Shield Security for WordPress

Version Description

Current Release = Released: 2nd May, 2018
(v.7) IMPROVED: reCAPTCHA JS is only included on pages where it's actually used by Shield.
(v.7) IMPROVED: Upgrade Bootstrap library to 4.1.0.
(v.7) IMPROVED: Include jQuery for the plugin badge as required

Release Info

Developer	paultgoodchild
Plugin	Shield Security for WordPress
Version	6.6.7
Comparing to
See all releases

Code changes from version 6.6.6 to 6.6.7

Files changed (9) hide show

icwp-plugin-controller.php +2 -2
icwp-wpsf.php +1 -1
plugin-spec.php +2 -2
readme.txt +11 -7
resources/css/bootstrap4.css +423 -448
resources/css/bootstrap4.min.css +2 -2
resources/js/bootstrap4.bundle.js +5345 -5240
resources/js/bootstrap4.bundle.min.js +2 -2
resources/js/bootstrap4.js +1643 -1625

icwp-plugin-controller.php CHANGED Viewed

	@@ -179,7 +179,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
179
180	if ( !$bMeetsRequirements ) {
181	$this->aRequirementsMessages = $aRequirementsMessages;
182	- add_action( '~~admin_menu~~', array( $this, 'adminNoticeDoesNotMeetRequirements' ) );
183	add_action( 'network_admin_notices', array( $this, 'adminNoticeDoesNotMeetRequirements' ) );
184	throw new Exception( 'Plugin does not meet minimum requirements' );
185	}
	@@ -1572,7 +1572,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
1572	catch ( Exception $oE ) {
1573	if ( $this->getIsValidAdminArea() ) {
1574	$this->sAdminNoticeError = $oE->getMessage();
1575	- add_action( '~~admin_menu~~', array( $this, 'adminNoticePluginFailedToLoad' ) );
1576	add_action( 'network_admin_notices', array( $this, 'adminNoticePluginFailedToLoad' ) );
1577	}
1578	}


179
180	if ( !$bMeetsRequirements ) {
181	$this->aRequirementsMessages = $aRequirementsMessages;
182	+ add_action( 'admin_notices', array( $this, 'adminNoticeDoesNotMeetRequirements' ) );
183	add_action( 'network_admin_notices', array( $this, 'adminNoticeDoesNotMeetRequirements' ) );
184	throw new Exception( 'Plugin does not meet minimum requirements' );
185	}

1572	catch ( Exception $oE ) {
1573	if ( $this->getIsValidAdminArea() ) {
1574	$this->sAdminNoticeError = $oE->getMessage();
1575	+ add_action( 'admin_notices', array( $this, 'adminNoticePluginFailedToLoad' ) );
1576	add_action( 'network_admin_notices', array( $this, 'adminNoticePluginFailedToLoad' ) );
1577	}
1578	}

icwp-wpsf.php CHANGED Viewed

	@@ -3,7 +3,7 @@
3	* Plugin Name: Shield Security
4	* Plugin URI: http://icwp.io/2f
5	* Description: Powerful, Easy-To-Use #1 Rated WordPress Security System
6	- * Version: 6.6.6
7	* Text Domain: wp-simple-firewall
8	* Domain Path: /languages/
9	* Author: One Dollar Plugin


3	* Plugin Name: Shield Security
4	* Plugin URI: http://icwp.io/2f
5	* Description: Powerful, Easy-To-Use #1 Rated WordPress Security System
6	+ * Version: 6.6.7
7	* Text Domain: wp-simple-firewall
8	* Domain Path: /languages/
9	* Author: One Dollar Plugin

plugin-spec.php CHANGED Viewed

	@@ -1,7 +1,7 @@
1	{
2	"properties": {
3	- "version": "6.6.6",
4	- "release_timestamp": ~~1524129189~~,
5	"slug_parent": "icwp",
6	"slug_plugin": "wpsf",
7	"human_name": "Shield",


1	{
2	"properties": {
3	+ "version": "6.6.7",
4	+ "release_timestamp": 1525248893,
5	"slug_parent": "icwp",
6	"slug_plugin": "wpsf",
7	"human_name": "Shield",

readme.txt CHANGED Viewed

	@@ -8,7 +8,7 @@ Requires at least: 3.5.0
8	Requires PHP: 5.2.4
9	Recommended PHP: 5.4
10	Tested up to: 4.9
11	- Stable tag: 6.6.6
12
13	Complete All-In-One Protection for your WordPress sites, that makes Security Easy for Everyone - it doesn't have to be hard anymore.
14
	@@ -345,23 +345,27 @@ Possible options are: network_admin, administrator, editor, author, contributor,
345
346	== Changelog ==
347
348	- Our policy was to never restrict security features to Pro upgrades. ~~[This has now changed](http://icwp.io/bs).~~

349
350	Shield Pro brings exclusive features to the serious webmaster to maximise site security. You'll also have access to our email technical support team.
351	If you don't want to support the work, no problem! You can still continue to use Shield Security and its free features in-full.
352
353	You can [go Pro for just $1/month](http://icwp.io/aa).
354
355	- = 6.6.6 - Current Release =
356	- Released: ~~19th~~ ~~April~~, 2018 ~~- [Release Notes](http://icwp.io/c3)~~
357
358	- * (v.6) ~~ADDED~~: ~~Small~~ ~~exclusion~~ in ~~the~~ ~~firewall~~ ~~for~~ a ~~jetpack~~ ~~parameter~~.
359	- * (v.6) ~~ADDED~~: ~~SVGs~~ to ~~the~~ ~~default~~ ~~list of files scanned by the plugin guard~~.
360	- * (v.6) ~~ADDED~~: ~~Workaround~~ for a ~~[ridiculous~~ ~~NGG~~ ~~bug](https://wordpress.org/support/topic/forcefully-executing-wp_footer-not-compatible-with-other-plugins/).~~
361
362	= 6.6 Series =
363	Released: 19th March, 2018 - [Release Notes](http://icwp.io/c3)
364



365	* (v.6) ADDED: Small exclusion in the firewall for a jetpack parameter.
366	* (v.6) ADDED: SVGs to the default list of files scanned by the plugin guard.
367	* (v.6) ADDED: Workaround for a [ridiculous NGG bug](https://wordpress.org/support/topic/forcefully-executing-wp_footer-not-compatible-with-other-plugins/).


8	Requires PHP: 5.2.4
9	Recommended PHP: 5.4
10	Tested up to: 4.9
11	+ Stable tag: 6.6.7
12
13	Complete All-In-One Protection for your WordPress sites, that makes Security Easy for Everyone - it doesn't have to be hard anymore.
14

345
346	== Changelog ==
347
348	+ Our policy was to never restrict security features to Pro upgrades.
349	+ [This has now changed](http://icwp.io/bs).
350
351	Shield Pro brings exclusive features to the serious webmaster to maximise site security. You'll also have access to our email technical support team.
352	If you don't want to support the work, no problem! You can still continue to use Shield Security and its free features in-full.
353
354	You can [go Pro for just $1/month](http://icwp.io/aa).
355
356	+ = 6.6.7 - Current Release =
357	+ Released: 2nd May, 2018
358
359	+ * (v.7) IMPROVED: reCAPTCHA JS is only included on pages where it's actually used by Shield.
360	+ * (v.7) IMPROVED: Upgrade Bootstrap library to 4.1.0.
361	+ * (v.7) IMPROVED: Include jQuery for the plugin badge as required
362
363	= 6.6 Series =
364	Released: 19th March, 2018 - [Release Notes](http://icwp.io/c3)
365
366	+ * (v.7) IMPROVED: reCAPTCHA JS is only included on pages where it's actually used by Shield.
367	+ * (v.7) IMPROVED: Upgrade Bootstrap library to 4.1.0.
368	+ * (v.7) IMPROVED: Include jQuery for the plugin badge as required
369	* (v.6) ADDED: Small exclusion in the firewall for a jetpack parameter.
370	* (v.6) ADDED: SVGs to the default list of files scanned by the plugin guard.
371	* (v.6) ADDED: Workaround for a [ridiculous NGG bug](https://wordpress.org/support/topic/forcefully-executing-wp_footer-not-compatible-with-other-plugins/).

resources/css/bootstrap4.css CHANGED Viewed

	@@ -1,5 +1,5 @@
1	/*!
2	- * Bootstrap v4.0.0 (https://getbootstrap.com)
3	* Copyright 2011-2018 The Bootstrap Authors
4	* Copyright 2011-2018 Twitter, Inc.
5	* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
	@@ -232,7 +232,7 @@ th {
232
233	label {
234	display: inline-block;
235	- margin-bottom: .5rem;
236	}
237
238	button {
	@@ -594,7 +594,6 @@ pre code {
594	}
595
596	.row {
597	- display: -webkit-box;
598	display: -ms-flexbox;
599	display: flex;
600	-ms-flex-wrap: wrap;
	@@ -630,14 +629,12 @@ pre code {
630	.col {
631	-ms-flex-preferred-size: 0;
632	flex-basis: 0;
633	- -webkit-box-flex: 1;
634	-ms-flex-positive: 1;
635	flex-grow: 1;
636	max-width: 100%;
637	}
638
639	.col-auto {
640	- -webkit-box-flex: 0;
641	-ms-flex: 0 0 auto;
642	flex: 0 0 auto;
643	width: auto;
	@@ -645,175 +642,148 @@ pre code {
645	}
646
647	.col-1 {
648	- -webkit-box-flex: 0;
649	-ms-flex: 0 0 8.333333%;
650	flex: 0 0 8.333333%;
651	max-width: 8.333333%;
652	}
653
654	.col-2 {
655	- -webkit-box-flex: 0;
656	-ms-flex: 0 0 16.666667%;
657	flex: 0 0 16.666667%;
658	max-width: 16.666667%;
659	}
660
661	.col-3 {
662	- -webkit-box-flex: 0;
663	-ms-flex: 0 0 25%;
664	flex: 0 0 25%;
665	max-width: 25%;
666	}
667
668	.col-4 {
669	- -webkit-box-flex: 0;
670	-ms-flex: 0 0 33.333333%;
671	flex: 0 0 33.333333%;
672	max-width: 33.333333%;
673	}
674
675	.col-5 {
676	- -webkit-box-flex: 0;
677	-ms-flex: 0 0 41.666667%;
678	flex: 0 0 41.666667%;
679	max-width: 41.666667%;
680	}
681
682	.col-6 {
683	- -webkit-box-flex: 0;
684	-ms-flex: 0 0 50%;
685	flex: 0 0 50%;
686	max-width: 50%;
687	}
688
689	.col-7 {
690	- -webkit-box-flex: 0;
691	-ms-flex: 0 0 58.333333%;
692	flex: 0 0 58.333333%;
693	max-width: 58.333333%;
694	}
695
696	.col-8 {
697	- -webkit-box-flex: 0;
698	-ms-flex: 0 0 66.666667%;
699	flex: 0 0 66.666667%;
700	max-width: 66.666667%;
701	}
702
703	.col-9 {
704	- -webkit-box-flex: 0;
705	-ms-flex: 0 0 75%;
706	flex: 0 0 75%;
707	max-width: 75%;
708	}
709
710	.col-10 {
711	- -webkit-box-flex: 0;
712	-ms-flex: 0 0 83.333333%;
713	flex: 0 0 83.333333%;
714	max-width: 83.333333%;
715	}
716
717	.col-11 {
718	- -webkit-box-flex: 0;
719	-ms-flex: 0 0 91.666667%;
720	flex: 0 0 91.666667%;
721	max-width: 91.666667%;
722	}
723
724	.col-12 {
725	- -webkit-box-flex: 0;
726	-ms-flex: 0 0 100%;
727	flex: 0 0 100%;
728	max-width: 100%;
729	}
730
731	.order-first {
732	- -webkit-box-ordinal-group: 0;
733	-ms-flex-order: -1;
734	order: -1;
735	}
736
737	.order-last {
738	- -webkit-box-ordinal-group: 14;
739	-ms-flex-order: 13;
740	order: 13;
741	}
742
743	.order-0 {
744	- -webkit-box-ordinal-group: 1;
745	-ms-flex-order: 0;
746	order: 0;
747	}
748
749	.order-1 {
750	- -webkit-box-ordinal-group: 2;
751	-ms-flex-order: 1;
752	order: 1;
753	}
754
755	.order-2 {
756	- -webkit-box-ordinal-group: 3;
757	-ms-flex-order: 2;
758	order: 2;
759	}
760
761	.order-3 {
762	- -webkit-box-ordinal-group: 4;
763	-ms-flex-order: 3;
764	order: 3;
765	}
766
767	.order-4 {
768	- -webkit-box-ordinal-group: 5;
769	-ms-flex-order: 4;
770	order: 4;
771	}
772
773	.order-5 {
774	- -webkit-box-ordinal-group: 6;
775	-ms-flex-order: 5;
776	order: 5;
777	}
778
779	.order-6 {
780	- -webkit-box-ordinal-group: 7;
781	-ms-flex-order: 6;
782	order: 6;
783	}
784
785	.order-7 {
786	- -webkit-box-ordinal-group: 8;
787	-ms-flex-order: 7;
788	order: 7;
789	}
790
791	.order-8 {
792	- -webkit-box-ordinal-group: 9;
793	-ms-flex-order: 8;
794	order: 8;
795	}
796
797	.order-9 {
798	- -webkit-box-ordinal-group: 10;
799	-ms-flex-order: 9;
800	order: 9;
801	}
802
803	.order-10 {
804	- -webkit-box-ordinal-group: 11;
805	-ms-flex-order: 10;
806	order: 10;
807	}
808
809	.order-11 {
810	- -webkit-box-ordinal-group: 12;
811	-ms-flex-order: 11;
812	order: 11;
813	}
814
815	.order-12 {
816	- -webkit-box-ordinal-group: 13;
817	-ms-flex-order: 12;
818	order: 12;
819	}
	@@ -866,162 +836,133 @@ pre code {
866	.col-sm {
867	-ms-flex-preferred-size: 0;
868	flex-basis: 0;
869	- -webkit-box-flex: 1;
870	-ms-flex-positive: 1;
871	flex-grow: 1;
872	max-width: 100%;
873	}
874	.col-sm-auto {
875	- -webkit-box-flex: 0;
876	-ms-flex: 0 0 auto;
877	flex: 0 0 auto;
878	width: auto;
879	max-width: none;
880	}
881	.col-sm-1 {
882	- -webkit-box-flex: 0;
883	-ms-flex: 0 0 8.333333%;
884	flex: 0 0 8.333333%;
885	max-width: 8.333333%;
886	}
887	.col-sm-2 {
888	- -webkit-box-flex: 0;
889	-ms-flex: 0 0 16.666667%;
890	flex: 0 0 16.666667%;
891	max-width: 16.666667%;
892	}
893	.col-sm-3 {
894	- -webkit-box-flex: 0;
895	-ms-flex: 0 0 25%;
896	flex: 0 0 25%;
897	max-width: 25%;
898	}
899	.col-sm-4 {
900	- -webkit-box-flex: 0;
901	-ms-flex: 0 0 33.333333%;
902	flex: 0 0 33.333333%;
903	max-width: 33.333333%;
904	}
905	.col-sm-5 {
906	- -webkit-box-flex: 0;
907	-ms-flex: 0 0 41.666667%;
908	flex: 0 0 41.666667%;
909	max-width: 41.666667%;
910	}
911	.col-sm-6 {
912	- -webkit-box-flex: 0;
913	-ms-flex: 0 0 50%;
914	flex: 0 0 50%;
915	max-width: 50%;
916	}
917	.col-sm-7 {
918	- -webkit-box-flex: 0;
919	-ms-flex: 0 0 58.333333%;
920	flex: 0 0 58.333333%;
921	max-width: 58.333333%;
922	}
923	.col-sm-8 {
924	- -webkit-box-flex: 0;
925	-ms-flex: 0 0 66.666667%;
926	flex: 0 0 66.666667%;
927	max-width: 66.666667%;
928	}
929	.col-sm-9 {
930	- -webkit-box-flex: 0;
931	-ms-flex: 0 0 75%;
932	flex: 0 0 75%;
933	max-width: 75%;
934	}
935	.col-sm-10 {
936	- -webkit-box-flex: 0;
937	-ms-flex: 0 0 83.333333%;
938	flex: 0 0 83.333333%;
939	max-width: 83.333333%;
940	}
941	.col-sm-11 {
942	- -webkit-box-flex: 0;
943	-ms-flex: 0 0 91.666667%;
944	flex: 0 0 91.666667%;
945	max-width: 91.666667%;
946	}
947	.col-sm-12 {
948	- -webkit-box-flex: 0;
949	-ms-flex: 0 0 100%;
950	flex: 0 0 100%;
951	max-width: 100%;
952	}
953	.order-sm-first {
954	- -webkit-box-ordinal-group: 0;
955	-ms-flex-order: -1;
956	order: -1;
957	}
958	.order-sm-last {
959	- -webkit-box-ordinal-group: 14;
960	-ms-flex-order: 13;
961	order: 13;
962	}
963	.order-sm-0 {
964	- -webkit-box-ordinal-group: 1;
965	-ms-flex-order: 0;
966	order: 0;
967	}
968	.order-sm-1 {
969	- -webkit-box-ordinal-group: 2;
970	-ms-flex-order: 1;
971	order: 1;
972	}
973	.order-sm-2 {
974	- -webkit-box-ordinal-group: 3;
975	-ms-flex-order: 2;
976	order: 2;
977	}
978	.order-sm-3 {
979	- -webkit-box-ordinal-group: 4;
980	-ms-flex-order: 3;
981	order: 3;
982	}
983	.order-sm-4 {
984	- -webkit-box-ordinal-group: 5;
985	-ms-flex-order: 4;
986	order: 4;
987	}
988	.order-sm-5 {
989	- -webkit-box-ordinal-group: 6;
990	-ms-flex-order: 5;
991	order: 5;
992	}
993	.order-sm-6 {
994	- -webkit-box-ordinal-group: 7;
995	-ms-flex-order: 6;
996	order: 6;
997	}
998	.order-sm-7 {
999	- -webkit-box-ordinal-group: 8;
1000	-ms-flex-order: 7;
1001	order: 7;
1002	}
1003	.order-sm-8 {
1004	- -webkit-box-ordinal-group: 9;
1005	-ms-flex-order: 8;
1006	order: 8;
1007	}
1008	.order-sm-9 {
1009	- -webkit-box-ordinal-group: 10;
1010	-ms-flex-order: 9;
1011	order: 9;
1012	}
1013	.order-sm-10 {
1014	- -webkit-box-ordinal-group: 11;
1015	-ms-flex-order: 10;
1016	order: 10;
1017	}
1018	.order-sm-11 {
1019	- -webkit-box-ordinal-group: 12;
1020	-ms-flex-order: 11;
1021	order: 11;
1022	}
1023	.order-sm-12 {
1024	- -webkit-box-ordinal-group: 13;
1025	-ms-flex-order: 12;
1026	order: 12;
1027	}
	@@ -1067,162 +1008,133 @@ pre code {
1067	.col-md {
1068	-ms-flex-preferred-size: 0;
1069	flex-basis: 0;
1070	- -webkit-box-flex: 1;
1071	-ms-flex-positive: 1;
1072	flex-grow: 1;
1073	max-width: 100%;
1074	}
1075	.col-md-auto {
1076	- -webkit-box-flex: 0;
1077	-ms-flex: 0 0 auto;
1078	flex: 0 0 auto;
1079	width: auto;
1080	max-width: none;
1081	}
1082	.col-md-1 {
1083	- -webkit-box-flex: 0;
1084	-ms-flex: 0 0 8.333333%;
1085	flex: 0 0 8.333333%;
1086	max-width: 8.333333%;
1087	}
1088	.col-md-2 {
1089	- -webkit-box-flex: 0;
1090	-ms-flex: 0 0 16.666667%;
1091	flex: 0 0 16.666667%;
1092	max-width: 16.666667%;
1093	}
1094	.col-md-3 {
1095	- -webkit-box-flex: 0;
1096	-ms-flex: 0 0 25%;
1097	flex: 0 0 25%;
1098	max-width: 25%;
1099	}
1100	.col-md-4 {
1101	- -webkit-box-flex: 0;
1102	-ms-flex: 0 0 33.333333%;
1103	flex: 0 0 33.333333%;
1104	max-width: 33.333333%;
1105	}
1106	.col-md-5 {
1107	- -webkit-box-flex: 0;
1108	-ms-flex: 0 0 41.666667%;
1109	flex: 0 0 41.666667%;
1110	max-width: 41.666667%;
1111	}
1112	.col-md-6 {
1113	- -webkit-box-flex: 0;
1114	-ms-flex: 0 0 50%;
1115	flex: 0 0 50%;
1116	max-width: 50%;
1117	}
1118	.col-md-7 {
1119	- -webkit-box-flex: 0;
1120	-ms-flex: 0 0 58.333333%;
1121	flex: 0 0 58.333333%;
1122	max-width: 58.333333%;
1123	}
1124	.col-md-8 {
1125	- -webkit-box-flex: 0;
1126	-ms-flex: 0 0 66.666667%;
1127	flex: 0 0 66.666667%;
1128	max-width: 66.666667%;
1129	}
1130	.col-md-9 {
1131	- -webkit-box-flex: 0;
1132	-ms-flex: 0 0 75%;
1133	flex: 0 0 75%;
1134	max-width: 75%;
1135	}
1136	.col-md-10 {
1137	- -webkit-box-flex: 0;
1138	-ms-flex: 0 0 83.333333%;
1139	flex: 0 0 83.333333%;
1140	max-width: 83.333333%;
1141	}
1142	.col-md-11 {
1143	- -webkit-box-flex: 0;
1144	-ms-flex: 0 0 91.666667%;
1145	flex: 0 0 91.666667%;
1146	max-width: 91.666667%;
1147	}
1148	.col-md-12 {
1149	- -webkit-box-flex: 0;
1150	-ms-flex: 0 0 100%;
1151	flex: 0 0 100%;
1152	max-width: 100%;
1153	}
1154	.order-md-first {
1155	- -webkit-box-ordinal-group: 0;
1156	-ms-flex-order: -1;
1157	order: -1;
1158	}
1159	.order-md-last {
1160	- -webkit-box-ordinal-group: 14;
1161	-ms-flex-order: 13;
1162	order: 13;
1163	}
1164	.order-md-0 {
1165	- -webkit-box-ordinal-group: 1;
1166	-ms-flex-order: 0;
1167	order: 0;
1168	}
1169	.order-md-1 {
1170	- -webkit-box-ordinal-group: 2;
1171	-ms-flex-order: 1;
1172	order: 1;
1173	}
1174	.order-md-2 {
1175	- -webkit-box-ordinal-group: 3;
1176	-ms-flex-order: 2;
1177	order: 2;
1178	}
1179	.order-md-3 {
1180	- -webkit-box-ordinal-group: 4;
1181	-ms-flex-order: 3;
1182	order: 3;
1183	}
1184	.order-md-4 {
1185	- -webkit-box-ordinal-group: 5;
1186	-ms-flex-order: 4;
1187	order: 4;
1188	}
1189	.order-md-5 {
1190	- -webkit-box-ordinal-group: 6;
1191	-ms-flex-order: 5;
1192	order: 5;
1193	}
1194	.order-md-6 {
1195	- -webkit-box-ordinal-group: 7;
1196	-ms-flex-order: 6;
1197	order: 6;
1198	}
1199	.order-md-7 {
1200	- -webkit-box-ordinal-group: 8;
1201	-ms-flex-order: 7;
1202	order: 7;
1203	}
1204	.order-md-8 {
1205	- -webkit-box-ordinal-group: 9;
1206	-ms-flex-order: 8;
1207	order: 8;
1208	}
1209	.order-md-9 {
1210	- -webkit-box-ordinal-group: 10;
1211	-ms-flex-order: 9;
1212	order: 9;
1213	}
1214	.order-md-10 {
1215	- -webkit-box-ordinal-group: 11;
1216	-ms-flex-order: 10;
1217	order: 10;
1218	}
1219	.order-md-11 {
1220	- -webkit-box-ordinal-group: 12;
1221	-ms-flex-order: 11;
1222	order: 11;
1223	}
1224	.order-md-12 {
1225	- -webkit-box-ordinal-group: 13;
1226	-ms-flex-order: 12;
1227	order: 12;
1228	}
	@@ -1268,162 +1180,133 @@ pre code {
1268	.col-lg {
1269	-ms-flex-preferred-size: 0;
1270	flex-basis: 0;
1271	- -webkit-box-flex: 1;
1272	-ms-flex-positive: 1;
1273	flex-grow: 1;
1274	max-width: 100%;
1275	}
1276	.col-lg-auto {
1277	- -webkit-box-flex: 0;
1278	-ms-flex: 0 0 auto;
1279	flex: 0 0 auto;
1280	width: auto;
1281	max-width: none;
1282	}
1283	.col-lg-1 {
1284	- -webkit-box-flex: 0;
1285	-ms-flex: 0 0 8.333333%;
1286	flex: 0 0 8.333333%;
1287	max-width: 8.333333%;
1288	}
1289	.col-lg-2 {
1290	- -webkit-box-flex: 0;
1291	-ms-flex: 0 0 16.666667%;
1292	flex: 0 0 16.666667%;
1293	max-width: 16.666667%;
1294	}
1295	.col-lg-3 {
1296	- -webkit-box-flex: 0;
1297	-ms-flex: 0 0 25%;
1298	flex: 0 0 25%;
1299	max-width: 25%;
1300	}
1301	.col-lg-4 {
1302	- -webkit-box-flex: 0;
1303	-ms-flex: 0 0 33.333333%;
1304	flex: 0 0 33.333333%;
1305	max-width: 33.333333%;
1306	}
1307	.col-lg-5 {
1308	- -webkit-box-flex: 0;
1309	-ms-flex: 0 0 41.666667%;
1310	flex: 0 0 41.666667%;
1311	max-width: 41.666667%;
1312	}
1313	.col-lg-6 {
1314	- -webkit-box-flex: 0;
1315	-ms-flex: 0 0 50%;
1316	flex: 0 0 50%;
1317	max-width: 50%;
1318	}
1319	.col-lg-7 {
1320	- -webkit-box-flex: 0;
1321	-ms-flex: 0 0 58.333333%;
1322	flex: 0 0 58.333333%;
1323	max-width: 58.333333%;
1324	}
1325	.col-lg-8 {
1326	- -webkit-box-flex: 0;
1327	-ms-flex: 0 0 66.666667%;
1328	flex: 0 0 66.666667%;
1329	max-width: 66.666667%;
1330	}
1331	.col-lg-9 {
1332	- -webkit-box-flex: 0;
1333	-ms-flex: 0 0 75%;
1334	flex: 0 0 75%;
1335	max-width: 75%;
1336	}
1337	.col-lg-10 {
1338	- -webkit-box-flex: 0;
1339	-ms-flex: 0 0 83.333333%;
1340	flex: 0 0 83.333333%;
1341	max-width: 83.333333%;
1342	}
1343	.col-lg-11 {
1344	- -webkit-box-flex: 0;
1345	-ms-flex: 0 0 91.666667%;
1346	flex: 0 0 91.666667%;
1347	max-width: 91.666667%;
1348	}
1349	.col-lg-12 {
1350	- -webkit-box-flex: 0;
1351	-ms-flex: 0 0 100%;
1352	flex: 0 0 100%;
1353	max-width: 100%;
1354	}
1355	.order-lg-first {
1356	- -webkit-box-ordinal-group: 0;
1357	-ms-flex-order: -1;
1358	order: -1;
1359	}
1360	.order-lg-last {
1361	- -webkit-box-ordinal-group: 14;
1362	-ms-flex-order: 13;
1363	order: 13;
1364	}
1365	.order-lg-0 {
1366	- -webkit-box-ordinal-group: 1;
1367	-ms-flex-order: 0;
1368	order: 0;
1369	}
1370	.order-lg-1 {
1371	- -webkit-box-ordinal-group: 2;
1372	-ms-flex-order: 1;
1373	order: 1;
1374	}
1375	.order-lg-2 {
1376	- -webkit-box-ordinal-group: 3;
1377	-ms-flex-order: 2;
1378	order: 2;
1379	}
1380	.order-lg-3 {
1381	- -webkit-box-ordinal-group: 4;
1382	-ms-flex-order: 3;
1383	order: 3;
1384	}
1385	.order-lg-4 {
1386	- -webkit-box-ordinal-group: 5;
1387	-ms-flex-order: 4;
1388	order: 4;
1389	}
1390	.order-lg-5 {
1391	- -webkit-box-ordinal-group: 6;
1392	-ms-flex-order: 5;
1393	order: 5;
1394	}
1395	.order-lg-6 {
1396	- -webkit-box-ordinal-group: 7;
1397	-ms-flex-order: 6;
1398	order: 6;
1399	}
1400	.order-lg-7 {
1401	- -webkit-box-ordinal-group: 8;
1402	-ms-flex-order: 7;
1403	order: 7;
1404	}
1405	.order-lg-8 {
1406	- -webkit-box-ordinal-group: 9;
1407	-ms-flex-order: 8;
1408	order: 8;
1409	}
1410	.order-lg-9 {
1411	- -webkit-box-ordinal-group: 10;
1412	-ms-flex-order: 9;
1413	order: 9;
1414	}
1415	.order-lg-10 {
1416	- -webkit-box-ordinal-group: 11;
1417	-ms-flex-order: 10;
1418	order: 10;
1419	}
1420	.order-lg-11 {
1421	- -webkit-box-ordinal-group: 12;
1422	-ms-flex-order: 11;
1423	order: 11;
1424	}
1425	.order-lg-12 {
1426	- -webkit-box-ordinal-group: 13;
1427	-ms-flex-order: 12;
1428	order: 12;
1429	}
	@@ -1469,162 +1352,133 @@ pre code {
1469	.col-xl {
1470	-ms-flex-preferred-size: 0;
1471	flex-basis: 0;
1472	- -webkit-box-flex: 1;
1473	-ms-flex-positive: 1;
1474	flex-grow: 1;
1475	max-width: 100%;
1476	}
1477	.col-xl-auto {
1478	- -webkit-box-flex: 0;
1479	-ms-flex: 0 0 auto;
1480	flex: 0 0 auto;
1481	width: auto;
1482	max-width: none;
1483	}
1484	.col-xl-1 {
1485	- -webkit-box-flex: 0;
1486	-ms-flex: 0 0 8.333333%;
1487	flex: 0 0 8.333333%;
1488	max-width: 8.333333%;
1489	}
1490	.col-xl-2 {
1491	- -webkit-box-flex: 0;
1492	-ms-flex: 0 0 16.666667%;
1493	flex: 0 0 16.666667%;
1494	max-width: 16.666667%;
1495	}
1496	.col-xl-3 {
1497	- -webkit-box-flex: 0;
1498	-ms-flex: 0 0 25%;
1499	flex: 0 0 25%;
1500	max-width: 25%;
1501	}
1502	.col-xl-4 {
1503	- -webkit-box-flex: 0;
1504	-ms-flex: 0 0 33.333333%;
1505	flex: 0 0 33.333333%;
1506	max-width: 33.333333%;
1507	}
1508	.col-xl-5 {
1509	- -webkit-box-flex: 0;
1510	-ms-flex: 0 0 41.666667%;
1511	flex: 0 0 41.666667%;
1512	max-width: 41.666667%;
1513	}
1514	.col-xl-6 {
1515	- -webkit-box-flex: 0;
1516	-ms-flex: 0 0 50%;
1517	flex: 0 0 50%;
1518	max-width: 50%;
1519	}
1520	.col-xl-7 {
1521	- -webkit-box-flex: 0;
1522	-ms-flex: 0 0 58.333333%;
1523	flex: 0 0 58.333333%;
1524	max-width: 58.333333%;
1525	}
1526	.col-xl-8 {
1527	- -webkit-box-flex: 0;
1528	-ms-flex: 0 0 66.666667%;
1529	flex: 0 0 66.666667%;
1530	max-width: 66.666667%;
1531	}
1532	.col-xl-9 {
1533	- -webkit-box-flex: 0;
1534	-ms-flex: 0 0 75%;
1535	flex: 0 0 75%;
1536	max-width: 75%;
1537	}
1538	.col-xl-10 {
1539	- -webkit-box-flex: 0;
1540	-ms-flex: 0 0 83.333333%;
1541	flex: 0 0 83.333333%;
1542	max-width: 83.333333%;
1543	}
1544	.col-xl-11 {
1545	- -webkit-box-flex: 0;
1546	-ms-flex: 0 0 91.666667%;
1547	flex: 0 0 91.666667%;
1548	max-width: 91.666667%;
1549	}
1550	.col-xl-12 {
1551	- -webkit-box-flex: 0;
1552	-ms-flex: 0 0 100%;
1553	flex: 0 0 100%;
1554	max-width: 100%;
1555	}
1556	.order-xl-first {
1557	- -webkit-box-ordinal-group: 0;
1558	-ms-flex-order: -1;
1559	order: -1;
1560	}
1561	.order-xl-last {
1562	- -webkit-box-ordinal-group: 14;
1563	-ms-flex-order: 13;
1564	order: 13;
1565	}
1566	.order-xl-0 {
1567	- -webkit-box-ordinal-group: 1;
1568	-ms-flex-order: 0;
1569	order: 0;
1570	}
1571	.order-xl-1 {
1572	- -webkit-box-ordinal-group: 2;
1573	-ms-flex-order: 1;
1574	order: 1;
1575	}
1576	.order-xl-2 {
1577	- -webkit-box-ordinal-group: 3;
1578	-ms-flex-order: 2;
1579	order: 2;
1580	}
1581	.order-xl-3 {
1582	- -webkit-box-ordinal-group: 4;
1583	-ms-flex-order: 3;
1584	order: 3;
1585	}
1586	.order-xl-4 {
1587	- -webkit-box-ordinal-group: 5;
1588	-ms-flex-order: 4;
1589	order: 4;
1590	}
1591	.order-xl-5 {
1592	- -webkit-box-ordinal-group: 6;
1593	-ms-flex-order: 5;
1594	order: 5;
1595	}
1596	.order-xl-6 {
1597	- -webkit-box-ordinal-group: 7;
1598	-ms-flex-order: 6;
1599	order: 6;
1600	}
1601	.order-xl-7 {
1602	- -webkit-box-ordinal-group: 8;
1603	-ms-flex-order: 7;
1604	order: 7;
1605	}
1606	.order-xl-8 {
1607	- -webkit-box-ordinal-group: 9;
1608	-ms-flex-order: 8;
1609	order: 8;
1610	}
1611	.order-xl-9 {
1612	- -webkit-box-ordinal-group: 10;
1613	-ms-flex-order: 9;
1614	order: 9;
1615	}
1616	.order-xl-10 {
1617	- -webkit-box-ordinal-group: 11;
1618	-ms-flex-order: 10;
1619	order: 10;
1620	}
1621	.order-xl-11 {
1622	- -webkit-box-ordinal-group: 12;
1623	-ms-flex-order: 11;
1624	order: 11;
1625	}
1626	.order-xl-12 {
1627	- -webkit-box-ordinal-group: 13;
1628	-ms-flex-order: 12;
1629	order: 12;
1630	}
	@@ -1712,6 +1566,13 @@ pre code {
1712	border-bottom-width: 2px;
1713	}
1714







1715	.table-striped tbody tr:nth-of-type(odd) {
1716	background-color: rgba(0, 0, 0, 0.05);
1717	}
	@@ -1968,6 +1829,12 @@ pre code {
1968	transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
1969	}
1970






1971	.form-control::-ms-expand {
1972	background-color: transparent;
1973	border: 0;
	@@ -2055,6 +1922,7 @@ select.form-control:focus::-ms-value {
2055	padding-bottom: 0.375rem;
2056	margin-bottom: 0;
2057	line-height: 1.5;

2058	background-color: transparent;
2059	border: solid transparent;
2060	border-width: 1px 0;
	@@ -2121,7 +1989,6 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
2121	}
2122
2123	.form-row {
2124	- display: -webkit-box;
2125	display: -ms-flexbox;
2126	display: flex;
2127	-ms-flex-wrap: wrap;
	@@ -2157,10 +2024,8 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
2157	}
2158
2159	.form-check-inline {
2160	- display: -webkit-inline-box;
2161	display: -ms-inline-flexbox;
2162	display: inline-flex;
2163	- -webkit-box-align: center;
2164	-ms-flex-align: center;
2165	align-items: center;
2166	padding-left: 0;
	@@ -2369,14 +2234,10 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
2369	}
2370
2371	.form-inline {
2372	- display: -webkit-box;
2373	display: -ms-flexbox;
2374	display: flex;
2375	- -webkit-box-orient: horizontal;
2376	- -webkit-box-direction: normal;
2377	-ms-flex-flow: row wrap;
2378	flex-flow: row wrap;
2379	- -webkit-box-align: center;
2380	-ms-flex-align: center;
2381	align-items: center;
2382	}
	@@ -2387,29 +2248,21 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
2387
2388	@media (min-width: 576px) {
2389	.form-inline label {
2390	- display: -webkit-box;
2391	display: -ms-flexbox;
2392	display: flex;
2393	- -webkit-box-align: center;
2394	-ms-flex-align: center;
2395	align-items: center;
2396	- -webkit-box-pack: center;
2397	-ms-flex-pack: center;
2398	justify-content: center;
2399	margin-bottom: 0;
2400	}
2401	.form-inline .form-group {
2402	- display: -webkit-box;
2403	display: -ms-flexbox;
2404	display: flex;
2405	- -webkit-box-flex: 0;
2406	-ms-flex: 0 0 auto;
2407	flex: 0 0 auto;
2408	- -webkit-box-orient: horizontal;
2409	- -webkit-box-direction: normal;
2410	-ms-flex-flow: row wrap;
2411	flex-flow: row wrap;
2412	- -webkit-box-align: center;
2413	-ms-flex-align: center;
2414	align-items: center;
2415	margin-bottom: 0;
	@@ -2422,17 +2275,15 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
2422	.form-inline .form-control-plaintext {
2423	display: inline-block;
2424	}
2425	- .form-inline .input-group {

2426	width: auto;
2427	}
2428	.form-inline .form-check {
2429	- display: -webkit-box;
2430	display: -ms-flexbox;
2431	display: flex;
2432	- -webkit-box-align: center;
2433	-ms-flex-align: center;
2434	align-items: center;
2435	- -webkit-box-pack: center;
2436	-ms-flex-pack: center;
2437	justify-content: center;
2438	width: auto;
	@@ -2445,10 +2296,8 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
2445	margin-left: 0;
2446	}
2447	.form-inline .custom-control {
2448	- -webkit-box-align: center;
2449	-ms-flex-align: center;
2450	align-items: center;
2451	- -webkit-box-pack: center;
2452	-ms-flex-pack: center;
2453	justify-content: center;
2454	}
	@@ -2475,6 +2324,12 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
2475	transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
2476	}
2477






2478	.btn:hover, .btn:focus {
2479	text-decoration: none;
2480	}
	@@ -3066,6 +2921,7 @@ fieldset:disabled a.btn {
3066
3067	.btn-link:disabled, .btn-link.disabled {
3068	color: #6c757d;

3069	}
3070
3071	.btn-lg, .btn-group-lg > .btn {
	@@ -3098,28 +2954,21 @@ input[type="button"].btn-block {
3098	}
3099
3100	.fade {
3101	- opacity: 0;
3102	transition: opacity 0.15s linear;
3103	}
3104
3105	- ~~.fade.show~~ {
3106	- ~~opacity:~~ 1;
3107	- }
3108	-
3109	- .collapse {
3110	- display: none;
3111	- }
3112	-
3113	- .collapse.show {
3114	- display: block;
3115	}
3116
3117	- tr.~~collapse~~.show {
3118	- ~~display~~: ~~table-row~~;
3119	}
3120
3121	- ~~tbody~~.collapse.show {
3122	- display: ~~table-row-group~~;
3123	}
3124
3125	.collapsing {
	@@ -3129,8 +2978,16 @@ tbody.collapse.show {
3129	transition: height 0.35s ease;
3130	}
3131






3132	.dropup,
3133	- .~~dropdown {~~


3134	position: relative;
3135	}
3136
	@@ -3171,7 +3028,14 @@ tbody.collapse.show {
3171	border-radius: 0.25rem;
3172	}
3173





3174	.dropup .dropdown-menu {


3175	margin-top: 0;
3176	margin-bottom: 0.125rem;
3177	}
	@@ -3194,6 +3058,9 @@ tbody.collapse.show {
3194	}
3195
3196	.dropright .dropdown-menu {



3197	margin-top: 0;
3198	margin-left: 0.125rem;
3199	}
	@@ -3206,6 +3073,7 @@ tbody.collapse.show {
3206	vertical-align: 0.255em;
3207	content: "";
3208	border-top: 0.3em solid transparent;

3209	border-bottom: 0.3em solid transparent;
3210	border-left: 0.3em solid;
3211	}
	@@ -3219,6 +3087,9 @@ tbody.collapse.show {
3219	}
3220
3221	.dropleft .dropdown-menu {



3222	margin-top: 0;
3223	margin-right: 0.125rem;
3224	}
	@@ -3256,6 +3127,11 @@ tbody.collapse.show {
3256	vertical-align: 0;
3257	}
3258





3259	.dropdown-divider {
3260	height: 0;
3261	margin: 0.5rem 0;
	@@ -3306,10 +3182,15 @@ tbody.collapse.show {
3306	white-space: nowrap;
3307	}
3308






3309	.btn-group,
3310	.btn-group-vertical {
3311	position: relative;
3312	- display: -webkit-inline-box;
3313	display: -ms-inline-flexbox;
3314	display: inline-flex;
3315	vertical-align: middle;
	@@ -3318,7 +3199,6 @@ tbody.collapse.show {
3318	.btn-group > .btn,
3319	.btn-group-vertical > .btn {
3320	position: relative;
3321	- -webkit-box-flex: 0;
3322	-ms-flex: 0 1 auto;
3323	flex: 0 1 auto;
3324	}
	@@ -3347,12 +3227,10 @@ tbody.collapse.show {
3347	}
3348
3349	.btn-toolbar {
3350	- display: -webkit-box;
3351	display: -ms-flexbox;
3352	display: flex;
3353	-ms-flex-wrap: wrap;
3354	flex-wrap: wrap;
3355	- -webkit-box-pack: start;
3356	-ms-flex-pack: start;
3357	justify-content: flex-start;
3358	}
	@@ -3382,10 +3260,16 @@ tbody.collapse.show {
3382	padding-left: 0.5625rem;
3383	}
3384
3385	- .dropdown-toggle-split::after {


3386	margin-left: 0;
3387	}
3388




3389	.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
3390	padding-right: 0.375rem;
3391	padding-left: 0.375rem;
	@@ -3397,14 +3281,10 @@ tbody.collapse.show {
3397	}
3398
3399	.btn-group-vertical {
3400	- -webkit-box-orient: vertical;
3401	- -webkit-box-direction: normal;
3402	-ms-flex-direction: column;
3403	flex-direction: column;
3404	- -webkit-box-align: start;
3405	-ms-flex-align: start;
3406	align-items: flex-start;
3407	- -webkit-box-pack: center;
3408	-ms-flex-pack: center;
3409	justify-content: center;
3410	}
	@@ -3450,12 +3330,10 @@ tbody.collapse.show {
3450
3451	.input-group {
3452	position: relative;
3453	- display: -webkit-box;
3454	display: -ms-flexbox;
3455	display: flex;
3456	-ms-flex-wrap: wrap;
3457	flex-wrap: wrap;
3458	- -webkit-box-align: stretch;
3459	-ms-flex-align: stretch;
3460	align-items: stretch;
3461	width: 100%;
	@@ -3465,7 +3343,6 @@ tbody.collapse.show {
3465	.input-group > .custom-select,
3466	.input-group > .custom-file {
3467	position: relative;
3468	- -webkit-box-flex: 1;
3469	-ms-flex: 1 1 auto;
3470	flex: 1 1 auto;
3471	width: 1%;
	@@ -3503,29 +3380,26 @@ tbody.collapse.show {
3503	}
3504
3505	.input-group > .custom-file {
3506	- display: -webkit-box;
3507	display: -ms-flexbox;
3508	display: flex;
3509	- -webkit-box-align: center;
3510	-ms-flex-align: center;
3511	align-items: center;
3512	}
3513
3514	.input-group > .custom-file:not(:last-child) .custom-file-label,
3515	- .input-group > .custom-file:not(:last-child) .custom-file-label::~~before~~ {
3516	border-top-right-radius: 0;
3517	border-bottom-right-radius: 0;
3518	}
3519
3520	.input-group > .custom-file:not(:first-child) .custom-file-label,
3521	- .input-group > .custom-file:not(:first-child) .custom-file-label::~~before~~ {
3522	border-top-left-radius: 0;
3523	border-bottom-left-radius: 0;
3524	}
3525
3526	.input-group-prepend,
3527	.input-group-append {
3528	- display: -webkit-box;
3529	display: -ms-flexbox;
3530	display: flex;
3531	}
	@@ -3556,10 +3430,8 @@ tbody.collapse.show {
3556	}
3557
3558	.input-group-text {
3559	- display: -webkit-box;
3560	display: -ms-flexbox;
3561	display: flex;
3562	- -webkit-box-align: center;
3563	-ms-flex-align: center;
3564	align-items: center;
3565	padding: 0.375rem 0.75rem;
	@@ -3608,7 +3480,6 @@ tbody.collapse.show {
3608	}
3609
3610	.custom-control-inline {
3611	- display: -webkit-inline-box;
3612	display: -ms-inline-flexbox;
3613	display: inline-flex;
3614	margin-right: 1rem;
	@@ -3793,12 +3664,12 @@ tbody.collapse.show {
3793	opacity: 0;
3794	}
3795
3796	- .custom-file-input:focus ~ .custom-file-~~control~~ {
3797	border-color: #80bdff;
3798	box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
3799	}
3800
3801	- .custom-file-input:focus ~ .custom-file-~~control~~::~~before~~ {
3802	border-color: #80bdff;
3803	}
3804
	@@ -3838,8 +3709,122 @@ tbody.collapse.show {
3838	border-radius: 0 0.25rem 0.25rem 0;
3839	}
3840



















































































































3841	.nav {
3842	- display: -webkit-box;
3843	display: -ms-flexbox;
3844	display: flex;
3845	-ms-flex-wrap: wrap;
	@@ -3910,7 +3895,6 @@ tbody.collapse.show {
3910	}
3911
3912	.nav-fill .nav-item {
3913	- -webkit-box-flex: 1;
3914	-ms-flex: 1 1 auto;
3915	flex: 1 1 auto;
3916	text-align: center;
	@@ -3919,7 +3903,6 @@ tbody.collapse.show {
3919	.nav-justified .nav-item {
3920	-ms-flex-preferred-size: 0;
3921	flex-basis: 0;
3922	- -webkit-box-flex: 1;
3923	-ms-flex-positive: 1;
3924	flex-grow: 1;
3925	text-align: center;
	@@ -3935,15 +3918,12 @@ tbody.collapse.show {
3935
3936	.navbar {
3937	position: relative;
3938	- display: -webkit-box;
3939	display: -ms-flexbox;
3940	display: flex;
3941	-ms-flex-wrap: wrap;
3942	flex-wrap: wrap;
3943	- -webkit-box-align: center;
3944	-ms-flex-align: center;
3945	align-items: center;
3946	- -webkit-box-pack: justify;
3947	-ms-flex-pack: justify;
3948	justify-content: space-between;
3949	padding: 0.5rem 1rem;
	@@ -3951,15 +3931,12 @@ tbody.collapse.show {
3951
3952	.navbar > .container,
3953	.navbar > .container-fluid {
3954	- display: -webkit-box;
3955	display: -ms-flexbox;
3956	display: flex;
3957	-ms-flex-wrap: wrap;
3958	flex-wrap: wrap;
3959	- -webkit-box-align: center;
3960	-ms-flex-align: center;
3961	align-items: center;
3962	- -webkit-box-pack: justify;
3963	-ms-flex-pack: justify;
3964	justify-content: space-between;
3965	}
	@@ -3979,11 +3956,8 @@ tbody.collapse.show {
3979	}
3980
3981	.navbar-nav {
3982	- display: -webkit-box;
3983	display: -ms-flexbox;
3984	display: flex;
3985	- -webkit-box-orient: vertical;
3986	- -webkit-box-direction: normal;
3987	-ms-flex-direction: column;
3988	flex-direction: column;
3989	padding-left: 0;
	@@ -4010,10 +3984,8 @@ tbody.collapse.show {
4010	.navbar-collapse {
4011	-ms-flex-preferred-size: 100%;
4012	flex-basis: 100%;
4013	- -webkit-box-flex: 1;
4014	-ms-flex-positive: 1;
4015	flex-grow: 1;
4016	- -webkit-box-align: center;
4017	-ms-flex-align: center;
4018	align-items: center;
4019	}
	@@ -4055,27 +4027,18 @@ tbody.collapse.show {
4055
4056	@media (min-width: 576px) {
4057	.navbar-expand-sm {
4058	- -webkit-box-orient: horizontal;
4059	- -webkit-box-direction: normal;
4060	-ms-flex-flow: row nowrap;
4061	flex-flow: row nowrap;
4062	- -webkit-box-pack: start;
4063	-ms-flex-pack: start;
4064	justify-content: flex-start;
4065	}
4066	.navbar-expand-sm .navbar-nav {
4067	- -webkit-box-orient: horizontal;
4068	- -webkit-box-direction: normal;
4069	-ms-flex-direction: row;
4070	flex-direction: row;
4071	}
4072	.navbar-expand-sm .navbar-nav .dropdown-menu {
4073	position: absolute;
4074	}
4075	- .navbar-expand-sm .navbar-nav .dropdown-menu-right {
4076	- right: 0;
4077	- left: auto;
4078	- }
4079	.navbar-expand-sm .navbar-nav .nav-link {
4080	padding-right: 0.5rem;
4081	padding-left: 0.5rem;
	@@ -4086,7 +4049,6 @@ tbody.collapse.show {
4086	flex-wrap: nowrap;
4087	}
4088	.navbar-expand-sm .navbar-collapse {
4089	- display: -webkit-box !important;
4090	display: -ms-flexbox !important;
4091	display: flex !important;
4092	-ms-flex-preferred-size: auto;
	@@ -4095,10 +4057,6 @@ tbody.collapse.show {
4095	.navbar-expand-sm .navbar-toggler {
4096	display: none;
4097	}
4098	- .navbar-expand-sm .dropup .dropdown-menu {
4099	- top: auto;
4100	- bottom: 100%;
4101	- }
4102	}
4103
4104	@media (max-width: 767.98px) {
	@@ -4111,27 +4069,18 @@ tbody.collapse.show {
4111
4112	@media (min-width: 768px) {
4113	.navbar-expand-md {
4114	- -webkit-box-orient: horizontal;
4115	- -webkit-box-direction: normal;
4116	-ms-flex-flow: row nowrap;
4117	flex-flow: row nowrap;
4118	- -webkit-box-pack: start;
4119	-ms-flex-pack: start;
4120	justify-content: flex-start;
4121	}
4122	.navbar-expand-md .navbar-nav {
4123	- -webkit-box-orient: horizontal;
4124	- -webkit-box-direction: normal;
4125	-ms-flex-direction: row;
4126	flex-direction: row;
4127	}
4128	.navbar-expand-md .navbar-nav .dropdown-menu {
4129	position: absolute;
4130	}
4131	- .navbar-expand-md .navbar-nav .dropdown-menu-right {
4132	- right: 0;
4133	- left: auto;
4134	- }
4135	.navbar-expand-md .navbar-nav .nav-link {
4136	padding-right: 0.5rem;
4137	padding-left: 0.5rem;
	@@ -4142,7 +4091,6 @@ tbody.collapse.show {
4142	flex-wrap: nowrap;
4143	}
4144	.navbar-expand-md .navbar-collapse {
4145	- display: -webkit-box !important;
4146	display: -ms-flexbox !important;
4147	display: flex !important;
4148	-ms-flex-preferred-size: auto;
	@@ -4151,10 +4099,6 @@ tbody.collapse.show {
4151	.navbar-expand-md .navbar-toggler {
4152	display: none;
4153	}
4154	- .navbar-expand-md .dropup .dropdown-menu {
4155	- top: auto;
4156	- bottom: 100%;
4157	- }
4158	}
4159
4160	@media (max-width: 991.98px) {
	@@ -4167,27 +4111,18 @@ tbody.collapse.show {
4167
4168	@media (min-width: 992px) {
4169	.navbar-expand-lg {
4170	- -webkit-box-orient: horizontal;
4171	- -webkit-box-direction: normal;
4172	-ms-flex-flow: row nowrap;
4173	flex-flow: row nowrap;
4174	- -webkit-box-pack: start;
4175	-ms-flex-pack: start;
4176	justify-content: flex-start;
4177	}
4178	.navbar-expand-lg .navbar-nav {
4179	- -webkit-box-orient: horizontal;
4180	- -webkit-box-direction: normal;
4181	-ms-flex-direction: row;
4182	flex-direction: row;
4183	}
4184	.navbar-expand-lg .navbar-nav .dropdown-menu {
4185	position: absolute;
4186	}
4187	- .navbar-expand-lg .navbar-nav .dropdown-menu-right {
4188	- right: 0;
4189	- left: auto;
4190	- }
4191	.navbar-expand-lg .navbar-nav .nav-link {
4192	padding-right: 0.5rem;
4193	padding-left: 0.5rem;
	@@ -4198,7 +4133,6 @@ tbody.collapse.show {
4198	flex-wrap: nowrap;
4199	}
4200	.navbar-expand-lg .navbar-collapse {
4201	- display: -webkit-box !important;
4202	display: -ms-flexbox !important;
4203	display: flex !important;
4204	-ms-flex-preferred-size: auto;
	@@ -4207,10 +4141,6 @@ tbody.collapse.show {
4207	.navbar-expand-lg .navbar-toggler {
4208	display: none;
4209	}
4210	- .navbar-expand-lg .dropup .dropdown-menu {
4211	- top: auto;
4212	- bottom: 100%;
4213	- }
4214	}
4215
4216	@media (max-width: 1199.98px) {
	@@ -4223,27 +4153,18 @@ tbody.collapse.show {
4223
4224	@media (min-width: 1200px) {
4225	.navbar-expand-xl {
4226	- -webkit-box-orient: horizontal;
4227	- -webkit-box-direction: normal;
4228	-ms-flex-flow: row nowrap;
4229	flex-flow: row nowrap;
4230	- -webkit-box-pack: start;
4231	-ms-flex-pack: start;
4232	justify-content: flex-start;
4233	}
4234	.navbar-expand-xl .navbar-nav {
4235	- -webkit-box-orient: horizontal;
4236	- -webkit-box-direction: normal;
4237	-ms-flex-direction: row;
4238	flex-direction: row;
4239	}
4240	.navbar-expand-xl .navbar-nav .dropdown-menu {
4241	position: absolute;
4242	}
4243	- .navbar-expand-xl .navbar-nav .dropdown-menu-right {
4244	- right: 0;
4245	- left: auto;
4246	- }
4247	.navbar-expand-xl .navbar-nav .nav-link {
4248	padding-right: 0.5rem;
4249	padding-left: 0.5rem;
	@@ -4254,7 +4175,6 @@ tbody.collapse.show {
4254	flex-wrap: nowrap;
4255	}
4256	.navbar-expand-xl .navbar-collapse {
4257	- display: -webkit-box !important;
4258	display: -ms-flexbox !important;
4259	display: flex !important;
4260	-ms-flex-preferred-size: auto;
	@@ -4263,18 +4183,11 @@ tbody.collapse.show {
4263	.navbar-expand-xl .navbar-toggler {
4264	display: none;
4265	}
4266	- .navbar-expand-xl .dropup .dropdown-menu {
4267	- top: auto;
4268	- bottom: 100%;
4269	- }
4270	}
4271
4272	.navbar-expand {
4273	- -webkit-box-orient: horizontal;
4274	- -webkit-box-direction: normal;
4275	-ms-flex-flow: row nowrap;
4276	flex-flow: row nowrap;
4277	- -webkit-box-pack: start;
4278	-ms-flex-pack: start;
4279	justify-content: flex-start;
4280	}
	@@ -4286,8 +4199,6 @@ tbody.collapse.show {
4286	}
4287
4288	.navbar-expand .navbar-nav {
4289	- -webkit-box-orient: horizontal;
4290	- -webkit-box-direction: normal;
4291	-ms-flex-direction: row;
4292	flex-direction: row;
4293	}
	@@ -4296,11 +4207,6 @@ tbody.collapse.show {
4296	position: absolute;
4297	}
4298
4299	- .navbar-expand .navbar-nav .dropdown-menu-right {
4300	- right: 0;
4301	- left: auto;
4302	- }
4303	-
4304	.navbar-expand .navbar-nav .nav-link {
4305	padding-right: 0.5rem;
4306	padding-left: 0.5rem;
	@@ -4313,7 +4219,6 @@ tbody.collapse.show {
4313	}
4314
4315	.navbar-expand .navbar-collapse {
4316	- display: -webkit-box !important;
4317	display: -ms-flexbox !important;
4318	display: flex !important;
4319	-ms-flex-preferred-size: auto;
	@@ -4324,11 +4229,6 @@ tbody.collapse.show {
4324	display: none;
4325	}
4326
4327	- .navbar-expand .dropup .dropdown-menu {
4328	- top: auto;
4329	- bottom: 100%;
4330	- }
4331	-
4332	.navbar-light .navbar-brand {
4333	color: rgba(0, 0, 0, 0.9);
4334	}
	@@ -4427,11 +4327,8 @@ tbody.collapse.show {
4427
4428	.card {
4429	position: relative;
4430	- display: -webkit-box;
4431	display: -ms-flexbox;
4432	display: flex;
4433	- -webkit-box-orient: vertical;
4434	- -webkit-box-direction: normal;
4435	-ms-flex-direction: column;
4436	flex-direction: column;
4437	min-width: 0;
	@@ -4458,7 +4355,6 @@ tbody.collapse.show {
4458	}
4459
4460	.card-body {
4461	- -webkit-box-flex: 1;
4462	-ms-flex: 1 1 auto;
4463	flex: 1 1 auto;
4464	padding: 1.25rem;
	@@ -4549,11 +4445,8 @@ tbody.collapse.show {
4549	}
4550
4551	.card-deck {
4552	- display: -webkit-box;
4553	display: -ms-flexbox;
4554	display: flex;
4555	- -webkit-box-orient: vertical;
4556	- -webkit-box-direction: normal;
4557	-ms-flex-direction: column;
4558	flex-direction: column;
4559	}
	@@ -4564,22 +4457,16 @@ tbody.collapse.show {
4564
4565	@media (min-width: 576px) {
4566	.card-deck {
4567	- -webkit-box-orient: horizontal;
4568	- -webkit-box-direction: normal;
4569	-ms-flex-flow: row wrap;
4570	flex-flow: row wrap;
4571	margin-right: -15px;
4572	margin-left: -15px;
4573	}
4574	.card-deck .card {
4575	- display: -webkit-box;
4576	display: -ms-flexbox;
4577	display: flex;
4578	- -webkit-box-flex: 1;
4579	-ms-flex: 1 0 0%;
4580	flex: 1 0 0%;
4581	- -webkit-box-orient: vertical;
4582	- -webkit-box-direction: normal;
4583	-ms-flex-direction: column;
4584	flex-direction: column;
4585	margin-right: 15px;
	@@ -4589,11 +4476,8 @@ tbody.collapse.show {
4589	}
4590
4591	.card-group {
4592	- display: -webkit-box;
4593	display: -ms-flexbox;
4594	display: flex;
4595	- -webkit-box-orient: vertical;
4596	- -webkit-box-direction: normal;
4597	-ms-flex-direction: column;
4598	flex-direction: column;
4599	}
	@@ -4604,13 +4488,10 @@ tbody.collapse.show {
4604
4605	@media (min-width: 576px) {
4606	.card-group {
4607	- -webkit-box-orient: horizontal;
4608	- -webkit-box-direction: normal;
4609	-ms-flex-flow: row wrap;
4610	flex-flow: row wrap;
4611	}
4612	.card-group > .card {
4613	- -webkit-box-flex: 1;
4614	-ms-flex: 1 0 0%;
4615	flex: 1 0 0%;
4616	margin-bottom: 0;
	@@ -4679,6 +4560,8 @@ tbody.collapse.show {
4679	-webkit-column-gap: 1.25rem;
4680	-moz-column-gap: 1.25rem;
4681	column-gap: 1.25rem;


4682	}
4683	.card-columns .card {
4684	display: inline-block;
	@@ -4686,8 +4569,27 @@ tbody.collapse.show {
4686	}
4687	}
4688




















4689	.breadcrumb {
4690	- display: -webkit-box;
4691	display: -ms-flexbox;
4692	display: flex;
4693	-ms-flex-wrap: wrap;
	@@ -4699,10 +4601,13 @@ tbody.collapse.show {
4699	border-radius: 0.25rem;
4700	}
4701




4702	.breadcrumb-item + .breadcrumb-item::before {
4703	display: inline-block;
4704	padding-right: 0.5rem;
4705	- padding-left: 0.5rem;
4706	color: #6c757d;
4707	content: "/";
4708	}
	@@ -4720,7 +4625,6 @@ tbody.collapse.show {
4720	}
4721
4722	.pagination {
4723	- display: -webkit-box;
4724	display: -ms-flexbox;
4725	display: flex;
4726	padding-left: 0;
	@@ -4740,6 +4644,7 @@ tbody.collapse.show {
4740	}
4741
4742	.page-link:hover {

4743	color: #0056b3;
4744	text-decoration: none;
4745	background-color: #e9ecef;
	@@ -5107,7 +5012,6 @@ tbody.collapse.show {
5107	}
5108
5109	.progress {
5110	- display: -webkit-box;
5111	display: -ms-flexbox;
5112	display: flex;
5113	height: 1rem;
	@@ -5118,22 +5022,25 @@ tbody.collapse.show {
5118	}
5119
5120	.progress-bar {
5121	- display: -webkit-box;
5122	display: -ms-flexbox;
5123	display: flex;
5124	- -webkit-box-orient: vertical;
5125	- -webkit-box-direction: normal;
5126	-ms-flex-direction: column;
5127	flex-direction: column;
5128	- -webkit-box-pack: center;
5129	-ms-flex-pack: center;
5130	justify-content: center;
5131	color: #fff;
5132	text-align: center;

5133	background-color: #007bff;
5134	transition: width 0.6s ease;
5135	}
5136






5137	.progress-bar-striped {
5138	background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
5139	background-size: 1rem 1rem;
	@@ -5145,26 +5052,20 @@ tbody.collapse.show {
5145	}
5146
5147	.media {
5148	- display: -webkit-box;
5149	display: -ms-flexbox;
5150	display: flex;
5151	- -webkit-box-align: start;
5152	-ms-flex-align: start;
5153	align-items: flex-start;
5154	}
5155
5156	.media-body {
5157	- -webkit-box-flex: 1;
5158	-ms-flex: 1;
5159	flex: 1;
5160	}
5161
5162	.list-group {
5163	- display: -webkit-box;
5164	display: -ms-flexbox;
5165	display: flex;
5166	- -webkit-box-orient: vertical;
5167	- -webkit-box-direction: normal;
5168	-ms-flex-direction: column;
5169	flex-direction: column;
5170	padding-left: 0;
	@@ -5430,16 +5331,20 @@ button.close {
5430	transform: translate(0, -25%);
5431	}
5432






5433	.modal.show .modal-dialog {
5434	-webkit-transform: translate(0, 0);
5435	transform: translate(0, 0);
5436	}
5437
5438	.modal-dialog-centered {
5439	- display: -webkit-box;
5440	display: -ms-flexbox;
5441	display: flex;
5442	- -webkit-box-align: center;
5443	-ms-flex-align: center;
5444	align-items: center;
5445	min-height: calc(100% - (0.5rem * 2));
	@@ -5447,11 +5352,8 @@ button.close {
5447
5448	.modal-content {
5449	position: relative;
5450	- display: -webkit-box;
5451	display: -ms-flexbox;
5452	display: flex;
5453	- -webkit-box-orient: vertical;
5454	- -webkit-box-direction: normal;
5455	-ms-flex-direction: column;
5456	flex-direction: column;
5457	width: 100%;
	@@ -5482,13 +5384,10 @@ button.close {
5482	}
5483
5484	.modal-header {
5485	- display: -webkit-box;
5486	display: -ms-flexbox;
5487	display: flex;
5488	- -webkit-box-align: start;
5489	-ms-flex-align: start;
5490	align-items: flex-start;
5491	- -webkit-box-pack: justify;
5492	-ms-flex-pack: justify;
5493	justify-content: space-between;
5494	padding: 1rem;
	@@ -5509,20 +5408,16 @@ button.close {
5509
5510	.modal-body {
5511	position: relative;
5512	- -webkit-box-flex: 1;
5513	-ms-flex: 1 1 auto;
5514	flex: 1 1 auto;
5515	padding: 1rem;
5516	}
5517
5518	.modal-footer {
5519	- display: -webkit-box;
5520	display: -ms-flexbox;
5521	display: flex;
5522	- -webkit-box-align: center;
5523	-ms-flex-align: center;
5524	align-items: center;
5525	- -webkit-box-pack: end;
5526	-ms-flex-pack: end;
5527	justify-content: flex-end;
5528	padding: 1rem;
	@@ -5862,7 +5757,6 @@ button.close {
5862	.carousel-item {
5863	position: relative;
5864	display: none;
5865	- -webkit-box-align: center;
5866	-ms-flex-align: center;
5867	align-items: center;
5868	width: 100%;
	@@ -5875,6 +5769,12 @@ button.close {
5875	perspective: 1000px;
5876	}
5877






5878	.carousel-item.active,
5879	.carousel-item-next,
5880	.carousel-item-prev {
	@@ -5929,18 +5829,52 @@ button.close {
5929	}
5930	}
5931





































5932	.carousel-control-prev,
5933	.carousel-control-next {
5934	position: absolute;
5935	top: 0;
5936	bottom: 0;
5937	- display: -webkit-box;
5938	display: -ms-flexbox;
5939	display: flex;
5940	- -webkit-box-align: center;
5941	-ms-flex-align: center;
5942	align-items: center;
5943	- -webkit-box-pack: center;
5944	-ms-flex-pack: center;
5945	justify-content: center;
5946	width: 15%;
	@@ -5989,10 +5923,8 @@ button.close {
5989	bottom: 10px;
5990	left: 0;
5991	z-index: 15;
5992	- display: -webkit-box;
5993	display: -ms-flexbox;
5994	display: flex;
5995	- -webkit-box-pack: center;
5996	-ms-flex-pack: center;
5997	justify-content: center;
5998	padding-left: 0;
	@@ -6003,7 +5935,6 @@ button.close {
6003
6004	.carousel-indicators li {
6005	position: relative;
6006	- -webkit-box-flex: 0;
6007	-ms-flex: 0 1 auto;
6008	flex: 0 1 auto;
6009	width: 30px;
	@@ -6305,13 +6236,11 @@ button.bg-dark:focus {
6305	}
6306
6307	.d-flex {
6308	- display: -webkit-box !important;
6309	display: -ms-flexbox !important;
6310	display: flex !important;
6311	}
6312
6313	.d-inline-flex {
6314	- display: -webkit-inline-box !important;
6315	display: -ms-inline-flexbox !important;
6316	display: inline-flex !important;
6317	}
	@@ -6339,12 +6268,10 @@ button.bg-dark:focus {
6339	display: table-cell !important;
6340	}
6341	.d-sm-flex {
6342	- display: -webkit-box !important;
6343	display: -ms-flexbox !important;
6344	display: flex !important;
6345	}
6346	.d-sm-inline-flex {
6347	- display: -webkit-inline-box !important;
6348	display: -ms-inline-flexbox !important;
6349	display: inline-flex !important;
6350	}
	@@ -6373,12 +6300,10 @@ button.bg-dark:focus {
6373	display: table-cell !important;
6374	}
6375	.d-md-flex {
6376	- display: -webkit-box !important;
6377	display: -ms-flexbox !important;
6378	display: flex !important;
6379	}
6380	.d-md-inline-flex {
6381	- display: -webkit-inline-box !important;
6382	display: -ms-inline-flexbox !important;
6383	display: inline-flex !important;
6384	}
	@@ -6407,12 +6332,10 @@ button.bg-dark:focus {
6407	display: table-cell !important;
6408	}
6409	.d-lg-flex {
6410	- display: -webkit-box !important;
6411	display: -ms-flexbox !important;
6412	display: flex !important;
6413	}
6414	.d-lg-inline-flex {
6415	- display: -webkit-inline-box !important;
6416	display: -ms-inline-flexbox !important;
6417	display: inline-flex !important;
6418	}
	@@ -6441,12 +6364,10 @@ button.bg-dark:focus {
6441	display: table-cell !important;
6442	}
6443	.d-xl-flex {
6444	- display: -webkit-box !important;
6445	display: -ms-flexbox !important;
6446	display: flex !important;
6447	}
6448	.d-xl-inline-flex {
6449	- display: -webkit-inline-box !important;
6450	display: -ms-inline-flexbox !important;
6451	display: inline-flex !important;
6452	}
	@@ -6475,12 +6396,10 @@ button.bg-dark:focus {
6475	display: table-cell !important;
6476	}
6477	.d-print-flex {
6478	- display: -webkit-box !important;
6479	display: -ms-flexbox !important;
6480	display: flex !important;
6481	}
6482	.d-print-inline-flex {
6483	- display: -webkit-inline-box !important;
6484	display: -ms-inline-flexbox !important;
6485	display: inline-flex !important;
6486	}
	@@ -6530,29 +6449,21 @@ button.bg-dark:focus {
6530	}
6531
6532	.flex-row {
6533	- -webkit-box-orient: horizontal !important;
6534	- -webkit-box-direction: normal !important;
6535	-ms-flex-direction: row !important;
6536	flex-direction: row !important;
6537	}
6538
6539	.flex-column {
6540	- -webkit-box-orient: vertical !important;
6541	- -webkit-box-direction: normal !important;
6542	-ms-flex-direction: column !important;
6543	flex-direction: column !important;
6544	}
6545
6546	.flex-row-reverse {
6547	- -webkit-box-orient: horizontal !important;
6548	- -webkit-box-direction: reverse !important;
6549	-ms-flex-direction: row-reverse !important;
6550	flex-direction: row-reverse !important;
6551	}
6552
6553	.flex-column-reverse {
6554	- -webkit-box-orient: vertical !important;
6555	- -webkit-box-direction: reverse !important;
6556	-ms-flex-direction: column-reverse !important;
6557	flex-direction: column-reverse !important;
6558	}
	@@ -6572,26 +6483,47 @@ button.bg-dark:focus {
6572	flex-wrap: wrap-reverse !important;
6573	}
6574

























6575	.justify-content-start {
6576	- -webkit-box-pack: start !important;
6577	-ms-flex-pack: start !important;
6578	justify-content: flex-start !important;
6579	}
6580
6581	.justify-content-end {
6582	- -webkit-box-pack: end !important;
6583	-ms-flex-pack: end !important;
6584	justify-content: flex-end !important;
6585	}
6586
6587	.justify-content-center {
6588	- -webkit-box-pack: center !important;
6589	-ms-flex-pack: center !important;
6590	justify-content: center !important;
6591	}
6592
6593	.justify-content-between {
6594	- -webkit-box-pack: justify !important;
6595	-ms-flex-pack: justify !important;
6596	justify-content: space-between !important;
6597	}
	@@ -6602,31 +6534,26 @@ button.bg-dark:focus {
6602	}
6603
6604	.align-items-start {
6605	- -webkit-box-align: start !important;
6606	-ms-flex-align: start !important;
6607	align-items: flex-start !important;
6608	}
6609
6610	.align-items-end {
6611	- -webkit-box-align: end !important;
6612	-ms-flex-align: end !important;
6613	align-items: flex-end !important;
6614	}
6615
6616	.align-items-center {
6617	- -webkit-box-align: center !important;
6618	-ms-flex-align: center !important;
6619	align-items: center !important;
6620	}
6621
6622	.align-items-baseline {
6623	- -webkit-box-align: baseline !important;
6624	-ms-flex-align: baseline !important;
6625	align-items: baseline !important;
6626	}
6627
6628	.align-items-stretch {
6629	- -webkit-box-align: stretch !important;
6630	-ms-flex-align: stretch !important;
6631	align-items: stretch !important;
6632	}
	@@ -6693,26 +6620,18 @@ button.bg-dark:focus {
6693
6694	@media (min-width: 576px) {
6695	.flex-sm-row {
6696	- -webkit-box-orient: horizontal !important;
6697	- -webkit-box-direction: normal !important;
6698	-ms-flex-direction: row !important;
6699	flex-direction: row !important;
6700	}
6701	.flex-sm-column {
6702	- -webkit-box-orient: vertical !important;
6703	- -webkit-box-direction: normal !important;
6704	-ms-flex-direction: column !important;
6705	flex-direction: column !important;
6706	}
6707	.flex-sm-row-reverse {
6708	- -webkit-box-orient: horizontal !important;
6709	- -webkit-box-direction: reverse !important;
6710	-ms-flex-direction: row-reverse !important;
6711	flex-direction: row-reverse !important;
6712	}
6713	.flex-sm-column-reverse {
6714	- -webkit-box-orient: vertical !important;
6715	- -webkit-box-direction: reverse !important;
6716	-ms-flex-direction: column-reverse !important;
6717	flex-direction: column-reverse !important;
6718	}
	@@ -6728,23 +6647,39 @@ button.bg-dark:focus {
6728	-ms-flex-wrap: wrap-reverse !important;
6729	flex-wrap: wrap-reverse !important;
6730	}




















6731	.justify-content-sm-start {
6732	- -webkit-box-pack: start !important;
6733	-ms-flex-pack: start !important;
6734	justify-content: flex-start !important;
6735	}
6736	.justify-content-sm-end {
6737	- -webkit-box-pack: end !important;
6738	-ms-flex-pack: end !important;
6739	justify-content: flex-end !important;
6740	}
6741	.justify-content-sm-center {
6742	- -webkit-box-pack: center !important;
6743	-ms-flex-pack: center !important;
6744	justify-content: center !important;
6745	}
6746	.justify-content-sm-between {
6747	- -webkit-box-pack: justify !important;
6748	-ms-flex-pack: justify !important;
6749	justify-content: space-between !important;
6750	}
	@@ -6753,27 +6688,22 @@ button.bg-dark:focus {
6753	justify-content: space-around !important;
6754	}
6755	.align-items-sm-start {
6756	- -webkit-box-align: start !important;
6757	-ms-flex-align: start !important;
6758	align-items: flex-start !important;
6759	}
6760	.align-items-sm-end {
6761	- -webkit-box-align: end !important;
6762	-ms-flex-align: end !important;
6763	align-items: flex-end !important;
6764	}
6765	.align-items-sm-center {
6766	- -webkit-box-align: center !important;
6767	-ms-flex-align: center !important;
6768	align-items: center !important;
6769	}
6770	.align-items-sm-baseline {
6771	- -webkit-box-align: baseline !important;
6772	-ms-flex-align: baseline !important;
6773	align-items: baseline !important;
6774	}
6775	.align-items-sm-stretch {
6776	- -webkit-box-align: stretch !important;
6777	-ms-flex-align: stretch !important;
6778	align-items: stretch !important;
6779	}
	@@ -6829,26 +6759,18 @@ button.bg-dark:focus {
6829
6830	@media (min-width: 768px) {
6831	.flex-md-row {
6832	- -webkit-box-orient: horizontal !important;
6833	- -webkit-box-direction: normal !important;
6834	-ms-flex-direction: row !important;
6835	flex-direction: row !important;
6836	}
6837	.flex-md-column {
6838	- -webkit-box-orient: vertical !important;
6839	- -webkit-box-direction: normal !important;
6840	-ms-flex-direction: column !important;
6841	flex-direction: column !important;
6842	}
6843	.flex-md-row-reverse {
6844	- -webkit-box-orient: horizontal !important;
6845	- -webkit-box-direction: reverse !important;
6846	-ms-flex-direction: row-reverse !important;
6847	flex-direction: row-reverse !important;
6848	}
6849	.flex-md-column-reverse {
6850	- -webkit-box-orient: vertical !important;
6851	- -webkit-box-direction: reverse !important;
6852	-ms-flex-direction: column-reverse !important;
6853	flex-direction: column-reverse !important;
6854	}
	@@ -6864,23 +6786,39 @@ button.bg-dark:focus {
6864	-ms-flex-wrap: wrap-reverse !important;
6865	flex-wrap: wrap-reverse !important;
6866	}




















6867	.justify-content-md-start {
6868	- -webkit-box-pack: start !important;
6869	-ms-flex-pack: start !important;
6870	justify-content: flex-start !important;
6871	}
6872	.justify-content-md-end {
6873	- -webkit-box-pack: end !important;
6874	-ms-flex-pack: end !important;
6875	justify-content: flex-end !important;
6876	}
6877	.justify-content-md-center {
6878	- -webkit-box-pack: center !important;
6879	-ms-flex-pack: center !important;
6880	justify-content: center !important;
6881	}
6882	.justify-content-md-between {
6883	- -webkit-box-pack: justify !important;
6884	-ms-flex-pack: justify !important;
6885	justify-content: space-between !important;
6886	}
	@@ -6889,27 +6827,22 @@ button.bg-dark:focus {
6889	justify-content: space-around !important;
6890	}
6891	.align-items-md-start {
6892	- -webkit-box-align: start !important;
6893	-ms-flex-align: start !important;
6894	align-items: flex-start !important;
6895	}
6896	.align-items-md-end {
6897	- -webkit-box-align: end !important;
6898	-ms-flex-align: end !important;
6899	align-items: flex-end !important;
6900	}
6901	.align-items-md-center {
6902	- -webkit-box-align: center !important;
6903	-ms-flex-align: center !important;
6904	align-items: center !important;
6905	}
6906	.align-items-md-baseline {
6907	- -webkit-box-align: baseline !important;
6908	-ms-flex-align: baseline !important;
6909	align-items: baseline !important;
6910	}
6911	.align-items-md-stretch {
6912	- -webkit-box-align: stretch !important;
6913	-ms-flex-align: stretch !important;
6914	align-items: stretch !important;
6915	}
	@@ -6965,26 +6898,18 @@ button.bg-dark:focus {
6965
6966	@media (min-width: 992px) {
6967	.flex-lg-row {
6968	- -webkit-box-orient: horizontal !important;
6969	- -webkit-box-direction: normal !important;
6970	-ms-flex-direction: row !important;
6971	flex-direction: row !important;
6972	}
6973	.flex-lg-column {
6974	- -webkit-box-orient: vertical !important;
6975	- -webkit-box-direction: normal !important;
6976	-ms-flex-direction: column !important;
6977	flex-direction: column !important;
6978	}
6979	.flex-lg-row-reverse {
6980	- -webkit-box-orient: horizontal !important;
6981	- -webkit-box-direction: reverse !important;
6982	-ms-flex-direction: row-reverse !important;
6983	flex-direction: row-reverse !important;
6984	}
6985	.flex-lg-column-reverse {
6986	- -webkit-box-orient: vertical !important;
6987	- -webkit-box-direction: reverse !important;
6988	-ms-flex-direction: column-reverse !important;
6989	flex-direction: column-reverse !important;
6990	}
	@@ -7000,23 +6925,39 @@ button.bg-dark:focus {
7000	-ms-flex-wrap: wrap-reverse !important;
7001	flex-wrap: wrap-reverse !important;
7002	}




















7003	.justify-content-lg-start {
7004	- -webkit-box-pack: start !important;
7005	-ms-flex-pack: start !important;
7006	justify-content: flex-start !important;
7007	}
7008	.justify-content-lg-end {
7009	- -webkit-box-pack: end !important;
7010	-ms-flex-pack: end !important;
7011	justify-content: flex-end !important;
7012	}
7013	.justify-content-lg-center {
7014	- -webkit-box-pack: center !important;
7015	-ms-flex-pack: center !important;
7016	justify-content: center !important;
7017	}
7018	.justify-content-lg-between {
7019	- -webkit-box-pack: justify !important;
7020	-ms-flex-pack: justify !important;
7021	justify-content: space-between !important;
7022	}
	@@ -7025,27 +6966,22 @@ button.bg-dark:focus {
7025	justify-content: space-around !important;
7026	}
7027	.align-items-lg-start {
7028	- -webkit-box-align: start !important;
7029	-ms-flex-align: start !important;
7030	align-items: flex-start !important;
7031	}
7032	.align-items-lg-end {
7033	- -webkit-box-align: end !important;
7034	-ms-flex-align: end !important;
7035	align-items: flex-end !important;
7036	}
7037	.align-items-lg-center {
7038	- -webkit-box-align: center !important;
7039	-ms-flex-align: center !important;
7040	align-items: center !important;
7041	}
7042	.align-items-lg-baseline {
7043	- -webkit-box-align: baseline !important;
7044	-ms-flex-align: baseline !important;
7045	align-items: baseline !important;
7046	}
7047	.align-items-lg-stretch {
7048	- -webkit-box-align: stretch !important;
7049	-ms-flex-align: stretch !important;
7050	align-items: stretch !important;
7051	}
	@@ -7101,26 +7037,18 @@ button.bg-dark:focus {
7101
7102	@media (min-width: 1200px) {
7103	.flex-xl-row {
7104	- -webkit-box-orient: horizontal !important;
7105	- -webkit-box-direction: normal !important;
7106	-ms-flex-direction: row !important;
7107	flex-direction: row !important;
7108	}
7109	.flex-xl-column {
7110	- -webkit-box-orient: vertical !important;
7111	- -webkit-box-direction: normal !important;
7112	-ms-flex-direction: column !important;
7113	flex-direction: column !important;
7114	}
7115	.flex-xl-row-reverse {
7116	- -webkit-box-orient: horizontal !important;
7117	- -webkit-box-direction: reverse !important;
7118	-ms-flex-direction: row-reverse !important;
7119	flex-direction: row-reverse !important;
7120	}
7121	.flex-xl-column-reverse {
7122	- -webkit-box-orient: vertical !important;
7123	- -webkit-box-direction: reverse !important;
7124	-ms-flex-direction: column-reverse !important;
7125	flex-direction: column-reverse !important;
7126	}
	@@ -7136,23 +7064,39 @@ button.bg-dark:focus {
7136	-ms-flex-wrap: wrap-reverse !important;
7137	flex-wrap: wrap-reverse !important;
7138	}




















7139	.justify-content-xl-start {
7140	- -webkit-box-pack: start !important;
7141	-ms-flex-pack: start !important;
7142	justify-content: flex-start !important;
7143	}
7144	.justify-content-xl-end {
7145	- -webkit-box-pack: end !important;
7146	-ms-flex-pack: end !important;
7147	justify-content: flex-end !important;
7148	}
7149	.justify-content-xl-center {
7150	- -webkit-box-pack: center !important;
7151	-ms-flex-pack: center !important;
7152	justify-content: center !important;
7153	}
7154	.justify-content-xl-between {
7155	- -webkit-box-pack: justify !important;
7156	-ms-flex-pack: justify !important;
7157	justify-content: space-between !important;
7158	}
	@@ -7161,27 +7105,22 @@ button.bg-dark:focus {
7161	justify-content: space-around !important;
7162	}
7163	.align-items-xl-start {
7164	- -webkit-box-align: start !important;
7165	-ms-flex-align: start !important;
7166	align-items: flex-start !important;
7167	}
7168	.align-items-xl-end {
7169	- -webkit-box-align: end !important;
7170	-ms-flex-align: end !important;
7171	align-items: flex-end !important;
7172	}
7173	.align-items-xl-center {
7174	- -webkit-box-align: center !important;
7175	-ms-flex-align: center !important;
7176	align-items: center !important;
7177	}
7178	.align-items-xl-baseline {
7179	- -webkit-box-align: baseline !important;
7180	-ms-flex-align: baseline !important;
7181	align-items: baseline !important;
7182	}
7183	.align-items-xl-stretch {
7184	- -webkit-box-align: stretch !important;
7185	-ms-flex-align: stretch !important;
7186	align-items: stretch !important;
7187	}
	@@ -7349,8 +7288,6 @@ button.bg-dark:focus {
7349	overflow: hidden;
7350	clip: rect(0, 0, 0, 0);
7351	white-space: nowrap;
7352	- -webkit-clip-path: inset(50%);
7353	- clip-path: inset(50%);
7354	border: 0;
7355	}
7356
	@@ -7361,8 +7298,22 @@ button.bg-dark:focus {
7361	overflow: visible;
7362	clip: auto;
7363	white-space: normal;
7364	- ~~-webkit-clip-path: none;~~
7365	- ~~clip-path: none;~~














7366	}
7367
7368	.w-25 {
	@@ -7381,6 +7332,10 @@ button.bg-dark:focus {
7381	width: 100% !important;
7382	}
7383




7384	.h-25 {
7385	height: 25% !important;
7386	}
	@@ -7397,6 +7352,10 @@ button.bg-dark:focus {
7397	height: 100% !important;
7398	}
7399




7400	.mw-100 {
7401	max-width: 100% !important;
7402	}
	@@ -8717,6 +8676,10 @@ button.bg-dark:focus {
8717	}
8718	}
8719




8720	.text-justify {
8721	text-align: justify !important;
8722	}
	@@ -8887,10 +8850,22 @@ a.text-dark:hover, a.text-dark:focus {
8887	color: #1d2124 !important;
8888	}
8889




8890	.text-muted {
8891	color: #6c757d !important;
8892	}
8893








8894	.text-hide {
8895	font: 0/0 a;
8896	color: transparent;
	@@ -8925,7 +8900,7 @@ a.text-dark:hover, a.text-dark:focus {
8925	}
8926	pre,
8927	blockquote {
8928	- border: 1px solid #~~999~~;
8929	page-break-inside: avoid;
8930	}
8931	thead {
	@@ -8969,7 +8944,7 @@ a.text-dark:hover, a.text-dark:focus {
8969	}
8970	.table-bordered th,
8971	.table-bordered td {
8972	- border: 1px solid #~~ddd~~ !important;
8973	}
8974	}
8975	/# sourceMappingURL=bootstrap.css.map /


1	/*!
2	+ * Bootstrap v4.1.0 (https://getbootstrap.com/)
3	* Copyright 2011-2018 The Bootstrap Authors
4	* Copyright 2011-2018 Twitter, Inc.
5	* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)

232
233	label {
234	display: inline-block;
235	+ margin-bottom: 0.5rem;
236	}
237
238	button {

594	}
595
596	.row {

597	display: -ms-flexbox;
598	display: flex;
599	-ms-flex-wrap: wrap;

629	.col {
630	-ms-flex-preferred-size: 0;
631	flex-basis: 0;

632	-ms-flex-positive: 1;
633	flex-grow: 1;
634	max-width: 100%;
635	}
636
637	.col-auto {

638	-ms-flex: 0 0 auto;
639	flex: 0 0 auto;
640	width: auto;

642	}
643
644	.col-1 {

645	-ms-flex: 0 0 8.333333%;
646	flex: 0 0 8.333333%;
647	max-width: 8.333333%;
648	}
649
650	.col-2 {

651	-ms-flex: 0 0 16.666667%;
652	flex: 0 0 16.666667%;
653	max-width: 16.666667%;
654	}
655
656	.col-3 {

657	-ms-flex: 0 0 25%;
658	flex: 0 0 25%;
659	max-width: 25%;
660	}
661
662	.col-4 {

663	-ms-flex: 0 0 33.333333%;
664	flex: 0 0 33.333333%;
665	max-width: 33.333333%;
666	}
667
668	.col-5 {

669	-ms-flex: 0 0 41.666667%;
670	flex: 0 0 41.666667%;
671	max-width: 41.666667%;
672	}
673
674	.col-6 {

675	-ms-flex: 0 0 50%;
676	flex: 0 0 50%;
677	max-width: 50%;
678	}
679
680	.col-7 {

681	-ms-flex: 0 0 58.333333%;
682	flex: 0 0 58.333333%;
683	max-width: 58.333333%;
684	}
685
686	.col-8 {

687	-ms-flex: 0 0 66.666667%;
688	flex: 0 0 66.666667%;
689	max-width: 66.666667%;
690	}
691
692	.col-9 {

693	-ms-flex: 0 0 75%;
694	flex: 0 0 75%;
695	max-width: 75%;
696	}
697
698	.col-10 {

699	-ms-flex: 0 0 83.333333%;
700	flex: 0 0 83.333333%;
701	max-width: 83.333333%;
702	}
703
704	.col-11 {

705	-ms-flex: 0 0 91.666667%;
706	flex: 0 0 91.666667%;
707	max-width: 91.666667%;
708	}
709
710	.col-12 {

711	-ms-flex: 0 0 100%;
712	flex: 0 0 100%;
713	max-width: 100%;
714	}
715
716	.order-first {

717	-ms-flex-order: -1;
718	order: -1;
719	}
720
721	.order-last {

722	-ms-flex-order: 13;
723	order: 13;
724	}
725
726	.order-0 {

727	-ms-flex-order: 0;
728	order: 0;
729	}
730
731	.order-1 {

732	-ms-flex-order: 1;
733	order: 1;
734	}
735
736	.order-2 {

737	-ms-flex-order: 2;
738	order: 2;
739	}
740
741	.order-3 {

742	-ms-flex-order: 3;
743	order: 3;
744	}
745
746	.order-4 {

747	-ms-flex-order: 4;
748	order: 4;
749	}
750
751	.order-5 {

752	-ms-flex-order: 5;
753	order: 5;
754	}
755
756	.order-6 {

757	-ms-flex-order: 6;
758	order: 6;
759	}
760
761	.order-7 {

762	-ms-flex-order: 7;
763	order: 7;
764	}
765
766	.order-8 {

767	-ms-flex-order: 8;
768	order: 8;
769	}
770
771	.order-9 {

772	-ms-flex-order: 9;
773	order: 9;
774	}
775
776	.order-10 {

777	-ms-flex-order: 10;
778	order: 10;
779	}
780
781	.order-11 {

782	-ms-flex-order: 11;
783	order: 11;
784	}
785
786	.order-12 {

787	-ms-flex-order: 12;
788	order: 12;
789	}

836	.col-sm {
837	-ms-flex-preferred-size: 0;
838	flex-basis: 0;

839	-ms-flex-positive: 1;
840	flex-grow: 1;
841	max-width: 100%;
842	}
843	.col-sm-auto {

844	-ms-flex: 0 0 auto;
845	flex: 0 0 auto;
846	width: auto;
847	max-width: none;
848	}
849	.col-sm-1 {

850	-ms-flex: 0 0 8.333333%;
851	flex: 0 0 8.333333%;
852	max-width: 8.333333%;
853	}
854	.col-sm-2 {

855	-ms-flex: 0 0 16.666667%;
856	flex: 0 0 16.666667%;
857	max-width: 16.666667%;
858	}
859	.col-sm-3 {

860	-ms-flex: 0 0 25%;
861	flex: 0 0 25%;
862	max-width: 25%;
863	}
864	.col-sm-4 {

865	-ms-flex: 0 0 33.333333%;
866	flex: 0 0 33.333333%;
867	max-width: 33.333333%;
868	}
869	.col-sm-5 {

870	-ms-flex: 0 0 41.666667%;
871	flex: 0 0 41.666667%;
872	max-width: 41.666667%;
873	}
874	.col-sm-6 {

875	-ms-flex: 0 0 50%;
876	flex: 0 0 50%;
877	max-width: 50%;
878	}
879	.col-sm-7 {

880	-ms-flex: 0 0 58.333333%;
881	flex: 0 0 58.333333%;
882	max-width: 58.333333%;
883	}
884	.col-sm-8 {

885	-ms-flex: 0 0 66.666667%;
886	flex: 0 0 66.666667%;
887	max-width: 66.666667%;
888	}
889	.col-sm-9 {

890	-ms-flex: 0 0 75%;
891	flex: 0 0 75%;
892	max-width: 75%;
893	}
894	.col-sm-10 {

895	-ms-flex: 0 0 83.333333%;
896	flex: 0 0 83.333333%;
897	max-width: 83.333333%;
898	}
899	.col-sm-11 {

900	-ms-flex: 0 0 91.666667%;
901	flex: 0 0 91.666667%;
902	max-width: 91.666667%;
903	}
904	.col-sm-12 {

905	-ms-flex: 0 0 100%;
906	flex: 0 0 100%;
907	max-width: 100%;
908	}
909	.order-sm-first {

910	-ms-flex-order: -1;
911	order: -1;
912	}
913	.order-sm-last {

914	-ms-flex-order: 13;
915	order: 13;
916	}
917	.order-sm-0 {

918	-ms-flex-order: 0;
919	order: 0;
920	}
921	.order-sm-1 {

922	-ms-flex-order: 1;
923	order: 1;
924	}
925	.order-sm-2 {

926	-ms-flex-order: 2;
927	order: 2;
928	}
929	.order-sm-3 {

930	-ms-flex-order: 3;
931	order: 3;
932	}
933	.order-sm-4 {

934	-ms-flex-order: 4;
935	order: 4;
936	}
937	.order-sm-5 {

938	-ms-flex-order: 5;
939	order: 5;
940	}
941	.order-sm-6 {

942	-ms-flex-order: 6;
943	order: 6;
944	}
945	.order-sm-7 {

946	-ms-flex-order: 7;
947	order: 7;
948	}
949	.order-sm-8 {

950	-ms-flex-order: 8;
951	order: 8;
952	}
953	.order-sm-9 {

954	-ms-flex-order: 9;
955	order: 9;
956	}
957	.order-sm-10 {

958	-ms-flex-order: 10;
959	order: 10;
960	}
961	.order-sm-11 {

962	-ms-flex-order: 11;
963	order: 11;
964	}
965	.order-sm-12 {

966	-ms-flex-order: 12;
967	order: 12;
968	}

1008	.col-md {
1009	-ms-flex-preferred-size: 0;
1010	flex-basis: 0;

1011	-ms-flex-positive: 1;
1012	flex-grow: 1;
1013	max-width: 100%;
1014	}
1015	.col-md-auto {

1016	-ms-flex: 0 0 auto;
1017	flex: 0 0 auto;
1018	width: auto;
1019	max-width: none;
1020	}
1021	.col-md-1 {

1022	-ms-flex: 0 0 8.333333%;
1023	flex: 0 0 8.333333%;
1024	max-width: 8.333333%;
1025	}
1026	.col-md-2 {

1027	-ms-flex: 0 0 16.666667%;
1028	flex: 0 0 16.666667%;
1029	max-width: 16.666667%;
1030	}
1031	.col-md-3 {

1032	-ms-flex: 0 0 25%;
1033	flex: 0 0 25%;
1034	max-width: 25%;
1035	}
1036	.col-md-4 {

1037	-ms-flex: 0 0 33.333333%;
1038	flex: 0 0 33.333333%;
1039	max-width: 33.333333%;
1040	}
1041	.col-md-5 {

1042	-ms-flex: 0 0 41.666667%;
1043	flex: 0 0 41.666667%;
1044	max-width: 41.666667%;
1045	}
1046	.col-md-6 {

1047	-ms-flex: 0 0 50%;
1048	flex: 0 0 50%;
1049	max-width: 50%;
1050	}
1051	.col-md-7 {

1052	-ms-flex: 0 0 58.333333%;
1053	flex: 0 0 58.333333%;
1054	max-width: 58.333333%;
1055	}
1056	.col-md-8 {

1057	-ms-flex: 0 0 66.666667%;
1058	flex: 0 0 66.666667%;
1059	max-width: 66.666667%;
1060	}
1061	.col-md-9 {

1062	-ms-flex: 0 0 75%;
1063	flex: 0 0 75%;
1064	max-width: 75%;
1065	}
1066	.col-md-10 {

1067	-ms-flex: 0 0 83.333333%;
1068	flex: 0 0 83.333333%;
1069	max-width: 83.333333%;
1070	}
1071	.col-md-11 {

1072	-ms-flex: 0 0 91.666667%;
1073	flex: 0 0 91.666667%;
1074	max-width: 91.666667%;
1075	}
1076	.col-md-12 {

1077	-ms-flex: 0 0 100%;
1078	flex: 0 0 100%;
1079	max-width: 100%;
1080	}
1081	.order-md-first {

1082	-ms-flex-order: -1;
1083	order: -1;
1084	}
1085	.order-md-last {

1086	-ms-flex-order: 13;
1087	order: 13;
1088	}
1089	.order-md-0 {

1090	-ms-flex-order: 0;
1091	order: 0;
1092	}
1093	.order-md-1 {

1094	-ms-flex-order: 1;
1095	order: 1;
1096	}
1097	.order-md-2 {

1098	-ms-flex-order: 2;
1099	order: 2;
1100	}
1101	.order-md-3 {

1102	-ms-flex-order: 3;
1103	order: 3;
1104	}
1105	.order-md-4 {

1106	-ms-flex-order: 4;
1107	order: 4;
1108	}
1109	.order-md-5 {

1110	-ms-flex-order: 5;
1111	order: 5;
1112	}
1113	.order-md-6 {

1114	-ms-flex-order: 6;
1115	order: 6;
1116	}
1117	.order-md-7 {

1118	-ms-flex-order: 7;
1119	order: 7;
1120	}
1121	.order-md-8 {

1122	-ms-flex-order: 8;
1123	order: 8;
1124	}
1125	.order-md-9 {

1126	-ms-flex-order: 9;
1127	order: 9;
1128	}
1129	.order-md-10 {

1130	-ms-flex-order: 10;
1131	order: 10;
1132	}
1133	.order-md-11 {

1134	-ms-flex-order: 11;
1135	order: 11;
1136	}
1137	.order-md-12 {

1138	-ms-flex-order: 12;
1139	order: 12;
1140	}

1180	.col-lg {
1181	-ms-flex-preferred-size: 0;
1182	flex-basis: 0;

1183	-ms-flex-positive: 1;
1184	flex-grow: 1;
1185	max-width: 100%;
1186	}
1187	.col-lg-auto {

1188	-ms-flex: 0 0 auto;
1189	flex: 0 0 auto;
1190	width: auto;
1191	max-width: none;
1192	}
1193	.col-lg-1 {

1194	-ms-flex: 0 0 8.333333%;
1195	flex: 0 0 8.333333%;
1196	max-width: 8.333333%;
1197	}
1198	.col-lg-2 {

1199	-ms-flex: 0 0 16.666667%;
1200	flex: 0 0 16.666667%;
1201	max-width: 16.666667%;
1202	}
1203	.col-lg-3 {

1204	-ms-flex: 0 0 25%;
1205	flex: 0 0 25%;
1206	max-width: 25%;
1207	}
1208	.col-lg-4 {

1209	-ms-flex: 0 0 33.333333%;
1210	flex: 0 0 33.333333%;
1211	max-width: 33.333333%;
1212	}
1213	.col-lg-5 {

1214	-ms-flex: 0 0 41.666667%;
1215	flex: 0 0 41.666667%;
1216	max-width: 41.666667%;
1217	}
1218	.col-lg-6 {

1219	-ms-flex: 0 0 50%;
1220	flex: 0 0 50%;
1221	max-width: 50%;
1222	}
1223	.col-lg-7 {

1224	-ms-flex: 0 0 58.333333%;
1225	flex: 0 0 58.333333%;
1226	max-width: 58.333333%;
1227	}
1228	.col-lg-8 {

1229	-ms-flex: 0 0 66.666667%;
1230	flex: 0 0 66.666667%;
1231	max-width: 66.666667%;
1232	}
1233	.col-lg-9 {

1234	-ms-flex: 0 0 75%;
1235	flex: 0 0 75%;
1236	max-width: 75%;
1237	}
1238	.col-lg-10 {

1239	-ms-flex: 0 0 83.333333%;
1240	flex: 0 0 83.333333%;
1241	max-width: 83.333333%;
1242	}
1243	.col-lg-11 {

1244	-ms-flex: 0 0 91.666667%;
1245	flex: 0 0 91.666667%;
1246	max-width: 91.666667%;
1247	}
1248	.col-lg-12 {

1249	-ms-flex: 0 0 100%;
1250	flex: 0 0 100%;
1251	max-width: 100%;
1252	}
1253	.order-lg-first {

1254	-ms-flex-order: -1;
1255	order: -1;
1256	}
1257	.order-lg-last {

1258	-ms-flex-order: 13;
1259	order: 13;
1260	}
1261	.order-lg-0 {

1262	-ms-flex-order: 0;
1263	order: 0;
1264	}
1265	.order-lg-1 {

1266	-ms-flex-order: 1;
1267	order: 1;
1268	}
1269	.order-lg-2 {

1270	-ms-flex-order: 2;
1271	order: 2;
1272	}
1273	.order-lg-3 {

1274	-ms-flex-order: 3;
1275	order: 3;
1276	}
1277	.order-lg-4 {

1278	-ms-flex-order: 4;
1279	order: 4;
1280	}
1281	.order-lg-5 {

1282	-ms-flex-order: 5;
1283	order: 5;
1284	}
1285	.order-lg-6 {

1286	-ms-flex-order: 6;
1287	order: 6;
1288	}
1289	.order-lg-7 {

1290	-ms-flex-order: 7;
1291	order: 7;
1292	}
1293	.order-lg-8 {

1294	-ms-flex-order: 8;
1295	order: 8;
1296	}
1297	.order-lg-9 {

1298	-ms-flex-order: 9;
1299	order: 9;
1300	}
1301	.order-lg-10 {

1302	-ms-flex-order: 10;
1303	order: 10;
1304	}
1305	.order-lg-11 {

1306	-ms-flex-order: 11;
1307	order: 11;
1308	}
1309	.order-lg-12 {

1310	-ms-flex-order: 12;
1311	order: 12;
1312	}

1352	.col-xl {
1353	-ms-flex-preferred-size: 0;
1354	flex-basis: 0;

1355	-ms-flex-positive: 1;
1356	flex-grow: 1;
1357	max-width: 100%;
1358	}
1359	.col-xl-auto {

1360	-ms-flex: 0 0 auto;
1361	flex: 0 0 auto;
1362	width: auto;
1363	max-width: none;
1364	}
1365	.col-xl-1 {

1366	-ms-flex: 0 0 8.333333%;
1367	flex: 0 0 8.333333%;
1368	max-width: 8.333333%;
1369	}
1370	.col-xl-2 {

1371	-ms-flex: 0 0 16.666667%;
1372	flex: 0 0 16.666667%;
1373	max-width: 16.666667%;
1374	}
1375	.col-xl-3 {

1376	-ms-flex: 0 0 25%;
1377	flex: 0 0 25%;
1378	max-width: 25%;
1379	}
1380	.col-xl-4 {

1381	-ms-flex: 0 0 33.333333%;
1382	flex: 0 0 33.333333%;
1383	max-width: 33.333333%;
1384	}
1385	.col-xl-5 {

1386	-ms-flex: 0 0 41.666667%;
1387	flex: 0 0 41.666667%;
1388	max-width: 41.666667%;
1389	}
1390	.col-xl-6 {

1391	-ms-flex: 0 0 50%;
1392	flex: 0 0 50%;
1393	max-width: 50%;
1394	}
1395	.col-xl-7 {

1396	-ms-flex: 0 0 58.333333%;
1397	flex: 0 0 58.333333%;
1398	max-width: 58.333333%;
1399	}
1400	.col-xl-8 {

1401	-ms-flex: 0 0 66.666667%;
1402	flex: 0 0 66.666667%;
1403	max-width: 66.666667%;
1404	}
1405	.col-xl-9 {

1406	-ms-flex: 0 0 75%;
1407	flex: 0 0 75%;
1408	max-width: 75%;
1409	}
1410	.col-xl-10 {

1411	-ms-flex: 0 0 83.333333%;
1412	flex: 0 0 83.333333%;
1413	max-width: 83.333333%;
1414	}
1415	.col-xl-11 {

1416	-ms-flex: 0 0 91.666667%;
1417	flex: 0 0 91.666667%;
1418	max-width: 91.666667%;
1419	}
1420	.col-xl-12 {

1421	-ms-flex: 0 0 100%;
1422	flex: 0 0 100%;
1423	max-width: 100%;
1424	}
1425	.order-xl-first {

1426	-ms-flex-order: -1;
1427	order: -1;
1428	}
1429	.order-xl-last {

1430	-ms-flex-order: 13;
1431	order: 13;
1432	}
1433	.order-xl-0 {

1434	-ms-flex-order: 0;
1435	order: 0;
1436	}
1437	.order-xl-1 {

1438	-ms-flex-order: 1;
1439	order: 1;
1440	}
1441	.order-xl-2 {

1442	-ms-flex-order: 2;
1443	order: 2;
1444	}
1445	.order-xl-3 {

1446	-ms-flex-order: 3;
1447	order: 3;
1448	}
1449	.order-xl-4 {

1450	-ms-flex-order: 4;
1451	order: 4;
1452	}
1453	.order-xl-5 {

1454	-ms-flex-order: 5;
1455	order: 5;
1456	}
1457	.order-xl-6 {

1458	-ms-flex-order: 6;
1459	order: 6;
1460	}
1461	.order-xl-7 {

1462	-ms-flex-order: 7;
1463	order: 7;
1464	}
1465	.order-xl-8 {

1466	-ms-flex-order: 8;
1467	order: 8;
1468	}
1469	.order-xl-9 {

1470	-ms-flex-order: 9;
1471	order: 9;
1472	}
1473	.order-xl-10 {

1474	-ms-flex-order: 10;
1475	order: 10;
1476	}
1477	.order-xl-11 {

1478	-ms-flex-order: 11;
1479	order: 11;
1480	}
1481	.order-xl-12 {

1482	-ms-flex-order: 12;
1483	order: 12;
1484	}

1566	border-bottom-width: 2px;
1567	}
1568
1569	+ .table-borderless th,
1570	+ .table-borderless td,
1571	+ .table-borderless thead th,
1572	+ .table-borderless tbody + tbody {
1573	+ border: 0;
1574	+ }
1575	+
1576	.table-striped tbody tr:nth-of-type(odd) {
1577	background-color: rgba(0, 0, 0, 0.05);
1578	}

1829	transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
1830	}
1831
1832	+ @media screen and (prefers-reduced-motion: reduce) {
1833	+ .form-control {
1834	+ transition: none;
1835	+ }
1836	+ }
1837	+
1838	.form-control::-ms-expand {
1839	background-color: transparent;
1840	border: 0;

1922	padding-bottom: 0.375rem;
1923	margin-bottom: 0;
1924	line-height: 1.5;
1925	+ color: #212529;
1926	background-color: transparent;
1927	border: solid transparent;
1928	border-width: 1px 0;

1989	}
1990
1991	.form-row {

1992	display: -ms-flexbox;
1993	display: flex;
1994	-ms-flex-wrap: wrap;

2024	}
2025
2026	.form-check-inline {

2027	display: -ms-inline-flexbox;
2028	display: inline-flex;

2029	-ms-flex-align: center;
2030	align-items: center;
2031	padding-left: 0;

2234	}
2235
2236	.form-inline {

2237	display: -ms-flexbox;
2238	display: flex;


2239	-ms-flex-flow: row wrap;
2240	flex-flow: row wrap;

2241	-ms-flex-align: center;
2242	align-items: center;
2243	}

2248
2249	@media (min-width: 576px) {
2250	.form-inline label {

2251	display: -ms-flexbox;
2252	display: flex;

2253	-ms-flex-align: center;
2254	align-items: center;

2255	-ms-flex-pack: center;
2256	justify-content: center;
2257	margin-bottom: 0;
2258	}
2259	.form-inline .form-group {

2260	display: -ms-flexbox;
2261	display: flex;

2262	-ms-flex: 0 0 auto;
2263	flex: 0 0 auto;


2264	-ms-flex-flow: row wrap;
2265	flex-flow: row wrap;

2266	-ms-flex-align: center;
2267	align-items: center;
2268	margin-bottom: 0;

2275	.form-inline .form-control-plaintext {
2276	display: inline-block;
2277	}
2278	+ .form-inline .input-group,
2279	+ .form-inline .custom-select {
2280	width: auto;
2281	}
2282	.form-inline .form-check {

2283	display: -ms-flexbox;
2284	display: flex;

2285	-ms-flex-align: center;
2286	align-items: center;

2287	-ms-flex-pack: center;
2288	justify-content: center;
2289	width: auto;

2296	margin-left: 0;
2297	}
2298	.form-inline .custom-control {

2299	-ms-flex-align: center;
2300	align-items: center;

2301	-ms-flex-pack: center;
2302	justify-content: center;
2303	}

2324	transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
2325	}
2326
2327	+ @media screen and (prefers-reduced-motion: reduce) {
2328	+ .btn {
2329	+ transition: none;
2330	+ }
2331	+ }
2332	+
2333	.btn:hover, .btn:focus {
2334	text-decoration: none;
2335	}

2921
2922	.btn-link:disabled, .btn-link.disabled {
2923	color: #6c757d;
2924	+ pointer-events: none;
2925	}
2926
2927	.btn-lg, .btn-group-lg > .btn {

2954	}
2955
2956	.fade {

2957	transition: opacity 0.15s linear;
2958	}
2959
2960	+ @media screen and (prefers-reduced-motion: reduce) {
2961	+ .fade {
2962	+ transition: none;
2963	+ }






2964	}
2965
2966	+ .fade:not(.show) {
2967	+ opacity: 0;
2968	}
2969
2970	+ .collapse:not(.show) {
2971	+ display: none;
2972	}
2973
2974	.collapsing {

2978	transition: height 0.35s ease;
2979	}
2980
2981	+ @media screen and (prefers-reduced-motion: reduce) {
2982	+ .collapsing {
2983	+ transition: none;
2984	+ }
2985	+ }
2986	+
2987	.dropup,
2988	+ .dropright,
2989	+ .dropdown,
2990	+ .dropleft {
2991	position: relative;
2992	}
2993

3028	border-radius: 0.25rem;
3029	}
3030
3031	+ .dropdown-menu-right {
3032	+ right: 0;
3033	+ left: auto;
3034	+ }
3035	+
3036	.dropup .dropdown-menu {
3037	+ top: auto;
3038	+ bottom: 100%;
3039	margin-top: 0;
3040	margin-bottom: 0.125rem;
3041	}

3058	}
3059
3060	.dropright .dropdown-menu {
3061	+ top: 0;
3062	+ right: auto;
3063	+ left: 100%;
3064	margin-top: 0;
3065	margin-left: 0.125rem;
3066	}

3073	vertical-align: 0.255em;
3074	content: "";
3075	border-top: 0.3em solid transparent;
3076	+ border-right: 0;
3077	border-bottom: 0.3em solid transparent;
3078	border-left: 0.3em solid;
3079	}

3087	}
3088
3089	.dropleft .dropdown-menu {
3090	+ top: 0;
3091	+ right: 100%;
3092	+ left: auto;
3093	margin-top: 0;
3094	margin-right: 0.125rem;
3095	}

3127	vertical-align: 0;
3128	}
3129
3130	+ .dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] {
3131	+ right: auto;
3132	+ bottom: auto;
3133	+ }
3134	+
3135	.dropdown-divider {
3136	height: 0;
3137	margin: 0.5rem 0;

3182	white-space: nowrap;
3183	}
3184
3185	+ .dropdown-item-text {
3186	+ display: block;
3187	+ padding: 0.25rem 1.5rem;
3188	+ color: #212529;
3189	+ }
3190	+
3191	.btn-group,
3192	.btn-group-vertical {
3193	position: relative;

3194	display: -ms-inline-flexbox;
3195	display: inline-flex;
3196	vertical-align: middle;

3199	.btn-group > .btn,
3200	.btn-group-vertical > .btn {
3201	position: relative;

3202	-ms-flex: 0 1 auto;
3203	flex: 0 1 auto;
3204	}

3227	}
3228
3229	.btn-toolbar {

3230	display: -ms-flexbox;
3231	display: flex;
3232	-ms-flex-wrap: wrap;
3233	flex-wrap: wrap;

3234	-ms-flex-pack: start;
3235	justify-content: flex-start;
3236	}

3260	padding-left: 0.5625rem;
3261	}
3262
3263	+ .dropdown-toggle-split::after,
3264	+ .dropup .dropdown-toggle-split::after,
3265	+ .dropright .dropdown-toggle-split::after {
3266	margin-left: 0;
3267	}
3268
3269	+ .dropleft .dropdown-toggle-split::before {
3270	+ margin-right: 0;
3271	+ }
3272	+
3273	.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
3274	padding-right: 0.375rem;
3275	padding-left: 0.375rem;

3281	}
3282
3283	.btn-group-vertical {


3284	-ms-flex-direction: column;
3285	flex-direction: column;

3286	-ms-flex-align: start;
3287	align-items: flex-start;

3288	-ms-flex-pack: center;
3289	justify-content: center;
3290	}

3330
3331	.input-group {
3332	position: relative;

3333	display: -ms-flexbox;
3334	display: flex;
3335	-ms-flex-wrap: wrap;
3336	flex-wrap: wrap;

3337	-ms-flex-align: stretch;
3338	align-items: stretch;
3339	width: 100%;

3343	.input-group > .custom-select,
3344	.input-group > .custom-file {
3345	position: relative;

3346	-ms-flex: 1 1 auto;
3347	flex: 1 1 auto;
3348	width: 1%;

3380	}
3381
3382	.input-group > .custom-file {

3383	display: -ms-flexbox;
3384	display: flex;

3385	-ms-flex-align: center;
3386	align-items: center;
3387	}
3388
3389	.input-group > .custom-file:not(:last-child) .custom-file-label,
3390	+ .input-group > .custom-file:not(:last-child) .custom-file-label::after {
3391	border-top-right-radius: 0;
3392	border-bottom-right-radius: 0;
3393	}
3394
3395	.input-group > .custom-file:not(:first-child) .custom-file-label,
3396	+ .input-group > .custom-file:not(:first-child) .custom-file-label::after {
3397	border-top-left-radius: 0;
3398	border-bottom-left-radius: 0;
3399	}
3400
3401	.input-group-prepend,
3402	.input-group-append {

3403	display: -ms-flexbox;
3404	display: flex;
3405	}

3430	}
3431
3432	.input-group-text {

3433	display: -ms-flexbox;
3434	display: flex;

3435	-ms-flex-align: center;
3436	align-items: center;
3437	padding: 0.375rem 0.75rem;

3480	}
3481
3482	.custom-control-inline {

3483	display: -ms-inline-flexbox;
3484	display: inline-flex;
3485	margin-right: 1rem;

3664	opacity: 0;
3665	}
3666
3667	+ .custom-file-input:focus ~ .custom-file-label {
3668	border-color: #80bdff;
3669	box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
3670	}
3671
3672	+ .custom-file-input:focus ~ .custom-file-label::after {
3673	border-color: #80bdff;
3674	}
3675

3709	border-radius: 0 0.25rem 0.25rem 0;
3710	}
3711
3712	+ .custom-range {
3713	+ width: 100%;
3714	+ padding-left: 0;
3715	+ background-color: transparent;
3716	+ -webkit-appearance: none;
3717	+ -moz-appearance: none;
3718	+ appearance: none;
3719	+ }
3720	+
3721	+ .custom-range:focus {
3722	+ outline: none;
3723	+ }
3724	+
3725	+ .custom-range::-moz-focus-outer {
3726	+ border: 0;
3727	+ }
3728	+
3729	+ .custom-range::-webkit-slider-thumb {
3730	+ width: 1rem;
3731	+ height: 1rem;
3732	+ margin-top: -0.25rem;
3733	+ background-color: #007bff;
3734	+ border: 0;
3735	+ border-radius: 1rem;
3736	+ -webkit-appearance: none;
3737	+ appearance: none;
3738	+ }
3739	+
3740	+ .custom-range::-webkit-slider-thumb:focus {
3741	+ outline: none;
3742	+ box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
3743	+ }
3744	+
3745	+ .custom-range::-webkit-slider-thumb:active {
3746	+ background-color: #b3d7ff;
3747	+ }
3748	+
3749	+ .custom-range::-webkit-slider-runnable-track {
3750	+ width: 100%;
3751	+ height: 0.5rem;
3752	+ color: transparent;
3753	+ cursor: pointer;
3754	+ background-color: #dee2e6;
3755	+ border-color: transparent;
3756	+ border-radius: 1rem;
3757	+ }
3758	+
3759	+ .custom-range::-moz-range-thumb {
3760	+ width: 1rem;
3761	+ height: 1rem;
3762	+ background-color: #007bff;
3763	+ border: 0;
3764	+ border-radius: 1rem;
3765	+ -moz-appearance: none;
3766	+ appearance: none;
3767	+ }
3768	+
3769	+ .custom-range::-moz-range-thumb:focus {
3770	+ outline: none;
3771	+ box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
3772	+ }
3773	+
3774	+ .custom-range::-moz-range-thumb:active {
3775	+ background-color: #b3d7ff;
3776	+ }
3777	+
3778	+ .custom-range::-moz-range-track {
3779	+ width: 100%;
3780	+ height: 0.5rem;
3781	+ color: transparent;
3782	+ cursor: pointer;
3783	+ background-color: #dee2e6;
3784	+ border-color: transparent;
3785	+ border-radius: 1rem;
3786	+ }
3787	+
3788	+ .custom-range::-ms-thumb {
3789	+ width: 1rem;
3790	+ height: 1rem;
3791	+ background-color: #007bff;
3792	+ border: 0;
3793	+ border-radius: 1rem;
3794	+ appearance: none;
3795	+ }
3796	+
3797	+ .custom-range::-ms-thumb:focus {
3798	+ outline: none;
3799	+ box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
3800	+ }
3801	+
3802	+ .custom-range::-ms-thumb:active {
3803	+ background-color: #b3d7ff;
3804	+ }
3805	+
3806	+ .custom-range::-ms-track {
3807	+ width: 100%;
3808	+ height: 0.5rem;
3809	+ color: transparent;
3810	+ cursor: pointer;
3811	+ background-color: transparent;
3812	+ border-color: transparent;
3813	+ border-width: 0.5rem;
3814	+ }
3815	+
3816	+ .custom-range::-ms-fill-lower {
3817	+ background-color: #dee2e6;
3818	+ border-radius: 1rem;
3819	+ }
3820	+
3821	+ .custom-range::-ms-fill-upper {
3822	+ margin-right: 15px;
3823	+ background-color: #dee2e6;
3824	+ border-radius: 1rem;
3825	+ }
3826	+
3827	.nav {

3828	display: -ms-flexbox;
3829	display: flex;
3830	-ms-flex-wrap: wrap;

3895	}
3896
3897	.nav-fill .nav-item {

3898	-ms-flex: 1 1 auto;
3899	flex: 1 1 auto;
3900	text-align: center;

3903	.nav-justified .nav-item {
3904	-ms-flex-preferred-size: 0;
3905	flex-basis: 0;

3906	-ms-flex-positive: 1;
3907	flex-grow: 1;
3908	text-align: center;

3918
3919	.navbar {
3920	position: relative;

3921	display: -ms-flexbox;
3922	display: flex;
3923	-ms-flex-wrap: wrap;
3924	flex-wrap: wrap;

3925	-ms-flex-align: center;
3926	align-items: center;

3927	-ms-flex-pack: justify;
3928	justify-content: space-between;
3929	padding: 0.5rem 1rem;

3931
3932	.navbar > .container,
3933	.navbar > .container-fluid {

3934	display: -ms-flexbox;
3935	display: flex;
3936	-ms-flex-wrap: wrap;
3937	flex-wrap: wrap;

3938	-ms-flex-align: center;
3939	align-items: center;

3940	-ms-flex-pack: justify;
3941	justify-content: space-between;
3942	}

3956	}
3957
3958	.navbar-nav {

3959	display: -ms-flexbox;
3960	display: flex;


3961	-ms-flex-direction: column;
3962	flex-direction: column;
3963	padding-left: 0;

3984	.navbar-collapse {
3985	-ms-flex-preferred-size: 100%;
3986	flex-basis: 100%;

3987	-ms-flex-positive: 1;
3988	flex-grow: 1;

3989	-ms-flex-align: center;
3990	align-items: center;
3991	}

4027
4028	@media (min-width: 576px) {
4029	.navbar-expand-sm {


4030	-ms-flex-flow: row nowrap;
4031	flex-flow: row nowrap;

4032	-ms-flex-pack: start;
4033	justify-content: flex-start;
4034	}
4035	.navbar-expand-sm .navbar-nav {


4036	-ms-flex-direction: row;
4037	flex-direction: row;
4038	}
4039	.navbar-expand-sm .navbar-nav .dropdown-menu {
4040	position: absolute;
4041	}




4042	.navbar-expand-sm .navbar-nav .nav-link {
4043	padding-right: 0.5rem;
4044	padding-left: 0.5rem;

4049	flex-wrap: nowrap;
4050	}
4051	.navbar-expand-sm .navbar-collapse {

4052	display: -ms-flexbox !important;
4053	display: flex !important;
4054	-ms-flex-preferred-size: auto;

4057	.navbar-expand-sm .navbar-toggler {
4058	display: none;
4059	}




4060	}
4061
4062	@media (max-width: 767.98px) {

4069
4070	@media (min-width: 768px) {
4071	.navbar-expand-md {


4072	-ms-flex-flow: row nowrap;
4073	flex-flow: row nowrap;

4074	-ms-flex-pack: start;
4075	justify-content: flex-start;
4076	}
4077	.navbar-expand-md .navbar-nav {


4078	-ms-flex-direction: row;
4079	flex-direction: row;
4080	}
4081	.navbar-expand-md .navbar-nav .dropdown-menu {
4082	position: absolute;
4083	}




4084	.navbar-expand-md .navbar-nav .nav-link {
4085	padding-right: 0.5rem;
4086	padding-left: 0.5rem;

4091	flex-wrap: nowrap;
4092	}
4093	.navbar-expand-md .navbar-collapse {

4094	display: -ms-flexbox !important;
4095	display: flex !important;
4096	-ms-flex-preferred-size: auto;

4099	.navbar-expand-md .navbar-toggler {
4100	display: none;
4101	}




4102	}
4103
4104	@media (max-width: 991.98px) {

4111
4112	@media (min-width: 992px) {
4113	.navbar-expand-lg {


4114	-ms-flex-flow: row nowrap;
4115	flex-flow: row nowrap;

4116	-ms-flex-pack: start;
4117	justify-content: flex-start;
4118	}
4119	.navbar-expand-lg .navbar-nav {


4120	-ms-flex-direction: row;
4121	flex-direction: row;
4122	}
4123	.navbar-expand-lg .navbar-nav .dropdown-menu {
4124	position: absolute;
4125	}




4126	.navbar-expand-lg .navbar-nav .nav-link {
4127	padding-right: 0.5rem;
4128	padding-left: 0.5rem;

4133	flex-wrap: nowrap;
4134	}
4135	.navbar-expand-lg .navbar-collapse {

4136	display: -ms-flexbox !important;
4137	display: flex !important;
4138	-ms-flex-preferred-size: auto;

4141	.navbar-expand-lg .navbar-toggler {
4142	display: none;
4143	}




4144	}
4145
4146	@media (max-width: 1199.98px) {

4153
4154	@media (min-width: 1200px) {
4155	.navbar-expand-xl {


4156	-ms-flex-flow: row nowrap;
4157	flex-flow: row nowrap;

4158	-ms-flex-pack: start;
4159	justify-content: flex-start;
4160	}
4161	.navbar-expand-xl .navbar-nav {


4162	-ms-flex-direction: row;
4163	flex-direction: row;
4164	}
4165	.navbar-expand-xl .navbar-nav .dropdown-menu {
4166	position: absolute;
4167	}




4168	.navbar-expand-xl .navbar-nav .nav-link {
4169	padding-right: 0.5rem;
4170	padding-left: 0.5rem;

4175	flex-wrap: nowrap;
4176	}
4177	.navbar-expand-xl .navbar-collapse {

4178	display: -ms-flexbox !important;
4179	display: flex !important;
4180	-ms-flex-preferred-size: auto;

4183	.navbar-expand-xl .navbar-toggler {
4184	display: none;
4185	}




4186	}
4187
4188	.navbar-expand {


4189	-ms-flex-flow: row nowrap;
4190	flex-flow: row nowrap;

4191	-ms-flex-pack: start;
4192	justify-content: flex-start;
4193	}

4199	}
4200
4201	.navbar-expand .navbar-nav {


4202	-ms-flex-direction: row;
4203	flex-direction: row;
4204	}

4207	position: absolute;
4208	}
4209





4210	.navbar-expand .navbar-nav .nav-link {
4211	padding-right: 0.5rem;
4212	padding-left: 0.5rem;

4219	}
4220
4221	.navbar-expand .navbar-collapse {

4222	display: -ms-flexbox !important;
4223	display: flex !important;
4224	-ms-flex-preferred-size: auto;

4229	display: none;
4230	}
4231





4232	.navbar-light .navbar-brand {
4233	color: rgba(0, 0, 0, 0.9);
4234	}

4327
4328	.card {
4329	position: relative;

4330	display: -ms-flexbox;
4331	display: flex;


4332	-ms-flex-direction: column;
4333	flex-direction: column;
4334	min-width: 0;

4355	}
4356
4357	.card-body {

4358	-ms-flex: 1 1 auto;
4359	flex: 1 1 auto;
4360	padding: 1.25rem;

4445	}
4446
4447	.card-deck {

4448	display: -ms-flexbox;
4449	display: flex;


4450	-ms-flex-direction: column;
4451	flex-direction: column;
4452	}

4457
4458	@media (min-width: 576px) {
4459	.card-deck {


4460	-ms-flex-flow: row wrap;
4461	flex-flow: row wrap;
4462	margin-right: -15px;
4463	margin-left: -15px;
4464	}
4465	.card-deck .card {

4466	display: -ms-flexbox;
4467	display: flex;

4468	-ms-flex: 1 0 0%;
4469	flex: 1 0 0%;


4470	-ms-flex-direction: column;
4471	flex-direction: column;
4472	margin-right: 15px;

4476	}
4477
4478	.card-group {

4479	display: -ms-flexbox;
4480	display: flex;


4481	-ms-flex-direction: column;
4482	flex-direction: column;
4483	}

4488
4489	@media (min-width: 576px) {
4490	.card-group {


4491	-ms-flex-flow: row wrap;
4492	flex-flow: row wrap;
4493	}
4494	.card-group > .card {

4495	-ms-flex: 1 0 0%;
4496	flex: 1 0 0%;
4497	margin-bottom: 0;

4560	-webkit-column-gap: 1.25rem;
4561	-moz-column-gap: 1.25rem;
4562	column-gap: 1.25rem;
4563	+ orphans: 1;
4564	+ widows: 1;
4565	}
4566	.card-columns .card {
4567	display: inline-block;

4569	}
4570	}
4571
4572	+ .accordion .card:not(:first-of-type):not(:last-of-type) {
4573	+ border-bottom: 0;
4574	+ border-radius: 0;
4575	+ }
4576	+
4577	+ .accordion .card:not(:first-of-type) .card-header:first-child {
4578	+ border-radius: 0;
4579	+ }
4580	+
4581	+ .accordion .card:first-of-type {
4582	+ border-bottom: 0;
4583	+ border-bottom-right-radius: 0;
4584	+ border-bottom-left-radius: 0;
4585	+ }
4586	+
4587	+ .accordion .card:last-of-type {
4588	+ border-top-left-radius: 0;
4589	+ border-top-right-radius: 0;
4590	+ }
4591	+
4592	.breadcrumb {

4593	display: -ms-flexbox;
4594	display: flex;
4595	-ms-flex-wrap: wrap;

4601	border-radius: 0.25rem;
4602	}
4603
4604	+ .breadcrumb-item + .breadcrumb-item {
4605	+ padding-left: 0.5rem;
4606	+ }
4607	+
4608	.breadcrumb-item + .breadcrumb-item::before {
4609	display: inline-block;
4610	padding-right: 0.5rem;

4611	color: #6c757d;
4612	content: "/";
4613	}

4625	}
4626
4627	.pagination {

4628	display: -ms-flexbox;
4629	display: flex;
4630	padding-left: 0;

4644	}
4645
4646	.page-link:hover {
4647	+ z-index: 2;
4648	color: #0056b3;
4649	text-decoration: none;
4650	background-color: #e9ecef;

5012	}
5013
5014	.progress {

5015	display: -ms-flexbox;
5016	display: flex;
5017	height: 1rem;

5022	}
5023
5024	.progress-bar {

5025	display: -ms-flexbox;
5026	display: flex;


5027	-ms-flex-direction: column;
5028	flex-direction: column;

5029	-ms-flex-pack: center;
5030	justify-content: center;
5031	color: #fff;
5032	text-align: center;
5033	+ white-space: nowrap;
5034	background-color: #007bff;
5035	transition: width 0.6s ease;
5036	}
5037
5038	+ @media screen and (prefers-reduced-motion: reduce) {
5039	+ .progress-bar {
5040	+ transition: none;
5041	+ }
5042	+ }
5043	+
5044	.progress-bar-striped {
5045	background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
5046	background-size: 1rem 1rem;

5052	}
5053
5054	.media {

5055	display: -ms-flexbox;
5056	display: flex;

5057	-ms-flex-align: start;
5058	align-items: flex-start;
5059	}
5060
5061	.media-body {

5062	-ms-flex: 1;
5063	flex: 1;
5064	}
5065
5066	.list-group {

5067	display: -ms-flexbox;
5068	display: flex;


5069	-ms-flex-direction: column;
5070	flex-direction: column;
5071	padding-left: 0;

5331	transform: translate(0, -25%);
5332	}
5333
5334	+ @media screen and (prefers-reduced-motion: reduce) {
5335	+ .modal.fade .modal-dialog {
5336	+ transition: none;
5337	+ }
5338	+ }
5339	+
5340	.modal.show .modal-dialog {
5341	-webkit-transform: translate(0, 0);
5342	transform: translate(0, 0);
5343	}
5344
5345	.modal-dialog-centered {

5346	display: -ms-flexbox;
5347	display: flex;

5348	-ms-flex-align: center;
5349	align-items: center;
5350	min-height: calc(100% - (0.5rem * 2));

5352
5353	.modal-content {
5354	position: relative;

5355	display: -ms-flexbox;
5356	display: flex;


5357	-ms-flex-direction: column;
5358	flex-direction: column;
5359	width: 100%;

5384	}
5385
5386	.modal-header {

5387	display: -ms-flexbox;
5388	display: flex;

5389	-ms-flex-align: start;
5390	align-items: flex-start;

5391	-ms-flex-pack: justify;
5392	justify-content: space-between;
5393	padding: 1rem;

5408
5409	.modal-body {
5410	position: relative;

5411	-ms-flex: 1 1 auto;
5412	flex: 1 1 auto;
5413	padding: 1rem;
5414	}
5415
5416	.modal-footer {

5417	display: -ms-flexbox;
5418	display: flex;

5419	-ms-flex-align: center;
5420	align-items: center;

5421	-ms-flex-pack: end;
5422	justify-content: flex-end;
5423	padding: 1rem;

5757	.carousel-item {
5758	position: relative;
5759	display: none;

5760	-ms-flex-align: center;
5761	align-items: center;
5762	width: 100%;

5769	perspective: 1000px;
5770	}
5771
5772	+ @media screen and (prefers-reduced-motion: reduce) {
5773	+ .carousel-item {
5774	+ transition: none;
5775	+ }
5776	+ }
5777	+
5778	.carousel-item.active,
5779	.carousel-item-next,
5780	.carousel-item-prev {

5829	}
5830	}
5831
5832	+ .carousel-fade .carousel-item {
5833	+ opacity: 0;
5834	+ transition-duration: .6s;
5835	+ transition-property: opacity;
5836	+ }
5837	+
5838	+ .carousel-fade .carousel-item.active,
5839	+ .carousel-fade .carousel-item-next.carousel-item-left,
5840	+ .carousel-fade .carousel-item-prev.carousel-item-right {
5841	+ opacity: 1;
5842	+ }
5843	+
5844	+ .carousel-fade .active.carousel-item-left,
5845	+ .carousel-fade .active.carousel-item-right {
5846	+ opacity: 0;
5847	+ }
5848	+
5849	+ .carousel-fade .carousel-item-next,
5850	+ .carousel-fade .carousel-item-prev,
5851	+ .carousel-fade .carousel-item.active,
5852	+ .carousel-fade .active.carousel-item-left,
5853	+ .carousel-fade .active.carousel-item-prev {
5854	+ -webkit-transform: translateX(0);
5855	+ transform: translateX(0);
5856	+ }
5857	+
5858	+ @supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
5859	+ .carousel-fade .carousel-item-next,
5860	+ .carousel-fade .carousel-item-prev,
5861	+ .carousel-fade .carousel-item.active,
5862	+ .carousel-fade .active.carousel-item-left,
5863	+ .carousel-fade .active.carousel-item-prev {
5864	+ -webkit-transform: translate3d(0, 0, 0);
5865	+ transform: translate3d(0, 0, 0);
5866	+ }
5867	+ }
5868	+
5869	.carousel-control-prev,
5870	.carousel-control-next {
5871	position: absolute;
5872	top: 0;
5873	bottom: 0;

5874	display: -ms-flexbox;
5875	display: flex;

5876	-ms-flex-align: center;
5877	align-items: center;

5878	-ms-flex-pack: center;
5879	justify-content: center;
5880	width: 15%;

5923	bottom: 10px;
5924	left: 0;
5925	z-index: 15;

5926	display: -ms-flexbox;
5927	display: flex;

5928	-ms-flex-pack: center;
5929	justify-content: center;
5930	padding-left: 0;

5935
5936	.carousel-indicators li {
5937	position: relative;

5938	-ms-flex: 0 1 auto;
5939	flex: 0 1 auto;
5940	width: 30px;

6236	}
6237
6238	.d-flex {

6239	display: -ms-flexbox !important;
6240	display: flex !important;
6241	}
6242
6243	.d-inline-flex {

6244	display: -ms-inline-flexbox !important;
6245	display: inline-flex !important;
6246	}

6268	display: table-cell !important;
6269	}
6270	.d-sm-flex {

6271	display: -ms-flexbox !important;
6272	display: flex !important;
6273	}
6274	.d-sm-inline-flex {

6275	display: -ms-inline-flexbox !important;
6276	display: inline-flex !important;
6277	}

6300	display: table-cell !important;
6301	}
6302	.d-md-flex {

6303	display: -ms-flexbox !important;
6304	display: flex !important;
6305	}
6306	.d-md-inline-flex {

6307	display: -ms-inline-flexbox !important;
6308	display: inline-flex !important;
6309	}

6332	display: table-cell !important;
6333	}
6334	.d-lg-flex {

6335	display: -ms-flexbox !important;
6336	display: flex !important;
6337	}
6338	.d-lg-inline-flex {

6339	display: -ms-inline-flexbox !important;
6340	display: inline-flex !important;
6341	}

6364	display: table-cell !important;
6365	}
6366	.d-xl-flex {

6367	display: -ms-flexbox !important;
6368	display: flex !important;
6369	}
6370	.d-xl-inline-flex {

6371	display: -ms-inline-flexbox !important;
6372	display: inline-flex !important;
6373	}

6396	display: table-cell !important;
6397	}
6398	.d-print-flex {

6399	display: -ms-flexbox !important;
6400	display: flex !important;
6401	}
6402	.d-print-inline-flex {

6403	display: -ms-inline-flexbox !important;
6404	display: inline-flex !important;
6405	}

6449	}
6450
6451	.flex-row {


6452	-ms-flex-direction: row !important;
6453	flex-direction: row !important;
6454	}
6455
6456	.flex-column {


6457	-ms-flex-direction: column !important;
6458	flex-direction: column !important;
6459	}
6460
6461	.flex-row-reverse {


6462	-ms-flex-direction: row-reverse !important;
6463	flex-direction: row-reverse !important;
6464	}
6465
6466	.flex-column-reverse {


6467	-ms-flex-direction: column-reverse !important;
6468	flex-direction: column-reverse !important;
6469	}

6483	flex-wrap: wrap-reverse !important;
6484	}
6485
6486	+ .flex-fill {
6487	+ -ms-flex: 1 1 auto !important;
6488	+ flex: 1 1 auto !important;
6489	+ }
6490	+
6491	+ .flex-grow-0 {
6492	+ -ms-flex-positive: 0 !important;
6493	+ flex-grow: 0 !important;
6494	+ }
6495	+
6496	+ .flex-grow-1 {
6497	+ -ms-flex-positive: 1 !important;
6498	+ flex-grow: 1 !important;
6499	+ }
6500	+
6501	+ .flex-shrink-0 {
6502	+ -ms-flex-negative: 0 !important;
6503	+ flex-shrink: 0 !important;
6504	+ }
6505	+
6506	+ .flex-shrink-1 {
6507	+ -ms-flex-negative: 1 !important;
6508	+ flex-shrink: 1 !important;
6509	+ }
6510	+
6511	.justify-content-start {

6512	-ms-flex-pack: start !important;
6513	justify-content: flex-start !important;
6514	}
6515
6516	.justify-content-end {

6517	-ms-flex-pack: end !important;
6518	justify-content: flex-end !important;
6519	}
6520
6521	.justify-content-center {

6522	-ms-flex-pack: center !important;
6523	justify-content: center !important;
6524	}
6525
6526	.justify-content-between {

6527	-ms-flex-pack: justify !important;
6528	justify-content: space-between !important;
6529	}

6534	}
6535
6536	.align-items-start {

6537	-ms-flex-align: start !important;
6538	align-items: flex-start !important;
6539	}
6540
6541	.align-items-end {

6542	-ms-flex-align: end !important;
6543	align-items: flex-end !important;
6544	}
6545
6546	.align-items-center {

6547	-ms-flex-align: center !important;
6548	align-items: center !important;
6549	}
6550
6551	.align-items-baseline {

6552	-ms-flex-align: baseline !important;
6553	align-items: baseline !important;
6554	}
6555
6556	.align-items-stretch {

6557	-ms-flex-align: stretch !important;
6558	align-items: stretch !important;
6559	}

6620
6621	@media (min-width: 576px) {
6622	.flex-sm-row {


6623	-ms-flex-direction: row !important;
6624	flex-direction: row !important;
6625	}
6626	.flex-sm-column {


6627	-ms-flex-direction: column !important;
6628	flex-direction: column !important;
6629	}
6630	.flex-sm-row-reverse {


6631	-ms-flex-direction: row-reverse !important;
6632	flex-direction: row-reverse !important;
6633	}
6634	.flex-sm-column-reverse {


6635	-ms-flex-direction: column-reverse !important;
6636	flex-direction: column-reverse !important;
6637	}

6647	-ms-flex-wrap: wrap-reverse !important;
6648	flex-wrap: wrap-reverse !important;
6649	}
6650	+ .flex-sm-fill {
6651	+ -ms-flex: 1 1 auto !important;
6652	+ flex: 1 1 auto !important;
6653	+ }
6654	+ .flex-sm-grow-0 {
6655	+ -ms-flex-positive: 0 !important;
6656	+ flex-grow: 0 !important;
6657	+ }
6658	+ .flex-sm-grow-1 {
6659	+ -ms-flex-positive: 1 !important;
6660	+ flex-grow: 1 !important;
6661	+ }
6662	+ .flex-sm-shrink-0 {
6663	+ -ms-flex-negative: 0 !important;
6664	+ flex-shrink: 0 !important;
6665	+ }
6666	+ .flex-sm-shrink-1 {
6667	+ -ms-flex-negative: 1 !important;
6668	+ flex-shrink: 1 !important;
6669	+ }
6670	.justify-content-sm-start {

6671	-ms-flex-pack: start !important;
6672	justify-content: flex-start !important;
6673	}
6674	.justify-content-sm-end {

6675	-ms-flex-pack: end !important;
6676	justify-content: flex-end !important;
6677	}
6678	.justify-content-sm-center {

6679	-ms-flex-pack: center !important;
6680	justify-content: center !important;
6681	}
6682	.justify-content-sm-between {

6683	-ms-flex-pack: justify !important;
6684	justify-content: space-between !important;
6685	}

6688	justify-content: space-around !important;
6689	}
6690	.align-items-sm-start {

6691	-ms-flex-align: start !important;
6692	align-items: flex-start !important;
6693	}
6694	.align-items-sm-end {

6695	-ms-flex-align: end !important;
6696	align-items: flex-end !important;
6697	}
6698	.align-items-sm-center {

6699	-ms-flex-align: center !important;
6700	align-items: center !important;
6701	}
6702	.align-items-sm-baseline {

6703	-ms-flex-align: baseline !important;
6704	align-items: baseline !important;
6705	}
6706	.align-items-sm-stretch {

6707	-ms-flex-align: stretch !important;
6708	align-items: stretch !important;
6709	}

6759
6760	@media (min-width: 768px) {
6761	.flex-md-row {


6762	-ms-flex-direction: row !important;
6763	flex-direction: row !important;
6764	}
6765	.flex-md-column {


6766	-ms-flex-direction: column !important;
6767	flex-direction: column !important;
6768	}
6769	.flex-md-row-reverse {


6770	-ms-flex-direction: row-reverse !important;
6771	flex-direction: row-reverse !important;
6772	}
6773	.flex-md-column-reverse {


6774	-ms-flex-direction: column-reverse !important;
6775	flex-direction: column-reverse !important;
6776	}

6786	-ms-flex-wrap: wrap-reverse !important;
6787	flex-wrap: wrap-reverse !important;
6788	}
6789	+ .flex-md-fill {
6790	+ -ms-flex: 1 1 auto !important;
6791	+ flex: 1 1 auto !important;
6792	+ }
6793	+ .flex-md-grow-0 {
6794	+ -ms-flex-positive: 0 !important;
6795	+ flex-grow: 0 !important;
6796	+ }
6797	+ .flex-md-grow-1 {
6798	+ -ms-flex-positive: 1 !important;
6799	+ flex-grow: 1 !important;
6800	+ }
6801	+ .flex-md-shrink-0 {
6802	+ -ms-flex-negative: 0 !important;
6803	+ flex-shrink: 0 !important;
6804	+ }
6805	+ .flex-md-shrink-1 {
6806	+ -ms-flex-negative: 1 !important;
6807	+ flex-shrink: 1 !important;
6808	+ }
6809	.justify-content-md-start {

6810	-ms-flex-pack: start !important;
6811	justify-content: flex-start !important;
6812	}
6813	.justify-content-md-end {

6814	-ms-flex-pack: end !important;
6815	justify-content: flex-end !important;
6816	}
6817	.justify-content-md-center {

6818	-ms-flex-pack: center !important;
6819	justify-content: center !important;
6820	}
6821	.justify-content-md-between {

6822	-ms-flex-pack: justify !important;
6823	justify-content: space-between !important;
6824	}

6827	justify-content: space-around !important;
6828	}
6829	.align-items-md-start {

6830	-ms-flex-align: start !important;
6831	align-items: flex-start !important;
6832	}
6833	.align-items-md-end {

6834	-ms-flex-align: end !important;
6835	align-items: flex-end !important;
6836	}
6837	.align-items-md-center {

6838	-ms-flex-align: center !important;
6839	align-items: center !important;
6840	}
6841	.align-items-md-baseline {

6842	-ms-flex-align: baseline !important;
6843	align-items: baseline !important;
6844	}
6845	.align-items-md-stretch {

6846	-ms-flex-align: stretch !important;
6847	align-items: stretch !important;
6848	}

6898
6899	@media (min-width: 992px) {
6900	.flex-lg-row {


6901	-ms-flex-direction: row !important;
6902	flex-direction: row !important;
6903	}
6904	.flex-lg-column {


6905	-ms-flex-direction: column !important;
6906	flex-direction: column !important;
6907	}
6908	.flex-lg-row-reverse {


6909	-ms-flex-direction: row-reverse !important;
6910	flex-direction: row-reverse !important;
6911	}
6912	.flex-lg-column-reverse {


6913	-ms-flex-direction: column-reverse !important;
6914	flex-direction: column-reverse !important;
6915	}

6925	-ms-flex-wrap: wrap-reverse !important;
6926	flex-wrap: wrap-reverse !important;
6927	}
6928	+ .flex-lg-fill {
6929	+ -ms-flex: 1 1 auto !important;
6930	+ flex: 1 1 auto !important;
6931	+ }
6932	+ .flex-lg-grow-0 {
6933	+ -ms-flex-positive: 0 !important;
6934	+ flex-grow: 0 !important;
6935	+ }
6936	+ .flex-lg-grow-1 {
6937	+ -ms-flex-positive: 1 !important;
6938	+ flex-grow: 1 !important;
6939	+ }
6940	+ .flex-lg-shrink-0 {
6941	+ -ms-flex-negative: 0 !important;
6942	+ flex-shrink: 0 !important;
6943	+ }
6944	+ .flex-lg-shrink-1 {
6945	+ -ms-flex-negative: 1 !important;
6946	+ flex-shrink: 1 !important;
6947	+ }
6948	.justify-content-lg-start {

6949	-ms-flex-pack: start !important;
6950	justify-content: flex-start !important;
6951	}
6952	.justify-content-lg-end {

6953	-ms-flex-pack: end !important;
6954	justify-content: flex-end !important;
6955	}
6956	.justify-content-lg-center {

6957	-ms-flex-pack: center !important;
6958	justify-content: center !important;
6959	}
6960	.justify-content-lg-between {

6961	-ms-flex-pack: justify !important;
6962	justify-content: space-between !important;
6963	}

6966	justify-content: space-around !important;
6967	}
6968	.align-items-lg-start {

6969	-ms-flex-align: start !important;
6970	align-items: flex-start !important;
6971	}
6972	.align-items-lg-end {

6973	-ms-flex-align: end !important;
6974	align-items: flex-end !important;
6975	}
6976	.align-items-lg-center {

6977	-ms-flex-align: center !important;
6978	align-items: center !important;
6979	}
6980	.align-items-lg-baseline {

6981	-ms-flex-align: baseline !important;
6982	align-items: baseline !important;
6983	}
6984	.align-items-lg-stretch {

6985	-ms-flex-align: stretch !important;
6986	align-items: stretch !important;
6987	}

7037
7038	@media (min-width: 1200px) {
7039	.flex-xl-row {


7040	-ms-flex-direction: row !important;
7041	flex-direction: row !important;
7042	}
7043	.flex-xl-column {


7044	-ms-flex-direction: column !important;
7045	flex-direction: column !important;
7046	}
7047	.flex-xl-row-reverse {


7048	-ms-flex-direction: row-reverse !important;
7049	flex-direction: row-reverse !important;
7050	}
7051	.flex-xl-column-reverse {


7052	-ms-flex-direction: column-reverse !important;
7053	flex-direction: column-reverse !important;
7054	}

7064	-ms-flex-wrap: wrap-reverse !important;
7065	flex-wrap: wrap-reverse !important;
7066	}
7067	+ .flex-xl-fill {
7068	+ -ms-flex: 1 1 auto !important;
7069	+ flex: 1 1 auto !important;
7070	+ }
7071	+ .flex-xl-grow-0 {
7072	+ -ms-flex-positive: 0 !important;
7073	+ flex-grow: 0 !important;
7074	+ }
7075	+ .flex-xl-grow-1 {
7076	+ -ms-flex-positive: 1 !important;
7077	+ flex-grow: 1 !important;
7078	+ }
7079	+ .flex-xl-shrink-0 {
7080	+ -ms-flex-negative: 0 !important;
7081	+ flex-shrink: 0 !important;
7082	+ }
7083	+ .flex-xl-shrink-1 {
7084	+ -ms-flex-negative: 1 !important;
7085	+ flex-shrink: 1 !important;
7086	+ }
7087	.justify-content-xl-start {

7088	-ms-flex-pack: start !important;
7089	justify-content: flex-start !important;
7090	}
7091	.justify-content-xl-end {

7092	-ms-flex-pack: end !important;
7093	justify-content: flex-end !important;
7094	}
7095	.justify-content-xl-center {

7096	-ms-flex-pack: center !important;
7097	justify-content: center !important;
7098	}
7099	.justify-content-xl-between {

7100	-ms-flex-pack: justify !important;
7101	justify-content: space-between !important;
7102	}

7105	justify-content: space-around !important;
7106	}
7107	.align-items-xl-start {

7108	-ms-flex-align: start !important;
7109	align-items: flex-start !important;
7110	}
7111	.align-items-xl-end {

7112	-ms-flex-align: end !important;
7113	align-items: flex-end !important;
7114	}
7115	.align-items-xl-center {

7116	-ms-flex-align: center !important;
7117	align-items: center !important;
7118	}
7119	.align-items-xl-baseline {

7120	-ms-flex-align: baseline !important;
7121	align-items: baseline !important;
7122	}
7123	.align-items-xl-stretch {

7124	-ms-flex-align: stretch !important;
7125	align-items: stretch !important;
7126	}

7288	overflow: hidden;
7289	clip: rect(0, 0, 0, 0);
7290	white-space: nowrap;


7291	border: 0;
7292	}
7293

7298	overflow: visible;
7299	clip: auto;
7300	white-space: normal;
7301	+ }
7302	+
7303	+ .shadow-sm {
7304	+ box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important;
7305	+ }
7306	+
7307	+ .shadow {
7308	+ box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important;
7309	+ }
7310	+
7311	+ .shadow-lg {
7312	+ box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important;
7313	+ }
7314	+
7315	+ .shadow-none {
7316	+ box-shadow: none !important;
7317	}
7318
7319	.w-25 {

7332	width: 100% !important;
7333	}
7334
7335	+ .w-auto {
7336	+ width: auto !important;
7337	+ }
7338	+
7339	.h-25 {
7340	height: 25% !important;
7341	}

7352	height: 100% !important;
7353	}
7354
7355	+ .h-auto {
7356	+ height: auto !important;
7357	+ }
7358	+
7359	.mw-100 {
7360	max-width: 100% !important;
7361	}

8676	}
8677	}
8678
8679	+ .text-monospace {
8680	+ font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
8681	+ }
8682	+
8683	.text-justify {
8684	text-align: justify !important;
8685	}

8850	color: #1d2124 !important;
8851	}
8852
8853	+ .text-body {
8854	+ color: #212529 !important;
8855	+ }
8856	+
8857	.text-muted {
8858	color: #6c757d !important;
8859	}
8860
8861	+ .text-black-50 {
8862	+ color: rgba(0, 0, 0, 0.5) !important;
8863	+ }
8864	+
8865	+ .text-white-50 {
8866	+ color: rgba(255, 255, 255, 0.5) !important;
8867	+ }
8868	+
8869	.text-hide {
8870	font: 0/0 a;
8871	color: transparent;

8900	}
8901	pre,
8902	blockquote {
8903	+ border: 1px solid #adb5bd;
8904	page-break-inside: avoid;
8905	}
8906	thead {

8944	}
8945	.table-bordered th,
8946	.table-bordered td {
8947	+ border: 1px solid #dee2e6 !important;
8948	}
8949	}
8950	/# sourceMappingURL=bootstrap.css.map /

resources/css/bootstrap4.min.css CHANGED Viewed

	@@ -1,7 +1,7 @@
1	/*!
2	- * Bootstrap v4.0.0 (https://getbootstrap.com)
3	* Copyright 2011-2018 The Bootstrap Authors
4	* Copyright 2011-2018 Twitter, Inc.
5	* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
6	- /:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:576px;--breakpoint-md:768px;--breakpoint-lg:992px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace},::after,::before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;-ms-overflow-style:scrollbar;-webkit-tap-highlight-color:transparent}@-ms-viewport{width:device-width}article,aside,dialog,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0}address{margin-bottom:1rem;font-style:normal;line-height:inherit}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}dfn{font-style:italic}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;text-decoration:none;background-color:transparent;-webkit-text-decoration-skip:objects}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:monospace,monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg:not(:root){overflow:hidden}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;font-family:inherit;font-weight:500;line-height:1.2;color:inherit}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem;font-weight:300;line-height:1.2}.display-2{font-size:5.5rem;font-weight:300;line-height:1.2}.display-3{font-size:4.5rem;font-weight:300;line-height:1.2}.display-4{font-size:3.5rem;font-weight:300;line-height:1.2}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,.1)}.small,small{font-size:80%;font-weight:400}.mark,mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer::before{content:"\2014 \00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}code{font-size:87.5%;color:#e83e8c;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#212529}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-10,.col-11,.col-12,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-auto,.col-lg,.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-auto,.col-md,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-auto,.col-sm,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-auto{position:relative;width:100%;min-height:1px;padding-right:15px;padding-left:15px}.col{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-sm-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-sm-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-sm-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-sm-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-sm-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-sm-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-sm-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-sm-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-sm-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-sm-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-sm-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-sm-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-sm-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-sm-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-sm-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-md-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-md-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-md-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-md-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-md-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-md-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-md-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-md-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-md-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-md-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-md-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-md-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-md-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-md-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-md-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-lg-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-lg-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-lg-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-lg-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-lg-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-lg-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-lg-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-lg-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-lg-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-lg-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-lg-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-lg-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-lg-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-lg-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-lg-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-xl-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-xl-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-xl-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-xl-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-xl-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-xl-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-xl-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-xl-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-xl-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-xl-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-xl-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-xl-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-xl-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-xl-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-xl-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.table{width:100%;max-width:100%;margin-bottom:1rem;background-color:transparent}.table td,.table th{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table .table{background-color:#fff}.table-sm td,.table-sm th{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-hover .table-primary:hover{background-color:#9fcdff}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-hover .table-secondary:hover{background-color:#c8cbcf}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-hover .table-success:hover{background-color:#b1dfbb}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-hover .table-info:hover{background-color:#abdde5}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-hover .table-warning:hover{background-color:#ffe8a1}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-hover .table-danger:hover{background-color:#f1b0b7}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-hover .table-light:hover{background-color:#ececf6}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-hover .table-dark:hover{background-color:#b9bbbe}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{color:#fff;background-color:#212529;border-color:#32383e}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#212529}.table-dark td,.table-dark th,.table-dark thead th{border-color:#32383e}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,.05)}.table-dark.table-hover tbody tr:hover{background-color:rgba(255,255,255,.075)}@media (max-width:575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-md>.table-bordered{border:0}}@media (max-width:991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.form-control::-webkit-input-placeholder{color:#6c757d;opacity:1}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control:-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:not([size]):not([multiple]){height:calc(2.25rem + 2px)}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm,.input-group-lg>.form-control-plaintext.form-control,.input-group-lg>.input-group-append>.form-control-plaintext.btn,.input-group-lg>.input-group-append>.form-control-plaintext.input-group-text,.input-group-lg>.input-group-prepend>.form-control-plaintext.btn,.input-group-lg>.input-group-prepend>.form-control-plaintext.input-group-text,.input-group-sm>.form-control-plaintext.form-control,.input-group-sm>.input-group-append>.form-control-plaintext.btn,.input-group-sm>.input-group-append>.form-control-plaintext.input-group-text,.input-group-sm>.input-group-prepend>.form-control-plaintext.btn,.input-group-sm>.input-group-prepend>.form-control-plaintext.input-group-text{padding-right:0;padding-left:0}.form-control-sm,.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group-sm>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-sm>select.form-control:not([size]):not([multiple]),select.form-control-sm:not([size]):not([multiple]){height:calc(1.8125rem + 2px)}.form-control-lg,.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-lg>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-lg>select.form-control:not([size]):not([multiple]),select.form-control-lg:not([size]):not([multiple]){height:calc(2.875rem + 2px)}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(40,167,69,.8);border-radius:.2rem}.custom-select.is-valid,.form-control.is-valid,.was-validated .custom-select:valid,.was-validated .form-control:valid{border-color:#28a745}.custom-select.is-valid:focus,.form-control.is-valid:focus,.was-validated .custom-select:valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip,.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip,.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip{display:block}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label::before,.was-validated .custom-control-input:valid~.custom-control-label::before{background-color:#71dd8a}.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip,.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid:checked~.custom-control-label::before,.was-validated .custom-control-input:valid:checked~.custom-control-label::before{background-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label::before,.was-validated .custom-control-input:valid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(40,167,69,.25)}.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid~.custom-file-label::before,.was-validated .custom-file-input:valid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip,.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip{display:block}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(220,53,69,.8);border-radius:.2rem}.custom-select.is-invalid,.form-control.is-invalid,.was-validated .custom-select:invalid,.was-validated .form-control:invalid{border-color:#dc3545}.custom-select.is-invalid:focus,.form-control.is-invalid:focus,.was-validated .custom-select:invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip,.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip,.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip{display:block}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label::before,.was-validated .custom-control-input:invalid~.custom-control-label::before{background-color:#efa2a9}.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip,.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid:checked~.custom-control-label::before,.was-validated .custom-control-input:invalid:checked~.custom-control-label::before{background-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label::before,.was-validated .custom-control-input:invalid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(220,53,69,.25)}.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid~.custom-file-label::before,.was-validated .custom-file-input:invalid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip,.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip{display:block}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.form-inline .form-check{width:100%}@media (min-width:576px){.form-inline label{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .input-group{width:auto}.form-inline .form-check{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;text-align:center;white-space:nowrap;vertical-align:middle;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.btn:focus,.btn:hover{text-decoration:none}.btn.focus,.btn:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.btn.disabled,.btn:disabled{opacity:.65}.btn:not(:disabled):not(.disabled){cursor:pointer}.btn:not(:disabled):not(.disabled).active,.btn:not(:disabled):not(.disabled):active{background-image:none}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:hover{color:#fff;background-color:#0069d9;border-color:#0062cc}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#0062cc;border-color:#005cbf}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-primary{color:#007bff;background-color:transparent;background-image:none;border-color:#007bff}.btn-outline-primary:hover{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#007bff;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{color:#6c757d;background-color:transparent;background-image:none;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-success{color:#28a745;background-color:transparent;background-image:none;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{color:#17a2b8;background-color:transparent;background-image:none;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{color:#ffc107;background-color:transparent;background-image:none;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{color:#dc3545;background-color:transparent;background-image:none;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{color:#f8f9fa;background-color:transparent;background-image:none;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{color:#343a40;background-color:transparent;background-image:none;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{font-weight:400;color:#007bff;background-color:transparent}.btn-link:hover{color:#0056b3;text-decoration:underline;background-color:transparent;border-color:transparent}.btn-link.focus,.btn-link:focus{text-decoration:underline;border-color:transparent;box-shadow:none}.btn-link.disabled,.btn-link:disabled{color:#6c757d}.btn-group-lg>.btn,.btn-lg{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-group-sm>.btn,.btn-sm{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{opacity:0;transition:opacity .15s linear}.fade.show{opacity:1}.collapse{display:none}.collapse.show{display:block}tr.collapse.show{display:table-row}tbody.collapse.show{display:table-row-group}.collapsing{position:relative;height:0;overflow:hidden;transition:height .35s ease}.dropdown,.dropup{position:relative}.dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#212529;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem}.dropup .dropdown-menu{margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;width:0;height:0;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#007bff}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#6c757d;white-space:nowrap}.btn-group,.btn-group-vertical{position:relative;display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;-webkit-box-flex:0;-ms-flex:0 1 auto;flex:0 1 auto}.btn-group-vertical>.btn:hover,.btn-group>.btn:hover{z-index:1}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus{z-index:1}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group,.btn-group-vertical .btn+.btn,.btn-group-vertical .btn+.btn-group,.btn-group-vertical .btn-group+.btn,.btn-group-vertical .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after{margin-left:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center}.btn-group-vertical .btn,.btn-group-vertical .btn-group{width:100%}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio],.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:stretch;-ms-flex-align:stretch;align-items:stretch;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control{position:relative;-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.custom-file:focus,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control{margin-left:-1px}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::before{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label,.input-group>.custom-file:not(:first-child) .custom-file-label::before{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-append,.input-group-prepend{display:-webkit-box;display:-ms-flexbox;display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked~.custom-control-label::before{color:#fff;background-color:#007bff}.custom-control-input:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:active~.custom-control-label::before{color:#fff;background-color:#b3d7ff}.custom-control-input:disabled~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label::before{background-color:#e9ecef}.custom-control-label{margin-bottom:0}.custom-control-label::before{position:absolute;top:.25rem;left:0;display:block;width:1rem;height:1rem;pointer-events:none;content:"";-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#dee2e6}.custom-control-label::after{position:absolute;top:.25rem;left:0;display:block;width:1rem;height:1rem;content:"";background-repeat:no-repeat;background-position:center center;background-size:50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-radio .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-select{display:inline-block;width:100%;height:calc(2.25rem + 2px);padding:.375rem 1.75rem .375rem .75rem;line-height:1.5;color:#495057;vertical-align:middle;background:#fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center;background-size:8px 10px;border:1px solid #ced4da;border-radius:.25rem;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-select:focus{border-color:#80bdff;outline:0;box-shadow:inset 0 1px 2px rgba(0,0,0,.075),0 0 5px rgba(128,189,255,.5)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{opacity:0}.custom-select-sm{height:calc(1.8125rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:75%}.custom-select-lg{height:calc(2.875rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:125%}.custom-file{position:relative;display:inline-block;width:100%;height:calc(2.25rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:calc(2.25rem + 2px);margin:0;opacity:0}.custom-file-input:focus~.custom-file-control{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:focus~.custom-file-control::before{border-color:#80bdff}.custom-file-input:lang(en)~.custom-file-label::after{content:"Browse"}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:calc(2.25rem + 2px);padding:.375rem .75rem;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:calc(calc(2.25rem + 2px) - 1px * 2);padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background-color:#e9ecef;border-left:1px solid #ced4da;border-radius:0 .25rem .25rem 0}.nav{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#007bff}.nav-fill .nav-item{-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;text-align:center}.nav-justified .nav-item{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{-ms-flex-preferred-size:100%;flex-basis:100%;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler:not(:disabled):not(.disabled){cursor:pointer}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat center center;background-size:100% 100%}@media (max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:576px){.navbar-expand-sm{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-sm .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:768px){.navbar-expand-md{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-md .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:992px){.navbar-expand-lg{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-lg .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:1200px){.navbar-expand-xl{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-xl .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .dropup .dropdown-menu{top:auto;bottom:100%}}.navbar-expand{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .dropup .dropdown-menu{top:auto;bottom:100%}.navbar-light .navbar-brand{color:rgba(0,0,0,.9)}.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,.9)}.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:rgba(255,255,255,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,.5);border-color:rgba(255,255,255,.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-dark .navbar-text{color:rgba(255,255,255,.5)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:calc(.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width:576px){.card-deck{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-flex:1;-ms-flex:1 0 0%;flex:1 0 0%;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width:576px){.card-group{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap}.card-group>.card{-webkit-box-flex:1;-ms-flex:1 0 0%;flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:first-child .card-header,.card-group>.card:first-child .card-img-top{border-top-right-radius:0}.card-group>.card:first-child .card-footer,.card-group>.card:first-child .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:last-child .card-header,.card-group>.card:last-child .card-img-top{border-top-left-radius:0}.card-group>.card:last-child .card-footer,.card-group>.card:last-child .card-img-bottom{border-bottom-left-radius:0}.card-group>.card:only-child{border-radius:.25rem}.card-group>.card:only-child .card-header,.card-group>.card:only-child .card-img-top{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card-group>.card:only-child .card-footer,.card-group>.card:only-child .card-img-bottom{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-group>.card:not(:first-child):not(:last-child):not(:only-child){border-radius:0}.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-footer,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-header,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-top{border-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:576px){.card-columns{-webkit-column-count:3;-moz-column-count:3;column-count:3;-webkit-column-gap:1.25rem;-moz-column-gap:1.25rem;column-gap:1.25rem}.card-columns .card{display:inline-block;width:100%}}.breadcrumb{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;padding-left:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:-webkit-box;display:-ms-flexbox;display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#007bff;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{color:#0056b3;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.page-link:not(:disabled):not(.disabled){cursor:pointer}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#007bff;border-color:#007bff}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#007bff}.badge-primary[href]:focus,.badge-primary[href]:hover{color:#fff;text-decoration:none;background-color:#0062cc}.badge-secondary{color:#fff;background-color:#6c757d}.badge-secondary[href]:focus,.badge-secondary[href]:hover{color:#fff;text-decoration:none;background-color:#545b62}.badge-success{color:#fff;background-color:#28a745}.badge-success[href]:focus,.badge-success[href]:hover{color:#fff;text-decoration:none;background-color:#1e7e34}.badge-info{color:#fff;background-color:#17a2b8}.badge-info[href]:focus,.badge-info[href]:hover{color:#fff;text-decoration:none;background-color:#117a8b}.badge-warning{color:#212529;background-color:#ffc107}.badge-warning[href]:focus,.badge-warning[href]:hover{color:#212529;text-decoration:none;background-color:#d39e00}.badge-danger{color:#fff;background-color:#dc3545}.badge-danger[href]:focus,.badge-danger[href]:hover{color:#fff;text-decoration:none;background-color:#bd2130}.badge-light{color:#212529;background-color:#f8f9fa}.badge-light[href]:focus,.badge-light[href]:hover{color:#212529;text-decoration:none;background-color:#dae0e5}.badge-dark{color:#fff;background-color:#343a40}.badge-dark[href]:focus,.badge-dark[href]:hover{color:#fff;text-decoration:none;background-color:#1d2124}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#004085;background-color:#cce5ff;border-color:#b8daff}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@-webkit-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:-webkit-box;display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem}.progress-bar{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;background-color:#007bff;transition:width .6s ease}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}.media{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start}.media-body{-webkit-box-flex:1;-ms-flex:1;flex:1}.list-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#212529;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item:focus,.list-group-item:hover{z-index:1;text-decoration:none}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#007bff;border-color:#007bff}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{border-bottom:0}.list-group-item-primary{color:#004085;background-color:#b8daff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#004085;background-color:#9fcdff}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#004085;border-color:#004085}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:focus,.close:hover{color:#000;text-decoration:none;opacity:.75}.close:not(:disabled):not(.disabled){cursor:pointer}button.close{padding:0;background-color:transparent;border:0;-webkit-appearance:none}.modal-open{overflow:hidden}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;outline:0}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:-webkit-transform .3s ease-out;transition:transform .3s ease-out;transition:transform .3s ease-out,-webkit-transform .3s ease-out;-webkit-transform:translate(0,-25%);transform:translate(0,-25%)}.modal.show .modal-dialog{-webkit-transform:translate(0,0);transform:translate(0,0)}.modal-dialog-centered{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;min-height:calc(100% - (.5rem * 2))}.modal-content{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;padding:1rem;border-bottom:1px solid #e9ecef;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem}.modal-footer{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:end;-ms-flex-pack:end;justify-content:flex-end;padding:1rem;border-top:1px solid #e9ecef}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-centered{min-height:calc(100% - (1.75rem * 2))}.modal-sm{max-width:300px}}@media (min-width:992px){.modal-lg{max-width:800px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow::before,.bs-tooltip-top .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=right] .arrow::before,.bs-tooltip-right .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow::before,.bs-tooltip-bottom .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=left] .arrow::before,.bs-tooltip-left .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::after,.popover .arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top] .arrow,.bs-popover-top .arrow{bottom:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::after,.bs-popover-top .arrow::before{border-width:.5rem .5rem 0}.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::before{bottom:0;border-top-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-top .arrow::after{bottom:1px;border-top-color:#fff}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right] .arrow,.bs-popover-right .arrow{left:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::after,.bs-popover-right .arrow::before{border-width:.5rem .5rem .5rem 0}.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::before{left:0;border-right-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-right .arrow::after{left:1px;border-right-color:#fff}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom] .arrow,.bs-popover-bottom .arrow{top:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::after,.bs-popover-bottom .arrow::before{border-width:0 .5rem .5rem .5rem}.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::before{top:0;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-bottom .arrow::after{top:1px;border-bottom-color:#fff}.bs-popover-auto[x-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left] .arrow,.bs-popover-left .arrow{right:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::after,.bs-popover-left .arrow::before{border-width:.5rem 0 .5rem .5rem}.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::before{right:0;border-left-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-left .arrow::after{right:1px;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;color:inherit;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#212529}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-item{position:relative;display:none;-webkit-box-align:center;-ms-flex-align:center;align-items:center;width:100%;transition:-webkit-transform .6s ease;transition:transform .6s ease;transition:transform .6s ease,-webkit-transform .6s ease;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.carousel-item-next,.carousel-item-prev{position:absolute;top:0}.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.active.carousel-item-right,.carousel-item-next{-webkit-transform:translateX(100%);transform:translateX(100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-right,.carousel-item-next{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}}.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translateX(-100%);transform:translateX(-100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:20px;height:20px;background:transparent no-repeat center center;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E")}.carousel-control-next-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E")}.carousel-indicators{position:absolute;right:0;bottom:10px;left:0;z-index:15;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{position:relative;-webkit-box-flex:0;-ms-flex:0 1 auto;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;background-color:rgba(255,255,255,.5)}.carousel-indicators li::before{position:absolute;top:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators li::after{position:absolute;bottom:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators .active{background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important;border-top-right-radius:.25rem!important}.rounded-right{border-top-right-radius:.25rem!important;border-bottom-right-radius:.25rem!important}.rounded-bottom{border-bottom-right-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-circle{border-radius:50%!important}.rounded-0{border-radius:0!important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.857143%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}@media (min-width:576px){.flex-sm-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-sm-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:768px){.flex-md-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-md-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-lg-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-xl-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports ((position:-webkit-sticky) or (position:sticky)){.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;-webkit-clip-path:inset(50%);clip-path:inset(50%);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal;-webkit-clip-path:none;clip-path:none}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-justify{text-align:justify!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0062cc!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#545b62!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#1e7e34!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#117a8b!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#d39e00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#bd2130!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#dae0e5!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#1d2124!important}.text-muted{color:#6c757d!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,::after,::before{text-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px!important}.container{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #ddd!important}}
7	/# sourceMappingURL=bootstrap.min.css.map /


1	/*!
2	+ * Bootstrap v4.1.0 (https://getbootstrap.com/)
3	* Copyright 2011-2018 The Bootstrap Authors
4	* Copyright 2011-2018 Twitter, Inc.
5	* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
6	+ /:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:576px;--breakpoint-md:768px;--breakpoint-lg:992px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace},::after,::before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;-ms-overflow-style:scrollbar;-webkit-tap-highlight-color:transparent}@-ms-viewport{width:device-width}article,aside,dialog,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0}address{margin-bottom:1rem;font-style:normal;line-height:inherit}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}dfn{font-style:italic}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;text-decoration:none;background-color:transparent;-webkit-text-decoration-skip:objects}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:monospace,monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg:not(:root){overflow:hidden}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;font-family:inherit;font-weight:500;line-height:1.2;color:inherit}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem;font-weight:300;line-height:1.2}.display-2{font-size:5.5rem;font-weight:300;line-height:1.2}.display-3{font-size:4.5rem;font-weight:300;line-height:1.2}.display-4{font-size:3.5rem;font-weight:300;line-height:1.2}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,.1)}.small,small{font-size:80%;font-weight:400}.mark,mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer::before{content:"\2014 \00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}code{font-size:87.5%;color:#e83e8c;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#212529}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-10,.col-11,.col-12,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-auto,.col-lg,.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-auto,.col-md,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-auto,.col-sm,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-auto{position:relative;width:100%;min-height:1px;padding-right:15px;padding-left:15px}.col{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-ms-flex-order:-1;order:-1}.order-last{-ms-flex-order:13;order:13}.order-0{-ms-flex-order:0;order:0}.order-1{-ms-flex-order:1;order:1}.order-2{-ms-flex-order:2;order:2}.order-3{-ms-flex-order:3;order:3}.order-4{-ms-flex-order:4;order:4}.order-5{-ms-flex-order:5;order:5}.order-6{-ms-flex-order:6;order:6}.order-7{-ms-flex-order:7;order:7}.order-8{-ms-flex-order:8;order:8}.order-9{-ms-flex-order:9;order:9}.order-10{-ms-flex-order:10;order:10}.order-11{-ms-flex-order:11;order:11}.order-12{-ms-flex-order:12;order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-sm-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-ms-flex-order:-1;order:-1}.order-sm-last{-ms-flex-order:13;order:13}.order-sm-0{-ms-flex-order:0;order:0}.order-sm-1{-ms-flex-order:1;order:1}.order-sm-2{-ms-flex-order:2;order:2}.order-sm-3{-ms-flex-order:3;order:3}.order-sm-4{-ms-flex-order:4;order:4}.order-sm-5{-ms-flex-order:5;order:5}.order-sm-6{-ms-flex-order:6;order:6}.order-sm-7{-ms-flex-order:7;order:7}.order-sm-8{-ms-flex-order:8;order:8}.order-sm-9{-ms-flex-order:9;order:9}.order-sm-10{-ms-flex-order:10;order:10}.order-sm-11{-ms-flex-order:11;order:11}.order-sm-12{-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-md-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-ms-flex-order:-1;order:-1}.order-md-last{-ms-flex-order:13;order:13}.order-md-0{-ms-flex-order:0;order:0}.order-md-1{-ms-flex-order:1;order:1}.order-md-2{-ms-flex-order:2;order:2}.order-md-3{-ms-flex-order:3;order:3}.order-md-4{-ms-flex-order:4;order:4}.order-md-5{-ms-flex-order:5;order:5}.order-md-6{-ms-flex-order:6;order:6}.order-md-7{-ms-flex-order:7;order:7}.order-md-8{-ms-flex-order:8;order:8}.order-md-9{-ms-flex-order:9;order:9}.order-md-10{-ms-flex-order:10;order:10}.order-md-11{-ms-flex-order:11;order:11}.order-md-12{-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-lg-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-ms-flex-order:-1;order:-1}.order-lg-last{-ms-flex-order:13;order:13}.order-lg-0{-ms-flex-order:0;order:0}.order-lg-1{-ms-flex-order:1;order:1}.order-lg-2{-ms-flex-order:2;order:2}.order-lg-3{-ms-flex-order:3;order:3}.order-lg-4{-ms-flex-order:4;order:4}.order-lg-5{-ms-flex-order:5;order:5}.order-lg-6{-ms-flex-order:6;order:6}.order-lg-7{-ms-flex-order:7;order:7}.order-lg-8{-ms-flex-order:8;order:8}.order-lg-9{-ms-flex-order:9;order:9}.order-lg-10{-ms-flex-order:10;order:10}.order-lg-11{-ms-flex-order:11;order:11}.order-lg-12{-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-xl-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-ms-flex-order:-1;order:-1}.order-xl-last{-ms-flex-order:13;order:13}.order-xl-0{-ms-flex-order:0;order:0}.order-xl-1{-ms-flex-order:1;order:1}.order-xl-2{-ms-flex-order:2;order:2}.order-xl-3{-ms-flex-order:3;order:3}.order-xl-4{-ms-flex-order:4;order:4}.order-xl-5{-ms-flex-order:5;order:5}.order-xl-6{-ms-flex-order:6;order:6}.order-xl-7{-ms-flex-order:7;order:7}.order-xl-8{-ms-flex-order:8;order:8}.order-xl-9{-ms-flex-order:9;order:9}.order-xl-10{-ms-flex-order:10;order:10}.order-xl-11{-ms-flex-order:11;order:11}.order-xl-12{-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.table{width:100%;max-width:100%;margin-bottom:1rem;background-color:transparent}.table td,.table th{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table .table{background-color:#fff}.table-sm td,.table-sm th{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-borderless tbody+tbody,.table-borderless td,.table-borderless th,.table-borderless thead th{border:0}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-hover .table-primary:hover{background-color:#9fcdff}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-hover .table-secondary:hover{background-color:#c8cbcf}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-hover .table-success:hover{background-color:#b1dfbb}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-hover .table-info:hover{background-color:#abdde5}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-hover .table-warning:hover{background-color:#ffe8a1}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-hover .table-danger:hover{background-color:#f1b0b7}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-hover .table-light:hover{background-color:#ececf6}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-hover .table-dark:hover{background-color:#b9bbbe}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{color:#fff;background-color:#212529;border-color:#32383e}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#212529}.table-dark td,.table-dark th,.table-dark thead th{border-color:#32383e}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,.05)}.table-dark.table-hover tbody tr:hover{background-color:rgba(255,255,255,.075)}@media (max-width:575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-md>.table-bordered{border:0}}@media (max-width:991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.form-control::-webkit-input-placeholder{color:#6c757d;opacity:1}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control:-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:not([size]):not([multiple]){height:calc(2.25rem + 2px)}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm,.input-group-lg>.form-control-plaintext.form-control,.input-group-lg>.input-group-append>.form-control-plaintext.btn,.input-group-lg>.input-group-append>.form-control-plaintext.input-group-text,.input-group-lg>.input-group-prepend>.form-control-plaintext.btn,.input-group-lg>.input-group-prepend>.form-control-plaintext.input-group-text,.input-group-sm>.form-control-plaintext.form-control,.input-group-sm>.input-group-append>.form-control-plaintext.btn,.input-group-sm>.input-group-append>.form-control-plaintext.input-group-text,.input-group-sm>.input-group-prepend>.form-control-plaintext.btn,.input-group-sm>.input-group-prepend>.form-control-plaintext.input-group-text{padding-right:0;padding-left:0}.form-control-sm,.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group-sm>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-sm>select.form-control:not([size]):not([multiple]),select.form-control-sm:not([size]):not([multiple]){height:calc(1.8125rem + 2px)}.form-control-lg,.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-lg>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-lg>select.form-control:not([size]):not([multiple]),select.form-control-lg:not([size]):not([multiple]){height:calc(2.875rem + 2px)}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:-ms-inline-flexbox;display:inline-flex;-ms-flex-align:center;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(40,167,69,.8);border-radius:.2rem}.custom-select.is-valid,.form-control.is-valid,.was-validated .custom-select:valid,.was-validated .form-control:valid{border-color:#28a745}.custom-select.is-valid:focus,.form-control.is-valid:focus,.was-validated .custom-select:valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip,.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip,.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip{display:block}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label::before,.was-validated .custom-control-input:valid~.custom-control-label::before{background-color:#71dd8a}.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip,.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid:checked~.custom-control-label::before,.was-validated .custom-control-input:valid:checked~.custom-control-label::before{background-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label::before,.was-validated .custom-control-input:valid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(40,167,69,.25)}.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid~.custom-file-label::before,.was-validated .custom-file-input:valid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip,.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip{display:block}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(220,53,69,.8);border-radius:.2rem}.custom-select.is-invalid,.form-control.is-invalid,.was-validated .custom-select:invalid,.was-validated .form-control:invalid{border-color:#dc3545}.custom-select.is-invalid:focus,.form-control.is-invalid:focus,.was-validated .custom-select:invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip,.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip,.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip{display:block}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label::before,.was-validated .custom-control-input:invalid~.custom-control-label::before{background-color:#efa2a9}.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip,.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid:checked~.custom-control-label::before,.was-validated .custom-control-input:invalid:checked~.custom-control-label::before{background-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label::before,.was-validated .custom-control-input:invalid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(220,53,69,.25)}.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid~.custom-file-label::before,.was-validated .custom-file-input:invalid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip,.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip{display:block}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{display:-ms-flexbox;display:flex;-ms-flex-flow:row wrap;flex-flow:row wrap;-ms-flex-align:center;align-items:center}.form-inline .form-check{width:100%}@media (min-width:576px){.form-inline label{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:-ms-flexbox;display:flex;-ms-flex:0 0 auto;flex:0 0 auto;-ms-flex-flow:row wrap;flex-flow:row wrap;-ms-flex-align:center;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .custom-select,.form-inline .input-group{width:auto}.form-inline .form-check{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;text-align:center;white-space:nowrap;vertical-align:middle;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:focus,.btn:hover{text-decoration:none}.btn.focus,.btn:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.btn.disabled,.btn:disabled{opacity:.65}.btn:not(:disabled):not(.disabled){cursor:pointer}.btn:not(:disabled):not(.disabled).active,.btn:not(:disabled):not(.disabled):active{background-image:none}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:hover{color:#fff;background-color:#0069d9;border-color:#0062cc}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#0062cc;border-color:#005cbf}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-primary{color:#007bff;background-color:transparent;background-image:none;border-color:#007bff}.btn-outline-primary:hover{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#007bff;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{color:#6c757d;background-color:transparent;background-image:none;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-success{color:#28a745;background-color:transparent;background-image:none;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{color:#17a2b8;background-color:transparent;background-image:none;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{color:#ffc107;background-color:transparent;background-image:none;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{color:#dc3545;background-color:transparent;background-image:none;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{color:#f8f9fa;background-color:transparent;background-image:none;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{color:#343a40;background-color:transparent;background-image:none;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{font-weight:400;color:#007bff;background-color:transparent}.btn-link:hover{color:#0056b3;text-decoration:underline;background-color:transparent;border-color:transparent}.btn-link.focus,.btn-link:focus{text-decoration:underline;border-color:transparent;box-shadow:none}.btn-link.disabled,.btn-link:disabled{color:#6c757d;pointer-events:none}.btn-group-lg>.btn,.btn-lg{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-group-sm>.btn,.btn-sm{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{transition:opacity .15s linear}@media screen and (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{position:relative;height:0;overflow:hidden;transition:height .35s ease}@media screen and (prefers-reduced-motion:reduce){.collapsing{transition:none}}.dropdown,.dropleft,.dropright,.dropup{position:relative}.dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#212529;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem}.dropdown-menu-right{right:0;left:auto}.dropup .dropdown-menu{top:auto;bottom:100%;margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{top:0;right:auto;left:100%;margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{top:0;right:100%;left:auto;margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;width:0;height:0;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-menu[x-placement^=bottom],.dropdown-menu[x-placement^=left],.dropdown-menu[x-placement^=right],.dropdown-menu[x-placement^=top]{right:auto;bottom:auto}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#007bff}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#6c757d;white-space:nowrap}.dropdown-item-text{display:block;padding:.25rem 1.5rem;color:#212529}.btn-group,.btn-group-vertical{position:relative;display:-ms-inline-flexbox;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;-ms-flex:0 1 auto;flex:0 1 auto}.btn-group-vertical>.btn:hover,.btn-group>.btn:hover{z-index:1}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus{z-index:1}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group,.btn-group-vertical .btn+.btn,.btn-group-vertical .btn+.btn-group,.btn-group-vertical .btn-group+.btn,.btn-group-vertical .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-pack:start;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropright .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropleft .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{-ms-flex-direction:column;flex-direction:column;-ms-flex-align:start;align-items:flex-start;-ms-flex-pack:center;justify-content:center}.btn-group-vertical .btn,.btn-group-vertical .btn-group{width:100%}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio],.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:stretch;align-items:stretch;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control{position:relative;-ms-flex:1 1 auto;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.custom-file:focus,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control{margin-left:-1px}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::after{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label,.input-group>.custom-file:not(:first-child) .custom-file-label::after{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-append,.input-group-prepend{display:-ms-flexbox;display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:-ms-inline-flexbox;display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked~.custom-control-label::before{color:#fff;background-color:#007bff}.custom-control-input:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:active~.custom-control-label::before{color:#fff;background-color:#b3d7ff}.custom-control-input:disabled~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label::before{background-color:#e9ecef}.custom-control-label{margin-bottom:0}.custom-control-label::before{position:absolute;top:.25rem;left:0;display:block;width:1rem;height:1rem;pointer-events:none;content:"";-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#dee2e6}.custom-control-label::after{position:absolute;top:.25rem;left:0;display:block;width:1rem;height:1rem;content:"";background-repeat:no-repeat;background-position:center center;background-size:50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-radio .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-select{display:inline-block;width:100%;height:calc(2.25rem + 2px);padding:.375rem 1.75rem .375rem .75rem;line-height:1.5;color:#495057;vertical-align:middle;background:#fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center;background-size:8px 10px;border:1px solid #ced4da;border-radius:.25rem;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-select:focus{border-color:#80bdff;outline:0;box-shadow:inset 0 1px 2px rgba(0,0,0,.075),0 0 5px rgba(128,189,255,.5)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{opacity:0}.custom-select-sm{height:calc(1.8125rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:75%}.custom-select-lg{height:calc(2.875rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:125%}.custom-file{position:relative;display:inline-block;width:100%;height:calc(2.25rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:calc(2.25rem + 2px);margin:0;opacity:0}.custom-file-input:focus~.custom-file-label{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:focus~.custom-file-label::after{border-color:#80bdff}.custom-file-input:lang(en)~.custom-file-label::after{content:"Browse"}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:calc(2.25rem + 2px);padding:.375rem .75rem;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:calc(calc(2.25rem + 2px) - 1px * 2);padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background-color:#e9ecef;border-left:1px solid #ced4da;border-radius:0 .25rem .25rem 0}.custom-range{width:100%;padding-left:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-range:focus{outline:0}.custom-range::-moz-focus-outer{border:0}.custom-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#007bff;border:0;border-radius:1rem;-webkit-appearance:none;appearance:none}.custom-range::-webkit-slider-thumb:focus{outline:0;box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-webkit-slider-thumb:active{background-color:#b3d7ff}.custom-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#007bff;border:0;border-radius:1rem;-moz-appearance:none;appearance:none}.custom-range::-moz-range-thumb:focus{outline:0;box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-moz-range-thumb:active{background-color:#b3d7ff}.custom-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-ms-thumb{width:1rem;height:1rem;background-color:#007bff;border:0;border-radius:1rem;appearance:none}.custom-range::-ms-thumb:focus{outline:0;box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-ms-thumb:active{background-color:#b3d7ff}.custom-range::-ms-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:transparent;border-color:transparent;border-width:.5rem}.custom-range::-ms-fill-lower{background-color:#dee2e6;border-radius:1rem}.custom-range::-ms-fill-upper{margin-right:15px;background-color:#dee2e6;border-radius:1rem}.nav{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#007bff}.nav-fill .nav-item{-ms-flex:1 1 auto;flex:1 1 auto;text-align:center}.nav-justified .nav-item{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{-ms-flex-preferred-size:100%;flex-basis:100%;-ms-flex-positive:1;flex-grow:1;-ms-flex-align:center;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler:not(:disabled):not(.disabled){cursor:pointer}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat center center;background-size:100% 100%}@media (max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:576px){.navbar-expand-sm{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-sm .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}}@media (max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:768px){.navbar-expand-md{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-md .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}}@media (max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:992px){.navbar-expand-lg{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-lg .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:1200px){.navbar-expand-xl{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-xl .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}}.navbar-expand{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-light .navbar-brand{color:rgba(0,0,0,.9)}.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,.9)}.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:rgba(255,255,255,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,.5);border-color:rgba(255,255,255,.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-dark .navbar-text{color:rgba(255,255,255,.5)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{position:relative;display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:calc(.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width:576px){.card-deck{-ms-flex-flow:row wrap;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{display:-ms-flexbox;display:flex;-ms-flex:1 0 0%;flex:1 0 0%;-ms-flex-direction:column;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width:576px){.card-group{-ms-flex-flow:row wrap;flex-flow:row wrap}.card-group>.card{-ms-flex:1 0 0%;flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:first-child .card-header,.card-group>.card:first-child .card-img-top{border-top-right-radius:0}.card-group>.card:first-child .card-footer,.card-group>.card:first-child .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:last-child .card-header,.card-group>.card:last-child .card-img-top{border-top-left-radius:0}.card-group>.card:last-child .card-footer,.card-group>.card:last-child .card-img-bottom{border-bottom-left-radius:0}.card-group>.card:only-child{border-radius:.25rem}.card-group>.card:only-child .card-header,.card-group>.card:only-child .card-img-top{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card-group>.card:only-child .card-footer,.card-group>.card:only-child .card-img-bottom{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-group>.card:not(:first-child):not(:last-child):not(:only-child){border-radius:0}.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-footer,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-header,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-top{border-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:576px){.card-columns{-webkit-column-count:3;-moz-column-count:3;column-count:3;-webkit-column-gap:1.25rem;-moz-column-gap:1.25rem;column-gap:1.25rem;orphans:1;widows:1}.card-columns .card{display:inline-block;width:100%}}.accordion .card:not(:first-of-type):not(:last-of-type){border-bottom:0;border-radius:0}.accordion .card:not(:first-of-type) .card-header:first-child{border-radius:0}.accordion .card:first-of-type{border-bottom:0;border-bottom-right-radius:0;border-bottom-left-radius:0}.accordion .card:last-of-type{border-top-left-radius:0;border-top-right-radius:0}.breadcrumb{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item{padding-left:.5rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:-ms-flexbox;display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#007bff;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{z-index:2;color:#0056b3;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.page-link:not(:disabled):not(.disabled){cursor:pointer}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#007bff;border-color:#007bff}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#007bff}.badge-primary[href]:focus,.badge-primary[href]:hover{color:#fff;text-decoration:none;background-color:#0062cc}.badge-secondary{color:#fff;background-color:#6c757d}.badge-secondary[href]:focus,.badge-secondary[href]:hover{color:#fff;text-decoration:none;background-color:#545b62}.badge-success{color:#fff;background-color:#28a745}.badge-success[href]:focus,.badge-success[href]:hover{color:#fff;text-decoration:none;background-color:#1e7e34}.badge-info{color:#fff;background-color:#17a2b8}.badge-info[href]:focus,.badge-info[href]:hover{color:#fff;text-decoration:none;background-color:#117a8b}.badge-warning{color:#212529;background-color:#ffc107}.badge-warning[href]:focus,.badge-warning[href]:hover{color:#212529;text-decoration:none;background-color:#d39e00}.badge-danger{color:#fff;background-color:#dc3545}.badge-danger[href]:focus,.badge-danger[href]:hover{color:#fff;text-decoration:none;background-color:#bd2130}.badge-light{color:#212529;background-color:#f8f9fa}.badge-light[href]:focus,.badge-light[href]:hover{color:#212529;text-decoration:none;background-color:#dae0e5}.badge-dark{color:#fff;background-color:#343a40}.badge-dark[href]:focus,.badge-dark[href]:hover{color:#fff;text-decoration:none;background-color:#1d2124}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#004085;background-color:#cce5ff;border-color:#b8daff}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@-webkit-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem}.progress-bar{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#007bff;transition:width .6s ease}@media screen and (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}.media{display:-ms-flexbox;display:flex;-ms-flex-align:start;align-items:flex-start}.media-body{-ms-flex:1;flex:1}.list-group{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#212529;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item:focus,.list-group-item:hover{z-index:1;text-decoration:none}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#007bff;border-color:#007bff}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{border-bottom:0}.list-group-item-primary{color:#004085;background-color:#b8daff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#004085;background-color:#9fcdff}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#004085;border-color:#004085}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:focus,.close:hover{color:#000;text-decoration:none;opacity:.75}.close:not(:disabled):not(.disabled){cursor:pointer}button.close{padding:0;background-color:transparent;border:0;-webkit-appearance:none}.modal-open{overflow:hidden}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;outline:0}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:-webkit-transform .3s ease-out;transition:transform .3s ease-out;transition:transform .3s ease-out,-webkit-transform .3s ease-out;-webkit-transform:translate(0,-25%);transform:translate(0,-25%)}@media screen and (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{-webkit-transform:translate(0,0);transform:translate(0,0)}.modal-dialog-centered{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;min-height:calc(100% - (.5rem * 2))}.modal-content{position:relative;display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:-ms-flexbox;display:flex;-ms-flex-align:start;align-items:flex-start;-ms-flex-pack:justify;justify-content:space-between;padding:1rem;border-bottom:1px solid #e9ecef;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem}.modal-footer{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:end;justify-content:flex-end;padding:1rem;border-top:1px solid #e9ecef}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-centered{min-height:calc(100% - (1.75rem * 2))}.modal-sm{max-width:300px}}@media (min-width:992px){.modal-lg{max-width:800px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow::before,.bs-tooltip-top .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=right] .arrow::before,.bs-tooltip-right .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow::before,.bs-tooltip-bottom .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=left] .arrow::before,.bs-tooltip-left .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::after,.popover .arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top] .arrow,.bs-popover-top .arrow{bottom:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::after,.bs-popover-top .arrow::before{border-width:.5rem .5rem 0}.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::before{bottom:0;border-top-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-top .arrow::after{bottom:1px;border-top-color:#fff}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right] .arrow,.bs-popover-right .arrow{left:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::after,.bs-popover-right .arrow::before{border-width:.5rem .5rem .5rem 0}.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::before{left:0;border-right-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-right .arrow::after{left:1px;border-right-color:#fff}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom] .arrow,.bs-popover-bottom .arrow{top:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::after,.bs-popover-bottom .arrow::before{border-width:0 .5rem .5rem .5rem}.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::before{top:0;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-bottom .arrow::after{top:1px;border-bottom-color:#fff}.bs-popover-auto[x-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left] .arrow,.bs-popover-left .arrow{right:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::after,.bs-popover-left .arrow::before{border-width:.5rem 0 .5rem .5rem}.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::before{right:0;border-left-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-left .arrow::after{right:1px;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;color:inherit;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#212529}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-item{position:relative;display:none;-ms-flex-align:center;align-items:center;width:100%;transition:-webkit-transform .6s ease;transition:transform .6s ease;transition:transform .6s ease,-webkit-transform .6s ease;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}@media screen and (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.carousel-item-next,.carousel-item-prev{position:absolute;top:0}.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.active.carousel-item-right,.carousel-item-next{-webkit-transform:translateX(100%);transform:translateX(100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-right,.carousel-item-next{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}}.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translateX(-100%);transform:translateX(-100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}}.carousel-fade .carousel-item{opacity:0;transition-duration:.6s;transition-property:opacity}.carousel-fade .carousel-item-next.carousel-item-left,.carousel-fade .carousel-item-prev.carousel-item-right,.carousel-fade .carousel-item.active{opacity:1}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{opacity:0}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-prev,.carousel-fade .carousel-item-next,.carousel-fade .carousel-item-prev,.carousel-fade .carousel-item.active{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-prev,.carousel-fade .carousel-item-next,.carousel-fade .carousel-item-prev,.carousel-fade .carousel-item.active{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:20px;height:20px;background:transparent no-repeat center center;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E")}.carousel-control-next-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E")}.carousel-indicators{position:absolute;right:0;bottom:10px;left:0;z-index:15;display:-ms-flexbox;display:flex;-ms-flex-pack:center;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{position:relative;-ms-flex:0 1 auto;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;background-color:rgba(255,255,255,.5)}.carousel-indicators li::before{position:absolute;top:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators li::after{position:absolute;bottom:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators .active{background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important;border-top-right-radius:.25rem!important}.rounded-right{border-top-right-radius:.25rem!important;border-bottom-right-radius:.25rem!important}.rounded-bottom{border-bottom-right-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-circle{border-radius:50%!important}.rounded-0{border-radius:0!important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.857143%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}@media (min-width:576px){.flex-sm-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-sm-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-sm-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-sm-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-sm-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-sm-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-sm-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:768px){.flex-md-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-md-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-md-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-md-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-md-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-md-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-md-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-lg-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-lg-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-lg-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-lg-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-lg-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-lg-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-xl-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-xl-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-xl-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-xl-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-xl-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-xl-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports ((position:-webkit-sticky) or (position:sticky)){.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-monospace{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}.text-justify{text-align:justify!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0062cc!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#545b62!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#1e7e34!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#117a8b!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#d39e00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#bd2130!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#dae0e5!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#1d2124!important}.text-body{color:#212529!important}.text-muted{color:#6c757d!important}.text-black-50{color:rgba(0,0,0,.5)!important}.text-white-50{color:rgba(255,255,255,.5)!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,::after,::before{text-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #adb5bd;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px!important}.container{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #dee2e6!important}}
7	/# sourceMappingURL=bootstrap.min.css.map /

resources/js/bootstrap4.bundle.js CHANGED Viewed

@@ -1,6328 +1,6433 @@
             /*!
-            -
              * Bootstrap v4.0.0 (https://getbootstrap.com)
               * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
               * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
               */
             (function (global, factory) {
-            -
            	typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery')) :
-            -
            	typeof define === 'function' && define.amd ? define(['exports', 'jquery'], factory) :
-            -
            	(factory((global.bootstrap = {}),global.jQuery));
             }(this, (function (exports,$) { 'use strict';
-            -
            $ = $ && $.hasOwnProperty('default') ? $['default'] : $;
-            -
            function _defineProperties(target, props) {
-            -
              for (var i = 0; i < props.length; i++) {
-            -
                var descriptor = props[i];
-            -
                descriptor.enumerable = descriptor.enumerable || false;
-            -
                descriptor.configurable = true;
-            -
                if ("value" in descriptor) descriptor.writable = true;
-            -
                Object.defineProperty(target, descriptor.key, descriptor);
+              }
-            -
            }
-            -
            function _createClass(Constructor, protoProps, staticProps) {
-            -
              if (protoProps) _defineProperties(Constructor.prototype, protoProps);
-            -
              if (staticProps) _defineProperties(Constructor, staticProps);
-            -
              return Constructor;
-            -
            }
-            -
            function _extends() {
-            -
              _extends = Object.assign || function (target) {
                 for (var i = 1; i < arguments.length; i++) {
-            -
                  var source = arguments[i];
-            -
                  for (var key in source) {
-            -
                    if (Object.prototype.hasOwnProperty.call(source, key)) {
-            -
                      target[key] = source[key];
-            -
                    }
+                  }
+                }
                 return target;
-            -
              };
-            -
-            -
              return _extends.apply(this, arguments);
-            -
            }
-            -
-            -
            function _inheritsLoose(subClass, superClass) {
-            -
              subClass.prototype = Object.create(superClass.prototype);
-            -
              subClass.prototype.constructor = subClass;
-            -
              subClass.__proto__ = superClass;
-            -
            }
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): util.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Util = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Private TransitionEnd Helpers
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var transition = false;
-            -
              var MAX_UID = 1000000; // Shoutout AngusCroll (https://goo.gl/pxwQGp)
-            -
-            -
              function toType(obj) {
-            -
                return {}.toString.call(obj).match(/\s([a-zA-Z]+)/)[1].toLowerCase();
-            -
              }
-            -
-            -
              function getSpecialTransitionEndEvent() {
-            -
                return {
-            -
                  bindType: transition.end,
-            -
                  delegateType: transition.end,
-            -
                  handle: function handle(event) {
-            -
                    if ($$$1(event.target).is(this)) {
-            -
                      return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params
-            -
                    }
-            -
                    return undefined; // eslint-disable-line no-undefined
-            -
                  }
-            -
                };
-            -
              }
-            -
              function transitionEndTest() {
-            -
                if (typeof window !== 'undefined' && window.QUnit) {
-            -
                  return false;
+                }
-            -
                return {
-            -
                  end: 'transitionend'
-            -
                };
-            -
              }
-            -
              function transitionEndEmulator(duration) {
-            -
                var _this = this;
-            -
                var called = false;
-            -
                $$$1(this).one(Util.TRANSITION_END, function () {
-            -
                  called = true;
-            -
                });
-            -
                setTimeout(function () {
-            -
                  if (!called) {
-            -
                    Util.triggerTransitionEnd(_this);
-            -
                  }
-            -
                }, duration);
-            -
                return this;
-            -
              }
-            -
              function setTransitionEndSupport() {
-            -
                transition = transitionEndTest();
-            -
                $$$1.fn.emulateTransitionEnd = transitionEndEmulator;
-            -
                if (Util.supportsTransitionEnd()) {
                   $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
+                }
-            -
              }
-            -
-            -
              function escapeId(selector) {
-            -
                // We escape IDs in case of special selectors (selector = '#myId:something')
-            -
                // $.escapeSelector does not exist in jQuery < 3
-            -
                selector = typeof $$$1.escapeSelector === 'function' ? $$$1.escapeSelector(selector).substr(1) : selector.replace(/(:|\.|\[|\]|,|=|@)/g, '\\$1');
-            -
                return selector;
-            -
              }
-            -
              /**
-            -
               * --------------------------------------------------------------------------
-            -
               * Public Util Api
-            -
               * --------------------------------------------------------------------------
-            -
               */
-            -
-            -
-            -
              var Util = {
-            -
                TRANSITION_END: 'bsTransitionEnd',
-            -
                getUID: function getUID(prefix) {
-            -
                  do {
-            -
                    // eslint-disable-next-line no-bitwise
-            -
                    prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here
-            -
                  } while (document.getElementById(prefix));
-            -
                  return prefix;
-            -
                },
-            -
                getSelectorFromElement: function getSelectorFromElement(element) {
-            -
                  var selector = element.getAttribute('data-target');
-            -
                  if (!selector || selector === '#') {
-            -
                    selector = element.getAttribute('href') || '';
-            -
                  } // If it's an ID
-            -
                  if (selector.charAt(0) === '#') {
-            -
                    selector = escapeId(selector);
-            -
                  }
-            -
                  try {
-            -
                    var $selector = $$$1(document).find(selector);
-            -
                    return $selector.length > 0 ? selector : null;
-            -
                  } catch (err) {
-            -
                    return null;
-            -
                  }
-            -
                },
-            -
                reflow: function reflow(element) {
-            -
                  return element.offsetHeight;
-            -
                },
-            -
                triggerTransitionEnd: function triggerTransitionEnd(element) {
-            -
                  $$$1(element).trigger(transition.end);
-            -
                },
-            -
                supportsTransitionEnd: function supportsTransitionEnd() {
-            -
                  return Boolean(transition);
-            -
                },
-            -
                isElement: function isElement(obj) {
-            -
                  return (obj[0] || obj).nodeType;
-            -
                },
-            -
                typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
-            -
                  for (var property in configTypes) {
-            -
                    if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
-            -
                      var expectedTypes = configTypes[property];
-            -
                      var value = config[property];
-            -
                      var valueType = value && Util.isElement(value) ? 'element' : toType(value);
-            -
-            -
                      if (!new RegExp(expectedTypes).test(valueType)) {
-            -
                        throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\"."));
+                      }
+                    }
+                  }
-            -
                }
-            -
              };
-            -
              setTransitionEndSupport();
-            -
              return Util;
-            -
            }($);
-            -
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): alert.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
-            -
            var Alert = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'alert';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.alert';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 150;
-            -
              var Selector = {
-            -
                DISMISS: '[data-dismiss="alert"]'
-            -
              };
-            -
              var Event = {
-            -
                CLOSE: "close" + EVENT_KEY,
-            -
                CLOSED: "closed" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                ALERT: 'alert',
-            -
                FADE: 'fade',
-            -
                SHOW: 'show'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
              var Alert =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Alert(element) {
-            -
                  this._element = element;
-            -
                } // Getters
-            -
                var _proto = Alert.prototype;
-            -
                // Public
-            -
                _proto.close = function close(element) {
-            -
                  element = element || this._element;
-            -
                  var rootElement = this._getRootElement(element);
-            -
                  var customEvent = this._triggerCloseEvent(rootElement);
-            -
                  if (customEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  this._removeElement(rootElement);
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._element = null;
-            -
                }; // Private
-            -
                _proto._getRootElement = function _getRootElement(element) {
-            -
                  var selector = Util.getSelectorFromElement(element);
-            -
                  var parent = false;
-            -
                  if (selector) {
-            -
                    parent = $$$1(selector)[0];
-            -
                  }
-            -
                  if (!parent) {
-            -
                    parent = $$$1(element).closest("." + ClassName.ALERT)[0];
-            -
                  }
-            -
                  return parent;
-            -
                };
-            -
                _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
-            -
                  var closeEvent = $$$1.Event(Event.CLOSE);
-            -
                  $$$1(element).trigger(closeEvent);
-            -
                  return closeEvent;
-            -
                };
-            -
                _proto._removeElement = function _removeElement(element) {
-            -
                  var _this = this;
-            -
                  $$$1(element).removeClass(ClassName.SHOW);
-            -
                  if (!Util.supportsTransitionEnd() || !$$$1(element).hasClass(ClassName.FADE)) {
-            -
                    this._destroyElement(element);
-            -
                    return;
-            -
                  }
-            -
                  $$$1(element).one(Util.TRANSITION_END, function (event) {
-            -
                    return _this._destroyElement(element, event);
-            -
                  }).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                };
-            -
                _proto._destroyElement = function _destroyElement(element) {
-            -
                  $$$1(element).detach().trigger(Event.CLOSED).remove();
-            -
                }; // Static
-            -
                Alert._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var $element = $$$1(this);
-            -
                    var data = $element.data(DATA_KEY);
-            -
                    if (!data) {
-            -
                      data = new Alert(this);
-            -
                      $element.data(DATA_KEY, data);
-            -
                    }
-            -
                    if (config === 'close') {
-            -
                      data[config](this);
-            -
                    }
-            -
                  });
-            -
                };
-            -
                Alert._handleDismiss = function _handleDismiss(alertInstance) {
-            -
                  return function (event) {
-            -
                    if (event) {
-            -
                      event.preventDefault();
-            -
                    }
-            -
                    alertInstance.close(this);
                   };
-            -
                };
-            -
                _createClass(Alert, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }]);
-            -
                return Alert;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert()));
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Alert._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Alert;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Alert._jQueryInterface;
-            -
              };
-            -
              return Alert;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): button.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Button = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'button';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.button';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var ClassName = {
-            -
                ACTIVE: 'active',
-            -
                BUTTON: 'btn',
-            -
                FOCUS: 'focus'
-            -
              };
-            -
              var Selector = {
-            -
                DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
-            -
                DATA_TOGGLE: '[data-toggle="buttons"]',
-            -
                INPUT: 'input',
-            -
                ACTIVE: '.active',
-            -
                BUTTON: '.btn'
-            -
              };
-            -
              var Event = {
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
-            -
                FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY)
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
              var Button =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Button(element) {
-            -
                  this._element = element;
-            -
                } // Getters
-            -
                var _proto = Button.prototype;
-            -
                // Public
-            -
                _proto.toggle = function toggle() {
-            -
                  var triggerChangeEvent = true;
-            -
                  var addAriaPressed = true;
-            -
                  var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
-            -
                  if (rootElement) {
-            -
                    var input = $$$1(this._element).find(Selector.INPUT)[0];
-            -
                    if (input) {
-            -
                      if (input.type === 'radio') {
-            -
                        if (input.checked && $$$1(this._element).hasClass(ClassName.ACTIVE)) {
-            -
                          triggerChangeEvent = false;
-            -
                        } else {
-            -
                          var activeElement = $$$1(rootElement).find(Selector.ACTIVE)[0];
-            -
                          if (activeElement) {
-            -
                            $$$1(activeElement).removeClass(ClassName.ACTIVE);
+                          }
+                        }
-            -
                      }
-            -
                      if (triggerChangeEvent) {
-            -
                        if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) {
-            -
                          return;
+                        }
-            -
                        input.checked = !$$$1(this._element).hasClass(ClassName.ACTIVE);
-            -
                        $$$1(input).trigger('change');
+                      }
-            -
                      input.focus();
-            -
                      addAriaPressed = false;
+                    }
-            -
                  }
-            -
                  if (addAriaPressed) {
-            -
                    this._element.setAttribute('aria-pressed', !$$$1(this._element).hasClass(ClassName.ACTIVE));
-            -
                  }
-            -
                  if (triggerChangeEvent) {
-            -
                    $$$1(this._element).toggleClass(ClassName.ACTIVE);
-            -
                  }
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._element = null;
-            -
                }; // Static
-            -
                Button._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    if (!data) {
-            -
                      data = new Button(this);
-            -
                      $$$1(this).data(DATA_KEY, data);
-            -
                    }
-            -
                    if (config === 'toggle') {
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
-            -
                _createClass(Button, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }]);
-            -
                return Button;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
-            -
                event.preventDefault();
-            -
                var button = event.target;
-            -
                if (!$$$1(button).hasClass(ClassName.BUTTON)) {
-            -
                  button = $$$1(button).closest(Selector.BUTTON);
-            -
                }
-            -
                Button._jQueryInterface.call($$$1(button), 'toggle');
-            -
              }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
-            -
                var button = $$$1(event.target).closest(Selector.BUTTON)[0];
-            -
                $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type));
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Button._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Button;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Button._jQueryInterface;
-            -
              };
-            -
              return Button;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): carousel.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Carousel = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'carousel';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.carousel';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 600;
-            -
              var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key
-            -
-            -
              var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key
-            -
-            -
              var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
-            -
-            -
              var Default = {
-            -
                interval: 5000,
-            -
                keyboard: true,
-            -
                slide: false,
-            -
                pause: 'hover',
-            -
                wrap: true
-            -
              };
-            -
              var DefaultType = {
-            -
                interval: '(number|boolean)',
-            -
                keyboard: 'boolean',
-            -
                slide: '(boolean|string)',
-            -
                pause: '(string|boolean)',
-            -
                wrap: 'boolean'
-            -
              };
-            -
              var Direction = {
-            -
                NEXT: 'next',
-            -
                PREV: 'prev',
-            -
                LEFT: 'left',
-            -
                RIGHT: 'right'
-            -
              };
-            -
              var Event = {
-            -
                SLIDE: "slide" + EVENT_KEY,
-            -
                SLID: "slid" + EVENT_KEY,
-            -
                KEYDOWN: "keydown" + EVENT_KEY,
-            -
                MOUSEENTER: "mouseenter" + EVENT_KEY,
-            -
                MOUSELEAVE: "mouseleave" + EVENT_KEY,
-            -
                TOUCHEND: "touchend" + EVENT_KEY,
-            -
                LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                CAROUSEL: 'carousel',
-            -
                ACTIVE: 'active',
-            -
                SLIDE: 'slide',
-            -
                RIGHT: 'carousel-item-right',
-            -
                LEFT: 'carousel-item-left',
-            -
                NEXT: 'carousel-item-next',
-            -
                PREV: 'carousel-item-prev',
-            -
                ITEM: 'carousel-item'
-            -
              };
-            -
              var Selector = {
-            -
                ACTIVE: '.active',
-            -
                ACTIVE_ITEM: '.active.carousel-item',
-            -
                ITEM: '.carousel-item',
-            -
                NEXT_PREV: '.carousel-item-next, .carousel-item-prev',
-            -
                INDICATORS: '.carousel-indicators',
-            -
                DATA_SLIDE: '[data-slide], [data-slide-to]',
-            -
                DATA_RIDE: '[data-ride="carousel"]'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
-            -
              };
-            -
-            -
              var Carousel =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Carousel(element, config) {
-            -
                  this._items = null;
-            -
                  this._interval = null;
-            -
                  this._activeElement = null;
-            -
                  this._isPaused = false;
-            -
                  this._isSliding = false;
-            -
                  this.touchTimeout = null;
-            -
                  this._config = this._getConfig(config);
-            -
                  this._element = $$$1(element)[0];
-            -
                  this._indicatorsElement = $$$1(this._element).find(Selector.INDICATORS)[0];
-            -
-            -
                  this._addEventListeners();
-            -
                } // Getters
-            -
-            -
-            -
                var _proto = Carousel.prototype;
-            -
-            -
                // Public
-            -
                _proto.next = function next() {
-            -
                  if (!this._isSliding) {
-            -
                    this._slide(Direction.NEXT);
-            -
                  }
                 };
-            -
-            -
                _proto.nextWhenVisible = function nextWhenVisible() {
-            -
                  // Don't call next when the page isn't visible
-            -
                  // or the carousel or its parent isn't visible
-            -
                  if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') {
-            -
                    this.next();
-            -
                  }
                 };
-            -
-            -
                _proto.prev = function prev() {
-            -
                  if (!this._isSliding) {
-            -
                    this._slide(Direction.PREV);
-            -
                  }
                 };
-            -
                _proto.pause = function pause(event) {
-            -
                  if (!event) {
-            -
                    this._isPaused = true;
-            -
                  }
-            -
-            -
                  if ($$$1(this._element).find(Selector.NEXT_PREV)[0] && Util.supportsTransitionEnd()) {
-            -
                    Util.triggerTransitionEnd(this._element);
-            -
                    this.cycle(true);
-            -
                  }
-            -
-            -
                  clearInterval(this._interval);
-            -
                  this._interval = null;
                 };
-            -
                _proto.cycle = function cycle(event) {
-            -
                  if (!event) {
                     this._isPaused = false;
-            -
                  }
-            -
                  if (this._interval) {
-            -
                    clearInterval(this._interval);
-            -
                    this._interval = null;
-            -
                  }
-            -
                  if (this._config.interval && !this._isPaused) {
-            -
                    this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
-            -
                  }
-            -
                };
-            -
                _proto.to = function to(index) {
-            -
                  var _this = this;
-            -
                  this._activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
-            -
                  var activeIndex = this._getItemIndex(this._activeElement);
-            -
                  if (index > this._items.length - 1 || index < 0) {
-            -
                    return;
-            -
                  }
-            -
                  if (this._isSliding) {
-            -
                    $$$1(this._element).one(Event.SLID, function () {
-            -
                      return _this.to(index);
-            -
                    });
-            -
                    return;
-            -
                  }
-            -
                  if (activeIndex === index) {
-            -
                    this.pause();
-            -
                    this.cycle();
-            -
                    return;
-            -
                  }
-            -
                  var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;
-            -
                  this._slide(direction, this._items[index]);
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1(this._element).off(EVENT_KEY);
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._items = null;
-            -
                  this._config = null;
-            -
                  this._element = null;
-            -
                  this._interval = null;
-            -
                  this._isPaused = null;
-            -
                  this._isSliding = null;
-            -
                  this._activeElement = null;
-            -
                  this._indicatorsElement = null;
-            -
                }; // Private
-            -
-            -
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, Default, config);
-            -
                  Util.typeCheckConfig(NAME, config, DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._addEventListeners = function _addEventListeners() {
-            -
                  var _this2 = this;
-            -
                  if (this._config.keyboard) {
-            -
                    $$$1(this._element).on(Event.KEYDOWN, function (event) {
-            -
                      return _this2._keydown(event);
-            -
                    });
-            -
                  }
-            -
                  if (this._config.pause === 'hover') {
-            -
                    $$$1(this._element).on(Event.MOUSEENTER, function (event) {
-            -
                      return _this2.pause(event);
-            -
                    }).on(Event.MOUSELEAVE, function (event) {
-            -
                      return _this2.cycle(event);
-            -
                    });
-            -
                    if ('ontouchstart' in document.documentElement) {
-            -
                      // If it's a touch-enabled device, mouseenter/leave are fired as
-            -
                      // part of the mouse compatibility events on first tap - the carousel
-            -
                      // would stop cycling until user tapped out of it;
-            -
                      // here, we listen for touchend, explicitly pause the carousel
-            -
                      // (as if it's the second time we tap on it, mouseenter compat event
-            -
                      // is NOT fired) and after a timeout (to allow for mouse compatibility
-            -
                      // events to fire) we explicitly restart cycling
-            -
                      $$$1(this._element).on(Event.TOUCHEND, function () {
-            -
                        _this2.pause();
-            -
-            -
                        if (_this2.touchTimeout) {
-            -
                          clearTimeout(_this2.touchTimeout);
-            -
                        }
-            -
                        _this2.touchTimeout = setTimeout(function (event) {
-            -
                          return _this2.cycle(event);
-            -
                        }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval);
-            -
                      });
+                    }
-            -
                  }
-            -
                };
-            -
                _proto._keydown = function _keydown(event) {
-            -
                  if (/input|textarea/i.test(event.target.tagName)) {
-            -
                    return;
-            -
                  }
-            -
                  switch (event.which) {
-            -
                    case ARROW_LEFT_KEYCODE:
-            -
                      event.preventDefault();
-            -
                      this.prev();
-            -
                      break;
-            -
                    case ARROW_RIGHT_KEYCODE:
-            -
                      event.preventDefault();
-            -
                      this.next();
-            -
                      break;
-            -
                    default:
-            -
                  }
-            -
                };
-            -
                _proto._getItemIndex = function _getItemIndex(element) {
-            -
                  this._items = $$$1.makeArray($$$1(element).parent().find(Selector.ITEM));
-            -
                  return this._items.indexOf(element);
-            -
                };
-            -
                _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
-            -
                  var isNextDirection = direction === Direction.NEXT;
-            -
                  var isPrevDirection = direction === Direction.PREV;
-            -
                  var activeIndex = this._getItemIndex(activeElement);
-            -
                  var lastItemIndex = this._items.length - 1;
-            -
                  var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex;
-            -
                  if (isGoingToWrap && !this._config.wrap) {
-            -
                    return activeElement;
-            -
                  }
-            -
                  var delta = direction === Direction.PREV ? -1 : 1;
-            -
                  var itemIndex = (activeIndex + delta) % this._items.length;
-            -
                  return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
-            -
                };
-            -
                _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
-            -
                  var targetIndex = this._getItemIndex(relatedTarget);
-            -
                  var fromIndex = this._getItemIndex($$$1(this._element).find(Selector.ACTIVE_ITEM)[0]);
-            -
                  var slideEvent = $$$1.Event(Event.SLIDE, {
-            -
                    relatedTarget: relatedTarget,
-            -
                    direction: eventDirectionName,
-            -
                    from: fromIndex,
-            -
                    to: targetIndex
-            -
                  });
-            -
                  $$$1(this._element).trigger(slideEvent);
-            -
                  return slideEvent;
-            -
                };
-            -
                _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
-            -
                  if (this._indicatorsElement) {
-            -
                    $$$1(this._indicatorsElement).find(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
-            -
                    var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
-            -
                    if (nextIndicator) {
-            -
                      $$$1(nextIndicator).addClass(ClassName.ACTIVE);
+                    }
-            -
                  }
-            -
                };
-            -
                _proto._slide = function _slide(direction, element) {
-            -
                  var _this3 = this;
-            -
                  var activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
-            -
                  var activeElementIndex = this._getItemIndex(activeElement);
-            -
                  var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement);
-            -
                  var nextElementIndex = this._getItemIndex(nextElement);
-            -
                  var isCycling = Boolean(this._interval);
-            -
                  var directionalClassName;
-            -
                  var orderClassName;
-            -
                  var eventDirectionName;
-            -
                  if (direction === Direction.NEXT) {
-            -
                    directionalClassName = ClassName.LEFT;
-            -
                    orderClassName = ClassName.NEXT;
-            -
                    eventDirectionName = Direction.LEFT;
-            -
                  } else {
-            -
                    directionalClassName = ClassName.RIGHT;
-            -
                    orderClassName = ClassName.PREV;
-            -
                    eventDirectionName = Direction.RIGHT;
-            -
                  }
-            -
                  if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) {
-            -
                    this._isSliding = false;
-            -
                    return;
-            -
                  }
-            -
                  var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);
-            -
                  if (slideEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  if (!activeElement || !nextElement) {
-            -
                    // Some weirdness is happening, so we bail
-            -
                    return;
-            -
                  }
-            -
                  this._isSliding = true;
-            -
                  if (isCycling) {
-            -
                    this.pause();
-            -
                  }
-            -
                  this._setActiveIndicatorElement(nextElement);
-            -
                  var slidEvent = $$$1.Event(Event.SLID, {
-            -
                    relatedTarget: nextElement,
-            -
                    direction: eventDirectionName,
-            -
                    from: activeElementIndex,
-            -
                    to: nextElementIndex
-            -
                  });
-            -
                  if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.SLIDE)) {
-            -
                    $$$1(nextElement).addClass(orderClassName);
-            -
                    Util.reflow(nextElement);
-            -
                    $$$1(activeElement).addClass(directionalClassName);
-            -
                    $$$1(nextElement).addClass(directionalClassName);
-            -
                    $$$1(activeElement).one(Util.TRANSITION_END, function () {
-            -
                      $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE);
-            -
                      $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName);
-            -
                      _this3._isSliding = false;
-            -
                      setTimeout(function () {
-            -
                        return $$$1(_this3._element).trigger(slidEvent);
-            -
                      }, 0);
-            -
                    }).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  } else {
-            -
                    $$$1(activeElement).removeClass(ClassName.ACTIVE);
-            -
                    $$$1(nextElement).addClass(ClassName.ACTIVE);
-            -
                    this._isSliding = false;
-            -
                    $$$1(this._element).trigger(slidEvent);
-            -
                  }
-            -
                  if (isCycling) {
-            -
                    this.cycle();
-            -
                  }
-            -
                }; // Static
-            -
                Carousel._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    var _config = _extends({}, Default, $$$1(this).data());
-            -
                    if (typeof config === 'object') {
-            -
                      _config = _extends({}, _config, config);
+                    }
-            -
                    var action = typeof config === 'string' ? config : _config.slide;
-            -
                    if (!data) {
-            -
                      data = new Carousel(this, _config);
-            -
                      $$$1(this).data(DATA_KEY, data);
+                    }
-            -
                    if (typeof config === 'number') {
-            -
                      data.to(config);
-            -
                    } else if (typeof action === 'string') {
-            -
                      if (typeof data[action] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + action + "\"");
+                      }
-            -
                      data[action]();
-            -
                    } else if (_config.interval) {
-            -
                      data.pause();
-            -
                      data.cycle();
+                    }
-            -
                  });
-            -
                };
-            -
                Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
-            -
                  var selector = Util.getSelectorFromElement(this);
-            -
                  if (!selector) {
-            -
                    return;
-            -
                  }
-            -
                  var target = $$$1(selector)[0];
-            -
                  if (!target || !$$$1(target).hasClass(ClassName.CAROUSEL)) {
-            -
                    return;
-            -
                  }
-            -
                  var config = _extends({}, $$$1(target).data(), $$$1(this).data());
-            -
                  var slideIndex = this.getAttribute('data-slide-to');
-            -
                  if (slideIndex) {
-            -
                    config.interval = false;
-            -
                  }
-            -
                  Carousel._jQueryInterface.call($$$1(target), config);
-            -
                  if (slideIndex) {
-            -
                    $$$1(target).data(DATA_KEY).to(slideIndex);
-            -
                  }
-            -
                  event.preventDefault();
-            -
                };
-            -
                _createClass(Carousel, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }]);
-            -
                return Carousel;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
-            -
              $$$1(window).on(Event.LOAD_DATA_API, function () {
-            -
                $$$1(Selector.DATA_RIDE).each(function () {
-            -
                  var $carousel = $$$1(this);
-            -
                  Carousel._jQueryInterface.call($carousel, $carousel.data());
                 });
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
-            -
              $$$1.fn[NAME] = Carousel._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Carousel;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Carousel._jQueryInterface;
-            -
              };
-            -
              return Carousel;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): collapse.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Collapse = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'collapse';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.collapse';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 600;
-            -
              var Default = {
-            -
                toggle: true,
-            -
                parent: ''
-            -
              };
-            -
              var DefaultType = {
-            -
                toggle: 'boolean',
-            -
                parent: '(string|element)'
-            -
              };
-            -
              var Event = {
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                SHOW: 'show',
-            -
                COLLAPSE: 'collapse',
-            -
                COLLAPSING: 'collapsing',
-            -
                COLLAPSED: 'collapsed'
-            -
              };
-            -
              var Dimension = {
-            -
                WIDTH: 'width',
-            -
                HEIGHT: 'height'
-            -
              };
-            -
              var Selector = {
-            -
                ACTIVES: '.show, .collapsing',
-            -
                DATA_TOGGLE: '[data-toggle="collapse"]'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
              var Collapse =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Collapse(element, config) {
-            -
                  this._isTransitioning = false;
-            -
                  this._element = element;
-            -
                  this._config = this._getConfig(config);
-            -
                  this._triggerArray = $$$1.makeArray($$$1("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
-            -
                  var tabToggles = $$$1(Selector.DATA_TOGGLE);
-            -
                  for (var i = 0; i < tabToggles.length; i++) {
-            -
                    var elem = tabToggles[i];
-            -
                    var selector = Util.getSelectorFromElement(elem);
-            -
                    if (selector !== null && $$$1(selector).filter(element).length > 0) {
-            -
                      this._selector = selector;
-            -
                      this._triggerArray.push(elem);
+                    }
-            -
                  }
-            -
                  this._parent = this._config.parent ? this._getParent() : null;
-            -
                  if (!this._config.parent) {
-            -
                    this._addAriaAndCollapsedClass(this._element, this._triggerArray);
-            -
                  }
-            -
                  if (this._config.toggle) {
-            -
                    this.toggle();
-            -
                  }
-            -
                } // Getters
-            -
                var _proto = Collapse.prototype;
-            -
                // Public
-            -
                _proto.toggle = function toggle() {
-            -
                  if ($$$1(this._element).hasClass(ClassName.SHOW)) {
-            -
                    this.hide();
-            -
                  } else {
-            -
                    this.show();
-            -
                  }
-            -
                };
-            -
                _proto.show = function show() {
-            -
                  var _this = this;
-            -
                  if (this._isTransitioning || $$$1(this._element).hasClass(ClassName.SHOW)) {
-            -
                    return;
-            -
                  }
-            -
                  var actives;
-            -
                  var activesData;
-            -
                  if (this._parent) {
-            -
                    actives = $$$1.makeArray($$$1(this._parent).find(Selector.ACTIVES).filter("[data-parent=\"" + this._config.parent + "\"]"));
-            -
                    if (actives.length === 0) {
-            -
                      actives = null;
+                    }
-            -
                  }
-            -
                  if (actives) {
-            -
                    activesData = $$$1(actives).not(this._selector).data(DATA_KEY);
-            -
                    if (activesData && activesData._isTransitioning) {
-            -
                      return;
+                    }
-            -
                  }
-            -
                  var startEvent = $$$1.Event(Event.SHOW);
-            -
                  $$$1(this._element).trigger(startEvent);
-            -
                  if (startEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  if (actives) {
-            -
                    Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide');
-            -
                    if (!activesData) {
-            -
                      $$$1(actives).data(DATA_KEY, null);
+                    }
-            -
                  }
-            -
                  var dimension = this._getDimension();
-            -
                  $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
-            -
                  this._element.style[dimension] = 0;
-            -
                  if (this._triggerArray.length > 0) {
-            -
                    $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
-            -
                  }
-            -
-            -
                  this.setTransitioning(true);
-            -
                  var complete = function complete() {
-            -
                    $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW);
-            -
                    _this._element.style[dimension] = '';
-            -
                    _this.setTransitioning(false);
-            -
                    $$$1(_this._element).trigger(Event.SHOWN);
-            -
                  };
-            -
                  if (!Util.supportsTransitionEnd()) {
-            -
                    complete();
-            -
                    return;
-            -
                  }
-            -
                  var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
-            -
                  var scrollSize = "scroll" + capitalizedDimension;
-            -
                  $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  this._element.style[dimension] = this._element[scrollSize] + "px";
-            -
                };
-            -
                _proto.hide = function hide() {
-            -
                  var _this2 = this;
-            -
                  if (this._isTransitioning || !$$$1(this._element).hasClass(ClassName.SHOW)) {
-            -
                    return;
-            -
                  }
-            -
                  var startEvent = $$$1.Event(Event.HIDE);
-            -
                  $$$1(this._element).trigger(startEvent);
-            -
                  if (startEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  var dimension = this._getDimension();
-            -
                  this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
-            -
                  Util.reflow(this._element);
-            -
                  $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
-            -
                  if (this._triggerArray.length > 0) {
-            -
                    for (var i = 0; i < this._triggerArray.length; i++) {
-            -
                      var trigger = this._triggerArray[i];
-            -
                      var selector = Util.getSelectorFromElement(trigger);
-            -
                      if (selector !== null) {
-            -
                        var $elem = $$$1(selector);
-            -
                        if (!$elem.hasClass(ClassName.SHOW)) {
-            -
                          $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
+                        }
+                      }
+                    }
-            -
                  }
-            -
-            -
                  this.setTransitioning(true);
-            -
                  var complete = function complete() {
-            -
                    _this2.setTransitioning(false);
-            -
-            -
                    $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN);
-            -
                  };
-            -
                  this._element.style[dimension] = '';
-            -
                  if (!Util.supportsTransitionEnd()) {
-            -
                    complete();
-            -
                    return;
-            -
                  }
-            -
                  $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                };
-            -
                _proto.setTransitioning = function setTransitioning(isTransitioning) {
-            -
                  this._isTransitioning = isTransitioning;
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._config = null;
-            -
                  this._parent = null;
-            -
                  this._element = null;
-            -
                  this._triggerArray = null;
-            -
                  this._isTransitioning = null;
-            -
                }; // Private
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, Default, config);
-            -
                  config.toggle = Boolean(config.toggle); // Coerce string values
-            -
                  Util.typeCheckConfig(NAME, config, DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._getDimension = function _getDimension() {
-            -
                  var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH);
-            -
                  return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
-            -
                };
-            -
                _proto._getParent = function _getParent() {
-            -
                  var _this3 = this;
-            -
                  var parent = null;
-            -
                  if (Util.isElement(this._config.parent)) {
-            -
                    parent = this._config.parent; // It's a jQuery object
-            -
                    if (typeof this._config.parent.jquery !== 'undefined') {
-            -
                      parent = this._config.parent[0];
+                    }
-            -
                  } else {
-            -
                    parent = $$$1(this._config.parent)[0];
-            -
                  }
-            -
                  var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
-            -
                  $$$1(parent).find(selector).each(function (i, element) {
-            -
                    _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
-            -
                  });
-            -
                  return parent;
-            -
                };
-            -
                _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
-            -
                  if (element) {
-            -
                    var isOpen = $$$1(element).hasClass(ClassName.SHOW);
-            -
                    if (triggerArray.length > 0) {
-            -
                      $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
+                    }
-            -
                  }
-            -
                }; // Static
-            -
                Collapse._getTargetFromElement = function _getTargetFromElement(element) {
-            -
                  var selector = Util.getSelectorFromElement(element);
-            -
                  return selector ? $$$1(selector)[0] : null;
-            -
                };
-            -
                Collapse._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var $this = $$$1(this);
-            -
                    var data = $this.data(DATA_KEY);
-            -
                    var _config = _extends({}, Default, $this.data(), typeof config === 'object' && config);
-            -
                    if (!data && _config.toggle && /show|hide/.test(config)) {
-            -
                      _config.toggle = false;
-            -
                    }
-            -
                    if (!data) {
-            -
                      data = new Collapse(this, _config);
-            -
                      $this.data(DATA_KEY, data);
-            -
                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
+                      }
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
                _createClass(Collapse, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }]);
-            -
                return Collapse;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
-            -
                // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
-            -
                if (event.currentTarget.tagName === 'A') {
-            -
                  event.preventDefault();
-            -
                }
-            -
                var $trigger = $$$1(this);
-            -
                var selector = Util.getSelectorFromElement(this);
-            -
                $$$1(selector).each(function () {
-            -
                  var $target = $$$1(this);
-            -
                  var data = $target.data(DATA_KEY);
-            -
                  var config = data ? 'toggle' : $trigger.data();
-            -
                  Collapse._jQueryInterface.call($target, config);
                 });
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Collapse._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Collapse;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Collapse._jQueryInterface;
-            -
              };
-            -
              return Collapse;
-            -
            }($);
-            -
-            -
            /**!
-            -
             * @fileOverview Kickass library to create and place poppers near their reference elements.
-            -
             * @version 1.12.9
-            -
             * @license
-            -
             * Copyright (c) 2016 Federico Zivolo and contributors
-            -
             *
-            -
             * Permission is hereby granted, free of charge, to any person obtaining a copy
-            -
             * of this software and associated documentation files (the "Software"), to deal
-            -
             * in the Software without restriction, including without limitation the rights
-            -
             * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
-            -
             * copies of the Software, and to permit persons to whom the Software is
-            -
             * furnished to do so, subject to the following conditions:
-            -
             *
-            -
             * The above copyright notice and this permission notice shall be included in all
-            -
             * copies or substantial portions of the Software.
-            -
             *
-            -
             * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
-            -
             * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
-            -
             * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
-            -
             * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
-            -
             * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
-            -
             * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
-            -
             * SOFTWARE.
-            -
             */
-            -
            var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined';
-            -
            var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox'];
-            -
            var timeoutDuration = 0;
-            -
            for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) {
-            -
              if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) {
-            -
                timeoutDuration = 1;
-            -
                break;
-            -
              }
-            -
            }
-            -
            function microtaskDebounce(fn) {
-            -
              var called = false;
-            -
              return function () {
-            -
                if (called) {
-            -
                  return;
+                }
-            -
                called = true;
-            -
                window.Promise.resolve().then(function () {
-            -
                  called = false;
-            -
                  fn();
-            -
                });
-            -
              };
-            -
            }
-            -
            function taskDebounce(fn) {
-            -
              var scheduled = false;
-            -
              return function () {
-            -
                if (!scheduled) {
-            -
                  scheduled = true;
-            -
                  setTimeout(function () {
-            -
                    scheduled = false;
                     fn();
-            -
                  }, timeoutDuration);
-            -
                }
-            -
              };
-            -
            }
-            -
-            -
            var supportsMicroTasks = isBrowser && window.Promise;
-            -
-            -
            /**
-            -
            * Create a debounced version of a method, that's asynchronously deferred
-            -
            * but called in the minimum time possible.
-            -
            *
-            -
            * @method
-            -
            * @memberof Popper.Utils
-            -
            * @argument {Function} fn
-            -
            * @returns {Function}
-            -
            */
-            -
            var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce;
-            -
-            -
            /**
-            -
             * Check if the given variable is a function
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Any} functionToCheck - variable to check
-            -
             * @returns {Boolean} answer to: is a function?
-            -
             */
-            -
            function isFunction(functionToCheck) {
-            -
              var getType = {};
-            -
              return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]';
-            -
            }
-            -
-            -
            /**
-            -
             * Get CSS computed property of the given element
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Eement} element
-            -
             * @argument {String} property
-            -
             */
-            -
            function getStyleComputedProperty(element, property) {
-            -
              if (element.nodeType !== 1) {
-            -
                return [];
-            -
              }
-            -
              // NOTE: 1 DOM access here
-            -
              var css = getComputedStyle(element, null);
-            -
              return property ? css[property] : css;
-            -
            }
-            -
-            -
            /**
-            -
             * Returns the parentNode or the host of the element
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element
-            -
             * @returns {Element} parent
-            -
             */
-            -
            function getParentNode(element) {
-            -
              if (element.nodeName === 'HTML') {
-            -
                return element;
-            -
              }
-            -
              return element.parentNode || element.host;
-            -
            }
-            -
-            -
            /**
-            -
             * Returns the scrolling parent of the given element
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element
-            -
             * @returns {Element} scroll parent
-            -
             */
-            -
            function getScrollParent(element) {
-            -
              // Return body, `getScroll` will take care to get the correct `scrollTop` from it
-            -
              if (!element) {
-            -
                return document.body;
+              }
-            -
              switch (element.nodeName) {
-            -
                case 'HTML':
-            -
                case 'BODY':
-            -
                  return element.ownerDocument.body;
-            -
                case '#document':
-            -
                  return element.body;
+              }
-            -
              // Firefox want us to check `-x` and `-y` variations as well
-            -
              var _getStyleComputedProp = getStyleComputedProperty(element),
-            -
                  overflow = _getStyleComputedProp.overflow,
-            -
                  overflowX = _getStyleComputedProp.overflowX,
-            -
                  overflowY = _getStyleComputedProp.overflowY;
-            -
              if (/(auto|scroll)/.test(overflow + overflowY + overflowX)) {
-            -
                return element;
+              }
-            -
              return getScrollParent(getParentNode(element));
-            -
            }
-            -
-            -
            /**
-            -
             * Returns the offset parent of the given element
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element
-            -
             * @returns {Element} offset parent
-            -
             */
-            -
            function getOffsetParent(element) {
-            -
              // NOTE: 1 DOM access here
-            -
              var offsetParent = element && element.offsetParent;
-            -
              var nodeName = offsetParent && offsetParent.nodeName;
-            -
-            -
              if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') {
-            -
                if (element) {
-            -
                  return element.ownerDocument.documentElement;
+                }
-            -
-            -
                return document.documentElement;
+              }
-            -
              // .offsetParent will return the closest TD or TABLE in case
-            -
              // no offsetParent is present, I hate this job...
-            -
              if (['TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') {
-            -
                return getOffsetParent(offsetParent);
-            -
              }
-            -
-            -
              return offsetParent;
-            -
            }
-            -
-            -
            function isOffsetContainer(element) {
-            -
              var nodeName = element.nodeName;
-            -
-            -
              if (nodeName === 'BODY') {
-            -
                return false;
-            -
              }
-            -
              return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element;
-            -
            }
-            -
-            -
            /**
-            -
             * Finds the root node (document, shadowDOM root) of the given element
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} node
-            -
             * @returns {Element} root node
-            -
             */
-            -
            function getRoot(node) {
-            -
              if (node.parentNode !== null) {
-            -
                return getRoot(node.parentNode);
+              }
-            -
              return node;
-            -
            }
-            -
-            -
            /**
-            -
             * Finds the offset parent common to the two provided nodes
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element1
-            -
             * @argument {Element} element2
-            -
             * @returns {Element} common offset parent
-            -
             */
-            -
            function findCommonOffsetParent(element1, element2) {
-            -
              // This check is needed to avoid errors in case one of the elements isn't defined for any reason
-            -
              if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) {
-            -
                return document.documentElement;
-            -
              }
-            -
              // Here we make sure to give as "start" the element that comes first in the DOM
-            -
              var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING;
-            -
              var start = order ? element1 : element2;
-            -
              var end = order ? element2 : element1;
-            -
              // Get common ancestor container
-            -
              var range = document.createRange();
-            -
              range.setStart(start, 0);
-            -
              range.setEnd(end, 0);
-            -
              var commonAncestorContainer = range.commonAncestorContainer;
-            -
              // Both nodes are inside #document
-            -
              if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) {
-            -
                if (isOffsetContainer(commonAncestorContainer)) {
-            -
                  return commonAncestorContainer;
+                }
-            -
                return getOffsetParent(commonAncestorContainer);
-            -
              }
-            -
-            -
              // one of the nodes is inside shadowDOM, find which one
-            -
              var element1root = getRoot(element1);
-            -
              if (element1root.host) {
-            -
                return findCommonOffsetParent(element1root.host, element2);
-            -
              } else {
-            -
                return findCommonOffsetParent(element1, getRoot(element2).host);
-            -
              }
-            -
            }
-            -
-            -
            /**
-            -
             * Gets the scroll value of the given element in the given side (top and left)
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element
-            -
             * @argument {String} side `top` or `left`
-            -
             * @returns {number} amount of scrolled pixels
-            -
             */
-            -
            function getScroll(element) {
-            -
              var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top';
-            -
-            -
              var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft';
-            -
              var nodeName = element.nodeName;
-            -
-            -
              if (nodeName === 'BODY' || nodeName === 'HTML') {
-            -
                var html = element.ownerDocument.documentElement;
-            -
                var scrollingElement = element.ownerDocument.scrollingElement || html;
-            -
                return scrollingElement[upperSide];
+              }
-            -
              return element[upperSide];
-            -
            }
-            -
-            -
            /*
-            -
             * Sum or subtract the element scroll values (left and top) from a given rect object
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {Object} rect - Rect object you want to change
-            -
             * @param {HTMLElement} element - The element from the function reads the scroll values
-            -
             * @param {Boolean} subtract - set to true if you want to subtract the scroll values
-            -
             * @return {Object} rect - The modifier rect object
-            -
             */
-            -
            function includeScroll(rect, element) {
-            -
              var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
-            -
-            -
              var scrollTop = getScroll(element, 'top');
-            -
              var scrollLeft = getScroll(element, 'left');
-            -
              var modifier = subtract ? -1 : 1;
-            -
              rect.top += scrollTop * modifier;
-            -
              rect.bottom += scrollTop * modifier;
-            -
              rect.left += scrollLeft * modifier;
-            -
              rect.right += scrollLeft * modifier;
-            -
              return rect;
-            -
            }
-            -
-            -
            /*
-            -
             * Helper to detect borders of a given element
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {CSSStyleDeclaration} styles
-            -
             * Result of `getStyleComputedProperty` on the given element
-            -
             * @param {String} axis - `x` or `y`
-            -
             * @return {number} borders - The borders size of the given axis
-            -
             */
-            -
-            -
            function getBordersSize(styles, axis) {
-            -
              var sideA = axis === 'x' ? 'Left' : 'Top';
-            -
              var sideB = sideA === 'Left' ? 'Right' : 'Bottom';
-            -
-            -
              return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10);
-            -
            }
-            -
-            -
            /**
-            -
             * Tells if you are running Internet Explorer 10
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @returns {Boolean} isIE10
-            -
             */
-            -
            var isIE10 = undefined;
-            -
-            -
            var isIE10$1 = function () {
-            -
              if (isIE10 === undefined) {
-            -
                isIE10 = navigator.appVersion.indexOf('MSIE 10') !== -1;
-            -
              }
-            -
              return isIE10;
-            -
            };
-            -
            function getSize(axis, body, html, computedStyle) {
-            -
              return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE10$1() ? html['offset' + axis] + computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')] + computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')] : 0);
-            -
            }
-            -
            function getWindowSizes() {
-            -
              var body = document.body;
-            -
              var html = document.documentElement;
-            -
              var computedStyle = isIE10$1() && getComputedStyle(html);
-            -
              return {
-            -
                height: getSize('Height', body, html, computedStyle),
-            -
                width: getSize('Width', body, html, computedStyle)
               };
-            -
            }
-            -
-            -
            var classCallCheck = function (instance, Constructor) {
-            -
              if (!(instance instanceof Constructor)) {
-            -
                throw new TypeError("Cannot call a class as a function");
-            -
              }
-            -
            };
-            -
            var createClass = function () {
-            -
              function defineProperties(target, props) {
-            -
                for (var i = 0; i < props.length; i++) {
-            -
                  var descriptor = props[i];
-            -
                  descriptor.enumerable = descriptor.enumerable || false;
-            -
                  descriptor.configurable = true;
-            -
                  if ("value" in descriptor) descriptor.writable = true;
-            -
                  Object.defineProperty(target, descriptor.key, descriptor);
+                }
-            -
              }
-            -
              return function (Constructor, protoProps, staticProps) {
-            -
                if (protoProps) defineProperties(Constructor.prototype, protoProps);
-            -
                if (staticProps) defineProperties(Constructor, staticProps);
-            -
                return Constructor;
-            -
              };
-            -
            }();
-            -
            var defineProperty = function (obj, key, value) {
-            -
              if (key in obj) {
-            -
                Object.defineProperty(obj, key, {
-            -
                  value: value,
-            -
                  enumerable: true,
-            -
                  configurable: true,
-            -
                  writable: true
-            -
                });
-            -
              } else {
-            -
                obj[key] = value;
+              }
-            -
              return obj;
-            -
            };
-            -
-            -
            var _extends$1 = Object.assign || function (target) {
-            -
              for (var i = 1; i < arguments.length; i++) {
-            -
                var source = arguments[i];
-            -
                for (var key in source) {
-            -
                  if (Object.prototype.hasOwnProperty.call(source, key)) {
-            -
                    target[key] = source[key];
-            -
                  }
+                }
+              }
-            -
              return target;
-            -
            };
-            -
-            -
            /**
-            -
             * Given element offsets, generate an output similar to getBoundingClientRect
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Object} offsets
-            -
             * @returns {Object} ClientRect like output
-            -
             */
-            -
            function getClientRect(offsets) {
-            -
              return _extends$1({}, offsets, {
-            -
                right: offsets.left + offsets.width,
-            -
                bottom: offsets.top + offsets.height
-            -
              });
-            -
            }
-            -
-            -
            /**
-            -
             * Get bounding client rect of given element
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {HTMLElement} element
-            -
             * @return {Object} client rect
-            -
             */
-            -
            function getBoundingClientRect(element) {
-            -
              var rect = {};
-            -
-            -
              // IE10 10 FIX: Please, don't ask, the element isn't
-            -
              // considered in DOM in some circumstances...
-            -
              // This isn't reproducible in IE10 compatibility mode of IE11
-            -
              if (isIE10$1()) {
-            -
                try {
-            -
                  rect = element.getBoundingClientRect();
-            -
                  var scrollTop = getScroll(element, 'top');
-            -
                  var scrollLeft = getScroll(element, 'left');
-            -
                  rect.top += scrollTop;
-            -
                  rect.left += scrollLeft;
-            -
                  rect.bottom += scrollTop;
-            -
                  rect.right += scrollLeft;
-            -
                } catch (err) {}
-            -
              } else {
-            -
                rect = element.getBoundingClientRect();
-            -
              }
-            -
-            -
              var result = {
-            -
                left: rect.left,
-            -
                top: rect.top,
-            -
                width: rect.right - rect.left,
-            -
                height: rect.bottom - rect.top
-            -
              };
-            -
-            -
              // subtract scrollbar size from sizes
-            -
              var sizes = element.nodeName === 'HTML' ? getWindowSizes() : {};
-            -
              var width = sizes.width || element.clientWidth || result.right - result.left;
-            -
              var height = sizes.height || element.clientHeight || result.bottom - result.top;
-            -
-            -
              var horizScrollbar = element.offsetWidth - width;
-            -
              var vertScrollbar = element.offsetHeight - height;
-            -
-            -
              // if an hypothetical scrollbar is detected, we must be sure it's not a `border`
-            -
              // we make this check conditional for performance reasons
-            -
              if (horizScrollbar || vertScrollbar) {
-            -
                var styles = getStyleComputedProperty(element);
-            -
                horizScrollbar -= getBordersSize(styles, 'x');
-            -
                vertScrollbar -= getBordersSize(styles, 'y');
-            -
                result.width -= horizScrollbar;
-            -
                result.height -= vertScrollbar;
+              }
-            -
              return getClientRect(result);
-            -
            }
-            -
-            -
            function getOffsetRectRelativeToArbitraryNode(children, parent) {
-            -
              var isIE10 = isIE10$1();
-            -
              var isHTML = parent.nodeName === 'HTML';
-            -
              var childrenRect = getBoundingClientRect(children);
-            -
              var parentRect = getBoundingClientRect(parent);
-            -
              var scrollParent = getScrollParent(children);
-            -
-            -
              var styles = getStyleComputedProperty(parent);
-            -
              var borderTopWidth = parseFloat(styles.borderTopWidth, 10);
-            -
              var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10);
-            -
-            -
              var offsets = getClientRect({
-            -
                top: childrenRect.top - parentRect.top - borderTopWidth,
-            -
                left: childrenRect.left - parentRect.left - borderLeftWidth,
-            -
                width: childrenRect.width,
-            -
                height: childrenRect.height
-            -
              });
-            -
              offsets.marginTop = 0;
-            -
              offsets.marginLeft = 0;
-            -
-            -
              // Subtract margins of documentElement in case it's being used as parent
-            -
              // we do this only on HTML because it's the only element that behaves
-            -
              // differently when margins are applied to it. The margins are included in
-            -
              // the box of the documentElement, in the other cases not.
-            -
              if (!isIE10 && isHTML) {
-            -
                var marginTop = parseFloat(styles.marginTop, 10);
-            -
                var marginLeft = parseFloat(styles.marginLeft, 10);
-            -
-            -
                offsets.top -= borderTopWidth - marginTop;
-            -
                offsets.bottom -= borderTopWidth - marginTop;
-            -
                offsets.left -= borderLeftWidth - marginLeft;
-            -
                offsets.right -= borderLeftWidth - marginLeft;
-            -
-            -
                // Attach marginTop and marginLeft because in some circumstances we may need them
-            -
                offsets.marginTop = marginTop;
-            -
                offsets.marginLeft = marginLeft;
-            -
              }
-            -
              if (isIE10 ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') {
-            -
                offsets = includeScroll(offsets, parent);
-            -
              }
-            -
              return offsets;
-            -
            }
-            -
            function getViewportOffsetRectRelativeToArtbitraryNode(element) {
-            -
              var html = element.ownerDocument.documentElement;
-            -
              var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html);
-            -
              var width = Math.max(html.clientWidth, window.innerWidth || 0);
-            -
              var height = Math.max(html.clientHeight, window.innerHeight || 0);
-            -
              var scrollTop = getScroll(html);
-            -
              var scrollLeft = getScroll(html, 'left');
-            -
              var offset = {
-            -
                top: scrollTop - relativeOffset.top + relativeOffset.marginTop,
-            -
                left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft,
-            -
                width: width,
-            -
                height: height
-            -
              };
-            -
              return getClientRect(offset);
-            -
            }
-            -
-            -
            /**
-            -
             * Check if the given element is fixed or is inside a fixed parent
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element
-            -
             * @argument {Element} customContainer
-            -
             * @returns {Boolean} answer to "isFixed?"
-            -
             */
-            -
            function isFixed(element) {
-            -
              var nodeName = element.nodeName;
-            -
              if (nodeName === 'BODY' || nodeName === 'HTML') {
-            -
                return false;
-            -
              }
-            -
              if (getStyleComputedProperty(element, 'position') === 'fixed') {
-            -
                return true;
-            -
              }
-            -
              return isFixed(getParentNode(element));
-            -
            }
-            -
-            -
            /**
-            -
             * Computed the boundaries limits and return them
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {HTMLElement} popper
-            -
             * @param {HTMLElement} reference
-            -
             * @param {number} padding
-            -
             * @param {HTMLElement} boundariesElement - Element used to define the boundaries
-            -
             * @returns {Object} Coordinates of the boundaries
-            -
             */
-            -
            function getBoundaries(popper, reference, padding, boundariesElement) {
-            -
              // NOTE: 1 DOM access here
-            -
              var boundaries = { top: 0, left: 0 };
-            -
              var offsetParent = findCommonOffsetParent(popper, reference);
-            -
-            -
              // Handle viewport case
-            -
              if (boundariesElement === 'viewport') {
-            -
                boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent);
-            -
              } else {
-            -
                // Handle other cases based on DOM element used as boundaries
-            -
                var boundariesNode = void 0;
-            -
                if (boundariesElement === 'scrollParent') {
-            -
                  boundariesNode = getScrollParent(getParentNode(reference));
-            -
                  if (boundariesNode.nodeName === 'BODY') {
-            -
                    boundariesNode = popper.ownerDocument.documentElement;
-            -
                  }
-            -
                } else if (boundariesElement === 'window') {
-            -
                  boundariesNode = popper.ownerDocument.documentElement;
                 } else {
-            -
                  boundariesNode = boundariesElement;
+                }
-            -
                var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent);
-            -
                // In case of HTML, we need a different computation
-            -
                if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) {
-            -
                  var _getWindowSizes = getWindowSizes(),
-            -
                      height = _getWindowSizes.height,
-            -
                      width = _getWindowSizes.width;
-            -
                  boundaries.top += offsets.top - offsets.marginTop;
-            -
                  boundaries.bottom = height + offsets.top;
-            -
                  boundaries.left += offsets.left - offsets.marginLeft;
-            -
                  boundaries.right = width + offsets.left;
-            -
                } else {
-            -
                  // for all the other DOM elements, this one is good
-            -
                  boundaries = offsets;
+                }
-            -
              }
-            -
              // Add paddings
-            -
              boundaries.left += padding;
-            -
              boundaries.top += padding;
-            -
              boundaries.right -= padding;
-            -
              boundaries.bottom -= padding;
-            -
-            -
              return boundaries;
-            -
            }
-            -
-            -
            function getArea(_ref) {
-            -
              var width = _ref.width,
-            -
                  height = _ref.height;
-            -
-            -
              return width * height;
-            -
            }
-            -
-            -
            /**
-            -
             * Utility used to transform the `auto` placement to the placement with more
-            -
             * available space.
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Object} data - The data object generated by update method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) {
-            -
              var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0;
-            -
-            -
              if (placement.indexOf('auto') === -1) {
-            -
                return placement;
+              }
-            -
              var boundaries = getBoundaries(popper, reference, padding, boundariesElement);
-            -
              var rects = {
-            -
                top: {
-            -
                  width: boundaries.width,
-            -
                  height: refRect.top - boundaries.top
-            -
                },
-            -
                right: {
-            -
                  width: boundaries.right - refRect.right,
-            -
                  height: boundaries.height
-            -
                },
-            -
                bottom: {
-            -
                  width: boundaries.width,
-            -
                  height: boundaries.bottom - refRect.bottom
-            -
                },
-            -
                left: {
-            -
                  width: refRect.left - boundaries.left,
-            -
                  height: boundaries.height
-            -
                }
-            -
              };
-            -
              var sortedAreas = Object.keys(rects).map(function (key) {
-            -
                return _extends$1({
-            -
                  key: key
-            -
                }, rects[key], {
-            -
                  area: getArea(rects[key])
-            -
                });
-            -
              }).sort(function (a, b) {
-            -
                return b.area - a.area;
-            -
              });
-            -
-            -
              var filteredAreas = sortedAreas.filter(function (_ref2) {
-            -
                var width = _ref2.width,
-            -
                    height = _ref2.height;
-            -
                return width >= popper.clientWidth && height >= popper.clientHeight;
-            -
              });
-            -
-            -
              var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key;
-            -
-            -
              var variation = placement.split('-')[1];
-            -
-            -
              return computedPlacement + (variation ? '-' + variation : '');
-            -
            }
-            -
-            -
            /**
-            -
             * Get offsets to the reference element
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {Object} state
-            -
             * @param {Element} popper - the popper element
-            -
             * @param {Element} reference - the reference element (the popper will be relative to this)
-            -
             * @returns {Object} An object containing the offsets which will be applied to the popper
-            -
             */
-            -
            function getReferenceOffsets(state, popper, reference) {
-            -
              var commonOffsetParent = findCommonOffsetParent(popper, reference);
-            -
              return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent);
-            -
            }
-            -
-            -
            /**
-            -
             * Get the outer sizes of the given element (offset size + margins)
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element
-            -
             * @returns {Object} object containing width and height properties
-            -
             */
-            -
            function getOuterSizes(element) {
-            -
              var styles = getComputedStyle(element);
-            -
              var x = parseFloat(styles.marginTop) + parseFloat(styles.marginBottom);
-            -
              var y = parseFloat(styles.marginLeft) + parseFloat(styles.marginRight);
-            -
              var result = {
-            -
                width: element.offsetWidth + y,
-            -
                height: element.offsetHeight + x
-            -
              };
-            -
              return result;
-            -
            }
-            -
-            -
            /**
-            -
             * Get the opposite placement of the given one
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {String} placement
-            -
             * @returns {String} flipped placement
-            -
             */
-            -
            function getOppositePlacement(placement) {
-            -
              var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' };
-            -
              return placement.replace(/left|right|bottom|top/g, function (matched) {
-            -
                return hash[matched];
-            -
              });
-            -
            }
-            -
-            -
            /**
-            -
             * Get offsets to the popper
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {Object} position - CSS position the Popper will get applied
-            -
             * @param {HTMLElement} popper - the popper element
-            -
             * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this)
-            -
             * @param {String} placement - one of the valid placement options
-            -
             * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper
-            -
             */
-            -
            function getPopperOffsets(popper, referenceOffsets, placement) {
-            -
              placement = placement.split('-')[0];
-            -
-            -
              // Get popper node sizes
-            -
              var popperRect = getOuterSizes(popper);
-            -
-            -
              // Add position, width and height to our offsets object
-            -
              var popperOffsets = {
-            -
                width: popperRect.width,
-            -
                height: popperRect.height
-            -
              };
-            -
              // depending by the popper placement we have to compute its offsets slightly differently
-            -
              var isHoriz = ['right', 'left'].indexOf(placement) !== -1;
-            -
              var mainSide = isHoriz ? 'top' : 'left';
-            -
              var secondarySide = isHoriz ? 'left' : 'top';
-            -
              var measurement = isHoriz ? 'height' : 'width';
-            -
              var secondaryMeasurement = !isHoriz ? 'height' : 'width';
-            -
-            -
              popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2;
-            -
              if (placement === secondarySide) {
-            -
                popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement];
-            -
              } else {
-            -
                popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)];
+              }
-            -
              return popperOffsets;
-            -
            }
-            -
-            -
            /**
-            -
             * Mimics the `find` method of Array
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Array} arr
-            -
             * @argument prop
-            -
             * @argument value
-            -
             * @returns index or -1
-            -
             */
-            -
            function find(arr, check) {
-            -
              // use native find if supported
-            -
              if (Array.prototype.find) {
-            -
                return arr.find(check);
+              }
-            -
              // use `filter` to obtain the same behavior of `find`
-            -
              return arr.filter(check)[0];
-            -
            }
-            -
-            -
            /**
-            -
             * Return the index of the matching object
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Array} arr
-            -
             * @argument prop
-            -
             * @argument value
-            -
             * @returns index or -1
-            -
             */
-            -
            function findIndex(arr, prop, value) {
-            -
              // use native findIndex if supported
-            -
              if (Array.prototype.findIndex) {
-            -
                return arr.findIndex(function (cur) {
-            -
                  return cur[prop] === value;
-            -
                });
-            -
              }
-            -
              // use `find` + `indexOf` if `findIndex` isn't supported
-            -
              var match = find(arr, function (obj) {
-            -
                return obj[prop] === value;
-            -
              });
-            -
              return arr.indexOf(match);
-            -
            }
-            -
-            -
            /**
-            -
             * Loop trough the list of modifiers and run them in order,
-            -
             * each of them will then edit the data object.
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {dataObject} data
-            -
             * @param {Array} modifiers
-            -
             * @param {String} ends - Optional modifier name used as stopper
-            -
             * @returns {dataObject}
-            -
             */
-            -
            function runModifiers(modifiers, data, ends) {
-            -
              var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends));
-            -
-            -
              modifiersToRun.forEach(function (modifier) {
-            -
                if (modifier['function']) {
-            -
                  // eslint-disable-line dot-notation
-            -
                  console.warn('`modifier.function` is deprecated, use `modifier.fn`!');
-            -
                }
-            -
                var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation
-            -
                if (modifier.enabled && isFunction(fn)) {
-            -
                  // Add properties to offsets to make them a complete clientRect object
-            -
                  // we do this before each modifier to make sure the previous one doesn't
-            -
                  // mess with these values
-            -
                  data.offsets.popper = getClientRect(data.offsets.popper);
-            -
                  data.offsets.reference = getClientRect(data.offsets.reference);
-            -
-            -
                  data = fn(data, modifier);
-            -
                }
-            -
              });
-            -
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * Updates the position of the popper, computing the new offsets and applying
-            -
             * the new style.<br />
-            -
             * Prefer `scheduleUpdate` over `update` because of performance reasons.
-            -
             * @method
-            -
             * @memberof Popper
-            -
             */
-            -
            function update() {
-            -
              // if popper is destroyed, don't perform any further update
-            -
              if (this.state.isDestroyed) {
-            -
                return;
+              }
-            -
              var data = {
-            -
                instance: this,
-            -
                styles: {},
-            -
                arrowStyles: {},
-            -
                attributes: {},
-            -
                flipped: false,
-            -
                offsets: {}
               };
-            -
              // compute reference element offsets
-            -
              data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference);
-            -
-            -
              // compute auto placement, store placement inside the data object,
-            -
              // modifiers will be able to edit `placement` if needed
-            -
              // and refer to originalPlacement to know the original value
-            -
              data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding);
-            -
              // store the computed placement inside `originalPlacement`
-            -
              data.originalPlacement = data.placement;
-            -
              // compute the popper offsets
-            -
              data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement);
-            -
              data.offsets.popper.position = 'absolute';
-            -
              // run the modifiers
-            -
              data = runModifiers(this.modifiers, data);
-            -
              // the first `update` will call `onCreate` callback
-            -
              // the other ones will call `onUpdate` callback
-            -
              if (!this.state.isCreated) {
-            -
                this.state.isCreated = true;
-            -
                this.options.onCreate(data);
-            -
              } else {
-            -
                this.options.onUpdate(data);
-            -
              }
-            -
            }
-            -
-            -
            /**
-            -
             * Helper used to know if the given modifier is enabled.
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @returns {Boolean}
-            -
             */
-            -
            function isModifierEnabled(modifiers, modifierName) {
-            -
              return modifiers.some(function (_ref) {
-            -
                var name = _ref.name,
-            -
                    enabled = _ref.enabled;
-            -
                return enabled && name === modifierName;
-            -
              });
-            -
            }
-            -
-            -
            /**
-            -
             * Get the prefixed supported property name
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {String} property (camelCase)
-            -
             * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix)
-            -
             */
-            -
            function getSupportedPropertyName(property) {
-            -
              var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O'];
-            -
              var upperProp = property.charAt(0).toUpperCase() + property.slice(1);
-            -
-            -
              for (var i = 0; i < prefixes.length - 1; i++) {
-            -
                var prefix = prefixes[i];
-            -
                var toCheck = prefix ? '' + prefix + upperProp : property;
-            -
                if (typeof document.body.style[toCheck] !== 'undefined') {
-            -
                  return toCheck;
-            -
                }
-            -
              }
-            -
              return null;
-            -
            }
-            -
-            -
            /**
-            -
             * Destroy the popper
-            -
             * @method
-            -
             * @memberof Popper
-            -
             */
-            -
            function destroy() {
-            -
              this.state.isDestroyed = true;
-            -
-            -
              // touch DOM only if `applyStyle` modifier is enabled
-            -
              if (isModifierEnabled(this.modifiers, 'applyStyle')) {
-            -
                this.popper.removeAttribute('x-placement');
-            -
                this.popper.style.left = '';
-            -
                this.popper.style.position = '';
-            -
                this.popper.style.top = '';
-            -
                this.popper.style[getSupportedPropertyName('transform')] = '';
-            -
              }
-            -
              this.disableEventListeners();
-            -
              // remove the popper if user explicity asked for the deletion on destroy
-            -
              // do not use `remove` because IE11 doesn't support it
-            -
              if (this.options.removeOnDestroy) {
-            -
                this.popper.parentNode.removeChild(this.popper);
-            -
              }
-            -
              return this;
-            -
            }
-            -
-            -
            /**
-            -
             * Get the window associated with the element
-            -
             * @argument {Element} element
-            -
             * @returns {Window}
-            -
             */
-            -
            function getWindow(element) {
-            -
              var ownerDocument = element.ownerDocument;
-            -
              return ownerDocument ? ownerDocument.defaultView : window;
-            -
            }
-            -
-            -
            function attachToScrollParents(scrollParent, event, callback, scrollParents) {
-            -
              var isBody = scrollParent.nodeName === 'BODY';
-            -
              var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent;
-            -
              target.addEventListener(event, callback, { passive: true });
-            -
-            -
              if (!isBody) {
-            -
                attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents);
-            -
              }
-            -
              scrollParents.push(target);
-            -
            }
-            -
-            -
            /**
-            -
             * Setup needed event listeners used to update the popper position
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @private
-            -
             */
-            -
            function setupEventListeners(reference, options, state, updateBound) {
-            -
              // Resize event listener on window
-            -
              state.updateBound = updateBound;
-            -
              getWindow(reference).addEventListener('resize', state.updateBound, { passive: true });
-            -
-            -
              // Scroll event listener on scroll parents
-            -
              var scrollElement = getScrollParent(reference);
-            -
              attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents);
-            -
              state.scrollElement = scrollElement;
-            -
              state.eventsEnabled = true;
-            -
-            -
              return state;
-            -
            }
-            -
-            -
            /**
-            -
             * It will add resize/scroll events and start recalculating
-            -
             * position of the popper element when they are triggered.
-            -
             * @method
-            -
             * @memberof Popper
-            -
             */
-            -
            function enableEventListeners() {
-            -
              if (!this.state.eventsEnabled) {
-            -
                this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate);
-            -
              }
-            -
            }
-            -
-            -
            /**
-            -
             * Remove event listeners used to update the popper position
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @private
-            -
             */
-            -
            function removeEventListeners(reference, state) {
-            -
              // Remove resize event listener on window
-            -
              getWindow(reference).removeEventListener('resize', state.updateBound);
-            -
-            -
              // Remove scroll event listener on scroll parents
-            -
              state.scrollParents.forEach(function (target) {
-            -
                target.removeEventListener('scroll', state.updateBound);
-            -
              });
-            -
-            -
              // Reset state
-            -
              state.updateBound = null;
-            -
              state.scrollParents = [];
-            -
              state.scrollElement = null;
-            -
              state.eventsEnabled = false;
-            -
              return state;
-            -
            }
-            -
-            -
            /**
-            -
             * It will remove resize/scroll events and won't recalculate popper position
-            -
             * when they are triggered. It also won't trigger onUpdate callback anymore,
-            -
             * unless you call `update` method manually.
-            -
             * @method
-            -
             * @memberof Popper
-            -
             */
-            -
            function disableEventListeners() {
-            -
              if (this.state.eventsEnabled) {
-            -
                cancelAnimationFrame(this.scheduleUpdate);
-            -
                this.state = removeEventListeners(this.reference, this.state);
-            -
              }
-            -
            }
-            -
-            -
            /**
-            -
             * Tells if a given input is a number
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {*} input to check
-            -
             * @return {Boolean}
-            -
             */
-            -
            function isNumeric(n) {
-            -
              return n !== '' && !isNaN(parseFloat(n)) && isFinite(n);
-            -
            }
-            -
-            -
            /**
-            -
             * Set the style to the given popper
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element - Element to apply the style to
-            -
             * @argument {Object} styles
-            -
             * Object with a list of properties and values which will be applied to the element
-            -
             */
-            -
            function setStyles(element, styles) {
-            -
              Object.keys(styles).forEach(function (prop) {
-            -
                var unit = '';
-            -
                // add unit if the value is numeric and is one of the following
-            -
                if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) {
-            -
                  unit = 'px';
-            -
                }
-            -
                element.style[prop] = styles[prop] + unit;
-            -
              });
-            -
            }
-            -
-            -
            /**
-            -
             * Set the attributes to the given popper
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {Element} element - Element to apply the attributes to
-            -
             * @argument {Object} styles
-            -
             * Object with a list of properties and values which will be applied to the element
-            -
             */
-            -
            function setAttributes(element, attributes) {
-            -
              Object.keys(attributes).forEach(function (prop) {
-            -
                var value = attributes[prop];
-            -
                if (value !== false) {
-            -
                  element.setAttribute(prop, attributes[prop]);
                 } else {
-            -
                  element.removeAttribute(prop);
+                }
-            -
              });
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by `update` method
-            -
             * @argument {Object} data.styles - List of style properties - values to apply to popper element
-            -
             * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The same data object
-            -
             */
-            -
            function applyStyle(data) {
-            -
              // any property present in `data.styles` will be applied to the popper,
-            -
              // in this way we can make the 3rd party modifiers add custom styles to it
-            -
              // Be aware, modifiers could override the properties defined in the previous
-            -
              // lines of this modifier!
-            -
              setStyles(data.instance.popper, data.styles);
-            -
-            -
              // any property present in `data.attributes` will be applied to the popper,
-            -
              // they will be set as HTML attributes of the element
-            -
              setAttributes(data.instance.popper, data.attributes);
-            -
-            -
              // if arrowElement is defined and arrowStyles has some properties
-            -
              if (data.arrowElement && Object.keys(data.arrowStyles).length) {
-            -
                setStyles(data.arrowElement, data.arrowStyles);
-            -
              }
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * Set the x-placement attribute before everything else because it could be used
-            -
             * to add margins to the popper margins needs to be calculated to get the
-            -
             * correct popper offsets.
-            -
             * @method
-            -
             * @memberof Popper.modifiers
-            -
             * @param {HTMLElement} reference - The reference element used to position the popper
-            -
             * @param {HTMLElement} popper - The HTML element used as popper.
-            -
             * @param {Object} options - Popper.js options
-            -
             */
-            -
            function applyStyleOnLoad(reference, popper, options, modifierOptions, state) {
-            -
              // compute reference element offsets
-            -
              var referenceOffsets = getReferenceOffsets(state, popper, reference);
-            -
-            -
              // compute auto placement, store placement inside the data object,
-            -
              // modifiers will be able to edit `placement` if needed
-            -
              // and refer to originalPlacement to know the original value
-            -
              var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding);
-            -
-            -
              popper.setAttribute('x-placement', placement);
-            -
-            -
              // Apply `position` to popper before anything else because
-            -
              // without the position applied we can't guarantee correct computations
-            -
              setStyles(popper, { position: 'absolute' });
-            -
-            -
              return options;
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by `update` method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function computeStyle(data, options) {
-            -
              var x = options.x,
-            -
                  y = options.y;
-            -
              var popper = data.offsets.popper;
-            -
-            -
              // Remove this legacy support in Popper.js v2
-            -
-            -
              var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) {
-            -
                return modifier.name === 'applyStyle';
-            -
              }).gpuAcceleration;
-            -
              if (legacyGpuAccelerationOption !== undefined) {
-            -
                console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!');
-            -
              }
-            -
              var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration;
-            -
              var offsetParent = getOffsetParent(data.instance.popper);
-            -
              var offsetParentRect = getBoundingClientRect(offsetParent);
-            -
              // Styles
-            -
              var styles = {
-            -
                position: popper.position
-            -
              };
-            -
              // floor sides to avoid blurry text
-            -
              var offsets = {
-            -
                left: Math.floor(popper.left),
-            -
                top: Math.floor(popper.top),
-            -
                bottom: Math.floor(popper.bottom),
-            -
                right: Math.floor(popper.right)
               };
-            -
              var sideA = x === 'bottom' ? 'top' : 'bottom';
-            -
              var sideB = y === 'right' ? 'left' : 'right';
-            -
-            -
              // if gpuAcceleration is set to `true` and transform is supported,
-            -
              //  we use `translate3d` to apply the position to the popper we
-            -
              // automatically use the supported prefixed version if needed
-            -
              var prefixedProperty = getSupportedPropertyName('transform');
-            -
-            -
              // now, let's make a step back and look at this code closely (wtf?)
-            -
              // If the content of the popper grows once it's been positioned, it
-            -
              // may happen that the popper gets misplaced because of the new content
-            -
              // overflowing its reference element
-            -
              // To avoid this problem, we provide two options (x and y), which allow
-            -
              // the consumer to define the offset origin.
-            -
              // If we position a popper on top of a reference element, we can set
-            -
              // `x` to `top` to make the popper grow towards its top instead of
-            -
              // its bottom.
-            -
              var left = void 0,
-            -
                  top = void 0;
-            -
              if (sideA === 'bottom') {
-            -
                top = -offsetParentRect.height + offsets.bottom;
-            -
              } else {
-            -
                top = offsets.top;
-            -
              }
-            -
              if (sideB === 'right') {
-            -
                left = -offsetParentRect.width + offsets.right;
-            -
              } else {
-            -
                left = offsets.left;
-            -
              }
-            -
              if (gpuAcceleration && prefixedProperty) {
-            -
                styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)';
-            -
                styles[sideA] = 0;
-            -
                styles[sideB] = 0;
-            -
                styles.willChange = 'transform';
-            -
              } else {
-            -
                // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties
-            -
                var invertTop = sideA === 'bottom' ? -1 : 1;
-            -
                var invertLeft = sideB === 'right' ? -1 : 1;
-            -
                styles[sideA] = top * invertTop;
-            -
                styles[sideB] = left * invertLeft;
-            -
                styles.willChange = sideA + ', ' + sideB;
+              }
-            -
              // Attributes
-            -
              var attributes = {
-            -
                'x-placement': data.placement
-            -
              };
-            -
              // Update `data` attributes, styles and arrowStyles
-            -
              data.attributes = _extends$1({}, attributes, data.attributes);
-            -
              data.styles = _extends$1({}, styles, data.styles);
-            -
              data.arrowStyles = _extends$1({}, data.offsets.arrow, data.arrowStyles);
-            -
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * Helper used to know if the given modifier depends from another one.<br />
-            -
             * It checks if the needed modifier is listed and enabled.
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @param {Array} modifiers - list of modifiers
-            -
             * @param {String} requestingName - name of requesting modifier
-            -
             * @param {String} requestedName - name of requested modifier
-            -
             * @returns {Boolean}
-            -
             */
-            -
            function isModifierRequired(modifiers, requestingName, requestedName) {
-            -
              var requesting = find(modifiers, function (_ref) {
-            -
                var name = _ref.name;
-            -
                return name === requestingName;
-            -
              });
-            -
-            -
              var isRequired = !!requesting && modifiers.some(function (modifier) {
-            -
                return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order;
-            -
              });
-            -
-            -
              if (!isRequired) {
-            -
                var _requesting = '`' + requestingName + '`';
-            -
                var requested = '`' + requestedName + '`';
-            -
                console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!');
-            -
              }
-            -
              return isRequired;
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by update method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function arrow(data, options) {
-            -
              var _data$offsets$arrow;
-            -
-            -
              // arrow depends on keepTogether in order to work
-            -
              if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) {
-            -
                return data;
-            -
              }
-            -
              var arrowElement = options.element;
-            -
              // if arrowElement is a string, suppose it's a CSS selector
-            -
              if (typeof arrowElement === 'string') {
-            -
                arrowElement = data.instance.popper.querySelector(arrowElement);
-            -
                // if arrowElement is not found, don't run the modifier
-            -
                if (!arrowElement) {
-            -
                  return data;
-            -
                }
-            -
              } else {
-            -
                // if the arrowElement isn't a query selector we must check that the
-            -
                // provided DOM node is child of its popper node
-            -
                if (!data.instance.popper.contains(arrowElement)) {
-            -
                  console.warn('WARNING: `arrow.element` must be child of its popper element!');
-            -
                  return data;
+                }
+              }
-            -
              var placement = data.placement.split('-')[0];
-            -
              var _data$offsets = data.offsets,
-            -
                  popper = _data$offsets.popper,
-            -
                  reference = _data$offsets.reference;
-            -
              var isVertical = ['left', 'right'].indexOf(placement) !== -1;
-            -
              var len = isVertical ? 'height' : 'width';
-            -
              var sideCapitalized = isVertical ? 'Top' : 'Left';
-            -
              var side = sideCapitalized.toLowerCase();
-            -
              var altSide = isVertical ? 'left' : 'top';
-            -
              var opSide = isVertical ? 'bottom' : 'right';
-            -
              var arrowElementSize = getOuterSizes(arrowElement)[len];
-            -
              //
-            -
              // extends keepTogether behavior making sure the popper and its
-            -
              // reference have enough pixels in conjuction
-            -
              //
-            -
              // top/left side
-            -
              if (reference[opSide] - arrowElementSize < popper[side]) {
-            -
                data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize);
-            -
              }
-            -
              // bottom/right side
-            -
              if (reference[side] + arrowElementSize > popper[opSide]) {
-            -
                data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide];
-            -
              }
-            -
              data.offsets.popper = getClientRect(data.offsets.popper);
-            -
-            -
              // compute center of the popper
-            -
              var center = reference[side] + reference[len] / 2 - arrowElementSize / 2;
-            -
-            -
              // Compute the sideValue using the updated popper offsets
-            -
              // take popper margin in account because we don't have this info available
-            -
              var css = getStyleComputedProperty(data.instance.popper);
-            -
              var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10);
-            -
              var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10);
-            -
              var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide;
-            -
-            -
              // prevent arrowElement from being placed not contiguously to its popper
-            -
              sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0);
-            -
-            -
              data.arrowElement = arrowElement;
-            -
              data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow);
-            -
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * Get the opposite placement variation of the given one
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {String} placement variation
-            -
             * @returns {String} flipped placement variation
-            -
             */
-            -
            function getOppositeVariation(variation) {
-            -
              if (variation === 'end') {
-            -
                return 'start';
-            -
              } else if (variation === 'start') {
-            -
                return 'end';
-            -
              }
-            -
              return variation;
-            -
            }
-            -
-            -
            /**
-            -
             * List of accepted placements to use as values of the `placement` option.<br />
-            -
             * Valid placements are:
-            -
             * - `auto`
-            -
             * - `top`
-            -
             * - `right`
-            -
             * - `bottom`
-            -
             * - `left`
-            -
             *
-            -
             * Each placement can have a variation from this list:
-            -
             * - `-start`
-            -
             * - `-end`
-            -
             *
-            -
             * Variations are interpreted easily if you think of them as the left to right
-            -
             * written languages. Horizontally (`top` and `bottom`), `start` is left and `end`
-            -
             * is right.<br />
-            -
             * Vertically (`left` and `right`), `start` is top and `end` is bottom.
-            -
             *
-            -
             * Some valid examples are:
-            -
             * - `top-end` (on top of reference, right aligned)
-            -
             * - `right-start` (on right of reference, top aligned)
-            -
             * - `bottom` (on bottom, centered)
-            -
             * - `auto-right` (on the side with more space available, alignment depends by placement)
-            -
             *
-            -
             * @static
-            -
             * @type {Array}
-            -
             * @enum {String}
-            -
             * @readonly
-            -
             * @method placements
-            -
             * @memberof Popper
-            -
             */
-            -
            var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start'];
-            -
-            -
            // Get rid of `auto` `auto-start` and `auto-end`
-            -
            var validPlacements = placements.slice(3);
-            -
-            -
            /**
-            -
             * Given an initial placement, returns all the subsequent placements
-            -
             * clockwise (or counter-clockwise).
-            -
             *
-            -
             * @method
-            -
             * @memberof Popper.Utils
-            -
             * @argument {String} placement - A valid placement (it accepts variations)
-            -
             * @argument {Boolean} counter - Set to true to walk the placements counterclockwise
-            -
             * @returns {Array} placements including their variations
-            -
             */
-            -
            function clockwise(placement) {
-            -
              var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
-            -
-            -
              var index = validPlacements.indexOf(placement);
-            -
              var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index));
-            -
              return counter ? arr.reverse() : arr;
-            -
            }
-            -
-            -
            var BEHAVIORS = {
-            -
              FLIP: 'flip',
-            -
              CLOCKWISE: 'clockwise',
-            -
              COUNTERCLOCKWISE: 'counterclockwise'
-            -
            };
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by update method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function flip(data, options) {
-            -
              // if `inner` modifier is enabled, we can't use the `flip` modifier
-            -
              if (isModifierEnabled(data.instance.modifiers, 'inner')) {
-            -
                return data;
-            -
              }
-            -
              if (data.flipped && data.placement === data.originalPlacement) {
-            -
                // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides
-            -
                return data;
+              }
-            -
              var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement);
-            -
              var placement = data.placement.split('-')[0];
-            -
              var placementOpposite = getOppositePlacement(placement);
-            -
              var variation = data.placement.split('-')[1] || '';
-            -
-            -
              var flipOrder = [];
-            -
              switch (options.behavior) {
-            -
                case BEHAVIORS.FLIP:
-            -
                  flipOrder = [placement, placementOpposite];
-            -
                  break;
-            -
                case BEHAVIORS.CLOCKWISE:
-            -
                  flipOrder = clockwise(placement);
-            -
                  break;
-            -
                case BEHAVIORS.COUNTERCLOCKWISE:
-            -
                  flipOrder = clockwise(placement, true);
-            -
                  break;
-            -
                default:
-            -
                  flipOrder = options.behavior;
+              }
-            -
              flipOrder.forEach(function (step, index) {
-            -
                if (placement !== step || flipOrder.length === index + 1) {
-            -
                  return data;
+                }
-            -
                placement = data.placement.split('-')[0];
-            -
                placementOpposite = getOppositePlacement(placement);
-            -
                var popperOffsets = data.offsets.popper;
-            -
                var refOffsets = data.offsets.reference;
-            -
                // using floor because the reference offsets may contain decimals we are not going to consider here
-            -
                var floor = Math.floor;
-            -
                var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom);
-            -
                var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left);
-            -
                var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right);
-            -
                var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top);
-            -
                var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom);
-            -
                var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom;
-            -
                // flip the variation if required
-            -
                var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
-            -
                var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom);
-            -
                if (overlapsRef || overflowsBoundaries || flippedVariation) {
-            -
                  // this boolean to detect any flip loop
-            -
                  data.flipped = true;
-            -
                  if (overlapsRef || overflowsBoundaries) {
-            -
                    placement = flipOrder[index + 1];
-            -
                  }
-            -
                  if (flippedVariation) {
-            -
                    variation = getOppositeVariation(variation);
+                  }
-            -
                  data.placement = placement + (variation ? '-' + variation : '');
-            -
-            -
                  // this object contains `position`, we want to preserve it along with
-            -
                  // any additional property we may add in the future
-            -
                  data.offsets.popper = _extends$1({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement));
-            -
                  data = runModifiers(data.instance.modifiers, data, 'flip');
-            -
                }
-            -
              });
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by update method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function keepTogether(data) {
-            -
              var _data$offsets = data.offsets,
-            -
                  popper = _data$offsets.popper,
-            -
                  reference = _data$offsets.reference;
-            -
-            -
              var placement = data.placement.split('-')[0];
-            -
              var floor = Math.floor;
-            -
              var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
-            -
              var side = isVertical ? 'right' : 'bottom';
-            -
              var opSide = isVertical ? 'left' : 'top';
-            -
              var measurement = isVertical ? 'width' : 'height';
-            -
-            -
              if (popper[side] < floor(reference[opSide])) {
-            -
                data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement];
-            -
              }
-            -
              if (popper[opSide] > floor(reference[side])) {
-            -
                data.offsets.popper[opSide] = floor(reference[side]);
+              }
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * Converts a string containing value + unit into a px value number
-            -
             * @function
-            -
             * @memberof {modifiers~offset}
-            -
             * @private
-            -
             * @argument {String} str - Value + unit string
-            -
             * @argument {String} measurement - `height` or `width`
-            -
             * @argument {Object} popperOffsets
-            -
             * @argument {Object} referenceOffsets
-            -
             * @returns {Number|String}
-            -
             * Value in pixels, or original string if no values were extracted
-            -
             */
-            -
            function toValue(str, measurement, popperOffsets, referenceOffsets) {
-            -
              // separate value from unit
-            -
              var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/);
-            -
              var value = +split[1];
-            -
              var unit = split[2];
-            -
-            -
              // If it's not a number it's an operator, I guess
-            -
              if (!value) {
-            -
                return str;
+              }
-            -
              if (unit.indexOf('%') === 0) {
-            -
                var element = void 0;
-            -
                switch (unit) {
-            -
                  case '%p':
-            -
                    element = popperOffsets;
-            -
                    break;
-            -
                  case '%':
-            -
                  case '%r':
-            -
                  default:
-            -
                    element = referenceOffsets;
-            -
                }
-            -
                var rect = getClientRect(element);
-            -
                return rect[measurement] / 100 * value;
-            -
              } else if (unit === 'vh' || unit === 'vw') {
-            -
                // if is a vh or vw, we calculate the size based on the viewport
-            -
                var size = void 0;
-            -
                if (unit === 'vh') {
-            -
                  size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0);
-            -
                } else {
-            -
                  size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0);
+                }
-            -
                return size / 100 * value;
-            -
              } else {
-            -
                // if is an explicit pixel unit, we get rid of the unit and keep the value
-            -
                // if is an implicit unit, it's px, and we return just the value
-            -
                return value;
-            -
              }
-            -
            }
-            -
-            -
            /**
-            -
             * Parse an `offset` string to extrapolate `x` and `y` numeric offsets.
-            -
             * @function
-            -
             * @memberof {modifiers~offset}
-            -
             * @private
-            -
             * @argument {String} offset
-            -
             * @argument {Object} popperOffsets
-            -
             * @argument {Object} referenceOffsets
-            -
             * @argument {String} basePlacement
-            -
             * @returns {Array} a two cells array with x and y offsets in numbers
-            -
             */
-            -
            function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) {
-            -
              var offsets = [0, 0];
-            -
-            -
              // Use height if placement is left or right and index is 0 otherwise use width
-            -
              // in this way the first offset will use an axis and the second one
-            -
              // will use the other one
-            -
              var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1;
-            -
-            -
              // Split the offset string to obtain a list of values and operands
-            -
              // The regex addresses values with the plus or minus sign in front (+10, -20, etc)
-            -
              var fragments = offset.split(/(\+|\-)/).map(function (frag) {
-            -
                return frag.trim();
-            -
              });
-            -
-            -
              // Detect if the offset string contains a pair of values or a single one
-            -
              // they could be separated by comma or space
-            -
              var divider = fragments.indexOf(find(fragments, function (frag) {
-            -
                return frag.search(/,|\s/) !== -1;
-            -
              }));
-            -
-            -
              if (fragments[divider] && fragments[divider].indexOf(',') === -1) {
-            -
                console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.');
-            -
              }
-            -
              // If divider is found, we divide the list of values and operands to divide
-            -
              // them by ofset X and Y.
-            -
              var splitRegex = /\s*,\s*|\s+/;
-            -
              var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments];
-            -
-            -
              // Convert the values with units to absolute pixels to allow our computations
-            -
              ops = ops.map(function (op, index) {
-            -
                // Most of the units rely on the orientation of the popper
-            -
                var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width';
-            -
                var mergeWithPrevious = false;
-            -
                return op
-            -
                // This aggregates any `+` or `-` sign that aren't considered operators
-            -
                // e.g.: 10 + +5 => [10, +, +5]
-            -
                .reduce(function (a, b) {
-            -
                  if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) {
-            -
                    a[a.length - 1] = b;
-            -
                    mergeWithPrevious = true;
-            -
                    return a;
-            -
                  } else if (mergeWithPrevious) {
-            -
                    a[a.length - 1] += b;
-            -
                    mergeWithPrevious = false;
-            -
                    return a;
-            -
                  } else {
-            -
                    return a.concat(b);
+                  }
-            -
                }, [])
-            -
                // Here we convert the string values into number values (in px)
-            -
                .map(function (str) {
-            -
                  return toValue(str, measurement, popperOffsets, referenceOffsets);
                 });
-            -
              });
-            -
              // Loop trough the offsets arrays and execute the operations
-            -
              ops.forEach(function (op, index) {
-            -
                op.forEach(function (frag, index2) {
-            -
                  if (isNumeric(frag)) {
-            -
                    offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1);
-            -
                  }
                 });
-            -
              });
-            -
              return offsets;
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by update method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @argument {Number|String} options.offset=0
-            -
             * The offset value as described in the modifier description
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function offset(data, _ref) {
-            -
              var offset = _ref.offset;
-            -
              var placement = data.placement,
-            -
                  _data$offsets = data.offsets,
-            -
                  popper = _data$offsets.popper,
-            -
                  reference = _data$offsets.reference;
-            -
-            -
              var basePlacement = placement.split('-')[0];
-            -
-            -
              var offsets = void 0;
-            -
              if (isNumeric(+offset)) {
-            -
                offsets = [+offset, 0];
-            -
              } else {
-            -
                offsets = parseOffset(offset, popper, reference, basePlacement);
+              }
-            -
              if (basePlacement === 'left') {
-            -
                popper.top += offsets[0];
-            -
                popper.left -= offsets[1];
-            -
              } else if (basePlacement === 'right') {
-            -
                popper.top += offsets[0];
-            -
                popper.left += offsets[1];
-            -
              } else if (basePlacement === 'top') {
-            -
                popper.left += offsets[0];
-            -
                popper.top -= offsets[1];
-            -
              } else if (basePlacement === 'bottom') {
-            -
                popper.left += offsets[0];
-            -
                popper.top += offsets[1];
+              }
-            -
              data.popper = popper;
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by `update` method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function preventOverflow(data, options) {
-            -
              var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper);
-            -
-            -
              // If offsetParent is the reference element, we really want to
-            -
              // go one step up and use the next offsetParent as reference to
-            -
              // avoid to make this modifier completely useless and look like broken
-            -
              if (data.instance.reference === boundariesElement) {
-            -
                boundariesElement = getOffsetParent(boundariesElement);
+              }
-            -
              var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement);
-            -
              options.boundaries = boundaries;
-            -
              var order = options.priority;
-            -
              var popper = data.offsets.popper;
-            -
              var check = {
-            -
                primary: function primary(placement) {
-            -
                  var value = popper[placement];
-            -
                  if (popper[placement] < boundaries[placement] && !options.escapeWithReference) {
-            -
                    value = Math.max(popper[placement], boundaries[placement]);
+                  }
-            -
                  return defineProperty({}, placement, value);
-            -
                },
-            -
                secondary: function secondary(placement) {
-            -
                  var mainSide = placement === 'right' ? 'left' : 'top';
-            -
                  var value = popper[mainSide];
-            -
                  if (popper[placement] > boundaries[placement] && !options.escapeWithReference) {
-            -
                    value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height));
+                  }
-            -
                  return defineProperty({}, mainSide, value);
-            -
                }
-            -
              };
-            -
              order.forEach(function (placement) {
-            -
                var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary';
-            -
                popper = _extends$1({}, popper, check[side](placement));
-            -
              });
-            -
-            -
              data.offsets.popper = popper;
-            -
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by `update` method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function shift(data) {
-            -
              var placement = data.placement;
-            -
              var basePlacement = placement.split('-')[0];
-            -
              var shiftvariation = placement.split('-')[1];
-            -
-            -
              // if shift shiftvariation is specified, run the modifier
-            -
              if (shiftvariation) {
-            -
                var _data$offsets = data.offsets,
-            -
                    reference = _data$offsets.reference,
-            -
                    popper = _data$offsets.popper;
-            -
                var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1;
-            -
                var side = isVertical ? 'left' : 'top';
-            -
                var measurement = isVertical ? 'width' : 'height';
-            -
                var shiftOffsets = {
-            -
                  start: defineProperty({}, side, reference[side]),
-            -
                  end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement])
                 };
-            -
                data.offsets.popper = _extends$1({}, popper, shiftOffsets[shiftvariation]);
+              }
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by update method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function hide(data) {
-            -
              if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) {
                 return data;
+              }
-            -
              var refRect = data.offsets.reference;
-            -
              var bound = find(data.instance.modifiers, function (modifier) {
-            -
                return modifier.name === 'preventOverflow';
-            -
              }).boundaries;
-            -
              if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) {
-            -
                // Avoid unnecessary DOM access if visibility hasn't changed
-            -
                if (data.hide === true) {
-            -
                  return data;
+                }
-            -
                data.hide = true;
-            -
                data.attributes['x-out-of-boundaries'] = '';
-            -
              } else {
-            -
                // Avoid unnecessary DOM access if visibility hasn't changed
-            -
                if (data.hide === false) {
                   return data;
+                }
-            -
                data.hide = false;
-            -
                data.attributes['x-out-of-boundaries'] = false;
+              }
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * @function
-            -
             * @memberof Modifiers
-            -
             * @argument {Object} data - The data object generated by `update` method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {Object} The data object, properly modified
-            -
             */
-            -
            function inner(data) {
-            -
              var placement = data.placement;
-            -
              var basePlacement = placement.split('-')[0];
-            -
              var _data$offsets = data.offsets,
-            -
                  popper = _data$offsets.popper,
-            -
                  reference = _data$offsets.reference;
-            -
-            -
              var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1;
-            -
-            -
              var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1;
-            -
-            -
              popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0);
-            -
-            -
              data.placement = getOppositePlacement(placement);
-            -
              data.offsets.popper = getClientRect(popper);
-            -
-            -
              return data;
-            -
            }
-            -
-            -
            /**
-            -
             * Modifier function, each modifier can have a function of this type assigned
-            -
             * to its `fn` property.<br />
-            -
             * These functions will be called on each update, this means that you must
-            -
             * make sure they are performant enough to avoid performance bottlenecks.
-            -
             *
-            -
             * @function ModifierFn
-            -
             * @argument {dataObject} data - The data object generated by `update` method
-            -
             * @argument {Object} options - Modifiers configuration and options
-            -
             * @returns {dataObject} The data object, properly modified
-            -
             */
-            -
-            -
            /**
-            -
             * Modifiers are plugins used to alter the behavior of your poppers.<br />
-            -
             * Popper.js uses a set of 9 modifiers to provide all the basic functionalities
-            -
             * needed by the library.
-            -
             *
-            -
             * Usually you don't want to override the `order`, `fn` and `onLoad` props.
-            -
             * All the other properties are configurations that could be tweaked.
-            -
             * @namespace modifiers
-            -
             */
-            -
            var modifiers = {
               /**
-            -
               * Modifier used to shift the popper on the start or end of its reference
-            -
               * element.<br />
-            -
               * It will read the variation of the `placement` property.<br />
-            -
               * It can be one either `-end` or `-start`.
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              shift: {
-            -
                /** @prop {number} order=100 - Index used to define the order of execution */
-            -
                order: 100,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: shift
-            -
              },
               /**
-            -
               * The `offset` modifier can shift your popper on both its axis.
-            -
               *
-            -
               * It accepts the following units:
-            -
               * - `px` or unitless, interpreted as pixels
-            -
               * - `%` or `%r`, percentage relative to the length of the reference element
-            -
               * - `%p`, percentage relative to the length of the popper element
-            -
               * - `vw`, CSS viewport width unit
-            -
               * - `vh`, CSS viewport height unit
+               *
-            -
               * For length is intended the main axis relative to the placement of the popper.<br />
-            -
               * This means that if the placement is `top` or `bottom`, the length will be the
-            -
               * `width`. In case of `left` or `right`, it will be the height.
+               *
-            -
               * You can provide a single value (as `Number` or `String`), or a pair of values
-            -
               * as `String` divided by a comma or one (or more) white spaces.<br />
-            -
               * The latter is a deprecated method because it leads to confusion and will be
-            -
               * removed in v2.<br />
-            -
               * Additionally, it accepts additions and subtractions between different units.
-            -
               * Note that multiplications and divisions aren't supported.
+               *
-            -
               * Valid examples are:
-            -
               * ```
-            -
               * 10
-            -
               * '10%'
-            -
               * '10, 10'
-            -
               * '10%, 10'
-            -
               * '10 + 10%'
-            -
               * '10 - 5vh + 3%'
-            -
               * '-10px + 5vh, 5px - 6%'
-            -
               * ```
-            -
               * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap
-            -
               * > with their reference element, unfortunately, you will have to disable the `flip` modifier.
-            -
               * > More on this [reading this issue](https://github.com/FezVrasta/popper.js/issues/373)
+               *
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              offset: {
-            -
                /** @prop {number} order=200 - Index used to define the order of execution */
-            -
                order: 200,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: offset,
-            -
                /** @prop {Number|String} offset=0
-            -
                 * The offset value as described in the modifier description
-            -
                 */
-            -
                offset: 0
-            -
              },
               /**
-            -
               * Modifier used to prevent the popper from being positioned outside the boundary.
-            -
               *
-            -
               * An scenario exists where the reference itself is not within the boundaries.<br />
-            -
               * We can say it has "escaped the boundaries" — or just "escaped".<br />
-            -
               * In this case we need to decide whether the popper should either:
+               *
-            -
               * - detach from the reference and remain "trapped" in the boundaries, or
-            -
               * - if it should ignore the boundary and "escape with its reference"
-            -
               *
-            -
               * When `escapeWithReference` is set to`true` and reference is completely
-            -
               * outside its boundaries, the popper will overflow (or completely leave)
-            -
               * the boundaries in order to remain attached to the edge of the reference.
-            -
               *
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              preventOverflow: {
-            -
                /** @prop {number} order=300 - Index used to define the order of execution */
-            -
                order: 300,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: preventOverflow,
-            -
                /**
-            -
                 * @prop {Array} [priority=['left','right','top','bottom']]
-            -
                 * Popper will try to prevent overflow following these priorities by default,
-            -
                 * then, it could overflow on the left and on top of the `boundariesElement`
-            -
                 */
-            -
                priority: ['left', 'right', 'top', 'bottom'],
-            -
                /**
-            -
                 * @prop {number} padding=5
-            -
                 * Amount of pixel used to define a minimum distance between the boundaries
-            -
                 * and the popper this makes sure the popper has always a little padding
-            -
                 * between the edges of its container
-            -
                 */
-            -
                padding: 5,
-            -
                /**
-            -
                 * @prop {String|HTMLElement} boundariesElement='scrollParent'
-            -
                 * Boundaries used by the modifier, can be `scrollParent`, `window`,
-            -
                 * `viewport` or any DOM element.
-            -
                 */
-            -
                boundariesElement: 'scrollParent'
-            -
              },
               /**
-            -
               * Modifier used to make sure the reference and its popper stay near eachothers
-            -
               * without leaving any gap between the two. Expecially useful when the arrow is
-            -
               * enabled and you want to assure it to point to its reference element.
-            -
               * It cares only about the first axis, you can still have poppers with margin
-            -
               * between the popper and its reference element.
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              keepTogether: {
-            -
                /** @prop {number} order=400 - Index used to define the order of execution */
-            -
                order: 400,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: keepTogether
-            -
              },
               /**
-            -
               * This modifier is used to move the `arrowElement` of the popper to make
-            -
               * sure it is positioned between the reference element and its popper element.
-            -
               * It will read the outer size of the `arrowElement` node to detect how many
-            -
               * pixels of conjuction are needed.
-            -
               *
-            -
               * It has no effect if no `arrowElement` is provided.
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              arrow: {
-            -
                /** @prop {number} order=500 - Index used to define the order of execution */
-            -
                order: 500,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: arrow,
-            -
                /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */
-            -
                element: '[x-arrow]'
-            -
              },
               /**
-            -
               * Modifier used to flip the popper's placement when it starts to overlap its
-            -
               * reference element.
-            -
               *
-            -
               * Requires the `preventOverflow` modifier before it in order to work.
-            -
               *
-            -
               * **NOTE:** this modifier will interrupt the current update cycle and will
-            -
               * restart it if it detects the need to flip the placement.
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              flip: {
-            -
                /** @prop {number} order=600 - Index used to define the order of execution */
-            -
                order: 600,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: flip,
-            -
                /**
-            -
                 * @prop {String|Array} behavior='flip'
-            -
                 * The behavior used to change the popper's placement. It can be one of
-            -
                 * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid
-            -
                 * placements (with optional variations).
-            -
                 */
-            -
                behavior: 'flip',
-            -
                /**
-            -
                 * @prop {number} padding=5
-            -
                 * The popper will flip if it hits the edges of the `boundariesElement`
-            -
                 */
-            -
                padding: 5,
-            -
                /**
-            -
                 * @prop {String|HTMLElement} boundariesElement='viewport'
-            -
                 * The element which will define the boundaries of the popper position,
-            -
                 * the popper will never be placed outside of the defined boundaries
-            -
                 * (except if keepTogether is enabled)
-            -
                 */
-            -
                boundariesElement: 'viewport'
-            -
              },
               /**
-            -
               * Modifier used to make the popper flow toward the inner of the reference element.
-            -
               * By default, when this modifier is disabled, the popper will be placed outside
-            -
               * the reference element.
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              inner: {
-            -
                /** @prop {number} order=700 - Index used to define the order of execution */
-            -
                order: 700,
-            -
                /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */
-            -
                enabled: false,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: inner
-            -
              },
               /**
-            -
               * Modifier used to hide the popper when its reference element is outside of the
-            -
               * popper boundaries. It will set a `x-out-of-boundaries` attribute which can
-            -
               * be used to hide with a CSS selector the popper when its reference is
-            -
               * out of boundaries.
-            -
               *
-            -
               * Requires the `preventOverflow` modifier before it in order to work.
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              hide: {
-            -
                /** @prop {number} order=800 - Index used to define the order of execution */
-            -
                order: 800,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: hide
-            -
              },
               /**
-            -
               * Computes the style that will be applied to the popper element to gets
-            -
               * properly positioned.
-            -
               *
-            -
               * Note that this modifier will not touch the DOM, it just prepares the styles
-            -
               * so that `applyStyle` modifier can apply it. This separation is useful
-            -
               * in case you need to replace `applyStyle` with a custom implementation.
+               *
-            -
               * This modifier has `850` as `order` value to maintain backward compatibility
-            -
               * with previous versions of Popper.js. Expect the modifiers ordering method
-            -
               * to change in future major versions of the library.
+               *
-            -
               * @memberof modifiers
-            -
               * @inner
                */
-            -
              computeStyle: {
-            -
                /** @prop {number} order=850 - Index used to define the order of execution */
-            -
                order: 850,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: computeStyle,
                 /**
-            -
                 * @prop {Boolean} gpuAcceleration=true
-            -
                 * If true, it uses the CSS 3d transformation to position the popper.
-            -
                 * Otherwise, it will use the `top` and `left` properties.
                  */
-            -
                gpuAcceleration: true,
                 /**
-            -
                 * @prop {string} [x='bottom']
-            -
                 * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin.
-            -
                 * Change this if your popper should grow in a direction different from `bottom`
                  */
-            -
                x: 'bottom',
                 /**
-            -
                 * @prop {string} [x='left']
-            -
                 * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin.
-            -
                 * Change this if your popper should grow in a direction different from `right`
                  */
-            -
                y: 'right'
-            -
              },
-            -
              /**
-            -
               * Applies the computed styles to the popper element.
-            -
               *
-            -
               * All the DOM manipulations are limited to this modifier. This is useful in case
-            -
               * you want to integrate Popper.js inside a framework or view library and you
-            -
               * want to delegate all the DOM manipulations to it.
-            -
               *
-            -
               * Note that if you disable this modifier, you must make sure the popper element
-            -
               * has its position set to `absolute` before Popper.js can do its work!
-            -
               *
-            -
               * Just disable this modifier and define you own to achieve the desired effect.
-            -
               *
-            -
               * @memberof modifiers
-            -
               * @inner
-            -
               */
-            -
              applyStyle: {
-            -
                /** @prop {number} order=900 - Index used to define the order of execution */
-            -
                order: 900,
-            -
                /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
-            -
                enabled: true,
-            -
                /** @prop {ModifierFn} */
-            -
                fn: applyStyle,
-            -
                /** @prop {Function} */
-            -
                onLoad: applyStyleOnLoad,
                 /**
-            -
                 * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier
-            -
                 * @prop {Boolean} gpuAcceleration=true
-            -
                 * If true, it uses the CSS 3d transformation to position the popper.
-            -
                 * Otherwise, it will use the `top` and `left` properties.
                  */
-            -
                gpuAcceleration: undefined
-            -
              }
-            -
            };
-            -
-            -
            /**
-            -
             * The `dataObject` is an object containing all the informations used by Popper.js
-            -
             * this object get passed to modifiers and to the `onCreate` and `onUpdate` callbacks.
-            -
             * @name dataObject
-            -
             * @property {Object} data.instance The Popper.js instance
-            -
             * @property {String} data.placement Placement applied to popper
-            -
             * @property {String} data.originalPlacement Placement originally defined on init
-            -
             * @property {Boolean} data.flipped True if popper has been flipped by flip modifier
-            -
             * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper.
-            -
             * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier
-            -
             * @property {Object} data.styles Any CSS property defined here will be applied to the popper, it expects the JavaScript nomenclature (eg. `marginBottom`)
-            -
             * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow, it expects the JavaScript nomenclature (eg. `marginBottom`)
-            -
             * @property {Object} data.boundaries Offsets of the popper boundaries
-            -
             * @property {Object} data.offsets The measurements of popper, reference and arrow elements.
-            -
             * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values
-            -
             * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values
-            -
             * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0
-            -
             */
-            -
-            -
            /**
-            -
             * Default options provided to Popper.js constructor.<br />
-            -
             * These can be overriden using the `options` argument of Popper.js.<br />
-            -
             * To override an option, simply pass as 3rd argument an object with the same
-            -
             * structure of this object, example:
-            -
             * ```
-            -
             * new Popper(ref, pop, {
-            -
             *   modifiers: {
-            -
             *     preventOverflow: { enabled: false }
-            -
             *   }
-            -
             * })
-            -
             * ```
-            -
             * @type {Object}
-            -
             * @static
-            -
             * @memberof Popper
-            -
             */
-            -
            var Defaults = {
-            -
              /**
-            -
               * Popper's placement
-            -
               * @prop {Popper.placements} placement='bottom'
-            -
               */
-            -
              placement: 'bottom',
-            -
              /**
-            -
               * Whether events (resize, scroll) are initially enabled
-            -
               * @prop {Boolean} eventsEnabled=true
-            -
               */
-            -
              eventsEnabled: true,
-            -
              /**
-            -
               * Set to true if you want to automatically remove the popper when
-            -
               * you call the `destroy` method.
-            -
               * @prop {Boolean} removeOnDestroy=false
-            -
               */
-            -
              removeOnDestroy: false,
               /**
-            -
               * Callback called when the popper is created.<br />
-            -
               * By default, is set to no-op.<br />
-            -
               * Access Popper.js instance with `data.instance`.
-            -
               * @prop {onCreate}
                */
-            -
              onCreate: function onCreate() {},
               /**
-            -
               * Callback called when the popper is updated, this callback is not called
-            -
               * on the initialization/creation of the popper, but only on subsequent
-            -
               * updates.<br />
-            -
               * By default, is set to no-op.<br />
-            -
               * Access Popper.js instance with `data.instance`.
-            -
               * @prop {onUpdate}
                */
-            -
              onUpdate: function onUpdate() {},
               /**
-            -
               * List of modifiers used to modify the offsets before they are applied to the popper.
-            -
               * They provide most of the functionalities of Popper.js
-            -
               * @prop {modifiers}
                */
-            -
              modifiers: modifiers
-            -
            };
-            -
-            -
            /**
-            -
             * @callback onCreate
-            -
             * @param {dataObject} data
-            -
             */
-            -
-            -
            /**
-            -
             * @callback onUpdate
-            -
             * @param {dataObject} data
-            -
             */
-            -
-            -
            // Utils
-            -
            // Methods
-            -
            var Popper = function () {
               /**
-            -
               * Create a new Popper.js instance
-            -
               * @class Popper
-            -
               * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper
-            -
               * @param {HTMLElement} popper - The HTML element used as popper.
-            -
               * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults)
-            -
               * @return {Object} instance - The generated Popper.js instance
                */
-            -
              function Popper(reference, popper) {
-            -
                var _this = this;
-            -
                var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
-            -
                classCallCheck(this, Popper);
-            -
                this.scheduleUpdate = function () {
-            -
                  return requestAnimationFrame(_this.update);
-            -
                };
-            -
                // make update() debounced, so that it only runs at most once-per-tick
-            -
                this.update = debounce(this.update.bind(this));
-            -
                // with {} we create a new object with the options inside it
-            -
                this.options = _extends$1({}, Popper.Defaults, options);
-            -
                // init state
-            -
                this.state = {
-            -
                  isDestroyed: false,
-            -
                  isCreated: false,
-            -
                  scrollParents: []
-            -
                };
-            -
                // get reference and popper elements (allow jQuery wrappers)
-            -
                this.reference = reference && reference.jquery ? reference[0] : reference;
-            -
                this.popper = popper && popper.jquery ? popper[0] : popper;
-            -
                // Deep merge modifiers options
-            -
                this.options.modifiers = {};
-            -
                Object.keys(_extends$1({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) {
-            -
                  _this.options.modifiers[name] = _extends$1({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {});
-            -
                });
-            -
                // Refactoring modifiers' list (Object => Array)
-            -
                this.modifiers = Object.keys(this.options.modifiers).map(function (name) {
-            -
                  return _extends$1({
-            -
                    name: name
-            -
                  }, _this.options.modifiers[name]);
-            -
                })
-            -
                // sort the modifiers by order
-            -
                .sort(function (a, b) {
-            -
                  return a.order - b.order;
-            -
                });
-            -
                // modifiers have the ability to execute arbitrary code when Popper.js get inited
-            -
                // such code is executed in the same order of its modifier
-            -
                // they could add new properties to their options configuration
-            -
                // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`!
-            -
                this.modifiers.forEach(function (modifierOptions) {
-            -
                  if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) {
-            -
                    modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state);
+                  }
-            -
                });
-            -
-            -
                // fire the first update to position the popper in the right place
-            -
                this.update();
-            -
                var eventsEnabled = this.options.eventsEnabled;
-            -
                if (eventsEnabled) {
-            -
                  // setup event listeners, they will take care of update the position in specific situations
-            -
                  this.enableEventListeners();
+                }
-            -
                this.state.eventsEnabled = eventsEnabled;
-            -
              }
-            -
              // We can't use class properties because they don't get listed in the
-            -
              // class prototype and break stuff like Sinon stubs
-            -
              createClass(Popper, [{
-            -
                key: 'update',
-            -
                value: function update$$1() {
-            -
                  return update.call(this);
-            -
                }
-            -
              }, {
-            -
                key: 'destroy',
-            -
                value: function destroy$$1() {
-            -
                  return destroy.call(this);
-            -
                }
-            -
              }, {
-            -
                key: 'enableEventListeners',
-            -
                value: function enableEventListeners$$1() {
-            -
                  return enableEventListeners.call(this);
-            -
                }
-            -
              }, {
-            -
                key: 'disableEventListeners',
-            -
                value: function disableEventListeners$$1() {
-            -
                  return disableEventListeners.call(this);
-            -
                }
-            -
                /**
-            -
                 * Schedule an update, it will run on the next UI update available
-            -
                 * @method scheduleUpdate
-            -
                 * @memberof Popper
-            -
                 */
-            -
                /**
-            -
                 * Collection of utilities useful when writing custom modifiers.
-            -
                 * Starting from version 1.7, this method is available only if you
-            -
                 * include `popper-utils.js` before `popper.js`.
-            -
                 *
-            -
                 * **DEPRECATION**: This way to access PopperUtils is deprecated
-            -
                 * and will be removed in v2! Use the PopperUtils module directly instead.
-            -
                 * Due to the high instability of the methods contained in Utils, we can't
-            -
                 * guarantee them to follow semver. Use them at your own risk!
-            -
                 * @static
-            -
                 * @private
-            -
                 * @type {Object}
-            -
                 * @deprecated since version 1.8
-            -
                 * @member Utils
-            -
                 * @memberof Popper
-            -
                 */
-            -
              }]);
-            -
              return Popper;
-            -
            }();
-            -
-            -
            /**
-            -
             * The `referenceObject` is an object that provides an interface compatible with Popper.js
-            -
             * and lets you use it as replacement of a real DOM node.<br />
-            -
             * You can use this method to position a popper relatively to a set of coordinates
-            -
             * in case you don't have a DOM node to use as reference.
-            -
             *
-            -
             * ```
-            -
             * new Popper(referenceObject, popperNode);
-            -
             * ```
-            -
             *
-            -
             * NB: This feature isn't supported in Internet Explorer 10
-            -
             * @name referenceObject
-            -
             * @property {Function} data.getBoundingClientRect
-            -
             * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method.
-            -
             * @property {number} data.clientWidth
-            -
             * An ES6 getter that will return the width of the virtual reference element.
-            -
             * @property {number} data.clientHeight
-            -
             * An ES6 getter that will return the height of the virtual reference element.
-            -
             */
-            -
-            -
-            -
            Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils;
-            -
            Popper.placements = placements;
-            -
            Popper.Defaults = Defaults;
-            -
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): dropdown.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
-            -
            var Dropdown = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'dropdown';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.dropdown';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
-            -
-            -
              var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key
-            -
-            -
              var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key
-            -
-            -
              var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key
-            -
-            -
              var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key
-            -
-            -
              var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse)
-            -
-            -
              var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE);
-            -
              var Event = {
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                CLICK: "click" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
-            -
                KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY,
-            -
                KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                DISABLED: 'disabled',
-            -
                SHOW: 'show',
-            -
                DROPUP: 'dropup',
-            -
                DROPRIGHT: 'dropright',
-            -
                DROPLEFT: 'dropleft',
-            -
                MENURIGHT: 'dropdown-menu-right',
-            -
                MENULEFT: 'dropdown-menu-left',
-            -
                POSITION_STATIC: 'position-static'
-            -
              };
-            -
              var Selector = {
-            -
                DATA_TOGGLE: '[data-toggle="dropdown"]',
-            -
                FORM_CHILD: '.dropdown form',
-            -
                MENU: '.dropdown-menu',
-            -
                NAVBAR_NAV: '.navbar-nav',
-            -
                VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled)'
-            -
              };
-            -
              var AttachmentMap = {
-            -
                TOP: 'top-start',
-            -
                TOPEND: 'top-end',
-            -
                BOTTOM: 'bottom-start',
-            -
                BOTTOMEND: 'bottom-end',
-            -
                RIGHT: 'right-start',
-            -
                RIGHTEND: 'right-end',
-            -
                LEFT: 'left-start',
-            -
                LEFTEND: 'left-end'
-            -
              };
-            -
              var Default = {
-            -
                offset: 0,
-            -
                flip: true,
-            -
                boundary: 'scrollParent'
-            -
              };
-            -
              var DefaultType = {
-            -
                offset: '(number|string|function)',
-            -
                flip: 'boolean',
-            -
                boundary: '(string|element)'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
              var Dropdown =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Dropdown(element, config) {
-            -
                  this._element = element;
-            -
                  this._popper = null;
-            -
                  this._config = this._getConfig(config);
-            -
                  this._menu = this._getMenuElement();
-            -
                  this._inNavbar = this._detectNavbar();
-            -
                  this._addEventListeners();
-            -
                } // Getters
-            -
                var _proto = Dropdown.prototype;
-            -
                // Public
-            -
                _proto.toggle = function toggle() {
-            -
                  if (this._element.disabled || $$$1(this._element).hasClass(ClassName.DISABLED)) {
-            -
                    return;
-            -
                  }
-            -
                  var parent = Dropdown._getParentFromElement(this._element);
-            -
                  var isActive = $$$1(this._menu).hasClass(ClassName.SHOW);
-            -
                  Dropdown._clearMenus();
-            -
                  if (isActive) {
-            -
                    return;
-            -
                  }
-            -
                  var relatedTarget = {
-            -
                    relatedTarget: this._element
-            -
                  };
-            -
                  var showEvent = $$$1.Event(Event.SHOW, relatedTarget);
-            -
                  $$$1(parent).trigger(showEvent);
-            -
                  if (showEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  } // Disable totally Popper.js for Dropdown in Navbar
-            -
                  if (!this._inNavbar) {
-            -
                    /**
-            -
                     * Check for Popper dependency
-            -
                     * Popper - https://popper.js.org
-            -
                     */
-            -
                    if (typeof Popper === 'undefined') {
-            -
                      throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)');
-            -
                    }
-            -
                    var element = this._element; // For dropup with alignment we use the parent as popper container
-            -
                    if ($$$1(parent).hasClass(ClassName.DROPUP)) {
-            -
                      if ($$$1(this._menu).hasClass(ClassName.MENULEFT) || $$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
-            -
                        element = parent;
-            -
                      }
-            -
                    } // If boundary is not `scrollParent`, then set position to `static`
-            -
                    // to allow the menu to "escape" the scroll parent's boundaries
-            -
                    // https://github.com/twbs/bootstrap/issues/24251
-            -
                    if (this._config.boundary !== 'scrollParent') {
-            -
                      $$$1(parent).addClass(ClassName.POSITION_STATIC);
-            -
                    }
-            -
                    this._popper = new Popper(element, this._menu, this._getPopperConfig());
-            -
                  } // If this is a touch-enabled device we add extra
-            -
                  // empty mouseover listeners to the body's immediate children;
-            -
                  // only needed because of broken event delegation on iOS
-            -
                  // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
-            -
                  if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) {
-            -
                    $$$1('body').children().on('mouseover', null, $$$1.noop);
-            -
                  }
-            -
                  this._element.focus();
-            -
                  this._element.setAttribute('aria-expanded', true);
-            -
                  $$$1(this._menu).toggleClass(ClassName.SHOW);
-            -
                  $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget));
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  $$$1(this._element).off(EVENT_KEY);
-            -
                  this._element = null;
-            -
                  this._menu = null;
-            -
                  if (this._popper !== null) {
-            -
                    this._popper.destroy();
-            -
                    this._popper = null;
-            -
                  }
-            -
                };
-            -
                _proto.update = function update() {
-            -
                  this._inNavbar = this._detectNavbar();
-            -
                  if (this._popper !== null) {
-            -
                    this._popper.scheduleUpdate();
-            -
                  }
-            -
                }; // Private
-            -
                _proto._addEventListeners = function _addEventListeners() {
-            -
                  var _this = this;
-            -
                  $$$1(this._element).on(Event.CLICK, function (event) {
-            -
                    event.preventDefault();
-            -
                    event.stopPropagation();
-            -
                    _this.toggle();
-            -
                  });
-            -
                };
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, this.constructor.Default, $$$1(this._element).data(), config);
-            -
                  Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._getMenuElement = function _getMenuElement() {
-            -
                  if (!this._menu) {
-            -
                    var parent = Dropdown._getParentFromElement(this._element);
-            -
                    this._menu = $$$1(parent).find(Selector.MENU)[0];
-            -
                  }
-            -
                  return this._menu;
-            -
                };
-            -
                _proto._getPlacement = function _getPlacement() {
-            -
                  var $parentDropdown = $$$1(this._element).parent();
-            -
                  var placement = AttachmentMap.BOTTOM; // Handle dropup
-            -
                  if ($parentDropdown.hasClass(ClassName.DROPUP)) {
-            -
                    placement = AttachmentMap.TOP;
-            -
                    if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
-            -
                      placement = AttachmentMap.TOPEND;
+                    }
-            -
                  } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) {
-            -
                    placement = AttachmentMap.RIGHT;
-            -
                  } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) {
-            -
                    placement = AttachmentMap.LEFT;
-            -
                  } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
-            -
                    placement = AttachmentMap.BOTTOMEND;
-            -
                  }
-            -
                  return placement;
-            -
                };
-            -
                _proto._detectNavbar = function _detectNavbar() {
-            -
                  return $$$1(this._element).closest('.navbar').length > 0;
-            -
                };
-            -
                _proto._getPopperConfig = function _getPopperConfig() {
-            -
                  var _this2 = this;
-            -
                  var offsetConf = {};
-            -
                  if (typeof this._config.offset === 'function') {
-            -
                    offsetConf.fn = function (data) {
-            -
                      data.offsets = _extends({}, data.offsets, _this2._config.offset(data.offsets) || {});
-            -
                      return data;
                     };
-            -
                  } else {
-            -
                    offsetConf.offset = this._config.offset;
-            -
                  }
-            -
                  var popperConfig = {
-            -
                    placement: this._getPlacement(),
-            -
                    modifiers: {
-            -
                      offset: offsetConf,
-            -
                      flip: {
-            -
                        enabled: this._config.flip
-            -
                      },
-            -
                      preventOverflow: {
-            -
                        boundariesElement: this._config.boundary
-            -
                      }
+                    }
-            -
                  };
-            -
                  return popperConfig;
-            -
                }; // Static
-            -
                Dropdown._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    var _config = typeof config === 'object' ? config : null;
-            -
                    if (!data) {
-            -
                      data = new Dropdown(this, _config);
-            -
                      $$$1(this).data(DATA_KEY, data);
-            -
                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
+                      }
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
                Dropdown._clearMenus = function _clearMenus(event) {
-            -
                  if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) {
-            -
                    return;
-            -
                  }
-            -
                  var toggles = $$$1.makeArray($$$1(Selector.DATA_TOGGLE));
-            -
                  for (var i = 0; i < toggles.length; i++) {
-            -
                    var parent = Dropdown._getParentFromElement(toggles[i]);
-            -
                    var context = $$$1(toggles[i]).data(DATA_KEY);
-            -
                    var relatedTarget = {
-            -
                      relatedTarget: toggles[i]
-            -
                    };
-            -
                    if (!context) {
-            -
                      continue;
-            -
                    }
-            -
                    var dropdownMenu = context._menu;
-            -
                    if (!$$$1(parent).hasClass(ClassName.SHOW)) {
-            -
                      continue;
-            -
                    }
-            -
                    if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) {
-            -
                      continue;
-            -
                    }
-            -
                    var hideEvent = $$$1.Event(Event.HIDE, relatedTarget);
-            -
                    $$$1(parent).trigger(hideEvent);
-            -
                    if (hideEvent.isDefaultPrevented()) {
-            -
                      continue;
-            -
                    } // If this is a touch-enabled device we remove the extra
-            -
                    // empty mouseover listeners we added for iOS support
-            -
                    if ('ontouchstart' in document.documentElement) {
-            -
                      $$$1('body').children().off('mouseover', null, $$$1.noop);
+                    }
-            -
                    toggles[i].setAttribute('aria-expanded', 'false');
-            -
                    $$$1(dropdownMenu).removeClass(ClassName.SHOW);
-            -
                    $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget));
-            -
                  }
-            -
                };
-            -
                Dropdown._getParentFromElement = function _getParentFromElement(element) {
-            -
                  var parent;
-            -
                  var selector = Util.getSelectorFromElement(element);
-            -
                  if (selector) {
-            -
                    parent = $$$1(selector)[0];
-            -
                  }
-            -
                  return parent || element.parentNode;
-            -
                }; // eslint-disable-next-line complexity
-            -
                Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
-            -
                  // If not input/textarea:
-            -
                  //  - And not a key in REGEXP_KEYDOWN => not a dropdown command
-            -
                  // If input/textarea:
-            -
                  //  - If space key => not a dropdown command
-            -
                  //  - If key is other than escape
-            -
                  //    - If key is not up or down => not a dropdown command
-            -
                  //    - If trigger inside the menu => not a dropdown command
-            -
                  if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
-            -
                    return;
-            -
                  }
-            -
                  event.preventDefault();
-            -
                  event.stopPropagation();
-            -
                  if (this.disabled || $$$1(this).hasClass(ClassName.DISABLED)) {
-            -
                    return;
-            -
                  }
-            -
                  var parent = Dropdown._getParentFromElement(this);
-            -
                  var isActive = $$$1(parent).hasClass(ClassName.SHOW);
-            -
                  if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
-            -
                    if (event.which === ESCAPE_KEYCODE) {
-            -
                      var toggle = $$$1(parent).find(Selector.DATA_TOGGLE)[0];
-            -
                      $$$1(toggle).trigger('focus');
+                    }
-            -
                    $$$1(this).trigger('click');
-            -
                    return;
-            -
                  }
-            -
-            -
                  var items = $$$1(parent).find(Selector.VISIBLE_ITEMS).get();
-            -
                  if (items.length === 0) {
-            -
                    return;
-            -
                  }
-            -
                  var index = items.indexOf(event.target);
-            -
                  if (event.which === ARROW_UP_KEYCODE && index > 0) {
-            -
                    // Up
-            -
                    index--;
-            -
                  }
-            -
                  if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
-            -
                    // Down
-            -
                    index++;
-            -
                  }
-            -
                  if (index < 0) {
-            -
                    index = 0;
-            -
                  }
-            -
                  items[index].focus();
-            -
                };
-            -
                _createClass(Dropdown, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }, {
-            -
                  key: "DefaultType",
-            -
                  get: function get() {
-            -
                    return DefaultType;
-            -
                  }
-            -
                }]);
-            -
                return Dropdown;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
-            -
                event.preventDefault();
-            -
                event.stopPropagation();
-            -
                Dropdown._jQueryInterface.call($$$1(this), 'toggle');
-            -
              }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) {
-            -
                e.stopPropagation();
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Dropdown._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Dropdown;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Dropdown._jQueryInterface;
-            -
              };
-            -
              return Dropdown;
-            -
            }($, Popper);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): modal.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Modal = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'modal';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.modal';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 300;
-            -
              var BACKDROP_TRANSITION_DURATION = 150;
-            -
              var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
-            -
-            -
              var Default = {
-            -
                backdrop: true,
-            -
                keyboard: true,
-            -
                focus: true,
-            -
                show: true
-            -
              };
-            -
              var DefaultType = {
-            -
                backdrop: '(boolean|string)',
-            -
                keyboard: 'boolean',
-            -
                focus: 'boolean',
-            -
                show: 'boolean'
-            -
              };
-            -
              var Event = {
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                FOCUSIN: "focusin" + EVENT_KEY,
-            -
                RESIZE: "resize" + EVENT_KEY,
-            -
                CLICK_DISMISS: "click.dismiss" + EVENT_KEY,
-            -
                KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY,
-            -
                MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY,
-            -
                MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                SCROLLBAR_MEASURER: 'modal-scrollbar-measure',
-            -
                BACKDROP: 'modal-backdrop',
-            -
                OPEN: 'modal-open',
-            -
                FADE: 'fade',
-            -
                SHOW: 'show'
-            -
              };
-            -
              var Selector = {
-            -
                DIALOG: '.modal-dialog',
-            -
                DATA_TOGGLE: '[data-toggle="modal"]',
-            -
                DATA_DISMISS: '[data-dismiss="modal"]',
-            -
                FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
-            -
                STICKY_CONTENT: '.sticky-top',
-            -
                NAVBAR_TOGGLER: '.navbar-toggler'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
-            -
              var Modal =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Modal(element, config) {
-            -
                  this._config = this._getConfig(config);
-            -
                  this._element = element;
-            -
                  this._dialog = $$$1(element).find(Selector.DIALOG)[0];
-            -
                  this._backdrop = null;
-            -
                  this._isShown = false;
-            -
                  this._isBodyOverflowing = false;
-            -
                  this._ignoreBackdropClick = false;
-            -
                  this._originalBodyPadding = 0;
-            -
                  this._scrollbarWidth = 0;
-            -
                } // Getters
-            -
-            -
-            -
                var _proto = Modal.prototype;
-            -
-            -
                // Public
-            -
                _proto.toggle = function toggle(relatedTarget) {
-            -
                  return this._isShown ? this.hide() : this.show(relatedTarget);
                 };
-            -
                _proto.show = function show(relatedTarget) {
-            -
                  var _this = this;
-            -
                  if (this._isTransitioning || this._isShown) {
-            -
                    return;
-            -
                  }
-            -
                  if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) {
-            -
                    this._isTransitioning = true;
-            -
                  }
-            -
                  var showEvent = $$$1.Event(Event.SHOW, {
-            -
                    relatedTarget: relatedTarget
-            -
                  });
-            -
                  $$$1(this._element).trigger(showEvent);
-            -
                  if (this._isShown || showEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  this._isShown = true;
-            -
                  this._checkScrollbar();
-            -
                  this._setScrollbar();
-            -
                  this._adjustDialog();
-            -
                  $$$1(document.body).addClass(ClassName.OPEN);
-            -
                  this._setEscapeEvent();
-            -
                  this._setResizeEvent();
-            -
                  $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) {
-            -
                    return _this.hide(event);
-            -
                  });
-            -
                  $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () {
-            -
                    $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) {
-            -
                      if ($$$1(event.target).is(_this._element)) {
-            -
                        _this._ignoreBackdropClick = true;
-            -
                      }
                     });
-            -
                  });
-            -
                  this._showBackdrop(function () {
-            -
                    return _this._showElement(relatedTarget);
-            -
                  });
-            -
                };
-            -
                _proto.hide = function hide(event) {
-            -
                  var _this2 = this;
-            -
                  if (event) {
-            -
                    event.preventDefault();
-            -
                  }
-            -
                  if (this._isTransitioning || !this._isShown) {
-            -
                    return;
-            -
                  }
-            -
                  var hideEvent = $$$1.Event(Event.HIDE);
-            -
                  $$$1(this._element).trigger(hideEvent);
-            -
                  if (!this._isShown || hideEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  this._isShown = false;
-            -
                  var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE);
-            -
                  if (transition) {
-            -
                    this._isTransitioning = true;
-            -
                  }
-            -
                  this._setEscapeEvent();
-            -
                  this._setResizeEvent();
-            -
                  $$$1(document).off(Event.FOCUSIN);
-            -
                  $$$1(this._element).removeClass(ClassName.SHOW);
-            -
                  $$$1(this._element).off(Event.CLICK_DISMISS);
-            -
                  $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS);
-            -
                  if (transition) {
-            -
                    $$$1(this._element).one(Util.TRANSITION_END, function (event) {
-            -
                      return _this2._hideModal(event);
-            -
                    }).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  } else {
-            -
                    this._hideModal();
-            -
                  }
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY);
-            -
                  this._config = null;
-            -
                  this._element = null;
-            -
                  this._dialog = null;
-            -
                  this._backdrop = null;
-            -
                  this._isShown = null;
-            -
                  this._isBodyOverflowing = null;
-            -
                  this._ignoreBackdropClick = null;
-            -
                  this._scrollbarWidth = null;
-            -
                };
-            -
                _proto.handleUpdate = function handleUpdate() {
-            -
                  this._adjustDialog();
-            -
                }; // Private
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, Default, config);
-            -
                  Util.typeCheckConfig(NAME, config, DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._showElement = function _showElement(relatedTarget) {
-            -
                  var _this3 = this;
-            -
                  var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE);
-            -
                  if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) {
-            -
                    // Don't move modal's DOM position
-            -
                    document.body.appendChild(this._element);
-            -
                  }
-            -
                  this._element.style.display = 'block';
-            -
                  this._element.removeAttribute('aria-hidden');
-            -
                  this._element.scrollTop = 0;
-            -
                  if (transition) {
-            -
                    Util.reflow(this._element);
-            -
                  }
-            -
                  $$$1(this._element).addClass(ClassName.SHOW);
-            -
                  if (this._config.focus) {
-            -
                    this._enforceFocus();
-            -
                  }
-            -
                  var shownEvent = $$$1.Event(Event.SHOWN, {
-            -
                    relatedTarget: relatedTarget
-            -
                  });
-            -
                  var transitionComplete = function transitionComplete() {
-            -
                    if (_this3._config.focus) {
-            -
                      _this3._element.focus();
+                    }
-            -
                    _this3._isTransitioning = false;
-            -
                    $$$1(_this3._element).trigger(shownEvent);
                   };
-            -
                  if (transition) {
-            -
                    $$$1(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  } else {
-            -
                    transitionComplete();
-            -
                  }
-            -
                };
-            -
                _proto._enforceFocus = function _enforceFocus() {
-            -
                  var _this4 = this;
-            -
                  $$$1(document).off(Event.FOCUSIN) // Guard against infinite focus loop
-            -
                  .on(Event.FOCUSIN, function (event) {
-            -
                    if (document !== event.target && _this4._element !== event.target && $$$1(_this4._element).has(event.target).length === 0) {
-            -
                      _this4._element.focus();
+                    }
-            -
                  });
-            -
                };
-            -
                _proto._setEscapeEvent = function _setEscapeEvent() {
-            -
                  var _this5 = this;
-            -
                  if (this._isShown && this._config.keyboard) {
-            -
                    $$$1(this._element).on(Event.KEYDOWN_DISMISS, function (event) {
-            -
                      if (event.which === ESCAPE_KEYCODE) {
-            -
                        event.preventDefault();
-            -
                        _this5.hide();
-            -
                      }
-            -
                    });
-            -
                  } else if (!this._isShown) {
-            -
                    $$$1(this._element).off(Event.KEYDOWN_DISMISS);
-            -
                  }
-            -
                };
-            -
                _proto._setResizeEvent = function _setResizeEvent() {
-            -
                  var _this6 = this;
-            -
                  if (this._isShown) {
-            -
                    $$$1(window).on(Event.RESIZE, function (event) {
-            -
                      return _this6.handleUpdate(event);
-            -
                    });
-            -
                  } else {
-            -
                    $$$1(window).off(Event.RESIZE);
-            -
                  }
-            -
                };
-            -
                _proto._hideModal = function _hideModal() {
-            -
                  var _this7 = this;
-            -
                  this._element.style.display = 'none';
-            -
                  this._element.setAttribute('aria-hidden', true);
-            -
                  this._isTransitioning = false;
-            -
                  this._showBackdrop(function () {
-            -
                    $$$1(document.body).removeClass(ClassName.OPEN);
-            -
                    _this7._resetAdjustments();
-            -
                    _this7._resetScrollbar();
-            -
                    $$$1(_this7._element).trigger(Event.HIDDEN);
-            -
                  });
-            -
                };
-            -
                _proto._removeBackdrop = function _removeBackdrop() {
-            -
                  if (this._backdrop) {
-            -
                    $$$1(this._backdrop).remove();
-            -
                    this._backdrop = null;
-            -
                  }
-            -
                };
-            -
                _proto._showBackdrop = function _showBackdrop(callback) {
-            -
                  var _this8 = this;
-            -
                  var animate = $$$1(this._element).hasClass(ClassName.FADE) ? ClassName.FADE : '';
-            -
                  if (this._isShown && this._config.backdrop) {
-            -
                    var doAnimate = Util.supportsTransitionEnd() && animate;
-            -
                    this._backdrop = document.createElement('div');
-            -
                    this._backdrop.className = ClassName.BACKDROP;
-            -
                    if (animate) {
-            -
                      $$$1(this._backdrop).addClass(animate);
-            -
                    }
-            -
                    $$$1(this._backdrop).appendTo(document.body);
-            -
                    $$$1(this._element).on(Event.CLICK_DISMISS, function (event) {
-            -
                      if (_this8._ignoreBackdropClick) {
-            -
                        _this8._ignoreBackdropClick = false;
                         return;
+                      }
-            -
                      if (event.target !== event.currentTarget) {
                         return;
+                      }
-            -
                      if (_this8._config.backdrop === 'static') {
-            -
                        _this8._element.focus();
-            -
                      } else {
-            -
                        _this8.hide();
-            -
                      }
-            -
                    });
-            -
                    if (doAnimate) {
-            -
                      Util.reflow(this._backdrop);
-            -
                    }
-            -
                    $$$1(this._backdrop).addClass(ClassName.SHOW);
-            -
                    if (!callback) {
-            -
                      return;
-            -
                    }
-            -
                    if (!doAnimate) {
                       callback();
-            -
                      return;
+                    }
-            -
                    $$$1(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION);
-            -
                  } else if (!this._isShown && this._backdrop) {
-            -
                    $$$1(this._backdrop).removeClass(ClassName.SHOW);
-            -
                    var callbackRemove = function callbackRemove() {
-            -
                      _this8._removeBackdrop();
-            -
-            -
                      if (callback) {
-            -
                        callback();
-            -
                      }
-            -
                    };
-            -
                    if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) {
-            -
                      $$$1(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION);
-            -
                    } else {
-            -
                      callbackRemove();
+                    }
-            -
                  } else if (callback) {
-            -
                    callback();
-            -
                  }
-            -
                }; // ----------------------------------------------------------------------
-            -
                // the following methods are used to handle overflowing modals
-            -
                // todo (fat): these should probably be refactored out of modal.js
-            -
                // ----------------------------------------------------------------------
-            -
                _proto._adjustDialog = function _adjustDialog() {
-            -
                  var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;
-            -
                  if (!this._isBodyOverflowing && isModalOverflowing) {
-            -
                    this._element.style.paddingLeft = this._scrollbarWidth + "px";
-            -
                  }
-            -
                  if (this._isBodyOverflowing && !isModalOverflowing) {
-            -
                    this._element.style.paddingRight = this._scrollbarWidth + "px";
-            -
                  }
-            -
                };
-            -
                _proto._resetAdjustments = function _resetAdjustments() {
-            -
                  this._element.style.paddingLeft = '';
-            -
                  this._element.style.paddingRight = '';
-            -
                };
-            -
                _proto._checkScrollbar = function _checkScrollbar() {
-            -
                  var rect = document.body.getBoundingClientRect();
-            -
                  this._isBodyOverflowing = rect.left + rect.right < window.innerWidth;
-            -
                  this._scrollbarWidth = this._getScrollbarWidth();
-            -
                };
-            -
                _proto._setScrollbar = function _setScrollbar() {
-            -
                  var _this9 = this;
-            -
                  if (this._isBodyOverflowing) {
-            -
                    // Note: DOMNode.style.paddingRight returns the actual value or '' if not set
-            -
                    //   while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
-            -
                    // Adjust fixed content padding
-            -
                    $$$1(Selector.FIXED_CONTENT).each(function (index, element) {
-            -
                      var actualPadding = $$$1(element)[0].style.paddingRight;
-            -
                      var calculatedPadding = $$$1(element).css('padding-right');
-            -
                      $$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
-            -
                    }); // Adjust sticky content margin
-            -
-            -
                    $$$1(Selector.STICKY_CONTENT).each(function (index, element) {
-            -
                      var actualMargin = $$$1(element)[0].style.marginRight;
-            -
                      var calculatedMargin = $$$1(element).css('margin-right');
-            -
                      $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
-            -
                    }); // Adjust navbar-toggler margin
-            -
-            -
                    $$$1(Selector.NAVBAR_TOGGLER).each(function (index, element) {
-            -
                      var actualMargin = $$$1(element)[0].style.marginRight;
-            -
                      var calculatedMargin = $$$1(element).css('margin-right');
-            -
                      $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) + _this9._scrollbarWidth + "px");
-            -
                    }); // Adjust body padding
-            -
-            -
                    var actualPadding = document.body.style.paddingRight;
-            -
                    var calculatedPadding = $$$1('body').css('padding-right');
-            -
                    $$$1('body').data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px");
-            -
                  }
-            -
                };
-            -
                _proto._resetScrollbar = function _resetScrollbar() {
-            -
                  // Restore fixed content padding
-            -
                  $$$1(Selector.FIXED_CONTENT).each(function (index, element) {
-            -
                    var padding = $$$1(element).data('padding-right');
                     if (typeof padding !== 'undefined') {
-            -
                      $$$1(element).css('padding-right', padding).removeData('padding-right');
-            -
                    }
-            -
                  }); // Restore sticky content and navbar-toggler margin
-            -
-            -
                  $$$1(Selector.STICKY_CONTENT + ", " + Selector.NAVBAR_TOGGLER).each(function (index, element) {
-            -
                    var margin = $$$1(element).data('margin-right');
-            -
-            -
                    if (typeof margin !== 'undefined') {
-            -
                      $$$1(element).css('margin-right', margin).removeData('margin-right');
+                    }
-            -
                  }); // Restore body padding
-            -
-            -
                  var padding = $$$1('body').data('padding-right');
-            -
                  if (typeof padding !== 'undefined') {
-            -
                    $$$1('body').css('padding-right', padding).removeData('padding-right');
-            -
                  }
-            -
                };
-            -
                _proto._getScrollbarWidth = function _getScrollbarWidth() {
-            -
                  // thx d.walsh
-            -
                  var scrollDiv = document.createElement('div');
-            -
                  scrollDiv.className = ClassName.SCROLLBAR_MEASURER;
-            -
                  document.body.appendChild(scrollDiv);
-            -
                  var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth;
-            -
                  document.body.removeChild(scrollDiv);
-            -
                  return scrollbarWidth;
-            -
                }; // Static
-            -
                Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    var _config = _extends({}, Modal.Default, $$$1(this).data(), typeof config === 'object' && config);
-            -
                    if (!data) {
-            -
                      data = new Modal(this, _config);
-            -
                      $$$1(this).data(DATA_KEY, data);
-            -
                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
+                      }
-            -
                      data[config](relatedTarget);
-            -
                    } else if (_config.show) {
-            -
                      data.show(relatedTarget);
+                    }
-            -
                  });
-            -
                };
-            -
-            -
                _createClass(Modal, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }]);
-            -
                return Modal;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
-            -
                var _this10 = this;
-            -
                var target;
-            -
                var selector = Util.getSelectorFromElement(this);
-            -
                if (selector) {
-            -
                  target = $$$1(selector)[0];
-            -
                }
-            -
                var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _extends({}, $$$1(target).data(), $$$1(this).data());
-            -
                if (this.tagName === 'A' || this.tagName === 'AREA') {
-            -
                  event.preventDefault();
-            -
                }
-            -
                var $target = $$$1(target).one(Event.SHOW, function (showEvent) {
-            -
                  if (showEvent.isDefaultPrevented()) {
-            -
                    // Only register focus restorer if modal will actually get shown
-            -
                    return;
+                  }
-            -
                  $target.one(Event.HIDDEN, function () {
-            -
                    if ($$$1(_this10).is(':visible')) {
-            -
                      _this10.focus();
+                    }
-            -
                  });
-            -
                });
-            -
                Modal._jQueryInterface.call($$$1(target), config, this);
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Modal._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Modal;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Modal._jQueryInterface;
-            -
              };
-            -
              return Modal;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): tooltip.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Tooltip = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'tooltip';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.tooltip';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 150;
-            -
              var CLASS_PREFIX = 'bs-tooltip';
-            -
              var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g');
-            -
              var DefaultType = {
-            -
                animation: 'boolean',
-            -
                template: 'string',
-            -
                title: '(string|element|function)',
-            -
                trigger: 'string',
-            -
                delay: '(number|object)',
-            -
                html: 'boolean',
-            -
                selector: '(string|boolean)',
-            -
                placement: '(string|function)',
-            -
                offset: '(number|string)',
-            -
                container: '(string|element|boolean)',
-            -
                fallbackPlacement: '(string|array)',
-            -
                boundary: '(string|element)'
-            -
              };
-            -
              var AttachmentMap = {
-            -
                AUTO: 'auto',
-            -
                TOP: 'top',
-            -
                RIGHT: 'right',
-            -
                BOTTOM: 'bottom',
-            -
                LEFT: 'left'
-            -
              };
-            -
              var Default = {
-            -
                animation: true,
-            -
                template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>',
-            -
                trigger: 'hover focus',
-            -
                title: '',
-            -
                delay: 0,
-            -
                html: false,
-            -
                selector: false,
-            -
                placement: 'top',
-            -
                offset: 0,
-            -
                container: false,
-            -
                fallbackPlacement: 'flip',
-            -
                boundary: 'scrollParent'
-            -
              };
-            -
              var HoverState = {
-            -
                SHOW: 'show',
-            -
                OUT: 'out'
-            -
              };
-            -
              var Event = {
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                INSERTED: "inserted" + EVENT_KEY,
-            -
                CLICK: "click" + EVENT_KEY,
-            -
                FOCUSIN: "focusin" + EVENT_KEY,
-            -
                FOCUSOUT: "focusout" + EVENT_KEY,
-            -
                MOUSEENTER: "mouseenter" + EVENT_KEY,
-            -
                MOUSELEAVE: "mouseleave" + EVENT_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                FADE: 'fade',
-            -
                SHOW: 'show'
-            -
              };
-            -
              var Selector = {
-            -
                TOOLTIP: '.tooltip',
-            -
                TOOLTIP_INNER: '.tooltip-inner',
-            -
                ARROW: '.arrow'
-            -
              };
-            -
              var Trigger = {
-            -
                HOVER: 'hover',
-            -
                FOCUS: 'focus',
-            -
                CLICK: 'click',
-            -
                MANUAL: 'manual'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
-            -
              };
-            -
-            -
              var Tooltip =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Tooltip(element, config) {
                   /**
-            -
                   * Check for Popper dependency
-            -
                   * Popper - https://popper.js.org
                    */
-            -
                  if (typeof Popper === 'undefined') {
-            -
                    throw new TypeError('Bootstrap tooltips require Popper.js (https://popper.js.org)');
-            -
                  } // private
-            -
                  this._isEnabled = true;
-            -
                  this._timeout = 0;
-            -
                  this._hoverState = '';
-            -
                  this._activeTrigger = {};
-            -
                  this._popper = null; // Protected
-            -
                  this.element = element;
-            -
                  this.config = this._getConfig(config);
-            -
                  this.tip = null;
-            -
                  this._setListeners();
-            -
                } // Getters
-            -
                var _proto = Tooltip.prototype;
-            -
                // Public
-            -
                _proto.enable = function enable() {
-            -
                  this._isEnabled = true;
-            -
                };
-            -
                _proto.disable = function disable() {
-            -
                  this._isEnabled = false;
-            -
                };
-            -
                _proto.toggleEnabled = function toggleEnabled() {
-            -
                  this._isEnabled = !this._isEnabled;
-            -
                };
-            -
                _proto.toggle = function toggle(event) {
-            -
                  if (!this._isEnabled) {
-            -
                    return;
-            -
                  }
-            -
                  if (event) {
-            -
                    var dataKey = this.constructor.DATA_KEY;
-            -
                    var context = $$$1(event.currentTarget).data(dataKey);
-            -
                    if (!context) {
-            -
                      context = new this.constructor(event.currentTarget, this._getDelegateConfig());
-            -
                      $$$1(event.currentTarget).data(dataKey, context);
+                    }
-            -
                    context._activeTrigger.click = !context._activeTrigger.click;
-            -
                    if (context._isWithActiveTrigger()) {
-            -
                      context._enter(null, context);
                     } else {
-            -
                      context._leave(null, context);
-            -
                    }
-            -
                  } else {
-            -
                    if ($$$1(this.getTipElement()).hasClass(ClassName.SHOW)) {
-            -
                      this._leave(null, this);
-            -
                      return;
-            -
                    }
-            -
                    this._enter(null, this);
-            -
                  }
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  clearTimeout(this._timeout);
-            -
                  $$$1.removeData(this.element, this.constructor.DATA_KEY);
-            -
                  $$$1(this.element).off(this.constructor.EVENT_KEY);
-            -
                  $$$1(this.element).closest('.modal').off('hide.bs.modal');
-            -
                  if (this.tip) {
-            -
                    $$$1(this.tip).remove();
-            -
                  }
-            -
                  this._isEnabled = null;
-            -
                  this._timeout = null;
-            -
                  this._hoverState = null;
-            -
                  this._activeTrigger = null;
-            -
                  if (this._popper !== null) {
-            -
                    this._popper.destroy();
-            -
                  }
-            -
                  this._popper = null;
-            -
                  this.element = null;
-            -
                  this.config = null;
-            -
                  this.tip = null;
-            -
                };
-            -
                _proto.show = function show() {
-            -
                  var _this = this;
-            -
                  if ($$$1(this.element).css('display') === 'none') {
-            -
                    throw new Error('Please use show on visible elements');
-            -
                  }
-            -
                  var showEvent = $$$1.Event(this.constructor.Event.SHOW);
-            -
                  if (this.isWithContent() && this._isEnabled) {
-            -
                    $$$1(this.element).trigger(showEvent);
-            -
                    var isInTheDom = $$$1.contains(this.element.ownerDocument.documentElement, this.element);
-            -
                    if (showEvent.isDefaultPrevented() || !isInTheDom) {
-            -
                      return;
-            -
                    }
-            -
                    var tip = this.getTipElement();
-            -
                    var tipId = Util.getUID(this.constructor.NAME);
-            -
                    tip.setAttribute('id', tipId);
-            -
                    this.element.setAttribute('aria-describedby', tipId);
-            -
                    this.setContent();
-            -
                    if (this.config.animation) {
-            -
                      $$$1(tip).addClass(ClassName.FADE);
-            -
                    }
-            -
                    var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement;
-            -
                    var attachment = this._getAttachment(placement);
-            -
                    this.addAttachmentClass(attachment);
-            -
                    var container = this.config.container === false ? document.body : $$$1(this.config.container);
-            -
                    $$$1(tip).data(this.constructor.DATA_KEY, this);
-            -
                    if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) {
-            -
                      $$$1(tip).appendTo(container);
-            -
                    }
-            -
                    $$$1(this.element).trigger(this.constructor.Event.INSERTED);
-            -
                    this._popper = new Popper(this.element, tip, {
-            -
                      placement: attachment,
-            -
                      modifiers: {
-            -
                        offset: {
-            -
                          offset: this.config.offset
-            -
                        },
-            -
                        flip: {
-            -
                          behavior: this.config.fallbackPlacement
                         },
-            -
                        arrow: {
-            -
                          element: Selector.ARROW
                         },
-            -
                        preventOverflow: {
-            -
                          boundariesElement: this.config.boundary
-            -
                        }
-            -
                      },
-            -
                      onCreate: function onCreate(data) {
-            -
                        if (data.originalPlacement !== data.placement) {
                           _this._handlePopperPlacementChange(data);
+                        }
-            -
                      },
-            -
                      onUpdate: function onUpdate(data) {
-            -
                        _this._handlePopperPlacementChange(data);
+                      }
-            -
                    });
-            -
                    $$$1(tip).addClass(ClassName.SHOW); // If this is a touch-enabled device we add extra
-            -
                    // empty mouseover listeners to the body's immediate children;
-            -
                    // only needed because of broken event delegation on iOS
-            -
                    // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
-            -
                    if ('ontouchstart' in document.documentElement) {
-            -
                      $$$1('body').children().on('mouseover', null, $$$1.noop);
-            -
                    }
-            -
                    var complete = function complete() {
-            -
                      if (_this.config.animation) {
-            -
                        _this._fixTransition();
-            -
                      }
-            -
                      var prevHoverState = _this._hoverState;
-            -
                      _this._hoverState = null;
-            -
                      $$$1(_this.element).trigger(_this.constructor.Event.SHOWN);
-            -
                      if (prevHoverState === HoverState.OUT) {
-            -
                        _this._leave(null, _this);
+                      }
-            -
                    };
-            -
-            -
                    if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) {
-            -
                      $$$1(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(Tooltip._TRANSITION_DURATION);
-            -
                    } else {
-            -
                      complete();
+                    }
-            -
                  }
-            -
                };
-            -
                _proto.hide = function hide(callback) {
-            -
                  var _this2 = this;
-            -
                  var tip = this.getTipElement();
-            -
                  var hideEvent = $$$1.Event(this.constructor.Event.HIDE);
-            -
                  var complete = function complete() {
-            -
                    if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) {
-            -
                      tip.parentNode.removeChild(tip);
-            -
                    }
-            -
                    _this2._cleanTipClass();
-            -
                    _this2.element.removeAttribute('aria-describedby');
-            -
                    $$$1(_this2.element).trigger(_this2.constructor.Event.HIDDEN);
-            -
                    if (_this2._popper !== null) {
-            -
                      _this2._popper.destroy();
-            -
                    }
-            -
                    if (callback) {
-            -
                      callback();
-            -
                    }
-            -
                  };
-            -
                  $$$1(this.element).trigger(hideEvent);
-            -
                  if (hideEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  $$$1(tip).removeClass(ClassName.SHOW); // If this is a touch-enabled device we remove the extra
-            -
                  // empty mouseover listeners we added for iOS support
-            -
                  if ('ontouchstart' in document.documentElement) {
-            -
                    $$$1('body').children().off('mouseover', null, $$$1.noop);
-            -
                  }
-            -
                  this._activeTrigger[Trigger.CLICK] = false;
-            -
                  this._activeTrigger[Trigger.FOCUS] = false;
-            -
                  this._activeTrigger[Trigger.HOVER] = false;
-            -
                  if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) {
-            -
                    $$$1(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  } else {
-            -
                    complete();
-            -
                  }
-            -
                  this._hoverState = '';
-            -
                };
-            -
                _proto.update = function update() {
-            -
                  if (this._popper !== null) {
-            -
                    this._popper.scheduleUpdate();
-            -
                  }
-            -
                }; // Protected
-            -
                _proto.isWithContent = function isWithContent() {
-            -
                  return Boolean(this.getTitle());
-            -
                };
-            -
                _proto.addAttachmentClass = function addAttachmentClass(attachment) {
-            -
                  $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
-            -
                };
-            -
                _proto.getTipElement = function getTipElement() {
-            -
                  this.tip = this.tip || $$$1(this.config.template)[0];
-            -
                  return this.tip;
-            -
                };
-            -
                _proto.setContent = function setContent() {
-            -
                  var $tip = $$$1(this.getTipElement());
-            -
                  this.setElementContent($tip.find(Selector.TOOLTIP_INNER), this.getTitle());
-            -
                  $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW);
-            -
                };
-            -
                _proto.setElementContent = function setElementContent($element, content) {
-            -
                  var html = this.config.html;
-            -
                  if (typeof content === 'object' && (content.nodeType || content.jquery)) {
-            -
                    // Content is a DOM node or a jQuery
-            -
                    if (html) {
-            -
                      if (!$$$1(content).parent().is($element)) {
-            -
                        $element.empty().append(content);
+                      }
                     } else {
-            -
                      $element.text($$$1(content).text());
+                    }
-            -
                  } else {
-            -
                    $element[html ? 'html' : 'text'](content);
-            -
                  }
-            -
                };
-            -
                _proto.getTitle = function getTitle() {
-            -
                  var title = this.element.getAttribute('data-original-title');
-            -
                  if (!title) {
-            -
                    title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title;
-            -
                  }
-            -
                  return title;
-            -
                }; // Private
-            -
                _proto._getAttachment = function _getAttachment(placement) {
-            -
                  return AttachmentMap[placement.toUpperCase()];
-            -
                };
-            -
                _proto._setListeners = function _setListeners() {
-            -
                  var _this3 = this;
-            -
                  var triggers = this.config.trigger.split(' ');
-            -
                  triggers.forEach(function (trigger) {
-            -
                    if (trigger === 'click') {
-            -
                      $$$1(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) {
-            -
                        return _this3.toggle(event);
                       });
-            -
                    } else if (trigger !== Trigger.MANUAL) {
-            -
                      var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN;
-            -
                      var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT;
-            -
                      $$$1(_this3.element).on(eventIn, _this3.config.selector, function (event) {
-            -
                        return _this3._enter(event);
-            -
                      }).on(eventOut, _this3.config.selector, function (event) {
-            -
                        return _this3._leave(event);
                       });
+                    }
-            -
                    $$$1(_this3.element).closest('.modal').on('hide.bs.modal', function () {
-            -
                      return _this3.hide();
-            -
                    });
-            -
                  });
-            -
-            -
                  if (this.config.selector) {
-            -
                    this.config = _extends({}, this.config, {
-            -
                      trigger: 'manual',
-            -
                      selector: ''
-            -
                    });
-            -
                  } else {
-            -
                    this._fixTitle();
-            -
                  }
-            -
                };
-            -
                _proto._fixTitle = function _fixTitle() {
-            -
                  var titleType = typeof this.element.getAttribute('data-original-title');
-            -
                  if (this.element.getAttribute('title') || titleType !== 'string') {
-            -
                    this.element.setAttribute('data-original-title', this.element.getAttribute('title') || '');
-            -
                    this.element.setAttribute('title', '');
-            -
                  }
-            -
                };
-            -
                _proto._enter = function _enter(event, context) {
-            -
                  var dataKey = this.constructor.DATA_KEY;
-            -
                  context = context || $$$1(event.currentTarget).data(dataKey);
-            -
                  if (!context) {
-            -
                    context = new this.constructor(event.currentTarget, this._getDelegateConfig());
-            -
                    $$$1(event.currentTarget).data(dataKey, context);
-            -
                  }
-            -
                  if (event) {
-            -
                    context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true;
-            -
                  }
-            -
                  if ($$$1(context.getTipElement()).hasClass(ClassName.SHOW) || context._hoverState === HoverState.SHOW) {
                     context._hoverState = HoverState.SHOW;
-            -
                    return;
-            -
                  }
-            -
-            -
                  clearTimeout(context._timeout);
-            -
                  context._hoverState = HoverState.SHOW;
-            -
-            -
                  if (!context.config.delay || !context.config.delay.show) {
-            -
                    context.show();
-            -
                    return;
-            -
                  }
-            -
                  context._timeout = setTimeout(function () {
-            -
                    if (context._hoverState === HoverState.SHOW) {
                       context.show();
+                    }
-            -
                  }, context.config.delay.show);
-            -
                };
-            -
                _proto._leave = function _leave(event, context) {
-            -
                  var dataKey = this.constructor.DATA_KEY;
-            -
                  context = context || $$$1(event.currentTarget).data(dataKey);
-            -
                  if (!context) {
-            -
                    context = new this.constructor(event.currentTarget, this._getDelegateConfig());
-            -
                    $$$1(event.currentTarget).data(dataKey, context);
-            -
                  }
-            -
                  if (event) {
-            -
                    context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false;
-            -
                  }
-            -
                  if (context._isWithActiveTrigger()) {
-            -
                    return;
-            -
                  }
-            -
                  clearTimeout(context._timeout);
-            -
                  context._hoverState = HoverState.OUT;
-            -
                  if (!context.config.delay || !context.config.delay.hide) {
-            -
                    context.hide();
-            -
                    return;
-            -
                  }
-            -
                  context._timeout = setTimeout(function () {
-            -
                    if (context._hoverState === HoverState.OUT) {
                       context.hide();
+                    }
-            -
                  }, context.config.delay.hide);
-            -
                };
-            -
                _proto._isWithActiveTrigger = function _isWithActiveTrigger() {
-            -
                  for (var trigger in this._activeTrigger) {
-            -
                    if (this._activeTrigger[trigger]) {
-            -
                      return true;
+                    }
-            -
                  }
-            -
                  return false;
-            -
                };
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, this.constructor.Default, $$$1(this.element).data(), config);
-            -
                  if (typeof config.delay === 'number') {
-            -
                    config.delay = {
-            -
                      show: config.delay,
-            -
                      hide: config.delay
-            -
                    };
-            -
                  }
-            -
                  if (typeof config.title === 'number') {
-            -
                    config.title = config.title.toString();
-            -
                  }
-            -
                  if (typeof config.content === 'number') {
-            -
                    config.content = config.content.toString();
-            -
                  }
-            -
                  Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._getDelegateConfig = function _getDelegateConfig() {
-            -
                  var config = {};
-            -
                  if (this.config) {
-            -
                    for (var key in this.config) {
-            -
                      if (this.constructor.Default[key] !== this.config[key]) {
-            -
                        config[key] = this.config[key];
+                      }
+                    }
-            -
                  }
-            -
                  return config;
-            -
                };
-            -
                _proto._cleanTipClass = function _cleanTipClass() {
-            -
                  var $tip = $$$1(this.getTipElement());
-            -
                  var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
-            -
                  if (tabClass !== null && tabClass.length > 0) {
-            -
                    $tip.removeClass(tabClass.join(''));
-            -
                  }
-            -
                };
-            -
                _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(data) {
-            -
                  this._cleanTipClass();
-            -
                  this.addAttachmentClass(this._getAttachment(data.placement));
-            -
                };
-            -
                _proto._fixTransition = function _fixTransition() {
-            -
                  var tip = this.getTipElement();
-            -
                  var initConfigAnimation = this.config.animation;
-            -
                  if (tip.getAttribute('x-placement') !== null) {
-            -
                    return;
-            -
                  }
-            -
                  $$$1(tip).removeClass(ClassName.FADE);
-            -
                  this.config.animation = false;
-            -
                  this.hide();
-            -
                  this.show();
-            -
                  this.config.animation = initConfigAnimation;
-            -
                }; // Static
-            -
                Tooltip._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    var _config = typeof config === 'object' && config;
-            -
                    if (!data && /dispose|hide/.test(config)) {
-            -
                      return;
-            -
                    }
-            -
                    if (!data) {
-            -
                      data = new Tooltip(this, _config);
-            -
                      $$$1(this).data(DATA_KEY, data);
-            -
                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
+                      }
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
-            -
                _createClass(Tooltip, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }, {
-            -
                  key: "NAME",
-            -
                  get: function get() {
-            -
                    return NAME;
-            -
                  }
-            -
                }, {
-            -
                  key: "DATA_KEY",
-            -
                  get: function get() {
-            -
                    return DATA_KEY;
-            -
                  }
-            -
                }, {
-            -
                  key: "Event",
-            -
                  get: function get() {
-            -
                    return Event;
-            -
                  }
-            -
                }, {
-            -
                  key: "EVENT_KEY",
-            -
                  get: function get() {
-            -
                    return EVENT_KEY;
-            -
                  }
-            -
                }, {
-            -
                  key: "DefaultType",
-            -
                  get: function get() {
-            -
                    return DefaultType;
-            -
                  }
-            -
                }]);
-            -
                return Tooltip;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Tooltip._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Tooltip;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Tooltip._jQueryInterface;
-            -
              };
-            -
              return Tooltip;
-            -
            }($, Popper);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): popover.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Popover = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'popover';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.popover';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var CLASS_PREFIX = 'bs-popover';
-            -
              var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g');
-            -
              var Default = _extends({}, Tooltip.Default, {
-            -
                placement: 'right',
-            -
                trigger: 'click',
-            -
                content: '',
-            -
                template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>'
-            -
              });
-            -
              var DefaultType = _extends({}, Tooltip.DefaultType, {
-            -
                content: '(string|element|function)'
-            -
              });
-            -
              var ClassName = {
-            -
                FADE: 'fade',
-            -
                SHOW: 'show'
-            -
              };
-            -
              var Selector = {
-            -
                TITLE: '.popover-header',
-            -
                CONTENT: '.popover-body'
-            -
              };
-            -
              var Event = {
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                INSERTED: "inserted" + EVENT_KEY,
-            -
                CLICK: "click" + EVENT_KEY,
-            -
                FOCUSIN: "focusin" + EVENT_KEY,
-            -
                FOCUSOUT: "focusout" + EVENT_KEY,
-            -
                MOUSEENTER: "mouseenter" + EVENT_KEY,
-            -
                MOUSELEAVE: "mouseleave" + EVENT_KEY
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
-            -
              var Popover =
-            -
              /*#__PURE__*/
-            -
              function (_Tooltip) {
-            -
                _inheritsLoose(Popover, _Tooltip);
-            -
-            -
                function Popover() {
-            -
                  return _Tooltip.apply(this, arguments) || this;
-            -
                }
-            -
-            -
                var _proto = Popover.prototype;
-            -
                // Overrides
-            -
                _proto.isWithContent = function isWithContent() {
-            -
                  return this.getTitle() || this._getContent();
                 };
-            -
-            -
                _proto.addAttachmentClass = function addAttachmentClass(attachment) {
-            -
                  $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
                 };
-            -
                _proto.getTipElement = function getTipElement() {
-            -
                  this.tip = this.tip || $$$1(this.config.template)[0];
-            -
                  return this.tip;
                 };
-            -
                _proto.setContent = function setContent() {
-            -
                  var $tip = $$$1(this.getTipElement()); // We use append for html objects to maintain js events
-            -
                  this.setElementContent($tip.find(Selector.TITLE), this.getTitle());
-            -
                  var content = this._getContent();
-            -
                  if (typeof content === 'function') {
-            -
                    content = content.call(this.element);
-            -
                  }
-            -
                  this.setElementContent($tip.find(Selector.CONTENT), content);
-            -
                  $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW);
-            -
                }; // Private
-            -
                _proto._getContent = function _getContent() {
-            -
                  return this.element.getAttribute('data-content') || this.config.content;
-            -
                };
-            -
                _proto._cleanTipClass = function _cleanTipClass() {
-            -
                  var $tip = $$$1(this.getTipElement());
-            -
                  var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
-            -
                  if (tabClass !== null && tabClass.length > 0) {
-            -
                    $tip.removeClass(tabClass.join(''));
-            -
                  }
-            -
                }; // Static
-            -
                Popover._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    var _config = typeof config === 'object' ? config : null;
-            -
                    if (!data && /destroy|hide/.test(config)) {
-            -
                      return;
+                    }
-            -
                    if (!data) {
-            -
                      data = new Popover(this, _config);
-            -
                      $$$1(this).data(DATA_KEY, data);
-            -
                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
+                      }
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
-            -
                _createClass(Popover, null, [{
-            -
                  key: "VERSION",
-            -
                  // Getters
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }, {
-            -
                  key: "NAME",
-            -
                  get: function get() {
-            -
                    return NAME;
-            -
                  }
-            -
                }, {
-            -
                  key: "DATA_KEY",
-            -
                  get: function get() {
-            -
                    return DATA_KEY;
-            -
                  }
-            -
                }, {
-            -
                  key: "Event",
-            -
                  get: function get() {
-            -
                    return Event;
-            -
                  }
-            -
                }, {
-            -
                  key: "EVENT_KEY",
-            -
                  get: function get() {
-            -
                    return EVENT_KEY;
-            -
                  }
-            -
                }, {
-            -
                  key: "DefaultType",
-            -
                  get: function get() {
-            -
                    return DefaultType;
-            -
                  }
-            -
                }]);
-            -
                return Popover;
-            -
              }(Tooltip);
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Popover._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Popover;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Popover._jQueryInterface;
-            -
              };
-            -
              return Popover;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): scrollspy.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var ScrollSpy = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'scrollspy';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.scrollspy';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var Default = {
-            -
                offset: 10,
-            -
                method: 'auto',
-            -
                target: ''
-            -
              };
-            -
              var DefaultType = {
-            -
                offset: 'number',
-            -
                method: 'string',
-            -
                target: '(string|element)'
-            -
              };
-            -
              var Event = {
-            -
                ACTIVATE: "activate" + EVENT_KEY,
-            -
                SCROLL: "scroll" + EVENT_KEY,
-            -
                LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                DROPDOWN_ITEM: 'dropdown-item',
-            -
                DROPDOWN_MENU: 'dropdown-menu',
-            -
                ACTIVE: 'active'
-            -
              };
-            -
              var Selector = {
-            -
                DATA_SPY: '[data-spy="scroll"]',
-            -
                ACTIVE: '.active',
-            -
                NAV_LIST_GROUP: '.nav, .list-group',
-            -
                NAV_LINKS: '.nav-link',
-            -
                NAV_ITEMS: '.nav-item',
-            -
                LIST_ITEMS: '.list-group-item',
-            -
                DROPDOWN: '.dropdown',
-            -
                DROPDOWN_ITEMS: '.dropdown-item',
-            -
                DROPDOWN_TOGGLE: '.dropdown-toggle'
-            -
              };
-            -
              var OffsetMethod = {
-            -
                OFFSET: 'offset',
-            -
                POSITION: 'position'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
-            -
              var ScrollSpy =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function ScrollSpy(element, config) {
-            -
                  var _this = this;
-            -
                  this._element = element;
-            -
                  this._scrollElement = element.tagName === 'BODY' ? window : element;
-            -
                  this._config = this._getConfig(config);
-            -
                  this._selector = this._config.target + " " + Selector.NAV_LINKS + "," + (this._config.target + " " + Selector.LIST_ITEMS + ",") + (this._config.target + " " + Selector.DROPDOWN_ITEMS);
-            -
                  this._offsets = [];
-            -
                  this._targets = [];
-            -
                  this._activeTarget = null;
-            -
                  this._scrollHeight = 0;
-            -
                  $$$1(this._scrollElement).on(Event.SCROLL, function (event) {
-            -
                    return _this._process(event);
-            -
                  });
-            -
                  this.refresh();
-            -
                  this._process();
-            -
                } // Getters
-            -
                var _proto = ScrollSpy.prototype;
-            -
                // Public
-            -
                _proto.refresh = function refresh() {
-            -
                  var _this2 = this;
-            -
                  var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION;
-            -
                  var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method;
-            -
                  var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0;
-            -
                  this._offsets = [];
-            -
                  this._targets = [];
-            -
                  this._scrollHeight = this._getScrollHeight();
-            -
                  var targets = $$$1.makeArray($$$1(this._selector));
-            -
                  targets.map(function (element) {
-            -
                    var target;
-            -
                    var targetSelector = Util.getSelectorFromElement(element);
-            -
                    if (targetSelector) {
-            -
                      target = $$$1(targetSelector)[0];
-            -
                    }
-            -
                    if (target) {
-            -
                      var targetBCR = target.getBoundingClientRect();
-            -
                      if (targetBCR.width || targetBCR.height) {
-            -
                        // TODO (fat): remove sketch reliance on jQuery position/offset
-            -
                        return [$$$1(target)[offsetMethod]().top + offsetBase, targetSelector];
+                      }
-            -
                    }
-            -
                    return null;
-            -
                  }).filter(function (item) {
-            -
                    return item;
-            -
                  }).sort(function (a, b) {
-            -
                    return a[0] - b[0];
-            -
                  }).forEach(function (item) {
-            -
                    _this2._offsets.push(item[0]);
-            -
                    _this2._targets.push(item[1]);
-            -
                  });
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  $$$1(this._scrollElement).off(EVENT_KEY);
-            -
                  this._element = null;
-            -
                  this._scrollElement = null;
-            -
                  this._config = null;
-            -
                  this._selector = null;
-            -
                  this._offsets = null;
-            -
                  this._targets = null;
-            -
                  this._activeTarget = null;
-            -
                  this._scrollHeight = null;
-            -
                }; // Private
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, Default, config);
-            -
                  if (typeof config.target !== 'string') {
-            -
                    var id = $$$1(config.target).attr('id');
-            -
                    if (!id) {
-            -
                      id = Util.getUID(NAME);
-            -
                      $$$1(config.target).attr('id', id);
+                    }
-            -
                    config.target = "#" + id;
-            -
                  }
-            -
                  Util.typeCheckConfig(NAME, config, DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._getScrollTop = function _getScrollTop() {
-            -
                  return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop;
-            -
                };
-            -
                _proto._getScrollHeight = function _getScrollHeight() {
-            -
                  return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight);
-            -
                };
-            -
                _proto._getOffsetHeight = function _getOffsetHeight() {
-            -
                  return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height;
-            -
                };
-            -
                _proto._process = function _process() {
-            -
                  var scrollTop = this._getScrollTop() + this._config.offset;
-            -
                  var scrollHeight = this._getScrollHeight();
-            -
                  var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight();
-            -
                  if (this._scrollHeight !== scrollHeight) {
-            -
                    this.refresh();
-            -
                  }
-            -
                  if (scrollTop >= maxScroll) {
-            -
                    var target = this._targets[this._targets.length - 1];
-            -
                    if (this._activeTarget !== target) {
-            -
                      this._activate(target);
+                    }
-            -
                    return;
-            -
                  }
-            -
-            -
                  if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) {
-            -
                    this._activeTarget = null;
-            -
                    this._clear();
-            -
                    return;
-            -
                  }
-            -
                  for (var i = this._offsets.length; i--;) {
-            -
                    var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
-            -
                    if (isActiveTarget) {
-            -
                      this._activate(this._targets[i]);
+                    }
-            -
                  }
-            -
                };
-            -
                _proto._activate = function _activate(target) {
-            -
                  this._activeTarget = target;
-            -
                  this._clear();
-            -
                  var queries = this._selector.split(','); // eslint-disable-next-line arrow-body-style
-            -
                  queries = queries.map(function (selector) {
-            -
                    return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]");
-            -
                  });
-            -
                  var $link = $$$1(queries.join(','));
-            -
                  if ($link.hasClass(ClassName.DROPDOWN_ITEM)) {
-            -
                    $link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
-            -
                    $link.addClass(ClassName.ACTIVE);
-            -
                  } else {
-            -
                    // Set triggered link as active
-            -
                    $link.addClass(ClassName.ACTIVE); // Set triggered links parents as active
-            -
                    // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor
-            -
                    $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_LINKS + ", " + Selector.LIST_ITEMS).addClass(ClassName.ACTIVE); // Handle special case when .nav-link is inside .nav-item
-            -
                    $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_ITEMS).children(Selector.NAV_LINKS).addClass(ClassName.ACTIVE);
-            -
                  }
-            -
                  $$$1(this._scrollElement).trigger(Event.ACTIVATE, {
-            -
                    relatedTarget: target
-            -
                  });
-            -
                };
-            -
                _proto._clear = function _clear() {
-            -
                  $$$1(this._selector).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
-            -
                }; // Static
-            -
                ScrollSpy._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    var _config = typeof config === 'object' && config;
-            -
                    if (!data) {
-            -
                      data = new ScrollSpy(this, _config);
-            -
                      $$$1(this).data(DATA_KEY, data);
-            -
                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
+                      }
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
-            -
                _createClass(ScrollSpy, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }]);
-            -
                return ScrollSpy;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(window).on(Event.LOAD_DATA_API, function () {
-            -
                var scrollSpys = $$$1.makeArray($$$1(Selector.DATA_SPY));
-            -
                for (var i = scrollSpys.length; i--;) {
-            -
                  var $spy = $$$1(scrollSpys[i]);
-            -
                  ScrollSpy._jQueryInterface.call($spy, $spy.data());
-            -
                }
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = ScrollSpy._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = ScrollSpy;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return ScrollSpy._jQueryInterface;
-            -
              };
-            -
              return ScrollSpy;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): tab.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Tab = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'tab';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.tab';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 150;
-            -
              var Event = {
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                DROPDOWN_MENU: 'dropdown-menu',
-            -
                ACTIVE: 'active',
-            -
                DISABLED: 'disabled',
-            -
                FADE: 'fade',
-            -
                SHOW: 'show'
-            -
              };
-            -
              var Selector = {
-            -
                DROPDOWN: '.dropdown',
-            -
                NAV_LIST_GROUP: '.nav, .list-group',
-            -
                ACTIVE: '.active',
-            -
                ACTIVE_UL: '> li > .active',
-            -
                DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',
-            -
                DROPDOWN_TOGGLE: '.dropdown-toggle',
-            -
                DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
              var Tab =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Tab(element) {
-            -
                  this._element = element;
-            -
                } // Getters
-            -
                var _proto = Tab.prototype;
-            -
                // Public
-            -
                _proto.show = function show() {
-            -
                  var _this = this;
-            -
                  if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $$$1(this._element).hasClass(ClassName.ACTIVE) || $$$1(this._element).hasClass(ClassName.DISABLED)) {
-            -
                    return;
-            -
                  }
-            -
                  var target;
-            -
                  var previous;
-            -
                  var listElement = $$$1(this._element).closest(Selector.NAV_LIST_GROUP)[0];
-            -
                  var selector = Util.getSelectorFromElement(this._element);
-            -
-            -
                  if (listElement) {
-            -
                    var itemSelector = listElement.nodeName === 'UL' ? Selector.ACTIVE_UL : Selector.ACTIVE;
-            -
                    previous = $$$1.makeArray($$$1(listElement).find(itemSelector));
-            -
                    previous = previous[previous.length - 1];
-            -
                  }
-            -
                  var hideEvent = $$$1.Event(Event.HIDE, {
-            -
                    relatedTarget: this._element
-            -
                  });
-            -
                  var showEvent = $$$1.Event(Event.SHOW, {
-            -
                    relatedTarget: previous
-            -
                  });
-            -
                  if (previous) {
-            -
                    $$$1(previous).trigger(hideEvent);
-            -
                  }
-            -
                  $$$1(this._element).trigger(showEvent);
-            -
                  if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  if (selector) {
-            -
                    target = $$$1(selector)[0];
-            -
                  }
-            -
                  this._activate(this._element, listElement);
-            -
                  var complete = function complete() {
-            -
                    var hiddenEvent = $$$1.Event(Event.HIDDEN, {
-            -
                      relatedTarget: _this._element
-            -
                    });
-            -
                    var shownEvent = $$$1.Event(Event.SHOWN, {
-            -
                      relatedTarget: previous
-            -
                    });
-            -
                    $$$1(previous).trigger(hiddenEvent);
-            -
                    $$$1(_this._element).trigger(shownEvent);
                   };
-            -
                  if (target) {
-            -
                    this._activate(target, target.parentNode, complete);
-            -
                  } else {
-            -
                    complete();
-            -
                  }
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._element = null;
-            -
                }; // Private
-            -
                _proto._activate = function _activate(element, container, callback) {
-            -
                  var _this2 = this;
-            -
                  var activeElements;
-            -
                  if (container.nodeName === 'UL') {
-            -
                    activeElements = $$$1(container).find(Selector.ACTIVE_UL);
-            -
                  } else {
-            -
                    activeElements = $$$1(container).children(Selector.ACTIVE);
-            -
                  }
-            -
                  var active = activeElements[0];
-            -
                  var isTransitioning = callback && Util.supportsTransitionEnd() && active && $$$1(active).hasClass(ClassName.FADE);
-            -
                  var complete = function complete() {
-            -
                    return _this2._transitionComplete(element, active, callback);
                   };
-            -
                  if (active && isTransitioning) {
-            -
                    $$$1(active).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  } else {
-            -
                    complete();
-            -
                  }
-            -
                };
-            -
                _proto._transitionComplete = function _transitionComplete(element, active, callback) {
-            -
                  if (active) {
-            -
                    $$$1(active).removeClass(ClassName.SHOW + " " + ClassName.ACTIVE);
-            -
                    var dropdownChild = $$$1(active.parentNode).find(Selector.DROPDOWN_ACTIVE_CHILD)[0];
-            -
                    if (dropdownChild) {
-            -
                      $$$1(dropdownChild).removeClass(ClassName.ACTIVE);
+                    }
-            -
                    if (active.getAttribute('role') === 'tab') {
-            -
                      active.setAttribute('aria-selected', false);
-            -
                    }
-            -
                  }
-            -
                  $$$1(element).addClass(ClassName.ACTIVE);
-            -
                  if (element.getAttribute('role') === 'tab') {
-            -
                    element.setAttribute('aria-selected', true);
-            -
                  }
-            -
                  Util.reflow(element);
-            -
                  $$$1(element).addClass(ClassName.SHOW);
-            -
                  if (element.parentNode && $$$1(element.parentNode).hasClass(ClassName.DROPDOWN_MENU)) {
-            -
                    var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0];
-            -
                    if (dropdownElement) {
-            -
                      $$$1(dropdownElement).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
+                    }
-            -
                    element.setAttribute('aria-expanded', true);
-            -
                  }
-            -
                  if (callback) {
-            -
                    callback();
-            -
                  }
-            -
                }; // Static
-            -
                Tab._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var $this = $$$1(this);
-            -
                    var data = $this.data(DATA_KEY);
-            -
                    if (!data) {
-            -
                      data = new Tab(this);
-            -
                      $this.data(DATA_KEY, data);
-            -
                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
+                      }
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
                _createClass(Tab, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }]);
-            -
                return Tab;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
-            -
                event.preventDefault();
-            -
                Tab._jQueryInterface.call($$$1(this), 'show');
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Tab._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Tab;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Tab._jQueryInterface;
-            -
              };
-            -
              return Tab;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0-alpha.6): index.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            (function ($$$1) {
-            -
              if (typeof $$$1 === 'undefined') {
-            -
                throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.');
-            -
              }
-            -
              var version = $$$1.fn.jquery.split(' ')[0].split('.');
-            -
              var minMajor = 1;
-            -
              var ltMajor = 2;
-            -
              var minMinor = 9;
-            -
              var minPatch = 1;
-            -
              var maxMajor = 4;
-            -
              if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) {
-            -
                throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0');
-            -
              }
-            -
            })($);
-            -
-            -
            exports.Util = Util;
-            -
            exports.Alert = Alert;
-            -
            exports.Button = Button;
-            -
            exports.Carousel = Carousel;
-            -
            exports.Collapse = Collapse;
-            -
            exports.Dropdown = Dropdown;
-            -
            exports.Modal = Modal;
-            -
            exports.Popover = Popover;
-            -
            exports.Scrollspy = ScrollSpy;
-            -
            exports.Tab = Tab;
-            -
            exports.Tooltip = Tooltip;
-            -
-            -
            Object.defineProperty(exports, '__esModule', { value: true });
             })));
             //# sourceMappingURL=bootstrap.bundle.js.map


1	/*!
2	+ * Bootstrap v4.1.0 (https://getbootstrap.com/)
3	* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
4	* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
5	*/
6	(function (global, factory) {
7	+ typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery')) :
8	+ typeof define === 'function' && define.amd ? define(['exports', 'jquery'], factory) :
9	+ (factory((global.bootstrap = {}),global.jQuery));
10	}(this, (function (exports,$) { 'use strict';
11
12	+ $ = $ && $.hasOwnProperty('default') ? $['default'] : $;
13
14	+ function _defineProperties(target, props) {
15	+ for (var i = 0; i < props.length; i++) {
16	+ var descriptor = props[i];
17	+ descriptor.enumerable = descriptor.enumerable \|\| false;
18	+ descriptor.configurable = true;
19	+ if ("value" in descriptor) descriptor.writable = true;
20	+ Object.defineProperty(target, descriptor.key, descriptor);
21	+ }
22	+ }
23	+
24	+ function _createClass(Constructor, protoProps, staticProps) {
25	+ if (protoProps) _defineProperties(Constructor.prototype, protoProps);
26	+ if (staticProps) _defineProperties(Constructor, staticProps);
27	+ return Constructor;
28	}

29
30	+ function _defineProperty(obj, key, value) {
31	+ if (key in obj) {
32	+ Object.defineProperty(obj, key, {
33	+ value: value,
34	+ enumerable: true,
35	+ configurable: true,
36	+ writable: true
37	+ });
38	+ } else {
39	+ obj[key] = value;
40	+ }
41	+
42	+ return obj;
43	+ }
44
45	+ function _objectSpread(target) {

46	for (var i = 1; i < arguments.length; i++) {
47	+ var source = arguments[i] != null ? arguments[i] : {};
48	+ var ownKeys = Object.keys(source);
49
50	+ if (typeof Object.getOwnPropertySymbols === 'function') {
51	+ ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) {
52	+ return Object.getOwnPropertyDescriptor(source, sym).enumerable;
53	+ }));
54	}
55	+
56	+ ownKeys.forEach(function (key) {
57	+ _defineProperty(target, key, source[key]);
58	+ });
59	}
60
61	return target;
62	+ }









63
64	+ function _inheritsLoose(subClass, superClass) {
65	+ subClass.prototype = Object.create(superClass.prototype);
66	+ subClass.prototype.constructor = subClass;
67	+ subClass.__proto__ = superClass;
68	+ }

69

70	/**
71	+ * --------------------------------------------------------------------------
72	+ * Bootstrap (v4.1.0): util.js
73	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
74	+ * --------------------------------------------------------------------------
75	*/















76
77	+ var Util = function ($$$1) {
78	+ /**
79	+ * ------------------------------------------------------------------------
80	+ * Private TransitionEnd Helpers
81	+ * ------------------------------------------------------------------------
82	+ */
83	+ var TRANSITION_END = 'transitionend';
84	+ var MAX_UID = 1000000;
85	+ var MILLISECONDS_MULTIPLIER = 1000; // Shoutout AngusCroll (https://goo.gl/pxwQGp)
86
87	+ function toType(obj) {
88	+ return {}.toString.call(obj).match(/\s([a-z]+)/i)[1].toLowerCase();

89	}
90
91	+ function getSpecialTransitionEndEvent() {
92	+ return {
93	+ bindType: TRANSITION_END,
94	+ delegateType: TRANSITION_END,
95	+ handle: function handle(event) {
96	+ if ($$$1(event.target).is(this)) {
97	+ return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params
98	+ }
99
100	+ return undefined; // eslint-disable-line no-undefined
101	+ }
102	+ };
103	+ }
104
105	+ function transitionEndEmulator(duration) {
106	+ var _this = this;









107
108	+ var called = false;
109	+ $$$1(this).one(Util.TRANSITION_END, function () {
110	+ called = true;
111	+ });
112	+ setTimeout(function () {
113	+ if (!called) {
114	+ Util.triggerTransitionEnd(_this);
115	+ }
116	+ }, duration);
117	+ return this;
118	+ }
119
120	+ function setTransitionEndSupport() {
121	+ $$$1.fn.emulateTransitionEnd = transitionEndEmulator;
122	$$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
123	}
124	+ /**
125	+ * --------------------------------------------------------------------------
126	+ * Public Util Api
127	+ * --------------------------------------------------------------------------
128	+ */

















129




130
131	+ var Util = {
132	+ TRANSITION_END: 'bsTransitionEnd',
133	+ getUID: function getUID(prefix) {
134	+ do {
135	+ // eslint-disable-next-line no-bitwise
136	+ prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here
137	+ } while (document.getElementById(prefix));
138
139	+ return prefix;
140	+ },
141	+ getSelectorFromElement: function getSelectorFromElement(element) {
142	+ var selector = element.getAttribute('data-target');
143
144	+ if (!selector \|\| selector === '#') {
145	+ selector = element.getAttribute('href') \|\| '';
146	+ }
147
148	+ try {
149	+ var $selector = $$$1(document).find(selector);
150	+ return $selector.length > 0 ? selector : null;
151	+ } catch (err) {
152	+ return null;
153	+ }
154	+ },
155	+ getTransitionDurationFromElement: function getTransitionDurationFromElement(element) {
156	+ if (!element) {
157	+ return 0;
158	+ } // Get transition-duration of the element
159	+
160	+
161	+ var transitionDuration = $$$1(element).css('transition-duration');
162	+ var floatTransitionDuration = parseFloat(transitionDuration); // Return 0 if element or transition duration is not found
163	+
164	+ if (!floatTransitionDuration) {
165	+ return 0;
166	+ } // If multiple durations are defined, take the first
167	+
168	+
169	+ transitionDuration = transitionDuration.split(',')[0];
170	+ return parseFloat(transitionDuration) * MILLISECONDS_MULTIPLIER;
171	+ },
172	+ reflow: function reflow(element) {
173	+ return element.offsetHeight;
174	+ },
175	+ triggerTransitionEnd: function triggerTransitionEnd(element) {
176	+ $$$1(element).trigger(TRANSITION_END);
177	+ },
178	+ // TODO: Remove in v5
179	+ supportsTransitionEnd: function supportsTransitionEnd() {
180	+ return Boolean(TRANSITION_END);
181	+ },
182	+ isElement: function isElement(obj) {
183	+ return (obj[0] \|\| obj).nodeType;
184	+ },
185	+ typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
186	+ for (var property in configTypes) {
187	+ if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
188	+ var expectedTypes = configTypes[property];
189	+ var value = config[property];
190	+ var valueType = value && Util.isElement(value) ? 'element' : toType(value);
191	+
192	+ if (!new RegExp(expectedTypes).test(valueType)) {
193	+ throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\"."));
194	+ }
195	}
196	}
197	}
198	+ };
199	+ setTransitionEndSupport();
200	+ return Util;
201	+ }($);
202	+









203	/**
204	+ * --------------------------------------------------------------------------
205	+ * Bootstrap (v4.1.0): alert.js
206	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
207	+ * --------------------------------------------------------------------------
208	*/
209	+
210	+ var Alert = function ($$$1) {

















211	/**
212	* ------------------------------------------------------------------------
213	+ * Constants
214	* ------------------------------------------------------------------------
215	*/
216	+ var NAME = 'alert';
217	+ var VERSION = '4.1.0';
218	+ var DATA_KEY = 'bs.alert';
219	+ var EVENT_KEY = "." + DATA_KEY;
220	+ var DATA_API_KEY = '.data-api';
221	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
222	+ var Selector = {
223	+ DISMISS: '[data-dismiss="alert"]'
224	+ };
225	+ var Event = {
226	+ CLOSE: "close" + EVENT_KEY,
227	+ CLOSED: "closed" + EVENT_KEY,
228	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
229	+ };
230	+ var ClassName = {
231	+ ALERT: 'alert',
232	+ FADE: 'fade',
233	+ SHOW: 'show'
234	+ /**
235	+ * ------------------------------------------------------------------------
236	+ * Class Definition
237	+ * ------------------------------------------------------------------------
238	+ */
239
240	+ };
241
242	+ var Alert =
243	+ /#__PURE__/
244	+ function () {
245	+ function Alert(element) {
246	+ this._element = element;
247	+ } // Getters
248
249
250	+ var _proto = Alert.prototype;
251
252	+ // Public
253	+ _proto.close = function close(element) {
254	+ element = element \|\| this._element;
255
256	+ var rootElement = this._getRootElement(element);
257
258	+ var customEvent = this._triggerCloseEvent(rootElement);
259
260	+ if (customEvent.isDefaultPrevented()) {
261	+ return;
262	+ }
263
264	+ this._removeElement(rootElement);
265	+ };
266
267	+ _proto.dispose = function dispose() {
268	+ $$$1.removeData(this._element, DATA_KEY);
269	+ this._element = null;
270	+ }; // Private
271
272
273	+ _proto._getRootElement = function _getRootElement(element) {
274	+ var selector = Util.getSelectorFromElement(element);
275	+ var parent = false;
276
277	+ if (selector) {
278	+ parent = $$$1(selector)[0];
279	+ }
280
281	+ if (!parent) {
282	+ parent = $$$1(element).closest("." + ClassName.ALERT)[0];
283	+ }
284
285	+ return parent;
286	+ };
287
288	+ _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
289	+ var closeEvent = $$$1.Event(Event.CLOSE);
290	+ $$$1(element).trigger(closeEvent);
291	+ return closeEvent;
292	+ };
293
294	+ _proto._removeElement = function _removeElement(element) {
295	+ var _this = this;
296
297	+ $$$1(element).removeClass(ClassName.SHOW);
298
299	+ if (!$$$1(element).hasClass(ClassName.FADE)) {
300	+ this._destroyElement(element);
301
302	+ return;
303	+ }
304
305	+ var transitionDuration = Util.getTransitionDurationFromElement(element);
306	+ $$$1(element).one(Util.TRANSITION_END, function (event) {
307	+ return _this._destroyElement(element, event);
308	+ }).emulateTransitionEnd(transitionDuration);
309	+ };
310
311	+ _proto._destroyElement = function _destroyElement(element) {
312	+ $$$1(element).detach().trigger(Event.CLOSED).remove();
313	+ }; // Static
314
315
316	+ Alert._jQueryInterface = function _jQueryInterface(config) {
317	+ return this.each(function () {
318	+ var $element = $$$1(this);
319	+ var data = $element.data(DATA_KEY);
320
321	+ if (!data) {
322	+ data = new Alert(this);
323	+ $element.data(DATA_KEY, data);
324	+ }
325
326	+ if (config === 'close') {
327	+ data[config](this);
328	+ }
329	+ });
330	+ };
331
332	+ Alert._handleDismiss = function _handleDismiss(alertInstance) {
333	+ return function (event) {
334	+ if (event) {
335	+ event.preventDefault();
336	+ }
337
338	+ alertInstance.close(this);
339	+ };
340	};

341
342	+ _createClass(Alert, null, [{
343	+ key: "VERSION",
344	+ get: function get() {
345	+ return VERSION;
346	+ }
347	+ }]);







348
349	+ return Alert;
350	+ }();
351	+ /**
352	+ * ------------------------------------------------------------------------
353	+ * Data Api implementation
354	+ * ------------------------------------------------------------------------
355	+ */
356






357
358	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert()));
359	+ /**
360	+ * ------------------------------------------------------------------------
361	+ * jQuery
362	+ * ------------------------------------------------------------------------
363	+ */
364
365	+ $$$1.fn[NAME] = Alert._jQueryInterface;
366	+ $$$1.fn[NAME].Constructor = Alert;


367
368	+ $$$1.fn[NAME].noConflict = function () {
369	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
370	+ return Alert._jQueryInterface;
371	+ };
372
373	+ return Alert;
374	+ }($);




375

376	/**
377	+ * --------------------------------------------------------------------------
378	+ * Bootstrap (v4.1.0): button.js
379	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
380	+ * --------------------------------------------------------------------------
381	*/
382	+
383	+ var Button = function ($$$1) {



















384	/**
385	* ------------------------------------------------------------------------
386	+ * Constants
387	* ------------------------------------------------------------------------
388	*/
389	+ var NAME = 'button';
390	+ var VERSION = '4.1.0';
391	+ var DATA_KEY = 'bs.button';
392	+ var EVENT_KEY = "." + DATA_KEY;
393	+ var DATA_API_KEY = '.data-api';
394	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
395	+ var ClassName = {
396	+ ACTIVE: 'active',
397	+ BUTTON: 'btn',
398	+ FOCUS: 'focus'
399	+ };
400	+ var Selector = {
401	+ DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
402	+ DATA_TOGGLE: '[data-toggle="buttons"]',
403	+ INPUT: 'input',
404	+ ACTIVE: '.active',
405	+ BUTTON: '.btn'
406	+ };
407	+ var Event = {
408	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
409	+ FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY)
410	+ /**
411	+ * ------------------------------------------------------------------------
412	+ * Class Definition
413	+ * ------------------------------------------------------------------------
414	+ */
415
416	+ };
417
418	+ var Button =
419	+ /#__PURE__/
420	+ function () {
421	+ function Button(element) {
422	+ this._element = element;
423	+ } // Getters
424
425
426	+ var _proto = Button.prototype;
427
428	+ // Public
429	+ _proto.toggle = function toggle() {
430	+ var triggerChangeEvent = true;
431	+ var addAriaPressed = true;
432	+ var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
433
434	+ if (rootElement) {
435	+ var input = $$$1(this._element).find(Selector.INPUT)[0];
436
437	+ if (input) {
438	+ if (input.type === 'radio') {
439	+ if (input.checked && $$$1(this._element).hasClass(ClassName.ACTIVE)) {
440	+ triggerChangeEvent = false;
441	+ } else {
442	+ var activeElement = $$$1(rootElement).find(Selector.ACTIVE)[0];
443
444	+ if (activeElement) {
445	+ $$$1(activeElement).removeClass(ClassName.ACTIVE);
446	+ }
447	}
448	}

449
450	+ if (triggerChangeEvent) {
451	+ if (input.hasAttribute('disabled') \|\| rootElement.hasAttribute('disabled') \|\| input.classList.contains('disabled') \|\| rootElement.classList.contains('disabled')) {
452	+ return;
453	+ }
454	+
455	+ input.checked = !$$$1(this._element).hasClass(ClassName.ACTIVE);
456	+ $$$1(input).trigger('change');
457	}
458
459	+ input.focus();
460	+ addAriaPressed = false;
461	}
462	+ }
463
464	+ if (addAriaPressed) {
465	+ this._element.setAttribute('aria-pressed', !$$$1(this._element).hasClass(ClassName.ACTIVE));
466	}

467
468	+ if (triggerChangeEvent) {
469	+ $$$1(this._element).toggleClass(ClassName.ACTIVE);
470	+ }
471	+ };
472
473	+ _proto.dispose = function dispose() {
474	+ $$$1.removeData(this._element, DATA_KEY);
475	+ this._element = null;
476	+ }; // Static
477




478
479	+ Button._jQueryInterface = function _jQueryInterface(config) {
480	+ return this.each(function () {
481	+ var data = $$$1(this).data(DATA_KEY);
482
483	+ if (!data) {
484	+ data = new Button(this);
485	+ $$$1(this).data(DATA_KEY, data);
486	+ }
487
488	+ if (config === 'toggle') {
489	+ data[config]();
490	+ }
491	+ });
492	+ };
493
494	+ _createClass(Button, null, [{
495	+ key: "VERSION",
496	+ get: function get() {
497	+ return VERSION;
498	}
499	+ }]);















500
501	+ return Button;
502	+ }();
503	+ /**
504	+ * ------------------------------------------------------------------------
505	+ * Data Api implementation
506	+ * ------------------------------------------------------------------------
507	+ */
508



509
510	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
511	+ event.preventDefault();
512	+ var button = event.target;
513
514	+ if (!$$$1(button).hasClass(ClassName.BUTTON)) {
515	+ button = $$$1(button).closest(Selector.BUTTON);
516	+ }







517
518	+ Button._jQueryInterface.call($$$1(button), 'toggle');
519	+ }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
520	+ var button = $$$1(event.target).closest(Selector.BUTTON)[0];
521	+ $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type));
522	+ });
523	+ /**
524	+ * ------------------------------------------------------------------------
525	+ * jQuery
526	+ * ------------------------------------------------------------------------
527	+ */
528
529	+ $$$1.fn[NAME] = Button._jQueryInterface;
530	+ $$$1.fn[NAME].Constructor = Button;


531
532	+ $$$1.fn[NAME].noConflict = function () {
533	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
534	+ return Button._jQueryInterface;
535	+ };
536
537	+ return Button;
538	+ }($);




539

540	/**
541	+ * --------------------------------------------------------------------------
542	+ * Bootstrap (v4.1.0): carousel.js
543	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
544	+ * --------------------------------------------------------------------------
545	*/
546	+
547	+ var Carousel = function ($$$1) {



























































548	/**
549	* ------------------------------------------------------------------------
550	+ * Constants
551	* ------------------------------------------------------------------------
552	*/
553	+ var NAME = 'carousel';
554	+ var VERSION = '4.1.0';
555	+ var DATA_KEY = 'bs.carousel';
556	+ var EVENT_KEY = "." + DATA_KEY;
557	+ var DATA_API_KEY = '.data-api';
558	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
559	+ var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key
560	+
561	+ var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key
562	+
563	+ var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
564	+
565	+ var Default = {
566	+ interval: 5000,
567	+ keyboard: true,
568	+ slide: false,
569	+ pause: 'hover',
570	+ wrap: true










571	};
572	+ var DefaultType = {
573	+ interval: '(number\|boolean)',
574	+ keyboard: 'boolean',
575	+ slide: '(boolean\|string)',
576	+ pause: '(string\|boolean)',
577	+ wrap: 'boolean'

578	};
579	+ var Direction = {
580	+ NEXT: 'next',
581	+ PREV: 'prev',
582	+ LEFT: 'left',
583	+ RIGHT: 'right'
584	};
585	+ var Event = {
586	+ SLIDE: "slide" + EVENT_KEY,
587	+ SLID: "slid" + EVENT_KEY,
588	+ KEYDOWN: "keydown" + EVENT_KEY,
589	+ MOUSEENTER: "mouseenter" + EVENT_KEY,
590	+ MOUSELEAVE: "mouseleave" + EVENT_KEY,
591	+ TOUCHEND: "touchend" + EVENT_KEY,
592	+ LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY,
593	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
594	+ };
595	+ var ClassName = {
596	+ CAROUSEL: 'carousel',
597	+ ACTIVE: 'active',
598	+ SLIDE: 'slide',
599	+ RIGHT: 'carousel-item-right',
600	+ LEFT: 'carousel-item-left',
601	+ NEXT: 'carousel-item-next',
602	+ PREV: 'carousel-item-prev',
603	+ ITEM: 'carousel-item'
604	+ };
605	+ var Selector = {
606	+ ACTIVE: '.active',
607	+ ACTIVE_ITEM: '.active.carousel-item',
608	+ ITEM: '.carousel-item',
609	+ NEXT_PREV: '.carousel-item-next, .carousel-item-prev',
610	+ INDICATORS: '.carousel-indicators',
611	+ DATA_SLIDE: '[data-slide], [data-slide-to]',
612	+ DATA_RIDE: '[data-ride="carousel"]'
613	+ /**
614	+ * ------------------------------------------------------------------------
615	+ * Class Definition
616	+ * ------------------------------------------------------------------------
617	+ */
618












619	};
620
621	+ var Carousel =
622	+ /#__PURE__/
623	+ function () {
624	+ function Carousel(element, config) {
625	+ this._items = null;
626	+ this._interval = null;
627	+ this._activeElement = null;
628	this._isPaused = false;
629	+ this._isSliding = false;
630	+ this.touchTimeout = null;
631	+ this._config = this._getConfig(config);
632	+ this._element = $$$1(element)[0];
633	+ this._indicatorsElement = $$$1(this._element).find(Selector.INDICATORS)[0];
634
635	+ this._addEventListeners();
636	+ } // Getters


637




638
639	+ var _proto = Carousel.prototype;

640
641	+ // Public
642	+ _proto.next = function next() {
643	+ if (!this._isSliding) {
644	+ this._slide(Direction.NEXT);
645	+ }
646	+ };
647
648	+ _proto.nextWhenVisible = function nextWhenVisible() {
649	+ // Don't call next when the page isn't visible
650	+ // or the carousel or its parent isn't visible
651	+ if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') {
652	+ this.next();
653	+ }
654	+ };
655
656	+ _proto.prev = function prev() {
657	+ if (!this._isSliding) {
658	+ this._slide(Direction.PREV);
659	+ }
660	+ };
661
662	+ _proto.pause = function pause(event) {
663	+ if (!event) {
664	+ this._isPaused = true;
665	+ }


666
667	+ if ($$$1(this._element).find(Selector.NEXT_PREV)[0]) {
668	+ Util.triggerTransitionEnd(this._element);
669	+ this.cycle(true);
670	+ }

671
672	+ clearInterval(this._interval);
673	+ this._interval = null;
674	+ };
675
676	+ _proto.cycle = function cycle(event) {
677	+ if (!event) {
678	+ this._isPaused = false;
679	+ }
680
681	+ if (this._interval) {
682	+ clearInterval(this._interval);
683	+ this._interval = null;
684	+ }















685
686	+ if (this._config.interval && !this._isPaused) {
687	+ this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
688	+ }
689	+ };
690
691	+ _proto.to = function to(index) {
692	+ var _this = this;



693
694	+ this._activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];





695
696	+ var activeIndex = this._getItemIndex(this._activeElement);













697
698	+ if (index > this._items.length - 1 \|\| index < 0) {
699	+ return;


700	}


701
702	+ if (this._isSliding) {
703	+ $$$1(this._element).one(Event.SLID, function () {
704	+ return _this.to(index);
705	+ });
706	+ return;
707	+ }
708
709	+ if (activeIndex === index) {
710	+ this.pause();
711	+ this.cycle();
712	+ return;
713	+ }
714
715	+ var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;



716
717	+ this._slide(direction, this._items[index]);
718	+ };

719
720	+ _proto.dispose = function dispose() {
721	+ $$$1(this._element).off(EVENT_KEY);
722	+ $$$1.removeData(this._element, DATA_KEY);
723	+ this._items = null;
724	+ this._config = null;
725	+ this._element = null;
726	+ this._interval = null;
727	+ this._isPaused = null;
728	+ this._isSliding = null;
729	+ this._activeElement = null;
730	+ this._indicatorsElement = null;
731	+ }; // Private
732



733
734	+ _proto._getConfig = function _getConfig(config) {
735	+ config = _objectSpread({}, Default, config);
736	+ Util.typeCheckConfig(NAME, config, DefaultType);
737	+ return config;
738	+ };
739
740	+ _proto._addEventListeners = function _addEventListeners() {
741	+ var _this2 = this;
742
743	+ if (this._config.keyboard) {
744	+ $$$1(this._element).on(Event.KEYDOWN, function (event) {
745	+ return _this2._keydown(event);
746	+ });
747	+ }
748
749	+ if (this._config.pause === 'hover') {
750	+ $$$1(this._element).on(Event.MOUSEENTER, function (event) {
751	+ return _this2.pause(event);
752	+ }).on(Event.MOUSELEAVE, function (event) {
753	+ return _this2.cycle(event);
754	+ });
755
756	+ if ('ontouchstart' in document.documentElement) {
757	+ // If it's a touch-enabled device, mouseenter/leave are fired as
758	+ // part of the mouse compatibility events on first tap - the carousel
759	+ // would stop cycling until user tapped out of it;
760	+ // here, we listen for touchend, explicitly pause the carousel
761	+ // (as if it's the second time we tap on it, mouseenter compat event
762	+ // is NOT fired) and after a timeout (to allow for mouse compatibility
763	+ // events to fire) we explicitly restart cycling
764	+ $$$1(this._element).on(Event.TOUCHEND, function () {
765	+ _this2.pause();
766	+
767	+ if (_this2.touchTimeout) {
768	+ clearTimeout(_this2.touchTimeout);
769	+ }
770
771	+ _this2.touchTimeout = setTimeout(function (event) {
772	+ return _this2.cycle(event);
773	+ }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval);
774	+ });
775	+ }
776	+ }
777	+ };
778
779	+ _proto._keydown = function _keydown(event) {
780	+ if (/input\|textarea/i.test(event.target.tagName)) {
781	+ return;
782	+ }





783
784	+ switch (event.which) {
785	+ case ARROW_LEFT_KEYCODE:
786	+ event.preventDefault();
787	+ this.prev();
788	+ break;
789
790	+ case ARROW_RIGHT_KEYCODE:
791	+ event.preventDefault();
792	+ this.next();
793	+ break;
794
795	+ default:

796	}
797	+ };

798
799	+ _proto._getItemIndex = function _getItemIndex(element) {
800	+ this._items = $$$1.makeArray($$$1(element).parent().find(Selector.ITEM));
801	+ return this._items.indexOf(element);
802	+ };
803
804	+ _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
805	+ var isNextDirection = direction === Direction.NEXT;
806	+ var isPrevDirection = direction === Direction.PREV;
807
808	+ var activeIndex = this._getItemIndex(activeElement);
809
810	+ var lastItemIndex = this._items.length - 1;
811	+ var isGoingToWrap = isPrevDirection && activeIndex === 0 \|\| isNextDirection && activeIndex === lastItemIndex;
812
813	+ if (isGoingToWrap && !this._config.wrap) {
814	+ return activeElement;
815	+ }
816
817	+ var delta = direction === Direction.PREV ? -1 : 1;
818	+ var itemIndex = (activeIndex + delta) % this._items.length;
819	+ return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
820	+ };
821
822	+ _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
823	+ var targetIndex = this._getItemIndex(relatedTarget);







824
825	+ var fromIndex = this._getItemIndex($$$1(this._element).find(Selector.ACTIVE_ITEM)[0]);



826
827	+ var slideEvent = $$$1.Event(Event.SLIDE, {
828	+ relatedTarget: relatedTarget,
829	+ direction: eventDirectionName,
830	+ from: fromIndex,
831	+ to: targetIndex
832	+ });
833	+ $$$1(this._element).trigger(slideEvent);
834	+ return slideEvent;
835	+ };
836
837	+ _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
838	+ if (this._indicatorsElement) {
839	+ $$$1(this._indicatorsElement).find(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
840
841	+ var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
842	+
843	+ if (nextIndicator) {
844	+ $$$1(nextIndicator).addClass(ClassName.ACTIVE);
845	+ }
846	+ }
847	+ };
848
849	+ _proto._slide = function _slide(direction, element) {
850	+ var _this3 = this;
851
852	+ var activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];


853
854	+ var activeElementIndex = this._getItemIndex(activeElement);
855
856	+ var nextElement = element \|\| activeElement && this._getItemByDirection(direction, activeElement);





857
858	+ var nextElementIndex = this._getItemIndex(nextElement);


















859
860	+ var isCycling = Boolean(this._interval);
861	+ var directionalClassName;
862	+ var orderClassName;
863	+ var eventDirectionName;
864
865	+ if (direction === Direction.NEXT) {
866	+ directionalClassName = ClassName.LEFT;
867	+ orderClassName = ClassName.NEXT;
868	+ eventDirectionName = Direction.LEFT;
869	+ } else {
870	+ directionalClassName = ClassName.RIGHT;
871	+ orderClassName = ClassName.PREV;
872	+ eventDirectionName = Direction.RIGHT;
873	+ }
874	+
875	+ if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) {
876	+ this._isSliding = false;
877	+ return;
878	+ }
879	+
880	+ var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);
881	+
882	+ if (slideEvent.isDefaultPrevented()) {
883	+ return;
884	+ }
885
886	+ if (!activeElement \|\| !nextElement) {
887	+ // Some weirdness is happening, so we bail
888	+ return;
889	+ }
890
891	+ this._isSliding = true;
892
893	+ if (isCycling) {
894	+ this.pause();
895	}
896
897	+ this._setActiveIndicatorElement(nextElement);
898	+
899	+ var slidEvent = $$$1.Event(Event.SLID, {
900	+ relatedTarget: nextElement,
901	+ direction: eventDirectionName,
902	+ from: activeElementIndex,
903	+ to: nextElementIndex
904	+ });
905	+
906	+ if ($$$1(this._element).hasClass(ClassName.SLIDE)) {
907	+ $$$1(nextElement).addClass(orderClassName);
908	+ Util.reflow(nextElement);
909	+ $$$1(activeElement).addClass(directionalClassName);
910	+ $$$1(nextElement).addClass(directionalClassName);
911	+ var transitionDuration = Util.getTransitionDurationFromElement(activeElement);
912	+ $$$1(activeElement).one(Util.TRANSITION_END, function () {
913	+ $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE);
914	+ $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName);
915	+ _this3._isSliding = false;
916	+ setTimeout(function () {
917	+ return $$$1(_this3._element).trigger(slidEvent);
918	+ }, 0);
919	+ }).emulateTransitionEnd(transitionDuration);
920	+ } else {
921	+ $$$1(activeElement).removeClass(ClassName.ACTIVE);
922	+ $$$1(nextElement).addClass(ClassName.ACTIVE);
923	+ this._isSliding = false;
924	+ $$$1(this._element).trigger(slidEvent);
925	+ }
926
927	+ if (isCycling) {
928	+ this.cycle();

929	}
930	+ }; // Static
931
932	+
933	+ Carousel._jQueryInterface = function _jQueryInterface(config) {
934	+ return this.each(function () {
935	+ var data = $$$1(this).data(DATA_KEY);
936	+
937	+ var _config = _objectSpread({}, Default, $$$1(this).data());
938	+
939	+ if (typeof config === 'object') {
940	+ _config = _objectSpread({}, _config, config);
941	+ }
942	+
943	+ var action = typeof config === 'string' ? config : _config.slide;
944	+
945	+ if (!data) {
946	+ data = new Carousel(this, _config);
947	+ $$$1(this).data(DATA_KEY, data);
948	+ }
949	+
950	+ if (typeof config === 'number') {
951	+ data.to(config);
952	+ } else if (typeof action === 'string') {
953	+ if (typeof data[action] === 'undefined') {
954	+ throw new TypeError("No method named \"" + action + "\"");
955	+ }
956	+
957	+ data[action]();
958	+ } else if (_config.interval) {
959	+ data.pause();
960	+ data.cycle();
961	}
962	+ });
963	+ };
964
965	+ Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
966	+ var selector = Util.getSelectorFromElement(this);
967	+
968	+ if (!selector) {
969	+ return;
970	}


971
972	+ var target = $$$1(selector)[0];

973
974	+ if (!target \|\| !$$$1(target).hasClass(ClassName.CAROUSEL)) {
975	+ return;
976	+ }
977
978	+ var config = _objectSpread({}, $$$1(target).data(), $$$1(this).data());
979
980	+ var slideIndex = this.getAttribute('data-slide-to');


981
982	+ if (slideIndex) {
983	+ config.interval = false;
984	+ }
985
986	+ Carousel._jQueryInterface.call($$$1(target), config);


987
988	+ if (slideIndex) {
989	+ $$$1(target).data(DATA_KEY).to(slideIndex);
990	+ }
991
992	+ event.preventDefault();
993	+ };

994
995	+ _createClass(Carousel, null, [{
996	+ key: "VERSION",
997	+ get: function get() {
998	+ return VERSION;
999	+ }
1000	+ }, {
1001	+ key: "Default",
1002	+ get: function get() {
1003	+ return Default;
1004	+ }
1005	+ }]);
1006
1007	+ return Carousel;
1008	+ }();
1009	+ /**
1010	+ * ------------------------------------------------------------------------
1011	+ * Data Api implementation
1012	+ * ------------------------------------------------------------------------
1013	+ */











1014
1015
1016	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
1017	+ $$$1(window).on(Event.LOAD_DATA_API, function () {
1018	+ $$$1(Selector.DATA_RIDE).each(function () {
1019	+ var $carousel = $$$1(this);
1020
1021	+ Carousel._jQueryInterface.call($carousel, $carousel.data());
1022	+ });
1023	});
1024	+ /**
1025	+ * ------------------------------------------------------------------------
1026	+ * jQuery
1027	+ * ------------------------------------------------------------------------
1028	+ */




1029
1030	+ $$$1.fn[NAME] = Carousel._jQueryInterface;
1031	+ $$$1.fn[NAME].Constructor = Carousel;


1032
1033	+ $$$1.fn[NAME].noConflict = function () {
1034	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
1035	+ return Carousel._jQueryInterface;
1036	+ };
1037
1038	+ return Carousel;
1039	+ }($);




1040

1041	/**
1042	+ * --------------------------------------------------------------------------
1043	+ * Bootstrap (v4.1.0): collapse.js
1044	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
1045	+ * --------------------------------------------------------------------------
1046	*/
1047	+
1048	+ var Collapse = function ($$$1) {

































1049	/**
1050	* ------------------------------------------------------------------------
1051	+ * Constants
1052	* ------------------------------------------------------------------------
1053	*/
1054	+ var NAME = 'collapse';
1055	+ var VERSION = '4.1.0';
1056	+ var DATA_KEY = 'bs.collapse';
1057	+ var EVENT_KEY = "." + DATA_KEY;
1058	+ var DATA_API_KEY = '.data-api';
1059	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
1060	+ var Default = {
1061	+ toggle: true,
1062	+ parent: ''
1063	+ };
1064	+ var DefaultType = {
1065	+ toggle: 'boolean',
1066	+ parent: '(string\|element)'
1067	+ };
1068	+ var Event = {
1069	+ SHOW: "show" + EVENT_KEY,
1070	+ SHOWN: "shown" + EVENT_KEY,
1071	+ HIDE: "hide" + EVENT_KEY,
1072	+ HIDDEN: "hidden" + EVENT_KEY,
1073	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
1074	+ };
1075	+ var ClassName = {
1076	+ SHOW: 'show',
1077	+ COLLAPSE: 'collapse',
1078	+ COLLAPSING: 'collapsing',
1079	+ COLLAPSED: 'collapsed'
1080	+ };
1081	+ var Dimension = {
1082	+ WIDTH: 'width',
1083	+ HEIGHT: 'height'
1084	+ };
1085	+ var Selector = {
1086	+ ACTIVES: '.show, .collapsing',
1087	+ DATA_TOGGLE: '[data-toggle="collapse"]'
1088	+ /**
1089	+ * ------------------------------------------------------------------------
1090	+ * Class Definition
1091	+ * ------------------------------------------------------------------------
1092	+ */
1093
1094	+ };
1095
1096	+ var Collapse =
1097	+ /#__PURE__/
1098	+ function () {
1099	+ function Collapse(element, config) {
1100	+ this._isTransitioning = false;
1101	+ this._element = element;
1102	+ this._config = this._getConfig(config);
1103	+ this._triggerArray = $$$1.makeArray($$$1("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
1104	+ var tabToggles = $$$1(Selector.DATA_TOGGLE);
1105
1106	+ for (var i = 0; i < tabToggles.length; i++) {
1107	+ var elem = tabToggles[i];
1108	+ var selector = Util.getSelectorFromElement(elem);
1109
1110	+ if (selector !== null && $$$1(selector).filter(element).length > 0) {
1111	+ this._selector = selector;
1112
1113	+ this._triggerArray.push(elem);
1114	+ }
1115	}

1116
1117	+ this._parent = this._config.parent ? this._getParent() : null;
1118
1119	+ if (!this._config.parent) {
1120	+ this._addAriaAndCollapsedClass(this._element, this._triggerArray);
1121	+ }
1122
1123	+ if (this._config.toggle) {
1124	+ this.toggle();
1125	+ }
1126	+ } // Getters
1127
1128
1129	+ var _proto = Collapse.prototype;
1130
1131	+ // Public
1132	+ _proto.toggle = function toggle() {
1133	+ if ($$$1(this._element).hasClass(ClassName.SHOW)) {
1134	+ this.hide();
1135	+ } else {
1136	+ this.show();
1137	+ }
1138	+ };
1139
1140	+ _proto.show = function show() {
1141	+ var _this = this;
1142
1143	+ if (this._isTransitioning \|\| $$$1(this._element).hasClass(ClassName.SHOW)) {
1144	+ return;
1145	+ }
1146
1147	+ var actives;
1148	+ var activesData;
1149
1150	+ if (this._parent) {
1151	+ actives = $$$1.makeArray($$$1(this._parent).find(Selector.ACTIVES).filter("[data-parent=\"" + this._config.parent + "\"]"));
1152
1153	+ if (actives.length === 0) {
1154	+ actives = null;
1155	+ }
1156	}

1157
1158	+ if (actives) {
1159	+ activesData = $$$1(actives).not(this._selector).data(DATA_KEY);
1160
1161	+ if (activesData && activesData._isTransitioning) {
1162	+ return;
1163	+ }
1164	}

1165
1166	+ var startEvent = $$$1.Event(Event.SHOW);
1167	+ $$$1(this._element).trigger(startEvent);
1168
1169	+ if (startEvent.isDefaultPrevented()) {
1170	+ return;
1171	+ }
1172
1173	+ if (actives) {
1174	+ Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide');
1175
1176	+ if (!activesData) {
1177	+ $$$1(actives).data(DATA_KEY, null);
1178	+ }
1179	}

1180
1181	+ var dimension = this._getDimension();
1182
1183	+ $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
1184	+ this._element.style[dimension] = 0;
1185
1186	+ if (this._triggerArray.length > 0) {
1187	+ $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
1188	+ }


1189
1190	+ this.setTransitioning(true);


1191
1192	+ var complete = function complete() {
1193	+ $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW);
1194	+ _this._element.style[dimension] = '';
1195
1196	+ _this.setTransitioning(false);

1197
1198	+ $$$1(_this._element).trigger(Event.SHOWN);
1199	+ };


1200
1201	+ var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
1202	+ var scrollSize = "scroll" + capitalizedDimension;
1203	+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
1204	+ $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
1205	+ this._element.style[dimension] = this._element[scrollSize] + "px";
1206	+ };
1207
1208	+ _proto.hide = function hide() {
1209	+ var _this2 = this;
1210
1211	+ if (this._isTransitioning \|\| !$$$1(this._element).hasClass(ClassName.SHOW)) {
1212	+ return;
1213	+ }
1214
1215	+ var startEvent = $$$1.Event(Event.HIDE);
1216	+ $$$1(this._element).trigger(startEvent);
1217
1218	+ if (startEvent.isDefaultPrevented()) {
1219	+ return;
1220	+ }
1221
1222	+ var dimension = this._getDimension();
1223
1224	+ this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
1225	+ Util.reflow(this._element);
1226	+ $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
1227
1228	+ if (this._triggerArray.length > 0) {
1229	+ for (var i = 0; i < this._triggerArray.length; i++) {
1230	+ var trigger = this._triggerArray[i];
1231	+ var selector = Util.getSelectorFromElement(trigger);
1232
1233	+ if (selector !== null) {
1234	+ var $elem = $$$1(selector);
1235
1236	+ if (!$elem.hasClass(ClassName.SHOW)) {
1237	+ $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
1238	+ }
1239	}
1240	}
1241	}



1242
1243	+ this.setTransitioning(true);




1244
1245	+ var complete = function complete() {
1246	+ _this2.setTransitioning(false);
1247
1248	+ $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN);
1249	+ };


1250
1251	+ this._element.style[dimension] = '';
1252	+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
1253	+ $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
1254	+ };
1255
1256	+ _proto.setTransitioning = function setTransitioning(isTransitioning) {
1257	+ this._isTransitioning = isTransitioning;
1258	+ };
1259
1260	+ _proto.dispose = function dispose() {
1261	+ $$$1.removeData(this._element, DATA_KEY);
1262	+ this._config = null;
1263	+ this._parent = null;
1264	+ this._element = null;
1265	+ this._triggerArray = null;
1266	+ this._isTransitioning = null;
1267	+ }; // Private
1268
1269
1270	+ _proto._getConfig = function _getConfig(config) {
1271	+ config = _objectSpread({}, Default, config);
1272	+ config.toggle = Boolean(config.toggle); // Coerce string values
1273
1274	+ Util.typeCheckConfig(NAME, config, DefaultType);
1275	+ return config;
1276	+ };
1277
1278	+ _proto._getDimension = function _getDimension() {
1279	+ var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH);
1280	+ return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
1281	+ };
1282
1283	+ _proto._getParent = function _getParent() {
1284	+ var _this3 = this;
1285
1286	+ var parent = null;
1287
1288	+ if (Util.isElement(this._config.parent)) {
1289	+ parent = this._config.parent; // It's a jQuery object
1290
1291	+ if (typeof this._config.parent.jquery !== 'undefined') {
1292	+ parent = this._config.parent[0];
1293	+ }
1294	+ } else {
1295	+ parent = $$$1(this._config.parent)[0];
1296	}



1297
1298	+ var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
1299	+ $$$1(parent).find(selector).each(function (i, element) {
1300	+ _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
1301	+ });
1302	+ return parent;
1303	+ };
1304
1305	+ _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
1306	+ if (element) {
1307	+ var isOpen = $$$1(element).hasClass(ClassName.SHOW);
1308
1309	+ if (triggerArray.length > 0) {
1310	+ $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
1311	+ }
1312	}
1313	+ }; // Static

1314
1315
1316	+ Collapse._getTargetFromElement = function _getTargetFromElement(element) {
1317	+ var selector = Util.getSelectorFromElement(element);
1318	+ return selector ? $$$1(selector)[0] : null;
1319	+ };
1320
1321	+ Collapse._jQueryInterface = function _jQueryInterface(config) {
1322	+ return this.each(function () {
1323	+ var $this = $$$1(this);
1324	+ var data = $this.data(DATA_KEY);
1325
1326	+ var _config = _objectSpread({}, Default, $this.data(), typeof config === 'object' && config);
1327
1328	+ if (!data && _config.toggle && /show\|hide/.test(config)) {
1329	+ _config.toggle = false;
1330	+ }
1331
1332	+ if (!data) {
1333	+ data = new Collapse(this, _config);
1334	+ $this.data(DATA_KEY, data);
1335	+ }
1336
1337	+ if (typeof config === 'string') {
1338	+ if (typeof data[config] === 'undefined') {
1339	+ throw new TypeError("No method named \"" + config + "\"");
1340	+ }
1341	+
1342	+ data[config]();
1343	}
1344	+ });
1345	+ };
1346
1347	+ _createClass(Collapse, null, [{
1348	+ key: "VERSION",
1349	+ get: function get() {
1350	+ return VERSION;
1351	}
1352	+ }, {
1353	+ key: "Default",
1354	+ get: function get() {
1355	+ return Default;
1356	+ }
1357	+ }]);
1358
1359	+ return Collapse;
1360	+ }();
1361	+ /**
1362	+ * ------------------------------------------------------------------------
1363	+ * Data Api implementation
1364	+ * ------------------------------------------------------------------------
1365	+ */











1366
1367
1368	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
1369	+ // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
1370	+ if (event.currentTarget.tagName === 'A') {
1371	+ event.preventDefault();
1372	+ }
1373
1374	+ var $trigger = $$$1(this);
1375	+ var selector = Util.getSelectorFromElement(this);
1376	+ $$$1(selector).each(function () {
1377	+ var $target = $$$1(this);
1378	+ var data = $target.data(DATA_KEY);
1379	+ var config = data ? 'toggle' : $trigger.data();
1380
1381	+ Collapse._jQueryInterface.call($target, config);
1382	+ });
1383	});
1384	+ /**
1385	+ * ------------------------------------------------------------------------
1386	+ * jQuery
1387	+ * ------------------------------------------------------------------------
1388	+ */

1389
1390	+ $$$1.fn[NAME] = Collapse._jQueryInterface;
1391	+ $$$1.fn[NAME].Constructor = Collapse;
1392
1393	+ $$$1.fn[NAME].noConflict = function () {
1394	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
1395	+ return Collapse._jQueryInterface;
1396	+ };
1397
1398	+ return Collapse;
1399	+ }($);


































1400
1401	+ /**!
1402	+ * @fileOverview Kickass library to create and place poppers near their reference elements.
1403	+ * @version 1.14.1
1404	+ * @license
1405	+ * Copyright (c) 2016 Federico Zivolo and contributors
1406	+ *
1407	+ * Permission is hereby granted, free of charge, to any person obtaining a copy
1408	+ * of this software and associated documentation files (the "Software"), to deal
1409	+ * in the Software without restriction, including without limitation the rights
1410	+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
1411	+ * copies of the Software, and to permit persons to whom the Software is
1412	+ * furnished to do so, subject to the following conditions:
1413	+ *
1414	+ * The above copyright notice and this permission notice shall be included in all
1415	+ * copies or substantial portions of the Software.
1416	+ *
1417	+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
1418	+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
1419	+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
1420	+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
1421	+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
1422	+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
1423	+ * SOFTWARE.
1424	+ */
1425	+ var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined';
1426	+ var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox'];
1427	+ var timeoutDuration = 0;
1428	+ for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) {
1429	+ if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) {
1430	+ timeoutDuration = 1;
1431	+ break;
1432	}
1433	+ }






1434
1435	+ function microtaskDebounce(fn) {
1436	+ var called = false;
1437	+ return function () {
1438	+ if (called) {
1439	+ return;
1440	+ }
1441	+ called = true;
1442	+ window.Promise.resolve().then(function () {
1443	+ called = false;
1444	fn();
1445	+ });
1446	+ };





































































1447	}
1448
1449	+ function taskDebounce(fn) {
1450	+ var scheduled = false;
1451	+ return function () {
1452	+ if (!scheduled) {
1453	+ scheduled = true;
1454	+ setTimeout(function () {
1455	+ scheduled = false;
1456	+ fn();
1457	+ }, timeoutDuration);
1458	+ }
1459	+ };
1460	}
1461
1462	+ var supportsMicroTasks = isBrowser && window.Promise;
1463
1464	+ /**
1465	+ * Create a debounced version of a method, that's asynchronously deferred
1466	+ * but called in the minimum time possible.
1467	+ *
1468	+ * @method
1469	+ * @memberof Popper.Utils
1470	+ * @argument {Function} fn
1471	+ * @returns {Function}
1472	+ */
1473	+ var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce;
1474
1475	+ /**
1476	+ * Check if the given variable is a function
1477	+ * @method
1478	+ * @memberof Popper.Utils
1479	+ * @argument {Any} functionToCheck - variable to check
1480	+ * @returns {Boolean} answer to: is a function?
1481	+ */
1482	+ function isFunction(functionToCheck) {
1483	+ var getType = {};
1484	+ return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]';
1485	}
1486
1487	+ /**
1488	+ * Get CSS computed property of the given element
1489	+ * @method
1490	+ * @memberof Popper.Utils
1491	+ * @argument {Eement} element
1492	+ * @argument {String} property
1493	+ */
1494	+ function getStyleComputedProperty(element, property) {
1495	+ if (element.nodeType !== 1) {
1496	+ return [];








1497	}
1498	+ // NOTE: 1 DOM access here
1499	+ var css = getComputedStyle(element, null);
1500	+ return property ? css[property] : css;
1501	}
1502
1503	+ /**
1504	+ * Returns the parentNode or the host of the element
1505	+ * @method
1506	+ * @memberof Popper.Utils
1507	+ * @argument {Element} element
1508	+ * @returns {Element} parent
1509	+ */
1510	+ function getParentNode(element) {
1511	+ if (element.nodeName === 'HTML') {
1512	+ return element;
1513	+ }
1514	+ return element.parentNode \|\| element.host;
















1515	}
1516
1517	+ /**
1518	+ * Returns the scrolling parent of the given element
1519	+ * @method
1520	+ * @memberof Popper.Utils
1521	+ * @argument {Element} element
1522	+ * @returns {Element} scroll parent
1523	+ */
1524	+ function getScrollParent(element) {
1525	+ // Return body, `getScroll` will take care to get the correct `scrollTop` from it
1526	+ if (!element) {
1527	+ return document.body;
1528	+ }




1529
1530	+ switch (element.nodeName) {
1531	+ case 'HTML':
1532	+ case 'BODY':
1533	+ return element.ownerDocument.body;
1534	+ case '#document':
1535	+ return element.body;
1536	+ }
1537
1538	+ // Firefox want us to check `-x` and `-y` variations as well




1539
1540	+ var _getStyleComputedProp = getStyleComputedProperty(element),
1541	+ overflow = _getStyleComputedProp.overflow,
1542	+ overflowX = _getStyleComputedProp.overflowX,
1543	+ overflowY = _getStyleComputedProp.overflowY;
1544
1545	+ if (/(auto\|scroll\|overlay)/.test(overflow + overflowY + overflowX)) {
1546	+ return element;

1547	}
1548
1549	+ return getScrollParent(getParentNode(element));





























1550	}
1551
1552	+ /**
1553	+ * Tells if you are running Internet Explorer
1554	+ * @method
1555	+ * @memberof Popper.Utils
1556	+ * @argument {number} version to check
1557	+ * @returns {Boolean} isIE
1558	+ */
1559	+ var cache = {};
















































1560
1561	+ var isIE = function () {
1562	+ var version = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'all';

1563
1564	+ version = version.toString();
1565	+ if (cache.hasOwnProperty(version)) {
1566	+ return cache[version];
1567	+ }
1568	+ switch (version) {
1569	+ case '11':
1570	+ cache[version] = navigator.userAgent.indexOf('Trident') !== -1;
1571	+ break;
1572	+ case '10':
1573	+ cache[version] = navigator.appVersion.indexOf('MSIE 10') !== -1;
1574	+ break;
1575	+ case 'all':
1576	+ cache[version] = navigator.userAgent.indexOf('Trident') !== -1 \|\| navigator.userAgent.indexOf('MSIE') !== -1;
1577	+ break;
1578	+ }
1579
1580	+ //Set IE
1581	+ cache.all = cache.all \|\| Object.keys(cache).some(function (key) {
1582	+ return cache[key];
1583	+ });
1584	+ return cache[version];
1585	};







1586
1587	+ /**
1588	+ * Returns the offset parent of the given element
1589	+ * @method
1590	+ * @memberof Popper.Utils
1591	+ * @argument {Element} element
1592	+ * @returns {Element} offset parent
1593	+ */
1594	+ function getOffsetParent(element) {
1595	+ if (!element) {
1596	+ return document.documentElement;
1597	}

1598
1599	+ var noOffsetParent = isIE(10) ? document.body : null;





1600
1601	+ // NOTE: 1 DOM access here
1602	+ var offsetParent = element.offsetParent;
1603	+ // Skip hidden elements which don't have an offsetParent
1604	+ while (offsetParent === noOffsetParent && element.nextElementSibling) {
1605	+ offsetParent = (element = element.nextElementSibling).offsetParent;
1606	+ }
1607
1608	+ var nodeName = offsetParent && offsetParent.nodeName;
1609
1610	+ if (!nodeName \|\| nodeName === 'BODY' \|\| nodeName === 'HTML') {
1611	+ return element ? element.ownerDocument.documentElement : document.documentElement;
1612	+ }
1613
1614	+ // .offsetParent will return the closest TD or TABLE in case
1615	+ // no offsetParent is present, I hate this job...
1616	+ if (['TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') {
1617	+ return getOffsetParent(offsetParent);
1618	+ }
1619
1620	+ return offsetParent;









1621	}
1622
1623	+ function isOffsetContainer(element) {
1624	+ var nodeName = element.nodeName;




1625
1626	+ if (nodeName === 'BODY') {
1627	+ return false;


1628	}
1629	+ return nodeName === 'HTML' \|\| getOffsetParent(element.firstElementChild) === element;
1630	}
1631
1632	+ /**
1633	+ * Finds the root node (document, shadowDOM root) of the given element
1634	+ * @method
1635	+ * @memberof Popper.Utils
1636	+ * @argument {Element} node
1637	+ * @returns {Element} root node
1638	+ */
1639	+ function getRoot(node) {
1640	+ if (node.parentNode !== null) {
1641	+ return getRoot(node.parentNode);
1642	+ }






















































1643
1644	+ return node;

1645	}
1646
1647	+ /**
1648	+ * Finds the offset parent common to the two provided nodes
1649	+ * @method
1650	+ * @memberof Popper.Utils
1651	+ * @argument {Element} element1
1652	+ * @argument {Element} element2
1653	+ * @returns {Element} common offset parent
1654	+ */
1655	+ function findCommonOffsetParent(element1, element2) {
1656	+ // This check is needed to avoid errors in case one of the elements isn't defined for any reason
1657	+ if (!element1 \|\| !element1.nodeType \|\| !element2 \|\| !element2.nodeType) {
1658	+ return document.documentElement;
1659	+ }



























1660
1661	+ // Here we make sure to give as "start" the element that comes first in the DOM
1662	+ var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING;
1663	+ var start = order ? element1 : element2;
1664	+ var end = order ? element2 : element1;
1665
1666	+ // Get common ancestor container
1667	+ var range = document.createRange();
1668	+ range.setStart(start, 0);
1669	+ range.setEnd(end, 0);
1670	+ var commonAncestorContainer = range.commonAncestorContainer;
1671
1672	+ // Both nodes are inside #document




1673
1674	+ if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer \|\| start.contains(end)) {
1675	+ if (isOffsetContainer(commonAncestorContainer)) {
1676	+ return commonAncestorContainer;
1677	+ }
1678
1679	+ return getOffsetParent(commonAncestorContainer);
1680	+ }




1681
1682	+ // one of the nodes is inside shadowDOM, find which one
1683	+ var element1root = getRoot(element1);
1684	+ if (element1root.host) {
1685	+ return findCommonOffsetParent(element1root.host, element2);














































1686	} else {
1687	+ return findCommonOffsetParent(element1, getRoot(element2).host);
1688	}
1689	+ }
1690
1691	+ /**
1692	+ * Gets the scroll value of the given element in the given side (top and left)
1693	+ * @method
1694	+ * @memberof Popper.Utils
1695	+ * @argument {Element} element
1696	+ * @argument {String} side `top` or `left`
1697	+ * @returns {number} amount of scrolled pixels
1698	+ */
1699	+ function getScroll(element) {
1700	+ var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top';
1701
1702	+ var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft';
1703	+ var nodeName = element.nodeName;



1704
1705	+ if (nodeName === 'BODY' \|\| nodeName === 'HTML') {
1706	+ var html = element.ownerDocument.documentElement;
1707	+ var scrollingElement = element.ownerDocument.scrollingElement \|\| html;
1708	+ return scrollingElement[upperSide];



1709	}

1710
1711	+ return element[upperSide];





























1712	}
1713
1714	+ /*
1715	+ * Sum or subtract the element scroll values (left and top) from a given rect object
1716	+ * @method
1717	+ * @memberof Popper.Utils
1718	+ * @param {Object} rect - Rect object you want to change
1719	+ * @param {HTMLElement} element - The element from the function reads the scroll values
1720	+ * @param {Boolean} subtract - set to true if you want to subtract the scroll values
1721	+ * @return {Object} rect - The modifier rect object
1722	+ */
1723	+ function includeScroll(rect, element) {
1724	+ var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
1725	+
1726	+ var scrollTop = getScroll(element, 'top');
1727	+ var scrollLeft = getScroll(element, 'left');
1728	+ var modifier = subtract ? -1 : 1;
1729	+ rect.top += scrollTop * modifier;
1730	+ rect.bottom += scrollTop * modifier;
1731	+ rect.left += scrollLeft * modifier;
1732	+ rect.right += scrollLeft * modifier;
1733	+ return rect;
1734	+ }
1735
1736	+ /*
1737	+ * Helper to detect borders of a given element
1738	+ * @method
1739	+ * @memberof Popper.Utils
1740	+ * @param {CSSStyleDeclaration} styles
1741	+ * Result of `getStyleComputedProperty` on the given element
1742	+ * @param {String} axis - `x` or `y`
1743	+ * @return {number} borders - The borders size of the given axis
1744	+ */









1745
1746	+ function getBordersSize(styles, axis) {
1747	+ var sideA = axis === 'x' ? 'Left' : 'Top';
1748	+ var sideB = sideA === 'Left' ? 'Right' : 'Bottom';























































































1749
1750	+ return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10);











1751	}
1752
1753	+ function getSize(axis, body, html, computedStyle) {
1754	+ return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE(10) ? html['offset' + axis] + computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')] + computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')] : 0);














1755	}
1756
1757	+ function getWindowSizes() {
1758	+ var body = document.body;
1759	+ var html = document.documentElement;
1760	+ var computedStyle = isIE(10) && getComputedStyle(html);
















1761
1762	+ return {
1763	+ height: getSize('Height', body, html, computedStyle),
1764	+ width: getSize('Width', body, html, computedStyle)
1765	+ };















































1766	}
1767
1768	+ var classCallCheck = function (instance, Constructor) {
1769	+ if (!(instance instanceof Constructor)) {
1770	+ throw new TypeError("Cannot call a class as a function");
1771	+ }



1772	};
1773
1774	+ var createClass = function () {
1775	+ function defineProperties(target, props) {
1776	+ for (var i = 0; i < props.length; i++) {
1777	+ var descriptor = props[i];
1778	+ descriptor.enumerable = descriptor.enumerable \|\| false;
1779	+ descriptor.configurable = true;
1780	+ if ("value" in descriptor) descriptor.writable = true;
1781	+ Object.defineProperty(target, descriptor.key, descriptor);
1782	+ }
1783	+ }
1784
1785	+ return function (Constructor, protoProps, staticProps) {
1786	+ if (protoProps) defineProperties(Constructor.prototype, protoProps);
1787	+ if (staticProps) defineProperties(Constructor, staticProps);
1788	+ return Constructor;
1789	+ };
1790	+ }();
1791



1792


1793





























































1794

1795
1796	+ var defineProperty = function (obj, key, value) {
1797	+ if (key in obj) {
1798	+ Object.defineProperty(obj, key, {
1799	+ value: value,
1800	+ enumerable: true,
1801	+ configurable: true,
1802	+ writable: true
1803	+ });





































































































































1804	} else {
1805	+ obj[key] = value;
1806	}



























1807
1808	+ return obj;
1809	+ };


















































1810
1811	+ var _extends = Object.assign \|\| function (target) {
1812	+ for (var i = 1; i < arguments.length; i++) {
1813	+ var source = arguments[i];
1814
1815	+ for (var key in source) {
1816	+ if (Object.prototype.hasOwnProperty.call(source, key)) {
1817	+ target[key] = source[key];
1818	+ }
1819	+ }
1820	+ }
1821
1822	+ return target;





1823	};
1824
1825	+ /**
1826	+ * Given element offsets, generate an output similar to getBoundingClientRect
1827	+ * @method
1828	+ * @memberof Popper.Utils
1829	+ * @argument {Object} offsets
1830	+ * @returns {Object} ClientRect like output
1831	+ */
1832	+ function getClientRect(offsets) {
1833	+ return _extends({}, offsets, {
1834	+ right: offsets.left + offsets.width,
1835	+ bottom: offsets.top + offsets.height
1836	+ });





























1837	}
1838
1839	+ /**
1840	+ * Get bounding client rect of given element
1841	+ * @method
1842	+ * @memberof Popper.Utils
1843	+ * @param {HTMLElement} element
1844	+ * @return {Object} client rect
1845	+ */
1846	+ function getBoundingClientRect(element) {
1847	+ var rect = {};
1848
1849	+ // IE10 10 FIX: Please, don't ask, the element isn't
1850	+ // considered in DOM in some circumstances...
1851	+ // This isn't reproducible in IE10 compatibility mode of IE11
1852	+ try {
1853	+ if (isIE(10)) {
1854	+ rect = element.getBoundingClientRect();
1855	+ var scrollTop = getScroll(element, 'top');
1856	+ var scrollLeft = getScroll(element, 'left');
1857	+ rect.top += scrollTop;
1858	+ rect.left += scrollLeft;
1859	+ rect.bottom += scrollTop;
1860	+ rect.right += scrollLeft;
1861	+ } else {
1862	+ rect = element.getBoundingClientRect();
1863	+ }
1864	+ } catch (e) {}


































1865
1866	+ var result = {
1867	+ left: rect.left,
1868	+ top: rect.top,
1869	+ width: rect.right - rect.left,
1870	+ height: rect.bottom - rect.top
1871	+ };
1872
1873	+ // subtract scrollbar size from sizes
1874	+ var sizes = element.nodeName === 'HTML' ? getWindowSizes() : {};
1875	+ var width = sizes.width \|\| element.clientWidth \|\| result.right - result.left;
1876	+ var height = sizes.height \|\| element.clientHeight \|\| result.bottom - result.top;
1877
1878	+ var horizScrollbar = element.offsetWidth - width;
1879	+ var vertScrollbar = element.offsetHeight - height;
1880	+
1881	+ // if an hypothetical scrollbar is detected, we must be sure it's not a `border`
1882	+ // we make this check conditional for performance reasons
1883	+ if (horizScrollbar \|\| vertScrollbar) {
1884	+ var styles = getStyleComputedProperty(element);
1885	+ horizScrollbar -= getBordersSize(styles, 'x');
1886	+ vertScrollbar -= getBordersSize(styles, 'y');
1887	+
1888	+ result.width -= horizScrollbar;
1889	+ result.height -= vertScrollbar;
1890	}
1891	+
1892	+ return getClientRect(result);
1893	}
1894
1895	+ function getOffsetRectRelativeToArbitraryNode(children, parent) {
1896	+ var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;


1897
1898	+ var isIE10 = isIE(10);
1899	+ var isHTML = parent.nodeName === 'HTML';
1900	+ var childrenRect = getBoundingClientRect(children);
1901	+ var parentRect = getBoundingClientRect(parent);
1902	+ var scrollParent = getScrollParent(children);
1903
1904	+ var styles = getStyleComputedProperty(parent);
1905	+ var borderTopWidth = parseFloat(styles.borderTopWidth, 10);
1906	+ var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10);



1907
1908	+ // In cases where the parent is fixed, we must ignore negative scroll in offset calc
1909	+ if (fixedPosition && parent.nodeName === 'HTML') {
1910	+ parentRect.top = Math.max(parentRect.top, 0);
1911	+ parentRect.left = Math.max(parentRect.left, 0);
1912	+ }
1913	+ var offsets = getClientRect({
1914	+ top: childrenRect.top - parentRect.top - borderTopWidth,
1915	+ left: childrenRect.left - parentRect.left - borderLeftWidth,
1916	+ width: childrenRect.width,
1917	+ height: childrenRect.height
1918	+ });
1919	+ offsets.marginTop = 0;
1920	+ offsets.marginLeft = 0;
1921	+
1922	+ // Subtract margins of documentElement in case it's being used as parent
1923	+ // we do this only on HTML because it's the only element that behaves
1924	+ // differently when margins are applied to it. The margins are included in
1925	+ // the box of the documentElement, in the other cases not.
1926	+ if (!isIE10 && isHTML) {
1927	+ var marginTop = parseFloat(styles.marginTop, 10);
1928	+ var marginLeft = parseFloat(styles.marginLeft, 10);
1929	+
1930	+ offsets.top -= borderTopWidth - marginTop;
1931	+ offsets.bottom -= borderTopWidth - marginTop;
1932	+ offsets.left -= borderLeftWidth - marginLeft;
1933	+ offsets.right -= borderLeftWidth - marginLeft;
1934	+
1935	+ // Attach marginTop and marginLeft because in some circumstances we may need them
1936	+ offsets.marginTop = marginTop;
1937	+ offsets.marginLeft = marginLeft;
1938	+ }
1939
1940	+ if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') {
1941	+ offsets = includeScroll(offsets, parent);
1942	+ }


















































































































1943
1944	+ return offsets;


1945	}
1946
1947	+ function getViewportOffsetRectRelativeToArtbitraryNode(element) {
1948	+ var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
1949
1950	+ var html = element.ownerDocument.documentElement;
1951	+ var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html);
1952	+ var width = Math.max(html.clientWidth, window.innerWidth \|\| 0);
1953	+ var height = Math.max(html.clientHeight, window.innerHeight \|\| 0);
1954	+
1955	+ var scrollTop = !excludeScroll ? getScroll(html) : 0;
1956	+ var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0;
1957	+
1958	+ var offset = {
1959	+ top: scrollTop - relativeOffset.top + relativeOffset.marginTop,
1960	+ left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft,
1961	+ width: width,
1962	+ height: height
1963	+ };
1964
1965	+ return getClientRect(offset);











1966	}
1967
1968	+ /**
1969	+ * Check if the given element is fixed or is inside a fixed parent
1970	+ * @method
1971	+ * @memberof Popper.Utils
1972	+ * @argument {Element} element
1973	+ * @argument {Element} customContainer
1974	+ * @returns {Boolean} answer to "isFixed?"
1975	+ */
1976	+ function isFixed(element) {
1977	+ var nodeName = element.nodeName;
1978	+ if (nodeName === 'BODY' \|\| nodeName === 'HTML') {
1979	+ return false;
1980	}
1981	+ if (getStyleComputedProperty(element, 'position') === 'fixed') {
1982	+ return true;
1983	+ }
1984	+ return isFixed(getParentNode(element));
1985	+ }
1986
1987	+ /**
1988	+ * Finds the first parent of an element that has a transformed property defined
1989	+ * @method
1990	+ * @memberof Popper.Utils
1991	+ * @argument {Element} element
1992	+ * @returns {Element} first transformed parent or documentElement
1993	+ */
1994
1995	+ function getFixedPositionOffsetParent(element) {
1996	+ // This check is needed to avoid errors in case one of the elements isn't defined for any reason
1997	+ if (!element \|\| !element.parentElement \|\| isIE()) {
1998	+ return document.documentElement;
1999	+ }
2000	+ var el = element.parentElement;
2001	+ while (el && getStyleComputedProperty(el, 'transform') === 'none') {
2002	+ el = el.parentElement;
2003	+ }
2004	+ return el \|\| document.documentElement;
2005	+ }
2006
2007	+ /**
2008	+ * Computed the boundaries limits and return them
2009	+ * @method
2010	+ * @memberof Popper.Utils
2011	+ * @param {HTMLElement} popper
2012	+ * @param {HTMLElement} reference
2013	+ * @param {number} padding
2014	+ * @param {HTMLElement} boundariesElement - Element used to define the boundaries
2015	+ * @param {Boolean} fixedPosition - Is in fixed position mode
2016	+ * @returns {Object} Coordinates of the boundaries
2017	+ */
2018	+ function getBoundaries(popper, reference, padding, boundariesElement) {
2019	+ var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false;
2020
2021	+ // NOTE: 1 DOM access here



2022
2023	+ var boundaries = { top: 0, left: 0 };
2024	+ var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference);
2025
2026	+ // Handle viewport case
2027	+ if (boundariesElement === 'viewport') {
2028	+ boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition);
2029	+ } else {
2030	+ // Handle other cases based on DOM element used as boundaries
2031	+ var boundariesNode = void 0;
2032	+ if (boundariesElement === 'scrollParent') {
2033	+ boundariesNode = getScrollParent(getParentNode(reference));
2034	+ if (boundariesNode.nodeName === 'BODY') {
2035	+ boundariesNode = popper.ownerDocument.documentElement;
2036	+ }
2037	+ } else if (boundariesElement === 'window') {
2038	+ boundariesNode = popper.ownerDocument.documentElement;
2039	+ } else {
2040	+ boundariesNode = boundariesElement;
2041	+ }
2042
2043	+ var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition);


2044
2045	+ // In case of HTML, we need a different computation
2046	+ if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) {
2047	+ var _getWindowSizes = getWindowSizes(),
2048	+ height = _getWindowSizes.height,
2049	+ width = _getWindowSizes.width;
2050
2051	+ boundaries.top += offsets.top - offsets.marginTop;
2052	+ boundaries.bottom = height + offsets.top;
2053	+ boundaries.left += offsets.left - offsets.marginLeft;
2054	+ boundaries.right = width + offsets.left;
2055	+ } else {
2056	+ // for all the other DOM elements, this one is good
2057	+ boundaries = offsets;
2058	}
2059	+ }
2060
2061	+ // Add paddings
2062	+ boundaries.left += padding;
2063	+ boundaries.top += padding;
2064	+ boundaries.right -= padding;
2065	+ boundaries.bottom -= padding;
2066
2067	+ return boundaries;





























2068	}
2069
2070	+ function getArea(_ref) {
2071	+ var width = _ref.width,
2072	+ height = _ref.height;
2073	+
2074	+ return width * height;



















2075	}
2076
2077	+ /**
2078	+ * Utility used to transform the `auto` placement to the placement with more
2079	+ * available space.
2080	+ * @method
2081	+ * @memberof Popper.Utils
2082	+ * @argument {Object} data - The data object generated by update method
2083	+ * @argument {Object} options - Modifiers configuration and options
2084	+ * @returns {Object} The data object, properly modified
2085	+ */
2086	+ function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) {
2087	+ var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0;
2088
2089	+ if (placement.indexOf('auto') === -1) {
2090	+ return placement;







2091	}










































2092
2093	+ var boundaries = getBoundaries(popper, reference, padding, boundariesElement);
2094	+
2095	+ var rects = {
2096	+ top: {
2097	+ width: boundaries.width,
2098	+ height: refRect.top - boundaries.top
2099	+ },
2100	+ right: {
2101	+ width: boundaries.right - refRect.right,
2102	+ height: boundaries.height
2103	+ },
2104	+ bottom: {
2105	+ width: boundaries.width,
2106	+ height: boundaries.bottom - refRect.bottom
2107	+ },
2108	+ left: {
2109	+ width: refRect.left - boundaries.left,
2110	+ height: boundaries.height






2111	}
2112	+ };
2113	+
2114	+ var sortedAreas = Object.keys(rects).map(function (key) {
2115	+ return _extends({
2116	+ key: key
2117	+ }, rects[key], {
2118	+ area: getArea(rects[key])
2119	+ });
2120	+ }).sort(function (a, b) {
2121	+ return b.area - a.area;
2122	});

2123
2124	+ var filteredAreas = sortedAreas.filter(function (_ref2) {
2125	+ var width = _ref2.width,
2126	+ height = _ref2.height;
2127	+ return width >= popper.clientWidth && height >= popper.clientHeight;


2128	});
2129	+
2130	+ var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key;
2131	+
2132	+ var variation = placement.split('-')[1];
2133	+
2134	+ return computedPlacement + (variation ? '-' + variation : '');





















2135	}
2136
2137	+ /**
2138	+ * Get offsets to the reference element
2139	+ * @method
2140	+ * @memberof Popper.Utils
2141	+ * @param {Object} state
2142	+ * @param {Element} popper - the popper element
2143	+ * @param {Element} reference - the reference element (the popper will be relative to this)
2144	+ * @param {Element} fixedPosition - is in fixed position mode
2145	+ * @returns {Object} An object containing the offsets which will be applied to the popper
2146	+ */
2147	+ function getReferenceOffsets(state, popper, reference) {
2148	+ var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null;
2149	+
2150	+ var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference);
2151	+ return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition);
2152	}
2153
2154	+ /**
2155	+ * Get the outer sizes of the given element (offset size + margins)
2156	+ * @method
2157	+ * @memberof Popper.Utils
2158	+ * @argument {Element} element
2159	+ * @returns {Object} object containing width and height properties
2160	+ */
2161	+ function getOuterSizes(element) {
2162	+ var styles = getComputedStyle(element);
2163	+ var x = parseFloat(styles.marginTop) + parseFloat(styles.marginBottom);
2164	+ var y = parseFloat(styles.marginLeft) + parseFloat(styles.marginRight);
2165	+ var result = {
2166	+ width: element.offsetWidth + y,
2167	+ height: element.offsetHeight + x
2168	+ };
2169	+ return result;
2170	+ }
2171	+
2172	+ /**
2173	+ * Get the opposite placement of the given one
2174	+ * @method
2175	+ * @memberof Popper.Utils
2176	+ * @argument {String} placement
2177	+ * @returns {String} flipped placement
2178	+ */
2179	+ function getOppositePlacement(placement) {
2180	+ var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' };
2181	+ return placement.replace(/left\|right\|bottom\|top/g, function (matched) {
2182	+ return hash[matched];
2183	+ });
2184	}
2185
2186	+ /**
2187	+ * Get offsets to the popper
2188	+ * @method
2189	+ * @memberof Popper.Utils
2190	+ * @param {Object} position - CSS position the Popper will get applied
2191	+ * @param {HTMLElement} popper - the popper element
2192	+ * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this)
2193	+ * @param {String} placement - one of the valid placement options
2194	+ * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper
2195	+ */
2196	+ function getPopperOffsets(popper, referenceOffsets, placement) {
2197	+ placement = placement.split('-')[0];
2198	+
2199	+ // Get popper node sizes
2200	+ var popperRect = getOuterSizes(popper);
2201	+
2202	+ // Add position, width and height to our offsets object
2203	+ var popperOffsets = {
2204	+ width: popperRect.width,
2205	+ height: popperRect.height
2206	+ };
2207	+
2208	+ // depending by the popper placement we have to compute its offsets slightly differently
2209	+ var isHoriz = ['right', 'left'].indexOf(placement) !== -1;
2210	+ var mainSide = isHoriz ? 'top' : 'left';
2211	+ var secondarySide = isHoriz ? 'left' : 'top';
2212	+ var measurement = isHoriz ? 'height' : 'width';
2213	+ var secondaryMeasurement = !isHoriz ? 'height' : 'width';
2214
2215	+ popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2;
2216	+ if (placement === secondarySide) {
2217	+ popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement];
2218	+ } else {
2219	+ popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)];
2220	+ }
2221
2222	+ return popperOffsets;
2223	+ }
2224	+
2225	+ /**
2226	+ * Mimics the `find` method of Array
2227	+ * @method
2228	+ * @memberof Popper.Utils
2229	+ * @argument {Array} arr
2230	+ * @argument prop
2231	+ * @argument value
2232	+ * @returns index or -1
2233	+ */
2234	+ function find(arr, check) {
2235	+ // use native find if supported
2236	+ if (Array.prototype.find) {
2237	+ return arr.find(check);
2238	+ }
2239	+
2240	+ // use `filter` to obtain the same behavior of `find`
2241	+ return arr.filter(check)[0];
2242	+ }
2243	+
2244	+ /**
2245	+ * Return the index of the matching object
2246	+ * @method
2247	+ * @memberof Popper.Utils
2248	+ * @argument {Array} arr
2249	+ * @argument prop
2250	+ * @argument value
2251	+ * @returns index or -1
2252	+ */
2253	+ function findIndex(arr, prop, value) {
2254	+ // use native findIndex if supported
2255	+ if (Array.prototype.findIndex) {
2256	+ return arr.findIndex(function (cur) {
2257	+ return cur[prop] === value;
2258	+ });
2259	+ }
2260	+
2261	+ // use `find` + `indexOf` if `findIndex` isn't supported
2262	+ var match = find(arr, function (obj) {
2263	+ return obj[prop] === value;
2264	+ });
2265	+ return arr.indexOf(match);
2266	+ }
2267	+
2268	+ /**
2269	+ * Loop trough the list of modifiers and run them in order,
2270	+ * each of them will then edit the data object.
2271	+ * @method
2272	+ * @memberof Popper.Utils
2273	+ * @param {dataObject} data
2274	+ * @param {Array} modifiers
2275	+ * @param {String} ends - Optional modifier name used as stopper
2276	+ * @returns {dataObject}
2277	+ */
2278	+ function runModifiers(modifiers, data, ends) {
2279	+ var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends));
2280	+
2281	+ modifiersToRun.forEach(function (modifier) {
2282	+ if (modifier['function']) {
2283	+ // eslint-disable-line dot-notation
2284	+ console.warn('`modifier.function` is deprecated, use `modifier.fn`!');
2285	}
2286	+ var fn = modifier['function'] \|\| modifier.fn; // eslint-disable-line dot-notation
2287	+ if (modifier.enabled && isFunction(fn)) {
2288	+ // Add properties to offsets to make them a complete clientRect object
2289	+ // we do this before each modifier to make sure the previous one doesn't
2290	+ // mess with these values
2291	+ data.offsets.popper = getClientRect(data.offsets.popper);
2292	+ data.offsets.reference = getClientRect(data.offsets.reference);
2293	+
2294	+ data = fn(data, modifier);
2295	}
2296	+ });


2297
2298	+ return data;
2299	+ }

























2300
2301	+ /**
2302	+ * Updates the position of the popper, computing the new offsets and applying
2303	+ * the new style.<br />
2304	+ * Prefer `scheduleUpdate` over `update` because of performance reasons.
2305	+ * @method
2306	+ * @memberof Popper
2307	+ */
2308	+ function update() {
2309	+ // if popper is destroyed, don't perform any further update
2310	+ if (this.state.isDestroyed) {
2311	+ return;
2312	+ }
2313
2314	+ var data = {
2315	+ instance: this,
2316	+ styles: {},
2317	+ arrowStyles: {},
2318	+ attributes: {},
2319	+ flipped: false,
2320	+ offsets: {}
2321	};
2322
2323	+ // compute reference element offsets
2324	+ data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed);
2325	+
2326	+ // compute auto placement, store placement inside the data object,
2327	+ // modifiers will be able to edit `placement` if needed
2328	+ // and refer to originalPlacement to know the original value
2329	+ data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding);
2330	+
2331	+ // store the computed placement inside `originalPlacement`
2332	+ data.originalPlacement = data.placement;
2333	+
2334	+ data.positionFixed = this.options.positionFixed;
2335	+
2336	+ // compute the popper offsets
2337	+ data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement);
2338	+ data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute';
2339	+
2340	+ // run the modifiers
2341	+ data = runModifiers(this.modifiers, data);
2342	+
2343	+ // the first `update` will call `onCreate` callback
2344	+ // the other ones will call `onUpdate` callback
2345	+ if (!this.state.isCreated) {
2346	+ this.state.isCreated = true;
2347	+ this.options.onCreate(data);
2348	+ } else {
2349	+ this.options.onUpdate(data);
2350	+ }
2351	+ }
2352	+
2353	+ /**
2354	+ * Helper used to know if the given modifier is enabled.
2355	+ * @method
2356	+ * @memberof Popper.Utils
2357	+ * @returns {Boolean}
2358	+ */
2359	+ function isModifierEnabled(modifiers, modifierName) {
2360	+ return modifiers.some(function (_ref) {
2361	+ var name = _ref.name,
2362	+ enabled = _ref.enabled;
2363	+ return enabled && name === modifierName;
2364	+ });
2365	+ }
2366	+
2367	+ /**
2368	+ * Get the prefixed supported property name
2369	+ * @method
2370	+ * @memberof Popper.Utils
2371	+ * @argument {String} property (camelCase)
2372	+ * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix)
2373	+ */
2374	+ function getSupportedPropertyName(property) {
2375	+ var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O'];
2376	+ var upperProp = property.charAt(0).toUpperCase() + property.slice(1);
2377	+
2378	+ for (var i = 0; i < prefixes.length; i++) {
2379	+ var prefix = prefixes[i];
2380	+ var toCheck = prefix ? '' + prefix + upperProp : property;
2381	+ if (typeof document.body.style[toCheck] !== 'undefined') {
2382	+ return toCheck;
2383	+ }
2384	+ }
2385	+ return null;
2386	+ }
2387	+
2388	+ /**
2389	+ * Destroy the popper
2390	+ * @method
2391	+ * @memberof Popper
2392	+ */
2393	+ function destroy() {
2394	+ this.state.isDestroyed = true;
2395	+
2396	+ // touch DOM only if `applyStyle` modifier is enabled
2397	+ if (isModifierEnabled(this.modifiers, 'applyStyle')) {
2398	+ this.popper.removeAttribute('x-placement');
2399	+ this.popper.style.position = '';
2400	+ this.popper.style.top = '';
2401	+ this.popper.style.left = '';
2402	+ this.popper.style.right = '';
2403	+ this.popper.style.bottom = '';
2404	+ this.popper.style.willChange = '';
2405	+ this.popper.style[getSupportedPropertyName('transform')] = '';
2406	+ }
2407	+
2408	+ this.disableEventListeners();
2409	+
2410	+ // remove the popper if user explicity asked for the deletion on destroy
2411	+ // do not use `remove` because IE11 doesn't support it
2412	+ if (this.options.removeOnDestroy) {
2413	+ this.popper.parentNode.removeChild(this.popper);
2414	+ }
2415	+ return this;
2416	+ }
2417	+
2418	+ /**
2419	+ * Get the window associated with the element
2420	+ * @argument {Element} element
2421	+ * @returns {Window}
2422	+ */
2423	+ function getWindow(element) {
2424	+ var ownerDocument = element.ownerDocument;
2425	+ return ownerDocument ? ownerDocument.defaultView : window;
2426	+ }
2427	+
2428	+ function attachToScrollParents(scrollParent, event, callback, scrollParents) {
2429	+ var isBody = scrollParent.nodeName === 'BODY';
2430	+ var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent;
2431	+ target.addEventListener(event, callback, { passive: true });
2432	+
2433	+ if (!isBody) {
2434	+ attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents);
2435	+ }
2436	+ scrollParents.push(target);
2437	+ }
2438	+
2439	+ /**
2440	+ * Setup needed event listeners used to update the popper position
2441	+ * @method
2442	+ * @memberof Popper.Utils
2443	+ * @private
2444	+ */
2445	+ function setupEventListeners(reference, options, state, updateBound) {
2446	+ // Resize event listener on window
2447	+ state.updateBound = updateBound;
2448	+ getWindow(reference).addEventListener('resize', state.updateBound, { passive: true });
2449	+
2450	+ // Scroll event listener on scroll parents
2451	+ var scrollElement = getScrollParent(reference);
2452	+ attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents);
2453	+ state.scrollElement = scrollElement;
2454	+ state.eventsEnabled = true;
2455	+
2456	+ return state;
2457	+ }
2458	+
2459	+ /**
2460	+ * It will add resize/scroll events and start recalculating
2461	+ * position of the popper element when they are triggered.
2462	+ * @method
2463	+ * @memberof Popper
2464	+ */
2465	+ function enableEventListeners() {
2466	+ if (!this.state.eventsEnabled) {
2467	+ this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate);
2468	+ }
2469	+ }
2470	+
2471	+ /**
2472	+ * Remove event listeners used to update the popper position
2473	+ * @method
2474	+ * @memberof Popper.Utils
2475	+ * @private
2476	+ */
2477	+ function removeEventListeners(reference, state) {
2478	+ // Remove resize event listener on window
2479	+ getWindow(reference).removeEventListener('resize', state.updateBound);
2480	+
2481	+ // Remove scroll event listener on scroll parents
2482	+ state.scrollParents.forEach(function (target) {
2483	+ target.removeEventListener('scroll', state.updateBound);
2484	+ });
2485	+
2486	+ // Reset state
2487	+ state.updateBound = null;
2488	+ state.scrollParents = [];
2489	+ state.scrollElement = null;
2490	+ state.eventsEnabled = false;
2491	+ return state;
2492	+ }
2493	+
2494	+ /**
2495	+ * It will remove resize/scroll events and won't recalculate popper position
2496	+ * when they are triggered. It also won't trigger onUpdate callback anymore,
2497	+ * unless you call `update` method manually.
2498	+ * @method
2499	+ * @memberof Popper
2500	+ */
2501	+ function disableEventListeners() {
2502	+ if (this.state.eventsEnabled) {
2503	+ cancelAnimationFrame(this.scheduleUpdate);
2504	+ this.state = removeEventListeners(this.reference, this.state);
2505	+ }
2506	+ }
2507	+
2508	+ /**
2509	+ * Tells if a given input is a number
2510	+ * @method
2511	+ * @memberof Popper.Utils
2512	+ * @param {*} input to check
2513	+ * @return {Boolean}
2514	+ */
2515	+ function isNumeric(n) {
2516	+ return n !== '' && !isNaN(parseFloat(n)) && isFinite(n);
2517	}
2518
2519	+ /**
2520	+ * Set the style to the given popper
2521	+ * @method
2522	+ * @memberof Popper.Utils
2523	+ * @argument {Element} element - Element to apply the style to
2524	+ * @argument {Object} styles
2525	+ * Object with a list of properties and values which will be applied to the element
2526	+ */
2527	+ function setStyles(element, styles) {
2528	+ Object.keys(styles).forEach(function (prop) {
2529	+ var unit = '';
2530	+ // add unit if the value is numeric and is one of the following
2531	+ if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) {
2532	+ unit = 'px';
2533	+ }
2534	+ element.style[prop] = styles[prop] + unit;
2535	+ });
2536	+ }
2537	+
2538	+ /**
2539	+ * Set the attributes to the given popper
2540	+ * @method
2541	+ * @memberof Popper.Utils
2542	+ * @argument {Element} element - Element to apply the attributes to
2543	+ * @argument {Object} styles
2544	+ * Object with a list of properties and values which will be applied to the element
2545	+ */
2546	+ function setAttributes(element, attributes) {
2547	+ Object.keys(attributes).forEach(function (prop) {
2548	+ var value = attributes[prop];
2549	+ if (value !== false) {
2550	+ element.setAttribute(prop, attributes[prop]);
2551	+ } else {
2552	+ element.removeAttribute(prop);
2553	+ }
2554	+ });
2555	+ }
2556	+
2557	+ /**
2558	+ * @function
2559	+ * @memberof Modifiers
2560	+ * @argument {Object} data - The data object generated by `update` method
2561	+ * @argument {Object} data.styles - List of style properties - values to apply to popper element
2562	+ * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element
2563	+ * @argument {Object} options - Modifiers configuration and options
2564	+ * @returns {Object} The same data object
2565	+ */
2566	+ function applyStyle(data) {
2567	+ // any property present in `data.styles` will be applied to the popper,
2568	+ // in this way we can make the 3rd party modifiers add custom styles to it
2569	+ // Be aware, modifiers could override the properties defined in the previous
2570	+ // lines of this modifier!
2571	+ setStyles(data.instance.popper, data.styles);
2572	+
2573	+ // any property present in `data.attributes` will be applied to the popper,
2574	+ // they will be set as HTML attributes of the element
2575	+ setAttributes(data.instance.popper, data.attributes);
2576	+
2577	+ // if arrowElement is defined and arrowStyles has some properties
2578	+ if (data.arrowElement && Object.keys(data.arrowStyles).length) {
2579	+ setStyles(data.arrowElement, data.arrowStyles);
2580	+ }
2581	+
2582	return data;
2583	}
2584
2585	+ /**
2586	+ * Set the x-placement attribute before everything else because it could be used
2587	+ * to add margins to the popper margins needs to be calculated to get the
2588	+ * correct popper offsets.
2589	+ * @method
2590	+ * @memberof Popper.modifiers
2591	+ * @param {HTMLElement} reference - The reference element used to position the popper
2592	+ * @param {HTMLElement} popper - The HTML element used as popper
2593	+ * @param {Object} options - Popper.js options
2594	+ */
2595	+ function applyStyleOnLoad(reference, popper, options, modifierOptions, state) {
2596	+ // compute reference element offsets
2597	+ var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed);
2598
2599	+ // compute auto placement, store placement inside the data object,
2600	+ // modifiers will be able to edit `placement` if needed
2601	+ // and refer to originalPlacement to know the original value
2602	+ var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding);
2603	+
2604	+ popper.setAttribute('x-placement', placement);
2605	+
2606	+ // Apply `position` to popper before anything else because
2607	+ // without the position applied we can't guarantee correct computations
2608	+ setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' });
2609	+
2610	+ return options;
2611	+ }
2612	+
2613	+ /**
2614	+ * @function
2615	+ * @memberof Modifiers
2616	+ * @argument {Object} data - The data object generated by `update` method
2617	+ * @argument {Object} options - Modifiers configuration and options
2618	+ * @returns {Object} The data object, properly modified
2619	+ */
2620	+ function computeStyle(data, options) {
2621	+ var x = options.x,
2622	+ y = options.y;
2623	+ var popper = data.offsets.popper;
2624	+
2625	+ // Remove this legacy support in Popper.js v2
2626	+
2627	+ var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) {
2628	+ return modifier.name === 'applyStyle';
2629	+ }).gpuAcceleration;
2630	+ if (legacyGpuAccelerationOption !== undefined) {
2631	+ console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!');
2632	+ }
2633	+ var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration;
2634	+
2635	+ var offsetParent = getOffsetParent(data.instance.popper);
2636	+ var offsetParentRect = getBoundingClientRect(offsetParent);
2637	+
2638	+ // Styles
2639	+ var styles = {
2640	+ position: popper.position
2641	+ };
2642	+
2643	+ // floor sides to avoid blurry text
2644	+ var offsets = {
2645	+ left: Math.floor(popper.left),
2646	+ top: Math.floor(popper.top),
2647	+ bottom: Math.floor(popper.bottom),
2648	+ right: Math.floor(popper.right)
2649	+ };
2650	+
2651	+ var sideA = x === 'bottom' ? 'top' : 'bottom';
2652	+ var sideB = y === 'right' ? 'left' : 'right';
2653	+
2654	+ // if gpuAcceleration is set to `true` and transform is supported,
2655	+ // we use `translate3d` to apply the position to the popper we
2656	+ // automatically use the supported prefixed version if needed
2657	+ var prefixedProperty = getSupportedPropertyName('transform');
2658	+
2659	+ // now, let's make a step back and look at this code closely (wtf?)
2660	+ // If the content of the popper grows once it's been positioned, it
2661	+ // may happen that the popper gets misplaced because of the new content
2662	+ // overflowing its reference element
2663	+ // To avoid this problem, we provide two options (x and y), which allow
2664	+ // the consumer to define the offset origin.
2665	+ // If we position a popper on top of a reference element, we can set
2666	+ // `x` to `top` to make the popper grow towards its top instead of
2667	+ // its bottom.
2668	+ var left = void 0,
2669	+ top = void 0;
2670	+ if (sideA === 'bottom') {
2671	+ top = -offsetParentRect.height + offsets.bottom;
2672	+ } else {
2673	+ top = offsets.top;
2674	+ }
2675	+ if (sideB === 'right') {
2676	+ left = -offsetParentRect.width + offsets.right;
2677	+ } else {
2678	+ left = offsets.left;
2679	}
2680	+ if (gpuAcceleration && prefixedProperty) {
2681	+ styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)';
2682	+ styles[sideA] = 0;
2683	+ styles[sideB] = 0;
2684	+ styles.willChange = 'transform';
2685	+ } else {
2686	+ // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties
2687	+ var invertTop = sideA === 'bottom' ? -1 : 1;
2688	+ var invertLeft = sideB === 'right' ? -1 : 1;
2689	+ styles[sideA] = top * invertTop;
2690	+ styles[sideB] = left * invertLeft;
2691	+ styles.willChange = sideA + ', ' + sideB;
2692	+ }
2693	+
2694	+ // Attributes
2695	+ var attributes = {
2696	+ 'x-placement': data.placement
2697	+ };
2698	+
2699	+ // Update `data` attributes, styles and arrowStyles
2700	+ data.attributes = _extends({}, attributes, data.attributes);
2701	+ data.styles = _extends({}, styles, data.styles);
2702	+ data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles);
2703	+
2704	+ return data;
2705	+ }
2706
2707	+ /**
2708	+ * Helper used to know if the given modifier depends from another one.<br />
2709	+ * It checks if the needed modifier is listed and enabled.
2710	+ * @method
2711	+ * @memberof Popper.Utils
2712	+ * @param {Array} modifiers - list of modifiers
2713	+ * @param {String} requestingName - name of requesting modifier
2714	+ * @param {String} requestedName - name of requested modifier
2715	+ * @returns {Boolean}
2716	+ */
2717	+ function isModifierRequired(modifiers, requestingName, requestedName) {
2718	+ var requesting = find(modifiers, function (_ref) {
2719	+ var name = _ref.name;
2720	+ return name === requestingName;
2721	+ });
2722	+
2723	+ var isRequired = !!requesting && modifiers.some(function (modifier) {
2724	+ return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order;
2725	+ });
2726	+
2727	+ if (!isRequired) {
2728	+ var _requesting = '`' + requestingName + '`';
2729	+ var requested = '`' + requestedName + '`';
2730	+ console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!');
2731	+ }
2732	+ return isRequired;
2733	+ }
2734	+
2735	+ /**
2736	+ * @function
2737	+ * @memberof Modifiers
2738	+ * @argument {Object} data - The data object generated by update method
2739	+ * @argument {Object} options - Modifiers configuration and options
2740	+ * @returns {Object} The data object, properly modified
2741	+ */
2742	+ function arrow(data, options) {
2743	+ var _data$offsets$arrow;
2744	+
2745	+ // arrow depends on keepTogether in order to work
2746	+ if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) {
2747	return data;
2748	}
2749
2750	+ var arrowElement = options.element;
2751	+
2752	+ // if arrowElement is a string, suppose it's a CSS selector
2753	+ if (typeof arrowElement === 'string') {
2754	+ arrowElement = data.instance.popper.querySelector(arrowElement);
2755	+
2756	+ // if arrowElement is not found, don't run the modifier
2757	+ if (!arrowElement) {
2758	+ return data;
2759	+ }
2760	+ } else {
2761	+ // if the arrowElement isn't a query selector we must check that the
2762	+ // provided DOM node is child of its popper node
2763	+ if (!data.instance.popper.contains(arrowElement)) {
2764	+ console.warn('WARNING: `arrow.element` must be child of its popper element!');
2765	+ return data;
2766	+ }
2767	+ }
2768	+
2769	+ var placement = data.placement.split('-')[0];
2770	+ var _data$offsets = data.offsets,
2771	+ popper = _data$offsets.popper,
2772	+ reference = _data$offsets.reference;
2773	+
2774	+ var isVertical = ['left', 'right'].indexOf(placement) !== -1;
2775	+
2776	+ var len = isVertical ? 'height' : 'width';
2777	+ var sideCapitalized = isVertical ? 'Top' : 'Left';
2778	+ var side = sideCapitalized.toLowerCase();
2779	+ var altSide = isVertical ? 'left' : 'top';
2780	+ var opSide = isVertical ? 'bottom' : 'right';
2781	+ var arrowElementSize = getOuterSizes(arrowElement)[len];
2782	+
2783	+ //
2784	+ // extends keepTogether behavior making sure the popper and its
2785	+ // reference have enough pixels in conjuction
2786	+ //
2787	+
2788	+ // top/left side
2789	+ if (reference[opSide] - arrowElementSize < popper[side]) {
2790	+ data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize);
2791	+ }
2792	+ // bottom/right side
2793	+ if (reference[side] + arrowElementSize > popper[opSide]) {
2794	+ data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide];
2795	+ }
2796	+ data.offsets.popper = getClientRect(data.offsets.popper);
2797	+
2798	+ // compute center of the popper
2799	+ var center = reference[side] + reference[len] / 2 - arrowElementSize / 2;
2800	+
2801	+ // Compute the sideValue using the updated popper offsets
2802	+ // take popper margin in account because we don't have this info available
2803	+ var css = getStyleComputedProperty(data.instance.popper);
2804	+ var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10);
2805	+ var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10);
2806	+ var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide;
2807	+
2808	+ // prevent arrowElement from being placed not contiguously to its popper
2809	+ sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0);
2810	+
2811	+ data.arrowElement = arrowElement;
2812	+ data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow);
2813	+
2814	+ return data;
2815	}
2816



















































2817	/**
2818	+ * Get the opposite placement variation of the given one
2819	+ * @method
2820	+ * @memberof Popper.Utils
2821	+ * @argument {String} placement variation
2822	+ * @returns {String} flipped placement variation

2823	*/
2824	+ function getOppositeVariation(variation) {
2825	+ if (variation === 'end') {
2826	+ return 'start';
2827	+ } else if (variation === 'start') {
2828	+ return 'end';
2829	+ }
2830	+ return variation;
2831	+ }
2832
2833	/**
2834	+ * List of accepted placements to use as values of the `placement` option.<br />
2835	+ * Valid placements are:
2836	+ * - `auto`
2837	+ * - `top`
2838	+ * - `right`
2839	+ * - `bottom`
2840	+ * - `left`

2841	*
2842	+ * Each placement can have a variation from this list:
2843	+ * - `-start`
2844	+ * - `-end`
2845	*
2846	+ * Variations are interpreted easily if you think of them as the left to right
2847	+ * written languages. Horizontally (`top` and `bottom`), `start` is left and `end`
2848	+ * is right.<br />
2849	+ * Vertically (`left` and `right`), `start` is top and `end` is bottom.


2850	*
2851	+ * Some valid examples are:
2852	+ * - `top-end` (on top of reference, right aligned)
2853	+ * - `right-start` (on right of reference, top aligned)
2854	+ * - `bottom` (on bottom, centered)
2855	+ * - `auto-right` (on the side with more space available, alignment depends by placement)








2856	*
2857	+ * @static
2858	+ * @type {Array}
2859	+ * @enum {String}
2860	+ * @readonly
2861	+ * @method placements
2862	+ * @memberof Popper
2863	*/
2864	+ var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start'];
2865	+
2866	+ // Get rid of `auto` `auto-start` and `auto-end`
2867	+ var validPlacements = placements.slice(3);








2868
2869	/**
2870	+ * Given an initial placement, returns all the subsequent placements
2871	+ * clockwise (or counter-clockwise).



2872	*
2873	+ * @method
2874	+ * @memberof Popper.Utils
2875	+ * @argument {String} placement - A valid placement (it accepts variations)
2876	+ * @argument {Boolean} counter - Set to true to walk the placements counterclockwise
2877	+ * @returns {Array} placements including their variations




2878	*/
2879	+ function clockwise(placement) {
2880	+ var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
2881	+
2882	+ var index = validPlacements.indexOf(placement);
2883	+ var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index));
2884	+ return counter ? arr.reverse() : arr;
2885	+ }
2886	+
2887	+ var BEHAVIORS = {
2888	+ FLIP: 'flip',
2889	+ CLOCKWISE: 'clockwise',
2890	+ COUNTERCLOCKWISE: 'counterclockwise'
2891	+ };
2892	+
2893	+ /**
2894	+ * @function
2895	+ * @memberof Modifiers
2896	+ * @argument {Object} data - The data object generated by update method
2897	+ * @argument {Object} options - Modifiers configuration and options
2898	+ * @returns {Object} The data object, properly modified
2899	+ */
2900	+ function flip(data, options) {
2901	+ // if `inner` modifier is enabled, we can't use the `flip` modifier
2902	+ if (isModifierEnabled(data.instance.modifiers, 'inner')) {
2903	+ return data;
2904	+ }
2905	+
2906	+ if (data.flipped && data.placement === data.originalPlacement) {
2907	+ // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides
2908	+ return data;
2909	+ }
2910	+
2911	+ var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed);
2912	+
2913	+ var placement = data.placement.split('-')[0];
2914	+ var placementOpposite = getOppositePlacement(placement);
2915	+ var variation = data.placement.split('-')[1] \|\| '';
2916	+
2917	+ var flipOrder = [];
2918	+
2919	+ switch (options.behavior) {
2920	+ case BEHAVIORS.FLIP:
2921	+ flipOrder = [placement, placementOpposite];
2922	+ break;
2923	+ case BEHAVIORS.CLOCKWISE:
2924	+ flipOrder = clockwise(placement);
2925	+ break;
2926	+ case BEHAVIORS.COUNTERCLOCKWISE:
2927	+ flipOrder = clockwise(placement, true);
2928	+ break;
2929	+ default:
2930	+ flipOrder = options.behavior;
2931	+ }
2932	+
2933	+ flipOrder.forEach(function (step, index) {
2934	+ if (placement !== step \|\| flipOrder.length === index + 1) {
2935	+ return data;
2936	+ }
2937	+
2938	+ placement = data.placement.split('-')[0];
2939	+ placementOpposite = getOppositePlacement(placement);
2940	+
2941	+ var popperOffsets = data.offsets.popper;
2942	+ var refOffsets = data.offsets.reference;
2943	+
2944	+ // using floor because the reference offsets may contain decimals we are not going to consider here
2945	+ var floor = Math.floor;
2946	+ var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) \|\| placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) \|\| placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) \|\| placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom);
2947	+
2948	+ var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left);
2949	+ var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right);
2950	+ var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top);
2951	+ var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom);
2952	+
2953	+ var overflowsBoundaries = placement === 'left' && overflowsLeft \|\| placement === 'right' && overflowsRight \|\| placement === 'top' && overflowsTop \|\| placement === 'bottom' && overflowsBottom;
2954	+
2955	+ // flip the variation if required
2956	+ var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
2957	+ var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft \|\| isVertical && variation === 'end' && overflowsRight \|\| !isVertical && variation === 'start' && overflowsTop \|\| !isVertical && variation === 'end' && overflowsBottom);
2958	+
2959	+ if (overlapsRef \|\| overflowsBoundaries \|\| flippedVariation) {
2960	+ // this boolean to detect any flip loop
2961	+ data.flipped = true;
2962	+
2963	+ if (overlapsRef \|\| overflowsBoundaries) {
2964	+ placement = flipOrder[index + 1];
2965	+ }
2966	+
2967	+ if (flippedVariation) {
2968	+ variation = getOppositeVariation(variation);
2969	+ }
2970	+
2971	+ data.placement = placement + (variation ? '-' + variation : '');
2972	+
2973	+ // this object contains `position`, we want to preserve it along with
2974	+ // any additional property we may add in the future
2975	+ data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement));
2976	+
2977	+ data = runModifiers(data.instance.modifiers, data, 'flip');
2978	+ }
2979	+ });
2980	+ return data;
2981	+ }
2982
2983	/**
2984	+ * @function
2985	+ * @memberof Modifiers
2986	+ * @argument {Object} data - The data object generated by update method
2987	+ * @argument {Object} options - Modifiers configuration and options
2988	+ * @returns {Object} The data object, properly modified


2989	*/
2990	+ function keepTogether(data) {
2991	+ var _data$offsets = data.offsets,
2992	+ popper = _data$offsets.popper,
2993	+ reference = _data$offsets.reference;
2994	+
2995	+ var placement = data.placement.split('-')[0];
2996	+ var floor = Math.floor;
2997	+ var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
2998	+ var side = isVertical ? 'right' : 'bottom';
2999	+ var opSide = isVertical ? 'left' : 'top';
3000	+ var measurement = isVertical ? 'width' : 'height';
3001	+
3002	+ if (popper[side] < floor(reference[opSide])) {
3003	+ data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement];
3004	+ }
3005	+ if (popper[opSide] > floor(reference[side])) {
3006	+ data.offsets.popper[opSide] = floor(reference[side]);
3007	+ }
3008	+
3009	+ return data;
3010	+ }
3011
3012	/**
3013	+ * Converts a string containing value + unit into a px value number
3014	+ * @function
3015	+ * @memberof {modifiers~offset}
3016	+ * @private
3017	+ * @argument {String} str - Value + unit string
3018	+ * @argument {String} measurement - `height` or `width`
3019	+ * @argument {Object} popperOffsets
3020	+ * @argument {Object} referenceOffsets
3021	+ * @returns {Number\|String}
3022	+ * Value in pixels, or original string if no values were extracted
3023	*/
3024	+ function toValue(str, measurement, popperOffsets, referenceOffsets) {
3025	+ // separate value from unit
3026	+ var split = str.match(/((?:\-\|\+)?\d\.?\d)(.*)/);
3027	+ var value = +split[1];
3028	+ var unit = split[2];
3029	+
3030	+ // If it's not a number it's an operator, I guess
3031	+ if (!value) {
3032	+ return str;
3033	+ }
3034	+
3035	+ if (unit.indexOf('%') === 0) {
3036	+ var element = void 0;
3037	+ switch (unit) {
3038	+ case '%p':
3039	+ element = popperOffsets;
3040	+ break;
3041	+ case '%':
3042	+ case '%r':
3043	+ default:
3044	+ element = referenceOffsets;
3045	+ }
3046	+
3047	+ var rect = getClientRect(element);
3048	+ return rect[measurement] / 100 * value;
3049	+ } else if (unit === 'vh' \|\| unit === 'vw') {
3050	+ // if is a vh or vw, we calculate the size based on the viewport
3051	+ var size = void 0;
3052	+ if (unit === 'vh') {
3053	+ size = Math.max(document.documentElement.clientHeight, window.innerHeight \|\| 0);
3054	+ } else {
3055	+ size = Math.max(document.documentElement.clientWidth, window.innerWidth \|\| 0);
3056	+ }
3057	+ return size / 100 * value;
3058	+ } else {
3059	+ // if is an explicit pixel unit, we get rid of the unit and keep the value
3060	+ // if is an implicit unit, it's px, and we return just the value
3061	+ return value;
3062	+ }
3063	+ }
3064
3065	/**
3066	+ * Parse an `offset` string to extrapolate `x` and `y` numeric offsets.
3067	+ * @function
3068	+ * @memberof {modifiers~offset}
3069	+ * @private
3070	+ * @argument {String} offset
3071	+ * @argument {Object} popperOffsets
3072	+ * @argument {Object} referenceOffsets
3073	+ * @argument {String} basePlacement
3074	+ * @returns {Array} a two cells array with x and y offsets in numbers
3075	*/
3076	+ function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) {
3077	+ var offsets = [0, 0];
3078	+
3079	+ // Use height if placement is left or right and index is 0 otherwise use width
3080	+ // in this way the first offset will use an axis and the second one
3081	+ // will use the other one
3082	+ var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1;
3083	+
3084	+ // Split the offset string to obtain a list of values and operands
3085	+ // The regex addresses values with the plus or minus sign in front (+10, -20, etc)
3086	+ var fragments = offset.split(/(\+\|\-)/).map(function (frag) {
3087	+ return frag.trim();
3088	+ });
3089	+
3090	+ // Detect if the offset string contains a pair of values or a single one
3091	+ // they could be separated by comma or space
3092	+ var divider = fragments.indexOf(find(fragments, function (frag) {
3093	+ return frag.search(/,\|\s/) !== -1;
3094	+ }));
3095	+
3096	+ if (fragments[divider] && fragments[divider].indexOf(',') === -1) {
3097	+ console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.');
3098	+ }
3099	+
3100	+ // If divider is found, we divide the list of values and operands to divide
3101	+ // them by ofset X and Y.
3102	+ var splitRegex = /\s,\s\|\s+/;
3103	+ var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments];
3104	+
3105	+ // Convert the values with units to absolute pixels to allow our computations
3106	+ ops = ops.map(function (op, index) {
3107	+ // Most of the units rely on the orientation of the popper
3108	+ var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width';
3109	+ var mergeWithPrevious = false;
3110	+ return op
3111	+ // This aggregates any `+` or `-` sign that aren't considered operators
3112	+ // e.g.: 10 + +5 => [10, +, +5]
3113	+ .reduce(function (a, b) {
3114	+ if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) {
3115	+ a[a.length - 1] = b;
3116	+ mergeWithPrevious = true;
3117	+ return a;
3118	+ } else if (mergeWithPrevious) {
3119	+ a[a.length - 1] += b;
3120	+ mergeWithPrevious = false;
3121	+ return a;
3122	+ } else {
3123	+ return a.concat(b);
3124	+ }
3125	+ }, [])
3126	+ // Here we convert the string values into number values (in px)
3127	+ .map(function (str) {
3128	+ return toValue(str, measurement, popperOffsets, referenceOffsets);
3129	+ });
3130	+ });
3131	+
3132	+ // Loop trough the offsets arrays and execute the operations
3133	+ ops.forEach(function (op, index) {
3134	+ op.forEach(function (frag, index2) {
3135	+ if (isNumeric(frag)) {
3136	+ offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1);
3137	+ }
3138	+ });
3139	+ });
3140	+ return offsets;
3141	+ }
3142
3143	/**
3144	+ * @function
3145	+ * @memberof Modifiers
3146	+ * @argument {Object} data - The data object generated by update method
3147	+ * @argument {Object} options - Modifiers configuration and options
3148	+ * @argument {Number\|String} options.offset=0
3149	+ * The offset value as described in the modifier description
3150	+ * @returns {Object} The data object, properly modified
3151	*/
3152	+ function offset(data, _ref) {
3153	+ var offset = _ref.offset;
3154	+ var placement = data.placement,
3155	+ _data$offsets = data.offsets,
3156	+ popper = _data$offsets.popper,
3157	+ reference = _data$offsets.reference;
3158	+
3159	+ var basePlacement = placement.split('-')[0];
3160	+
3161	+ var offsets = void 0;
3162	+ if (isNumeric(+offset)) {
3163	+ offsets = [+offset, 0];
3164	+ } else {
3165	+ offsets = parseOffset(offset, popper, reference, basePlacement);
3166	+ }
3167	+
3168	+ if (basePlacement === 'left') {
3169	+ popper.top += offsets[0];
3170	+ popper.left -= offsets[1];
3171	+ } else if (basePlacement === 'right') {
3172	+ popper.top += offsets[0];
3173	+ popper.left += offsets[1];
3174	+ } else if (basePlacement === 'top') {
3175	+ popper.left += offsets[0];
3176	+ popper.top -= offsets[1];
3177	+ } else if (basePlacement === 'bottom') {
3178	+ popper.left += offsets[0];
3179	+ popper.top += offsets[1];
3180	+ }
3181	+
3182	+ data.popper = popper;
3183	+ return data;
3184	+ }
3185
3186	/**
3187	+ * @function
3188	+ * @memberof Modifiers
3189	+ * @argument {Object} data - The data object generated by `update` method
3190	+ * @argument {Object} options - Modifiers configuration and options
3191	+ * @returns {Object} The data object, properly modified



3192	*/
3193	+ function preventOverflow(data, options) {
3194	+ var boundariesElement = options.boundariesElement \|\| getOffsetParent(data.instance.popper);
3195	+
3196	+ // If offsetParent is the reference element, we really want to
3197	+ // go one step up and use the next offsetParent as reference to
3198	+ // avoid to make this modifier completely useless and look like broken
3199	+ if (data.instance.reference === boundariesElement) {
3200	+ boundariesElement = getOffsetParent(boundariesElement);
3201	+ }
3202	+
3203	+ var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed);
3204	+ options.boundaries = boundaries;
3205	+
3206	+ var order = options.priority;
3207	+ var popper = data.offsets.popper;
3208	+
3209	+ var check = {
3210	+ primary: function primary(placement) {
3211	+ var value = popper[placement];
3212	+ if (popper[placement] < boundaries[placement] && !options.escapeWithReference) {
3213	+ value = Math.max(popper[placement], boundaries[placement]);
3214	+ }
3215	+ return defineProperty({}, placement, value);
3216	+ },
3217	+ secondary: function secondary(placement) {
3218	+ var mainSide = placement === 'right' ? 'left' : 'top';
3219	+ var value = popper[mainSide];
3220	+ if (popper[placement] > boundaries[placement] && !options.escapeWithReference) {
3221	+ value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height));
3222	+ }
3223	+ return defineProperty({}, mainSide, value);
3224	+ }
3225	+ };
3226	+
3227	+ order.forEach(function (placement) {
3228	+ var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary';
3229	+ popper = _extends({}, popper, check[side](placement));
3230	+ });
3231	+
3232	+ data.offsets.popper = popper;
3233	+
3234	+ return data;
3235	+ }
3236
3237	/**
3238	+ * @function
3239	+ * @memberof Modifiers
3240	+ * @argument {Object} data - The data object generated by `update` method
3241	+ * @argument {Object} options - Modifiers configuration and options
3242	+ * @returns {Object} The data object, properly modified
3243	+ */
3244	+ function shift(data) {
3245	+ var placement = data.placement;
3246	+ var basePlacement = placement.split('-')[0];
3247	+ var shiftvariation = placement.split('-')[1];
3248	+
3249	+ // if shift shiftvariation is specified, run the modifier
3250	+ if (shiftvariation) {
3251	+ var _data$offsets = data.offsets,
3252	+ reference = _data$offsets.reference,
3253	+ popper = _data$offsets.popper;
3254	+
3255	+ var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1;
3256	+ var side = isVertical ? 'left' : 'top';
3257	+ var measurement = isVertical ? 'width' : 'height';
3258	+
3259	+ var shiftOffsets = {
3260	+ start: defineProperty({}, side, reference[side]),
3261	+ end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement])
3262	+ };
3263	+
3264	+ data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]);
3265	+ }
3266	+
3267	+ return data;
3268	+ }
3269	+
3270	+ /**
3271	+ * @function
3272	+ * @memberof Modifiers
3273	+ * @argument {Object} data - The data object generated by update method
3274	+ * @argument {Object} options - Modifiers configuration and options
3275	+ * @returns {Object} The data object, properly modified
3276	+ */
3277	+ function hide(data) {
3278	+ if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) {
3279	+ return data;
3280	+ }
3281	+
3282	+ var refRect = data.offsets.reference;
3283	+ var bound = find(data.instance.modifiers, function (modifier) {
3284	+ return modifier.name === 'preventOverflow';
3285	+ }).boundaries;
3286	+
3287	+ if (refRect.bottom < bound.top \|\| refRect.left > bound.right \|\| refRect.top > bound.bottom \|\| refRect.right < bound.left) {
3288	+ // Avoid unnecessary DOM access if visibility hasn't changed
3289	+ if (data.hide === true) {
3290	+ return data;
3291	+ }
3292	+
3293	+ data.hide = true;
3294	+ data.attributes['x-out-of-boundaries'] = '';
3295	+ } else {
3296	+ // Avoid unnecessary DOM access if visibility hasn't changed
3297	+ if (data.hide === false) {
3298	+ return data;
3299	+ }
3300	+
3301	+ data.hide = false;
3302	+ data.attributes['x-out-of-boundaries'] = false;
3303	+ }
3304	+
3305	+ return data;
3306	+ }
3307	+
3308	+ /**
3309	+ * @function
3310	+ * @memberof Modifiers
3311	+ * @argument {Object} data - The data object generated by `update` method
3312	+ * @argument {Object} options - Modifiers configuration and options
3313	+ * @returns {Object} The data object, properly modified
3314	+ */
3315	+ function inner(data) {
3316	+ var placement = data.placement;
3317	+ var basePlacement = placement.split('-')[0];
3318	+ var _data$offsets = data.offsets,
3319	+ popper = _data$offsets.popper,
3320	+ reference = _data$offsets.reference;
3321	+
3322	+ var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1;
3323	+
3324	+ var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1;
3325	+
3326	+ popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0);
3327	+
3328	+ data.placement = getOppositePlacement(placement);
3329	+ data.offsets.popper = getClientRect(popper);
3330	+
3331	+ return data;
3332	+ }
3333	+
3334	+ /**
3335	+ * Modifier function, each modifier can have a function of this type assigned
3336	+ * to its `fn` property.<br />
3337	+ * These functions will be called on each update, this means that you must
3338	+ * make sure they are performant enough to avoid performance bottlenecks.
3339	*
3340	+ * @function ModifierFn
3341	+ * @argument {dataObject} data - The data object generated by `update` method
3342	+ * @argument {Object} options - Modifiers configuration and options
3343	+ * @returns {dataObject} The data object, properly modified
3344	+ */
3345	+
3346	+ /**
3347	+ * Modifiers are plugins used to alter the behavior of your poppers.<br />
3348	+ * Popper.js uses a set of 9 modifiers to provide all the basic functionalities
3349	+ * needed by the library.
3350	*
3351	+ * Usually you don't want to override the `order`, `fn` and `onLoad` props.
3352	+ * All the other properties are configurations that could be tweaked.
3353	+ * @namespace modifiers
3354	*/
3355	+ var modifiers = {






3356	/**
3357	+ * Modifier used to shift the popper on the start or end of its reference
3358	+ * element.<br />
3359	+ * It will read the variation of the `placement` property.<br />
3360	+ * It can be one either `-end` or `-start`.
3361	+ * @memberof modifiers
3362	+ * @inner
3363	*/
3364	+ shift: {
3365	+ /** @prop {number} order=100 - Index used to define the order of execution */
3366	+ order: 100,
3367	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3368	+ enabled: true,
3369	+ /** @prop {ModifierFn} */
3370	+ fn: shift
3371	+ },
3372	+
3373	/**
3374	+ * The `offset` modifier can shift your popper on both its axis.
3375	+ *
3376	+ * It accepts the following units:
3377	+ * - `px` or unitless, interpreted as pixels
3378	+ * - `%` or `%r`, percentage relative to the length of the reference element
3379	+ * - `%p`, percentage relative to the length of the popper element
3380	+ * - `vw`, CSS viewport width unit
3381	+ * - `vh`, CSS viewport height unit
3382	+ *
3383	+ * For length is intended the main axis relative to the placement of the popper.<br />
3384	+ * This means that if the placement is `top` or `bottom`, the length will be the
3385	+ * `width`. In case of `left` or `right`, it will be the height.
3386	+ *
3387	+ * You can provide a single value (as `Number` or `String`), or a pair of values
3388	+ * as `String` divided by a comma or one (or more) white spaces.<br />
3389	+ * The latter is a deprecated method because it leads to confusion and will be
3390	+ * removed in v2.<br />
3391	+ * Additionally, it accepts additions and subtractions between different units.
3392	+ * Note that multiplications and divisions aren't supported.
3393	+ *
3394	+ * Valid examples are:
3395	+ * ```
3396	+ * 10
3397	+ * '10%'
3398	+ * '10, 10'
3399	+ * '10%, 10'
3400	+ * '10 + 10%'
3401	+ * '10 - 5vh + 3%'
3402	+ * '-10px + 5vh, 5px - 6%'
3403	+ * ```
3404	+ * > NB: If you desire to apply offsets to your poppers in a way that may make them overlap
3405	+ * > with their reference element, unfortunately, you will have to disable the `flip` modifier.
3406	+ * > More on this [reading this issue](https://github.com/FezVrasta/popper.js/issues/373)
3407	+ *
3408	+ * @memberof modifiers
3409	+ * @inner
3410	*/
3411	+ offset: {
3412	+ /** @prop {number} order=200 - Index used to define the order of execution */
3413	+ order: 200,
3414	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3415	+ enabled: true,
3416	+ /** @prop {ModifierFn} */
3417	+ fn: offset,
3418	+ /** @prop {Number\|String} offset=0
3419	+ * The offset value as described in the modifier description
3420	+ */
3421	+ offset: 0
3422	+ },
3423	+
3424	/**
3425	+ * Modifier used to prevent the popper from being positioned outside the boundary.
3426	+ *
3427	+ * An scenario exists where the reference itself is not within the boundaries.<br />
3428	+ * We can say it has "escaped the boundaries" — or just "escaped".<br />
3429	+ * In this case we need to decide whether the popper should either:
3430	+ *
3431	+ * - detach from the reference and remain "trapped" in the boundaries, or
3432	+ * - if it should ignore the boundary and "escape with its reference"
3433	+ *
3434	+ * When `escapeWithReference` is set to`true` and reference is completely
3435	+ * outside its boundaries, the popper will overflow (or completely leave)
3436	+ * the boundaries in order to remain attached to the edge of the reference.
3437	+ *
3438	+ * @memberof modifiers
3439	+ * @inner
3440	*/
3441	+ preventOverflow: {
3442	+ /** @prop {number} order=300 - Index used to define the order of execution */
3443	+ order: 300,
3444	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3445	+ enabled: true,
3446	+ /** @prop {ModifierFn} */
3447	+ fn: preventOverflow,
3448	+ /**
3449	+ * @prop {Array} [priority=['left','right','top','bottom']]
3450	+ * Popper will try to prevent overflow following these priorities by default,
3451	+ * then, it could overflow on the left and on top of the `boundariesElement`
3452	+ */
3453	+ priority: ['left', 'right', 'top', 'bottom'],
3454	+ /**
3455	+ * @prop {number} padding=5
3456	+ * Amount of pixel used to define a minimum distance between the boundaries
3457	+ * and the popper this makes sure the popper has always a little padding
3458	+ * between the edges of its container
3459	+ */
3460	+ padding: 5,
3461	+ /**
3462	+ * @prop {String\|HTMLElement} boundariesElement='scrollParent'
3463	+ * Boundaries used by the modifier, can be `scrollParent`, `window`,
3464	+ * `viewport` or any DOM element.
3465	+ */
3466	+ boundariesElement: 'scrollParent'
3467	+ },
3468
























3469	/**
3470	+ * Modifier used to make sure the reference and its popper stay near eachothers
3471	+ * without leaving any gap between the two. Expecially useful when the arrow is
3472	+ * enabled and you want to assure it to point to its reference element.
3473	+ * It cares only about the first axis, you can still have poppers with margin
3474	+ * between the popper and its reference element.
3475	+ * @memberof modifiers
3476	+ * @inner
3477	*/
3478	+ keepTogether: {
3479	+ /** @prop {number} order=400 - Index used to define the order of execution */
3480	+ order: 400,
3481	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3482	+ enabled: true,
3483	+ /** @prop {ModifierFn} */
3484	+ fn: keepTogether
3485	+ },





































3486
3487	+ /**
3488	+ * This modifier is used to move the `arrowElement` of the popper to make
3489	+ * sure it is positioned between the reference element and its popper element.
3490	+ * It will read the outer size of the `arrowElement` node to detect how many
3491	+ * pixels of conjuction are needed.
3492	+ *
3493	+ * It has no effect if no `arrowElement` is provided.
3494	+ * @memberof modifiers
3495	+ * @inner
3496	+ */
3497	+ arrow: {
3498	+ /** @prop {number} order=500 - Index used to define the order of execution */
3499	+ order: 500,
3500	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3501	+ enabled: true,
3502	+ /** @prop {ModifierFn} */
3503	+ fn: arrow,
3504	+ /** @prop {String\|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */
3505	+ element: '[x-arrow]'
3506	+ },
3507
3508	+ /**
3509	+ * Modifier used to flip the popper's placement when it starts to overlap its
3510	+ * reference element.
3511	+ *
3512	+ * Requires the `preventOverflow` modifier before it in order to work.
3513	+ *
3514	+ * NOTE: this modifier will interrupt the current update cycle and will
3515	+ * restart it if it detects the need to flip the placement.
3516	+ * @memberof modifiers
3517	+ * @inner
3518	+ */
3519	+ flip: {
3520	+ /** @prop {number} order=600 - Index used to define the order of execution */
3521	+ order: 600,
3522	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3523	+ enabled: true,
3524	+ /** @prop {ModifierFn} */
3525	+ fn: flip,
3526	+ /**
3527	+ * @prop {String\|Array} behavior='flip'
3528	+ * The behavior used to change the popper's placement. It can be one of
3529	+ * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid
3530	+ * placements (with optional variations).
3531	+ */
3532	+ behavior: 'flip',
3533	+ /**
3534	+ * @prop {number} padding=5
3535	+ * The popper will flip if it hits the edges of the `boundariesElement`
3536	+ */
3537	+ padding: 5,
3538	+ /**
3539	+ * @prop {String\|HTMLElement} boundariesElement='viewport'
3540	+ * The element which will define the boundaries of the popper position,
3541	+ * the popper will never be placed outside of the defined boundaries
3542	+ * (except if keepTogether is enabled)
3543	+ */
3544	+ boundariesElement: 'viewport'
3545	+ },
3546	+
3547	+ /**
3548	+ * Modifier used to make the popper flow toward the inner of the reference element.
3549	+ * By default, when this modifier is disabled, the popper will be placed outside
3550	+ * the reference element.
3551	+ * @memberof modifiers
3552	+ * @inner
3553	+ */
3554	+ inner: {
3555	+ /** @prop {number} order=700 - Index used to define the order of execution */
3556	+ order: 700,
3557	+ /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */
3558	+ enabled: false,
3559	+ /** @prop {ModifierFn} */
3560	+ fn: inner
3561	+ },
3562	+
3563	+ /**
3564	+ * Modifier used to hide the popper when its reference element is outside of the
3565	+ * popper boundaries. It will set a `x-out-of-boundaries` attribute which can
3566	+ * be used to hide with a CSS selector the popper when its reference is
3567	+ * out of boundaries.
3568	+ *
3569	+ * Requires the `preventOverflow` modifier before it in order to work.
3570	+ * @memberof modifiers
3571	+ * @inner
3572	+ */
3573	+ hide: {
3574	+ /** @prop {number} order=800 - Index used to define the order of execution */
3575	+ order: 800,
3576	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3577	+ enabled: true,
3578	+ /** @prop {ModifierFn} */
3579	+ fn: hide
3580	+ },
3581	+
3582	+ /**
3583	+ * Computes the style that will be applied to the popper element to gets
3584	+ * properly positioned.
3585	+ *
3586	+ * Note that this modifier will not touch the DOM, it just prepares the styles
3587	+ * so that `applyStyle` modifier can apply it. This separation is useful
3588	+ * in case you need to replace `applyStyle` with a custom implementation.
3589	+ *
3590	+ * This modifier has `850` as `order` value to maintain backward compatibility
3591	+ * with previous versions of Popper.js. Expect the modifiers ordering method
3592	+ * to change in future major versions of the library.
3593	+ *
3594	+ * @memberof modifiers
3595	+ * @inner
3596	+ */
3597	+ computeStyle: {
3598	+ /** @prop {number} order=850 - Index used to define the order of execution */
3599	+ order: 850,
3600	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3601	+ enabled: true,
3602	+ /** @prop {ModifierFn} */
3603	+ fn: computeStyle,
3604	+ /**
3605	+ * @prop {Boolean} gpuAcceleration=true
3606	+ * If true, it uses the CSS 3d transformation to position the popper.
3607	+ * Otherwise, it will use the `top` and `left` properties.
3608	+ */
3609	+ gpuAcceleration: true,
3610	+ /**
3611	+ * @prop {string} [x='bottom']
3612	+ * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin.
3613	+ * Change this if your popper should grow in a direction different from `bottom`
3614	+ */
3615	+ x: 'bottom',
3616	+ /**
3617	+ * @prop {string} [x='left']
3618	+ * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin.
3619	+ * Change this if your popper should grow in a direction different from `right`
3620	+ */
3621	+ y: 'right'
3622	+ },
3623	+
3624	+ /**
3625	+ * Applies the computed styles to the popper element.
3626	+ *
3627	+ * All the DOM manipulations are limited to this modifier. This is useful in case
3628	+ * you want to integrate Popper.js inside a framework or view library and you
3629	+ * want to delegate all the DOM manipulations to it.
3630	+ *
3631	+ * Note that if you disable this modifier, you must make sure the popper element
3632	+ * has its position set to `absolute` before Popper.js can do its work!
3633	+ *
3634	+ * Just disable this modifier and define you own to achieve the desired effect.
3635	+ *
3636	+ * @memberof modifiers
3637	+ * @inner
3638	+ */
3639	+ applyStyle: {
3640	+ /** @prop {number} order=900 - Index used to define the order of execution */
3641	+ order: 900,
3642	+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
3643	+ enabled: true,
3644	+ /** @prop {ModifierFn} */
3645	+ fn: applyStyle,
3646	+ /** @prop {Function} */
3647	+ onLoad: applyStyleOnLoad,
3648	+ /**
3649	+ * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier
3650	+ * @prop {Boolean} gpuAcceleration=true
3651	+ * If true, it uses the CSS 3d transformation to position the popper.
3652	+ * Otherwise, it will use the `top` and `left` properties.
3653	+ */
3654	+ gpuAcceleration: undefined
3655	+ }
3656	+ };
3657
3658	/**
3659	+ * The `dataObject` is an object containing all the informations used by Popper.js
3660	+ * this object get passed to modifiers and to the `onCreate` and `onUpdate` callbacks.
3661	+ * @name dataObject
3662	+ * @property {Object} data.instance The Popper.js instance
3663	+ * @property {String} data.placement Placement applied to popper
3664	+ * @property {String} data.originalPlacement Placement originally defined on init
3665	+ * @property {Boolean} data.flipped True if popper has been flipped by flip modifier
3666	+ * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper.
3667	+ * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier
3668	+ * @property {Object} data.styles Any CSS property defined here will be applied to the popper, it expects the JavaScript nomenclature (eg. `marginBottom`)
3669	+ * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow, it expects the JavaScript nomenclature (eg. `marginBottom`)
3670	+ * @property {Object} data.boundaries Offsets of the popper boundaries
3671	+ * @property {Object} data.offsets The measurements of popper, reference and arrow elements.
3672	+ * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values
3673	+ * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values
3674	+ * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0
3675	*/

3676
3677	/**
3678	+ * Default options provided to Popper.js constructor.<br />
3679	+ * These can be overriden using the `options` argument of Popper.js.<br />
3680	+ * To override an option, simply pass as 3rd argument an object with the same
3681	+ * structure of this object, example:
3682	+ * ```
3683	+ * new Popper(ref, pop, {
3684	+ * modifiers: {
3685	+ * preventOverflow: { enabled: false }
3686	+ * }
3687	+ * })
3688	+ * ```
3689	+ * @type {Object}
3690	+ * @static
3691	+ * @memberof Popper
3692	*/
3693	+ var Defaults = {
3694	+ /**
3695	+ * Popper's placement
3696	+ * @prop {Popper.placements} placement='bottom'
3697	+ */
3698	+ placement: 'bottom',
3699	+
3700	+ /**
3701	+ * Set this to true if you want popper to position it self in 'fixed' mode
3702	+ * @prop {Boolean} positionFixed=false
3703	+ */
3704	+ positionFixed: false,
3705	+
3706	+ /**
3707	+ * Whether events (resize, scroll) are initially enabled
3708	+ * @prop {Boolean} eventsEnabled=true
3709	+ */
3710	+ eventsEnabled: true,
3711	+
3712	+ /**
3713	+ * Set to true if you want to automatically remove the popper when
3714	+ * you call the `destroy` method.
3715	+ * @prop {Boolean} removeOnDestroy=false
3716	+ */
3717	+ removeOnDestroy: false,
3718	+
3719	+ /**
3720	+ * Callback called when the popper is created.<br />
3721	+ * By default, is set to no-op.<br />
3722	+ * Access Popper.js instance with `data.instance`.
3723	+ * @prop {onCreate}
3724	+ */
3725	+ onCreate: function onCreate() {},
3726	+
3727	+ /**
3728	+ * Callback called when the popper is updated, this callback is not called
3729	+ * on the initialization/creation of the popper, but only on subsequent
3730	+ * updates.<br />
3731	+ * By default, is set to no-op.<br />
3732	+ * Access Popper.js instance with `data.instance`.
3733	+ * @prop {onUpdate}
3734	+ */
3735	+ onUpdate: function onUpdate() {},
3736	+
3737	+ /**
3738	+ * List of modifiers used to modify the offsets before they are applied to the popper.
3739	+ * They provide most of the functionalities of Popper.js
3740	+ * @prop {modifiers}
3741	+ */
3742	+ modifiers: modifiers
3743	+ };
3744
3745	/**
3746	+ * @callback onCreate
3747	+ * @param {dataObject} data

3748	*/
3749	+















3750	/**
3751	+ * @callback onUpdate
3752	+ * @param {dataObject} data




3753	*/


3754
3755	+ // Utils
3756	+ // Methods
3757	+ var Popper = function () {
3758	+ /**
3759	+ * Create a new Popper.js instance
3760	+ * @class Popper
3761	+ * @param {HTMLElement\|referenceObject} reference - The reference element used to position the popper
3762	+ * @param {HTMLElement} popper - The HTML element used as popper.
3763	+ * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults)
3764	+ * @return {Object} instance - The generated Popper.js instance
3765	+ */
3766	+ function Popper(reference, popper) {
3767	+ var _this = this;
3768	+
3769	+ var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
3770	+ classCallCheck(this, Popper);
3771	+
3772	+ this.scheduleUpdate = function () {
3773	+ return requestAnimationFrame(_this.update);
3774	+ };
3775	+
3776	+ // make update() debounced, so that it only runs at most once-per-tick
3777	+ this.update = debounce(this.update.bind(this));
3778
3779	+ // with {} we create a new object with the options inside it
3780	+ this.options = _extends({}, Popper.Defaults, options);

3781
3782	+ // init state
3783	+ this.state = {
3784	+ isDestroyed: false,
3785	+ isCreated: false,
3786	+ scrollParents: []
3787	+ };
3788
3789	+ // get reference and popper elements (allow jQuery wrappers)
3790	+ this.reference = reference && reference.jquery ? reference[0] : reference;
3791	+ this.popper = popper && popper.jquery ? popper[0] : popper;
3792
3793	+ // Deep merge modifiers options
3794	+ this.options.modifiers = {};
3795	+ Object.keys(_extends({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) {
3796	+ _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] \|\| {}, options.modifiers ? options.modifiers[name] : {});
3797	+ });

3798
3799	+ // Refactoring modifiers' list (Object => Array)
3800	+ this.modifiers = Object.keys(this.options.modifiers).map(function (name) {
3801	+ return _extends({
3802	+ name: name
3803	+ }, _this.options.modifiers[name]);
3804	+ })
3805	+ // sort the modifiers by order
3806	+ .sort(function (a, b) {
3807	+ return a.order - b.order;
3808	+ });
3809
3810	+ // modifiers have the ability to execute arbitrary code when Popper.js get inited
3811	+ // such code is executed in the same order of its modifier
3812	+ // they could add new properties to their options configuration
3813	+ // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`!
3814	+ this.modifiers.forEach(function (modifierOptions) {
3815	+ if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) {
3816	+ modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state);
3817	+ }
3818	+ });
3819
3820	+ // fire the first update to position the popper in the right place
3821	+ this.update();








3822
3823	+ var eventsEnabled = this.options.eventsEnabled;
3824	+ if (eventsEnabled) {
3825	+ // setup event listeners, they will take care of update the position in specific situations
3826	+ this.enableEventListeners();



3827	}




3828
3829	+ this.state.eventsEnabled = eventsEnabled;



3830	}
3831
3832	+ // We can't use class properties because they don't get listed in the
3833	+ // class prototype and break stuff like Sinon stubs
3834


3835
3836	+ createClass(Popper, [{
3837	+ key: 'update',
3838	+ value: function update$$1() {
3839	+ return update.call(this);
3840	+ }
3841	+ }, {
3842	+ key: 'destroy',
3843	+ value: function destroy$$1() {
3844	+ return destroy.call(this);
3845	+ }
3846	+ }, {
3847	+ key: 'enableEventListeners',
3848	+ value: function enableEventListeners$$1() {
3849	+ return enableEventListeners.call(this);
3850	+ }
3851	+ }, {
3852	+ key: 'disableEventListeners',
3853	+ value: function disableEventListeners$$1() {
3854	+ return disableEventListeners.call(this);
3855	+ }
3856
3857	+ /**
3858	+ * Schedule an update, it will run on the next UI update available
3859	+ * @method scheduleUpdate
3860	+ * @memberof Popper
3861	+ */















3862





3863
3864	+ /**
3865	+ * Collection of utilities useful when writing custom modifiers.
3866	+ * Starting from version 1.7, this method is available only if you
3867	+ * include `popper-utils.js` before `popper.js`.
3868	+ *
3869	+ * DEPRECATION: This way to access PopperUtils is deprecated
3870	+ * and will be removed in v2! Use the PopperUtils module directly instead.
3871	+ * Due to the high instability of the methods contained in Utils, we can't
3872	+ * guarantee them to follow semver. Use them at your own risk!
3873	+ * @static
3874	+ * @private
3875	+ * @type {Object}
3876	+ * @deprecated since version 1.8
3877	+ * @member Utils
3878	+ * @memberof Popper
3879	+ */
3880
3881	+ }]);
3882	+ return Popper;
3883	+ }();













3884





































3885	/**
3886	+ * The `referenceObject` is an object that provides an interface compatible with Popper.js
3887	+ * and lets you use it as replacement of a real DOM node.<br />
3888	+ * You can use this method to position a popper relatively to a set of coordinates
3889	+ * in case you don't have a DOM node to use as reference.
3890	+ *
3891	+ * ```
3892	+ * new Popper(referenceObject, popperNode);
3893	+ * ```
3894	+ *
3895	+ * NB: This feature isn't supported in Internet Explorer 10
3896	+ * @name referenceObject
3897	+ * @property {Function} data.getBoundingClientRect
3898	+ * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method.
3899	+ * @property {number} data.clientWidth
3900	+ * An ES6 getter that will return the width of the virtual reference element.
3901	+ * @property {number} data.clientHeight
3902	+ * An ES6 getter that will return the height of the virtual reference element.
3903	*/
3904	+
3905	+
3906	+ Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils;
3907	+ Popper.placements = placements;
3908	+ Popper.Defaults = Defaults;
3909	+
3910	+ /**
3911	+ * --------------------------------------------------------------------------
3912	+ * Bootstrap (v4.1.0): dropdown.js
3913	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
3914	+ * --------------------------------------------------------------------------
3915	+ */
3916	+
3917	+ var Dropdown = function ($$$1) {



















































3918	/**
3919	* ------------------------------------------------------------------------
3920	+ * Constants
3921	* ------------------------------------------------------------------------
3922	*/
3923	+ var NAME = 'dropdown';
3924	+ var VERSION = '4.1.0';
3925	+ var DATA_KEY = 'bs.dropdown';
3926	+ var EVENT_KEY = "." + DATA_KEY;
3927	+ var DATA_API_KEY = '.data-api';
3928	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
3929	+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
3930	+
3931	+ var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key
3932	+
3933	+ var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key
3934	+
3935	+ var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key
3936	+
3937	+ var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key
3938	+
3939	+ var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse)
3940	+
3941	+ var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "\|" + ARROW_DOWN_KEYCODE + "\|" + ESCAPE_KEYCODE);
3942	+ var Event = {
3943	+ HIDE: "hide" + EVENT_KEY,
3944	+ HIDDEN: "hidden" + EVENT_KEY,
3945	+ SHOW: "show" + EVENT_KEY,
3946	+ SHOWN: "shown" + EVENT_KEY,
3947	+ CLICK: "click" + EVENT_KEY,
3948	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
3949	+ KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY,
3950	+ KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY
3951	+ };
3952	+ var ClassName = {
3953	+ DISABLED: 'disabled',
3954	+ SHOW: 'show',
3955	+ DROPUP: 'dropup',
3956	+ DROPRIGHT: 'dropright',
3957	+ DROPLEFT: 'dropleft',
3958	+ MENURIGHT: 'dropdown-menu-right',
3959	+ MENULEFT: 'dropdown-menu-left',
3960	+ POSITION_STATIC: 'position-static'
3961	+ };
3962	+ var Selector = {
3963	+ DATA_TOGGLE: '[data-toggle="dropdown"]',
3964	+ FORM_CHILD: '.dropdown form',
3965	+ MENU: '.dropdown-menu',
3966	+ NAVBAR_NAV: '.navbar-nav',
3967	+ VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)'
3968	+ };
3969	+ var AttachmentMap = {
3970	+ TOP: 'top-start',
3971	+ TOPEND: 'top-end',
3972	+ BOTTOM: 'bottom-start',
3973	+ BOTTOMEND: 'bottom-end',
3974	+ RIGHT: 'right-start',
3975	+ RIGHTEND: 'right-end',
3976	+ LEFT: 'left-start',
3977	+ LEFTEND: 'left-end'
3978	+ };
3979	+ var Default = {
3980	+ offset: 0,
3981	+ flip: true,
3982	+ boundary: 'scrollParent',
3983	+ reference: 'toggle',
3984	+ display: 'dynamic'
3985	+ };
3986	+ var DefaultType = {
3987	+ offset: '(number\|string\|function)',
3988	+ flip: 'boolean',
3989	+ boundary: '(string\|element)',
3990	+ reference: '(string\|element)',
3991	+ display: 'string'
3992	+ /**
3993	+ * ------------------------------------------------------------------------
3994	+ * Class Definition
3995	+ * ------------------------------------------------------------------------
3996	+ */
3997
3998	+ };
3999
4000	+ var Dropdown =
4001	+ /#__PURE__/
4002	+ function () {
4003	+ function Dropdown(element, config) {
4004	+ this._element = element;
4005	+ this._popper = null;
4006	+ this._config = this._getConfig(config);
4007	+ this._menu = this._getMenuElement();
4008	+ this._inNavbar = this._detectNavbar();
4009
4010	+ this._addEventListeners();
4011	+ } // Getters
4012
4013
4014	+ var _proto = Dropdown.prototype;
4015
4016	+ // Public
4017	+ _proto.toggle = function toggle() {
4018	+ if (this._element.disabled \|\| $$$1(this._element).hasClass(ClassName.DISABLED)) {
4019	+ return;
4020	+ }
4021
4022	+ var parent = Dropdown._getParentFromElement(this._element);
4023
4024	+ var isActive = $$$1(this._menu).hasClass(ClassName.SHOW);
4025
4026	+ Dropdown._clearMenus();
4027
4028	+ if (isActive) {
4029	+ return;
4030	+ }
4031
4032	+ var relatedTarget = {
4033	+ relatedTarget: this._element
4034	+ };
4035	+ var showEvent = $$$1.Event(Event.SHOW, relatedTarget);
4036	+ $$$1(parent).trigger(showEvent);
4037
4038	+ if (showEvent.isDefaultPrevented()) {
4039	+ return;
4040	+ } // Disable totally Popper.js for Dropdown in Navbar
4041
4042
4043	+ if (!this._inNavbar) {
4044	+ /**
4045	+ * Check for Popper dependency
4046	+ * Popper - https://popper.js.org
4047	+ */
4048	+ if (typeof Popper === 'undefined') {
4049	+ throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)');
4050	+ }
4051
4052	+ var referenceElement = this._element;
4053
4054	+ if (this._config.reference === 'parent') {
4055	+ referenceElement = parent;
4056	+ } else if (Util.isElement(this._config.reference)) {
4057	+ referenceElement = this._config.reference; // Check if it's jQuery element



4058
4059	+ if (typeof this._config.reference.jquery !== 'undefined') {
4060	+ referenceElement = this._config.reference[0];
4061	+ }
4062	+ } // If boundary is not `scrollParent`, then set position to `static`
4063	+ // to allow the menu to "escape" the scroll parent's boundaries
4064	+ // https://github.com/twbs/bootstrap/issues/24251
4065



4066
4067	+ if (this._config.boundary !== 'scrollParent') {
4068	+ $$$1(parent).addClass(ClassName.POSITION_STATIC);
4069	+ }


4070
4071	+ this._popper = new Popper(referenceElement, this._menu, this._getPopperConfig());
4072	+ } // If this is a touch-enabled device we add extra
4073	+ // empty mouseover listeners to the body's immediate children;
4074	+ // only needed because of broken event delegation on iOS
4075	+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
4076



4077
4078	+ if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) {
4079	+ $$$1(document.body).children().on('mouseover', null, $$$1.noop);
4080	+ }
4081
4082	+ this._element.focus();
4083
4084	+ this._element.setAttribute('aria-expanded', true);


4085
4086	+ $$$1(this._menu).toggleClass(ClassName.SHOW);
4087	+ $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget));
4088	+ };


4089
4090	+ _proto.dispose = function dispose() {
4091	+ $$$1.removeData(this._element, DATA_KEY);
4092	+ $$$1(this._element).off(EVENT_KEY);
4093	+ this._element = null;
4094	+ this._menu = null;
4095
4096	+ if (this._popper !== null) {
4097	+ this._popper.destroy();

4098
4099	+ this._popper = null;
4100	+ }
4101	+ };
4102
4103	+ _proto.update = function update() {
4104	+ this._inNavbar = this._detectNavbar();


4105
4106	+ if (this._popper !== null) {
4107	+ this._popper.scheduleUpdate();
4108	+ }
4109	+ }; // Private
4110


4111
4112	+ _proto._addEventListeners = function _addEventListeners() {
4113	+ var _this = this;

4114
4115	+ $$$1(this._element).on(Event.CLICK, function (event) {
4116	+ event.preventDefault();
4117	+ event.stopPropagation();
4118
4119	+ _this.toggle();
4120	+ });
4121	+ };


4122
4123	+ _proto._getConfig = function _getConfig(config) {
4124	+ config = _objectSpread({}, this.constructor.Default, $$$1(this._element).data(), config);
4125	+ Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
4126	+ return config;
4127	+ };
4128
4129	+ _proto._getMenuElement = function _getMenuElement() {
4130	+ if (!this._menu) {
4131	+ var parent = Dropdown._getParentFromElement(this._element);
4132
4133	+ this._menu = $$$1(parent).find(Selector.MENU)[0];
4134	+ }
4135	+
4136	+ return this._menu;
4137	+ };
4138
4139	+ _proto._getPlacement = function _getPlacement() {
4140	+ var $parentDropdown = $$$1(this._element).parent();
4141	+ var placement = AttachmentMap.BOTTOM; // Handle dropup
4142
4143	+ if ($parentDropdown.hasClass(ClassName.DROPUP)) {
4144	+ placement = AttachmentMap.TOP;
4145
4146	+ if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
4147	+ placement = AttachmentMap.TOPEND;
4148	+ }
4149	+ } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) {
4150	+ placement = AttachmentMap.RIGHT;
4151	+ } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) {
4152	+ placement = AttachmentMap.LEFT;
4153	+ } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
4154	+ placement = AttachmentMap.BOTTOMEND;
4155	}







4156
4157	+ return placement;
4158	+ };
4159
4160	+ _proto._detectNavbar = function _detectNavbar() {
4161	+ return $$$1(this._element).closest('.navbar').length > 0;
4162	+ };
4163
4164	+ _proto._getPopperConfig = function _getPopperConfig() {
4165	+ var _this2 = this;
4166	+
4167	+ var offsetConf = {};
4168	+
4169	+ if (typeof this._config.offset === 'function') {
4170	+ offsetConf.fn = function (data) {
4171	+ data.offsets = _objectSpread({}, data.offsets, _this2._config.offset(data.offsets) \|\| {});
4172	+ return data;
4173	+ };
4174	+ } else {
4175	+ offsetConf.offset = this._config.offset;
4176	+ }
4177
4178	+ var popperConfig = {
4179	+ placement: this._getPlacement(),
4180	+ modifiers: {
4181	+ offset: offsetConf,
4182	+ flip: {
4183	+ enabled: this._config.flip
4184	+ },
4185	+ preventOverflow: {
4186	+ boundariesElement: this._config.boundary
4187	+ }
4188	+ } // Disable Popper.js if we have a static display
4189




4190	};



4191
4192	+ if (this._config.display === 'static') {
4193	+ popperConfig.modifiers.applyStyle = {
4194	+ enabled: false
4195	+ };






4196	}



4197
4198	+ return popperConfig;
4199	+ }; // Static
4200



4201
4202	+ Dropdown._jQueryInterface = function _jQueryInterface(config) {
4203	+ return this.each(function () {
4204	+ var data = $$$1(this).data(DATA_KEY);
4205
4206	+ var _config = typeof config === 'object' ? config : null;
4207	+
4208	+ if (!data) {
4209	+ data = new Dropdown(this, _config);
4210	+ $$$1(this).data(DATA_KEY, data);
4211	+ }
4212
4213	+ if (typeof config === 'string') {
4214	+ if (typeof data[config] === 'undefined') {
4215	+ throw new TypeError("No method named \"" + config + "\"");
4216	+ }
4217	+
4218	+ data[config]();
4219	}
4220	+ });
4221	+ };
4222
4223	+ Dropdown._clearMenus = function _clearMenus(event) {
4224	+ if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH \|\| event.type === 'keyup' && event.which !== TAB_KEYCODE)) {
4225	+ return;
4226	}


4227
4228	+ var toggles = $$$1.makeArray($$$1(Selector.DATA_TOGGLE));



4229
4230	+ for (var i = 0; i < toggles.length; i++) {
4231	+ var parent = Dropdown._getParentFromElement(toggles[i]);
4232
4233	+ var context = $$$1(toggles[i]).data(DATA_KEY);
4234	+ var relatedTarget = {
4235	+ relatedTarget: toggles[i]
4236	+ };
4237
4238	+ if (!context) {
4239	+ continue;
4240	+ }

4241
4242	+ var dropdownMenu = context._menu;


4243
4244	+ if (!$$$1(parent).hasClass(ClassName.SHOW)) {
4245	+ continue;
4246	+ }
4247
4248	+ if (event && (event.type === 'click' && /input\|textarea/i.test(event.target.tagName) \|\| event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) {
4249	+ continue;
4250	+ }
4251
4252	+ var hideEvent = $$$1.Event(Event.HIDE, relatedTarget);
4253	+ $$$1(parent).trigger(hideEvent);

4254
4255	+ if (hideEvent.isDefaultPrevented()) {
4256	+ continue;
4257	+ } // If this is a touch-enabled device we remove the extra
4258	+ // empty mouseover listeners we added for iOS support
4259




4260
4261	+ if ('ontouchstart' in document.documentElement) {
4262	+ $$$1(document.body).children().off('mouseover', null, $$$1.noop);
4263	+ }
4264
4265	+ toggles[i].setAttribute('aria-expanded', 'false');
4266	+ $$$1(dropdownMenu).removeClass(ClassName.SHOW);
4267	+ $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget));
4268	}
4269	+ };
4270
4271	+ Dropdown._getParentFromElement = function _getParentFromElement(element) {
4272	+ var parent;
4273	+ var selector = Util.getSelectorFromElement(element);


4274
4275	+ if (selector) {
4276	+ parent = $$$1(selector)[0];
4277	+ }
4278
4279	+ return parent \|\| element.parentNode;
4280	+ }; // eslint-disable-next-line complexity

4281


4282
4283	+ Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
4284	+ // If not input/textarea:
4285	+ // - And not a key in REGEXP_KEYDOWN => not a dropdown command
4286	+ // If input/textarea:
4287	+ // - If space key => not a dropdown command
4288	+ // - If key is other than escape
4289	+ // - If key is not up or down => not a dropdown command
4290	+ // - If trigger inside the menu => not a dropdown command
4291	+ if (/input\|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE \|\| event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE \|\| $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
4292	+ return;
4293	+ }
4294
4295	+ event.preventDefault();
4296	+ event.stopPropagation();









4297
4298	+ if (this.disabled \|\| $$$1(this).hasClass(ClassName.DISABLED)) {
4299	+ return;
4300	+ }
4301
4302	+ var parent = Dropdown._getParentFromElement(this);


4303
4304	+ var isActive = $$$1(parent).hasClass(ClassName.SHOW);
4305
4306	+ if (!isActive && (event.which !== ESCAPE_KEYCODE \|\| event.which !== SPACE_KEYCODE) \|\| isActive && (event.which === ESCAPE_KEYCODE \|\| event.which === SPACE_KEYCODE)) {
4307	+ if (event.which === ESCAPE_KEYCODE) {
4308	+ var toggle = $$$1(parent).find(Selector.DATA_TOGGLE)[0];
4309	+ $$$1(toggle).trigger('focus');
4310	+ }
4311
4312	+ $$$1(this).trigger('click');
4313	+ return;


4314	}
4315
4316	+ var items = $$$1(parent).find(Selector.VISIBLE_ITEMS).get();




4317
4318	+ if (items.length === 0) {
4319	+ return;
4320	+ }
4321
4322	+ var index = items.indexOf(event.target);
4323
4324	+ if (event.which === ARROW_UP_KEYCODE && index > 0) {
4325	+ // Up
4326	+ index--;
4327	+ }
4328
4329	+ if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
4330	+ // Down
4331	+ index++;
4332	+ }
4333
4334	+ if (index < 0) {
4335	+ index = 0;
4336	+ }
4337
4338	+ items[index].focus();
4339	+ };
4340
4341	+ _createClass(Dropdown, null, [{
4342	+ key: "VERSION",
4343	+ get: function get() {
4344	+ return VERSION;
4345	+ }
4346	+ }, {
4347	+ key: "Default",
4348	+ get: function get() {
4349	+ return Default;
4350	+ }
4351	+ }, {
4352	+ key: "DefaultType",
4353	+ get: function get() {
4354	+ return DefaultType;
4355	+ }
4356	+ }]);







4357
4358	+ return Dropdown;
4359	+ }();
4360	+ /**
4361	+ * ------------------------------------------------------------------------
4362	+ * Data Api implementation
4363	+ * ------------------------------------------------------------------------
4364	+ */
4365



4366
4367	+ $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
4368	+ event.preventDefault();
4369	+ event.stopPropagation();






4370
4371	+ Dropdown._jQueryInterface.call($$$1(this), 'toggle');
4372	+ }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) {
4373	+ e.stopPropagation();
4374	+ });
4375	+ /**
4376	+ * ------------------------------------------------------------------------
4377	+ * jQuery
4378	+ * ------------------------------------------------------------------------
4379	+ */
4380
4381	+ $$$1.fn[NAME] = Dropdown._jQueryInterface;
4382	+ $$$1.fn[NAME].Constructor = Dropdown;


4383
4384	+ $$$1.fn[NAME].noConflict = function () {
4385	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
4386	+ return Dropdown._jQueryInterface;
4387	+ };
4388
4389	+ return Dropdown;
4390	+ }($, Popper);




4391

4392	/**
4393	+ * --------------------------------------------------------------------------
4394	+ * Bootstrap (v4.1.0): modal.js
4395	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
4396	+ * --------------------------------------------------------------------------
4397	*/
4398	+
4399	+ var Modal = function ($$$1) {















































4400	/**
4401	* ------------------------------------------------------------------------
4402	+ * Constants
4403	* ------------------------------------------------------------------------
4404	*/
4405	+ var NAME = 'modal';
4406	+ var VERSION = '4.1.0';
4407	+ var DATA_KEY = 'bs.modal';
4408	+ var EVENT_KEY = "." + DATA_KEY;
4409	+ var DATA_API_KEY = '.data-api';
4410	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
4411	+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
4412	+
4413	+ var Default = {
4414	+ backdrop: true,
4415	+ keyboard: true,
4416	+ focus: true,
4417	+ show: true
4418	+ };
4419	+ var DefaultType = {
4420	+ backdrop: '(boolean\|string)',
4421	+ keyboard: 'boolean',
4422	+ focus: 'boolean',
4423	+ show: 'boolean'
4424	+ };
4425	+ var Event = {
4426	+ HIDE: "hide" + EVENT_KEY,
4427	+ HIDDEN: "hidden" + EVENT_KEY,
4428	+ SHOW: "show" + EVENT_KEY,
4429	+ SHOWN: "shown" + EVENT_KEY,
4430	+ FOCUSIN: "focusin" + EVENT_KEY,
4431	+ RESIZE: "resize" + EVENT_KEY,
4432	+ CLICK_DISMISS: "click.dismiss" + EVENT_KEY,
4433	+ KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY,
4434	+ MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY,
4435	+ MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY,
4436	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
4437	+ };
4438	+ var ClassName = {
4439	+ SCROLLBAR_MEASURER: 'modal-scrollbar-measure',
4440	+ BACKDROP: 'modal-backdrop',
4441	+ OPEN: 'modal-open',
4442	+ FADE: 'fade',
4443	+ SHOW: 'show'
4444	+ };
4445	+ var Selector = {
4446	+ DIALOG: '.modal-dialog',
4447	+ DATA_TOGGLE: '[data-toggle="modal"]',
4448	+ DATA_DISMISS: '[data-dismiss="modal"]',
4449	+ FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
4450	+ STICKY_CONTENT: '.sticky-top',
4451	+ NAVBAR_TOGGLER: '.navbar-toggler'
4452	+ /**
4453	+ * ------------------------------------------------------------------------
4454	+ * Class Definition
4455	+ * ------------------------------------------------------------------------
4456	+ */
4457























4458	};
4459
4460	+ var Modal =
4461	+ /#__PURE__/
4462	+ function () {
4463	+ function Modal(element, config) {
4464	+ this._config = this._getConfig(config);
4465	+ this._element = element;
4466	+ this._dialog = $$$1(element).find(Selector.DIALOG)[0];
4467	+ this._backdrop = null;
4468	+ this._isShown = false;
4469	+ this._isBodyOverflowing = false;
4470	+ this._ignoreBackdropClick = false;
4471	+ this._scrollbarWidth = 0;
4472	+ } // Getters
4473



4474
4475	+ var _proto = Modal.prototype;
4476	+
4477	+ // Public
4478	+ _proto.toggle = function toggle(relatedTarget) {
4479	+ return this._isShown ? this.hide() : this.show(relatedTarget);
4480	+ };
4481	+
4482	+ _proto.show = function show(relatedTarget) {
4483	+ var _this = this;
4484	+
4485	+ if (this._isTransitioning \|\| this._isShown) {
4486	+ return;
4487	+ }
4488	+
4489	+ if ($$$1(this._element).hasClass(ClassName.FADE)) {
4490	+ this._isTransitioning = true;
4491	+ }
4492	+
4493	+ var showEvent = $$$1.Event(Event.SHOW, {
4494	+ relatedTarget: relatedTarget
4495	+ });
4496	+ $$$1(this._element).trigger(showEvent);
4497
4498	+ if (this._isShown \|\| showEvent.isDefaultPrevented()) {
4499	+ return;
4500	+ }

4501
4502	+ this._isShown = true;


4503
4504	+ this._checkScrollbar();
4505
4506	+ this._setScrollbar();
4507
4508	+ this._adjustDialog();
4509
4510	+ $$$1(document.body).addClass(ClassName.OPEN);
4511
4512	+ this._setEscapeEvent();
4513
4514	+ this._setResizeEvent();
4515
4516	+ $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) {
4517	+ return _this.hide(event);
4518	+ });
4519	+ $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () {
4520	+ $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) {
4521	+ if ($$$1(event.target).is(_this._element)) {
4522	+ _this._ignoreBackdropClick = true;
4523	+ }
4524	+ });
4525	+ });
4526
4527	+ this._showBackdrop(function () {
4528	+ return _this._showElement(relatedTarget);






4529	});
4530	+ };
4531
4532	+ _proto.hide = function hide(event) {
4533	+ var _this2 = this;


4534
4535	+ if (event) {
4536	+ event.preventDefault();
4537	+ }
4538
4539	+ if (this._isTransitioning \|\| !this._isShown) {
4540	+ return;
4541	+ }
4542
4543	+ var hideEvent = $$$1.Event(Event.HIDE);
4544	+ $$$1(this._element).trigger(hideEvent);

4545
4546	+ if (!this._isShown \|\| hideEvent.isDefaultPrevented()) {
4547	+ return;
4548	+ }
4549
4550	+ this._isShown = false;
4551	+ var transition = $$$1(this._element).hasClass(ClassName.FADE);
4552	+
4553	+ if (transition) {
4554	+ this._isTransitioning = true;
4555	+ }
4556
4557	+ this._setEscapeEvent();

4558
4559	+ this._setResizeEvent();


4560
4561	+ $$$1(document).off(Event.FOCUSIN);
4562	+ $$$1(this._element).removeClass(ClassName.SHOW);
4563	+ $$$1(this._element).off(Event.CLICK_DISMISS);
4564	+ $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS);
4565
4566	+ if (transition) {
4567	+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
4568	+ $$$1(this._element).one(Util.TRANSITION_END, function (event) {
4569	+ return _this2._hideModal(event);
4570	+ }).emulateTransitionEnd(transitionDuration);
4571	+ } else {
4572	+ this._hideModal();
4573	+ }
4574	+ };
4575
4576	+ _proto.dispose = function dispose() {
4577	+ $$$1.removeData(this._element, DATA_KEY);
4578	+ $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY);
4579	+ this._config = null;
4580	+ this._element = null;
4581	+ this._dialog = null;
4582	+ this._backdrop = null;
4583	+ this._isShown = null;
4584	+ this._isBodyOverflowing = null;
4585	+ this._ignoreBackdropClick = null;
4586	+ this._scrollbarWidth = null;
4587	+ };
4588
4589	+ _proto.handleUpdate = function handleUpdate() {
4590	+ this._adjustDialog();
4591	+ }; // Private





4592












4593
4594	+ _proto._getConfig = function _getConfig(config) {
4595	+ config = _objectSpread({}, Default, config);
4596	+ Util.typeCheckConfig(NAME, config, DefaultType);
4597	+ return config;
4598	+ };
4599
4600	+ _proto._showElement = function _showElement(relatedTarget) {
4601	+ var _this3 = this;
4602
4603	+ var transition = $$$1(this._element).hasClass(ClassName.FADE);




4604
4605	+ if (!this._element.parentNode \|\| this._element.parentNode.nodeType !== Node.ELEMENT_NODE) {
4606	+ // Don't move modal's DOM position
4607	+ document.body.appendChild(this._element);
4608	+ }
4609
4610	+ this._element.style.display = 'block';
4611
4612	+ this._element.removeAttribute('aria-hidden');



4613
4614	+ this._element.scrollTop = 0;
4615
4616	+ if (transition) {
4617	+ Util.reflow(this._element);
4618	+ }
4619
4620	+ $$$1(this._element).addClass(ClassName.SHOW);
4621
4622	+ if (this._config.focus) {
4623	+ this._enforceFocus();
4624	+ }
4625
4626	+ var shownEvent = $$$1.Event(Event.SHOWN, {
4627	+ relatedTarget: relatedTarget
4628	+ });
4629
4630	+ var transitionComplete = function transitionComplete() {
4631	+ if (_this3._config.focus) {
4632	+ _this3._element.focus();
4633	+ }
4634
4635	+ _this3._isTransitioning = false;
4636	+ $$$1(_this3._element).trigger(shownEvent);
4637	+ };
4638
4639	+ if (transition) {
4640	+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
4641	+ $$$1(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(transitionDuration);
4642	+ } else {
4643	+ transitionComplete();
4644	}
4645	+ };
4646	+
4647	+ _proto._enforceFocus = function _enforceFocus() {
4648	+ var _this4 = this;
4649
4650	+ $$$1(document).off(Event.FOCUSIN) // Guard against infinite focus loop
4651	+ .on(Event.FOCUSIN, function (event) {
4652	+ if (document !== event.target && _this4._element !== event.target && $$$1(_this4._element).has(event.target).length === 0) {
4653	+ _this4._element.focus();
4654	+ }
4655	+ });
4656	};
4657
4658	+ _proto._setEscapeEvent = function _setEscapeEvent() {
4659	+ var _this5 = this;
4660	+
4661	+ if (this._isShown && this._config.keyboard) {
4662	+ $$$1(this._element).on(Event.KEYDOWN_DISMISS, function (event) {
4663	+ if (event.which === ESCAPE_KEYCODE) {
4664	+ event.preventDefault();
4665
4666	+ _this5.hide();
4667	+ }
4668	+ });
4669	+ } else if (!this._isShown) {
4670	+ $$$1(this._element).off(Event.KEYDOWN_DISMISS);
4671	+ }
4672	+ };
4673
4674	+ _proto._setResizeEvent = function _setResizeEvent() {
4675	+ var _this6 = this;
4676	+
4677	+ if (this._isShown) {
4678	+ $$$1(window).on(Event.RESIZE, function (event) {
4679	+ return _this6.handleUpdate(event);
4680	+ });
4681	+ } else {
4682	+ $$$1(window).off(Event.RESIZE);
4683	}
4684	+ };

4685
4686	+ _proto._hideModal = function _hideModal() {
4687	+ var _this7 = this;
4688
4689	+ this._element.style.display = 'none';



4690
4691	+ this._element.setAttribute('aria-hidden', true);






4692
4693	+ this._isTransitioning = false;

4694
4695	+ this._showBackdrop(function () {
4696	+ $$$1(document.body).removeClass(ClassName.OPEN);






4697
4698	+ _this7._resetAdjustments();

4699
4700	+ _this7._resetScrollbar();
4701
4702	+ $$$1(_this7._element).trigger(Event.HIDDEN);
4703	+ });
4704	+ };
4705
4706	+ _proto._removeBackdrop = function _removeBackdrop() {
4707	+ if (this._backdrop) {
4708	+ $$$1(this._backdrop).remove();
4709	+ this._backdrop = null;
4710	+ }
4711	+ };
4712
4713	+ _proto._showBackdrop = function _showBackdrop(callback) {
4714	+ var _this8 = this;
4715
4716	+ var animate = $$$1(this._element).hasClass(ClassName.FADE) ? ClassName.FADE : '';
4717
4718	+ if (this._isShown && this._config.backdrop) {
4719	+ this._backdrop = document.createElement('div');
4720	+ this._backdrop.className = ClassName.BACKDROP;
4721
4722	+ if (animate) {
4723	+ $$$1(this._backdrop).addClass(animate);
4724	+ }
4725
4726	+ $$$1(this._backdrop).appendTo(document.body);
4727	+ $$$1(this._element).on(Event.CLICK_DISMISS, function (event) {
4728	+ if (_this8._ignoreBackdropClick) {
4729	+ _this8._ignoreBackdropClick = false;
4730	+ return;
4731	+ }
4732
4733	+ if (event.target !== event.currentTarget) {
4734	+ return;
4735	+ }
4736
4737	+ if (_this8._config.backdrop === 'static') {
4738	+ _this8._element.focus();
4739	+ } else {
4740	+ _this8.hide();
4741	+ }
4742	+ });
4743
4744	+ if (animate) {
4745	+ Util.reflow(this._backdrop);
4746	+ }

4747
4748	+ $$$1(this._backdrop).addClass(ClassName.SHOW);


4749
4750	+ if (!callback) {



4751	return;
4752	}
4753
4754	+ if (!animate) {
4755	+ callback();
4756	return;
4757	}
4758
4759	+ var backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop);
4760	+ $$$1(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(backdropTransitionDuration);
4761	+ } else if (!this._isShown && this._backdrop) {
4762	+ $$$1(this._backdrop).removeClass(ClassName.SHOW);


4763
4764	+ var callbackRemove = function callbackRemove() {
4765	+ _this8._removeBackdrop();

4766
4767	+ if (callback) {
4768	+ callback();
4769	+ }
4770	+ };
4771
4772	+ if ($$$1(this._element).hasClass(ClassName.FADE)) {
4773	+ var _backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop);

4774
4775	+ $$$1(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(_backdropTransitionDuration);
4776	+ } else {
4777	+ callbackRemove();
4778	+ }
4779	+ } else if (callback) {
4780	callback();

4781	}
4782	+ }; // ----------------------------------------------------------------------
4783	+ // the following methods are used to handle overflowing modals
4784	+ // todo (fat): these should probably be refactored out of modal.js
4785	+ // ----------------------------------------------------------------------
4786



4787
4788	+ _proto._adjustDialog = function _adjustDialog() {
4789	+ var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;





4790
4791	+ if (!this._isBodyOverflowing && isModalOverflowing) {
4792	+ this._element.style.paddingLeft = this._scrollbarWidth + "px";


4793	}







4794
4795	+ if (this._isBodyOverflowing && !isModalOverflowing) {
4796	+ this._element.style.paddingRight = this._scrollbarWidth + "px";
4797	+ }
4798	+ };
4799
4800	+ _proto._resetAdjustments = function _resetAdjustments() {
4801	+ this._element.style.paddingLeft = '';
4802	+ this._element.style.paddingRight = '';
4803	+ };
4804
4805	+ _proto._checkScrollbar = function _checkScrollbar() {
4806	+ var rect = document.body.getBoundingClientRect();
4807	+ this._isBodyOverflowing = rect.left + rect.right < window.innerWidth;
4808	+ this._scrollbarWidth = this._getScrollbarWidth();
4809	+ };
4810
4811	+ _proto._setScrollbar = function _setScrollbar() {
4812	+ var _this9 = this;
4813	+
4814	+ if (this._isBodyOverflowing) {
4815	+ // Note: DOMNode.style.paddingRight returns the actual value or '' if not set
4816	+ // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
4817	+ // Adjust fixed content padding
4818	+ $$$1(Selector.FIXED_CONTENT).each(function (index, element) {
4819	+ var actualPadding = $$$1(element)[0].style.paddingRight;
4820	+ var calculatedPadding = $$$1(element).css('padding-right');
4821	+ $$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
4822	+ }); // Adjust sticky content margin
4823	+
4824	+ $$$1(Selector.STICKY_CONTENT).each(function (index, element) {
4825	+ var actualMargin = $$$1(element)[0].style.marginRight;
4826	+ var calculatedMargin = $$$1(element).css('margin-right');
4827	+ $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
4828	+ }); // Adjust navbar-toggler margin
4829	+
4830	+ $$$1(Selector.NAVBAR_TOGGLER).each(function (index, element) {
4831	+ var actualMargin = $$$1(element)[0].style.marginRight;
4832	+ var calculatedMargin = $$$1(element).css('margin-right');
4833	+ $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) + _this9._scrollbarWidth + "px");
4834	+ }); // Adjust body padding
4835	+
4836	+ var actualPadding = document.body.style.paddingRight;
4837	+ var calculatedPadding = $$$1(document.body).css('padding-right');
4838	+ $$$1(document.body).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px");
4839	+ }
4840	+ };
4841
4842	+ _proto._resetScrollbar = function _resetScrollbar() {
4843	+ // Restore fixed content padding
4844	+ $$$1(Selector.FIXED_CONTENT).each(function (index, element) {
4845	+ var padding = $$$1(element).data('padding-right');
4846
4847	+ if (typeof padding !== 'undefined') {
4848	+ $$$1(element).css('padding-right', padding).removeData('padding-right');
4849	+ }
4850	+ }); // Restore sticky content and navbar-toggler margin

4851
4852	+ $$$1(Selector.STICKY_CONTENT + ", " + Selector.NAVBAR_TOGGLER).each(function (index, element) {
4853	+ var margin = $$$1(element).data('margin-right');
4854
4855	+ if (typeof margin !== 'undefined') {
4856	+ $$$1(element).css('margin-right', margin).removeData('margin-right');
4857	+ }
4858	+ }); // Restore body padding























4859
4860	+ var padding = $$$1(document.body).data('padding-right');



4861
4862	if (typeof padding !== 'undefined') {
4863	+ $$$1(document.body).css('padding-right', padding).removeData('padding-right');








4864	}
4865	+ };


4866
4867	+ _proto._getScrollbarWidth = function _getScrollbarWidth() {
4868	+ // thx d.walsh
4869	+ var scrollDiv = document.createElement('div');
4870	+ scrollDiv.className = ClassName.SCROLLBAR_MEASURER;
4871	+ document.body.appendChild(scrollDiv);
4872	+ var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth;
4873	+ document.body.removeChild(scrollDiv);
4874	+ return scrollbarWidth;
4875	+ }; // Static
4876









4877
4878	+ Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) {
4879	+ return this.each(function () {
4880	+ var data = $$$1(this).data(DATA_KEY);
4881
4882	+ var _config = _objectSpread({}, Modal.Default, $$$1(this).data(), typeof config === 'object' && config);


4883
4884	+ if (!data) {
4885	+ data = new Modal(this, _config);
4886	+ $$$1(this).data(DATA_KEY, data);
4887	+ }
4888
4889	+ if (typeof config === 'string') {
4890	+ if (typeof data[config] === 'undefined') {
4891	+ throw new TypeError("No method named \"" + config + "\"");
4892	+ }
4893
4894	+ data[config](relatedTarget);
4895	+ } else if (_config.show) {
4896	+ data.show(relatedTarget);
4897	}
4898	+ });
4899	+ };
4900
4901	+ _createClass(Modal, null, [{
4902	+ key: "VERSION",
4903	+ get: function get() {
4904	+ return VERSION;
4905	}
4906	+ }, {
4907	+ key: "Default",
4908	+ get: function get() {
4909	+ return Default;
4910	+ }
4911	+ }]);















4912
4913	+ return Modal;
4914	+ }();
4915	+ /**
4916	+ * ------------------------------------------------------------------------
4917	+ * Data Api implementation
4918	+ * ------------------------------------------------------------------------
4919	+ */
4920


4921
4922	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
4923	+ var _this10 = this;
4924
4925	+ var target;
4926	+ var selector = Util.getSelectorFromElement(this);

4927
4928	+ if (selector) {
4929	+ target = $$$1(selector)[0];
4930	+ }
4931
4932	+ var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _objectSpread({}, $$$1(target).data(), $$$1(this).data());


4933
4934	+ if (this.tagName === 'A' \|\| this.tagName === 'AREA') {
4935	+ event.preventDefault();


4936	}
4937
4938	+ var $target = $$$1(target).one(Event.SHOW, function (showEvent) {
4939	+ if (showEvent.isDefaultPrevented()) {
4940	+ // Only register focus restorer if modal will actually get shown
4941	+ return;
4942	}


4943
4944	+ $target.one(Event.HIDDEN, function () {
4945	+ if ($$$1(_this10).is(':visible')) {
4946	+ _this10.focus();
4947	+ }
4948	+ });
4949	+ });

4950
4951	+ Modal._jQueryInterface.call($$$1(target), config, this);
4952	+ });
4953	+ /**
4954	+ * ------------------------------------------------------------------------
4955	+ * jQuery
4956	+ * ------------------------------------------------------------------------
4957	+ */
4958
4959	+ $$$1.fn[NAME] = Modal._jQueryInterface;
4960	+ $$$1.fn[NAME].Constructor = Modal;


4961
4962	+ $$$1.fn[NAME].noConflict = function () {
4963	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
4964	+ return Modal._jQueryInterface;
4965	+ };
4966
4967	+ return Modal;
4968	+ }($);




4969

4970	/**
4971	+ * --------------------------------------------------------------------------
4972	+ * Bootstrap (v4.1.0): tooltip.js
4973	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
4974	+ * --------------------------------------------------------------------------
4975	*/
4976	+
4977	+ var Tooltip = function ($$$1) {







































































4978	/**
4979	* ------------------------------------------------------------------------
4980	+ * Constants
4981	* ------------------------------------------------------------------------
4982	*/
4983	+ var NAME = 'tooltip';
4984	+ var VERSION = '4.1.0';
4985	+ var DATA_KEY = 'bs.tooltip';
4986	+ var EVENT_KEY = "." + DATA_KEY;
4987	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
4988	+ var CLASS_PREFIX = 'bs-tooltip';
4989	+ var BSCLS_PREFIX_REGEX = new RegExp("(^\|\\s)" + CLASS_PREFIX + "\\S+", 'g');
4990	+ var DefaultType = {
4991	+ animation: 'boolean',
4992	+ template: 'string',
4993	+ title: '(string\|element\|function)',
4994	+ trigger: 'string',
4995	+ delay: '(number\|object)',
4996	+ html: 'boolean',
4997	+ selector: '(string\|boolean)',
4998	+ placement: '(string\|function)',
4999	+ offset: '(number\|string)',
5000	+ container: '(string\|element\|boolean)',
5001	+ fallbackPlacement: '(string\|array)',
5002	+ boundary: '(string\|element)'
5003	+ };
5004	+ var AttachmentMap = {
5005	+ AUTO: 'auto',
5006	+ TOP: 'top',
5007	+ RIGHT: 'right',
5008	+ BOTTOM: 'bottom',
5009	+ LEFT: 'left'
5010	+ };
5011	+ var Default = {
5012	+ animation: true,
5013	+ template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>',
5014	+ trigger: 'hover focus',
5015	+ title: '',
5016	+ delay: 0,
5017	+ html: false,
5018	+ selector: false,
5019	+ placement: 'top',
5020	+ offset: 0,
5021	+ container: false,
5022	+ fallbackPlacement: 'flip',
5023	+ boundary: 'scrollParent'
5024	+ };
5025	+ var HoverState = {
5026	+ SHOW: 'show',
5027	+ OUT: 'out'
5028	+ };
5029	+ var Event = {
5030	+ HIDE: "hide" + EVENT_KEY,
5031	+ HIDDEN: "hidden" + EVENT_KEY,
5032	+ SHOW: "show" + EVENT_KEY,
5033	+ SHOWN: "shown" + EVENT_KEY,
5034	+ INSERTED: "inserted" + EVENT_KEY,
5035	+ CLICK: "click" + EVENT_KEY,
5036	+ FOCUSIN: "focusin" + EVENT_KEY,
5037	+ FOCUSOUT: "focusout" + EVENT_KEY,
5038	+ MOUSEENTER: "mouseenter" + EVENT_KEY,
5039	+ MOUSELEAVE: "mouseleave" + EVENT_KEY
5040	+ };
5041	+ var ClassName = {
5042	+ FADE: 'fade',
5043	+ SHOW: 'show'
5044	+ };
5045	+ var Selector = {
5046	+ TOOLTIP: '.tooltip',
5047	+ TOOLTIP_INNER: '.tooltip-inner',
5048	+ ARROW: '.arrow'
5049	+ };
5050	+ var Trigger = {
5051	+ HOVER: 'hover',
5052	+ FOCUS: 'focus',
5053	+ CLICK: 'click',
5054	+ MANUAL: 'manual'
5055	/**
5056	+ * ------------------------------------------------------------------------
5057	+ * Class Definition
5058	+ * ------------------------------------------------------------------------
5059	*/



5060
5061	+ };
5062
5063	+ var Tooltip =
5064	+ /#__PURE__/
5065	+ function () {
5066	+ function Tooltip(element, config) {
5067	+ /**
5068	+ * Check for Popper dependency
5069	+ * Popper - https://popper.js.org
5070	+ */
5071	+ if (typeof Popper === 'undefined') {
5072	+ throw new TypeError('Bootstrap tooltips require Popper.js (https://popper.js.org)');
5073	+ } // private
5074



5075
5076	+ this._isEnabled = true;
5077	+ this._timeout = 0;
5078	+ this._hoverState = '';
5079	+ this._activeTrigger = {};
5080	+ this._popper = null; // Protected
5081
5082	+ this.element = element;
5083	+ this.config = this._getConfig(config);
5084	+ this.tip = null;
5085
5086	+ this._setListeners();
5087	+ } // Getters
5088




5089
5090	+ var _proto = Tooltip.prototype;


5091
5092	+ // Public
5093	+ _proto.enable = function enable() {
5094	+ this._isEnabled = true;
5095	+ };
5096
5097	+ _proto.disable = function disable() {
5098	+ this._isEnabled = false;
5099	+ };

5100
5101	+ _proto.toggleEnabled = function toggleEnabled() {
5102	+ this._isEnabled = !this._isEnabled;
5103	+ };
5104
5105	+ _proto.toggle = function toggle(event) {
5106	+ if (!this._isEnabled) {
5107	+ return;
5108	}
5109
5110	+ if (event) {
5111	+ var dataKey = this.constructor.DATA_KEY;
5112	+ var context = $$$1(event.currentTarget).data(dataKey);
5113	+
5114	+ if (!context) {
5115	+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
5116	+ $$$1(event.currentTarget).data(dataKey, context);
5117	+ }
5118	+
5119	+ context._activeTrigger.click = !context._activeTrigger.click;
5120
5121	+ if (context._isWithActiveTrigger()) {
5122	+ context._enter(null, context);
5123	+ } else {
5124	+ context._leave(null, context);
5125	+ }
5126	} else {
5127	+ if ($$$1(this.getTipElement()).hasClass(ClassName.SHOW)) {
5128	+ this._leave(null, this);



5129
5130	+ return;
5131	+ }
5132
5133	+ this._enter(null, this);
5134	+ }
5135	+ };
5136
5137	+ _proto.dispose = function dispose() {
5138	+ clearTimeout(this._timeout);
5139	+ $$$1.removeData(this.element, this.constructor.DATA_KEY);
5140	+ $$$1(this.element).off(this.constructor.EVENT_KEY);
5141	+ $$$1(this.element).closest('.modal').off('hide.bs.modal');
5142
5143	+ if (this.tip) {
5144	+ $$$1(this.tip).remove();
5145	+ }
5146
5147	+ this._isEnabled = null;
5148	+ this._timeout = null;
5149	+ this._hoverState = null;
5150	+ this._activeTrigger = null;
5151
5152	+ if (this._popper !== null) {
5153	+ this._popper.destroy();
5154	+ }
5155
5156	+ this._popper = null;
5157	+ this.element = null;
5158	+ this.config = null;
5159	+ this.tip = null;
5160	+ };
5161
5162	+ _proto.show = function show() {
5163	+ var _this = this;
5164
5165	+ if ($$$1(this.element).css('display') === 'none') {
5166	+ throw new Error('Please use show on visible elements');
5167	+ }
5168
5169	+ var showEvent = $$$1.Event(this.constructor.Event.SHOW);
5170
5171	+ if (this.isWithContent() && this._isEnabled) {
5172	+ $$$1(this.element).trigger(showEvent);
5173	+ var isInTheDom = $$$1.contains(this.element.ownerDocument.documentElement, this.element);
5174
5175	+ if (showEvent.isDefaultPrevented() \|\| !isInTheDom) {
5176	+ return;
5177	+ }
5178
5179	+ var tip = this.getTipElement();
5180	+ var tipId = Util.getUID(this.constructor.NAME);
5181	+ tip.setAttribute('id', tipId);
5182	+ this.element.setAttribute('aria-describedby', tipId);
5183	+ this.setContent();
5184
5185	+ if (this.config.animation) {
5186	+ $$$1(tip).addClass(ClassName.FADE);
5187	+ }
5188
5189	+ var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement;
5190
5191	+ var attachment = this._getAttachment(placement);
5192
5193	+ this.addAttachmentClass(attachment);
5194	+ var container = this.config.container === false ? document.body : $$$1(this.config.container);
5195	+ $$$1(tip).data(this.constructor.DATA_KEY, this);
5196
5197	+ if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) {
5198	+ $$$1(tip).appendTo(container);
5199	+ }
5200
5201	+ $$$1(this.element).trigger(this.constructor.Event.INSERTED);
5202	+ this._popper = new Popper(this.element, tip, {
5203	+ placement: attachment,
5204	+ modifiers: {
5205	+ offset: {
5206	+ offset: this.config.offset
5207	+ },
5208	+ flip: {
5209	+ behavior: this.config.fallbackPlacement
5210	+ },
5211	+ arrow: {
5212	+ element: Selector.ARROW
5213	+ },
5214	+ preventOverflow: {
5215	+ boundariesElement: this.config.boundary
5216	+ }
5217	},
5218	+ onCreate: function onCreate(data) {
5219	+ if (data.originalPlacement !== data.placement) {
5220	+ _this._handlePopperPlacementChange(data);
5221	+ }
5222	},
5223	+ onUpdate: function onUpdate(data) {





5224	_this._handlePopperPlacementChange(data);
5225	}
5226	+ });
5227	+ $$$1(tip).addClass(ClassName.SHOW); // If this is a touch-enabled device we add extra
5228	+ // empty mouseover listeners to the body's immediate children;
5229	+ // only needed because of broken event delegation on iOS
5230	+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
5231	+
5232	+ if ('ontouchstart' in document.documentElement) {
5233	+ $$$1(document.body).children().on('mouseover', null, $$$1.noop);
5234	}





5235
5236	+ var complete = function complete() {
5237	+ if (_this.config.animation) {
5238	+ _this._fixTransition();
5239	+ }
5240
5241	+ var prevHoverState = _this._hoverState;
5242	+ _this._hoverState = null;
5243	+ $$$1(_this.element).trigger(_this.constructor.Event.SHOWN);

5244
5245	+ if (prevHoverState === HoverState.OUT) {
5246	+ _this._leave(null, _this);
5247	+ }
5248	+ };
5249
5250	+ if ($$$1(this.tip).hasClass(ClassName.FADE)) {
5251	+ var transitionDuration = Util.getTransitionDurationFromElement(this.tip);
5252	+ $$$1(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
5253	+ } else {
5254	+ complete();
5255	}






5256	}
5257	+ };

5258
5259	+ _proto.hide = function hide(callback) {
5260	+ var _this2 = this;
5261
5262	+ var tip = this.getTipElement();
5263	+ var hideEvent = $$$1.Event(this.constructor.Event.HIDE);
5264
5265	+ var complete = function complete() {
5266	+ if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) {
5267	+ tip.parentNode.removeChild(tip);
5268	+ }
5269
5270	+ _this2._cleanTipClass();
5271
5272	+ _this2.element.removeAttribute('aria-describedby');
5273
5274	+ $$$1(_this2.element).trigger(_this2.constructor.Event.HIDDEN);
5275
5276	+ if (_this2._popper !== null) {
5277	+ _this2._popper.destroy();
5278	+ }
5279
5280	+ if (callback) {
5281	+ callback();
5282	+ }
5283	+ };
5284
5285	+ $$$1(this.element).trigger(hideEvent);
5286
5287	+ if (hideEvent.isDefaultPrevented()) {
5288	+ return;
5289	+ }
5290
5291	+ $$$1(tip).removeClass(ClassName.SHOW); // If this is a touch-enabled device we remove the extra
5292	+ // empty mouseover listeners we added for iOS support
5293
5294	+ if ('ontouchstart' in document.documentElement) {
5295	+ $$$1(document.body).children().off('mouseover', null, $$$1.noop);
5296	+ }
5297
5298	+ this._activeTrigger[Trigger.CLICK] = false;
5299	+ this._activeTrigger[Trigger.FOCUS] = false;
5300	+ this._activeTrigger[Trigger.HOVER] = false;
5301
5302	+ if ($$$1(this.tip).hasClass(ClassName.FADE)) {
5303	+ var transitionDuration = Util.getTransitionDurationFromElement(tip);
5304	+ $$$1(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
5305	+ } else {
5306	+ complete();
5307	+ }
5308
5309	+ this._hoverState = '';
5310	+ };
5311
5312	+ _proto.update = function update() {
5313	+ if (this._popper !== null) {
5314	+ this._popper.scheduleUpdate();
5315	+ }
5316	+ }; // Protected
5317
5318
5319	+ _proto.isWithContent = function isWithContent() {
5320	+ return Boolean(this.getTitle());
5321	+ };
5322
5323	+ _proto.addAttachmentClass = function addAttachmentClass(attachment) {
5324	+ $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
5325	+ };
5326
5327	+ _proto.getTipElement = function getTipElement() {
5328	+ this.tip = this.tip \|\| $$$1(this.config.template)[0];
5329	+ return this.tip;
5330	+ };
5331
5332	+ _proto.setContent = function setContent() {
5333	+ var $tip = $$$1(this.getTipElement());
5334	+ this.setElementContent($tip.find(Selector.TOOLTIP_INNER), this.getTitle());
5335	+ $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW);
5336	+ };
5337
5338	+ _proto.setElementContent = function setElementContent($element, content) {
5339	+ var html = this.config.html;
5340
5341	+ if (typeof content === 'object' && (content.nodeType \|\| content.jquery)) {
5342	+ // Content is a DOM node or a jQuery
5343	+ if (html) {
5344	+ if (!$$$1(content).parent().is($element)) {
5345	+ $element.empty().append(content);
5346	+ }
5347	+ } else {
5348	+ $element.text($$$1(content).text());
5349	}
5350	} else {
5351	+ $element[html ? 'html' : 'text'](content);
5352	}
5353	+ };



5354
5355	+ _proto.getTitle = function getTitle() {
5356	+ var title = this.element.getAttribute('data-original-title');
5357
5358	+ if (!title) {
5359	+ title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title;
5360	+ }
5361
5362	+ return title;
5363	+ }; // Private
5364
5365
5366	+ _proto._getAttachment = function _getAttachment(placement) {
5367	+ return AttachmentMap[placement.toUpperCase()];
5368	+ };
5369
5370	+ _proto._setListeners = function _setListeners() {
5371	+ var _this3 = this;
5372	+
5373	+ var triggers = this.config.trigger.split(' ');
5374	+ triggers.forEach(function (trigger) {
5375	+ if (trigger === 'click') {
5376	+ $$$1(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) {
5377	+ return _this3.toggle(event);
5378	+ });
5379	+ } else if (trigger !== Trigger.MANUAL) {
5380	+ var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN;
5381	+ var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT;
5382	+ $$$1(_this3.element).on(eventIn, _this3.config.selector, function (event) {
5383	+ return _this3._enter(event);
5384	+ }).on(eventOut, _this3.config.selector, function (event) {
5385	+ return _this3._leave(event);
5386	+ });
5387	+ }
5388
5389	+ $$$1(_this3.element).closest('.modal').on('hide.bs.modal', function () {
5390	+ return _this3.hide();



5391	});
5392	+ });
5393	+
5394	+ if (this.config.selector) {
5395	+ this.config = _objectSpread({}, this.config, {
5396	+ trigger: 'manual',
5397	+ selector: ''

5398	});
5399	+ } else {
5400	+ this._fixTitle();
5401	}
5402	+ };
5403
5404	+ _proto._fixTitle = function _fixTitle() {
5405	+ var titleType = typeof this.element.getAttribute('data-original-title');












5406
5407	+ if (this.element.getAttribute('title') \|\| titleType !== 'string') {
5408	+ this.element.setAttribute('data-original-title', this.element.getAttribute('title') \|\| '');
5409	+ this.element.setAttribute('title', '');
5410	+ }
5411	+ };
5412
5413	+ _proto._enter = function _enter(event, context) {
5414	+ var dataKey = this.constructor.DATA_KEY;
5415	+ context = context \|\| $$$1(event.currentTarget).data(dataKey);


5416
5417	+ if (!context) {
5418	+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
5419	+ $$$1(event.currentTarget).data(dataKey, context);
5420	+ }
5421
5422	+ if (event) {
5423	+ context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true;
5424	+ }

5425
5426	+ if ($$$1(context.getTipElement()).hasClass(ClassName.SHOW) \|\| context._hoverState === HoverState.SHOW) {
5427	+ context._hoverState = HoverState.SHOW;
5428	+ return;
5429	+ }
5430
5431	+ clearTimeout(context._timeout);
5432	context._hoverState = HoverState.SHOW;










5433
5434	+ if (!context.config.delay \|\| !context.config.delay.show) {

5435	context.show();
5436	+ return;
5437	}


5438
5439	+ context._timeout = setTimeout(function () {
5440	+ if (context._hoverState === HoverState.SHOW) {
5441	+ context.show();
5442	+ }
5443	+ }, context.config.delay.show);
5444	+ };
5445
5446	+ _proto._leave = function _leave(event, context) {
5447	+ var dataKey = this.constructor.DATA_KEY;
5448	+ context = context \|\| $$$1(event.currentTarget).data(dataKey);

5449
5450	+ if (!context) {
5451	+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
5452	+ $$$1(event.currentTarget).data(dataKey, context);
5453	+ }
5454
5455	+ if (event) {
5456	+ context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false;
5457	+ }
5458
5459	+ if (context._isWithActiveTrigger()) {
5460	+ return;
5461	+ }
5462
5463	+ clearTimeout(context._timeout);
5464	+ context._hoverState = HoverState.OUT;


5465
5466	+ if (!context.config.delay \|\| !context.config.delay.hide) {

5467	context.hide();
5468	+ return;
5469	}


5470
5471	+ context._timeout = setTimeout(function () {
5472	+ if (context._hoverState === HoverState.OUT) {
5473	+ context.hide();
5474	+ }
5475	+ }, context.config.delay.hide);
5476	+ };
5477	+
5478	+ _proto._isWithActiveTrigger = function _isWithActiveTrigger() {
5479	+ for (var trigger in this._activeTrigger) {
5480	+ if (this._activeTrigger[trigger]) {
5481	+ return true;
5482	+ }
5483	}

5484
5485	+ return false;
5486	+ };
5487
5488	+ _proto._getConfig = function _getConfig(config) {
5489	+ config = _objectSpread({}, this.constructor.Default, $$$1(this.element).data(), config);
5490
5491	+ if (typeof config.delay === 'number') {
5492	+ config.delay = {
5493	+ show: config.delay,
5494	+ hide: config.delay
5495	+ };
5496	+ }
5497
5498	+ if (typeof config.title === 'number') {
5499	+ config.title = config.title.toString();
5500	+ }
5501
5502	+ if (typeof config.content === 'number') {
5503	+ config.content = config.content.toString();
5504	+ }
5505
5506	+ Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
5507	+ return config;
5508	+ };
5509
5510	+ _proto._getDelegateConfig = function _getDelegateConfig() {
5511	+ var config = {};
5512
5513	+ if (this.config) {
5514	+ for (var key in this.config) {
5515	+ if (this.constructor.Default[key] !== this.config[key]) {
5516	+ config[key] = this.config[key];
5517	+ }
5518	}
5519	}

5520
5521	+ return config;
5522	+ };
5523
5524	+ _proto._cleanTipClass = function _cleanTipClass() {
5525	+ var $tip = $$$1(this.getTipElement());
5526	+ var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
5527
5528	+ if (tabClass !== null && tabClass.length > 0) {
5529	+ $tip.removeClass(tabClass.join(''));
5530	+ }
5531	+ };
5532
5533	+ _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(data) {
5534	+ this._cleanTipClass();
5535
5536	+ this.addAttachmentClass(this._getAttachment(data.placement));
5537	+ };
5538
5539	+ _proto._fixTransition = function _fixTransition() {
5540	+ var tip = this.getTipElement();
5541	+ var initConfigAnimation = this.config.animation;
5542
5543	+ if (tip.getAttribute('x-placement') !== null) {
5544	+ return;
5545	+ }
5546	+
5547	+ $$$1(tip).removeClass(ClassName.FADE);
5548	+ this.config.animation = false;
5549	+ this.hide();
5550	+ this.show();
5551	+ this.config.animation = initConfigAnimation;
5552	+ }; // Static
5553






5554
5555	+ Tooltip._jQueryInterface = function _jQueryInterface(config) {
5556	+ return this.each(function () {
5557	+ var data = $$$1(this).data(DATA_KEY);
5558
5559	+ var _config = typeof config === 'object' && config;


5560
5561	+ if (!data && /dispose\|hide/.test(config)) {
5562	+ return;
5563	+ }
5564
5565	+ if (!data) {
5566	+ data = new Tooltip(this, _config);
5567	+ $$$1(this).data(DATA_KEY, data);
5568	+ }
5569
5570	+ if (typeof config === 'string') {
5571	+ if (typeof data[config] === 'undefined') {
5572	+ throw new TypeError("No method named \"" + config + "\"");
5573	+ }
5574
5575	+ data[config]();


5576	}
5577	+ });
5578	+ };
5579
5580	+ _createClass(Tooltip, null, [{
5581	+ key: "VERSION",
5582	+ get: function get() {
5583	+ return VERSION;
5584	}
5585	+ }, {
5586	+ key: "Default",
5587	+ get: function get() {
5588	+ return Default;
5589	+ }
5590	+ }, {
5591	+ key: "NAME",
5592	+ get: function get() {
5593	+ return NAME;
5594	+ }
5595	+ }, {
5596	+ key: "DATA_KEY",
5597	+ get: function get() {
5598	+ return DATA_KEY;
5599	+ }
5600	+ }, {
5601	+ key: "Event",
5602	+ get: function get() {
5603	+ return Event;
5604	+ }
5605	+ }, {
5606	+ key: "EVENT_KEY",
5607	+ get: function get() {
5608	+ return EVENT_KEY;
5609	+ }
5610	+ }, {
5611	+ key: "DefaultType",
5612	+ get: function get() {
5613	+ return DefaultType;
5614	+ }
5615	+ }]);















5616
5617	+ return Tooltip;
5618	+ }();
5619	+ /**
5620	+ * ------------------------------------------------------------------------
5621	+ * jQuery
5622	+ * ------------------------------------------------------------------------
5623	+ */
5624


5625
5626	+ $$$1.fn[NAME] = Tooltip._jQueryInterface;
5627	+ $$$1.fn[NAME].Constructor = Tooltip;


5628
5629	+ $$$1.fn[NAME].noConflict = function () {
5630	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
5631	+ return Tooltip._jQueryInterface;
5632	+ };
5633
5634	+ return Tooltip;
5635	+ }($, Popper);




5636

5637	/**
5638	+ * --------------------------------------------------------------------------
5639	+ * Bootstrap (v4.1.0): popover.js
5640	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
5641	+ * --------------------------------------------------------------------------
5642	*/
5643	+
5644	+ var Popover = function ($$$1) {

































5645	/**
5646	* ------------------------------------------------------------------------
5647	+ * Constants
5648	* ------------------------------------------------------------------------
5649	*/
5650	+ var NAME = 'popover';
5651	+ var VERSION = '4.1.0';
5652	+ var DATA_KEY = 'bs.popover';
5653	+ var EVENT_KEY = "." + DATA_KEY;
5654	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
5655	+ var CLASS_PREFIX = 'bs-popover';
5656	+ var BSCLS_PREFIX_REGEX = new RegExp("(^\|\\s)" + CLASS_PREFIX + "\\S+", 'g');
5657	+
5658	+ var Default = _objectSpread({}, Tooltip.Default, {
5659	+ placement: 'right',
5660	+ trigger: 'click',
5661	+ content: '',
5662	+ template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>'
5663	+ });
5664
5665	+ var DefaultType = _objectSpread({}, Tooltip.DefaultType, {
5666	+ content: '(string\|element\|function)'
5667	+ });









5668
5669	+ var ClassName = {
5670	+ FADE: 'fade',
5671	+ SHOW: 'show'
5672	};
5673	+ var Selector = {
5674	+ TITLE: '.popover-header',
5675	+ CONTENT: '.popover-body'
5676	};
5677	+ var Event = {
5678	+ HIDE: "hide" + EVENT_KEY,
5679	+ HIDDEN: "hidden" + EVENT_KEY,
5680	+ SHOW: "show" + EVENT_KEY,
5681	+ SHOWN: "shown" + EVENT_KEY,
5682	+ INSERTED: "inserted" + EVENT_KEY,
5683	+ CLICK: "click" + EVENT_KEY,
5684	+ FOCUSIN: "focusin" + EVENT_KEY,
5685	+ FOCUSOUT: "focusout" + EVENT_KEY,
5686	+ MOUSEENTER: "mouseenter" + EVENT_KEY,
5687	+ MOUSELEAVE: "mouseleave" + EVENT_KEY
5688	+ /**
5689	+ * ------------------------------------------------------------------------
5690	+ * Class Definition
5691	+ * ------------------------------------------------------------------------
5692	+ */
5693



5694	};
5695
5696	+ var Popover =
5697	+ /#__PURE__/
5698	+ function (_Tooltip) {
5699	+ _inheritsLoose(Popover, _Tooltip);
5700
5701	+ function Popover() {
5702	+ return _Tooltip.apply(this, arguments) \|\| this;
5703	+ }
5704
5705	+ var _proto = Popover.prototype;
5706
5707	+ // Overrides
5708	+ _proto.isWithContent = function isWithContent() {
5709	+ return this.getTitle() \|\| this._getContent();
5710	+ };
5711	+
5712	+ _proto.addAttachmentClass = function addAttachmentClass(attachment) {
5713	+ $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
5714	+ };
5715
5716	+ _proto.getTipElement = function getTipElement() {
5717	+ this.tip = this.tip \|\| $$$1(this.config.template)[0];
5718	+ return this.tip;
5719	+ };
5720
5721	+ _proto.setContent = function setContent() {
5722	+ var $tip = $$$1(this.getTipElement()); // We use append for html objects to maintain js events
5723
5724	+ this.setElementContent($tip.find(Selector.TITLE), this.getTitle());


5725
5726	+ var content = this._getContent();


5727
5728	+ if (typeof content === 'function') {
5729	+ content = content.call(this.element);
5730	+ }
5731	+
5732	+ this.setElementContent($tip.find(Selector.CONTENT), content);
5733	+ $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW);
5734	+ }; // Private
5735
5736
5737	+ _proto._getContent = function _getContent() {
5738	+ return this.element.getAttribute('data-content') \|\| this.config.content;
5739	+ };
5740
5741	+ _proto._cleanTipClass = function _cleanTipClass() {
5742	+ var $tip = $$$1(this.getTipElement());
5743	+ var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
5744
5745	+ if (tabClass !== null && tabClass.length > 0) {
5746	+ $tip.removeClass(tabClass.join(''));
5747	}
5748	+ }; // Static
5749	+
5750	+
5751	+ Popover._jQueryInterface = function _jQueryInterface(config) {
5752	+ return this.each(function () {
5753	+ var data = $$$1(this).data(DATA_KEY);
5754	+
5755	+ var _config = typeof config === 'object' ? config : null;
5756	+
5757	+ if (!data && /destroy\|hide/.test(config)) {
5758	+ return;
5759	+ }
5760	+
5761	+ if (!data) {
5762	+ data = new Popover(this, _config);
5763	+ $$$1(this).data(DATA_KEY, data);
5764	+ }
5765
5766	+ if (typeof config === 'string') {
5767	+ if (typeof data[config] === 'undefined') {
5768	+ throw new TypeError("No method named \"" + config + "\"");
5769	+ }
5770
5771	+ data[config]();


5772	}
5773	+ });
5774	+ };
5775
5776	+ _createClass(Popover, null, [{
5777	+ key: "VERSION",
5778	+ // Getters
5779	+ get: function get() {
5780	+ return VERSION;
5781	}
5782	+ }, {
5783	+ key: "Default",
5784	+ get: function get() {
5785	+ return Default;
5786	+ }
5787	+ }, {
5788	+ key: "NAME",
5789	+ get: function get() {
5790	+ return NAME;
5791	+ }
5792	+ }, {
5793	+ key: "DATA_KEY",
5794	+ get: function get() {
5795	+ return DATA_KEY;
5796	+ }
5797	+ }, {
5798	+ key: "Event",
5799	+ get: function get() {
5800	+ return Event;
5801	+ }
5802	+ }, {
5803	+ key: "EVENT_KEY",
5804	+ get: function get() {
5805	+ return EVENT_KEY;
5806	+ }
5807	+ }, {
5808	+ key: "DefaultType",
5809	+ get: function get() {
5810	+ return DefaultType;
5811	+ }
5812	+ }]);
















5813
5814	+ return Popover;
5815	+ }(Tooltip);
5816	+ /**
5817	+ * ------------------------------------------------------------------------
5818	+ * jQuery
5819	+ * ------------------------------------------------------------------------
5820	+ */
5821


5822
5823	+ $$$1.fn[NAME] = Popover._jQueryInterface;
5824	+ $$$1.fn[NAME].Constructor = Popover;


5825
5826	+ $$$1.fn[NAME].noConflict = function () {
5827	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
5828	+ return Popover._jQueryInterface;
5829	+ };
5830
5831	+ return Popover;
5832	+ }($);




5833

5834	/**
5835	+ * --------------------------------------------------------------------------
5836	+ * Bootstrap (v4.1.0): scrollspy.js
5837	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
5838	+ * --------------------------------------------------------------------------
5839	*/
5840	+
5841	+ var ScrollSpy = function ($$$1) {






































5842	/**
5843	* ------------------------------------------------------------------------
5844	+ * Constants
5845	* ------------------------------------------------------------------------
5846	*/
5847	+ var NAME = 'scrollspy';
5848	+ var VERSION = '4.1.0';
5849	+ var DATA_KEY = 'bs.scrollspy';
5850	+ var EVENT_KEY = "." + DATA_KEY;
5851	+ var DATA_API_KEY = '.data-api';
5852	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
5853	+ var Default = {
5854	+ offset: 10,
5855	+ method: 'auto',
5856	+ target: ''
5857	+ };
5858	+ var DefaultType = {
5859	+ offset: 'number',
5860	+ method: 'string',
5861	+ target: '(string\|element)'
5862	+ };
5863	+ var Event = {
5864	+ ACTIVATE: "activate" + EVENT_KEY,
5865	+ SCROLL: "scroll" + EVENT_KEY,
5866	+ LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY
5867	+ };
5868	+ var ClassName = {
5869	+ DROPDOWN_ITEM: 'dropdown-item',
5870	+ DROPDOWN_MENU: 'dropdown-menu',
5871	+ ACTIVE: 'active'
5872	+ };
5873	+ var Selector = {
5874	+ DATA_SPY: '[data-spy="scroll"]',
5875	+ ACTIVE: '.active',
5876	+ NAV_LIST_GROUP: '.nav, .list-group',
5877	+ NAV_LINKS: '.nav-link',
5878	+ NAV_ITEMS: '.nav-item',
5879	+ LIST_ITEMS: '.list-group-item',
5880	+ DROPDOWN: '.dropdown',
5881	+ DROPDOWN_ITEMS: '.dropdown-item',
5882	+ DROPDOWN_TOGGLE: '.dropdown-toggle'
5883	+ };
5884	+ var OffsetMethod = {
5885	+ OFFSET: 'offset',
5886	+ POSITION: 'position'
5887	+ /**
5888	+ * ------------------------------------------------------------------------
5889	+ * Class Definition
5890	+ * ------------------------------------------------------------------------
5891	+ */
5892
5893	+ };






5894
5895	+ var ScrollSpy =
5896	+ /#__PURE__/
5897	+ function () {
5898	+ function ScrollSpy(element, config) {
5899	+ var _this = this;
5900	+
5901	+ this._element = element;
5902	+ this._scrollElement = element.tagName === 'BODY' ? window : element;
5903	+ this._config = this._getConfig(config);
5904	+ this._selector = this._config.target + " " + Selector.NAV_LINKS + "," + (this._config.target + " " + Selector.LIST_ITEMS + ",") + (this._config.target + " " + Selector.DROPDOWN_ITEMS);
5905	+ this._offsets = [];
5906	+ this._targets = [];
5907	+ this._activeTarget = null;
5908	+ this._scrollHeight = 0;
5909	+ $$$1(this._scrollElement).on(Event.SCROLL, function (event) {
5910	+ return _this._process(event);
5911	+ });
5912	+ this.refresh();
5913
5914	+ this._process();
5915	+ } // Getters
5916
5917
5918	+ var _proto = ScrollSpy.prototype;
5919
5920	+ // Public
5921	+ _proto.refresh = function refresh() {
5922	+ var _this2 = this;
5923
5924	+ var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION;
5925	+ var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method;
5926	+ var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0;
5927	+ this._offsets = [];
5928	+ this._targets = [];
5929	+ this._scrollHeight = this._getScrollHeight();
5930	+ var targets = $$$1.makeArray($$$1(this._selector));
5931	+ targets.map(function (element) {
5932	+ var target;
5933	+ var targetSelector = Util.getSelectorFromElement(element);
5934
5935	+ if (targetSelector) {
5936	+ target = $$$1(targetSelector)[0];
5937	+ }
5938
5939	+ if (target) {
5940	+ var targetBCR = target.getBoundingClientRect();
5941
5942	+ if (targetBCR.width \|\| targetBCR.height) {
5943	+ // TODO (fat): remove sketch reliance on jQuery position/offset
5944	+ return [$$$1(target)[offsetMethod]().top + offsetBase, targetSelector];
5945	+ }
5946	}

5947
5948	+ return null;
5949	+ }).filter(function (item) {
5950	+ return item;
5951	+ }).sort(function (a, b) {
5952	+ return a[0] - b[0];
5953	+ }).forEach(function (item) {
5954	+ _this2._offsets.push(item[0]);
5955
5956	+ _this2._targets.push(item[1]);
5957	+ });
5958	+ };
5959	+
5960	+ _proto.dispose = function dispose() {
5961	+ $$$1.removeData(this._element, DATA_KEY);
5962	+ $$$1(this._scrollElement).off(EVENT_KEY);
5963	+ this._element = null;
5964	+ this._scrollElement = null;
5965	+ this._config = null;
5966	+ this._selector = null;
5967	+ this._offsets = null;
5968	+ this._targets = null;
5969	+ this._activeTarget = null;
5970	+ this._scrollHeight = null;
5971	+ }; // Private
5972












5973
5974	+ _proto._getConfig = function _getConfig(config) {
5975	+ config = _objectSpread({}, Default, config);
5976
5977	+ if (typeof config.target !== 'string') {
5978	+ var id = $$$1(config.target).attr('id');
5979
5980	+ if (!id) {
5981	+ id = Util.getUID(NAME);
5982	+ $$$1(config.target).attr('id', id);
5983	+ }
5984
5985	+ config.target = "#" + id;


5986	}
5987
5988	+ Util.typeCheckConfig(NAME, config, DefaultType);
5989	+ return config;
5990	+ };
5991
5992	+ _proto._getScrollTop = function _getScrollTop() {
5993	+ return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop;
5994	+ };
5995
5996	+ _proto._getScrollHeight = function _getScrollHeight() {
5997	+ return this._scrollElement.scrollHeight \|\| Math.max(document.body.scrollHeight, document.documentElement.scrollHeight);
5998	+ };
5999
6000	+ _proto._getOffsetHeight = function _getOffsetHeight() {
6001	+ return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height;
6002	+ };
6003
6004	+ _proto._process = function _process() {
6005	+ var scrollTop = this._getScrollTop() + this._config.offset;

6006
6007	+ var scrollHeight = this._getScrollHeight();

6008
6009	+ var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight();
6010
6011	+ if (this._scrollHeight !== scrollHeight) {
6012	+ this.refresh();
6013	+ }
6014
6015	+ if (scrollTop >= maxScroll) {
6016	+ var target = this._targets[this._targets.length - 1];

6017
6018	+ if (this._activeTarget !== target) {
6019	+ this._activate(target);
6020	+ }
6021
6022	+ return;

6023	}
6024
6025	+ if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) {
6026	+ this._activeTarget = null;



6027
6028	+ this._clear();
6029
6030	+ return;
6031	+ }
6032
6033	+ for (var i = this._offsets.length; i--;) {
6034	+ var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' \|\| scrollTop < this._offsets[i + 1]);
6035
6036	+ if (isActiveTarget) {
6037	+ this._activate(this._targets[i]);
6038	+ }
6039	}
6040	+ };

6041
6042	+ _proto._activate = function _activate(target) {
6043	+ this._activeTarget = target;
6044
6045	+ this._clear();
6046
6047	+ var queries = this._selector.split(','); // eslint-disable-next-line arrow-body-style
6048
6049
6050	+ queries = queries.map(function (selector) {
6051	+ return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]");
6052	+ });
6053	+ var $link = $$$1(queries.join(','));
6054
6055	+ if ($link.hasClass(ClassName.DROPDOWN_ITEM)) {
6056	+ $link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
6057	+ $link.addClass(ClassName.ACTIVE);
6058	+ } else {
6059	+ // Set triggered link as active
6060	+ $link.addClass(ClassName.ACTIVE); // Set triggered links parents as active
6061	+ // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor
6062
6063	+ $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_LINKS + ", " + Selector.LIST_ITEMS).addClass(ClassName.ACTIVE); // Handle special case when .nav-link is inside .nav-item
6064
6065	+ $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_ITEMS).children(Selector.NAV_LINKS).addClass(ClassName.ACTIVE);
6066	+ }
6067
6068	+ $$$1(this._scrollElement).trigger(Event.ACTIVATE, {
6069	+ relatedTarget: target
6070	+ });
6071	+ };
6072
6073	+ _proto._clear = function _clear() {
6074	+ $$$1(this._selector).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
6075	+ }; // Static
6076
6077
6078	+ ScrollSpy._jQueryInterface = function _jQueryInterface(config) {
6079	+ return this.each(function () {
6080	+ var data = $$$1(this).data(DATA_KEY);
6081
6082	+ var _config = typeof config === 'object' && config;
6083
6084	+ if (!data) {
6085	+ data = new ScrollSpy(this, _config);
6086	+ $$$1(this).data(DATA_KEY, data);
6087	+ }
6088	+
6089	+ if (typeof config === 'string') {
6090	+ if (typeof data[config] === 'undefined') {
6091	+ throw new TypeError("No method named \"" + config + "\"");
6092	+ }
6093
6094	+ data[config]();


6095	}
6096	+ });
6097	+ };
6098
6099	+ _createClass(ScrollSpy, null, [{
6100	+ key: "VERSION",
6101	+ get: function get() {
6102	+ return VERSION;
6103	}
6104	+ }, {
6105	+ key: "Default",
6106	+ get: function get() {
6107	+ return Default;
6108	+ }
6109	+ }]);















6110
6111	+ return ScrollSpy;
6112	+ }();
6113	+ /**
6114	+ * ------------------------------------------------------------------------
6115	+ * Data Api implementation
6116	+ * ------------------------------------------------------------------------
6117	+ */
6118


6119
6120	+ $$$1(window).on(Event.LOAD_DATA_API, function () {
6121	+ var scrollSpys = $$$1.makeArray($$$1(Selector.DATA_SPY));
6122
6123	+ for (var i = scrollSpys.length; i--;) {
6124	+ var $spy = $$$1(scrollSpys[i]);






6125
6126	+ ScrollSpy._jQueryInterface.call($spy, $spy.data());
6127	+ }
6128	+ });
6129	+ /**
6130	+ * ------------------------------------------------------------------------
6131	+ * jQuery
6132	+ * ------------------------------------------------------------------------
6133	+ */
6134
6135	+ $$$1.fn[NAME] = ScrollSpy._jQueryInterface;
6136	+ $$$1.fn[NAME].Constructor = ScrollSpy;


6137
6138	+ $$$1.fn[NAME].noConflict = function () {
6139	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
6140	+ return ScrollSpy._jQueryInterface;
6141	+ };
6142
6143	+ return ScrollSpy;
6144	+ }($);




6145

6146	/**
6147	+ * --------------------------------------------------------------------------
6148	+ * Bootstrap (v4.1.0): tab.js
6149	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
6150	+ * --------------------------------------------------------------------------
6151	*/
6152	+
6153	+ var Tab = function ($$$1) {



























6154	/**
6155	* ------------------------------------------------------------------------
6156	+ * Constants
6157	* ------------------------------------------------------------------------
6158	*/
6159	+ var NAME = 'tab';
6160	+ var VERSION = '4.1.0';
6161	+ var DATA_KEY = 'bs.tab';
6162	+ var EVENT_KEY = "." + DATA_KEY;
6163	+ var DATA_API_KEY = '.data-api';
6164	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
6165	+ var Event = {
6166	+ HIDE: "hide" + EVENT_KEY,
6167	+ HIDDEN: "hidden" + EVENT_KEY,
6168	+ SHOW: "show" + EVENT_KEY,
6169	+ SHOWN: "shown" + EVENT_KEY,
6170	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
6171	+ };
6172	+ var ClassName = {
6173	+ DROPDOWN_MENU: 'dropdown-menu',
6174	+ ACTIVE: 'active',
6175	+ DISABLED: 'disabled',
6176	+ FADE: 'fade',
6177	+ SHOW: 'show'
6178	+ };
6179	+ var Selector = {
6180	+ DROPDOWN: '.dropdown',
6181	+ NAV_LIST_GROUP: '.nav, .list-group',
6182	+ ACTIVE: '.active',
6183	+ ACTIVE_UL: '> li > .active',
6184	+ DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',
6185	+ DROPDOWN_TOGGLE: '.dropdown-toggle',
6186	+ DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active'
6187	+ /**
6188	+ * ------------------------------------------------------------------------
6189	+ * Class Definition
6190	+ * ------------------------------------------------------------------------
6191	+ */
6192
6193	+ };
6194
6195	+ var Tab =
6196	+ /#__PURE__/
6197	+ function () {
6198	+ function Tab(element) {
6199	+ this._element = element;
6200	+ } // Getters
6201
6202
6203	+ var _proto = Tab.prototype;
6204
6205	+ // Public
6206	+ _proto.show = function show() {
6207	+ var _this = this;
6208
6209	+ if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $$$1(this._element).hasClass(ClassName.ACTIVE) \|\| $$$1(this._element).hasClass(ClassName.DISABLED)) {
6210	+ return;
6211	+ }
6212
6213	+ var target;
6214	+ var previous;
6215	+ var listElement = $$$1(this._element).closest(Selector.NAV_LIST_GROUP)[0];
6216	+ var selector = Util.getSelectorFromElement(this._element);
6217	+
6218	+ if (listElement) {
6219	+ var itemSelector = listElement.nodeName === 'UL' ? Selector.ACTIVE_UL : Selector.ACTIVE;
6220	+ previous = $$$1.makeArray($$$1(listElement).find(itemSelector));
6221	+ previous = previous[previous.length - 1];
6222	+ }
6223
6224	+ var hideEvent = $$$1.Event(Event.HIDE, {
6225	+ relatedTarget: this._element
6226	+ });
6227	+ var showEvent = $$$1.Event(Event.SHOW, {
6228	+ relatedTarget: previous
6229	+ });
6230
6231	+ if (previous) {
6232	+ $$$1(previous).trigger(hideEvent);
6233	+ }
6234
6235	+ $$$1(this._element).trigger(showEvent);
6236
6237	+ if (showEvent.isDefaultPrevented() \|\| hideEvent.isDefaultPrevented()) {
6238	+ return;
6239	+ }
6240
6241	+ if (selector) {
6242	+ target = $$$1(selector)[0];
6243	+ }
6244
6245	+ this._activate(this._element, listElement);
6246
6247	+ var complete = function complete() {
6248	+ var hiddenEvent = $$$1.Event(Event.HIDDEN, {
6249	+ relatedTarget: _this._element
6250	+ });
6251	+ var shownEvent = $$$1.Event(Event.SHOWN, {
6252	+ relatedTarget: previous
6253	+ });
6254	+ $$$1(previous).trigger(hiddenEvent);
6255	+ $$$1(_this._element).trigger(shownEvent);
6256	+ };
6257	+
6258	+ if (target) {
6259	+ this._activate(target, target.parentNode, complete);
6260	+ } else {
6261	+ complete();
6262	+ }
6263	};
6264
6265	+ _proto.dispose = function dispose() {
6266	+ $$$1.removeData(this._element, DATA_KEY);
6267	+ this._element = null;
6268	+ }; // Private


6269




6270
6271	+ _proto._activate = function _activate(element, container, callback) {
6272	+ var _this2 = this;
6273
6274	+ var activeElements;

6275
6276	+ if (container.nodeName === 'UL') {
6277	+ activeElements = $$$1(container).find(Selector.ACTIVE_UL);
6278	+ } else {
6279	+ activeElements = $$$1(container).children(Selector.ACTIVE);
6280	+ }
6281
6282	+ var active = activeElements[0];
6283	+ var isTransitioning = callback && active && $$$1(active).hasClass(ClassName.FADE);



6284
6285	+ var complete = function complete() {
6286	+ return _this2._transitionComplete(element, active, callback);
6287	+ };
6288
6289	+ if (active && isTransitioning) {
6290	+ var transitionDuration = Util.getTransitionDurationFromElement(active);
6291	+ $$$1(active).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
6292	+ } else {
6293	+ complete();
6294	+ }
6295	};
6296
6297	+ _proto._transitionComplete = function _transitionComplete(element, active, callback) {
6298	+ if (active) {
6299	+ $$$1(active).removeClass(ClassName.SHOW + " " + ClassName.ACTIVE);
6300	+ var dropdownChild = $$$1(active.parentNode).find(Selector.DROPDOWN_ACTIVE_CHILD)[0];


6301
6302	+ if (dropdownChild) {
6303	+ $$$1(dropdownChild).removeClass(ClassName.ACTIVE);
6304	+ }

6305
6306	+ if (active.getAttribute('role') === 'tab') {
6307	+ active.setAttribute('aria-selected', false);
6308	+ }
6309	}
6310
6311	+ $$$1(element).addClass(ClassName.ACTIVE);



6312
6313	+ if (element.getAttribute('role') === 'tab') {
6314	+ element.setAttribute('aria-selected', true);
6315	+ }
6316
6317	+ Util.reflow(element);
6318	+ $$$1(element).addClass(ClassName.SHOW);

6319
6320	+ if (element.parentNode && $$$1(element.parentNode).hasClass(ClassName.DROPDOWN_MENU)) {
6321	+ var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0];
6322
6323	+ if (dropdownElement) {
6324	+ $$$1(dropdownElement).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
6325	+ }
6326
6327	+ element.setAttribute('aria-expanded', true);

6328	}
6329
6330	+ if (callback) {
6331	+ callback();
6332	+ }
6333	+ }; // Static
6334




6335
6336	+ Tab._jQueryInterface = function _jQueryInterface(config) {
6337	+ return this.each(function () {
6338	+ var $this = $$$1(this);
6339	+ var data = $this.data(DATA_KEY);
6340
6341	+ if (!data) {
6342	+ data = new Tab(this);
6343	+ $this.data(DATA_KEY, data);
6344	+ }
6345
6346	+ if (typeof config === 'string') {
6347	+ if (typeof data[config] === 'undefined') {
6348	+ throw new TypeError("No method named \"" + config + "\"");
6349	+ }
6350
6351	+ data[config]();


6352	}
6353	+ });
6354	+ };
6355
6356	+ _createClass(Tab, null, [{
6357	+ key: "VERSION",
6358	+ get: function get() {
6359	+ return VERSION;
6360	}
6361	+ }]);

6362
6363	+ return Tab;
6364	+ }();
6365	+ /**
6366	+ * ------------------------------------------------------------------------
6367	+ * Data Api implementation
6368	+ * ------------------------------------------------------------------------
6369	+ */






6370
6371
6372	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
6373	+ event.preventDefault();
6374
6375	+ Tab._jQueryInterface.call($$$1(this), 'show');
6376	+ });
6377	+ /**
6378	+ * ------------------------------------------------------------------------
6379	+ * jQuery
6380	+ * ------------------------------------------------------------------------
6381	+ */
6382
6383	+ $$$1.fn[NAME] = Tab._jQueryInterface;
6384	+ $$$1.fn[NAME].Constructor = Tab;
6385
6386	+ $$$1.fn[NAME].noConflict = function () {
6387	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
6388	+ return Tab._jQueryInterface;
6389	+ };
6390
6391	+ return Tab;
6392	+ }($);
6393
6394	+ /**
6395	+ * --------------------------------------------------------------------------
6396	+ * Bootstrap (v4.0.0): index.js
6397	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
6398	+ * --------------------------------------------------------------------------
6399	+ */
6400
6401	+ (function ($$$1) {
6402	+ if (typeof $$$1 === 'undefined') {
6403	+ throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.');
6404	+ }
6405
6406	+ var version = $$$1.fn.jquery.split(' ')[0].split('.');
6407	+ var minMajor = 1;
6408	+ var ltMajor = 2;
6409	+ var minMinor = 9;
6410	+ var minPatch = 1;
6411	+ var maxMajor = 4;
6412
6413	+ if (version[0] < ltMajor && version[1] < minMinor \|\| version[0] === minMajor && version[1] === minMinor && version[2] < minPatch \|\| version[0] >= maxMajor) {
6414	+ throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0');
6415	+ }
6416	+ })($);
6417	+
6418	+ exports.Util = Util;
6419	+ exports.Alert = Alert;
6420	+ exports.Button = Button;
6421	+ exports.Carousel = Carousel;
6422	+ exports.Collapse = Collapse;
6423	+ exports.Dropdown = Dropdown;
6424	+ exports.Modal = Modal;
6425	+ exports.Popover = Popover;
6426	+ exports.Scrollspy = ScrollSpy;
6427	+ exports.Tab = Tab;
6428	+ exports.Tooltip = Tooltip;
6429	+
6430	+ Object.defineProperty(exports, '__esModule', { value: true });
6431
6432	})));
6433	//# sourceMappingURL=bootstrap.bundle.js.map

resources/js/bootstrap4.bundle.min.js CHANGED Viewed

	@@ -1,7 +1,7 @@
1	/*!
2	- * Bootstrap v4.0.0 (https://getbootstrap.com)
3	* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
4	* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
5	*/
6	- !function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function n(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable\|\|!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function i(t,e,i){return e&&n(t.prototype,e),i&&n(t,i),t}function r(){return(r=Object.assign\|\|function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t}).apply(this,arguments)}for(var o,s,a,l,c,h,f,u,d,p,g,m,_,v,E,y,b,T,C,w,I,A,D,S,O,N,k=function(t){var e=!1;function n(e){var n=this,r=!1;return t(this).one(i.TRANSITION_END,function(){r=!0}),setTimeout(function(){r\|\|i.triggerTransitionEnd(n)},e),this}var i={TRANSITION_END:"bsTransitionEnd",getUID:function(t){do{t+=~~(1e6Math.random())}while(document.getElementById(t));return t},getSelectorFromElement:function(e){var n,i=e.getAttribute("data-target");i&&"#"!==i\|\|(i=e.getAttribute("href")\|\|""),"#"===i.charAt(0)&&(n=i,i=n="function"==typeof t.escapeSelector?t.escapeSelector(n).substr(1):n.replace(/(:\|\.\|\[\|\]\|,\|=\|@)/g,"\\$1"));try{return t(document).find(i).length>0?i:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]\|\|t).nodeType},typeCheckConfig:function(t,e,n){for(var r in n)if(Object.prototype.hasOwnProperty.call(n,r)){var o=n[r],s=e[r],a=s&&i.isElement(s)?"element":(l=s,{}.toString.call(l).match(/\s([a-zA-Z]+)/)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(t.toUpperCase()+': Option "'+r+'" provided type "'+a+'" but expected type "'+o+'".')}var l}};return e=("undefined"==typeof window\|\|!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e=e&&e.hasOwnProperty("default")?e.default:e),L=(s="alert",l="."+(a="bs.alert"),c=(o=e).fn[s],h={CLOSE:"close"+l,CLOSED:"closed"+l,CLICK_DATA_API:"click"+l+".data-api"},f="alert",u="fade",d="show",p=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t\|\|this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()\|\|this._removeElement(e)},e.dispose=function(){o.removeData(this._element,a),this._element=null},e._getRootElement=function(t){var e=k.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n\|\|(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(h.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(d),k.supportsTransitionEnd()&&o(t).hasClass(u)?o(t).one(k.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(h.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(a);i\|\|(i=new t(this),n.data(a,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(h.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),o.fn[s]=p._jQueryInterface,o.fn[s].Constructor=p,o.fn[s].noConflict=function(){return o.fn[s]=c,p._jQueryInterface},p),P=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",C="focus",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',A="input",D=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:"focus"+v+E+" blur"+v+E},N=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(A)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(D)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")\|\|n.hasAttribute("disabled")\|\|i.classList.contains("disabled")\|\|n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},e.dispose=function(){g.removeData(this._element,_),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=g(this).data(_);n\|\|(n=new t(this),g(this).data(_,n)),"toggle"===e&&n[e]()})},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)\|\|(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),x=function(t){var e="carousel",n="bs.carousel",o="."+n,s=t.fn[e],a={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},l={interval:"(number\|boolean)",keyboard:"boolean",slide:"(boolean\|string)",pause:"(string\|boolean)",wrap:"boolean"},c="next",h="prev",f="left",u="right",d={SLIDE:"slide"+o,SLID:"slid"+o,KEYDOWN:"keydown"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o,TOUCHEND:"touchend"+o,LOAD_DATA_API:"load"+o+".data-api",CLICK_DATA_API:"click"+o+".data-api"},p="carousel",g="active",m="slide",_="carousel-item-right",v="carousel-item-left",E="carousel-item-next",y="carousel-item-prev",b={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},T=function(){function s(e,n){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(n),this._element=t(e)[0],this._indicatorsElement=t(this._element).find(b.INDICATORS)[0],this._addEventListeners()}var T=s.prototype;return T.next=function(){this._isSliding\|\|this._slide(c)},T.nextWhenVisible=function(){!document.hidden&&t(this._element).is(":visible")&&"hidden"!==t(this._element).css("visibility")&&this.next()},T.prev=function(){this._isSliding\|\|this._slide(h)},T.pause=function(e){e\|\|(this._isPaused=!0),t(this._element).find(b.NEXT_PREV)[0]&&k.supportsTransitionEnd()&&(k.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},T.cycle=function(t){t\|\|(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},T.to=function(e){var n=this;this._activeElement=t(this._element).find(b.ACTIVE_ITEM)[0];var i=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1\|\|e<0))if(this._isSliding)t(this._element).one(d.SLID,function(){return n.to(e)});else{if(i===e)return this.pause(),void this.cycle();var r=e>i?c:h;this._slide(r,this._items[e])}},T.dispose=function(){t(this._element).off(o),t.removeData(this._element,n),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},T._getConfig=function(t){return t=r({},a,t),k.typeCheckConfig(e,t,l),t},T._addEventListeners=function(){var e=this;this._config.keyboard&&t(this._element).on(d.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(t(this._element).on(d.MOUSEENTER,function(t){return e.pause(t)}).on(d.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&t(this._element).on(d.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},T._keydown=function(t){if(!/input\|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},T._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(b.ITEM)),this._items.indexOf(e)},T._getItemByDirection=function(t,e){var n=t===c,i=t===h,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r\|\|n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===h?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},T._triggerSlideEvent=function(e,n){var i=this._getItemIndex(e),r=this._getItemIndex(t(this._element).find(b.ACTIVE_ITEM)[0]),o=t.Event(d.SLIDE,{relatedTarget:e,direction:n,from:r,to:i});return t(this._element).trigger(o),o},T._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(b.ACTIVE).removeClass(g);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(g)}},T._slide=function(e,n){var i,r,o,s=this,a=t(this._element).find(b.ACTIVE_ITEM)[0],l=this._getItemIndex(a),h=n\|\|a&&this._getItemByDirection(e,a),p=this._getItemIndex(h),T=Boolean(this._interval);if(e===c?(i=v,r=E,o=f):(i=_,r=y,o=u),h&&t(h).hasClass(g))this._isSliding=!1;else if(!this._triggerSlideEvent(h,o).isDefaultPrevented()&&a&&h){this._isSliding=!0,T&&this.pause(),this._setActiveIndicatorElement(h);var C=t.Event(d.SLID,{relatedTarget:h,direction:o,from:l,to:p});k.supportsTransitionEnd()&&t(this._element).hasClass(m)?(t(h).addClass(r),k.reflow(h),t(a).addClass(i),t(h).addClass(i),t(a).one(k.TRANSITION_END,function(){t(h).removeClass(i+" "+r).addClass(g),t(a).removeClass(g+" "+r+" "+i),s._isSliding=!1,setTimeout(function(){return t(s._element).trigger(C)},0)}).emulateTransitionEnd(600)):(t(a).removeClass(g),t(h).addClass(g),this._isSliding=!1,t(this._element).trigger(C)),T&&this.cycle()}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),o=r({},a,t(this).data());"object"==typeof e&&(o=r({},o,e));var l="string"==typeof e?e:o.slide;if(i\|\|(i=new s(this,o),t(this).data(n,i)),"number"==typeof e)i.to(e);else if("string"==typeof l){if("undefined"==typeof i[l])throw new TypeError('No method named "'+l+'"');i[l]()}else o.interval&&(i.pause(),i.cycle())})},s._dataApiClickHandler=function(e){var i=k.getSelectorFromElement(this);if(i){var o=t(i)[0];if(o&&t(o).hasClass(p)){var a=r({},t(o).data(),t(this).data()),l=this.getAttribute("data-slide-to");l&&(a.interval=!1),s._jQueryInterface.call(t(o),a),l&&t(o).data(n).to(l),e.preventDefault()}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(document).on(d.CLICK_DATA_API,b.DATA_SLIDE,T._dataApiClickHandler),t(window).on(d.LOAD_DATA_API,function(){t(b.DATA_RIDE).each(function(){var e=t(this);T._jQueryInterface.call(e,e.data())})}),t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),R=function(t){var e="collapse",n="bs.collapse",o="."+n,s=t.fn[e],a={toggle:!0,parent:""},l={toggle:"boolean",parent:"(string\|element)"},c={SHOW:"show"+o,SHOWN:"shown"+o,HIDE:"hide"+o,HIDDEN:"hidden"+o,CLICK_DATA_API:"click"+o+".data-api"},h="show",f="collapse",u="collapsing",d="collapsed",p="width",g="height",m={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},_=function(){function o(e,n){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(n),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var i=t(m.DATA_TOGGLE),r=0;r<i.length;r++){var o=i[r],s=k.getSelectorFromElement(o);null!==s&&t(s).filter(e).length>0&&(this._selector=s,this._triggerArray.push(o))}this._parent=this._config.parent?this._getParent():null,this._config.parent\|\|this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var s=o.prototype;return s.toggle=function(){t(this._element).hasClass(h)?this.hide():this.show()},s.show=function(){var e,i,r=this;if(!this._isTransitioning&&!t(this._element).hasClass(h)&&(this._parent&&0===(e=t.makeArray(t(this._parent).find(m.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(i=t(e).not(this._selector).data(n))&&i._isTransitioning))){var s=t.Event(c.SHOW);if(t(this._element).trigger(s),!s.isDefaultPrevented()){e&&(o._jQueryInterface.call(t(e).not(this._selector),"hide"),i\|\|t(e).data(n,null));var a=this._getDimension();t(this._element).removeClass(f).addClass(u),this._element.style[a]=0,this._triggerArray.length>0&&t(this._triggerArray).removeClass(d).attr("aria-expanded",!0),this.setTransitioning(!0);var l=function(){t(r._element).removeClass(u).addClass(f).addClass(h),r._element.style[a]="",r.setTransitioning(!1),t(r._element).trigger(c.SHOWN)};if(k.supportsTransitionEnd()){var p="scroll"+(a[0].toUpperCase()+a.slice(1));t(this._element).one(k.TRANSITION_END,l).emulateTransitionEnd(600),this._element.style[a]=this._element[p]+"px"}else l()}}},s.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(h)){var n=t.Event(c.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension();if(this._element.style[i]=this._element.getBoundingClientRect()[i]+"px",k.reflow(this._element),t(this._element).addClass(u).removeClass(f).removeClass(h),this._triggerArray.length>0)for(var r=0;r<this._triggerArray.length;r++){var o=this._triggerArray[r],s=k.getSelectorFromElement(o);if(null!==s)t(s).hasClass(h)\|\|t(o).addClass(d).attr("aria-expanded",!1)}this.setTransitioning(!0);var a=function(){e.setTransitioning(!1),t(e._element).removeClass(u).addClass(f).trigger(c.HIDDEN)};this._element.style[i]="",k.supportsTransitionEnd()?t(this._element).one(k.TRANSITION_END,a).emulateTransitionEnd(600):a()}}},s.setTransitioning=function(t){this._isTransitioning=t},s.dispose=function(){t.removeData(this._element,n),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},s._getConfig=function(t){return(t=r({},a,t)).toggle=Boolean(t.toggle),k.typeCheckConfig(e,t,l),t},s._getDimension=function(){return t(this._element).hasClass(p)?p:g},s._getParent=function(){var e=this,n=null;k.isElement(this._config.parent)?(n=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(n=this._config.parent[0])):n=t(this._config.parent)[0];var i='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return t(n).find(i).each(function(t,n){e._addAriaAndCollapsedClass(o._getTargetFromElement(n),[n])}),n},s._addAriaAndCollapsedClass=function(e,n){if(e){var i=t(e).hasClass(h);n.length>0&&t(n).toggleClass(d,!i).attr("aria-expanded",i)}},o._getTargetFromElement=function(e){var n=k.getSelectorFromElement(e);return n?t(n)[0]:null},o._jQueryInterface=function(e){return this.each(function(){var i=t(this),s=i.data(n),l=r({},a,i.data(),"object"==typeof e&&e);if(!s&&l.toggle&&/show\|hide/.test(e)&&(l.toggle=!1),s\|\|(s=new o(this,l),i.data(n,s)),"string"==typeof e){if("undefined"==typeof s[e])throw new TypeError('No method named "'+e+'"');s[e]()}})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(c.CLICK_DATA_API,m.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var i=t(this),r=k.getSelectorFromElement(this);t(r).each(function(){var e=t(this),r=e.data(n)?"toggle":i.data();_._jQueryInterface.call(e,r)})}),t.fn[e]=_._jQueryInterface,t.fn[e].Constructor=_,t.fn[e].noConflict=function(){return t.fn[e]=s,_._jQueryInterface},_}(e),j="undefined"!=typeof window&&"undefined"!=typeof document,H=["Edge","Trident","Firefox"],M=0,W=0;W<H.length;W+=1)if(j&&navigator.userAgent.indexOf(H[W])>=0){M=1;break}var U=j&&window.Promise?function(t){var e=!1;return function(){e\|\|(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e\|\|(e=!0,setTimeout(function(){e=!1,t()},M))}};function B(t){return t&&"[object Function]"==={}.toString.call(t)}function F(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function K(t){return"HTML"===t.nodeName?t:t.parentNode\|\|t.host}function V(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=F(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto\|scroll)/.test(n+r+i)?t:V(K(t))}function Q(t){var e=t&&t.offsetParent,n=e&&e.nodeName;return n&&"BODY"!==n&&"HTML"!==n?-1!==["TD","TABLE"].indexOf(e.nodeName)&&"static"===F(e,"position")?Q(e):e:t?t.ownerDocument.documentElement:document.documentElement}function Y(t){return null!==t.parentNode?Y(t.parentNode):t}function G(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l\|\|i.contains(r))return"BODY"===(a=(s=l).nodeName)\|\|"HTML"!==a&&Q(s.firstElementChild)!==s?Q(l):l;var c=Y(t);return c.host?G(c.host,e):G(t,Y(e).host)}function q(t){var e="top"===(arguments.length>1&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n\|\|"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement\|\|i)[e]}return t[e]}function z(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}var X=void 0,Z=function(){return void 0===X&&(X=-1!==navigator.appVersion.indexOf("MSIE 10")),X};function J(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Z()?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function $(){var t=document.body,e=document.documentElement,n=Z()&&getComputedStyle(e);return{height:J("Height",t,e,n),width:J("Width",t,e,n)}}var tt=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},et=function(){function t(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable\|\|!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(e,n,i){return n&&t(e.prototype,n),i&&t(e,i),e}}(),nt=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},it=Object.assign\|\|function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function rt(t){return it({},t,{right:t.left+t.width,bottom:t.top+t.height})}function ot(t){var e={};if(Z())try{e=t.getBoundingClientRect();var n=q(t,"top"),i=q(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}catch(t){}else e=t.getBoundingClientRect();var r={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},o="HTML"===t.nodeName?$():{},s=o.width\|\|t.clientWidth\|\|r.right-r.left,a=o.height\|\|t.clientHeight\|\|r.bottom-r.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l\|\|c){var h=F(t);l-=z(h,"x"),c-=z(h,"y"),r.width-=l,r.height-=c}return rt(r)}function st(t,e){var n=Z(),i="HTML"===e.nodeName,r=ot(t),o=ot(e),s=V(t),a=F(e),l=parseFloat(a.borderTopWidth,10),c=parseFloat(a.borderLeftWidth,10),h=rt({top:r.top-o.top-l,left:r.left-o.left-c,width:r.width,height:r.height});if(h.marginTop=0,h.marginLeft=0,!n&&i){var f=parseFloat(a.marginTop,10),u=parseFloat(a.marginLeft,10);h.top-=l-f,h.bottom-=l-f,h.left-=c-u,h.right-=c-u,h.marginTop=f,h.marginLeft=u}return(n?e.contains(s):e===s&&"BODY"!==s.nodeName)&&(h=function(t,e){var n=arguments.length>2&&void 0!==arguments[2]&&arguments[2],i=q(e,"top"),r=q(e,"left"),o=n?-1:1;return t.top+=io,t.bottom+=io,t.left+=ro,t.right+=ro,t}(h,e)),h}function at(t,e,n,i){var r,o,s,a,l,c,h,f={top:0,left:0},u=G(t,e);if("viewport"===i)o=(r=u).ownerDocument.documentElement,s=st(r,o),a=Math.max(o.clientWidth,window.innerWidth\|\|0),l=Math.max(o.clientHeight,window.innerHeight\|\|0),c=q(o),h=q(o,"left"),f=rt({top:c-s.top+s.marginTop,left:h-s.left+s.marginLeft,width:a,height:l});else{var d=void 0;"scrollParent"===i?"BODY"===(d=V(K(e))).nodeName&&(d=t.ownerDocument.documentElement):d="window"===i?t.ownerDocument.documentElement:i;var p=st(d,u);if("HTML"!==d.nodeName\|\|function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===F(e,"position")\|\|t(K(e)))}(u))f=p;else{var g=$(),m=g.height,_=g.width;f.top+=p.top-p.marginTop,f.bottom=m+p.top,f.left+=p.left-p.marginLeft,f.right=_+p.left}}return f.left+=n,f.top+=n,f.right-=n,f.bottom-=n,f}function lt(t,e,n,i,r){var o=arguments.length>5&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=at(n,i,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return it({key:t},a[t],{area:(e=a[t],e.widthe.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,i=t.height;return e>=n.clientWidth&&i>=n.clientHeight}),h=c.length>0?c[0].key:l[0].key,f=t.split("-")[1];return h+(f?"-"+f:"")}function ct(t,e,n){return st(n,G(e,n))}function ht(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function ft(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left\|right\|bottom\|top/g,function(t){return e[t]})}function ut(t,e,n){n=n.split("-")[0];var i=ht(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[ft(a)],r}function dt(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function pt(t,e,n){return(void 0===n?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=dt(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",n))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var n=t.function\|\|t.fn;t.enabled&&B(n)&&(e.offsets.popper=rt(e.offsets.popper),e.offsets.reference=rt(e.offsets.reference),e=n(e,t))}),e}function gt(t,e){return t.some(function(t){var n=t.name;return t.enabled&&n===e})}function mt(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length-1;i++){var r=e[i],o=r?""+r+n:t;if("undefined"!=typeof document.body.style[o])return o}return null}function _t(t){var e=t.ownerDocument;return e?e.defaultView:window}function vt(t,e,n,i){n.updateBound=i,_t(t).addEventListener("resize",n.updateBound,{passive:!0});var r=V(t);return function t(e,n,i,r){var o="BODY"===e.nodeName,s=o?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),o\|\|t(V(s.parentNode),n,i,r),r.push(s)}(r,"scroll",n.updateBound,n.scrollParents),n.scrollElement=r,n.eventsEnabled=!0,n}function Et(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,_t(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function yt(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function bt(t,e){Object.keys(e).forEach(function(n){var i="";-1!==["width","height","top","right","bottom","left"].indexOf(n)&&yt(e[n])&&(i="px"),t.style[n]=e[n]+i})}function Tt(t,e,n){var i=dt(t,function(t){return t.name===e}),r=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!r){var o="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return r}var Ct=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],wt=Ct.slice(3);function It(t){var e=arguments.length>1&&void 0!==arguments[1]&&arguments[1],n=wt.indexOf(t),i=wt.slice(n+1).concat(wt.slice(0,n));return e?i.reverse():i}var At={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function Dt(t,e,n,i){var r=[0,0],o=-1!==["right","left"].indexOf(i),s=t.split(/(\+\|\-)/).map(function(t){return t.trim()}),a=s.indexOf(dt(s,function(t){return-1!==t.search(/,\|\s/)}));s[a]&&-1===s[a].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s,\s\|\s+/,c=-1!==a?[s.slice(0,a).concat([s[a].split(l)[0]]),[s[a].split(l)[1]].concat(s.slice(a+1))]:[s];return(c=c.map(function(t,i){var r=(1===i?!o:o)?"height":"width",s=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,s=!0,t):s?(t[t.length-1]+=e,s=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-\|\+)?\d\.?\d)(.)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return rt(a)[e]/100o}if("vh"===s\|\|"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight\|\|0):Math.max(document.documentElement.clientWidth,window.innerWidth\|\|0))/100o;return o}(t,r,e,n)})})).forEach(function(t,e){t.forEach(function(n,i){yt(n)&&(r[e]+=n("-"===t[i-1]?-1:1))})}),r}var St={placement:"bottom",eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",h={start:nt({},l,o[l]),end:nt({},l,o[l]+o[c]-s[c])};t.offsets.popper=it({},s,h[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=yt(+n)?[+n,0]:Dt(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,e){var n=e.boundariesElement\|\|Q(t.instance.popper);t.instance.reference===n&&(n=Q(n));var i=at(t.instance.popper,t.instance.reference,e.padding,n);e.boundaries=i;var r=e.priority,o=t.offsets.popper,s={primary:function(t){var n=o[t];return o[t]<i[t]&&!e.escapeWithReference&&(n=Math.max(o[t],i[t])),nt({},t,n)},secondary:function(t){var n="right"===t?"left":"top",r=o[n];return o[t]>i[t]&&!e.escapeWithReference&&(r=Math.min(o[n],i[t]-("right"===t?o.width:o.height))),nt({},n,r)}};return r.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";o=it({},o,s[e](t))}),t.offsets.popper=o,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<o(i[l])&&(t.offsets.popper[l]=o(i[l])-n[c]),n[l]>o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!Tt(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",h=l?"Top":"Left",f=h.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=ht(i)[c];a[d]-p<s[f]&&(t.offsets.popper[f]-=s[f]-(a[d]-p)),a[f]+p>s[d]&&(t.offsets.popper[f]+=a[f]+p-s[d]),t.offsets.popper=rt(t.offsets.popper);var g=a[f]+a[c]/2-p/2,m=F(t.instance.popper),_=parseFloat(m["margin"+h],10),v=parseFloat(m["border"+h+"Width"],10),E=g-t.offsets.popper[f]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(nt(n={},f,Math.round(E)),nt(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(t,e){if(gt(t.instance.modifiers,"inner"))return t;if(t.flipped&&t.placement===t.originalPlacement)return t;var n=at(t.instance.popper,t.instance.reference,e.padding,e.boundariesElement),i=t.placement.split("-")[0],r=ft(i),o=t.placement.split("-")[1]\|\|"",s=[];switch(e.behavior){case At.FLIP:s=[i,r];break;case At.CLOCKWISE:s=It(i);break;case At.COUNTERCLOCKWISE:s=It(i,!0);break;default:s=e.behavior}return s.forEach(function(a,l){if(i!==a\|\|s.length===l+1)return t;i=t.placement.split("-")[0],r=ft(i);var c,h=t.offsets.popper,f=t.offsets.reference,u=Math.floor,d="left"===i&&u(h.right)>u(f.left)\|\|"right"===i&&u(h.left)<u(f.right)\|\|"top"===i&&u(h.bottom)>u(f.top)\|\|"bottom"===i&&u(h.top)<u(f.bottom),p=u(h.left)<u(n.left),g=u(h.right)>u(n.right),m=u(h.top)<u(n.top),_=u(h.bottom)>u(n.bottom),v="left"===i&&p\|\|"right"===i&&g\|\|"top"===i&&m\|\|"bottom"===i&&_,E=-1!==["top","bottom"].indexOf(i),y=!!e.flipVariations&&(E&&"start"===o&&p\|\|E&&"end"===o&&g\|\|!E&&"start"===o&&m\|\|!E&&"end"===o&&_);(d\|\|v\|\|y)&&(t.flipped=!0,(d\|\|v)&&(i=s[l+1]),y&&(o="end"===(c=o)?"start":"start"===c?"end":c),t.placement=i+(o?"-"+o:""),t.offsets.popper=it({},t.offsets.popper,ut(t.instance.popper,t.offsets.reference,t.placement)),t=pt(t.instance.modifiers,t,"flip"))}),t},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=ft(e),t.offsets.popper=rt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!Tt(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=dt(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top\|\|e.left>n.right\|\|e.top>n.bottom\|\|e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,r=t.offsets.popper,o=dt(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s=void 0!==o?o:e.gpuAcceleration,a=ot(Q(t.instance.popper)),l={position:r.position},c={left:Math.floor(r.left),top:Math.floor(r.top),bottom:Math.floor(r.bottom),right:Math.floor(r.right)},h="bottom"===n?"top":"bottom",f="right"===i?"left":"right",u=mt("transform"),d=void 0,p=void 0;if(p="bottom"===h?-a.height+c.bottom:c.top,d="right"===f?-a.width+c.right:c.left,s&&u)l[u]="translate3d("+d+"px, "+p+"px, 0)",l[h]=0,l[f]=0,l.willChange="transform";else{var g="bottom"===h?-1:1,m="right"===f?-1:1;l[h]=pg,l[f]=dm,l.willChange=h+", "+f}var _={"x-placement":t.placement};return t.attributes=it({},_,t.attributes),t.styles=it({},l,t.styles),t.arrowStyles=it({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return bt(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&bt(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,r){var o=ct(0,e,t),s=lt(n.placement,o,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),bt(e,{position:"absolute"}),n},gpuAcceleration:void 0}}},Ot=function(){function t(e,n){var i=this,r=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{};tt(this,t),this.scheduleUpdate=function(){return requestAnimationFrame(i.update)},this.update=U(this.update.bind(this)),this.options=it({},t.Defaults,r),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=e&&e.jquery?e[0]:e,this.popper=n&&n.jquery?n[0]:n,this.options.modifiers={},Object.keys(it({},t.Defaults.modifiers,r.modifiers)).forEach(function(e){i.options.modifiers[e]=it({},t.Defaults.modifiers[e]\|\|{},r.modifiers?r.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return it({name:t},i.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&B(t.onLoad)&&t.onLoad(i.reference,i.popper,i.options,t,i.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return et(t,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=ct(this.state,this.popper,this.reference),t.placement=lt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.offsets.popper=ut(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position="absolute",t=pt(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,gt(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.left="",this.popper.style.position="",this.popper.style.top="",this.popper.style[mt("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled\|\|(this.state=vt(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return Et.call(this)}}]),t}();Ot.Utils=("undefined"!=typeof window?window:global).PopperUtils,Ot.placements=Ct,Ot.Defaults=St;var Nt=function(t){var e="dropdown",n="bs.dropdown",o="."+n,s=t.fn[e],a=new RegExp("38\|40\|27"),l={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,CLICK:"click"+o,CLICK_DATA_API:"click"+o+".data-api",KEYDOWN_DATA_API:"keydown"+o+".data-api",KEYUP_DATA_API:"keyup"+o+".data-api"},c="disabled",h="show",f="dropup",u="dropright",d="dropleft",p="dropdown-menu-right",g="dropdown-menu-left",m="position-static",_='[data-toggle="dropdown"]',v=".dropdown form",E=".dropdown-menu",y=".navbar-nav",b=".dropdown-menu .dropdown-item:not(.disabled)",T="top-start",C="top-end",w="bottom-start",I="bottom-end",A="right-start",D="left-start",S={offset:0,flip:!0,boundary:"scrollParent"},O={offset:"(number\|string\|function)",flip:"boolean",boundary:"(string\|element)"},N=function(){function s(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var v=s.prototype;return v.toggle=function(){if(!this._element.disabled&&!t(this._element).hasClass(c)){var e=s._getParentFromElement(this._element),n=t(this._menu).hasClass(h);if(s._clearMenus(),!n){var i={relatedTarget:this._element},r=t.Event(l.SHOW,i);if(t(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof Ot)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;t(e).hasClass(f)&&(t(this._menu).hasClass(g)\|\|t(this._menu).hasClass(p))&&(o=e),"scrollParent"!==this._config.boundary&&t(e).addClass(m),this._popper=new Ot(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===t(e).closest(y).length&&t("body").children().on("mouseover",null,t.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),t(this._menu).toggleClass(h),t(e).toggleClass(h).trigger(t.Event(l.SHOWN,i))}}}},v.dispose=function(){t.removeData(this._element,n),t(this._element).off(o),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},v.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},v._addEventListeners=function(){var e=this;t(this._element).on(l.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},v._getConfig=function(n){return n=r({},this.constructor.Default,t(this._element).data(),n),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},v._getMenuElement=function(){if(!this._menu){var e=s._getParentFromElement(this._element);this._menu=t(e).find(E)[0]}return this._menu},v._getPlacement=function(){var e=t(this._element).parent(),n=w;return e.hasClass(f)?(n=T,t(this._menu).hasClass(p)&&(n=C)):e.hasClass(u)?n=A:e.hasClass(d)?n=D:t(this._menu).hasClass(p)&&(n=I),n},v._detectNavbar=function(){return t(this._element).closest(".navbar").length>0},v._getPopperConfig=function(){var t=this,e={};return"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)\|\|{}),e}:e.offset=this._config.offset,{placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i\|\|(i=new s(this,"object"==typeof e?e:null),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s._clearMenus=function(e){if(!e\|\|3!==e.which&&("keyup"!==e.type\|\|9===e.which))for(var i=t.makeArray(t(_)),r=0;r<i.length;r++){var o=s._getParentFromElement(i[r]),a=t(i[r]).data(n),c={relatedTarget:i[r]};if(a){var f=a._menu;if(t(o).hasClass(h)&&!(e&&("click"===e.type&&/input\|textarea/i.test(e.target.tagName)\|\|"keyup"===e.type&&9===e.which)&&t.contains(o,e.target))){var u=t.Event(l.HIDE,c);t(o).trigger(u),u.isDefaultPrevented()\|\|("ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),i[r].setAttribute("aria-expanded","false"),t(f).removeClass(h),t(o).removeClass(h).trigger(t.Event(l.HIDDEN,c)))}}}},s._getParentFromElement=function(e){var n,i=k.getSelectorFromElement(e);return i&&(n=t(i)[0]),n\|\|e.parentNode},s._dataApiKeydownHandler=function(e){if((/input\|textarea/i.test(e.target.tagName)?!(32===e.which\|\|27!==e.which&&(40!==e.which&&38!==e.which\|\|t(e.target).closest(E).length)):a.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!t(this).hasClass(c))){var n=s._getParentFromElement(this),i=t(n).hasClass(h);if((i\|\|27===e.which&&32===e.which)&&(!i\|\|27!==e.which&&32!==e.which)){var r=t(n).find(b).get();if(0!==r.length){var o=r.indexOf(e.target);38===e.which&&o>0&&o--,40===e.which&&o<r.length-1&&o++,o<0&&(o=0),r[o].focus()}}else{if(27===e.which){var l=t(n).find(_)[0];t(l).trigger("focus")}t(this).trigger("click")}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return S}},{key:"DefaultType",get:function(){return O}}]),s}();return t(document).on(l.KEYDOWN_DATA_API,_,N._dataApiKeydownHandler).on(l.KEYDOWN_DATA_API,E,N._dataApiKeydownHandler).on(l.CLICK_DATA_API+" "+l.KEYUP_DATA_API,N._clearMenus).on(l.CLICK_DATA_API,_,function(e){e.preventDefault(),e.stopPropagation(),N._jQueryInterface.call(t(this),"toggle")}).on(l.CLICK_DATA_API,v,function(t){t.stopPropagation()}),t.fn[e]=N._jQueryInterface,t.fn[e].Constructor=N,t.fn[e].noConflict=function(){return t.fn[e]=s,N._jQueryInterface},N}(e),kt=function(t){var e="bs.modal",n="."+e,o=t.fn.modal,s={backdrop:!0,keyboard:!0,focus:!0,show:!0},a={backdrop:"(boolean\|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},l={HIDE:"hide"+n,HIDDEN:"hidden"+n,SHOW:"show"+n,SHOWN:"shown"+n,FOCUSIN:"focusin"+n,RESIZE:"resize"+n,CLICK_DISMISS:"click.dismiss"+n,KEYDOWN_DISMISS:"keydown.dismiss"+n,MOUSEUP_DISMISS:"mouseup.dismiss"+n,MOUSEDOWN_DISMISS:"mousedown.dismiss"+n,CLICK_DATA_API:"click.bs.modal.data-api"},c="modal-scrollbar-measure",h="modal-backdrop",f="modal-open",u="fade",d="show",p={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},g=function(){function o(e,n){this._config=this._getConfig(n),this._element=e,this._dialog=t(e).find(p.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._originalBodyPadding=0,this._scrollbarWidth=0}var g=o.prototype;return g.toggle=function(t){return this._isShown?this.hide():this.show(t)},g.show=function(e){var n=this;if(!this._isTransitioning&&!this._isShown){k.supportsTransitionEnd()&&t(this._element).hasClass(u)&&(this._isTransitioning=!0);var i=t.Event(l.SHOW,{relatedTarget:e});t(this._element).trigger(i),this._isShown\|\|i.isDefaultPrevented()\|\|(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),t(document.body).addClass(f),this._setEscapeEvent(),this._setResizeEvent(),t(this._element).on(l.CLICK_DISMISS,p.DATA_DISMISS,function(t){return n.hide(t)}),t(this._dialog).on(l.MOUSEDOWN_DISMISS,function(){t(n._element).one(l.MOUSEUP_DISMISS,function(e){t(e.target).is(n._element)&&(n._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return n._showElement(e)}))}},g.hide=function(e){var n=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var i=t.Event(l.HIDE);if(t(this._element).trigger(i),this._isShown&&!i.isDefaultPrevented()){this._isShown=!1;var r=k.supportsTransitionEnd()&&t(this._element).hasClass(u);r&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),t(document).off(l.FOCUSIN),t(this._element).removeClass(d),t(this._element).off(l.CLICK_DISMISS),t(this._dialog).off(l.MOUSEDOWN_DISMISS),r?t(this._element).one(k.TRANSITION_END,function(t){return n._hideModal(t)}).emulateTransitionEnd(300):this._hideModal()}}},g.dispose=function(){t.removeData(this._element,e),t(window,document,this._element,this._backdrop).off(n),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},g.handleUpdate=function(){this._adjustDialog()},g._getConfig=function(t){return t=r({},s,t),k.typeCheckConfig("modal",t,a),t},g._showElement=function(e){var n=this,i=k.supportsTransitionEnd()&&t(this._element).hasClass(u);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE\|\|document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,i&&k.reflow(this._element),t(this._element).addClass(d),this._config.focus&&this._enforceFocus();var r=t.Event(l.SHOWN,{relatedTarget:e}),o=function(){n._config.focus&&n._element.focus(),n._isTransitioning=!1,t(n._element).trigger(r)};i?t(this._dialog).one(k.TRANSITION_END,o).emulateTransitionEnd(300):o()},g._enforceFocus=function(){var e=this;t(document).off(l.FOCUSIN).on(l.FOCUSIN,function(n){document!==n.target&&e._element!==n.target&&0===t(e._element).has(n.target).length&&e._element.focus()})},g._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?t(this._element).on(l.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown\|\|t(this._element).off(l.KEYDOWN_DISMISS)},g._setResizeEvent=function(){var e=this;this._isShown?t(window).on(l.RESIZE,function(t){return e.handleUpdate(t)}):t(window).off(l.RESIZE)},g._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){t(document.body).removeClass(f),e._resetAdjustments(),e._resetScrollbar(),t(e._element).trigger(l.HIDDEN)})},g._removeBackdrop=function(){this._backdrop&&(t(this._backdrop).remove(),this._backdrop=null)},g._showBackdrop=function(e){var n=this,i=t(this._element).hasClass(u)?u:"";if(this._isShown&&this._config.backdrop){var r=k.supportsTransitionEnd()&&i;if(this._backdrop=document.createElement("div"),this._backdrop.className=h,i&&t(this._backdrop).addClass(i),t(this._backdrop).appendTo(document.body),t(this._element).on(l.CLICK_DISMISS,function(t){n._ignoreBackdropClick?n._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===n._config.backdrop?n._element.focus():n.hide())}),r&&k.reflow(this._backdrop),t(this._backdrop).addClass(d),!e)return;if(!r)return void e();t(this._backdrop).one(k.TRANSITION_END,e).emulateTransitionEnd(150)}else if(!this._isShown&&this._backdrop){t(this._backdrop).removeClass(d);var o=function(){n._removeBackdrop(),e&&e()};k.supportsTransitionEnd()&&t(this._element).hasClass(u)?t(this._backdrop).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o()}else e&&e()},g._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},g._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},g._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},g._setScrollbar=function(){var e=this;if(this._isBodyOverflowing){t(p.FIXED_CONTENT).each(function(n,i){var r=t(i)[0].style.paddingRight,o=t(i).css("padding-right");t(i).data("padding-right",r).css("padding-right",parseFloat(o)+e._scrollbarWidth+"px")}),t(p.STICKY_CONTENT).each(function(n,i){var r=t(i)[0].style.marginRight,o=t(i).css("margin-right");t(i).data("margin-right",r).css("margin-right",parseFloat(o)-e._scrollbarWidth+"px")}),t(p.NAVBAR_TOGGLER).each(function(n,i){var r=t(i)[0].style.marginRight,o=t(i).css("margin-right");t(i).data("margin-right",r).css("margin-right",parseFloat(o)+e._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=t("body").css("padding-right");t("body").data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},g._resetScrollbar=function(){t(p.FIXED_CONTENT).each(function(e,n){var i=t(n).data("padding-right");"undefined"!=typeof i&&t(n).css("padding-right",i).removeData("padding-right")}),t(p.STICKY_CONTENT+", "+p.NAVBAR_TOGGLER).each(function(e,n){var i=t(n).data("margin-right");"undefined"!=typeof i&&t(n).css("margin-right",i).removeData("margin-right")});var e=t("body").data("padding-right");"undefined"!=typeof e&&t("body").css("padding-right",e).removeData("padding-right")},g._getScrollbarWidth=function(){var t=document.createElement("div");t.className=c,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(n,i){return this.each(function(){var s=t(this).data(e),a=r({},o.Default,t(this).data(),"object"==typeof n&&n);if(s\|\|(s=new o(this,a),t(this).data(e,s)),"string"==typeof n){if("undefined"==typeof s[n])throw new TypeError('No method named "'+n+'"');s[n](i)}else a.show&&s.show(i)})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return s}}]),o}();return t(document).on(l.CLICK_DATA_API,p.DATA_TOGGLE,function(n){var i,o=this,s=k.getSelectorFromElement(this);s&&(i=t(s)[0]);var a=t(i).data(e)?"toggle":r({},t(i).data(),t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName\|\|n.preventDefault();var c=t(i).one(l.SHOW,function(e){e.isDefaultPrevented()\|\|c.one(l.HIDDEN,function(){t(o).is(":visible")&&o.focus()})});g._jQueryInterface.call(t(i),a,this)}),t.fn.modal=g._jQueryInterface,t.fn.modal.Constructor=g,t.fn.modal.noConflict=function(){return t.fn.modal=o,g._jQueryInterface},g}(e),Lt=function(t){var e="tooltip",n="bs.tooltip",o="."+n,s=t.fn[e],a=new RegExp("(^\|\\s)bs-tooltip\\S+","g"),l={animation:"boolean",template:"string",title:"(string\|element\|function)",trigger:"string",delay:"(number\|object)",html:"boolean",selector:"(string\|boolean)",placement:"(string\|function)",offset:"(number\|string)",container:"(string\|element\|boolean)",fallbackPlacement:"(string\|array)",boundary:"(string\|element)"},c={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},h={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},f="show",u="out",d={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},p="fade",g="show",m=".tooltip-inner",_=".arrow",v="hover",E="focus",y="click",b="manual",T=function(){function s(t,e){if("undefined"==typeof Ot)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var T=s.prototype;return T.enable=function(){this._isEnabled=!0},T.disable=function(){this._isEnabled=!1},T.toggleEnabled=function(){this._isEnabled=!this._isEnabled},T.toggle=function(e){if(this._isEnabled)if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i\|\|(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(g))return void this._leave(null,this);this._enter(null,this)}},T.dispose=function(){clearTimeout(this._timeout),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),t(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},T.show=function(){var e=this;if("none"===t(this.element).css("display"))throw new Error("Please use show on visible elements");var n=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(n);var i=t.contains(this.element.ownerDocument.documentElement,this.element);if(n.isDefaultPrevented()\|\|!i)return;var r=this.getTipElement(),o=k.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&t(r).addClass(p);var a="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,l=this._getAttachment(a);this.addAttachmentClass(l);var c=!1===this.config.container?document.body:t(this.config.container);t(r).data(this.constructor.DATA_KEY,this),t.contains(this.element.ownerDocument.documentElement,this.tip)\|\|t(r).appendTo(c),t(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new Ot(this.element,r,{placement:l,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:_},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),t(r).addClass(g),"ontouchstart"in document.documentElement&&t("body").children().on("mouseover",null,t.noop);var h=function(){e.config.animation&&e._fixTransition();var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===u&&e._leave(null,e)};k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(this.tip).one(k.TRANSITION_END,h).emulateTransitionEnd(s._TRANSITION_DURATION):h()}},T.hide=function(e){var n=this,i=this.getTipElement(),r=t.Event(this.constructor.Event.HIDE),o=function(){n._hoverState!==f&&i.parentNode&&i.parentNode.removeChild(i),n._cleanTipClass(),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),null!==n._popper&&n._popper.destroy(),e&&e()};t(this.element).trigger(r),r.isDefaultPrevented()\|\|(t(i).removeClass(g),"ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),this._activeTrigger[y]=!1,this._activeTrigger[E]=!1,this._activeTrigger[v]=!1,k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(i).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o(),this._hoverState="")},T.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},T.isWithContent=function(){return Boolean(this.getTitle())},T.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-tooltip-"+e)},T.getTipElement=function(){return this.tip=this.tip\|\|t(this.config.template)[0],this.tip},T.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m),this.getTitle()),e.removeClass(p+" "+g)},T.setElementContent=function(e,n){var i=this.config.html;"object"==typeof n&&(n.nodeType\|\|n.jquery)?i?t(n).parent().is(e)\|\|e.empty().append(n):e.text(t(n).text()):e[i?"html":"text"](n)},T.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t\|\|(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},T._getAttachment=function(t){return c[t.toUpperCase()]},T._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(n!==b){var i=n===v?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,r=n===v?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,function(t){return e._enter(t)}).on(r,e.config.selector,function(t){return e._leave(t)})}t(e.element).closest(".modal").on("hide.bs.modal",function(){return e.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},T._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")\|\|"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")\|\|""),this.element.setAttribute("title",""))},T._enter=function(e,n){var i=this.constructor.DATA_KEY;(n=n\|\|t(e.currentTarget).data(i))\|\|(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?E:v]=!0),t(n.getTipElement()).hasClass(g)\|\|n._hoverState===f?n._hoverState=f:(clearTimeout(n._timeout),n._hoverState=f,n.config.delay&&n.config.delay.show?n._timeout=setTimeout(function(){n._hoverState===f&&n.show()},n.config.delay.show):n.show())},T._leave=function(e,n){var i=this.constructor.DATA_KEY;(n=n\|\|t(e.currentTarget).data(i))\|\|(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?E:v]=!1),n._isWithActiveTrigger()\|\|(clearTimeout(n._timeout),n._hoverState=u,n.config.delay&&n.config.delay.hide?n._timeout=setTimeout(function(){n._hoverState===u&&n.hide()},n.config.delay.hide):n.hide())},T._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},T._getConfig=function(n){return"number"==typeof(n=r({},this.constructor.Default,t(this.element).data(),n)).delay&&(n.delay={show:n.delay,hide:n.delay}),"number"==typeof n.title&&(n.title=n.title.toString()),"number"==typeof n.content&&(n.content=n.content.toString()),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},T._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},T._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},T._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},T._fixTransition=function(){var e=this.getTipElement(),n=this.config.animation;null===e.getAttribute("x-placement")&&(t(e).removeClass(p),this.config.animation=!1,this.hide(),this.show(),this.config.animation=n)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e&&e;if((i\|\|!/dispose\|hide/.test(e))&&(i\|\|(i=new s(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return h}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return d}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return l}}]),s}();return t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),Pt=function(t){var e="popover",n="bs.popover",o="."+n,s=t.fn[e],a=new RegExp("(^\|\\s)bs-popover\\S+","g"),l=r({},Lt.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),c=r({},Lt.DefaultType,{content:"(string\|element\|function)"}),h="fade",f="show",u=".popover-header",d=".popover-body",p={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},g=function(r){var s,g;function m(){return r.apply(this,arguments)\|\|this}g=r,(s=m).prototype=Object.create(g.prototype),s.prototype.constructor=s,s.__proto__=g;var _=m.prototype;return _.isWithContent=function(){return this.getTitle()\|\|this._getContent()},_.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-popover-"+e)},_.getTipElement=function(){return this.tip=this.tip\|\|t(this.config.template)[0],this.tip},_.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(u),this.getTitle());var n=this._getContent();"function"==typeof n&&(n=n.call(this.element)),this.setElementContent(e.find(d),n),e.removeClass(h+" "+f)},_._getContent=function(){return this.element.getAttribute("data-content")\|\|this.config.content},_._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},m._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e?e:null;if((i\|\|!/destroy\|hide/.test(e))&&(i\|\|(i=new m(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(m,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return l}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return p}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return c}}]),m}(Lt);return t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),xt=function(t){var e="scrollspy",n="bs.scrollspy",o="."+n,s=t.fn[e],a={offset:10,method:"auto",target:""},l={offset:"number",method:"string",target:"(string\|element)"},c={ACTIVATE:"activate"+o,SCROLL:"scroll"+o,LOAD_DATA_API:"load"+o+".data-api"},h="dropdown-item",f="active",u={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},d="offset",p="position",g=function(){function s(e,n){var i=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(n),this._selector=this._config.target+" "+u.NAV_LINKS+","+this._config.target+" "+u.LIST_ITEMS+","+this._config.target+" "+u.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,t(this._scrollElement).on(c.SCROLL,function(t){return i._process(t)}),this.refresh(),this._process()}var g=s.prototype;return g.refresh=function(){var e=this,n=this._scrollElement===this._scrollElement.window?d:p,i="auto"===this._config.method?n:this._config.method,r=i===p?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),t.makeArray(t(this._selector)).map(function(e){var n,o=k.getSelectorFromElement(e);if(o&&(n=t(o)[0]),n){var s=n.getBoundingClientRect();if(s.width\|\|s.height)return[t(n)[i]().top+r,o]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},g.dispose=function(){t.removeData(this._element,n),t(this._scrollElement).off(o),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},g._getConfig=function(n){if("string"!=typeof(n=r({},a,n)).target){var i=t(n.target).attr("id");i\|\|(i=k.getUID(e),t(n.target).attr("id",i)),n.target="#"+i}return k.typeCheckConfig(e,n,l),n},g._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},g._getScrollHeight=function(){return this._scrollElement.scrollHeight\|\|Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},g._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},g._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&this._offsets[0]>0)return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]\|\|t<this._offsets[r+1])&&this._activate(this._targets[r])}}},g._activate=function(e){this._activeTarget=e,this._clear();var n=this._selector.split(",");n=n.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var i=t(n.join(","));i.hasClass(h)?(i.closest(u.DROPDOWN).find(u.DROPDOWN_TOGGLE).addClass(f),i.addClass(f)):(i.addClass(f),i.parents(u.NAV_LIST_GROUP).prev(u.NAV_LINKS+", "+u.LIST_ITEMS).addClass(f),i.parents(u.NAV_LIST_GROUP).prev(u.NAV_ITEMS).children(u.NAV_LINKS).addClass(f)),t(this._scrollElement).trigger(c.ACTIVATE,{relatedTarget:e})},g._clear=function(){t(this._selector).filter(u.ACTIVE).removeClass(f)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i\|\|(i=new s(this,"object"==typeof e&&e),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(window).on(c.LOAD_DATA_API,function(){for(var e=t.makeArray(t(u.DATA_SPY)),n=e.length;n--;){var i=t(e[n]);g._jQueryInterface.call(i,i.data())}}),t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),Rt=function(t){var e=".bs.tab",n=t.fn.tab,r={HIDE:"hide"+e,HIDDEN:"hidden"+e,SHOW:"show"+e,SHOWN:"shown"+e,CLICK_DATA_API:"click.bs.tab.data-api"},o="dropdown-menu",s="active",a="disabled",l="fade",c="show",h=".dropdown",f=".nav, .list-group",u=".active",d="> li > .active",p='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',g=".dropdown-toggle",m="> .dropdown-menu .active",_=function(){function e(t){this._element=t}var n=e.prototype;return n.show=function(){var e=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&t(this._element).hasClass(s)\|\|t(this._element).hasClass(a))){var n,i,o=t(this._element).closest(f)[0],l=k.getSelectorFromElement(this._element);if(o){var c="UL"===o.nodeName?d:u;i=(i=t.makeArray(t(o).find(c)))[i.length-1]}var h=t.Event(r.HIDE,{relatedTarget:this._element}),p=t.Event(r.SHOW,{relatedTarget:i});if(i&&t(i).trigger(h),t(this._element).trigger(p),!p.isDefaultPrevented()&&!h.isDefaultPrevented()){l&&(n=t(l)[0]),this._activate(this._element,o);var g=function(){var n=t.Event(r.HIDDEN,{relatedTarget:e._element}),o=t.Event(r.SHOWN,{relatedTarget:i});t(i).trigger(n),t(e._element).trigger(o)};n?this._activate(n,n.parentNode,g):g()}}},n.dispose=function(){t.removeData(this._element,"bs.tab"),this._element=null},n._activate=function(e,n,i){var r=this,o=("UL"===n.nodeName?t(n).find(d):t(n).children(u))[0],s=i&&k.supportsTransitionEnd()&&o&&t(o).hasClass(l),a=function(){return r._transitionComplete(e,o,i)};o&&s?t(o).one(k.TRANSITION_END,a).emulateTransitionEnd(150):a()},n._transitionComplete=function(e,n,i){if(n){t(n).removeClass(c+" "+s);var r=t(n.parentNode).find(m)[0];r&&t(r).removeClass(s),"tab"===n.getAttribute("role")&&n.setAttribute("aria-selected",!1)}if(t(e).addClass(s),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),k.reflow(e),t(e).addClass(c),e.parentNode&&t(e.parentNode).hasClass(o)){var a=t(e).closest(h)[0];a&&t(a).find(g).addClass(s),e.setAttribute("aria-expanded",!0)}i&&i()},e._jQueryInterface=function(n){return this.each(function(){var i=t(this),r=i.data("bs.tab");if(r\|\|(r=new e(this),i.data("bs.tab",r)),"string"==typeof n){if("undefined"==typeof r[n])throw new TypeError('No method named "'+n+'"');r[n]()}})},i(e,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),e}();return t(document).on(r.CLICK_DATA_API,p,function(e){e.preventDefault(),_._jQueryInterface.call(t(this),"show")}),t.fn.tab=_._jQueryInterface,t.fn.tab.Constructor=_,t.fn.tab.noConflict=function(){return t.fn.tab=n,_._jQueryInterface},_}(e);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9\|\|1===e[0]&&9===e[1]&&e[2]<1\|\|e[0]>=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=k,t.Alert=L,t.Button=P,t.Carousel=x,t.Collapse=R,t.Dropdown=Nt,t.Modal=kt,t.Popover=Pt,t.Scrollspy=xt,t.Tab=Rt,t.Tooltip=Lt,Object.defineProperty(t,"__esModule",{value:!0})});
7	//# sourceMappingURL=bootstrap.bundle.min.js.map


1	/*!
2	+ * Bootstrap v4.1.0 (https://getbootstrap.com/)
3	* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
4	* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
5	*/
6	+ !function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable\|\|!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function c(r){for(var t=1;t<arguments.length;t++){var o=null!=arguments[t]?arguments[t]:{},e=Object.keys(o);"function"==typeof Object.getOwnPropertySymbols&&(e=e.concat(Object.getOwnPropertySymbols(o).filter(function(t){return Object.getOwnPropertyDescriptor(o,t).enumerable}))),e.forEach(function(t){var e,n,i;e=r,i=o[n=t],n in e?Object.defineProperty(e,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):e[n]=i})}return r}for(var r,n,o,a,l,f,h,u,d,p,g,m,_,v,E,y,b,T,C,w,I,D,A,S,O,N,k,L,P,x,j,R,M,H,W,F,U,B,K,V,Q,Y,G,q,z,X,J,Z,$,tt,et,nt,it,rt,ot,st,at,lt,ct,ft,ht,ut,dt,pt,gt=function(i){var e="transitionend";function t(t){var e=this,n=!1;return i(this).one(l.TRANSITION_END,function(){n=!0}),setTimeout(function(){n\|\|l.triggerTransitionEnd(e)},t),this}var l={TRANSITION_END:"bsTransitionEnd",getUID:function(t){for(;t+=~~(1e6Math.random()),document.getElementById(t););return t},getSelectorFromElement:function(t){var e=t.getAttribute("data-target");e&&"#"!==e\|\|(e=t.getAttribute("href")\|\|"");try{return 0<i(document).find(e).length?e:null}catch(t){return null}},getTransitionDurationFromElement:function(t){if(!t)return 0;var e=i(t).css("transition-duration");return parseFloat(e)?(e=e.split(",")[0],1e3parseFloat(e)):0},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(t){i(t).trigger(e)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]\|\|t).nodeType},typeCheckConfig:function(t,e,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var r=n[i],o=e[i],s=o&&l.isElement(o)?"element":(a=o,{}.toString.call(a).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(r).test(s))throw new Error(t.toUpperCase()+': Option "'+i+'" provided type "'+s+'" but expected type "'+r+'".')}var a}};return i.fn.emulateTransitionEnd=t,i.event.special[l.TRANSITION_END]={bindType:e,delegateType:e,handle:function(t){if(i(t.target).is(this))return t.handleObj.handler.apply(this,arguments)}},l}(e=e&&e.hasOwnProperty("default")?e.default:e),mt=(n="alert",a="."+(o="bs.alert"),l=(r=e).fn[n],f={CLOSE:"close"+a,CLOSED:"closed"+a,CLICK_DATA_API:"click"+a+".data-api"},h="alert",u="fade",d="show",p=function(){function i(t){this._element=t}var t=i.prototype;return t.close=function(t){t=t\|\|this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()\|\|this._removeElement(e)},t.dispose=function(){r.removeData(this._element,o),this._element=null},t._getRootElement=function(t){var e=gt.getSelectorFromElement(t),n=!1;return e&&(n=r(e)[0]),n\|\|(n=r(t).closest("."+h)[0]),n},t._triggerCloseEvent=function(t){var e=r.Event(f.CLOSE);return r(t).trigger(e),e},t._removeElement=function(e){var n=this;if(r(e).removeClass(d),r(e).hasClass(u)){var t=gt.getTransitionDurationFromElement(e);r(e).one(gt.TRANSITION_END,function(t){return n._destroyElement(e,t)}).emulateTransitionEnd(t)}else this._destroyElement(e)},t._destroyElement=function(t){r(t).detach().trigger(f.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var t=r(this),e=t.data(o);e\|\|(e=new i(this),t.data(o,e)),"close"===n&&e[n](this)})},i._handleDismiss=function(e){return function(t){t&&t.preventDefault(),e.close(this)}},s(i,null,[{key:"VERSION",get:function(){return"4.1.0"}}]),i}(),r(document).on(f.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),r.fn[n]=p._jQueryInterface,r.fn[n].Constructor=p,r.fn[n].noConflict=function(){return r.fn[n]=l,p._jQueryInterface},p),_t=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',D="input",A=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:(C="focus")+v+E+" blur"+v+E},N=function(){function n(t){this._element=t}var t=n.prototype;return t.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(D)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(A)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")\|\|n.hasAttribute("disabled")\|\|i.classList.contains("disabled")\|\|n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},t.dispose=function(){g.removeData(this._element,_),this._element=null},n._jQueryInterface=function(e){return this.each(function(){var t=g(this).data(_);t\|\|(t=new n(this),g(this).data(_,t)),"toggle"===e&&t[e]()})},s(n,null,[{key:"VERSION",get:function(){return"4.1.0"}}]),n}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)\|\|(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),vt=(L="carousel",x="."+(P="bs.carousel"),j=".data-api",R=(k=e).fn[L],M={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},H={interval:"(number\|boolean)",keyboard:"boolean",slide:"(boolean\|string)",pause:"(string\|boolean)",wrap:"boolean"},W="next",F="prev",U="left",B="right",K={SLIDE:"slide"+x,SLID:"slid"+x,KEYDOWN:"keydown"+x,MOUSEENTER:"mouseenter"+x,MOUSELEAVE:"mouseleave"+x,TOUCHEND:"touchend"+x,LOAD_DATA_API:"load"+x+j,CLICK_DATA_API:"click"+x+j},V="carousel",Q="active",Y="slide",G="carousel-item-right",q="carousel-item-left",z="carousel-item-next",X="carousel-item-prev",J={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},Z=function(){function o(t,e){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(e),this._element=k(t)[0],this._indicatorsElement=k(this._element).find(J.INDICATORS)[0],this._addEventListeners()}var t=o.prototype;return t.next=function(){this._isSliding\|\|this._slide(W)},t.nextWhenVisible=function(){!document.hidden&&k(this._element).is(":visible")&&"hidden"!==k(this._element).css("visibility")&&this.next()},t.prev=function(){this._isSliding\|\|this._slide(F)},t.pause=function(t){t\|\|(this._isPaused=!0),k(this._element).find(J.NEXT_PREV)[0]&&(gt.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},t.cycle=function(t){t\|\|(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},t.to=function(t){var e=this;this._activeElement=k(this._element).find(J.ACTIVE_ITEM)[0];var n=this._getItemIndex(this._activeElement);if(!(t>this._items.length-1\|\|t<0))if(this._isSliding)k(this._element).one(K.SLID,function(){return e.to(t)});else{if(n===t)return this.pause(),void this.cycle();var i=n<t?W:F;this._slide(i,this._items[t])}},t.dispose=function(){k(this._element).off(x),k.removeData(this._element,P),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},t._getConfig=function(t){return t=c({},M,t),gt.typeCheckConfig(L,t,H),t},t._addEventListeners=function(){var e=this;this._config.keyboard&&k(this._element).on(K.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(k(this._element).on(K.MOUSEENTER,function(t){return e.pause(t)}).on(K.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&k(this._element).on(K.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},t._keydown=function(t){if(!/input\|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},t._getItemIndex=function(t){return this._items=k.makeArray(k(t).parent().find(J.ITEM)),this._items.indexOf(t)},t._getItemByDirection=function(t,e){var n=t===W,i=t===F,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r\|\|n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===F?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},t._triggerSlideEvent=function(t,e){var n=this._getItemIndex(t),i=this._getItemIndex(k(this._element).find(J.ACTIVE_ITEM)[0]),r=k.Event(K.SLIDE,{relatedTarget:t,direction:e,from:i,to:n});return k(this._element).trigger(r),r},t._setActiveIndicatorElement=function(t){if(this._indicatorsElement){k(this._indicatorsElement).find(J.ACTIVE).removeClass(Q);var e=this._indicatorsElement.children[this._getItemIndex(t)];e&&k(e).addClass(Q)}},t._slide=function(t,e){var n,i,r,o=this,s=k(this._element).find(J.ACTIVE_ITEM)[0],a=this._getItemIndex(s),l=e\|\|s&&this._getItemByDirection(t,s),c=this._getItemIndex(l),f=Boolean(this._interval);if(t===W?(n=q,i=z,r=U):(n=G,i=X,r=B),l&&k(l).hasClass(Q))this._isSliding=!1;else if(!this._triggerSlideEvent(l,r).isDefaultPrevented()&&s&&l){this._isSliding=!0,f&&this.pause(),this._setActiveIndicatorElement(l);var h=k.Event(K.SLID,{relatedTarget:l,direction:r,from:a,to:c});if(k(this._element).hasClass(Y)){k(l).addClass(i),gt.reflow(l),k(s).addClass(n),k(l).addClass(n);var u=gt.getTransitionDurationFromElement(s);k(s).one(gt.TRANSITION_END,function(){k(l).removeClass(n+" "+i).addClass(Q),k(s).removeClass(Q+" "+i+" "+n),o._isSliding=!1,setTimeout(function(){return k(o._element).trigger(h)},0)}).emulateTransitionEnd(u)}else k(s).removeClass(Q),k(l).addClass(Q),this._isSliding=!1,k(this._element).trigger(h);f&&this.cycle()}},o._jQueryInterface=function(i){return this.each(function(){var t=k(this).data(P),e=c({},M,k(this).data());"object"==typeof i&&(e=c({},e,i));var n="string"==typeof i?i:e.slide;if(t\|\|(t=new o(this,e),k(this).data(P,t)),"number"==typeof i)t.to(i);else if("string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}else e.interval&&(t.pause(),t.cycle())})},o._dataApiClickHandler=function(t){var e=gt.getSelectorFromElement(this);if(e){var n=k(e)[0];if(n&&k(n).hasClass(V)){var i=c({},k(n).data(),k(this).data()),r=this.getAttribute("data-slide-to");r&&(i.interval=!1),o._jQueryInterface.call(k(n),i),r&&k(n).data(P).to(r),t.preventDefault()}}},s(o,null,[{key:"VERSION",get:function(){return"4.1.0"}},{key:"Default",get:function(){return M}}]),o}(),k(document).on(K.CLICK_DATA_API,J.DATA_SLIDE,Z._dataApiClickHandler),k(window).on(K.LOAD_DATA_API,function(){k(J.DATA_RIDE).each(function(){var t=k(this);Z._jQueryInterface.call(t,t.data())})}),k.fn[L]=Z._jQueryInterface,k.fn[L].Constructor=Z,k.fn[L].noConflict=function(){return k.fn[L]=R,Z._jQueryInterface},Z),Et=(tt="collapse",nt="."+(et="bs.collapse"),it=($=e).fn[tt],rt={toggle:!0,parent:""},ot={toggle:"boolean",parent:"(string\|element)"},st={SHOW:"show"+nt,SHOWN:"shown"+nt,HIDE:"hide"+nt,HIDDEN:"hidden"+nt,CLICK_DATA_API:"click"+nt+".data-api"},at="show",lt="collapse",ct="collapsing",ft="collapsed",ht="width",ut="height",dt={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},pt=function(){function a(t,e){this._isTransitioning=!1,this._element=t,this._config=this._getConfig(e),this._triggerArray=$.makeArray($('[data-toggle="collapse"][href="#'+t.id+'"],[data-toggle="collapse"][data-target="#'+t.id+'"]'));for(var n=$(dt.DATA_TOGGLE),i=0;i<n.length;i++){var r=n[i],o=gt.getSelectorFromElement(r);null!==o&&0<$(o).filter(t).length&&(this._selector=o,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent\|\|this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var t=a.prototype;return t.toggle=function(){$(this._element).hasClass(at)?this.hide():this.show()},t.show=function(){var t,e,n=this;if(!this._isTransitioning&&!$(this._element).hasClass(at)&&(this._parent&&0===(t=$.makeArray($(this._parent).find(dt.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(t=null),!(t&&(e=$(t).not(this._selector).data(et))&&e._isTransitioning))){var i=$.Event(st.SHOW);if($(this._element).trigger(i),!i.isDefaultPrevented()){t&&(a._jQueryInterface.call($(t).not(this._selector),"hide"),e\|\|$(t).data(et,null));var r=this._getDimension();$(this._element).removeClass(lt).addClass(ct),(this._element.style[r]=0)<this._triggerArray.length&&$(this._triggerArray).removeClass(ft).attr("aria-expanded",!0),this.setTransitioning(!0);var o="scroll"+(r[0].toUpperCase()+r.slice(1)),s=gt.getTransitionDurationFromElement(this._element);$(this._element).one(gt.TRANSITION_END,function(){$(n._element).removeClass(ct).addClass(lt).addClass(at),n._element.style[r]="",n.setTransitioning(!1),$(n._element).trigger(st.SHOWN)}).emulateTransitionEnd(s),this._element.style[r]=this._element[o]+"px"}}},t.hide=function(){var t=this;if(!this._isTransitioning&&$(this._element).hasClass(at)){var e=$.Event(st.HIDE);if($(this._element).trigger(e),!e.isDefaultPrevented()){var n=this._getDimension();if(this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",gt.reflow(this._element),$(this._element).addClass(ct).removeClass(lt).removeClass(at),0<this._triggerArray.length)for(var i=0;i<this._triggerArray.length;i++){var r=this._triggerArray[i],o=gt.getSelectorFromElement(r);if(null!==o)$(o).hasClass(at)\|\|$(r).addClass(ft).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var s=gt.getTransitionDurationFromElement(this._element);$(this._element).one(gt.TRANSITION_END,function(){t.setTransitioning(!1),$(t._element).removeClass(ct).addClass(lt).trigger(st.HIDDEN)}).emulateTransitionEnd(s)}}},t.setTransitioning=function(t){this._isTransitioning=t},t.dispose=function(){$.removeData(this._element,et),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},t._getConfig=function(t){return(t=c({},rt,t)).toggle=Boolean(t.toggle),gt.typeCheckConfig(tt,t,ot),t},t._getDimension=function(){return $(this._element).hasClass(ht)?ht:ut},t._getParent=function(){var n=this,t=null;gt.isElement(this._config.parent)?(t=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(t=this._config.parent[0])):t=$(this._config.parent)[0];var e='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return $(t).find(e).each(function(t,e){n._addAriaAndCollapsedClass(a._getTargetFromElement(e),[e])}),t},t._addAriaAndCollapsedClass=function(t,e){if(t){var n=$(t).hasClass(at);0<e.length&&$(e).toggleClass(ft,!n).attr("aria-expanded",n)}},a._getTargetFromElement=function(t){var e=gt.getSelectorFromElement(t);return e?$(e)[0]:null},a._jQueryInterface=function(i){return this.each(function(){var t=$(this),e=t.data(et),n=c({},rt,t.data(),"object"==typeof i&&i);if(!e&&n.toggle&&/show\|hide/.test(i)&&(n.toggle=!1),e\|\|(e=new a(this,n),t.data(et,e)),"string"==typeof i){if("undefined"==typeof e[i])throw new TypeError('No method named "'+i+'"');e[i]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.1.0"}},{key:"Default",get:function(){return rt}}]),a}(),$(document).on(st.CLICK_DATA_API,dt.DATA_TOGGLE,function(t){"A"===t.currentTarget.tagName&&t.preventDefault();var n=$(this),e=gt.getSelectorFromElement(this);$(e).each(function(){var t=$(this),e=t.data(et)?"toggle":n.data();pt._jQueryInterface.call(t,e)})}),$.fn[tt]=pt._jQueryInterface,$.fn[tt].Constructor=pt,$.fn[tt].noConflict=function(){return $.fn[tt]=it,pt._jQueryInterface},pt),yt="undefined"!=typeof window&&"undefined"!=typeof document,bt=["Edge","Trident","Firefox"],Tt=0,Ct=0;Ct<bt.length;Ct+=1)if(yt&&0<=navigator.userAgent.indexOf(bt[Ct])){Tt=1;break}var wt=yt&&window.Promise?function(t){var e=!1;return function(){e\|\|(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e\|\|(e=!0,setTimeout(function(){e=!1,t()},Tt))}};function It(t){return t&&"[object Function]"==={}.toString.call(t)}function Dt(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function At(t){return"HTML"===t.nodeName?t:t.parentNode\|\|t.host}function St(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=Dt(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto\|scroll\|overlay)/.test(n+r+i)?t:St(At(t))}var Ot={},Nt=function(){var t=0<arguments.length&&void 0!==arguments[0]?arguments[0]:"all";if(t=t.toString(),Ot.hasOwnProperty(t))return Ot[t];switch(t){case"11":Ot[t]=-1!==navigator.userAgent.indexOf("Trident");break;case"10":Ot[t]=-1!==navigator.appVersion.indexOf("MSIE 10");break;case"all":Ot[t]=-1!==navigator.userAgent.indexOf("Trident")\|\|-1!==navigator.userAgent.indexOf("MSIE")}return Ot.all=Ot.all\|\|Object.keys(Ot).some(function(t){return Ot[t]}),Ot[t]};function kt(t){if(!t)return document.documentElement;for(var e=Nt(10)?document.body:null,n=t.offsetParent;n===e&&t.nextElementSibling;)n=(t=t.nextElementSibling).offsetParent;var i=n&&n.nodeName;return i&&"BODY"!==i&&"HTML"!==i?-1!==["TD","TABLE"].indexOf(n.nodeName)&&"static"===Dt(n,"position")?kt(n):n:t?t.ownerDocument.documentElement:document.documentElement}function Lt(t){return null!==t.parentNode?Lt(t.parentNode):t}function Pt(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l\|\|i.contains(r))return"BODY"===(a=(s=l).nodeName)\|\|"HTML"!==a&&kt(s.firstElementChild)!==s?kt(l):l;var c=Lt(t);return c.host?Pt(c.host,e):Pt(t,Lt(e).host)}function xt(t){var e="top"===(1<arguments.length&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n\|\|"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement\|\|i)[e]}return t[e]}function jt(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}function Rt(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Nt(10)?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function Mt(){var t=document.body,e=document.documentElement,n=Nt(10)&&getComputedStyle(e);return{height:Rt("Height",t,e,n),width:Rt("Width",t,e,n)}}var Ht=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},Wt=function(){function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable\|\|!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}}(),Ft=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},Ut=Object.assign\|\|function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function Bt(t){return Ut({},t,{right:t.left+t.width,bottom:t.top+t.height})}function Kt(t){var e={};try{if(Nt(10)){e=t.getBoundingClientRect();var n=xt(t,"top"),i=xt(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}else e=t.getBoundingClientRect()}catch(t){}var r={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},o="HTML"===t.nodeName?Mt():{},s=o.width\|\|t.clientWidth\|\|r.right-r.left,a=o.height\|\|t.clientHeight\|\|r.bottom-r.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l\|\|c){var f=Dt(t);l-=jt(f,"x"),c-=jt(f,"y"),r.width-=l,r.height-=c}return Bt(r)}function Vt(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=Nt(10),r="HTML"===e.nodeName,o=Kt(t),s=Kt(e),a=St(t),l=Dt(e),c=parseFloat(l.borderTopWidth,10),f=parseFloat(l.borderLeftWidth,10);n&&"HTML"===e.nodeName&&(s.top=Math.max(s.top,0),s.left=Math.max(s.left,0));var h=Bt({top:o.top-s.top-c,left:o.left-s.left-f,width:o.width,height:o.height});if(h.marginTop=0,h.marginLeft=0,!i&&r){var u=parseFloat(l.marginTop,10),d=parseFloat(l.marginLeft,10);h.top-=c-u,h.bottom-=c-u,h.left-=f-d,h.right-=f-d,h.marginTop=u,h.marginLeft=d}return(i&&!n?e.contains(a):e===a&&"BODY"!==a.nodeName)&&(h=function(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=xt(e,"top"),r=xt(e,"left"),o=n?-1:1;return t.top+=io,t.bottom+=io,t.left+=ro,t.right+=ro,t}(h,e)),h}function Qt(t){if(!t\|\|!t.parentElement\|\|Nt())return document.documentElement;for(var e=t.parentElement;e&&"none"===Dt(e,"transform");)e=e.parentElement;return e\|\|document.documentElement}function Yt(t,e,n,i){var r=4<arguments.length&&void 0!==arguments[4]&&arguments[4],o={top:0,left:0},s=r?Qt(t):Pt(t,e);if("viewport"===i)o=function(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=t.ownerDocument.documentElement,i=Vt(t,n),r=Math.max(n.clientWidth,window.innerWidth\|\|0),o=Math.max(n.clientHeight,window.innerHeight\|\|0),s=e?0:xt(n),a=e?0:xt(n,"left");return Bt({top:s-i.top+i.marginTop,left:a-i.left+i.marginLeft,width:r,height:o})}(s,r);else{var a=void 0;"scrollParent"===i?"BODY"===(a=St(At(e))).nodeName&&(a=t.ownerDocument.documentElement):a="window"===i?t.ownerDocument.documentElement:i;var l=Vt(a,s,r);if("HTML"!==a.nodeName\|\|function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===Dt(e,"position")\|\|t(At(e)))}(s))o=l;else{var c=Mt(),f=c.height,h=c.width;o.top+=l.top-l.marginTop,o.bottom=f+l.top,o.left+=l.left-l.marginLeft,o.right=h+l.left}}return o.left+=n,o.top+=n,o.right-=n,o.bottom-=n,o}function Gt(t,e,i,n,r){var o=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=Yt(i,n,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return Ut({key:t},a[t],{area:(e=a[t],e.widthe.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,n=t.height;return e>=i.clientWidth&&n>=i.clientHeight}),f=0<c.length?c[0].key:l[0].key,h=t.split("-")[1];return f+(h?"-"+h:"")}function qt(t,e,n){var i=3<arguments.length&&void 0!==arguments[3]?arguments[3]:null;return Vt(n,i?Qt(e):Pt(e,n),i)}function zt(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function Xt(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left\|right\|bottom\|top/g,function(t){return e[t]})}function Jt(t,e,n){n=n.split("-")[0];var i=zt(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[Xt(a)],r}function Zt(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function $t(t,n,e){return(void 0===e?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=Zt(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",e))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var e=t.function\|\|t.fn;t.enabled&&It(e)&&(n.offsets.popper=Bt(n.offsets.popper),n.offsets.reference=Bt(n.offsets.reference),n=e(n,t))}),n}function te(t,n){return t.some(function(t){var e=t.name;return t.enabled&&e===n})}function ee(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length;i++){var r=e[i],o=r?""+r+n:t;if("undefined"!=typeof document.body.style[o])return o}return null}function ne(t){var e=t.ownerDocument;return e?e.defaultView:window}function ie(t,e,n,i){n.updateBound=i,ne(t).addEventListener("resize",n.updateBound,{passive:!0});var r=St(t);return function t(e,n,i,r){var o="BODY"===e.nodeName,s=o?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),o\|\|t(St(s.parentNode),n,i,r),r.push(s)}(r,"scroll",n.updateBound,n.scrollParents),n.scrollElement=r,n.eventsEnabled=!0,n}function re(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,ne(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function oe(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function se(n,i){Object.keys(i).forEach(function(t){var e="";-1!==["width","height","top","right","bottom","left"].indexOf(t)&&oe(i[t])&&(e="px"),n.style[t]=i[t]+e})}function ae(t,e,n){var i=Zt(t,function(t){return t.name===e}),r=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!r){var o="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return r}var le=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],ce=le.slice(3);function fe(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=ce.indexOf(t),i=ce.slice(n+1).concat(ce.slice(0,n));return e?i.reverse():i}var he={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function ue(t,r,o,e){var s=[0,0],a=-1!==["right","left"].indexOf(e),n=t.split(/(\+\|\-)/).map(function(t){return t.trim()}),i=n.indexOf(Zt(n,function(t){return-1!==t.search(/,\|\s/)}));n[i]&&-1===n[i].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s,\s\|\s+/,c=-1!==i?[n.slice(0,i).concat([n[i].split(l)[0]]),[n[i].split(l)[1]].concat(n.slice(i+1))]:[n];return(c=c.map(function(t,e){var n=(1===e?!a:a)?"height":"width",i=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,i=!0,t):i?(t[t.length-1]+=e,i=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-\|\+)?\d\.?\d)(.)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return Bt(a)[e]/100o}if("vh"===s\|\|"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight\|\|0):Math.max(document.documentElement.clientWidth,window.innerWidth\|\|0))/100o;return o}(t,n,r,o)})})).forEach(function(n,i){n.forEach(function(t,e){oe(t)&&(s[i]+=t("-"===n[e-1]?-1:1))})}),s}var de={placement:"bottom",positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",f={start:Ft({},l,o[l]),end:Ft({},l,o[l]+o[c]-s[c])};t.offsets.popper=Ut({},s,f[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=oe(+n)?[+n,0]:ue(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,i){var e=i.boundariesElement\|\|kt(t.instance.popper);t.instance.reference===e&&(e=kt(e));var r=Yt(t.instance.popper,t.instance.reference,i.padding,e,t.positionFixed);i.boundaries=r;var n=i.priority,o=t.offsets.popper,s={primary:function(t){var e=o[t];return o[t]<r[t]&&!i.escapeWithReference&&(e=Math.max(o[t],r[t])),Ft({},t,e)},secondary:function(t){var e="right"===t?"left":"top",n=o[e];return o[t]>r[t]&&!i.escapeWithReference&&(n=Math.min(o[e],r[t]-("right"===t?o.width:o.height))),Ft({},e,n)}};return n.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";o=Ut({},o,s[e](t))}),t.offsets.popper=o,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<o(i[l])&&(t.offsets.popper[l]=o(i[l])-n[c]),n[l]>o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!ae(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",f=l?"Top":"Left",h=f.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=zt(i)[c];a[d]-p<s[h]&&(t.offsets.popper[h]-=s[h]-(a[d]-p)),a[h]+p>s[d]&&(t.offsets.popper[h]+=a[h]+p-s[d]),t.offsets.popper=Bt(t.offsets.popper);var g=a[h]+a[c]/2-p/2,m=Dt(t.instance.popper),_=parseFloat(m["margin"+f],10),v=parseFloat(m["border"+f+"Width"],10),E=g-t.offsets.popper[h]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(Ft(n={},h,Math.round(E)),Ft(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(p,g){if(te(p.instance.modifiers,"inner"))return p;if(p.flipped&&p.placement===p.originalPlacement)return p;var m=Yt(p.instance.popper,p.instance.reference,g.padding,g.boundariesElement,p.positionFixed),_=p.placement.split("-")[0],v=Xt(_),E=p.placement.split("-")[1]\|\|"",y=[];switch(g.behavior){case he.FLIP:y=[_,v];break;case he.CLOCKWISE:y=fe(_);break;case he.COUNTERCLOCKWISE:y=fe(_,!0);break;default:y=g.behavior}return y.forEach(function(t,e){if(_!==t\|\|y.length===e+1)return p;_=p.placement.split("-")[0],v=Xt(_);var n,i=p.offsets.popper,r=p.offsets.reference,o=Math.floor,s="left"===_&&o(i.right)>o(r.left)\|\|"right"===_&&o(i.left)<o(r.right)\|\|"top"===_&&o(i.bottom)>o(r.top)\|\|"bottom"===_&&o(i.top)<o(r.bottom),a=o(i.left)<o(m.left),l=o(i.right)>o(m.right),c=o(i.top)<o(m.top),f=o(i.bottom)>o(m.bottom),h="left"===_&&a\|\|"right"===_&&l\|\|"top"===_&&c\|\|"bottom"===_&&f,u=-1!==["top","bottom"].indexOf(_),d=!!g.flipVariations&&(u&&"start"===E&&a\|\|u&&"end"===E&&l\|\|!u&&"start"===E&&c\|\|!u&&"end"===E&&f);(s\|\|h\|\|d)&&(p.flipped=!0,(s\|\|h)&&(_=y[e+1]),d&&(E="end"===(n=E)?"start":"start"===n?"end":n),p.placement=_+(E?"-"+E:""),p.offsets.popper=Ut({},p.offsets.popper,Jt(p.instance.popper,p.offsets.reference,p.placement)),p=$t(p.instance.modifiers,p,"flip"))}),p},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=Xt(e),t.offsets.popper=Bt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!ae(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=Zt(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top\|\|e.left>n.right\|\|e.top>n.bottom\|\|e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,r=t.offsets.popper,o=Zt(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s=void 0!==o?o:e.gpuAcceleration,a=Kt(kt(t.instance.popper)),l={position:r.position},c={left:Math.floor(r.left),top:Math.floor(r.top),bottom:Math.floor(r.bottom),right:Math.floor(r.right)},f="bottom"===n?"top":"bottom",h="right"===i?"left":"right",u=ee("transform"),d=void 0,p=void 0;if(p="bottom"===f?-a.height+c.bottom:c.top,d="right"===h?-a.width+c.right:c.left,s&&u)l[u]="translate3d("+d+"px, "+p+"px, 0)",l[f]=0,l[h]=0,l.willChange="transform";else{var g="bottom"===f?-1:1,m="right"===h?-1:1;l[f]=pg,l[h]=d*m,l.willChange=f+", "+h}var _={"x-placement":t.placement};return t.attributes=Ut({},_,t.attributes),t.styles=Ut({},l,t.styles),t.arrowStyles=Ut({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return se(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&se(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,r){var o=qt(r,e,t,n.positionFixed),s=Gt(n.placement,o,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),se(e,{position:n.positionFixed?"fixed":"absolute"}),n},gpuAcceleration:void 0}}},pe=function(){function o(t,e){var n=this,i=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};Ht(this,o),this.scheduleUpdate=function(){return requestAnimationFrame(n.update)},this.update=wt(this.update.bind(this)),this.options=Ut({},o.Defaults,i),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=t&&t.jquery?t[0]:t,this.popper=e&&e.jquery?e[0]:e,this.options.modifiers={},Object.keys(Ut({},o.Defaults.modifiers,i.modifiers)).forEach(function(t){n.options.modifiers[t]=Ut({},o.Defaults.modifiers[t]\|\|{},i.modifiers?i.modifiers[t]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return Ut({name:t},n.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&It(t.onLoad)&&t.onLoad(n.reference,n.popper,n.options,t,n.state)}),this.update();var r=this.options.eventsEnabled;r&&this.enableEventListeners(),this.state.eventsEnabled=r}return Wt(o,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=qt(this.state,this.popper,this.reference,this.options.positionFixed),t.placement=Gt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.positionFixed=this.options.positionFixed,t.offsets.popper=Jt(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position=this.options.positionFixed?"fixed":"absolute",t=$t(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,te(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.position="",this.popper.style.top="",this.popper.style.left="",this.popper.style.right="",this.popper.style.bottom="",this.popper.style.willChange="",this.popper.style[ee("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled\|\|(this.state=ie(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return re.call(this)}}]),o}();pe.Utils=("undefined"!=typeof window?window:global).PopperUtils,pe.placements=le,pe.Defaults=de;var ge,me,_e,ve,Ee,ye,be,Te,Ce,we,Ie,De,Ae,Se,Oe,Ne,ke,Le,Pe,xe,je,Re,Me,He,We,Fe,Ue,Be,Ke,Ve,Qe,Ye,Ge,qe,ze,Xe,Je,Ze,$e,tn,en,nn,rn,on,sn,an,ln,cn,fn,hn,un,dn,pn,gn,mn,_n,vn,En,yn,bn,Tn,Cn,wn,In,Dn,An,Sn,On,Nn,kn,Ln,Pn,xn,jn,Rn,Mn,Hn,Wn,Fn,Un,Bn,Kn,Vn,Qn,Yn,Gn,qn,zn,Xn,Jn,Zn,$n,ti,ei,ni,ii,ri,oi,si,ai,li,ci,fi,hi,ui,di,pi,gi,mi,_i,vi,Ei,yi,bi=(me="dropdown",ve="."+(_e="bs.dropdown"),Ee=".data-api",ye=(ge=e).fn[me],be=new RegExp("38\|40\|27"),Te={HIDE:"hide"+ve,HIDDEN:"hidden"+ve,SHOW:"show"+ve,SHOWN:"shown"+ve,CLICK:"click"+ve,CLICK_DATA_API:"click"+ve+Ee,KEYDOWN_DATA_API:"keydown"+ve+Ee,KEYUP_DATA_API:"keyup"+ve+Ee},Ce="disabled",we="show",Ie="dropup",De="dropright",Ae="dropleft",Se="dropdown-menu-right",Oe="position-static",Ne='[data-toggle="dropdown"]',ke=".dropdown form",Le=".dropdown-menu",Pe=".navbar-nav",xe=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",je="top-start",Re="top-end",Me="bottom-start",He="bottom-end",We="right-start",Fe="left-start",Ue={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},Be={offset:"(number\|string\|function)",flip:"boolean",boundary:"(string\|element)",reference:"(string\|element)",display:"string"},Ke=function(){function l(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var t=l.prototype;return t.toggle=function(){if(!this._element.disabled&&!ge(this._element).hasClass(Ce)){var t=l._getParentFromElement(this._element),e=ge(this._menu).hasClass(we);if(l._clearMenus(),!e){var n={relatedTarget:this._element},i=ge.Event(Te.SHOW,n);if(ge(t).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof pe)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var r=this._element;"parent"===this._config.reference?r=t:gt.isElement(this._config.reference)&&(r=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(r=this._config.reference[0])),"scrollParent"!==this._config.boundary&&ge(t).addClass(Oe),this._popper=new pe(r,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===ge(t).closest(Pe).length&&ge(document.body).children().on("mouseover",null,ge.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),ge(this._menu).toggleClass(we),ge(t).toggleClass(we).trigger(ge.Event(Te.SHOWN,n))}}}},t.dispose=function(){ge.removeData(this._element,_e),ge(this._element).off(ve),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},t.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},t._addEventListeners=function(){var e=this;ge(this._element).on(Te.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},t._getConfig=function(t){return t=c({},this.constructor.Default,ge(this._element).data(),t),gt.typeCheckConfig(me,t,this.constructor.DefaultType),t},t._getMenuElement=function(){if(!this._menu){var t=l._getParentFromElement(this._element);this._menu=ge(t).find(Le)[0]}return this._menu},t._getPlacement=function(){var t=ge(this._element).parent(),e=Me;return t.hasClass(Ie)?(e=je,ge(this._menu).hasClass(Se)&&(e=Re)):t.hasClass(De)?e=We:t.hasClass(Ae)?e=Fe:ge(this._menu).hasClass(Se)&&(e=He),e},t._detectNavbar=function(){return 0<ge(this._element).closest(".navbar").length},t._getPopperConfig=function(){var e=this,t={};"function"==typeof this._config.offset?t.fn=function(t){return t.offsets=c({},t.offsets,e._config.offset(t.offsets)\|\|{}),t}:t.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:t,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},l._jQueryInterface=function(e){return this.each(function(){var t=ge(this).data(_e);if(t\|\|(t=new l(this,"object"==typeof e?e:null),ge(this).data(_e,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},l._clearMenus=function(t){if(!t\|\|3!==t.which&&("keyup"!==t.type\|\|9===t.which))for(var e=ge.makeArray(ge(Ne)),n=0;n<e.length;n++){var i=l._getParentFromElement(e[n]),r=ge(e[n]).data(_e),o={relatedTarget:e[n]};if(r){var s=r._menu;if(ge(i).hasClass(we)&&!(t&&("click"===t.type&&/input\|textarea/i.test(t.target.tagName)\|\|"keyup"===t.type&&9===t.which)&&ge.contains(i,t.target))){var a=ge.Event(Te.HIDE,o);ge(i).trigger(a),a.isDefaultPrevented()\|\|("ontouchstart"in document.documentElement&&ge(document.body).children().off("mouseover",null,ge.noop),e[n].setAttribute("aria-expanded","false"),ge(s).removeClass(we),ge(i).removeClass(we).trigger(ge.Event(Te.HIDDEN,o)))}}}},l._getParentFromElement=function(t){var e,n=gt.getSelectorFromElement(t);return n&&(e=ge(n)[0]),e\|\|t.parentNode},l._dataApiKeydownHandler=function(t){if((/input\|textarea/i.test(t.target.tagName)?!(32===t.which\|\|27!==t.which&&(40!==t.which&&38!==t.which\|\|ge(t.target).closest(Le).length)):be.test(t.which))&&(t.preventDefault(),t.stopPropagation(),!this.disabled&&!ge(this).hasClass(Ce))){var e=l._getParentFromElement(this),n=ge(e).hasClass(we);if((n\|\|27===t.which&&32===t.which)&&(!n\|\|27!==t.which&&32!==t.which)){var i=ge(e).find(xe).get();if(0!==i.length){var r=i.indexOf(t.target);38===t.which&&0<r&&r--,40===t.which&&r<i.length-1&&r++,r<0&&(r=0),i[r].focus()}}else{if(27===t.which){var o=ge(e).find(Ne)[0];ge(o).trigger("focus")}ge(this).trigger("click")}}},s(l,null,[{key:"VERSION",get:function(){return"4.1.0"}},{key:"Default",get:function(){return Ue}},{key:"DefaultType",get:function(){return Be}}]),l}(),ge(document).on(Te.KEYDOWN_DATA_API,Ne,Ke._dataApiKeydownHandler).on(Te.KEYDOWN_DATA_API,Le,Ke._dataApiKeydownHandler).on(Te.CLICK_DATA_API+" "+Te.KEYUP_DATA_API,Ke._clearMenus).on(Te.CLICK_DATA_API,Ne,function(t){t.preventDefault(),t.stopPropagation(),Ke._jQueryInterface.call(ge(this),"toggle")}).on(Te.CLICK_DATA_API,ke,function(t){t.stopPropagation()}),ge.fn[me]=Ke._jQueryInterface,ge.fn[me].Constructor=Ke,ge.fn[me].noConflict=function(){return ge.fn[me]=ye,Ke._jQueryInterface},Ke),Ti=(Qe="modal",Ge="."+(Ye="bs.modal"),qe=(Ve=e).fn[Qe],ze={backdrop:!0,keyboard:!0,focus:!0,show:!0},Xe={backdrop:"(boolean\|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},Je={HIDE:"hide"+Ge,HIDDEN:"hidden"+Ge,SHOW:"show"+Ge,SHOWN:"shown"+Ge,FOCUSIN:"focusin"+Ge,RESIZE:"resize"+Ge,CLICK_DISMISS:"click.dismiss"+Ge,KEYDOWN_DISMISS:"keydown.dismiss"+Ge,MOUSEUP_DISMISS:"mouseup.dismiss"+Ge,MOUSEDOWN_DISMISS:"mousedown.dismiss"+Ge,CLICK_DATA_API:"click"+Ge+".data-api"},Ze="modal-scrollbar-measure",$e="modal-backdrop",tn="modal-open",en="fade",nn="show",rn={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},on=function(){function r(t,e){this._config=this._getConfig(e),this._element=t,this._dialog=Ve(t).find(rn.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._scrollbarWidth=0}var t=r.prototype;return t.toggle=function(t){return this._isShown?this.hide():this.show(t)},t.show=function(t){var e=this;if(!this._isTransitioning&&!this._isShown){Ve(this._element).hasClass(en)&&(this._isTransitioning=!0);var n=Ve.Event(Je.SHOW,{relatedTarget:t});Ve(this._element).trigger(n),this._isShown\|\|n.isDefaultPrevented()\|\|(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),Ve(document.body).addClass(tn),this._setEscapeEvent(),this._setResizeEvent(),Ve(this._element).on(Je.CLICK_DISMISS,rn.DATA_DISMISS,function(t){return e.hide(t)}),Ve(this._dialog).on(Je.MOUSEDOWN_DISMISS,function(){Ve(e._element).one(Je.MOUSEUP_DISMISS,function(t){Ve(t.target).is(e._element)&&(e._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return e._showElement(t)}))}},t.hide=function(t){var e=this;if(t&&t.preventDefault(),!this._isTransitioning&&this._isShown){var n=Ve.Event(Je.HIDE);if(Ve(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=Ve(this._element).hasClass(en);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),Ve(document).off(Je.FOCUSIN),Ve(this._element).removeClass(nn),Ve(this._element).off(Je.CLICK_DISMISS),Ve(this._dialog).off(Je.MOUSEDOWN_DISMISS),i){var r=gt.getTransitionDurationFromElement(this._element);Ve(this._element).one(gt.TRANSITION_END,function(t){return e._hideModal(t)}).emulateTransitionEnd(r)}else this._hideModal()}}},t.dispose=function(){Ve.removeData(this._element,Ye),Ve(window,document,this._element,this._backdrop).off(Ge),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},t.handleUpdate=function(){this._adjustDialog()},t._getConfig=function(t){return t=c({},ze,t),gt.typeCheckConfig(Qe,t,Xe),t},t._showElement=function(t){var e=this,n=Ve(this._element).hasClass(en);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE\|\|document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,n&&gt.reflow(this._element),Ve(this._element).addClass(nn),this._config.focus&&this._enforceFocus();var i=Ve.Event(Je.SHOWN,{relatedTarget:t}),r=function(){e._config.focus&&e._element.focus(),e._isTransitioning=!1,Ve(e._element).trigger(i)};if(n){var o=gt.getTransitionDurationFromElement(this._element);Ve(this._dialog).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r()},t._enforceFocus=function(){var e=this;Ve(document).off(Je.FOCUSIN).on(Je.FOCUSIN,function(t){document!==t.target&&e._element!==t.target&&0===Ve(e._element).has(t.target).length&&e._element.focus()})},t._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?Ve(this._element).on(Je.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown\|\|Ve(this._element).off(Je.KEYDOWN_DISMISS)},t._setResizeEvent=function(){var e=this;this._isShown?Ve(window).on(Je.RESIZE,function(t){return e.handleUpdate(t)}):Ve(window).off(Je.RESIZE)},t._hideModal=function(){var t=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){Ve(document.body).removeClass(tn),t._resetAdjustments(),t._resetScrollbar(),Ve(t._element).trigger(Je.HIDDEN)})},t._removeBackdrop=function(){this._backdrop&&(Ve(this._backdrop).remove(),this._backdrop=null)},t._showBackdrop=function(t){var e=this,n=Ve(this._element).hasClass(en)?en:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=$e,n&&Ve(this._backdrop).addClass(n),Ve(this._backdrop).appendTo(document.body),Ve(this._element).on(Je.CLICK_DISMISS,function(t){e._ignoreBackdropClick?e._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===e._config.backdrop?e._element.focus():e.hide())}),n&&gt.reflow(this._backdrop),Ve(this._backdrop).addClass(nn),!t)return;if(!n)return void t();var i=gt.getTransitionDurationFromElement(this._backdrop);Ve(this._backdrop).one(gt.TRANSITION_END,t).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){Ve(this._backdrop).removeClass(nn);var r=function(){e._removeBackdrop(),t&&t()};if(Ve(this._element).hasClass(en)){var o=gt.getTransitionDurationFromElement(this._backdrop);Ve(this._backdrop).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r()}else t&&t()},t._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},t._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},t._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},t._setScrollbar=function(){var r=this;if(this._isBodyOverflowing){Ve(rn.FIXED_CONTENT).each(function(t,e){var n=Ve(e)[0].style.paddingRight,i=Ve(e).css("padding-right");Ve(e).data("padding-right",n).css("padding-right",parseFloat(i)+r._scrollbarWidth+"px")}),Ve(rn.STICKY_CONTENT).each(function(t,e){var n=Ve(e)[0].style.marginRight,i=Ve(e).css("margin-right");Ve(e).data("margin-right",n).css("margin-right",parseFloat(i)-r._scrollbarWidth+"px")}),Ve(rn.NAVBAR_TOGGLER).each(function(t,e){var n=Ve(e)[0].style.marginRight,i=Ve(e).css("margin-right");Ve(e).data("margin-right",n).css("margin-right",parseFloat(i)+r._scrollbarWidth+"px")});var t=document.body.style.paddingRight,e=Ve(document.body).css("padding-right");Ve(document.body).data("padding-right",t).css("padding-right",parseFloat(e)+this._scrollbarWidth+"px")}},t._resetScrollbar=function(){Ve(rn.FIXED_CONTENT).each(function(t,e){var n=Ve(e).data("padding-right");"undefined"!=typeof n&&Ve(e).css("padding-right",n).removeData("padding-right")}),Ve(rn.STICKY_CONTENT+", "+rn.NAVBAR_TOGGLER).each(function(t,e){var n=Ve(e).data("margin-right");"undefined"!=typeof n&&Ve(e).css("margin-right",n).removeData("margin-right")});var t=Ve(document.body).data("padding-right");"undefined"!=typeof t&&Ve(document.body).css("padding-right",t).removeData("padding-right")},t._getScrollbarWidth=function(){var t=document.createElement("div");t.className=Ze,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},r._jQueryInterface=function(n,i){return this.each(function(){var t=Ve(this).data(Ye),e=c({},r.Default,Ve(this).data(),"object"==typeof n&&n);if(t\|\|(t=new r(this,e),Ve(this).data(Ye,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},s(r,null,[{key:"VERSION",get:function(){return"4.1.0"}},{key:"Default",get:function(){return ze}}]),r}(),Ve(document).on(Je.CLICK_DATA_API,rn.DATA_TOGGLE,function(t){var e,n=this,i=gt.getSelectorFromElement(this);i&&(e=Ve(i)[0]);var r=Ve(e).data(Ye)?"toggle":c({},Ve(e).data(),Ve(this).data());"A"!==this.tagName&&"AREA"!==this.tagName\|\|t.preventDefault();var o=Ve(e).one(Je.SHOW,function(t){t.isDefaultPrevented()\|\|o.one(Je.HIDDEN,function(){Ve(n).is(":visible")&&n.focus()})});on._jQueryInterface.call(Ve(e),r,this)}),Ve.fn[Qe]=on._jQueryInterface,Ve.fn[Qe].Constructor=on,Ve.fn[Qe].noConflict=function(){return Ve.fn[Qe]=qe,on._jQueryInterface},on),Ci=(an="tooltip",cn="."+(ln="bs.tooltip"),fn=(sn=e).fn[an],hn="bs-tooltip",un=new RegExp("(^\|\\s)"+hn+"\\S+","g"),gn={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!(pn={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"}),selector:!(dn={animation:"boolean",template:"string",title:"(string\|element\|function)",trigger:"string",delay:"(number\|object)",html:"boolean",selector:"(string\|boolean)",placement:"(string\|function)",offset:"(number\|string)",container:"(string\|element\|boolean)",fallbackPlacement:"(string\|array)",boundary:"(string\|element)"}),placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},_n="out",vn={HIDE:"hide"+cn,HIDDEN:"hidden"+cn,SHOW:(mn="show")+cn,SHOWN:"shown"+cn,INSERTED:"inserted"+cn,CLICK:"click"+cn,FOCUSIN:"focusin"+cn,FOCUSOUT:"focusout"+cn,MOUSEENTER:"mouseenter"+cn,MOUSELEAVE:"mouseleave"+cn},En="fade",yn="show",bn=".tooltip-inner",Tn=".arrow",Cn="hover",wn="focus",In="click",Dn="manual",An=function(){function i(t,e){if("undefined"==typeof pe)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var t=i.prototype;return t.enable=function(){this._isEnabled=!0},t.disable=function(){this._isEnabled=!1},t.toggleEnabled=function(){this._isEnabled=!this._isEnabled},t.toggle=function(t){if(this._isEnabled)if(t){var e=this.constructor.DATA_KEY,n=sn(t.currentTarget).data(e);n\|\|(n=new this.constructor(t.currentTarget,this._getDelegateConfig()),sn(t.currentTarget).data(e,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(sn(this.getTipElement()).hasClass(yn))return void this._leave(null,this);this._enter(null,this)}},t.dispose=function(){clearTimeout(this._timeout),sn.removeData(this.element,this.constructor.DATA_KEY),sn(this.element).off(this.constructor.EVENT_KEY),sn(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&sn(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},t.show=function(){var e=this;if("none"===sn(this.element).css("display"))throw new Error("Please use show on visible elements");var t=sn.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){sn(this.element).trigger(t);var n=sn.contains(this.element.ownerDocument.documentElement,this.element);if(t.isDefaultPrevented()\|\|!n)return;var i=this.getTipElement(),r=gt.getUID(this.constructor.NAME);i.setAttribute("id",r),this.element.setAttribute("aria-describedby",r),this.setContent(),this.config.animation&&sn(i).addClass(En);var o="function"==typeof this.config.placement?this.config.placement.call(this,i,this.element):this.config.placement,s=this._getAttachment(o);this.addAttachmentClass(s);var a=!1===this.config.container?document.body:sn(this.config.container);sn(i).data(this.constructor.DATA_KEY,this),sn.contains(this.element.ownerDocument.documentElement,this.tip)\|\|sn(i).appendTo(a),sn(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new pe(this.element,i,{placement:s,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:Tn},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),sn(i).addClass(yn),"ontouchstart"in document.documentElement&&sn(document.body).children().on("mouseover",null,sn.noop);var l=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,sn(e.element).trigger(e.constructor.Event.SHOWN),t===_n&&e._leave(null,e)};if(sn(this.tip).hasClass(En)){var c=gt.getTransitionDurationFromElement(this.tip);sn(this.tip).one(gt.TRANSITION_END,l).emulateTransitionEnd(c)}else l()}},t.hide=function(t){var e=this,n=this.getTipElement(),i=sn.Event(this.constructor.Event.HIDE),r=function(){e._hoverState!==mn&&n.parentNode&&n.parentNode.removeChild(n),e._cleanTipClass(),e.element.removeAttribute("aria-describedby"),sn(e.element).trigger(e.constructor.Event.HIDDEN),null!==e._popper&&e._popper.destroy(),t&&t()};if(sn(this.element).trigger(i),!i.isDefaultPrevented()){if(sn(n).removeClass(yn),"ontouchstart"in document.documentElement&&sn(document.body).children().off("mouseover",null,sn.noop),this._activeTrigger[In]=!1,this._activeTrigger[wn]=!1,this._activeTrigger[Cn]=!1,sn(this.tip).hasClass(En)){var o=gt.getTransitionDurationFromElement(n);sn(n).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r();this._hoverState=""}},t.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},t.isWithContent=function(){return Boolean(this.getTitle())},t.addAttachmentClass=function(t){sn(this.getTipElement()).addClass(hn+"-"+t)},t.getTipElement=function(){return this.tip=this.tip\|\|sn(this.config.template)[0],this.tip},t.setContent=function(){var t=sn(this.getTipElement());this.setElementContent(t.find(bn),this.getTitle()),t.removeClass(En+" "+yn)},t.setElementContent=function(t,e){var n=this.config.html;"object"==typeof e&&(e.nodeType\|\|e.jquery)?n?sn(e).parent().is(t)\|\|t.empty().append(e):t.text(sn(e).text()):t[n?"html":"text"](e)},t.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t\|\|(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},t._getAttachment=function(t){return pn[t.toUpperCase()]},t._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(t){if("click"===t)sn(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(t){return i.toggle(t)});else if(t!==Dn){var e=t===Cn?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=t===Cn?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;sn(i.element).on(e,i.config.selector,function(t){return i._enter(t)}).on(n,i.config.selector,function(t){return i._leave(t)})}sn(i.element).closest(".modal").on("hide.bs.modal",function(){return i.hide()})}),this.config.selector?this.config=c({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},t._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")\|\|"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")\|\|""),this.element.setAttribute("title",""))},t._enter=function(t,e){var n=this.constructor.DATA_KEY;(e=e\|\|sn(t.currentTarget).data(n))\|\|(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),sn(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusin"===t.type?wn:Cn]=!0),sn(e.getTipElement()).hasClass(yn)\|\|e._hoverState===mn?e._hoverState=mn:(clearTimeout(e._timeout),e._hoverState=mn,e.config.delay&&e.config.delay.show?e._timeout=setTimeout(function(){e._hoverState===mn&&e.show()},e.config.delay.show):e.show())},t._leave=function(t,e){var n=this.constructor.DATA_KEY;(e=e\|\|sn(t.currentTarget).data(n))\|\|(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),sn(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusout"===t.type?wn:Cn]=!1),e._isWithActiveTrigger()\|\|(clearTimeout(e._timeout),e._hoverState=_n,e.config.delay&&e.config.delay.hide?e._timeout=setTimeout(function(){e._hoverState===_n&&e.hide()},e.config.delay.hide):e.hide())},t._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},t._getConfig=function(t){return"number"==typeof(t=c({},this.constructor.Default,sn(this.element).data(),t)).delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),gt.typeCheckConfig(an,t,this.constructor.DefaultType),t},t._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},t._cleanTipClass=function(){var t=sn(this.getTipElement()),e=t.attr("class").match(un);null!==e&&0<e.length&&t.removeClass(e.join(""))},t._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},t._fixTransition=function(){var t=this.getTipElement(),e=this.config.animation;null===t.getAttribute("x-placement")&&(sn(t).removeClass(En),this.config.animation=!1,this.hide(),this.show(),this.config.animation=e)},i._jQueryInterface=function(n){return this.each(function(){var t=sn(this).data(ln),e="object"==typeof n&&n;if((t\|\|!/dispose\|hide/.test(n))&&(t\|\|(t=new i(this,e),sn(this).data(ln,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.0"}},{key:"Default",get:function(){return gn}},{key:"NAME",get:function(){return an}},{key:"DATA_KEY",get:function(){return ln}},{key:"Event",get:function(){return vn}},{key:"EVENT_KEY",get:function(){return cn}},{key:"DefaultType",get:function(){return dn}}]),i}(),sn.fn[an]=An._jQueryInterface,sn.fn[an].Constructor=An,sn.fn[an].noConflict=function(){return sn.fn[an]=fn,An._jQueryInterface},An),wi=(On="popover",kn="."+(Nn="bs.popover"),Ln=(Sn=e).fn[On],Pn="bs-popover",xn=new RegExp("(^\|\\s)"+Pn+"\\S+","g"),jn=c({},Ci.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),Rn=c({},Ci.DefaultType,{content:"(string\|element\|function)"}),Mn="fade",Wn=".popover-header",Fn=".popover-body",Un={HIDE:"hide"+kn,HIDDEN:"hidden"+kn,SHOW:(Hn="show")+kn,SHOWN:"shown"+kn,INSERTED:"inserted"+kn,CLICK:"click"+kn,FOCUSIN:"focusin"+kn,FOCUSOUT:"focusout"+kn,MOUSEENTER:"mouseenter"+kn,MOUSELEAVE:"mouseleave"+kn},Bn=function(t){var e,n;function i(){return t.apply(this,arguments)\|\|this}n=t,(e=i).prototype=Object.create(n.prototype),(e.prototype.constructor=e).__proto__=n;var r=i.prototype;return r.isWithContent=function(){return this.getTitle()\|\|this._getContent()},r.addAttachmentClass=function(t){Sn(this.getTipElement()).addClass(Pn+"-"+t)},r.getTipElement=function(){return this.tip=this.tip\|\|Sn(this.config.template)[0],this.tip},r.setContent=function(){var t=Sn(this.getTipElement());this.setElementContent(t.find(Wn),this.getTitle());var e=this._getContent();"function"==typeof e&&(e=e.call(this.element)),this.setElementContent(t.find(Fn),e),t.removeClass(Mn+" "+Hn)},r._getContent=function(){return this.element.getAttribute("data-content")\|\|this.config.content},r._cleanTipClass=function(){var t=Sn(this.getTipElement()),e=t.attr("class").match(xn);null!==e&&0<e.length&&t.removeClass(e.join(""))},i._jQueryInterface=function(n){return this.each(function(){var t=Sn(this).data(Nn),e="object"==typeof n?n:null;if((t\|\|!/destroy\|hide/.test(n))&&(t\|\|(t=new i(this,e),Sn(this).data(Nn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.0"}},{key:"Default",get:function(){return jn}},{key:"NAME",get:function(){return On}},{key:"DATA_KEY",get:function(){return Nn}},{key:"Event",get:function(){return Un}},{key:"EVENT_KEY",get:function(){return kn}},{key:"DefaultType",get:function(){return Rn}}]),i}(Ci),Sn.fn[On]=Bn._jQueryInterface,Sn.fn[On].Constructor=Bn,Sn.fn[On].noConflict=function(){return Sn.fn[On]=Ln,Bn._jQueryInterface},Bn),Ii=(Vn="scrollspy",Yn="."+(Qn="bs.scrollspy"),Gn=(Kn=e).fn[Vn],qn={offset:10,method:"auto",target:""},zn={offset:"number",method:"string",target:"(string\|element)"},Xn={ACTIVATE:"activate"+Yn,SCROLL:"scroll"+Yn,LOAD_DATA_API:"load"+Yn+".data-api"},Jn="dropdown-item",Zn="active",$n={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},ti="offset",ei="position",ni=function(){function n(t,e){var n=this;this._element=t,this._scrollElement="BODY"===t.tagName?window:t,this._config=this._getConfig(e),this._selector=this._config.target+" "+$n.NAV_LINKS+","+this._config.target+" "+$n.LIST_ITEMS+","+this._config.target+" "+$n.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,Kn(this._scrollElement).on(Xn.SCROLL,function(t){return n._process(t)}),this.refresh(),this._process()}var t=n.prototype;return t.refresh=function(){var e=this,t=this._scrollElement===this._scrollElement.window?ti:ei,r="auto"===this._config.method?t:this._config.method,o=r===ei?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),Kn.makeArray(Kn(this._selector)).map(function(t){var e,n=gt.getSelectorFromElement(t);if(n&&(e=Kn(n)[0]),e){var i=e.getBoundingClientRect();if(i.width\|\|i.height)return[Kn(e)[r]().top+o,n]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},t.dispose=function(){Kn.removeData(this._element,Qn),Kn(this._scrollElement).off(Yn),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},t._getConfig=function(t){if("string"!=typeof(t=c({},qn,t)).target){var e=Kn(t.target).attr("id");e\|\|(e=gt.getUID(Vn),Kn(t.target).attr("id",e)),t.target="#"+e}return gt.typeCheckConfig(Vn,t,zn),t},t._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},t._getScrollHeight=function(){return this._scrollElement.scrollHeight\|\|Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},t._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},t._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),n<=t){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]\|\|t<this._offsets[r+1])&&this._activate(this._targets[r])}}},t._activate=function(e){this._activeTarget=e,this._clear();var t=this._selector.split(",");t=t.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var n=Kn(t.join(","));n.hasClass(Jn)?(n.closest($n.DROPDOWN).find($n.DROPDOWN_TOGGLE).addClass(Zn),n.addClass(Zn)):(n.addClass(Zn),n.parents($n.NAV_LIST_GROUP).prev($n.NAV_LINKS+", "+$n.LIST_ITEMS).addClass(Zn),n.parents($n.NAV_LIST_GROUP).prev($n.NAV_ITEMS).children($n.NAV_LINKS).addClass(Zn)),Kn(this._scrollElement).trigger(Xn.ACTIVATE,{relatedTarget:e})},t._clear=function(){Kn(this._selector).filter($n.ACTIVE).removeClass(Zn)},n._jQueryInterface=function(e){return this.each(function(){var t=Kn(this).data(Qn);if(t\|\|(t=new n(this,"object"==typeof e&&e),Kn(this).data(Qn,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.1.0"}},{key:"Default",get:function(){return qn}}]),n}(),Kn(window).on(Xn.LOAD_DATA_API,function(){for(var t=Kn.makeArray(Kn($n.DATA_SPY)),e=t.length;e--;){var n=Kn(t[e]);ni._jQueryInterface.call(n,n.data())}}),Kn.fn[Vn]=ni._jQueryInterface,Kn.fn[Vn].Constructor=ni,Kn.fn[Vn].noConflict=function(){return Kn.fn[Vn]=Gn,ni._jQueryInterface},ni),Di=(oi="."+(ri="bs.tab"),si=(ii=e).fn.tab,ai={HIDE:"hide"+oi,HIDDEN:"hidden"+oi,SHOW:"show"+oi,SHOWN:"shown"+oi,CLICK_DATA_API:"click"+oi+".data-api"},li="dropdown-menu",ci="active",fi="disabled",hi="fade",ui="show",di=".dropdown",pi=".nav, .list-group",gi=".active",mi="> li > .active",_i='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',vi=".dropdown-toggle",Ei="> .dropdown-menu .active",yi=function(){function i(t){this._element=t}var t=i.prototype;return t.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&ii(this._element).hasClass(ci)\|\|ii(this._element).hasClass(fi))){var t,i,e=ii(this._element).closest(pi)[0],r=gt.getSelectorFromElement(this._element);if(e){var o="UL"===e.nodeName?mi:gi;i=(i=ii.makeArray(ii(e).find(o)))[i.length-1]}var s=ii.Event(ai.HIDE,{relatedTarget:this._element}),a=ii.Event(ai.SHOW,{relatedTarget:i});if(i&&ii(i).trigger(s),ii(this._element).trigger(a),!a.isDefaultPrevented()&&!s.isDefaultPrevented()){r&&(t=ii(r)[0]),this._activate(this._element,e);var l=function(){var t=ii.Event(ai.HIDDEN,{relatedTarget:n._element}),e=ii.Event(ai.SHOWN,{relatedTarget:i});ii(i).trigger(t),ii(n._element).trigger(e)};t?this._activate(t,t.parentNode,l):l()}}},t.dispose=function(){ii.removeData(this._element,ri),this._element=null},t._activate=function(t,e,n){var i=this,r=("UL"===e.nodeName?ii(e).find(mi):ii(e).children(gi))[0],o=n&&r&&ii(r).hasClass(hi),s=function(){return i._transitionComplete(t,r,n)};if(r&&o){var a=gt.getTransitionDurationFromElement(r);ii(r).one(gt.TRANSITION_END,s).emulateTransitionEnd(a)}else s()},t._transitionComplete=function(t,e,n){if(e){ii(e).removeClass(ui+" "+ci);var i=ii(e.parentNode).find(Ei)[0];i&&ii(i).removeClass(ci),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!1)}if(ii(t).addClass(ci),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!0),gt.reflow(t),ii(t).addClass(ui),t.parentNode&&ii(t.parentNode).hasClass(li)){var r=ii(t).closest(di)[0];r&&ii(r).find(vi).addClass(ci),t.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var t=ii(this),e=t.data(ri);if(e\|\|(e=new i(this),t.data(ri,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.0"}}]),i}(),ii(document).on(ai.CLICK_DATA_API,_i,function(t){t.preventDefault(),yi._jQueryInterface.call(ii(this),"show")}),ii.fn.tab=yi._jQueryInterface,ii.fn.tab.Constructor=yi,ii.fn.tab.noConflict=function(){return ii.fn.tab=si,yi._jQueryInterface},yi);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9\|\|1===e[0]&&9===e[1]&&e[2]<1\|\|4<=e[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=gt,t.Alert=mt,t.Button=_t,t.Carousel=vt,t.Collapse=Et,t.Dropdown=bi,t.Modal=Ti,t.Popover=wi,t.Scrollspy=Ii,t.Tab=Di,t.Tooltip=Ci,Object.defineProperty(t,"__esModule",{value:!0})});
7	//# sourceMappingURL=bootstrap.bundle.min.js.map

resources/js/bootstrap4.js CHANGED Viewed

@@ -1,3894 +1,3925 @@
             /*!
-            -
              * Bootstrap v4.0.0 (https://getbootstrap.com)
               * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
               * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
               */
             (function (global, factory) {
-            -
            	typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery'), require('popper.js')) :
-            -
            	typeof define === 'function' && define.amd ? define(['exports', 'jquery', 'popper.js'], factory) :
-            -
            	(factory((global.bootstrap = {}),global.jQuery,global.Popper));
             }(this, (function (exports,$,Popper) { 'use strict';
-            -
            $ = $ && $.hasOwnProperty('default') ? $['default'] : $;
-            -
            Popper = Popper && Popper.hasOwnProperty('default') ? Popper['default'] : Popper;
-            -
            function _defineProperties(target, props) {
-            -
              for (var i = 0; i < props.length; i++) {
-            -
                var descriptor = props[i];
-            -
                descriptor.enumerable = descriptor.enumerable || false;
-            -
                descriptor.configurable = true;
-            -
                if ("value" in descriptor) descriptor.writable = true;
-            -
                Object.defineProperty(target, descriptor.key, descriptor);
-            -
              }
-            -
            }
-            -
-            -
            function _createClass(Constructor, protoProps, staticProps) {
-            -
              if (protoProps) _defineProperties(Constructor.prototype, protoProps);
-            -
              if (staticProps) _defineProperties(Constructor, staticProps);
-            -
              return Constructor;
-            -
            }
-            -
-            -
            function _extends() {
-            -
              _extends = Object.assign || function (target) {
-            -
                for (var i = 1; i < arguments.length; i++) {
-            -
                  var source = arguments[i];
-            -
-            -
                  for (var key in source) {
-            -
                    if (Object.prototype.hasOwnProperty.call(source, key)) {
-            -
                      target[key] = source[key];
-            -
                    }
-            -
                  }
+                }
-            -
-            -
                return target;
-            -
              };
-            -
-            -
              return _extends.apply(this, arguments);
-            -
            }
-            -
-            -
            function _inheritsLoose(subClass, superClass) {
-            -
              subClass.prototype = Object.create(superClass.prototype);
-            -
              subClass.prototype.constructor = subClass;
-            -
              subClass.__proto__ = superClass;
-            -
            }
-            -
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): util.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
-            -
            var Util = function ($$$1) {
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Private TransitionEnd Helpers
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              var transition = false;
-            -
              var MAX_UID = 1000000; // Shoutout AngusCroll (https://goo.gl/pxwQGp)
-            -
-            -
              function toType(obj) {
-            -
                return {}.toString.call(obj).match(/\s([a-zA-Z]+)/)[1].toLowerCase();
+              }
-            -
              function getSpecialTransitionEndEvent() {
-            -
                return {
-            -
                  bindType: transition.end,
-            -
                  delegateType: transition.end,
-            -
                  handle: function handle(event) {
-            -
                    if ($$$1(event.target).is(this)) {
-            -
                      return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params
-            -
                    }
-            -
-            -
                    return undefined; // eslint-disable-line no-undefined
-            -
                  }
-            -
                };
+              }
-            -
              function transitionEndTest() {
-            -
                if (typeof window !== 'undefined' && window.QUnit) {
-            -
                  return false;
+                }
-            -
                return {
-            -
                  end: 'transitionend'
-            -
                };
+              }
-            -
              function transitionEndEmulator(duration) {
-            -
                var _this = this;
-            -
                var called = false;
-            -
                $$$1(this).one(Util.TRANSITION_END, function () {
-            -
                  called = true;
-            -
                });
-            -
                setTimeout(function () {
-            -
                  if (!called) {
-            -
                    Util.triggerTransitionEnd(_this);
+                  }
-            -
                }, duration);
-            -
                return this;
-            -
              }
-            -
-            -
              function setTransitionEndSupport() {
-            -
                transition = transitionEndTest();
-            -
                $$$1.fn.emulateTransitionEnd = transitionEndEmulator;
-            -
                if (Util.supportsTransitionEnd()) {
-            -
                  $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
+                }
+              }
-            -
              function escapeId(selector) {
-            -
                // We escape IDs in case of special selectors (selector = '#myId:something')
-            -
                // $.escapeSelector does not exist in jQuery < 3
-            -
                selector = typeof $$$1.escapeSelector === 'function' ? $$$1.escapeSelector(selector).substr(1) : selector.replace(/(:|\.|\[|\]|,|=|@)/g, '\\$1');
-            -
                return selector;
+              }
               /**
                * --------------------------------------------------------------------------
-            -
               * Public Util Api
                * --------------------------------------------------------------------------
                */
-            -
              var Util = {
-            -
                TRANSITION_END: 'bsTransitionEnd',
-            -
                getUID: function getUID(prefix) {
-            -
                  do {
-            -
                    // eslint-disable-next-line no-bitwise
-            -
                    prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here
-            -
                  } while (document.getElementById(prefix));
-            -
                  return prefix;
-            -
                },
-            -
                getSelectorFromElement: function getSelectorFromElement(element) {
-            -
                  var selector = element.getAttribute('data-target');
-            -
                  if (!selector || selector === '#') {
-            -
                    selector = element.getAttribute('href') || '';
-            -
                  } // If it's an ID
-            -
                  if (selector.charAt(0) === '#') {
-            -
                    selector = escapeId(selector);
-            -
                  }
-            -
                  try {
-            -
                    var $selector = $$$1(document).find(selector);
-            -
                    return $selector.length > 0 ? selector : null;
-            -
                  } catch (err) {
-            -
                    return null;
-            -
                  }
-            -
                },
-            -
                reflow: function reflow(element) {
-            -
                  return element.offsetHeight;
-            -
                },
-            -
                triggerTransitionEnd: function triggerTransitionEnd(element) {
-            -
                  $$$1(element).trigger(transition.end);
-            -
                },
-            -
                supportsTransitionEnd: function supportsTransitionEnd() {
-            -
                  return Boolean(transition);
-            -
                },
-            -
                isElement: function isElement(obj) {
-            -
                  return (obj[0] || obj).nodeType;
-            -
                },
-            -
                typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
-            -
                  for (var property in configTypes) {
-            -
                    if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
-            -
                      var expectedTypes = configTypes[property];
-            -
                      var value = config[property];
-            -
                      var valueType = value && Util.isElement(value) ? 'element' : toType(value);
-            -
-            -
                      if (!new RegExp(expectedTypes).test(valueType)) {
-            -
                        throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\"."));
+                      }
+                    }
+                  }
-            -
                }
-            -
              };
-            -
              setTransitionEndSupport();
-            -
              return Util;
-            -
            }($);
-            -
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): alert.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
-            -
            var Alert = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'alert';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.alert';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 150;
-            -
              var Selector = {
-            -
                DISMISS: '[data-dismiss="alert"]'
-            -
              };
-            -
              var Event = {
-            -
                CLOSE: "close" + EVENT_KEY,
-            -
                CLOSED: "closed" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                ALERT: 'alert',
-            -
                FADE: 'fade',
-            -
                SHOW: 'show'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
              var Alert =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Alert(element) {
-            -
                  this._element = element;
-            -
                } // Getters
-            -
                var _proto = Alert.prototype;
-            -
                // Public
-            -
                _proto.close = function close(element) {
-            -
                  element = element || this._element;
-            -
                  var rootElement = this._getRootElement(element);
-            -
                  var customEvent = this._triggerCloseEvent(rootElement);
-            -
                  if (customEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  this._removeElement(rootElement);
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._element = null;
-            -
                }; // Private
-            -
                _proto._getRootElement = function _getRootElement(element) {
-            -
                  var selector = Util.getSelectorFromElement(element);
-            -
                  var parent = false;
-            -
                  if (selector) {
-            -
                    parent = $$$1(selector)[0];
-            -
                  }
-            -
                  if (!parent) {
-            -
                    parent = $$$1(element).closest("." + ClassName.ALERT)[0];
-            -
                  }
-            -
                  return parent;
-            -
                };
-            -
                _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
-            -
                  var closeEvent = $$$1.Event(Event.CLOSE);
-            -
                  $$$1(element).trigger(closeEvent);
-            -
                  return closeEvent;
-            -
                };
-            -
                _proto._removeElement = function _removeElement(element) {
-            -
                  var _this = this;
-            -
                  $$$1(element).removeClass(ClassName.SHOW);
-            -
                  if (!Util.supportsTransitionEnd() || !$$$1(element).hasClass(ClassName.FADE)) {
-            -
                    this._destroyElement(element);
-            -
                    return;
-            -
                  }
-            -
                  $$$1(element).one(Util.TRANSITION_END, function (event) {
-            -
                    return _this._destroyElement(element, event);
-            -
                  }).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                };
-            -
                _proto._destroyElement = function _destroyElement(element) {
-            -
                  $$$1(element).detach().trigger(Event.CLOSED).remove();
-            -
                }; // Static
-            -
                Alert._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var $element = $$$1(this);
-            -
                    var data = $element.data(DATA_KEY);
-            -
                    if (!data) {
-            -
                      data = new Alert(this);
-            -
                      $element.data(DATA_KEY, data);
-            -
                    }
-            -
                    if (config === 'close') {
-            -
                      data[config](this);
-            -
                    }
-            -
                  });
-            -
                };
-            -
                Alert._handleDismiss = function _handleDismiss(alertInstance) {
-            -
                  return function (event) {
-            -
                    if (event) {
-            -
                      event.preventDefault();
-            -
                    }
-            -
                    alertInstance.close(this);
                   };
-            -
                };
-            -
                _createClass(Alert, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }]);
-            -
                return Alert;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert()));
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Alert._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Alert;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Alert._jQueryInterface;
-            -
              };
-            -
              return Alert;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): button.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Button = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'button';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.button';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var ClassName = {
-            -
                ACTIVE: 'active',
-            -
                BUTTON: 'btn',
-            -
                FOCUS: 'focus'
-            -
              };
-            -
              var Selector = {
-            -
                DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
-            -
                DATA_TOGGLE: '[data-toggle="buttons"]',
-            -
                INPUT: 'input',
-            -
                ACTIVE: '.active',
-            -
                BUTTON: '.btn'
-            -
              };
-            -
              var Event = {
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
-            -
                FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY)
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
              var Button =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Button(element) {
-            -
                  this._element = element;
-            -
                } // Getters
-            -
                var _proto = Button.prototype;
-            -
                // Public
-            -
                _proto.toggle = function toggle() {
-            -
                  var triggerChangeEvent = true;
-            -
                  var addAriaPressed = true;
-            -
                  var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
-            -
                  if (rootElement) {
-            -
                    var input = $$$1(this._element).find(Selector.INPUT)[0];
-            -
                    if (input) {
-            -
                      if (input.type === 'radio') {
-            -
                        if (input.checked && $$$1(this._element).hasClass(ClassName.ACTIVE)) {
-            -
                          triggerChangeEvent = false;
-            -
                        } else {
-            -
                          var activeElement = $$$1(rootElement).find(Selector.ACTIVE)[0];
-            -
                          if (activeElement) {
-            -
                            $$$1(activeElement).removeClass(ClassName.ACTIVE);
+                          }
+                        }
-            -
                      }
-            -
                      if (triggerChangeEvent) {
-            -
                        if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) {
-            -
                          return;
+                        }
-            -
                        input.checked = !$$$1(this._element).hasClass(ClassName.ACTIVE);
-            -
                        $$$1(input).trigger('change');
+                      }
-            -
                      input.focus();
-            -
                      addAriaPressed = false;
+                    }
-            -
                  }
-            -
                  if (addAriaPressed) {
-            -
                    this._element.setAttribute('aria-pressed', !$$$1(this._element).hasClass(ClassName.ACTIVE));
-            -
                  }
-            -
                  if (triggerChangeEvent) {
-            -
                    $$$1(this._element).toggleClass(ClassName.ACTIVE);
-            -
                  }
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._element = null;
-            -
                }; // Static
-            -
                Button._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    if (!data) {
-            -
                      data = new Button(this);
-            -
                      $$$1(this).data(DATA_KEY, data);
-            -
                    }
-            -
                    if (config === 'toggle') {
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
-            -
                _createClass(Button, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }]);
-            -
                return Button;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
-            -
                event.preventDefault();
-            -
                var button = event.target;
-            -
                if (!$$$1(button).hasClass(ClassName.BUTTON)) {
-            -
                  button = $$$1(button).closest(Selector.BUTTON);
-            -
                }
-            -
                Button._jQueryInterface.call($$$1(button), 'toggle');
-            -
              }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
-            -
                var button = $$$1(event.target).closest(Selector.BUTTON)[0];
-            -
                $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type));
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Button._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Button;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Button._jQueryInterface;
-            -
              };
-            -
              return Button;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): carousel.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Carousel = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'carousel';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.carousel';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 600;
-            -
              var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key
-            -
-            -
              var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key
-            -
-            -
              var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
-            -
-            -
              var Default = {
-            -
                interval: 5000,
-            -
                keyboard: true,
-            -
                slide: false,
-            -
                pause: 'hover',
-            -
                wrap: true
-            -
              };
-            -
              var DefaultType = {
-            -
                interval: '(number|boolean)',
-            -
                keyboard: 'boolean',
-            -
                slide: '(boolean|string)',
-            -
                pause: '(string|boolean)',
-            -
                wrap: 'boolean'
-            -
              };
-            -
              var Direction = {
-            -
                NEXT: 'next',
-            -
                PREV: 'prev',
-            -
                LEFT: 'left',
-            -
                RIGHT: 'right'
-            -
              };
-            -
              var Event = {
-            -
                SLIDE: "slide" + EVENT_KEY,
-            -
                SLID: "slid" + EVENT_KEY,
-            -
                KEYDOWN: "keydown" + EVENT_KEY,
-            -
                MOUSEENTER: "mouseenter" + EVENT_KEY,
-            -
                MOUSELEAVE: "mouseleave" + EVENT_KEY,
-            -
                TOUCHEND: "touchend" + EVENT_KEY,
-            -
                LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                CAROUSEL: 'carousel',
-            -
                ACTIVE: 'active',
-            -
                SLIDE: 'slide',
-            -
                RIGHT: 'carousel-item-right',
-            -
                LEFT: 'carousel-item-left',
-            -
                NEXT: 'carousel-item-next',
-            -
                PREV: 'carousel-item-prev',
-            -
                ITEM: 'carousel-item'
-            -
              };
-            -
              var Selector = {
-            -
                ACTIVE: '.active',
-            -
                ACTIVE_ITEM: '.active.carousel-item',
-            -
                ITEM: '.carousel-item',
-            -
                NEXT_PREV: '.carousel-item-next, .carousel-item-prev',
-            -
                INDICATORS: '.carousel-indicators',
-            -
                DATA_SLIDE: '[data-slide], [data-slide-to]',
-            -
                DATA_RIDE: '[data-ride="carousel"]'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
-            -
              var Carousel =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Carousel(element, config) {
-            -
                  this._items = null;
-            -
                  this._interval = null;
-            -
                  this._activeElement = null;
-            -
                  this._isPaused = false;
-            -
                  this._isSliding = false;
-            -
                  this.touchTimeout = null;
-            -
                  this._config = this._getConfig(config);
-            -
                  this._element = $$$1(element)[0];
-            -
                  this._indicatorsElement = $$$1(this._element).find(Selector.INDICATORS)[0];
-            -
-            -
                  this._addEventListeners();
-            -
                } // Getters
-            -
                var _proto = Carousel.prototype;
-            -
                // Public
-            -
                _proto.next = function next() {
-            -
                  if (!this._isSliding) {
-            -
                    this._slide(Direction.NEXT);
-            -
                  }
-            -
                };
-            -
                _proto.nextWhenVisible = function nextWhenVisible() {
-            -
                  // Don't call next when the page isn't visible
-            -
                  // or the carousel or its parent isn't visible
-            -
                  if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') {
-            -
                    this.next();
-            -
                  }
-            -
                };
-            -
                _proto.prev = function prev() {
-            -
                  if (!this._isSliding) {
-            -
                    this._slide(Direction.PREV);
-            -
                  }
-            -
                };
-            -
                _proto.pause = function pause(event) {
-            -
                  if (!event) {
-            -
                    this._isPaused = true;
-            -
                  }
-            -
                  if ($$$1(this._element).find(Selector.NEXT_PREV)[0] && Util.supportsTransitionEnd()) {
-            -
                    Util.triggerTransitionEnd(this._element);
-            -
                    this.cycle(true);
-            -
                  }
-            -
                  clearInterval(this._interval);
-            -
                  this._interval = null;
-            -
                };
-            -
                _proto.cycle = function cycle(event) {
-            -
                  if (!event) {
-            -
                    this._isPaused = false;
-            -
                  }
-            -
                  if (this._interval) {
                     clearInterval(this._interval);
                     this._interval = null;
-            -
                  }
-            -
                  if (this._config.interval && !this._isPaused) {
-            -
                    this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
-            -
                  }
-            -
                };
-            -
                _proto.to = function to(index) {
-            -
                  var _this = this;
-            -
                  this._activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
-            -
                  var activeIndex = this._getItemIndex(this._activeElement);
-            -
                  if (index > this._items.length - 1 || index < 0) {
-            -
                    return;
-            -
                  }
-            -
                  if (this._isSliding) {
-            -
                    $$$1(this._element).one(Event.SLID, function () {
-            -
                      return _this.to(index);
-            -
                    });
-            -
                    return;
-            -
                  }
-            -
                  if (activeIndex === index) {
-            -
                    this.pause();
-            -
                    this.cycle();
-            -
                    return;
-            -
                  }
-            -
                  var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;
-            -
                  this._slide(direction, this._items[index]);
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1(this._element).off(EVENT_KEY);
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._items = null;
-            -
                  this._config = null;
-            -
                  this._element = null;
-            -
                  this._interval = null;
-            -
                  this._isPaused = null;
-            -
                  this._isSliding = null;
-            -
                  this._activeElement = null;
-            -
                  this._indicatorsElement = null;
-            -
                }; // Private
-            -
-            -
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, Default, config);
-            -
                  Util.typeCheckConfig(NAME, config, DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._addEventListeners = function _addEventListeners() {
-            -
                  var _this2 = this;
-            -
                  if (this._config.keyboard) {
-            -
                    $$$1(this._element).on(Event.KEYDOWN, function (event) {
-            -
                      return _this2._keydown(event);
-            -
                    });
-            -
                  }
-            -
                  if (this._config.pause === 'hover') {
-            -
                    $$$1(this._element).on(Event.MOUSEENTER, function (event) {
-            -
                      return _this2.pause(event);
-            -
                    }).on(Event.MOUSELEAVE, function (event) {
-            -
                      return _this2.cycle(event);
-            -
                    });
-            -
                    if ('ontouchstart' in document.documentElement) {
-            -
                      // If it's a touch-enabled device, mouseenter/leave are fired as
-            -
                      // part of the mouse compatibility events on first tap - the carousel
-            -
                      // would stop cycling until user tapped out of it;
-            -
                      // here, we listen for touchend, explicitly pause the carousel
-            -
                      // (as if it's the second time we tap on it, mouseenter compat event
-            -
                      // is NOT fired) and after a timeout (to allow for mouse compatibility
-            -
                      // events to fire) we explicitly restart cycling
-            -
                      $$$1(this._element).on(Event.TOUCHEND, function () {
-            -
                        _this2.pause();
-            -
-            -
                        if (_this2.touchTimeout) {
-            -
                          clearTimeout(_this2.touchTimeout);
-            -
                        }
-            -
                        _this2.touchTimeout = setTimeout(function (event) {
-            -
                          return _this2.cycle(event);
-            -
                        }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval);
                       });
+                    }
-            -
                  }
-            -
                };
-            -
                _proto._keydown = function _keydown(event) {
-            -
                  if (/input|textarea/i.test(event.target.tagName)) {
-            -
                    return;
-            -
                  }
-            -
-            -
                  switch (event.which) {
-            -
                    case ARROW_LEFT_KEYCODE:
-            -
                      event.preventDefault();
-            -
                      this.prev();
-            -
                      break;
-            -
-            -
                    case ARROW_RIGHT_KEYCODE:
-            -
                      event.preventDefault();
-            -
                      this.next();
-            -
                      break;
-            -
-            -
                    default:
-            -
                  }
-            -
                };
-            -
-            -
                _proto._getItemIndex = function _getItemIndex(element) {
-            -
                  this._items = $$$1.makeArray($$$1(element).parent().find(Selector.ITEM));
-            -
                  return this._items.indexOf(element);
-            -
                };
-            -
                _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
-            -
                  var isNextDirection = direction === Direction.NEXT;
-            -
                  var isPrevDirection = direction === Direction.PREV;
-            -
                  var activeIndex = this._getItemIndex(activeElement);
-            -
                  var lastItemIndex = this._items.length - 1;
-            -
                  var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex;
-            -
                  if (isGoingToWrap && !this._config.wrap) {
-            -
                    return activeElement;
-            -
                  }
-            -
                  var delta = direction === Direction.PREV ? -1 : 1;
-            -
                  var itemIndex = (activeIndex + delta) % this._items.length;
-            -
                  return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
-            -
                };
-            -
                _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
-            -
                  var targetIndex = this._getItemIndex(relatedTarget);
-            -
                  var fromIndex = this._getItemIndex($$$1(this._element).find(Selector.ACTIVE_ITEM)[0]);
-            -
                  var slideEvent = $$$1.Event(Event.SLIDE, {
-            -
                    relatedTarget: relatedTarget,
-            -
                    direction: eventDirectionName,
-            -
                    from: fromIndex,
-            -
                    to: targetIndex
-            -
                  });
-            -
                  $$$1(this._element).trigger(slideEvent);
-            -
                  return slideEvent;
-            -
                };
-            -
                _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
-            -
                  if (this._indicatorsElement) {
-            -
                    $$$1(this._indicatorsElement).find(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
-            -
                    var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
-            -
                    if (nextIndicator) {
-            -
                      $$$1(nextIndicator).addClass(ClassName.ACTIVE);
+                    }
-            -
                  }
-            -
                };
-            -
                _proto._slide = function _slide(direction, element) {
-            -
                  var _this3 = this;
-            -
                  var activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
-            -
                  var activeElementIndex = this._getItemIndex(activeElement);
-            -
                  var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement);
-            -
                  var nextElementIndex = this._getItemIndex(nextElement);
-            -
                  var isCycling = Boolean(this._interval);
-            -
                  var directionalClassName;
-            -
                  var orderClassName;
-            -
                  var eventDirectionName;
-            -
                  if (direction === Direction.NEXT) {
-            -
                    directionalClassName = ClassName.LEFT;
-            -
                    orderClassName = ClassName.NEXT;
-            -
                    eventDirectionName = Direction.LEFT;
-            -
                  } else {
-            -
                    directionalClassName = ClassName.RIGHT;
-            -
                    orderClassName = ClassName.PREV;
-            -
                    eventDirectionName = Direction.RIGHT;
-            -
                  }
-            -
-            -
                  if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) {
-            -
                    this._isSliding = false;
-            -
                    return;
-            -
                  }
-            -
                  var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);
-            -
                  if (slideEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  if (!activeElement || !nextElement) {
-            -
                    // Some weirdness is happening, so we bail
-            -
                    return;
-            -
                  }
-            -
                  this._isSliding = true;
-            -
                  if (isCycling) {
-            -
                    this.pause();
-            -
                  }
-            -
                  this._setActiveIndicatorElement(nextElement);
-            -
                  var slidEvent = $$$1.Event(Event.SLID, {
-            -
                    relatedTarget: nextElement,
-            -
                    direction: eventDirectionName,
-            -
                    from: activeElementIndex,
-            -
                    to: nextElementIndex
-            -
                  });
-            -
                  if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.SLIDE)) {
-            -
                    $$$1(nextElement).addClass(orderClassName);
-            -
                    Util.reflow(nextElement);
-            -
                    $$$1(activeElement).addClass(directionalClassName);
-            -
                    $$$1(nextElement).addClass(directionalClassName);
-            -
                    $$$1(activeElement).one(Util.TRANSITION_END, function () {
-            -
                      $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE);
-            -
                      $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName);
-            -
                      _this3._isSliding = false;
-            -
                      setTimeout(function () {
-            -
                        return $$$1(_this3._element).trigger(slidEvent);
-            -
                      }, 0);
-            -
                    }).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  } else {
-            -
                    $$$1(activeElement).removeClass(ClassName.ACTIVE);
-            -
                    $$$1(nextElement).addClass(ClassName.ACTIVE);
-            -
                    this._isSliding = false;
-            -
                    $$$1(this._element).trigger(slidEvent);
-            -
                  }
-            -
                  if (isCycling) {
-            -
                    this.cycle();
-            -
                  }
-            -
                }; // Static
-            -
                Carousel._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    var _config = _extends({}, Default, $$$1(this).data());
-            -
                    if (typeof config === 'object') {
-            -
                      _config = _extends({}, _config, config);
+                    }
-            -
                    var action = typeof config === 'string' ? config : _config.slide;
-            -
                    if (!data) {
-            -
                      data = new Carousel(this, _config);
-            -
                      $$$1(this).data(DATA_KEY, data);
+                    }
-            -
                    if (typeof config === 'number') {
-            -
                      data.to(config);
-            -
                    } else if (typeof action === 'string') {
-            -
                      if (typeof data[action] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + action + "\"");
+                      }
-            -
                      data[action]();
-            -
                    } else if (_config.interval) {
-            -
                      data.pause();
-            -
                      data.cycle();
+                    }
-            -
                  });
-            -
                };
-            -
                Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
-            -
                  var selector = Util.getSelectorFromElement(this);
-            -
                  if (!selector) {
-            -
                    return;
-            -
                  }
-            -
                  var target = $$$1(selector)[0];
-            -
                  if (!target || !$$$1(target).hasClass(ClassName.CAROUSEL)) {
-            -
                    return;
-            -
                  }
-            -
                  var config = _extends({}, $$$1(target).data(), $$$1(this).data());
-            -
                  var slideIndex = this.getAttribute('data-slide-to');
-            -
                  if (slideIndex) {
-            -
                    config.interval = false;
-            -
                  }
-            -
                  Carousel._jQueryInterface.call($$$1(target), config);
-            -
                  if (slideIndex) {
-            -
                    $$$1(target).data(DATA_KEY).to(slideIndex);
-            -
                  }
-            -
                  event.preventDefault();
-            -
                };
-            -
                _createClass(Carousel, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }]);
-            -
                return Carousel;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
-            -
              $$$1(window).on(Event.LOAD_DATA_API, function () {
-            -
                $$$1(Selector.DATA_RIDE).each(function () {
-            -
                  var $carousel = $$$1(this);
-            -
                  Carousel._jQueryInterface.call($carousel, $carousel.data());
                 });
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
-            -
              $$$1.fn[NAME] = Carousel._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Carousel;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Carousel._jQueryInterface;
-            -
              };
-            -
              return Carousel;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): collapse.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Collapse = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'collapse';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.collapse';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 600;
-            -
              var Default = {
-            -
                toggle: true,
-            -
                parent: ''
-            -
              };
-            -
              var DefaultType = {
-            -
                toggle: 'boolean',
-            -
                parent: '(string|element)'
-            -
              };
-            -
              var Event = {
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                SHOW: 'show',
-            -
                COLLAPSE: 'collapse',
-            -
                COLLAPSING: 'collapsing',
-            -
                COLLAPSED: 'collapsed'
-            -
              };
-            -
              var Dimension = {
-            -
                WIDTH: 'width',
-            -
                HEIGHT: 'height'
-            -
              };
-            -
              var Selector = {
-            -
                ACTIVES: '.show, .collapsing',
-            -
                DATA_TOGGLE: '[data-toggle="collapse"]'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
              var Collapse =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Collapse(element, config) {
-            -
                  this._isTransitioning = false;
-            -
                  this._element = element;
-            -
                  this._config = this._getConfig(config);
-            -
                  this._triggerArray = $$$1.makeArray($$$1("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
-            -
                  var tabToggles = $$$1(Selector.DATA_TOGGLE);
-            -
                  for (var i = 0; i < tabToggles.length; i++) {
-            -
                    var elem = tabToggles[i];
-            -
                    var selector = Util.getSelectorFromElement(elem);
-            -
                    if (selector !== null && $$$1(selector).filter(element).length > 0) {
-            -
                      this._selector = selector;
-            -
                      this._triggerArray.push(elem);
+                    }
-            -
                  }
-            -
                  this._parent = this._config.parent ? this._getParent() : null;
-            -
                  if (!this._config.parent) {
-            -
                    this._addAriaAndCollapsedClass(this._element, this._triggerArray);
-            -
                  }
-            -
                  if (this._config.toggle) {
-            -
                    this.toggle();
-            -
                  }
-            -
                } // Getters
-            -
                var _proto = Collapse.prototype;
-            -
                // Public
-            -
                _proto.toggle = function toggle() {
-            -
                  if ($$$1(this._element).hasClass(ClassName.SHOW)) {
-            -
                    this.hide();
-            -
                  } else {
-            -
                    this.show();
-            -
                  }
-            -
                };
-            -
                _proto.show = function show() {
-            -
                  var _this = this;
-            -
                  if (this._isTransitioning || $$$1(this._element).hasClass(ClassName.SHOW)) {
-            -
                    return;
-            -
                  }
-            -
                  var actives;
-            -
                  var activesData;
-            -
                  if (this._parent) {
-            -
                    actives = $$$1.makeArray($$$1(this._parent).find(Selector.ACTIVES).filter("[data-parent=\"" + this._config.parent + "\"]"));
-            -
                    if (actives.length === 0) {
-            -
                      actives = null;
+                    }
-            -
                  }
-            -
                  if (actives) {
-            -
                    activesData = $$$1(actives).not(this._selector).data(DATA_KEY);
-            -
                    if (activesData && activesData._isTransitioning) {
-            -
                      return;
+                    }
-            -
                  }
-            -
                  var startEvent = $$$1.Event(Event.SHOW);
-            -
                  $$$1(this._element).trigger(startEvent);
-            -
                  if (startEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  if (actives) {
-            -
                    Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide');
-            -
                    if (!activesData) {
-            -
                      $$$1(actives).data(DATA_KEY, null);
+                    }
-            -
                  }
-            -
-            -
                  var dimension = this._getDimension();
-            -
                  $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
-            -
                  this._element.style[dimension] = 0;
-            -
                  if (this._triggerArray.length > 0) {
-            -
                    $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
-            -
                  }
-            -
                  this.setTransitioning(true);
-            -
                  var complete = function complete() {
-            -
                    $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW);
-            -
                    _this._element.style[dimension] = '';
-            -
                    _this.setTransitioning(false);
-            -
                    $$$1(_this._element).trigger(Event.SHOWN);
-            -
                  };
-            -
                  if (!Util.supportsTransitionEnd()) {
-            -
                    complete();
-            -
                    return;
-            -
                  }
-            -
                  var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
-            -
                  var scrollSize = "scroll" + capitalizedDimension;
-            -
                  $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  this._element.style[dimension] = this._element[scrollSize] + "px";
-            -
                };
-            -
                _proto.hide = function hide() {
-            -
                  var _this2 = this;
-            -
                  if (this._isTransitioning || !$$$1(this._element).hasClass(ClassName.SHOW)) {
-            -
                    return;
-            -
                  }
-            -
                  var startEvent = $$$1.Event(Event.HIDE);
-            -
                  $$$1(this._element).trigger(startEvent);
-            -
                  if (startEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  var dimension = this._getDimension();
-            -
                  this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
-            -
                  Util.reflow(this._element);
-            -
                  $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
-            -
                  if (this._triggerArray.length > 0) {
-            -
                    for (var i = 0; i < this._triggerArray.length; i++) {
-            -
                      var trigger = this._triggerArray[i];
-            -
                      var selector = Util.getSelectorFromElement(trigger);
-            -
                      if (selector !== null) {
-            -
                        var $elem = $$$1(selector);
-            -
                        if (!$elem.hasClass(ClassName.SHOW)) {
-            -
                          $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
+                        }
+                      }
+                    }
-            -
                  }
-            -
-            -
                  this.setTransitioning(true);
-            -
                  var complete = function complete() {
-            -
                    _this2.setTransitioning(false);
-            -
-            -
                    $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN);
-            -
                  };
-            -
                  this._element.style[dimension] = '';
-            -
                  if (!Util.supportsTransitionEnd()) {
-            -
                    complete();
-            -
                    return;
-            -
                  }
-            -
                  $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                };
-            -
                _proto.setTransitioning = function setTransitioning(isTransitioning) {
-            -
                  this._isTransitioning = isTransitioning;
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  this._config = null;
-            -
                  this._parent = null;
-            -
                  this._element = null;
-            -
                  this._triggerArray = null;
-            -
                  this._isTransitioning = null;
-            -
                }; // Private
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, Default, config);
-            -
                  config.toggle = Boolean(config.toggle); // Coerce string values
-            -
                  Util.typeCheckConfig(NAME, config, DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._getDimension = function _getDimension() {
-            -
                  var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH);
-            -
                  return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
-            -
                };
-            -
                _proto._getParent = function _getParent() {
-            -
                  var _this3 = this;
-            -
                  var parent = null;
-            -
                  if (Util.isElement(this._config.parent)) {
-            -
                    parent = this._config.parent; // It's a jQuery object
-            -
                    if (typeof this._config.parent.jquery !== 'undefined') {
-            -
                      parent = this._config.parent[0];
+                    }
-            -
                  } else {
-            -
                    parent = $$$1(this._config.parent)[0];
-            -
                  }
-            -
                  var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
-            -
                  $$$1(parent).find(selector).each(function (i, element) {
-            -
                    _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
-            -
                  });
-            -
                  return parent;
-            -
                };
-            -
                _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
-            -
                  if (element) {
-            -
                    var isOpen = $$$1(element).hasClass(ClassName.SHOW);
-            -
                    if (triggerArray.length > 0) {
-            -
                      $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
+                    }
-            -
                  }
-            -
                }; // Static
-            -
                Collapse._getTargetFromElement = function _getTargetFromElement(element) {
-            -
                  var selector = Util.getSelectorFromElement(element);
-            -
                  return selector ? $$$1(selector)[0] : null;
-            -
                };
-            -
                Collapse._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var $this = $$$1(this);
-            -
                    var data = $this.data(DATA_KEY);
-            -
                    var _config = _extends({}, Default, $this.data(), typeof config === 'object' && config);
-            -
                    if (!data && _config.toggle && /show|hide/.test(config)) {
-            -
                      _config.toggle = false;
-            -
                    }
-            -
                    if (!data) {
-            -
                      data = new Collapse(this, _config);
-            -
                      $this.data(DATA_KEY, data);
-            -
                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
+                      }
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
                _createClass(Collapse, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }]);
-            -
                return Collapse;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
-            -
                // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
-            -
                if (event.currentTarget.tagName === 'A') {
-            -
                  event.preventDefault();
-            -
                }
-            -
                var $trigger = $$$1(this);
-            -
                var selector = Util.getSelectorFromElement(this);
-            -
                $$$1(selector).each(function () {
-            -
                  var $target = $$$1(this);
-            -
                  var data = $target.data(DATA_KEY);
-            -
                  var config = data ? 'toggle' : $trigger.data();
-            -
                  Collapse._jQueryInterface.call($target, config);
                 });
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
-            -
              $$$1.fn[NAME] = Collapse._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Collapse;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Collapse._jQueryInterface;
-            -
              };
-            -
              return Collapse;
-            -
            }($);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): dropdown.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Dropdown = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'dropdown';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.dropdown';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
-            -
-            -
              var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key
-            -
-            -
              var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key
-            -
-            -
              var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key
-            -
-            -
              var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key
-            -
-            -
              var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse)
-            -
-            -
              var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE);
-            -
              var Event = {
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                CLICK: "click" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
-            -
                KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY,
-            -
                KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                DISABLED: 'disabled',
-            -
                SHOW: 'show',
-            -
                DROPUP: 'dropup',
-            -
                DROPRIGHT: 'dropright',
-            -
                DROPLEFT: 'dropleft',
-            -
                MENURIGHT: 'dropdown-menu-right',
-            -
                MENULEFT: 'dropdown-menu-left',
-            -
                POSITION_STATIC: 'position-static'
-            -
              };
-            -
              var Selector = {
-            -
                DATA_TOGGLE: '[data-toggle="dropdown"]',
-            -
                FORM_CHILD: '.dropdown form',
-            -
                MENU: '.dropdown-menu',
-            -
                NAVBAR_NAV: '.navbar-nav',
-            -
                VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled)'
-            -
              };
-            -
              var AttachmentMap = {
-            -
                TOP: 'top-start',
-            -
                TOPEND: 'top-end',
-            -
                BOTTOM: 'bottom-start',
-            -
                BOTTOMEND: 'bottom-end',
-            -
                RIGHT: 'right-start',
-            -
                RIGHTEND: 'right-end',
-            -
                LEFT: 'left-start',
-            -
                LEFTEND: 'left-end'
-            -
              };
-            -
              var Default = {
-            -
                offset: 0,
-            -
                flip: true,
-            -
                boundary: 'scrollParent'
-            -
              };
-            -
              var DefaultType = {
-            -
                offset: '(number|string|function)',
-            -
                flip: 'boolean',
-            -
                boundary: '(string|element)'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
-            -
              var Dropdown =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Dropdown(element, config) {
-            -
                  this._element = element;
-            -
                  this._popper = null;
-            -
                  this._config = this._getConfig(config);
-            -
                  this._menu = this._getMenuElement();
-            -
                  this._inNavbar = this._detectNavbar();
-            -
-            -
                  this._addEventListeners();
-            -
                } // Getters
-            -
                var _proto = Dropdown.prototype;
-            -
                // Public
-            -
                _proto.toggle = function toggle() {
-            -
                  if (this._element.disabled || $$$1(this._element).hasClass(ClassName.DISABLED)) {
-            -
                    return;
-            -
                  }
-            -
                  var parent = Dropdown._getParentFromElement(this._element);
-            -
                  var isActive = $$$1(this._menu).hasClass(ClassName.SHOW);
-            -
                  Dropdown._clearMenus();
-            -
                  if (isActive) {
-            -
                    return;
-            -
                  }
-            -
                  var relatedTarget = {
-            -
                    relatedTarget: this._element
-            -
                  };
-            -
                  var showEvent = $$$1.Event(Event.SHOW, relatedTarget);
-            -
                  $$$1(parent).trigger(showEvent);
-            -
                  if (showEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  } // Disable totally Popper.js for Dropdown in Navbar
-            -
                  if (!this._inNavbar) {
-            -
                    /**
-            -
                     * Check for Popper dependency
-            -
                     * Popper - https://popper.js.org
-            -
                     */
-            -
                    if (typeof Popper === 'undefined') {
-            -
                      throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)');
-            -
                    }
-            -
                    var element = this._element; // For dropup with alignment we use the parent as popper container
-            -
                    if ($$$1(parent).hasClass(ClassName.DROPUP)) {
-            -
                      if ($$$1(this._menu).hasClass(ClassName.MENULEFT) || $$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
-            -
                        element = parent;
+                      }
-            -
                    } // If boundary is not `scrollParent`, then set position to `static`
-            -
                    // to allow the menu to "escape" the scroll parent's boundaries
-            -
                    // https://github.com/twbs/bootstrap/issues/24251
-            -
-            -
                    if (this._config.boundary !== 'scrollParent') {
-            -
                      $$$1(parent).addClass(ClassName.POSITION_STATIC);
-            -
                    }
-            -
                    this._popper = new Popper(element, this._menu, this._getPopperConfig());
-            -
                  } // If this is a touch-enabled device we add extra
-            -
                  // empty mouseover listeners to the body's immediate children;
-            -
                  // only needed because of broken event delegation on iOS
-            -
                  // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
-            -
                  if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) {
-            -
                    $$$1('body').children().on('mouseover', null, $$$1.noop);
-            -
                  }
-            -
                  this._element.focus();
-            -
                  this._element.setAttribute('aria-expanded', true);
-            -
                  $$$1(this._menu).toggleClass(ClassName.SHOW);
-            -
                  $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget));
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  $$$1(this._element).off(EVENT_KEY);
-            -
                  this._element = null;
-            -
                  this._menu = null;
-            -
                  if (this._popper !== null) {
-            -
                    this._popper.destroy();
-            -
                    this._popper = null;
-            -
                  }
-            -
                };
-            -
                _proto.update = function update() {
-            -
                  this._inNavbar = this._detectNavbar();
-            -
                  if (this._popper !== null) {
-            -
                    this._popper.scheduleUpdate();
-            -
                  }
-            -
                }; // Private
-            -
                _proto._addEventListeners = function _addEventListeners() {
-            -
                  var _this = this;
-            -
                  $$$1(this._element).on(Event.CLICK, function (event) {
-            -
                    event.preventDefault();
-            -
                    event.stopPropagation();
-            -
                    _this.toggle();
-            -
                  });
-            -
                };
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, this.constructor.Default, $$$1(this._element).data(), config);
-            -
                  Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
-            -
                  return config;
-            -
                };
-            -
                _proto._getMenuElement = function _getMenuElement() {
-            -
                  if (!this._menu) {
-            -
                    var parent = Dropdown._getParentFromElement(this._element);
-            -
                    this._menu = $$$1(parent).find(Selector.MENU)[0];
-            -
                  }
-            -
                  return this._menu;
-            -
                };
-            -
                _proto._getPlacement = function _getPlacement() {
-            -
                  var $parentDropdown = $$$1(this._element).parent();
-            -
                  var placement = AttachmentMap.BOTTOM; // Handle dropup
-            -
                  if ($parentDropdown.hasClass(ClassName.DROPUP)) {
-            -
                    placement = AttachmentMap.TOP;
-            -
                    if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
-            -
                      placement = AttachmentMap.TOPEND;
+                    }
-            -
                  } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) {
-            -
                    placement = AttachmentMap.RIGHT;
-            -
                  } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) {
-            -
                    placement = AttachmentMap.LEFT;
-            -
                  } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
-            -
                    placement = AttachmentMap.BOTTOMEND;
-            -
                  }
-            -
-            -
                  return placement;
-            -
                };
-            -
-            -
                _proto._detectNavbar = function _detectNavbar() {
-            -
                  return $$$1(this._element).closest('.navbar').length > 0;
-            -
                };
-            -
                _proto._getPopperConfig = function _getPopperConfig() {
-            -
                  var _this2 = this;
-            -
                  var offsetConf = {};
-            -
                  if (typeof this._config.offset === 'function') {
-            -
                    offsetConf.fn = function (data) {
-            -
                      data.offsets = _extends({}, data.offsets, _this2._config.offset(data.offsets) || {});
-            -
                      return data;
-            -
                    };
-            -
                  } else {
-            -
                    offsetConf.offset = this._config.offset;
-            -
                  }
-            -
                  var popperConfig = {
-            -
                    placement: this._getPlacement(),
-            -
                    modifiers: {
-            -
                      offset: offsetConf,
-            -
                      flip: {
-            -
                        enabled: this._config.flip
-            -
                      },
-            -
                      preventOverflow: {
-            -
                        boundariesElement: this._config.boundary
+                      }
+                    }
                   };
-            -
                  return popperConfig;
-            -
                }; // Static
-            -
                Dropdown._jQueryInterface = function _jQueryInterface(config) {
-            -
                  return this.each(function () {
-            -
                    var data = $$$1(this).data(DATA_KEY);
-            -
                    var _config = typeof config === 'object' ? config : null;
-            -
                    if (!data) {
-            -
                      data = new Dropdown(this, _config);
-            -
                      $$$1(this).data(DATA_KEY, data);
+                    }
-            -
                    if (typeof config === 'string') {
-            -
                      if (typeof data[config] === 'undefined') {
-            -
                        throw new TypeError("No method named \"" + config + "\"");
-            -
                      }
-            -
                      data[config]();
+                    }
-            -
                  });
-            -
                };
-            -
                Dropdown._clearMenus = function _clearMenus(event) {
-            -
                  if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) {
-            -
                    return;
-            -
                  }
-            -
                  var toggles = $$$1.makeArray($$$1(Selector.DATA_TOGGLE));
-            -
                  for (var i = 0; i < toggles.length; i++) {
-            -
                    var parent = Dropdown._getParentFromElement(toggles[i]);
-            -
                    var context = $$$1(toggles[i]).data(DATA_KEY);
-            -
                    var relatedTarget = {
-            -
                      relatedTarget: toggles[i]
-            -
                    };
-            -
                    if (!context) {
-            -
                      continue;
-            -
                    }
-            -
                    var dropdownMenu = context._menu;
-            -
                    if (!$$$1(parent).hasClass(ClassName.SHOW)) {
-            -
                      continue;
-            -
                    }
-            -
                    if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) {
-            -
                      continue;
+                    }
-            -
                    var hideEvent = $$$1.Event(Event.HIDE, relatedTarget);
-            -
                    $$$1(parent).trigger(hideEvent);
-            -
                    if (hideEvent.isDefaultPrevented()) {
-            -
                      continue;
-            -
                    } // If this is a touch-enabled device we remove the extra
-            -
                    // empty mouseover listeners we added for iOS support
-            -
                    if ('ontouchstart' in document.documentElement) {
-            -
                      $$$1('body').children().off('mouseover', null, $$$1.noop);
-            -
                    }
-            -
                    toggles[i].setAttribute('aria-expanded', 'false');
-            -
                    $$$1(dropdownMenu).removeClass(ClassName.SHOW);
-            -
                    $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget));
-            -
                  }
-            -
                };
-            -
                Dropdown._getParentFromElement = function _getParentFromElement(element) {
-            -
                  var parent;
-            -
                  var selector = Util.getSelectorFromElement(element);
-            -
                  if (selector) {
-            -
                    parent = $$$1(selector)[0];
-            -
                  }
-            -
                  return parent || element.parentNode;
-            -
                }; // eslint-disable-next-line complexity
-            -
                Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
-            -
                  // If not input/textarea:
-            -
                  //  - And not a key in REGEXP_KEYDOWN => not a dropdown command
-            -
                  // If input/textarea:
-            -
                  //  - If space key => not a dropdown command
-            -
                  //  - If key is other than escape
-            -
                  //    - If key is not up or down => not a dropdown command
-            -
                  //    - If trigger inside the menu => not a dropdown command
-            -
                  if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
-            -
                    return;
-            -
                  }
-            -
                  event.preventDefault();
-            -
                  event.stopPropagation();
-            -
                  if (this.disabled || $$$1(this).hasClass(ClassName.DISABLED)) {
-            -
                    return;
-            -
                  }
-            -
                  var parent = Dropdown._getParentFromElement(this);
-            -
                  var isActive = $$$1(parent).hasClass(ClassName.SHOW);
-            -
                  if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
-            -
                    if (event.which === ESCAPE_KEYCODE) {
-            -
                      var toggle = $$$1(parent).find(Selector.DATA_TOGGLE)[0];
-            -
                      $$$1(toggle).trigger('focus');
+                    }
-            -
                    $$$1(this).trigger('click');
-            -
                    return;
-            -
                  }
-            -
                  var items = $$$1(parent).find(Selector.VISIBLE_ITEMS).get();
-            -
                  if (items.length === 0) {
-            -
                    return;
-            -
                  }
-            -
                  var index = items.indexOf(event.target);
-            -
                  if (event.which === ARROW_UP_KEYCODE && index > 0) {
-            -
                    // Up
-            -
                    index--;
-            -
                  }
-            -
                  if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
-            -
                    // Down
-            -
                    index++;
-            -
                  }
-            -
                  if (index < 0) {
-            -
                    index = 0;
-            -
                  }
-            -
                  items[index].focus();
-            -
                };
-            -
                _createClass(Dropdown, null, [{
-            -
                  key: "VERSION",
-            -
                  get: function get() {
-            -
                    return VERSION;
-            -
                  }
-            -
                }, {
-            -
                  key: "Default",
-            -
                  get: function get() {
-            -
                    return Default;
-            -
                  }
-            -
                }, {
-            -
                  key: "DefaultType",
-            -
                  get: function get() {
-            -
                    return DefaultType;
-            -
                  }
-            -
                }]);
-            -
                return Dropdown;
-            -
              }();
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Data Api implementation
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
-            -
                event.preventDefault();
-            -
                event.stopPropagation();
-            -
                Dropdown._jQueryInterface.call($$$1(this), 'toggle');
-            -
              }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) {
-            -
                e.stopPropagation();
-            -
              });
-            -
              /**
-            -
               * ------------------------------------------------------------------------
-            -
               * jQuery
-            -
               * ------------------------------------------------------------------------
-            -
               */
-            -
              $$$1.fn[NAME] = Dropdown._jQueryInterface;
-            -
              $$$1.fn[NAME].Constructor = Dropdown;
-            -
              $$$1.fn[NAME].noConflict = function () {
-            -
                $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
-            -
                return Dropdown._jQueryInterface;
-            -
              };
-            -
              return Dropdown;
-            -
            }($, Popper);
-            -
            /**
-            -
             * --------------------------------------------------------------------------
-            -
             * Bootstrap (v4.0.0): modal.js
-            -
             * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
-            -
             * --------------------------------------------------------------------------
-            -
             */
-            -
            var Modal = function ($$$1) {
               /**
-            -
               * ------------------------------------------------------------------------
-            -
               * Constants
-            -
               * ------------------------------------------------------------------------
                */
-            -
              var NAME = 'modal';
-            -
              var VERSION = '4.0.0';
-            -
              var DATA_KEY = 'bs.modal';
-            -
              var EVENT_KEY = "." + DATA_KEY;
-            -
              var DATA_API_KEY = '.data-api';
-            -
              var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
-            -
              var TRANSITION_DURATION = 300;
-            -
              var BACKDROP_TRANSITION_DURATION = 150;
-            -
              var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
-            -
-            -
              var Default = {
-            -
                backdrop: true,
-            -
                keyboard: true,
-            -
                focus: true,
-            -
                show: true
-            -
              };
-            -
              var DefaultType = {
-            -
                backdrop: '(boolean|string)',
-            -
                keyboard: 'boolean',
-            -
                focus: 'boolean',
-            -
                show: 'boolean'
-            -
              };
-            -
              var Event = {
-            -
                HIDE: "hide" + EVENT_KEY,
-            -
                HIDDEN: "hidden" + EVENT_KEY,
-            -
                SHOW: "show" + EVENT_KEY,
-            -
                SHOWN: "shown" + EVENT_KEY,
-            -
                FOCUSIN: "focusin" + EVENT_KEY,
-            -
                RESIZE: "resize" + EVENT_KEY,
-            -
                CLICK_DISMISS: "click.dismiss" + EVENT_KEY,
-            -
                KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY,
-            -
                MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY,
-            -
                MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY,
-            -
                CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
-            -
              };
-            -
              var ClassName = {
-            -
                SCROLLBAR_MEASURER: 'modal-scrollbar-measure',
-            -
                BACKDROP: 'modal-backdrop',
-            -
                OPEN: 'modal-open',
-            -
                FADE: 'fade',
-            -
                SHOW: 'show'
-            -
              };
-            -
              var Selector = {
-            -
                DIALOG: '.modal-dialog',
-            -
                DATA_TOGGLE: '[data-toggle="modal"]',
-            -
                DATA_DISMISS: '[data-dismiss="modal"]',
-            -
                FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
-            -
                STICKY_CONTENT: '.sticky-top',
-            -
                NAVBAR_TOGGLER: '.navbar-toggler'
                 /**
                  * ------------------------------------------------------------------------
-            -
                 * Class Definition
                  * ------------------------------------------------------------------------
                  */
-            -
              };
-            -
-            -
              var Modal =
-            -
              /*#__PURE__*/
-            -
              function () {
-            -
                function Modal(element, config) {
-            -
                  this._config = this._getConfig(config);
-            -
                  this._element = element;
-            -
                  this._dialog = $$$1(element).find(Selector.DIALOG)[0];
-            -
                  this._backdrop = null;
-            -
                  this._isShown = false;
-            -
                  this._isBodyOverflowing = false;
-            -
                  this._ignoreBackdropClick = false;
-            -
                  this._originalBodyPadding = 0;
-            -
                  this._scrollbarWidth = 0;
-            -
                } // Getters
-            -
-            -
-            -
                var _proto = Modal.prototype;
-            -
-            -
                // Public
-            -
                _proto.toggle = function toggle(relatedTarget) {
-            -
                  return this._isShown ? this.hide() : this.show(relatedTarget);
                 };
-            -
                _proto.show = function show(relatedTarget) {
-            -
                  var _this = this;
-            -
                  if (this._isTransitioning || this._isShown) {
-            -
                    return;
-            -
                  }
-            -
                  if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) {
-            -
                    this._isTransitioning = true;
-            -
                  }
-            -
                  var showEvent = $$$1.Event(Event.SHOW, {
-            -
                    relatedTarget: relatedTarget
-            -
                  });
-            -
                  $$$1(this._element).trigger(showEvent);
-            -
                  if (this._isShown || showEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  this._isShown = true;
-            -
                  this._checkScrollbar();
-            -
                  this._setScrollbar();
-            -
                  this._adjustDialog();
-            -
                  $$$1(document.body).addClass(ClassName.OPEN);
-            -
                  this._setEscapeEvent();
-            -
                  this._setResizeEvent();
-            -
                  $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) {
-            -
                    return _this.hide(event);
-            -
                  });
-            -
                  $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () {
-            -
                    $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) {
-            -
                      if ($$$1(event.target).is(_this._element)) {
-            -
                        _this._ignoreBackdropClick = true;
-            -
                      }
                     });
-            -
                  });
-            -
                  this._showBackdrop(function () {
-            -
                    return _this._showElement(relatedTarget);
-            -
                  });
-            -
                };
-            -
                _proto.hide = function hide(event) {
-            -
                  var _this2 = this;
-            -
                  if (event) {
-            -
                    event.preventDefault();
-            -
                  }
-            -
                  if (this._isTransitioning || !this._isShown) {
-            -
                    return;
-            -
                  }
-            -
                  var hideEvent = $$$1.Event(Event.HIDE);
-            -
                  $$$1(this._element).trigger(hideEvent);
-            -
                  if (!this._isShown || hideEvent.isDefaultPrevented()) {
-            -
                    return;
-            -
                  }
-            -
                  this._isShown = false;
-            -
                  var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE);
-            -
                  if (transition) {
-            -
                    this._isTransitioning = true;
-            -
                  }
-            -
                  this._setEscapeEvent();
-            -
                  this._setResizeEvent();
-            -
                  $$$1(document).off(Event.FOCUSIN);
-            -
                  $$$1(this._element).removeClass(ClassName.SHOW);
-            -
                  $$$1(this._element).off(Event.CLICK_DISMISS);
-            -
                  $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS);
-            -
                  if (transition) {
-            -
                    $$$1(this._element).one(Util.TRANSITION_END, function (event) {
-            -
                      return _this2._hideModal(event);
-            -
                    }).emulateTransitionEnd(TRANSITION_DURATION);
-            -
                  } else {
-            -
                    this._hideModal();
-            -
                  }
-            -
                };
-            -
                _proto.dispose = function dispose() {
-            -
                  $$$1.removeData(this._element, DATA_KEY);
-            -
                  $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY);
-            -
                  this._config = null;
-            -
                  this._element = null;
-            -
                  this._dialog = null;
-            -
                  this._backdrop = null;
-            -
                  this._isShown = null;
-            -
                  this._isBodyOverflowing = null;
-            -
                  this._ignoreBackdropClick = null;
-            -
                  this._scrollbarWidth = null;
-            -
                };
-            -
                _proto.handleUpdate = function handleUpdate() {
-            -
                  this._adjustDialog();
-            -
                }; // Private
-            -
                _proto._getConfig = function _getConfig(config) {
-            -
                  config = _extends({}, Default, config);
-            -
                  Util.typeCheckConfig(NAME, config, DefaultType);
-            -
                  return config;
-            -
                };


1	/*!
2	+ * Bootstrap v4.1.0 (https://getbootstrap.com/)
3	* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
4	* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
5	*/
6	(function (global, factory) {
7	+ typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery'), require('popper.js')) :
8	+ typeof define === 'function' && define.amd ? define(['exports', 'jquery', 'popper.js'], factory) :
9	+ (factory((global.bootstrap = {}),global.jQuery,global.Popper));
10	}(this, (function (exports,$,Popper) { 'use strict';
11
12	+ $ = $ && $.hasOwnProperty('default') ? $['default'] : $;
13	+ Popper = Popper && Popper.hasOwnProperty('default') ? Popper['default'] : Popper;
14
15	+ function _defineProperties(target, props) {
16	+ for (var i = 0; i < props.length; i++) {
17	+ var descriptor = props[i];
18	+ descriptor.enumerable = descriptor.enumerable \|\| false;
19	+ descriptor.configurable = true;
20	+ if ("value" in descriptor) descriptor.writable = true;
21	+ Object.defineProperty(target, descriptor.key, descriptor);



















22	}































23	}
24
25	+ function _createClass(Constructor, protoProps, staticProps) {
26	+ if (protoProps) _defineProperties(Constructor.prototype, protoProps);
27	+ if (staticProps) _defineProperties(Constructor, staticProps);
28	+ return Constructor;








29	}
30
31	+ function _defineProperty(obj, key, value) {
32	+ if (key in obj) {
33	+ Object.defineProperty(obj, key, {
34	+ value: value,
35	+ enumerable: true,
36	+ configurable: true,
37	+ writable: true
38	+ });
39	+ } else {
40	+ obj[key] = value;
41	}
42
43	+ return obj;


44	}
45
46	+ function _objectSpread(target) {
47	+ for (var i = 1; i < arguments.length; i++) {
48	+ var source = arguments[i] != null ? arguments[i] : {};
49	+ var ownKeys = Object.keys(source);
50
51	+ if (typeof Object.getOwnPropertySymbols === 'function') {
52	+ ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) {
53	+ return Object.getOwnPropertyDescriptor(source, sym).enumerable;
54	+ }));



55	}







56
57	+ ownKeys.forEach(function (key) {
58	+ _defineProperty(target, key, source[key]);
59	+ });
60	}
61	+
62	+ return target;
63	}
64
65	+ function _inheritsLoose(subClass, superClass) {
66	+ subClass.prototype = Object.create(superClass.prototype);
67	+ subClass.prototype.constructor = subClass;
68	+ subClass.__proto__ = superClass;

69	}
70	+
71	/**
72	* --------------------------------------------------------------------------
73	+ * Bootstrap (v4.1.0): util.js
74	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
75	* --------------------------------------------------------------------------
76	*/
77
78	+ var Util = function ($$$1) {
79	+ /**
80	+ * ------------------------------------------------------------------------
81	+ * Private TransitionEnd Helpers
82	+ * ------------------------------------------------------------------------
83	+ */
84	+ var TRANSITION_END = 'transitionend';
85	+ var MAX_UID = 1000000;
86	+ var MILLISECONDS_MULTIPLIER = 1000; // Shoutout AngusCroll (https://goo.gl/pxwQGp)
87	+
88	+ function toType(obj) {
89	+ return {}.toString.call(obj).match(/\s([a-z]+)/i)[1].toLowerCase();
90	+ }
91
92	+ function getSpecialTransitionEndEvent() {
93	+ return {
94	+ bindType: TRANSITION_END,
95	+ delegateType: TRANSITION_END,
96	+ handle: function handle(event) {
97	+ if ($$$1(event.target).is(this)) {
98	+ return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params
99	+ }
100
101	+ return undefined; // eslint-disable-line no-undefined
102	+ }
103	+ };
104	+ }
105
106	+ function transitionEndEmulator(duration) {
107	+ var _this = this;

108
109	+ var called = false;
110	+ $$$1(this).one(Util.TRANSITION_END, function () {
111	+ called = true;
112	+ });
113	+ setTimeout(function () {
114	+ if (!called) {
115	+ Util.triggerTransitionEnd(_this);
116	+ }
117	+ }, duration);
118	+ return this;
119	+ }
120
121	+ function setTransitionEndSupport() {
122	+ $$$1.fn.emulateTransitionEnd = transitionEndEmulator;
123	+ $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
124	+ }
125	+ /**
126	+ * --------------------------------------------------------------------------
127	+ * Public Util Api
128	+ * --------------------------------------------------------------------------
129	+ */
130
131	+
132	+ var Util = {
133	+ TRANSITION_END: 'bsTransitionEnd',
134	+ getUID: function getUID(prefix) {
135	+ do {
136	+ // eslint-disable-next-line no-bitwise
137	+ prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here
138	+ } while (document.getElementById(prefix));
139	+
140	+ return prefix;
141	+ },
142	+ getSelectorFromElement: function getSelectorFromElement(element) {
143	+ var selector = element.getAttribute('data-target');
144	+
145	+ if (!selector \|\| selector === '#') {
146	+ selector = element.getAttribute('href') \|\| '';
147	+ }
148	+
149	+ try {
150	+ var $selector = $$$1(document).find(selector);
151	+ return $selector.length > 0 ? selector : null;
152	+ } catch (err) {
153	+ return null;
154	+ }
155	+ },
156	+ getTransitionDurationFromElement: function getTransitionDurationFromElement(element) {
157	+ if (!element) {
158	+ return 0;
159	+ } // Get transition-duration of the element
160	+
161	+
162	+ var transitionDuration = $$$1(element).css('transition-duration');
163	+ var floatTransitionDuration = parseFloat(transitionDuration); // Return 0 if element or transition duration is not found
164	+
165	+ if (!floatTransitionDuration) {
166	+ return 0;
167	+ } // If multiple durations are defined, take the first
168	+
169	+
170	+ transitionDuration = transitionDuration.split(',')[0];
171	+ return parseFloat(transitionDuration) * MILLISECONDS_MULTIPLIER;
172	+ },
173	+ reflow: function reflow(element) {
174	+ return element.offsetHeight;
175	+ },
176	+ triggerTransitionEnd: function triggerTransitionEnd(element) {
177	+ $$$1(element).trigger(TRANSITION_END);
178	+ },
179	+ // TODO: Remove in v5
180	+ supportsTransitionEnd: function supportsTransitionEnd() {
181	+ return Boolean(TRANSITION_END);
182	+ },
183	+ isElement: function isElement(obj) {
184	+ return (obj[0] \|\| obj).nodeType;
185	+ },
186	+ typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
187	+ for (var property in configTypes) {
188	+ if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
189	+ var expectedTypes = configTypes[property];
190	+ var value = config[property];
191	+ var valueType = value && Util.isElement(value) ? 'element' : toType(value);
192	+
193	+ if (!new RegExp(expectedTypes).test(valueType)) {
194	+ throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\"."));
195	+ }
196	}
197	}
198	}
199	+ };
200	+ setTransitionEndSupport();
201	+ return Util;
202	+ }($);
203	+









204	/**
205	+ * --------------------------------------------------------------------------
206	+ * Bootstrap (v4.1.0): alert.js
207	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
208	+ * --------------------------------------------------------------------------
209	*/
210	+
211	+ var Alert = function ($$$1) {

















212	/**
213	* ------------------------------------------------------------------------
214	+ * Constants
215	* ------------------------------------------------------------------------
216	*/
217	+ var NAME = 'alert';
218	+ var VERSION = '4.1.0';
219	+ var DATA_KEY = 'bs.alert';
220	+ var EVENT_KEY = "." + DATA_KEY;
221	+ var DATA_API_KEY = '.data-api';
222	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
223	+ var Selector = {
224	+ DISMISS: '[data-dismiss="alert"]'
225	+ };
226	+ var Event = {
227	+ CLOSE: "close" + EVENT_KEY,
228	+ CLOSED: "closed" + EVENT_KEY,
229	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
230	+ };
231	+ var ClassName = {
232	+ ALERT: 'alert',
233	+ FADE: 'fade',
234	+ SHOW: 'show'
235	+ /**
236	+ * ------------------------------------------------------------------------
237	+ * Class Definition
238	+ * ------------------------------------------------------------------------
239	+ */
240
241	+ };
242
243	+ var Alert =
244	+ /#__PURE__/
245	+ function () {
246	+ function Alert(element) {
247	+ this._element = element;
248	+ } // Getters
249
250
251	+ var _proto = Alert.prototype;
252
253	+ // Public
254	+ _proto.close = function close(element) {
255	+ element = element \|\| this._element;
256
257	+ var rootElement = this._getRootElement(element);
258
259	+ var customEvent = this._triggerCloseEvent(rootElement);
260
261	+ if (customEvent.isDefaultPrevented()) {
262	+ return;
263	+ }
264
265	+ this._removeElement(rootElement);
266	+ };
267
268	+ _proto.dispose = function dispose() {
269	+ $$$1.removeData(this._element, DATA_KEY);
270	+ this._element = null;
271	+ }; // Private
272
273
274	+ _proto._getRootElement = function _getRootElement(element) {
275	+ var selector = Util.getSelectorFromElement(element);
276	+ var parent = false;
277
278	+ if (selector) {
279	+ parent = $$$1(selector)[0];
280	+ }
281
282	+ if (!parent) {
283	+ parent = $$$1(element).closest("." + ClassName.ALERT)[0];
284	+ }
285
286	+ return parent;
287	+ };
288
289	+ _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
290	+ var closeEvent = $$$1.Event(Event.CLOSE);
291	+ $$$1(element).trigger(closeEvent);
292	+ return closeEvent;
293	+ };
294
295	+ _proto._removeElement = function _removeElement(element) {
296	+ var _this = this;
297
298	+ $$$1(element).removeClass(ClassName.SHOW);
299
300	+ if (!$$$1(element).hasClass(ClassName.FADE)) {
301	+ this._destroyElement(element);
302
303	+ return;
304	+ }
305
306	+ var transitionDuration = Util.getTransitionDurationFromElement(element);
307	+ $$$1(element).one(Util.TRANSITION_END, function (event) {
308	+ return _this._destroyElement(element, event);
309	+ }).emulateTransitionEnd(transitionDuration);
310	+ };
311
312	+ _proto._destroyElement = function _destroyElement(element) {
313	+ $$$1(element).detach().trigger(Event.CLOSED).remove();
314	+ }; // Static
315
316
317	+ Alert._jQueryInterface = function _jQueryInterface(config) {
318	+ return this.each(function () {
319	+ var $element = $$$1(this);
320	+ var data = $element.data(DATA_KEY);
321
322	+ if (!data) {
323	+ data = new Alert(this);
324	+ $element.data(DATA_KEY, data);
325	+ }
326
327	+ if (config === 'close') {
328	+ data[config](this);
329	+ }
330	+ });
331	+ };
332
333	+ Alert._handleDismiss = function _handleDismiss(alertInstance) {
334	+ return function (event) {
335	+ if (event) {
336	+ event.preventDefault();
337	+ }
338
339	+ alertInstance.close(this);
340	+ };
341	};

342
343	+ _createClass(Alert, null, [{
344	+ key: "VERSION",
345	+ get: function get() {
346	+ return VERSION;
347	+ }
348	+ }]);







349
350	+ return Alert;
351	+ }();
352	+ /**
353	+ * ------------------------------------------------------------------------
354	+ * Data Api implementation
355	+ * ------------------------------------------------------------------------
356	+ */
357






358
359	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert()));
360	+ /**
361	+ * ------------------------------------------------------------------------
362	+ * jQuery
363	+ * ------------------------------------------------------------------------
364	+ */
365
366	+ $$$1.fn[NAME] = Alert._jQueryInterface;
367	+ $$$1.fn[NAME].Constructor = Alert;


368
369	+ $$$1.fn[NAME].noConflict = function () {
370	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
371	+ return Alert._jQueryInterface;
372	+ };
373
374	+ return Alert;
375	+ }($);




376

377	/**
378	+ * --------------------------------------------------------------------------
379	+ * Bootstrap (v4.1.0): button.js
380	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
381	+ * --------------------------------------------------------------------------
382	*/
383	+
384	+ var Button = function ($$$1) {



















385	/**
386	* ------------------------------------------------------------------------
387	+ * Constants
388	* ------------------------------------------------------------------------
389	*/
390	+ var NAME = 'button';
391	+ var VERSION = '4.1.0';
392	+ var DATA_KEY = 'bs.button';
393	+ var EVENT_KEY = "." + DATA_KEY;
394	+ var DATA_API_KEY = '.data-api';
395	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
396	+ var ClassName = {
397	+ ACTIVE: 'active',
398	+ BUTTON: 'btn',
399	+ FOCUS: 'focus'
400	+ };
401	+ var Selector = {
402	+ DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
403	+ DATA_TOGGLE: '[data-toggle="buttons"]',
404	+ INPUT: 'input',
405	+ ACTIVE: '.active',
406	+ BUTTON: '.btn'
407	+ };
408	+ var Event = {
409	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
410	+ FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY)
411	+ /**
412	+ * ------------------------------------------------------------------------
413	+ * Class Definition
414	+ * ------------------------------------------------------------------------
415	+ */
416
417	+ };
418
419	+ var Button =
420	+ /#__PURE__/
421	+ function () {
422	+ function Button(element) {
423	+ this._element = element;
424	+ } // Getters
425
426
427	+ var _proto = Button.prototype;
428
429	+ // Public
430	+ _proto.toggle = function toggle() {
431	+ var triggerChangeEvent = true;
432	+ var addAriaPressed = true;
433	+ var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
434
435	+ if (rootElement) {
436	+ var input = $$$1(this._element).find(Selector.INPUT)[0];
437
438	+ if (input) {
439	+ if (input.type === 'radio') {
440	+ if (input.checked && $$$1(this._element).hasClass(ClassName.ACTIVE)) {
441	+ triggerChangeEvent = false;
442	+ } else {
443	+ var activeElement = $$$1(rootElement).find(Selector.ACTIVE)[0];
444
445	+ if (activeElement) {
446	+ $$$1(activeElement).removeClass(ClassName.ACTIVE);
447	+ }
448	}
449	}

450
451	+ if (triggerChangeEvent) {
452	+ if (input.hasAttribute('disabled') \|\| rootElement.hasAttribute('disabled') \|\| input.classList.contains('disabled') \|\| rootElement.classList.contains('disabled')) {
453	+ return;
454	+ }
455	+
456	+ input.checked = !$$$1(this._element).hasClass(ClassName.ACTIVE);
457	+ $$$1(input).trigger('change');
458	}
459
460	+ input.focus();
461	+ addAriaPressed = false;
462	}
463	+ }
464
465	+ if (addAriaPressed) {
466	+ this._element.setAttribute('aria-pressed', !$$$1(this._element).hasClass(ClassName.ACTIVE));
467	}

468
469	+ if (triggerChangeEvent) {
470	+ $$$1(this._element).toggleClass(ClassName.ACTIVE);
471	+ }
472	+ };
473
474	+ _proto.dispose = function dispose() {
475	+ $$$1.removeData(this._element, DATA_KEY);
476	+ this._element = null;
477	+ }; // Static
478




479
480	+ Button._jQueryInterface = function _jQueryInterface(config) {
481	+ return this.each(function () {
482	+ var data = $$$1(this).data(DATA_KEY);
483
484	+ if (!data) {
485	+ data = new Button(this);
486	+ $$$1(this).data(DATA_KEY, data);
487	+ }
488
489	+ if (config === 'toggle') {
490	+ data[config]();
491	+ }
492	+ });
493	+ };
494
495	+ _createClass(Button, null, [{
496	+ key: "VERSION",
497	+ get: function get() {
498	+ return VERSION;
499	}
500	+ }]);















501
502	+ return Button;
503	+ }();
504	+ /**
505	+ * ------------------------------------------------------------------------
506	+ * Data Api implementation
507	+ * ------------------------------------------------------------------------
508	+ */
509



510
511	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
512	+ event.preventDefault();
513	+ var button = event.target;
514
515	+ if (!$$$1(button).hasClass(ClassName.BUTTON)) {
516	+ button = $$$1(button).closest(Selector.BUTTON);
517	+ }







518
519	+ Button._jQueryInterface.call($$$1(button), 'toggle');
520	+ }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
521	+ var button = $$$1(event.target).closest(Selector.BUTTON)[0];
522	+ $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type));
523	+ });
524	+ /**
525	+ * ------------------------------------------------------------------------
526	+ * jQuery
527	+ * ------------------------------------------------------------------------
528	+ */
529
530	+ $$$1.fn[NAME] = Button._jQueryInterface;
531	+ $$$1.fn[NAME].Constructor = Button;


532
533	+ $$$1.fn[NAME].noConflict = function () {
534	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
535	+ return Button._jQueryInterface;
536	+ };
537
538	+ return Button;
539	+ }($);




540

541	/**
542	+ * --------------------------------------------------------------------------
543	+ * Bootstrap (v4.1.0): carousel.js
544	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
545	+ * --------------------------------------------------------------------------
546	*/
547	+
548	+ var Carousel = function ($$$1) {



























































549	/**
550	* ------------------------------------------------------------------------
551	+ * Constants
552	* ------------------------------------------------------------------------
553	*/
554	+ var NAME = 'carousel';
555	+ var VERSION = '4.1.0';
556	+ var DATA_KEY = 'bs.carousel';
557	+ var EVENT_KEY = "." + DATA_KEY;
558	+ var DATA_API_KEY = '.data-api';
559	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
560	+ var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key
561	+
562	+ var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key
563	+
564	+ var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
565	+
566	+ var Default = {
567	+ interval: 5000,
568	+ keyboard: true,
569	+ slide: false,
570	+ pause: 'hover',
571	+ wrap: true
572	+ };
573	+ var DefaultType = {
574	+ interval: '(number\|boolean)',
575	+ keyboard: 'boolean',
576	+ slide: '(boolean\|string)',
577	+ pause: '(string\|boolean)',
578	+ wrap: 'boolean'
579	+ };
580	+ var Direction = {
581	+ NEXT: 'next',
582	+ PREV: 'prev',
583	+ LEFT: 'left',
584	+ RIGHT: 'right'
585	+ };
586	+ var Event = {
587	+ SLIDE: "slide" + EVENT_KEY,
588	+ SLID: "slid" + EVENT_KEY,
589	+ KEYDOWN: "keydown" + EVENT_KEY,
590	+ MOUSEENTER: "mouseenter" + EVENT_KEY,
591	+ MOUSELEAVE: "mouseleave" + EVENT_KEY,
592	+ TOUCHEND: "touchend" + EVENT_KEY,
593	+ LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY,
594	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
595	+ };
596	+ var ClassName = {
597	+ CAROUSEL: 'carousel',
598	+ ACTIVE: 'active',
599	+ SLIDE: 'slide',
600	+ RIGHT: 'carousel-item-right',
601	+ LEFT: 'carousel-item-left',
602	+ NEXT: 'carousel-item-next',
603	+ PREV: 'carousel-item-prev',
604	+ ITEM: 'carousel-item'
605	+ };
606	+ var Selector = {
607	+ ACTIVE: '.active',
608	+ ACTIVE_ITEM: '.active.carousel-item',
609	+ ITEM: '.carousel-item',
610	+ NEXT_PREV: '.carousel-item-next, .carousel-item-prev',
611	+ INDICATORS: '.carousel-indicators',
612	+ DATA_SLIDE: '[data-slide], [data-slide-to]',
613	+ DATA_RIDE: '[data-ride="carousel"]'
614	+ /**
615	+ * ------------------------------------------------------------------------
616	+ * Class Definition
617	+ * ------------------------------------------------------------------------
618	+ */
619
620	+ };

















621
622	+ var Carousel =
623	+ /#__PURE__/
624	+ function () {
625	+ function Carousel(element, config) {
626	+ this._items = null;
627	+ this._interval = null;
628	+ this._activeElement = null;
629	+ this._isPaused = false;
630	+ this._isSliding = false;
631	+ this.touchTimeout = null;
632	+ this._config = this._getConfig(config);
633	+ this._element = $$$1(element)[0];
634	+ this._indicatorsElement = $$$1(this._element).find(Selector.INDICATORS)[0];
635
636	+ this._addEventListeners();
637	+ } // Getters
638






639
640	+ var _proto = Carousel.prototype;






641
642	+ // Public
643	+ _proto.next = function next() {
644	+ if (!this._isSliding) {
645	+ this._slide(Direction.NEXT);
646	+ }
647	+ };
648
649	+ _proto.nextWhenVisible = function nextWhenVisible() {
650	+ // Don't call next when the page isn't visible
651	+ // or the carousel or its parent isn't visible
652	+ if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') {
653	+ this.next();
654	+ }
655	+ };
656
657	+ _proto.prev = function prev() {
658	+ if (!this._isSliding) {
659	+ this._slide(Direction.PREV);
660	+ }
661	+ };
662
663	+ _proto.pause = function pause(event) {
664	+ if (!event) {
665	+ this._isPaused = true;
666	+ }
667
668	+ if ($$$1(this._element).find(Selector.NEXT_PREV)[0]) {
669	+ Util.triggerTransitionEnd(this._element);
670	+ this.cycle(true);
671	+ }
672

673	clearInterval(this._interval);
674	this._interval = null;
675	+ };
676
677	+ _proto.cycle = function cycle(event) {
678	+ if (!event) {
679	+ this._isPaused = false;
680	+ }
681
682	+ if (this._interval) {
683	+ clearInterval(this._interval);
684	+ this._interval = null;
685	+ }
686	+
687	+ if (this._config.interval && !this._isPaused) {
688	+ this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
689	+ }
690	+ };
691
692	+ _proto.to = function to(index) {
693	+ var _this = this;
694
695	+ this._activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
696
697	+ var activeIndex = this._getItemIndex(this._activeElement);


698
699	+ if (index > this._items.length - 1 \|\| index < 0) {
700	+ return;
701	+ }



702
703	+ if (this._isSliding) {
704	+ $$$1(this._element).one(Event.SLID, function () {
705	+ return _this.to(index);
706	+ });
707	+ return;
708	+ }
709
710	+ if (activeIndex === index) {
711	+ this.pause();
712	+ this.cycle();
713	+ return;
714	+ }
715
716	+ var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;

717
718	+ this._slide(direction, this._items[index]);
719	+ };

















720
721	+ _proto.dispose = function dispose() {
722	+ $$$1(this._element).off(EVENT_KEY);
723	+ $$$1.removeData(this._element, DATA_KEY);
724	+ this._items = null;
725	+ this._config = null;
726	+ this._element = null;
727	+ this._interval = null;
728	+ this._isPaused = null;
729	+ this._isSliding = null;
730	+ this._activeElement = null;
731	+ this._indicatorsElement = null;
732	+ }; // Private
733





734
735	+ _proto._getConfig = function _getConfig(config) {
736	+ config = _objectSpread({}, Default, config);
737	+ Util.typeCheckConfig(NAME, config, DefaultType);
738	+ return config;
739	+ };

740
741	+ _proto._addEventListeners = function _addEventListeners() {
742	+ var _this2 = this;












743
744	+ if (this._config.keyboard) {
745	+ $$$1(this._element).on(Event.KEYDOWN, function (event) {
746	+ return _this2._keydown(event);
747	});
748	}


749
750	+ if (this._config.pause === 'hover') {
751	+ $$$1(this._element).on(Event.MOUSEENTER, function (event) {
752	+ return _this2.pause(event);
753	+ }).on(Event.MOUSELEAVE, function (event) {
754	+ return _this2.cycle(event);
755	+ });


















756
757	+ if ('ontouchstart' in document.documentElement) {
758	+ // If it's a touch-enabled device, mouseenter/leave are fired as
759	+ // part of the mouse compatibility events on first tap - the carousel
760	+ // would stop cycling until user tapped out of it;
761	+ // here, we listen for touchend, explicitly pause the carousel
762	+ // (as if it's the second time we tap on it, mouseenter compat event
763	+ // is NOT fired) and after a timeout (to allow for mouse compatibility
764	+ // events to fire) we explicitly restart cycling
765	+ $$$1(this._element).on(Event.TOUCHEND, function () {
766	+ _this2.pause();
767	+
768	+ if (_this2.touchTimeout) {
769	+ clearTimeout(_this2.touchTimeout);
770	+ }
771
772	+ _this2.touchTimeout = setTimeout(function (event) {
773	+ return _this2.cycle(event);
774	+ }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval);
775	+ });
776	+ }
777	+ }
778	+ };
779
780	+ _proto._keydown = function _keydown(event) {
781	+ if (/input\|textarea/i.test(event.target.tagName)) {
782	+ return;
783	+ }
784
785	+ switch (event.which) {
786	+ case ARROW_LEFT_KEYCODE:
787	+ event.preventDefault();
788	+ this.prev();
789	+ break;
790
791	+ case ARROW_RIGHT_KEYCODE:
792	+ event.preventDefault();
793	+ this.next();
794	+ break;
795
796	+ default:
797	+ }
798	+ };
799
800	+ _proto._getItemIndex = function _getItemIndex(element) {
801	+ this._items = $$$1.makeArray($$$1(element).parent().find(Selector.ITEM));
802	+ return this._items.indexOf(element);
803	+ };
804
805	+ _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
806	+ var isNextDirection = direction === Direction.NEXT;
807	+ var isPrevDirection = direction === Direction.PREV;






808
809	+ var activeIndex = this._getItemIndex(activeElement);


810
811	+ var lastItemIndex = this._items.length - 1;
812	+ var isGoingToWrap = isPrevDirection && activeIndex === 0 \|\| isNextDirection && activeIndex === lastItemIndex;
813
814	+ if (isGoingToWrap && !this._config.wrap) {
815	+ return activeElement;
816	}


817
818	+ var delta = direction === Direction.PREV ? -1 : 1;
819	+ var itemIndex = (activeIndex + delta) % this._items.length;
820	+ return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
821	+ };
822
823	+ _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
824	+ var targetIndex = this._getItemIndex(relatedTarget);
825
826	+ var fromIndex = this._getItemIndex($$$1(this._element).find(Selector.ACTIVE_ITEM)[0]);
827
828	+ var slideEvent = $$$1.Event(Event.SLIDE, {
829	+ relatedTarget: relatedTarget,
830	+ direction: eventDirectionName,
831	+ from: fromIndex,
832	+ to: targetIndex
833	+ });
834	+ $$$1(this._element).trigger(slideEvent);
835	+ return slideEvent;
836	+ };
837
838	+ _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
839	+ if (this._indicatorsElement) {
840	+ $$$1(this._indicatorsElement).find(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
841
842	+ var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];



843
844	+ if (nextIndicator) {
845	+ $$$1(nextIndicator).addClass(ClassName.ACTIVE);
846	+ }
847	+ }
848	+ };









849
850	+ _proto._slide = function _slide(direction, element) {
851	+ var _this3 = this;
852
853	+ var activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];


854
855	+ var activeElementIndex = this._getItemIndex(activeElement);



856
857	+ var nextElement = element \|\| activeElement && this._getItemByDirection(direction, activeElement);
858
859	+ var nextElementIndex = this._getItemIndex(nextElement);


860
861	+ var isCycling = Boolean(this._interval);
862	+ var directionalClassName;
863	+ var orderClassName;
864	+ var eventDirectionName;
865
866	+ if (direction === Direction.NEXT) {
867	+ directionalClassName = ClassName.LEFT;
868	+ orderClassName = ClassName.NEXT;
869	+ eventDirectionName = Direction.LEFT;
870	+ } else {
871	+ directionalClassName = ClassName.RIGHT;
872	+ orderClassName = ClassName.PREV;
873	+ eventDirectionName = Direction.RIGHT;
874	+ }
875
876	+ if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) {
877	+ this._isSliding = false;
878	+ return;
879	+ }















880
881	+ var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);



882
883	+ if (slideEvent.isDefaultPrevented()) {
884	+ return;
885	+ }
886
887	+ if (!activeElement \|\| !nextElement) {
888	+ // Some weirdness is happening, so we bail
889	+ return;
890	+ }
891
892	+ this._isSliding = true;
893
894	+ if (isCycling) {
895	+ this.pause();
896	}
897
898	+ this._setActiveIndicatorElement(nextElement);
899	+
900	+ var slidEvent = $$$1.Event(Event.SLID, {
901	+ relatedTarget: nextElement,
902	+ direction: eventDirectionName,
903	+ from: activeElementIndex,
904	+ to: nextElementIndex
905	+ });
906	+
907	+ if ($$$1(this._element).hasClass(ClassName.SLIDE)) {
908	+ $$$1(nextElement).addClass(orderClassName);
909	+ Util.reflow(nextElement);
910	+ $$$1(activeElement).addClass(directionalClassName);
911	+ $$$1(nextElement).addClass(directionalClassName);
912	+ var transitionDuration = Util.getTransitionDurationFromElement(activeElement);
913	+ $$$1(activeElement).one(Util.TRANSITION_END, function () {
914	+ $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE);
915	+ $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName);
916	+ _this3._isSliding = false;
917	+ setTimeout(function () {
918	+ return $$$1(_this3._element).trigger(slidEvent);
919	+ }, 0);
920	+ }).emulateTransitionEnd(transitionDuration);
921	+ } else {
922	+ $$$1(activeElement).removeClass(ClassName.ACTIVE);
923	+ $$$1(nextElement).addClass(ClassName.ACTIVE);
924	+ this._isSliding = false;
925	+ $$$1(this._element).trigger(slidEvent);
926	+ }
927
928	+ if (isCycling) {
929	+ this.cycle();

930	}
931	+ }; // Static
932	+
933	+
934	+ Carousel._jQueryInterface = function _jQueryInterface(config) {
935	+ return this.each(function () {
936	+ var data = $$$1(this).data(DATA_KEY);
937	+
938	+ var _config = _objectSpread({}, Default, $$$1(this).data());
939	+
940	+ if (typeof config === 'object') {
941	+ _config = _objectSpread({}, _config, config);
942	+ }
943
944	+ var action = typeof config === 'string' ? config : _config.slide;
945	+
946	+ if (!data) {
947	+ data = new Carousel(this, _config);
948	+ $$$1(this).data(DATA_KEY, data);
949	+ }
950	+
951	+ if (typeof config === 'number') {
952	+ data.to(config);
953	+ } else if (typeof action === 'string') {
954	+ if (typeof data[action] === 'undefined') {
955	+ throw new TypeError("No method named \"" + action + "\"");
956	+ }
957	+
958	+ data[action]();
959	+ } else if (_config.interval) {
960	+ data.pause();
961	+ data.cycle();
962	}
963	+ });
964	+ };
965	+
966	+ Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
967	+ var selector = Util.getSelectorFromElement(this);
968
969	+ if (!selector) {
970	+ return;


971	}


972
973	+ var target = $$$1(selector)[0];

974
975	+ if (!target \|\| !$$$1(target).hasClass(ClassName.CAROUSEL)) {
976	+ return;
977	+ }
978
979	+ var config = _objectSpread({}, $$$1(target).data(), $$$1(this).data());
980
981	+ var slideIndex = this.getAttribute('data-slide-to');


982
983	+ if (slideIndex) {
984	+ config.interval = false;
985	+ }
986
987	+ Carousel._jQueryInterface.call($$$1(target), config);


988
989	+ if (slideIndex) {
990	+ $$$1(target).data(DATA_KEY).to(slideIndex);
991	+ }
992
993	+ event.preventDefault();
994	+ };

995
996	+ _createClass(Carousel, null, [{
997	+ key: "VERSION",
998	+ get: function get() {
999	+ return VERSION;
1000	+ }
1001	+ }, {
1002	+ key: "Default",
1003	+ get: function get() {
1004	+ return Default;
1005	+ }
1006	+ }]);
1007
1008	+ return Carousel;
1009	+ }();
1010	+ /**
1011	+ * ------------------------------------------------------------------------
1012	+ * Data Api implementation
1013	+ * ------------------------------------------------------------------------
1014	+ */











1015
1016
1017	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
1018	+ $$$1(window).on(Event.LOAD_DATA_API, function () {
1019	+ $$$1(Selector.DATA_RIDE).each(function () {
1020	+ var $carousel = $$$1(this);
1021
1022	+ Carousel._jQueryInterface.call($carousel, $carousel.data());
1023	+ });
1024	});
1025	+ /**
1026	+ * ------------------------------------------------------------------------
1027	+ * jQuery
1028	+ * ------------------------------------------------------------------------
1029	+ */




1030
1031	+ $$$1.fn[NAME] = Carousel._jQueryInterface;
1032	+ $$$1.fn[NAME].Constructor = Carousel;


1033
1034	+ $$$1.fn[NAME].noConflict = function () {
1035	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
1036	+ return Carousel._jQueryInterface;
1037	+ };
1038
1039	+ return Carousel;
1040	+ }($);




1041

1042	/**
1043	+ * --------------------------------------------------------------------------
1044	+ * Bootstrap (v4.1.0): collapse.js
1045	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
1046	+ * --------------------------------------------------------------------------
1047	*/
1048	+
1049	+ var Collapse = function ($$$1) {

































1050	/**
1051	* ------------------------------------------------------------------------
1052	+ * Constants
1053	* ------------------------------------------------------------------------
1054	*/
1055	+ var NAME = 'collapse';
1056	+ var VERSION = '4.1.0';
1057	+ var DATA_KEY = 'bs.collapse';
1058	+ var EVENT_KEY = "." + DATA_KEY;
1059	+ var DATA_API_KEY = '.data-api';
1060	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
1061	+ var Default = {
1062	+ toggle: true,
1063	+ parent: ''
1064	+ };
1065	+ var DefaultType = {
1066	+ toggle: 'boolean',
1067	+ parent: '(string\|element)'
1068	+ };
1069	+ var Event = {
1070	+ SHOW: "show" + EVENT_KEY,
1071	+ SHOWN: "shown" + EVENT_KEY,
1072	+ HIDE: "hide" + EVENT_KEY,
1073	+ HIDDEN: "hidden" + EVENT_KEY,
1074	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
1075	+ };
1076	+ var ClassName = {
1077	+ SHOW: 'show',
1078	+ COLLAPSE: 'collapse',
1079	+ COLLAPSING: 'collapsing',
1080	+ COLLAPSED: 'collapsed'
1081	+ };
1082	+ var Dimension = {
1083	+ WIDTH: 'width',
1084	+ HEIGHT: 'height'
1085	+ };
1086	+ var Selector = {
1087	+ ACTIVES: '.show, .collapsing',
1088	+ DATA_TOGGLE: '[data-toggle="collapse"]'
1089	+ /**
1090	+ * ------------------------------------------------------------------------
1091	+ * Class Definition
1092	+ * ------------------------------------------------------------------------
1093	+ */
1094
1095	+ };
1096
1097	+ var Collapse =
1098	+ /#__PURE__/
1099	+ function () {
1100	+ function Collapse(element, config) {
1101	+ this._isTransitioning = false;
1102	+ this._element = element;
1103	+ this._config = this._getConfig(config);
1104	+ this._triggerArray = $$$1.makeArray($$$1("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
1105	+ var tabToggles = $$$1(Selector.DATA_TOGGLE);
1106
1107	+ for (var i = 0; i < tabToggles.length; i++) {
1108	+ var elem = tabToggles[i];
1109	+ var selector = Util.getSelectorFromElement(elem);
1110
1111	+ if (selector !== null && $$$1(selector).filter(element).length > 0) {
1112	+ this._selector = selector;
1113
1114	+ this._triggerArray.push(elem);
1115	+ }
1116	}

1117
1118	+ this._parent = this._config.parent ? this._getParent() : null;
1119
1120	+ if (!this._config.parent) {
1121	+ this._addAriaAndCollapsedClass(this._element, this._triggerArray);
1122	+ }
1123
1124	+ if (this._config.toggle) {
1125	+ this.toggle();
1126	+ }
1127	+ } // Getters
1128
1129
1130	+ var _proto = Collapse.prototype;
1131
1132	+ // Public
1133	+ _proto.toggle = function toggle() {
1134	+ if ($$$1(this._element).hasClass(ClassName.SHOW)) {
1135	+ this.hide();
1136	+ } else {
1137	+ this.show();
1138	+ }
1139	+ };
1140
1141	+ _proto.show = function show() {
1142	+ var _this = this;
1143
1144	+ if (this._isTransitioning \|\| $$$1(this._element).hasClass(ClassName.SHOW)) {
1145	+ return;
1146	+ }
1147
1148	+ var actives;
1149	+ var activesData;
1150
1151	+ if (this._parent) {
1152	+ actives = $$$1.makeArray($$$1(this._parent).find(Selector.ACTIVES).filter("[data-parent=\"" + this._config.parent + "\"]"));
1153
1154	+ if (actives.length === 0) {
1155	+ actives = null;
1156	+ }
1157	}

1158
1159	+ if (actives) {
1160	+ activesData = $$$1(actives).not(this._selector).data(DATA_KEY);
1161
1162	+ if (activesData && activesData._isTransitioning) {
1163	+ return;
1164	+ }
1165	}

1166
1167	+ var startEvent = $$$1.Event(Event.SHOW);
1168	+ $$$1(this._element).trigger(startEvent);
1169
1170	+ if (startEvent.isDefaultPrevented()) {
1171	+ return;
1172	+ }
1173
1174	+ if (actives) {
1175	+ Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide');
1176
1177	+ if (!activesData) {
1178	+ $$$1(actives).data(DATA_KEY, null);
1179	+ }
1180	}



1181
1182	+ var dimension = this._getDimension();

1183
1184	+ $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
1185	+ this._element.style[dimension] = 0;

1186
1187	+ if (this._triggerArray.length > 0) {
1188	+ $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
1189	+ }
1190
1191	+ this.setTransitioning(true);


1192
1193	+ var complete = function complete() {
1194	+ $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW);
1195	+ _this._element.style[dimension] = '';
1196
1197	+ _this.setTransitioning(false);

1198
1199	+ $$$1(_this._element).trigger(Event.SHOWN);
1200	+ };


1201
1202	+ var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
1203	+ var scrollSize = "scroll" + capitalizedDimension;
1204	+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
1205	+ $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
1206	+ this._element.style[dimension] = this._element[scrollSize] + "px";
1207	+ };
1208
1209	+ _proto.hide = function hide() {
1210	+ var _this2 = this;
1211
1212	+ if (this._isTransitioning \|\| !$$$1(this._element).hasClass(ClassName.SHOW)) {
1213	+ return;
1214	+ }
1215
1216	+ var startEvent = $$$1.Event(Event.HIDE);
1217	+ $$$1(this._element).trigger(startEvent);
1218
1219	+ if (startEvent.isDefaultPrevented()) {
1220	+ return;
1221	+ }
1222
1223	+ var dimension = this._getDimension();
1224
1225	+ this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
1226	+ Util.reflow(this._element);
1227	+ $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
1228
1229	+ if (this._triggerArray.length > 0) {
1230	+ for (var i = 0; i < this._triggerArray.length; i++) {
1231	+ var trigger = this._triggerArray[i];
1232	+ var selector = Util.getSelectorFromElement(trigger);
1233
1234	+ if (selector !== null) {
1235	+ var $elem = $$$1(selector);
1236
1237	+ if (!$elem.hasClass(ClassName.SHOW)) {
1238	+ $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
1239	+ }
1240	}
1241	}
1242	}



1243
1244	+ this.setTransitioning(true);




1245
1246	+ var complete = function complete() {
1247	+ _this2.setTransitioning(false);
1248
1249	+ $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN);
1250	+ };


1251
1252	+ this._element.style[dimension] = '';
1253	+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
1254	+ $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
1255	+ };
1256
1257	+ _proto.setTransitioning = function setTransitioning(isTransitioning) {
1258	+ this._isTransitioning = isTransitioning;
1259	+ };
1260
1261	+ _proto.dispose = function dispose() {
1262	+ $$$1.removeData(this._element, DATA_KEY);
1263	+ this._config = null;
1264	+ this._parent = null;
1265	+ this._element = null;
1266	+ this._triggerArray = null;
1267	+ this._isTransitioning = null;
1268	+ }; // Private
1269
1270
1271	+ _proto._getConfig = function _getConfig(config) {
1272	+ config = _objectSpread({}, Default, config);
1273	+ config.toggle = Boolean(config.toggle); // Coerce string values
1274
1275	+ Util.typeCheckConfig(NAME, config, DefaultType);
1276	+ return config;
1277	+ };
1278
1279	+ _proto._getDimension = function _getDimension() {
1280	+ var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH);
1281	+ return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
1282	+ };
1283
1284	+ _proto._getParent = function _getParent() {
1285	+ var _this3 = this;
1286
1287	+ var parent = null;
1288
1289	+ if (Util.isElement(this._config.parent)) {
1290	+ parent = this._config.parent; // It's a jQuery object
1291
1292	+ if (typeof this._config.parent.jquery !== 'undefined') {
1293	+ parent = this._config.parent[0];
1294	+ }
1295	+ } else {
1296	+ parent = $$$1(this._config.parent)[0];
1297	}



1298
1299	+ var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
1300	+ $$$1(parent).find(selector).each(function (i, element) {
1301	+ _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
1302	+ });
1303	+ return parent;
1304	+ };
1305
1306	+ _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
1307	+ if (element) {
1308	+ var isOpen = $$$1(element).hasClass(ClassName.SHOW);
1309
1310	+ if (triggerArray.length > 0) {
1311	+ $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
1312	+ }
1313	}
1314	+ }; // Static

1315
1316
1317	+ Collapse._getTargetFromElement = function _getTargetFromElement(element) {
1318	+ var selector = Util.getSelectorFromElement(element);
1319	+ return selector ? $$$1(selector)[0] : null;
1320	+ };
1321
1322	+ Collapse._jQueryInterface = function _jQueryInterface(config) {
1323	+ return this.each(function () {
1324	+ var $this = $$$1(this);
1325	+ var data = $this.data(DATA_KEY);
1326
1327	+ var _config = _objectSpread({}, Default, $this.data(), typeof config === 'object' && config);
1328
1329	+ if (!data && _config.toggle && /show\|hide/.test(config)) {
1330	+ _config.toggle = false;
1331	+ }
1332
1333	+ if (!data) {
1334	+ data = new Collapse(this, _config);
1335	+ $this.data(DATA_KEY, data);
1336	+ }
1337	+
1338	+ if (typeof config === 'string') {
1339	+ if (typeof data[config] === 'undefined') {
1340	+ throw new TypeError("No method named \"" + config + "\"");
1341	+ }
1342
1343	+ data[config]();


1344	}
1345	+ });
1346	+ };
1347
1348	+ _createClass(Collapse, null, [{
1349	+ key: "VERSION",
1350	+ get: function get() {
1351	+ return VERSION;
1352	}
1353	+ }, {
1354	+ key: "Default",
1355	+ get: function get() {
1356	+ return Default;
1357	+ }
1358	+ }]);
1359
1360	+ return Collapse;
1361	+ }();
1362	+ /**
1363	+ * ------------------------------------------------------------------------
1364	+ * Data Api implementation
1365	+ * ------------------------------------------------------------------------
1366	+ */











1367
1368
1369	+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
1370	+ // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
1371	+ if (event.currentTarget.tagName === 'A') {
1372	+ event.preventDefault();
1373	+ }
1374
1375	+ var $trigger = $$$1(this);
1376	+ var selector = Util.getSelectorFromElement(this);
1377	+ $$$1(selector).each(function () {
1378	+ var $target = $$$1(this);
1379	+ var data = $target.data(DATA_KEY);
1380	+ var config = data ? 'toggle' : $trigger.data();
1381
1382	+ Collapse._jQueryInterface.call($target, config);
1383	+ });
1384	});
1385	+ /**
1386	+ * ------------------------------------------------------------------------
1387	+ * jQuery
1388	+ * ------------------------------------------------------------------------
1389	+ */




1390
1391	+ $$$1.fn[NAME] = Collapse._jQueryInterface;
1392	+ $$$1.fn[NAME].Constructor = Collapse;


1393
1394	+ $$$1.fn[NAME].noConflict = function () {
1395	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
1396	+ return Collapse._jQueryInterface;
1397	+ };
1398
1399	+ return Collapse;
1400	+ }($);




1401

1402	/**
1403	+ * --------------------------------------------------------------------------
1404	+ * Bootstrap (v4.1.0): dropdown.js
1405	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
1406	+ * --------------------------------------------------------------------------
1407	*/
1408	+
1409	+ var Dropdown = function ($$$1) {































































1410	/**
1411	* ------------------------------------------------------------------------
1412	+ * Constants
1413	* ------------------------------------------------------------------------
1414	*/
1415	+ var NAME = 'dropdown';
1416	+ var VERSION = '4.1.0';
1417	+ var DATA_KEY = 'bs.dropdown';
1418	+ var EVENT_KEY = "." + DATA_KEY;
1419	+ var DATA_API_KEY = '.data-api';
1420	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
1421	+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
1422	+
1423	+ var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key
1424	+
1425	+ var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key
1426	+
1427	+ var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key
1428	+
1429	+ var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key
1430	+
1431	+ var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse)
1432	+
1433	+ var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "\|" + ARROW_DOWN_KEYCODE + "\|" + ESCAPE_KEYCODE);
1434	+ var Event = {
1435	+ HIDE: "hide" + EVENT_KEY,
1436	+ HIDDEN: "hidden" + EVENT_KEY,
1437	+ SHOW: "show" + EVENT_KEY,
1438	+ SHOWN: "shown" + EVENT_KEY,
1439	+ CLICK: "click" + EVENT_KEY,
1440	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
1441	+ KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY,
1442	+ KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY
1443	+ };
1444	+ var ClassName = {
1445	+ DISABLED: 'disabled',
1446	+ SHOW: 'show',
1447	+ DROPUP: 'dropup',
1448	+ DROPRIGHT: 'dropright',
1449	+ DROPLEFT: 'dropleft',
1450	+ MENURIGHT: 'dropdown-menu-right',
1451	+ MENULEFT: 'dropdown-menu-left',
1452	+ POSITION_STATIC: 'position-static'
1453	+ };
1454	+ var Selector = {
1455	+ DATA_TOGGLE: '[data-toggle="dropdown"]',
1456	+ FORM_CHILD: '.dropdown form',
1457	+ MENU: '.dropdown-menu',
1458	+ NAVBAR_NAV: '.navbar-nav',
1459	+ VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)'
1460	+ };
1461	+ var AttachmentMap = {
1462	+ TOP: 'top-start',
1463	+ TOPEND: 'top-end',
1464	+ BOTTOM: 'bottom-start',
1465	+ BOTTOMEND: 'bottom-end',
1466	+ RIGHT: 'right-start',
1467	+ RIGHTEND: 'right-end',
1468	+ LEFT: 'left-start',
1469	+ LEFTEND: 'left-end'
1470	+ };
1471	+ var Default = {
1472	+ offset: 0,
1473	+ flip: true,
1474	+ boundary: 'scrollParent',
1475	+ reference: 'toggle',
1476	+ display: 'dynamic'
1477	+ };
1478	+ var DefaultType = {
1479	+ offset: '(number\|string\|function)',
1480	+ flip: 'boolean',
1481	+ boundary: '(string\|element)',
1482	+ reference: '(string\|element)',
1483	+ display: 'string'
1484	+ /**
1485	+ * ------------------------------------------------------------------------
1486	+ * Class Definition
1487	+ * ------------------------------------------------------------------------
1488	+ */
1489
1490	+ };













1491
1492	+ var Dropdown =
1493	+ /#__PURE__/
1494	+ function () {
1495	+ function Dropdown(element, config) {
1496	+ this._element = element;
1497	+ this._popper = null;
1498	+ this._config = this._getConfig(config);
1499	+ this._menu = this._getMenuElement();
1500	+ this._inNavbar = this._detectNavbar();
1501
1502	+ this._addEventListeners();
1503	+ } // Getters
1504





1505
1506	+ var _proto = Dropdown.prototype;
1507
1508	+ // Public
1509	+ _proto.toggle = function toggle() {
1510	+ if (this._element.disabled \|\| $$$1(this._element).hasClass(ClassName.DISABLED)) {
1511	+ return;
1512	+ }
1513
1514	+ var parent = Dropdown._getParentFromElement(this._element);
1515
1516	+ var isActive = $$$1(this._menu).hasClass(ClassName.SHOW);


1517
1518	+ Dropdown._clearMenus();




1519
1520	+ if (isActive) {
1521	+ return;
1522	+ }
1523
1524	+ var relatedTarget = {
1525	+ relatedTarget: this._element
1526	+ };
1527	+ var showEvent = $$$1.Event(Event.SHOW, relatedTarget);
1528	+ $$$1(parent).trigger(showEvent);
1529
1530	+ if (showEvent.isDefaultPrevented()) {
1531	+ return;
1532	+ } // Disable totally Popper.js for Dropdown in Navbar





1533

1534
1535	+ if (!this._inNavbar) {
1536	+ /**
1537	+ * Check for Popper dependency
1538	+ * Popper - https://popper.js.org
1539	+ */
1540	+ if (typeof Popper === 'undefined') {
1541	+ throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)');
1542	}




1543
1544	+ var referenceElement = this._element;


1545
1546	+ if (this._config.reference === 'parent') {
1547	+ referenceElement = parent;
1548	+ } else if (Util.isElement(this._config.reference)) {
1549	+ referenceElement = this._config.reference; // Check if it's jQuery element

1550
1551	+ if (typeof this._config.reference.jquery !== 'undefined') {
1552	+ referenceElement = this._config.reference[0];
1553	+ }
1554	+ } // If boundary is not `scrollParent`, then set position to `static`
1555	+ // to allow the menu to "escape" the scroll parent's boundaries
1556	+ // https://github.com/twbs/bootstrap/issues/24251
1557



1558
1559	+ if (this._config.boundary !== 'scrollParent') {
1560	+ $$$1(parent).addClass(ClassName.POSITION_STATIC);
1561	+ }
1562
1563	+ this._popper = new Popper(referenceElement, this._menu, this._getPopperConfig());
1564	+ } // If this is a touch-enabled device we add extra
1565	+ // empty mouseover listeners to the body's immediate children;
1566	+ // only needed because of broken event delegation on iOS
1567	+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
1568



1569
1570	+ if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) {
1571	+ $$$1(document.body).children().on('mouseover', null, $$$1.noop);
1572	+ }


1573
1574	+ this._element.focus();

1575
1576	+ this._element.setAttribute('aria-expanded', true);


1577
1578	+ $$$1(this._menu).toggleClass(ClassName.SHOW);
1579	+ $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget));
1580	+ };
1581
1582	+ _proto.dispose = function dispose() {
1583	+ $$$1.removeData(this._element, DATA_KEY);
1584	+ $$$1(this._element).off(EVENT_KEY);
1585	+ this._element = null;
1586	+ this._menu = null;
1587
1588	+ if (this._popper !== null) {
1589	+ this._popper.destroy();
1590
1591	+ this._popper = null;
1592	+ }
1593	+ };
1594
1595	+ _proto.update = function update() {
1596	+ this._inNavbar = this._detectNavbar();

1597
1598	+ if (this._popper !== null) {
1599	+ this._popper.scheduleUpdate();
1600	+ }
1601	+ }; // Private
1602





1603
1604	+ _proto._addEventListeners = function _addEventListeners() {
1605	+ var _this = this;

1606
1607	+ $$$1(this._element).on(Event.CLICK, function (event) {
1608	+ event.preventDefault();
1609	+ event.stopPropagation();
1610
1611	+ _this.toggle();
1612	+ });
1613	+ };
1614
1615	+ _proto._getConfig = function _getConfig(config) {
1616	+ config = _objectSpread({}, this.constructor.Default, $$$1(this._element).data(), config);
1617	+ Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
1618	+ return config;
1619	+ };
1620
1621	+ _proto._getMenuElement = function _getMenuElement() {
1622	+ if (!this._menu) {
1623	+ var parent = Dropdown._getParentFromElement(this._element);
1624
1625	+ this._menu = $$$1(parent).find(Selector.MENU)[0];

1626	}














1627
1628	+ return this._menu;
1629	+ };
1630
1631	+ _proto._getPlacement = function _getPlacement() {
1632	+ var $parentDropdown = $$$1(this._element).parent();
1633	+ var placement = AttachmentMap.BOTTOM; // Handle dropup
1634
1635	+ if ($parentDropdown.hasClass(ClassName.DROPUP)) {
1636	+ placement = AttachmentMap.TOP;






1637
1638	+ if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
1639	+ placement = AttachmentMap.TOPEND;







1640	}
1641	+ } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) {
1642	+ placement = AttachmentMap.RIGHT;
1643	+ } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) {
1644	+ placement = AttachmentMap.LEFT;
1645	+ } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
1646	+ placement = AttachmentMap.BOTTOMEND;
1647	}
1648	+
1649	+ return placement;
1650	};


1651
1652	+ _proto._detectNavbar = function _detectNavbar() {
1653	+ return $$$1(this._element).closest('.navbar').length > 0;
1654	+ };
1655
1656	+ _proto._getPopperConfig = function _getPopperConfig() {
1657	+ var _this2 = this;

1658
1659	+ var offsetConf = {};
1660
1661	+ if (typeof this._config.offset === 'function') {
1662	+ offsetConf.fn = function (data) {
1663	+ data.offsets = _objectSpread({}, data.offsets, _this2._config.offset(data.offsets) \|\| {});
1664	+ return data;
1665	+ };
1666	+ } else {
1667	+ offsetConf.offset = this._config.offset;
1668	}
1669
1670	+ var popperConfig = {
1671	+ placement: this._getPlacement(),
1672	+ modifiers: {
1673	+ offset: offsetConf,
1674	+ flip: {
1675	+ enabled: this._config.flip
1676	+ },
1677	+ preventOverflow: {
1678	+ boundariesElement: this._config.boundary
1679	+ }
1680	+ } // Disable Popper.js if we have a static display
1681	+
1682	+ };
1683
1684	+ if (this._config.display === 'static') {
1685	+ popperConfig.modifiers.applyStyle = {
1686	+ enabled: false
1687	+ };
1688	}


1689
1690	+ return popperConfig;
1691	+ }; // Static


1692

1693
1694	+ Dropdown._jQueryInterface = function _jQueryInterface(config) {
1695	+ return this.each(function () {
1696	+ var data = $$$1(this).data(DATA_KEY);
1697
1698	+ var _config = typeof config === 'object' ? config : null;



1699
1700	+ if (!data) {
1701	+ data = new Dropdown(this, _config);
1702	+ $$$1(this).data(DATA_KEY, data);
1703	+ }
1704
1705	+ if (typeof config === 'string') {
1706	+ if (typeof data[config] === 'undefined') {
1707	+ throw new TypeError("No method named \"" + config + "\"");
1708	+ }
1709
1710	+ data[config]();
1711	+ }
1712	+ });
1713	+ };
1714
1715	+ Dropdown._clearMenus = function _clearMenus(event) {
1716	+ if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH \|\| event.type === 'keyup' && event.which !== TAB_KEYCODE)) {
1717	+ return;
1718	}
1719
1720	+ var toggles = $$$1.makeArray($$$1(Selector.DATA_TOGGLE));

1721
1722	+ for (var i = 0; i < toggles.length; i++) {
1723	+ var parent = Dropdown._getParentFromElement(toggles[i]);


1724
1725	+ var context = $$$1(toggles[i]).data(DATA_KEY);
1726	+ var relatedTarget = {
1727	+ relatedTarget: toggles[i]
1728	+ };
1729
1730	+ if (!context) {
1731	+ continue;
1732	+ }
1733
1734	+ var dropdownMenu = context._menu;




1735
1736	+ if (!$$$1(parent).hasClass(ClassName.SHOW)) {
1737	+ continue;
1738	+ }
1739
1740	+ if (event && (event.type === 'click' && /input\|textarea/i.test(event.target.tagName) \|\| event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) {
1741	+ continue;
1742	+ }
1743
1744	+ var hideEvent = $$$1.Event(Event.HIDE, relatedTarget);
1745	+ $$$1(parent).trigger(hideEvent);
1746
1747	+ if (hideEvent.isDefaultPrevented()) {
1748	+ continue;
1749	+ } // If this is a touch-enabled device we remove the extra
1750	+ // empty mouseover listeners we added for iOS support
1751











1752
1753	+ if ('ontouchstart' in document.documentElement) {
1754	+ $$$1(document.body).children().off('mouseover', null, $$$1.noop);
1755	+ }
1756
1757	+ toggles[i].setAttribute('aria-expanded', 'false');
1758	+ $$$1(dropdownMenu).removeClass(ClassName.SHOW);
1759	+ $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget));
1760	+ }
1761	+ };
1762	+
1763	+ Dropdown._getParentFromElement = function _getParentFromElement(element) {
1764	+ var parent;
1765	+ var selector = Util.getSelectorFromElement(element);
1766	+
1767	+ if (selector) {
1768	+ parent = $$$1(selector)[0];
1769	+ }
1770
1771	+ return parent \|\| element.parentNode;
1772	+ }; // eslint-disable-next-line complexity
1773

1774
1775	+ Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
1776	+ // If not input/textarea:
1777	+ // - And not a key in REGEXP_KEYDOWN => not a dropdown command
1778	+ // If input/textarea:
1779	+ // - If space key => not a dropdown command
1780	+ // - If key is other than escape
1781	+ // - If key is not up or down => not a dropdown command
1782	+ // - If trigger inside the menu => not a dropdown command
1783	+ if (/input\|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE \|\| event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE \|\| $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
1784	+ return;
1785	}
1786
1787	+ event.preventDefault();
1788	+ event.stopPropagation();

1789
1790	+ if (this.disabled \|\| $$$1(this).hasClass(ClassName.DISABLED)) {
1791	+ return;
1792	+ }
1793
1794	+ var parent = Dropdown._getParentFromElement(this);


1795
1796	+ var isActive = $$$1(parent).hasClass(ClassName.SHOW);
1797
1798	+ if (!isActive && (event.which !== ESCAPE_KEYCODE \|\| event.which !== SPACE_KEYCODE) \|\| isActive && (event.which === ESCAPE_KEYCODE \|\| event.which === SPACE_KEYCODE)) {
1799	+ if (event.which === ESCAPE_KEYCODE) {
1800	+ var toggle = $$$1(parent).find(Selector.DATA_TOGGLE)[0];
1801	+ $$$1(toggle).trigger('focus');
1802	+ }
1803
1804	+ $$$1(this).trigger('click');
1805	+ return;
1806	+ }

1807
1808	+ var items = $$$1(parent).find(Selector.VISIBLE_ITEMS).get();


1809
1810	+ if (items.length === 0) {
1811	+ return;
1812	+ }
1813
1814	+ var index = items.indexOf(event.target);






















1815
1816	+ if (event.which === ARROW_UP_KEYCODE && index > 0) {
1817	+ // Up
1818	+ index--;
1819	+ }
1820
1821	+ if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
1822	+ // Down
1823	+ index++;
1824	+ }
1825	+
1826	+ if (index < 0) {
1827	+ index = 0;
1828	+ }
1829	+
1830	+ items[index].focus();
1831	+ };
1832	+
1833	+ _createClass(Dropdown, null, [{
1834	+ key: "VERSION",
1835	+ get: function get() {
1836	+ return VERSION;
1837	+ }
1838	+ }, {
1839	+ key: "Default",
1840	+ get: function get() {
1841	+ return Default;
1842	+ }
1843	+ }, {
1844	+ key: "DefaultType",
1845	+ get: function get() {
1846	+ return DefaultType;
1847	+ }
1848	+ }]);
1849	+
1850	+ return Dropdown;
1851	+ }();
1852	+ /**
1853	+ * ------------------------------------------------------------------------
1854	+ * Data Api implementation
1855	+ * ------------------------------------------------------------------------
1856	+ */
1857









1858
1859	+ $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
1860	+ event.preventDefault();
1861	+ event.stopPropagation();
1862	+
1863	+ Dropdown._jQueryInterface.call($$$1(this), 'toggle');
1864	+ }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) {
1865	+ e.stopPropagation();
1866	+ });
1867	+ /**
1868	+ * ------------------------------------------------------------------------
1869	+ * jQuery
1870	+ * ------------------------------------------------------------------------
1871	+ */
1872
1873	+ $$$1.fn[NAME] = Dropdown._jQueryInterface;
1874	+ $$$1.fn[NAME].Constructor = Dropdown;


1875
1876	+ $$$1.fn[NAME].noConflict = function () {
1877	+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
1878	+ return Dropdown._jQueryInterface;
1879	+ };
1880
1881	+ return Dropdown;
1882	+ }($, Popper);




1883

1884	/**
1885	+ * --------------------------------------------------------------------------
1886	+ * Bootstrap (v4.1.0): modal.js
1887	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
1888	+ * --------------------------------------------------------------------------
1889	*/
1890	+
1891	+ var Modal = function ($$$1) {















































1892	/**
1893	* ------------------------------------------------------------------------
1894	+ * Constants
1895	* ------------------------------------------------------------------------
1896	*/
1897	+ var NAME = 'modal';
1898	+ var VERSION = '4.1.0';
1899	+ var DATA_KEY = 'bs.modal';
1900	+ var EVENT_KEY = "." + DATA_KEY;
1901	+ var DATA_API_KEY = '.data-api';
1902	+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
1903	+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
1904	+
1905	+ var Default = {
1906	+ backdrop: true,
1907	+ keyboard: true,
1908	+ focus: true,
1909	+ show: true
1910	+ };
1911	+ var DefaultType = {
1912	+ backdrop: '(boolean\|string)',
1913	+ keyboard: 'boolean',
1914	+ focus: 'boolean',
1915	+ show: 'boolean'
1916	+ };
1917	+ var Event = {
1918	+ HIDE: "hide" + EVENT_KEY,
1919	+ HIDDEN: "hidden" + EVENT_KEY,
1920	+ SHOW: "show" + EVENT_KEY,
1921	+ SHOWN: "shown" + EVENT_KEY,
1922	+ FOCUSIN: "focusin" + EVENT_KEY,
1923	+ RESIZE: "resize" + EVENT_KEY,
1924	+ CLICK_DISMISS: "click.dismiss" + EVENT_KEY,
1925	+ KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY,
1926	+ MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY,
1927	+ MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY,
1928	+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
1929	+ };
1930	+ var ClassName = {
1931	+ SCROLLBAR_MEASURER: 'modal-scrollbar-measure',
1932	+ BACKDROP: 'modal-backdrop',
1933	+ OPEN: 'modal-open',
1934	+ FADE: 'fade',
1935	+ SHOW: 'show'
1936	+ };
1937	+ var Selector = {
1938	+ DIALOG: '.modal-dialog',
1939	+ DATA_TOGGLE: '[data-toggle="modal"]',
1940	+ DATA_DISMISS: '[data-dismiss="modal"]',
1941	+ FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
1942	+ STICKY_CONTENT: '.sticky-top',
1943	+ NAVBAR_TOGGLER: '.navbar-toggler'
1944	+ /**
1945	+ * ------------------------------------------------------------------------
1946	+ * Class Definition
1947	+ * ------------------------------------------------------------------------
1948	+ */
1949























1950	};
1951
1952	+ var Modal =
1953	+ /#__PURE__/
1954	+ function () {
1955	+ function Modal(element, config) {
1956	+ this._config = this._getConfig(config);
1957	+ this._element = element;
1958	+ this._dialog = $$$1(element).find(Selector.DIALOG)[0];
1959	+ this._backdrop = null;
1960	+ this._isShown = false;
1961	+ this._isBodyOverflowing = false;
1962	+ this._ignoreBackdropClick = false;
1963	+ this._scrollbarWidth = 0;
1964	+ } // Getters
1965



1966
1967	+ var _proto = Modal.prototype;


1968
1969	+ // Public
1970	+ _proto.toggle = function toggle(relatedTarget) {
1971	+ return this._isShown ? this.hide() : this.show(relatedTarget);
1972	+ };
1973
1974	+ _proto.show = function show(relatedTarget) {
1975	+ var _this = this;
1976	+
1977	+ if (this._isTransitioning \|\| this._isShown) {
1978	+ return;
1979	+ }
1980	+
1981	+ if ($$$1(this._element).hasClass(ClassName.FADE)) {
1982	+ this._isTransitioning = true;
1983	+ }
1984	+
1985	+ var showEvent = $$$1.Event(Event.SHOW, {
1986	+ relatedTarget: relatedTarget
1987	+ });
1988	+ $$$1(this._element).trigger(showEvent);
1989
1990	+ if (this._isShown \|\| showEvent.isDefaultPrevented()) {
1991	+ return;
1992	+ }
1993
1994	+ this._isShown = true;
1995
1996	+ this._checkScrollbar();
1997
1998	+ this._setScrollbar();
1999
2000	+ this._adjustDialog();
2001
2002	+ $$$1(document.body).addClass(ClassName.OPEN);
2003
2004	+ this._setEscapeEvent();
2005
2006	+ this._setResizeEvent();
2007	+
2008	+ $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) {
2009	+ return _this.hide(event);
2010	+ });
2011	+ $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () {
2012	+ $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) {
2013	+ if ($$$1(event.target).is(_this._element)) {
2014	+ _this._ignoreBackdropClick = true;
2015	+ }
2016	+ });
2017	});

2018
2019	+ this._showBackdrop(function () {
2020	+ return _this._showElement(relatedTarget);
2021	+ });
2022	+ };
2023
2024	+ _proto.hide = function hide(event) {
2025	+ var _this2 = this;
2026
2027	+ if (event) {
2028	+ event.preventDefault();
2029	+ }
2030
2031	+ if (this._isTransitioning \|\| !this._isShown) {
2032	+ return;
2033	+ }
2034
2035	+ var hideEvent = $$$1.Event(Event.HIDE);
2036	+ $$$1(this._element).trigger(hideEvent);
2037
2038	+ if (!this._isShown \|\| hideEvent.isDefaultPrevented()) {
2039	+ return;
2040	+ }
2041
2042	+ this._isShown = false;
2043	+ var transition = $$$1(this._element).hasClass(ClassName.FADE);
2044
2045	+ if (transition) {
2046	+ this._isTransitioning = true;
2047	+ }
2048
2049	+ this._setEscapeEvent();
2050
2051	+ this._setResizeEvent();
2052
2053	+ $$$1(document).off(Event.FOCUSIN);
2054	+ $$$1(this._element).removeClass(ClassName.SHOW);
2055	+ $$$1(this._element).off(Event.CLICK_DISMISS);
2056	+ $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS);
2057
2058	+ if (transition) {
2059	+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
2060	+ $$$1(this._element).one(Util.TRANSITION_END, function (event) {
2061	+ return _this2._hideModal(event);
2062	+ }).emulateTransitionEnd(transitionDuration);
2063	+ } else {
2064	+ this._hideModal();
2065	+ }
2066	+ };
2067
2068	+ _proto.dispose = function dispose() {
2069	+ $$$1.removeData(this._element, DATA_KEY);
2070	+ $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY);
2071	+ this._config = null;
2072	+ this._element = null;
2073	+ this._dialog = null;
2074	+ this._backdrop = null;
2075	+ this._isShown = null;
2076	+ this._isBodyOverflowing = null;
2077	+ this._ignoreBackdropClick = null;
2078	+ this._scrollbarWidth = null;
2079	+ };
2080
2081	+ _proto.handleUpdate = function handleUpdate() {
2082	+ this._adjustDialog();
2083	+ }; // Private
2084
2085
2086	+ _proto._getConfig = function _getConfig(config) {
2087	+ config = _objectSpread({}, Default, config);
2088	+ Util.typeCheckConfig(NAME, config, DefaultType);
2089	+ return config;

Shield Security for WordPress - Version 6.6.7

Version Description

Release Info

Code changes from version 6.6.6 to 6.6.7