <xs:element ref="xlf:mrk"/>
30	+ <xs:element ref="xlf:sm"/>
31	+ <xs:element ref="xlf:em"/>
32	+ </xs:choice>
33	+ </xs:group>
34	+
35	+ <!-- Attribute Types -->
36	+
37	+ <xs:simpleType name="yesNo">
38	+ <xs:restriction base="xs:string">
39	+ <xs:enumeration value="yes"/>
40	+ <xs:enumeration value="no"/>
41	+ </xs:restriction>
42	+ </xs:simpleType>
43	+
44	+ <xs:simpleType name="yesNoFirstNo">
45	+ <xs:restriction base="xs:string">
46	+ <xs:enumeration value="yes"/>
47	+ <xs:enumeration value="firstNo"/>
48	+ <xs:enumeration value="no"/>
49	+ </xs:restriction>
50	+ </xs:simpleType>
51	+
52	+ <xs:simpleType name="dirValue">
53	+ <xs:restriction base="xs:string">
54	+ <xs:enumeration value="ltr"/>
55	+ <xs:enumeration value="rtl"/>
56	+ <xs:enumeration value="auto"/>
57	+ </xs:restriction>
58	+ </xs:simpleType>
59	+
60	+ <xs:simpleType name="appliesTo">
61	+ <xs:restriction base="xs:string">
62	+ <xs:enumeration value="source"/>
63	+ <xs:enumeration value="target"/>
64	+ </xs:restriction>
65	+ </xs:simpleType>
66	+
67	+ <xs:simpleType name="userDefinedValue">
68	+ <xs:restriction base="xs:string">
69	+ <xs:pattern value="[^\s:]+:[^\s:]+"/>
70	+ </xs:restriction>
71	+ </xs:simpleType>
72	+
73	+ <xs:simpleType name="attrType_type">
74	+ <xs:restriction base="xs:string">
75	+ <xs:enumeration value="fmt"/>
76	+ <xs:enumeration value="ui"/>
77	+ <xs:enumeration value="quote"/>
78	+ <xs:enumeration value="link"/>
79	+ <xs:enumeration value="image"/>
80	+ <xs:enumeration value="other"/>
81	+ </xs:restriction>
82	+ </xs:simpleType>
83	+
84	+ <xs:simpleType name="typeForMrkValues">
85	+ <xs:restriction base="xs:NMTOKEN">
86	+ <xs:enumeration value="generic"/>
87	+ <xs:enumeration value="comment"/>
88	+ <xs:enumeration value="term"/>
89	+ </xs:restriction>
90	+ </xs:simpleType>
91	+
92	+ <xs:simpleType name="attrType_typeForMrk">
93	+ <xs:union memberTypes="xlf:typeForMrkValues xlf:userDefinedValue"/>
94	+ </xs:simpleType>
95	+
96	+ <xs:simpleType name="priorityValue">
97	+ <xs:restriction base="xs:positiveInteger">
98	+ <xs:minInclusive value="1"/>
99	+ <xs:maxInclusive value="10"/>
100	+ </xs:restriction>
101	+ </xs:simpleType>
102	+
103	+ <xs:simpleType name="stateType">
104	+ <xs:restriction base="xs:string">
105	+ <xs:enumeration value="initial"/>
106	+ <xs:enumeration value="translated"/>
107	+ <xs:enumeration value="reviewed"/>
108	+ <xs:enumeration value="final"/>
109	+ </xs:restriction>
110	+ </xs:simpleType>
111	+
112	+ <!-- Structural Elements -->
113	+
114	+ <xs:element name="xliff">
115	+ <xs:complexType mixed="false">
116	+ <xs:sequence>
117	+ <xs:element minOccurs="1" maxOccurs="unbounded" ref="xlf:file"/>
118	+ </xs:sequence>
119	+ <xs:attribute name="version" use="required"/>
120	+ <xs:attribute name="srcLang" use="required"/>
121	+ <xs:attribute name="trgLang" use="optional"/>
122	+ <xs:attribute ref="xml:space" use="optional" default="default"/>
123	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
124	+ </xs:complexType>
125	+ </xs:element>
126	+
127	+ <xs:element name="file">
128	+ <xs:complexType mixed="false">
129	+ <xs:sequence>
130	+ <xs:element minOccurs="0" maxOccurs="1" ref="xlf:skeleton"/>
131	+ <xs:any minOccurs="0" maxOccurs="unbounded" namespace="##other"
132	+ processContents="lax"/>
133	+ <xs:element minOccurs="0" maxOccurs="1" ref="xlf:notes"/>
134	+ <xs:choice minOccurs="1" maxOccurs="unbounded">
135	+ <xs:element ref="xlf:unit"/>
136	+ <xs:element ref="xlf:group"/>
137	+ </xs:choice>
138	+ </xs:sequence>
139	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
140	+ <xs:attribute name="canResegment" use="optional" type="xlf:yesNo" default="yes"/>
141	+ <xs:attribute name="original" use="optional"/>
142	+ <xs:attribute name="translate" use="optional" type="xlf:yesNo" default="yes"/>
143	+ <xs:attribute name="srcDir" use="optional" type="xlf:dirValue" default="auto"/>
144	+ <xs:attribute name="trgDir" use="optional" type="xlf:dirValue" default="auto"/>
145	+ <xs:attribute ref="xml:space" use="optional"/>
146	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
147	+ </xs:complexType>
148	+ </xs:element>
149	+
150	+ <xs:element name="skeleton">
151	+ <xs:complexType mixed="true">
152	+ <xs:sequence>
153	+ <xs:any minOccurs="0" maxOccurs="unbounded" namespace="##other"
154	+ processContents="lax"/>
155	+ </xs:sequence>
156	+ <xs:attribute name="href" use="optional"/>
157	+ </xs:complexType>
158	+ </xs:element>
159	+
160	+ <xs:element name="group">
161	+ <xs:complexType mixed="false">
162	+ <xs:sequence>
163	+ <xs:any minOccurs="0" maxOccurs="unbounded" namespace="##other"
164	+ processContents="lax"/>
165	+ <xs:element minOccurs="0" maxOccurs="1" ref="xlf:notes"/>
166	+ <xs:choice minOccurs="0" maxOccurs="unbounded">
167	+ <xs:element ref="xlf:unit"/>
168	+ <xs:element ref="xlf:group"/>
169	+ </xs:choice>
170	+ </xs:sequence>
171	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
172	+ <xs:attribute name="name" use="optional"/>
173	+ <xs:attribute name="canResegment" use="optional" type="xlf:yesNo"/>
174	+ <xs:attribute name="translate" use="optional" type="xlf:yesNo"/>
175	+ <xs:attribute name="srcDir" use="optional" type="xlf:dirValue"/>
176	+ <xs:attribute name="trgDir" use="optional" type="xlf:dirValue"/>
177	+ <xs:attribute name="type" use="optional" type="xlf:userDefinedValue"/>
178	+ <xs:attribute ref="xml:space" use="optional"/>
179	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
180	+ </xs:complexType>
181	+ </xs:element>
182	+
183	+ <xs:element name="unit">
184	+ <xs:complexType mixed="false">
185	+ <xs:sequence>
186	+ <xs:any minOccurs="0" maxOccurs="unbounded" namespace="##other"
187	+ processContents="lax"/>
188	+ <xs:element minOccurs="0" maxOccurs="1" ref="xlf:notes"/>
189	+ <xs:element minOccurs="0" maxOccurs="1" ref="xlf:originalData"/>
190	+ <xs:choice minOccurs="1" maxOccurs="unbounded">
191	+ <xs:element ref="xlf:segment"/>
192	+ <xs:element ref="xlf:ignorable"/>
193	+ </xs:choice>
194	+ </xs:sequence>
195	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
196	+ <xs:attribute name="name" use="optional"/>
197	+ <xs:attribute name="canResegment" use="optional" type="xlf:yesNo"/>
198	+ <xs:attribute name="translate" use="optional" type="xlf:yesNo"/>
199	+ <xs:attribute name="srcDir" use="optional" type="xlf:dirValue"/>
200	+ <xs:attribute name="trgDir" use="optional" type="xlf:dirValue"/>
201	+ <xs:attribute ref="xml:space" use="optional"/>
202	+ <xs:attribute name="type" use="optional" type="xlf:userDefinedValue"/>
203	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
204	+ </xs:complexType>
205	+ </xs:element>
206	+
207	+ <xs:element name="segment">
208	+ <xs:complexType mixed="false">
209	+ <xs:sequence>
210	+ <xs:element minOccurs="1" maxOccurs="1" ref="xlf:source"/>
211	+ <xs:element minOccurs="0" maxOccurs="1" ref="xlf:target"/>
212	+ </xs:sequence>
213	+ <xs:attribute name="id" use="optional" type="xs:NMTOKEN"/>
214	+ <xs:attribute name="canResegment" use="optional" type="xlf:yesNo"/>
215	+ <xs:attribute name="state" use="optional" type="xlf:stateType" default="initial"/>
216	+ <xs:attribute name="subState" use="optional"/>
217	+ </xs:complexType>
218	+ </xs:element>
219	+
220	+ <xs:element name="ignorable">
221	+ <xs:complexType mixed="false">
222	+ <xs:sequence>
223	+ <xs:element minOccurs="1" maxOccurs="1" ref="xlf:source"/>
224	+ <xs:element minOccurs="0" maxOccurs="1" ref="xlf:target"/>
225	+ </xs:sequence>
226	+ <xs:attribute name="id" use="optional" type="xs:NMTOKEN"/>
227	+ </xs:complexType>
228	+ </xs:element>
229	+
230	+ <xs:element name="notes">
231	+ <xs:complexType mixed="false">
232	+ <xs:sequence>
233	+ <xs:element minOccurs="1" maxOccurs="unbounded" ref="xlf:note"/>
234	+ </xs:sequence>
235	+ </xs:complexType>
236	+ </xs:element>
237	+
238	+ <xs:element name="note">
239	+ <xs:complexType mixed="true">
240	+ <xs:attribute name="id" use="optional" type="xs:NMTOKEN"/>
241	+ <xs:attribute name="appliesTo" use="optional" type="xlf:appliesTo"/>
242	+ <xs:attribute name="category" use="optional"/>
243	+ <xs:attribute name="priority" use="optional" type="xlf:priorityValue" default="1"/>
244	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
245	+ </xs:complexType>
246	+ </xs:element>
247	+
248	+ <xs:element name="originalData">
249	+ <xs:complexType mixed="false">
250	+ <xs:sequence>
251	+ <xs:element minOccurs="1" maxOccurs="unbounded" ref="xlf:data"/>
252	+ </xs:sequence>
253	+ </xs:complexType>
254	+ </xs:element>
255	+
256	+ <xs:element name="data">
257	+ <xs:complexType mixed="true">
258	+ <xs:sequence>
259	+ <xs:element minOccurs="0" maxOccurs="unbounded" ref="xlf:cp"/>
260	+ </xs:sequence>
261	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
262	+ <xs:attribute name="dir" use="optional" type="xlf:dirValue" default="auto"/>
263	+ <xs:attribute ref="xml:space" use="optional" fixed="preserve"/>
264	+ </xs:complexType>
265	+ </xs:element>
266	+
267	+ <xs:element name="source">
268	+ <xs:complexType mixed="true">
269	+ <xs:group ref="xlf:inline" minOccurs="0" maxOccurs="unbounded"/>
270	+ <xs:attribute ref="xml:lang" use="optional"/>
271	+ <xs:attribute ref="xml:space" use="optional"/>
272	+ </xs:complexType>
273	+ </xs:element>
274	+
275	+ <xs:element name="target">
276	+ <xs:complexType mixed="true">
277	+ <xs:group ref="xlf:inline" minOccurs="0" maxOccurs="unbounded"/>
278	+ <xs:attribute ref="xml:lang" use="optional"/>
279	+ <xs:attribute ref="xml:space" use="optional"/>
280	+ <xs:attribute name="order" use="optional" type="xs:positiveInteger"/>
281	+ </xs:complexType>
282	+ </xs:element>
283	+
284	+ <!-- Inline Elements -->
285	+
286	+ <xs:element name="cp">
287	+ <!-- Code Point -->
288	+ <xs:complexType mixed="false">
289	+ <xs:attribute name="hex" use="required" type="xs:hexBinary"/>
290	+ </xs:complexType>
291	+ </xs:element>
292	+
293	+ <xs:element name="ph">
294	+ <!-- Placeholder -->
295	+ <xs:complexType mixed="false">
296	+ <xs:attribute name="canCopy" use="optional" type="xlf:yesNo" default="yes"/>
297	+ <xs:attribute name="canDelete" use="optional" type="xlf:yesNo" default="yes"/>
298	+ <xs:attribute name="canReorder" use="optional" type="xlf:yesNoFirstNo" default="yes"/>
299	+ <xs:attribute name="copyOf" use="optional" type="xs:NMTOKEN"/>
300	+ <xs:attribute name="disp" use="optional"/>
301	+ <xs:attribute name="equiv" use="optional"/>
302	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
303	+ <xs:attribute name="dataRef" use="optional" type="xs:NMTOKEN"/>
304	+ <xs:attribute name="subFlows" use="optional" type="xs:NMTOKENS"/>
305	+ <xs:attribute name="subType" use="optional" type="xlf:userDefinedValue"/>
306	+ <xs:attribute name="type" use="optional" type="xlf:attrType_type"/>
307	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
308	+ </xs:complexType>
309	+ </xs:element>
310	+
311	+ <xs:element name="pc">
312	+ <!-- Paired Code -->
313	+ <xs:complexType mixed="true">
314	+ <xs:group ref="xlf:inline" minOccurs="0" maxOccurs="unbounded"/>
315	+ <xs:attribute name="canCopy" use="optional" type="xlf:yesNo" default="yes"/>
316	+ <xs:attribute name="canDelete" use="optional" type="xlf:yesNo" default="yes"/>
317	+ <xs:attribute name="canOverlap" use="optional" type="xlf:yesNo"/>
318	+ <xs:attribute name="canReorder" use="optional" type="xlf:yesNoFirstNo" default="yes"/>
319	+ <xs:attribute name="copyOf" use="optional" type="xs:NMTOKEN"/>
320	+ <xs:attribute name="dispEnd" use="optional"/>
321	+ <xs:attribute name="dispStart" use="optional"/>
322	+ <xs:attribute name="equivEnd" use="optional"/>
323	+ <xs:attribute name="equivStart" use="optional"/>
324	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
325	+ <xs:attribute name="dataRefEnd" use="optional" type="xs:NMTOKEN"/>
326	+ <xs:attribute name="dataRefStart" use="optional" type="xs:NMTOKEN"/>
327	+ <xs:attribute name="subFlowsEnd" use="optional" type="xs:NMTOKENS"/>
328	+ <xs:attribute name="subFlowsStart" use="optional" type="xs:NMTOKENS"/>
329	+ <xs:attribute name="subType" use="optional" type="xlf:userDefinedValue"/>
330	+ <xs:attribute name="type" use="optional" type="xlf:attrType_type"/>
331	+ <xs:attribute name="dir" use="optional" type="xlf:dirValue"/>
332	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
333	+ </xs:complexType>
334	+ </xs:element>
335	+
336	+ <xs:element name="sc">
337	+ <!-- Start Code -->
338	+ <xs:complexType mixed="false">
339	+ <xs:attribute name="canCopy" use="optional" type="xlf:yesNo" default="yes"/>
340	+ <xs:attribute name="canDelete" use="optional" type="xlf:yesNo" default="yes"/>
341	+ <xs:attribute name="canOverlap" use="optional" type="xlf:yesNo" default="yes"/>
342	+ <xs:attribute name="canReorder" use="optional" type="xlf:yesNoFirstNo" default="yes"/>
343	+ <xs:attribute name="copyOf" use="optional" type="xs:NMTOKEN"/>
344	+ <xs:attribute name="dataRef" use="optional" type="xs:NMTOKEN"/>
345	+ <xs:attribute name="dir" use="optional" type="xlf:dirValue"/>
346	+ <xs:attribute name="disp" use="optional"/>
347	+ <xs:attribute name="equiv" use="optional"/>
348	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
349	+ <xs:attribute name="isolated" use="optional" type="xlf:yesNo" default="no"/>
350	+ <xs:attribute name="subFlows" use="optional" type="xs:NMTOKENS"/>
351	+ <xs:attribute name="subType" use="optional" type="xlf:userDefinedValue"/>
352	+ <xs:attribute name="type" use="optional" type="xlf:attrType_type"/>
353	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
354	+ </xs:complexType>
355	+ </xs:element>
356	+
357	+ <xs:element name="ec">
358	+ <!-- End Code -->
359	+ <xs:complexType mixed="false">
360	+ <xs:attribute name="canCopy" use="optional" type="xlf:yesNo" default="yes"/>
361	+ <xs:attribute name="canDelete" use="optional" type="xlf:yesNo" default="yes"/>
362	+ <xs:attribute name="canOverlap" use="optional" type="xlf:yesNo" default="yes"/>
363	+ <xs:attribute name="canReorder" use="optional" type="xlf:yesNoFirstNo" default="yes"/>
364	+ <xs:attribute name="copyOf" use="optional" type="xs:NMTOKEN"/>
365	+ <xs:attribute name="dataRef" use="optional" type="xs:NMTOKEN"/>
366	+ <xs:attribute name="dir" use="optional" type="xlf:dirValue"/>
367	+ <xs:attribute name="disp" use="optional"/>
368	+ <xs:attribute name="equiv" use="optional"/>
369	+ <xs:attribute name="id" use="optional" type="xs:NMTOKEN"/>
370	+ <xs:attribute name="isolated" use="optional" type="xlf:yesNo" default="no"/>
371	+ <xs:attribute name="startRef" use="optional" type="xs:NMTOKEN"/>
372	+ <xs:attribute name="subFlows" use="optional" type="xs:NMTOKENS"/>
373	+ <xs:attribute name="subType" use="optional" type="xlf:userDefinedValue"/>
374	+ <xs:attribute name="type" use="optional" type="xlf:attrType_type"/>
375	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
376	+ </xs:complexType>
377	+ </xs:element>
378	+
379	+ <xs:element name="mrk">
380	+ <!-- Annotation Marker -->
381	+ <xs:complexType mixed="true">
382	+ <xs:group ref="xlf:inline" minOccurs="0" maxOccurs="unbounded"/>
383	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
384	+ <xs:attribute name="translate" use="optional" type="xlf:yesNo"/>
385	+ <xs:attribute name="type" use="optional" type="xlf:attrType_typeForMrk"/>
386	+ <xs:attribute name="ref" use="optional" type="xs:anyURI"/>
387	+ <xs:attribute name="value" use="optional"/>
388	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
389	+ </xs:complexType>
390	+ </xs:element>
391	+
392	+ <xs:element name="sm">
393	+ <!-- Start Annotation Marker -->
394	+ <xs:complexType mixed="false">
395	+ <xs:attribute name="id" use="required" type="xs:NMTOKEN"/>
396	+ <xs:attribute name="translate" use="optional" type="xlf:yesNo"/>
397	+ <xs:attribute name="type" use="optional" type="xlf:attrType_typeForMrk"/>
398	+ <xs:attribute name="ref" use="optional" type="xs:anyURI"/>
399	+ <xs:attribute name="value" use="optional"/>
400	+ <xs:anyAttribute namespace="##other" processContents="lax"/>
401	+ </xs:complexType>
402	+ </xs:element>
403	+
404	+ <xs:element name="em">
405	+ <!-- End Annotation Marker -->
406	+ <xs:complexType mixed="false">
407	+ <xs:attribute name="startRef" use="required" type="xs:NMTOKEN"/>
408	+ </xs:complexType>
409	+ </xs:element>
410	+
411	+ </xs:schema>

src/common/lib/vendor/symfony/translation/Loader/schema/dic/xliff-core/xml.xsd ADDED Viewed

	@@ -0,0 +1,309 @@


1	+ <?xml version='1.0'?>
2	+ <?xml-stylesheet href="../2008/09/xsd.xsl" type="text/xsl"?>
3	+ <xs:schema targetNamespace="http://www.w3.org/XML/1998/namespace"
4	+ xmlns:xs="http://www.w3.org/2001/XMLSchema"
5	+ xmlns ="http://www.w3.org/1999/xhtml"
6	+ xml:lang="en">
7	+
8	+ <xs:annotation>
9	+ <xs:documentation>
10	+ <div>
11	+ <h1>About the XML namespace</h1>
12	+
13	+ <div class="bodytext">
14	+ <p>
15	+
16	+ This schema document describes the XML namespace, in a form
17	+ suitable for import by other schema documents.
18	+ </p>
19	+ <p>
20	+ See <a href="http://www.w3.org/XML/1998/namespace.html">
21	+ http://www.w3.org/XML/1998/namespace.html</a> and
22	+ <a href="http://www.w3.org/TR/REC-xml">
23	+ http://www.w3.org/TR/REC-xml</a> for information
24	+ about this namespace.
25	+ </p>
26	+
27	+ <p>
28	+ Note that local names in this namespace are intended to be
29	+ defined only by the World Wide Web Consortium or its subgroups.
30	+ The names currently defined in this namespace are listed below.
31	+ They should not be used with conflicting semantics by any Working
32	+ Group, specification, or document instance.
33	+ </p>
34	+ <p>
35	+ See further below in this document for more information about <a
36	+ href="#usage">how to refer to this schema document from your own
37	+ XSD schema documents</a> and about <a href="#nsversioning">the
38	+ namespace-versioning policy governing this schema document</a>.
39	+ </p>
40	+ </div>
41	+ </div>
42	+
43	+ </xs:documentation>
44	+ </xs:annotation>
45	+
46	+ <xs:attribute name="lang">
47	+ <xs:annotation>
48	+ <xs:documentation>
49	+ <div>
50	+
51	+ <h3>lang (as an attribute name)</h3>
52	+ <p>
53	+
54	+ denotes an attribute whose value
55	+ is a language code for the natural language of the content of
56	+ any element; its value is inherited. This name is reserved
57	+ by virtue of its definition in the XML specification.</p>
58	+
59	+ </div>
60	+ <div>
61	+ <h4>Notes</h4>
62	+ <p>
63	+ Attempting to install the relevant ISO 2- and 3-letter
64	+ codes as the enumerated possible values is probably never
65	+ going to be a realistic possibility.
66	+ </p>
67	+ <p>
68	+
69	+ See BCP 47 at <a href="http://www.rfc-editor.org/rfc/bcp/bcp47.txt">
70	+ http://www.rfc-editor.org/rfc/bcp/bcp47.txt</a>
71	+ and the IANA language subtag registry at
72	+ <a href="http://www.iana.org/assignments/language-subtag-registry">
73	+ http://www.iana.org/assignments/language-subtag-registry</a>
74	+ for further information.
75	+ </p>
76	+ <p>
77	+
78	+ The union allows for the 'un-declaration' of xml:lang with
79	+ the empty string.
80	+ </p>
81	+ </div>
82	+ </xs:documentation>
83	+ </xs:annotation>
84	+ <xs:simpleType>
85	+ <xs:union memberTypes="xs:language">
86	+ <xs:simpleType>
87	+ <xs:restriction base="xs:string">
88	+ <xs:enumeration value=""/>
89	+
90	+ </xs:restriction>
91	+ </xs:simpleType>
92	+ </xs:union>
93	+ </xs:simpleType>
94	+ </xs:attribute>
95	+
96	+ <xs:attribute name="space">
97	+ <xs:annotation>
98	+ <xs:documentation>
99	+
100	+ <div>
101	+
102	+ <h3>space (as an attribute name)</h3>
103	+ <p>
104	+ denotes an attribute whose
105	+ value is a keyword indicating what whitespace processing
106	+ discipline is intended for the content of the element; its
107	+ value is inherited. This name is reserved by virtue of its
108	+ definition in the XML specification.</p>
109	+
110	+ </div>
111	+ </xs:documentation>
112	+ </xs:annotation>
113	+ <xs:simpleType>
114	+
115	+ <xs:restriction base="xs:NCName">
116	+ <xs:enumeration value="default"/>
117	+ <xs:enumeration value="preserve"/>
118	+ </xs:restriction>
119	+ </xs:simpleType>
120	+ </xs:attribute>
121	+
122	+ <xs:attribute name="base" type="xs:anyURI"> <xs:annotation>
123	+ <xs:documentation>
124	+
125	+ <div>
126	+
127	+ <h3>base (as an attribute name)</h3>
128	+ <p>
129	+ denotes an attribute whose value
130	+ provides a URI to be used as the base for interpreting any
131	+ relative URIs in the scope of the element on which it
132	+ appears; its value is inherited. This name is reserved
133	+ by virtue of its definition in the XML Base specification.</p>
134	+
135	+ <p>
136	+ See <a
137	+ href="http://www.w3.org/TR/xmlbase/">http://www.w3.org/TR/xmlbase/</a>
138	+ for information about this attribute.
139	+ </p>
140	+
141	+ </div>
142	+ </xs:documentation>
143	+ </xs:annotation>
144	+ </xs:attribute>
145	+
146	+ <xs:attribute name="id" type="xs:ID">
147	+ <xs:annotation>
148	+ <xs:documentation>
149	+ <div>
150	+
151	+ <h3>id (as an attribute name)</h3>
152	+ <p>
153	+
154	+ denotes an attribute whose value
155	+ should be interpreted as if declared to be of type ID.
156	+ This name is reserved by virtue of its definition in the
157	+ xml:id specification.</p>
158	+
159	+ <p>
160	+ See <a
161	+ href="http://www.w3.org/TR/xml-id/">http://www.w3.org/TR/xml-id/</a>
162	+ for information about this attribute.
163	+ </p>
164	+ </div>
165	+ </xs:documentation>
166	+ </xs:annotation>
167	+
168	+ </xs:attribute>
169	+
170	+ <xs:attributeGroup name="specialAttrs">
171	+ <xs:attribute ref="xml:base"/>
172	+ <xs:attribute ref="xml:lang"/>
173	+ <xs:attribute ref="xml:space"/>
174	+ <xs:attribute ref="xml:id"/>
175	+ </xs:attributeGroup>
176	+
177	+ <xs:annotation>
178	+
179	+ <xs:documentation>
180	+ <div>
181	+
182	+ <h3>Father (in any context at all)</h3>
183	+
184	+ <div class="bodytext">
185	+ <p>
186	+ denotes Jon Bosak, the chair of
187	+ the original XML Working Group. This name is reserved by
188	+ the following decision of the W3C XML Plenary and
189	+ XML Coordination groups:
190	+ </p>
191	+ <blockquote>
192	+ <p>
193	+
194	+ In appreciation for his vision, leadership and
195	+ dedication the W3C XML Plenary on this 10th day of
196	+ February, 2000, reserves for Jon Bosak in perpetuity
197	+ the XML name "xml:Father".
198	+ </p>
199	+ </blockquote>
200	+ </div>
201	+ </div>
202	+ </xs:documentation>
203	+ </xs:annotation>
204	+
205	+ <xs:annotation>
206	+ <xs:documentation>
207	+
208	+ <div xml:id="usage" id="usage">
209	+ <h2><a name="usage">About this schema document</a></h2>
210	+
211	+ <div class="bodytext">
212	+ <p>
213	+ This schema defines attributes and an attribute group suitable
214	+ for use by schemas wishing to allow <code>xml:base</code>,
215	+ <code>xml:lang</code>, <code>xml:space</code> or
216	+ <code>xml:id</code> attributes on elements they define.
217	+ </p>
218	+
219	+ <p>
220	+ To enable this, such a schema must import this schema for
221	+ the XML namespace, e.g. as follows:
222	+ </p>
223	+ <pre>
224	+ <schema.. .>
225	+ .. .
226	+ <import namespace="http://www.w3.org/XML/1998/namespace"
227	+ schemaLocation="http://www.w3.org/2001/xml.xsd"/>
228	+ </pre>
229	+ <p>
230	+ or
231	+ </p>
232	+ <pre>
233	+
234	+ <import namespace="http://www.w3.org/XML/1998/namespace"
235	+ schemaLocation="http://www.w3.org/2009/01/xml.xsd"/>
236	+ </pre>
237	+ <p>
238	+ Subsequently, qualified reference to any of the attributes or the
239	+ group defined below will have the desired effect, e.g.
240	+ </p>
241	+ <pre>
242	+ <type.. .>
243	+ .. .
244	+ <attributeGroup ref="xml:specialAttrs"/>
245	+ </pre>
246	+ <p>
247	+ will define a type which will schema-validate an instance element
248	+ with any of those attributes.
249	+ </p>
250	+
251	+ </div>
252	+ </div>
253	+ </xs:documentation>
254	+ </xs:annotation>
255	+
256	+ <xs:annotation>
257	+ <xs:documentation>
258	+ <div id="nsversioning" xml:id="nsversioning">
259	+ <h2><a name="nsversioning">Versioning policy for this schema document</a></h2>
260	+
261	+ <div class="bodytext">
262	+ <p>
263	+ In keeping with the XML Schema WG's standard versioning
264	+ policy, this schema document will persist at
265	+ <a href="http://www.w3.org/2009/01/xml.xsd">
266	+ http://www.w3.org/2009/01/xml.xsd</a>.
267	+ </p>
268	+ <p>
269	+ At the date of issue it can also be found at
270	+ <a href="http://www.w3.org/2001/xml.xsd">
271	+ http://www.w3.org/2001/xml.xsd</a>.
272	+ </p>
273	+
274	+ <p>
275	+ The schema document at that URI may however change in the future,
276	+ in order to remain compatible with the latest version of XML
277	+ Schema itself, or with the XML namespace itself. In other words,
278	+ if the XML Schema or XML namespaces change, the version of this
279	+ document at <a href="http://www.w3.org/2001/xml.xsd">
280	+ http://www.w3.org/2001/xml.xsd
281	+ </a>
282	+ will change accordingly; the version at
283	+ <a href="http://www.w3.org/2009/01/xml.xsd">
284	+ http://www.w3.org/2009/01/xml.xsd
285	+ </a>
286	+ will not change.
287	+ </p>
288	+ <p>
289	+
290	+ Previous dated (and unchanging) versions of this schema
291	+ document are at:
292	+ </p>
293	+ <ul>
294	+ <li><a href="http://www.w3.org/2009/01/xml.xsd">
295	+ http://www.w3.org/2009/01/xml.xsd</a></li>
296	+ <li><a href="http://www.w3.org/2007/08/xml.xsd">
297	+ http://www.w3.org/2007/08/xml.xsd</a></li>
298	+ <li><a href="http://www.w3.org/2004/10/xml.xsd">
299	+
300	+ http://www.w3.org/2004/10/xml.xsd</a></li>
301	+ <li><a href="http://www.w3.org/2001/03/xml.xsd">
302	+ http://www.w3.org/2001/03/xml.xsd</a></li>
303	+ </ul>
304	+ </div>
305	+ </div>
306	+ </xs:documentation>
307	+ </xs:annotation>
308	+
309	+ </xs:schema>

src/common/lib/vendor/symfony/translation/LoggingTranslator.php ADDED Viewed

	@@ -0,0 +1,136 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ use Psr\Log\LoggerInterface;
15	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
16	+
17	+ /**
18	+ * @author Abdellatif Ait boudad <a.aitboudad@gmail.com>
19	+ */
20	+ class LoggingTranslator implements TranslatorInterface, TranslatorBagInterface
21	+ {
22	+ /**
23	+ * @var TranslatorInterface\|TranslatorBagInterface
24	+ */
25	+ private $translator;
26	+
27	+ private $logger;
28	+
29	+ /**
30	+ * @param TranslatorInterface $translator The translator must implement TranslatorBagInterface
31	+ * @param LoggerInterface $logger
32	+ */
33	+ public function __construct(TranslatorInterface $translator, LoggerInterface $logger)
34	+ {
35	+ if (!$translator instanceof TranslatorBagInterface) {
36	+ throw new InvalidArgumentException(sprintf('The Translator "%s" must implement TranslatorInterface and TranslatorBagInterface.', get_class($translator)));
37	+ }
38	+
39	+ $this->translator = $translator;
40	+ $this->logger = $logger;
41	+ }
42	+
43	+ /**
44	+ * {@inheritdoc}
45	+ */
46	+ public function trans($id, array $parameters = array(), $domain = null, $locale = null)
47	+ {
48	+ $trans = $this->translator->trans($id, $parameters, $domain, $locale);
49	+ $this->log($id, $domain, $locale);
50	+
51	+ return $trans;
52	+ }
53	+
54	+ /**
55	+ * {@inheritdoc}
56	+ */
57	+ public function transChoice($id, $number, array $parameters = array(), $domain = null, $locale = null)
58	+ {
59	+ $trans = $this->translator->transChoice($id, $number, $parameters, $domain, $locale);
60	+ $this->log($id, $domain, $locale);
61	+
62	+ return $trans;
63	+ }
64	+
65	+ /**
66	+ * {@inheritdoc}
67	+ */
68	+ public function setLocale($locale)
69	+ {
70	+ $this->translator->setLocale($locale);
71	+ }
72	+
73	+ /**
74	+ * {@inheritdoc}
75	+ */
76	+ public function getLocale()
77	+ {
78	+ return $this->translator->getLocale();
79	+ }
80	+
81	+ /**
82	+ * {@inheritdoc}
83	+ */
84	+ public function getCatalogue($locale = null)
85	+ {
86	+ return $this->translator->getCatalogue($locale);
87	+ }
88	+
89	+ /**
90	+ * Gets the fallback locales.
91	+ *
92	+ * @return array $locales The fallback locales
93	+ */
94	+ public function getFallbackLocales()
95	+ {
96	+ if ($this->translator instanceof Translator \|\| method_exists($this->translator, 'getFallbackLocales')) {
97	+ return $this->translator->getFallbackLocales();
98	+ }
99	+
100	+ return array();
101	+ }
102	+
103	+ /**
104	+ * Passes through all unknown calls onto the translator object.
105	+ */
106	+ public function __call($method, $args)
107	+ {
108	+ return call_user_func_array(array($this->translator, $method), $args);
109	+ }
110	+
111	+ /**
112	+ * Logs for missing translations.
113	+ *
114	+ * @param string $id
115	+ * @param string\|null $domain
116	+ * @param string\|null $locale
117	+ */
118	+ private function log($id, $domain, $locale)
119	+ {
120	+ if (null === $domain) {
121	+ $domain = 'messages';
122	+ }
123	+
124	+ $id = (string) $id;
125	+ $catalogue = $this->translator->getCatalogue($locale);
126	+ if ($catalogue->defines($id, $domain)) {
127	+ return;
128	+ }
129	+
130	+ if ($catalogue->has($id, $domain)) {
131	+ $this->logger->debug('Translation use fallback catalogue.', array('id' => $id, 'domain' => $domain, 'locale' => $catalogue->getLocale()));
132	+ } else {
133	+ $this->logger->warning('Translation not found.', array('id' => $id, 'domain' => $domain, 'locale' => $catalogue->getLocale()));
134	+ }
135	+ }
136	+ }

src/common/lib/vendor/symfony/translation/MessageCatalogue.php ADDED Viewed

	@@ -0,0 +1,271 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ use Symfony\Component\Config\Resource\ResourceInterface;
15	+ use Symfony\Component\Translation\Exception\LogicException;
16	+
17	+ /**
18	+ * @author Fabien Potencier <fabien@symfony.com>
19	+ */
20	+ class MessageCatalogue implements MessageCatalogueInterface, MetadataAwareInterface
21	+ {
22	+ private $messages = array();
23	+ private $metadata = array();
24	+ private $resources = array();
25	+ private $locale;
26	+ private $fallbackCatalogue;
27	+ private $parent;
28	+
29	+ /**
30	+ * @param string $locale The locale
31	+ * @param array $messages An array of messages classified by domain
32	+ */
33	+ public function __construct($locale, array $messages = array())
34	+ {
35	+ $this->locale = $locale;
36	+ $this->messages = $messages;
37	+ }
38	+
39	+ /**
40	+ * {@inheritdoc}
41	+ */
42	+ public function getLocale()
43	+ {
44	+ return $this->locale;
45	+ }
46	+
47	+ /**
48	+ * {@inheritdoc}
49	+ */
50	+ public function getDomains()
51	+ {
52	+ return array_keys($this->messages);
53	+ }
54	+
55	+ /**
56	+ * {@inheritdoc}
57	+ */
58	+ public function all($domain = null)
59	+ {
60	+ if (null === $domain) {
61	+ return $this->messages;
62	+ }
63	+
64	+ return isset($this->messages[$domain]) ? $this->messages[$domain] : array();
65	+ }
66	+
67	+ /**
68	+ * {@inheritdoc}
69	+ */
70	+ public function set($id, $translation, $domain = 'messages')
71	+ {
72	+ $this->add(array($id => $translation), $domain);
73	+ }
74	+
75	+ /**
76	+ * {@inheritdoc}
77	+ */
78	+ public function has($id, $domain = 'messages')
79	+ {
80	+ if (isset($this->messages[$domain][$id])) {
81	+ return true;
82	+ }
83	+
84	+ if (null !== $this->fallbackCatalogue) {
85	+ return $this->fallbackCatalogue->has($id, $domain);
86	+ }
87	+
88	+ return false;
89	+ }
90	+
91	+ /**
92	+ * {@inheritdoc}
93	+ */
94	+ public function defines($id, $domain = 'messages')
95	+ {
96	+ return isset($this->messages[$domain][$id]);
97	+ }
98	+
99	+ /**
100	+ * {@inheritdoc}
101	+ */
102	+ public function get($id, $domain = 'messages')
103	+ {
104	+ if (isset($this->messages[$domain][$id])) {
105	+ return $this->messages[$domain][$id];
106	+ }
107	+
108	+ if (null !== $this->fallbackCatalogue) {
109	+ return $this->fallbackCatalogue->get($id, $domain);
110	+ }
111	+
112	+ return $id;
113	+ }
114	+
115	+ /**
116	+ * {@inheritdoc}
117	+ */
118	+ public function replace($messages, $domain = 'messages')
119	+ {
120	+ $this->messages[$domain] = array();
121	+
122	+ $this->add($messages, $domain);
123	+ }
124	+
125	+ /**
126	+ * {@inheritdoc}
127	+ */
128	+ public function add($messages, $domain = 'messages')
129	+ {
130	+ if (!isset($this->messages[$domain])) {
131	+ $this->messages[$domain] = $messages;
132	+ } else {
133	+ $this->messages[$domain] = array_replace($this->messages[$domain], $messages);
134	+ }
135	+ }
136	+
137	+ /**
138	+ * {@inheritdoc}
139	+ */
140	+ public function addCatalogue(MessageCatalogueInterface $catalogue)
141	+ {
142	+ if ($catalogue->getLocale() !== $this->locale) {
143	+ throw new LogicException(sprintf('Cannot add a catalogue for locale "%s" as the current locale for this catalogue is "%s"', $catalogue->getLocale(), $this->locale));
144	+ }
145	+
146	+ foreach ($catalogue->all() as $domain => $messages) {
147	+ $this->add($messages, $domain);
148	+ }
149	+
150	+ foreach ($catalogue->getResources() as $resource) {
151	+ $this->addResource($resource);
152	+ }
153	+
154	+ if ($catalogue instanceof MetadataAwareInterface) {
155	+ $metadata = $catalogue->getMetadata('', '');
156	+ $this->addMetadata($metadata);
157	+ }
158	+ }
159	+
160	+ /**
161	+ * {@inheritdoc}
162	+ */
163	+ public function addFallbackCatalogue(MessageCatalogueInterface $catalogue)
164	+ {
165	+ // detect circular references
166	+ $c = $catalogue;
167	+ while ($c = $c->getFallbackCatalogue()) {
168	+ if ($c->getLocale() === $this->getLocale()) {
169	+ throw new LogicException(sprintf('Circular reference detected when adding a fallback catalogue for locale "%s".', $catalogue->getLocale()));
170	+ }
171	+ }
172	+
173	+ $c = $this;
174	+ do {
175	+ if ($c->getLocale() === $catalogue->getLocale()) {
176	+ throw new LogicException(sprintf('Circular reference detected when adding a fallback catalogue for locale "%s".', $catalogue->getLocale()));
177	+ }
178	+
179	+ foreach ($catalogue->getResources() as $resource) {
180	+ $c->addResource($resource);
181	+ }
182	+ } while ($c = $c->parent);
183	+
184	+ $catalogue->parent = $this;
185	+ $this->fallbackCatalogue = $catalogue;
186	+
187	+ foreach ($catalogue->getResources() as $resource) {
188	+ $this->addResource($resource);
189	+ }
190	+ }
191	+
192	+ /**
193	+ * {@inheritdoc}
194	+ */
195	+ public function getFallbackCatalogue()
196	+ {
197	+ return $this->fallbackCatalogue;
198	+ }
199	+
200	+ /**
201	+ * {@inheritdoc}
202	+ */
203	+ public function getResources()
204	+ {
205	+ return array_values($this->resources);
206	+ }
207	+
208	+ /**
209	+ * {@inheritdoc}
210	+ */
211	+ public function addResource(ResourceInterface $resource)
212	+ {
213	+ $this->resources[$resource->__toString()] = $resource;
214	+ }
215	+
216	+ /**
217	+ * {@inheritdoc}
218	+ */
219	+ public function getMetadata($key = '', $domain = 'messages')
220	+ {
221	+ if ('' == $domain) {
222	+ return $this->metadata;
223	+ }
224	+
225	+ if (isset($this->metadata[$domain])) {
226	+ if ('' == $key) {
227	+ return $this->metadata[$domain];
228	+ }
229	+
230	+ if (isset($this->metadata[$domain][$key])) {
231	+ return $this->metadata[$domain][$key];
232	+ }
233	+ }
234	+ }
235	+
236	+ /**
237	+ * {@inheritdoc}
238	+ */
239	+ public function setMetadata($key, $value, $domain = 'messages')
240	+ {
241	+ $this->metadata[$domain][$key] = $value;
242	+ }
243	+
244	+ /**
245	+ * {@inheritdoc}
246	+ */
247	+ public function deleteMetadata($key = '', $domain = 'messages')
248	+ {
249	+ if ('' == $domain) {
250	+ $this->metadata = array();
251	+ } elseif ('' == $key) {
252	+ unset($this->metadata[$domain]);
253	+ } else {
254	+ unset($this->metadata[$domain][$key]);
255	+ }
256	+ }
257	+
258	+ /**
259	+ * Adds current values with the new values.
260	+ *
261	+ * @param array $values Values to add
262	+ */
263	+ private function addMetadata(array $values)
264	+ {
265	+ foreach ($values as $domain => $keys) {
266	+ foreach ($keys as $key => $value) {
267	+ $this->setMetadata($key, $value, $domain);
268	+ }
269	+ }
270	+ }
271	+ }

src/common/lib/vendor/symfony/translation/MessageCatalogueInterface.php ADDED Viewed

	@@ -0,0 +1,136 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ use Symfony\Component\Config\Resource\ResourceInterface;
15	+
16	+ /**
17	+ * MessageCatalogueInterface.
18	+ *
19	+ * @author Fabien Potencier <fabien@symfony.com>
20	+ */
21	+ interface MessageCatalogueInterface
22	+ {
23	+ /**
24	+ * Gets the catalogue locale.
25	+ *
26	+ * @return string The locale
27	+ */
28	+ public function getLocale();
29	+
30	+ /**
31	+ * Gets the domains.
32	+ *
33	+ * @return array An array of domains
34	+ */
35	+ public function getDomains();
36	+
37	+ /**
38	+ * Gets the messages within a given domain.
39	+ *
40	+ * If $domain is null, it returns all messages.
41	+ *
42	+ * @param string $domain The domain name
43	+ *
44	+ * @return array An array of messages
45	+ */
46	+ public function all($domain = null);
47	+
48	+ /**
49	+ * Sets a message translation.
50	+ *
51	+ * @param string $id The message id
52	+ * @param string $translation The messages translation
53	+ * @param string $domain The domain name
54	+ */
55	+ public function set($id, $translation, $domain = 'messages');
56	+
57	+ /**
58	+ * Checks if a message has a translation.
59	+ *
60	+ * @param string $id The message id
61	+ * @param string $domain The domain name
62	+ *
63	+ * @return bool true if the message has a translation, false otherwise
64	+ */
65	+ public function has($id, $domain = 'messages');
66	+
67	+ /**
68	+ * Checks if a message has a translation (it does not take into account the fallback mechanism).
69	+ *
70	+ * @param string $id The message id
71	+ * @param string $domain The domain name
72	+ *
73	+ * @return bool true if the message has a translation, false otherwise
74	+ */
75	+ public function defines($id, $domain = 'messages');
76	+
77	+ /**
78	+ * Gets a message translation.
79	+ *
80	+ * @param string $id The message id
81	+ * @param string $domain The domain name
82	+ *
83	+ * @return string The message translation
84	+ */
85	+ public function get($id, $domain = 'messages');
86	+
87	+ /**
88	+ * Sets translations for a given domain.
89	+ *
90	+ * @param array $messages An array of translations
91	+ * @param string $domain The domain name
92	+ */
93	+ public function replace($messages, $domain = 'messages');
94	+
95	+ /**
96	+ * Adds translations for a given domain.
97	+ *
98	+ * @param array $messages An array of translations
99	+ * @param string $domain The domain name
100	+ */
101	+ public function add($messages, $domain = 'messages');
102	+
103	+ /**
104	+ * Merges translations from the given Catalogue into the current one.
105	+ *
106	+ * The two catalogues must have the same locale.
107	+ */
108	+ public function addCatalogue(MessageCatalogueInterface $catalogue);
109	+
110	+ /**
111	+ * Merges translations from the given Catalogue into the current one
112	+ * only when the translation does not exist.
113	+ *
114	+ * This is used to provide default translations when they do not exist for the current locale.
115	+ */
116	+ public function addFallbackCatalogue(MessageCatalogueInterface $catalogue);
117	+
118	+ /**
119	+ * Gets the fallback catalogue.
120	+ *
121	+ * @return self\|null A MessageCatalogueInterface instance or null when no fallback has been set
122	+ */
123	+ public function getFallbackCatalogue();
124	+
125	+ /**
126	+ * Returns an array of resources loaded to build this collection.
127	+ *
128	+ * @return ResourceInterface[] An array of resources
129	+ */
130	+ public function getResources();
131	+
132	+ /**
133	+ * Adds a resource for this collection.
134	+ */
135	+ public function addResource(ResourceInterface $resource);
136	+ }

src/common/lib/vendor/symfony/translation/MessageSelector.php ADDED Viewed

	@@ -0,0 +1,94 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ use Symfony\Component\Translation\Exception\InvalidArgumentException;
15	+
16	+ /**
17	+ * MessageSelector.
18	+ *
19	+ * @author Fabien Potencier <fabien@symfony.com>
20	+ * @author Bernhard Schussek <bschussek@gmail.com>
21	+ */
22	+ class MessageSelector
23	+ {
24	+ /**
25	+ * Given a message with different plural translations separated by a
26	+ * pipe (\|), this method returns the correct portion of the message based
27	+ * on the given number, locale and the pluralization rules in the message
28	+ * itself.
29	+ *
30	+ * The message supports two different types of pluralization rules:
31	+ *
32	+ * interval: {0} There are no apples\|{1} There is one apple\|]1,Inf] There are %count% apples
33	+ * indexed: There is one apple\|There are %count% apples
34	+ *
35	+ * The indexed solution can also contain labels (e.g. one: There is one apple).
36	+ * This is purely for making the translations more clear - it does not
37	+ * affect the functionality.
38	+ *
39	+ * The two methods can also be mixed:
40	+ * {0} There are no apples\|one: There is one apple\|more: There are %count% apples
41	+ *
42	+ * @param string $message The message being translated
43	+ * @param int $number The number of items represented for the message
44	+ * @param string $locale The locale to use for choosing
45	+ *
46	+ * @return string
47	+ *
48	+ * @throws InvalidArgumentException
49	+ */
50	+ public function choose($message, $number, $locale)
51	+ {
52	+ $parts = array();
53	+ if (preg_match('/^\\|++$/', $message)) {
54	+ $parts = explode('\|', $message);
55	+ } elseif (preg_match_all('/(?:\\|\\|\|[^\\|])++/', $message, $matches)) {
56	+ $parts = $matches[0];
57	+ }
58	+
59	+ $explicitRules = array();
60	+ $standardRules = array();
61	+ foreach ($parts as $part) {
62	+ $part = trim(str_replace('\|\|', '\|', $part));
63	+
64	+ if (preg_match('/^(?P<interval>'.Interval::getIntervalRegexp().')\s(?P<message>.?)$/xs', $part, $matches)) {
65	+ $explicitRules[$matches['interval']] = $matches['message'];
66	+ } elseif (preg_match('/^\w+\:\s(.?)$/', $part, $matches)) {
67	+ $standardRules[] = $matches[1];
68	+ } else {
69	+ $standardRules[] = $part;
70	+ }
71	+ }
72	+
73	+ // try to match an explicit rule, then fallback to the standard ones
74	+ foreach ($explicitRules as $interval => $m) {
75	+ if (Interval::test($number, $interval)) {
76	+ return $m;
77	+ }
78	+ }
79	+
80	+ $position = PluralizationRules::get($number, $locale);
81	+
82	+ if (!isset($standardRules[$position])) {
83	+ // when there's exactly one rule given, and that rule is a standard
84	+ // rule, use this rule
85	+ if (1 === count($parts) && isset($standardRules[0])) {
86	+ return $standardRules[0];
87	+ }
88	+
89	+ throw new InvalidArgumentException(sprintf('Unable to choose a translation for "%s" with locale "%s" for value "%d". Double check that this translation has the correct plural options (e.g. "There is one apple\|There are %%count%% apples").', $message, $locale, $number));
90	+ }
91	+
92	+ return $standardRules[$position];
93	+ }
94	+ }

src/common/lib/vendor/symfony/translation/MetadataAwareInterface.php ADDED Viewed

	@@ -0,0 +1,54 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ /**
15	+ * MetadataAwareInterface.
16	+ *
17	+ * @author Fabien Potencier <fabien@symfony.com>
18	+ */
19	+ interface MetadataAwareInterface
20	+ {
21	+ /**
22	+ * Gets metadata for the given domain and key.
23	+ *
24	+ * Passing an empty domain will return an array with all metadata indexed by
25	+ * domain and then by key. Passing an empty key will return an array with all
26	+ * metadata for the given domain.
27	+ *
28	+ * @param string $key The key
29	+ * @param string $domain The domain name
30	+ *
31	+ * @return mixed The value that was set or an array with the domains/keys or null
32	+ */
33	+ public function getMetadata($key = '', $domain = 'messages');
34	+
35	+ /**
36	+ * Adds metadata to a message domain.
37	+ *
38	+ * @param string $key The key
39	+ * @param mixed $value The value
40	+ * @param string $domain The domain name
41	+ */
42	+ public function setMetadata($key, $value, $domain = 'messages');
43	+
44	+ /**
45	+ * Deletes metadata for the given key and domain.
46	+ *
47	+ * Passing an empty domain will delete all metadata. Passing an empty key will
48	+ * delete all metadata for the given domain.
49	+ *
50	+ * @param string $key The key
51	+ * @param string $domain The domain name
52	+ */
53	+ public function deleteMetadata($key = '', $domain = 'messages');
54	+ }

src/common/lib/vendor/symfony/translation/PluralizationRules.php ADDED Viewed

	@@ -0,0 +1,208 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation;
13	+
14	+ /**
15	+ * Returns the plural rules for a given locale.
16	+ *
17	+ * @author Fabien Potencier <fabien@symfony.com>
18	+ */
19	+ class PluralizationRules
20	+ {
21	+ private static $rules = array();
22	+
23	+ /**
24	+ * Returns the plural position to use for the given locale and number.
25	+ *
26	+ * @param int $number The number
27	+ * @param string $locale The locale
28	+ *
29	+ * @return int The plural position
30	+ */
31	+ public static function get($number, $locale)
32	+ {
33	+ if ('pt_BR' === $locale) {
34	+ // temporary set a locale for brazilian
35	+ $locale = 'xbr';
36	+ }
37	+
38	+ if (strlen($locale) > 3) {
39	+ $locale = substr($locale, 0, -strlen(strrchr($locale, '_')));
40	+ }
41	+
42	+ if (isset(self::$rules[$locale])) {
43	+ $return = call_user_func(self::$rules[$locale], $number);
44	+
45	+ if (!is_int($return) \|\| $return < 0) {
46	+ return 0;
47	+ }
48	+
49	+ return $return;
50	+ }
51	+
52	+ /*
53	+ * The plural rules are derived from code of the Zend Framework (2010-09-25),
54	+ * which is subject to the new BSD license (http://framework.zend.com/license/new-bsd).
55	+ * Copyright (c) 2005-2010 Zend Technologies USA Inc. (http://www.zend.com)
56	+ */
57	+ switch ($locale) {
58	+ case 'az':
59	+ case 'bo':
60	+ case 'dz':
61	+ case 'id':
62	+ case 'ja':
63	+ case 'jv':
64	+ case 'ka':
65	+ case 'km':
66	+ case 'kn':
67	+ case 'ko':
68	+ case 'ms':
69	+ case 'th':
70	+ case 'tr':
71	+ case 'vi':
72	+ case 'zh':
73	+ return 0;
74	+
75	+ case 'af':
76	+ case 'bn':
77	+ case 'bg':
78	+ case 'ca':
79	+ case 'da':
80	+ case 'de':
81	+ case 'el':
82	+ case 'en':
83	+ case 'eo':
84	+ case 'es':
85	+ case 'et':
86	+ case 'eu':
87	+ case 'fa':
88	+ case 'fi':
89	+ case 'fo':
90	+ case 'fur':
91	+ case 'fy':
92	+ case 'gl':
93	+ case 'gu':
94	+ case 'ha':
95	+ case 'he':
96	+ case 'hu':
97	+ case 'is':
98	+ case 'it':
99	+ case 'ku':
100	+ case 'lb':
101	+ case 'ml':
102	+ case 'mn':
103	+ case 'mr':
104	+ case 'nah':
105	+ case 'nb':
106	+ case 'ne':
107	+ case 'nl':
108	+ case 'nn':
109	+ case 'no':
110	+ case 'om':
111	+ case 'or':
112	+ case 'pa':
113	+ case 'pap':
114	+ case 'ps':
115	+ case 'pt':
116	+ case 'so':
117	+ case 'sq':
118	+ case 'sv':
119	+ case 'sw':
120	+ case 'ta':
121	+ case 'te':
122	+ case 'tk':
123	+ case 'ur':
124	+ case 'zu':
125	+ return (1 == $number) ? 0 : 1;
126	+
127	+ case 'am':
128	+ case 'bh':
129	+ case 'fil':
130	+ case 'fr':
131	+ case 'gun':
132	+ case 'hi':
133	+ case 'hy':
134	+ case 'ln':
135	+ case 'mg':
136	+ case 'nso':
137	+ case 'xbr':
138	+ case 'ti':
139	+ case 'wa':
140	+ return ((0 == $number) \|\| (1 == $number)) ? 0 : 1;
141	+
142	+ case 'be':
143	+ case 'bs':
144	+ case 'hr':
145	+ case 'ru':
146	+ case 'sr':
147	+ case 'uk':
148	+ return ((1 == $number % 10) && (11 != $number % 100)) ? 0 : ((($number % 10 >= 2) && ($number % 10 <= 4) && (($number % 100 < 10) \|\| ($number % 100 >= 20))) ? 1 : 2);
149	+
150	+ case 'cs':
151	+ case 'sk':
152	+ return (1 == $number) ? 0 : ((($number >= 2) && ($number <= 4)) ? 1 : 2);
153	+
154	+ case 'ga':
155	+ return (1 == $number) ? 0 : ((2 == $number) ? 1 : 2);
156	+
157	+ case 'lt':
158	+ return ((1 == $number % 10) && (11 != $number % 100)) ? 0 : ((($number % 10 >= 2) && (($number % 100 < 10) \|\| ($number % 100 >= 20))) ? 1 : 2);
159	+
160	+ case 'sl':
161	+ return (1 == $number % 100) ? 0 : ((2 == $number % 100) ? 1 : (((3 == $number % 100) \|\| (4 == $number % 100)) ? 2 : 3));
162	+
163	+ case 'mk':
164	+ return (1 == $number % 10) ? 0 : 1;
165	+
166	+ case 'mt':
167	+ return (1 == $number) ? 0 : (((0 == $number) \|\| (($number % 100 > 1) && ($number % 100 < 11))) ? 1 : ((($number % 100 > 10) && ($number % 100 < 20)) ? 2 : 3));
168	+
169	+ case 'lv':
170	+ return (0 == $number) ? 0 : (((1 == $number % 10) && (11 != $number % 100)) ? 1 : 2);
171	+
172	+ case 'pl':
173	+ return (1 == $number) ? 0 : ((($number % 10 >= 2) && ($number % 10 <= 4) && (($number % 100 < 12) \|\| ($number % 100 > 14))) ? 1 : 2);
174	+
175	+ case 'cy':
176	+ return (1 == $number) ? 0 : ((2 == $number) ? 1 : (((8 == $number) \|\| (11 == $number)) ? 2 : 3));
177	+
178	+ case 'ro':
179	+ return (1 == $number) ? 0 : (((0 == $number) \|\| (($number % 100 > 0) && ($number % 100 < 20))) ? 1 : 2);
180	+
181	+ case 'ar':
182	+ return (0 == $number) ? 0 : ((1 == $number) ? 1 : ((2 == $number) ? 2 : ((($number % 100 >= 3) && ($number % 100 <= 10)) ? 3 : ((($number % 100 >= 11) && ($number % 100 <= 99)) ? 4 : 5))));
183	+
184	+ default:
185	+ return 0;
186	+ }
187	+ }
188	+
189	+ /**
190	+ * Overrides the default plural rule for a given locale.
191	+ *
192	+ * @param callable $rule A PHP callable
193	+ * @param string $locale The locale
194	+ */
195	+ public static function set(callable $rule, $locale)
196	+ {
197	+ if ('pt_BR' === $locale) {
198	+ // temporary set a locale for brazilian
199	+ $locale = 'xbr';
200	+ }
201	+
202	+ if (strlen($locale) > 3) {
203	+ $locale = substr($locale, 0, -strlen(strrchr($locale, '_')));
204	+ }
205	+
206	+ self::$rules[$locale] = $rule;
207	+ }
208	+ }

src/common/lib/vendor/symfony/translation/README.md ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ Translation Component
2	+ =====================
3	+
4	+ The Translation component provides tools to internationalize your application.
5	+
6	+ Resources
7	+ ---------
8	+
9	+ * [Documentation](https://symfony.com/doc/current/components/translation/index.html)
10	+ * [Contributing](https://symfony.com/doc/current/contributing/index.html)
11	+ * [Report issues](https://github.com/symfony/symfony/issues) and
12	+ [send Pull Requests](https://github.com/symfony/symfony/pulls)
13	+ in the [main Symfony repository](https://github.com/symfony/symfony)

src/common/lib/vendor/symfony/translation/Reader/TranslationReader.php ADDED Viewed

	@@ -0,0 +1,63 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Reader;
13	+
14	+ use Symfony\Component\Finder\Finder;
15	+ use Symfony\Component\Translation\Loader\LoaderInterface;
16	+ use Symfony\Component\Translation\MessageCatalogue;
17	+
18	+ /**
19	+ * TranslationReader reads translation messages from translation files.
20	+ *
21	+ * @author Michel Salib <michelsalib@hotmail.com>
22	+ */
23	+ class TranslationReader implements TranslationReaderInterface
24	+ {
25	+ /**
26	+ * Loaders used for import.
27	+ *
28	+ * @var array
29	+ */
30	+ private $loaders = array();
31	+
32	+ /**
33	+ * Adds a loader to the translation extractor.
34	+ *
35	+ * @param string $format The format of the loader
36	+ * @param LoaderInterface $loader
37	+ */
38	+ public function addLoader($format, LoaderInterface $loader)
39	+ {
40	+ $this->loaders[$format] = $loader;
41	+ }
42	+
43	+ /**
44	+ * {@inheritdoc}
45	+ */
46	+ public function read($directory, MessageCatalogue $catalogue)
47	+ {
48	+ if (!is_dir($directory)) {
49	+ return;
50	+ }
51	+
52	+ foreach ($this->loaders as $format => $loader) {
53	+ // load any existing translation files
54	+ $finder = new Finder();
55	+ $extension = $catalogue->getLocale().'.'.$format;
56	+ $files = $finder->files()->name('*.'.$extension)->in($directory);
57	+ foreach ($files as $file) {
58	+ $domain = substr($file->getFilename(), 0, -1 * strlen($extension) - 1);
59	+ $catalogue->addCatalogue($loader->load($file->getPathname(), $catalogue->getLocale(), $domain));
60	+ }
61	+ }
62	+ }
63	+ }

src/common/lib/vendor/symfony/translation/Reader/TranslationReaderInterface.php ADDED Viewed

	@@ -0,0 +1,30 @@


1	+ <?php
2	+
3	+ /*
4	+ * This file is part of the Symfony package.
5	+ *
6	+ * (c) Fabien Potencier <fabien@symfony.com>
7	+ *
8	+ * For the full copyright and license information, please view the LICENSE
9	+ * file that was distributed with this source code.
10	+ */
11	+
12	+ namespace Symfony\Component\Translation\Reader;
13	+
14	+ use Symfony\Component\Translation\MessageCatalogue;
15	+
16	+ /**
17	+ * TranslationReader reads translation messages from translation files.
18	+ *
19	+ * @author Tobias Nyholm <tobias.nyholm@gmail.com>
20	+ */
21	+ interface TranslationReaderInterface
22	+ {
23	+ /**
24	+ * Reads translation messages from a directory to the catalogue.
25	+ *
26	+ * @param string $directory
27	+ * @param MessageCatalogue $catalogue
28	+ */
29	+ public function read($directory, MessageCatalogue $catalogue);
30	+ }

src/common/lib/vendor/symfony/translation/Resources/schemas/xliff-core-1.2-strict.xsd ADDED Viewed

	@@ -0,0 +1,2223 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+
3	+ <!--
4	+
5	+ May-19-2004:
6	+ - Changed the <choice> for ElemType_header, moving minOccurs="0" maxOccurs="unbounded" from its elements
7	+ to <choice> itself.
8	+ - Added <choice> for ElemType_trans-unit to allow "any order" for <context-group>, <count-group>, <prop-group>, <note>, and
9	+ <alt-trans>.
10	+
11	+ Oct-2005
12	+ - updated version info to 1.2
13	+ - equiv-trans attribute to <trans-unit> element
14	+ - merged-trans attribute for <group> element
15	+ - Add the <seg-source> element as optional in the <trans-unit> and <alt-trans> content models, at the same level as <source>
16	+ - Create a new value "seg" for the mtype attribute of the <mrk> element
17	+ - Add mid as an optional attribute for the <alt-trans> element
18	+
19	+ Nov-14-2005
20	+ - Changed name attribute for <context-group> from required to optional
21	+ - Added extension point at <xliff>
22	+
23	+ Jan-9-2006
24	+ - Added alttranstype type attribute to <alt-trans>, and values
25	+
26	+ Jan-10-2006
27	+ - Corrected error with overwritten purposeValueList
28	+ - Corrected name="AttrType_Version", attribute should have been "name"
29	+
30	+ -->
31	+ <xsd:schema xmlns:xlf="urn:oasis:names:tc:xliff:document:1.2" xmlns:xsd="http://www.w3.org/2001/XMLSchema" elementFormDefault="qualified" targetNamespace="urn:oasis:names:tc:xliff:document:1.2" xml:lang="en">
32	+ <!-- Import for xml:lang and xml:space -->
33	+ <xsd:import namespace="http://www.w3.org/XML/1998/namespace" schemaLocation="http://www.w3.org/2001/xml.xsd"/>
34	+ <!-- Attributes Lists -->
35	+ <xsd:simpleType name="XTend">
36	+ <xsd:restriction base="xsd:string">
37	+ <xsd:pattern value="x-[^\s]+"/>
38	+ </xsd:restriction>
39	+ </xsd:simpleType>
40	+ <xsd:simpleType name="context-typeValueList">
41	+ <xsd:annotation>
42	+ <xsd:documentation>Values for the attribute 'context-type'.</xsd:documentation>
43	+ </xsd:annotation>
44	+ <xsd:restriction base="xsd:string">
45	+ <xsd:enumeration value="database">
46	+ <xsd:annotation>
47	+ <xsd:documentation>Indicates a database content.</xsd:documentation>
48	+ </xsd:annotation>
49	+ </xsd:enumeration>
50	+ <xsd:enumeration value="element">
51	+ <xsd:annotation>
52	+ <xsd:documentation>Indicates the content of an element within an XML document.</xsd:documentation>
53	+ </xsd:annotation>
54	+ </xsd:enumeration>
55	+ <xsd:enumeration value="elementtitle">
56	+ <xsd:annotation>
57	+ <xsd:documentation>Indicates the name of an element within an XML document.</xsd:documentation>
58	+ </xsd:annotation>
59	+ </xsd:enumeration>
60	+ <xsd:enumeration value="linenumber">
61	+ <xsd:annotation>
62	+ <xsd:documentation>Indicates the line number from the sourcefile (see context-type="sourcefile") where the <source> is found.</xsd:documentation>
63	+ </xsd:annotation>
64	+ </xsd:enumeration>
65	+ <xsd:enumeration value="numparams">
66	+ <xsd:annotation>
67	+ <xsd:documentation>Indicates a the number of parameters contained within the <source>.</xsd:documentation>
68	+ </xsd:annotation>
69	+ </xsd:enumeration>
70	+ <xsd:enumeration value="paramnotes">
71	+ <xsd:annotation>
72	+ <xsd:documentation>Indicates notes pertaining to the parameters in the <source>.</xsd:documentation>
73	+ </xsd:annotation>
74	+ </xsd:enumeration>
75	+ <xsd:enumeration value="record">
76	+ <xsd:annotation>
77	+ <xsd:documentation>Indicates the content of a record within a database.</xsd:documentation>
78	+ </xsd:annotation>
79	+ </xsd:enumeration>
80	+ <xsd:enumeration value="recordtitle">
81	+ <xsd:annotation>
82	+ <xsd:documentation>Indicates the name of a record within a database.</xsd:documentation>
83	+ </xsd:annotation>
84	+ </xsd:enumeration>
85	+ <xsd:enumeration value="sourcefile">
86	+ <xsd:annotation>
87	+ <xsd:documentation>Indicates the original source file in the case that multiple files are merged to form the original file from which the XLIFF file is created. This differs from the original <file> attribute in that this sourcefile is one of many that make up that file.</xsd:documentation>
88	+ </xsd:annotation>
89	+ </xsd:enumeration>
90	+ </xsd:restriction>
91	+ </xsd:simpleType>
92	+ <xsd:simpleType name="count-typeValueList">
93	+ <xsd:annotation>
94	+ <xsd:documentation>Values for the attribute 'count-type'.</xsd:documentation>
95	+ </xsd:annotation>
96	+ <xsd:restriction base="xsd:NMTOKEN">
97	+ <xsd:enumeration value="num-usages">
98	+ <xsd:annotation>
99	+ <xsd:documentation>Indicates the count units are items that are used X times in a certain context; example: this is a reusable text unit which is used 42 times in other texts.</xsd:documentation>
100	+ </xsd:annotation>
101	+ </xsd:enumeration>
102	+ <xsd:enumeration value="repetition">
103	+ <xsd:annotation>
104	+ <xsd:documentation>Indicates the count units are translation units existing already in the same document.</xsd:documentation>
105	+ </xsd:annotation>
106	+ </xsd:enumeration>
107	+ <xsd:enumeration value="total">
108	+ <xsd:annotation>
109	+ <xsd:documentation>Indicates a total count.</xsd:documentation>
110	+ </xsd:annotation>
111	+ </xsd:enumeration>
112	+ </xsd:restriction>
113	+ </xsd:simpleType>
114	+ <xsd:simpleType name="InlineDelimitersValueList">
115	+ <xsd:annotation>
116	+ <xsd:documentation>Values for the attribute 'ctype' when used other elements than <ph> or <x>.</xsd:documentation>
117	+ </xsd:annotation>
118	+ <xsd:restriction base="xsd:NMTOKEN">
119	+ <xsd:enumeration value="bold">
120	+ <xsd:annotation>
121	+ <xsd:documentation>Indicates a run of bolded text.</xsd:documentation>
122	+ </xsd:annotation>
123	+ </xsd:enumeration>
124	+ <xsd:enumeration value="italic">
125	+ <xsd:annotation>
126	+ <xsd:documentation>Indicates a run of text in italics.</xsd:documentation>
127	+ </xsd:annotation>
128	+ </xsd:enumeration>
129	+ <xsd:enumeration value="underlined">
130	+ <xsd:annotation>
131	+ <xsd:documentation>Indicates a run of underlined text.</xsd:documentation>
132	+ </xsd:annotation>
133	+ </xsd:enumeration>
134	+ <xsd:enumeration value="link">
135	+ <xsd:annotation>
136	+ <xsd:documentation>Indicates a run of hyper-text.</xsd:documentation>
137	+ </xsd:annotation>
138	+ </xsd:enumeration>
139	+ </xsd:restriction>
140	+ </xsd:simpleType>
141	+ <xsd:simpleType name="InlinePlaceholdersValueList">
142	+ <xsd:annotation>
143	+ <xsd:documentation>Values for the attribute 'ctype' when used with <ph> or <x>.</xsd:documentation>
144	+ </xsd:annotation>
145	+ <xsd:restriction base="xsd:NMTOKEN">
146	+ <xsd:enumeration value="image">
147	+ <xsd:annotation>
148	+ <xsd:documentation>Indicates a inline image.</xsd:documentation>
149	+ </xsd:annotation>
150	+ </xsd:enumeration>
151	+ <xsd:enumeration value="pb">
152	+ <xsd:annotation>
153	+ <xsd:documentation>Indicates a page break.</xsd:documentation>
154	+ </xsd:annotation>
155	+ </xsd:enumeration>
156	+ <xsd:enumeration value="lb">
157	+ <xsd:annotation>
158	+ <xsd:documentation>Indicates a line break.</xsd:documentation>
159	+ </xsd:annotation>
160	+ </xsd:enumeration>
161	+ </xsd:restriction>
162	+ </xsd:simpleType>
163	+ <xsd:simpleType name="mime-typeValueList">
164	+ <xsd:restriction base="xsd:string">
165	+ <xsd:pattern value="(text\|multipart\|message\|application\|image\|audio\|video\|model)(/.+)*"/>
166	+ </xsd:restriction>
167	+ </xsd:simpleType>
168	+ <xsd:simpleType name="datatypeValueList">
169	+ <xsd:annotation>
170	+ <xsd:documentation>Values for the attribute 'datatype'.</xsd:documentation>
171	+ </xsd:annotation>
172	+ <xsd:restriction base="xsd:NMTOKEN">
173	+ <xsd:enumeration value="asp">
174	+ <xsd:annotation>
175	+ <xsd:documentation>Indicates Active Server Page data.</xsd:documentation>
176	+ </xsd:annotation>
177	+ </xsd:enumeration>
178	+ <xsd:enumeration value="c">
179	+ <xsd:annotation>
180	+ <xsd:documentation>Indicates C source file data.</xsd:documentation>
181	+ </xsd:annotation>
182	+ </xsd:enumeration>
183	+ <xsd:enumeration value="cdf">
184	+ <xsd:annotation>
185	+ <xsd:documentation>Indicates Channel Definition Format (CDF) data.</xsd:documentation>
186	+ </xsd:annotation>
187	+ </xsd:enumeration>
188	+ <xsd:enumeration value="cfm">
189	+ <xsd:annotation>
190	+ <xsd:documentation>Indicates ColdFusion data.</xsd:documentation>
191	+ </xsd:annotation>
192	+ </xsd:enumeration>
193	+ <xsd:enumeration value="cpp">
194	+ <xsd:annotation>
195	+ <xsd:documentation>Indicates C++ source file data.</xsd:documentation>
196	+ </xsd:annotation>
197	+ </xsd:enumeration>
198	+ <xsd:enumeration value="csharp">
199	+ <xsd:annotation>
200	+ <xsd:documentation>Indicates C-Sharp data.</xsd:documentation>
201	+ </xsd:annotation>
202	+ </xsd:enumeration>
203	+ <xsd:enumeration value="cstring">
204	+ <xsd:annotation>
205	+ <xsd:documentation>Indicates strings from C, ASM, and driver files data.</xsd:documentation>
206	+ </xsd:annotation>
207	+ </xsd:enumeration>
208	+ <xsd:enumeration value="csv">
209	+ <xsd:annotation>
210	+ <xsd:documentation>Indicates comma-separated values data.</xsd:documentation>
211	+ </xsd:annotation>
212	+ </xsd:enumeration>
213	+ <xsd:enumeration value="database">
214	+ <xsd:annotation>
215	+ <xsd:documentation>Indicates database data.</xsd:documentation>
216	+ </xsd:annotation>
217	+ </xsd:enumeration>
218	+ <xsd:enumeration value="documentfooter">
219	+ <xsd:annotation>
220	+ <xsd:documentation>Indicates portions of document that follows data and contains metadata.</xsd:documentation>
221	+ </xsd:annotation>
222	+ </xsd:enumeration>
223	+ <xsd:enumeration value="documentheader">
224	+ <xsd:annotation>
225	+ <xsd:documentation>Indicates portions of document that precedes data and contains metadata.</xsd:documentation>
226	+ </xsd:annotation>
227	+ </xsd:enumeration>
228	+ <xsd:enumeration value="filedialog">
229	+ <xsd:annotation>
230	+ <xsd:documentation>Indicates data from standard UI file operations dialogs (e.g., Open, Save, Save As, Export, Import).</xsd:documentation>
231	+ </xsd:annotation>
232	+ </xsd:enumeration>
233	+ <xsd:enumeration value="form">
234	+ <xsd:annotation>
235	+ <xsd:documentation>Indicates standard user input screen data.</xsd:documentation>
236	+ </xsd:annotation>
237	+ </xsd:enumeration>
238	+ <xsd:enumeration value="html">
239	+ <xsd:annotation>
240	+ <xsd:documentation>Indicates HyperText Markup Language (HTML) data - document instance.</xsd:documentation>
241	+ </xsd:annotation>
242	+ </xsd:enumeration>
243	+ <xsd:enumeration value="htmlbody">
244	+ <xsd:annotation>
245	+ <xsd:documentation>Indicates content within an HTML document’s <body> element.</xsd:documentation>
246	+ </xsd:annotation>
247	+ </xsd:enumeration>
248	+ <xsd:enumeration value="ini">
249	+ <xsd:annotation>
250	+ <xsd:documentation>Indicates Windows INI file data.</xsd:documentation>
251	+ </xsd:annotation>
252	+ </xsd:enumeration>
253	+ <xsd:enumeration value="interleaf">
254	+ <xsd:annotation>
255	+ <xsd:documentation>Indicates Interleaf data.</xsd:documentation>
256	+ </xsd:annotation>
257	+ </xsd:enumeration>
258	+ <xsd:enumeration value="javaclass">
259	+ <xsd:annotation>
260	+ <xsd:documentation>Indicates Java source file data (extension '.java').</xsd:documentation>
261	+ </xsd:annotation>
262	+ </xsd:enumeration>
263	+ <xsd:enumeration value="javapropertyresourcebundle">
264	+ <xsd:annotation>
265	+ <xsd:documentation>Indicates Java property resource bundle data.</xsd:documentation>
266	+ </xsd:annotation>
267	+ </xsd:enumeration>
268	+ <xsd:enumeration value="javalistresourcebundle">
269	+ <xsd:annotation>
270	+ <xsd:documentation>Indicates Java list resource bundle data.</xsd:documentation>
271	+ </xsd:annotation>
272	+ </xsd:enumeration>
273	+ <xsd:enumeration value="javascript">
274	+ <xsd:annotation>
275	+ <xsd:documentation>Indicates JavaScript source file data.</xsd:documentation>
276	+ </xsd:annotation>
277	+ </xsd:enumeration>
278	+ <xsd:enumeration value="jscript">
279	+ <xsd:annotation>
280	+ <xsd:documentation>Indicates JScript source file data.</xsd:documentation>
281	+ </xsd:annotation>
282	+ </xsd:enumeration>
283	+ <xsd:enumeration value="layout">
284	+ <xsd:annotation>
285	+ <xsd:documentation>Indicates information relating to formatting.</xsd:documentation>
286	+ </xsd:annotation>
287	+ </xsd:enumeration>
288	+ <xsd:enumeration value="lisp">
289	+ <xsd:annotation>
290	+ <xsd:documentation>Indicates LISP source file data.</xsd:documentation>
291	+ </xsd:annotation>
292	+ </xsd:enumeration>
293	+ <xsd:enumeration value="margin">
294	+ <xsd:annotation>
295	+ <xsd:documentation>Indicates information relating to margin formats.</xsd:documentation>
296	+ </xsd:annotation>
297	+ </xsd:enumeration>
298	+ <xsd:enumeration value="menufile">
299	+ <xsd:annotation>
300	+ <xsd:documentation>Indicates a file containing menu.</xsd:documentation>
301	+ </xsd:annotation>
302	+ </xsd:enumeration>
303	+ <xsd:enumeration value="messagefile">
304	+ <xsd:annotation>
305	+ <xsd:documentation>Indicates numerically identified string table.</xsd:documentation>
306	+ </xsd:annotation>
307	+ </xsd:enumeration>
308	+ <xsd:enumeration value="mif">
309	+ <xsd:annotation>
310	+ <xsd:documentation>Indicates Maker Interchange Format (MIF) data.</xsd:documentation>
311	+ </xsd:annotation>
312	+ </xsd:enumeration>
313	+ <xsd:enumeration value="mimetype">
314	+ <xsd:annotation>
315	+ <xsd:documentation>Indicates that the datatype attribute value is a MIME Type value and is defined in the mime-type attribute.</xsd:documentation>
316	+ </xsd:annotation>
317	+ </xsd:enumeration>
318	+ <xsd:enumeration value="mo">
319	+ <xsd:annotation>
320	+ <xsd:documentation>Indicates GNU Machine Object data.</xsd:documentation>
321	+ </xsd:annotation>
322	+ </xsd:enumeration>
323	+ <xsd:enumeration value="msglib">
324	+ <xsd:annotation>
325	+ <xsd:documentation>Indicates Message Librarian strings created by Novell's Message Librarian Tool.</xsd:documentation>
326	+ </xsd:annotation>
327	+ </xsd:enumeration>
328	+ <xsd:enumeration value="pagefooter">
329	+ <xsd:annotation>
330	+ <xsd:documentation>Indicates information to be displayed at the bottom of each page of a document.</xsd:documentation>
331	+ </xsd:annotation>
332	+ </xsd:enumeration>
333	+ <xsd:enumeration value="pageheader">
334	+ <xsd:annotation>
335	+ <xsd:documentation>Indicates information to be displayed at the top of each page of a document.</xsd:documentation>
336	+ </xsd:annotation>
337	+ </xsd:enumeration>
338	+ <xsd:enumeration value="parameters">
339	+ <xsd:annotation>
340	+ <xsd:documentation>Indicates a list of property values (e.g., settings within INI files or preferences dialog).</xsd:documentation>
341	+ </xsd:annotation>
342	+ </xsd:enumeration>
343	+ <xsd:enumeration value="pascal">
344	+ <xsd:annotation>
345	+ <xsd:documentation>Indicates Pascal source file data.</xsd:documentation>
346	+ </xsd:annotation>
347	+ </xsd:enumeration>
348	+ <xsd:enumeration value="php">
349	+ <xsd:annotation>
350	+ <xsd:documentation>Indicates Hypertext Preprocessor data.</xsd:documentation>
351	+ </xsd:annotation>
352	+ </xsd:enumeration>
353	+ <xsd:enumeration value="plaintext">
354	+ <xsd:annotation>
355	+ <xsd:documentation>Indicates plain text file (no formatting other than, possibly, wrapping).</xsd:documentation>
356	+ </xsd:annotation>
357	+ </xsd:enumeration>
358	+ <xsd:enumeration value="po">
359	+ <xsd:annotation>
360	+ <xsd:documentation>Indicates GNU Portable Object file.</xsd:documentation>
361	+ </xsd:annotation>
362	+ </xsd:enumeration>
363	+ <xsd:enumeration value="report">
364	+ <xsd:annotation>
365	+ <xsd:documentation>Indicates dynamically generated user defined document. e.g. Oracle Report, Crystal Report, etc.</xsd:documentation>
366	+ </xsd:annotation>
367	+ </xsd:enumeration>
368	+ <xsd:enumeration value="resources">
369	+ <xsd:annotation>
370	+ <xsd:documentation>Indicates Windows .NET binary resources.</xsd:documentation>
371	+ </xsd:annotation>
372	+ </xsd:enumeration>
373	+ <xsd:enumeration value="resx">
374	+ <xsd:annotation>
375	+ <xsd:documentation>Indicates Windows .NET Resources.</xsd:documentation>
376	+ </xsd:annotation>
377	+ </xsd:enumeration>
378	+ <xsd:enumeration value="rtf">
379	+ <xsd:annotation>
380	+ <xsd:documentation>Indicates Rich Text Format (RTF) data.</xsd:documentation>
381	+ </xsd:annotation>
382	+ </xsd:enumeration>
383	+ <xsd:enumeration value="sgml">
384	+ <xsd:annotation>
385	+ <xsd:documentation>Indicates Standard Generalized Markup Language (SGML) data - document instance.</xsd:documentation>
386	+ </xsd:annotation>
387	+ </xsd:enumeration>
388	+ <xsd:enumeration value="sgmldtd">
389	+ <xsd:annotation>
390	+ <xsd:documentation>Indicates Standard Generalized Markup Language (SGML) data - Document Type Definition (DTD).</xsd:documentation>
391	+ </xsd:annotation>
392	+ </xsd:enumeration>
393	+ <xsd:enumeration value="svg">
394	+ <xsd:annotation>
395	+ <xsd:documentation>Indicates Scalable Vector Graphic (SVG) data.</xsd:documentation>
396	+ </xsd:annotation>
397	+ </xsd:enumeration>
398	+ <xsd:enumeration value="vbscript">
399	+ <xsd:annotation>
400	+ <xsd:documentation>Indicates VisualBasic Script source file.</xsd:documentation>
401	+ </xsd:annotation>
402	+ </xsd:enumeration>
403	+ <xsd:enumeration value="warning">
404	+ <xsd:annotation>
405	+ <xsd:documentation>Indicates warning message.</xsd:documentation>
406	+ </xsd:annotation>
407	+ </xsd:enumeration>
408	+ <xsd:enumeration value="winres">
409	+ <xsd:annotation>
410	+ <xsd:documentation>Indicates Windows (Win32) resources (i.e. resources extracted from an RC script, a message file, or a compiled file).</xsd:documentation>
411	+ </xsd:annotation>
412	+ </xsd:enumeration>
413	+ <xsd:enumeration value="xhtml">
414	+ <xsd:annotation>
415	+ <xsd:documentation>Indicates Extensible HyperText Markup Language (XHTML) data - document instance.</xsd:documentation>
416	+ </xsd:annotation>
417	+ </xsd:enumeration>
418	+ <xsd:enumeration value="xml">
419	+ <xsd:annotation>
420	+ <xsd:documentation>Indicates Extensible Markup Language (XML) data - document instance.</xsd:documentation>
421	+ </xsd:annotation>
422	+ </xsd:enumeration>
423	+ <xsd:enumeration value="xmldtd">
424	+ <xsd:annotation>
425	+ <xsd:documentation>Indicates Extensible Markup Language (XML) data - Document Type Definition (DTD).</xsd:documentation>
426	+ </xsd:annotation>
427	+ </xsd:enumeration>
428	+ <xsd:enumeration value="xsl">
429	+ <xsd:annotation>
430	+ <xsd:documentation>Indicates Extensible Stylesheet Language (XSL) data.</xsd:documentation>
431	+ </xsd:annotation>
432	+ </xsd:enumeration>
433	+ <xsd:enumeration value="xul">
434	+ <xsd:annotation>
435	+ <xsd:documentation>Indicates XUL elements.</xsd:documentation>
436	+ </xsd:annotation>
437	+ </xsd:enumeration>
438	+ </xsd:restriction>
439	+ </xsd:simpleType>
440	+ <xsd:simpleType name="mtypeValueList">
441	+ <xsd:annotation>
442	+ <xsd:documentation>Values for the attribute 'mtype'.</xsd:documentation>
443	+ </xsd:annotation>
444	+ <xsd:restriction base="xsd:NMTOKEN">
445	+ <xsd:enumeration value="abbrev">
446	+ <xsd:annotation>
447	+ <xsd:documentation>Indicates the marked text is an abbreviation.</xsd:documentation>
448	+ </xsd:annotation>
449	+ </xsd:enumeration>
450	+ <xsd:enumeration value="abbreviated-form">
451	+ <xsd:annotation>
452	+ <xsd:documentation>ISO-12620 2.1.8: A term resulting from the omission of any part of the full term while designating the same concept.</xsd:documentation>
453	+ </xsd:annotation>
454	+ </xsd:enumeration>
455	+ <xsd:enumeration value="abbreviation">
456	+ <xsd:annotation>
457	+ <xsd:documentation>ISO-12620 2.1.8.1: An abbreviated form of a simple term resulting from the omission of some of its letters (e.g. 'adj.' for 'adjective').</xsd:documentation>
458	+ </xsd:annotation>
459	+ </xsd:enumeration>
460	+ <xsd:enumeration value="acronym">
461	+ <xsd:annotation>
462	+ <xsd:documentation>ISO-12620 2.1.8.4: An abbreviated form of a term made up of letters from the full form of a multiword term strung together into a sequence pronounced only syllabically (e.g. 'radar' for 'radio detecting and ranging').</xsd:documentation>
463	+ </xsd:annotation>
464	+ </xsd:enumeration>
465	+ <xsd:enumeration value="appellation">
466	+ <xsd:annotation>
467	+ <xsd:documentation>ISO-12620: A proper-name term, such as the name of an agency or other proper entity.</xsd:documentation>
468	+ </xsd:annotation>
469	+ </xsd:enumeration>
470	+ <xsd:enumeration value="collocation">
471	+ <xsd:annotation>
472	+ <xsd:documentation>ISO-12620 2.1.18.1: A recurrent word combination characterized by cohesion in that the components of the collocation must co-occur within an utterance or series of utterances, even though they do not necessarily have to maintain immediate proximity to one another.</xsd:documentation>
473	+ </xsd:annotation>
474	+ </xsd:enumeration>
475	+ <xsd:enumeration value="common-name">
476	+ <xsd:annotation>
477	+ <xsd:documentation>ISO-12620 2.1.5: A synonym for an international scientific term that is used in general discourse in a given language.</xsd:documentation>
478	+ </xsd:annotation>
479	+ </xsd:enumeration>
480	+ <xsd:enumeration value="datetime">
481	+ <xsd:annotation>
482	+ <xsd:documentation>Indicates the marked text is

Shield Security for WordPress - Version 6.0.0

Version Description

Release Info

Code changes from version 5.20.1 to 6.0.0