Version Description
Series = Released: 6th September, 2018 - Release Notes
(v.0) NEW: [PRO] Traffic Watcher - live tracking of all requests to your site.
(v.0) NEW: [PRO] Yubikey - Allows for multiple Yubikeys on the same user profile.
(v.0) ADDED: [PRO] Option to include listing of affected files within Hack Guard notification emails.
(v.0) ADDED: Option to delete the Security Admin Access Key
(v.0) ADDED: Option to add WooCommerce roles to 2FA-Email setting.
(v.0) CHANGED: Basic Stats system now requires minimum PHP v5.4.
(v.0) CHANGED: Password Policies now requires minimum WordPress v4.4.
(v.0) IMPROVED: Password expiration now redirects to the 'set password' screen, instead of the user profile.
(v.0) IMPROVED: Password capture for purposes of password policies is improved.
(v.0) IMPROVED: You can now delete the 'forceoff' file from inside the WP Admin.
(v.0) IMPROVED: Audit Trail entries for emails will identify the file that's calling the
wp_mail
function.(v.0) IMPROVED: Audit Trail entries for post editing will identify the post type wherever possible.
(v.0) IMPROVED: Audit Trail entries will try to display all message text correctly.
(v.0) IMPROVED: Login/Register/Password forms are only checked when visitor is not logged-in.
(v.0) IMPROVED: Major database code refactoring and other code improvements.
(v.0) IMPROVED: User sessions handling.
(v.0) IMPROVED: Security Admin UX - ajax session checking, with admin notifications and auto-page reload.
(v.0) IMPROVED: Security Admin password setting now requires a confirmation password entry.
(v.0) IMPROVED: Refined Cooldown timing system.
(v.0) IMPROVED: Refined Bot checkbox Javascript.
(v.0) IMPROVED: Cron entry cleanup after deactivation.
(v.0) UPDATED: Bootstrap libraries to latest release v4.1.3.
(v.0) FIXED: Potential bug with Plugin/Themes guard scanning.
(v.0) FIXED: PHP Warning(s).
Full Changelog
Release Info
Developer | paultgoodchild |
Plugin | Shield Security for WordPress |
Version | 6.9.0 |
Comparing to | |
See all releases |
Code changes from version 6.8.2 to 6.9.0
- changelog.html +106 -3871
- icwp-plugin-controller.php +176 -70
- icwp-wpsf.php +2 -2
- init.php +1 -1
- languages/default.mo +0 -0
- languages/default.po +2415 -1595
- languages/wp-simple-firewall-fr_CA.mo +0 -0
- languages/wp-simple-firewall-fr_FR.mo +0 -0
- languages/wp-simple-firewall-pt_BR.mo +0 -0
- languages/wp-simple-firewall-pt_PT.mo +0 -0
- plugin-spec.php +59 -46
- readme.txt +28 -70
- resources/css/bootstrap4.css +146 -98
- resources/css/bootstrap4.min.css +2 -3
- resources/css/global-plugin.css +1 -3
- resources/css/plugin.css +41 -4
- resources/images/flags/ad.png +0 -0
- resources/images/flags/ae.png +0 -0
- resources/images/flags/af.png +0 -0
- resources/images/flags/ag.png +0 -0
- resources/images/flags/al.png +0 -0
- resources/images/flags/am.png +0 -0
- resources/images/flags/ao.png +0 -0
- resources/images/flags/ar.png +0 -0
- resources/images/flags/at.png +0 -0
- resources/images/flags/au.png +0 -0
- resources/images/flags/az.png +0 -0
- resources/images/flags/ba.png +0 -0
- resources/images/flags/bb.png +0 -0
- resources/images/flags/bd.png +0 -0
- resources/images/flags/be.png +0 -0
- resources/images/flags/bf.png +0 -0
- resources/images/flags/bg.png +0 -0
- resources/images/flags/bh.png +0 -0
- resources/images/flags/bi.png +0 -0
- resources/images/flags/bj.png +0 -0
- resources/images/flags/bn.png +0 -0
- resources/images/flags/bo.png +0 -0
- resources/images/flags/br.png +0 -0
- resources/images/flags/bs.png +0 -0
- resources/images/flags/bt.png +0 -0
- resources/images/flags/bw.png +0 -0
- resources/images/flags/by.png +0 -0
- resources/images/flags/bz.png +0 -0
- resources/images/flags/ca.png +0 -0
- resources/images/flags/cd.png +0 -0
- resources/images/flags/cf.png +0 -0
- resources/images/flags/cg.png +0 -0
- resources/images/flags/ch.png +0 -0
- resources/images/flags/ci.png +0 -0
- resources/images/flags/cl.png +0 -0
- resources/images/flags/cm.png +0 -0
- resources/images/flags/cn.png +0 -0
- resources/images/flags/co.png +0 -0
- resources/images/flags/cr.png +0 -0
- resources/images/flags/cu.png +0 -0
- resources/images/flags/cv.png +0 -0
- resources/images/flags/cy.png +0 -0
- resources/images/flags/cz.png +0 -0
- resources/images/flags/de.png +0 -0
- resources/images/flags/dj.png +0 -0
- resources/images/flags/dk.png +0 -0
- resources/images/flags/dm.png +0 -0
- resources/images/flags/do.png +0 -0
- resources/images/flags/dz.png +0 -0
- resources/images/flags/ec.png +0 -0
- resources/images/flags/ee.png +0 -0
- resources/images/flags/eg.png +0 -0
- resources/images/flags/eh.png +0 -0
- resources/images/flags/er.png +0 -0
- resources/images/flags/es.png +0 -0
- resources/images/flags/et.png +0 -0
- resources/images/flags/fi.png +0 -0
- resources/images/flags/fj.png +0 -0
- resources/images/flags/fm.png +0 -0
- resources/images/flags/fr.png +0 -0
- resources/images/flags/ga.png +0 -0
- resources/images/flags/gb.png +0 -0
- resources/images/flags/gd.png +0 -0
- resources/images/flags/ge.png +0 -0
- resources/images/flags/gh.png +0 -0
- resources/images/flags/gm.png +0 -0
- resources/images/flags/gn.png +0 -0
- resources/images/flags/gq.png +0 -0
- resources/images/flags/gr.png +0 -0
- resources/images/flags/gt.png +0 -0
- resources/images/flags/gw.png +0 -0
- resources/images/flags/gy.png +0 -0
- resources/images/flags/hn.png +0 -0
- resources/images/flags/hr.png +0 -0
- resources/images/flags/ht.png +0 -0
- resources/images/flags/hu.png +0 -0
- resources/images/flags/id.png +0 -0
- resources/images/flags/ie.png +0 -0
- resources/images/flags/il.png +0 -0
- resources/images/flags/in.png +0 -0
- resources/images/flags/iq.png +0 -0
- resources/images/flags/ir.png +0 -0
- resources/images/flags/is.png +0 -0
- resources/images/flags/it.png +0 -0
- resources/images/flags/jm.png +0 -0
- resources/images/flags/jo.png +0 -0
- resources/images/flags/jp.png +0 -0
- resources/images/flags/ke.png +0 -0
- resources/images/flags/kg.png +0 -0
- resources/images/flags/kh.png +0 -0
- resources/images/flags/ki.png +0 -0
- resources/images/flags/km.png +0 -0
- resources/images/flags/kn.png +0 -0
- resources/images/flags/kp.png +0 -0
- resources/images/flags/kr.png +0 -0
- resources/images/flags/ks.png +0 -0
- resources/images/flags/kw.png +0 -0
- resources/images/flags/kz.png +0 -0
- resources/images/flags/la.png +0 -0
- resources/images/flags/lb.png +0 -0
- resources/images/flags/lc.png +0 -0
- resources/images/flags/li.png +0 -0
- resources/images/flags/lk.png +0 -0
- resources/images/flags/lr.png +0 -0
- resources/images/flags/ls.png +0 -0
- resources/images/flags/lt.png +0 -0
- resources/images/flags/lu.png +0 -0
- resources/images/flags/lv.png +0 -0
- resources/images/flags/ly.png +0 -0
- resources/images/flags/ma.png +0 -0
- resources/images/flags/mc.png +0 -0
- resources/images/flags/md.png +0 -0
- resources/images/flags/me.png +0 -0
- resources/images/flags/mg.png +0 -0
- resources/images/flags/mh.png +0 -0
- resources/images/flags/mk.png +0 -0
- resources/images/flags/ml.png +0 -0
- resources/images/flags/mm.png +0 -0
- resources/images/flags/mn.png +0 -0
- resources/images/flags/mr.png +0 -0
- resources/images/flags/mt.png +0 -0
- resources/images/flags/mu.png +0 -0
- resources/images/flags/mv.png +0 -0
- resources/images/flags/mw.png +0 -0
- resources/images/flags/mx.png +0 -0
- resources/images/flags/my.png +0 -0
- resources/images/flags/mz.png +0 -0
- resources/images/flags/na.png +0 -0
- resources/images/flags/ne.png +0 -0
- resources/images/flags/ng.png +0 -0
- resources/images/flags/ni.png +0 -0
- resources/images/flags/nl.png +0 -0
- resources/images/flags/no.png +0 -0
- resources/images/flags/np.png +0 -0
- resources/images/flags/nr.png +0 -0
- resources/images/flags/nz.png +0 -0
- resources/images/flags/om.png +0 -0
- resources/images/flags/pa.png +0 -0
- resources/images/flags/pe.png +0 -0
- resources/images/flags/pg.png +0 -0
- resources/images/flags/ph.png +0 -0
- resources/images/flags/pk.png +0 -0
- resources/images/flags/pl.png +0 -0
- resources/images/flags/pt.png +0 -0
- resources/images/flags/pw.png +0 -0
- resources/images/flags/py.png +0 -0
- resources/images/flags/qa.png +0 -0
- resources/images/flags/ro.png +0 -0
- resources/images/flags/rs.png +0 -0
- resources/images/flags/ru.png +0 -0
- resources/images/flags/rw.png +0 -0
- resources/images/flags/sa.png +0 -0
- resources/images/flags/sb.png +0 -0
- resources/images/flags/sc.png +0 -0
- resources/images/flags/sd.png +0 -0
- resources/images/flags/se.png +0 -0
- resources/images/flags/sg.png +0 -0
- resources/images/flags/si.png +0 -0
- resources/images/flags/sk.png +0 -0
- resources/images/flags/sl.png +0 -0
- resources/images/flags/sm.png +0 -0
- resources/images/flags/sn.png +0 -0
- resources/images/flags/so.png +0 -0
- resources/images/flags/sr.png +0 -0
- resources/images/flags/st.png +0 -0
- resources/images/flags/sv.png +0 -0
- resources/images/flags/sy.png +0 -0
- resources/images/flags/sz.png +0 -0
- resources/images/flags/td.png +0 -0
- resources/images/flags/tg.png +0 -0
- resources/images/flags/th.png +0 -0
- resources/images/flags/tj.png +0 -0
- resources/images/flags/tl.png +0 -0
- resources/images/flags/tm.png +0 -0
- resources/images/flags/tn.png +0 -0
- resources/images/flags/to.png +0 -0
- resources/images/flags/tr.png +0 -0
- resources/images/flags/tt.png +0 -0
- resources/images/flags/tv.png +0 -0
- resources/images/flags/tw.png +0 -0
- resources/images/flags/tz.png +0 -0
- resources/images/flags/ua.png +0 -0
- resources/images/flags/ug.png +0 -0
- resources/images/flags/us.png +0 -0
- resources/images/flags/uy.png +0 -0
- resources/images/flags/uz.png +0 -0
- resources/images/flags/va.png +0 -0
- resources/images/flags/vc.png +0 -0
- resources/images/flags/ve.png +0 -0
- resources/images/flags/vn.png +0 -0
- resources/images/flags/vu.png +0 -0
- resources/images/flags/ws.png +0 -0
- resources/images/flags/ye.png +0 -0
- resources/images/flags/za.png +0 -0
- resources/images/flags/zm.png +0 -0
- resources/images/flags/zw.png +0 -0
- resources/js/bootstrap4.bundle.js +124 -108
- resources/js/bootstrap4.bundle.min.js +2 -3
- resources/js/bootstrap4.js +124 -108
- resources/js/bootstrap4.min.js +2 -3
- resources/js/global-plugin.js +5 -4
- resources/js/plugin.js +105 -15
- src/common/Components/GeoIp2/GeoLite2-Country.mmdb +0 -0
- src/common/Components/Tables/AuditTrailTable.php +11 -0
- src/common/Components/Tables/LiveTrafficTable.php +15 -0
@@ -1,3825 +1,84 @@
|
|
1 |
-
<!DOCTYPE html><html><head><meta charset="utf-8"><title>Untitled Document.md</title>
|
2 |
-
<
|
3 |
-
|
4 |
-
|
5 |
-
|
6 |
-
|
7 |
-
|
8 |
-
|
9 |
-
|
10 |
-
|
11 |
-
|
12 |
-
|
13 |
-
|
14 |
-
|
15 |
-
|
16 |
-
|
17 |
-
|
18 |
-
|
19 |
-
|
20 |
-
|
21 |
-
|
22 |
-
|
23 |
-
|
24 |
-
|
25 |
-
|
26 |
-
|
27 |
-
|
28 |
-
|
29 |
-
|
30 |
-
|
31 |
-
|
32 |
-
|
33 |
-
|
34 |
-
|
35 |
-
|
36 |
-
|
37 |
-
|
38 |
-
|
39 |
-
|
40 |
-
|
41 |
-
.
|
42 |
-
|
43 |
-
|
44 |
-
|
45 |
-
|
46 |
-
|
47 |
-
|
48 |
-
|
49 |
-
|
50 |
-
|
51 |
-
.
|
52 |
-
|
53 |
-
|
54 |
-
|
55 |
-
|
56 |
-
.
|
57 |
-
|
58 |
-
|
59 |
-
|
60 |
-
|
61 |
-
|
62 |
-
|
63 |
-
|
64 |
-
|
65 |
-
|
66 |
-
|
67 |
-
.
|
68 |
-
|
69 |
-
|
70 |
-
|
71 |
-
|
72 |
-
|
73 |
-
|
74 |
-
.
|
75 |
-
|
76 |
-
|
77 |
-
.
|
78 |
-
|
79 |
-
|
80 |
-
|
81 |
-
|
82 |
-
}
|
83 |
-
.table-bordered, .table-bordered > thead > tr > th, .table-bordered > thead > tr > td, .table-bordered > tbody > tr > th, .table-bordered > tbody > tr > td, .table-bordered > tfoot > tr > th, .table-bordered > tfoot > tr > td {
|
84 |
-
border: 1px solid #dddddd
|
85 |
-
}
|
86 |
-
.table-bordered > thead > tr > th, .table-bordered > thead > tr > td {
|
87 |
-
border-bottom-width: 2px
|
88 |
-
}
|
89 |
-
.table-striped > tbody > tr:nth-child(odd) > td, .table-striped > tbody > tr:nth-child(odd) > th {
|
90 |
-
background-color: #f9f9f9
|
91 |
-
}
|
92 |
-
.table-hover > tbody > tr:hover > td, .table-hover > tbody > tr:hover > th {
|
93 |
-
background-color: #f5f5f5
|
94 |
-
}
|
95 |
-
table col[class*="col-"] {
|
96 |
-
position: static;
|
97 |
-
float: none;
|
98 |
-
display: table-column
|
99 |
-
}
|
100 |
-
table td[class*="col-"], table th[class*="col-"] {
|
101 |
-
position: static;
|
102 |
-
float: none;
|
103 |
-
display: table-cell
|
104 |
-
}
|
105 |
-
.table > thead > tr > td.active, .table > thead > tr > th.active, .table > thead > tr.active > td, .table > thead > tr.active > th, .table > tbody > tr > td.active, .table > tbody > tr > th.active, .table > tbody > tr.active > td, .table > tbody > tr.active > th, .table > tfoot > tr > td.active, .table > tfoot > tr > th.active, .table > tfoot > tr.active > td, .table > tfoot > tr.active > th {
|
106 |
-
background-color: #f5f5f5
|
107 |
-
}
|
108 |
-
.table-hover > tbody > tr > td.active:hover, .table-hover > tbody > tr > th.active:hover, .table-hover > tbody > tr.active:hover > td, .table-hover > tbody > tr:hover > .active, .table-hover > tbody > tr.active:hover > th {
|
109 |
-
background-color: #e8e8e8
|
110 |
-
}
|
111 |
-
.table > thead > tr > td.success, .table > thead > tr > th.success, .table > thead > tr.success > td, .table > thead > tr.success > th, .table > tbody > tr > td.success, .table > tbody > tr > th.success, .table > tbody > tr.success > td, .table > tbody > tr.success > th, .table > tfoot > tr > td.success, .table > tfoot > tr > th.success, .table > tfoot > tr.success > td, .table > tfoot > tr.success > th {
|
112 |
-
background-color: #dff0d8
|
113 |
-
}
|
114 |
-
.table-hover > tbody > tr > td.success:hover, .table-hover > tbody > tr > th.success:hover, .table-hover > tbody > tr.success:hover > td, .table-hover > tbody > tr:hover > .success, .table-hover > tbody > tr.success:hover > th {
|
115 |
-
background-color: #d0e9c6
|
116 |
-
}
|
117 |
-
.table > thead > tr > td.info, .table > thead > tr > th.info, .table > thead > tr.info > td, .table > thead > tr.info > th, .table > tbody > tr > td.info, .table > tbody > tr > th.info, .table > tbody > tr.info > td, .table > tbody > tr.info > th, .table > tfoot > tr > td.info, .table > tfoot > tr > th.info, .table > tfoot > tr.info > td, .table > tfoot > tr.info > th {
|
118 |
-
background-color: #d9edf7
|
119 |
-
}
|
120 |
-
.table-hover > tbody > tr > td.info:hover, .table-hover > tbody > tr > th.info:hover, .table-hover > tbody > tr.info:hover > td, .table-hover > tbody > tr:hover > .info, .table-hover > tbody > tr.info:hover > th {
|
121 |
-
background-color: #c4e3f3
|
122 |
-
}
|
123 |
-
.table > thead > tr > td.warning, .table > thead > tr > th.warning, .table > thead > tr.warning > td, .table > thead > tr.warning > th, .table > tbody > tr > td.warning, .table > tbody > tr > th.warning, .table > tbody > tr.warning > td, .table > tbody > tr.warning > th, .table > tfoot > tr > td.warning, .table > tfoot > tr > th.warning, .table > tfoot > tr.warning > td, .table > tfoot > tr.warning > th {
|
124 |
-
background-color: #fcf8e3
|
125 |
-
}
|
126 |
-
.table-hover > tbody > tr > td.warning:hover, .table-hover > tbody > tr > th.warning:hover, .table-hover > tbody > tr.warning:hover > td, .table-hover > tbody > tr:hover > .warning, .table-hover > tbody > tr.warning:hover > th {
|
127 |
-
background-color: #faf2cc
|
128 |
-
}
|
129 |
-
.table > thead > tr > td.danger, .table > thead > tr > th.danger, .table > thead > tr.danger > td, .table > thead > tr.danger > th, .table > tbody > tr > td.danger, .table > tbody > tr > th.danger, .table > tbody > tr.danger > td, .table > tbody > tr.danger > th, .table > tfoot > tr > td.danger, .table > tfoot > tr > th.danger, .table > tfoot > tr.danger > td, .table > tfoot > tr.danger > th {
|
130 |
-
background-color: #f2dede
|
131 |
-
}
|
132 |
-
.table-hover > tbody > tr > td.danger:hover, .table-hover > tbody > tr > th.danger:hover, .table-hover > tbody > tr.danger:hover > td, .table-hover > tbody > tr:hover > .danger, .table-hover > tbody > tr.danger:hover > th {
|
133 |
-
background-color: #ebcccc
|
134 |
-
}
|
135 |
-
fieldset {
|
136 |
-
border: 0;
|
137 |
-
min-width: 0
|
138 |
-
}
|
139 |
-
legend {
|
140 |
-
display: block;
|
141 |
-
width: 100%;
|
142 |
-
margin-bottom: 20px;
|
143 |
-
font-size: 21px;
|
144 |
-
line-height: inherit;
|
145 |
-
color: #333333;
|
146 |
-
border-bottom: 1px solid #e5e5e5
|
147 |
-
}
|
148 |
-
label {
|
149 |
-
display: inline-block;
|
150 |
-
max-width: 100%;
|
151 |
-
margin-bottom: 5px;
|
152 |
-
font-weight: 700
|
153 |
-
}
|
154 |
-
input[type="radio"], input[type="checkbox"] {
|
155 |
-
margin: 4px 0 0;
|
156 |
-
margin-top: 1px \9;
|
157 |
-
line-height: normal
|
158 |
-
}
|
159 |
-
input[type="file"] {
|
160 |
-
display: block
|
161 |
-
}
|
162 |
-
input[type="range"] {
|
163 |
-
display: block;
|
164 |
-
width: 100%
|
165 |
-
}
|
166 |
-
select[multiple], select[size] {
|
167 |
-
height: auto
|
168 |
-
}
|
169 |
-
input[type="file"]:focus, input[type="radio"]:focus, input[type="checkbox"]:focus {
|
170 |
-
outline: thin dotted;
|
171 |
-
outline: 5px auto -webkit-focus-ring-color;
|
172 |
-
outline-offset: -2px
|
173 |
-
}
|
174 |
-
output {
|
175 |
-
padding-top: 7px
|
176 |
-
}
|
177 |
-
output, .form-control {
|
178 |
-
display: block;
|
179 |
-
font-size: 14px;
|
180 |
-
line-height: 1.4285714;
|
181 |
-
color: #555555
|
182 |
-
}
|
183 |
-
.form-control {
|
184 |
-
width: 100%;
|
185 |
-
height: 34px;
|
186 |
-
padding: 6px 12px;
|
187 |
-
background-color: #ffffff;
|
188 |
-
background-image: none;
|
189 |
-
border: 1px solid #cccccc;
|
190 |
-
border-radius: 4px;
|
191 |
-
box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
|
192 |
-
-webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
|
193 |
-
transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s
|
194 |
-
}
|
195 |
-
.form-control:focus {
|
196 |
-
border-color: #66afe9;
|
197 |
-
outline: 0;
|
198 |
-
box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 8px rgba(102, 175, 233, .6)
|
199 |
-
}
|
200 |
-
.form-control::-moz-placeholder {
|
201 |
-
color: #777777;
|
202 |
-
opacity: 1
|
203 |
-
}
|
204 |
-
.form-control:-ms-input-placeholder {
|
205 |
-
color: #777777
|
206 |
-
}
|
207 |
-
.form-control::-webkit-input-placeholder {
|
208 |
-
color: #777777
|
209 |
-
}
|
210 |
-
.form-control[disabled], .form-control[readonly], fieldset[disabled] .form-control {
|
211 |
-
cursor: not-allowed;
|
212 |
-
background-color: #eeeeee;
|
213 |
-
opacity: 1
|
214 |
-
}
|
215 |
-
textarea.form-control {
|
216 |
-
height: auto
|
217 |
-
}
|
218 |
-
input[type="date"], input[type="time"], input[type="datetime-local"], input[type="month"] {
|
219 |
-
line-height: 34px;
|
220 |
-
line-height: 1.4285714 \0
|
221 |
-
}
|
222 |
-
input[type="date"].input-sm, .form-horizontal .form-group-sm input[type="date"].form-control, .input-group-sm > input[type="date"].form-control, .input-group-sm > input[type="date"].input-group-addon, .input-group-sm > .input-group-btn > input[type="date"].btn, input[type="time"].input-sm, .form-horizontal .form-group-sm input[type="time"].form-control, .input-group-sm > input[type="time"].form-control, .input-group-sm > input[type="time"].input-group-addon, .input-group-sm > .input-group-btn > input[type="time"].btn, input[type="datetime-local"].input-sm, .form-horizontal .form-group-sm input[type="datetime-local"].form-control, .input-group-sm > input[type="datetime-local"].form-control, .input-group-sm > input[type="datetime-local"].input-group-addon, .input-group-sm > .input-group-btn > input[type="datetime-local"].btn, input[type="month"].input-sm, .form-horizontal .form-group-sm input[type="month"].form-control, .input-group-sm > input[type="month"].form-control, .input-group-sm > input[type="month"].input-group-addon, .input-group-sm > .input-group-btn > input[type="month"].btn {
|
223 |
-
line-height: 30px
|
224 |
-
}
|
225 |
-
input[type="date"].input-lg, .form-horizontal .form-group-lg input[type="date"].form-control, .input-group-lg > input[type="date"].form-control, .input-group-lg > input[type="date"].input-group-addon, .input-group-lg > .input-group-btn > input[type="date"].btn, input[type="time"].input-lg, .form-horizontal .form-group-lg input[type="time"].form-control, .input-group-lg > input[type="time"].form-control, .input-group-lg > input[type="time"].input-group-addon, .input-group-lg > .input-group-btn > input[type="time"].btn, input[type="datetime-local"].input-lg, .form-horizontal .form-group-lg input[type="datetime-local"].form-control, .input-group-lg > input[type="datetime-local"].form-control, .input-group-lg > input[type="datetime-local"].input-group-addon, .input-group-lg > .input-group-btn > input[type="datetime-local"].btn, input[type="month"].input-lg, .form-horizontal .form-group-lg input[type="month"].form-control, .input-group-lg > input[type="month"].form-control, .input-group-lg > input[type="month"].input-group-addon, .input-group-lg > .input-group-btn > input[type="month"].btn {
|
226 |
-
line-height: 46px
|
227 |
-
}
|
228 |
-
.form-group {
|
229 |
-
margin-bottom: 15px
|
230 |
-
}
|
231 |
-
.radio, .checkbox {
|
232 |
-
position: relative;
|
233 |
-
display: block;
|
234 |
-
min-height: 20px;
|
235 |
-
margin-top: 10px;
|
236 |
-
margin-bottom: 10px
|
237 |
-
}
|
238 |
-
.radio label, .checkbox label {
|
239 |
-
padding-left: 20px;
|
240 |
-
margin-bottom: 0;
|
241 |
-
font-weight: 400;
|
242 |
-
cursor: pointer
|
243 |
-
}
|
244 |
-
.radio input[type="radio"], .radio-inline input[type="radio"], .checkbox input[type="checkbox"], .checkbox-inline input[type="checkbox"] {
|
245 |
-
position: absolute;
|
246 |
-
margin-left: -20px;
|
247 |
-
margin-top: 4px \9
|
248 |
-
}
|
249 |
-
.radio + .radio, .checkbox + .checkbox {
|
250 |
-
margin-top: -5px
|
251 |
-
}
|
252 |
-
.radio-inline, .checkbox-inline {
|
253 |
-
display: inline-block;
|
254 |
-
padding-left: 20px;
|
255 |
-
margin-bottom: 0;
|
256 |
-
vertical-align: middle;
|
257 |
-
font-weight: 400;
|
258 |
-
cursor: pointer
|
259 |
-
}
|
260 |
-
.radio-inline + .radio-inline, .checkbox-inline + .checkbox-inline {
|
261 |
-
margin-top: 0;
|
262 |
-
margin-left: 10px
|
263 |
-
}
|
264 |
-
input[type="radio"][disabled], input[type="radio"].disabled, fieldset[disabled] input[type="radio"], input[type="checkbox"][disabled], input[type="checkbox"].disabled, fieldset[disabled] input[type="checkbox"], .radio-inline.disabled, fieldset[disabled] .radio-inline, .checkbox-inline.disabled, fieldset[disabled] .checkbox-inline, .radio.disabled label, fieldset[disabled] .radio label, .checkbox.disabled label, fieldset[disabled] .checkbox label {
|
265 |
-
cursor: not-allowed
|
266 |
-
}
|
267 |
-
.form-control-static {
|
268 |
-
padding-top: 7px;
|
269 |
-
padding-bottom: 7px;
|
270 |
-
margin-bottom: 0
|
271 |
-
}
|
272 |
-
.form-control-static.input-lg, .form-horizontal .form-group-lg .form-control-static.form-control, .input-group-lg > .form-control-static.form-control, .input-group-lg > .form-control-static.input-group-addon, .input-group-lg > .input-group-btn > .form-control-static.btn, .form-control-static.input-sm, .form-horizontal .form-group-sm .form-control-static.form-control, .input-group-sm > .form-control-static.form-control, .input-group-sm > .form-control-static.input-group-addon, .input-group-sm > .input-group-btn > .form-control-static.btn {
|
273 |
-
padding-left: 0;
|
274 |
-
padding-right: 0
|
275 |
-
}
|
276 |
-
.input-sm, .form-horizontal .form-group-sm .form-control, .input-group-sm > .form-control {
|
277 |
-
height: 30px;
|
278 |
-
padding: 5px 10px;
|
279 |
-
font-size: 12px;
|
280 |
-
line-height: 1.5;
|
281 |
-
border-radius: 3px
|
282 |
-
}
|
283 |
-
.input-group-sm > .input-group-addon {
|
284 |
-
height: 30px;
|
285 |
-
line-height: 1.5
|
286 |
-
}
|
287 |
-
.input-group-sm > .input-group-btn > .btn {
|
288 |
-
height: 30px;
|
289 |
-
padding: 5px 10px;
|
290 |
-
font-size: 12px;
|
291 |
-
line-height: 1.5;
|
292 |
-
border-radius: 3px
|
293 |
-
}
|
294 |
-
select.input-sm, .form-horizontal .form-group-sm select.form-control, .input-group-sm > select.form-control, .input-group-sm > select.input-group-addon, .input-group-sm > .input-group-btn > select.btn {
|
295 |
-
height: 30px;
|
296 |
-
line-height: 30px
|
297 |
-
}
|
298 |
-
textarea.input-sm, .form-horizontal .form-group-sm textarea.form-control, .input-group-sm > textarea.form-control, .input-group-sm > textarea.input-group-addon, .input-group-sm > .input-group-btn > textarea.btn, select[multiple].input-sm, .form-horizontal .form-group-sm select[multiple].form-control, .input-group-sm > select[multiple].form-control, .input-group-sm > select[multiple].input-group-addon, .input-group-sm > .input-group-btn > select[multiple].btn {
|
299 |
-
height: auto
|
300 |
-
}
|
301 |
-
.input-lg, .form-horizontal .form-group-lg .form-control, .input-group-lg > .form-control {
|
302 |
-
height: 46px;
|
303 |
-
padding: 10px 16px;
|
304 |
-
font-size: 18px;
|
305 |
-
line-height: 1.33;
|
306 |
-
border-radius: 6px
|
307 |
-
}
|
308 |
-
.input-group-lg > .input-group-addon {
|
309 |
-
height: 46px;
|
310 |
-
line-height: 1.33
|
311 |
-
}
|
312 |
-
.input-group-lg > .input-group-btn > .btn {
|
313 |
-
height: 46px;
|
314 |
-
padding: 10px 16px;
|
315 |
-
font-size: 18px;
|
316 |
-
line-height: 1.33;
|
317 |
-
border-radius: 6px
|
318 |
-
}
|
319 |
-
select.input-lg, .form-horizontal .form-group-lg select.form-control, .input-group-lg > select.form-control, .input-group-lg > select.input-group-addon, .input-group-lg > .input-group-btn > select.btn {
|
320 |
-
height: 46px;
|
321 |
-
line-height: 46px
|
322 |
-
}
|
323 |
-
textarea.input-lg, .form-horizontal .form-group-lg textarea.form-control, .input-group-lg > textarea.form-control, .input-group-lg > textarea.input-group-addon, .input-group-lg > .input-group-btn > textarea.btn, select[multiple].input-lg, .form-horizontal .form-group-lg select[multiple].form-control, .input-group-lg > select[multiple].form-control, .input-group-lg > select[multiple].input-group-addon, .input-group-lg > .input-group-btn > select[multiple].btn {
|
324 |
-
height: auto
|
325 |
-
}
|
326 |
-
.has-feedback {
|
327 |
-
position: relative
|
328 |
-
}
|
329 |
-
.has-feedback .form-control {
|
330 |
-
padding-right: 42.5px
|
331 |
-
}
|
332 |
-
.form-control-feedback {
|
333 |
-
position: absolute;
|
334 |
-
top: 25px;
|
335 |
-
right: 0;
|
336 |
-
z-index: 2;
|
337 |
-
display: block;
|
338 |
-
width: 34px;
|
339 |
-
height: 34px;
|
340 |
-
line-height: 34px;
|
341 |
-
text-align: center
|
342 |
-
}
|
343 |
-
.input-lg + .form-control-feedback, .form-horizontal .form-group-lg .form-control + .form-control-feedback, .input-group-lg > .form-control + .form-control-feedback, .input-group-lg > .input-group-addon + .form-control-feedback, .input-group-lg > .input-group-btn > .btn + .form-control-feedback {
|
344 |
-
width: 46px;
|
345 |
-
height: 46px;
|
346 |
-
line-height: 46px
|
347 |
-
}
|
348 |
-
.input-sm + .form-control-feedback, .form-horizontal .form-group-sm .form-control + .form-control-feedback, .input-group-sm > .form-control + .form-control-feedback, .input-group-sm > .input-group-addon + .form-control-feedback, .input-group-sm > .input-group-btn > .btn + .form-control-feedback {
|
349 |
-
width: 30px;
|
350 |
-
height: 30px;
|
351 |
-
line-height: 30px
|
352 |
-
}
|
353 |
-
.has-success .help-block, .has-success .control-label, .has-success .radio, .has-success .checkbox, .has-success .radio-inline, .has-success .checkbox-inline {
|
354 |
-
color: #3c763d
|
355 |
-
}
|
356 |
-
.has-success .form-control {
|
357 |
-
border-color: #3c763d;
|
358 |
-
box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075)
|
359 |
-
}
|
360 |
-
.has-success .form-control:focus {
|
361 |
-
border-color: #2b542c;
|
362 |
-
box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #67b168
|
363 |
-
}
|
364 |
-
.has-success .input-group-addon {
|
365 |
-
color: #3c763d;
|
366 |
-
border-color: #3c763d;
|
367 |
-
background-color: #dff0d8
|
368 |
-
}
|
369 |
-
.has-success .form-control-feedback {
|
370 |
-
color: #3c763d
|
371 |
-
}
|
372 |
-
.has-warning .help-block, .has-warning .control-label, .has-warning .radio, .has-warning .checkbox, .has-warning .radio-inline, .has-warning .checkbox-inline {
|
373 |
-
color: #8a6d3b
|
374 |
-
}
|
375 |
-
.has-warning .form-control {
|
376 |
-
border-color: #8a6d3b;
|
377 |
-
box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075)
|
378 |
-
}
|
379 |
-
.has-warning .form-control:focus {
|
380 |
-
border-color: #66512c;
|
381 |
-
box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #c0a16b
|
382 |
-
}
|
383 |
-
.has-warning .input-group-addon {
|
384 |
-
color: #8a6d3b;
|
385 |
-
border-color: #8a6d3b;
|
386 |
-
background-color: #fcf8e3
|
387 |
-
}
|
388 |
-
.has-warning .form-control-feedback {
|
389 |
-
color: #8a6d3b
|
390 |
-
}
|
391 |
-
.has-error .help-block, .has-error .control-label, .has-error .radio, .has-error .checkbox, .has-error .radio-inline, .has-error .checkbox-inline {
|
392 |
-
color: #a94442
|
393 |
-
}
|
394 |
-
.has-error .form-control {
|
395 |
-
border-color: #a94442;
|
396 |
-
box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075)
|
397 |
-
}
|
398 |
-
.has-error .form-control:focus {
|
399 |
-
border-color: #843534;
|
400 |
-
box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #ce8483
|
401 |
-
}
|
402 |
-
.has-error .input-group-addon {
|
403 |
-
color: #a94442;
|
404 |
-
border-color: #a94442;
|
405 |
-
background-color: #f2dede
|
406 |
-
}
|
407 |
-
.has-error .form-control-feedback {
|
408 |
-
color: #a94442
|
409 |
-
}
|
410 |
-
.has-feedback label.sr-only ~ .form-control-feedback {
|
411 |
-
top: 0
|
412 |
-
}
|
413 |
-
.help-block {
|
414 |
-
display: block;
|
415 |
-
margin-top: 5px;
|
416 |
-
margin-bottom: 10px;
|
417 |
-
color: #737373
|
418 |
-
}
|
419 |
-
.form-horizontal .radio, .form-horizontal .checkbox, .form-horizontal .radio-inline, .form-horizontal .checkbox-inline {
|
420 |
-
margin-top: 0;
|
421 |
-
margin-bottom: 0;
|
422 |
-
padding-top: 7px
|
423 |
-
}
|
424 |
-
.form-horizontal .radio, .form-horizontal .checkbox {
|
425 |
-
min-height: 27px
|
426 |
-
}
|
427 |
-
.form-horizontal .form-group {
|
428 |
-
margin-left: -15px;
|
429 |
-
margin-right: -15px
|
430 |
-
}
|
431 |
-
.form-horizontal .form-group:before {
|
432 |
-
content: " ";
|
433 |
-
display: table
|
434 |
-
}
|
435 |
-
.form-horizontal .form-group:after {
|
436 |
-
content: " ";
|
437 |
-
display: table;
|
438 |
-
clear: both
|
439 |
-
}
|
440 |
-
.form-horizontal .has-feedback .form-control-feedback {
|
441 |
-
top: 0;
|
442 |
-
right: 15px
|
443 |
-
}
|
444 |
-
.btn {
|
445 |
-
display: inline-block;
|
446 |
-
vertical-align: middle;
|
447 |
-
cursor: pointer;
|
448 |
-
background-image: none;
|
449 |
-
border: 1px solid transparent;
|
450 |
-
white-space: nowrap;
|
451 |
-
-webkit-user-select: none;
|
452 |
-
-moz-user-select: none;
|
453 |
-
-ms-user-select: none;
|
454 |
-
user-select: none
|
455 |
-
}
|
456 |
-
.btn:focus, .btn:active:focus, .btn.active:focus {
|
457 |
-
outline: thin dotted;
|
458 |
-
outline: 5px auto -webkit-focus-ring-color;
|
459 |
-
outline-offset: -2px
|
460 |
-
}
|
461 |
-
.btn:hover, .btn:focus {
|
462 |
-
color: #333333;
|
463 |
-
text-decoration: none
|
464 |
-
}
|
465 |
-
.btn:active, .btn.active {
|
466 |
-
outline: 0;
|
467 |
-
background-image: none;
|
468 |
-
box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125)
|
469 |
-
}
|
470 |
-
.btn.disabled, .btn[disabled], fieldset[disabled] .btn {
|
471 |
-
cursor: not-allowed;
|
472 |
-
pointer-events: none;
|
473 |
-
opacity: .65;
|
474 |
-
filter: alpha(opacity=65);
|
475 |
-
box-shadow: none
|
476 |
-
}
|
477 |
-
.btn-default {
|
478 |
-
color: #333333;
|
479 |
-
background-color: #ffffff;
|
480 |
-
border-color: #cccccc
|
481 |
-
}
|
482 |
-
.btn-default:hover, .btn-default:focus, .btn-default:active, .btn-default.active, .open > .btn-default.dropdown-toggle {
|
483 |
-
color: #333333;
|
484 |
-
background-color: #e6e6e6;
|
485 |
-
border-color: #adadad
|
486 |
-
}
|
487 |
-
.btn-default:active, .btn-default.active, .open > .btn-default.dropdown-toggle {
|
488 |
-
background-image: none
|
489 |
-
}
|
490 |
-
.btn-default.disabled, .btn-default.disabled:hover, .btn-default.disabled:focus, .btn-default.disabled:active, .btn-default.disabled.active, .btn-default[disabled], .btn-default[disabled]:hover, .btn-default[disabled]:focus, .btn-default[disabled]:active, .btn-default[disabled].active, fieldset[disabled] .btn-default, fieldset[disabled] .btn-default:hover, fieldset[disabled] .btn-default:focus, fieldset[disabled] .btn-default:active, fieldset[disabled] .btn-default.active {
|
491 |
-
background-color: #ffffff;
|
492 |
-
border-color: #cccccc
|
493 |
-
}
|
494 |
-
.btn-default .badge {
|
495 |
-
color: #ffffff;
|
496 |
-
background-color: #333333
|
497 |
-
}
|
498 |
-
.btn-primary {
|
499 |
-
color: #ffffff;
|
500 |
-
background-color: #428bca;
|
501 |
-
border-color: #357ebd
|
502 |
-
}
|
503 |
-
.btn-primary:hover, .btn-primary:focus, .btn-primary:active, .btn-primary.active, .open > .btn-primary.dropdown-toggle {
|
504 |
-
color: #ffffff;
|
505 |
-
background-color: #3071a9;
|
506 |
-
border-color: #285e8e
|
507 |
-
}
|
508 |
-
.btn-primary:active, .btn-primary.active, .open > .btn-primary.dropdown-toggle {
|
509 |
-
background-image: none
|
510 |
-
}
|
511 |
-
.btn-primary.disabled, .btn-primary.disabled:hover, .btn-primary.disabled:focus, .btn-primary.disabled:active, .btn-primary.disabled.active, .btn-primary[disabled], .btn-primary[disabled]:hover, .btn-primary[disabled]:focus, .btn-primary[disabled]:active, .btn-primary[disabled].active, fieldset[disabled] .btn-primary, fieldset[disabled] .btn-primary:hover, fieldset[disabled] .btn-primary:focus, fieldset[disabled] .btn-primary:active, fieldset[disabled] .btn-primary.active {
|
512 |
-
background-color: #428bca;
|
513 |
-
border-color: #357ebd
|
514 |
-
}
|
515 |
-
.btn-primary .badge {
|
516 |
-
color: #428bca;
|
517 |
-
background-color: #ffffff
|
518 |
-
}
|
519 |
-
.btn-success {
|
520 |
-
color: #ffffff;
|
521 |
-
background-color: #5cb85c;
|
522 |
-
border-color: #4cae4c
|
523 |
-
}
|
524 |
-
.btn-success:hover, .btn-success:focus, .btn-success:active, .btn-success.active, .open > .btn-success.dropdown-toggle {
|
525 |
-
color: #ffffff;
|
526 |
-
background-color: #449d44;
|
527 |
-
border-color: #398439
|
528 |
-
}
|
529 |
-
.btn-success:active, .btn-success.active, .open > .btn-success.dropdown-toggle {
|
530 |
-
background-image: none
|
531 |
-
}
|
532 |
-
.btn-success.disabled, .btn-success.disabled:hover, .btn-success.disabled:focus, .btn-success.disabled:active, .btn-success.disabled.active, .btn-success[disabled], .btn-success[disabled]:hover, .btn-success[disabled]:focus, .btn-success[disabled]:active, .btn-success[disabled].active, fieldset[disabled] .btn-success, fieldset[disabled] .btn-success:hover, fieldset[disabled] .btn-success:focus, fieldset[disabled] .btn-success:active, fieldset[disabled] .btn-success.active {
|
533 |
-
background-color: #5cb85c;
|
534 |
-
border-color: #4cae4c
|
535 |
-
}
|
536 |
-
.btn-success .badge {
|
537 |
-
color: #5cb85c;
|
538 |
-
background-color: #ffffff
|
539 |
-
}
|
540 |
-
.btn-info {
|
541 |
-
color: #ffffff;
|
542 |
-
background-color: #5bc0de;
|
543 |
-
border-color: #46b8da
|
544 |
-
}
|
545 |
-
.btn-info:hover, .btn-info:focus, .btn-info:active, .btn-info.active, .open > .btn-info.dropdown-toggle {
|
546 |
-
color: #ffffff;
|
547 |
-
background-color: #31b0d5;
|
548 |
-
border-color: #269abc
|
549 |
-
}
|
550 |
-
.btn-info:active, .btn-info.active, .open > .btn-info.dropdown-toggle {
|
551 |
-
background-image: none
|
552 |
-
}
|
553 |
-
.btn-info.disabled, .btn-info.disabled:hover, .btn-info.disabled:focus, .btn-info.disabled:active, .btn-info.disabled.active, .btn-info[disabled], .btn-info[disabled]:hover, .btn-info[disabled]:focus, .btn-info[disabled]:active, .btn-info[disabled].active, fieldset[disabled] .btn-info, fieldset[disabled] .btn-info:hover, fieldset[disabled] .btn-info:focus, fieldset[disabled] .btn-info:active, fieldset[disabled] .btn-info.active {
|
554 |
-
background-color: #5bc0de;
|
555 |
-
border-color: #46b8da
|
556 |
-
}
|
557 |
-
.btn-info .badge {
|
558 |
-
color: #5bc0de;
|
559 |
-
background-color: #ffffff
|
560 |
-
}
|
561 |
-
.btn-warning {
|
562 |
-
color: #ffffff;
|
563 |
-
background-color: #f0ad4e;
|
564 |
-
border-color: #eea236
|
565 |
-
}
|
566 |
-
.btn-warning:hover, .btn-warning:focus, .btn-warning:active, .btn-warning.active, .open > .btn-warning.dropdown-toggle {
|
567 |
-
color: #ffffff;
|
568 |
-
background-color: #ec971f;
|
569 |
-
border-color: #d58512
|
570 |
-
}
|
571 |
-
.btn-warning:active, .btn-warning.active, .open > .btn-warning.dropdown-toggle {
|
572 |
-
background-image: none
|
573 |
-
}
|
574 |
-
.btn-warning.disabled, .btn-warning.disabled:hover, .btn-warning.disabled:focus, .btn-warning.disabled:active, .btn-warning.disabled.active, .btn-warning[disabled], .btn-warning[disabled]:hover, .btn-warning[disabled]:focus, .btn-warning[disabled]:active, .btn-warning[disabled].active, fieldset[disabled] .btn-warning, fieldset[disabled] .btn-warning:hover, fieldset[disabled] .btn-warning:focus, fieldset[disabled] .btn-warning:active, fieldset[disabled] .btn-warning.active {
|
575 |
-
background-color: #f0ad4e;
|
576 |
-
border-color: #eea236
|
577 |
-
}
|
578 |
-
.btn-warning .badge {
|
579 |
-
color: #f0ad4e;
|
580 |
-
background-color: #ffffff
|
581 |
-
}
|
582 |
-
.btn-danger {
|
583 |
-
color: #ffffff;
|
584 |
-
background-color: #d9534f;
|
585 |
-
border-color: #d43f3a
|
586 |
-
}
|
587 |
-
.btn-danger:hover, .btn-danger:focus, .btn-danger:active, .btn-danger.active, .open > .btn-danger.dropdown-toggle {
|
588 |
-
color: #ffffff;
|
589 |
-
background-color: #c9302c;
|
590 |
-
border-color: #ac2925
|
591 |
-
}
|
592 |
-
.btn-danger:active, .btn-danger.active, .open > .btn-danger.dropdown-toggle {
|
593 |
-
background-image: none
|
594 |
-
}
|
595 |
-
.btn-danger.disabled, .btn-danger.disabled:hover, .btn-danger.disabled:focus, .btn-danger.disabled:active, .btn-danger.disabled.active, .btn-danger[disabled], .btn-danger[disabled]:hover, .btn-danger[disabled]:focus, .btn-danger[disabled]:active, .btn-danger[disabled].active, fieldset[disabled] .btn-danger, fieldset[disabled] .btn-danger:hover, fieldset[disabled] .btn-danger:focus, fieldset[disabled] .btn-danger:active, fieldset[disabled] .btn-danger.active {
|
596 |
-
background-color: #d9534f;
|
597 |
-
border-color: #d43f3a
|
598 |
-
}
|
599 |
-
.btn-danger .badge {
|
600 |
-
color: #d9534f;
|
601 |
-
background-color: #ffffff
|
602 |
-
}
|
603 |
-
.btn-link {
|
604 |
-
color: #428bca;
|
605 |
-
font-weight: 400;
|
606 |
-
cursor: pointer;
|
607 |
-
border-radius: 0
|
608 |
-
}
|
609 |
-
.btn-link, .btn-link:active, .btn-link[disabled], fieldset[disabled] .btn-link {
|
610 |
-
background-color: transparent;
|
611 |
-
box-shadow: none
|
612 |
-
}
|
613 |
-
.btn-link, .btn-link:hover, .btn-link:focus, .btn-link:active {
|
614 |
-
border-color: transparent
|
615 |
-
}
|
616 |
-
.btn-link:hover, .btn-link:focus {
|
617 |
-
color: #2a6496;
|
618 |
-
text-decoration: underline;
|
619 |
-
background-color: transparent
|
620 |
-
}
|
621 |
-
.btn-link[disabled]:hover, .btn-link[disabled]:focus, fieldset[disabled] .btn-link:hover, fieldset[disabled] .btn-link:focus {
|
622 |
-
color: #777777;
|
623 |
-
text-decoration: none
|
624 |
-
}
|
625 |
-
.btn-lg {
|
626 |
-
padding: 10px 16px;
|
627 |
-
font-size: 18px;
|
628 |
-
line-height: 1.33;
|
629 |
-
border-radius: 6px
|
630 |
-
}
|
631 |
-
.btn-sm {
|
632 |
-
padding: 5px 10px
|
633 |
-
}
|
634 |
-
.btn-sm, .btn-xs {
|
635 |
-
font-size: 12px;
|
636 |
-
line-height: 1.5;
|
637 |
-
border-radius: 3px
|
638 |
-
}
|
639 |
-
.btn-xs {
|
640 |
-
padding: 1px 5px
|
641 |
-
}
|
642 |
-
.btn-block {
|
643 |
-
display: block;
|
644 |
-
width: 100%
|
645 |
-
}
|
646 |
-
.btn-block + .btn-block {
|
647 |
-
margin-top: 5px
|
648 |
-
}
|
649 |
-
input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="button"].btn-block {
|
650 |
-
width: 100%
|
651 |
-
}
|
652 |
-
.fade {
|
653 |
-
opacity: 0;
|
654 |
-
-webkit-transition: opacity .15s linear;
|
655 |
-
transition: opacity .15s linear
|
656 |
-
}
|
657 |
-
.fade.in {
|
658 |
-
opacity: 1
|
659 |
-
}
|
660 |
-
.collapse {
|
661 |
-
display: none
|
662 |
-
}
|
663 |
-
.collapse.in {
|
664 |
-
display: block
|
665 |
-
}
|
666 |
-
tr.collapse.in {
|
667 |
-
display: table-row
|
668 |
-
}
|
669 |
-
tbody.collapse.in {
|
670 |
-
display: table-row-group
|
671 |
-
}
|
672 |
-
.collapsing {
|
673 |
-
position: relative;
|
674 |
-
height: 0;
|
675 |
-
overflow: hidden;
|
676 |
-
-webkit-transition: height .35s ease;
|
677 |
-
transition: height .35s ease
|
678 |
-
}
|
679 |
-
.input-group {
|
680 |
-
position: relative;
|
681 |
-
display: table;
|
682 |
-
border-collapse: separate
|
683 |
-
}
|
684 |
-
.input-group[class*="col-"] {
|
685 |
-
float: none;
|
686 |
-
padding-left: 0;
|
687 |
-
padding-right: 0
|
688 |
-
}
|
689 |
-
.input-group .form-control {
|
690 |
-
position: relative;
|
691 |
-
z-index: 2;
|
692 |
-
float: left;
|
693 |
-
width: 100%;
|
694 |
-
margin-bottom: 0
|
695 |
-
}
|
696 |
-
.input-group-addon, .input-group-btn, .input-group .form-control {
|
697 |
-
display: table-cell
|
698 |
-
}
|
699 |
-
.input-group-addon:not(:first-child):not(:last-child), .input-group-btn:not(:first-child):not(:last-child), .input-group .form-control:not(:first-child):not(:last-child) {
|
700 |
-
border-radius: 0
|
701 |
-
}
|
702 |
-
.input-group-addon {
|
703 |
-
white-space: nowrap
|
704 |
-
}
|
705 |
-
.input-group-addon, .input-group-btn {
|
706 |
-
width: 1%;
|
707 |
-
vertical-align: middle
|
708 |
-
}
|
709 |
-
.input-group-addon {
|
710 |
-
padding: 6px 12px;
|
711 |
-
font-size: 14px;
|
712 |
-
font-weight: 400;
|
713 |
-
line-height: 1;
|
714 |
-
color: #555555;
|
715 |
-
text-align: center;
|
716 |
-
background-color: #eeeeee;
|
717 |
-
border: 1px solid #cccccc;
|
718 |
-
border-radius: 4px
|
719 |
-
}
|
720 |
-
.input-group-addon.input-sm, .form-horizontal .form-group-sm .input-group-addon.form-control, .input-group-sm > .input-group-addon, .input-group-sm > .input-group-btn > .input-group-addon.btn {
|
721 |
-
padding: 5px 10px;
|
722 |
-
font-size: 12px;
|
723 |
-
border-radius: 3px
|
724 |
-
}
|
725 |
-
.input-group-addon.input-lg, .form-horizontal .form-group-lg .input-group-addon.form-control, .input-group-lg > .input-group-addon, .input-group-lg > .input-group-btn > .input-group-addon.btn {
|
726 |
-
padding: 10px 16px;
|
727 |
-
font-size: 18px;
|
728 |
-
border-radius: 6px
|
729 |
-
}
|
730 |
-
.input-group-addon input[type="radio"], .input-group-addon input[type="checkbox"] {
|
731 |
-
margin-top: 0
|
732 |
-
}
|
733 |
-
.input-group .form-control:first-child, .input-group-addon:first-child, .input-group-btn:first-child > .btn, .input-group-btn:first-child > .btn-group > .btn, .input-group-btn:first-child > .dropdown-toggle, .input-group-btn:last-child > .btn:not(:last-child):not(.dropdown-toggle), .input-group-btn:last-child > .btn-group:not(:last-child) > .btn {
|
734 |
-
border-bottom-right-radius: 0;
|
735 |
-
border-top-right-radius: 0
|
736 |
-
}
|
737 |
-
.input-group-addon:first-child {
|
738 |
-
border-right: 0
|
739 |
-
}
|
740 |
-
.input-group .form-control:last-child, .input-group-addon:last-child, .input-group-btn:last-child > .btn, .input-group-btn:last-child > .btn-group > .btn, .input-group-btn:last-child > .dropdown-toggle, .input-group-btn:first-child > .btn:not(:first-child), .input-group-btn:first-child > .btn-group:not(:first-child) > .btn {
|
741 |
-
border-bottom-left-radius: 0;
|
742 |
-
border-top-left-radius: 0
|
743 |
-
}
|
744 |
-
.input-group-addon:last-child {
|
745 |
-
border-left: 0
|
746 |
-
}
|
747 |
-
.input-group-btn {
|
748 |
-
font-size: 0;
|
749 |
-
white-space: nowrap
|
750 |
-
}
|
751 |
-
.input-group-btn, .input-group-btn > .btn {
|
752 |
-
position: relative
|
753 |
-
}
|
754 |
-
.input-group-btn > .btn + .btn {
|
755 |
-
margin-left: -1px
|
756 |
-
}
|
757 |
-
.input-group-btn > .btn:hover, .input-group-btn > .btn:focus, .input-group-btn > .btn:active {
|
758 |
-
z-index: 2
|
759 |
-
}
|
760 |
-
.input-group-btn:first-child > .btn, .input-group-btn:first-child > .btn-group {
|
761 |
-
margin-right: -1px
|
762 |
-
}
|
763 |
-
.input-group-btn:last-child > .btn, .input-group-btn:last-child > .btn-group {
|
764 |
-
margin-left: -1px
|
765 |
-
}
|
766 |
-
.pagination {
|
767 |
-
display: inline-block;
|
768 |
-
padding-left: 0;
|
769 |
-
margin: 20px 0;
|
770 |
-
border-radius: 4px
|
771 |
-
}
|
772 |
-
.pagination > li {
|
773 |
-
display: inline
|
774 |
-
}
|
775 |
-
.pagination > li > a, .pagination > li > span {
|
776 |
-
position: relative;
|
777 |
-
float: left;
|
778 |
-
padding: 6px 12px;
|
779 |
-
line-height: 1.4285714;
|
780 |
-
text-decoration: none;
|
781 |
-
color: #428bca;
|
782 |
-
background-color: #ffffff;
|
783 |
-
border: 1px solid #dddddd;
|
784 |
-
margin-left: -1px
|
785 |
-
}
|
786 |
-
.pagination > li:first-child > a, .pagination > li:first-child > span {
|
787 |
-
margin-left: 0;
|
788 |
-
border-bottom-left-radius: 4px;
|
789 |
-
border-top-left-radius: 4px
|
790 |
-
}
|
791 |
-
.pagination > li:last-child > a, .pagination > li:last-child > span {
|
792 |
-
border-bottom-right-radius: 4px;
|
793 |
-
border-top-right-radius: 4px
|
794 |
-
}
|
795 |
-
.pagination > li > a:hover, .pagination > li > a:focus, .pagination > li > span:hover, .pagination > li > span:focus {
|
796 |
-
color: #2a6496;
|
797 |
-
background-color: #eeeeee;
|
798 |
-
border-color: #dddddd
|
799 |
-
}
|
800 |
-
.pagination > .active > a, .pagination > .active > a:hover, .pagination > .active > a:focus, .pagination > .active > span, .pagination > .active > span:hover, .pagination > .active > span:focus {
|
801 |
-
z-index: 2;
|
802 |
-
color: #ffffff;
|
803 |
-
background-color: #428bca;
|
804 |
-
border-color: #428bca;
|
805 |
-
cursor: default
|
806 |
-
}
|
807 |
-
.pagination > .disabled > span, .pagination > .disabled > span:hover, .pagination > .disabled > span:focus, .pagination > .disabled > a, .pagination > .disabled > a:hover, .pagination > .disabled > a:focus {
|
808 |
-
color: #777777;
|
809 |
-
background-color: #ffffff;
|
810 |
-
border-color: #dddddd;
|
811 |
-
cursor: not-allowed
|
812 |
-
}
|
813 |
-
.pagination-lg > li > a, .pagination-lg > li > span {
|
814 |
-
padding: 10px 16px;
|
815 |
-
font-size: 18px
|
816 |
-
}
|
817 |
-
.pagination-lg > li:first-child > a, .pagination-lg > li:first-child > span {
|
818 |
-
border-bottom-left-radius: 6px;
|
819 |
-
border-top-left-radius: 6px
|
820 |
-
}
|
821 |
-
.pagination-lg > li:last-child > a, .pagination-lg > li:last-child > span {
|
822 |
-
border-bottom-right-radius: 6px;
|
823 |
-
border-top-right-radius: 6px
|
824 |
-
}
|
825 |
-
.pagination-sm > li > a, .pagination-sm > li > span {
|
826 |
-
padding: 5px 10px;
|
827 |
-
font-size: 12px
|
828 |
-
}
|
829 |
-
.pagination-sm > li:first-child > a, .pagination-sm > li:first-child > span {
|
830 |
-
border-bottom-left-radius: 3px;
|
831 |
-
border-top-left-radius: 3px
|
832 |
-
}
|
833 |
-
.pagination-sm > li:last-child > a, .pagination-sm > li:last-child > span {
|
834 |
-
border-bottom-right-radius: 3px;
|
835 |
-
border-top-right-radius: 3px
|
836 |
-
}
|
837 |
-
.close {
|
838 |
-
float: right;
|
839 |
-
font-size: 21px;
|
840 |
-
font-weight: 700;
|
841 |
-
line-height: 1;
|
842 |
-
color: #000000;
|
843 |
-
text-shadow: 0 1px 0 #ffffff;
|
844 |
-
opacity: .2;
|
845 |
-
filter: alpha(opacity=20)
|
846 |
-
}
|
847 |
-
.close:hover, .close:focus {
|
848 |
-
color: #000000;
|
849 |
-
text-decoration: none;
|
850 |
-
cursor: pointer;
|
851 |
-
opacity: .5;
|
852 |
-
filter: alpha(opacity=50)
|
853 |
-
}
|
854 |
-
button.close {
|
855 |
-
padding: 0;
|
856 |
-
cursor: pointer;
|
857 |
-
background: 0 0;
|
858 |
-
border: 0;
|
859 |
-
-webkit-appearance: none
|
860 |
-
}
|
861 |
-
.modal-open, .modal {
|
862 |
-
overflow: hidden
|
863 |
-
}
|
864 |
-
.modal {
|
865 |
-
display: none;
|
866 |
-
position: fixed;
|
867 |
-
top: 0;
|
868 |
-
right: 0;
|
869 |
-
bottom: 0;
|
870 |
-
left: 0;
|
871 |
-
z-index: 1050;
|
872 |
-
-webkit-overflow-scrolling: touch;
|
873 |
-
outline: 0
|
874 |
-
}
|
875 |
-
.modal.fade .modal-dialog {
|
876 |
-
-webkit-transform: translate3d(0, -25%, 0);
|
877 |
-
transform: translate3d(0, -25%, 0);
|
878 |
-
-webkit-transition: -webkit-transform .3s ease-out;
|
879 |
-
transition: transform .3s ease-out;
|
880 |
-
transition: transform .3s ease-out, -webkit-transform .3s ease-out
|
881 |
-
}
|
882 |
-
.modal.in .modal-dialog {
|
883 |
-
-webkit-transform: translate3d(0, 0, 0);
|
884 |
-
transform: translate3d(0, 0, 0)
|
885 |
-
}
|
886 |
-
.modal-open .modal {
|
887 |
-
overflow-x: hidden;
|
888 |
-
overflow-y: auto
|
889 |
-
}
|
890 |
-
.modal-dialog {
|
891 |
-
position: relative;
|
892 |
-
width: auto;
|
893 |
-
margin: 10px
|
894 |
-
}
|
895 |
-
.modal-content {
|
896 |
-
position: relative;
|
897 |
-
background-color: #ffffff;
|
898 |
-
border: 1px solid #999999;
|
899 |
-
border: 1px solid rgba(0, 0, 0, .2);
|
900 |
-
border-radius: 6px;
|
901 |
-
box-shadow: 0 3px 9px rgba(0, 0, 0, .5);
|
902 |
-
background-clip: padding-box;
|
903 |
-
outline: 0
|
904 |
-
}
|
905 |
-
.modal-backdrop {
|
906 |
-
position: fixed;
|
907 |
-
top: 0;
|
908 |
-
right: 0;
|
909 |
-
bottom: 0;
|
910 |
-
left: 0;
|
911 |
-
z-index: 1040;
|
912 |
-
background-color: #000000
|
913 |
-
}
|
914 |
-
.modal-backdrop.fade {
|
915 |
-
opacity: 0;
|
916 |
-
filter: alpha(opacity=0)
|
917 |
-
}
|
918 |
-
.modal-backdrop.in {
|
919 |
-
opacity: .5;
|
920 |
-
filter: alpha(opacity=50)
|
921 |
-
}
|
922 |
-
.modal-header {
|
923 |
-
padding: 15px;
|
924 |
-
border-bottom: 1px solid #e5e5e5;
|
925 |
-
min-height: 16.4285714px
|
926 |
-
}
|
927 |
-
.modal-header .close {
|
928 |
-
margin-top: -2px
|
929 |
-
}
|
930 |
-
.modal-title {
|
931 |
-
margin: 0;
|
932 |
-
line-height: 1.4285714
|
933 |
-
}
|
934 |
-
.modal-body {
|
935 |
-
position: relative;
|
936 |
-
padding: 15px
|
937 |
-
}
|
938 |
-
.modal-footer {
|
939 |
-
padding: 15px;
|
940 |
-
text-align: right;
|
941 |
-
border-top: 1px solid #e5e5e5
|
942 |
-
}
|
943 |
-
.modal-footer:before, .modal-footer:after {
|
944 |
-
content: " ";
|
945 |
-
display: table
|
946 |
-
}
|
947 |
-
.modal-footer:after {
|
948 |
-
clear: both
|
949 |
-
}
|
950 |
-
.modal-footer .btn + .btn {
|
951 |
-
margin-left: 5px;
|
952 |
-
margin-bottom: 0
|
953 |
-
}
|
954 |
-
.modal-footer .btn-group .btn + .btn {
|
955 |
-
margin-left: -1px
|
956 |
-
}
|
957 |
-
.modal-footer .btn-block + .btn-block {
|
958 |
-
margin-left: 0
|
959 |
-
}
|
960 |
-
.modal-scrollbar-measure {
|
961 |
-
position: absolute;
|
962 |
-
top: -9999px;
|
963 |
-
width: 50px;
|
964 |
-
height: 50px;
|
965 |
-
overflow: scroll
|
966 |
-
}
|
967 |
-
.clearfix:before, .clearfix:after {
|
968 |
-
content: " ";
|
969 |
-
display: table
|
970 |
-
}
|
971 |
-
.clearfix:after {
|
972 |
-
clear: both
|
973 |
-
}
|
974 |
-
.center-block {
|
975 |
-
display: block;
|
976 |
-
margin-left: auto;
|
977 |
-
margin-right: auto
|
978 |
-
}
|
979 |
-
.pull-right {
|
980 |
-
float: right !important
|
981 |
-
}
|
982 |
-
.pull-left {
|
983 |
-
float: left !important
|
984 |
-
}
|
985 |
-
.hide {
|
986 |
-
display: none !important
|
987 |
-
}
|
988 |
-
.show {
|
989 |
-
display: block !important
|
990 |
-
}
|
991 |
-
.invisible {
|
992 |
-
visibility: hidden
|
993 |
-
}
|
994 |
-
.text-hide {
|
995 |
-
font: 0/0 a;
|
996 |
-
color: transparent;
|
997 |
-
text-shadow: none;
|
998 |
-
background-color: transparent;
|
999 |
-
border: 0
|
1000 |
-
}
|
1001 |
-
.hidden {
|
1002 |
-
display: none !important;
|
1003 |
-
visibility: hidden !important
|
1004 |
-
}
|
1005 |
-
.affix {
|
1006 |
-
position: fixed;
|
1007 |
-
-webkit-transform: translate3d(0, 0, 0);
|
1008 |
-
transform: translate3d(0, 0, 0)
|
1009 |
-
}
|
1010 |
-
.hljs {
|
1011 |
-
display: block;
|
1012 |
-
overflow-x: auto;
|
1013 |
-
padding: .5em;
|
1014 |
-
background: #002b36;
|
1015 |
-
color: #839496;
|
1016 |
-
-webkit-text-size-adjust: none
|
1017 |
-
}
|
1018 |
-
.hljs-comment, .hljs-template_comment, .diff .hljs-header, .hljs-doctype, .hljs-pi, .lisp .hljs-string, .hljs-javadoc {
|
1019 |
-
color: #586e75
|
1020 |
-
}
|
1021 |
-
.hljs-keyword, .hljs-winutils, .method, .hljs-addition, .css .hljs-tag, .hljs-request, .hljs-status, .nginx .hljs-title {
|
1022 |
-
color: #859900
|
1023 |
-
}
|
1024 |
-
.hljs-number, .hljs-command, .hljs-string, .hljs-tag .hljs-value, .hljs-rules .hljs-value, .hljs-phpdoc, .hljs-dartdoc, .tex .hljs-formula, .hljs-regexp, .hljs-hexcolor, .hljs-link_url {
|
1025 |
-
color: #2aa198
|
1026 |
-
}
|
1027 |
-
.hljs-title, .hljs-localvars, .hljs-chunk, .hljs-decorator, .hljs-built_in, .hljs-identifier, .vhdl .hljs-literal, .hljs-id, .css .hljs-function {
|
1028 |
-
color: #268bd2
|
1029 |
-
}
|
1030 |
-
.hljs-attribute, .hljs-variable, .lisp .hljs-body, .smalltalk .hljs-number, .hljs-constant, .hljs-class .hljs-title, .hljs-parent, .hljs-type, .hljs-link_reference {
|
1031 |
-
color: #b58900
|
1032 |
-
}
|
1033 |
-
.hljs-preprocessor, .hljs-preprocessor .hljs-keyword, .hljs-pragma, .hljs-shebang, .hljs-symbol, .hljs-symbol .hljs-string, .diff .hljs-change, .hljs-special, .hljs-attr_selector, .hljs-subst, .hljs-cdata, .css .hljs-pseudo, .hljs-header {
|
1034 |
-
color: #cb4b16
|
1035 |
-
}
|
1036 |
-
.hljs-deletion, .hljs-important {
|
1037 |
-
color: #dc322f
|
1038 |
-
}
|
1039 |
-
.hljs-link_label {
|
1040 |
-
color: #6c71c4
|
1041 |
-
}
|
1042 |
-
.tex .hljs-formula {
|
1043 |
-
background: #073642
|
1044 |
-
}
|
1045 |
-
*, *:before, *:after {
|
1046 |
-
box-sizing: border-box
|
1047 |
-
}
|
1048 |
-
html {
|
1049 |
-
-ms-text-size-adjust: 100%;
|
1050 |
-
-webkit-text-size-adjust: 100%
|
1051 |
-
}
|
1052 |
-
body {
|
1053 |
-
margin: 0
|
1054 |
-
}
|
1055 |
-
article, aside, details, figcaption, figure, footer, header, hgroup, main, nav, section, summary {
|
1056 |
-
display: block
|
1057 |
-
}
|
1058 |
-
audio, canvas, progress, video {
|
1059 |
-
display: inline-block;
|
1060 |
-
vertical-align: baseline
|
1061 |
-
}
|
1062 |
-
audio:not([controls]) {
|
1063 |
-
display: none;
|
1064 |
-
height: 0
|
1065 |
-
}
|
1066 |
-
[hidden], template {
|
1067 |
-
display: none
|
1068 |
-
}
|
1069 |
-
a {
|
1070 |
-
background: 0 0
|
1071 |
-
}
|
1072 |
-
a:active, a:hover {
|
1073 |
-
outline: 0
|
1074 |
-
}
|
1075 |
-
abbr[title] {
|
1076 |
-
border-bottom: 1px dotted
|
1077 |
-
}
|
1078 |
-
b, strong {
|
1079 |
-
font-weight: 700
|
1080 |
-
}
|
1081 |
-
dfn {
|
1082 |
-
font-style: italic
|
1083 |
-
}
|
1084 |
-
h1 {
|
1085 |
-
margin: .67em 0
|
1086 |
-
}
|
1087 |
-
mark {
|
1088 |
-
background: #ffff00;
|
1089 |
-
color: #000000
|
1090 |
-
}
|
1091 |
-
small {
|
1092 |
-
font-size: 80%
|
1093 |
-
}
|
1094 |
-
sub, sup {
|
1095 |
-
font-size: 75%;
|
1096 |
-
line-height: 0;
|
1097 |
-
position: relative;
|
1098 |
-
vertical-align: baseline
|
1099 |
-
}
|
1100 |
-
sup {
|
1101 |
-
top: -.5em
|
1102 |
-
}
|
1103 |
-
sub {
|
1104 |
-
bottom: -.25em
|
1105 |
-
}
|
1106 |
-
images {
|
1107 |
-
border: 0
|
1108 |
-
}
|
1109 |
-
svg:not(:root) {
|
1110 |
-
overflow: hidden
|
1111 |
-
}
|
1112 |
-
figure {
|
1113 |
-
margin: 1em 40px
|
1114 |
-
}
|
1115 |
-
hr {
|
1116 |
-
box-sizing: content-box;
|
1117 |
-
height: 0
|
1118 |
-
}
|
1119 |
-
pre {
|
1120 |
-
overflow: auto
|
1121 |
-
}
|
1122 |
-
code, kbd {
|
1123 |
-
font-size: 1em
|
1124 |
-
}
|
1125 |
-
code, kbd, pre, samp {
|
1126 |
-
font-family: monospace, monospace
|
1127 |
-
}
|
1128 |
-
samp {
|
1129 |
-
font-size: 1em
|
1130 |
-
}
|
1131 |
-
button, input, optgroup, select, textarea {
|
1132 |
-
color: inherit;
|
1133 |
-
font: inherit;
|
1134 |
-
margin: 0
|
1135 |
-
}
|
1136 |
-
button {
|
1137 |
-
overflow: visible
|
1138 |
-
}
|
1139 |
-
button, select {
|
1140 |
-
text-transform: none
|
1141 |
-
}
|
1142 |
-
button, html input[type="button"], input[type="reset"], input[type="submit"] {
|
1143 |
-
-webkit-appearance: button;
|
1144 |
-
cursor: pointer
|
1145 |
-
}
|
1146 |
-
button[disabled], html input[disabled] {
|
1147 |
-
cursor: default
|
1148 |
-
}
|
1149 |
-
button::-moz-focus-inner, input::-moz-focus-inner {
|
1150 |
-
border: 0;
|
1151 |
-
padding: 0
|
1152 |
-
}
|
1153 |
-
input {
|
1154 |
-
line-height: normal
|
1155 |
-
}
|
1156 |
-
input[type="checkbox"], input[type="radio"] {
|
1157 |
-
box-sizing: border-box;
|
1158 |
-
padding: 0
|
1159 |
-
}
|
1160 |
-
input[type="number"]::-webkit-inner-spin-button, input[type="number"]::-webkit-outer-spin-button {
|
1161 |
-
height: auto
|
1162 |
-
}
|
1163 |
-
input[type="search"] {
|
1164 |
-
-webkit-appearance: textfield;
|
1165 |
-
box-sizing: content-box
|
1166 |
-
}
|
1167 |
-
input[type="search"]::-webkit-search-cancel-button, input[type="search"]::-webkit-search-decoration {
|
1168 |
-
-webkit-appearance: none
|
1169 |
-
}
|
1170 |
-
fieldset {
|
1171 |
-
border: 1px solid silver;
|
1172 |
-
margin: 0 2px;
|
1173 |
-
padding: .35em .625em .75em
|
1174 |
-
}
|
1175 |
-
legend {
|
1176 |
-
border: 0;
|
1177 |
-
padding: 0
|
1178 |
-
}
|
1179 |
-
textarea {
|
1180 |
-
overflow: auto
|
1181 |
-
}
|
1182 |
-
optgroup {
|
1183 |
-
font-weight: 700
|
1184 |
-
}
|
1185 |
-
table {
|
1186 |
-
border-collapse: collapse;
|
1187 |
-
border-spacing: 0
|
1188 |
-
}
|
1189 |
-
.debug {
|
1190 |
-
background-color: #ffc0cb !important
|
1191 |
-
}
|
1192 |
-
.ellipsis {
|
1193 |
-
overflow: hidden;
|
1194 |
-
text-overflow: ellipsis;
|
1195 |
-
white-space: nowrap
|
1196 |
-
}
|
1197 |
-
.ir {
|
1198 |
-
background-color: transparent;
|
1199 |
-
border: 0;
|
1200 |
-
overflow: hidden
|
1201 |
-
}
|
1202 |
-
.ir::before {
|
1203 |
-
content: '';
|
1204 |
-
display: block;
|
1205 |
-
height: 150%;
|
1206 |
-
width: 0
|
1207 |
-
}
|
1208 |
-
html {
|
1209 |
-
font-size: .875em;
|
1210 |
-
background: #ffffff;
|
1211 |
-
color: #373d49
|
1212 |
-
}
|
1213 |
-
html, body {
|
1214 |
-
font-family: Georgia, Cambria, serif;
|
1215 |
-
height: 100%
|
1216 |
-
}
|
1217 |
-
body {
|
1218 |
-
font-size: 1rem;
|
1219 |
-
font-weight: 400;
|
1220 |
-
line-height: 2rem
|
1221 |
-
}
|
1222 |
-
ul, ol {
|
1223 |
-
margin-bottom: .83999rem;
|
1224 |
-
padding-top: .16001rem
|
1225 |
-
}
|
1226 |
-
li {
|
1227 |
-
-webkit-font-feature-settings: 'kern' 1, 'onum' 1, 'liga' 1;
|
1228 |
-
font-feature-settings: 'kern' 1, 'onum' 1, 'liga' 1;
|
1229 |
-
margin-left: 1rem
|
1230 |
-
}
|
1231 |
-
li > ul, li > ol {
|
1232 |
-
margin-bottom: 0
|
1233 |
-
}
|
1234 |
-
p {
|
1235 |
-
padding-top: .66001rem;
|
1236 |
-
-webkit-font-feature-settings: 'kern' 1, 'onum' 1, 'liga' 1;
|
1237 |
-
font-feature-settings: 'kern' 1, 'onum' 1, 'liga' 1;
|
1238 |
-
margin-top: 0
|
1239 |
-
}
|
1240 |
-
p, pre {
|
1241 |
-
margin-bottom: 1.33999rem
|
1242 |
-
}
|
1243 |
-
pre {
|
1244 |
-
font-size: 1rem;
|
1245 |
-
padding: .66001rem 9.5px 9.5px;
|
1246 |
-
line-height: 2rem;
|
1247 |
-
background: -webkit-linear-gradient(top, #ffffff 0, #ffffff .75rem, #f5f7fa .75rem, #f5f7fa 2.75rem, #ffffff 2.75rem, #ffffff 4rem);
|
1248 |
-
background: linear-gradient(to bottom, #ffffff 0, #ffffff .75rem, #f5f7fa .75rem, #f5f7fa 2.75rem, #ffffff 2.75rem, #ffffff 4rem);
|
1249 |
-
background-size: 100% 4rem;
|
1250 |
-
border-color: #d3daea
|
1251 |
-
}
|
1252 |
-
blockquote {
|
1253 |
-
margin: 0
|
1254 |
-
}
|
1255 |
-
blockquote p {
|
1256 |
-
font-size: 1rem;
|
1257 |
-
margin-bottom: .33999rem;
|
1258 |
-
font-style: italic;
|
1259 |
-
padding: .66001rem 1rem 1rem;
|
1260 |
-
border-left: 3px solid #a0aabf
|
1261 |
-
}
|
1262 |
-
th, td {
|
1263 |
-
padding: 12px
|
1264 |
-
}
|
1265 |
-
h1, h2, h3, h4, h5, h6 {
|
1266 |
-
font-family: "Source Sans Pro", "Helvetica Neue", Helvetica, Arial, sans-serif;
|
1267 |
-
-webkit-font-feature-settings: 'dlig' 1, 'liga' 1, 'lnum' 1, 'kern' 1;
|
1268 |
-
font-feature-settings: 'dlig' 1, 'liga' 1, 'lnum' 1, 'kern' 1;
|
1269 |
-
font-style: normal;
|
1270 |
-
font-weight: 600;
|
1271 |
-
margin-top: 0
|
1272 |
-
}
|
1273 |
-
h1 {
|
1274 |
-
line-height: 3rem;
|
1275 |
-
font-size: 2.0571429rem;
|
1276 |
-
margin-bottom: .21999rem;
|
1277 |
-
padding-top: .78001rem
|
1278 |
-
}
|
1279 |
-
h2 {
|
1280 |
-
font-size: 1.953125rem;
|
1281 |
-
margin-bottom: .1835837rem;
|
1282 |
-
padding-top: .8164163rem
|
1283 |
-
}
|
1284 |
-
h2, h3 {
|
1285 |
-
line-height: 3rem
|
1286 |
-
}
|
1287 |
-
h3 {
|
1288 |
-
font-size: 1.6457143rem;
|
1289 |
-
margin-bottom: .07599rem;
|
1290 |
-
padding-top: .92401rem
|
1291 |
-
}
|
1292 |
-
h4 {
|
1293 |
-
font-size: 1.5625rem;
|
1294 |
-
margin-bottom: .546865rem;
|
1295 |
-
padding-top: .453135rem
|
1296 |
-
}
|
1297 |
-
h5 {
|
1298 |
-
font-size: 1.25rem;
|
1299 |
-
margin-bottom: -.56251rem;
|
1300 |
-
padding-top: .56251rem
|
1301 |
-
}
|
1302 |
-
h6 {
|
1303 |
-
font-size: 1rem;
|
1304 |
-
margin-bottom: -.65001rem;
|
1305 |
-
padding-top: .65001rem
|
1306 |
-
}
|
1307 |
-
a {
|
1308 |
-
cursor: pointer;
|
1309 |
-
color: #15b748;
|
1310 |
-
text-decoration: none
|
1311 |
-
}
|
1312 |
-
a:hover, a:focus {
|
1313 |
-
border-bottom-color: #15b748;
|
1314 |
-
color: #17c1a1
|
1315 |
-
}
|
1316 |
-
img {
|
1317 |
-
height: auto;
|
1318 |
-
max-width: 100%
|
1319 |
-
}
|
1320 |
-
.g {
|
1321 |
-
display: block
|
1322 |
-
}
|
1323 |
-
.g:after {
|
1324 |
-
clear: both;
|
1325 |
-
content: '';
|
1326 |
-
display: table
|
1327 |
-
}
|
1328 |
-
.g-b {
|
1329 |
-
float: left;
|
1330 |
-
margin: 0;
|
1331 |
-
width: 100%
|
1332 |
-
}
|
1333 |
-
.g {
|
1334 |
-
margin-left: -16px;
|
1335 |
-
margin-right: -16px
|
1336 |
-
}
|
1337 |
-
.g-b {
|
1338 |
-
padding-left: 16px;
|
1339 |
-
padding-right: 16px
|
1340 |
-
}
|
1341 |
-
.g-b--center {
|
1342 |
-
display: block;
|
1343 |
-
float: none;
|
1344 |
-
margin: 0 auto
|
1345 |
-
}
|
1346 |
-
.g-b--right {
|
1347 |
-
float: right
|
1348 |
-
}
|
1349 |
-
.g-b--1of1 {
|
1350 |
-
width: 100%
|
1351 |
-
}
|
1352 |
-
.g-b--1of2, .g-b--2of4, .g-b--3of6, .g-b--4of8, .g-b--5of10, .g-b--6of12 {
|
1353 |
-
width: 50%
|
1354 |
-
}
|
1355 |
-
.g-b--1of3, .g-b--2of6, .g-b--4of12 {
|
1356 |
-
width: 33.333%
|
1357 |
-
}
|
1358 |
-
.g-b--2of3, .g-b--4of6, .g-b--8of12 {
|
1359 |
-
width: 66.666%
|
1360 |
-
}
|
1361 |
-
.g-b--1of4, .g-b--2of8, .g-b--3of12 {
|
1362 |
-
width: 25%
|
1363 |
-
}
|
1364 |
-
.g-b--3of4, .g-b--6of8, .g-b--9of12 {
|
1365 |
-
width: 75%
|
1366 |
-
}
|
1367 |
-
.g-b--1of5, .g-b--2of10 {
|
1368 |
-
width: 20%
|
1369 |
-
}
|
1370 |
-
.g-b--2of5, .g-b--4of10 {
|
1371 |
-
width: 40%
|
1372 |
-
}
|
1373 |
-
.g-b--3of5, .g-b--6of10 {
|
1374 |
-
width: 60%
|
1375 |
-
}
|
1376 |
-
.g-b--4of5, .g-b--8of10 {
|
1377 |
-
width: 80%
|
1378 |
-
}
|
1379 |
-
.g-b--1of6, .g-b--2of12 {
|
1380 |
-
width: 16.666%
|
1381 |
-
}
|
1382 |
-
.g-b--5of6, .g-b--10of12 {
|
1383 |
-
width: 83.333%
|
1384 |
-
}
|
1385 |
-
.g-b--1of8 {
|
1386 |
-
width: 12.5%
|
1387 |
-
}
|
1388 |
-
.g-b--3of8 {
|
1389 |
-
width: 37.5%
|
1390 |
-
}
|
1391 |
-
.g-b--5of8 {
|
1392 |
-
width: 62.5%
|
1393 |
-
}
|
1394 |
-
.g-b--7of8 {
|
1395 |
-
width: 87.5%
|
1396 |
-
}
|
1397 |
-
.g-b--1of10 {
|
1398 |
-
width: 10%
|
1399 |
-
}
|
1400 |
-
.g-b--3of10 {
|
1401 |
-
width: 30%
|
1402 |
-
}
|
1403 |
-
.g-b--7of10 {
|
1404 |
-
width: 70%
|
1405 |
-
}
|
1406 |
-
.g-b--9of10 {
|
1407 |
-
width: 90%
|
1408 |
-
}
|
1409 |
-
.g-b--1of12 {
|
1410 |
-
width: 8.333%
|
1411 |
-
}
|
1412 |
-
.g-b--5of12 {
|
1413 |
-
width: 41.666%
|
1414 |
-
}
|
1415 |
-
.g-b--7of12 {
|
1416 |
-
width: 58.333%
|
1417 |
-
}
|
1418 |
-
.g-b--11of12 {
|
1419 |
-
width: 91.666%
|
1420 |
-
}
|
1421 |
-
.g-b--push--1of1 {
|
1422 |
-
margin-left: 100%
|
1423 |
-
}
|
1424 |
-
.g-b--push--1of2, .g-b--push--2of4, .g-b--push--3of6, .g-b--push--4of8, .g-b--push--5of10, .g-b--push--6of12 {
|
1425 |
-
margin-left: 50%
|
1426 |
-
}
|
1427 |
-
.g-b--push--1of3, .g-b--push--2of6, .g-b--push--4of12 {
|
1428 |
-
margin-left: 33.333%
|
1429 |
-
}
|
1430 |
-
.g-b--push--2of3, .g-b--push--4of6, .g-b--push--8of12 {
|
1431 |
-
margin-left: 66.666%
|
1432 |
-
}
|
1433 |
-
.g-b--push--1of4, .g-b--push--2of8, .g-b--push--3of12 {
|
1434 |
-
margin-left: 25%
|
1435 |
-
}
|
1436 |
-
.g-b--push--3of4, .g-b--push--6of8, .g-b--push--9of12 {
|
1437 |
-
margin-left: 75%
|
1438 |
-
}
|
1439 |
-
.g-b--push--1of5, .g-b--push--2of10 {
|
1440 |
-
margin-left: 20%
|
1441 |
-
}
|
1442 |
-
.g-b--push--2of5, .g-b--push--4of10 {
|
1443 |
-
margin-left: 40%
|
1444 |
-
}
|
1445 |
-
.g-b--push--3of5, .g-b--push--6of10 {
|
1446 |
-
margin-left: 60%
|
1447 |
-
}
|
1448 |
-
.g-b--push--4of5, .g-b--push--8of10 {
|
1449 |
-
margin-left: 80%
|
1450 |
-
}
|
1451 |
-
.g-b--push--1of6, .g-b--push--2of12 {
|
1452 |
-
margin-left: 16.666%
|
1453 |
-
}
|
1454 |
-
.g-b--push--5of6, .g-b--push--10of12 {
|
1455 |
-
margin-left: 83.333%
|
1456 |
-
}
|
1457 |
-
.g-b--push--1of8 {
|
1458 |
-
margin-left: 12.5%
|
1459 |
-
}
|
1460 |
-
.g-b--push--3of8 {
|
1461 |
-
margin-left: 37.5%
|
1462 |
-
}
|
1463 |
-
.g-b--push--5of8 {
|
1464 |
-
margin-left: 62.5%
|
1465 |
-
}
|
1466 |
-
.g-b--push--7of8 {
|
1467 |
-
margin-left: 87.5%
|
1468 |
-
}
|
1469 |
-
.g-b--push--1of10 {
|
1470 |
-
margin-left: 10%
|
1471 |
-
}
|
1472 |
-
.g-b--push--3of10 {
|
1473 |
-
margin-left: 30%
|
1474 |
-
}
|
1475 |
-
.g-b--push--7of10 {
|
1476 |
-
margin-left: 70%
|
1477 |
-
}
|
1478 |
-
.g-b--push--9of10 {
|
1479 |
-
margin-left: 90%
|
1480 |
-
}
|
1481 |
-
.g-b--push--1of12 {
|
1482 |
-
margin-left: 8.333%
|
1483 |
-
}
|
1484 |
-
.g-b--push--5of12 {
|
1485 |
-
margin-left: 41.666%
|
1486 |
-
}
|
1487 |
-
.g-b--push--7of12 {
|
1488 |
-
margin-left: 58.333%
|
1489 |
-
}
|
1490 |
-
.g-b--push--11of12 {
|
1491 |
-
margin-left: 91.666%
|
1492 |
-
}
|
1493 |
-
.g-b--pull--1of1 {
|
1494 |
-
margin-right: 100%
|
1495 |
-
}
|
1496 |
-
.g-b--pull--1of2, .g-b--pull--2of4, .g-b--pull--3of6, .g-b--pull--4of8, .g-b--pull--5of10, .g-b--pull--6of12 {
|
1497 |
-
margin-right: 50%
|
1498 |
-
}
|
1499 |
-
.g-b--pull--1of3, .g-b--pull--2of6, .g-b--pull--4of12 {
|
1500 |
-
margin-right: 33.333%
|
1501 |
-
}
|
1502 |
-
.g-b--pull--2of3, .g-b--pull--4of6, .g-b--pull--8of12 {
|
1503 |
-
margin-right: 66.666%
|
1504 |
-
}
|
1505 |
-
.g-b--pull--1of4, .g-b--pull--2of8, .g-b--pull--3of12 {
|
1506 |
-
margin-right: 25%
|
1507 |
-
}
|
1508 |
-
.g-b--pull--3of4, .g-b--pull--6of8, .g-b--pull--9of12 {
|
1509 |
-
margin-right: 75%
|
1510 |
-
}
|
1511 |
-
.g-b--pull--1of5, .g-b--pull--2of10 {
|
1512 |
-
margin-right: 20%
|
1513 |
-
}
|
1514 |
-
.g-b--pull--2of5, .g-b--pull--4of10 {
|
1515 |
-
margin-right: 40%
|
1516 |
-
}
|
1517 |
-
.g-b--pull--3of5, .g-b--pull--6of10 {
|
1518 |
-
margin-right: 60%
|
1519 |
-
}
|
1520 |
-
.g-b--pull--4of5, .g-b--pull--8of10 {
|
1521 |
-
margin-right: 80%
|
1522 |
-
}
|
1523 |
-
.g-b--pull--1of6, .g-b--pull--2of12 {
|
1524 |
-
margin-right: 16.666%
|
1525 |
-
}
|
1526 |
-
.g-b--pull--5of6, .g-b--pull--10of12 {
|
1527 |
-
margin-right: 83.333%
|
1528 |
-
}
|
1529 |
-
.g-b--pull--1of8 {
|
1530 |
-
margin-right: 12.5%
|
1531 |
-
}
|
1532 |
-
.g-b--pull--3of8 {
|
1533 |
-
margin-right: 37.5%
|
1534 |
-
}
|
1535 |
-
.g-b--pull--5of8 {
|
1536 |
-
margin-right: 62.5%
|
1537 |
-
}
|
1538 |
-
.g-b--pull--7of8 {
|
1539 |
-
margin-right: 87.5%
|
1540 |
-
}
|
1541 |
-
.g-b--pull--1of10 {
|
1542 |
-
margin-right: 10%
|
1543 |
-
}
|
1544 |
-
.g-b--pull--3of10 {
|
1545 |
-
margin-right: 30%
|
1546 |
-
}
|
1547 |
-
.g-b--pull--7of10 {
|
1548 |
-
margin-right: 70%
|
1549 |
-
}
|
1550 |
-
.g-b--pull--9of10 {
|
1551 |
-
margin-right: 90%
|
1552 |
-
}
|
1553 |
-
.g-b--pull--1of12 {
|
1554 |
-
margin-right: 8.333%
|
1555 |
-
}
|
1556 |
-
.g-b--pull--5of12 {
|
1557 |
-
margin-right: 41.666%
|
1558 |
-
}
|
1559 |
-
.g-b--pull--7of12 {
|
1560 |
-
margin-right: 58.333%
|
1561 |
-
}
|
1562 |
-
.g-b--pull--11of12 {
|
1563 |
-
margin-right: 91.666%
|
1564 |
-
}
|
1565 |
-
.splashscreen {
|
1566 |
-
position: fixed;
|
1567 |
-
top: 0;
|
1568 |
-
left: 0;
|
1569 |
-
width: 100%;
|
1570 |
-
height: 100%;
|
1571 |
-
background-color: #373d49;
|
1572 |
-
z-index: 22
|
1573 |
-
}
|
1574 |
-
.splashscreen-dillinger {
|
1575 |
-
width: 260px;
|
1576 |
-
height: auto;
|
1577 |
-
display: block;
|
1578 |
-
margin: 0 auto;
|
1579 |
-
padding-bottom: 3rem
|
1580 |
-
}
|
1581 |
-
.splashscreen p {
|
1582 |
-
font-size: 1.25rem;
|
1583 |
-
padding-top: .56251rem;
|
1584 |
-
font-family: "Source Sans Pro", "Helvetica Neue", Helvetica, Arial, sans-serif;
|
1585 |
-
font-weight: 400;
|
1586 |
-
text-align: center;
|
1587 |
-
max-width: 500px;
|
1588 |
-
margin: 0 auto;
|
1589 |
-
color: #ffffff
|
1590 |
-
}
|
1591 |
-
.sp-center {
|
1592 |
-
position: relative;
|
1593 |
-
-webkit-transform: translateY(-50%);
|
1594 |
-
transform: translateY(-50%);
|
1595 |
-
top: 50%
|
1596 |
-
}
|
1597 |
-
.open-menu > .wrapper {
|
1598 |
-
overflow-x: hidden
|
1599 |
-
}
|
1600 |
-
.page {
|
1601 |
-
margin: 0 auto;
|
1602 |
-
position: relative;
|
1603 |
-
top: 0;
|
1604 |
-
left: 0;
|
1605 |
-
width: 100%;
|
1606 |
-
height: 100%;
|
1607 |
-
z-index: 2;
|
1608 |
-
-webkit-transition: all .25s ease-in-out;
|
1609 |
-
transition: all .25s ease-in-out;
|
1610 |
-
background-color: #ffffff;
|
1611 |
-
padding-top: 51px;
|
1612 |
-
will-change: left
|
1613 |
-
}
|
1614 |
-
.open-menu .page {
|
1615 |
-
left: 270px
|
1616 |
-
}
|
1617 |
-
.title {
|
1618 |
-
line-height: 1rem;
|
1619 |
-
font-size: .8rem;
|
1620 |
-
margin-bottom: .77999rem;
|
1621 |
-
padding-top: .22001rem;
|
1622 |
-
font-weight: 500;
|
1623 |
-
color: #a0aabf;
|
1624 |
-
letter-spacing: 1px;
|
1625 |
-
text-transform: uppercase;
|
1626 |
-
padding-left: 16px;
|
1627 |
-
padding-right: 16px;
|
1628 |
-
margin-top: 1rem
|
1629 |
-
}
|
1630 |
-
.split-preview .title {
|
1631 |
-
padding-left: 0
|
1632 |
-
}
|
1633 |
-
.title-document {
|
1634 |
-
line-height: 1rem;
|
1635 |
-
font-size: 1.25rem;
|
1636 |
-
margin-bottom: .89999rem;
|
1637 |
-
padding-top: .10001rem;
|
1638 |
-
font-weight: 400;
|
1639 |
-
font-family: "Ubuntu Mono", Monaco;
|
1640 |
-
color: #373d49;
|
1641 |
-
padding-left: 16px;
|
1642 |
-
padding-right: 16px;
|
1643 |
-
width: 80%;
|
1644 |
-
min-width: 300px;
|
1645 |
-
outline: 0;
|
1646 |
-
border: none
|
1647 |
-
}
|
1648 |
-
.icon {
|
1649 |
-
display: block;
|
1650 |
-
margin: 0 auto;
|
1651 |
-
width: 36px;
|
1652 |
-
height: 36px;
|
1653 |
-
border-radius: 3px;
|
1654 |
-
text-align: center
|
1655 |
-
}
|
1656 |
-
.icon svg {
|
1657 |
-
display: inline-block;
|
1658 |
-
margin-left: auto;
|
1659 |
-
margin-right: auto
|
1660 |
-
}
|
1661 |
-
.icon-preview {
|
1662 |
-
background-color: #373d49;
|
1663 |
-
line-height: 40px
|
1664 |
-
}
|
1665 |
-
.icon-preview svg {
|
1666 |
-
width: 19px;
|
1667 |
-
height: 12px
|
1668 |
-
}
|
1669 |
-
.icon-settings {
|
1670 |
-
background-color: #373d49;
|
1671 |
-
line-height: 44px
|
1672 |
-
}
|
1673 |
-
.icon-settings svg {
|
1674 |
-
width: 18px;
|
1675 |
-
height: 18px
|
1676 |
-
}
|
1677 |
-
.icon-link {
|
1678 |
-
width: 16px;
|
1679 |
-
height: 16px;
|
1680 |
-
line-height: 1;
|
1681 |
-
margin-right: 24px;
|
1682 |
-
text-align: right
|
1683 |
-
}
|
1684 |
-
.navbar {
|
1685 |
-
background-color: #373d49;
|
1686 |
-
height: 51px;
|
1687 |
-
width: 100%;
|
1688 |
-
position: fixed;
|
1689 |
-
top: 0;
|
1690 |
-
left: 0;
|
1691 |
-
z-index: 6;
|
1692 |
-
-webkit-transition: all .25s ease-in-out;
|
1693 |
-
transition: all .25s ease-in-out;
|
1694 |
-
will-change: left
|
1695 |
-
}
|
1696 |
-
.navbar:after {
|
1697 |
-
content: "";
|
1698 |
-
display: table;
|
1699 |
-
clear: both
|
1700 |
-
}
|
1701 |
-
.open-menu .navbar {
|
1702 |
-
left: 270px
|
1703 |
-
}
|
1704 |
-
.navbar-brand {
|
1705 |
-
float: left;
|
1706 |
-
margin: 0 0 0 24px;
|
1707 |
-
padding: 0;
|
1708 |
-
line-height: 42px
|
1709 |
-
}
|
1710 |
-
.navbar-brand svg {
|
1711 |
-
width: 85px;
|
1712 |
-
height: 11px
|
1713 |
-
}
|
1714 |
-
.nav-left {
|
1715 |
-
float: left
|
1716 |
-
}
|
1717 |
-
.nav-right {
|
1718 |
-
float: right
|
1719 |
-
}
|
1720 |
-
.nav-sidebar {
|
1721 |
-
width: 100%
|
1722 |
-
}
|
1723 |
-
.menu {
|
1724 |
-
list-style: none;
|
1725 |
-
margin: 0;
|
1726 |
-
padding: 0
|
1727 |
-
}
|
1728 |
-
.menu a {
|
1729 |
-
border: 0;
|
1730 |
-
color: #a0aabf;
|
1731 |
-
font-family: "Source Sans Pro", "Helvetica Neue", Helvetica, Arial, sans-serif;
|
1732 |
-
outline: none;
|
1733 |
-
text-transform: uppercase
|
1734 |
-
}
|
1735 |
-
.menu a:hover {
|
1736 |
-
color: #15b748
|
1737 |
-
}
|
1738 |
-
.menu .menu-item {
|
1739 |
-
border: 0;
|
1740 |
-
display: none;
|
1741 |
-
float: left;
|
1742 |
-
margin: 0;
|
1743 |
-
position: relative
|
1744 |
-
}
|
1745 |
-
.menu .menu-item > a {
|
1746 |
-
display: block;
|
1747 |
-
font-size: 12px;
|
1748 |
-
height: 51px;
|
1749 |
-
letter-spacing: 1px;
|
1750 |
-
line-height: 51px;
|
1751 |
-
padding: 0 24px
|
1752 |
-
}
|
1753 |
-
.menu .menu-item--settings, .menu .menu-item--preview, .menu .menu-item--save-to.in-sidebar, .menu .menu-item--import-from.in-sidebar, .menu .menu-item--link-unlink.in-sidebar, .menu .menu-item--documents.in-sidebar {
|
1754 |
-
display: block
|
1755 |
-
}
|
1756 |
-
.menu .menu-item--documents {
|
1757 |
-
padding-bottom: 1rem
|
1758 |
-
}
|
1759 |
-
.menu .menu-item.open > a {
|
1760 |
-
background-color: #1d212a
|
1761 |
-
}
|
1762 |
-
.menu .menu-item-icon > a {
|
1763 |
-
height: auto;
|
1764 |
-
padding: 0
|
1765 |
-
}
|
1766 |
-
.menu .menu-item-icon:hover > a {
|
1767 |
-
background-color: transparent
|
1768 |
-
}
|
1769 |
-
.menu .menu-link.open i {
|
1770 |
-
background-color: #1d212a
|
1771 |
-
}
|
1772 |
-
.menu .menu-link.open g {
|
1773 |
-
fill: #15b748
|
1774 |
-
}
|
1775 |
-
.menu .menu-link-preview, .menu .menu-link-settings {
|
1776 |
-
margin-top: 8px;
|
1777 |
-
width: 51px
|
1778 |
-
}
|
1779 |
-
.menu-sidebar {
|
1780 |
-
width: 100%
|
1781 |
-
}
|
1782 |
-
.menu-sidebar .menu-item {
|
1783 |
-
float: none;
|
1784 |
-
margin-bottom: 1px;
|
1785 |
-
width: 100%
|
1786 |
-
}
|
1787 |
-
.menu-sidebar .menu-item.open > a {
|
1788 |
-
background-color: #373d49
|
1789 |
-
}
|
1790 |
-
.menu-sidebar .open .caret {
|
1791 |
-
-webkit-transform: rotate(180deg);
|
1792 |
-
transform: rotate(180deg)
|
1793 |
-
}
|
1794 |
-
.menu-sidebar > .menu-item:hover .dropdown a, .menu-sidebar > .menu-item:hover .settings a {
|
1795 |
-
background-color: transparent
|
1796 |
-
}
|
1797 |
-
.menu-sidebar .menu-link {
|
1798 |
-
background-color: #373d49;
|
1799 |
-
font-weight: 600
|
1800 |
-
}
|
1801 |
-
.menu-sidebar .menu-link:after {
|
1802 |
-
content: "";
|
1803 |
-
display: table;
|
1804 |
-
clear: both
|
1805 |
-
}
|
1806 |
-
.menu-sidebar .menu-link > span {
|
1807 |
-
float: left
|
1808 |
-
}
|
1809 |
-
.menu-sidebar .menu-link > .caret {
|
1810 |
-
float: right;
|
1811 |
-
text-align: right;
|
1812 |
-
top: 22px
|
1813 |
-
}
|
1814 |
-
.menu-sidebar .dropdown, .menu-sidebar .settings {
|
1815 |
-
background-color: transparent;
|
1816 |
-
position: static;
|
1817 |
-
width: 100%
|
1818 |
-
}
|
1819 |
-
.dropdown {
|
1820 |
-
position: absolute;
|
1821 |
-
right: 0;
|
1822 |
-
top: 51px;
|
1823 |
-
width: 188px
|
1824 |
-
}
|
1825 |
-
.dropdown, .settings {
|
1826 |
-
display: none;
|
1827 |
-
background-color: #1d212a
|
1828 |
-
}
|
1829 |
-
.dropdown {
|
1830 |
-
padding: 0
|
1831 |
-
}
|
1832 |
-
.dropdown, .settings, .sidebar-list {
|
1833 |
-
list-style: none;
|
1834 |
-
margin: 0
|
1835 |
-
}
|
1836 |
-
.sidebar-list {
|
1837 |
-
padding: 0
|
1838 |
-
}
|
1839 |
-
.dropdown li {
|
1840 |
-
margin: 32px 0;
|
1841 |
-
padding: 0 0 0 32px
|
1842 |
-
}
|
1843 |
-
.dropdown li, .settings li {
|
1844 |
-
line-height: 1
|
1845 |
-
}
|
1846 |
-
.sidebar-list li {
|
1847 |
-
line-height: 1;
|
1848 |
-
margin: 32px 0;
|
1849 |
-
padding: 0 0 0 32px
|
1850 |
-
}
|
1851 |
-
.dropdown a {
|
1852 |
-
color: #d0d6e2
|
1853 |
-
}
|
1854 |
-
.dropdown a, .settings a, .sidebar-list a {
|
1855 |
-
display: block;
|
1856 |
-
text-transform: none
|
1857 |
-
}
|
1858 |
-
.sidebar-list a {
|
1859 |
-
color: #d0d6e2
|
1860 |
-
}
|
1861 |
-
.dropdown a:after, .settings a:after, .sidebar-list a:after {
|
1862 |
-
content: "";
|
1863 |
-
display: table;
|
1864 |
-
clear: both
|
1865 |
-
}
|
1866 |
-
.dropdown .icon, .settings .icon, .sidebar-list .icon {
|
1867 |
-
float: right
|
1868 |
-
}
|
1869 |
-
.open .dropdown, .open .settings, .open .sidebar-list {
|
1870 |
-
display: block
|
1871 |
-
}
|
1872 |
-
.open .dropdown.collapse, .open .collapse.settings, .open .sidebar-list.collapse {
|
1873 |
-
display: none
|
1874 |
-
}
|
1875 |
-
.open .dropdown.collapse.in, .open .collapse.in.settings, .open .sidebar-list.collapse.in {
|
1876 |
-
display: block
|
1877 |
-
}
|
1878 |
-
.dropdown .unlinked .icon, .settings .unlinked .icon, .sidebar-list .unlinked .icon {
|
1879 |
-
opacity: .3
|
1880 |
-
}
|
1881 |
-
.dropdown.documents li, .documents.settings li, .sidebar-list.documents li {
|
1882 |
-
background-image: url("../img/icons/file.svg");
|
1883 |
-
background-position: 240px center;
|
1884 |
-
background-repeat: no-repeat;
|
1885 |
-
background-size: 14px 16px;
|
1886 |
-
padding: 3px 32px
|
1887 |
-
}
|
1888 |
-
.dropdown.documents li.octocat, .documents.settings li.octocat, .sidebar-list.documents li.octocat {
|
1889 |
-
background-image: url("../img/icons/octocat.svg");
|
1890 |
-
background-position: 234px center;
|
1891 |
-
background-size: 24px 24px
|
1892 |
-
}
|
1893 |
-
.dropdown.documents li:last-child, .documents.settings li:last-child, .sidebar-list.documents li:last-child {
|
1894 |
-
margin-bottom: 1rem
|
1895 |
-
}
|
1896 |
-
.dropdown.documents li.active a, .documents.settings li.active a, .sidebar-list.documents li.active a {
|
1897 |
-
color: #15b748
|
1898 |
-
}
|
1899 |
-
.settings {
|
1900 |
-
position: fixed;
|
1901 |
-
top: 67px;
|
1902 |
-
right: 16px;
|
1903 |
-
border-radius: 3px;
|
1904 |
-
width: 288px;
|
1905 |
-
background-color: #373d49;
|
1906 |
-
padding: 16px;
|
1907 |
-
z-index: 7
|
1908 |
-
}
|
1909 |
-
.show-settings .settings {
|
1910 |
-
display: block
|
1911 |
-
}
|
1912 |
-
.settings .has-checkbox {
|
1913 |
-
float: left
|
1914 |
-
}
|
1915 |
-
.settings a {
|
1916 |
-
font-size: 1.25rem;
|
1917 |
-
font-family: "Source Sans Pro", "Helvetica Neue", Helvetica, Arial, sans-serif;
|
1918 |
-
font-weight: 400;
|
1919 |
-
-webkit-font-smoothing: antialiased;
|
1920 |
-
line-height: 28px;
|
1921 |
-
color: #d0d6e2
|
1922 |
-
}
|
1923 |
-
.settings a:after {
|
1924 |
-
content: "";
|
1925 |
-
display: table;
|
1926 |
-
clear: both
|
1927 |
-
}
|
1928 |
-
.settings a:hover {
|
1929 |
-
color: #15b748
|
1930 |
-
}
|
1931 |
-
.settings li {
|
1932 |
-
border-bottom: 1px solid #4f535b;
|
1933 |
-
margin: 0;
|
1934 |
-
padding: 16px 0
|
1935 |
-
}
|
1936 |
-
.settings li:last-child {
|
1937 |
-
border-bottom: none
|
1938 |
-
}
|
1939 |
-
.brand {
|
1940 |
-
border: none;
|
1941 |
-
display: block
|
1942 |
-
}
|
1943 |
-
.brand:hover g {
|
1944 |
-
fill: #15b748
|
1945 |
-
}
|
1946 |
-
.toggle {
|
1947 |
-
display: block;
|
1948 |
-
float: left;
|
1949 |
-
height: 16px;
|
1950 |
-
padding: 25px 16px 26px;
|
1951 |
-
width: 40px
|
1952 |
-
}
|
1953 |
-
.toggle span:after, .toggle span:before {
|
1954 |
-
content: '';
|
1955 |
-
left: 0;
|
1956 |
-
position: absolute;
|
1957 |
-
top: -6px
|
1958 |
-
}
|
1959 |
-
.toggle span:after {
|
1960 |
-
top: 6px
|
1961 |
-
}
|
1962 |
-
.toggle span {
|
1963 |
-
display: block;
|
1964 |
-
position: relative
|
1965 |
-
}
|
1966 |
-
.toggle span, .toggle span:after, .toggle span:before {
|
1967 |
-
-webkit-backface-visibility: hidden;
|
1968 |
-
backface-visibility: hidden;
|
1969 |
-
background-color: #d3daea;
|
1970 |
-
height: 2px;
|
1971 |
-
-webkit-transition: all .3s;
|
1972 |
-
transition: all .3s;
|
1973 |
-
width: 20px
|
1974 |
-
}
|
1975 |
-
.open-menu .toggle span {
|
1976 |
-
background-color: transparent
|
1977 |
-
}
|
1978 |
-
.open-menu .toggle span:before {
|
1979 |
-
-webkit-transform: rotate(45deg) translate(3px, 3px);
|
1980 |
-
transform: rotate(45deg) translate(3px, 3px)
|
1981 |
-
}
|
1982 |
-
.open-menu .toggle span:after {
|
1983 |
-
-webkit-transform: rotate(-45deg) translate(5px, -6px);
|
1984 |
-
transform: rotate(-45deg) translate(5px, -6px)
|
1985 |
-
}
|
1986 |
-
.caret {
|
1987 |
-
display: inline-block;
|
1988 |
-
width: 0;
|
1989 |
-
height: 0;
|
1990 |
-
margin-left: 6px;
|
1991 |
-
vertical-align: middle;
|
1992 |
-
position: relative;
|
1993 |
-
top: -1px;
|
1994 |
-
border-top: 4px solid;
|
1995 |
-
border-right: 4px solid transparent;
|
1996 |
-
border-left: 4px solid transparent
|
1997 |
-
}
|
1998 |
-
.sidebar {
|
1999 |
-
overflow: auto;
|
2000 |
-
height: 100%;
|
2001 |
-
padding-right: 15px;
|
2002 |
-
padding-bottom: 15px;
|
2003 |
-
width: 285px
|
2004 |
-
}
|
2005 |
-
.sidebar-wrapper {
|
2006 |
-
-webkit-overflow-scrolling: touch;
|
2007 |
-
background-color: #2b2f36;
|
2008 |
-
left: 0;
|
2009 |
-
height: 100%;
|
2010 |
-
overflow-y: hidden;
|
2011 |
-
position: fixed;
|
2012 |
-
top: 0;
|
2013 |
-
width: 285px;
|
2014 |
-
z-index: 1
|
2015 |
-
}
|
2016 |
-
.sidebar-branding {
|
2017 |
-
width: 160px;
|
2018 |
-
padding: 0;
|
2019 |
-
margin: 16px auto
|
2020 |
-
}
|
2021 |
-
.header {
|
2022 |
-
border-bottom: 1px solid #e8e8e8;
|
2023 |
-
position: relative
|
2024 |
-
}
|
2025 |
-
.words, .characters {
|
2026 |
-
line-height: 1rem;
|
2027 |
-
font-size: .8rem;
|
2028 |
-
margin-bottom: .77999rem;
|
2029 |
-
padding-top: .22001rem;
|
2030 |
-
font-weight: 500;
|
2031 |
-
font-family: "Source Sans Pro", "Helvetica Neue", Helvetica, Arial, sans-serif;
|
2032 |
-
color: #a0aabf;
|
2033 |
-
letter-spacing: 1px;
|
2034 |
-
text-transform: uppercase;
|
2035 |
-
z-index: 5;
|
2036 |
-
position: absolute;
|
2037 |
-
right: 16px;
|
2038 |
-
top: 0
|
2039 |
-
}
|
2040 |
-
.words span, .characters span {
|
2041 |
-
color: #000000
|
2042 |
-
}
|
2043 |
-
.words + .characters {
|
2044 |
-
top: 22px
|
2045 |
-
}
|
2046 |
-
.btn {
|
2047 |
-
text-align: center;
|
2048 |
-
display: inline-block;
|
2049 |
-
width: 100%;
|
2050 |
-
text-transform: uppercase;
|
2051 |
-
font-weight: 600;
|
2052 |
-
font-family: "Source Sans Pro", "Helvetica Neue", Helvetica, Arial, sans-serif;
|
2053 |
-
font-size: 14px;
|
2054 |
-
text-shadow: 0 1px 0 #1b8b77;
|
2055 |
-
padding: 16px 24px;
|
2056 |
-
background-color: #15b748;
|
2057 |
-
border-radius: 3px;
|
2058 |
-
margin: 0 auto 16px;
|
2059 |
-
line-height: 1;
|
2060 |
-
color: #ffffff;
|
2061 |
-
-webkit-transition: all .15s linear;
|
2062 |
-
transition: all .15s linear;
|
2063 |
-
-webkit-font-smoothing: antialiased
|
2064 |
-
}
|
2065 |
-
.btn--new, .btn--save {
|
2066 |
-
display: block;
|
2067 |
-
width: 238px
|
2068 |
-
}
|
2069 |
-
.btn--new:hover, .btn--new:focus, .btn--save:hover, .btn--save:focus {
|
2070 |
-
color: #ffffff;
|
2071 |
-
border-bottom-color: transparent;
|
2072 |
-
box-shadow: 0 1px 3px #24b59c;
|
2073 |
-
text-shadow: 0 1px 0 #24b59c
|
2074 |
-
}
|
2075 |
-
.btn--save {
|
2076 |
-
background-color: #4a5261;
|
2077 |
-
text-shadow: 0 1px 1px #1e2127
|
2078 |
-
}
|
2079 |
-
.btn--save:hover, .btn--save:focus {
|
2080 |
-
color: #ffffff;
|
2081 |
-
border-bottom-color: transparent;
|
2082 |
-
box-shadow: 0 1px 5px #08090a;
|
2083 |
-
text-shadow: none
|
2084 |
-
}
|
2085 |
-
.btn--delete {
|
2086 |
-
display: block;
|
2087 |
-
width: 238px;
|
2088 |
-
background-color: transparent;
|
2089 |
-
font-size: 12px;
|
2090 |
-
text-shadow: none
|
2091 |
-
}
|
2092 |
-
.btn--delete:hover, .btn--delete:focus {
|
2093 |
-
color: #ffffff;
|
2094 |
-
border-bottom-color: transparent;
|
2095 |
-
text-shadow: 0 1px 0 #08090a;
|
2096 |
-
opacity: .8
|
2097 |
-
}
|
2098 |
-
.btn--delete-modal, .btn--ok, .btn--close {
|
2099 |
-
border-top: 0;
|
2100 |
-
background-color: #4a5261;
|
2101 |
-
text-shadow: 0 1px 0 #08090a;
|
2102 |
-
margin: 0
|
2103 |
-
}
|
2104 |
-
.btn--delete-modal:hover, .btn--delete-modal:focus, .btn--ok:hover, .btn--ok:focus, .btn--close:hover, .btn--close:focus {
|
2105 |
-
color: #ffffff;
|
2106 |
-
background-color: #292d36;
|
2107 |
-
text-shadow: none
|
2108 |
-
}
|
2109 |
-
.btn--delete-modal {
|
2110 |
-
display: inline;
|
2111 |
-
width: auto
|
2112 |
-
}
|
2113 |
-
.overlay {
|
2114 |
-
position: absolute;
|
2115 |
-
top: 0;
|
2116 |
-
left: 0;
|
2117 |
-
width: 100%;
|
2118 |
-
height: 100%;
|
2119 |
-
background-color: rgba(55, 61, 73, .8);
|
2120 |
-
-webkit-transition: all .25s ease-in-out;
|
2121 |
-
transition: all .25s ease-in-out;
|
2122 |
-
-webkit-transition-timing-function: ease-out;
|
2123 |
-
transition-timing-function: ease-out;
|
2124 |
-
will-change: left, opacity, visibility;
|
2125 |
-
z-index: 5;
|
2126 |
-
opacity: 0;
|
2127 |
-
visibility: hidden
|
2128 |
-
}
|
2129 |
-
.show-settings .overlay {
|
2130 |
-
visibility: visible;
|
2131 |
-
opacity: 1
|
2132 |
-
}
|
2133 |
-
.switch {
|
2134 |
-
float: right;
|
2135 |
-
line-height: 1
|
2136 |
-
}
|
2137 |
-
.switch input {
|
2138 |
-
display: none
|
2139 |
-
}
|
2140 |
-
.switch small {
|
2141 |
-
display: inline-block;
|
2142 |
-
cursor: pointer;
|
2143 |
-
padding: 0 24px 0 0;
|
2144 |
-
-webkit-transition: all ease .2s;
|
2145 |
-
transition: all ease .2s;
|
2146 |
-
background-color: #2b2f36;
|
2147 |
-
border-color: #2b2f36
|
2148 |
-
}
|
2149 |
-
.switch small, .switch small:before {
|
2150 |
-
border-radius: 30px;
|
2151 |
-
box-shadow: inset 0 0 2px 0 #14171f
|
2152 |
-
}
|
2153 |
-
.switch small:before {
|
2154 |
-
display: block;
|
2155 |
-
content: '';
|
2156 |
-
width: 28px;
|
2157 |
-
height: 28px;
|
2158 |
-
background: #ffffff
|
2159 |
-
}
|
2160 |
-
.switch.checked small {
|
2161 |
-
padding-right: 0;
|
2162 |
-
padding-left: 24px;
|
2163 |
-
background-color: #15b748;
|
2164 |
-
box-shadow: none
|
2165 |
-
}
|
2166 |
-
.modal--dillinger.about .modal-dialog {
|
2167 |
-
font-size: 1.25rem;
|
2168 |
-
max-width: 500px
|
2169 |
-
}
|
2170 |
-
.modal--dillinger.scope .modal-dialog {
|
2171 |
-
max-width: 300px;
|
2172 |
-
margin: 5rem auto
|
2173 |
-
}
|
2174 |
-
.modal--dillinger .modal-dialog {
|
2175 |
-
max-width: 600px;
|
2176 |
-
width: auto;
|
2177 |
-
margin: 5rem auto
|
2178 |
-
}
|
2179 |
-
.modal--dillinger .modal-content {
|
2180 |
-
background: #373d49;
|
2181 |
-
border-radius: 3px;
|
2182 |
-
box-shadow: 0 2px 5px 0 #2c3b59;
|
2183 |
-
color: #ffffff;
|
2184 |
-
font-family: "Source Sans Pro", "Helvetica Neue", Helvetica, Arial, sans-serif;
|
2185 |
-
font-weight: 400;
|
2186 |
-
padding: 2rem
|
2187 |
-
}
|
2188 |
-
.modal--dillinger ul {
|
2189 |
-
list-style-type: disc;
|
2190 |
-
margin: 1rem 0;
|
2191 |
-
padding: 0 0 0 1rem
|
2192 |
-
}
|
2193 |
-
.modal--dillinger li {
|
2194 |
-
padding: 0;
|
2195 |
-
margin: 0
|
2196 |
-
}
|
2197 |
-
.modal--dillinger .modal-header {
|
2198 |
-
border: 0;
|
2199 |
-
padding: 0
|
2200 |
-
}
|
2201 |
-
.modal--dillinger .modal-body {
|
2202 |
-
padding: 0
|
2203 |
-
}
|
2204 |
-
.modal--dillinger .modal-footer {
|
2205 |
-
border: 0;
|
2206 |
-
padding: 0
|
2207 |
-
}
|
2208 |
-
.modal--dillinger .close {
|
2209 |
-
color: #ffffff;
|
2210 |
-
opacity: 1
|
2211 |
-
}
|
2212 |
-
.modal-backdrop {
|
2213 |
-
background-color: #373d49
|
2214 |
-
}
|
2215 |
-
.pagination--dillinger {
|
2216 |
-
padding: 0 !important;
|
2217 |
-
margin: 1.5rem 0 !important;
|
2218 |
-
-webkit-box-pack: justify;
|
2219 |
-
-ms-flex-pack: justify;
|
2220 |
-
justify-content: space-between;
|
2221 |
-
-webkit-box-orient: horizontal;
|
2222 |
-
-webkit-box-direction: normal;
|
2223 |
-
-ms-flex-direction: row;
|
2224 |
-
flex-direction: row;
|
2225 |
-
-webkit-box-align: center;
|
2226 |
-
-ms-flex-align: center;
|
2227 |
-
align-items: center;
|
2228 |
-
-ms-flex-line-pack: stretch;
|
2229 |
-
align-content: stretch
|
2230 |
-
}
|
2231 |
-
.pagination--dillinger, .pagination--dillinger li {
|
2232 |
-
display: -webkit-box;
|
2233 |
-
display: -ms-flexbox;
|
2234 |
-
display: flex
|
2235 |
-
}
|
2236 |
-
.pagination--dillinger li {
|
2237 |
-
-webkit-box-flex: 1;
|
2238 |
-
-ms-flex-positive: 1;
|
2239 |
-
flex-grow: 1;
|
2240 |
-
text-align: center
|
2241 |
-
}
|
2242 |
-
.pagination--dillinger li:first-child > a, .pagination--dillinger li.disabled > a, .pagination--dillinger li.disabled > a:hover, .pagination--dillinger li.disabled > a:focus, .pagination--dillinger li > a {
|
2243 |
-
background-color: transparent;
|
2244 |
-
border-color: #4f535b;
|
2245 |
-
border-right-color: transparent
|
2246 |
-
}
|
2247 |
-
.pagination--dillinger li.active > a, .pagination--dillinger li.active > a:hover, .pagination--dillinger li.active > a:focus {
|
2248 |
-
border-color: #4a5261;
|
2249 |
-
background-color: #4a5261;
|
2250 |
-
color: #ffffff
|
2251 |
-
}
|
2252 |
-
.pagination--dillinger li > a {
|
2253 |
-
float: none;
|
2254 |
-
color: #ffffff;
|
2255 |
-
width: 100%;
|
2256 |
-
display: block;
|
2257 |
-
text-align: center;
|
2258 |
-
margin: 0;
|
2259 |
-
border-right-color: transparent;
|
2260 |
-
padding: 6px
|
2261 |
-
}
|
2262 |
-
.pagination--dillinger li > a:hover, .pagination--dillinger li > a:focus {
|
2263 |
-
border-color: #15b748;
|
2264 |
-
background-color: #15b748;
|
2265 |
-
color: #ffffff
|
2266 |
-
}
|
2267 |
-
.pagination--dillinger li:last-child a {
|
2268 |
-
border-color: #4f535b
|
2269 |
-
}
|
2270 |
-
.pagination--dillinger li:first-child a {
|
2271 |
-
border-right-color: transparent
|
2272 |
-
}
|
2273 |
-
.diNotify {
|
2274 |
-
position: absolute;
|
2275 |
-
z-index: 9999;
|
2276 |
-
left: 0;
|
2277 |
-
right: 0;
|
2278 |
-
top: 0;
|
2279 |
-
margin: 0 auto;
|
2280 |
-
max-width: 400px;
|
2281 |
-
text-align: center;
|
2282 |
-
-webkit-transition: top .5s ease-in-out, opacity .5s ease-in-out;
|
2283 |
-
transition: top .5s ease-in-out, opacity .5s ease-in-out;
|
2284 |
-
visibility: hidden
|
2285 |
-
}
|
2286 |
-
.diNotify-body {
|
2287 |
-
-webkit-font-smoothing: antialiased;
|
2288 |
-
background-color: #15b748;
|
2289 |
-
background: #666e7f;
|
2290 |
-
border-radius: 3px;
|
2291 |
-
color: #ffffff;
|
2292 |
-
font-family: "Source Sans Pro", "Helvetica Neue", Helvetica, Arial, sans-serif;
|
2293 |
-
font-weight: 400;
|
2294 |
-
overflow: hidden;
|
2295 |
-
padding: 1rem 2rem .5rem;
|
2296 |
-
display: -webkit-box;
|
2297 |
-
display: -ms-flexbox;
|
2298 |
-
display: flex;
|
2299 |
-
-webkit-box-align: baseline;
|
2300 |
-
-ms-flex-align: baseline;
|
2301 |
-
align-items: baseline;
|
2302 |
-
-webkit-box-pack: center;
|
2303 |
-
-ms-flex-pack: center;
|
2304 |
-
justify-content: center
|
2305 |
-
}
|
2306 |
-
.diNotify-icon {
|
2307 |
-
display: block;
|
2308 |
-
width: 16px;
|
2309 |
-
height: 16px;
|
2310 |
-
line-height: 16px;
|
2311 |
-
position: relative;
|
2312 |
-
top: 3px
|
2313 |
-
}
|
2314 |
-
.diNotify-message {
|
2315 |
-
padding-left: 1rem
|
2316 |
-
}
|
2317 |
-
.zen-wrapper {
|
2318 |
-
position: fixed;
|
2319 |
-
top: 0;
|
2320 |
-
left: 0;
|
2321 |
-
right: 0;
|
2322 |
-
bottom: 0;
|
2323 |
-
width: 100%;
|
2324 |
-
height: 100%;
|
2325 |
-
z-index: 10;
|
2326 |
-
background-color: #ffffff;
|
2327 |
-
opacity: 0;
|
2328 |
-
-webkit-transition: opacity .25s ease-in-out;
|
2329 |
-
transition: opacity .25s ease-in-out
|
2330 |
-
}
|
2331 |
-
.zen-wrapper.on {
|
2332 |
-
opacity: 1
|
2333 |
-
}
|
2334 |
-
.enter-zen-mode {
|
2335 |
-
background-image: url("../img/icons/enter-zen.svg");
|
2336 |
-
right: .5rem;
|
2337 |
-
top: .313rem;
|
2338 |
-
display: none
|
2339 |
-
}
|
2340 |
-
.enter-zen-mode, .close-zen-mode {
|
2341 |
-
font: 0/0 a;
|
2342 |
-
color: transparent;
|
2343 |
-
text-shadow: none;
|
2344 |
-
background-color: transparent;
|
2345 |
-
border: 0;
|
2346 |
-
background-repeat: no-repeat;
|
2347 |
-
width: 32px;
|
2348 |
-
height: 32px;
|
2349 |
-
display: block;
|
2350 |
-
position: absolute
|
2351 |
-
}
|
2352 |
-
.close-zen-mode {
|
2353 |
-
background-image: url("../img/icons/exit-zen.svg");
|
2354 |
-
right: 1rem;
|
2355 |
-
top: 1rem
|
2356 |
-
}
|
2357 |
-
.zen-page {
|
2358 |
-
position: relative;
|
2359 |
-
top: 0;
|
2360 |
-
bottom: 0;
|
2361 |
-
z-index: 11;
|
2362 |
-
height: 100%;
|
2363 |
-
width: 100%
|
2364 |
-
}
|
2365 |
-
#zen {
|
2366 |
-
font-size: 1.25rem;
|
2367 |
-
width: 300px;
|
2368 |
-
height: 80%;
|
2369 |
-
margin: 0 auto;
|
2370 |
-
position: relative;
|
2371 |
-
top: 10%
|
2372 |
-
}
|
2373 |
-
#zen:before, #zen:after {
|
2374 |
-
content: "";
|
2375 |
-
position: absolute;
|
2376 |
-
height: 10%;
|
2377 |
-
width: 100%;
|
2378 |
-
z-index: 12;
|
2379 |
-
pointer-events: none
|
2380 |
-
}
|
2381 |
-
#preview .table {
|
2382 |
-
width: auto
|
2383 |
-
}
|
2384 |
-
.ui-resizable {
|
2385 |
-
position: relative
|
2386 |
-
}
|
2387 |
-
.ui-resizable-handle {
|
2388 |
-
position: absolute;
|
2389 |
-
font-size: .1px;
|
2390 |
-
z-index: 99999;
|
2391 |
-
display: block
|
2392 |
-
}
|
2393 |
-
.ui-resizable-e {
|
2394 |
-
background-color: #666666;
|
2395 |
-
border-right: 8px solid #e8e8e8;
|
2396 |
-
border-left: 1px solid #222222;
|
2397 |
-
width: 10px;
|
2398 |
-
z-index: 88 !important;
|
2399 |
-
position: relative
|
2400 |
-
}
|
2401 |
-
.ui-resizable-e:after {
|
2402 |
-
content: "-";
|
2403 |
-
display: block;
|
2404 |
-
position: absolute;
|
2405 |
-
top: calc(50% - 16px);
|
2406 |
-
left: 0;
|
2407 |
-
height: 25px;
|
2408 |
-
width: 2px;
|
2409 |
-
background-color: rgba(0, 0, 0, .4);
|
2410 |
-
margin: 3px
|
2411 |
-
}
|
2412 |
-
#editor {
|
2413 |
-
cursor: ew-resize;
|
2414 |
-
position: relative;
|
2415 |
-
z-index: auto
|
2416 |
-
}
|
2417 |
-
.profile-pic {
|
2418 |
-
float: left;
|
2419 |
-
width: 250px
|
2420 |
-
}
|
2421 |
-
#_default_ a::before {
|
2422 |
-
color: #a0aabf
|
2423 |
-
}
|
2424 |
-
#_default_ img {
|
2425 |
-
display: none
|
2426 |
-
}
|
2427 |
-
#_default_ #_default_ {
|
2428 |
-
display: block;
|
2429 |
-
float: left;
|
2430 |
-
max-width: 38%;
|
2431 |
-
word-wrap: break-word
|
2432 |
-
}
|
2433 |
-
#_default_ .default-ad {
|
2434 |
-
display: none
|
2435 |
-
}
|
2436 |
-
#_default_ ._default_ {
|
2437 |
-
display: block
|
2438 |
-
}
|
2439 |
-
#_default_ a {
|
2440 |
-
color: #15b748;
|
2441 |
-
text-decoration: none
|
2442 |
-
}
|
2443 |
-
#_default_ a:hover {
|
2444 |
-
color: #8ae8d8
|
2445 |
-
}
|
2446 |
-
#_default_ .default-image {
|
2447 |
-
display: none
|
2448 |
-
}
|
2449 |
-
#_default_ .default-title:after {
|
2450 |
-
content: " — "
|
2451 |
-
}
|
2452 |
-
#_default_ .default-title, #_default_ .default-description {
|
2453 |
-
display: inline
|
2454 |
-
}
|
2455 |
-
#_default_ .default-title {
|
2456 |
-
position: relative;
|
2457 |
-
font-weight: 600;
|
2458 |
-
display: none
|
2459 |
-
}
|
2460 |
-
#_default_ a:before {
|
2461 |
-
position: relative;
|
2462 |
-
top: 0;
|
2463 |
-
padding: 5px;
|
2464 |
-
color: #a0aabf;
|
2465 |
-
content: "Ad";
|
2466 |
-
text-transform: uppercase;
|
2467 |
-
font-size: 8px;
|
2468 |
-
font-family: Verdana, sans-serif
|
2469 |
-
}
|
2470 |
-
#_default_ {
|
2471 |
-
display: block;
|
2472 |
-
float: left;
|
2473 |
-
max-width: 38%;
|
2474 |
-
word-wrap: break-word
|
2475 |
-
}
|
2476 |
-
#_default_ ._default_ {
|
2477 |
-
display: block;
|
2478 |
-
font-size: .75rem;
|
2479 |
-
height: 51px;
|
2480 |
-
letter-spacing: 1px;
|
2481 |
-
line-height: 1rem;
|
2482 |
-
padding: 18px 24px
|
2483 |
-
}
|
2484 |
-
.split {
|
2485 |
-
overflow: scroll;
|
2486 |
-
padding: 0 !important
|
2487 |
-
}
|
2488 |
-
.split-editor {
|
2489 |
-
padding-left: 0;
|
2490 |
-
padding-right: 0;
|
2491 |
-
position: relative;
|
2492 |
-
z-index: 3
|
2493 |
-
}
|
2494 |
-
.show-preview .split-editor {
|
2495 |
-
display: none
|
2496 |
-
}
|
2497 |
-
.split-preview {
|
2498 |
-
background-color: #ffffff;
|
2499 |
-
display: none;
|
2500 |
-
top: 0;
|
2501 |
-
position: relative;
|
2502 |
-
z-index: 4
|
2503 |
-
}
|
2504 |
-
.show-preview .split-preview {
|
2505 |
-
display: block
|
2506 |
-
}
|
2507 |
-
#editor {
|
2508 |
-
font-size: 1rem;
|
2509 |
-
font-family: "Ubuntu Mono", Monaco;
|
2510 |
-
font-weight: 400;
|
2511 |
-
line-height: 2rem;
|
2512 |
-
width: 100%;
|
2513 |
-
height: 100%
|
2514 |
-
}
|
2515 |
-
#editor .ace_gutter {
|
2516 |
-
-webkit-font-smoothing: antialiased
|
2517 |
-
}
|
2518 |
-
.editor-header {
|
2519 |
-
width: 50%;
|
2520 |
-
float: left;
|
2521 |
-
border-bottom: 1px solid #e8e8e8;
|
2522 |
-
position: relative
|
2523 |
-
}
|
2524 |
-
.editor-header--first {
|
2525 |
-
border-right: 1px solid #e8e8e8
|
2526 |
-
}
|
2527 |
-
.editor-header .title {
|
2528 |
-
display: inline-block
|
2529 |
-
}
|
2530 |
-
.preview-html {
|
2531 |
-
padding: 15px
|
2532 |
-
}
|
2533 |
-
.preview-html a {
|
2534 |
-
color: #a0aabf;
|
2535 |
-
text-decoration: underline
|
2536 |
-
}
|
2537 |
-
.preview-src {
|
2538 |
-
white-space: normal
|
2539 |
-
}
|
2540 |
-
.preview-mode-toggle-src {
|
2541 |
-
background-image: url("../img/icons/code.svg")
|
2542 |
-
}
|
2543 |
-
.preview-mode-toggle-src, .preview-mode-toggle-html {
|
2544 |
-
font: 0/0 a;
|
2545 |
-
color: transparent;
|
2546 |
-
text-shadow: none;
|
2547 |
-
background-color: transparent;
|
2548 |
-
border: 0;
|
2549 |
-
background-repeat: no-repeat;
|
2550 |
-
width: 32px;
|
2551 |
-
height: 32px;
|
2552 |
-
display: block;
|
2553 |
-
position: absolute;
|
2554 |
-
right: .5rem;
|
2555 |
-
top: .5rem;
|
2556 |
-
display: none
|
2557 |
-
}
|
2558 |
-
.preview-mode-toggle-html {
|
2559 |
-
background-image: url("../img/icons/eye.svg")
|
2560 |
-
}
|
2561 |
-
.sr-only {
|
2562 |
-
visibility: hidden;
|
2563 |
-
text-overflow: 110%;
|
2564 |
-
overflow: hidden;
|
2565 |
-
top: -100px;
|
2566 |
-
position: absolute
|
2567 |
-
}
|
2568 |
-
.mnone {
|
2569 |
-
margin: 0 !important
|
2570 |
-
}
|
2571 |
-
@media screen and (min-width: 27.5em) {
|
2572 |
-
html {
|
2573 |
-
font-size: .875em
|
2574 |
-
}
|
2575 |
-
body {
|
2576 |
-
font-size: 1rem
|
2577 |
-
}
|
2578 |
-
ul, ol {
|
2579 |
-
margin-bottom: .83999rem;
|
2580 |
-
padding-top: .16001rem
|
2581 |
-
}
|
2582 |
-
p {
|
2583 |
-
padding-top: .66001rem
|
2584 |
-
}
|
2585 |
-
p, pre {
|
2586 |
-
margin-bottom: 1.33999rem
|
2587 |
-
}
|
2588 |
-
pre, blockquote p {
|
2589 |
-
font-size: 1rem;
|
2590 |
-
padding-top: .66001rem
|
2591 |
-
}
|
2592 |
-
blockquote p {
|
2593 |
-
margin-bottom: .33999rem
|
2594 |
-
}
|
2595 |
-
h1 {
|
2596 |
-
font-size: 2.0571429rem;
|
2597 |
-
margin-bottom: .21999rem;
|
2598 |
-
padding-top: .78001rem
|
2599 |
-
}
|
2600 |
-
h2 {
|
2601 |
-
font-size: 1.953125rem;
|
2602 |
-
margin-bottom: .1835837rem;
|
2603 |
-
padding-top: .8164163rem
|
2604 |
-
}
|
2605 |
-
h3 {
|
2606 |
-
font-size: 1.6457143rem;
|
2607 |
-
margin-bottom: .07599rem;
|
2608 |
-
padding-top: .92401rem
|
2609 |
-
}
|
2610 |
-
h4 {
|
2611 |
-
font-size: 1.5625rem;
|
2612 |
-
margin-bottom: .546865rem;
|
2613 |
-
padding-top: .453135rem
|
2614 |
-
}
|
2615 |
-
h5 {
|
2616 |
-
font-size: 1.25rem;
|
2617 |
-
margin-bottom: -.56251rem;
|
2618 |
-
padding-top: .56251rem
|
2619 |
-
}
|
2620 |
-
h6 {
|
2621 |
-
font-size: 1rem;
|
2622 |
-
margin-bottom: -.65001rem;
|
2623 |
-
padding-top: .65001rem
|
2624 |
-
}
|
2625 |
-
.g {
|
2626 |
-
margin-left: -16px;
|
2627 |
-
margin-right: -16px
|
2628 |
-
}
|
2629 |
-
.g-b {
|
2630 |
-
padding-left: 16px;
|
2631 |
-
padding-right: 16px
|
2632 |
-
}
|
2633 |
-
.g-b--m1of1 {
|
2634 |
-
width: 100%
|
2635 |
-
}
|
2636 |
-
.g-b--m1of2, .g-b--m2of4, .g-b--m3of6, .g-b--m4of8, .g-b--m5of10, .g-b--m6of12 {
|
2637 |
-
width: 50%
|
2638 |
-
}
|
2639 |
-
.g-b--m1of3, .g-b--m2of6, .g-b--m4of12 {
|
2640 |
-
width: 33.333%
|
2641 |
-
}
|
2642 |
-
.g-b--m2of3, .g-b--m4of6, .g-b--m8of12 {
|
2643 |
-
width: 66.666%
|
2644 |
-
}
|
2645 |
-
.g-b--m1of4, .g-b--m2of8, .g-b--m3of12 {
|
2646 |
-
width: 25%
|
2647 |
-
}
|
2648 |
-
.g-b--m3of4, .g-b--m6of8, .g-b--m9of12 {
|
2649 |
-
width: 75%
|
2650 |
-
}
|
2651 |
-
.g-b--m1of5, .g-b--m2of10 {
|
2652 |
-
width: 20%
|
2653 |
-
}
|
2654 |
-
.g-b--m2of5, .g-b--m4of10 {
|
2655 |
-
width: 40%
|
2656 |
-
}
|
2657 |
-
.g-b--m3of5, .g-b--m6of10 {
|
2658 |
-
width: 60%
|
2659 |
-
}
|
2660 |
-
.g-b--m4of5, .g-b--m8of10 {
|
2661 |
-
width: 80%
|
2662 |
-
}
|
2663 |
-
.g-b--m1of6, .g-b--m2of12 {
|
2664 |
-
width: 16.666%
|
2665 |
-
}
|
2666 |
-
.g-b--m5of6, .g-b--m10of12 {
|
2667 |
-
width: 83.333%
|
2668 |
-
}
|
2669 |
-
.g-b--m1of8 {
|
2670 |
-
width: 12.5%
|
2671 |
-
}
|
2672 |
-
.g-b--m3of8 {
|
2673 |
-
width: 37.5%
|
2674 |
-
}
|
2675 |
-
.g-b--m5of8 {
|
2676 |
-
width: 62.5%
|
2677 |
-
}
|
2678 |
-
.g-b--m7of8 {
|
2679 |
-
width: 87.5%
|
2680 |
-
}
|
2681 |
-
.g-b--m1of10 {
|
2682 |
-
width: 10%
|
2683 |
-
}
|
2684 |
-
.g-b--m3of10 {
|
2685 |
-
width: 30%
|
2686 |
-
}
|
2687 |
-
.g-b--m7of10 {
|
2688 |
-
width: 70%
|
2689 |
-
}
|
2690 |
-
.g-b--m9of10 {
|
2691 |
-
width: 90%
|
2692 |
-
}
|
2693 |
-
.g-b--m1of12 {
|
2694 |
-
width: 8.333%
|
2695 |
-
}
|
2696 |
-
.g-b--m5of12 {
|
2697 |
-
width: 41.666%
|
2698 |
-
}
|
2699 |
-
.g-b--m7of12 {
|
2700 |
-
width: 58.333%
|
2701 |
-
}
|
2702 |
-
.g-b--m11of12 {
|
2703 |
-
width: 91.666%
|
2704 |
-
}
|
2705 |
-
.g-b--push--m1of1 {
|
2706 |
-
margin-left: 100%
|
2707 |
-
}
|
2708 |
-
.g-b--push--m1of2, .g-b--push--m2of4, .g-b--push--m3of6, .g-b--push--m4of8, .g-b--push--m5of10, .g-b--push--m6of12 {
|
2709 |
-
margin-left: 50%
|
2710 |
-
}
|
2711 |
-
.g-b--push--m1of3, .g-b--push--m2of6, .g-b--push--m4of12 {
|
2712 |
-
margin-left: 33.333%
|
2713 |
-
}
|
2714 |
-
.g-b--push--m2of3, .g-b--push--m4of6, .g-b--push--m8of12 {
|
2715 |
-
margin-left: 66.666%
|
2716 |
-
}
|
2717 |
-
.g-b--push--m1of4, .g-b--push--m2of8, .g-b--push--m3of12 {
|
2718 |
-
margin-left: 25%
|
2719 |
-
}
|
2720 |
-
.g-b--push--m3of4, .g-b--push--m6of8, .g-b--push--m9of12 {
|
2721 |
-
margin-left: 75%
|
2722 |
-
}
|
2723 |
-
.g-b--push--m1of5, .g-b--push--m2of10 {
|
2724 |
-
margin-left: 20%
|
2725 |
-
}
|
2726 |
-
.g-b--push--m2of5, .g-b--push--m4of10 {
|
2727 |
-
margin-left: 40%
|
2728 |
-
}
|
2729 |
-
.g-b--push--m3of5, .g-b--push--m6of10 {
|
2730 |
-
margin-left: 60%
|
2731 |
-
}
|
2732 |
-
.g-b--push--m4of5, .g-b--push--m8of10 {
|
2733 |
-
margin-left: 80%
|
2734 |
-
}
|
2735 |
-
.g-b--push--m1of6, .g-b--push--m2of12 {
|
2736 |
-
margin-left: 16.666%
|
2737 |
-
}
|
2738 |
-
.g-b--push--m5of6, .g-b--push--m10of12 {
|
2739 |
-
margin-left: 83.333%
|
2740 |
-
}
|
2741 |
-
.g-b--push--m1of8 {
|
2742 |
-
margin-left: 12.5%
|
2743 |
-
}
|
2744 |
-
.g-b--push--m3of8 {
|
2745 |
-
margin-left: 37.5%
|
2746 |
-
}
|
2747 |
-
.g-b--push--m5of8 {
|
2748 |
-
margin-left: 62.5%
|
2749 |
-
}
|
2750 |
-
.g-b--push--m7of8 {
|
2751 |
-
margin-left: 87.5%
|
2752 |
-
}
|
2753 |
-
.g-b--push--m1of10 {
|
2754 |
-
margin-left: 10%
|
2755 |
-
}
|
2756 |
-
.g-b--push--m3of10 {
|
2757 |
-
margin-left: 30%
|
2758 |
-
}
|
2759 |
-
.g-b--push--m7of10 {
|
2760 |
-
margin-left: 70%
|
2761 |
-
}
|
2762 |
-
.g-b--push--m9of10 {
|
2763 |
-
margin-left: 90%
|
2764 |
-
}
|
2765 |
-
.g-b--push--m1of12 {
|
2766 |
-
margin-left: 8.333%
|
2767 |
-
}
|
2768 |
-
.g-b--push--m5of12 {
|
2769 |
-
margin-left: 41.666%
|
2770 |
-
}
|
2771 |
-
.g-b--push--m7of12 {
|
2772 |
-
margin-left: 58.333%
|
2773 |
-
}
|
2774 |
-
.g-b--push--m11of12 {
|
2775 |
-
margin-left: 91.666%
|
2776 |
-
}
|
2777 |
-
.g-b--pull--m1of1 {
|
2778 |
-
margin-right: 100%
|
2779 |
-
}
|
2780 |
-
.g-b--pull--m1of2, .g-b--pull--m2of4, .g-b--pull--m3of6, .g-b--pull--m4of8, .g-b--pull--m5of10, .g-b--pull--m6of12 {
|
2781 |
-
margin-right: 50%
|
2782 |
-
}
|
2783 |
-
.g-b--pull--m1of3, .g-b--pull--m2of6, .g-b--pull--m4of12 {
|
2784 |
-
margin-right: 33.333%
|
2785 |
-
}
|
2786 |
-
.g-b--pull--m2of3, .g-b--pull--m4of6, .g-b--pull--m8of12 {
|
2787 |
-
margin-right: 66.666%
|
2788 |
-
}
|
2789 |
-
.g-b--pull--m1of4, .g-b--pull--m2of8, .g-b--pull--m3of12 {
|
2790 |
-
margin-right: 25%
|
2791 |
-
}
|
2792 |
-
.g-b--pull--m3of4, .g-b--pull--m6of8, .g-b--pull--m9of12 {
|
2793 |
-
margin-right: 75%
|
2794 |
-
}
|
2795 |
-
.g-b--pull--m1of5, .g-b--pull--m2of10 {
|
2796 |
-
margin-right: 20%
|
2797 |
-
}
|
2798 |
-
.g-b--pull--m2of5, .g-b--pull--m4of10 {
|
2799 |
-
margin-right: 40%
|
2800 |
-
}
|
2801 |
-
.g-b--pull--m3of5, .g-b--pull--m6of10 {
|
2802 |
-
margin-right: 60%
|
2803 |
-
}
|
2804 |
-
.g-b--pull--m4of5, .g-b--pull--m8of10 {
|
2805 |
-
margin-right: 80%
|
2806 |
-
}
|
2807 |
-
.g-b--pull--m1of6, .g-b--pull--m2of12 {
|
2808 |
-
margin-right: 16.666%
|
2809 |
-
}
|
2810 |
-
.g-b--pull--m5of6, .g-b--pull--m10of12 {
|
2811 |
-
margin-right: 83.333%
|
2812 |
-
}
|
2813 |
-
.g-b--pull--m1of8 {
|
2814 |
-
margin-right: 12.5%
|
2815 |
-
}
|
2816 |
-
.g-b--pull--m3of8 {
|
2817 |
-
margin-right: 37.5%
|
2818 |
-
}
|
2819 |
-
.g-b--pull--m5of8 {
|
2820 |
-
margin-right: 62.5%
|
2821 |
-
}
|
2822 |
-
.g-b--pull--m7of8 {
|
2823 |
-
margin-right: 87.5%
|
2824 |
-
}
|
2825 |
-
.g-b--pull--m1of10 {
|
2826 |
-
margin-right: 10%
|
2827 |
-
}
|
2828 |
-
.g-b--pull--m3of10 {
|
2829 |
-
margin-right: 30%
|
2830 |
-
}
|
2831 |
-
.g-b--pull--m7of10 {
|
2832 |
-
margin-right: 70%
|
2833 |
-
}
|
2834 |
-
.g-b--pull--m9of10 {
|
2835 |
-
margin-right: 90%
|
2836 |
-
}
|
2837 |
-
.g-b--pull--m1of12 {
|
2838 |
-
margin-right: 8.333%
|
2839 |
-
}
|
2840 |
-
.g-b--pull--m5of12 {
|
2841 |
-
margin-right: 41.666%
|
2842 |
-
}
|
2843 |
-
.g-b--pull--m7of12 {
|
2844 |
-
margin-right: 58.333%
|
2845 |
-
}
|
2846 |
-
.g-b--pull--m11of12 {
|
2847 |
-
margin-right: 91.666%
|
2848 |
-
}
|
2849 |
-
.splashscreen p {
|
2850 |
-
font-size: 1.25rem;
|
2851 |
-
margin-bottom: 1.43749rem;
|
2852 |
-
padding-top: .56251rem
|
2853 |
-
}
|
2854 |
-
.title {
|
2855 |
-
font-size: .8rem;
|
2856 |
-
margin-bottom: .77999rem;
|
2857 |
-
padding-top: .22001rem
|
2858 |
-
}
|
2859 |
-
.title-document {
|
2860 |
-
margin-bottom: .89999rem;
|
2861 |
-
padding-top: .10001rem
|
2862 |
-
}
|
2863 |
-
.title-document, .settings a {
|
2864 |
-
font-size: 1.25rem
|
2865 |
-
}
|
2866 |
-
.words, .characters {
|
2867 |
-
font-size: .8rem;
|
2868 |
-
margin-bottom: .77999rem;
|
2869 |
-
padding-top: .22001rem
|
2870 |
-
}
|
2871 |
-
.modal--dillinger.about .modal-dialog, #zen {
|
2872 |
-
font-size: 1.25rem
|
2873 |
-
}
|
2874 |
-
#zen {
|
2875 |
-
width: 400px
|
2876 |
-
}
|
2877 |
-
#editor {
|
2878 |
-
font-size: 1rem
|
2879 |
-
}
|
2880 |
-
}
|
2881 |
-
@media screen and (min-width: 46.25em) {
|
2882 |
-
html {
|
2883 |
-
font-size: .875em
|
2884 |
-
}
|
2885 |
-
body {
|
2886 |
-
font-size: 1rem
|
2887 |
-
}
|
2888 |
-
ul, ol {
|
2889 |
-
margin-bottom: .83999rem;
|
2890 |
-
padding-top: .16001rem
|
2891 |
-
}
|
2892 |
-
p {
|
2893 |
-
padding-top: .66001rem
|
2894 |
-
}
|
2895 |
-
p, pre {
|
2896 |
-
margin-bottom: 1.33999rem
|
2897 |
-
}
|
2898 |
-
pre, blockquote p {
|
2899 |
-
font-size: 1rem;
|
2900 |
-
padding-top: .66001rem
|
2901 |
-
}
|
2902 |
-
blockquote p {
|
2903 |
-
margin-bottom: .33999rem
|
2904 |
-
}
|
2905 |
-
h1 {
|
2906 |
-
font-size: 2.0571429rem;
|
2907 |
-
margin-bottom: .21999rem;
|
2908 |
-
padding-top: .78001rem
|
2909 |
-
}
|
2910 |
-
h2 {
|
2911 |
-
font-size: 1.953125rem;
|
2912 |
-
margin-bottom: .1835837rem;
|
2913 |
-
padding-top: .8164163rem
|
2914 |
-
}
|
2915 |
-
h3 {
|
2916 |
-
font-size: 1.6457143rem;
|
2917 |
-
margin-bottom: .07599rem;
|
2918 |
-
padding-top: .92401rem
|
2919 |
-
}
|
2920 |
-
h4 {
|
2921 |
-
font-size: 1.5625rem;
|
2922 |
-
margin-bottom: .546865rem;
|
2923 |
-
padding-top: .453135rem
|
2924 |
-
}
|
2925 |
-
h5 {
|
2926 |
-
font-size: 1.25rem;
|
2927 |
-
margin-bottom: -.56251rem;
|
2928 |
-
padding-top: .56251rem
|
2929 |
-
}
|
2930 |
-
h6 {
|
2931 |
-
font-size: 1rem;
|
2932 |
-
margin-bottom: -.65001rem;
|
2933 |
-
padding-top: .65001rem
|
2934 |
-
}
|
2935 |
-
.g {
|
2936 |
-
margin-left: -16px;
|
2937 |
-
margin-right: -16px
|
2938 |
-
}
|
2939 |
-
.g-b {
|
2940 |
-
padding-left: 16px;
|
2941 |
-
padding-right: 16px
|
2942 |
-
}
|
2943 |
-
.g-b--t1of1 {
|
2944 |
-
width: 100%
|
2945 |
-
}
|
2946 |
-
.g-b--t1of2, .g-b--t2of4, .g-b--t3of6, .g-b--t4of8, .g-b--t5of10, .g-b--t6of12 {
|
2947 |
-
width: 50%
|
2948 |
-
}
|
2949 |
-
.g-b--t1of3, .g-b--t2of6, .g-b--t4of12 {
|
2950 |
-
width: 33.333%
|
2951 |
-
}
|
2952 |
-
.g-b--t2of3, .g-b--t4of6, .g-b--t8of12 {
|
2953 |
-
width: 66.666%
|
2954 |
-
}
|
2955 |
-
.g-b--t1of4, .g-b--t2of8, .g-b--t3of12 {
|
2956 |
-
width: 25%
|
2957 |
-
}
|
2958 |
-
.g-b--t3of4, .g-b--t6of8, .g-b--t9of12 {
|
2959 |
-
width: 75%
|
2960 |
-
}
|
2961 |
-
.g-b--t1of5, .g-b--t2of10 {
|
2962 |
-
width: 20%
|
2963 |
-
}
|
2964 |
-
.g-b--t2of5, .g-b--t4of10 {
|
2965 |
-
width: 40%
|
2966 |
-
}
|
2967 |
-
.g-b--t3of5, .g-b--t6of10 {
|
2968 |
-
width: 60%
|
2969 |
-
}
|
2970 |
-
.g-b--t4of5, .g-b--t8of10 {
|
2971 |
-
width: 80%
|
2972 |
-
}
|
2973 |
-
.g-b--t1of6, .g-b--t2of12 {
|
2974 |
-
width: 16.666%
|
2975 |
-
}
|
2976 |
-
.g-b--t5of6, .g-b--t10of12 {
|
2977 |
-
width: 83.333%
|
2978 |
-
}
|
2979 |
-
.g-b--t1of8 {
|
2980 |
-
width: 12.5%
|
2981 |
-
}
|
2982 |
-
.g-b--t3of8 {
|
2983 |
-
width: 37.5%
|
2984 |
-
}
|
2985 |
-
.g-b--t5of8 {
|
2986 |
-
width: 62.5%
|
2987 |
-
}
|
2988 |
-
.g-b--t7of8 {
|
2989 |
-
width: 87.5%
|
2990 |
-
}
|
2991 |
-
.g-b--t1of10 {
|
2992 |
-
width: 10%
|
2993 |
-
}
|
2994 |
-
.g-b--t3of10 {
|
2995 |
-
width: 30%
|
2996 |
-
}
|
2997 |
-
.g-b--t7of10 {
|
2998 |
-
width: 70%
|
2999 |
-
}
|
3000 |
-
.g-b--t9of10 {
|
3001 |
-
width: 90%
|
3002 |
-
}
|
3003 |
-
.g-b--t1of12 {
|
3004 |
-
width: 8.333%
|
3005 |
-
}
|
3006 |
-
.g-b--t5of12 {
|
3007 |
-
width: 41.666%
|
3008 |
-
}
|
3009 |
-
.g-b--t7of12 {
|
3010 |
-
width: 58.333%
|
3011 |
-
}
|
3012 |
-
.g-b--t11of12 {
|
3013 |
-
width: 91.666%
|
3014 |
-
}
|
3015 |
-
.g-b--push--t1of1 {
|
3016 |
-
margin-left: 100%
|
3017 |
-
}
|
3018 |
-
.g-b--push--t1of2, .g-b--push--t2of4, .g-b--push--t3of6, .g-b--push--t4of8, .g-b--push--t5of10, .g-b--push--t6of12 {
|
3019 |
-
margin-left: 50%
|
3020 |
-
}
|
3021 |
-
.g-b--push--t1of3, .g-b--push--t2of6, .g-b--push--t4of12 {
|
3022 |
-
margin-left: 33.333%
|
3023 |
-
}
|
3024 |
-
.g-b--push--t2of3, .g-b--push--t4of6, .g-b--push--t8of12 {
|
3025 |
-
margin-left: 66.666%
|
3026 |
-
}
|
3027 |
-
.g-b--push--t1of4, .g-b--push--t2of8, .g-b--push--t3of12 {
|
3028 |
-
margin-left: 25%
|
3029 |
-
}
|
3030 |
-
.g-b--push--t3of4, .g-b--push--t6of8, .g-b--push--t9of12 {
|
3031 |
-
margin-left: 75%
|
3032 |
-
}
|
3033 |
-
.g-b--push--t1of5, .g-b--push--t2of10 {
|
3034 |
-
margin-left: 20%
|
3035 |
-
}
|
3036 |
-
.g-b--push--t2of5, .g-b--push--t4of10 {
|
3037 |
-
margin-left: 40%
|
3038 |
-
}
|
3039 |
-
.g-b--push--t3of5, .g-b--push--t6of10 {
|
3040 |
-
margin-left: 60%
|
3041 |
-
}
|
3042 |
-
.g-b--push--t4of5, .g-b--push--t8of10 {
|
3043 |
-
margin-left: 80%
|
3044 |
-
}
|
3045 |
-
.g-b--push--t1of6, .g-b--push--t2of12 {
|
3046 |
-
margin-left: 16.666%
|
3047 |
-
}
|
3048 |
-
.g-b--push--t5of6, .g-b--push--t10of12 {
|
3049 |
-
margin-left: 83.333%
|
3050 |
-
}
|
3051 |
-
.g-b--push--t1of8 {
|
3052 |
-
margin-left: 12.5%
|
3053 |
-
}
|
3054 |
-
.g-b--push--t3of8 {
|
3055 |
-
margin-left: 37.5%
|
3056 |
-
}
|
3057 |
-
.g-b--push--t5of8 {
|
3058 |
-
margin-left: 62.5%
|
3059 |
-
}
|
3060 |
-
.g-b--push--t7of8 {
|
3061 |
-
margin-left: 87.5%
|
3062 |
-
}
|
3063 |
-
.g-b--push--t1of10 {
|
3064 |
-
margin-left: 10%
|
3065 |
-
}
|
3066 |
-
.g-b--push--t3of10 {
|
3067 |
-
margin-left: 30%
|
3068 |
-
}
|
3069 |
-
.g-b--push--t7of10 {
|
3070 |
-
margin-left: 70%
|
3071 |
-
}
|
3072 |
-
.g-b--push--t9of10 {
|
3073 |
-
margin-left: 90%
|
3074 |
-
}
|
3075 |
-
.g-b--push--t1of12 {
|
3076 |
-
margin-left: 8.333%
|
3077 |
-
}
|
3078 |
-
.g-b--push--t5of12 {
|
3079 |
-
margin-left: 41.666%
|
3080 |
-
}
|
3081 |
-
.g-b--push--t7of12 {
|
3082 |
-
margin-left: 58.333%
|
3083 |
-
}
|
3084 |
-
.g-b--push--t11of12 {
|
3085 |
-
margin-left: 91.666%
|
3086 |
-
}
|
3087 |
-
.g-b--pull--t1of1 {
|
3088 |
-
margin-right: 100%
|
3089 |
-
}
|
3090 |
-
.g-b--pull--t1of2, .g-b--pull--t2of4, .g-b--pull--t3of6, .g-b--pull--t4of8, .g-b--pull--t5of10, .g-b--pull--t6of12 {
|
3091 |
-
margin-right: 50%
|
3092 |
-
}
|
3093 |
-
.g-b--pull--t1of3, .g-b--pull--t2of6, .g-b--pull--t4of12 {
|
3094 |
-
margin-right: 33.333%
|
3095 |
-
}
|
3096 |
-
.g-b--pull--t2of3, .g-b--pull--t4of6, .g-b--pull--t8of12 {
|
3097 |
-
margin-right: 66.666%
|
3098 |
-
}
|
3099 |
-
.g-b--pull--t1of4, .g-b--pull--t2of8, .g-b--pull--t3of12 {
|
3100 |
-
margin-right: 25%
|
3101 |
-
}
|
3102 |
-
.g-b--pull--t3of4, .g-b--pull--t6of8, .g-b--pull--t9of12 {
|
3103 |
-
margin-right: 75%
|
3104 |
-
}
|
3105 |
-
.g-b--pull--t1of5, .g-b--pull--t2of10 {
|
3106 |
-
margin-right: 20%
|
3107 |
-
}
|
3108 |
-
.g-b--pull--t2of5, .g-b--pull--t4of10 {
|
3109 |
-
margin-right: 40%
|
3110 |
-
}
|
3111 |
-
.g-b--pull--t3of5, .g-b--pull--t6of10 {
|
3112 |
-
margin-right: 60%
|
3113 |
-
}
|
3114 |
-
.g-b--pull--t4of5, .g-b--pull--t8of10 {
|
3115 |
-
margin-right: 80%
|
3116 |
-
}
|
3117 |
-
.g-b--pull--t1of6, .g-b--pull--t2of12 {
|
3118 |
-
margin-right: 16.666%
|
3119 |
-
}
|
3120 |
-
.g-b--pull--t5of6, .g-b--pull--t10of12 {
|
3121 |
-
margin-right: 83.333%
|
3122 |
-
}
|
3123 |
-
.g-b--pull--t1of8 {
|
3124 |
-
margin-right: 12.5%
|
3125 |
-
}
|
3126 |
-
.g-b--pull--t3of8 {
|
3127 |
-
margin-right: 37.5%
|
3128 |
-
}
|
3129 |
-
.g-b--pull--t5of8 {
|
3130 |
-
margin-right: 62.5%
|
3131 |
-
}
|
3132 |
-
.g-b--pull--t7of8 {
|
3133 |
-
margin-right: 87.5%
|
3134 |
-
}
|
3135 |
-
.g-b--pull--t1of10 {
|
3136 |
-
margin-right: 10%
|
3137 |
-
}
|
3138 |
-
.g-b--pull--t3of10 {
|
3139 |
-
margin-right: 30%
|
3140 |
-
}
|
3141 |
-
.g-b--pull--t7of10 {
|
3142 |
-
margin-right: 70%
|
3143 |
-
}
|
3144 |
-
.g-b--pull--t9of10 {
|
3145 |
-
margin-right: 90%
|
3146 |
-
}
|
3147 |
-
.g-b--pull--t1of12 {
|
3148 |
-
margin-right: 8.333%
|
3149 |
-
}
|
3150 |
-
.g-b--pull--t5of12 {
|
3151 |
-
margin-right: 41.666%
|
3152 |
-
}
|
3153 |
-
.g-b--pull--t7of12 {
|
3154 |
-
margin-right: 58.333%
|
3155 |
-
}
|
3156 |
-
.g-b--pull--t11of12 {
|
3157 |
-
margin-right: 91.666%
|
3158 |
-
}
|
3159 |
-
.splashscreen-dillinger {
|
3160 |
-
width: 500px
|
3161 |
-
}
|
3162 |
-
.splashscreen p {
|
3163 |
-
font-size: 1.25rem;
|
3164 |
-
margin-bottom: 1.43749rem;
|
3165 |
-
padding-top: .56251rem
|
3166 |
-
}
|
3167 |
-
.title {
|
3168 |
-
font-size: .8rem;
|
3169 |
-
margin-bottom: .77999rem;
|
3170 |
-
padding-top: .22001rem
|
3171 |
-
}
|
3172 |
-
.title-document {
|
3173 |
-
font-size: 1.25rem;
|
3174 |
-
margin-bottom: .89999rem;
|
3175 |
-
padding-top: .10001rem
|
3176 |
-
}
|
3177 |
-
.menu .menu-item--save-to, .menu .menu-item--import-from {
|
3178 |
-
display: block
|
3179 |
-
}
|
3180 |
-
.menu .menu-item--preview, .menu .menu-item--save-to.in-sidebar, .menu .menu-item--import-from.in-sidebar {
|
3181 |
-
display: none
|
3182 |
-
}
|
3183 |
-
.settings a {
|
3184 |
-
font-size: 1.25rem
|
3185 |
-
}
|
3186 |
-
.words, .characters {
|
3187 |
-
font-size: .8rem;
|
3188 |
-
margin-bottom: .77999rem;
|
3189 |
-
padding-top: .22001rem
|
3190 |
-
}
|
3191 |
-
.modal--dillinger.about .modal-dialog {
|
3192 |
-
font-size: 1.25rem
|
3193 |
-
}
|
3194 |
-
.enter-zen-mode {
|
3195 |
-
display: block
|
3196 |
-
}
|
3197 |
-
.close-zen-mode {
|
3198 |
-
right: 3rem;
|
3199 |
-
top: 3rem
|
3200 |
-
}
|
3201 |
-
#zen {
|
3202 |
-
font-size: 1.25rem;
|
3203 |
-
width: 500px
|
3204 |
-
}
|
3205 |
-
.split-editor {
|
3206 |
-
border-right: 1px solid #e8e8e8;
|
3207 |
-
float: left;
|
3208 |
-
height: calc(100vh - 172px);
|
3209 |
-
-webkit-overflow-scrolling: touch;
|
3210 |
-
padding-right: 16px;
|
3211 |
-
width: 50%
|
3212 |
-
}
|
3213 |
-
.show-preview .split-editor {
|
3214 |
-
display: block
|
3215 |
-
}
|
3216 |
-
.split-preview {
|
3217 |
-
display: block;
|
3218 |
-
float: right;
|
3219 |
-
height: calc(100vh - 172px);
|
3220 |
-
-webkit-overflow-scrolling: touch;
|
3221 |
-
position: relative;
|
3222 |
-
top: 0;
|
3223 |
-
width: 50%
|
3224 |
-
}
|
3225 |
-
#editor {
|
3226 |
-
font-size: 1rem
|
3227 |
-
}
|
3228 |
-
.preview-mode-toggle-src, .preview-mode-toggle-html {
|
3229 |
-
display: block
|
3230 |
-
}
|
3231 |
-
}
|
3232 |
-
@media screen and (min-width: 62.5em) {
|
3233 |
-
html {
|
3234 |
-
font-size: .875em
|
3235 |
-
}
|
3236 |
-
body {
|
3237 |
-
font-size: 1rem
|
3238 |
-
}
|
3239 |
-
ul, ol {
|
3240 |
-
margin-bottom: .83999rem;
|
3241 |
-
padding-top: .16001rem
|
3242 |
-
}
|
3243 |
-
p {
|
3244 |
-
padding-top: .66001rem
|
3245 |
-
}
|
3246 |
-
p, pre {
|
3247 |
-
margin-bottom: 1.33999rem
|
3248 |
-
}
|
3249 |
-
pre, blockquote p {
|
3250 |
-
font-size: 1rem;
|
3251 |
-
padding-top: .66001rem
|
3252 |
-
}
|
3253 |
-
blockquote p {
|
3254 |
-
margin-bottom: .33999rem
|
3255 |
-
}
|
3256 |
-
h1 {
|
3257 |
-
font-size: 2.0571429rem;
|
3258 |
-
margin-bottom: .21999rem;
|
3259 |
-
padding-top: .78001rem
|
3260 |
-
}
|
3261 |
-
h2 {
|
3262 |
-
font-size: 1.953125rem;
|
3263 |
-
margin-bottom: .1835837rem;
|
3264 |
-
padding-top: .8164163rem
|
3265 |
-
}
|
3266 |
-
h3 {
|
3267 |
-
font-size: 1.6457143rem;
|
3268 |
-
margin-bottom: .07599rem;
|
3269 |
-
padding-top: .92401rem
|
3270 |
-
}
|
3271 |
-
h4 {
|
3272 |
-
font-size: 1.5625rem;
|
3273 |
-
margin-bottom: .546865rem;
|
3274 |
-
padding-top: .453135rem
|
3275 |
-
}
|
3276 |
-
h5 {
|
3277 |
-
font-size: 1.25rem;
|
3278 |
-
margin-bottom: -.56251rem;
|
3279 |
-
padding-top: .56251rem
|
3280 |
-
}
|
3281 |
-
h6 {
|
3282 |
-
font-size: 1rem;
|
3283 |
-
margin-bottom: -.65001rem;
|
3284 |
-
padding-top: .65001rem
|
3285 |
-
}
|
3286 |
-
.g {
|
3287 |
-
margin-left: -16px;
|
3288 |
-
margin-right: -16px
|
3289 |
-
}
|
3290 |
-
.g-b {
|
3291 |
-
padding-left: 16px;
|
3292 |
-
padding-right: 16px
|
3293 |
-
}
|
3294 |
-
.g-b--d1of1 {
|
3295 |
-
width: 100%
|
3296 |
-
}
|
3297 |
-
.g-b--d1of2, .g-b--d2of4, .g-b--d3of6, .g-b--d4of8, .g-b--d5of10, .g-b--d6of12 {
|
3298 |
-
width: 50%
|
3299 |
-
}
|
3300 |
-
.g-b--d1of3, .g-b--d2of6, .g-b--d4of12 {
|
3301 |
-
width: 33.333%
|
3302 |
-
}
|
3303 |
-
.g-b--d2of3, .g-b--d4of6, .g-b--d8of12 {
|
3304 |
-
width: 66.666%
|
3305 |
-
}
|
3306 |
-
.g-b--d1of4, .g-b--d2of8, .g-b--d3of12 {
|
3307 |
-
width: 25%
|
3308 |
-
}
|
3309 |
-
.g-b--d3of4, .g-b--d6of8, .g-b--d9of12 {
|
3310 |
-
width: 75%
|
3311 |
-
}
|
3312 |
-
.g-b--d1of5, .g-b--d2of10 {
|
3313 |
-
width: 20%
|
3314 |
-
}
|
3315 |
-
.g-b--d2of5, .g-b--d4of10 {
|
3316 |
-
width: 40%
|
3317 |
-
}
|
3318 |
-
.g-b--d3of5, .g-b--d6of10 {
|
3319 |
-
width: 60%
|
3320 |
-
}
|
3321 |
-
.g-b--d4of5, .g-b--d8of10 {
|
3322 |
-
width: 80%
|
3323 |
-
}
|
3324 |
-
.g-b--d1of6, .g-b--d2of12 {
|
3325 |
-
width: 16.666%
|
3326 |
-
}
|
3327 |
-
.g-b--d5of6, .g-b--d10of12 {
|
3328 |
-
width: 83.333%
|
3329 |
-
}
|
3330 |
-
.g-b--d1of8 {
|
3331 |
-
width: 12.5%
|
3332 |
-
}
|
3333 |
-
.g-b--d3of8 {
|
3334 |
-
width: 37.5%
|
3335 |
-
}
|
3336 |
-
.g-b--d5of8 {
|
3337 |
-
width: 62.5%
|
3338 |
-
}
|
3339 |
-
.g-b--d7of8 {
|
3340 |
-
width: 87.5%
|
3341 |
-
}
|
3342 |
-
.g-b--d1of10 {
|
3343 |
-
width: 10%
|
3344 |
-
}
|
3345 |
-
.g-b--d3of10 {
|
3346 |
-
width: 30%
|
3347 |
-
}
|
3348 |
-
.g-b--d7of10 {
|
3349 |
-
width: 70%
|
3350 |
-
}
|
3351 |
-
.g-b--d9of10 {
|
3352 |
-
width: 90%
|
3353 |
-
}
|
3354 |
-
.g-b--d1of12 {
|
3355 |
-
width: 8.333%
|
3356 |
-
}
|
3357 |
-
.g-b--d5of12 {
|
3358 |
-
width: 41.666%
|
3359 |
-
}
|
3360 |
-
.g-b--d7of12 {
|
3361 |
-
width: 58.333%
|
3362 |
-
}
|
3363 |
-
.g-b--d11of12 {
|
3364 |
-
width: 91.666%
|
3365 |
-
}
|
3366 |
-
.g-b--push--d1of1 {
|
3367 |
-
margin-left: 100%
|
3368 |
-
}
|
3369 |
-
.g-b--push--d1of2, .g-b--push--d2of4, .g-b--push--d3of6, .g-b--push--d4of8, .g-b--push--d5of10, .g-b--push--d6of12 {
|
3370 |
-
margin-left: 50%
|
3371 |
-
}
|
3372 |
-
.g-b--push--d1of3, .g-b--push--d2of6, .g-b--push--d4of12 {
|
3373 |
-
margin-left: 33.333%
|
3374 |
-
}
|
3375 |
-
.g-b--push--d2of3, .g-b--push--d4of6, .g-b--push--d8of12 {
|
3376 |
-
margin-left: 66.666%
|
3377 |
-
}
|
3378 |
-
.g-b--push--d1of4, .g-b--push--d2of8, .g-b--push--d3of12 {
|
3379 |
-
margin-left: 25%
|
3380 |
-
}
|
3381 |
-
.g-b--push--d3of4, .g-b--push--d6of8, .g-b--push--d9of12 {
|
3382 |
-
margin-left: 75%
|
3383 |
-
}
|
3384 |
-
.g-b--push--d1of5, .g-b--push--d2of10 {
|
3385 |
-
margin-left: 20%
|
3386 |
-
}
|
3387 |
-
.g-b--push--d2of5, .g-b--push--d4of10 {
|
3388 |
-
margin-left: 40%
|
3389 |
-
}
|
3390 |
-
.g-b--push--d3of5, .g-b--push--d6of10 {
|
3391 |
-
margin-left: 60%
|
3392 |
-
}
|
3393 |
-
.g-b--push--d4of5, .g-b--push--d8of10 {
|
3394 |
-
margin-left: 80%
|
3395 |
-
}
|
3396 |
-
.g-b--push--d1of6, .g-b--push--d2of12 {
|
3397 |
-
margin-left: 16.666%
|
3398 |
-
}
|
3399 |
-
.g-b--push--d5of6, .g-b--push--d10of12 {
|
3400 |
-
margin-left: 83.333%
|
3401 |
-
}
|
3402 |
-
.g-b--push--d1of8 {
|
3403 |
-
margin-left: 12.5%
|
3404 |
-
}
|
3405 |
-
.g-b--push--d3of8 {
|
3406 |
-
margin-left: 37.5%
|
3407 |
-
}
|
3408 |
-
.g-b--push--d5of8 {
|
3409 |
-
margin-left: 62.5%
|
3410 |
-
}
|
3411 |
-
.g-b--push--d7of8 {
|
3412 |
-
margin-left: 87.5%
|
3413 |
-
}
|
3414 |
-
.g-b--push--d1of10 {
|
3415 |
-
margin-left: 10%
|
3416 |
-
}
|
3417 |
-
.g-b--push--d3of10 {
|
3418 |
-
margin-left: 30%
|
3419 |
-
}
|
3420 |
-
.g-b--push--d7of10 {
|
3421 |
-
margin-left: 70%
|
3422 |
-
}
|
3423 |
-
.g-b--push--d9of10 {
|
3424 |
-
margin-left: 90%
|
3425 |
-
}
|
3426 |
-
.g-b--push--d1of12 {
|
3427 |
-
margin-left: 8.333%
|
3428 |
-
}
|
3429 |
-
.g-b--push--d5of12 {
|
3430 |
-
margin-left: 41.666%
|
3431 |
-
}
|
3432 |
-
.g-b--push--d7of12 {
|
3433 |
-
margin-left: 58.333%
|
3434 |
-
}
|
3435 |
-
.g-b--push--d11of12 {
|
3436 |
-
margin-left: 91.666%
|
3437 |
-
}
|
3438 |
-
.g-b--pull--d1of1 {
|
3439 |
-
margin-right: 100%
|
3440 |
-
}
|
3441 |
-
.g-b--pull--d1of2, .g-b--pull--d2of4, .g-b--pull--d3of6, .g-b--pull--d4of8, .g-b--pull--d5of10, .g-b--pull--d6of12 {
|
3442 |
-
margin-right: 50%
|
3443 |
-
}
|
3444 |
-
.g-b--pull--d1of3, .g-b--pull--d2of6, .g-b--pull--d4of12 {
|
3445 |
-
margin-right: 33.333%
|
3446 |
-
}
|
3447 |
-
.g-b--pull--d2of3, .g-b--pull--d4of6, .g-b--pull--d8of12 {
|
3448 |
-
margin-right: 66.666%
|
3449 |
-
}
|
3450 |
-
.g-b--pull--d1of4, .g-b--pull--d2of8, .g-b--pull--d3of12 {
|
3451 |
-
margin-right: 25%
|
3452 |
-
}
|
3453 |
-
.g-b--pull--d3of4, .g-b--pull--d6of8, .g-b--pull--d9of12 {
|
3454 |
-
margin-right: 75%
|
3455 |
-
}
|
3456 |
-
.g-b--pull--d1of5, .g-b--pull--d2of10 {
|
3457 |
-
margin-right: 20%
|
3458 |
-
}
|
3459 |
-
.g-b--pull--d2of5, .g-b--pull--d4of10 {
|
3460 |
-
margin-right: 40%
|
3461 |
-
}
|
3462 |
-
.g-b--pull--d3of5, .g-b--pull--d6of10 {
|
3463 |
-
margin-right: 60%
|
3464 |
-
}
|
3465 |
-
.g-b--pull--d4of5, .g-b--pull--d8of10 {
|
3466 |
-
margin-right: 80%
|
3467 |
-
}
|
3468 |
-
.g-b--pull--d1of6, .g-b--pull--d2of12 {
|
3469 |
-
margin-right: 16.666%
|
3470 |
-
}
|
3471 |
-
.g-b--pull--d5of6, .g-b--pull--d10of12 {
|
3472 |
-
margin-right: 83.333%
|
3473 |
-
}
|
3474 |
-
.g-b--pull--d1of8 {
|
3475 |
-
margin-right: 12.5%
|
3476 |
-
}
|
3477 |
-
.g-b--pull--d3of8 {
|
3478 |
-
margin-right: 37.5%
|
3479 |
-
}
|
3480 |
-
.g-b--pull--d5of8 {
|
3481 |
-
margin-right: 62.5%
|
3482 |
-
}
|
3483 |
-
.g-b--pull--d7of8 {
|
3484 |
-
margin-right: 87.5%
|
3485 |
-
}
|
3486 |
-
.g-b--pull--d1of10 {
|
3487 |
-
margin-right: 10%
|
3488 |
-
}
|
3489 |
-
.g-b--pull--d3of10 {
|
3490 |
-
margin-right: 30%
|
3491 |
-
}
|
3492 |
-
.g-b--pull--d7of10 {
|
3493 |
-
margin-right: 70%
|
3494 |
-
}
|
3495 |
-
.g-b--pull--d9of10 {
|
3496 |
-
margin-right: 90%
|
3497 |
-
}
|
3498 |
-
.g-b--pull--d1of12 {
|
3499 |
-
margin-right: 8.333%
|
3500 |
-
}
|
3501 |
-
.g-b--pull--d5of12 {
|
3502 |
-
margin-right: 41.666%
|
3503 |
-
}
|
3504 |
-
.g-b--pull--d7of12 {
|
3505 |
-
margin-right: 58.333%
|
3506 |
-
}
|
3507 |
-
.g-b--pull--d11of12 {
|
3508 |
-
margin-right: 91.666%
|
3509 |
-
}
|
3510 |
-
.splashscreen-dillinger {
|
3511 |
-
width: 700px
|
3512 |
-
}
|
3513 |
-
.splashscreen p {
|
3514 |
-
font-size: 1.25rem;
|
3515 |
-
margin-bottom: 1.43749rem;
|
3516 |
-
padding-top: .56251rem
|
3517 |
-
}
|
3518 |
-
.title {
|
3519 |
-
font-size: .8rem;
|
3520 |
-
margin-bottom: .77999rem;
|
3521 |
-
padding-top: .22001rem
|
3522 |
-
}
|
3523 |
-
.title-document {
|
3524 |
-
font-size: 1.25rem;
|
3525 |
-
margin-bottom: .89999rem;
|
3526 |
-
padding-top: .10001rem
|
3527 |
-
}
|
3528 |
-
.menu .menu-item--export-as {
|
3529 |
-
display: block
|
3530 |
-
}
|
3531 |
-
.menu .menu-item--preview {
|
3532 |
-
display: none
|
3533 |
-
}
|
3534 |
-
.settings a {
|
3535 |
-
font-size: 1.25rem
|
3536 |
-
}
|
3537 |
-
.words, .characters {
|
3538 |
-
font-size: .8rem;
|
3539 |
-
margin-bottom: .77999rem;
|
3540 |
-
padding-top: .22001rem
|
3541 |
-
}
|
3542 |
-
.modal--dillinger.about .modal-dialog, #zen {
|
3543 |
-
font-size: 1.25rem
|
3544 |
-
}
|
3545 |
-
#zen {
|
3546 |
-
width: 700px
|
3547 |
-
}
|
3548 |
-
#editor {
|
3549 |
-
font-size: 1rem
|
3550 |
-
}
|
3551 |
-
}
|
3552 |
-
@media screen and (min-width: 87.5em) {
|
3553 |
-
html {
|
3554 |
-
font-size: .875em
|
3555 |
-
}
|
3556 |
-
body {
|
3557 |
-
font-size: 1rem
|
3558 |
-
}
|
3559 |
-
ul, ol {
|
3560 |
-
margin-bottom: .83999rem;
|
3561 |
-
padding-top: .16001rem
|
3562 |
-
}
|
3563 |
-
p {
|
3564 |
-
padding-top: .66001rem
|
3565 |
-
}
|
3566 |
-
p, pre {
|
3567 |
-
margin-bottom: 1.33999rem
|
3568 |
-
}
|
3569 |
-
pre, blockquote p {
|
3570 |
-
font-size: 1rem;
|
3571 |
-
padding-top: .66001rem
|
3572 |
-
}
|
3573 |
-
blockquote p {
|
3574 |
-
margin-bottom: .33999rem
|
3575 |
-
}
|
3576 |
-
h1 {
|
3577 |
-
font-size: 2.0571429rem;
|
3578 |
-
margin-bottom: .21999rem;
|
3579 |
-
padding-top: .78001rem
|
3580 |
-
}
|
3581 |
-
h2 {
|
3582 |
-
font-size: 1.953125rem;
|
3583 |
-
margin-bottom: .1835837rem;
|
3584 |
-
padding-top: .8164163rem
|
3585 |
-
}
|
3586 |
-
h3 {
|
3587 |
-
font-size: 1.6457143rem;
|
3588 |
-
margin-bottom: .07599rem;
|
3589 |
-
padding-top: .92401rem
|
3590 |
-
}
|
3591 |
-
h4 {
|
3592 |
-
font-size: 1.5625rem;
|
3593 |
-
margin-bottom: .546865rem;
|
3594 |
-
padding-top: .453135rem
|
3595 |
-
}
|
3596 |
-
h5 {
|
3597 |
-
font-size: 1.25rem;
|
3598 |
-
margin-bottom: -.56251rem;
|
3599 |
-
padding-top: .56251rem
|
3600 |
-
}
|
3601 |
-
h6 {
|
3602 |
-
font-size: 1rem;
|
3603 |
-
margin-bottom: -.65001rem;
|
3604 |
-
padding-top: .65001rem
|
3605 |
-
}
|
3606 |
-
.splashscreen-dillinger {
|
3607 |
-
width: 800px
|
3608 |
-
}
|
3609 |
-
.splashscreen p {
|
3610 |
-
font-size: 1.25rem;
|
3611 |
-
margin-bottom: 1.43749rem;
|
3612 |
-
padding-top: .56251rem
|
3613 |
-
}
|
3614 |
-
.title {
|
3615 |
-
font-size: .8rem;
|
3616 |
-
margin-bottom: .77999rem;
|
3617 |
-
padding-top: .22001rem
|
3618 |
-
}
|
3619 |
-
.title-document {
|
3620 |
-
margin-bottom: .89999rem;
|
3621 |
-
padding-top: .10001rem
|
3622 |
-
}
|
3623 |
-
.title-document, .settings a {
|
3624 |
-
font-size: 1.25rem
|
3625 |
-
}
|
3626 |
-
.words, .characters {
|
3627 |
-
font-size: .8rem;
|
3628 |
-
margin-bottom: .77999rem;
|
3629 |
-
padding-top: .22001rem
|
3630 |
-
}
|
3631 |
-
.modal--dillinger.about .modal-dialog, #zen {
|
3632 |
-
font-size: 1.25rem
|
3633 |
-
}
|
3634 |
-
#editor {
|
3635 |
-
font-size: 1rem
|
3636 |
-
}
|
3637 |
-
}
|
3638 |
-
@media (min-width: 768px) {
|
3639 |
-
.form-inline .form-group {
|
3640 |
-
display: inline-block;
|
3641 |
-
margin-bottom: 0;
|
3642 |
-
vertical-align: middle
|
3643 |
-
}
|
3644 |
-
.form-inline .form-control {
|
3645 |
-
display: inline-block;
|
3646 |
-
width: auto;
|
3647 |
-
vertical-align: middle
|
3648 |
-
}
|
3649 |
-
.form-inline .input-group {
|
3650 |
-
display: inline-table;
|
3651 |
-
vertical-align: middle
|
3652 |
-
}
|
3653 |
-
.form-inline .input-group .input-group-addon, .form-inline .input-group .input-group-btn, .form-inline .input-group .form-control {
|
3654 |
-
width: auto
|
3655 |
-
}
|
3656 |
-
.form-inline .input-group > .form-control {
|
3657 |
-
width: 100%
|
3658 |
-
}
|
3659 |
-
.form-inline .control-label {
|
3660 |
-
margin-bottom: 0;
|
3661 |
-
vertical-align: middle
|
3662 |
-
}
|
3663 |
-
.form-inline .radio, .form-inline .checkbox {
|
3664 |
-
display: inline-block;
|
3665 |
-
margin-top: 0;
|
3666 |
-
margin-bottom: 0;
|
3667 |
-
vertical-align: middle
|
3668 |
-
}
|
3669 |
-
.form-inline .radio label, .form-inline .checkbox label {
|
3670 |
-
padding-left: 0
|
3671 |
-
}
|
3672 |
-
.form-inline .radio input[type="radio"], .form-inline .checkbox input[type="checkbox"] {
|
3673 |
-
position: relative;
|
3674 |
-
margin-left: 0
|
3675 |
-
}
|
3676 |
-
.form-inline .has-feedback .form-control-feedback {
|
3677 |
-
top: 0
|
3678 |
-
}
|
3679 |
-
.form-horizontal .control-label {
|
3680 |
-
text-align: right;
|
3681 |
-
margin-bottom: 0;
|
3682 |
-
padding-top: 7px
|
3683 |
-
}
|
3684 |
-
.form-horizontal .form-group-lg .control-label {
|
3685 |
-
padding-top: 14.3px
|
3686 |
-
}
|
3687 |
-
.form-horizontal .form-group-sm .control-label {
|
3688 |
-
padding-top: 6px
|
3689 |
-
}
|
3690 |
-
.modal-dialog {
|
3691 |
-
width: 600px;
|
3692 |
-
margin: 30px auto
|
3693 |
-
}
|
3694 |
-
.modal-content {
|
3695 |
-
box-shadow: 0 5px 15px rgba(0, 0, 0, .5)
|
3696 |
-
}
|
3697 |
-
.modal-sm {
|
3698 |
-
width: 300px
|
3699 |
-
}
|
3700 |
-
}
|
3701 |
-
@media (min-width: 992px) {
|
3702 |
-
.modal-lg {
|
3703 |
-
width: 900px
|
3704 |
-
}
|
3705 |
-
}
|
3706 |
-
@media screen and (max-width: 1200px) {
|
3707 |
-
#_default_ {
|
3708 |
-
max-width: 30%
|
3709 |
-
}
|
3710 |
-
#_default_ ._default_ {
|
3711 |
-
font-size: .825rem;
|
3712 |
-
line-height: .875rem;
|
3713 |
-
padding: 12px 12px 6px 24px;
|
3714 |
-
text-align: justify
|
3715 |
-
}
|
3716 |
-
}
|
3717 |
-
@media screen and (max-width: 1100px) {
|
3718 |
-
#_default_ {
|
3719 |
-
max-width: 27%
|
3720 |
-
}
|
3721 |
-
#_default_ ._default_ {
|
3722 |
-
font-size: .8rem;
|
3723 |
-
line-height: .85rem;
|
3724 |
-
padding: 12px 6px 6px 24px;
|
3725 |
-
text-align: justify
|
3726 |
-
}
|
3727 |
-
}
|
3728 |
-
@media screen and (max-width: 1000px) {
|
3729 |
-
#_default_ {
|
3730 |
-
max-width: 24%
|
3731 |
-
}
|
3732 |
-
#_default_ ._default_ {
|
3733 |
-
font-size: .775rem;
|
3734 |
-
line-height: .8rem;
|
3735 |
-
padding: 12px 6px 6px 24px;
|
3736 |
-
text-align: justify
|
3737 |
-
}
|
3738 |
-
}
|
3739 |
-
@media screen and (max-width: 900px) {
|
3740 |
-
#_default_ {
|
3741 |
-
max-width: 30%
|
3742 |
-
}
|
3743 |
-
}
|
3744 |
-
@media screen and (max-width: 767px) {
|
3745 |
-
.table-responsive {
|
3746 |
-
width: 100%;
|
3747 |
-
margin-bottom: 15px;
|
3748 |
-
overflow-y: hidden;
|
3749 |
-
overflow-x: auto;
|
3750 |
-
-ms-overflow-style: -ms-autohiding-scrollbar;
|
3751 |
-
border: 1px solid #dddddd;
|
3752 |
-
-webkit-overflow-scrolling: touch
|
3753 |
-
}
|
3754 |
-
.table-responsive > .table {
|
3755 |
-
margin-bottom: 0
|
3756 |
-
}
|
3757 |
-
.table-responsive > .table > thead > tr > th, .table-responsive > .table > thead > tr > td, .table-responsive > .table > tbody > tr > th, .table-responsive > .table > tbody > tr > td, .table-responsive > .table > tfoot > tr > th, .table-responsive > .table > tfoot > tr > td {
|
3758 |
-
white-space: nowrap
|
3759 |
-
}
|
3760 |
-
.table-responsive > .table-bordered {
|
3761 |
-
border: 0
|
3762 |
-
}
|
3763 |
-
.table-responsive > .table-bordered > thead > tr > th:first-child, .table-responsive > .table-bordered > thead > tr > td:first-child, .table-responsive > .table-bordered > tbody > tr > th:first-child, .table-responsive > .table-bordered > tbody > tr > td:first-child, .table-responsive > .table-bordered > tfoot > tr > th:first-child, .table-responsive > .table-bordered > tfoot > tr > td:first-child {
|
3764 |
-
border-left: 0
|
3765 |
-
}
|
3766 |
-
.table-responsive > .table-bordered > thead > tr > th:last-child, .table-responsive > .table-bordered > thead > tr > td:last-child, .table-responsive > .table-bordered > tbody > tr > th:last-child, .table-responsive > .table-bordered > tbody > tr > td:last-child, .table-responsive > .table-bordered > tfoot > tr > th:last-child, .table-responsive > .table-bordered > tfoot > tr > td:last-child {
|
3767 |
-
border-right: 0
|
3768 |
-
}
|
3769 |
-
.table-responsive > .table-bordered > tbody > tr:last-child > th, .table-responsive > .table-bordered > tbody > tr:last-child > td, .table-responsive > .table-bordered > tfoot > tr:last-child > th, .table-responsive > .table-bordered > tfoot > tr:last-child > td {
|
3770 |
-
border-bottom: 0
|
3771 |
-
}
|
3772 |
-
}
|
3773 |
-
@media screen and (max-width: 720px) {
|
3774 |
-
#_default_ {
|
3775 |
-
max-width: 60%
|
3776 |
-
}
|
3777 |
-
#_default_ ._default_ {
|
3778 |
-
font-size: .75rem;
|
3779 |
-
line-height: 1rem;
|
3780 |
-
padding: 12px 24px
|
3781 |
-
}
|
3782 |
-
}
|
3783 |
-
@media screen and (max-width: 620px) {
|
3784 |
-
#_default_ {
|
3785 |
-
max-width: 50%
|
3786 |
-
}
|
3787 |
-
#_default_ ._default_ {
|
3788 |
-
font-size: .66rem;
|
3789 |
-
letter-spacing: 1px;
|
3790 |
-
line-height: 1rem;
|
3791 |
-
padding: 10px 24px
|
3792 |
-
}
|
3793 |
-
}
|
3794 |
-
@media screen and (max-width: 520px) {
|
3795 |
-
#_default_ ._default_ {
|
3796 |
-
font-size: .4rem;
|
3797 |
-
line-height: .875rem;
|
3798 |
-
padding: 6px 12px 6px 24px;
|
3799 |
-
text-align: justify
|
3800 |
-
}
|
3801 |
-
}
|
3802 |
-
@media screen and (max-width: 460px) {
|
3803 |
-
#_default_ {
|
3804 |
-
display: none
|
3805 |
-
}
|
3806 |
-
}
|
3807 |
-
@media screen and (max-width: 46.1875em) {
|
3808 |
-
.editor-header {
|
3809 |
-
display: none
|
3810 |
-
}
|
3811 |
-
.editor-header--first {
|
3812 |
-
display: block;
|
3813 |
-
width: 100%
|
3814 |
-
}
|
3815 |
-
}</style></head>
|
3816 |
-
<body id="preview">
|
3817 |
-
<style>
|
3818 |
-
#preview {
|
3819 |
-
padding-left: 20px;
|
3820 |
-
}
|
3821 |
-
</style>
|
3822 |
-
<h2>Changelog: Shield Security for WordPress</h2>
|
3823 |
<p>= 6.5 Series =<br>
|
3824 |
<em>Released: 5th March, 2018</em> - <a href="https://icwp.io/bu">Release Notes</a></p>
|
3825 |
<ul>
|
@@ -3842,8 +101,7 @@ img {
|
|
3842 |
<em>Released: 12th February, 2018</em> - <a href="https://icwp.io/bc">Release Notes</a></p>
|
3843 |
<ul>
|
3844 |
<li><strong>(v.3)</strong> FIXED: Bug with automatic updates delay setting</li>
|
3845 |
-
<li><strong>(v.2)</strong> CHANGED: Changed a text that seems to cause servers to swallow-up emails. <a
|
3846 |
-
href="https://icwp.io/bi">See here for more reliable email</a></li>
|
3847 |
<li><strong>(v.1)</strong> FIXED: Options page javascript to work around conflicts.</li>
|
3848 |
<li><strong>(v.0)</strong> ADDED: [<strong>PRO</strong>] <a href="https://icwp.io/bc">Automatic updates stability delay</a></li>
|
3849 |
<li><strong>(v.0)</strong> IMPROVED: Complete <a href="https://icwp.io/bd">plugin UI rebuild</a>, using the new Bootstrap 4.</li>
|
@@ -3958,8 +216,7 @@ img {
|
|
3958 |
<li><strong>(v.2)</strong> FIX: Restore display of help links for options.</li>
|
3959 |
<li><strong>(v.1)</strong> FIX: PHP 5.2 incompatibility.</li>
|
3960 |
<li><strong>(v.0)</strong> ADDED: New option for <a href="https://icwp.io/94">Unrecognised File Scanner</a> to scan the Uploads folder for JS and PHP files.</li>
|
3961 |
-
<li><strong>(v.0)</strong> ADDED: Option to provide custom list of files to be excluded from the <a
|
3962 |
-
href="https://icwp.io/94">Unrecognised File Scanner</a>.</li>
|
3963 |
</ul>
|
3964 |
<p>= 5.12 Series =<br>
|
3965 |
<em>Released: 3rd August, 2017</em></p>
|
@@ -4093,8 +350,7 @@ or service authenticates the request it will be honoured, whether anonymous or n
|
|
4093 |
<p><strong>(v.2)</strong> TRANSLATIONS: Dutch (56%)</p>
|
4094 |
</li>
|
4095 |
<li>
|
4096 |
-
<p><strong>(v.1)</strong> ADDED: Built-in forceful protection in the form of a wp_die() against the (currently) un-patched W3 Total Cache XSS vulnerability <a
|
4097 |
-
href="https://icwp.io/7j">more info</a></p>
|
4098 |
</li>
|
4099 |
<li>
|
4100 |
<p><strong>(v.1)</strong> IMPROVED: Better XMLRPC Lockdown - prevents ANY XMLRPC command processing.</p>
|
@@ -4136,8 +392,7 @@ or service authenticates the request it will be honoured, whether anonymous or n
|
|
4136 |
<p>= 5.4 Series =</p>
|
4137 |
<ul>
|
4138 |
<li><strong>(v.5)</strong> CHANGED: User Management module is no-longer enabled by default on clean installations</li>
|
4139 |
-
<li><strong>(v.5)</strong> CHANGED: Made the GASP checkbox for Login protection clickable by label. <a
|
4140 |
-
href="https://github.com/FernleafSystems/Shield/pull/22">Thanks Aubrey!</a></li>
|
4141 |
<li><strong>(v.5)</strong> CHANGED: Shield Statistics only shows for WordPress admins (instead of all users)</li>
|
4142 |
<li><strong>(v.5)</strong> FIXED: Added a couple of guards to ensure data is of the correct format to prevent spurious errors</li>
|
4143 |
<li><strong>(v.5)</strong> FIXED: Bug where automatic file repair links from emails we’re not working.</li>
|
@@ -4192,13 +447,11 @@ or service authenticates the request it will be honoured, whether anonymous or n
|
|
4192 |
<li><strong>(v.3)</strong> FIXED: Issue with setting session cookies with PHP 7</li>
|
4193 |
<li><strong>(v.2)</strong> FIXED: <a href="https://icwp.io/5s">Rename WordPress Login URL</a> bug</li>
|
4194 |
<li><strong>(v.2)</strong> CHANGED: reCAPTCHA text usage corrected throughout plugin.</li>
|
4195 |
-
<li><strong>(v.1)</strong> CHANGED: Removed the whole ‘wp-content’ directory from the <a
|
4196 |
-
href="https://icwp.io/wpsf40">Core File Scanner</a> feature.</li>
|
4197 |
<li><strong>(v.1)</strong> CHANGED: A WordPress filter to change the plugin badge text content (see FAQ)</li>
|
4198 |
<li><strong>(v.1)</strong> CHANGED: Tweaked the plugin badge styling.</li>
|
4199 |
<li><strong>(v.1)</strong> CHANGED: All emails sent by the plugin contain the name of the site and the current plugin version in the email footer.</li>
|
4200 |
-
<li><strong>(v.1)</strong> ADDED: In-plugin links to blogs and info articles for Google ReCaptcha and <a
|
4201 |
-
href="https://icwp.io/wpsf43">Google Authenticator</a></li>
|
4202 |
<li><strong>(v.0)</strong> NEW: WordPress Simple Firewall plugin has been re-branded and is called <strong>Shield</strong></li>
|
4203 |
<li><strong>(v.0)</strong> ADDED: NEW feature - <a href="https://icwp.io/shld2">Google ReCaptcha</a> for Comment SPAM and Login protection.</li>
|
4204 |
<li><strong>(v.0)</strong> ADDED: Support for this plugin is now Premium. Added Premium Support page that links to Helpdesk.</li>
|
@@ -4214,8 +467,7 @@ or service authenticates the request it will be honoured, whether anonymous or n
|
|
4214 |
<li><strong>(v.0)</strong> CHANGED: Email-based Two-Factor Authentication is now stateless/session-less - it will not check validity per-page load.</li>
|
4215 |
<li><strong>(v.0)</strong> CHANGED: Changes to the email-based authentication system - now only 1 option and it no longer locks to IP or browser.</li>
|
4216 |
<li><strong>(v.0)</strong> CHANGED: Various efficiency improvements including reduced SQL updates.</li>
|
4217 |
-
<li><strong>(v.0)</strong> CHANGED: Email system is improved and now send emails from the default WordPress sender. This may be <a
|
4218 |
-
href="https://icontrolwp.freshdesk.com/support/solutions/articles/3000048723">changed with filter</a>.</li>
|
4219 |
</ul>
|
4220 |
<p>= 4.16 Series =<br>
|
4221 |
<em>Released: 20th January, 2016</em></p>
|
@@ -4225,8 +477,7 @@ or service authenticates the request it will be honoured, whether anonymous or n
|
|
4225 |
<li><strong>(v.2)</strong> TRANSLATIONS: Turkish (100%)</li>
|
4226 |
<li><strong>(v.1)</strong> CHANGED: Improved the contents of the <a href="https://icwp.io/wpsf40">Core File Scanner</a> notification email with links to original source files.</li>
|
4227 |
<li><strong>(v.1)</strong> CHANGED: Now also excluding the /wp-content/languages/ directory since translations may update independently.</li>
|
4228 |
-
<li><strong>(v.1)</strong> CHANGED: Handles the special case of <a
|
4229 |
-
href="https://wordpress.org/support/topic/problem-with-checksum-hashes">old index.php files</a></li>
|
4230 |
<li><strong>(v.0)</strong> ADDED: Feature: <a href="https://icwp.io/wpsf40">Automatically scans WordPress Core files</a> and detects alterations from the default WordPress Core File data</li>
|
4231 |
<li><strong>(v.0)</strong> ADDED: Feature: to automatically attempt to repair/replace WordPress Core files that are discovered which have been altered.</li>
|
4232 |
<li><strong>(v.0)</strong> ADDED: Option to toggle the <a href="https://icwp.io/wpsf41">Plugin Vulnerabilities cron</a>.</li>
|
@@ -4245,12 +496,10 @@ or service authenticates the request it will be honoured, whether anonymous or n
|
|
4245 |
<em>Released: 20th November, 2015</em></p>
|
4246 |
<ul>
|
4247 |
<li><strong>(v.2)</strong> ADDED: User notice message displayed when the ‘Theme My Login’ plugin is active and you try to rename your login URL - It is not compatible.</li>
|
4248 |
-
<li><strong>(v.1)</strong> ADDED: Added WordPress filter option to specify URL instead of present a 404 when Rename WP Login is active. <a
|
4249 |
-
href="https://icontrolwp.freshdesk.com/solution/articles/3000044812">more info</a></li>
|
4250 |
<li><strong>(v.1)</strong> ADDED: Added ‘Unique Plugin Installation ID’ to be utilized in the future.</li>
|
4251 |
<li><strong>(v.1)</strong> FIXED: WordPress Comments bug where some comments didn’t pass through the SPAM filters in a certain scenario.</li>
|
4252 |
-
<li><strong>(v.0)</strong> ADDED: <a
|
4253 |
-
href="https://icwp.io/wpsf33">Custom Automatic Update Notifications Email</a> that runs separately to the in-built WordPress core notification email.</li>
|
4254 |
<li><strong>(v.0)</strong> ADDED: Filter to remove the admin area IP address footer text</li>
|
4255 |
<li><strong>(v.0)</strong> CHANGED: Added native support for PayPal return links - whitelisting “verify_sign” parameter.</li>
|
4256 |
<li><strong>(v.0)</strong> CHANGED: Tweak patterns for matching on ‘WordPress terms’.</li>
|
@@ -4273,15 +522,13 @@ or service authenticates the request it will be honoured, whether anonymous or n
|
|
4273 |
<p>= 4.12 Series =<br>
|
4274 |
<em>Released: 10th October, 2015</em></p>
|
4275 |
<ul>
|
4276 |
-
<li><strong>(v.0)</strong> NEW: Option to completely disable the XML-RPC system. <a
|
4277 |
-
href="https://icwp.io/wpsf31">more info</a></li>
|
4278 |
<li><strong>(v.0)</strong> CHANGED: Logged-in users are automatically forwarded to the WordPress admin only if they are Administrators.</li>
|
4279 |
</ul>
|
4280 |
<p>= 4.11 Series =<br>
|
4281 |
<em>Released: 5th October, 2015</em></p>
|
4282 |
<ul>
|
4283 |
-
<li><strong>(v.0)</strong> NEW: Ability to now completely block the update/changing of certain WordPress site options. <a
|
4284 |
-
href="https://icwp.io/wpsf30">more info</a></li>
|
4285 |
<li><strong>(v.0)</strong> FIXED: Various small bugs with the IP Manager UI ajax.</li>
|
4286 |
<li><strong>(v.0)</strong> FIXED: Uncaught PHP Exception when a site’s hosting isn’t properly configured to handle IPv6 addresses.</li>
|
4287 |
<li><strong>(v.0)</strong> TRANSLATIONS: Danish - 57%, Czech - 100%, Finnish - 94%</li>
|
@@ -4338,12 +585,10 @@ or service authenticates the request it will be honoured, whether anonymous or n
|
|
4338 |
<p><strong>(v.1)</strong> CHANGED: Default transgressions limit is now 7</p>
|
4339 |
</li>
|
4340 |
<li>
|
4341 |
-
<p><strong>(v.1)</strong> ADDED: Ability to reset plugin options to default using ‘reset’ flag file. <a
|
4342 |
-
href="https://icwp.io/wpsf28">more info</a></p>
|
4343 |
</li>
|
4344 |
<li>
|
4345 |
-
<p><strong>(v.0)</strong> NEW FEATURE: ‘FABLE’ - <a
|
4346 |
-
href="https://icwp.io/wpsf27">Fully Automatic Black Listing Engine</a>.</p>
|
4347 |
</li>
|
4348 |
</ul>
|
4349 |
<p>Simply put, FABLE will automatically block all malicious traffic by IP, based on their activity. This Security Plugin will track malicious behaviour<br>
|
@@ -4375,8 +620,7 @@ will outright block any access they have to your WordPress site.</p>
|
|
4375 |
<li><strong>(v.8)</strong> CHANGED: Firewall, User Sessions and Lockdown Feature Modules are now enabled by default for new installations.</li>
|
4376 |
<li><strong>(v.8)</strong> FIX: Some server email programs can’t handle colons (:) in the email subject (because supporting all characters would be waaay too radical man).</li>
|
4377 |
<li><strong>(v.8)</strong> ADDED: Function to better get the WordPress home URL to prevent interference from other plugins.</li>
|
4378 |
-
<li><strong>(v.8)</strong> CHANGED: Updated Text For <a
|
4379 |
-
href="https://icwp.io/6e">Author Scan Block</a> feature.</li>
|
4380 |
<li><strong>(v.7)</strong> CHANGED: How author query blocking works to be more reliable and stricter - only runs when users are not logged in, and it will DIE instead of redirect.</li>
|
4381 |
<li><strong>(v.6)</strong> ADDED: New Option: prevent detection of usernames using the ?author=N query. (location under section: Lockdown -> Obscurity)</li>
|
4382 |
<li><strong>(v.6)</strong> FIXED: Infinite redirect loop logic prevents redirect for rejected comment SPAM that’s posted in bulk. This results in email notifications for spam comments.</li>
|
@@ -4388,12 +632,10 @@ will outright block any access they have to your WordPress site.</p>
|
|
4388 |
<li><strong>(v.3)</strong> ADDED: Further checking for availability of certain PHP/server data before enabling the rename WordPress login feature</li>
|
4389 |
<li><strong>(v.3)</strong> ADDED: Option to add the Plugin Badge as a Widget to your side-bar or page footer, or any other widget area.</li>
|
4390 |
<li><strong>(v.3)</strong> TRANSLATIONS: Polish - 100%</li>
|
4391 |
-
<li><strong>(v.2)</strong> ADDED: Email notifications sent out to report email address on a daily cron. <a
|
4392 |
-
href="https://www.icontrolwp.com/2015/07/plugin-vulnerability-email-notifications/">more info</a></li>
|
4393 |
<li><strong>(v.2)</strong> FIX: Work around a WordPress inline plugin update Javascript bug.</li>
|
4394 |
<li><strong>(v.1)</strong> FIX: Fix syntax support for earlier versions of PHP.</li>
|
4395 |
-
<li><strong>(v.0)</strong> FEATURE: Plugin Vulnerabilities Detection: If you’re running plugins with known vulnerabilities you will be warned - <a
|
4396 |
-
href="https://icwp.io/wpsf22">more info</a></li>
|
4397 |
</ul>
|
4398 |
<p>= 4.8 Series =<br>
|
4399 |
<em>Released: 21st June, 2015</em></p>
|
@@ -4434,8 +676,7 @@ will outright block any access they have to your WordPress site.</p>
|
|
4434 |
<p>= 4.6 Series =<br>
|
4435 |
<em>Released: 10th April, 2015</em></p>
|
4436 |
<ul>
|
4437 |
-
<li><strong>(v.3)</strong> SECURITY: Added protection against XSS vulnerability in WordPress comments. <a
|
4438 |
-
href="https://icwp.io/63">Learn More</a> - Note: This is not a vulnerability with the Firewall plugin.</li>
|
4439 |
<li><strong>(v.3)</strong> SECURITY: Added extra precautions to WordPress URL redirects. <a href="https://icwp.io/64">Learn More</a>.</li>
|
4440 |
<li><strong>(v.3)</strong> TRANSLATIONS: Russian (70%), Czech (67%)</li>
|
4441 |
<li><strong>(v.2)</strong> FIX: Bug with the database table verification logic.</li>
|
@@ -4444,8 +685,7 @@ will outright block any access they have to your WordPress site.</p>
|
|
4444 |
<li><strong>(v.1)</strong> UPDATED: Plugin Badge styling</li>
|
4445 |
<li><strong>(v.1)</strong> UPDATED: Updated Czech(41%) and Spanish (60%) translations</li>
|
4446 |
<li><strong>(v.0)</strong> ADDED: New feature that displays the last login time for all users on the users listing page (User Management feature must be enabled).</li>
|
4447 |
-
<li><strong>(v.0)</strong> ADDED: <strong>Completely optional</strong> promotional Plugin Badge option - help us promote the plugin and reassure your site visitors at the same time. <a
|
4448 |
-
href="https://icwp.io/5x">Learn More</a></li>
|
4449 |
<li><strong>(v.0)</strong> UPDATED: Updated Czech(38%) translations</li>
|
4450 |
</ul>
|
4451 |
<p>= 4.5 Series =<br>
|
@@ -4541,8 +781,7 @@ will outright block any access they have to your WordPress site.</p>
|
|
4541 |
<li>ADDED: A warning message on the WordPress admin if the “forceOff” override is active.</li>
|
4542 |
<li>CHANGED: The ‘forceOff’ system is now temporary - i.e. it doesn’t save the configuration, and so once this file is removed, the plugin returns to the settings specified.</li>
|
4543 |
<li>CHANGED: The ‘forceOn’ option is now removed.</li>
|
4544 |
-
<li>FIXED: Problems with certain hosting environments reading in files with the “.yaml” extension - <a
|
4545 |
-
href="https://wordpress.org/support/topic/yaml-breaks-plugin">support ref</a></li>
|
4546 |
<li>FIXED: Small issue where when the file system paths change, some variables don’t update properly.</li>
|
4547 |
</ul>
|
4548 |
<p>= 3.5.0 =</p>
|
@@ -4565,8 +804,7 @@ will outright block any access they have to your WordPress site.</p>
|
|
4565 |
</ul>
|
4566 |
<p>= 3.2.1 =</p>
|
4567 |
<ul>
|
4568 |
-
<li>FIXED: Custom Comment Filter message problem when using more than one substitution. <a
|
4569 |
-
href="https://wordpress.org/support/topic/warning-sprintf-too-few-arguments-in-hometnrastropublic_htmlwpwp-conten?replies=8#post-5927337">ref</a></li>
|
4570 |
</ul>
|
4571 |
<p>= 3.2.0 =</p>
|
4572 |
<ul>
|
@@ -4660,8 +898,7 @@ will outright block any access they have to your WordPress site.</p>
|
|
4660 |
<p>= 2.6.0 =</p>
|
4661 |
<p><strong>Major Features Release: Please review SPAM comments filtering options to determine where SPAM goes</strong></p>
|
4662 |
<ul>
|
4663 |
-
<li>FEATURE: Added Human SPAM comments filtering - replacement for Akismet that doesn’t use or send any data to 3rd party services. Uses <a
|
4664 |
-
href="https://github.com/splorp/wordpress-comment-blacklist">Blacklist provided and maintained by Grant Hutchinson</a></li>
|
4665 |
<li>ENHANCED: Two-Factor Login now automatically logs in the user to the admin area without them having to re-login again.</li>
|
4666 |
<li>ENHANCED: Added ability to terminate all currently (two-factor) verified logins.</li>
|
4667 |
<li>ENHANCED: Spam filter/scanning adds an explanation to the SPAM content to show why a message was filtered.</li>
|
@@ -4709,8 +946,7 @@ will outright block any access they have to your WordPress site.</p>
|
|
4709 |
</ul>
|
4710 |
<p>= 2.5.0 =</p>
|
4711 |
<ul>
|
4712 |
-
<li>FEATURE: Two-Factor Authenticated Login using <a
|
4713 |
-
href="https://icwp.io/4i">Yubikey</a> One Time Passwords (OTP).</li>
|
4714 |
</ul>
|
4715 |
<p>= 2.4.3 =</p>
|
4716 |
<ul>
|
@@ -4773,8 +1009,7 @@ entries and was forcing users to re-login every 24hrs.</li>
|
|
4773 |
<p>= 2.2.0 =</p>
|
4774 |
<ul>
|
4775 |
<li>CHANGED: Certain filesystem calls are more compatible with restrictive hosting environments.</li>
|
4776 |
-
<li>CHANGED: Plugin is now ready to integate with <a
|
4777 |
-
href="http://www.icontrolwp.com/2013/11/manage-wordpress-automatic-background-updates-icontrolwp/">iControlWP automatic background updates system</a>.</li>
|
4778 |
<li>FIX: Login Protection Cooldown feature may not operate properly in certain scenarios.</li>
|
4779 |
</ul>
|
4780 |
<p>= 2.1.5 =</p>
|
@@ -4885,7 +1120,7 @@ of WP Multisite support).</li>
|
|
4885 |
<p>= 1.5.2 =</p>
|
4886 |
<ul>
|
4887 |
<li>CHANGED: The method for finding the client IP address is more thorough, in a bid to work with Proxy servers etc.</li>
|
4888 |
-
<li>FIXED: PHP notice reported here: <a href="
|
4889 |
</ul>
|
4890 |
<p>= 1.5.1 =</p>
|
4891 |
<ul>
|
1 |
+
<!DOCTYPE html><html><head><meta charset="utf-8"><title>Untitled Document.md</title><style></style></head><body id="preview">
|
2 |
+
<p>= 6.9.0 - Series =<br>
|
3 |
+
<em>Released: 6th September, 2018</em> - <a href="https://icwp.io/dc">Release Notes</a></p>
|
4 |
+
<ul>
|
5 |
+
<li><strong>(v.0)</strong> NEW: [<strong>PRO</strong>] <a href="https://icwp.io/c1">Traffic Watcher</a> - live tracking of all requests to your site.</li>
|
6 |
+
<li><strong>(v.0)</strong> NEW: [<strong>PRO</strong>] <a href="https://icwp.io/c1">Yubikey</a> - Allows for multiple Yubikeys on the same user profile.</li>
|
7 |
+
<li><strong>(v.0)</strong> ADDED: [<strong>PRO</strong>] Option to include listing of affected files within Hack Guard notification emails.</li>
|
8 |
+
<li><strong>(v.0)</strong> ADDED: Option to delete the Security Admin Access Key</li>
|
9 |
+
<li><strong>(v.0)</strong> ADDED: Option to add WooCommerce roles to 2FA-Email setting.</li>
|
10 |
+
<li><strong>(v.0)</strong> CHANGED: Basic Stats system now requires minimum PHP v5.4.</li>
|
11 |
+
<li><strong>(v.0)</strong> CHANGED: Password Policies now requires minimum WordPress v4.4.</li>
|
12 |
+
<li><strong>(v.0)</strong> IMPROVED: Password expiration now redirects to the ‘set password’ screen, instead of the user profile.</li>
|
13 |
+
<li><strong>(v.0)</strong> IMPROVED: Password capture for purposes of password policies is improved.</li>
|
14 |
+
<li><strong>(v.0)</strong> IMPROVED: You can now delete the ‘forceoff’ file from inside the WP Admin.</li>
|
15 |
+
<li><strong>(v.0)</strong> IMPROVED: Audit Trail entries for emails will identify the file that’s calling the <code>wp_mail</code> function.</li>
|
16 |
+
<li><strong>(v.0)</strong> IMPROVED: Audit Trail entries for post editing will identify the post type wherever possible.</li>
|
17 |
+
<li><strong>(v.0)</strong> IMPROVED: Audit Trail entries will try to display all message text correctly.</li>
|
18 |
+
<li><strong>(v.0)</strong> IMPROVED: Login/Register/Password forms are only checked when visitor is not logged-in.</li>
|
19 |
+
<li><strong>(v.0)</strong> IMPROVED: Major database code refactoring and other code improvements.</li>
|
20 |
+
<li><strong>(v.0)</strong> IMPROVED: User sessions handling.</li>
|
21 |
+
<li><strong>(v.0)</strong> IMPROVED: Security Admin UX - ajax session checking, with admin notifications and auto-page reload.</li>
|
22 |
+
<li><strong>(v.0)</strong> IMPROVED: Security Admin password setting now requires a confirmation password entry.</li>
|
23 |
+
<li><strong>(v.0)</strong> IMPROVED: Refined Cooldown timing system.</li>
|
24 |
+
<li><strong>(v.0)</strong> IMPROVED: Refined Bot checkbox Javascript.</li>
|
25 |
+
<li><strong>(v.0)</strong> IMPROVED: Cron entry cleanup after deactivation.</li>
|
26 |
+
<li><strong>(v.0)</strong> UPDATED: Bootstrap libraries to latest release v4.1.3.</li>
|
27 |
+
<li><strong>(v.0)</strong> FIXED: Potential bug with Plugin/Themes guard scanning.</li>
|
28 |
+
<li><strong>(v.0)</strong> FIXED: PHP Warning(s).</li>
|
29 |
+
</ul>
|
30 |
+
<p>= 6.8 Series =<br>
|
31 |
+
<em>Released: 11th June, 2018</em> - <a href="https://icwp.io/d4">Release Notes</a></p>
|
32 |
+
<ul>
|
33 |
+
<li><strong>(v.2)</strong> FIXED: Bug with multi-factor authentication verification.</li>
|
34 |
+
<li><strong>(v.2)</strong> FIXED: Bug with chosen reCAPTCHA style not being honoured on login pages</li>
|
35 |
+
<li><strong>(v.2)</strong> FIXED: Bug with Invisible reCAPTCHA + WooCommerce</li>
|
36 |
+
<li><strong>(v.2)</strong> FIXED: Bug with Pwned passwords always being checked even if setting turned off.</li>
|
37 |
+
<li><strong>(v.1)</strong> FIXED: A couple of bugs with WooCommerce reCAPTCHA processing.</li>
|
38 |
+
<li><strong>(v.1)</strong> FIXED: A bug with user sessions cleaning</li>
|
39 |
+
<li><strong>(v.0)</strong> ADDED: [<strong>PRO</strong>] White Label - ability to re-brand the entire Shield Security plugin to your company brand.</li>
|
40 |
+
<li><strong>(v.0)</strong> ADDED: [<strong>PRO</strong>] Option for all users to receive notification email upon login to their accounts.</li>
|
41 |
+
<li><strong>(v.0)</strong> IMPROVED: Completely rebuilt the bot and reCAPTCHA login protection system.</li>
|
42 |
+
<li><strong>(v.0)</strong> IMPROVED: Import/Export system hugely improved with respect to automated push of options from Master sites.</li>
|
43 |
+
<li><strong>(v.0)</strong> IMPROVED: A different approach to sessions management that should handle sessions a bit better.</li>
|
44 |
+
<li><strong>(v.0)</strong> IMPROVED: Expired user sessions are cleaned from the DB using a cron, and on Insights Dashboard load.</li>
|
45 |
+
</ul>
|
46 |
+
<p>= 6.7 Series =<br>
|
47 |
+
<em>Released: 21st May, 2018</em> - <a href="https://icwp.io/cx">Release Notes</a></p>
|
48 |
+
<ul>
|
49 |
+
<li><strong>(v.2)</strong> ADDED: [<strong>PRO</strong>] Admin Notes feature - Notes can now be easily deleted (editing will not be possible).</li>
|
50 |
+
<li><strong>(v.2)</strong> UPDATED: Some translations.</li>
|
51 |
+
<li><strong>(v.2)</strong> FIXED: A few bugs with the Insights Dashboard.</li>
|
52 |
+
<li><strong>(v.2)</strong> FIXED: Removed the dependency on jQuery with Invisible reCAPTCHA.</li>
|
53 |
+
<li><strong>(v.1)</strong> FIXED: A few bugs with the Insights Dashboard</li>
|
54 |
+
<li><strong>(v.1)</strong> ADDED: [<strong>PRO</strong>] Admin Notes feature - you can now add notes to the Shield plugin in the Insights Dashboard.</li>
|
55 |
+
<li><strong>(v.0)</strong> ADDED: All-New Insights Dashboard providing a high-level overview of your site security, with recommendations.</li>
|
56 |
+
<li><strong>(v.0)</strong> ADDED: Helpful, explanatory videos directly into the Guided Welcome Wizard.</li>
|
57 |
+
<li><strong>(v.0)</strong> ADDED: A simple test cron to demonstrate whether your site crons are running.</li>
|
58 |
+
<li><strong>(v.0)</strong> ADDED: [<strong>PRO</strong>] Full support for new WordPress GDPR Privacy Policy controls for exporting and erasing data.</li>
|
59 |
+
<li><strong>(v.0)</strong> ADDED: [<strong>PRO</strong>] New GDPR guided wizard for exporting/erasing particular data based on custom search results.</li>
|
60 |
+
<li><strong>(v.0)</strong> CHANGED: Guided Wizards now load through WP admin to fix ajax problems for poorly configured SSL on some sites</li>
|
61 |
+
<li><strong>(v.0)</strong> IMPROVED: Upgraded Bootstrap library to 4.1.1.</li>
|
62 |
+
<li><strong>(v.0)</strong> IMPROVED: Compatibility with AIO Events Cal - they like to force their old Twig libraries on everyone else.</li>
|
63 |
+
</ul>
|
64 |
+
<p>= 6.6 Series =<br>
|
65 |
+
<em>Released: 19th March, 2018</em> - <a href="https://icwp.io/c3">Release Notes</a></p>
|
66 |
+
<ul>
|
67 |
+
<li><strong>(v.7)</strong> IMPROVED: reCAPTCHA JS is only included on pages where it’s actually used by Shield.</li>
|
68 |
+
<li><strong>(v.7)</strong> IMPROVED: Upgrade Bootstrap library to 4.1.0.</li>
|
69 |
+
<li><strong>(v.7)</strong> IMPROVED: Include jQuery for the plugin badge as required</li>
|
70 |
+
<li><strong>(v.6)</strong> ADDED: Small exclusion in the firewall for a jetpack parameter.</li>
|
71 |
+
<li><strong>(v.6)</strong> ADDED: SVGs to the default list of files scanned by the plugin guard.</li>
|
72 |
+
<li><strong>(v.6)</strong> ADDED: Workaround for a <a href="https://wordpress.org/support/topic/forcefully-executing-wp_footer-not-compatible-with-other-plugins/">ridiculous NGG bug</a>.</li>
|
73 |
+
<li><strong>(v.1-4)</strong> FIXED: Various small fixes and improvements</li>
|
74 |
+
<li><strong>(v.4)</strong> FIXED: PHP Fatal Error on wp object cache.</li>
|
75 |
+
<li><strong>(v.0)</strong> NEW: [<strong>PRO</strong>] <a href="https://icwp.io/c1">Keyless Activation of Pro licenses</a>.</li>
|
76 |
+
<li><strong>(v.0)</strong> ADDED: <a href="https://icwp.io/c2">WordPress Password Policies</a>.</li>
|
77 |
+
<li><strong>(v.0)</strong> ADDED: Pwned Passwords Detection.</li>
|
78 |
+
<li><strong>(v.0)</strong> IMPROVED: Major rewrite of plugin AJAX handling.</li>
|
79 |
+
<li><strong>(v.0)</strong> IMPROVED: Notices to indicate the time of the last scans.</li>
|
80 |
+
<li><strong>(v.0)</strong> FIXED: A few bugs</li>
|
81 |
+
</ul>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
82 |
<p>= 6.5 Series =<br>
|
83 |
<em>Released: 5th March, 2018</em> - <a href="https://icwp.io/bu">Release Notes</a></p>
|
84 |
<ul>
|
101 |
<em>Released: 12th February, 2018</em> - <a href="https://icwp.io/bc">Release Notes</a></p>
|
102 |
<ul>
|
103 |
<li><strong>(v.3)</strong> FIXED: Bug with automatic updates delay setting</li>
|
104 |
+
<li><strong>(v.2)</strong> CHANGED: Changed a text that seems to cause servers to swallow-up emails. <a href="https://icwp.io/bi">See here for more reliable email</a></li>
|
|
|
105 |
<li><strong>(v.1)</strong> FIXED: Options page javascript to work around conflicts.</li>
|
106 |
<li><strong>(v.0)</strong> ADDED: [<strong>PRO</strong>] <a href="https://icwp.io/bc">Automatic updates stability delay</a></li>
|
107 |
<li><strong>(v.0)</strong> IMPROVED: Complete <a href="https://icwp.io/bd">plugin UI rebuild</a>, using the new Bootstrap 4.</li>
|
216 |
<li><strong>(v.2)</strong> FIX: Restore display of help links for options.</li>
|
217 |
<li><strong>(v.1)</strong> FIX: PHP 5.2 incompatibility.</li>
|
218 |
<li><strong>(v.0)</strong> ADDED: New option for <a href="https://icwp.io/94">Unrecognised File Scanner</a> to scan the Uploads folder for JS and PHP files.</li>
|
219 |
+
<li><strong>(v.0)</strong> ADDED: Option to provide custom list of files to be excluded from the <a href="https://icwp.io/94">Unrecognised File Scanner</a>.</li>
|
|
|
220 |
</ul>
|
221 |
<p>= 5.12 Series =<br>
|
222 |
<em>Released: 3rd August, 2017</em></p>
|
350 |
<p><strong>(v.2)</strong> TRANSLATIONS: Dutch (56%)</p>
|
351 |
</li>
|
352 |
<li>
|
353 |
+
<p><strong>(v.1)</strong> ADDED: Built-in forceful protection in the form of a wp_die() against the (currently) un-patched W3 Total Cache XSS vulnerability <a href="https://icwp.io/7j">more info</a></p>
|
|
|
354 |
</li>
|
355 |
<li>
|
356 |
<p><strong>(v.1)</strong> IMPROVED: Better XMLRPC Lockdown - prevents ANY XMLRPC command processing.</p>
|
392 |
<p>= 5.4 Series =</p>
|
393 |
<ul>
|
394 |
<li><strong>(v.5)</strong> CHANGED: User Management module is no-longer enabled by default on clean installations</li>
|
395 |
+
<li><strong>(v.5)</strong> CHANGED: Made the GASP checkbox for Login protection clickable by label. <a href="https://github.com/FernleafSystems/Shield/pull/22">Thanks Aubrey!</a></li>
|
|
|
396 |
<li><strong>(v.5)</strong> CHANGED: Shield Statistics only shows for WordPress admins (instead of all users)</li>
|
397 |
<li><strong>(v.5)</strong> FIXED: Added a couple of guards to ensure data is of the correct format to prevent spurious errors</li>
|
398 |
<li><strong>(v.5)</strong> FIXED: Bug where automatic file repair links from emails we’re not working.</li>
|
447 |
<li><strong>(v.3)</strong> FIXED: Issue with setting session cookies with PHP 7</li>
|
448 |
<li><strong>(v.2)</strong> FIXED: <a href="https://icwp.io/5s">Rename WordPress Login URL</a> bug</li>
|
449 |
<li><strong>(v.2)</strong> CHANGED: reCAPTCHA text usage corrected throughout plugin.</li>
|
450 |
+
<li><strong>(v.1)</strong> CHANGED: Removed the whole ‘wp-content’ directory from the <a href="https://icwp.io/wpsf40">Core File Scanner</a> feature.</li>
|
|
|
451 |
<li><strong>(v.1)</strong> CHANGED: A WordPress filter to change the plugin badge text content (see FAQ)</li>
|
452 |
<li><strong>(v.1)</strong> CHANGED: Tweaked the plugin badge styling.</li>
|
453 |
<li><strong>(v.1)</strong> CHANGED: All emails sent by the plugin contain the name of the site and the current plugin version in the email footer.</li>
|
454 |
+
<li><strong>(v.1)</strong> ADDED: In-plugin links to blogs and info articles for Google ReCaptcha and <a href="https://icwp.io/wpsf43">Google Authenticator</a></li>
|
|
|
455 |
<li><strong>(v.0)</strong> NEW: WordPress Simple Firewall plugin has been re-branded and is called <strong>Shield</strong></li>
|
456 |
<li><strong>(v.0)</strong> ADDED: NEW feature - <a href="https://icwp.io/shld2">Google ReCaptcha</a> for Comment SPAM and Login protection.</li>
|
457 |
<li><strong>(v.0)</strong> ADDED: Support for this plugin is now Premium. Added Premium Support page that links to Helpdesk.</li>
|
467 |
<li><strong>(v.0)</strong> CHANGED: Email-based Two-Factor Authentication is now stateless/session-less - it will not check validity per-page load.</li>
|
468 |
<li><strong>(v.0)</strong> CHANGED: Changes to the email-based authentication system - now only 1 option and it no longer locks to IP or browser.</li>
|
469 |
<li><strong>(v.0)</strong> CHANGED: Various efficiency improvements including reduced SQL updates.</li>
|
470 |
+
<li><strong>(v.0)</strong> CHANGED: Email system is improved and now send emails from the default WordPress sender. This may be <a href="https://icontrolwp.freshdesk.com/support/solutions/articles/3000048723">changed with filter</a>.</li>
|
|
|
471 |
</ul>
|
472 |
<p>= 4.16 Series =<br>
|
473 |
<em>Released: 20th January, 2016</em></p>
|
477 |
<li><strong>(v.2)</strong> TRANSLATIONS: Turkish (100%)</li>
|
478 |
<li><strong>(v.1)</strong> CHANGED: Improved the contents of the <a href="https://icwp.io/wpsf40">Core File Scanner</a> notification email with links to original source files.</li>
|
479 |
<li><strong>(v.1)</strong> CHANGED: Now also excluding the /wp-content/languages/ directory since translations may update independently.</li>
|
480 |
+
<li><strong>(v.1)</strong> CHANGED: Handles the special case of <a href="https://wordpress.org/support/topic/problem-with-checksum-hashes">old index.php files</a></li>
|
|
|
481 |
<li><strong>(v.0)</strong> ADDED: Feature: <a href="https://icwp.io/wpsf40">Automatically scans WordPress Core files</a> and detects alterations from the default WordPress Core File data</li>
|
482 |
<li><strong>(v.0)</strong> ADDED: Feature: to automatically attempt to repair/replace WordPress Core files that are discovered which have been altered.</li>
|
483 |
<li><strong>(v.0)</strong> ADDED: Option to toggle the <a href="https://icwp.io/wpsf41">Plugin Vulnerabilities cron</a>.</li>
|
496 |
<em>Released: 20th November, 2015</em></p>
|
497 |
<ul>
|
498 |
<li><strong>(v.2)</strong> ADDED: User notice message displayed when the ‘Theme My Login’ plugin is active and you try to rename your login URL - It is not compatible.</li>
|
499 |
+
<li><strong>(v.1)</strong> ADDED: Added WordPress filter option to specify URL instead of present a 404 when Rename WP Login is active. <a href="https://icontrolwp.freshdesk.com/solution/articles/3000044812">more info</a></li>
|
|
|
500 |
<li><strong>(v.1)</strong> ADDED: Added ‘Unique Plugin Installation ID’ to be utilized in the future.</li>
|
501 |
<li><strong>(v.1)</strong> FIXED: WordPress Comments bug where some comments didn’t pass through the SPAM filters in a certain scenario.</li>
|
502 |
+
<li><strong>(v.0)</strong> ADDED: <a href="https://icwp.io/wpsf33">Custom Automatic Update Notifications Email</a> that runs separately to the in-built WordPress core notification email.</li>
|
|
|
503 |
<li><strong>(v.0)</strong> ADDED: Filter to remove the admin area IP address footer text</li>
|
504 |
<li><strong>(v.0)</strong> CHANGED: Added native support for PayPal return links - whitelisting “verify_sign” parameter.</li>
|
505 |
<li><strong>(v.0)</strong> CHANGED: Tweak patterns for matching on ‘WordPress terms’.</li>
|
522 |
<p>= 4.12 Series =<br>
|
523 |
<em>Released: 10th October, 2015</em></p>
|
524 |
<ul>
|
525 |
+
<li><strong>(v.0)</strong> NEW: Option to completely disable the XML-RPC system. <a href="https://icwp.io/wpsf31">more info</a></li>
|
|
|
526 |
<li><strong>(v.0)</strong> CHANGED: Logged-in users are automatically forwarded to the WordPress admin only if they are Administrators.</li>
|
527 |
</ul>
|
528 |
<p>= 4.11 Series =<br>
|
529 |
<em>Released: 5th October, 2015</em></p>
|
530 |
<ul>
|
531 |
+
<li><strong>(v.0)</strong> NEW: Ability to now completely block the update/changing of certain WordPress site options. <a href="https://icwp.io/wpsf30">more info</a></li>
|
|
|
532 |
<li><strong>(v.0)</strong> FIXED: Various small bugs with the IP Manager UI ajax.</li>
|
533 |
<li><strong>(v.0)</strong> FIXED: Uncaught PHP Exception when a site’s hosting isn’t properly configured to handle IPv6 addresses.</li>
|
534 |
<li><strong>(v.0)</strong> TRANSLATIONS: Danish - 57%, Czech - 100%, Finnish - 94%</li>
|
585 |
<p><strong>(v.1)</strong> CHANGED: Default transgressions limit is now 7</p>
|
586 |
</li>
|
587 |
<li>
|
588 |
+
<p><strong>(v.1)</strong> ADDED: Ability to reset plugin options to default using ‘reset’ flag file. <a href="https://icwp.io/wpsf28">more info</a></p>
|
|
|
589 |
</li>
|
590 |
<li>
|
591 |
+
<p><strong>(v.0)</strong> NEW FEATURE: ‘FABLE’ - <a href="https://icwp.io/wpsf27">Fully Automatic Black Listing Engine</a>.</p>
|
|
|
592 |
</li>
|
593 |
</ul>
|
594 |
<p>Simply put, FABLE will automatically block all malicious traffic by IP, based on their activity. This Security Plugin will track malicious behaviour<br>
|
620 |
<li><strong>(v.8)</strong> CHANGED: Firewall, User Sessions and Lockdown Feature Modules are now enabled by default for new installations.</li>
|
621 |
<li><strong>(v.8)</strong> FIX: Some server email programs can’t handle colons (:) in the email subject (because supporting all characters would be waaay too radical man).</li>
|
622 |
<li><strong>(v.8)</strong> ADDED: Function to better get the WordPress home URL to prevent interference from other plugins.</li>
|
623 |
+
<li><strong>(v.8)</strong> CHANGED: Updated Text For <a href="https://icwp.io/6e">Author Scan Block</a> feature.</li>
|
|
|
624 |
<li><strong>(v.7)</strong> CHANGED: How author query blocking works to be more reliable and stricter - only runs when users are not logged in, and it will DIE instead of redirect.</li>
|
625 |
<li><strong>(v.6)</strong> ADDED: New Option: prevent detection of usernames using the ?author=N query. (location under section: Lockdown -> Obscurity)</li>
|
626 |
<li><strong>(v.6)</strong> FIXED: Infinite redirect loop logic prevents redirect for rejected comment SPAM that’s posted in bulk. This results in email notifications for spam comments.</li>
|
632 |
<li><strong>(v.3)</strong> ADDED: Further checking for availability of certain PHP/server data before enabling the rename WordPress login feature</li>
|
633 |
<li><strong>(v.3)</strong> ADDED: Option to add the Plugin Badge as a Widget to your side-bar or page footer, or any other widget area.</li>
|
634 |
<li><strong>(v.3)</strong> TRANSLATIONS: Polish - 100%</li>
|
635 |
+
<li><strong>(v.2)</strong> ADDED: Email notifications sent out to report email address on a daily cron. <a href="https://www.icontrolwp.com/2015/07/plugin-vulnerability-email-notifications/">more info</a></li>
|
|
|
636 |
<li><strong>(v.2)</strong> FIX: Work around a WordPress inline plugin update Javascript bug.</li>
|
637 |
<li><strong>(v.1)</strong> FIX: Fix syntax support for earlier versions of PHP.</li>
|
638 |
+
<li><strong>(v.0)</strong> FEATURE: Plugin Vulnerabilities Detection: If you’re running plugins with known vulnerabilities you will be warned - <a href="https://icwp.io/wpsf22">more info</a></li>
|
|
|
639 |
</ul>
|
640 |
<p>= 4.8 Series =<br>
|
641 |
<em>Released: 21st June, 2015</em></p>
|
676 |
<p>= 4.6 Series =<br>
|
677 |
<em>Released: 10th April, 2015</em></p>
|
678 |
<ul>
|
679 |
+
<li><strong>(v.3)</strong> SECURITY: Added protection against XSS vulnerability in WordPress comments. <a href="https://icwp.io/63">Learn More</a> - Note: This is not a vulnerability with the Firewall plugin.</li>
|
|
|
680 |
<li><strong>(v.3)</strong> SECURITY: Added extra precautions to WordPress URL redirects. <a href="https://icwp.io/64">Learn More</a>.</li>
|
681 |
<li><strong>(v.3)</strong> TRANSLATIONS: Russian (70%), Czech (67%)</li>
|
682 |
<li><strong>(v.2)</strong> FIX: Bug with the database table verification logic.</li>
|
685 |
<li><strong>(v.1)</strong> UPDATED: Plugin Badge styling</li>
|
686 |
<li><strong>(v.1)</strong> UPDATED: Updated Czech(41%) and Spanish (60%) translations</li>
|
687 |
<li><strong>(v.0)</strong> ADDED: New feature that displays the last login time for all users on the users listing page (User Management feature must be enabled).</li>
|
688 |
+
<li><strong>(v.0)</strong> ADDED: <strong>Completely optional</strong> promotional Plugin Badge option - help us promote the plugin and reassure your site visitors at the same time. <a href="https://icwp.io/5x">Learn More</a></li>
|
|
|
689 |
<li><strong>(v.0)</strong> UPDATED: Updated Czech(38%) translations</li>
|
690 |
</ul>
|
691 |
<p>= 4.5 Series =<br>
|
781 |
<li>ADDED: A warning message on the WordPress admin if the “forceOff” override is active.</li>
|
782 |
<li>CHANGED: The ‘forceOff’ system is now temporary - i.e. it doesn’t save the configuration, and so once this file is removed, the plugin returns to the settings specified.</li>
|
783 |
<li>CHANGED: The ‘forceOn’ option is now removed.</li>
|
784 |
+
<li>FIXED: Problems with certain hosting environments reading in files with the “.yaml” extension - <a href="https://wordpress.org/support/topic/yaml-breaks-plugin">support ref</a></li>
|
|
|
785 |
<li>FIXED: Small issue where when the file system paths change, some variables don’t update properly.</li>
|
786 |
</ul>
|
787 |
<p>= 3.5.0 =</p>
|
804 |
</ul>
|
805 |
<p>= 3.2.1 =</p>
|
806 |
<ul>
|
807 |
+
<li>FIXED: Custom Comment Filter message problem when using more than one substitution. <a href="http://wordpress.org/support/topic/warning-sprintf-too-few-arguments-in-hometnrastropublic_htmlwpwp-conten?replies=8#post-5927337">ref</a></li>
|
|
|
808 |
</ul>
|
809 |
<p>= 3.2.0 =</p>
|
810 |
<ul>
|
898 |
<p>= 2.6.0 =</p>
|
899 |
<p><strong>Major Features Release: Please review SPAM comments filtering options to determine where SPAM goes</strong></p>
|
900 |
<ul>
|
901 |
+
<li>FEATURE: Added Human SPAM comments filtering - replacement for Akismet that doesn’t use or send any data to 3rd party services. Uses <a href="https://github.com/splorp/wordpress-comment-blacklist">Blacklist provided and maintained by Grant Hutchinson</a></li>
|
|
|
902 |
<li>ENHANCED: Two-Factor Login now automatically logs in the user to the admin area without them having to re-login again.</li>
|
903 |
<li>ENHANCED: Added ability to terminate all currently (two-factor) verified logins.</li>
|
904 |
<li>ENHANCED: Spam filter/scanning adds an explanation to the SPAM content to show why a message was filtered.</li>
|
946 |
</ul>
|
947 |
<p>= 2.5.0 =</p>
|
948 |
<ul>
|
949 |
+
<li>FEATURE: Two-Factor Authenticated Login using <a href="https://icwp.io/4i">Yubikey</a> One Time Passwords (OTP).</li>
|
|
|
950 |
</ul>
|
951 |
<p>= 2.4.3 =</p>
|
952 |
<ul>
|
1009 |
<p>= 2.2.0 =</p>
|
1010 |
<ul>
|
1011 |
<li>CHANGED: Certain filesystem calls are more compatible with restrictive hosting environments.</li>
|
1012 |
+
<li>CHANGED: Plugin is now ready to integate with <a href="http://www.icontrolwp.com/2013/11/manage-wordpress-automatic-background-updates-icontrolwp/">iControlWP automatic background updates system</a>.</li>
|
|
|
1013 |
<li>FIX: Login Protection Cooldown feature may not operate properly in certain scenarios.</li>
|
1014 |
</ul>
|
1015 |
<p>= 2.1.5 =</p>
|
1120 |
<p>= 1.5.2 =</p>
|
1121 |
<ul>
|
1122 |
<li>CHANGED: The method for finding the client IP address is more thorough, in a bid to work with Proxy servers etc.</li>
|
1123 |
+
<li>FIXED: PHP notice reported here: <a href="http://wordpress.org/support/topic/getting-errors-when-logged-in">http://wordpress.org/support/topic/getting-errors-when-logged-in</a></li>
|
1124 |
</ul>
|
1125 |
<p>= 1.5.1 =</p>
|
1126 |
<ul>
|
@@ -1,6 +1,6 @@
|
|
1 |
<?php
|
2 |
/**
|
3 |
-
* Copyright (c) 2018
|
4 |
* All rights reserved.
|
5 |
* "Shield" (formerly WordPress Simple Firewall) is distributed under the GNU
|
6 |
* General Public License, Version 2, June 1991. Copyright (C) 1989, 1991 Free
|
@@ -44,9 +44,9 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
44 |
protected $bRebuildOptions;
|
45 |
|
46 |
/**
|
47 |
-
* @var
|
48 |
*/
|
49 |
-
protected $
|
50 |
|
51 |
/**
|
52 |
* @var boolean
|
@@ -264,6 +264,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
264 |
do_action( $this->prefix( 'delete_plugin' ) );
|
265 |
$this->deletePluginControllerOptions();
|
266 |
}
|
|
|
267 |
}
|
268 |
|
269 |
public function onWpActivatePlugin() {
|
@@ -307,8 +308,8 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
307 |
|
308 |
// outsource the collection of admin notices
|
309 |
if ( is_admin() ) {
|
310 |
-
$oNofics = $this->
|
311 |
-
$oNofics->
|
312 |
add_filter( $this->prefix( 'ajaxAuthAction' ), array( $oNofics, 'handleAuthAjax' ) );
|
313 |
}
|
314 |
}
|
@@ -326,7 +327,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
326 |
/**
|
327 |
*/
|
328 |
public function onWpLoaded() {
|
329 |
-
if ( $this->
|
330 |
$this->doPluginFormSubmit();
|
331 |
$this->downloadOptionsExport();
|
332 |
}
|
@@ -342,7 +343,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
342 |
/**
|
343 |
*/
|
344 |
public function onWpAdminMenu() {
|
345 |
-
if ( $this->
|
346 |
$this->createPluginMenu();
|
347 |
}
|
348 |
}
|
@@ -350,7 +351,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
350 |
/**
|
351 |
*/
|
352 |
public function onWpDashboardSetup() {
|
353 |
-
if ( $this->
|
354 |
wp_add_dashboard_widget(
|
355 |
$this->prefix( 'dashboard_widget' ),
|
356 |
apply_filters( $this->prefix( 'dashboard_widget_title' ), $this->getHumanName() ),
|
@@ -413,18 +414,26 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
413 |
check_ajax_referer( $sNonceAction, 'exec_nonce' );
|
414 |
|
415 |
$sAction = $this->loadWpUsers()->isUserLoggedIn() ? 'ajaxAuthAction' : 'ajaxNonAuthAction';
|
416 |
-
|
417 |
-
$
|
|
|
|
|
418 |
|
419 |
-
if (
|
420 |
-
$bSuccess = $
|
421 |
-
wp_send_json(
|
422 |
-
array(
|
423 |
-
'success' => $bSuccess,
|
424 |
-
'data' => $aResponse
|
425 |
-
)
|
426 |
-
);
|
427 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
428 |
}
|
429 |
|
430 |
/**
|
@@ -555,38 +564,47 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
555 |
*/
|
556 |
public function onWpPluginActionLinks( $aActionLinks ) {
|
557 |
|
558 |
-
if ( $this->
|
559 |
|
560 |
$aLinksToAdd = $this->getPluginSpec_ActionLinks( 'add' );
|
561 |
-
if (
|
562 |
|
563 |
-
$
|
|
|
|
|
564 |
foreach ( $aLinksToAdd as $aLink ) {
|
565 |
-
|
566 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
567 |
}
|
568 |
|
569 |
-
if (
|
570 |
-
|
571 |
-
|
572 |
-
$sSettingsLink = sprintf( $sLinkTemplate, $this->{$sMethod}(), "_top", $aLink[ 'name' ] );;
|
573 |
-
$aActionLinks = array_merge(
|
574 |
-
array(
|
575 |
-
$this->prefix( 'dashboard' ) => $sSettingsLink
|
576 |
-
),
|
577 |
-
$aActionLinks
|
578 |
-
);
|
579 |
-
}
|
580 |
}
|
581 |
-
|
582 |
-
|
583 |
-
|
584 |
-
|
585 |
-
$this->prefix( 'dashboard' ) => $sSettingsLink
|
586 |
-
),
|
587 |
-
$aActionLinks
|
588 |
-
);
|
589 |
}
|
|
|
|
|
|
|
|
|
|
|
590 |
}
|
591 |
}
|
592 |
}
|
@@ -607,18 +625,19 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
607 |
}
|
608 |
|
609 |
public function onWpEnqueueAdminJs() {
|
|
|
610 |
|
611 |
-
if ( $this->
|
612 |
$aAdminJs = $this->getPluginSpec_Include( 'admin' );
|
613 |
if ( isset( $aAdminJs[ 'js' ] ) && !empty( $aAdminJs[ 'js' ] ) && is_array( $aAdminJs[ 'js' ] ) ) {
|
614 |
-
$
|
615 |
foreach ( $aAdminJs[ 'css' ] as $sAsset ) {
|
616 |
$sUrl = $this->getPluginUrl_Js( $sAsset.'.js' );
|
617 |
if ( !empty( $sUrl ) ) {
|
618 |
$sUnique = $this->prefix( $sAsset );
|
619 |
-
wp_register_script( $sUnique, $sUrl, $
|
620 |
wp_enqueue_script( $sUnique );
|
621 |
-
$
|
622 |
}
|
623 |
}
|
624 |
}
|
@@ -627,14 +646,24 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
627 |
if ( $this->getIsPage_PluginAdmin() ) {
|
628 |
$aAdminJs = $this->getPluginSpec_Include( 'plugin_admin' );
|
629 |
if ( isset( $aAdminJs[ 'js' ] ) && !empty( $aAdminJs[ 'js' ] ) && is_array( $aAdminJs[ 'js' ] ) ) {
|
630 |
-
$
|
631 |
-
foreach ( $aAdminJs[ 'js' ] as $
|
632 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
633 |
if ( !empty( $sUrl ) ) {
|
634 |
-
$sUnique = $this->prefix( $
|
635 |
-
wp_register_script( $sUnique, $sUrl, $
|
636 |
wp_enqueue_script( $sUnique );
|
637 |
-
$
|
638 |
}
|
639 |
}
|
640 |
}
|
@@ -643,7 +672,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
643 |
|
644 |
public function onWpEnqueueAdminCss() {
|
645 |
|
646 |
-
if ( $this->
|
647 |
$aAdminCss = $this->getPluginSpec_Include( 'admin' );
|
648 |
if ( isset( $aAdminCss[ 'css' ] ) && !empty( $aAdminCss[ 'css' ] ) && is_array( $aAdminCss[ 'css' ] ) ) {
|
649 |
$sDependent = false;
|
@@ -748,7 +777,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
748 |
|
749 |
$oConOptions = $this->getPluginControllerOptions();
|
750 |
|
751 |
-
if ( !$oWp->
|
752 |
$sAutoupdateSpec = 'yes'; // so that we appear to be automatically updating
|
753 |
}
|
754 |
|
@@ -909,7 +938,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
909 |
* @return bool
|
910 |
*/
|
911 |
protected function doPluginFormSubmit() {
|
912 |
-
if ( !$this->
|
913 |
return false;
|
914 |
}
|
915 |
|
@@ -951,8 +980,8 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
951 |
* @return mixed|null
|
952 |
*/
|
953 |
protected function getPluginSpec_ActionLinks( $sKey ) {
|
954 |
-
$
|
955 |
-
return isset( $
|
956 |
}
|
957 |
|
958 |
/**
|
@@ -1034,7 +1063,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1034 |
* @param bool $bCheckUserPerms - do we check the logged-in user permissions
|
1035 |
* @return bool
|
1036 |
*/
|
1037 |
-
public function
|
1038 |
if ( $bCheckUserPerms && $this->loadWpTrack()->getWpActionHasFired( 'init' )
|
1039 |
&& !$this->getMeetsBasePermissions() ) {
|
1040 |
return false;
|
@@ -1078,7 +1107,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1078 |
/**
|
1079 |
* @return string
|
1080 |
*/
|
1081 |
-
public function
|
1082 |
return $this->getPluginSpec_Property( 'logging_enabled' );
|
1083 |
}
|
1084 |
|
@@ -1099,7 +1128,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1099 |
/**
|
1100 |
* @return bool
|
1101 |
*/
|
1102 |
-
protected function
|
1103 |
if ( $this->loadWp()->isAjax() || ( empty( $_POST ) && empty( $_GET ) ) ) {
|
1104 |
return false;
|
1105 |
}
|
@@ -1436,6 +1465,24 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1436 |
$this->saveCurrentPluginControllerOptions();
|
1437 |
}
|
1438 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1439 |
/**
|
1440 |
* @return bool
|
1441 |
*/
|
@@ -1443,6 +1490,20 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1443 |
return (bool)$this->getPluginSpec_Property( 'enable_premium' );
|
1444 |
}
|
1445 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1446 |
/**
|
1447 |
* @return bool
|
1448 |
*/
|
@@ -1489,7 +1550,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1489 |
/**
|
1490 |
*/
|
1491 |
public function deactivateSelf() {
|
1492 |
-
if ( $this->
|
1493 |
deactivate_plugins( $this->getPluginBaseFile() );
|
1494 |
}
|
1495 |
}
|
@@ -1501,14 +1562,35 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1501 |
self::$sSessionId = null;
|
1502 |
}
|
1503 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1504 |
/**
|
1505 |
* Returns true if you're overriding OFF. We don't do override ON any more (as of 3.5.1)
|
1506 |
*/
|
1507 |
public function getIfForceOffActive() {
|
1508 |
-
|
1509 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1510 |
}
|
1511 |
-
return $this->
|
1512 |
}
|
1513 |
|
1514 |
/**
|
@@ -1527,18 +1609,26 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1527 |
}
|
1528 |
|
1529 |
/**
|
1530 |
-
* @param bool $
|
1531 |
* @return string
|
1532 |
*/
|
1533 |
-
public function getUniqueRequestId( $
|
1534 |
if ( !isset( self::$sRequestId ) ) {
|
1535 |
$oDp = $this->loadDP();
|
1536 |
-
self::$sRequestId = md5(
|
1537 |
-
|
|
|
1538 |
}
|
1539 |
return self::$sRequestId;
|
1540 |
}
|
1541 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1542 |
/**
|
1543 |
* @return string
|
1544 |
*/
|
@@ -1595,7 +1685,7 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1595 |
$bSuccess = true;
|
1596 |
}
|
1597 |
catch ( Exception $oE ) {
|
1598 |
-
if ( $this->
|
1599 |
$this->sAdminNoticeError = $oE->getMessage();
|
1600 |
add_action( 'admin_notices', array( $this, 'adminNoticePluginFailedToLoad' ) );
|
1601 |
add_action( 'network_admin_notices', array( $this, 'adminNoticePluginFailedToLoad' ) );
|
@@ -1646,7 +1736,8 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1646 |
return $oHandler;
|
1647 |
}
|
1648 |
|
1649 |
-
if ( !empty( $aModProps[ 'min_php' ] ) && !$this->loadDP()
|
|
|
1650 |
return null;
|
1651 |
}
|
1652 |
|
@@ -1683,6 +1774,21 @@ class ICWP_WPSF_Plugin_Controller extends ICWP_WPSF_Foundation {
|
|
1683 |
return $this->{$sOptionsVarName};
|
1684 |
}
|
1685 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1686 |
/**
|
1687 |
* @param array[] $aRegistered
|
1688 |
* @return array[]
|
1 |
<?php
|
2 |
/**
|
3 |
+
* Copyright (c) 2018 One Dollar Plugin <support@onedollarplugin.com>
|
4 |
* All rights reserved.
|
5 |
* "Shield" (formerly WordPress Simple Firewall) is distributed under the GNU
|
6 |
* General Public License, Version 2, June 1991. Copyright (C) 1989, 1991 Free
|
44 |
protected $bRebuildOptions;
|
45 |
|
46 |
/**
|
47 |
+
* @var string
|
48 |
*/
|
49 |
+
protected $sForceOffFile;
|
50 |
|
51 |
/**
|
52 |
* @var boolean
|
264 |
do_action( $this->prefix( 'delete_plugin' ) );
|
265 |
$this->deletePluginControllerOptions();
|
266 |
}
|
267 |
+
$this->deleteCronJobs();
|
268 |
}
|
269 |
|
270 |
public function onWpActivatePlugin() {
|
308 |
|
309 |
// outsource the collection of admin notices
|
310 |
if ( is_admin() ) {
|
311 |
+
$oNofics = $this->loadWpNotices();
|
312 |
+
$oNofics->setPrefix( $this->prefix() );
|
313 |
add_filter( $this->prefix( 'ajaxAuthAction' ), array( $oNofics, 'handleAuthAjax' ) );
|
314 |
}
|
315 |
}
|
327 |
/**
|
328 |
*/
|
329 |
public function onWpLoaded() {
|
330 |
+
if ( $this->isValidAdminArea() ) {
|
331 |
$this->doPluginFormSubmit();
|
332 |
$this->downloadOptionsExport();
|
333 |
}
|
343 |
/**
|
344 |
*/
|
345 |
public function onWpAdminMenu() {
|
346 |
+
if ( $this->isValidAdminArea() ) {
|
347 |
$this->createPluginMenu();
|
348 |
}
|
349 |
}
|
351 |
/**
|
352 |
*/
|
353 |
public function onWpDashboardSetup() {
|
354 |
+
if ( $this->isValidAdminArea() ) {
|
355 |
wp_add_dashboard_widget(
|
356 |
$this->prefix( 'dashboard_widget' ),
|
357 |
apply_filters( $this->prefix( 'dashboard_widget_title' ), $this->getHumanName() ),
|
414 |
check_ajax_referer( $sNonceAction, 'exec_nonce' );
|
415 |
|
416 |
$sAction = $this->loadWpUsers()->isUserLoggedIn() ? 'ajaxAuthAction' : 'ajaxNonAuthAction';
|
417 |
+
ob_start();
|
418 |
+
$aResponseData = apply_filters( $this->prefix( $sAction ), array() );
|
419 |
+
$aResponseData = apply_filters( $this->prefix( 'ajaxAction' ), $aResponseData );
|
420 |
+
$sNoise = ob_get_clean();
|
421 |
|
422 |
+
if ( is_array( $aResponseData ) && isset( $aResponseData[ 'success' ] ) ) {
|
423 |
+
$bSuccess = $aResponseData[ 'success' ];
|
|
|
|
|
|
|
|
|
|
|
|
|
424 |
}
|
425 |
+
else {
|
426 |
+
$bSuccess = false;
|
427 |
+
$aResponseData = array();
|
428 |
+
}
|
429 |
+
|
430 |
+
wp_send_json(
|
431 |
+
array(
|
432 |
+
'success' => $bSuccess,
|
433 |
+
'data' => $aResponseData,
|
434 |
+
'noise' => $sNoise
|
435 |
+
)
|
436 |
+
);
|
437 |
}
|
438 |
|
439 |
/**
|
564 |
*/
|
565 |
public function onWpPluginActionLinks( $aActionLinks ) {
|
566 |
|
567 |
+
if ( $this->isValidAdminArea() ) {
|
568 |
|
569 |
$aLinksToAdd = $this->getPluginSpec_ActionLinks( 'add' );
|
570 |
+
if ( is_array( $aLinksToAdd ) ) {
|
571 |
|
572 |
+
$bPro = $this->isPremiumActive();
|
573 |
+
$oDP = $this->loadDP();
|
574 |
+
$sLinkTemplate = '<a href="%s" target="%s" title="%s">%s</a>';
|
575 |
foreach ( $aLinksToAdd as $aLink ) {
|
576 |
+
$aLink = array_merge(
|
577 |
+
array(
|
578 |
+
'highlight' => false,
|
579 |
+
'show' => 'always',
|
580 |
+
'name' => '',
|
581 |
+
'title' => '',
|
582 |
+
'href' => '',
|
583 |
+
'target' => '_top',
|
584 |
+
),
|
585 |
+
$aLink
|
586 |
+
);
|
587 |
+
|
588 |
+
$sShow = $aLink[ 'show' ];
|
589 |
+
$bShow = ( $sShow == 'always' ) || ( $bPro && $sShow == 'pro' ) || ( !$bPro && $sShow == 'free' );
|
590 |
+
if ( !$oDP->validUrl( $aLink[ 'href' ] ) && method_exists( $this, $aLink[ 'href' ] ) ) {
|
591 |
+
$aLink[ 'href' ] = $this->{$aLink[ 'href' ]}();
|
592 |
}
|
593 |
|
594 |
+
if ( !$bShow || !$oDP->validUrl( $aLink[ 'href' ] )
|
595 |
+
|| empty( $aLink[ 'name' ] ) || empty( $aLink[ 'href' ] ) ) {
|
596 |
+
continue;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
597 |
}
|
598 |
+
|
599 |
+
$sLink = sprintf( $sLinkTemplate, $aLink[ 'href' ], $aLink[ 'target' ], $aLink[ 'title' ], $aLink[ 'name' ] );
|
600 |
+
if ( $aLink[ 'highlight' ] ) {
|
601 |
+
$sLink = sprintf( '<span style="font-weight: bold;">%s</span>', $sLink );
|
|
|
|
|
|
|
|
|
602 |
}
|
603 |
+
|
604 |
+
$aActionLinks = array_merge(
|
605 |
+
array( $this->prefix( sanitize_key( $aLink[ 'name' ] ) ) => $sLink ),
|
606 |
+
$aActionLinks
|
607 |
+
);
|
608 |
}
|
609 |
}
|
610 |
}
|
625 |
}
|
626 |
|
627 |
public function onWpEnqueueAdminJs() {
|
628 |
+
$sVers = $this->getVersion();
|
629 |
|
630 |
+
if ( $this->isValidAdminArea() ) {
|
631 |
$aAdminJs = $this->getPluginSpec_Include( 'admin' );
|
632 |
if ( isset( $aAdminJs[ 'js' ] ) && !empty( $aAdminJs[ 'js' ] ) && is_array( $aAdminJs[ 'js' ] ) ) {
|
633 |
+
$sDep = false;
|
634 |
foreach ( $aAdminJs[ 'css' ] as $sAsset ) {
|
635 |
$sUrl = $this->getPluginUrl_Js( $sAsset.'.js' );
|
636 |
if ( !empty( $sUrl ) ) {
|
637 |
$sUnique = $this->prefix( $sAsset );
|
638 |
+
wp_register_script( $sUnique, $sUrl, $sDep ? array( $sDep ) : array(), $sVers );
|
639 |
wp_enqueue_script( $sUnique );
|
640 |
+
$sDep = $sUnique;
|
641 |
}
|
642 |
}
|
643 |
}
|
646 |
if ( $this->getIsPage_PluginAdmin() ) {
|
647 |
$aAdminJs = $this->getPluginSpec_Include( 'plugin_admin' );
|
648 |
if ( isset( $aAdminJs[ 'js' ] ) && !empty( $aAdminJs[ 'js' ] ) && is_array( $aAdminJs[ 'js' ] ) ) {
|
649 |
+
$sDep = false;
|
650 |
+
foreach ( $aAdminJs[ 'js' ] as $sAsset ) {
|
651 |
+
|
652 |
+
// Built-in handles
|
653 |
+
if ( in_array( $sAsset, array( 'jquery' ) ) ) {
|
654 |
+
if ( wp_script_is( $sAsset, 'registered' ) ) {
|
655 |
+
wp_enqueue_script( $sAsset );
|
656 |
+
$sDep = $sAsset;
|
657 |
+
}
|
658 |
+
continue;
|
659 |
+
}
|
660 |
+
|
661 |
+
$sUrl = $this->getPluginUrl_Js( $sAsset.'.js' );
|
662 |
if ( !empty( $sUrl ) ) {
|
663 |
+
$sUnique = $this->prefix( $sAsset );
|
664 |
+
wp_register_script( $sUnique, $sUrl, $sDep ? array( $sDep ) : array(), $sVers );
|
665 |
wp_enqueue_script( $sUnique );
|
666 |
+
$sDep = $sUnique;
|
667 |
}
|
668 |
}
|
669 |
}
|
672 |
|
673 |
public function onWpEnqueueAdminCss() {
|
674 |
|
675 |
+
if ( $this->isValidAdminArea() ) {
|
676 |
$aAdminCss = $this->getPluginSpec_Include( 'admin' );
|
677 |
if ( isset( $aAdminCss[ 'css' ] ) && !empty( $aAdminCss[ 'css' ] ) && is_array( $aAdminCss[ 'css' ] ) ) {
|
678 |
$sDependent = false;
|
777 |
|
778 |
$oConOptions = $this->getPluginControllerOptions();
|
779 |
|
780 |
+
if ( !$oWp->isRunningAutomaticUpdates() && $sAutoupdateSpec == 'confidence' ) {
|
781 |
$sAutoupdateSpec = 'yes'; // so that we appear to be automatically updating
|
782 |
}
|
783 |
|
938 |
* @return bool
|
939 |
*/
|
940 |
protected function doPluginFormSubmit() {
|
941 |
+
if ( !$this->isPluginFormSubmit() ) {
|
942 |
return false;
|
943 |
}
|
944 |
|
980 |
* @return mixed|null
|
981 |
*/
|
982 |
protected function getPluginSpec_ActionLinks( $sKey ) {
|
983 |
+
$oOpts = $this->getPluginControllerOptions();
|
984 |
+
return isset( $oOpts->plugin_spec[ 'action_links' ][ $sKey ] ) ? $oOpts->plugin_spec[ 'action_links' ][ $sKey ] : array();
|
985 |
}
|
986 |
|
987 |
/**
|
1063 |
* @param bool $bCheckUserPerms - do we check the logged-in user permissions
|
1064 |
* @return bool
|
1065 |
*/
|
1066 |
+
public function isValidAdminArea( $bCheckUserPerms = true ) {
|
1067 |
if ( $bCheckUserPerms && $this->loadWpTrack()->getWpActionHasFired( 'init' )
|
1068 |
&& !$this->getMeetsBasePermissions() ) {
|
1069 |
return false;
|
1107 |
/**
|
1108 |
* @return string
|
1109 |
*/
|
1110 |
+
public function isLoggingEnabled() {
|
1111 |
return $this->getPluginSpec_Property( 'logging_enabled' );
|
1112 |
}
|
1113 |
|
1128 |
/**
|
1129 |
* @return bool
|
1130 |
*/
|
1131 |
+
protected function isPluginFormSubmit() {
|
1132 |
if ( $this->loadWp()->isAjax() || ( empty( $_POST ) && empty( $_GET ) ) ) {
|
1133 |
return false;
|
1134 |
}
|
1465 |
$this->saveCurrentPluginControllerOptions();
|
1466 |
}
|
1467 |
|
1468 |
+
/**
|
1469 |
+
*/
|
1470 |
+
protected function deleteCronJobs() {
|
1471 |
+
$oWpCron = $this->loadWpCronProcessor();
|
1472 |
+
$aCrons = $oWpCron->getCrons();
|
1473 |
+
|
1474 |
+
$sPattern = sprintf( '#^(%s|%s)#', $this->getParentSlug(), $this->getPluginSlug() );
|
1475 |
+
foreach ( $aCrons as $aCron ) {
|
1476 |
+
if ( is_array( $aCrons ) ) {
|
1477 |
+
foreach ( $aCron as $sKey => $aCronEntry ) {
|
1478 |
+
if ( is_string( $sKey ) && preg_match( $sPattern, $sKey ) ) {
|
1479 |
+
$oWpCron->deleteCronJob( $sKey );
|
1480 |
+
}
|
1481 |
+
}
|
1482 |
+
}
|
1483 |
+
}
|
1484 |
+
}
|
1485 |
+
|
1486 |
/**
|
1487 |
* @return bool
|
1488 |
*/
|
1490 |
return (bool)$this->getPluginSpec_Property( 'enable_premium' );
|
1491 |
}
|
1492 |
|
1493 |
+
/**
|
1494 |
+
* @return bool
|
1495 |
+
*/
|
1496 |
+
public function isPremiumActive() {
|
1497 |
+
return apply_filters( $this->getPremiumLicenseFilterName(), false );
|
1498 |
+
}
|
1499 |
+
|
1500 |
+
/**
|
1501 |
+
* @return string
|
1502 |
+
*/
|
1503 |
+
public function getPremiumLicenseFilterName() {
|
1504 |
+
return $this->prefix( 'license_is_valid'.$this->getUniqueRequestId( false ) );
|
1505 |
+
}
|
1506 |
+
|
1507 |
/**
|
1508 |
* @return bool
|
1509 |
*/
|
1550 |
/**
|
1551 |
*/
|
1552 |
public function deactivateSelf() {
|
1553 |
+
if ( $this->isValidAdminArea() && function_exists( 'deactivate_plugins' ) ) {
|
1554 |
deactivate_plugins( $this->getPluginBaseFile() );
|
1555 |
}
|
1556 |
}
|
1562 |
self::$sSessionId = null;
|
1563 |
}
|
1564 |
|
1565 |
+
/**
|
1566 |
+
* @return $this
|
1567 |
+
*/
|
1568 |
+
public function deleteForceOffFile() {
|
1569 |
+
if ( $this->getIfForceOffActive() ) {
|
1570 |
+
$this->loadFS()->deleteFile( $this->getForceOffFilePath() );
|
1571 |
+
$this->sForceOffFile = null;
|
1572 |
+
clearstatcache();
|
1573 |
+
}
|
1574 |
+
return $this;
|
1575 |
+
}
|
1576 |
+
|
1577 |
/**
|
1578 |
* Returns true if you're overriding OFF. We don't do override ON any more (as of 3.5.1)
|
1579 |
*/
|
1580 |
public function getIfForceOffActive() {
|
1581 |
+
return ( $this->getForceOffFilePath() !== false );
|
1582 |
+
}
|
1583 |
+
|
1584 |
+
/**
|
1585 |
+
* @return null|string
|
1586 |
+
*/
|
1587 |
+
protected function getForceOffFilePath() {
|
1588 |
+
if ( !isset( $this->sForceOffFile ) ) {
|
1589 |
+
$oFs = $this->loadFS();
|
1590 |
+
$sFile = $oFs->fileExistsInDir( 'forceOff', $this->getRootDir(), false );
|
1591 |
+
$this->sForceOffFile = ( !is_null( $sFile ) && $oFs->isFile( $sFile ) ) ? $sFile : false;
|
1592 |
}
|
1593 |
+
return $this->sForceOffFile;
|
1594 |
}
|
1595 |
|
1596 |
/**
|
1609 |
}
|
1610 |
|
1611 |
/**
|
1612 |
+
* @param bool $bSetIfNeeded
|
1613 |
* @return string
|
1614 |
*/
|
1615 |
+
public function getUniqueRequestId( $bSetIfNeeded = true ) {
|
1616 |
if ( !isset( self::$sRequestId ) ) {
|
1617 |
$oDp = $this->loadDP();
|
1618 |
+
self::$sRequestId = md5(
|
1619 |
+
$this->getSessionId( $bSetIfNeeded ).$this->loadIpService()->getRequestIp().$oDp->time().wp_rand()
|
1620 |
+
);
|
1621 |
}
|
1622 |
return self::$sRequestId;
|
1623 |
}
|
1624 |
|
1625 |
+
/**
|
1626 |
+
* @return string
|
1627 |
+
*/
|
1628 |
+
public function getShortRequestId() {
|
1629 |
+
return substr( $this->getUniqueRequestId( false ), 0, 10 );
|
1630 |
+
}
|
1631 |
+
|
1632 |
/**
|
1633 |
* @return string
|
1634 |
*/
|
1685 |
$bSuccess = true;
|
1686 |
}
|
1687 |
catch ( Exception $oE ) {
|
1688 |
+
if ( $this->isValidAdminArea() ) {
|
1689 |
$this->sAdminNoticeError = $oE->getMessage();
|
1690 |
add_action( 'admin_notices', array( $this, 'adminNoticePluginFailedToLoad' ) );
|
1691 |
add_action( 'network_admin_notices', array( $this, 'adminNoticePluginFailedToLoad' ) );
|
1736 |
return $oHandler;
|
1737 |
}
|
1738 |
|
1739 |
+
if ( !empty( $aModProps[ 'min_php' ] ) && !$this->loadDP()
|
1740 |
+
->getPhpVersionIsAtLeast( $aModProps[ 'min_php' ] ) ) {
|
1741 |
return null;
|
1742 |
}
|
1743 |
|
1774 |
return $this->{$sOptionsVarName};
|
1775 |
}
|
1776 |
|
1777 |
+
/**
|
1778 |
+
* @return ICWP_UserMeta
|
1779 |
+
*/
|
1780 |
+
public function getCurrentUserMeta() {
|
1781 |
+
return $this->loadWpUsers()->metaVoForUser( $this->prefix() );
|
1782 |
+
}
|
1783 |
+
|
1784 |
+
/**
|
1785 |
+
* @param $oUser WP_User
|
1786 |
+
* @return ICWP_UserMeta
|
1787 |
+
*/
|
1788 |
+
public function getUserMeta( $oUser ) {
|
1789 |
+
return $this->loadWpUsers()->metaVoForUser( $this->prefix(), $oUser->ID );
|
1790 |
+
}
|
1791 |
+
|
1792 |
/**
|
1793 |
* @param array[] $aRegistered
|
1794 |
* @return array[]
|
@@ -3,7 +3,7 @@
|
|
3 |
* Plugin Name: Shield Security
|
4 |
* Plugin URI: https://icwp.io/2f
|
5 |
* Description: Powerful, Easy-To-Use #1 Rated WordPress Security System
|
6 |
-
* Version: 6.
|
7 |
* Text Domain: wp-simple-firewall
|
8 |
* Domain Path: /languages/
|
9 |
* Author: One Dollar Plugin
|
@@ -11,7 +11,7 @@
|
|
11 |
*/
|
12 |
|
13 |
/**
|
14 |
-
* Copyright (c) 2018
|
15 |
* All rights reserved.
|
16 |
* "Shield" (formerly WordPress Simple Firewall) is distributed under the GNU
|
17 |
* General Public License, Version 2, June 1991. Copyright (C) 1989, 1991 Free
|
3 |
* Plugin Name: Shield Security
|
4 |
* Plugin URI: https://icwp.io/2f
|
5 |
* Description: Powerful, Easy-To-Use #1 Rated WordPress Security System
|
6 |
+
* Version: 6.9.0
|
7 |
* Text Domain: wp-simple-firewall
|
8 |
* Domain Path: /languages/
|
9 |
* Author: One Dollar Plugin
|
11 |
*/
|
12 |
|
13 |
/**
|
14 |
+
* Copyright (c) 2018 One Dollar Plugin <support@onedollarplugin.com>
|
15 |
* All rights reserved.
|
16 |
* "Shield" (formerly WordPress Simple Firewall) is distributed under the GNU
|
17 |
* General Public License, Version 2, June 1991. Copyright (C) 1989, 1991 Free
|
@@ -56,7 +56,7 @@ class ICWP_Wordpress_Simple_Firewall extends ICWP_WPSF_Foundation {
|
|
56 |
*/
|
57 |
public function onWpPluginActionLinks( $aActionLinks, $sPluginFile ) {
|
58 |
$oCon = $this->getController();
|
59 |
-
if ( !$oCon->
|
60 |
return $aActionLinks;
|
61 |
}
|
62 |
|
56 |
*/
|
57 |
public function onWpPluginActionLinks( $aActionLinks, $sPluginFile ) {
|
58 |
$oCon = $this->getController();
|
59 |
+
if ( !$oCon->isValidAdminArea() ) {
|
60 |
return $aActionLinks;
|
61 |
}
|
62 |
|
Binary file
|
@@ -1,15 +1,15 @@
|
|
1 |
msgid ""
|
2 |
msgstr ""
|
3 |
"Project-Id-Version: WPSF v2.0\n"
|
4 |
-
"POT-Creation-Date: 2018-
|
5 |
-
"PO-Revision-Date: 2018-
|
6 |
"Last-Translator: \n"
|
7 |
"Language-Team: \n"
|
8 |
"Language: en_GB\n"
|
9 |
"MIME-Version: 1.0\n"
|
10 |
"Content-Type: text/plain; charset=UTF-8\n"
|
11 |
"Content-Transfer-Encoding: 8bit\n"
|
12 |
-
"X-Generator: Poedit 2.
|
13 |
"X-Poedit-KeywordsList: _wpsf__;gettext;gettext_noop;_wpsf_e\n"
|
14 |
"X-Poedit-Basepath: ..\n"
|
15 |
"X-Poedit-SourceCharset: UTF-8\n"
|
@@ -18,3671 +18,4238 @@ msgstr ""
|
|
18 |
"X-Poedit-SearchPathExcluded-0: .git\n"
|
19 |
"X-Poedit-SearchPathExcluded-1: .idea\n"
|
20 |
|
21 |
-
#: init.php:
|
22 |
-
msgid "Upgrade Now To Keep Your
|
23 |
msgstr ""
|
24 |
|
25 |
-
#: src/common/Components/Tables/AuditTrailTable.php:
|
|
|
26 |
msgid "Refresh"
|
27 |
msgstr ""
|
28 |
|
29 |
-
#: src/features/admin_access_restriction.php:42
|
30 |
-
msgid "Enter your Security Admin Access Key"
|
31 |
-
msgstr ""
|
32 |
-
|
33 |
-
#: src/features/admin_access_restriction.php:54
|
34 |
#: src/features/admin_access_restriction.php:72
|
|
|
35 |
msgid "Security Admin Access Key Accepted."
|
36 |
msgstr ""
|
37 |
|
38 |
-
#: src/features/admin_access_restriction.php:
|
39 |
-
#: src/features/admin_access_restriction.php:
|
40 |
msgid "Please wait"
|
41 |
msgstr ""
|
42 |
|
43 |
-
#: src/features/admin_access_restriction.php:
|
|
|
44 |
msgid "Failed to process key - you may need to re-login to WordPress."
|
45 |
msgstr ""
|
46 |
|
47 |
-
#: src/features/admin_access_restriction.php:
|
48 |
-
#: src/features/admin_access_restriction.php:
|
49 |
msgid "Error - Invalid Key"
|
50 |
msgstr ""
|
51 |
|
52 |
-
#: src/features/admin_access_restriction.php:
|
53 |
-
|
54 |
-
msgid "%s Security Admin key accepted."
|
55 |
msgstr ""
|
56 |
|
57 |
-
#: src/features/admin_access_restriction.php:
|
58 |
-
|
59 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
60 |
msgstr ""
|
61 |
|
62 |
-
#: src/features/admin_access_restriction.php:
|
63 |
-
#: src/features/audit_trail.php:
|
64 |
-
#: src/features/comments_filter.php:
|
65 |
-
#: src/features/hack_protect.php:
|
66 |
-
#: src/features/ips.php:
|
67 |
-
#: src/features/login_protect.php:
|
68 |
-
#: src/features/statistics.php:
|
69 |
-
#: src/features/user_management.php:
|
70 |
#, php-format
|
71 |
msgid "Enable Module: %s"
|
72 |
msgstr ""
|
73 |
|
74 |
-
#: src/features/admin_access_restriction.php:
|
75 |
-
#: src/features/admin_access_restriction.php:
|
76 |
-
#: src/features/admin_access_restriction.php:
|
77 |
-
#: src/features/admin_access_restriction.php:
|
78 |
-
#: src/features/audit_trail.php:
|
79 |
-
#: src/features/audit_trail.php:
|
80 |
-
#: src/features/autoupdates.php:
|
81 |
-
#: src/features/autoupdates.php:
|
82 |
-
#: src/features/base_wpsf.php:
|
83 |
-
#: src/features/comments_filter.php:
|
84 |
-
#: src/features/comments_filter.php:
|
85 |
-
#: src/features/hack_protect.php:
|
86 |
-
#: src/features/hack_protect.php:
|
87 |
-
#: src/features/hack_protect.php:
|
88 |
-
#: src/features/hack_protect.php:
|
89 |
-
#: src/features/headers.php:
|
90 |
-
#: src/features/headers.php:
|
91 |
-
#: src/features/ips.php:
|
92 |
-
#: src/features/license.php:
|
93 |
-
#: src/features/lockdown.php:
|
94 |
-
#: src/features/lockdown.php:
|
95 |
-
#: src/features/login_protect.php:
|
96 |
-
#: src/features/login_protect.php:
|
97 |
-
#: src/features/login_protect.php:
|
98 |
-
#: src/features/login_protect.php:
|
99 |
-
#: src/features/plugin.php:
|
100 |
-
#: src/features/sessions.php:53 src/features/statistics.php:
|
101 |
-
#: src/features/statistics.php:
|
102 |
-
#: src/features/
|
103 |
-
#: src/features/user_management.php:
|
104 |
-
#: src/features/user_management.php:
|
105 |
-
|
106 |
-
msgid "Purpose
|
107 |
msgstr ""
|
108 |
|
109 |
-
#: src/features/admin_access_restriction.php:
|
110 |
-
#: src/features/admin_access_restriction.php:
|
111 |
msgid ""
|
112 |
"Restricts access to this plugin preventing unauthorized changes to your "
|
113 |
"security settings."
|
114 |
msgstr ""
|
115 |
|
116 |
-
#: src/features/admin_access_restriction.php:
|
117 |
-
#: src/features/admin_access_restriction.php:
|
118 |
-
#: src/features/admin_access_restriction.php:
|
119 |
-
#: src/features/audit_trail.php:
|
120 |
-
#: src/features/audit_trail.php:
|
121 |
-
#: src/features/autoupdates.php:
|
122 |
-
#: src/features/autoupdates.php:
|
123 |
-
#: src/features/comments_filter.php:
|
124 |
-
#: src/features/comments_filter.php:
|
125 |
-
#: src/features/firewall.php:
|
126 |
-
#: src/features/firewall.php:
|
127 |
-
#: src/features/hack_protect.php:
|
128 |
-
#: src/features/hack_protect.php:
|
129 |
-
#: src/features/hack_protect.php:
|
130 |
-
#: src/features/hack_protect.php:
|
131 |
-
#: src/features/headers.php:
|
132 |
-
#: src/features/ips.php:
|
133 |
-
#: src/features/license.php:
|
134 |
-
#: src/features/lockdown.php:
|
135 |
-
#: src/features/lockdown.php:
|
136 |
-
#: src/features/login_protect.php:
|
137 |
-
#: src/features/login_protect.php:
|
138 |
-
#: src/features/
|
139 |
-
#: src/features/sessions.php:54 src/features/statistics.php:
|
140 |
-
#: src/features/statistics.php:
|
141 |
-
#: src/features/
|
142 |
-
#: src/features/user_management.php:
|
143 |
-
#: src/features/user_management.php:
|
144 |
-
|
145 |
-
msgid "Recommendation
|
146 |
msgstr ""
|
147 |
|
148 |
-
#: src/features/admin_access_restriction.php:
|
149 |
-
#: src/features/audit_trail.php:
|
150 |
-
#: src/features/comments_filter.php:
|
151 |
-
#: src/features/hack_protect.php:
|
152 |
-
#: src/features/hack_protect.php:
|
153 |
-
#: src/features/hack_protect.php:
|
154 |
-
#: src/features/ips.php:
|
155 |
-
#: src/features/login_protect.php:
|
156 |
-
#: src/features/statistics.php:
|
157 |
-
#: src/features/user_management.php:
|
158 |
#, php-format
|
159 |
msgid "Keep the %s feature turned on."
|
160 |
msgstr ""
|
161 |
|
162 |
-
#: src/features/admin_access_restriction.php:
|
163 |
-
#: src/features/admin_access_restriction.php:
|
164 |
-
#: src/features/plugin.php:
|
165 |
msgid "Security Admin"
|
166 |
msgstr ""
|
167 |
|
168 |
-
#: src/features/admin_access_restriction.php:
|
169 |
msgid "You need to also enter a new Access Key to enable this feature."
|
170 |
msgstr ""
|
171 |
|
172 |
-
#: src/features/admin_access_restriction.php:
|
173 |
-
#: src/features/audit_trail.php:
|
174 |
-
#: src/features/comments_filter.php:
|
175 |
-
#: src/features/hack_protect.php:
|
176 |
-
#: src/features/ips.php:
|
177 |
-
#: src/features/login_protect.php:
|
178 |
-
#: src/features/statistics.php:
|
179 |
-
#: src/features/user_management.php:
|
180 |
#, php-format
|
181 |
msgid "%s/%s Module"
|
182 |
msgstr ""
|
183 |
|
184 |
-
#: src/features/admin_access_restriction.php:
|
185 |
-
#: src/features/admin_access_restriction.php:
|
186 |
-
#: src/features/audit_trail.php:
|
187 |
-
#: src/features/comments_filter.php:
|
188 |
-
#: src/features/hack_protect.php:
|
189 |
-
#: src/features/ips.php:
|
190 |
-
#: src/features/login_protect.php:
|
191 |
-
#: src/features/statistics.php:
|
192 |
-
#: src/features/user_management.php:
|
193 |
msgid "Enable"
|
194 |
msgstr ""
|
195 |
|
196 |
-
#: src/features/admin_access_restriction.php:
|
197 |
-
#: src/features/audit_trail.php:
|
198 |
-
#: src/features/comments_filter.php:
|
199 |
-
#: src/features/hack_protect.php:
|
200 |
-
#: src/features/ips.php:
|
201 |
-
#: src/features/login_protect.php:
|
202 |
-
#: src/features/statistics.php:
|
203 |
-
#: src/features/user_management.php:
|
204 |
msgid "Disable"
|
205 |
msgstr ""
|
206 |
|
207 |
-
#: src/features/admin_access_restriction.php:
|
208 |
msgid "Security Admin Restriction Settings"
|
209 |
msgstr ""
|
210 |
|
211 |
-
#: src/features/admin_access_restriction.php:
|
212 |
-
#: src/features/admin_access_restriction.php:
|
213 |
-
#: src/features/comments_filter.php:
|
214 |
-
#: src/features/login_protect.php:
|
215 |
-
#: src/features/plugin.php:
|
216 |
-
#: src/features/user_management.php:
|
217 |
-
#: src/features/user_management.php:
|
218 |
msgid "Use of this feature is highly recommend."
|
219 |
msgstr ""
|
220 |
|
221 |
-
#: src/features/admin_access_restriction.php:
|
222 |
msgid "Security Admin Settings"
|
223 |
msgstr ""
|
224 |
|
225 |
-
#: src/features/admin_access_restriction.php:
|
226 |
msgid "Security Admin Restriction Zones"
|
227 |
msgstr ""
|
228 |
|
229 |
-
#: src/features/admin_access_restriction.php:
|
230 |
msgid ""
|
231 |
"Restricts access to key WordPress areas for all users not authenticated with "
|
232 |
"the Security Admin Access system."
|
233 |
msgstr ""
|
234 |
|
235 |
-
#: src/features/admin_access_restriction.php:
|
236 |
msgid "Access Restriction Zones"
|
237 |
msgstr ""
|
238 |
|
239 |
-
#: src/features/admin_access_restriction.php:
|
240 |
-
|
|
|
|
|
241 |
msgstr ""
|
242 |
|
243 |
-
#: src/features/admin_access_restriction.php:
|
244 |
#, php-format
|
245 |
msgid "Rename and re-brand the %s plugin for your client site installations."
|
246 |
msgstr ""
|
247 |
|
248 |
-
#: src/features/admin_access_restriction.php:
|
249 |
-
#: src/features/
|
250 |
-
msgid "
|
|
|
|
|
|
|
|
|
251 |
msgstr ""
|
252 |
|
253 |
-
#: src/features/admin_access_restriction.php:
|
254 |
-
#: src/features/audit_trail.php:
|
255 |
-
#: src/features/comments_filter.php:
|
256 |
-
#: src/features/hack_protect.php:
|
257 |
-
#: src/features/ips.php:
|
258 |
-
#: src/features/login_protect.php:
|
259 |
-
#: src/features/sessions.php:79 src/features/statistics.php:
|
260 |
-
#: src/features/statistics.php:
|
|
|
261 |
#, php-format
|
262 |
msgid "Enable %s Module"
|
263 |
msgstr ""
|
264 |
|
265 |
-
#: src/features/admin_access_restriction.php:
|
266 |
msgid "Enforce Security Admin Access Restriction"
|
267 |
msgstr ""
|
268 |
|
269 |
-
#: src/features/admin_access_restriction.php:
|
270 |
msgid ""
|
271 |
"Enable this with great care and consideration. Ensure that you set a key "
|
272 |
"that you have set an access key that you will remember."
|
273 |
msgstr ""
|
274 |
|
275 |
-
#: src/features/admin_access_restriction.php:
|
276 |
msgid "Security Admin Access Key"
|
277 |
msgstr ""
|
278 |
|
279 |
-
#: src/features/admin_access_restriction.php:
|
280 |
msgid "Provide/Update Security Admin Access Key"
|
281 |
msgstr ""
|
282 |
|
283 |
-
#: src/features/admin_access_restriction.php:
|
284 |
-
#: src/features/admin_access_restriction.php:
|
285 |
-
#: src/features/admin_access_restriction.php:
|
286 |
-
#: src/features/admin_access_restriction.php:
|
287 |
-
#: src/features/admin_access_restriction.php:
|
288 |
-
#: src/features/admin_access_restriction.php:
|
289 |
-
|
290 |
-
msgid "Careful: %s"
|
291 |
msgstr ""
|
292 |
|
293 |
-
#: src/features/admin_access_restriction.php:
|
294 |
msgid ""
|
295 |
"If you forget this, you could potentially lock yourself out from using this "
|
296 |
"plugin."
|
297 |
msgstr ""
|
298 |
|
299 |
-
#: src/features/admin_access_restriction.php:
|
300 |
msgid "Security Key Currently Set"
|
301 |
msgstr ""
|
302 |
|
303 |
-
#: src/features/admin_access_restriction.php:
|
304 |
msgid "Security Key NOT Currently Set"
|
305 |
msgstr ""
|
306 |
|
307 |
-
#: src/features/admin_access_restriction.php:
|
|
|
|
|
|
|
|
|
|
|
308 |
msgid "Security Admin Timeout"
|
309 |
msgstr ""
|
310 |
|
311 |
-
#: src/features/admin_access_restriction.php:
|
312 |
msgid "Specify An Automatic Timeout Interval For Security Admin Access"
|
313 |
msgstr ""
|
314 |
|
315 |
-
#: src/features/admin_access_restriction.php:
|
316 |
msgid "This will automatically expire your Security Admin Session."
|
317 |
msgstr ""
|
318 |
|
319 |
-
#: src/features/admin_access_restriction.php:
|
320 |
-
|
321 |
-
|
|
|
|
|
322 |
msgstr ""
|
323 |
|
324 |
-
#: src/features/admin_access_restriction.php:
|
325 |
msgid "Pages"
|
326 |
msgstr ""
|
327 |
|
328 |
-
#: src/features/admin_access_restriction.php:
|
329 |
msgid "Restrict Access To Key WordPress Posts And Pages Actions"
|
330 |
msgstr ""
|
331 |
|
332 |
-
#: src/features/admin_access_restriction.php:
|
333 |
msgid "This will restrict access to page/post creation, editing and deletion."
|
334 |
msgstr ""
|
335 |
|
336 |
-
#: src/features/admin_access_restriction.php:
|
337 |
-
#: src/features/admin_access_restriction.php:
|
338 |
-
#: src/features/admin_access_restriction.php:
|
339 |
-
#: src/features/
|
340 |
-
#: src/features/login_protect.php:
|
341 |
-
|
342 |
-
|
|
|
|
|
|
|
343 |
msgstr ""
|
344 |
|
345 |
-
#: src/features/admin_access_restriction.php:
|
346 |
-
#: src/features/admin_access_restriction.php:
|
347 |
-
#: src/features/admin_access_restriction.php:
|
348 |
#, php-format
|
349 |
msgid "Selecting \"%s\" will also restrict all other options."
|
350 |
msgstr ""
|
351 |
|
352 |
-
#: src/features/admin_access_restriction.php:
|
353 |
msgid "Edit"
|
354 |
msgstr ""
|
355 |
|
356 |
-
#: src/features/admin_access_restriction.php:
|
357 |
-
#: src/features/audit_trail.php:
|
358 |
-
#: src/features/audit_trail.php:
|
|
|
|
|
359 |
msgid "Plugins"
|
360 |
msgstr ""
|
361 |
|
362 |
-
#: src/features/admin_access_restriction.php:
|
363 |
msgid "Restrict Access To Key WordPress Plugin Actions"
|
364 |
msgstr ""
|
365 |
|
366 |
-
#: src/features/admin_access_restriction.php:
|
367 |
msgid ""
|
368 |
"This will restrict access to plugin installation, update, activation and "
|
369 |
"deletion."
|
370 |
msgstr ""
|
371 |
|
372 |
-
#: src/features/admin_access_restriction.php:
|
373 |
-
#: src/features/admin_access_restriction.php:
|
374 |
msgid "Activate"
|
375 |
msgstr ""
|
376 |
|
377 |
-
#: src/features/admin_access_restriction.php:
|
378 |
msgid "WordPress Options"
|
379 |
msgstr ""
|
380 |
|
381 |
-
#: src/features/admin_access_restriction.php:
|
382 |
msgid "Restrict Access To Certain WordPress Admin Options"
|
383 |
msgstr ""
|
384 |
|
385 |
-
#: src/features/admin_access_restriction.php:
|
386 |
msgid ""
|
387 |
"This will restrict the ability of WordPress administrators from changing key "
|
388 |
"WordPress settings."
|
389 |
msgstr ""
|
390 |
|
391 |
-
#: src/features/admin_access_restriction.php:
|
392 |
msgid "Admin Users"
|
393 |
msgstr ""
|
394 |
|
395 |
-
#: src/features/admin_access_restriction.php:
|
396 |
msgid "Restrict Access To Create/Delete/Modify Other Admin Users"
|
397 |
msgstr ""
|
398 |
|
399 |
-
#: src/features/admin_access_restriction.php:
|
400 |
msgid ""
|
401 |
"This will restrict the ability of WordPress administrators from creating, "
|
402 |
"modifying or promoting other administrators."
|
403 |
msgstr ""
|
404 |
|
405 |
-
#: src/features/admin_access_restriction.php:
|
406 |
-
#: src/features/audit_trail.php:
|
407 |
-
#: src/features/audit_trail.php:
|
|
|
408 |
msgid "Themes"
|
409 |
msgstr ""
|
410 |
|
411 |
-
#: src/features/admin_access_restriction.php:
|
412 |
msgid "Restrict Access To WordPress Theme Actions"
|
413 |
msgstr ""
|
414 |
|
415 |
-
#: src/features/admin_access_restriction.php:
|
416 |
msgid ""
|
417 |
"This will restrict access to theme installation, update, activation and "
|
418 |
"deletion."
|
419 |
msgstr ""
|
420 |
|
421 |
-
#: src/features/admin_access_restriction.php:
|
422 |
#, php-format
|
423 |
msgid "%s and %s"
|
424 |
msgstr ""
|
425 |
|
426 |
-
#: src/features/admin_access_restriction.php:
|
427 |
msgid "Edit Theme Options"
|
428 |
msgstr ""
|
429 |
|
430 |
-
#: src/features/admin_access_restriction.php:
|
431 |
msgid "Activate Your White Label Settings"
|
432 |
msgstr ""
|
433 |
|
434 |
-
#: src/features/admin_access_restriction.php:
|
435 |
msgid "Turn on/off the application of your White Label settings."
|
436 |
msgstr ""
|
437 |
|
438 |
-
#: src/features/admin_access_restriction.php:
|
439 |
msgid "Hide Updates"
|
440 |
msgstr ""
|
441 |
|
442 |
-
#: src/features/admin_access_restriction.php:
|
443 |
msgid "Hide Plugin Updates From Non-Security Admins"
|
444 |
msgstr ""
|
445 |
|
446 |
-
#: src/features/admin_access_restriction.php:
|
447 |
-
|
|
|
448 |
msgstr ""
|
449 |
|
450 |
-
#: src/features/admin_access_restriction.php:
|
451 |
-
#: src/features/admin_access_restriction.php:
|
452 |
msgid "Plugin Name"
|
453 |
msgstr ""
|
454 |
|
455 |
-
#: src/features/admin_access_restriction.php:
|
456 |
msgid "The Name Of The Plugin"
|
457 |
msgstr ""
|
458 |
|
459 |
-
#: src/features/admin_access_restriction.php:
|
460 |
msgid "The name of the plugin that will be displayed to your site users."
|
461 |
msgstr ""
|
462 |
|
463 |
-
#: src/features/admin_access_restriction.php:
|
464 |
msgid "Menu Title"
|
465 |
msgstr ""
|
466 |
|
467 |
-
#: src/features/admin_access_restriction.php:
|
468 |
msgid "The Main Menu Title Of The Plugin"
|
469 |
msgstr ""
|
470 |
|
471 |
-
#: src/features/admin_access_restriction.php:
|
472 |
#, php-format
|
473 |
msgid ""
|
474 |
"The Main Menu Title Of The Plugin. If left empty, the \"%s\" will be used."
|
475 |
msgstr ""
|
476 |
|
477 |
-
#: src/features/admin_access_restriction.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
478 |
msgid "Description"
|
479 |
msgstr ""
|
480 |
|
481 |
-
#: src/features/admin_access_restriction.php:
|
482 |
msgid "The Description Of The Plugin"
|
483 |
msgstr ""
|
484 |
|
485 |
-
#: src/features/admin_access_restriction.php:
|
486 |
msgid "The description of the plugin displayed on the plugins page."
|
487 |
msgstr ""
|
488 |
|
489 |
-
#: src/features/admin_access_restriction.php:
|
490 |
msgid "Home URL"
|
491 |
msgstr ""
|
492 |
|
493 |
-
#: src/features/admin_access_restriction.php:
|
494 |
msgid "Plugin Home Page URL"
|
495 |
msgstr ""
|
496 |
|
497 |
-
#: src/features/admin_access_restriction.php:
|
498 |
msgid ""
|
499 |
"When a user clicks the home link for this plugin, this is where they'll be "
|
500 |
"directed."
|
501 |
msgstr ""
|
502 |
|
503 |
-
#: src/features/admin_access_restriction.php:
|
504 |
-
msgid "Icon
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
505 |
msgstr ""
|
506 |
|
507 |
-
#: src/features/admin_access_restriction.php:
|
508 |
-
msgid "
|
509 |
msgstr ""
|
510 |
|
511 |
-
#: src/features/admin_access_restriction.php:
|
512 |
-
msgid "
|
513 |
msgstr ""
|
514 |
|
515 |
-
#: src/features/audit_trail.php:
|
516 |
msgid "Your IP"
|
517 |
msgstr ""
|
518 |
|
519 |
-
#: src/features/audit_trail.php:
|
520 |
-
#: src/features/license.php:
|
521 |
msgid "Audit Trail Viewer"
|
522 |
msgstr ""
|
523 |
|
524 |
-
#: src/features/audit_trail.php:
|
525 |
msgid "Review audit trail logs "
|
526 |
msgstr ""
|
527 |
|
528 |
-
#: src/features/audit_trail.php:
|
529 |
msgid "Users"
|
530 |
msgstr ""
|
531 |
|
532 |
-
#: src/features/audit_trail.php:
|
533 |
msgid "WordPress"
|
534 |
msgstr ""
|
535 |
|
536 |
-
#: src/features/audit_trail.php:
|
537 |
msgid "Posts"
|
538 |
msgstr ""
|
539 |
|
540 |
-
#: src/features/audit_trail.php:
|
541 |
-
#: src/features/audit_trail.php:
|
542 |
msgid "Emails"
|
543 |
msgstr ""
|
544 |
|
545 |
-
#: src/features/audit_trail.php:
|
546 |
msgid "Time"
|
547 |
msgstr ""
|
548 |
|
549 |
-
#: src/features/audit_trail.php:
|
550 |
msgid "Event"
|
551 |
msgstr ""
|
552 |
|
553 |
-
#: src/features/audit_trail.php:
|
554 |
msgid "Message"
|
555 |
msgstr ""
|
556 |
|
557 |
-
#: src/features/audit_trail.php:
|
|
|
|
|
|
|
558 |
msgid "Username"
|
559 |
msgstr ""
|
560 |
|
561 |
-
#: src/features/audit_trail.php:
|
562 |
msgid "Category"
|
563 |
msgstr ""
|
564 |
|
565 |
-
#: src/features/audit_trail.php:
|
|
|
|
|
|
|
|
|
566 |
msgid "IP Address"
|
567 |
msgstr ""
|
568 |
|
569 |
-
#: src/features/audit_trail.php:
|
570 |
msgid "You"
|
571 |
msgstr ""
|
572 |
|
573 |
-
#: src/features/audit_trail.php:
|
574 |
msgid "There are currently no audit entries this is section."
|
575 |
msgstr ""
|
576 |
|
577 |
#: src/features/audit_trail.php:219
|
|
|
|
|
|
|
|
|
|
|
578 |
msgid ""
|
579 |
"The Audit Trail is designed so you can look back on events and analyse what "
|
580 |
"happened and what may have gone wrong."
|
581 |
msgstr ""
|
582 |
|
583 |
-
#: src/features/audit_trail.php:
|
584 |
-
#: src/wizards/plugin.php:
|
585 |
msgid "Audit Trail"
|
586 |
msgstr ""
|
587 |
|
588 |
-
#: src/features/audit_trail.php:
|
589 |
msgid "Audit Trail Options"
|
590 |
msgstr ""
|
591 |
|
592 |
-
#: src/features/audit_trail.php:
|
593 |
msgid "Provides finer control over the audit trail itself."
|
594 |
msgstr ""
|
595 |
|
596 |
-
#: src/features/audit_trail.php:
|
|
|
597 |
msgid "These settings are dependent on your requirements."
|
598 |
msgstr ""
|
599 |
|
600 |
-
#: src/features/audit_trail.php:
|
601 |
-
#: src/features/base_wpsf.php:146
|
602 |
-
msgid "Options"
|
603 |
-
msgstr ""
|
604 |
-
|
605 |
-
#: src/features/audit_trail.php:235
|
606 |
msgid "Enable Audit Contexts"
|
607 |
msgstr ""
|
608 |
|
609 |
-
#: src/features/audit_trail.php:
|
610 |
msgid "Specify which types of actions on your site are logged."
|
611 |
msgstr ""
|
612 |
|
613 |
-
#: src/features/audit_trail.php:
|
614 |
msgid "Audit Contexts"
|
615 |
msgstr ""
|
616 |
|
617 |
-
#: src/features/audit_trail.php:
|
618 |
-
#: src/features/firewall.php:
|
619 |
-
#: src/features/headers.php:
|
620 |
-
#: src/features/lockdown.php:
|
621 |
-
#: src/features/sessions.php:80 src/features/statistics.php:
|
622 |
-
#: src/features/statistics.php:
|
|
|
623 |
#, php-format
|
624 |
msgid "Enable (or Disable) The %s Module"
|
625 |
msgstr ""
|
626 |
|
627 |
-
#: src/features/audit_trail.php:
|
628 |
-
#: src/features/comments_filter.php:
|
629 |
-
#: src/features/hack_protect.php:
|
630 |
-
#: src/features/ips.php:
|
631 |
-
#: src/features/login_protect.php:
|
632 |
-
#: src/features/statistics.php:
|
633 |
-
#: src/features/user_management.php:
|
634 |
#, php-format
|
635 |
msgid "Un-Checking this option will completely disable the %s module."
|
636 |
msgstr ""
|
637 |
|
638 |
-
#: src/features/audit_trail.php:
|
639 |
msgid "Max Trail Length"
|
640 |
msgstr ""
|
641 |
|
642 |
-
#: src/features/audit_trail.php:
|
643 |
msgid "Maximum Audit Trail Length To Keep"
|
644 |
msgstr ""
|
645 |
|
646 |
-
#: src/features/audit_trail.php:
|
647 |
msgid ""
|
648 |
"Automatically remove any audit trail entries when this limit is exceeded."
|
649 |
msgstr ""
|
650 |
|
651 |
-
#: src/features/audit_trail.php:
|
652 |
msgid "Auto Clean"
|
653 |
msgstr ""
|
654 |
|
655 |
-
#: src/features/audit_trail.php:
|
656 |
msgid "Enable Audit Auto Cleaning"
|
657 |
msgstr ""
|
658 |
|
659 |
-
#: src/features/audit_trail.php:
|
660 |
msgid ""
|
661 |
"Events older than the number of days specified will be automatically cleaned "
|
662 |
"from the database."
|
663 |
msgstr ""
|
664 |
|
665 |
-
#: src/features/audit_trail.php:
|
666 |
-
#: src/features/audit_trail.php:
|
667 |
msgid "Users And Logins"
|
668 |
msgstr ""
|
669 |
|
670 |
-
#: src/features/audit_trail.php:
|
671 |
-
#: src/features/audit_trail.php:
|
672 |
-
#: src/features/audit_trail.php:
|
673 |
-
#: src/features/audit_trail.php:
|
674 |
#, php-format
|
675 |
msgid "Enable Audit Context - %s"
|
676 |
msgstr ""
|
677 |
|
678 |
-
#: src/features/audit_trail.php:
|
679 |
-
#: src/features/audit_trail.php:
|
680 |
-
#: src/features/audit_trail.php:
|
681 |
-
#: src/features/audit_trail.php:
|
682 |
#, php-format
|
683 |
msgid ""
|
684 |
"When this context is enabled, the audit trail will track activity relating "
|
685 |
"to: %s"
|
686 |
msgstr ""
|
687 |
|
688 |
-
#: src/features/audit_trail.php:
|
689 |
msgid "WordPress Plugins"
|
690 |
msgstr ""
|
691 |
|
692 |
-
#: src/features/audit_trail.php:
|
693 |
msgid "WordPress Themes"
|
694 |
msgstr ""
|
695 |
|
696 |
-
#: src/features/audit_trail.php:
|
697 |
msgid "Posts And Pages"
|
698 |
msgstr ""
|
699 |
|
700 |
-
#: src/features/audit_trail.php:
|
701 |
msgid "Editing and publishing of posts and pages"
|
702 |
msgstr ""
|
703 |
|
704 |
-
#: src/features/audit_trail.php:
|
705 |
msgid "WordPress And Settings"
|
706 |
msgstr ""
|
707 |
|
708 |
-
#: src/features/audit_trail.php:
|
709 |
msgid "WordPress upgrades and changes to particular WordPress settings"
|
710 |
msgstr ""
|
711 |
|
712 |
-
#: src/features/audit_trail.php:
|
713 |
msgid "Email Sending"
|
714 |
msgstr ""
|
715 |
|
716 |
-
#: src/features/autoupdates.php:
|
717 |
#, php-format
|
718 |
msgid "Plugin \"%s\" will %s."
|
719 |
msgstr ""
|
720 |
|
721 |
-
#: src/features/autoupdates.php:
|
722 |
msgid "update automatically"
|
723 |
msgstr ""
|
724 |
|
725 |
-
#: src/features/autoupdates.php:
|
726 |
msgid "not update automatically"
|
727 |
msgstr ""
|
728 |
|
729 |
-
#: src/features/autoupdates.php:
|
730 |
msgid "Failed to change the update status of the plugin."
|
731 |
msgstr ""
|
732 |
|
733 |
-
#: src/features/autoupdates.php:
|
734 |
-
msgid "Nonce security checking failed. Please reload."
|
735 |
-
msgstr ""
|
736 |
-
|
737 |
-
#: src/features/autoupdates.php:164
|
738 |
msgid ""
|
739 |
"Automatic Updates lets you manage the WordPress automatic updates engine so "
|
740 |
"you choose what exactly gets updated automatically."
|
741 |
msgstr ""
|
742 |
|
743 |
-
#: src/features/autoupdates.php:
|
744 |
-
#: src/features/plugin.php:
|
745 |
msgid "Automatic Updates"
|
746 |
msgstr ""
|
747 |
|
748 |
-
#: src/features/autoupdates.php:
|
749 |
msgid "Disable ALL WordPress Automatic Updates"
|
750 |
msgstr ""
|
751 |
|
752 |
-
#: src/features/autoupdates.php:
|
753 |
msgid ""
|
754 |
"If you never want WordPress to automatically update anything on your site, "
|
755 |
"turn on this option."
|
756 |
msgstr ""
|
757 |
|
758 |
-
#: src/features/autoupdates.php:
|
759 |
msgid "Do not turn on this option unless you really need to block updates."
|
760 |
msgstr ""
|
761 |
|
762 |
-
#: src/features/autoupdates.php:
|
763 |
msgid "Turn Off"
|
764 |
msgstr ""
|
765 |
|
766 |
-
#: src/features/autoupdates.php:
|
767 |
msgid "Automatic Plugin Self-Update"
|
768 |
msgstr ""
|
769 |
|
770 |
-
#: src/features/autoupdates.php:
|
771 |
#, php-format
|
772 |
msgid ""
|
773 |
"Allows the %s plugin to automatically update itself when an update is "
|
774 |
"available."
|
775 |
msgstr ""
|
776 |
|
777 |
-
#: src/features/autoupdates.php:
|
778 |
msgid "Keep this option turned on."
|
779 |
msgstr ""
|
780 |
|
781 |
-
#: src/features/autoupdates.php:
|
782 |
msgid "Self-Update"
|
783 |
msgstr ""
|
784 |
|
785 |
-
#: src/features/autoupdates.php:
|
786 |
msgid "Automatic Updates For WordPress Components"
|
787 |
msgstr ""
|
788 |
|
789 |
-
#: src/features/autoupdates.php:
|
790 |
msgid "Control how automatic updates for each WordPress component is handled."
|
791 |
msgstr ""
|
792 |
|
793 |
-
#: src/features/autoupdates.php:
|
794 |
msgid "You should at least allow minor updates for the WordPress core."
|
795 |
msgstr ""
|
796 |
|
797 |
-
#: src/features/autoupdates.php:
|
798 |
msgid "WordPress Components"
|
799 |
msgstr ""
|
800 |
|
801 |
-
#: src/features/autoupdates.php:
|
802 |
msgid "Auto-Update Options"
|
803 |
msgstr ""
|
804 |
|
805 |
-
#: src/features/autoupdates.php:
|
806 |
msgid "Make adjustments to how automatic updates are handled on your site."
|
807 |
msgstr ""
|
808 |
|
809 |
-
#: src/features/autoupdates.php:
|
810 |
msgid "Disable All"
|
811 |
msgstr ""
|
812 |
|
813 |
-
#: src/features/autoupdates.php:
|
814 |
msgid "Completely Disable WordPress Automatic Updates"
|
815 |
msgstr ""
|
816 |
|
817 |
-
#: src/features/autoupdates.php:
|
818 |
msgid ""
|
819 |
"When selected, regardless of any other settings, all WordPress automatic "
|
820 |
"updates on this site will be completely disabled!"
|
821 |
msgstr ""
|
822 |
|
823 |
-
#: src/features/autoupdates.php:
|
824 |
msgid "Auto Update Plugin"
|
825 |
msgstr ""
|
826 |
|
827 |
-
#: src/features/autoupdates.php:
|
828 |
msgid "Always Automatically Update This Plugin"
|
829 |
msgstr ""
|
830 |
|
831 |
-
#: src/features/autoupdates.php:
|
832 |
#, php-format
|
833 |
msgid ""
|
834 |
"Regardless of any component settings below, automatically update the \"%s\" "
|
835 |
"plugin."
|
836 |
msgstr ""
|
837 |
|
838 |
-
#: src/features/autoupdates.php:
|
839 |
msgid "WordPress Core Updates"
|
840 |
msgstr ""
|
841 |
|
842 |
-
#: src/features/autoupdates.php:
|
843 |
msgid "Decide how the WordPress Core will automatically update, if at all"
|
844 |
msgstr ""
|
845 |
|
846 |
-
#: src/features/autoupdates.php:
|
847 |
msgid ""
|
848 |
"At least automatically upgrading minor versions is recommended (and is the "
|
849 |
"WordPress default)."
|
850 |
msgstr ""
|
851 |
|
852 |
-
#: src/features/autoupdates.php:
|
853 |
msgid "Translations"
|
854 |
msgstr ""
|
855 |
|
856 |
-
#: src/features/autoupdates.php:
|
857 |
msgid "Automatically Update Translations"
|
858 |
msgstr ""
|
859 |
|
860 |
-
#: src/features/autoupdates.php:
|
861 |
msgid ""
|
862 |
"Note: Automatic updates for translations are enabled on WordPress by default."
|
863 |
msgstr ""
|
864 |
|
865 |
-
#: src/features/autoupdates.php:
|
866 |
msgid "Automatically Update All Plugins"
|
867 |
msgstr ""
|
868 |
|
869 |
-
#: src/features/autoupdates.php:
|
870 |
msgid ""
|
871 |
"Note: Automatic updates for plugins are disabled on WordPress by default."
|
872 |
msgstr ""
|
873 |
|
874 |
-
#: src/features/autoupdates.php:
|
875 |
msgid "Individually Select Plugins"
|
876 |
msgstr ""
|
877 |
|
878 |
-
#: src/features/autoupdates.php:
|
879 |
msgid "Select Individual Plugins To Automatically Update"
|
880 |
msgstr ""
|
881 |
|
882 |
-
#: src/features/autoupdates.php:
|
883 |
msgid ""
|
884 |
"Turning this on will provide an option on the plugins page to select whether "
|
885 |
"a plugin is automatically updated."
|
886 |
msgstr ""
|
887 |
|
888 |
-
#: src/features/autoupdates.php:
|
889 |
msgid "Automatically Update Themes"
|
890 |
msgstr ""
|
891 |
|
892 |
-
#: src/features/autoupdates.php:
|
893 |
msgid ""
|
894 |
"Note: Automatic updates for themes are disabled on WordPress by default."
|
895 |
msgstr ""
|
896 |
|
897 |
-
#: src/features/autoupdates.php:
|
898 |
msgid "Ignore Version Control"
|
899 |
msgstr ""
|
900 |
|
901 |
-
#: src/features/autoupdates.php:
|
902 |
msgid "Ignore Version Control Systems Such As GIT and SVN"
|
903 |
msgstr ""
|
904 |
|
905 |
-
#: src/features/autoupdates.php:
|
906 |
msgid ""
|
907 |
"If you use SVN or GIT and WordPress detects it, automatic updates are "
|
908 |
"disabled by default. Check this box to ignore version control systems and "
|
909 |
"allow automatic updates."
|
910 |
msgstr ""
|
911 |
|
912 |
-
#: src/features/autoupdates.php:
|
913 |
msgid "Send Report Email"
|
914 |
msgstr ""
|
915 |
|
916 |
-
#: src/features/autoupdates.php:
|
917 |
msgid "Send email notices after automatic updates"
|
918 |
msgstr ""
|
919 |
|
920 |
-
#: src/features/autoupdates.php:
|
921 |
msgid ""
|
922 |
"You can turn on/off email notices from automatic updates by un/checking this "
|
923 |
"box."
|
924 |
msgstr ""
|
925 |
|
926 |
-
#: src/features/autoupdates.php:
|
927 |
msgid "Report Email Address"
|
928 |
msgstr ""
|
929 |
|
930 |
-
#: src/features/autoupdates.php:
|
931 |
msgid "Where to send upgrade notification reports"
|
932 |
msgstr ""
|
933 |
|
934 |
-
#: src/features/autoupdates.php:
|
935 |
msgid "If this is empty, it will default to the Site Admin email address"
|
936 |
msgstr ""
|
937 |
|
938 |
-
#: src/features/autoupdates.php:
|
939 |
msgid "Update Delay"
|
940 |
msgstr ""
|
941 |
|
942 |
-
#: src/features/autoupdates.php:
|
943 |
msgid "Delay Automatic Updates For Period Of Stability"
|
944 |
msgstr ""
|
945 |
|
946 |
-
#: src/features/autoupdates.php:
|
|
|
947 |
msgid ""
|
948 |
-
"
|
949 |
-
"
|
950 |
msgstr ""
|
951 |
|
952 |
-
#: src/features/autoupdates.php:
|
953 |
msgid ""
|
954 |
"This helps ensure updates are more stable before they're automatically "
|
955 |
"applied to your site."
|
956 |
msgstr ""
|
957 |
|
958 |
-
#: src/features/base.php:
|
959 |
-
msgid "
|
|
|
|
|
960 |
msgstr ""
|
961 |
|
962 |
-
#: src/features/base.php:
|
963 |
#, php-format
|
964 |
msgid "Failed up to update %s plugin options."
|
965 |
msgstr ""
|
966 |
|
967 |
-
#: src/features/base.php:
|
968 |
#, php-format
|
969 |
msgid "%s Plugin options updated successfully."
|
970 |
msgstr ""
|
971 |
|
972 |
-
#: src/features/base.php:
|
973 |
#, php-format
|
974 |
msgid ""
|
975 |
"Failed to update %s options as you are not authenticated with %s as a "
|
976 |
"Security Admin."
|
977 |
msgstr ""
|
978 |
|
979 |
-
#: src/features/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
980 |
msgid "Settings"
|
981 |
msgstr ""
|
982 |
|
983 |
-
#: src/features/base_wpsf.php:
|
984 |
msgid "On"
|
985 |
msgstr ""
|
986 |
|
987 |
-
#: src/features/base_wpsf.php:
|
988 |
msgid "Off"
|
989 |
msgstr ""
|
990 |
|
991 |
-
#: src/features/base_wpsf.php:
|
992 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
993 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
994 |
#: src/processors/hackprotect_wpvulnscan.php:147
|
995 |
-
#: src/processors/loginprotect_intent.php:
|
996 |
msgid "More Info"
|
997 |
msgstr ""
|
998 |
|
999 |
-
#: src/features/base_wpsf.php:
|
1000 |
msgid "Blog"
|
1001 |
msgstr ""
|
1002 |
|
1003 |
-
#: src/features/base_wpsf.php:
|
1004 |
msgid "Save All Settings"
|
1005 |
msgstr ""
|
1006 |
|
1007 |
-
#: src/features/base_wpsf.php:
|
1008 |
msgid "Configure Module"
|
1009 |
msgstr ""
|
1010 |
|
1011 |
-
#: src/features/base_wpsf.php:
|
1012 |
msgid "Actions and Info"
|
1013 |
msgstr ""
|
1014 |
|
1015 |
-
#: src/features/base_wpsf.php:
|
1016 |
msgid "Perform actions for this module"
|
1017 |
msgstr ""
|
1018 |
|
1019 |
-
#: src/features/base_wpsf.php:
|
1020 |
msgid "Help"
|
1021 |
msgstr ""
|
1022 |
|
1023 |
-
#: src/features/base_wpsf.php:
|
1024 |
msgid "Learn More"
|
1025 |
msgstr ""
|
1026 |
|
1027 |
-
#: src/features/base_wpsf.php:
|
1028 |
msgid "Plugin Access Restricted"
|
1029 |
msgstr ""
|
1030 |
|
1031 |
-
#: src/features/base_wpsf.php:
|
1032 |
msgid ""
|
1033 |
"This security plugin is restricted to administrators with the Security "
|
1034 |
"Access Key."
|
1035 |
msgstr ""
|
1036 |
|
1037 |
-
#: src/features/base_wpsf.php:
|
1038 |
msgid "Please provide the Security Access Key to manage this plugin."
|
1039 |
msgstr ""
|
1040 |
|
1041 |
-
#: src/features/base_wpsf.php:
|
1042 |
msgid "To manage this plugin you must enter the access key."
|
1043 |
msgstr ""
|
1044 |
|
1045 |
-
#: src/features/base_wpsf.php:
|
1046 |
msgid "Enter Access Key"
|
1047 |
msgstr ""
|
1048 |
|
1049 |
-
#: src/features/base_wpsf.php:
|
1050 |
msgid "Submit Security Admin Key"
|
1051 |
msgstr ""
|
1052 |
|
1053 |
-
#: src/features/base_wpsf.php:
|
1054 |
msgid "Forgotten Key"
|
1055 |
msgstr ""
|
1056 |
|
1057 |
-
#: src/features/base_wpsf.php:
|
1058 |
msgid "Nonce security checking failed - the nonce value was empty."
|
1059 |
msgstr ""
|
1060 |
|
1061 |
-
#: src/features/base_wpsf.php:
|
1062 |
#, php-format
|
1063 |
msgid "Nonce security checking failed - the nonce supplied was \"%s\"."
|
1064 |
msgstr ""
|
1065 |
|
1066 |
-
#: src/features/base_wpsf.php:
|
1067 |
msgid "User Messages"
|
1068 |
msgstr ""
|
1069 |
|
1070 |
-
#: src/features/base_wpsf.php:
|
1071 |
msgid "Customize the messages displayed to the user."
|
1072 |
msgstr ""
|
1073 |
|
1074 |
-
#: src/features/base_wpsf.php:
|
1075 |
msgid ""
|
1076 |
"Use this section if you need to communicate to the user in a particular "
|
1077 |
"manner."
|
1078 |
msgstr ""
|
1079 |
|
1080 |
-
#: src/features/base_wpsf.php:
|
1081 |
-
|
1082 |
-
msgid "Hint - %s"
|
1083 |
msgstr ""
|
1084 |
|
1085 |
-
#: src/features/base_wpsf.php:
|
1086 |
#, php-format
|
1087 |
msgid "To reset any message to its default, enter the text exactly: %s"
|
1088 |
msgstr ""
|
1089 |
|
1090 |
-
#: src/features/comments_filter.php:
|
1091 |
msgid "I'm not a spammer."
|
1092 |
msgstr ""
|
1093 |
|
1094 |
-
#: src/features/comments_filter.php:
|
1095 |
msgid "Please check the box to confirm you're not a spammer."
|
1096 |
msgstr ""
|
1097 |
|
1098 |
-
#: src/features/comments_filter.php:
|
1099 |
#, php-format
|
1100 |
msgid "Please wait %s seconds before posting your comment."
|
1101 |
msgstr ""
|
1102 |
|
1103 |
-
#: src/features/comments_filter.php:
|
1104 |
msgid "Please reload this page to post a comment."
|
1105 |
msgstr ""
|
1106 |
|
1107 |
-
#: src/features/comments_filter.php:
|
1108 |
msgid "Comments SPAM Protection"
|
1109 |
msgstr ""
|
1110 |
|
1111 |
-
#: src/features/comments_filter.php:
|
1112 |
#, php-format
|
1113 |
msgid ""
|
1114 |
"The Comments Filter can block 100% of automated spam bots and also offer the "
|
1115 |
"option to analyse human-generated spam."
|
1116 |
msgstr ""
|
1117 |
|
1118 |
-
#: src/features/comments_filter.php:
|
1119 |
msgid "Comments Filter"
|
1120 |
msgstr ""
|
1121 |
|
1122 |
-
#: src/features/comments_filter.php:
|
1123 |
#, php-format
|
1124 |
msgid "%s Comment SPAM Protection"
|
1125 |
msgstr ""
|
1126 |
|
1127 |
-
#: src/features/comments_filter.php:
|
1128 |
msgid "Automatic Bot"
|
1129 |
msgstr ""
|
1130 |
|
1131 |
-
#: src/features/comments_filter.php:
|
1132 |
#, php-format
|
1133 |
msgid "Blocks 100% of all automated bot-generated comment SPAM."
|
1134 |
msgstr ""
|
1135 |
|
1136 |
-
#: src/features/comments_filter.php:
|
1137 |
msgid "Bot SPAM"
|
1138 |
msgstr ""
|
1139 |
|
1140 |
-
#: src/features/comments_filter.php:
|
1141 |
msgid "Adds Google reCAPTCHA to the Comment Forms."
|
1142 |
msgstr ""
|
1143 |
|
1144 |
-
#: src/features/comments_filter.php:
|
1145 |
msgid "Keep this turned on."
|
1146 |
msgstr ""
|
1147 |
|
1148 |
-
#: src/features/comments_filter.php:
|
1149 |
-
#: src/features/login_protect.php:452 src/features/plugin.php:685
|
1150 |
-
#: src/features/user_management.php:225
|
1151 |
-
#, php-format
|
1152 |
-
msgid "Note - %s"
|
1153 |
-
msgstr ""
|
1154 |
-
|
1155 |
-
#: src/features/comments_filter.php:133 src/features/login_protect.php:452
|
1156 |
msgid ""
|
1157 |
"You will need to register for Google reCAPTCHA keys and store them in the "
|
1158 |
"Shield 'Dashboard' settings."
|
1159 |
msgstr ""
|
1160 |
|
1161 |
-
#: src/features/comments_filter.php:
|
1162 |
#, php-format
|
1163 |
msgid "%s Comment SPAM Protection Filter"
|
1164 |
msgstr ""
|
1165 |
|
1166 |
-
#: src/features/comments_filter.php:
|
1167 |
msgid "Human"
|
1168 |
msgstr ""
|
1169 |
|
1170 |
-
#: src/features/comments_filter.php:
|
1171 |
msgid "Uses a 3rd party SPAM dictionary to detect human-based comment SPAM."
|
1172 |
msgstr ""
|
1173 |
|
1174 |
-
#: src/features/comments_filter.php:
|
1175 |
msgid ""
|
1176 |
"This tool, unlike other SPAM tools such as Akismet, will not send your "
|
1177 |
"comment data to 3rd party services for analysis."
|
1178 |
msgstr ""
|
1179 |
|
1180 |
-
#: src/features/comments_filter.php:
|
1181 |
msgid "Human SPAM"
|
1182 |
msgstr ""
|
1183 |
|
1184 |
-
#: src/features/comments_filter.php:
|
1185 |
msgid "Enable (or Disable) The Comment SPAM Protection Feature"
|
1186 |
msgstr ""
|
1187 |
|
1188 |
-
#: src/features/comments_filter.php:
|
1189 |
-
#: src/wizards/plugin.php:
|
1190 |
msgid "Comment SPAM Protection"
|
1191 |
msgstr ""
|
1192 |
|
1193 |
-
#: src/features/comments_filter.php:
|
1194 |
msgid "Human SPAM Filter"
|
1195 |
msgstr ""
|
1196 |
|
1197 |
-
#: src/features/comments_filter.php:
|
1198 |
#, php-format
|
1199 |
msgid "Enable (or Disable) The %s Feature"
|
1200 |
msgstr ""
|
1201 |
|
1202 |
-
#: src/features/comments_filter.php:
|
1203 |
msgid ""
|
1204 |
"Scans the content of WordPress comments for keywords that are indicative of "
|
1205 |
"SPAM and marks the comment according to your preferred setting below."
|
1206 |
msgstr ""
|
1207 |
|
1208 |
-
#: src/features/comments_filter.php:
|
1209 |
msgid "Comment Filter Items"
|
1210 |
msgstr ""
|
1211 |
|
1212 |
-
#: src/features/comments_filter.php:
|
1213 |
msgid "Select The Items To Scan For SPAM"
|
1214 |
msgstr ""
|
1215 |
|
1216 |
-
#: src/features/comments_filter.php:
|
1217 |
msgid ""
|
1218 |
"When a user submits a comment, only the selected parts of the comment data "
|
1219 |
"will be scanned for SPAM content."
|
1220 |
msgstr ""
|
1221 |
|
1222 |
-
#: src/features/comments_filter.php:
|
1223 |
#, php-format
|
1224 |
msgid "Recommended: %s"
|
1225 |
msgstr ""
|
1226 |
|
1227 |
-
#: src/features/comments_filter.php:
|
1228 |
msgid "All"
|
1229 |
msgstr ""
|
1230 |
|
1231 |
-
#: src/features/comments_filter.php:
|
1232 |
msgid "Default SPAM Action"
|
1233 |
msgstr ""
|
1234 |
|
1235 |
-
#: src/features/comments_filter.php:
|
1236 |
msgid "How To Categorise Comments When Identified To Be SPAM"
|
1237 |
msgstr ""
|
1238 |
|
1239 |
-
#: src/features/comments_filter.php:
|
1240 |
#, php-format
|
1241 |
msgid ""
|
1242 |
"When a comment is detected as being SPAM from %s, the comment will be "
|
1243 |
"categorised based on this setting."
|
1244 |
msgstr ""
|
1245 |
|
1246 |
-
#: src/features/comments_filter.php:
|
1247 |
msgid "a human commenter"
|
1248 |
msgstr ""
|
1249 |
|
1250 |
-
#: src/features/comments_filter.php:
|
1251 |
msgid "SPAM Bot Protection"
|
1252 |
msgstr ""
|
1253 |
|
1254 |
-
#: src/features/comments_filter.php:
|
1255 |
msgid "Block Automatic Comment SPAM By Bots"
|
1256 |
msgstr ""
|
1257 |
|
1258 |
-
#: src/features/comments_filter.php:
|
1259 |
msgid ""
|
1260 |
"Simple, yet highly effective SPAM Bot protection for your WordPress comments."
|
1261 |
msgstr ""
|
1262 |
|
1263 |
-
#: src/features/comments_filter.php:
|
1264 |
msgid "an automatic bot"
|
1265 |
msgstr ""
|
1266 |
|
1267 |
-
#: src/features/comments_filter.php:
|
1268 |
msgid "Comments Cooldown"
|
1269 |
msgstr ""
|
1270 |
|
1271 |
-
#: src/features/comments_filter.php:
|
1272 |
msgid "Limit posting comments to X seconds after the page has loaded"
|
1273 |
msgstr ""
|
1274 |
|
1275 |
-
#: src/features/comments_filter.php:
|
1276 |
msgid ""
|
1277 |
"By forcing a comments cooldown period, you restrict a Spambot's ability to "
|
1278 |
"post multiple times to your posts."
|
1279 |
msgstr ""
|
1280 |
|
1281 |
-
#: src/features/comments_filter.php:
|
1282 |
msgid "Comment Token Expire"
|
1283 |
msgstr ""
|
1284 |
|
1285 |
-
#: src/features/comments_filter.php:
|
1286 |
msgid "A visitor has X seconds within which to post a comment"
|
1287 |
msgstr ""
|
1288 |
|
1289 |
-
#: src/features/comments_filter.php:
|
1290 |
msgid ""
|
1291 |
"Default: 600 seconds (10 minutes). Each visitor is given a unique 'Token' so "
|
1292 |
"they can comment. This restricts spambots, but we need to force these tokens "
|
1293 |
"to expire and at the same time not bother the visitors."
|
1294 |
msgstr ""
|
1295 |
|
1296 |
-
#: src/features/comments_filter.php:
|
1297 |
msgid "GASP Checkbox Message"
|
1298 |
msgstr ""
|
1299 |
|
1300 |
-
#: src/features/comments_filter.php:
|
1301 |
msgid "If you want a custom checkbox message, please provide this here"
|
1302 |
msgstr ""
|
1303 |
|
1304 |
-
#: src/features/comments_filter.php:
|
1305 |
msgid "You can customise the message beside the checkbox."
|
1306 |
msgstr ""
|
1307 |
|
1308 |
-
#: src/features/comments_filter.php:
|
1309 |
-
#: src/features/comments_filter.php:
|
1310 |
#, php-format
|
1311 |
msgid "Default Message: %s"
|
1312 |
msgstr ""
|
1313 |
|
1314 |
-
#: src/features/comments_filter.php:
|
1315 |
msgid "Please check the box to confirm you're not a spammer"
|
1316 |
msgstr ""
|
1317 |
|
1318 |
-
#: src/features/comments_filter.php:
|
1319 |
msgid "Enable Google reCAPTCHA For Comments"
|
1320 |
msgstr ""
|
1321 |
|
1322 |
-
#: src/features/comments_filter.php:
|
1323 |
msgid "Use Google reCAPTCHA on the comments form to prevent bot-spam comments."
|
1324 |
msgstr ""
|
1325 |
|
1326 |
-
#: src/features/comments_filter.php:
|
1327 |
-
#: src/features/plugin.php:
|
1328 |
msgid "reCAPTCHA Style"
|
1329 |
msgstr ""
|
1330 |
|
1331 |
-
#: src/features/comments_filter.php:
|
1332 |
msgid "How Google reCAPTCHA Will Be Displayed"
|
1333 |
msgstr ""
|
1334 |
|
1335 |
-
#: src/features/comments_filter.php:
|
1336 |
-
#: src/features/plugin.php:
|
1337 |
msgid ""
|
1338 |
"You can choose the reCAPTCHA display format that best suits your site, "
|
1339 |
"including the new Invisible Recaptcha"
|
1340 |
msgstr ""
|
1341 |
|
1342 |
-
#: src/features/comments_filter.php:
|
1343 |
msgid "GASP Alert Message"
|
1344 |
msgstr ""
|
1345 |
|
1346 |
-
#: src/features/comments_filter.php:
|
1347 |
msgid "If you want a custom alert message, please provide this here"
|
1348 |
msgstr ""
|
1349 |
|
1350 |
-
#: src/features/comments_filter.php:
|
1351 |
msgid ""
|
1352 |
"This alert message is displayed when a visitor attempts to submit a comment "
|
1353 |
"without checking the box."
|
1354 |
msgstr ""
|
1355 |
|
1356 |
-
#: src/features/comments_filter.php:
|
1357 |
msgid "GASP Wait Message"
|
1358 |
msgstr ""
|
1359 |
|
1360 |
-
#: src/features/comments_filter.php:
|
1361 |
msgid ""
|
1362 |
"If you want a custom submit-button wait message, please provide this here."
|
1363 |
msgstr ""
|
1364 |
|
1365 |
-
#: src/features/comments_filter.php:
|
1366 |
#, php-format
|
1367 |
msgid ""
|
1368 |
"Where you see the '%s' this will be the number of seconds. You must ensure "
|
1369 |
"you include 1, and only 1, of these."
|
1370 |
msgstr ""
|
1371 |
|
1372 |
-
#: src/features/comments_filter.php:
|
1373 |
#, php-format
|
1374 |
msgid "Please wait %s seconds before posting your comment"
|
1375 |
msgstr ""
|
1376 |
|
1377 |
-
#: src/features/comments_filter.php:
|
1378 |
msgid "GASP Reload Message"
|
1379 |
msgstr ""
|
1380 |
|
1381 |
-
#: src/features/comments_filter.php:
|
1382 |
msgid ""
|
1383 |
"If you want a custom message when the comment token has expired, please "
|
1384 |
"provide this here."
|
1385 |
msgstr ""
|
1386 |
|
1387 |
-
#: src/features/comments_filter.php:
|
1388 |
msgid ""
|
1389 |
"This message is displayed on the submit-button when the comment token is "
|
1390 |
"expired"
|
1391 |
msgstr ""
|
1392 |
|
1393 |
-
#: src/features/comments_filter.php:
|
1394 |
msgid "Please reload this page to post a comment"
|
1395 |
msgstr ""
|
1396 |
|
1397 |
-
#: src/features/email.php:
|
1398 |
msgid "Email Options"
|
1399 |
msgstr ""
|
1400 |
|
1401 |
-
#: src/features/email.php:
|
1402 |
msgid "Email Throttle Limit"
|
1403 |
msgstr ""
|
1404 |
|
1405 |
-
#: src/features/email.php:
|
1406 |
msgid "Limit Emails Per Second"
|
1407 |
msgstr ""
|
1408 |
|
1409 |
-
#: src/features/email.php:
|
1410 |
msgid ""
|
1411 |
"You throttle emails sent by this plugin by limiting the number of emails "
|
1412 |
"sent every second. This is useful in case you get hit by a bot attack. Zero "
|
1413 |
"(0) turns this off. Suggested: 10"
|
1414 |
msgstr ""
|
1415 |
|
1416 |
-
#: src/features/firewall.php:
|
1417 |
#, php-format
|
1418 |
msgid "You were blocked by the %s."
|
1419 |
msgstr ""
|
1420 |
|
1421 |
-
#: src/features/firewall.php:
|
1422 |
msgid ""
|
1423 |
"The Firewall is designed to analyse data sent to your website and block any "
|
1424 |
"requests that appear to be malicious."
|
1425 |
msgstr ""
|
1426 |
|
1427 |
-
#: src/features/firewall.php:
|
1428 |
msgid "Firewall"
|
1429 |
msgstr ""
|
1430 |
|
1431 |
-
#: src/features/firewall.php:
|
1432 |
msgid "Firewall Blocking Options"
|
1433 |
msgstr ""
|
1434 |
|
1435 |
-
#: src/features/firewall.php:
|
1436 |
msgid "Here you choose what kind of malicious data to scan for."
|
1437 |
msgstr ""
|
1438 |
|
1439 |
-
#: src/features/firewall.php:
|
1440 |
msgid "Turn on as many options here as you can."
|
1441 |
msgstr ""
|
1442 |
|
1443 |
-
#: src/features/firewall.php:
|
1444 |
msgid ""
|
1445 |
"If you find an incompatibility or something stops working, un-check 1 option "
|
1446 |
"at a time until you find the problem or review the Audit Trail."
|
1447 |
msgstr ""
|
1448 |
|
1449 |
-
#: src/features/firewall.php:
|
1450 |
msgid "Firewall Blocking"
|
1451 |
msgstr ""
|
1452 |
|
1453 |
-
#: src/features/firewall.php:
|
1454 |
msgid "Choose Firewall Block Response"
|
1455 |
msgstr ""
|
1456 |
|
1457 |
-
#: src/features/firewall.php:
|
1458 |
msgid ""
|
1459 |
"Here you choose how the plugin will respond when it detects malicious data."
|
1460 |
msgstr ""
|
1461 |
|
1462 |
-
#: src/features/firewall.php:
|
1463 |
#, php-format
|
1464 |
msgid "Choose the option \"%s\"."
|
1465 |
msgstr ""
|
1466 |
|
1467 |
-
#: src/features/firewall.php:
|
1468 |
msgid "Die With Message"
|
1469 |
msgstr ""
|
1470 |
|
1471 |
-
#: src/features/firewall.php:
|
1472 |
msgid "Firewall Response"
|
1473 |
msgstr ""
|
1474 |
|
1475 |
-
#: src/features/firewall.php:
|
1476 |
msgid ""
|
1477 |
"Whitelists - IPs, Pages, Parameters, and Users that by-pass the Firewall"
|
1478 |
msgstr ""
|
1479 |
|
1480 |
-
#: src/features/firewall.php:
|
1481 |
msgid ""
|
1482 |
"In principle you should not need to whitelist anything or anyone unless you "
|
1483 |
"have discovered a collision with another plugin."
|
1484 |
msgstr ""
|
1485 |
|
1486 |
-
#: src/features/firewall.php:
|
1487 |
msgid ""
|
1488 |
"Do not whitelist anything unless you are confident in what you are doing."
|
1489 |
msgstr ""
|
1490 |
|
1491 |
-
#: src/features/firewall.php:
|
1492 |
msgid "Whitelist"
|
1493 |
msgstr ""
|
1494 |
|
1495 |
-
#: src/features/firewall.php:
|
1496 |
msgid "Include Cookies"
|
1497 |
msgstr ""
|
1498 |
|
1499 |
-
#: src/features/firewall.php:
|
1500 |
msgid "Also Test Cookie Values In Firewall Tests"
|
1501 |
msgstr ""
|
1502 |
|
1503 |
-
#: src/features/firewall.php:
|
1504 |
msgid ""
|
1505 |
"The firewall tests GET and POST, but with this option checked it will also "
|
1506 |
"check COOKIE values."
|
1507 |
msgstr ""
|
1508 |
|
1509 |
-
#: src/features/firewall.php:
|
1510 |
msgid "Directory Traversals"
|
1511 |
msgstr ""
|
1512 |
|
1513 |
-
#: src/features/firewall.php:
|
1514 |
msgid "Block Directory Traversals"
|
1515 |
msgstr ""
|
1516 |
|
1517 |
-
#: src/features/firewall.php:
|
1518 |
#, php-format
|
1519 |
msgid ""
|
1520 |
"This will block directory traversal paths in in application parameters (e.g. "
|
1521 |
"%s, etc)."
|
1522 |
msgstr ""
|
1523 |
|
1524 |
-
#: src/features/firewall.php:
|
1525 |
msgid "SQL Queries"
|
1526 |
msgstr ""
|
1527 |
|
1528 |
-
#: src/features/firewall.php:
|
1529 |
msgid "Block SQL Queries"
|
1530 |
msgstr ""
|
1531 |
|
1532 |
-
#: src/features/firewall.php:
|
1533 |
#, php-format
|
1534 |
msgid "This will block sql in application parameters (e.g. %s, etc)."
|
1535 |
msgstr ""
|
1536 |
|
1537 |
-
#: src/features/firewall.php:
|
1538 |
msgid "WordPress Terms"
|
1539 |
msgstr ""
|
1540 |
|
1541 |
-
#: src/features/firewall.php:
|
1542 |
msgid "Block WordPress Specific Terms"
|
1543 |
msgstr ""
|
1544 |
|
1545 |
-
#: src/features/firewall.php:
|
1546 |
msgid ""
|
1547 |
"This will block WordPress specific terms in application parameters (wp_, "
|
1548 |
"user_login, etc.)."
|
1549 |
msgstr ""
|
1550 |
|
1551 |
-
#: src/features/firewall.php:
|
1552 |
msgid "Field Truncation"
|
1553 |
msgstr ""
|
1554 |
|
1555 |
-
#: src/features/firewall.php:
|
1556 |
msgid "Block Field Truncation Attacks"
|
1557 |
msgstr ""
|
1558 |
|
1559 |
-
#: src/features/firewall.php:
|
1560 |
msgid "This will block field truncation attacks in application parameters."
|
1561 |
msgstr ""
|
1562 |
|
1563 |
-
#: src/features/firewall.php:
|
1564 |
msgid "PHP Code"
|
1565 |
msgstr ""
|
1566 |
|
1567 |
-
#: src/features/firewall.php:
|
1568 |
#, php-format
|
1569 |
msgid "Block %s"
|
1570 |
msgstr ""
|
1571 |
|
1572 |
-
#: src/features/firewall.php:
|
1573 |
msgid "PHP Code Includes"
|
1574 |
msgstr ""
|
1575 |
|
1576 |
-
#: src/features/firewall.php:
|
1577 |
msgid "This will block any data that appears to try and include PHP files."
|
1578 |
msgstr ""
|
1579 |
|
1580 |
-
#: src/features/firewall.php:
|
1581 |
msgid "Will probably block saving within the Plugin/Theme file editors."
|
1582 |
msgstr ""
|
1583 |
|
1584 |
-
#: src/features/firewall.php:
|
1585 |
msgid "Exe File Uploads"
|
1586 |
msgstr ""
|
1587 |
|
1588 |
-
#: src/features/firewall.php:
|
1589 |
msgid "Block Executable File Uploads"
|
1590 |
msgstr ""
|
1591 |
|
1592 |
-
#: src/features/firewall.php:
|
1593 |
msgid "This will block executable file uploads (.php, .exe, etc.)."
|
1594 |
msgstr ""
|
1595 |
|
1596 |
-
#: src/features/firewall.php:
|
1597 |
msgid "Leading Schemas"
|
1598 |
msgstr ""
|
1599 |
|
1600 |
-
#: src/features/firewall.php:
|
1601 |
msgid "Block Leading Schemas (HTTPS / HTTP)"
|
1602 |
msgstr ""
|
1603 |
|
1604 |
-
#: src/features/firewall.php:
|
1605 |
msgid ""
|
1606 |
"This will block leading schemas http:// and https:// in application "
|
1607 |
"parameters (off by default; may cause problems with other plugins)."
|
1608 |
msgstr ""
|
1609 |
|
1610 |
-
#: src/features/firewall.php:
|
1611 |
msgid "Aggressive Scan"
|
1612 |
msgstr ""
|
1613 |
|
1614 |
-
#: src/features/firewall.php:
|
1615 |
msgid "Aggressively Block Data"
|
1616 |
msgstr ""
|
1617 |
|
1618 |
-
#: src/features/firewall.php:
|
1619 |
msgid ""
|
1620 |
"Employs a set of aggressive rules to detect and block malicious data "
|
1621 |
"submitted to your site."
|
1622 |
msgstr ""
|
1623 |
|
1624 |
-
#: src/features/firewall.php:
|
1625 |
-
#: src/
|
1626 |
-
#: src/
|
1627 |
-
#: src/
|
1628 |
-
#: src/
|
1629 |
-
#: src/processors/
|
1630 |
-
|
1631 |
-
|
|
|
|
|
|
|
|
|
|
|
1632 |
msgstr ""
|
1633 |
|
1634 |
-
#: src/features/firewall.php:
|
1635 |
msgid "May cause an increase in false-positive firewall blocks."
|
1636 |
msgstr ""
|
1637 |
|
1638 |
-
#: src/features/firewall.php:
|
1639 |
msgid "Block Response"
|
1640 |
msgstr ""
|
1641 |
|
1642 |
-
#: src/features/firewall.php:
|
1643 |
msgid "Choose how the firewall responds when it blocks a request"
|
1644 |
msgstr ""
|
1645 |
|
1646 |
-
#: src/features/firewall.php:
|
1647 |
msgid ""
|
1648 |
"We recommend dying with a message so you know what might have occurred when "
|
1649 |
"the firewall blocks you"
|
1650 |
msgstr ""
|
1651 |
|
1652 |
-
#: src/features/firewall.php:
|
1653 |
msgid "Send Email Report"
|
1654 |
msgstr ""
|
1655 |
|
1656 |
-
#: src/features/firewall.php:
|
1657 |
msgid ""
|
1658 |
"When a visitor is blocked the firewall will send an email to the configured "
|
1659 |
"email address"
|
1660 |
msgstr ""
|
1661 |
|
1662 |
-
#: src/features/firewall.php:
|
1663 |
msgid ""
|
1664 |
"Use with caution - if you get hit by automated bots you may send out too "
|
1665 |
"many emails and you could get blocked by your host"
|
1666 |
msgstr ""
|
1667 |
|
1668 |
-
#: src/features/firewall.php:
|
1669 |
msgid "Whitelist Parameters"
|
1670 |
msgstr ""
|
1671 |
|
1672 |
-
#: src/features/firewall.php:
|
1673 |
msgid ""
|
1674 |
"Detail pages and parameters that are whitelisted (ignored by the firewall)"
|
1675 |
msgstr ""
|
1676 |
|
1677 |
-
#: src/features/firewall.php:
|
1678 |
msgid ""
|
1679 |
"This should be used with caution and you should only provide parameter names "
|
1680 |
"that you must have excluded"
|
1681 |
msgstr ""
|
1682 |
|
1683 |
-
#: src/features/firewall.php:
|
1684 |
-
#: src/features/firewall.php:
|
1685 |
#, php-format
|
1686 |
msgid "Ignore %s"
|
1687 |
msgstr ""
|
1688 |
|
1689 |
-
#: src/features/firewall.php:
|
1690 |
-
#: src/features/login_protect.php:
|
1691 |
msgid "Administrators"
|
1692 |
msgstr ""
|
1693 |
|
1694 |
-
#: src/features/firewall.php:
|
1695 |
msgid ""
|
1696 |
"Authenticated administrator users will not be processed by the firewall "
|
1697 |
"rules."
|
1698 |
msgstr ""
|
1699 |
|
1700 |
-
#: src/features/firewall.php:
|
1701 |
msgid "Search Engines"
|
1702 |
msgstr ""
|
1703 |
|
1704 |
-
#: src/features/firewall.php:
|
1705 |
msgid "Ignore Search Engine Bot Traffic"
|
1706 |
msgstr ""
|
1707 |
|
1708 |
-
#: src/features/firewall.php:
|
1709 |
msgid ""
|
1710 |
"The firewall will try to recognise search engine spiders/bots and not apply "
|
1711 |
"firewall rules to them."
|
1712 |
msgstr ""
|
1713 |
|
1714 |
-
#: src/features/firewall.php:
|
1715 |
msgid "Firewall Block Message"
|
1716 |
msgstr ""
|
1717 |
|
1718 |
-
#: src/features/firewall.php:
|
1719 |
msgid "Message Displayed To Visitor When A Firewall Block Is Triggered"
|
1720 |
msgstr ""
|
1721 |
|
1722 |
-
#: src/features/firewall.php:
|
1723 |
msgid "This is the message displayed to visitors that trigger the firewall."
|
1724 |
msgstr ""
|
1725 |
|
1726 |
-
#: src/features/hack_protect.php:
|
1727 |
#, php-format
|
1728 |
msgid "%s per day"
|
1729 |
msgstr ""
|
1730 |
|
1731 |
-
#: src/features/hack_protect.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1732 |
#, php-format
|
1733 |
msgid ""
|
1734 |
"Sorry, this feature is not available because we cannot write to disk at this "
|
1735 |
"location: \"%s\""
|
1736 |
msgstr ""
|
1737 |
|
1738 |
-
#: src/features/hack_protect.php:
|
1739 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1740 |
msgstr ""
|
1741 |
|
1742 |
-
#: src/features/hack_protect.php:
|
1743 |
msgid "Set how frequently the Hack Guard scans will run."
|
1744 |
msgstr ""
|
1745 |
|
1746 |
-
#: src/features/hack_protect.php:
|
1747 |
msgid ""
|
1748 |
"Hack Guard is a set of tools to warn you and protect you against hacks on "
|
1749 |
"your site."
|
1750 |
msgstr ""
|
1751 |
|
1752 |
-
#: src/features/hack_protect.php:
|
1753 |
msgid "Hack Guard"
|
1754 |
msgstr ""
|
1755 |
|
1756 |
-
#: src/features/hack_protect.php:
|
1757 |
msgid "Vulnerabilities Scanner"
|
1758 |
msgstr ""
|
1759 |
|
1760 |
-
#: src/features/hack_protect.php:
|
1761 |
msgid ""
|
1762 |
"Regularly scan your WordPress plugins and themes for known security "
|
1763 |
"vulnerabilities."
|
1764 |
msgstr ""
|
1765 |
|
1766 |
-
#: src/features/hack_protect.php:
|
1767 |
-
#: src/features/hack_protect.php:
|
1768 |
msgid "Plugin Vulnerabilities Scanner"
|
1769 |
msgstr ""
|
1770 |
|
1771 |
-
#: src/features/hack_protect.php:
|
1772 |
msgid ""
|
1773 |
"Ensure this is turned on and you will always know if any of your assets have "
|
1774 |
"known security vulnerabilities."
|
1775 |
msgstr ""
|
1776 |
|
1777 |
-
#: src/features/hack_protect.php:
|
1778 |
msgid ""
|
1779 |
"Regularly scan your plugins against a database of known vulnerabilities."
|
1780 |
msgstr ""
|
1781 |
|
1782 |
-
#: src/features/hack_protect.php:
|
1783 |
msgid "Plugin Vulnerabilities"
|
1784 |
msgstr ""
|
1785 |
|
1786 |
-
#: src/features/hack_protect.php:
|
1787 |
msgid "Core File Integrity Scanner"
|
1788 |
msgstr ""
|
1789 |
|
1790 |
-
#: src/features/hack_protect.php:
|
1791 |
msgid ""
|
1792 |
"Regularly scan your WordPress core files for changes compared to official "
|
1793 |
"WordPress files."
|
1794 |
msgstr ""
|
1795 |
|
1796 |
-
#: src/features/hack_protect.php:
|
1797 |
msgid "Core File Scanner"
|
1798 |
msgstr ""
|
1799 |
|
1800 |
-
#: src/features/hack_protect.php:
|
1801 |
-
#: src/features/hack_protect.php:
|
1802 |
msgid "Unrecognised Files Scanner"
|
1803 |
msgstr ""
|
1804 |
|
1805 |
-
#: src/features/hack_protect.php:
|
1806 |
msgid "Regularly scan your WordPress core folders for files that don't belong."
|
1807 |
msgstr ""
|
1808 |
|
1809 |
-
#: src/features/hack_protect.php:
|
1810 |
msgid "Plugins and Themes Guard"
|
1811 |
msgstr ""
|
1812 |
|
1813 |
-
#: src/features/hack_protect.php:
|
1814 |
msgid "Plugins/Themes Guard"
|
1815 |
msgstr ""
|
1816 |
|
1817 |
-
#: src/features/hack_protect.php:
|
1818 |
msgid "Detect malicious changes to your themes and plugins."
|
1819 |
msgstr ""
|
1820 |
|
1821 |
-
#: src/features/hack_protect.php:
|
1822 |
msgid "Keep the Plugins/Theme Guard feature turned on."
|
1823 |
msgstr ""
|
1824 |
|
1825 |
-
#: src/features/hack_protect.php:
|
1826 |
-
msgid "
|
1827 |
msgstr ""
|
1828 |
|
1829 |
-
#: src/features/hack_protect.php:
|
1830 |
msgid "Integrity Checks"
|
1831 |
msgstr ""
|
1832 |
|
1833 |
-
#: src/features/hack_protect.php:
|
1834 |
msgid "Monitor for unrecognised changes to your system."
|
1835 |
msgstr ""
|
1836 |
|
1837 |
-
#: src/features/hack_protect.php:
|
1838 |
msgid "Enable these to prevent unauthorized changes to your WordPress site."
|
1839 |
msgstr ""
|
1840 |
|
1841 |
-
#: src/features/hack_protect.php:
|
1842 |
msgid "Daily Scan Frequency"
|
1843 |
msgstr ""
|
1844 |
|
1845 |
-
#: src/features/hack_protect.php:
|
1846 |
msgid "Number Of Times To Automatically Run File Scan In 24hrs"
|
1847 |
msgstr ""
|
1848 |
|
1849 |
-
#: src/features/hack_protect.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1850 |
msgid ""
|
1851 |
-
"
|
1852 |
-
"
|
1853 |
msgstr ""
|
1854 |
|
1855 |
-
#: src/features/hack_protect.php:
|
1856 |
#, php-format
|
1857 |
msgid "Daily Cron - %s"
|
1858 |
msgstr ""
|
1859 |
|
1860 |
-
#: src/features/hack_protect.php:
|
1861 |
msgid "Scans Plugins For Known Vulnerabilities"
|
1862 |
msgstr ""
|
1863 |
|
1864 |
-
#: src/features/hack_protect.php:
|
1865 |
msgid ""
|
1866 |
"Runs a scan of all your plugins against a database of known WordPress plugin "
|
1867 |
"vulnerabilities."
|
1868 |
msgstr ""
|
1869 |
|
1870 |
-
#: src/features/hack_protect.php:
|
1871 |
msgid "Vulnerability Scanner"
|
1872 |
msgstr ""
|
1873 |
|
1874 |
-
#: src/features/hack_protect.php:
|
1875 |
msgid "Enable The Vulnerability Scanner"
|
1876 |
msgstr ""
|
1877 |
|
1878 |
-
#: src/features/hack_protect.php:
|
1879 |
msgid ""
|
1880 |
"Runs a scan of all your plugins against a database of known WordPress "
|
1881 |
"vulnerabilities."
|
1882 |
msgstr ""
|
1883 |
|
1884 |
-
#: src/features/hack_protect.php:
|
1885 |
msgid "Apply Updates Automatically To Vulnerable Plugins"
|
1886 |
msgstr ""
|
1887 |
|
1888 |
-
#: src/features/hack_protect.php:
|
1889 |
msgid ""
|
1890 |
"When an update becomes available, automatically apply updates to items with "
|
1891 |
"known vulnerabilities."
|
1892 |
msgstr ""
|
1893 |
|
1894 |
-
#: src/features/hack_protect.php:
|
1895 |
msgid "Highlight Plugins"
|
1896 |
msgstr ""
|
1897 |
|
1898 |
-
#: src/features/hack_protect.php:
|
1899 |
msgid "Highlight Vulnerable Plugins Upon Display"
|
1900 |
msgstr ""
|
1901 |
|
1902 |
-
#: src/features/hack_protect.php:
|
1903 |
msgid "Vulnerable plugins will be highlighted on the main plugins page."
|
1904 |
msgstr ""
|
1905 |
|
1906 |
-
#: src/features/hack_protect.php:
|
1907 |
msgid "Scans WordPress Core Files For Alterations"
|
1908 |
msgstr ""
|
1909 |
|
1910 |
-
#: src/features/hack_protect.php:
|
1911 |
msgid ""
|
1912 |
"Compares all WordPress core files on your site against the official "
|
1913 |
"WordPress files."
|
1914 |
msgstr ""
|
1915 |
|
1916 |
-
#: src/features/hack_protect.php:
|
1917 |
msgid "WordPress Core files should never be altered for any reason."
|
1918 |
msgstr ""
|
1919 |
|
1920 |
-
#: src/features/hack_protect.php:
|
1921 |
msgid "Auto Repair"
|
1922 |
msgstr ""
|
1923 |
|
1924 |
-
#: src/features/hack_protect.php:
|
1925 |
msgid "Automatically Repair WordPress Core Files That Have Been Altered"
|
1926 |
msgstr ""
|
1927 |
|
1928 |
-
#: src/features/hack_protect.php:
|
1929 |
msgid ""
|
1930 |
"Attempts to automatically repair WordPress Core files with the official "
|
1931 |
"WordPress file data, for files that have been altered or are missing."
|
1932 |
msgstr ""
|
1933 |
|
1934 |
-
#: src/features/hack_protect.php:
|
1935 |
msgid "Daily Scan For Unrecognised Files In Core Directories"
|
1936 |
msgstr ""
|
1937 |
|
1938 |
-
#: src/features/hack_protect.php:
|
1939 |
msgid ""
|
1940 |
"Scans for, and automatically deletes, any files in your core WordPress "
|
1941 |
"folders that are not part of your WordPress installation."
|
1942 |
msgstr ""
|
1943 |
|
1944 |
-
#: src/features/hack_protect.php:
|
1945 |
msgid "Scan Uploads"
|
1946 |
msgstr ""
|
1947 |
|
1948 |
-
#: src/features/hack_protect.php:
|
1949 |
msgid "Scan Uploads Folder For PHP and Javascript"
|
1950 |
msgstr ""
|
1951 |
|
1952 |
-
#: src/features/hack_protect.php:
|
1953 |
msgid ""
|
1954 |
"Take care when turning on this option - if you are unsure, leave it disabled."
|
1955 |
msgstr ""
|
1956 |
|
1957 |
-
#: src/features/hack_protect.php:
|
1958 |
msgid ""
|
1959 |
"The Uploads folder is primarily for media, but could be used to store "
|
1960 |
"nefarious files."
|
1961 |
msgstr ""
|
1962 |
|
1963 |
-
#: src/features/hack_protect.php:
|
1964 |
msgid "File Exclusions"
|
1965 |
msgstr ""
|
1966 |
|
1967 |
-
#: src/features/hack_protect.php:
|
1968 |
msgid "Provide A List Of Files To Be Excluded From The Scan"
|
1969 |
msgstr ""
|
1970 |
|
1971 |
-
#: src/features/hack_protect.php:
|
1972 |
msgid "Take a new line for each file you wish to exclude from the scan."
|
1973 |
msgstr ""
|
1974 |
|
1975 |
-
#: src/features/hack_protect.php:
|
1976 |
msgid "No commas are necessary."
|
1977 |
msgstr ""
|
1978 |
|
1979 |
-
#: src/features/hack_protect.php:
|
1980 |
msgid "Enable Integrity Scan"
|
1981 |
msgstr ""
|
1982 |
|
1983 |
-
#: src/features/hack_protect.php:
|
1984 |
msgid "Scans For Critical Changes Made To Your WordPress Site"
|
1985 |
msgstr ""
|
1986 |
|
1987 |
-
#: src/features/hack_protect.php:
|
1988 |
msgid "Detects changes made to your WordPress site outside of WordPress."
|
1989 |
msgstr ""
|
1990 |
|
1991 |
-
#: src/features/hack_protect.php:
|
1992 |
msgid "Monitor User Accounts"
|
1993 |
msgstr ""
|
1994 |
|
1995 |
-
#: src/features/hack_protect.php:
|
1996 |
msgid "Scans For Critical Changes Made To User Accounts"
|
1997 |
msgstr ""
|
1998 |
|
1999 |
-
#: src/features/hack_protect.php:
|
2000 |
msgid ""
|
2001 |
"Detects changes made to critical user account information that were made "
|
2002 |
"directly on the database and outside of the WordPress system."
|
2003 |
msgstr ""
|
2004 |
|
2005 |
-
#: src/features/hack_protect.php:
|
2006 |
msgid "An example of this might be some form of SQL Injection attack."
|
2007 |
msgstr ""
|
2008 |
|
2009 |
-
#: src/features/hack_protect.php:
|
2010 |
-
#: src/features/ips.php:243 src/features/ips.php:250
|
2011 |
-
#: src/features/lockdown.php:173
|
2012 |
-
#, php-format
|
2013 |
-
msgid "Warning: %s"
|
2014 |
-
msgstr ""
|
2015 |
-
|
2016 |
-
#: src/features/hack_protect.php:718
|
2017 |
msgid ""
|
2018 |
"Enabling this option for every page low may slow down your site with large "
|
2019 |
"numbers of users."
|
2020 |
msgstr ""
|
2021 |
|
2022 |
-
#: src/features/hack_protect.php:
|
2023 |
msgid ""
|
2024 |
-
"This option may cause
|
2025 |
"user accounts."
|
2026 |
msgstr ""
|
2027 |
|
2028 |
-
#: src/features/hack_protect.php:
|
2029 |
-
#: src/features/headers.php:
|
2030 |
-
#: src/features/login_protect.php:
|
|
|
2031 |
#, php-format
|
2032 |
msgid "Enable %s"
|
2033 |
msgstr ""
|
2034 |
|
2035 |
-
#: src/features/hack_protect.php:
|
2036 |
msgid "Guard"
|
2037 |
msgstr ""
|
2038 |
|
2039 |
-
#: src/features/hack_protect.php:
|
2040 |
msgid "Enable The Guard For Plugin And Theme Files"
|
2041 |
msgstr ""
|
2042 |
|
2043 |
-
#: src/features/hack_protect.php:
|
2044 |
msgid ""
|
2045 |
"When enabled the Guard will automatically scan for changes to your Plugin "
|
2046 |
"and Theme files."
|
2047 |
msgstr ""
|
2048 |
|
2049 |
-
#: src/features/hack_protect.php:
|
2050 |
msgid "Guard/Scan Depth"
|
2051 |
msgstr ""
|
2052 |
|
2053 |
-
#: src/features/hack_protect.php:
|
2054 |
msgid "How Deep Into The Plugin Directories To Scan And Guard"
|
2055 |
msgstr ""
|
2056 |
|
2057 |
-
#: src/features/hack_protect.php:
|
2058 |
msgid ""
|
2059 |
"The Guard normally scans only the top level of a folder. Increasing depth "
|
2060 |
"will increase scan times."
|
2061 |
msgstr ""
|
2062 |
|
2063 |
-
#: src/features/hack_protect.php:
|
2064 |
#, php-format
|
2065 |
msgid ""
|
2066 |
"Setting it to %s will remove this limit and all sub-folders will be scanned "
|
2067 |
"- not recommended"
|
2068 |
msgstr ""
|
2069 |
|
2070 |
-
#: src/features/hack_protect.php:
|
2071 |
msgid "Included File Types"
|
2072 |
msgstr ""
|
2073 |
|
2074 |
-
#: src/features/hack_protect.php:
|
2075 |
msgid "The File Types (by File Extension) Included In The Scan"
|
2076 |
msgstr ""
|
2077 |
|
2078 |
-
#: src/features/hack_protect.php:
|
2079 |
msgid "Take a new line for each file extension."
|
2080 |
msgstr ""
|
2081 |
|
2082 |
-
#: src/features/hack_protect.php:
|
2083 |
msgid "No commas(,) or periods(.) necessary."
|
2084 |
msgstr ""
|
2085 |
|
2086 |
-
#: src/features/hack_protect.php:
|
2087 |
msgid "Remove all extensions to scan all file type (not recommended)."
|
2088 |
msgstr ""
|
2089 |
|
2090 |
-
#: src/features/hack_protect.php:
|
2091 |
msgid "Show Re-Install Links"
|
2092 |
msgstr ""
|
2093 |
|
2094 |
-
#: src/features/hack_protect.php:
|
2095 |
msgid "Show Re-Install Links For Plugins"
|
2096 |
msgstr ""
|
2097 |
|
2098 |
-
#: src/features/hack_protect.php:
|
2099 |
msgid ""
|
2100 |
"Show links to re-install plugins and offer re-install when activating "
|
2101 |
"plugins."
|
2102 |
msgstr ""
|
2103 |
|
2104 |
-
#: src/features/headers.php:
|
2105 |
msgid ""
|
2106 |
"Protect visitors to your site by implementing increased security response "
|
2107 |
"headers."
|
2108 |
msgstr ""
|
2109 |
|
2110 |
-
#: src/features/headers.php:
|
2111 |
-
#: src/features/headers.php:
|
2112 |
msgid ""
|
2113 |
"Enabling these features are advised, but you must test them on your site "
|
2114 |
"thoroughly."
|
2115 |
msgstr ""
|
2116 |
|
2117 |
-
#: src/features/headers.php:
|
2118 |
msgid "Advanced Security Headers"
|
2119 |
msgstr ""
|
2120 |
|
2121 |
-
#: src/features/headers.php:
|
2122 |
msgid "Security Headers"
|
2123 |
msgstr ""
|
2124 |
|
2125 |
-
#: src/features/headers.php:
|
2126 |
-
#: src/features/headers.php:
|
2127 |
msgid "Content Security Policy"
|
2128 |
msgstr ""
|
2129 |
|
2130 |
-
#: src/features/headers.php:
|
2131 |
msgid ""
|
2132 |
"Restrict the sources and types of content that may be loaded and processed "
|
2133 |
"by visitor browsers."
|
2134 |
msgstr ""
|
2135 |
|
2136 |
-
#: src/features/headers.php:
|
2137 |
msgid "Block iFrames"
|
2138 |
msgstr ""
|
2139 |
|
2140 |
-
#: src/features/headers.php:
|
2141 |
msgid "Block Remote iFrames Of This Site"
|
2142 |
msgstr ""
|
2143 |
|
2144 |
-
#: src/features/headers.php:
|
2145 |
msgid ""
|
2146 |
"The setting prevents any external website from embedding your site in an "
|
2147 |
"iFrame."
|
2148 |
msgstr ""
|
2149 |
|
2150 |
-
#: src/features/headers.php:
|
2151 |
msgid "This is useful for preventing so-called \"ClickJack attacks\"."
|
2152 |
msgstr ""
|
2153 |
|
2154 |
-
#: src/features/headers.php:
|
2155 |
msgid "Referrer Policy"
|
2156 |
msgstr ""
|
2157 |
|
2158 |
-
#: src/features/headers.php:
|
2159 |
msgid "Referrer Policy Header"
|
2160 |
msgstr ""
|
2161 |
|
2162 |
-
#: src/features/headers.php:
|
2163 |
msgid ""
|
2164 |
"The Referrer Policy Header allows you to control when and what referral "
|
2165 |
"information a browser may pass along with links clicked on your site."
|
2166 |
msgstr ""
|
2167 |
|
2168 |
-
#: src/features/headers.php:
|
2169 |
msgid "XSS Protection"
|
2170 |
msgstr ""
|
2171 |
|
2172 |
-
#: src/features/headers.php:
|
2173 |
msgid "Employ Built-In Browser XSS Protection"
|
2174 |
msgstr ""
|
2175 |
|
2176 |
-
#: src/features/headers.php:
|
2177 |
msgid ""
|
2178 |
"Directs compatible browsers to block what they detect as Reflective XSS "
|
2179 |
"attacks."
|
2180 |
msgstr ""
|
2181 |
|
2182 |
-
#: src/features/headers.php:
|
2183 |
msgid "Prevent Mime-Sniff"
|
2184 |
msgstr ""
|
2185 |
|
2186 |
-
#: src/features/headers.php:
|
2187 |
msgid "Turn-Off Browser Mime-Sniff"
|
2188 |
msgstr ""
|
2189 |
|
2190 |
-
#: src/features/headers.php:
|
2191 |
msgid "Reduces visitor exposure to malicious user-uploaded content."
|
2192 |
msgstr ""
|
2193 |
|
2194 |
-
#: src/features/headers.php:
|
2195 |
msgid ""
|
2196 |
"Allows for permission and restriction of all resources loaded on your site."
|
2197 |
msgstr ""
|
2198 |
|
2199 |
-
#: src/features/headers.php:
|
2200 |
msgid "Self"
|
2201 |
msgstr ""
|
2202 |
|
2203 |
-
#: src/features/headers.php:
|
2204 |
msgid "Allow 'self' Directive"
|
2205 |
msgstr ""
|
2206 |
|
2207 |
-
#: src/features/headers.php:
|
2208 |
msgid "Using 'self' is generally recommended."
|
2209 |
msgstr ""
|
2210 |
|
2211 |
-
#: src/features/headers.php:
|
2212 |
msgid ""
|
2213 |
"It essentially means that resources from your own host:protocol are "
|
2214 |
"permitted."
|
2215 |
msgstr ""
|
2216 |
|
2217 |
-
#: src/features/headers.php:
|
2218 |
msgid "Inline Entities"
|
2219 |
msgstr ""
|
2220 |
|
2221 |
-
#: src/features/headers.php:
|
2222 |
msgid "Allow Inline Scripts and CSS"
|
2223 |
msgstr ""
|
2224 |
|
2225 |
-
#: src/features/headers.php:
|
2226 |
msgid ""
|
2227 |
"Allows parsing of Javascript and CSS declared in-line in your html document."
|
2228 |
msgstr ""
|
2229 |
|
2230 |
-
#: src/features/headers.php:
|
2231 |
msgid "Embedded Data"
|
2232 |
msgstr ""
|
2233 |
|
2234 |
-
#: src/features/headers.php:
|
2235 |
msgid "Allow \"data:\" Directives"
|
2236 |
msgstr ""
|
2237 |
|
2238 |
-
#: src/features/headers.php:
|
2239 |
msgid ""
|
2240 |
"Allows use of embedded data directives, most commonly used for images and "
|
2241 |
"fonts."
|
2242 |
msgstr ""
|
2243 |
|
2244 |
-
#: src/features/headers.php:
|
2245 |
msgid "Allow eval()"
|
2246 |
msgstr ""
|
2247 |
|
2248 |
-
#: src/features/headers.php:
|
2249 |
msgid "Allow Javascript eval()"
|
2250 |
msgstr ""
|
2251 |
|
2252 |
-
#: src/features/headers.php:
|
2253 |
msgid "Permits the use of Javascript the eval() function."
|
2254 |
msgstr ""
|
2255 |
|
2256 |
-
#: src/features/headers.php:
|
2257 |
msgid "HTTPS"
|
2258 |
msgstr ""
|
2259 |
|
2260 |
-
#: src/features/headers.php:
|
2261 |
msgid "HTTPS Resource Loading"
|
2262 |
msgstr ""
|
2263 |
|
2264 |
-
#: src/features/headers.php:
|
2265 |
msgid "Allows loading of any content provided over HTTPS."
|
2266 |
msgstr ""
|
2267 |
|
2268 |
-
#: src/features/headers.php:
|
2269 |
msgid "Permitted Hosts"
|
2270 |
msgstr ""
|
2271 |
|
2272 |
-
#: src/features/headers.php:
|
2273 |
msgid "Permitted Hosts and Domains"
|
2274 |
msgstr ""
|
2275 |
|
2276 |
-
#: src/features/headers.php:
|
2277 |
msgid ""
|
2278 |
"You can explicitly state which hosts/domain from which content may be loaded."
|
2279 |
msgstr ""
|
2280 |
|
2281 |
-
#: src/features/headers.php:
|
2282 |
msgid ""
|
2283 |
"Take great care and test your site as you may block legitimate resources."
|
2284 |
msgstr ""
|
2285 |
|
2286 |
-
#: src/features/headers.php:
|
2287 |
msgid "If in-doubt, leave blank or use \"*\" only."
|
2288 |
msgstr ""
|
2289 |
|
2290 |
-
#: src/features/headers.php:
|
2291 |
msgid ""
|
2292 |
"You can force only HTTPS for a given domain by prefixing it with \"https://"
|
2293 |
"\"."
|
2294 |
msgstr ""
|
2295 |
|
2296 |
-
#: src/features/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2297 |
msgid "Manage IP Lists"
|
2298 |
msgstr ""
|
2299 |
|
2300 |
-
#: src/features/ips.php:
|
2301 |
msgid "Add/Remove IPs"
|
2302 |
msgstr ""
|
2303 |
|
2304 |
-
#: src/features/ips.php:
|
2305 |
-
|
2306 |
-
msgid "now: %s"
|
2307 |
msgstr ""
|
2308 |
|
2309 |
-
#: src/features/ips.php:
|
2310 |
msgid ""
|
2311 |
"Repeated login attempts that fail will result in a complete ban of your IP "
|
2312 |
"Address."
|
2313 |
msgstr ""
|
2314 |
|
2315 |
-
#: src/features/ips.php:
|
2316 |
#, php-format
|
2317 |
msgid ""
|
2318 |
"You have %s remaining transgression(s) against this site and then you will "
|
2319 |
"be black listed."
|
2320 |
msgstr ""
|
2321 |
|
2322 |
-
#: src/features/ips.php:
|
2323 |
msgid "Seriously, stop repeating what you are doing or you will be locked out."
|
2324 |
msgstr ""
|
2325 |
|
2326 |
-
#: src/features/ips.php:
|
2327 |
msgid ""
|
2328 |
"The IP Manager allows you to whitelist, blacklist and configure auto-"
|
2329 |
"blacklist rules."
|
2330 |
msgstr ""
|
2331 |
|
2332 |
-
#: src/features/ips.php:
|
2333 |
-
#: src/wizards/plugin.php:
|
2334 |
msgid "IP Manager"
|
2335 |
msgstr ""
|
2336 |
|
2337 |
-
#: src/features/ips.php:
|
2338 |
msgid "You should also carefully review the automatic black list settings."
|
2339 |
msgstr ""
|
2340 |
|
2341 |
-
#: src/features/ips.php:
|
2342 |
msgid "Automatic IP Black List"
|
2343 |
msgstr ""
|
2344 |
|
2345 |
-
#: src/features/ips.php:
|
2346 |
msgid ""
|
2347 |
"The Automatic IP Black List system will block the IP addresses of naughty "
|
2348 |
"visitors after a specified number of transgressions."
|
2349 |
msgstr ""
|
2350 |
|
2351 |
-
#: src/features/ips.php:
|
2352 |
msgid "Auto Black List"
|
2353 |
msgstr ""
|
2354 |
|
2355 |
-
#: src/features/ips.php:
|
2356 |
msgid "Bad Request Tracking"
|
2357 |
msgstr ""
|
2358 |
|
2359 |
-
#: src/features/ips.php:
|
2360 |
msgid "Request Tracking"
|
2361 |
msgstr ""
|
2362 |
|
2363 |
-
#: src/features/ips.php:
|
2364 |
msgid "Track strange behaviour to determine whether visitors are legitimate."
|
2365 |
msgstr ""
|
2366 |
|
2367 |
-
#: src/features/ips.php:
|
2368 |
msgid ""
|
2369 |
"These aren't security issues in their own right, but may indicate probing "
|
2370 |
"bots."
|
2371 |
msgstr ""
|
2372 |
|
2373 |
-
#: src/features/ips.php:
|
2374 |
msgid "Transgression Limit"
|
2375 |
msgstr ""
|
2376 |
|
2377 |
-
#: src/features/ips.php:
|
2378 |
msgid ""
|
2379 |
"Visitor IP address will be Black Listed after X bad actions on your site"
|
2380 |
msgstr ""
|
2381 |
|
2382 |
-
#: src/features/ips.php:
|
2383 |
#, php-format
|
2384 |
msgid ""
|
2385 |
"A black mark is set against an IP address each time a visitor trips the "
|
2386 |
"defenses of the %s plugin."
|
2387 |
msgstr ""
|
2388 |
|
2389 |
-
#: src/features/ips.php:
|
2390 |
msgid ""
|
2391 |
"When the number of these transgressions exceeds specified limit, they are "
|
2392 |
"automatically blocked from accessing the site."
|
2393 |
msgstr ""
|
2394 |
|
2395 |
-
#: src/features/ips.php:
|
2396 |
#, php-format
|
2397 |
msgid "Set this to \"0\" to turn off the %s feature."
|
2398 |
msgstr ""
|
2399 |
|
2400 |
-
#: src/features/ips.php:
|
2401 |
msgid "Auto Block Expiration"
|
2402 |
msgstr ""
|
2403 |
|
2404 |
-
#: src/features/ips.php:
|
2405 |
msgid "After 1 \"X\" a black listed IP will be removed from the black list"
|
2406 |
msgstr ""
|
2407 |
|
2408 |
-
#: src/features/ips.php:
|
2409 |
msgid "Permanent and lengthy IP Black Lists are harmful to performance."
|
2410 |
msgstr ""
|
2411 |
|
2412 |
-
#: src/features/ips.php:
|
2413 |
msgid ""
|
2414 |
"You should allow IP addresses on the black list to be eventually removed "
|
2415 |
"over time."
|
2416 |
msgstr ""
|
2417 |
|
2418 |
-
#: src/features/ips.php:
|
2419 |
msgid ""
|
2420 |
"Shorter IP black lists are more efficient and a more intelligent use of an "
|
2421 |
"IP-based blocking system."
|
2422 |
msgstr ""
|
2423 |
|
2424 |
-
#: src/features/ips.php:
|
2425 |
msgid "Track 404s"
|
2426 |
msgstr ""
|
2427 |
|
2428 |
-
#: src/features/ips.php:
|
2429 |
msgid "Use 404s As An Transgression"
|
2430 |
msgstr ""
|
2431 |
|
2432 |
-
#: src/features/ips.php:
|
2433 |
msgid "Repeated 404s may indicate a probing bot."
|
2434 |
msgstr ""
|
2435 |
|
2436 |
-
#: src/features/ips.php:
|
2437 |
msgid "Login Failed"
|
2438 |
msgstr ""
|
2439 |
|
2440 |
-
#: src/features/ips.php:
|
2441 |
msgid "Visitor Triggers The IP Transgression System Through A Failed Login"
|
2442 |
msgstr ""
|
2443 |
|
2444 |
-
#: src/features/ips.php:
|
2445 |
msgid "This message is displayed if the visitor fails a login attempt."
|
2446 |
msgstr ""
|
2447 |
|
2448 |
-
#: src/features/ips.php:
|
2449 |
msgid "Remaining Transgressions"
|
2450 |
msgstr ""
|
2451 |
|
2452 |
-
#: src/features/ips.php:
|
2453 |
msgid "Visitor Triggers The IP Transgression System Through A Firewall Block"
|
2454 |
msgstr ""
|
2455 |
|
2456 |
-
#: src/features/ips.php:
|
2457 |
msgid ""
|
2458 |
"This message is displayed if the visitor triggered the IP Transgression "
|
2459 |
"system and reports how many transgressions remain before being blocked."
|
2460 |
msgstr ""
|
2461 |
|
2462 |
-
#: src/features/ips.php:
|
2463 |
#, php-format
|
2464 |
msgid ""
|
2465 |
"Sorry, the %s feature may not be disabled while there are IP addresses in "
|
2466 |
"the White List"
|
2467 |
msgstr ""
|
2468 |
|
2469 |
-
#: src/features/license.php:
|
2470 |
msgid "Name"
|
2471 |
msgstr ""
|
2472 |
|
2473 |
-
#: src/features/license.php:
|
2474 |
msgid "Active"
|
2475 |
msgstr ""
|
2476 |
|
2477 |
-
#: src/features/license.php:
|
2478 |
msgid "Status"
|
2479 |
msgstr ""
|
2480 |
|
2481 |
-
#: src/features/license.php:
|
2482 |
msgid "Key"
|
2483 |
msgstr ""
|
2484 |
|
2485 |
-
#: src/features/license.php:
|
2486 |
msgid "Expires"
|
2487 |
msgstr ""
|
2488 |
|
2489 |
-
#: src/features/license.php:
|
2490 |
msgid "Owner"
|
2491 |
msgstr ""
|
2492 |
|
2493 |
-
#: src/features/license.php:
|
2494 |
msgid "Checked"
|
2495 |
msgstr ""
|
2496 |
|
2497 |
-
#: src/features/license.php:
|
2498 |
msgid "Error"
|
2499 |
msgstr ""
|
2500 |
|
2501 |
-
#: src/features/license.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2502 |
msgid "License Options"
|
2503 |
msgstr ""
|
2504 |
|
2505 |
-
#: src/features/license.php:
|
2506 |
-
|
|
|
2507 |
msgstr ""
|
2508 |
|
2509 |
-
#: src/features/license.php:
|
2510 |
msgid "TODO."
|
2511 |
msgstr ""
|
2512 |
|
2513 |
-
#: src/features/license.php:
|
2514 |
-
#: src/features/license.php:
|
2515 |
msgid "License Key"
|
2516 |
msgstr ""
|
2517 |
|
2518 |
-
#: src/features/lockdown.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2519 |
msgid ""
|
2520 |
"Lockdown helps secure-up certain loosely-controlled WordPress settings on "
|
2521 |
"your site."
|
2522 |
msgstr ""
|
2523 |
|
2524 |
-
#: src/features/lockdown.php:
|
2525 |
-
msgid "Lockdown"
|
2526 |
-
msgstr ""
|
2527 |
-
|
2528 |
-
#: src/features/lockdown.php:73 src/features/lockdown.php:78
|
2529 |
msgid "API & XML-RPC"
|
2530 |
msgstr ""
|
2531 |
|
2532 |
-
#: src/features/lockdown.php:
|
2533 |
msgid "Lockdown certain core WordPress system features."
|
2534 |
msgstr ""
|
2535 |
|
2536 |
-
#: src/features/lockdown.php:
|
2537 |
msgid ""
|
2538 |
"This depends on your usage and needs for certain WordPress functions and "
|
2539 |
"features."
|
2540 |
msgstr ""
|
2541 |
|
2542 |
-
#: src/features/lockdown.php:
|
2543 |
msgid "Permissions and Access Options"
|
2544 |
msgstr ""
|
2545 |
|
2546 |
-
#: src/features/lockdown.php:
|
2547 |
msgid "Provides finer control of certain WordPress permissions."
|
2548 |
msgstr ""
|
2549 |
|
2550 |
-
#: src/features/lockdown.php:
|
2551 |
msgid "Only enable SSL if you have a valid certificate installed."
|
2552 |
msgstr ""
|
2553 |
|
2554 |
-
#: src/features/lockdown.php:
|
2555 |
msgid "Permissions"
|
2556 |
msgstr ""
|
2557 |
|
2558 |
-
#: src/features/lockdown.php:
|
2559 |
msgid "WordPress Obscurity Options"
|
2560 |
msgstr ""
|
2561 |
|
2562 |
-
#: src/features/lockdown.php:
|
2563 |
msgid "Obscures certain WordPress settings from public view."
|
2564 |
msgstr ""
|
2565 |
|
2566 |
-
#: src/features/lockdown.php:
|
2567 |
msgid ""
|
2568 |
"Obscurity is not true security and so these settings are down to your "
|
2569 |
"personal tastes."
|
2570 |
msgstr ""
|
2571 |
|
2572 |
-
#: src/features/lockdown.php:
|
2573 |
msgid "Obscurity"
|
2574 |
msgstr ""
|
2575 |
|
2576 |
-
#: src/features/lockdown.php:
|
2577 |
#, php-format
|
2578 |
msgid "Disable %s"
|
2579 |
msgstr ""
|
2580 |
|
2581 |
-
#: src/features/lockdown.php:
|
2582 |
#, php-format
|
2583 |
msgid "Disable The %s System"
|
2584 |
msgstr ""
|
2585 |
|
2586 |
-
#: src/features/lockdown.php:
|
2587 |
#, php-format
|
2588 |
msgid "Checking this option will completely turn off the whole %s system."
|
2589 |
msgstr ""
|
2590 |
|
2591 |
-
#: src/features/lockdown.php:
|
2592 |
msgid "Anonymous Rest API"
|
2593 |
msgstr ""
|
2594 |
|
2595 |
-
#: src/features/lockdown.php:
|
2596 |
msgid "You can choose to completely disable anonymous access to the REST API."
|
2597 |
msgstr ""
|
2598 |
|
2599 |
-
#: src/features/lockdown.php:
|
2600 |
msgid "Rest API Exclusions"
|
2601 |
msgstr ""
|
2602 |
|
2603 |
-
#: src/features/lockdown.php:
|
2604 |
msgid "Anonymous REST API Exclusions"
|
2605 |
msgstr ""
|
2606 |
|
2607 |
-
#: src/features/lockdown.php:
|
2608 |
msgid ""
|
2609 |
"Any namespaces provided here will be excluded from the Anonymous API "
|
2610 |
"restriction."
|
2611 |
msgstr ""
|
2612 |
|
2613 |
-
#: src/features/lockdown.php:
|
2614 |
msgid "Disable File Editing"
|
2615 |
msgstr ""
|
2616 |
|
2617 |
-
#: src/features/lockdown.php:
|
2618 |
msgid "Disable Ability To Edit Files From Within WordPress"
|
2619 |
msgstr ""
|
2620 |
|
2621 |
-
#: src/features/lockdown.php:
|
2622 |
msgid ""
|
2623 |
"Removes the option to directly edit any files from within the WordPress "
|
2624 |
"admin area."
|
2625 |
msgstr ""
|
2626 |
|
2627 |
-
#: src/features/lockdown.php:
|
2628 |
msgid "Equivalent to setting \"DISALLOW_FILE_EDIT\" to TRUE."
|
2629 |
msgstr ""
|
2630 |
|
2631 |
-
#: src/features/lockdown.php:
|
2632 |
msgid "Force SSL Admin"
|
2633 |
msgstr ""
|
2634 |
|
2635 |
-
#: src/features/lockdown.php:
|
2636 |
msgid "Forces WordPress Admin Dashboard To Be Delivered Over SSL"
|
2637 |
msgstr ""
|
2638 |
|
2639 |
-
#: src/features/lockdown.php:
|
2640 |
msgid ""
|
2641 |
"Please only enable this option if you have a valid SSL certificate installed."
|
2642 |
msgstr ""
|
2643 |
|
2644 |
-
#: src/features/lockdown.php:
|
2645 |
msgid "Equivalent to setting \"FORCE_SSL_ADMIN\" to TRUE."
|
2646 |
msgstr ""
|
2647 |
|
2648 |
-
#: src/features/lockdown.php:
|
2649 |
msgid "Mask WordPress Version"
|
2650 |
msgstr ""
|
2651 |
|
2652 |
-
#: src/features/lockdown.php:
|
2653 |
msgid "Prevents Public Display Of Your WordPress Version"
|
2654 |
msgstr ""
|
2655 |
|
2656 |
-
#: src/features/lockdown.php:
|
2657 |
msgid ""
|
2658 |
"Enter how you would like your WordPress version displayed publicly. Leave "
|
2659 |
"blank to disable this feature."
|
2660 |
msgstr ""
|
2661 |
|
2662 |
-
#: src/features/lockdown.php:
|
2663 |
msgid ""
|
2664 |
-
"
|
2665 |
-
"
|
2666 |
msgstr ""
|
2667 |
|
2668 |
-
#: src/features/lockdown.php:
|
2669 |
msgid "WP Generator Tag"
|
2670 |
msgstr ""
|
2671 |
|
2672 |
-
#: src/features/lockdown.php:
|
2673 |
msgid "Remove WP Generator Meta Tag"
|
2674 |
msgstr ""
|
2675 |
|
2676 |
-
#: src/features/lockdown.php:
|
2677 |
msgid ""
|
2678 |
"Remove a meta tag from your WordPress pages that publicly displays that your "
|
2679 |
"site is WordPress and its current version."
|
2680 |
msgstr ""
|
2681 |
|
2682 |
-
#: src/features/lockdown.php:
|
2683 |
msgid "Block Username Fishing"
|
2684 |
msgstr ""
|
2685 |
|
2686 |
-
#: src/features/lockdown.php:
|
2687 |
msgid "Block the ability to discover WordPress usernames based on author IDs"
|
2688 |
msgstr ""
|
2689 |
|
2690 |
-
#: src/features/lockdown.php:
|
2691 |
#, php-format
|
2692 |
msgid "When enabled, any URL requests containing \"%s\" will be killed."
|
2693 |
msgstr ""
|
2694 |
|
2695 |
-
#: src/features/lockdown.php:
|
2696 |
msgid ""
|
2697 |
"Enabling this option may interfere with expected operations of your site."
|
2698 |
msgstr ""
|
2699 |
|
2700 |
-
#: src/features/login_protect.php:
|
2701 |
msgid "Email verification completed successfully."
|
2702 |
msgstr ""
|
2703 |
|
2704 |
-
#: src/features/login_protect.php:
|
2705 |
msgid "Email verification could not be completed."
|
2706 |
msgstr ""
|
2707 |
|
2708 |
-
#: src/features/login_protect.php:
|
2709 |
msgid ""
|
2710 |
"Before enabling 2-factor email authentication for your WordPress site, you "
|
2711 |
"must verify you can receive this email."
|
2712 |
msgstr ""
|
2713 |
|
2714 |
-
#: src/features/login_protect.php:
|
2715 |
msgid ""
|
2716 |
"This verifies your website can send email and that your account can receive "
|
2717 |
"emails sent from your site."
|
2718 |
msgstr ""
|
2719 |
|
2720 |
-
#: src/features/login_protect.php:
|
2721 |
#, php-format
|
2722 |
msgid "Click the verify link: %s"
|
2723 |
msgstr ""
|
2724 |
|
2725 |
-
#: src/features/login_protect.php:
|
2726 |
#, php-format
|
2727 |
msgid "Here's your code for the guided wizard: %s"
|
2728 |
msgstr ""
|
2729 |
|
2730 |
-
#: src/features/login_protect.php:
|
2731 |
msgid "Email Sending Verification"
|
2732 |
msgstr ""
|
2733 |
|
2734 |
-
#: src/features/login_protect.php:
|
2735 |
msgid "Subscribers"
|
2736 |
msgstr ""
|
2737 |
|
2738 |
-
#: src/features/login_protect.php:
|
2739 |
msgid "Contributors"
|
2740 |
msgstr ""
|
2741 |
|
2742 |
-
#: src/features/login_protect.php:
|
2743 |
msgid "Authors"
|
2744 |
msgstr ""
|
2745 |
|
2746 |
-
#: src/features/login_protect.php:
|
2747 |
msgid "Editors"
|
2748 |
msgstr ""
|
2749 |
|
2750 |
-
#: src/features/login_protect.php:
|
2751 |
msgid "I'm a human."
|
2752 |
msgstr ""
|
2753 |
|
2754 |
-
#: src/features/login_protect.php:
|
2755 |
msgid "Please check the box to show us you're a human."
|
2756 |
msgstr ""
|
2757 |
|
2758 |
-
#: src/features/login_protect.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2759 |
msgid ""
|
2760 |
"Login Guard blocks all automated and brute force attempts to log in to your "
|
2761 |
"site."
|
2762 |
msgstr ""
|
2763 |
|
2764 |
-
#: src/features/login_protect.php:
|
2765 |
-
#: src/wizards/plugin.php:
|
2766 |
msgid "Login Guard"
|
2767 |
msgstr ""
|
2768 |
|
2769 |
-
#: src/features/login_protect.php:
|
2770 |
msgid "Adds Google reCAPTCHA to the Login Forms."
|
2771 |
msgstr ""
|
2772 |
|
2773 |
-
#: src/features/login_protect.php:
|
2774 |
msgid "Hide WordPress Login Page"
|
2775 |
msgstr ""
|
2776 |
|
2777 |
-
#: src/features/login_protect.php:
|
2778 |
#, php-format
|
2779 |
msgid "Rename \"%s\""
|
2780 |
msgstr ""
|
2781 |
|
2782 |
-
#: src/features/login_protect.php:
|
2783 |
msgid "Hide Login Page"
|
2784 |
msgstr ""
|
2785 |
|
2786 |
-
#: src/features/login_protect.php:
|
2787 |
msgid ""
|
2788 |
"To hide your wp-login.php page from brute force attacks and hacking attempts "
|
2789 |
"- if your login page cannot be found, no-one can login."
|
2790 |
msgstr ""
|
2791 |
|
2792 |
-
#: src/features/login_protect.php:
|
2793 |
msgid ""
|
2794 |
"This is not required for complete security and if your site has irregular or "
|
2795 |
"inconsistent configuration it may not work for you."
|
2796 |
msgstr ""
|
2797 |
|
2798 |
-
#: src/features/login_protect.php:
|
2799 |
-
#: src/features/user_management.php:
|
2800 |
msgid "Multi-Factor Authentication"
|
2801 |
msgstr ""
|
2802 |
|
2803 |
-
#: src/features/login_protect.php:
|
2804 |
msgid "Multi-Factor Auth"
|
2805 |
msgstr ""
|
2806 |
|
2807 |
-
#: src/features/login_protect.php:
|
2808 |
msgid ""
|
2809 |
"Verifies the identity of users who log in to your site - i.e. they are who "
|
2810 |
"they say they are."
|
2811 |
msgstr ""
|
2812 |
|
2813 |
-
#: src/features/login_protect.php:
|
2814 |
-
#: src/features/login_protect.php:
|
2815 |
msgid "You may combine multiple authentication factors for increased security."
|
2816 |
msgstr ""
|
2817 |
|
2818 |
-
#: src/features/login_protect.php:
|
2819 |
msgid "Email Two-Factor Authentication"
|
2820 |
msgstr ""
|
2821 |
|
2822 |
-
#: src/features/login_protect.php:
|
2823 |
msgid "2FA - Email"
|
2824 |
msgstr ""
|
2825 |
|
2826 |
-
#: src/features/login_protect.php:
|
2827 |
msgid ""
|
2828 |
"Verifies the identity of users who log in to your site using email-based one-"
|
2829 |
"time-passwords."
|
2830 |
msgstr ""
|
2831 |
|
2832 |
-
#: src/features/login_protect.php:
|
2833 |
msgid "However, if your host blocks email sending you may lock yourself out."
|
2834 |
msgstr ""
|
2835 |
|
2836 |
-
#: src/features/login_protect.php:
|
2837 |
msgid "Google Authenticator Two-Factor Authentication"
|
2838 |
msgstr ""
|
2839 |
|
2840 |
-
#: src/features/login_protect.php:
|
2841 |
msgid "2FA - Google Authenticator"
|
2842 |
msgstr ""
|
2843 |
|
2844 |
-
#: src/features/login_protect.php:
|
2845 |
msgid ""
|
2846 |
"Verifies the identity of users who log in to your site using Google "
|
2847 |
"Authenticator one-time-passwords."
|
2848 |
msgstr ""
|
2849 |
|
2850 |
-
#: src/features/login_protect.php:
|
2851 |
msgid "Brute Force Login Protection"
|
2852 |
msgstr ""
|
2853 |
|
2854 |
-
#: src/features/login_protect.php:
|
2855 |
-
msgid "
|
2856 |
msgstr ""
|
2857 |
|
2858 |
-
#: src/features/login_protect.php:
|
2859 |
msgid ""
|
2860 |
"Blocks brute force hacking attacks against your login and registration pages."
|
2861 |
msgstr ""
|
2862 |
|
2863 |
-
#: src/features/login_protect.php:
|
2864 |
msgid "Yubikey Two-Factor Authentication"
|
2865 |
msgstr ""
|
2866 |
|
2867 |
-
#: src/features/login_protect.php:
|
2868 |
msgid "2FA -Yubikey"
|
2869 |
msgstr ""
|
2870 |
|
2871 |
-
#: src/features/login_protect.php:
|
2872 |
msgid ""
|
2873 |
"Verifies the identity of users who log in to your site using Yubikey one-"
|
2874 |
"time-passwords."
|
2875 |
msgstr ""
|
2876 |
|
2877 |
-
#: src/features/login_protect.php:
|
2878 |
msgid "Hide WP Login Page"
|
2879 |
msgstr ""
|
2880 |
|
2881 |
-
#: src/features/login_protect.php:
|
2882 |
msgid "Hide The WordPress Login Page"
|
2883 |
msgstr ""
|
2884 |
|
2885 |
-
#: src/features/login_protect.php:
|
2886 |
msgid "Creating a path here will disable your wp-login.php"
|
2887 |
msgstr ""
|
2888 |
|
2889 |
-
#: src/features/login_protect.php:
|
2890 |
#, php-format
|
2891 |
msgid "Only letters and numbers are permitted: %s"
|
2892 |
msgstr ""
|
2893 |
|
2894 |
-
#: src/features/login_protect.php:
|
2895 |
#, php-format
|
2896 |
msgid "Your current login URL is: %s"
|
2897 |
msgstr ""
|
2898 |
|
2899 |
-
#: src/features/login_protect.php:
|
2900 |
msgid "Require All Active Authentication Factors"
|
2901 |
msgstr ""
|
2902 |
|
2903 |
-
#: src/features/login_protect.php:
|
2904 |
msgid ""
|
2905 |
"When enabled, all multi-factor authentication methods will be applied to a "
|
2906 |
"user login. Disable to require only one to login."
|
2907 |
msgstr ""
|
2908 |
|
2909 |
-
#: src/features/login_protect.php:
|
2910 |
msgid "Multi-Factor By-Pass"
|
2911 |
msgstr ""
|
2912 |
|
2913 |
-
#: src/features/login_protect.php:
|
2914 |
msgid ""
|
2915 |
"A User Can By-Pass Multi-Factor Authentication (MFA) For The Set Number Of "
|
2916 |
"Days"
|
2917 |
msgstr ""
|
2918 |
|
2919 |
-
#: src/features/login_protect.php:
|
2920 |
msgid ""
|
2921 |
"Enter the number of days a user can by-pass future MFA after a successful "
|
2922 |
"MFA-login. 0 to disable."
|
2923 |
msgstr ""
|
2924 |
|
2925 |
-
#: src/features/login_protect.php:
|
2926 |
#: src/processors/loginprotect_googleauthenticator.php:41
|
2927 |
#: src/processors/loginprotect_googleauthenticator.php:45
|
2928 |
#: src/processors/loginprotect_googleauthenticator.php:47
|
2929 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
2930 |
msgid "Google Authenticator"
|
2931 |
msgstr ""
|
2932 |
|
2933 |
-
#: src/features/login_protect.php:
|
2934 |
msgid "Allow Users To Use Google Authenticator"
|
2935 |
msgstr ""
|
2936 |
|
2937 |
-
#: src/features/login_protect.php:
|
2938 |
msgid ""
|
2939 |
"When enabled, users will have the option to add Google Authenticator to "
|
2940 |
"their WordPress user profile"
|
2941 |
msgstr ""
|
2942 |
|
2943 |
-
#: src/features/login_protect.php:
|
2944 |
-
#: src/features/login_protect.php:
|
2945 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
2946 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
2947 |
msgid "Email Authentication"
|
2948 |
msgstr ""
|
2949 |
|
2950 |
-
#: src/features/login_protect.php:
|
2951 |
#, php-format
|
2952 |
msgid "Two-Factor Login Authentication By %s"
|
2953 |
msgstr ""
|
2954 |
|
2955 |
-
#: src/features/login_protect.php:
|
|
|
2956 |
msgid "Email"
|
2957 |
msgstr ""
|
2958 |
|
2959 |
-
#: src/features/login_protect.php:
|
2960 |
msgid ""
|
2961 |
"All users will be required to verify their login by email-based two-factor "
|
2962 |
"authentication."
|
2963 |
msgstr ""
|
2964 |
|
2965 |
-
#: src/features/login_protect.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2966 |
#, php-format
|
2967 |
-
msgid "
|
2968 |
msgstr ""
|
2969 |
|
2970 |
-
#: src/features/login_protect.php:
|
2971 |
-
msgid "
|
2972 |
msgstr ""
|
2973 |
|
2974 |
-
#: src/features/login_protect.php:
|
2975 |
msgid ""
|
2976 |
-
"
|
2977 |
msgstr ""
|
2978 |
|
2979 |
-
#: src/features/login_protect.php:
|
2980 |
-
|
2981 |
-
|
|
|
2982 |
msgstr ""
|
2983 |
|
2984 |
-
#: src/features/login_protect.php:
|
2985 |
-
msgid "
|
2986 |
msgstr ""
|
2987 |
|
2988 |
-
#: src/features/login_protect.php:
|
2989 |
-
msgid "
|
2990 |
msgstr ""
|
2991 |
|
2992 |
-
#: src/features/login_protect.php:
|
2993 |
-
msgid "
|
2994 |
msgstr ""
|
2995 |
|
2996 |
-
#: src/features/login_protect.php:
|
|
|
|
|
|
|
|
|
|
|
2997 |
msgid "Bot Protection"
|
2998 |
msgstr ""
|
2999 |
|
3000 |
-
#: src/features/login_protect.php:
|
3001 |
msgid "Protect WP Login From Automated Login Attempts By Bots"
|
3002 |
msgstr ""
|
3003 |
|
3004 |
-
#: src/features/login_protect.php:
|
3005 |
msgid ""
|
3006 |
"Adds a dynamically (Javascript) generated checkbox to the login form that "
|
3007 |
"prevents bots using automated login techniques."
|
3008 |
msgstr ""
|
3009 |
|
3010 |
-
#: src/features/login_protect.php:
|
3011 |
msgid "ON"
|
3012 |
msgstr ""
|
3013 |
|
3014 |
-
#: src/features/login_protect.php:
|
3015 |
-
msgid "
|
3016 |
msgstr ""
|
3017 |
|
3018 |
-
#: src/features/login_protect.php:
|
3019 |
-
msgid "Limit
|
3020 |
msgstr ""
|
3021 |
|
3022 |
-
#: src/features/login_protect.php:
|
3023 |
msgid ""
|
3024 |
-
"WordPress will process only ONE
|
3025 |
"specified."
|
3026 |
msgstr ""
|
3027 |
|
3028 |
-
#: src/features/login_protect.php:
|
3029 |
msgid "Zero (0) turns this off."
|
3030 |
msgstr ""
|
3031 |
|
3032 |
-
#: src/features/login_protect.php:
|
3033 |
-
#: src/features/login_protect.php:652
|
3034 |
-
#, php-format
|
3035 |
-
msgid "Default: \"%s\"."
|
3036 |
-
msgstr ""
|
3037 |
-
|
3038 |
-
#: src/features/login_protect.php:607
|
3039 |
msgid "User Registration"
|
3040 |
msgstr ""
|
3041 |
|
3042 |
-
#: src/features/login_protect.php:
|
3043 |
msgid "Apply Brute Force Protection To User Registration And Lost Passwords"
|
3044 |
msgstr ""
|
3045 |
|
3046 |
-
#: src/features/login_protect.php:
|
3047 |
msgid ""
|
3048 |
"When enabled, settings in this section will also apply to new user "
|
3049 |
"registration and users trying to reset passwords."
|
3050 |
msgstr ""
|
3051 |
|
3052 |
-
#: src/features/login_protect.php:
|
3053 |
msgid "Enable Yubikey Authentication"
|
3054 |
msgstr ""
|
3055 |
|
3056 |
-
#: src/features/login_protect.php:
|
3057 |
msgid "Turn On / Off Yubikey Authentication On This Site"
|
3058 |
msgstr ""
|
3059 |
|
3060 |
-
#: src/features/login_protect.php:
|
3061 |
msgid ""
|
3062 |
"Combined with your Yubikey API details this will form the basis of your "
|
3063 |
"Yubikey Authentication"
|
3064 |
msgstr ""
|
3065 |
|
3066 |
-
#: src/features/login_protect.php:
|
3067 |
msgid "Yubikey App ID"
|
3068 |
msgstr ""
|
3069 |
|
3070 |
-
#: src/features/login_protect.php:
|
3071 |
msgid "Your Unique Yubikey App ID"
|
3072 |
msgstr ""
|
3073 |
|
3074 |
-
#: src/features/login_protect.php:
|
3075 |
msgid ""
|
3076 |
"Combined with your Yubikey API Key this will form the basis of your Yubikey "
|
3077 |
"Authentication"
|
3078 |
msgstr ""
|
3079 |
|
3080 |
-
#: src/features/login_protect.php:
|
3081 |
msgid ""
|
3082 |
"Please review the info link on how to obtain your own Yubikey App ID and API "
|
3083 |
"Key."
|
3084 |
msgstr ""
|
3085 |
|
3086 |
-
#: src/features/login_protect.php:
|
3087 |
msgid "Yubikey API Key"
|
3088 |
msgstr ""
|
3089 |
|
3090 |
-
#: src/features/login_protect.php:
|
3091 |
msgid "Your Unique Yubikey App API Key"
|
3092 |
msgstr ""
|
3093 |
|
3094 |
-
#: src/features/login_protect.php:
|
3095 |
msgid ""
|
3096 |
"Combined with your Yubikey App ID this will form the basis of your Yubikey "
|
3097 |
"Authentication."
|
3098 |
msgstr ""
|
3099 |
|
3100 |
-
#: src/features/login_protect.php:
|
3101 |
msgid ""
|
3102 |
"Please review the info link on how to get your own Yubikey App ID and API "
|
3103 |
"Key."
|
3104 |
msgstr ""
|
3105 |
|
3106 |
-
#: src/features/login_protect.php:
|
3107 |
msgid "Yubikey Unique Keys"
|
3108 |
msgstr ""
|
3109 |
|
3110 |
-
#: src/features/login_protect.php:
|
3111 |
msgid ""
|
3112 |
"This method for Yubikeys is no longer supported. Please see your user profile"
|
3113 |
msgstr ""
|
3114 |
|
3115 |
-
#: src/features/login_protect.php:
|
3116 |
-
|
3117 |
-
msgid "Format: %s"
|
3118 |
msgstr ""
|
3119 |
|
3120 |
-
#: src/features/login_protect.php:
|
3121 |
msgid "Provide Username<->Yubikey Pairs that are usable for this site."
|
3122 |
msgstr ""
|
3123 |
|
3124 |
-
#: src/features/login_protect.php:
|
3125 |
msgid ""
|
3126 |
"If a Username if not assigned a Yubikey, Yubikey Authentication is OFF for "
|
3127 |
"that user."
|
3128 |
msgstr ""
|
3129 |
|
3130 |
-
#: src/features/login_protect.php:
|
3131 |
msgid ""
|
3132 |
"Each [Username,Key] pair should be separated by a new line: you only need to "
|
3133 |
"provide the first 12 characters of the yubikey."
|
3134 |
msgstr ""
|
3135 |
|
3136 |
-
#: src/features/login_protect.php:
|
3137 |
msgid "GASP Checkbox Text"
|
3138 |
msgstr ""
|
3139 |
|
3140 |
-
#: src/features/login_protect.php:
|
3141 |
msgid "The User Message Displayed Next To The GASP Checkbox"
|
3142 |
msgstr ""
|
3143 |
|
3144 |
-
#: src/features/login_protect.php:
|
3145 |
msgid ""
|
3146 |
"You can change the text displayed to the user beside the checkbox if you "
|
3147 |
"need a custom message."
|
3148 |
msgstr ""
|
3149 |
|
3150 |
-
#: src/features/login_protect.php:
|
3151 |
msgid "GASP Alert Text"
|
3152 |
msgstr ""
|
3153 |
|
3154 |
-
#: src/features/login_protect.php:
|
3155 |
msgid "The Message Displayed If The User Doesn't Check The Box"
|
3156 |
msgstr ""
|
3157 |
|
3158 |
-
#: src/features/login_protect.php:
|
3159 |
msgid ""
|
3160 |
"You can change the text displayed to the user in the alert message if they "
|
3161 |
"don't check the box."
|
3162 |
msgstr ""
|
3163 |
|
3164 |
-
#: src/features/plugin.php:
|
|
|
|
|
|
|
|
|
3165 |
msgid "Sorry, you do not have permission to disable this plugin."
|
3166 |
msgstr ""
|
3167 |
|
3168 |
-
#: src/features/plugin.php:
|
3169 |
msgid "You need to authenticate first."
|
3170 |
msgstr ""
|
3171 |
|
3172 |
-
#: src/features/plugin.php:
|
3173 |
#, php-format
|
3174 |
msgid "This Site Is Protected By %s"
|
3175 |
msgstr ""
|
3176 |
|
3177 |
-
#: src/features/plugin.php:
|
3178 |
msgid "Plugin Actions"
|
3179 |
msgstr ""
|
3180 |
|
3181 |
-
#: src/features/plugin.php:
|
3182 |
msgid "E.g. Import/Export"
|
3183 |
msgstr ""
|
3184 |
|
3185 |
-
#: src/features/plugin.php:
|
3186 |
msgid "Global Security Plugin Disable"
|
3187 |
msgstr ""
|
3188 |
|
3189 |
-
#: src/features/plugin.php:
|
3190 |
msgid "Plugin Defaults"
|
3191 |
msgstr ""
|
3192 |
|
3193 |
-
#: src/features/plugin.php:
|
3194 |
msgid "Important default settings used throughout the plugin."
|
3195 |
msgstr ""
|
3196 |
|
3197 |
-
#: src/features/plugin.php:
|
3198 |
msgid "Import"
|
3199 |
msgstr ""
|
3200 |
|
3201 |
-
#: src/features/plugin.php:
|
3202 |
msgid "Export"
|
3203 |
msgstr ""
|
3204 |
|
3205 |
-
#: src/features/plugin.php:
|
3206 |
msgid ""
|
3207 |
"Automatically import options, and deploy configurations across your entire "
|
3208 |
"network."
|
3209 |
msgstr ""
|
3210 |
|
3211 |
-
#: src/features/plugin.php:
|
3212 |
msgid "This is a Pro-only feature."
|
3213 |
msgstr ""
|
3214 |
|
3215 |
-
#: src/features/plugin.php:
|
3216 |
msgid "General Plugin Options"
|
3217 |
msgstr ""
|
3218 |
|
3219 |
-
#: src/features/plugin.php:
|
3220 |
msgid "General Options"
|
3221 |
msgstr ""
|
3222 |
|
3223 |
-
#: src/features/plugin.php:
|
3224 |
msgid "Google"
|
3225 |
msgstr ""
|
3226 |
|
3227 |
-
#: src/features/plugin.php:
|
3228 |
-
|
|
|
|
|
|
|
|
|
|
|
3229 |
msgstr ""
|
3230 |
|
3231 |
-
#: src/features/plugin.php:
|
3232 |
-
msgid "
|
3233 |
msgstr ""
|
3234 |
|
3235 |
-
#: src/features/plugin.php:
|
3236 |
-
|
|
|
3237 |
msgstr ""
|
3238 |
|
3239 |
-
#: src/features/plugin.php:
|
3240 |
msgid "Duo Security"
|
3241 |
msgstr ""
|
3242 |
|
3243 |
-
#: src/features/plugin.php:
|
3244 |
msgid "Enable/Disable Plugin Modules"
|
3245 |
msgstr ""
|
3246 |
|
3247 |
-
#: src/features/plugin.php:
|
3248 |
msgid "Enable/Disable All Plugin Modules"
|
3249 |
msgstr ""
|
3250 |
|
3251 |
-
#: src/features/plugin.php:
|
3252 |
#, php-format
|
3253 |
msgid "Uncheck this option to disable all %s features."
|
3254 |
msgstr ""
|
3255 |
|
3256 |
-
#: src/features/plugin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3257 |
msgid "Information Gathering"
|
3258 |
msgstr ""
|
3259 |
|
3260 |
-
#: src/features/plugin.php:
|
3261 |
msgid "Permit Anonymous Usage Information Gathering"
|
3262 |
msgstr ""
|
3263 |
|
3264 |
-
#: src/features/plugin.php:
|
3265 |
msgid ""
|
3266 |
"Allows us to gather information on statistics and features in-use across our "
|
3267 |
"client installations."
|
3268 |
msgstr ""
|
3269 |
|
3270 |
-
#: src/features/plugin.php:
|
3271 |
msgid ""
|
3272 |
"This information is strictly anonymous and contains no personally, or "
|
3273 |
"otherwise, identifiable data."
|
3274 |
msgstr ""
|
3275 |
|
3276 |
-
#: src/features/plugin.php:
|
3277 |
msgid "Click to see the exact data that would be sent."
|
3278 |
msgstr ""
|
3279 |
|
3280 |
-
#: src/features/plugin.php:
|
3281 |
msgid "IP Source"
|
3282 |
msgstr ""
|
3283 |
|
3284 |
-
#: src/features/plugin.php:
|
3285 |
msgid "Which IP Address Is Yours"
|
3286 |
msgstr ""
|
3287 |
|
3288 |
-
#: src/features/plugin.php:
|
3289 |
msgid ""
|
3290 |
"There are many possible ways to detect visitor IP addresses. If Auto-Detect "
|
3291 |
"is not working, please select yours from the list."
|
3292 |
msgstr ""
|
3293 |
|
3294 |
-
#: src/features/plugin.php:
|
3295 |
msgid ""
|
3296 |
"If the option you select becomes unavailable, we will revert to auto "
|
3297 |
"detection."
|
3298 |
msgstr ""
|
3299 |
|
3300 |
-
#: src/features/plugin.php:
|
3301 |
#, php-format
|
3302 |
msgid "Current source is: %s"
|
3303 |
msgstr ""
|
3304 |
|
3305 |
-
#: src/features/plugin.php:
|
3306 |
msgid "Report Email"
|
3307 |
msgstr ""
|
3308 |
|
3309 |
-
#: src/features/plugin.php:
|
3310 |
msgid "Where to send email reports"
|
3311 |
msgstr ""
|
3312 |
|
3313 |
-
#: src/features/plugin.php:
|
3314 |
#, php-format
|
3315 |
msgid "If this is empty, it will default to the blog admin email address: %s"
|
3316 |
msgstr ""
|
3317 |
|
3318 |
-
#: src/features/plugin.php:
|
3319 |
msgid "In-Plugin Notices"
|
3320 |
msgstr ""
|
3321 |
|
3322 |
-
#: src/features/plugin.php:
|
3323 |
msgid "Display Plugin Specific Notices"
|
3324 |
msgstr ""
|
3325 |
|
3326 |
-
#: src/features/plugin.php:
|
3327 |
msgid ""
|
3328 |
"Disable this option to hide certain plugin admin notices about available "
|
3329 |
"updates and post-update notices."
|
3330 |
msgstr ""
|
3331 |
|
3332 |
-
#: src/features/plugin.php:
|
3333 |
msgid "Show Plugin Badge"
|
3334 |
msgstr ""
|
3335 |
|
3336 |
-
#: src/features/plugin.php:
|
3337 |
msgid "Display Plugin Badge On Your Site"
|
3338 |
msgstr ""
|
3339 |
|
3340 |
-
#: src/features/plugin.php:
|
3341 |
msgid ""
|
3342 |
"Enabling this option helps support the plugin by spreading the word about it "
|
3343 |
"on your website."
|
3344 |
msgstr ""
|
3345 |
|
3346 |
-
#: src/features/plugin.php:
|
3347 |
msgid ""
|
3348 |
"The plugin badge also lets visitors know your are taking your website "
|
3349 |
"security seriously."
|
3350 |
msgstr ""
|
3351 |
|
3352 |
-
#: src/features/plugin.php:
|
3353 |
msgid "Read this carefully before enabling this option."
|
3354 |
msgstr ""
|
3355 |
|
3356 |
-
#: src/features/plugin.php:
|
3357 |
msgid "Delete Plugin Settings"
|
3358 |
msgstr ""
|
3359 |
|
3360 |
-
#: src/features/plugin.php:
|
3361 |
msgid "Delete All Plugin Settings Upon Plugin Deactivation"
|
3362 |
msgstr ""
|
3363 |
|
3364 |
-
#: src/features/plugin.php:
|
3365 |
msgid "Careful: Removes all plugin options when you deactivate the plugin"
|
3366 |
msgstr ""
|
3367 |
|
3368 |
-
#: src/features/plugin.php:
|
3369 |
msgid "XML-RPC Compatibility"
|
3370 |
msgstr ""
|
3371 |
|
3372 |
-
#: src/features/plugin.php:
|
3373 |
msgid "Allow Login Through XML-RPC To By-Pass Accounts Management Rules"
|
3374 |
msgstr ""
|
3375 |
|
3376 |
-
#: src/features/plugin.php:
|
3377 |
msgid ""
|
3378 |
"Enable this if you need XML-RPC functionality e.g. if you use the WordPress "
|
3379 |
"iPhone/Android App."
|
3380 |
msgstr ""
|
3381 |
|
3382 |
-
#: src/features/plugin.php:
|
3383 |
msgid "Allow Import/Export"
|
3384 |
msgstr ""
|
3385 |
|
3386 |
-
#: src/features/plugin.php:
|
3387 |
msgid "Allow Import And Export Of Options On This Site"
|
3388 |
msgstr ""
|
3389 |
|
3390 |
-
#: src/features/plugin.php:
|
3391 |
msgid "Uncheck this box to completely disable import and export of options."
|
3392 |
msgstr ""
|
3393 |
|
3394 |
-
#: src/features/plugin.php:
|
3395 |
-
msgid "Note"
|
3396 |
-
msgstr ""
|
3397 |
-
|
3398 |
-
#: src/features/plugin.php:773
|
3399 |
msgid "Import/Export is a premium-only feature."
|
3400 |
msgstr ""
|
3401 |
|
3402 |
-
#: src/features/plugin.php:
|
3403 |
msgid "Export Whitelist"
|
3404 |
msgstr ""
|
3405 |
|
3406 |
-
#: src/features/plugin.php:
|
3407 |
msgid "Whitelisted Sites To Export Options From This Site"
|
3408 |
msgstr ""
|
3409 |
|
3410 |
-
#: src/features/plugin.php:
|
3411 |
msgid "Whitelisted sites may export options from this site without the key."
|
3412 |
msgstr ""
|
3413 |
|
3414 |
-
#: src/features/plugin.php:
|
3415 |
msgid "List each site URL on a new line."
|
3416 |
msgstr ""
|
3417 |
|
3418 |
-
#: src/features/plugin.php:
|
3419 |
msgid "This is to be used in conjunction with the Master Import Site feature."
|
3420 |
msgstr ""
|
3421 |
|
3422 |
-
#: src/features/plugin.php:
|
3423 |
msgid "Master Import Site"
|
3424 |
msgstr ""
|
3425 |
|
3426 |
-
#: src/features/plugin.php:
|
3427 |
msgid "Automatically Import Options From This Site URL"
|
3428 |
msgstr ""
|
3429 |
|
3430 |
-
#: src/features/plugin.php:
|
3431 |
msgid "Supplying a site URL here will make this site an 'Options Slave'."
|
3432 |
msgstr ""
|
3433 |
|
3434 |
-
#: src/features/plugin.php:
|
3435 |
-
msgid ""
|
3436 |
-
"Options will be automatically imported from the Master Import site each day."
|
3437 |
-
msgstr ""
|
3438 |
-
|
3439 |
-
#: src/features/plugin.php:789 src/processors/loginprotect_wplogin.php:74
|
3440 |
-
#: src/processors/loginprotect_wplogin.php:93
|
3441 |
-
msgid "Warning"
|
3442 |
msgstr ""
|
3443 |
|
3444 |
-
#: src/features/plugin.php:
|
3445 |
msgid ""
|
3446 |
"Use of this feature will overwrite existing options and replace them with "
|
3447 |
"those from the Master Import Site."
|
3448 |
msgstr ""
|
3449 |
|
3450 |
-
#: src/features/plugin.php:
|
3451 |
msgid "Notify Whitelist"
|
3452 |
msgstr ""
|
3453 |
|
3454 |
-
#: src/features/plugin.php:
|
3455 |
msgid "Notify Sites On The Whitelist To Update Options From Master"
|
3456 |
msgstr ""
|
3457 |
|
3458 |
-
#: src/features/plugin.php:
|
3459 |
msgid ""
|
3460 |
"When enabled, manual options saving will notify sites on the whitelist to "
|
3461 |
"export options from the Master site."
|
3462 |
msgstr ""
|
3463 |
|
3464 |
-
#: src/features/plugin.php:
|
3465 |
msgid "Secret Key"
|
3466 |
msgstr ""
|
3467 |
|
3468 |
-
#: src/features/plugin.php:
|
3469 |
msgid "Import/Export Secret Key"
|
3470 |
msgstr ""
|
3471 |
|
3472 |
-
#: src/features/plugin.php:
|
3473 |
msgid ""
|
3474 |
"Keep this Secret Key private as it will allow the import and export of "
|
3475 |
"options."
|
3476 |
msgstr ""
|
3477 |
|
3478 |
-
#: src/features/plugin.php:
|
3479 |
msgid "Installation ID"
|
3480 |
msgstr ""
|
3481 |
|
3482 |
-
#: src/features/plugin.php:
|
3483 |
msgid "Unique Plugin Installation ID"
|
3484 |
msgstr ""
|
3485 |
|
3486 |
-
#: src/features/plugin.php:
|
3487 |
msgid "Keep this ID private."
|
3488 |
msgstr ""
|
3489 |
|
3490 |
-
#: src/features/plugin.php:
|
3491 |
msgid "reCAPTCHA Secret"
|
3492 |
msgstr ""
|
3493 |
|
3494 |
-
#: src/features/plugin.php:
|
3495 |
msgid "Google reCAPTCHA Secret Key"
|
3496 |
msgstr ""
|
3497 |
|
3498 |
-
#: src/features/plugin.php:
|
3499 |
msgid "Enter your Google reCAPTCHA secret key for use throughout the plugin."
|
3500 |
msgstr ""
|
3501 |
|
3502 |
-
#: src/features/plugin.php:
|
3503 |
msgid "reCAPTCHA Site Key"
|
3504 |
msgstr ""
|
3505 |
|
3506 |
-
#: src/features/plugin.php:
|
3507 |
msgid "Google reCAPTCHA Site Key"
|
3508 |
msgstr ""
|
3509 |
|
3510 |
-
#: src/features/plugin.php:
|
3511 |
msgid "Enter your Google reCAPTCHA site key for use throughout the plugin"
|
3512 |
msgstr ""
|
3513 |
|
3514 |
-
#: src/features/plugin.php:
|
3515 |
msgid "How Google reCAPTCHA Will Be Displayed By Default"
|
3516 |
msgstr ""
|
3517 |
|
3518 |
-
#: src/features/plugin.php:
|
3519 |
msgid "IP Whitelist"
|
3520 |
msgstr ""
|
3521 |
|
3522 |
-
#: src/features/plugin.php:
|
3523 |
msgid "IP Address White List"
|
3524 |
msgstr ""
|
3525 |
|
3526 |
-
#: src/features/plugin.php:
|
3527 |
msgid ""
|
3528 |
"Any IP addresses on this list will by-pass all Plugin Security Checking."
|
3529 |
msgstr ""
|
3530 |
|
3531 |
-
#: src/features/plugin.php:
|
3532 |
-
#: src/processors/plugin.php:
|
3533 |
#, php-format
|
3534 |
msgid "Your IP address is: %s"
|
3535 |
msgstr ""
|
3536 |
|
3537 |
-
#: src/features/plugin.php:
|
3538 |
msgid "Choose IP Addresses To Blacklist"
|
3539 |
msgstr ""
|
3540 |
|
3541 |
-
#: src/features/plugin.php:
|
|
|
|
|
|
|
|
|
|
|
3542 |
msgid "Blacklist"
|
3543 |
msgstr ""
|
3544 |
|
3545 |
-
#: src/features/plugin.php:
|
3546 |
msgid "Logging"
|
3547 |
msgstr ""
|
3548 |
|
3549 |
-
#: src/features/plugin.php:
|
3550 |
#, php-format
|
3551 |
msgid ""
|
3552 |
"User \"%s\" was forcefully logged out as they were not verified by either "
|
3553 |
"cookie or IP address (or both)."
|
3554 |
msgstr ""
|
3555 |
|
3556 |
-
#: src/features/plugin.php:
|
3557 |
#, php-format
|
3558 |
msgid ""
|
3559 |
"User \"%s\" was found to be un-verified at the given IP Address: \"%s\"."
|
3560 |
msgstr ""
|
3561 |
|
3562 |
-
#: src/features/plugin.php:
|
3563 |
msgid "Cookie"
|
3564 |
msgstr ""
|
3565 |
|
3566 |
-
#: src/features/plugin.php:
|
3567 |
msgid "IP"
|
3568 |
msgstr ""
|
3569 |
|
3570 |
-
#: src/features/plugin.php:
|
3571 |
msgid ""
|
3572 |
"This will restrict all user login sessions to a single browser. Use this if "
|
3573 |
"your users have dynamic IP addresses."
|
3574 |
msgstr ""
|
3575 |
|
3576 |
-
#: src/features/plugin.php:
|
3577 |
msgid ""
|
3578 |
"All users will be required to authenticate their login by email-based two-"
|
3579 |
"factor authentication, when logging in from a new IP address"
|
3580 |
msgstr ""
|
3581 |
|
3582 |
-
#: src/features/plugin.php:
|
3583 |
msgid "2-Factor Auth"
|
3584 |
msgstr ""
|
3585 |
|
3586 |
-
#: src/features/plugin.php:
|
3587 |
msgid "Include Logged-In Users"
|
3588 |
msgstr ""
|
3589 |
|
3590 |
-
#: src/features/plugin.php:
|
3591 |
msgid "You may also enable GASP for logged in users"
|
3592 |
msgstr ""
|
3593 |
|
3594 |
-
#: src/features/plugin.php:
|
3595 |
msgid ""
|
3596 |
"Since logged-in users would be expected to be vetted already, this is off by "
|
3597 |
"default."
|
3598 |
msgstr ""
|
3599 |
|
3600 |
-
#: src/features/plugin.php:
|
3601 |
msgid "Protect your security plugin not just your WordPress site"
|
3602 |
msgstr ""
|
3603 |
|
3604 |
-
#: src/features/plugin.php:
|
3605 |
msgid "Get a view on what happens on your site, when it happens"
|
3606 |
msgstr ""
|
3607 |
|
3608 |
-
#: src/features/plugin.php:
|
3609 |
msgid "Take back full control of WordPress automatic updates"
|
3610 |
msgstr ""
|
3611 |
|
3612 |
-
#: src/features/plugin.php:
|
3613 |
msgid "Comments SPAM"
|
3614 |
msgstr ""
|
3615 |
|
3616 |
-
#: src/features/plugin.php:
|
3617 |
msgid "Block comment SPAM and retain your privacy"
|
3618 |
msgstr ""
|
3619 |
|
3620 |
-
#: src/features/plugin.php:
|
3621 |
msgid "Automatically block malicious URLs and data sent to your site"
|
3622 |
msgstr ""
|
3623 |
|
3624 |
-
#: src/features/plugin.php:
|
3625 |
msgid "HTTP Headers"
|
3626 |
msgstr ""
|
3627 |
|
3628 |
-
#: src/features/plugin.php:
|
3629 |
msgid "Control HTTP Security Headers"
|
3630 |
msgstr ""
|
3631 |
|
3632 |
-
#: src/features/plugin.php:
|
3633 |
msgid "Manage Visitor IP Address"
|
3634 |
msgstr ""
|
3635 |
|
3636 |
-
#: src/features/plugin.php:
|
3637 |
msgid "Harden the more loosely controlled settings of your site"
|
3638 |
msgstr ""
|
3639 |
|
3640 |
-
#: src/features/plugin.php:
|
3641 |
msgid ""
|
3642 |
"Block brute force attacks and secure user identities with Two-Factor "
|
3643 |
"Authentication"
|
3644 |
msgstr ""
|
3645 |
|
3646 |
-
#: src/features/plugin.php:
|
3647 |
msgid "Dashboard"
|
3648 |
msgstr ""
|
3649 |
|
3650 |
-
#: src/features/plugin.php:
|
3651 |
msgid "General Plugin Settings"
|
3652 |
msgstr ""
|
3653 |
|
3654 |
-
#: src/features/plugin.php:
|
3655 |
msgid "Statistics"
|
3656 |
msgstr ""
|
3657 |
|
3658 |
-
#: src/features/plugin.php:
|
3659 |
msgid "Summary of the main security actions taken by this plugin"
|
3660 |
msgstr ""
|
3661 |
|
3662 |
-
#: src/features/plugin.php:
|
3663 |
msgid "Stats Viewer"
|
3664 |
msgstr ""
|
3665 |
|
3666 |
-
#: src/features/plugin.php:
|
3667 |
msgid "Premium Support"
|
3668 |
msgstr ""
|
3669 |
|
3670 |
-
#: src/features/plugin.php:
|
3671 |
msgid "Premium Plugin Support Centre"
|
3672 |
msgstr ""
|
3673 |
|
3674 |
-
#: src/features/plugin.php:
|
3675 |
-
#: src/features/user_management.php:
|
3676 |
msgid "User Management"
|
3677 |
msgstr ""
|
3678 |
|
3679 |
-
#: src/features/plugin.php:
|
3680 |
msgid ""
|
3681 |
"Get true user sessions and control account sharing, session duration and "
|
3682 |
"timeouts"
|
3683 |
msgstr ""
|
3684 |
|
3685 |
-
#: src/features/plugin.php:
|
3686 |
msgid "Two-Factor Authentication"
|
3687 |
msgstr ""
|
3688 |
|
@@ -3690,392 +4257,569 @@ msgstr ""
|
|
3690 |
msgid "Creates and Manages User Sessions."
|
3691 |
msgstr ""
|
3692 |
|
3693 |
-
#: src/features/statistics.php:
|
3694 |
msgid "Helps you see at a glance how effective the plugin has been."
|
3695 |
msgstr ""
|
3696 |
|
3697 |
-
#: src/features/statistics.php:
|
3698 |
msgid "To track stats and issue reports."
|
3699 |
msgstr ""
|
3700 |
|
3701 |
-
#: src/features/statistics.php:
|
3702 |
msgid "Statistics Sharing"
|
3703 |
msgstr ""
|
3704 |
|
3705 |
-
#: src/features/statistics.php:
|
3706 |
msgid ""
|
3707 |
"Help us to provide globally accessible statistics on the effectiveness of "
|
3708 |
"the plugin."
|
3709 |
msgstr ""
|
3710 |
|
3711 |
-
#: src/features/statistics.php:
|
3712 |
msgid "Enabling this option helps us improve our plugin over time."
|
3713 |
msgstr ""
|
3714 |
|
3715 |
-
#: src/features/statistics.php:
|
3716 |
msgid "All statistics data collection is 100% anonymous."
|
3717 |
msgstr ""
|
3718 |
|
3719 |
-
#: src/features/statistics.php:
|
3720 |
msgid ""
|
3721 |
"Neither we nor anyone else will be able to trace the data back to the "
|
3722 |
"originating site."
|
3723 |
msgstr ""
|
3724 |
|
3725 |
-
#: src/features/statistics.php:
|
3726 |
msgid "Sharing"
|
3727 |
msgstr ""
|
3728 |
|
3729 |
-
#: src/features/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3730 |
msgid "User Sessions"
|
3731 |
msgstr ""
|
3732 |
|
3733 |
-
#: src/features/user_management.php:
|
3734 |
msgid "Review user sessions"
|
3735 |
msgstr ""
|
3736 |
|
3737 |
-
#: src/features/user_management.php:
|
3738 |
msgid "Current User Sessions"
|
3739 |
msgstr ""
|
3740 |
|
3741 |
-
#: src/features/user_management.php:
|
3742 |
msgid "Logged In At"
|
3743 |
msgstr ""
|
3744 |
|
3745 |
-
#: src/features/user_management.php:
|
3746 |
msgid "Last Activity At"
|
3747 |
msgstr ""
|
3748 |
|
3749 |
-
#: src/features/user_management.php:
|
3750 |
msgid "Last Activity URI"
|
3751 |
msgstr ""
|
3752 |
|
3753 |
-
#: src/features/user_management.php:
|
3754 |
msgid "Login IP"
|
3755 |
msgstr ""
|
3756 |
|
3757 |
-
#: src/features/user_management.php:
|
3758 |
msgid ""
|
3759 |
"You need to enable the User Management feature to view and manage user "
|
3760 |
"sessions."
|
3761 |
msgstr ""
|
3762 |
|
3763 |
-
#: src/features/user_management.php:
|
|
|
|
|
|
|
|
|
3764 |
msgid "Weak"
|
3765 |
msgstr ""
|
3766 |
|
3767 |
-
#: src/features/user_management.php:
|
3768 |
msgid "Medium"
|
3769 |
msgstr ""
|
3770 |
|
3771 |
-
#: src/features/user_management.php:
|
3772 |
msgid "Strong"
|
3773 |
msgstr ""
|
3774 |
|
3775 |
-
#: src/features/user_management.php:
|
3776 |
msgid "Very Strong"
|
3777 |
msgstr ""
|
3778 |
|
3779 |
-
#: src/features/user_management.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3780 |
msgid ""
|
3781 |
"User Management offers real user sessions, finer control over user session "
|
3782 |
"time-out, and ensures users have logged-in in a correct manner."
|
3783 |
msgstr ""
|
3784 |
|
3785 |
-
#: src/features/user_management.php:
|
3786 |
msgid "Password Policies"
|
3787 |
msgstr ""
|
3788 |
|
3789 |
-
#: src/features/user_management.php:
|
3790 |
msgid "Have full control over passwords used by users on the site."
|
3791 |
msgstr ""
|
3792 |
|
3793 |
-
#: src/features/user_management.php:
|
3794 |
msgid "Admin Login Notification"
|
3795 |
msgstr ""
|
3796 |
|
3797 |
-
#: src/features/user_management.php:
|
3798 |
msgid ""
|
3799 |
"So you can be made aware of when a WordPress administrator has logged into "
|
3800 |
"your site when you are not expecting it."
|
3801 |
msgstr ""
|
3802 |
|
3803 |
-
#: src/features/user_management.php:
|
3804 |
msgid "Notifications"
|
3805 |
msgstr ""
|
3806 |
|
3807 |
-
#: src/features/user_management.php:
|
3808 |
msgid "Multi-Factor User Authentication"
|
3809 |
msgstr ""
|
3810 |
|
3811 |
-
#: src/features/user_management.php:
|
3812 |
msgid "User Session Management"
|
3813 |
msgstr ""
|
3814 |
|
3815 |
-
#: src/features/user_management.php:
|
3816 |
msgid ""
|
3817 |
"Allows you to better control user sessions on your site and expire idle "
|
3818 |
"sessions and prevent account sharing."
|
3819 |
msgstr ""
|
3820 |
|
3821 |
-
#: src/features/user_management.php:
|
3822 |
msgid "Session Options"
|
3823 |
msgstr ""
|
3824 |
|
3825 |
-
#: src/features/user_management.php:
|
3826 |
msgid "Admin Login Notification Email"
|
3827 |
msgstr ""
|
3828 |
|
3829 |
-
#: src/features/user_management.php:
|
3830 |
msgid "Send An Notification Email When Administrator Logs In"
|
3831 |
msgstr ""
|
3832 |
|
3833 |
-
#: src/features/user_management.php:
|
3834 |
msgid ""
|
3835 |
"If you would like to be notified every time an administrator user logs into "
|
3836 |
"this WordPress site, enter a notification email address."
|
3837 |
msgstr ""
|
3838 |
|
3839 |
-
#: src/features/user_management.php:
|
3840 |
msgid "No email address - No Notification."
|
3841 |
msgstr ""
|
3842 |
|
3843 |
-
#: src/features/user_management.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3844 |
msgid "Session Timeout"
|
3845 |
msgstr ""
|
3846 |
|
3847 |
-
#: src/features/user_management.php:
|
3848 |
msgid "Specify How Many Days After Login To Automatically Force Re-Login"
|
3849 |
msgstr ""
|
3850 |
|
3851 |
-
#: src/features/user_management.php:
|
3852 |
msgid ""
|
3853 |
"WordPress default is 2 days, or 14 days if you check the \"Remember Me\" box."
|
3854 |
msgstr ""
|
3855 |
|
3856 |
-
#: src/features/user_management.php:
|
3857 |
#, php-format
|
3858 |
msgid "This cannot be less than %s."
|
3859 |
msgstr ""
|
3860 |
|
3861 |
-
#: src/features/user_management.php:
|
3862 |
-
#, php-format
|
3863 |
-
msgid "Default: %s."
|
3864 |
-
msgstr ""
|
3865 |
-
|
3866 |
-
#: src/features/user_management.php:298
|
3867 |
msgid "Idle Timeout"
|
3868 |
msgstr ""
|
3869 |
|
3870 |
-
#: src/features/user_management.php:
|
3871 |
msgid "Specify How Many Hours After Inactivity To Automatically Logout User"
|
3872 |
msgstr ""
|
3873 |
|
3874 |
-
#: src/features/user_management.php:
|
3875 |
msgid ""
|
3876 |
"If the user is inactive for the number of hours specified, they will be "
|
3877 |
"forcefully logged out next time they return."
|
3878 |
msgstr ""
|
3879 |
|
3880 |
-
#: src/features/user_management.php:
|
3881 |
#, php-format
|
3882 |
msgid "Set to %s to turn off this option."
|
3883 |
msgstr ""
|
3884 |
|
3885 |
-
#: src/features/user_management.php:
|
3886 |
msgid "Lock To Location"
|
3887 |
msgstr ""
|
3888 |
|
3889 |
-
#: src/features/user_management.php:
|
3890 |
msgid "Locks A User Session To IP address"
|
3891 |
msgstr ""
|
3892 |
|
3893 |
-
#: src/features/user_management.php:
|
3894 |
msgid ""
|
3895 |
"When selected, a session is restricted to the same IP address as when the "
|
3896 |
"user logged in."
|
3897 |
msgstr ""
|
3898 |
|
3899 |
-
#: src/features/user_management.php:
|
3900 |
msgid ""
|
3901 |
"If a logged-in user's IP address changes, the session will be invalidated "
|
3902 |
"and they'll be forced to re-login to WordPress."
|
3903 |
msgstr ""
|
3904 |
|
3905 |
-
#: src/features/user_management.php:
|
3906 |
msgid "Max Simultaneous Sessions"
|
3907 |
msgstr ""
|
3908 |
|
3909 |
-
#: src/features/user_management.php:
|
3910 |
msgid "Limit Simultaneous Sessions For The Same Username"
|
3911 |
msgstr ""
|
3912 |
|
3913 |
-
#: src/features/user_management.php:
|
3914 |
msgid ""
|
3915 |
"The number provided here is the maximum number of simultaneous, distinct, "
|
3916 |
"sessions allowed for any given username."
|
3917 |
msgstr ""
|
3918 |
|
3919 |
-
#: src/features/user_management.php:
|
3920 |
msgid "Zero (0) will allow unlimited simultaneous sessions."
|
3921 |
msgstr ""
|
3922 |
|
3923 |
-
#: src/features/user_management.php:
|
3924 |
msgid "Enable Password Policies"
|
3925 |
msgstr ""
|
3926 |
|
3927 |
-
#: src/features/user_management.php:
|
3928 |
msgid "Enable The Password Policies Detailed Below"
|
3929 |
msgstr ""
|
3930 |
|
3931 |
-
#: src/features/user_management.php:
|
3932 |
msgid "Turn on/off all password policy settings."
|
3933 |
msgstr ""
|
3934 |
|
3935 |
-
#: src/features/user_management.php:
|
3936 |
msgid "Prevent Pwned Passwords"
|
3937 |
msgstr ""
|
3938 |
|
3939 |
-
#: src/features/user_management.php:
|
3940 |
-
msgid "Prevent Use Of
|
3941 |
msgstr ""
|
3942 |
|
3943 |
-
#: src/features/user_management.php:
|
3944 |
msgid ""
|
3945 |
"Prevents users from using any passwords found on the public available list "
|
3946 |
"of \"pwned\" passwords."
|
3947 |
msgstr ""
|
3948 |
|
3949 |
-
#: src/features/user_management.php:
|
3950 |
msgid "Minimum Length"
|
3951 |
msgstr ""
|
3952 |
|
3953 |
-
#: src/features/user_management.php:
|
3954 |
msgid "Minimum Password Length"
|
3955 |
msgstr ""
|
3956 |
|
3957 |
-
#: src/features/user_management.php:
|
3958 |
msgid ""
|
3959 |
"All passwords that a user sets must be at least this many characters in "
|
3960 |
"length."
|
3961 |
msgstr ""
|
3962 |
|
3963 |
-
#: src/features/user_management.php:
|
|
|
|
|
|
|
|
|
3964 |
msgid "Minimum Strength"
|
3965 |
msgstr ""
|
3966 |
|
3967 |
-
#: src/features/user_management.php:
|
3968 |
msgid "Minimum Password Strength"
|
3969 |
msgstr ""
|
3970 |
|
3971 |
-
#: src/features/user_management.php:
|
3972 |
msgid "All passwords that a user sets must meet this minimum strength."
|
3973 |
msgstr ""
|
3974 |
|
3975 |
-
#: src/features/user_management.php:
|
3976 |
-
msgid "Apply To Existing"
|
3977 |
msgstr ""
|
3978 |
|
3979 |
-
#: src/features/user_management.php:
|
3980 |
msgid "Apply Password Policies To Existing Users and Their Passwords"
|
3981 |
msgstr ""
|
3982 |
|
3983 |
-
#: src/features/user_management.php:
|
3984 |
msgid ""
|
3985 |
"Forces existing users to update their passwords if they don't meet "
|
3986 |
"requirements, after they next login."
|
3987 |
msgstr ""
|
3988 |
|
3989 |
-
#: src/features/user_management.php:
|
3990 |
msgid "Note: You may want to warn users prior to enabling this option."
|
3991 |
msgstr ""
|
3992 |
|
3993 |
-
#: src/features/user_management.php:
|
3994 |
msgid "Password Expiration"
|
3995 |
msgstr ""
|
3996 |
|
3997 |
-
#: src/features/user_management.php:
|
3998 |
msgid "Passwords Expire After This Many Days"
|
3999 |
msgstr ""
|
4000 |
|
4001 |
-
#: src/features/user_management.php:
|
4002 |
msgid ""
|
4003 |
"Users will be forced to reset their passwords after the number of days "
|
4004 |
"specified."
|
4005 |
msgstr ""
|
4006 |
|
4007 |
-
#: src/
|
4008 |
-
|
4009 |
-
msgstr ""
|
4010 |
-
|
4011 |
-
#: src/processors/admin_access_restriction.php:199
|
4012 |
-
#: src/processors/admin_access_restriction.php:235
|
4013 |
#, php-format
|
4014 |
msgid "%s Security Restrictions Applied"
|
4015 |
msgstr ""
|
4016 |
|
4017 |
-
#: src/processors/admin_access_restriction.php:
|
4018 |
msgid ""
|
4019 |
"Altering certain options has been restricted by your WordPress security "
|
4020 |
"administrator."
|
4021 |
msgstr ""
|
4022 |
|
4023 |
-
#: src/processors/admin_access_restriction.php:
|
4024 |
msgid ""
|
4025 |
"Repeated failed attempts to authenticate will probably lock you out of this "
|
4026 |
"site."
|
4027 |
msgstr ""
|
4028 |
|
4029 |
-
#: src/processors/admin_access_restriction.php:
|
4030 |
msgid "Admin Access Login"
|
4031 |
msgstr ""
|
4032 |
|
4033 |
-
#: src/processors/admin_access_restriction.php:
|
4034 |
-
#: src/processors/admin_access_restriction.php:
|
4035 |
#, php-format
|
4036 |
msgid "Go here to manage settings and authenticate with the %s plugin."
|
4037 |
msgstr ""
|
4038 |
|
4039 |
-
#: src/processors/admin_access_restriction.php:
|
4040 |
msgid ""
|
4041 |
"Editing existing administrators, promoting existing users to the "
|
4042 |
"administrator role, or deleting administrator users is currently restricted."
|
4043 |
msgstr ""
|
4044 |
|
4045 |
-
#: src/processors/admin_access_restriction.php:
|
4046 |
msgid ""
|
4047 |
"Please authenticate with the Security Admin system before attempting any "
|
4048 |
"administrator user modifications."
|
4049 |
msgstr ""
|
4050 |
|
4051 |
-
#: src/processors/admin_access_restriction.php:
|
4052 |
msgid "Unlock Now"
|
4053 |
msgstr ""
|
4054 |
|
4055 |
-
#: src/processors/admin_access_restriction.php:
|
4056 |
-
#: src/processors/admin_access_restriction.php:
|
4057 |
msgid "Security Admin Login"
|
4058 |
msgstr ""
|
4059 |
|
4060 |
-
#: src/processors/admin_access_restriction.php:
|
4061 |
#: src/processors/hackprotect_ptguard.php:63
|
4062 |
msgid "Editing this option is currently restricted."
|
4063 |
msgstr ""
|
4064 |
|
4065 |
-
#: src/processors/admin_access_restriction.php:
|
4066 |
msgid "Unlock"
|
4067 |
msgstr ""
|
4068 |
|
4069 |
-
#: src/processors/audit_trail_emails.php:
|
4070 |
#, php-format
|
4071 |
msgid "There was an attempt to send an email using the \"%s\" function."
|
4072 |
msgstr ""
|
4073 |
|
4074 |
-
#: src/processors/audit_trail_emails.php:
|
4075 |
#, php-format
|
4076 |
msgid "It was sent to \"%s\" with the subject \"%s\"."
|
4077 |
msgstr ""
|
4078 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4079 |
#: src/processors/audit_trail_plugins.php:28
|
4080 |
#, php-format
|
4081 |
msgid "Plugin \"%s\" was activated."
|
@@ -4098,31 +4842,36 @@ msgstr ""
|
|
4098 |
msgid "WordPress Post entitled \"%s\" was permanently deleted from trash."
|
4099 |
msgstr ""
|
4100 |
|
4101 |
-
#: src/processors/audit_trail_posts.php:
|
4102 |
msgid "moved to trash"
|
4103 |
msgstr ""
|
4104 |
|
4105 |
-
#: src/processors/audit_trail_posts.php:
|
4106 |
msgid "recovered from trash"
|
4107 |
msgstr ""
|
4108 |
|
4109 |
#: src/processors/audit_trail_posts.php:55
|
4110 |
-
|
|
|
4111 |
msgstr ""
|
4112 |
|
4113 |
#: src/processors/audit_trail_posts.php:59
|
4114 |
-
msgid "
|
4115 |
msgstr ""
|
4116 |
|
4117 |
-
#: src/processors/audit_trail_posts.php:
|
4118 |
-
msgid "
|
4119 |
msgstr ""
|
4120 |
|
4121 |
-
#: src/processors/audit_trail_posts.php:
|
4122 |
#, php-format
|
4123 |
msgid "Post entitled \"%s\" was %s."
|
4124 |
msgstr ""
|
4125 |
|
|
|
|
|
|
|
|
|
4126 |
#: src/processors/audit_trail_themes.php:25
|
4127 |
#, php-format
|
4128 |
msgid "Theme \"%s\" was activated."
|
@@ -4145,29 +4894,33 @@ msgstr ""
|
|
4145 |
msgid "Attempted user login by \"%s\" failed."
|
4146 |
msgstr ""
|
4147 |
|
4148 |
-
#: src/processors/audit_trail_users.php:
|
4149 |
msgid "New WordPress user registered."
|
4150 |
msgstr ""
|
4151 |
|
4152 |
-
#: src/processors/audit_trail_users.php:
|
4153 |
#, php-format
|
4154 |
msgid "New username is \"%s\" with email address \"%s\"."
|
4155 |
msgstr ""
|
4156 |
|
4157 |
-
#: src/processors/audit_trail_users.php:
|
4158 |
msgid "WordPress user deleted."
|
4159 |
msgstr ""
|
4160 |
|
4161 |
-
#: src/processors/audit_trail_users.php:
|
|
|
|
|
|
|
|
|
4162 |
#, php-format
|
4163 |
msgid "Username was \"%s\" with email address \"%s\"."
|
4164 |
msgstr ""
|
4165 |
|
4166 |
-
#: src/processors/audit_trail_users.php:
|
4167 |
msgid "Their posts were not reassigned to another user."
|
4168 |
msgstr ""
|
4169 |
|
4170 |
-
#: src/processors/audit_trail_users.php:
|
4171 |
#, php-format
|
4172 |
msgid "Their posts were reassigned to user \"%s\"."
|
4173 |
msgstr ""
|
@@ -4182,310 +4935,313 @@ msgstr ""
|
|
4182 |
msgid "WordPress Permalinks Structure was updated from \"%s\" to \"%s\"."
|
4183 |
msgstr ""
|
4184 |
|
4185 |
-
#: src/processors/autoupdates.php:
|
4186 |
#, php-format
|
4187 |
msgid ""
|
4188 |
"This is a quick notification from the %s that WordPress Automatic Updates "
|
4189 |
"just completed on your site with the following results."
|
4190 |
msgstr ""
|
4191 |
|
4192 |
-
#: src/processors/autoupdates.php:
|
4193 |
msgid "Plugins Updated:"
|
4194 |
msgstr ""
|
4195 |
|
4196 |
-
#: src/processors/autoupdates.php:
|
|
|
|
|
|
|
|
|
|
|
4197 |
msgid "Themes Updated:"
|
4198 |
msgstr ""
|
4199 |
|
4200 |
-
#: src/processors/autoupdates.php:
|
|
|
|
|
|
|
|
|
|
|
4201 |
msgid "WordPress Core Updated:"
|
4202 |
msgstr ""
|
4203 |
|
4204 |
-
#: src/processors/autoupdates.php:
|
4205 |
msgid "Thank you."
|
4206 |
msgstr ""
|
4207 |
|
4208 |
-
#: src/processors/autoupdates.php:
|
4209 |
#, php-format
|
4210 |
msgid "Notice: %s"
|
4211 |
msgstr ""
|
4212 |
|
4213 |
-
#: src/processors/autoupdates.php:
|
4214 |
msgid "Automatic Updates Completed"
|
4215 |
msgstr ""
|
4216 |
|
4217 |
-
#: src/processors/autoupdates.php:
|
4218 |
msgid ""
|
4219 |
"Automatic updates for this plugin is controlled by another plugin or setting."
|
4220 |
msgstr ""
|
4221 |
|
4222 |
-
#: src/processors/base_commentsfilter.php:
|
4223 |
-
#: src/processors/commentsfilter_antibotspam.php:
|
4224 |
#, php-format
|
4225 |
msgid "%s plugin marked this comment as \"%s\"."
|
4226 |
msgstr ""
|
4227 |
|
4228 |
-
#: src/processors/base_commentsfilter.php:
|
4229 |
-
#: src/processors/commentsfilter_antibotspam.php:
|
4230 |
#, php-format
|
4231 |
msgid "Reason: %s"
|
4232 |
msgstr ""
|
4233 |
|
4234 |
-
#: src/processors/base_plugin.php:
|
4235 |
msgid "I'd rather not show this support"
|
4236 |
msgstr ""
|
4237 |
|
4238 |
-
#: src/processors/base_plugin.php:
|
4239 |
msgid "I've done this already"
|
4240 |
msgstr ""
|
4241 |
|
4242 |
-
#: src/processors/base_plugin.php:
|
4243 |
msgid "I don't need the setup wizard just now"
|
4244 |
msgstr ""
|
4245 |
|
4246 |
-
#: src/processors/base_plugin.php:
|
4247 |
#, php-format
|
4248 |
msgid "Get started quickly with the %s Setup Wizard"
|
4249 |
msgstr ""
|
4250 |
|
4251 |
-
#: src/processors/base_plugin.php:
|
4252 |
#, php-format
|
4253 |
msgid ""
|
4254 |
"The welcome wizard will help you get setup quickly and become familiar with "
|
4255 |
"some of the core %s features"
|
4256 |
msgstr ""
|
4257 |
|
4258 |
-
#: src/processors/base_plugin.php:
|
4259 |
#, php-format
|
4260 |
msgid ""
|
4261 |
"%s has a helpful setup wizard to walk you through the main features. "
|
4262 |
"Unfortunately your PHP version is reeeaally old as it needs PHP 5.4+"
|
4263 |
msgstr ""
|
4264 |
|
4265 |
-
#: src/processors/base_plugin.php:
|
4266 |
#, php-format
|
4267 |
msgid "Your PHP version is very old: %s"
|
4268 |
msgstr ""
|
4269 |
|
4270 |
-
#: src/processors/base_plugin.php:
|
4271 |
#, php-format
|
4272 |
msgid "Newer features of %s do not support your PHP version."
|
4273 |
msgstr ""
|
4274 |
|
4275 |
-
#: src/processors/base_plugin.php:
|
4276 |
msgid ""
|
4277 |
"You should ask your host to upgrade or provide a much newer PHP version."
|
4278 |
msgstr ""
|
4279 |
|
4280 |
-
#: src/processors/base_plugin.php:
|
4281 |
msgid "Please read here for further information:"
|
4282 |
msgstr ""
|
4283 |
|
4284 |
-
#: src/processors/base_plugin.php:
|
4285 |
-
#: src/processors/base_plugin.php:
|
4286 |
msgid "Dismiss this notice"
|
4287 |
msgstr ""
|
4288 |
|
4289 |
-
#: src/processors/base_plugin.php:
|
4290 |
msgid "Dropping support for PHP 5.2 and 5.3"
|
4291 |
msgstr ""
|
4292 |
|
4293 |
-
#: src/processors/base_plugin.php:
|
4294 |
#, php-format
|
4295 |
msgid "Update available for the %s plugin."
|
4296 |
msgstr ""
|
4297 |
|
4298 |
-
#: src/processors/base_plugin.php:
|
4299 |
msgid "Please click to update immediately"
|
4300 |
msgstr ""
|
4301 |
|
4302 |
-
#: src/processors/base_plugin.php:
|
4303 |
#, php-format
|
4304 |
msgid "Can you help translate the %s plugin?"
|
4305 |
msgstr ""
|
4306 |
|
4307 |
-
#: src/processors/base_plugin.php:
|
4308 |
#, php-format
|
4309 |
msgid "Head over to: %s"
|
4310 |
msgstr ""
|
4311 |
|
4312 |
-
#: src/processors/base_wpsf.php:
|
4313 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
4314 |
msgid "Whoops."
|
4315 |
msgstr ""
|
4316 |
|
4317 |
-
#: src/processors/base_wpsf.php:
|
4318 |
msgid "Google reCAPTCHA was not submitted."
|
4319 |
msgstr ""
|
4320 |
|
4321 |
-
#: src/processors/base_wpsf.php:
|
4322 |
msgid "Google reCAPTCHA verification failed."
|
4323 |
msgstr ""
|
4324 |
|
4325 |
-
#: src/processors/
|
|
|
|
|
|
|
|
|
4326 |
msgid ""
|
4327 |
"It appears you have Akismet Anti-SPAM running alongside the our human Anti-"
|
4328 |
"SPAM filter."
|
4329 |
msgstr ""
|
4330 |
|
4331 |
-
#: src/processors/comments_filter.php:
|
4332 |
msgid "This is not recommended and you should disable Akismet."
|
4333 |
msgstr ""
|
4334 |
|
4335 |
-
#: src/processors/comments_filter.php:
|
4336 |
msgid "Click to deactivate Akismet now."
|
4337 |
msgstr ""
|
4338 |
|
4339 |
-
#: src/processors/commentsfilter_antibotspam.php:
|
4340 |
-
#: src/processors/commentsfilter_antibotspam.php:
|
4341 |
-
#: src/processors/commentsfilter_antibotspam.php:
|
4342 |
#, php-format
|
4343 |
msgid "Failed GASP Bot Filter Test (%s)"
|
4344 |
msgstr ""
|
4345 |
|
4346 |
-
#: src/processors/commentsfilter_antibotspam.php:
|
4347 |
msgid "checkbox"
|
4348 |
msgstr ""
|
4349 |
|
4350 |
-
#: src/processors/commentsfilter_antibotspam.php:
|
4351 |
msgid "honeypot"
|
4352 |
msgstr ""
|
4353 |
|
4354 |
-
#: src/processors/commentsfilter_antibotspam.php:
|
4355 |
msgid "comment token failure"
|
4356 |
msgstr ""
|
4357 |
|
4358 |
-
#: src/processors/commentsfilter_humanspam.php:
|
4359 |
#, php-format
|
4360 |
msgid "Human SPAM filter found \"%s\" in \"%s\""
|
4361 |
msgstr ""
|
4362 |
|
4363 |
-
#: src/processors/email.php:
|
4364 |
msgid "Hi !"
|
4365 |
msgstr ""
|
4366 |
|
4367 |
-
#: src/processors/email.php:
|
4368 |
#, php-format
|
4369 |
msgid "Email sent from the %s Plugin v%s, on %s."
|
4370 |
msgstr ""
|
4371 |
|
4372 |
-
#: src/processors/email.php:
|
4373 |
msgid "Note: Email delays are caused by website hosting and email providers."
|
4374 |
msgstr ""
|
4375 |
|
4376 |
-
#: src/processors/email.php:
|
4377 |
#, php-format
|
4378 |
msgid "Time Sent: %s"
|
4379 |
msgstr ""
|
4380 |
|
4381 |
-
#: src/processors/firewall.php:
|
4382 |
#, php-format
|
4383 |
msgid "Skipping firewall checking for this visit: %s."
|
4384 |
msgstr ""
|
4385 |
|
4386 |
-
#: src/processors/firewall.php:
|
4387 |
msgid "Parsing the URI failed"
|
4388 |
msgstr ""
|
4389 |
|
4390 |
-
#: src/processors/firewall.php:
|
4391 |
msgid "Visitor detected as Search Engine Bot"
|
4392 |
msgstr ""
|
4393 |
|
4394 |
-
#: src/processors/firewall.php:
|
4395 |
#, php-format
|
4396 |
msgid "Firewall Trigger: %s."
|
4397 |
msgstr ""
|
4398 |
|
4399 |
-
#: src/processors/firewall.php:
|
4400 |
msgid "EXE File Uploads"
|
4401 |
msgstr ""
|
4402 |
|
4403 |
-
#: src/processors/firewall.php:
|
4404 |
msgid "Something in the URL, Form or Cookie data wasn't appropriate."
|
4405 |
msgstr ""
|
4406 |
|
4407 |
-
#: src/processors/firewall.php:
|
4408 |
msgid "Page parameter failed firewall check."
|
4409 |
msgstr ""
|
4410 |
|
4411 |
-
#: src/processors/firewall.php:
|
4412 |
#, php-format
|
4413 |
msgid "The offending parameter was \"%s\" with a value of \"%s\"."
|
4414 |
msgstr ""
|
4415 |
|
4416 |
-
#: src/processors/firewall.php:
|
4417 |
msgid "Visitor connection was killed with wp_die()"
|
4418 |
msgstr ""
|
4419 |
|
4420 |
-
#: src/processors/firewall.php:
|
4421 |
msgid "Visitor connection was killed with wp_die() and a message"
|
4422 |
msgstr ""
|
4423 |
|
4424 |
-
#: src/processors/firewall.php:
|
4425 |
msgid "Visitor was sent HOME"
|
4426 |
msgstr ""
|
4427 |
|
4428 |
-
#: src/processors/firewall.php:
|
4429 |
msgid "Visitor was sent 404"
|
4430 |
msgstr ""
|
4431 |
|
4432 |
-
#: src/processors/firewall.php:
|
4433 |
-
msgid "Unknown"
|
4434 |
-
msgstr ""
|
4435 |
-
|
4436 |
-
#: src/processors/firewall.php:277
|
4437 |
#, php-format
|
4438 |
-
msgid "Firewall Block
|
4439 |
msgstr ""
|
4440 |
|
4441 |
-
#: src/processors/firewall.php:
|
4442 |
#, php-format
|
4443 |
-
msgid "
|
4444 |
msgstr ""
|
4445 |
|
4446 |
-
#: src/processors/firewall.php:
|
4447 |
#, php-format
|
4448 |
-
msgid "
|
4449 |
msgstr ""
|
4450 |
|
4451 |
-
#: src/processors/firewall.php:
|
4452 |
#, php-format
|
4453 |
msgid "%s has blocked a page visit to your site."
|
4454 |
msgstr ""
|
4455 |
|
4456 |
-
#: src/processors/firewall.php:
|
4457 |
msgid "Log details for this visitor are below:"
|
4458 |
msgstr ""
|
4459 |
|
4460 |
-
#: src/processors/firewall.php:
|
4461 |
-
#: src/processors/loginprotect_twofactorauth.php:189
|
4462 |
-
#: src/processors/user_management.php:180
|
4463 |
-
#, php-format
|
4464 |
-
msgid "IP Address: %s"
|
4465 |
-
msgstr ""
|
4466 |
-
|
4467 |
-
#: src/processors/firewall.php:475
|
4468 |
#, php-format
|
4469 |
msgid "You can look up the offending IP Address here: %s"
|
4470 |
msgstr ""
|
4471 |
|
4472 |
-
#: src/processors/firewall.php:
|
4473 |
msgid "Firewall Block Alert"
|
4474 |
msgstr ""
|
4475 |
|
4476 |
-
#: src/processors/firewall.php:
|
4477 |
msgid "Directory Traversal"
|
4478 |
msgstr ""
|
4479 |
|
4480 |
-
#: src/processors/firewall.php:
|
4481 |
msgid "Leading Schema"
|
4482 |
msgstr ""
|
4483 |
|
4484 |
-
#: src/processors/firewall.php:
|
4485 |
msgid "Aggressive Rules"
|
4486 |
msgstr ""
|
4487 |
|
4488 |
-
#: src/processors/firewall.php:
|
4489 |
msgid "Unknown Rules"
|
4490 |
msgstr ""
|
4491 |
|
@@ -4494,38 +5250,34 @@ msgstr ""
|
|
4494 |
msgid "%s escaped HTML the following comment due to its size: %s"
|
4495 |
msgstr ""
|
4496 |
|
4497 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4498 |
msgid "File was successfully replaced with an original from WordPress.org"
|
4499 |
msgstr ""
|
4500 |
|
4501 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4502 |
msgid "File was not replaced"
|
4503 |
msgstr ""
|
4504 |
|
4505 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4506 |
-
|
4507 |
-
msgid "The %s Core File Scanner found files with potential problems."
|
4508 |
msgstr ""
|
4509 |
|
4510 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4511 |
-
#: src/processors/hackprotect_filecleanerscan.php:225
|
4512 |
-
#: src/processors/hackprotect_ptguard.php:455
|
4513 |
#, php-format
|
4514 |
-
msgid "
|
4515 |
-
msgstr ""
|
4516 |
-
|
4517 |
-
#: src/processors/hackprotect_corechecksumscan.php:248
|
4518 |
-
#: src/processors/hackprotect_filecleanerscan.php:232
|
4519 |
-
msgid "More Info On This Scanner"
|
4520 |
msgstr ""
|
4521 |
|
4522 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4523 |
-
|
|
|
4524 |
msgstr ""
|
4525 |
|
4526 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4527 |
-
|
4528 |
-
|
|
|
|
|
|
|
4529 |
msgstr ""
|
4530 |
|
4531 |
#: src/processors/hackprotect_corechecksumscan.php:274
|
@@ -4533,195 +5285,196 @@ msgstr ""
|
|
4533 |
msgid "%s has already attempted to repair the files."
|
4534 |
msgstr ""
|
4535 |
|
|
|
|
|
|
|
|
|
|
|
|
|
4536 |
#: src/processors/hackprotect_corechecksumscan.php:278
|
4537 |
-
#: src/processors/hackprotect_corechecksumscan.php:312
|
4538 |
msgid ""
|
4539 |
-
"
|
4540 |
-
"
|
4541 |
msgstr ""
|
4542 |
|
4543 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4544 |
-
|
4545 |
-
|
|
|
4546 |
msgstr ""
|
4547 |
|
4548 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4549 |
-
|
|
|
4550 |
msgstr ""
|
4551 |
|
4552 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4553 |
-
#: src/processors/hackprotect_filecleanerscan.php:
|
4554 |
msgid "Run Scanner"
|
4555 |
msgstr ""
|
4556 |
|
4557 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4558 |
-
|
4559 |
-
"
|
4560 |
-
"settings."
|
4561 |
msgstr ""
|
4562 |
|
4563 |
#: src/processors/hackprotect_corechecksumscan.php:327
|
4564 |
msgid ""
|
4565 |
-
"
|
4566 |
-
"
|
4567 |
-
msgstr ""
|
4568 |
-
|
4569 |
-
#: src/processors/hackprotect_corechecksumscan.php:330
|
4570 |
-
msgid ""
|
4571 |
-
"You should review these files and replace them with official versions if "
|
4572 |
-
"required."
|
4573 |
msgstr ""
|
4574 |
|
4575 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4576 |
-
msgid ""
|
4577 |
-
"Alternatively you can have the plugin attempt to repair/replace these files "
|
4578 |
-
"automatically."
|
4579 |
msgstr ""
|
4580 |
|
4581 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4582 |
-
#: src/processors/hackprotect_filecleanerscan.php:
|
4583 |
msgid "Repair file now"
|
4584 |
msgstr ""
|
4585 |
|
4586 |
-
#: src/processors/hackprotect_corechecksumscan.php:
|
4587 |
-
#: src/processors/hackprotect_filecleanerscan.php:
|
4588 |
msgid "WordPress.org source file"
|
4589 |
msgstr ""
|
4590 |
|
4591 |
-
#: src/processors/hackprotect_filecleanerscan.php:
|
4592 |
-
|
4593 |
-
msgid "The %s Unrecognised File Scanner found files which you need to review."
|
4594 |
msgstr ""
|
4595 |
|
4596 |
#: src/processors/hackprotect_filecleanerscan.php:237
|
4597 |
-
|
|
|
4598 |
msgstr ""
|
4599 |
|
4600 |
-
#: src/processors/hackprotect_filecleanerscan.php:
|
4601 |
#, php-format
|
4602 |
-
msgid "
|
|
|
|
|
|
|
|
|
4603 |
msgstr ""
|
4604 |
|
4605 |
-
#: src/processors/hackprotect_filecleanerscan.php:
|
4606 |
-
#: src/processors/hackprotect_filecleanerscan.php:296
|
4607 |
#, php-format
|
4608 |
msgid "%s has attempted to delete these files based on your current settings."
|
4609 |
msgstr ""
|
4610 |
|
4611 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4612 |
#: src/processors/hackprotect_wpvulnscan.php:177
|
4613 |
#, php-format
|
4614 |
msgid "Plugin Name: %s"
|
4615 |
msgstr ""
|
4616 |
|
4617 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4618 |
#: src/processors/hackprotect_wpvulnscan.php:179
|
4619 |
#, php-format
|
4620 |
msgid "Vulnerability Type: %s"
|
4621 |
msgstr ""
|
4622 |
|
4623 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4624 |
#, php-format
|
4625 |
msgid "Vulnerable Plugin Version Range: %s"
|
4626 |
msgstr ""
|
4627 |
|
4628 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4629 |
#: src/processors/hackprotect_wpvulnscan.php:181
|
4630 |
#, php-format
|
4631 |
msgid "Further Information: %s"
|
4632 |
msgstr ""
|
4633 |
|
4634 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4635 |
#, php-format
|
4636 |
msgid ""
|
4637 |
"%s has detected a plugin with a known security vulnerability on your site."
|
4638 |
msgstr ""
|
4639 |
|
4640 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4641 |
-
#: src/processors/hackprotect_wpvulnscan.php:
|
4642 |
msgid "Details for the plugin(s) are below:"
|
4643 |
msgstr ""
|
4644 |
|
4645 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4646 |
-
#: src/processors/hackprotect_wpvulnscan.php:
|
4647 |
msgid "You should update or remove these plugins at your earliest convenience."
|
4648 |
msgstr ""
|
4649 |
|
4650 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4651 |
-
#: src/processors/hackprotect_wpvulnscan.php:
|
4652 |
msgid "Plugin(s) Discovered With Known Security Vulnerabilities."
|
4653 |
msgstr ""
|
4654 |
|
4655 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4656 |
-
#: src/processors/hackprotect_wpvulnscan.php:
|
4657 |
#, php-format
|
4658 |
msgid "Successfully sent Plugin Vulnerability Notification email alert to: %s"
|
4659 |
msgstr ""
|
4660 |
|
4661 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4662 |
-
#: src/processors/hackprotect_wpvulnscan.php:
|
4663 |
#, php-format
|
4664 |
msgid "Failed to send Plugin Vulnerability Notification email alert to: %s"
|
4665 |
msgstr ""
|
4666 |
|
4667 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4668 |
#, php-format
|
4669 |
msgid ""
|
4670 |
"%s has discovered that the currently installed version of the \"%s\" plugin "
|
4671 |
"has a known security vulnerability."
|
4672 |
msgstr ""
|
4673 |
|
4674 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4675 |
#: src/processors/hackprotect_wpvulnscan.php:145
|
4676 |
msgid "Vulnerability Type"
|
4677 |
msgstr ""
|
4678 |
|
4679 |
-
#: src/processors/hackprotect_pluginvulnerabilities.php:
|
4680 |
msgid "Vulnerable Versions"
|
4681 |
msgstr ""
|
4682 |
|
4683 |
-
#: src/processors/hackprotect_ptguard.php:
|
4684 |
msgid "Silenced repeated email alert from Plugin/Theme Scan Guard"
|
4685 |
msgstr ""
|
4686 |
|
4687 |
-
#: src/processors/hackprotect_ptguard.php:
|
4688 |
#, php-format
|
4689 |
msgid ""
|
4690 |
"%s has detected at least 1 Plugins/Themes have been modified on your site."
|
4691 |
msgstr ""
|
4692 |
|
4693 |
-
#: src/processors/hackprotect_ptguard.php:
|
4694 |
msgid ""
|
4695 |
"You will receive only 1 email notification about these changes in a 1 week "
|
4696 |
"period."
|
4697 |
msgstr ""
|
4698 |
|
4699 |
-
#: src/processors/hackprotect_ptguard.php:
|
4700 |
msgid "Details of the problem items are below:"
|
4701 |
msgstr ""
|
4702 |
|
4703 |
-
#: src/processors/hackprotect_ptguard.php:
|
4704 |
msgid "Modified Plugins:"
|
4705 |
msgstr ""
|
4706 |
|
4707 |
-
#: src/processors/hackprotect_ptguard.php:
|
4708 |
msgid "Modified Themes:"
|
4709 |
msgstr ""
|
4710 |
|
4711 |
-
#: src/processors/hackprotect_ptguard.php:
|
4712 |
msgid "Run the scanner"
|
4713 |
msgstr ""
|
4714 |
|
4715 |
-
#: src/processors/hackprotect_ptguard.php:
|
4716 |
msgid "Plugins/Themes Have Been Altered"
|
4717 |
msgstr ""
|
4718 |
|
4719 |
-
#: src/processors/hackprotect_ptguard.php:
|
4720 |
#, php-format
|
4721 |
msgid "Successfully sent Plugin/Theme Guard email alert to: %s"
|
4722 |
msgstr ""
|
4723 |
|
4724 |
-
#: src/processors/hackprotect_ptguard.php:
|
4725 |
#, php-format
|
4726 |
msgid "Failed to send Plugin/Theme Guard email alert to: %s"
|
4727 |
msgstr ""
|
@@ -4755,100 +5508,96 @@ msgstr ""
|
|
4755 |
msgid "Fixed Version: %s"
|
4756 |
msgstr ""
|
4757 |
|
4758 |
-
#: src/processors/hackprotect_wpvulnscan.php:
|
4759 |
#, php-format
|
4760 |
msgid "%s has detected plugins with known security vulnerabilities."
|
4761 |
msgstr ""
|
4762 |
|
4763 |
-
#: src/processors/hackprotect_wpvulnscan.php:
|
4764 |
#, php-format
|
4765 |
msgid "Go To Your Plugins: %s"
|
4766 |
msgstr ""
|
4767 |
|
4768 |
-
#: src/processors/ips.php:
|
4769 |
#, php-format
|
4770 |
msgid "404 detected at \"%s\""
|
4771 |
msgstr ""
|
4772 |
|
4773 |
-
#: src/processors/ips.php:
|
4774 |
#, php-format
|
4775 |
msgid "%s is ignoring you"
|
4776 |
msgstr ""
|
4777 |
|
4778 |
-
#: src/processors/ips.php:
|
4779 |
msgid ""
|
4780 |
"Your IP address is whitelisted and NO features you activate apply to you."
|
4781 |
msgstr ""
|
4782 |
|
4783 |
-
#: src/processors/ips.php:
|
4784 |
msgid "Including the hiding the WP Login page."
|
4785 |
msgstr ""
|
4786 |
|
4787 |
-
#: src/processors/ips.php:
|
4788 |
#, php-format
|
4789 |
msgid ""
|
4790 |
"Visitor was found to be on the Black List with IP address \"%s\" and their "
|
4791 |
"connection was killed."
|
4792 |
msgstr ""
|
4793 |
|
4794 |
-
#: src/processors/ips.php:
|
4795 |
#, php-format
|
4796 |
msgid "You have been black listed by the %s plugin."
|
4797 |
msgstr ""
|
4798 |
|
4799 |
-
#: src/processors/ips.php:
|
4800 |
#, php-format
|
4801 |
msgid ""
|
4802 |
"You tripped the security plugin defenses a total of %s times making you a "
|
4803 |
"suspect."
|
4804 |
msgstr ""
|
4805 |
|
4806 |
-
#: src/processors/ips.php:
|
4807 |
msgid "If you believe this to be in error, please contact the site owner."
|
4808 |
msgstr ""
|
4809 |
|
4810 |
-
#: src/processors/ips.php:
|
4811 |
#, php-format
|
4812 |
msgid ""
|
4813 |
"Time remaining until you are automatically removed from the black list: %s "
|
4814 |
"minute(s)"
|
4815 |
msgstr ""
|
4816 |
|
4817 |
-
#: src/processors/ips.php:
|
4818 |
msgid ""
|
4819 |
"If you attempt to access the site within this period the counter will be "
|
4820 |
"reset."
|
4821 |
msgstr ""
|
4822 |
|
4823 |
-
#: src/processors/ips.php:
|
4824 |
#, php-format
|
4825 |
msgid "Auto Black List transgression counter was incremented from %s to %s."
|
4826 |
msgstr ""
|
4827 |
|
4828 |
-
#: src/processors/ips.php:
|
4829 |
msgid "Auto Black List transgression counter was started for visitor."
|
4830 |
msgstr ""
|
4831 |
|
4832 |
-
#: src/processors/ips.php:
|
4833 |
msgid "No Label"
|
4834 |
msgstr ""
|
4835 |
|
4836 |
-
#: src/processors/lockdown.php:
|
4837 |
#, php-format
|
4838 |
msgid "Anonymous access to the WordPress Rest API has been restricted by %s."
|
4839 |
msgstr ""
|
4840 |
|
4841 |
-
#: src/processors/lockdown.php:
|
4842 |
#, php-format
|
4843 |
msgid ""
|
4844 |
"The \"author\" query parameter has been blocked by %s to protect against "
|
4845 |
"user login name fishing."
|
4846 |
msgstr ""
|
4847 |
|
4848 |
-
#: src/processors/lockdown.php:204 src/processors/plugin_tracking.php:38
|
4849 |
-
msgid "Learn More."
|
4850 |
-
msgstr ""
|
4851 |
-
|
4852 |
#: src/processors/login_protect.php:68
|
4853 |
msgid "Please verify email has been received"
|
4854 |
msgstr ""
|
@@ -4876,52 +5625,50 @@ msgstr ""
|
|
4876 |
msgid "To turn this notice off, disable 2-Factor Authentication."
|
4877 |
msgstr ""
|
4878 |
|
4879 |
-
#: src/processors/loginprotect_cooldown.php:
|
4880 |
-
msgid "
|
4881 |
msgstr ""
|
4882 |
|
4883 |
-
#: src/processors/loginprotect_cooldown.php:
|
4884 |
#, php-format
|
4885 |
-
msgid "You must wait %s seconds before attempting
|
4886 |
msgstr ""
|
4887 |
|
4888 |
-
#: src/processors/loginprotect_cooldown.php:
|
4889 |
-
|
4890 |
-
|
4891 |
-
msgstr ""
|
4892 |
-
|
4893 |
-
#: src/processors/loginprotect_cooldown.php:55
|
4894 |
-
msgid "register"
|
4895 |
-
msgstr ""
|
4896 |
-
|
4897 |
-
#: src/processors/loginprotect_gasp.php:81
|
4898 |
-
msgid "Bot Checking Failed."
|
4899 |
msgstr ""
|
4900 |
|
4901 |
-
#: src/processors/loginprotect_gasp.php:
|
4902 |
msgid "You MUST enable Javascript to be able to login"
|
4903 |
msgstr ""
|
4904 |
|
4905 |
-
#: src/processors/loginprotect_gasp.php:
|
|
|
4906 |
#, php-format
|
4907 |
msgid "User \"%s\" attempted to %s but GASP checkbox was not present."
|
4908 |
msgstr ""
|
4909 |
|
4910 |
-
#: src/processors/loginprotect_gasp.php:
|
4911 |
-
#: src/processors/loginprotect_gasp.php:
|
|
|
|
|
4912 |
msgid "Probably a BOT."
|
4913 |
msgstr ""
|
4914 |
|
4915 |
-
#: src/processors/loginprotect_gasp.php:
|
|
|
4916 |
msgid "You must check that box to say you're not a bot."
|
4917 |
msgstr ""
|
4918 |
|
4919 |
-
#: src/processors/loginprotect_gasp.php:
|
|
|
4920 |
#, php-format
|
4921 |
msgid "User \"%s\" attempted to %s but they were caught by the GASP honeypot."
|
4922 |
msgstr ""
|
4923 |
|
4924 |
-
#: src/processors/loginprotect_gasp.php:
|
|
|
4925 |
#, php-format
|
4926 |
msgid "You appear to be a bot - terminating %s attempt."
|
4927 |
msgstr ""
|
@@ -4956,7 +5703,7 @@ msgid "Remove %s"
|
|
4956 |
msgstr ""
|
4957 |
|
4958 |
#: src/processors/loginprotect_googleauthenticator.php:42
|
4959 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
4960 |
msgid "Google Authenticator Code"
|
4961 |
msgstr ""
|
4962 |
|
@@ -4969,13 +5716,13 @@ msgid "Scan This QR Code"
|
|
4969 |
msgstr ""
|
4970 |
|
4971 |
#: src/processors/loginprotect_googleauthenticator.php:46
|
4972 |
-
#: src/processors/loginprotect_yubikey.php:
|
4973 |
#, php-format
|
4974 |
msgid "Sorry, %s may not be added to another user's account."
|
4975 |
msgstr ""
|
4976 |
|
4977 |
#: src/processors/loginprotect_googleauthenticator.php:47
|
4978 |
-
#: src/processors/loginprotect_yubikey.php:
|
4979 |
#, php-format
|
4980 |
msgid ""
|
4981 |
"Sorry, %s may only be removed from another user's account by a Security "
|
@@ -4983,234 +5730,226 @@ msgid ""
|
|
4983 |
msgstr ""
|
4984 |
|
4985 |
#: src/processors/loginprotect_googleauthenticator.php:48
|
4986 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
4987 |
-
#: src/processors/loginprotect_yubikey.php:
|
4988 |
#, php-format
|
4989 |
msgid "Provided by %s"
|
4990 |
msgstr ""
|
4991 |
|
4992 |
#: src/processors/loginprotect_googleauthenticator.php:49
|
4993 |
-
#: src/processors/loginprotect_yubikey.php:
|
4994 |
msgid "Understand how to remove Google Authenticator"
|
4995 |
msgstr ""
|
4996 |
|
4997 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
4998 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
4999 |
msgid "Google Authenticator was successfully removed from the account."
|
5000 |
msgstr ""
|
5001 |
|
5002 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5003 |
msgid ""
|
5004 |
"Google Authenticator could not be removed from the account - ensure your "
|
5005 |
"code is correct."
|
5006 |
msgstr ""
|
5007 |
|
5008 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5009 |
-
#: src/processors/loginprotect_yubikey.php:
|
5010 |
msgid "One Time Password (OTP) was not valid."
|
5011 |
msgstr ""
|
5012 |
|
5013 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5014 |
-
#: src/processors/loginprotect_yubikey.php:
|
5015 |
msgid "Please try again."
|
5016 |
msgstr ""
|
5017 |
|
5018 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5019 |
msgid ""
|
5020 |
"An email has been sent to you in order to confirm Google Authenticator "
|
5021 |
"removal"
|
5022 |
msgstr ""
|
5023 |
|
5024 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5025 |
msgid ""
|
5026 |
"We tried to send an email for you to confirm Google Authenticator removal "
|
5027 |
"but it failed."
|
5028 |
msgstr ""
|
5029 |
|
5030 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5031 |
-
#: src/processors/loginprotect_yubikey.php:92
|
5032 |
#, php-format
|
5033 |
msgid "%s was successfully added to your account."
|
5034 |
msgstr ""
|
5035 |
|
5036 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5037 |
msgid "Did we forget to use the Google Authenticator?"
|
5038 |
msgstr ""
|
5039 |
|
5040 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5041 |
msgid "Oh dear."
|
5042 |
msgstr ""
|
5043 |
|
5044 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5045 |
msgid "Google Authenticator Code Failed."
|
5046 |
msgstr ""
|
5047 |
|
5048 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5049 |
msgid "Please use your Google Authenticator App to retrieve your code."
|
5050 |
msgstr ""
|
5051 |
|
5052 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5053 |
msgid ""
|
5054 |
"You have requested the removal of Google Authenticator from your WordPress "
|
5055 |
"account."
|
5056 |
msgstr ""
|
5057 |
|
5058 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5059 |
msgid "Please click the link below to confirm."
|
5060 |
msgstr ""
|
5061 |
|
5062 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5063 |
msgid "Google Authenticator Removal Confirmation"
|
5064 |
msgstr ""
|
5065 |
|
5066 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5067 |
msgid "Google Authenticator was successfully removed from this account."
|
5068 |
msgstr ""
|
5069 |
|
5070 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5071 |
#, php-format
|
5072 |
msgid ""
|
5073 |
"User \"%s\" verified their identity using Google Authenticator Two-Factor "
|
5074 |
"Authentication."
|
5075 |
msgstr ""
|
5076 |
|
5077 |
-
#: src/processors/loginprotect_googleauthenticator.php:
|
5078 |
#, php-format
|
5079 |
msgid ""
|
5080 |
"User \"%s\" failed to verify their identity using Google Authenticator Two-"
|
5081 |
"Factor Authentication."
|
5082 |
msgstr ""
|
5083 |
|
5084 |
-
#: src/processors/loginprotect_intent.php:
|
5085 |
msgid "Success"
|
5086 |
msgstr ""
|
5087 |
|
5088 |
-
#: src/processors/loginprotect_intent.php:
|
5089 |
msgid "Thank you for authenticating your login."
|
5090 |
msgstr ""
|
5091 |
|
5092 |
-
#: src/processors/loginprotect_intent.php:
|
5093 |
msgid "One or more of your authentication codes failed or was missing"
|
5094 |
msgstr ""
|
5095 |
|
5096 |
-
#: src/processors/loginprotect_intent.php:
|
5097 |
msgid "Please supply all authentication codes"
|
5098 |
msgstr ""
|
5099 |
|
5100 |
-
#: src/processors/loginprotect_intent.php:
|
5101 |
msgid "Please supply at least 1 authentication code"
|
5102 |
msgstr ""
|
5103 |
|
5104 |
-
#: src/processors/loginprotect_intent.php:
|
5105 |
msgid "Cancel Login"
|
5106 |
msgstr ""
|
5107 |
|
5108 |
-
#: src/processors/loginprotect_intent.php:
|
5109 |
msgid "Time Remaining"
|
5110 |
msgstr ""
|
5111 |
|
5112 |
-
#: src/processors/loginprotect_intent.php:
|
5113 |
msgid "Calculating"
|
5114 |
msgstr ""
|
5115 |
|
5116 |
-
#: src/processors/loginprotect_intent.php:
|
5117 |
msgid "Seconds"
|
5118 |
msgstr ""
|
5119 |
|
5120 |
-
#: src/processors/loginprotect_intent.php:
|
5121 |
msgid "Login Expired"
|
5122 |
msgstr ""
|
5123 |
|
5124 |
-
#: src/processors/loginprotect_intent.php:
|
5125 |
msgid "Verify My Login"
|
5126 |
msgstr ""
|
5127 |
|
5128 |
-
#: src/processors/loginprotect_intent.php:
|
5129 |
msgid "What is this?"
|
5130 |
msgstr ""
|
5131 |
|
5132 |
-
#: src/processors/loginprotect_intent.php:
|
5133 |
#, php-format
|
5134 |
msgid "%s Login Verification"
|
5135 |
msgstr ""
|
5136 |
|
5137 |
-
#: src/processors/loginprotect_intent.php:
|
5138 |
#, php-format
|
5139 |
msgid "Don't ask again on this browser for %s day(s)"
|
5140 |
msgstr ""
|
5141 |
|
5142 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5143 |
#, php-format
|
5144 |
msgid ""
|
5145 |
"User \"%s\" verified their identity using Email Two-Factor Authentication."
|
5146 |
msgstr ""
|
5147 |
|
5148 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5149 |
#, php-format
|
5150 |
msgid ""
|
5151 |
"User \"%s\" failed to verify their identity using Email Two-Factor "
|
5152 |
"Authentication."
|
5153 |
msgstr ""
|
5154 |
|
5155 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5156 |
msgid "This code was just sent to your registered Email address."
|
5157 |
msgstr ""
|
5158 |
|
5159 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5160 |
msgid "Email OTP"
|
5161 |
msgstr ""
|
5162 |
|
5163 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5164 |
msgid "Someone attempted to login into this WordPress site using your account."
|
5165 |
msgstr ""
|
5166 |
|
5167 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5168 |
msgid "Login requires verification with the following code."
|
5169 |
msgstr ""
|
5170 |
|
5171 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5172 |
#, php-format
|
5173 |
msgid "Verification Code: %s"
|
5174 |
msgstr ""
|
5175 |
|
5176 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5177 |
msgid "Login Details"
|
5178 |
msgstr ""
|
5179 |
|
5180 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5181 |
-
|
5182 |
-
msgid "URL: %s"
|
5183 |
-
msgstr ""
|
5184 |
-
|
5185 |
-
#: src/processors/loginprotect_twofactorauth.php:188
|
5186 |
-
#: src/processors/user_management.php:178
|
5187 |
-
#, php-format
|
5188 |
-
msgid "Username: %s"
|
5189 |
msgstr ""
|
5190 |
|
5191 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5192 |
msgid "Why no login link?"
|
5193 |
msgstr ""
|
5194 |
|
5195 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5196 |
msgid "Two-Factor Login Verification"
|
5197 |
msgstr ""
|
5198 |
|
5199 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5200 |
#, php-format
|
5201 |
msgid ""
|
5202 |
"User \"%s\" was sent an email to verify their Identity using Two-Factor "
|
5203 |
"Login Auth for IP address \"%s\"."
|
5204 |
msgstr ""
|
5205 |
|
5206 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5207 |
#, php-format
|
5208 |
msgid ""
|
5209 |
"Tried to send email to User \"%s\" to verify their identity using Two-Factor "
|
5210 |
"Login Auth for IP address \"%s\", but email sending failed."
|
5211 |
msgstr ""
|
5212 |
|
5213 |
-
#: src/processors/loginprotect_twofactorauth.php:
|
5214 |
msgid "Check the box to enable email-based login authentication."
|
5215 |
msgstr ""
|
5216 |
|
@@ -5247,124 +5986,155 @@ msgid ""
|
|
5247 |
"cannot parse the necessary information."
|
5248 |
msgstr ""
|
5249 |
|
5250 |
-
#: src/processors/loginprotect_yubikey.php:
|
5251 |
msgid "This is your unique Yubikey Device ID."
|
5252 |
msgstr ""
|
5253 |
|
5254 |
-
#: src/processors/loginprotect_yubikey.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5255 |
msgid "Provide a One Time Password from your Yubikey."
|
5256 |
msgstr ""
|
5257 |
|
5258 |
-
#: src/processors/loginprotect_yubikey.php:
|
5259 |
-
msgid "This will remove Yubikey
|
5260 |
msgstr ""
|
5261 |
|
5262 |
-
#: src/processors/loginprotect_yubikey.php:
|
5263 |
-
msgid "This will add Yubikey
|
5264 |
msgstr ""
|
5265 |
|
5266 |
#: src/processors/loginprotect_yubikey.php:41
|
|
|
|
|
|
|
|
|
|
|
|
|
5267 |
msgid "Yubikey ID"
|
5268 |
msgstr ""
|
5269 |
|
5270 |
-
#: src/processors/loginprotect_yubikey.php:
|
5271 |
-
#: src/processors/loginprotect_yubikey.php:
|
5272 |
msgid "Yubikey OTP"
|
5273 |
msgstr ""
|
5274 |
|
5275 |
-
#: src/processors/loginprotect_yubikey.php:
|
5276 |
msgid "Yubikey Authentication"
|
5277 |
msgstr ""
|
5278 |
|
5279 |
-
#: src/processors/loginprotect_yubikey.php:
|
5280 |
-
#: src/processors/loginprotect_yubikey.php:93
|
5281 |
-
#: src/processors/loginprotect_yubikey.php:102
|
5282 |
msgid "Yubikey"
|
5283 |
msgstr ""
|
5284 |
|
5285 |
-
#: src/processors/loginprotect_yubikey.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5286 |
#, php-format
|
5287 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
|
5288 |
msgstr ""
|
5289 |
|
5290 |
-
#: src/processors/loginprotect_yubikey.php:
|
5291 |
#, php-format
|
5292 |
msgid ""
|
5293 |
"User \"%s\" logged in without a Yubikey One Time Password because no "
|
5294 |
"username-yubikey pair was found for this user."
|
5295 |
msgstr ""
|
5296 |
|
5297 |
-
#: src/processors/loginprotect_yubikey.php:
|
5298 |
#, php-format
|
5299 |
msgid ""
|
5300 |
"User \"%s\" attempted to login but Yubikey ID \"%s\" used was not in list of "
|
5301 |
"authorised keys."
|
5302 |
msgstr ""
|
5303 |
|
5304 |
-
#: src/processors/loginprotect_yubikey.php:
|
5305 |
-
#: src/processors/loginprotect_yubikey.php:
|
5306 |
#, php-format
|
5307 |
msgid "ERROR: %s"
|
5308 |
msgstr ""
|
5309 |
|
5310 |
-
#: src/processors/loginprotect_yubikey.php:
|
5311 |
msgid ""
|
5312 |
"The Yubikey provided is not on the list of permitted keys for this user."
|
5313 |
msgstr ""
|
5314 |
|
5315 |
-
#: src/processors/loginprotect_yubikey.php:
|
5316 |
-
#: src/processors/loginprotect_yubikey.php:215
|
5317 |
-
#, php-format
|
5318 |
-
msgid ""
|
5319 |
-
"User \"%s\" successfully logged in using a validated Yubikey One Time "
|
5320 |
-
"Password."
|
5321 |
-
msgstr ""
|
5322 |
-
|
5323 |
-
#: src/processors/loginprotect_yubikey.php:174
|
5324 |
#, php-format
|
5325 |
msgid ""
|
5326 |
"User \"%s\" attempted to login but Yubikey One Time Password failed to "
|
5327 |
"validate due to invalid Yubi API response.\"."
|
5328 |
msgstr ""
|
5329 |
|
5330 |
-
#: src/processors/loginprotect_yubikey.php:
|
5331 |
msgid "The Yubikey authentication was not validated successfully."
|
5332 |
msgstr ""
|
5333 |
|
5334 |
-
#: src/processors/
|
5335 |
-
#, php-format
|
5336 |
-
msgid ""
|
5337 |
-
"User \"%s\" failed to verify their identity using Yubikey One Time Password."
|
5338 |
-
msgstr ""
|
5339 |
-
|
5340 |
-
#: src/processors/loginprotect_yubikey.php:238
|
5341 |
-
msgid "Use your Yubikey to generate a new code."
|
5342 |
-
msgstr ""
|
5343 |
-
|
5344 |
-
#: src/processors/plugin.php:159
|
5345 |
#, php-format
|
5346 |
msgid "%s plugin is not currently processing requests"
|
5347 |
msgstr ""
|
5348 |
|
5349 |
-
#: src/processors/plugin.php:
|
5350 |
#, php-format
|
5351 |
msgid "Please delete the \"%s\" file to reactivate the %s protection"
|
5352 |
msgstr ""
|
5353 |
|
5354 |
-
#: src/processors/plugin.php:
|
|
|
|
|
|
|
|
|
5355 |
msgid "Your Name"
|
5356 |
msgstr ""
|
5357 |
|
5358 |
-
#: src/processors/plugin.php:
|
5359 |
msgid "Your Email"
|
5360 |
msgstr ""
|
5361 |
|
5362 |
-
#: src/processors/plugin_badge.php:
|
5363 |
#, php-format
|
5364 |
msgid "%s is provided by %s"
|
5365 |
msgstr ""
|
5366 |
|
5367 |
-
#: src/processors/plugin_badge.php:
|
5368 |
#, php-format
|
5369 |
msgid "Days Installed: %s"
|
5370 |
msgstr ""
|
@@ -5384,232 +6154,274 @@ msgstr ""
|
|
5384 |
msgid "Site Secured"
|
5385 |
msgstr ""
|
5386 |
|
5387 |
-
#: src/processors/plugin_importexport.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5388 |
#, php-format
|
5389 |
msgid "Not currently running %s Pro."
|
5390 |
msgstr ""
|
5391 |
|
5392 |
-
#: src/processors/plugin_importexport.php:
|
5393 |
msgid "Export of options is currently disabled."
|
5394 |
msgstr ""
|
5395 |
|
5396 |
-
#: src/processors/plugin_importexport.php:
|
5397 |
msgid "Handshake verification failed."
|
5398 |
msgstr ""
|
5399 |
|
5400 |
-
#: src/processors/plugin_importexport.php:
|
5401 |
#, php-format
|
5402 |
msgid "Options exported to site %s."
|
5403 |
msgstr ""
|
5404 |
|
5405 |
-
#: src/processors/plugin_importexport.php:
|
5406 |
#, php-format
|
5407 |
msgid "Site added to export white list: %s."
|
5408 |
msgstr ""
|
5409 |
|
5410 |
-
#: src/processors/plugin_importexport.php:
|
5411 |
#, php-format
|
5412 |
msgid "Options imported from %s."
|
5413 |
msgstr ""
|
5414 |
|
5415 |
-
#: src/processors/plugin_importexport.php:
|
5416 |
#, php-format
|
5417 |
msgid "Master Site URL set to %s."
|
5418 |
msgstr ""
|
5419 |
|
5420 |
-
#: src/processors/plugin_tracking.php:
|
5421 |
#, php-format
|
5422 |
msgid "Make %s even better by sharing usage info?"
|
5423 |
msgstr ""
|
5424 |
|
5425 |
-
#: src/processors/plugin_tracking.php:
|
5426 |
#, php-format
|
5427 |
msgid "We're hoping to understand how %s is configured and used."
|
5428 |
msgstr ""
|
5429 |
|
5430 |
-
#: src/processors/plugin_tracking.php:
|
5431 |
msgid "We'd like to understand how effective it is on a global scale."
|
5432 |
msgstr ""
|
5433 |
|
5434 |
-
#: src/processors/plugin_tracking.php:
|
5435 |
msgid ""
|
5436 |
"The data sent is always completely anonymous and we can never track you or "
|
5437 |
"your site."
|
5438 |
msgstr ""
|
5439 |
|
5440 |
-
#: src/processors/plugin_tracking.php:
|
5441 |
msgid "It can be turned-off at any time within the plugin options."
|
5442 |
msgstr ""
|
5443 |
|
5444 |
-
#: src/processors/plugin_tracking.php:
|
5445 |
msgid "Click to see the RAW data that would be sent"
|
5446 |
msgstr ""
|
5447 |
|
5448 |
-
#: src/processors/plugin_tracking.php:
|
5449 |
msgid "Absolutely"
|
5450 |
msgstr ""
|
5451 |
|
5452 |
-
#: src/processors/sessions.php:
|
5453 |
msgid "You're already logged-in."
|
5454 |
msgstr ""
|
5455 |
|
5456 |
-
#: src/processors/sessions.php:
|
5457 |
msgid "Go To Admin"
|
5458 |
msgstr ""
|
5459 |
|
5460 |
-
#: src/processors/statistics.php:
|
5461 |
-
msgid "Comment Blocks"
|
5462 |
-
msgstr ""
|
5463 |
-
|
5464 |
-
#: src/processors/statistics.php:132
|
5465 |
-
msgid "Firewall Blocks"
|
5466 |
-
msgstr ""
|
5467 |
-
|
5468 |
-
#: src/processors/statistics.php:133
|
5469 |
-
msgid "Login Blocks"
|
5470 |
-
msgstr ""
|
5471 |
-
|
5472 |
-
#: src/processors/statistics.php:134
|
5473 |
msgid "Login Verified"
|
5474 |
msgstr ""
|
5475 |
|
5476 |
-
#: src/processors/statistics.php:
|
5477 |
msgid "IP Auto Black-Listed"
|
5478 |
msgstr ""
|
5479 |
|
5480 |
-
#: src/processors/statistics.php:
|
5481 |
msgid "Total Transgressions"
|
5482 |
msgstr ""
|
5483 |
|
5484 |
-
#: src/processors/statistics.php:
|
5485 |
-
|
|
|
5486 |
msgstr ""
|
5487 |
|
5488 |
-
#: src/processors/user_management.php:
|
5489 |
msgid "Last Login"
|
5490 |
msgstr ""
|
5491 |
|
5492 |
-
#: src/processors/user_management.php:
|
5493 |
msgid "Not Recorded"
|
5494 |
msgstr ""
|
5495 |
|
5496 |
-
#: src/processors/user_management.php:
|
5497 |
#, php-format
|
5498 |
msgid ""
|
5499 |
"As requested, %s is notifying you of a successful %s login to a WordPress "
|
5500 |
"site that you manage."
|
5501 |
msgstr ""
|
5502 |
|
5503 |
-
#: src/processors/user_management.php:
|
5504 |
#, php-format
|
5505 |
msgid "Important: %s"
|
5506 |
msgstr ""
|
5507 |
|
5508 |
-
#: src/processors/user_management.php:
|
5509 |
msgid ""
|
5510 |
"This user may now be subject to additional Two-Factor Authentication before "
|
5511 |
"completing their login."
|
5512 |
msgstr ""
|
5513 |
|
5514 |
-
#: src/processors/user_management.php:
|
5515 |
msgid "Details for this user are below:"
|
5516 |
msgstr ""
|
5517 |
|
5518 |
-
#: src/processors/user_management.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5519 |
#, php-format
|
5520 |
-
msgid "
|
5521 |
msgstr ""
|
5522 |
|
5523 |
-
#: src/processors/user_management.php:
|
5524 |
#, php-format
|
5525 |
-
msgid "
|
5526 |
msgstr ""
|
5527 |
|
5528 |
-
#: src/processors/user_management.php:
|
5529 |
-
msgid "
|
5530 |
msgstr ""
|
5531 |
|
5532 |
-
#: src/processors/user_management.php:
|
5533 |
-
|
5534 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5535 |
msgstr ""
|
5536 |
|
5537 |
-
#: src/processors/
|
5538 |
#, php-format
|
5539 |
-
msgid "
|
|
|
|
|
|
|
|
|
5540 |
msgstr ""
|
5541 |
|
5542 |
-
#: src/processors/usermanagement_passwords.php:
|
5543 |
msgid ""
|
5544 |
-
"Your password doesn't
|
5545 |
-
"
|
|
|
|
|
|
|
|
|
|
|
|
|
5546 |
msgstr ""
|
5547 |
|
5548 |
-
#: src/processors/usermanagement_passwords.php:
|
5549 |
msgid ""
|
5550 |
"Your security administrator has imposed requirements for password quality."
|
5551 |
msgstr ""
|
5552 |
|
5553 |
-
#: src/processors/usermanagement_passwords.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5554 |
#, php-format
|
5555 |
msgid "Password length (%s) too short (min: %s characters)"
|
5556 |
msgstr ""
|
5557 |
|
5558 |
-
#: src/processors/usermanagement_passwords.php:
|
5559 |
-
#: src/processors/usermanagement_passwords.php:
|
5560 |
msgid "Please use a different password."
|
5561 |
msgstr ""
|
5562 |
|
5563 |
-
#: src/processors/usermanagement_passwords.php:
|
5564 |
-
#: src/processors/usermanagement_passwords.php:319
|
5565 |
msgid "This password has already been pwned."
|
5566 |
msgstr ""
|
5567 |
|
5568 |
-
#: src/processors/usermanagement_passwords.php:
|
5569 |
-
#: src/processors/usermanagement_passwords.php:
|
5570 |
#, php-format
|
5571 |
msgid "%s times"
|
5572 |
msgstr ""
|
5573 |
|
5574 |
-
#: src/processors/
|
|
|
|
|
|
|
|
|
5575 |
msgid "Your session has expired."
|
5576 |
msgstr ""
|
5577 |
|
5578 |
-
#: src/processors/usermanagement_sessions.php:
|
5579 |
msgid "Your session was idle for too long."
|
5580 |
msgstr ""
|
5581 |
|
5582 |
-
#: src/processors/usermanagement_sessions.php:
|
5583 |
msgid "Your session was locked to another IP Address."
|
5584 |
msgstr ""
|
5585 |
|
5586 |
-
#: src/processors/usermanagement_sessions.php:
|
5587 |
#, php-format
|
5588 |
msgid "You do not currently have a %s user session."
|
5589 |
msgstr ""
|
5590 |
|
5591 |
-
#: src/processors/usermanagement_sessions.php:
|
5592 |
msgid "An administrator has terminated this session."
|
5593 |
msgstr ""
|
5594 |
|
5595 |
-
#: src/processors/usermanagement_sessions.php:
|
5596 |
msgid "Not a user."
|
5597 |
msgstr ""
|
5598 |
|
5599 |
-
#: src/processors/usermanagement_sessions.php:
|
5600 |
msgid "Your session was terminated."
|
5601 |
msgstr ""
|
5602 |
|
5603 |
-
#: src/processors/usermanagement_sessions.php:
|
5604 |
msgid "Please login again."
|
5605 |
msgstr ""
|
5606 |
|
5607 |
-
#: src/wizards/base.php:
|
5608 |
#, php-format
|
5609 |
msgid "%s Wizard"
|
5610 |
msgstr ""
|
5611 |
|
5612 |
-
#: src/wizards/base.php:
|
5613 |
msgid "No Access"
|
5614 |
msgstr ""
|
5615 |
|
@@ -5626,7 +6438,7 @@ msgstr ""
|
|
5626 |
msgid "All changes detected have been ignored."
|
5627 |
msgstr ""
|
5628 |
|
5629 |
-
#: src/wizards/hack_protect.php:
|
5630 |
msgid "The plugin has been deactivated."
|
5631 |
msgstr ""
|
5632 |
|
@@ -5660,176 +6472,184 @@ msgstr ""
|
|
5660 |
msgid "disabled"
|
5661 |
msgstr ""
|
5662 |
|
5663 |
-
#: src/wizards/plugin.php:
|
5664 |
#, php-format
|
5665 |
msgid "%s Welcome Wizard"
|
5666 |
msgstr ""
|
5667 |
|
5668 |
-
#: src/wizards/plugin.php:
|
5669 |
msgid "Where to find Shield"
|
5670 |
msgstr ""
|
5671 |
|
5672 |
-
#: src/wizards/plugin.php:
|
5673 |
msgid "Accessing Each Module"
|
5674 |
msgstr ""
|
5675 |
|
5676 |
-
#: src/wizards/plugin.php:
|
5677 |
msgid "Accessing Options"
|
5678 |
msgstr ""
|
5679 |
|
5680 |
-
#: src/wizards/plugin.php:
|
5681 |
msgid "Launching Wizards"
|
5682 |
msgstr ""
|
5683 |
|
5684 |
-
#: src/wizards/plugin.php:
|
5685 |
msgid "Finding Help"
|
5686 |
msgstr ""
|
5687 |
|
5688 |
-
#: src/wizards/plugin.php:
|
5689 |
msgid "Actions (not Options)"
|
5690 |
msgstr ""
|
5691 |
|
5692 |
-
#: src/wizards/plugin.php:
|
5693 |
msgid "Help For Each Option"
|
5694 |
msgstr ""
|
5695 |
|
5696 |
-
#: src/wizards/plugin.php:
|
5697 |
msgid "Module On/Off Switch"
|
5698 |
msgstr ""
|
5699 |
|
5700 |
-
#: src/wizards/plugin.php:
|
5701 |
#, php-format
|
5702 |
msgid "You'll find the main %s settings in the left-hand WordPress menu."
|
5703 |
msgstr ""
|
5704 |
|
5705 |
-
#: src/wizards/plugin.php:
|
5706 |
msgid ""
|
5707 |
"Shield is split up into independent modules for accessing the options of "
|
5708 |
"each feature."
|
5709 |
msgstr ""
|
5710 |
|
5711 |
-
#: src/wizards/plugin.php:
|
5712 |
msgid ""
|
5713 |
"When you load a module, you can access the options by clicking on the "
|
5714 |
"Options Panel link."
|
5715 |
msgstr ""
|
5716 |
|
5717 |
-
#: src/wizards/plugin.php:
|
5718 |
msgid "Launch helpful walk-through wizards for modules that have them."
|
5719 |
msgstr ""
|
5720 |
|
5721 |
-
#: src/wizards/plugin.php:
|
5722 |
msgid ""
|
5723 |
"Each module also has a brief overview help section - there is more in-depth "
|
5724 |
"help available."
|
5725 |
msgstr ""
|
5726 |
|
5727 |
-
#: src/wizards/plugin.php:
|
5728 |
msgid ""
|
5729 |
"Certain modules have extra actions and features, e.g. Audit Trail Viewer."
|
5730 |
msgstr ""
|
5731 |
|
5732 |
-
#: src/wizards/plugin.php:
|
5733 |
msgid "Note: Not all modules have the actions section"
|
5734 |
msgstr ""
|
5735 |
|
5736 |
-
#: src/wizards/plugin.php:
|
5737 |
msgid ""
|
5738 |
"Each module has an Enable/Disable checkbox to turn on/off all processing for "
|
5739 |
"that module"
|
5740 |
msgstr ""
|
5741 |
|
5742 |
-
#: src/wizards/plugin.php:
|
5743 |
msgid ""
|
5744 |
"To help you understand each option, most of them have a more info link, and/"
|
5745 |
"or a blog link, to read more"
|
5746 |
msgstr ""
|
5747 |
|
5748 |
-
#: src/wizards/plugin.php:
|
5749 |
msgid "Success!"
|
5750 |
msgstr ""
|
5751 |
|
5752 |
-
#: src/wizards/plugin.php:
|
5753 |
-
msgid "License
|
5754 |
msgstr ""
|
5755 |
|
5756 |
-
#: src/wizards/plugin.php:
|
5757 |
-
msgid "License
|
5758 |
msgstr ""
|
5759 |
|
5760 |
-
#: src/wizards/plugin.php:
|
5761 |
msgid "Options imported successfully to your site."
|
5762 |
msgstr ""
|
5763 |
|
5764 |
-
#: src/wizards/plugin.php:
|
5765 |
msgid "Secret key was empty."
|
5766 |
msgstr ""
|
5767 |
|
5768 |
-
#: src/wizards/plugin.php:
|
5769 |
msgid "Secret key was not 40 characters long."
|
5770 |
msgstr ""
|
5771 |
|
5772 |
-
#: src/wizards/plugin.php:
|
5773 |
msgid ""
|
5774 |
"Secret key contains invalid characters - it should be letters and numbers "
|
5775 |
"only."
|
5776 |
msgstr ""
|
5777 |
|
5778 |
-
#: src/wizards/plugin.php:
|
5779 |
msgid "Source site URL could not be parsed correctly."
|
5780 |
msgstr ""
|
5781 |
|
5782 |
-
#: src/wizards/plugin.php:
|
5783 |
msgid "Could not parse the response from the site."
|
5784 |
msgstr ""
|
5785 |
|
5786 |
-
#: src/wizards/plugin.php:
|
5787 |
msgid "Check the secret key is correct for the remote site."
|
5788 |
msgstr ""
|
5789 |
|
5790 |
-
#: src/wizards/plugin.php:
|
5791 |
msgid "Failure response returned from the site."
|
5792 |
msgstr ""
|
5793 |
|
5794 |
-
#: src/wizards/plugin.php:
|
5795 |
#, php-format
|
5796 |
msgid "Remote site responded with - %s"
|
5797 |
msgstr ""
|
5798 |
|
5799 |
-
#: src/wizards/plugin.php:
|
5800 |
msgid "Data returned from the site was empty."
|
5801 |
msgstr ""
|
5802 |
|
5803 |
-
#: src/wizards/plugin.php:
|
5804 |
msgid "Security Admin setup was successful."
|
5805 |
msgstr ""
|
5806 |
|
5807 |
-
#: src/wizards/plugin.php:
|
5808 |
-
#: src/wizards/plugin.php:
|
5809 |
-
#: src/wizards/plugin.php:
|
5810 |
msgid "No changes were made as no option was selected"
|
5811 |
msgstr ""
|
5812 |
|
5813 |
-
#: src/wizards/plugin.php:
|
5814 |
-
#: src/wizards/plugin.php:
|
5815 |
msgid "Enabled"
|
5816 |
msgstr ""
|
5817 |
|
5818 |
-
#: src/wizards/plugin.php:
|
5819 |
-
#: src/wizards/plugin.php:
|
5820 |
msgid "Disabled"
|
5821 |
msgstr ""
|
5822 |
|
5823 |
-
#: src/wizards/plugin.php:
|
5824 |
-
#: src/wizards/plugin.php:
|
5825 |
#, php-format
|
5826 |
msgid "%s setting could not be changed at this time."
|
5827 |
msgstr ""
|
5828 |
|
5829 |
-
#: src/wizards/plugin.php:
|
5830 |
msgid "Preferences have been saved."
|
5831 |
msgstr ""
|
5832 |
|
5833 |
-
#:
|
5834 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5835 |
msgstr ""
|
1 |
msgid ""
|
2 |
msgstr ""
|
3 |
"Project-Id-Version: WPSF v2.0\n"
|
4 |
+
"POT-Creation-Date: 2018-09-04 13:38+0100\n"
|
5 |
+
"PO-Revision-Date: 2018-09-04 13:38+0100\n"
|
6 |
"Last-Translator: \n"
|
7 |
"Language-Team: \n"
|
8 |
"Language: en_GB\n"
|
9 |
"MIME-Version: 1.0\n"
|
10 |
"Content-Type: text/plain; charset=UTF-8\n"
|
11 |
"Content-Transfer-Encoding: 8bit\n"
|
12 |
+
"X-Generator: Poedit 2.1.1\n"
|
13 |
"X-Poedit-KeywordsList: _wpsf__;gettext;gettext_noop;_wpsf_e\n"
|
14 |
"X-Poedit-Basepath: ..\n"
|
15 |
"X-Poedit-SourceCharset: UTF-8\n"
|
18 |
"X-Poedit-SearchPathExcluded-0: .git\n"
|
19 |
"X-Poedit-SearchPathExcluded-1: .idea\n"
|
20 |
|
21 |
+
#: init.php:47
|
22 |
+
msgid "Upgrade Now To Keep Your Security Up-To-Date With The Latest Features."
|
23 |
msgstr ""
|
24 |
|
25 |
+
#: src/common/Components/Tables/AuditTrailTable.php:26
|
26 |
+
#: src/common/Components/Tables/LiveTrafficTable.php:15
|
27 |
msgid "Refresh"
|
28 |
msgstr ""
|
29 |
|
|
|
|
|
|
|
|
|
|
|
30 |
#: src/features/admin_access_restriction.php:72
|
31 |
+
#: src/features/admin_access_restriction.php:106
|
32 |
msgid "Security Admin Access Key Accepted."
|
33 |
msgstr ""
|
34 |
|
35 |
+
#: src/features/admin_access_restriction.php:73
|
36 |
+
#: src/features/admin_access_restriction.php:107
|
37 |
msgid "Please wait"
|
38 |
msgstr ""
|
39 |
|
40 |
+
#: src/features/admin_access_restriction.php:76
|
41 |
+
#: src/features/admin_access_restriction.php:110
|
42 |
msgid "Failed to process key - you may need to re-login to WordPress."
|
43 |
msgstr ""
|
44 |
|
45 |
+
#: src/features/admin_access_restriction.php:80
|
46 |
+
#: src/features/admin_access_restriction.php:114
|
47 |
msgid "Error - Invalid Key"
|
48 |
msgstr ""
|
49 |
|
50 |
+
#: src/features/admin_access_restriction.php:131
|
51 |
+
msgid "Enter your Security Admin Access Key"
|
|
|
52 |
msgstr ""
|
53 |
|
54 |
+
#: src/features/admin_access_restriction.php:250
|
55 |
+
msgid "Security Admin key accepted."
|
56 |
+
msgstr ""
|
57 |
+
|
58 |
+
#: src/features/admin_access_restriction.php:253
|
59 |
+
msgid "Security Admin key not accepted."
|
60 |
+
msgstr ""
|
61 |
+
|
62 |
+
#: src/features/admin_access_restriction.php:394
|
63 |
+
msgid "Security Admin Protection"
|
64 |
+
msgstr ""
|
65 |
+
|
66 |
+
#: src/features/admin_access_restriction.php:403
|
67 |
+
msgid "The Security Admin protection is not active."
|
68 |
+
msgstr ""
|
69 |
+
|
70 |
+
#: src/features/admin_access_restriction.php:407
|
71 |
+
#: src/features/audit_trail.php:304 src/features/base_wpsf.php:169
|
72 |
+
#: src/features/base_wpsf.php:207 src/features/hack_protect.php:661
|
73 |
+
#: src/features/hack_protect.php:682 src/features/hack_protect.php:703
|
74 |
+
#: src/features/hack_protect.php:724 src/features/insights.php:438
|
75 |
+
#: src/features/lockdown.php:62 src/features/user_management.php:288
|
76 |
+
msgid "Options"
|
77 |
+
msgstr ""
|
78 |
+
|
79 |
+
#: src/features/admin_access_restriction.php:408
|
80 |
+
msgid "Security Admin should be turned-on to protect your security settings."
|
81 |
msgstr ""
|
82 |
|
83 |
+
#: src/features/admin_access_restriction.php:438
|
84 |
+
#: src/features/audit_trail.php:290 src/features/autoupdates.php:186
|
85 |
+
#: src/features/comments_filter.php:103 src/features/firewall.php:59
|
86 |
+
#: src/features/hack_protect.php:764 src/features/headers.php:120
|
87 |
+
#: src/features/ips.php:302 src/features/lockdown.php:85
|
88 |
+
#: src/features/login_protect.php:537 src/features/sessions.php:51
|
89 |
+
#: src/features/statistics.php:51 src/features/statistics.php:60
|
90 |
+
#: src/features/traffic.php:426 src/features/user_management.php:311
|
91 |
#, php-format
|
92 |
msgid "Enable Module: %s"
|
93 |
msgstr ""
|
94 |
|
95 |
+
#: src/features/admin_access_restriction.php:440
|
96 |
+
#: src/features/admin_access_restriction.php:450
|
97 |
+
#: src/features/admin_access_restriction.php:459
|
98 |
+
#: src/features/admin_access_restriction.php:469
|
99 |
+
#: src/features/audit_trail.php:292 src/features/audit_trail.php:301
|
100 |
+
#: src/features/audit_trail.php:310 src/features/autoupdates.php:188
|
101 |
+
#: src/features/autoupdates.php:197 src/features/autoupdates.php:206
|
102 |
+
#: src/features/autoupdates.php:216 src/features/autoupdates.php:226
|
103 |
+
#: src/features/base_wpsf.php:319 src/features/comments_filter.php:105
|
104 |
+
#: src/features/comments_filter.php:114 src/features/comments_filter.php:124
|
105 |
+
#: src/features/comments_filter.php:133 src/features/firewall.php:61
|
106 |
+
#: src/features/hack_protect.php:759 src/features/hack_protect.php:766
|
107 |
+
#: src/features/hack_protect.php:775 src/features/hack_protect.php:785
|
108 |
+
#: src/features/hack_protect.php:794 src/features/hack_protect.php:803
|
109 |
+
#: src/features/hack_protect.php:813 src/features/hack_protect.php:823
|
110 |
+
#: src/features/headers.php:122 src/features/headers.php:131
|
111 |
+
#: src/features/headers.php:140 src/features/ips.php:304
|
112 |
+
#: src/features/ips.php:314 src/features/ips.php:324
|
113 |
+
#: src/features/license.php:650 src/features/lockdown.php:87
|
114 |
+
#: src/features/lockdown.php:96 src/features/lockdown.php:105
|
115 |
+
#: src/features/lockdown.php:114 src/features/login_protect.php:540
|
116 |
+
#: src/features/login_protect.php:549 src/features/login_protect.php:560
|
117 |
+
#: src/features/login_protect.php:569 src/features/login_protect.php:578
|
118 |
+
#: src/features/login_protect.php:588 src/features/login_protect.php:597
|
119 |
+
#: src/features/login_protect.php:606 src/features/plugin.php:733
|
120 |
+
#: src/features/plugin.php:740 src/features/plugin.php:755
|
121 |
+
#: src/features/sessions.php:53 src/features/statistics.php:53
|
122 |
+
#: src/features/statistics.php:62 src/features/statistics.php:71
|
123 |
+
#: src/features/traffic.php:428 src/features/traffic.php:437
|
124 |
+
#: src/features/user_management.php:313 src/features/user_management.php:323
|
125 |
+
#: src/features/user_management.php:332 src/features/user_management.php:341
|
126 |
+
#: src/features/user_management.php:350
|
127 |
+
msgid "Purpose"
|
128 |
msgstr ""
|
129 |
|
130 |
+
#: src/features/admin_access_restriction.php:440
|
131 |
+
#: src/features/admin_access_restriction.php:450
|
132 |
msgid ""
|
133 |
"Restricts access to this plugin preventing unauthorized changes to your "
|
134 |
"security settings."
|
135 |
msgstr ""
|
136 |
|
137 |
+
#: src/features/admin_access_restriction.php:441
|
138 |
+
#: src/features/admin_access_restriction.php:451
|
139 |
+
#: src/features/admin_access_restriction.php:460
|
140 |
+
#: src/features/audit_trail.php:293 src/features/audit_trail.php:302
|
141 |
+
#: src/features/audit_trail.php:311 src/features/autoupdates.php:189
|
142 |
+
#: src/features/autoupdates.php:198 src/features/autoupdates.php:208
|
143 |
+
#: src/features/autoupdates.php:217 src/features/base_wpsf.php:320
|
144 |
+
#: src/features/comments_filter.php:106 src/features/comments_filter.php:115
|
145 |
+
#: src/features/comments_filter.php:125 src/features/comments_filter.php:134
|
146 |
+
#: src/features/firewall.php:62 src/features/firewall.php:71
|
147 |
+
#: src/features/firewall.php:82 src/features/firewall.php:91
|
148 |
+
#: src/features/hack_protect.php:767 src/features/hack_protect.php:776
|
149 |
+
#: src/features/hack_protect.php:786 src/features/hack_protect.php:795
|
150 |
+
#: src/features/hack_protect.php:804 src/features/hack_protect.php:814
|
151 |
+
#: src/features/hack_protect.php:824 src/features/headers.php:123
|
152 |
+
#: src/features/headers.php:132 src/features/headers.php:141
|
153 |
+
#: src/features/ips.php:305 src/features/ips.php:315 src/features/ips.php:325
|
154 |
+
#: src/features/license.php:651 src/features/lockdown.php:88
|
155 |
+
#: src/features/lockdown.php:97 src/features/lockdown.php:106
|
156 |
+
#: src/features/lockdown.php:115 src/features/login_protect.php:541
|
157 |
+
#: src/features/login_protect.php:550 src/features/login_protect.php:561
|
158 |
+
#: src/features/login_protect.php:579 src/features/login_protect.php:598
|
159 |
+
#: src/features/login_protect.php:703 src/features/plugin.php:757
|
160 |
+
#: src/features/sessions.php:54 src/features/statistics.php:54
|
161 |
+
#: src/features/statistics.php:63 src/features/statistics.php:72
|
162 |
+
#: src/features/traffic.php:429 src/features/traffic.php:438
|
163 |
+
#: src/features/user_management.php:314 src/features/user_management.php:324
|
164 |
+
#: src/features/user_management.php:333 src/features/user_management.php:342
|
165 |
+
#: src/features/user_management.php:351
|
166 |
+
msgid "Recommendation"
|
167 |
msgstr ""
|
168 |
|
169 |
+
#: src/features/admin_access_restriction.php:441
|
170 |
+
#: src/features/audit_trail.php:293 src/features/autoupdates.php:189
|
171 |
+
#: src/features/comments_filter.php:106 src/features/firewall.php:62
|
172 |
+
#: src/features/hack_protect.php:767 src/features/hack_protect.php:776
|
173 |
+
#: src/features/hack_protect.php:786 src/features/hack_protect.php:795
|
174 |
+
#: src/features/hack_protect.php:804 src/features/ips.php:305
|
175 |
+
#: src/features/ips.php:315 src/features/lockdown.php:88
|
176 |
+
#: src/features/login_protect.php:541 src/features/sessions.php:54
|
177 |
+
#: src/features/statistics.php:54 src/features/statistics.php:63
|
178 |
+
#: src/features/user_management.php:314
|
179 |
#, php-format
|
180 |
msgid "Keep the %s feature turned on."
|
181 |
msgstr ""
|
182 |
|
183 |
+
#: src/features/admin_access_restriction.php:441
|
184 |
+
#: src/features/admin_access_restriction.php:503 src/features/plugin.php:945
|
185 |
+
#: src/features/plugin.php:947 src/wizards/base_wpsf.php:65
|
186 |
msgid "Security Admin"
|
187 |
msgstr ""
|
188 |
|
189 |
+
#: src/features/admin_access_restriction.php:442
|
190 |
msgid "You need to also enter a new Access Key to enable this feature."
|
191 |
msgstr ""
|
192 |
|
193 |
+
#: src/features/admin_access_restriction.php:444
|
194 |
+
#: src/features/audit_trail.php:295 src/features/autoupdates.php:191
|
195 |
+
#: src/features/comments_filter.php:108 src/features/firewall.php:64
|
196 |
+
#: src/features/hack_protect.php:769 src/features/headers.php:125
|
197 |
+
#: src/features/ips.php:308 src/features/lockdown.php:90
|
198 |
+
#: src/features/login_protect.php:538 src/features/sessions.php:56
|
199 |
+
#: src/features/statistics.php:56 src/features/statistics.php:65
|
200 |
+
#: src/features/traffic.php:431 src/features/user_management.php:316
|
201 |
#, php-format
|
202 |
msgid "%s/%s Module"
|
203 |
msgstr ""
|
204 |
|
205 |
+
#: src/features/admin_access_restriction.php:444
|
206 |
+
#: src/features/admin_access_restriction.php:574
|
207 |
+
#: src/features/audit_trail.php:295 src/features/autoupdates.php:191
|
208 |
+
#: src/features/comments_filter.php:108 src/features/firewall.php:64
|
209 |
+
#: src/features/hack_protect.php:769 src/features/headers.php:125
|
210 |
+
#: src/features/ips.php:308 src/features/lockdown.php:90
|
211 |
+
#: src/features/login_protect.php:538 src/features/sessions.php:56
|
212 |
+
#: src/features/statistics.php:56 src/features/statistics.php:65
|
213 |
+
#: src/features/traffic.php:431 src/features/user_management.php:316
|
214 |
msgid "Enable"
|
215 |
msgstr ""
|
216 |
|
217 |
+
#: src/features/admin_access_restriction.php:444
|
218 |
+
#: src/features/audit_trail.php:295 src/features/autoupdates.php:191
|
219 |
+
#: src/features/comments_filter.php:108 src/features/firewall.php:64
|
220 |
+
#: src/features/hack_protect.php:769 src/features/headers.php:125
|
221 |
+
#: src/features/ips.php:308 src/features/lockdown.php:90
|
222 |
+
#: src/features/login_protect.php:538 src/features/sessions.php:56
|
223 |
+
#: src/features/statistics.php:56 src/features/statistics.php:65
|
224 |
+
#: src/features/traffic.php:431 src/features/user_management.php:316
|
225 |
msgid "Disable"
|
226 |
msgstr ""
|
227 |
|
228 |
+
#: src/features/admin_access_restriction.php:448
|
229 |
msgid "Security Admin Restriction Settings"
|
230 |
msgstr ""
|
231 |
|
232 |
+
#: src/features/admin_access_restriction.php:451
|
233 |
+
#: src/features/admin_access_restriction.php:460
|
234 |
+
#: src/features/comments_filter.php:115 src/features/comments_filter.php:134
|
235 |
+
#: src/features/login_protect.php:579 src/features/login_protect.php:598
|
236 |
+
#: src/features/plugin.php:758 src/features/user_management.php:324
|
237 |
+
#: src/features/user_management.php:333 src/features/user_management.php:342
|
238 |
+
#: src/features/user_management.php:351
|
239 |
msgid "Use of this feature is highly recommend."
|
240 |
msgstr ""
|
241 |
|
242 |
+
#: src/features/admin_access_restriction.php:453
|
243 |
msgid "Security Admin Settings"
|
244 |
msgstr ""
|
245 |
|
246 |
+
#: src/features/admin_access_restriction.php:457
|
247 |
msgid "Security Admin Restriction Zones"
|
248 |
msgstr ""
|
249 |
|
250 |
+
#: src/features/admin_access_restriction.php:459
|
251 |
msgid ""
|
252 |
"Restricts access to key WordPress areas for all users not authenticated with "
|
253 |
"the Security Admin Access system."
|
254 |
msgstr ""
|
255 |
|
256 |
+
#: src/features/admin_access_restriction.php:462
|
257 |
msgid "Access Restriction Zones"
|
258 |
msgstr ""
|
259 |
|
260 |
+
#: src/features/admin_access_restriction.php:466
|
261 |
+
#: src/features/admin_access_restriction.php:479
|
262 |
+
#: src/features/admin_access_restriction.php:574
|
263 |
+
msgid "White Label"
|
264 |
msgstr ""
|
265 |
|
266 |
+
#: src/features/admin_access_restriction.php:470
|
267 |
#, php-format
|
268 |
msgid "Rename and re-brand the %s plugin for your client site installations."
|
269 |
msgstr ""
|
270 |
|
271 |
+
#: src/features/admin_access_restriction.php:474
|
272 |
+
#: src/features/login_protect.php:683
|
273 |
+
msgid "Important"
|
274 |
+
msgstr ""
|
275 |
+
|
276 |
+
#: src/features/admin_access_restriction.php:475
|
277 |
+
msgid "The Security Admin system must be active for these settings to apply."
|
278 |
msgstr ""
|
279 |
|
280 |
+
#: src/features/admin_access_restriction.php:503
|
281 |
+
#: src/features/audit_trail.php:338 src/features/autoupdates.php:251
|
282 |
+
#: src/features/comments_filter.php:188 src/features/firewall.php:115
|
283 |
+
#: src/features/hack_protect.php:847 src/features/headers.php:166
|
284 |
+
#: src/features/ips.php:347 src/features/lockdown.php:140
|
285 |
+
#: src/features/login_protect.php:631 src/features/plugin.php:805
|
286 |
+
#: src/features/sessions.php:79 src/features/statistics.php:99
|
287 |
+
#: src/features/statistics.php:105 src/features/traffic.php:463
|
288 |
+
#: src/features/user_management.php:376
|
289 |
#, php-format
|
290 |
msgid "Enable %s Module"
|
291 |
msgstr ""
|
292 |
|
293 |
+
#: src/features/admin_access_restriction.php:504
|
294 |
msgid "Enforce Security Admin Access Restriction"
|
295 |
msgstr ""
|
296 |
|
297 |
+
#: src/features/admin_access_restriction.php:505
|
298 |
msgid ""
|
299 |
"Enable this with great care and consideration. Ensure that you set a key "
|
300 |
"that you have set an access key that you will remember."
|
301 |
msgstr ""
|
302 |
|
303 |
+
#: src/features/admin_access_restriction.php:509
|
304 |
msgid "Security Admin Access Key"
|
305 |
msgstr ""
|
306 |
|
307 |
+
#: src/features/admin_access_restriction.php:510
|
308 |
msgid "Provide/Update Security Admin Access Key"
|
309 |
msgstr ""
|
310 |
|
311 |
+
#: src/features/admin_access_restriction.php:511
|
312 |
+
#: src/features/admin_access_restriction.php:532
|
313 |
+
#: src/features/admin_access_restriction.php:539
|
314 |
+
#: src/features/admin_access_restriction.php:546
|
315 |
+
#: src/features/admin_access_restriction.php:552
|
316 |
+
#: src/features/admin_access_restriction.php:558
|
317 |
+
msgid "Careful"
|
|
|
318 |
msgstr ""
|
319 |
|
320 |
+
#: src/features/admin_access_restriction.php:511
|
321 |
msgid ""
|
322 |
"If you forget this, you could potentially lock yourself out from using this "
|
323 |
"plugin."
|
324 |
msgstr ""
|
325 |
|
326 |
+
#: src/features/admin_access_restriction.php:512
|
327 |
msgid "Security Key Currently Set"
|
328 |
msgstr ""
|
329 |
|
330 |
+
#: src/features/admin_access_restriction.php:512
|
331 |
msgid "Security Key NOT Currently Set"
|
332 |
msgstr ""
|
333 |
|
334 |
+
#: src/features/admin_access_restriction.php:513
|
335 |
+
#, php-format
|
336 |
+
msgid "To delete the access key, type exactly \"%s\" and save."
|
337 |
+
msgstr ""
|
338 |
+
|
339 |
+
#: src/features/admin_access_restriction.php:517
|
340 |
msgid "Security Admin Timeout"
|
341 |
msgstr ""
|
342 |
|
343 |
+
#: src/features/admin_access_restriction.php:518
|
344 |
msgid "Specify An Automatic Timeout Interval For Security Admin Access"
|
345 |
msgstr ""
|
346 |
|
347 |
+
#: src/features/admin_access_restriction.php:519
|
348 |
msgid "This will automatically expire your Security Admin Session."
|
349 |
msgstr ""
|
350 |
|
351 |
+
#: src/features/admin_access_restriction.php:523
|
352 |
+
#: src/features/hack_protect.php:855 src/features/hack_protect.php:921
|
353 |
+
#: src/features/login_protect.php:711 src/features/login_protect.php:754
|
354 |
+
#: src/features/login_protect.php:761 src/features/user_management.php:399
|
355 |
+
msgid "Default"
|
356 |
msgstr ""
|
357 |
|
358 |
+
#: src/features/admin_access_restriction.php:530
|
359 |
msgid "Pages"
|
360 |
msgstr ""
|
361 |
|
362 |
+
#: src/features/admin_access_restriction.php:531
|
363 |
msgid "Restrict Access To Key WordPress Posts And Pages Actions"
|
364 |
msgstr ""
|
365 |
|
366 |
+
#: src/features/admin_access_restriction.php:532
|
367 |
msgid "This will restrict access to page/post creation, editing and deletion."
|
368 |
msgstr ""
|
369 |
|
370 |
+
#: src/features/admin_access_restriction.php:533
|
371 |
+
#: src/features/admin_access_restriction.php:540
|
372 |
+
#: src/features/admin_access_restriction.php:561
|
373 |
+
#: src/features/comments_filter.php:126 src/features/headers.php:239
|
374 |
+
#: src/features/login_protect.php:551 src/features/login_protect.php:580
|
375 |
+
#: src/features/login_protect.php:589 src/features/login_protect.php:607
|
376 |
+
#: src/features/login_protect.php:674 src/features/login_protect.php:682
|
377 |
+
#: src/features/login_protect.php:696 src/features/plugin.php:759
|
378 |
+
#: src/features/plugin.php:763 src/features/plugin.php:857
|
379 |
+
msgid "Note"
|
380 |
msgstr ""
|
381 |
|
382 |
+
#: src/features/admin_access_restriction.php:533
|
383 |
+
#: src/features/admin_access_restriction.php:540
|
384 |
+
#: src/features/admin_access_restriction.php:563
|
385 |
#, php-format
|
386 |
msgid "Selecting \"%s\" will also restrict all other options."
|
387 |
msgstr ""
|
388 |
|
389 |
+
#: src/features/admin_access_restriction.php:533
|
390 |
msgid "Edit"
|
391 |
msgstr ""
|
392 |
|
393 |
+
#: src/features/admin_access_restriction.php:537
|
394 |
+
#: src/features/audit_trail.php:187 src/features/audit_trail.php:362
|
395 |
+
#: src/features/audit_trail.php:363 src/features/autoupdates.php:282
|
396 |
+
#: src/features/hack_protect.php:733 src/features/insights.php:330
|
397 |
+
#: src/features/insights.php:347
|
398 |
msgid "Plugins"
|
399 |
msgstr ""
|
400 |
|
401 |
+
#: src/features/admin_access_restriction.php:538
|
402 |
msgid "Restrict Access To Key WordPress Plugin Actions"
|
403 |
msgstr ""
|
404 |
|
405 |
+
#: src/features/admin_access_restriction.php:539
|
406 |
msgid ""
|
407 |
"This will restrict access to plugin installation, update, activation and "
|
408 |
"deletion."
|
409 |
msgstr ""
|
410 |
|
411 |
+
#: src/features/admin_access_restriction.php:540
|
412 |
+
#: src/features/admin_access_restriction.php:566
|
413 |
msgid "Activate"
|
414 |
msgstr ""
|
415 |
|
416 |
+
#: src/features/admin_access_restriction.php:544
|
417 |
msgid "WordPress Options"
|
418 |
msgstr ""
|
419 |
|
420 |
+
#: src/features/admin_access_restriction.php:545
|
421 |
msgid "Restrict Access To Certain WordPress Admin Options"
|
422 |
msgstr ""
|
423 |
|
424 |
+
#: src/features/admin_access_restriction.php:546
|
425 |
msgid ""
|
426 |
"This will restrict the ability of WordPress administrators from changing key "
|
427 |
"WordPress settings."
|
428 |
msgstr ""
|
429 |
|
430 |
+
#: src/features/admin_access_restriction.php:550
|
431 |
msgid "Admin Users"
|
432 |
msgstr ""
|
433 |
|
434 |
+
#: src/features/admin_access_restriction.php:551
|
435 |
msgid "Restrict Access To Create/Delete/Modify Other Admin Users"
|
436 |
msgstr ""
|
437 |
|
438 |
+
#: src/features/admin_access_restriction.php:552
|
439 |
msgid ""
|
440 |
"This will restrict the ability of WordPress administrators from creating, "
|
441 |
"modifying or promoting other administrators."
|
442 |
msgstr ""
|
443 |
|
444 |
+
#: src/features/admin_access_restriction.php:556
|
445 |
+
#: src/features/audit_trail.php:188 src/features/audit_trail.php:368
|
446 |
+
#: src/features/audit_trail.php:369 src/features/autoupdates.php:294
|
447 |
+
#: src/features/insights.php:376 src/features/insights.php:387
|
448 |
msgid "Themes"
|
449 |
msgstr ""
|
450 |
|
451 |
+
#: src/features/admin_access_restriction.php:557
|
452 |
msgid "Restrict Access To WordPress Theme Actions"
|
453 |
msgstr ""
|
454 |
|
455 |
+
#: src/features/admin_access_restriction.php:558
|
456 |
msgid ""
|
457 |
"This will restrict access to theme installation, update, activation and "
|
458 |
"deletion."
|
459 |
msgstr ""
|
460 |
|
461 |
+
#: src/features/admin_access_restriction.php:565
|
462 |
#, php-format
|
463 |
msgid "%s and %s"
|
464 |
msgstr ""
|
465 |
|
466 |
+
#: src/features/admin_access_restriction.php:567
|
467 |
msgid "Edit Theme Options"
|
468 |
msgstr ""
|
469 |
|
470 |
+
#: src/features/admin_access_restriction.php:575
|
471 |
msgid "Activate Your White Label Settings"
|
472 |
msgstr ""
|
473 |
|
474 |
+
#: src/features/admin_access_restriction.php:576
|
475 |
msgid "Turn on/off the application of your White Label settings."
|
476 |
msgstr ""
|
477 |
|
478 |
+
#: src/features/admin_access_restriction.php:579
|
479 |
msgid "Hide Updates"
|
480 |
msgstr ""
|
481 |
|
482 |
+
#: src/features/admin_access_restriction.php:580
|
483 |
msgid "Hide Plugin Updates From Non-Security Admins"
|
484 |
msgstr ""
|
485 |
|
486 |
+
#: src/features/admin_access_restriction.php:581
|
487 |
+
#, php-format
|
488 |
+
msgid "Hide available %s updates from non-security administrators."
|
489 |
msgstr ""
|
490 |
|
491 |
+
#: src/features/admin_access_restriction.php:584
|
492 |
+
#: src/features/admin_access_restriction.php:591
|
493 |
msgid "Plugin Name"
|
494 |
msgstr ""
|
495 |
|
496 |
+
#: src/features/admin_access_restriction.php:585
|
497 |
msgid "The Name Of The Plugin"
|
498 |
msgstr ""
|
499 |
|
500 |
+
#: src/features/admin_access_restriction.php:586
|
501 |
msgid "The name of the plugin that will be displayed to your site users."
|
502 |
msgstr ""
|
503 |
|
504 |
+
#: src/features/admin_access_restriction.php:589
|
505 |
msgid "Menu Title"
|
506 |
msgstr ""
|
507 |
|
508 |
+
#: src/features/admin_access_restriction.php:590
|
509 |
msgid "The Main Menu Title Of The Plugin"
|
510 |
msgstr ""
|
511 |
|
512 |
+
#: src/features/admin_access_restriction.php:591
|
513 |
#, php-format
|
514 |
msgid ""
|
515 |
"The Main Menu Title Of The Plugin. If left empty, the \"%s\" will be used."
|
516 |
msgstr ""
|
517 |
|
518 |
+
#: src/features/admin_access_restriction.php:594
|
519 |
+
msgid "Company Name"
|
520 |
+
msgstr ""
|
521 |
+
|
522 |
+
#: src/features/admin_access_restriction.php:595
|
523 |
+
msgid "The Name Of Your Company"
|
524 |
+
msgstr ""
|
525 |
+
|
526 |
+
#: src/features/admin_access_restriction.php:596
|
527 |
+
msgid "Provide the name of your company."
|
528 |
+
msgstr ""
|
529 |
+
|
530 |
+
#: src/features/admin_access_restriction.php:599
|
531 |
msgid "Description"
|
532 |
msgstr ""
|
533 |
|
534 |
+
#: src/features/admin_access_restriction.php:600
|
535 |
msgid "The Description Of The Plugin"
|
536 |
msgstr ""
|
537 |
|
538 |
+
#: src/features/admin_access_restriction.php:601
|
539 |
msgid "The description of the plugin displayed on the plugins page."
|
540 |
msgstr ""
|
541 |
|
542 |
+
#: src/features/admin_access_restriction.php:604
|
543 |
msgid "Home URL"
|
544 |
msgstr ""
|
545 |
|
546 |
+
#: src/features/admin_access_restriction.php:605
|
547 |
msgid "Plugin Home Page URL"
|
548 |
msgstr ""
|
549 |
|
550 |
+
#: src/features/admin_access_restriction.php:606
|
551 |
msgid ""
|
552 |
"When a user clicks the home link for this plugin, this is where they'll be "
|
553 |
"directed."
|
554 |
msgstr ""
|
555 |
|
556 |
+
#: src/features/admin_access_restriction.php:609
|
557 |
+
msgid "Menu Icon"
|
558 |
+
msgstr ""
|
559 |
+
|
560 |
+
#: src/features/admin_access_restriction.php:610
|
561 |
+
msgid "Menu Icon URL"
|
562 |
+
msgstr ""
|
563 |
+
|
564 |
+
#: src/features/admin_access_restriction.php:611
|
565 |
+
msgid "The URL of the icon to display in the menu."
|
566 |
+
msgstr ""
|
567 |
+
|
568 |
+
#: src/features/admin_access_restriction.php:612
|
569 |
+
#: src/features/admin_access_restriction.php:618
|
570 |
+
#, php-format
|
571 |
+
msgid "The %s should measure %s."
|
572 |
+
msgstr ""
|
573 |
+
|
574 |
+
#: src/features/admin_access_restriction.php:612
|
575 |
+
msgid "icon"
|
576 |
+
msgstr ""
|
577 |
+
|
578 |
+
#: src/features/admin_access_restriction.php:615
|
579 |
+
msgid "Dashboard Logo"
|
580 |
+
msgstr ""
|
581 |
+
|
582 |
+
#: src/features/admin_access_restriction.php:616
|
583 |
+
msgid "Dashboard Logo URL"
|
584 |
msgstr ""
|
585 |
|
586 |
+
#: src/features/admin_access_restriction.php:617
|
587 |
+
msgid "The URL of the logo to display in the admin pages."
|
588 |
msgstr ""
|
589 |
|
590 |
+
#: src/features/admin_access_restriction.php:618
|
591 |
+
msgid "logo"
|
592 |
msgstr ""
|
593 |
|
594 |
+
#: src/features/audit_trail.php:139
|
595 |
msgid "Your IP"
|
596 |
msgstr ""
|
597 |
|
598 |
+
#: src/features/audit_trail.php:169 src/features/audit_trail.php:183
|
599 |
+
#: src/features/license.php:89 src/features/plugin.php:950
|
600 |
msgid "Audit Trail Viewer"
|
601 |
msgstr ""
|
602 |
|
603 |
+
#: src/features/audit_trail.php:184 src/features/license.php:90
|
604 |
msgid "Review audit trail logs "
|
605 |
msgstr ""
|
606 |
|
607 |
+
#: src/features/audit_trail.php:186 src/features/user_management.php:266
|
608 |
msgid "Users"
|
609 |
msgstr ""
|
610 |
|
611 |
+
#: src/features/audit_trail.php:189
|
612 |
msgid "WordPress"
|
613 |
msgstr ""
|
614 |
|
615 |
+
#: src/features/audit_trail.php:190
|
616 |
msgid "Posts"
|
617 |
msgstr ""
|
618 |
|
619 |
+
#: src/features/audit_trail.php:191 src/features/audit_trail.php:386
|
620 |
+
#: src/features/audit_trail.php:387
|
621 |
msgid "Emails"
|
622 |
msgstr ""
|
623 |
|
624 |
+
#: src/features/audit_trail.php:192 src/processors/user_management.php:240
|
625 |
msgid "Time"
|
626 |
msgstr ""
|
627 |
|
628 |
+
#: src/features/audit_trail.php:193
|
629 |
msgid "Event"
|
630 |
msgstr ""
|
631 |
|
632 |
+
#: src/features/audit_trail.php:194
|
633 |
msgid "Message"
|
634 |
msgstr ""
|
635 |
|
636 |
+
#: src/features/audit_trail.php:195 src/features/user_management.php:157
|
637 |
+
#: src/processors/loginprotect_twofactorauth.php:161
|
638 |
+
#: src/processors/user_management.php:210
|
639 |
+
#: src/processors/user_management.php:238
|
640 |
msgid "Username"
|
641 |
msgstr ""
|
642 |
|
643 |
+
#: src/features/audit_trail.php:196
|
644 |
msgid "Category"
|
645 |
msgstr ""
|
646 |
|
647 |
+
#: src/features/audit_trail.php:197 src/features/plugin.php:937
|
648 |
+
#: src/processors/firewall.php:468
|
649 |
+
#: src/processors/loginprotect_twofactorauth.php:162
|
650 |
+
#: src/processors/user_management.php:212
|
651 |
+
#: src/processors/user_management.php:239
|
652 |
msgid "IP Address"
|
653 |
msgstr ""
|
654 |
|
655 |
+
#: src/features/audit_trail.php:198 src/features/traffic.php:357
|
656 |
msgid "You"
|
657 |
msgstr ""
|
658 |
|
659 |
+
#: src/features/audit_trail.php:199
|
660 |
msgid "There are currently no audit entries this is section."
|
661 |
msgstr ""
|
662 |
|
663 |
#: src/features/audit_trail.php:219
|
664 |
+
#, php-format
|
665 |
+
msgid "[%s] Audit Trail Entries"
|
666 |
+
msgstr ""
|
667 |
+
|
668 |
+
#: src/features/audit_trail.php:292
|
669 |
msgid ""
|
670 |
"The Audit Trail is designed so you can look back on events and analyse what "
|
671 |
"happened and what may have gone wrong."
|
672 |
msgstr ""
|
673 |
|
674 |
+
#: src/features/audit_trail.php:293 src/features/plugin.php:948
|
675 |
+
#: src/wizards/plugin.php:492 src/wizards/plugin.php:497
|
676 |
msgid "Audit Trail"
|
677 |
msgstr ""
|
678 |
|
679 |
+
#: src/features/audit_trail.php:299
|
680 |
msgid "Audit Trail Options"
|
681 |
msgstr ""
|
682 |
|
683 |
+
#: src/features/audit_trail.php:301
|
684 |
msgid "Provides finer control over the audit trail itself."
|
685 |
msgstr ""
|
686 |
|
687 |
+
#: src/features/audit_trail.php:302 src/features/audit_trail.php:311
|
688 |
+
#: src/features/traffic.php:438
|
689 |
msgid "These settings are dependent on your requirements."
|
690 |
msgstr ""
|
691 |
|
692 |
+
#: src/features/audit_trail.php:308
|
|
|
|
|
|
|
|
|
|
|
693 |
msgid "Enable Audit Contexts"
|
694 |
msgstr ""
|
695 |
|
696 |
+
#: src/features/audit_trail.php:310
|
697 |
msgid "Specify which types of actions on your site are logged."
|
698 |
msgstr ""
|
699 |
|
700 |
+
#: src/features/audit_trail.php:313
|
701 |
msgid "Audit Contexts"
|
702 |
msgstr ""
|
703 |
|
704 |
+
#: src/features/audit_trail.php:339 src/features/autoupdates.php:252
|
705 |
+
#: src/features/firewall.php:116 src/features/hack_protect.php:848
|
706 |
+
#: src/features/headers.php:167 src/features/ips.php:348
|
707 |
+
#: src/features/lockdown.php:141 src/features/login_protect.php:632
|
708 |
+
#: src/features/sessions.php:80 src/features/statistics.php:100
|
709 |
+
#: src/features/statistics.php:106 src/features/traffic.php:464
|
710 |
+
#: src/features/user_management.php:377
|
711 |
#, php-format
|
712 |
msgid "Enable (or Disable) The %s Module"
|
713 |
msgstr ""
|
714 |
|
715 |
+
#: src/features/audit_trail.php:340 src/features/autoupdates.php:253
|
716 |
+
#: src/features/comments_filter.php:190 src/features/firewall.php:117
|
717 |
+
#: src/features/hack_protect.php:849 src/features/headers.php:168
|
718 |
+
#: src/features/ips.php:349 src/features/lockdown.php:142
|
719 |
+
#: src/features/login_protect.php:633 src/features/sessions.php:81
|
720 |
+
#: src/features/statistics.php:101 src/features/statistics.php:107
|
721 |
+
#: src/features/traffic.php:465 src/features/user_management.php:378
|
722 |
#, php-format
|
723 |
msgid "Un-Checking this option will completely disable the %s module."
|
724 |
msgstr ""
|
725 |
|
726 |
+
#: src/features/audit_trail.php:344
|
727 |
msgid "Max Trail Length"
|
728 |
msgstr ""
|
729 |
|
730 |
+
#: src/features/audit_trail.php:345
|
731 |
msgid "Maximum Audit Trail Length To Keep"
|
732 |
msgstr ""
|
733 |
|
734 |
+
#: src/features/audit_trail.php:346
|
735 |
msgid ""
|
736 |
"Automatically remove any audit trail entries when this limit is exceeded."
|
737 |
msgstr ""
|
738 |
|
739 |
+
#: src/features/audit_trail.php:350
|
740 |
msgid "Auto Clean"
|
741 |
msgstr ""
|
742 |
|
743 |
+
#: src/features/audit_trail.php:351
|
744 |
msgid "Enable Audit Auto Cleaning"
|
745 |
msgstr ""
|
746 |
|
747 |
+
#: src/features/audit_trail.php:352
|
748 |
msgid ""
|
749 |
"Events older than the number of days specified will be automatically cleaned "
|
750 |
"from the database."
|
751 |
msgstr ""
|
752 |
|
753 |
+
#: src/features/audit_trail.php:356 src/features/audit_trail.php:357
|
754 |
+
#: src/features/audit_trail.php:358
|
755 |
msgid "Users And Logins"
|
756 |
msgstr ""
|
757 |
|
758 |
+
#: src/features/audit_trail.php:357 src/features/audit_trail.php:363
|
759 |
+
#: src/features/audit_trail.php:369 src/features/audit_trail.php:375
|
760 |
+
#: src/features/audit_trail.php:381 src/features/audit_trail.php:387
|
761 |
+
#: src/features/audit_trail.php:393
|
762 |
#, php-format
|
763 |
msgid "Enable Audit Context - %s"
|
764 |
msgstr ""
|
765 |
|
766 |
+
#: src/features/audit_trail.php:358 src/features/audit_trail.php:364
|
767 |
+
#: src/features/audit_trail.php:370 src/features/audit_trail.php:376
|
768 |
+
#: src/features/audit_trail.php:382 src/features/audit_trail.php:388
|
769 |
+
#: src/features/audit_trail.php:394
|
770 |
#, php-format
|
771 |
msgid ""
|
772 |
"When this context is enabled, the audit trail will track activity relating "
|
773 |
"to: %s"
|
774 |
msgstr ""
|
775 |
|
776 |
+
#: src/features/audit_trail.php:364
|
777 |
msgid "WordPress Plugins"
|
778 |
msgstr ""
|
779 |
|
780 |
+
#: src/features/audit_trail.php:370
|
781 |
msgid "WordPress Themes"
|
782 |
msgstr ""
|
783 |
|
784 |
+
#: src/features/audit_trail.php:374 src/features/audit_trail.php:375
|
785 |
msgid "Posts And Pages"
|
786 |
msgstr ""
|
787 |
|
788 |
+
#: src/features/audit_trail.php:376
|
789 |
msgid "Editing and publishing of posts and pages"
|
790 |
msgstr ""
|
791 |
|
792 |
+
#: src/features/audit_trail.php:380 src/features/audit_trail.php:381
|
793 |
msgid "WordPress And Settings"
|
794 |
msgstr ""
|
795 |
|
796 |
+
#: src/features/audit_trail.php:382
|
797 |
msgid "WordPress upgrades and changes to particular WordPress settings"
|
798 |
msgstr ""
|
799 |
|
800 |
+
#: src/features/audit_trail.php:388
|
801 |
msgid "Email Sending"
|
802 |
msgstr ""
|
803 |
|
804 |
+
#: src/features/autoupdates.php:140
|
805 |
#, php-format
|
806 |
msgid "Plugin \"%s\" will %s."
|
807 |
msgstr ""
|
808 |
|
809 |
+
#: src/features/autoupdates.php:143
|
810 |
msgid "update automatically"
|
811 |
msgstr ""
|
812 |
|
813 |
+
#: src/features/autoupdates.php:143
|
814 |
msgid "not update automatically"
|
815 |
msgstr ""
|
816 |
|
817 |
+
#: src/features/autoupdates.php:148
|
818 |
msgid "Failed to change the update status of the plugin."
|
819 |
msgstr ""
|
820 |
|
821 |
+
#: src/features/autoupdates.php:188
|
|
|
|
|
|
|
|
|
822 |
msgid ""
|
823 |
"Automatic Updates lets you manage the WordPress automatic updates engine so "
|
824 |
"you choose what exactly gets updated automatically."
|
825 |
msgstr ""
|
826 |
|
827 |
+
#: src/features/autoupdates.php:189 src/features/hack_protect.php:878
|
828 |
+
#: src/features/plugin.php:951
|
829 |
msgid "Automatic Updates"
|
830 |
msgstr ""
|
831 |
|
832 |
+
#: src/features/autoupdates.php:195
|
833 |
msgid "Disable ALL WordPress Automatic Updates"
|
834 |
msgstr ""
|
835 |
|
836 |
+
#: src/features/autoupdates.php:197
|
837 |
msgid ""
|
838 |
"If you never want WordPress to automatically update anything on your site, "
|
839 |
"turn on this option."
|
840 |
msgstr ""
|
841 |
|
842 |
+
#: src/features/autoupdates.php:198
|
843 |
msgid "Do not turn on this option unless you really need to block updates."
|
844 |
msgstr ""
|
845 |
|
846 |
+
#: src/features/autoupdates.php:200
|
847 |
msgid "Turn Off"
|
848 |
msgstr ""
|
849 |
|
850 |
+
#: src/features/autoupdates.php:204
|
851 |
msgid "Automatic Plugin Self-Update"
|
852 |
msgstr ""
|
853 |
|
854 |
+
#: src/features/autoupdates.php:206
|
855 |
#, php-format
|
856 |
msgid ""
|
857 |
"Allows the %s plugin to automatically update itself when an update is "
|
858 |
"available."
|
859 |
msgstr ""
|
860 |
|
861 |
+
#: src/features/autoupdates.php:208
|
862 |
msgid "Keep this option turned on."
|
863 |
msgstr ""
|
864 |
|
865 |
+
#: src/features/autoupdates.php:210
|
866 |
msgid "Self-Update"
|
867 |
msgstr ""
|
868 |
|
869 |
+
#: src/features/autoupdates.php:214
|
870 |
msgid "Automatic Updates For WordPress Components"
|
871 |
msgstr ""
|
872 |
|
873 |
+
#: src/features/autoupdates.php:216
|
874 |
msgid "Control how automatic updates for each WordPress component is handled."
|
875 |
msgstr ""
|
876 |
|
877 |
+
#: src/features/autoupdates.php:217
|
878 |
msgid "You should at least allow minor updates for the WordPress core."
|
879 |
msgstr ""
|
880 |
|
881 |
+
#: src/features/autoupdates.php:219
|
882 |
msgid "WordPress Components"
|
883 |
msgstr ""
|
884 |
|
885 |
+
#: src/features/autoupdates.php:223 src/features/autoupdates.php:224
|
886 |
msgid "Auto-Update Options"
|
887 |
msgstr ""
|
888 |
|
889 |
+
#: src/features/autoupdates.php:226
|
890 |
msgid "Make adjustments to how automatic updates are handled on your site."
|
891 |
msgstr ""
|
892 |
|
893 |
+
#: src/features/autoupdates.php:257
|
894 |
msgid "Disable All"
|
895 |
msgstr ""
|
896 |
|
897 |
+
#: src/features/autoupdates.php:258
|
898 |
msgid "Completely Disable WordPress Automatic Updates"
|
899 |
msgstr ""
|
900 |
|
901 |
+
#: src/features/autoupdates.php:259
|
902 |
msgid ""
|
903 |
"When selected, regardless of any other settings, all WordPress automatic "
|
904 |
"updates on this site will be completely disabled!"
|
905 |
msgstr ""
|
906 |
|
907 |
+
#: src/features/autoupdates.php:263
|
908 |
msgid "Auto Update Plugin"
|
909 |
msgstr ""
|
910 |
|
911 |
+
#: src/features/autoupdates.php:264
|
912 |
msgid "Always Automatically Update This Plugin"
|
913 |
msgstr ""
|
914 |
|
915 |
+
#: src/features/autoupdates.php:265
|
916 |
#, php-format
|
917 |
msgid ""
|
918 |
"Regardless of any component settings below, automatically update the \"%s\" "
|
919 |
"plugin."
|
920 |
msgstr ""
|
921 |
|
922 |
+
#: src/features/autoupdates.php:270
|
923 |
msgid "WordPress Core Updates"
|
924 |
msgstr ""
|
925 |
|
926 |
+
#: src/features/autoupdates.php:271
|
927 |
msgid "Decide how the WordPress Core will automatically update, if at all"
|
928 |
msgstr ""
|
929 |
|
930 |
+
#: src/features/autoupdates.php:272
|
931 |
msgid ""
|
932 |
"At least automatically upgrading minor versions is recommended (and is the "
|
933 |
"WordPress default)."
|
934 |
msgstr ""
|
935 |
|
936 |
+
#: src/features/autoupdates.php:276
|
937 |
msgid "Translations"
|
938 |
msgstr ""
|
939 |
|
940 |
+
#: src/features/autoupdates.php:277
|
941 |
msgid "Automatically Update Translations"
|
942 |
msgstr ""
|
943 |
|
944 |
+
#: src/features/autoupdates.php:278
|
945 |
msgid ""
|
946 |
"Note: Automatic updates for translations are enabled on WordPress by default."
|
947 |
msgstr ""
|
948 |
|
949 |
+
#: src/features/autoupdates.php:283
|
950 |
msgid "Automatically Update All Plugins"
|
951 |
msgstr ""
|
952 |
|
953 |
+
#: src/features/autoupdates.php:284
|
954 |
msgid ""
|
955 |
"Note: Automatic updates for plugins are disabled on WordPress by default."
|
956 |
msgstr ""
|
957 |
|
958 |
+
#: src/features/autoupdates.php:288
|
959 |
msgid "Individually Select Plugins"
|
960 |
msgstr ""
|
961 |
|
962 |
+
#: src/features/autoupdates.php:289
|
963 |
msgid "Select Individual Plugins To Automatically Update"
|
964 |
msgstr ""
|
965 |
|
966 |
+
#: src/features/autoupdates.php:290
|
967 |
msgid ""
|
968 |
"Turning this on will provide an option on the plugins page to select whether "
|
969 |
"a plugin is automatically updated."
|
970 |
msgstr ""
|
971 |
|
972 |
+
#: src/features/autoupdates.php:295
|
973 |
msgid "Automatically Update Themes"
|
974 |
msgstr ""
|
975 |
|
976 |
+
#: src/features/autoupdates.php:296
|
977 |
msgid ""
|
978 |
"Note: Automatic updates for themes are disabled on WordPress by default."
|
979 |
msgstr ""
|
980 |
|
981 |
+
#: src/features/autoupdates.php:300
|
982 |
msgid "Ignore Version Control"
|
983 |
msgstr ""
|
984 |
|
985 |
+
#: src/features/autoupdates.php:301
|
986 |
msgid "Ignore Version Control Systems Such As GIT and SVN"
|
987 |
msgstr ""
|
988 |
|
989 |
+
#: src/features/autoupdates.php:302
|
990 |
msgid ""
|
991 |
"If you use SVN or GIT and WordPress detects it, automatic updates are "
|
992 |
"disabled by default. Check this box to ignore version control systems and "
|
993 |
"allow automatic updates."
|
994 |
msgstr ""
|
995 |
|
996 |
+
#: src/features/autoupdates.php:306
|
997 |
msgid "Send Report Email"
|
998 |
msgstr ""
|
999 |
|
1000 |
+
#: src/features/autoupdates.php:307
|
1001 |
msgid "Send email notices after automatic updates"
|
1002 |
msgstr ""
|
1003 |
|
1004 |
+
#: src/features/autoupdates.php:308
|
1005 |
msgid ""
|
1006 |
"You can turn on/off email notices from automatic updates by un/checking this "
|
1007 |
"box."
|
1008 |
msgstr ""
|
1009 |
|
1010 |
+
#: src/features/autoupdates.php:312
|
1011 |
msgid "Report Email Address"
|
1012 |
msgstr ""
|
1013 |
|
1014 |
+
#: src/features/autoupdates.php:313
|
1015 |
msgid "Where to send upgrade notification reports"
|
1016 |
msgstr ""
|
1017 |
|
1018 |
+
#: src/features/autoupdates.php:314
|
1019 |
msgid "If this is empty, it will default to the Site Admin email address"
|
1020 |
msgstr ""
|
1021 |
|
1022 |
+
#: src/features/autoupdates.php:318
|
1023 |
msgid "Update Delay"
|
1024 |
msgstr ""
|
1025 |
|
1026 |
+
#: src/features/autoupdates.php:319
|
1027 |
msgid "Delay Automatic Updates For Period Of Stability"
|
1028 |
msgstr ""
|
1029 |
|
1030 |
+
#: src/features/autoupdates.php:320
|
1031 |
+
#, php-format
|
1032 |
msgid ""
|
1033 |
+
"%s will delay upgrades until the new update has been available for the set "
|
1034 |
+
"number of days."
|
1035 |
msgstr ""
|
1036 |
|
1037 |
+
#: src/features/autoupdates.php:321
|
1038 |
msgid ""
|
1039 |
"This helps ensure updates are more stable before they're automatically "
|
1040 |
"applied to your site."
|
1041 |
msgstr ""
|
1042 |
|
1043 |
+
#: src/features/base.php:980
|
1044 |
+
msgid ""
|
1045 |
+
"Unfortunately your WordPress and/or PHP versions are too old to support this "
|
1046 |
+
"feature."
|
1047 |
msgstr ""
|
1048 |
|
1049 |
+
#: src/features/base.php:1149
|
1050 |
#, php-format
|
1051 |
msgid "Failed up to update %s plugin options."
|
1052 |
msgstr ""
|
1053 |
|
1054 |
+
#: src/features/base.php:1154
|
1055 |
#, php-format
|
1056 |
msgid "%s Plugin options updated successfully."
|
1057 |
msgstr ""
|
1058 |
|
1059 |
+
#: src/features/base.php:1158
|
1060 |
#, php-format
|
1061 |
msgid ""
|
1062 |
"Failed to update %s options as you are not authenticated with %s as a "
|
1063 |
"Security Admin."
|
1064 |
msgstr ""
|
1065 |
|
1066 |
+
#: src/features/base.php:1224
|
1067 |
+
msgid "Plugin options updated successfully."
|
1068 |
+
msgstr ""
|
1069 |
+
|
1070 |
+
#: src/features/base.php:1612
|
1071 |
+
msgid "Support Forums"
|
1072 |
+
msgstr ""
|
1073 |
+
|
1074 |
+
#: src/features/base_wpsf.php:49 src/features/base_wpsf.php:51
|
1075 |
+
msgid "Security Admin session has timed-out."
|
1076 |
+
msgstr ""
|
1077 |
+
|
1078 |
+
#: src/features/base_wpsf.php:49
|
1079 |
+
msgid "Reload now?"
|
1080 |
+
msgstr ""
|
1081 |
+
|
1082 |
+
#: src/features/base_wpsf.php:50
|
1083 |
+
msgid "Security Admin session has nearly timed-out."
|
1084 |
+
msgstr ""
|
1085 |
+
|
1086 |
+
#: src/features/base_wpsf.php:163 src/features/base_wpsf.php:201
|
1087 |
msgid "Settings"
|
1088 |
msgstr ""
|
1089 |
|
1090 |
+
#: src/features/base_wpsf.php:164 src/features/base_wpsf.php:202
|
1091 |
msgid "On"
|
1092 |
msgstr ""
|
1093 |
|
1094 |
+
#: src/features/base_wpsf.php:165 src/features/base_wpsf.php:203
|
1095 |
msgid "Off"
|
1096 |
msgstr ""
|
1097 |
|
1098 |
+
#: src/features/base_wpsf.php:166 src/features/base_wpsf.php:204
|
1099 |
+
#: src/processors/hackprotect_corechecksumscan.php:280
|
1100 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:156
|
1101 |
#: src/processors/hackprotect_wpvulnscan.php:147
|
1102 |
+
#: src/processors/loginprotect_intent.php:281
|
1103 |
msgid "More Info"
|
1104 |
msgstr ""
|
1105 |
|
1106 |
+
#: src/features/base_wpsf.php:167 src/features/base_wpsf.php:205
|
1107 |
msgid "Blog"
|
1108 |
msgstr ""
|
1109 |
|
1110 |
+
#: src/features/base_wpsf.php:168 src/features/base_wpsf.php:206
|
1111 |
msgid "Save All Settings"
|
1112 |
msgstr ""
|
1113 |
|
1114 |
+
#: src/features/base_wpsf.php:170 src/features/base_wpsf.php:208
|
1115 |
msgid "Configure Module"
|
1116 |
msgstr ""
|
1117 |
|
1118 |
+
#: src/features/base_wpsf.php:171 src/features/base_wpsf.php:209
|
1119 |
msgid "Actions and Info"
|
1120 |
msgstr ""
|
1121 |
|
1122 |
+
#: src/features/base_wpsf.php:172 src/features/base_wpsf.php:210
|
1123 |
msgid "Perform actions for this module"
|
1124 |
msgstr ""
|
1125 |
|
1126 |
+
#: src/features/base_wpsf.php:173 src/features/base_wpsf.php:211
|
1127 |
msgid "Help"
|
1128 |
msgstr ""
|
1129 |
|
1130 |
+
#: src/features/base_wpsf.php:174 src/features/base_wpsf.php:212
|
1131 |
msgid "Learn More"
|
1132 |
msgstr ""
|
1133 |
|
1134 |
+
#: src/features/base_wpsf.php:176 src/features/base_wpsf.php:214
|
1135 |
msgid "Plugin Access Restricted"
|
1136 |
msgstr ""
|
1137 |
|
1138 |
+
#: src/features/base_wpsf.php:177 src/features/base_wpsf.php:215
|
1139 |
msgid ""
|
1140 |
"This security plugin is restricted to administrators with the Security "
|
1141 |
"Access Key."
|
1142 |
msgstr ""
|
1143 |
|
1144 |
+
#: src/features/base_wpsf.php:178 src/features/base_wpsf.php:216
|
1145 |
msgid "Please provide the Security Access Key to manage this plugin."
|
1146 |
msgstr ""
|
1147 |
|
1148 |
+
#: src/features/base_wpsf.php:179 src/features/base_wpsf.php:217
|
1149 |
msgid "To manage this plugin you must enter the access key."
|
1150 |
msgstr ""
|
1151 |
|
1152 |
+
#: src/features/base_wpsf.php:180 src/features/base_wpsf.php:218
|
1153 |
msgid "Enter Access Key"
|
1154 |
msgstr ""
|
1155 |
|
1156 |
+
#: src/features/base_wpsf.php:181 src/features/base_wpsf.php:219
|
1157 |
msgid "Submit Security Admin Key"
|
1158 |
msgstr ""
|
1159 |
|
1160 |
+
#: src/features/base_wpsf.php:182 src/features/base_wpsf.php:220
|
1161 |
msgid "Forgotten Key"
|
1162 |
msgstr ""
|
1163 |
|
1164 |
+
#: src/features/base_wpsf.php:234
|
1165 |
msgid "Nonce security checking failed - the nonce value was empty."
|
1166 |
msgstr ""
|
1167 |
|
1168 |
+
#: src/features/base_wpsf.php:235
|
1169 |
#, php-format
|
1170 |
msgid "Nonce security checking failed - the nonce supplied was \"%s\"."
|
1171 |
msgstr ""
|
1172 |
|
1173 |
+
#: src/features/base_wpsf.php:316 src/features/base_wpsf.php:317
|
1174 |
msgid "User Messages"
|
1175 |
msgstr ""
|
1176 |
|
1177 |
+
#: src/features/base_wpsf.php:319
|
1178 |
msgid "Customize the messages displayed to the user."
|
1179 |
msgstr ""
|
1180 |
|
1181 |
+
#: src/features/base_wpsf.php:320
|
1182 |
msgid ""
|
1183 |
"Use this section if you need to communicate to the user in a particular "
|
1184 |
"manner."
|
1185 |
msgstr ""
|
1186 |
|
1187 |
+
#: src/features/base_wpsf.php:321
|
1188 |
+
msgid "Hint"
|
|
|
1189 |
msgstr ""
|
1190 |
|
1191 |
+
#: src/features/base_wpsf.php:321
|
1192 |
#, php-format
|
1193 |
msgid "To reset any message to its default, enter the text exactly: %s"
|
1194 |
msgstr ""
|
1195 |
|
1196 |
+
#: src/features/comments_filter.php:44
|
1197 |
msgid "I'm not a spammer."
|
1198 |
msgstr ""
|
1199 |
|
1200 |
+
#: src/features/comments_filter.php:47
|
1201 |
msgid "Please check the box to confirm you're not a spammer."
|
1202 |
msgstr ""
|
1203 |
|
1204 |
+
#: src/features/comments_filter.php:50
|
1205 |
#, php-format
|
1206 |
msgid "Please wait %s seconds before posting your comment."
|
1207 |
msgstr ""
|
1208 |
|
1209 |
+
#: src/features/comments_filter.php:53
|
1210 |
msgid "Please reload this page to post a comment."
|
1211 |
msgstr ""
|
1212 |
|
1213 |
+
#: src/features/comments_filter.php:103
|
1214 |
msgid "Comments SPAM Protection"
|
1215 |
msgstr ""
|
1216 |
|
1217 |
+
#: src/features/comments_filter.php:105
|
1218 |
#, php-format
|
1219 |
msgid ""
|
1220 |
"The Comments Filter can block 100% of automated spam bots and also offer the "
|
1221 |
"option to analyse human-generated spam."
|
1222 |
msgstr ""
|
1223 |
|
1224 |
+
#: src/features/comments_filter.php:106
|
1225 |
msgid "Comments Filter"
|
1226 |
msgstr ""
|
1227 |
|
1228 |
+
#: src/features/comments_filter.php:112
|
1229 |
#, php-format
|
1230 |
msgid "%s Comment SPAM Protection"
|
1231 |
msgstr ""
|
1232 |
|
1233 |
+
#: src/features/comments_filter.php:112
|
1234 |
msgid "Automatic Bot"
|
1235 |
msgstr ""
|
1236 |
|
1237 |
+
#: src/features/comments_filter.php:114
|
1238 |
#, php-format
|
1239 |
msgid "Blocks 100% of all automated bot-generated comment SPAM."
|
1240 |
msgstr ""
|
1241 |
|
1242 |
+
#: src/features/comments_filter.php:117
|
1243 |
msgid "Bot SPAM"
|
1244 |
msgstr ""
|
1245 |
|
1246 |
+
#: src/features/comments_filter.php:124
|
1247 |
msgid "Adds Google reCAPTCHA to the Comment Forms."
|
1248 |
msgstr ""
|
1249 |
|
1250 |
+
#: src/features/comments_filter.php:125 src/features/login_protect.php:550
|
1251 |
msgid "Keep this turned on."
|
1252 |
msgstr ""
|
1253 |
|
1254 |
+
#: src/features/comments_filter.php:126 src/features/login_protect.php:551
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1255 |
msgid ""
|
1256 |
"You will need to register for Google reCAPTCHA keys and store them in the "
|
1257 |
"Shield 'Dashboard' settings."
|
1258 |
msgstr ""
|
1259 |
|
1260 |
+
#: src/features/comments_filter.php:131
|
1261 |
#, php-format
|
1262 |
msgid "%s Comment SPAM Protection Filter"
|
1263 |
msgstr ""
|
1264 |
|
1265 |
+
#: src/features/comments_filter.php:131
|
1266 |
msgid "Human"
|
1267 |
msgstr ""
|
1268 |
|
1269 |
+
#: src/features/comments_filter.php:133
|
1270 |
msgid "Uses a 3rd party SPAM dictionary to detect human-based comment SPAM."
|
1271 |
msgstr ""
|
1272 |
|
1273 |
+
#: src/features/comments_filter.php:135
|
1274 |
msgid ""
|
1275 |
"This tool, unlike other SPAM tools such as Akismet, will not send your "
|
1276 |
"comment data to 3rd party services for analysis."
|
1277 |
msgstr ""
|
1278 |
|
1279 |
+
#: src/features/comments_filter.php:137
|
1280 |
msgid "Human SPAM"
|
1281 |
msgstr ""
|
1282 |
|
1283 |
+
#: src/features/comments_filter.php:189
|
1284 |
msgid "Enable (or Disable) The Comment SPAM Protection Feature"
|
1285 |
msgstr ""
|
1286 |
|
1287 |
+
#: src/features/comments_filter.php:190 src/wizards/plugin.php:707
|
1288 |
+
#: src/wizards/plugin.php:712
|
1289 |
msgid "Comment SPAM Protection"
|
1290 |
msgstr ""
|
1291 |
|
1292 |
+
#: src/features/comments_filter.php:194 src/features/comments_filter.php:195
|
1293 |
msgid "Human SPAM Filter"
|
1294 |
msgstr ""
|
1295 |
|
1296 |
+
#: src/features/comments_filter.php:195
|
1297 |
#, php-format
|
1298 |
msgid "Enable (or Disable) The %s Feature"
|
1299 |
msgstr ""
|
1300 |
|
1301 |
+
#: src/features/comments_filter.php:196
|
1302 |
msgid ""
|
1303 |
"Scans the content of WordPress comments for keywords that are indicative of "
|
1304 |
"SPAM and marks the comment according to your preferred setting below."
|
1305 |
msgstr ""
|
1306 |
|
1307 |
+
#: src/features/comments_filter.php:200
|
1308 |
msgid "Comment Filter Items"
|
1309 |
msgstr ""
|
1310 |
|
1311 |
+
#: src/features/comments_filter.php:201
|
1312 |
msgid "Select The Items To Scan For SPAM"
|
1313 |
msgstr ""
|
1314 |
|
1315 |
+
#: src/features/comments_filter.php:202
|
1316 |
msgid ""
|
1317 |
"When a user submits a comment, only the selected parts of the comment data "
|
1318 |
"will be scanned for SPAM content."
|
1319 |
msgstr ""
|
1320 |
|
1321 |
+
#: src/features/comments_filter.php:202
|
1322 |
#, php-format
|
1323 |
msgid "Recommended: %s"
|
1324 |
msgstr ""
|
1325 |
|
1326 |
+
#: src/features/comments_filter.php:202
|
1327 |
msgid "All"
|
1328 |
msgstr ""
|
1329 |
|
1330 |
+
#: src/features/comments_filter.php:206 src/features/comments_filter.php:218
|
1331 |
msgid "Default SPAM Action"
|
1332 |
msgstr ""
|
1333 |
|
1334 |
+
#: src/features/comments_filter.php:207 src/features/comments_filter.php:219
|
1335 |
msgid "How To Categorise Comments When Identified To Be SPAM"
|
1336 |
msgstr ""
|
1337 |
|
1338 |
+
#: src/features/comments_filter.php:208 src/features/comments_filter.php:220
|
1339 |
#, php-format
|
1340 |
msgid ""
|
1341 |
"When a comment is detected as being SPAM from %s, the comment will be "
|
1342 |
"categorised based on this setting."
|
1343 |
msgstr ""
|
1344 |
|
1345 |
+
#: src/features/comments_filter.php:208
|
1346 |
msgid "a human commenter"
|
1347 |
msgstr ""
|
1348 |
|
1349 |
+
#: src/features/comments_filter.php:212
|
1350 |
msgid "SPAM Bot Protection"
|
1351 |
msgstr ""
|
1352 |
|
1353 |
+
#: src/features/comments_filter.php:213
|
1354 |
msgid "Block Automatic Comment SPAM By Bots"
|
1355 |
msgstr ""
|
1356 |
|
1357 |
+
#: src/features/comments_filter.php:214
|
1358 |
msgid ""
|
1359 |
"Simple, yet highly effective SPAM Bot protection for your WordPress comments."
|
1360 |
msgstr ""
|
1361 |
|
1362 |
+
#: src/features/comments_filter.php:220
|
1363 |
msgid "an automatic bot"
|
1364 |
msgstr ""
|
1365 |
|
1366 |
+
#: src/features/comments_filter.php:224
|
1367 |
msgid "Comments Cooldown"
|
1368 |
msgstr ""
|
1369 |
|
1370 |
+
#: src/features/comments_filter.php:225
|
1371 |
msgid "Limit posting comments to X seconds after the page has loaded"
|
1372 |
msgstr ""
|
1373 |
|
1374 |
+
#: src/features/comments_filter.php:226
|
1375 |
msgid ""
|
1376 |
"By forcing a comments cooldown period, you restrict a Spambot's ability to "
|
1377 |
"post multiple times to your posts."
|
1378 |
msgstr ""
|
1379 |
|
1380 |
+
#: src/features/comments_filter.php:230
|
1381 |
msgid "Comment Token Expire"
|
1382 |
msgstr ""
|
1383 |
|
1384 |
+
#: src/features/comments_filter.php:231
|
1385 |
msgid "A visitor has X seconds within which to post a comment"
|
1386 |
msgstr ""
|
1387 |
|
1388 |
+
#: src/features/comments_filter.php:232
|
1389 |
msgid ""
|
1390 |
"Default: 600 seconds (10 minutes). Each visitor is given a unique 'Token' so "
|
1391 |
"they can comment. This restricts spambots, but we need to force these tokens "
|
1392 |
"to expire and at the same time not bother the visitors."
|
1393 |
msgstr ""
|
1394 |
|
1395 |
+
#: src/features/comments_filter.php:236
|
1396 |
msgid "GASP Checkbox Message"
|
1397 |
msgstr ""
|
1398 |
|
1399 |
+
#: src/features/comments_filter.php:237
|
1400 |
msgid "If you want a custom checkbox message, please provide this here"
|
1401 |
msgstr ""
|
1402 |
|
1403 |
+
#: src/features/comments_filter.php:238
|
1404 |
msgid "You can customise the message beside the checkbox."
|
1405 |
msgstr ""
|
1406 |
|
1407 |
+
#: src/features/comments_filter.php:239 src/features/comments_filter.php:258
|
1408 |
+
#: src/features/comments_filter.php:265 src/features/comments_filter.php:272
|
1409 |
#, php-format
|
1410 |
msgid "Default Message: %s"
|
1411 |
msgstr ""
|
1412 |
|
1413 |
+
#: src/features/comments_filter.php:239 src/features/comments_filter.php:258
|
1414 |
msgid "Please check the box to confirm you're not a spammer"
|
1415 |
msgstr ""
|
1416 |
|
1417 |
+
#: src/features/comments_filter.php:244
|
1418 |
msgid "Enable Google reCAPTCHA For Comments"
|
1419 |
msgstr ""
|
1420 |
|
1421 |
+
#: src/features/comments_filter.php:245
|
1422 |
msgid "Use Google reCAPTCHA on the comments form to prevent bot-spam comments."
|
1423 |
msgstr ""
|
1424 |
|
1425 |
+
#: src/features/comments_filter.php:249 src/features/login_protect.php:687
|
1426 |
+
#: src/features/plugin.php:907
|
1427 |
msgid "reCAPTCHA Style"
|
1428 |
msgstr ""
|
1429 |
|
1430 |
+
#: src/features/comments_filter.php:250 src/features/login_protect.php:688
|
1431 |
msgid "How Google reCAPTCHA Will Be Displayed"
|
1432 |
msgstr ""
|
1433 |
|
1434 |
+
#: src/features/comments_filter.php:251 src/features/login_protect.php:689
|
1435 |
+
#: src/features/plugin.php:909
|
1436 |
msgid ""
|
1437 |
"You can choose the reCAPTCHA display format that best suits your site, "
|
1438 |
"including the new Invisible Recaptcha"
|
1439 |
msgstr ""
|
1440 |
|
1441 |
+
#: src/features/comments_filter.php:255
|
1442 |
msgid "GASP Alert Message"
|
1443 |
msgstr ""
|
1444 |
|
1445 |
+
#: src/features/comments_filter.php:256
|
1446 |
msgid "If you want a custom alert message, please provide this here"
|
1447 |
msgstr ""
|
1448 |
|
1449 |
+
#: src/features/comments_filter.php:257
|
1450 |
msgid ""
|
1451 |
"This alert message is displayed when a visitor attempts to submit a comment "
|
1452 |
"without checking the box."
|
1453 |
msgstr ""
|
1454 |
|
1455 |
+
#: src/features/comments_filter.php:262
|
1456 |
msgid "GASP Wait Message"
|
1457 |
msgstr ""
|
1458 |
|
1459 |
+
#: src/features/comments_filter.php:263
|
1460 |
msgid ""
|
1461 |
"If you want a custom submit-button wait message, please provide this here."
|
1462 |
msgstr ""
|
1463 |
|
1464 |
+
#: src/features/comments_filter.php:264
|
1465 |
#, php-format
|
1466 |
msgid ""
|
1467 |
"Where you see the '%s' this will be the number of seconds. You must ensure "
|
1468 |
"you include 1, and only 1, of these."
|
1469 |
msgstr ""
|
1470 |
|
1471 |
+
#: src/features/comments_filter.php:265
|
1472 |
#, php-format
|
1473 |
msgid "Please wait %s seconds before posting your comment"
|
1474 |
msgstr ""
|
1475 |
|
1476 |
+
#: src/features/comments_filter.php:269
|
1477 |
msgid "GASP Reload Message"
|
1478 |
msgstr ""
|
1479 |
|
1480 |
+
#: src/features/comments_filter.php:270
|
1481 |
msgid ""
|
1482 |
"If you want a custom message when the comment token has expired, please "
|
1483 |
"provide this here."
|
1484 |
msgstr ""
|
1485 |
|
1486 |
+
#: src/features/comments_filter.php:271
|
1487 |
msgid ""
|
1488 |
"This message is displayed on the submit-button when the comment token is "
|
1489 |
"expired"
|
1490 |
msgstr ""
|
1491 |
|
1492 |
+
#: src/features/comments_filter.php:272
|
1493 |
msgid "Please reload this page to post a comment"
|
1494 |
msgstr ""
|
1495 |
|
1496 |
+
#: src/features/email.php:33
|
1497 |
msgid "Email Options"
|
1498 |
msgstr ""
|
1499 |
|
1500 |
+
#: src/features/email.php:53
|
1501 |
msgid "Email Throttle Limit"
|
1502 |
msgstr ""
|
1503 |
|
1504 |
+
#: src/features/email.php:54
|
1505 |
msgid "Limit Emails Per Second"
|
1506 |
msgstr ""
|
1507 |
|
1508 |
+
#: src/features/email.php:55
|
1509 |
msgid ""
|
1510 |
"You throttle emails sent by this plugin by limiting the number of emails "
|
1511 |
"sent every second. This is useful in case you get hit by a bot attack. Zero "
|
1512 |
"(0) turns this off. Suggested: 10"
|
1513 |
msgstr ""
|
1514 |
|
1515 |
+
#: src/features/firewall.php:36
|
1516 |
#, php-format
|
1517 |
msgid "You were blocked by the %s."
|
1518 |
msgstr ""
|
1519 |
|
1520 |
+
#: src/features/firewall.php:61
|
1521 |
msgid ""
|
1522 |
"The Firewall is designed to analyse data sent to your website and block any "
|
1523 |
"requests that appear to be malicious."
|
1524 |
msgstr ""
|
1525 |
|
1526 |
+
#: src/features/firewall.php:62 src/features/plugin.php:956
|
1527 |
msgid "Firewall"
|
1528 |
msgstr ""
|
1529 |
|
1530 |
+
#: src/features/firewall.php:68
|
1531 |
msgid "Firewall Blocking Options"
|
1532 |
msgstr ""
|
1533 |
|
1534 |
+
#: src/features/firewall.php:70
|
1535 |
msgid "Here you choose what kind of malicious data to scan for."
|
1536 |
msgstr ""
|
1537 |
|
1538 |
+
#: src/features/firewall.php:72
|
1539 |
msgid "Turn on as many options here as you can."
|
1540 |
msgstr ""
|
1541 |
|
1542 |
+
#: src/features/firewall.php:73
|
1543 |
msgid ""
|
1544 |
"If you find an incompatibility or something stops working, un-check 1 option "
|
1545 |
"at a time until you find the problem or review the Audit Trail."
|
1546 |
msgstr ""
|
1547 |
|
1548 |
+
#: src/features/firewall.php:75
|
1549 |
msgid "Firewall Blocking"
|
1550 |
msgstr ""
|
1551 |
|
1552 |
+
#: src/features/firewall.php:79
|
1553 |
msgid "Choose Firewall Block Response"
|
1554 |
msgstr ""
|
1555 |
|
1556 |
+
#: src/features/firewall.php:81
|
1557 |
msgid ""
|
1558 |
"Here you choose how the plugin will respond when it detects malicious data."
|
1559 |
msgstr ""
|
1560 |
|
1561 |
+
#: src/features/firewall.php:82
|
1562 |
#, php-format
|
1563 |
msgid "Choose the option \"%s\"."
|
1564 |
msgstr ""
|
1565 |
|
1566 |
+
#: src/features/firewall.php:82
|
1567 |
msgid "Die With Message"
|
1568 |
msgstr ""
|
1569 |
|
1570 |
+
#: src/features/firewall.php:84
|
1571 |
msgid "Firewall Response"
|
1572 |
msgstr ""
|
1573 |
|
1574 |
+
#: src/features/firewall.php:88
|
1575 |
msgid ""
|
1576 |
"Whitelists - IPs, Pages, Parameters, and Users that by-pass the Firewall"
|
1577 |
msgstr ""
|
1578 |
|
1579 |
+
#: src/features/firewall.php:90
|
1580 |
msgid ""
|
1581 |
"In principle you should not need to whitelist anything or anyone unless you "
|
1582 |
"have discovered a collision with another plugin."
|
1583 |
msgstr ""
|
1584 |
|
1585 |
+
#: src/features/firewall.php:91
|
1586 |
msgid ""
|
1587 |
"Do not whitelist anything unless you are confident in what you are doing."
|
1588 |
msgstr ""
|
1589 |
|
1590 |
+
#: src/features/firewall.php:93
|
1591 |
msgid "Whitelist"
|
1592 |
msgstr ""
|
1593 |
|
1594 |
+
#: src/features/firewall.php:121
|
1595 |
msgid "Include Cookies"
|
1596 |
msgstr ""
|
1597 |
|
1598 |
+
#: src/features/firewall.php:122
|
1599 |
msgid "Also Test Cookie Values In Firewall Tests"
|
1600 |
msgstr ""
|
1601 |
|
1602 |
+
#: src/features/firewall.php:123
|
1603 |
msgid ""
|
1604 |
"The firewall tests GET and POST, but with this option checked it will also "
|
1605 |
"check COOKIE values."
|
1606 |
msgstr ""
|
1607 |
|
1608 |
+
#: src/features/firewall.php:127
|
1609 |
msgid "Directory Traversals"
|
1610 |
msgstr ""
|
1611 |
|
1612 |
+
#: src/features/firewall.php:128
|
1613 |
msgid "Block Directory Traversals"
|
1614 |
msgstr ""
|
1615 |
|
1616 |
+
#: src/features/firewall.php:129
|
1617 |
#, php-format
|
1618 |
msgid ""
|
1619 |
"This will block directory traversal paths in in application parameters (e.g. "
|
1620 |
"%s, etc)."
|
1621 |
msgstr ""
|
1622 |
|
1623 |
+
#: src/features/firewall.php:133 src/processors/firewall.php:536
|
1624 |
msgid "SQL Queries"
|
1625 |
msgstr ""
|
1626 |
|
1627 |
+
#: src/features/firewall.php:134
|
1628 |
msgid "Block SQL Queries"
|
1629 |
msgstr ""
|
1630 |
|
1631 |
+
#: src/features/firewall.php:135
|
1632 |
#, php-format
|
1633 |
msgid "This will block sql in application parameters (e.g. %s, etc)."
|
1634 |
msgstr ""
|
1635 |
|
1636 |
+
#: src/features/firewall.php:139 src/processors/firewall.php:530
|
1637 |
msgid "WordPress Terms"
|
1638 |
msgstr ""
|
1639 |
|
1640 |
+
#: src/features/firewall.php:140
|
1641 |
msgid "Block WordPress Specific Terms"
|
1642 |
msgstr ""
|
1643 |
|
1644 |
+
#: src/features/firewall.php:141
|
1645 |
msgid ""
|
1646 |
"This will block WordPress specific terms in application parameters (wp_, "
|
1647 |
"user_login, etc.)."
|
1648 |
msgstr ""
|
1649 |
|
1650 |
+
#: src/features/firewall.php:145 src/processors/firewall.php:533
|
1651 |
msgid "Field Truncation"
|
1652 |
msgstr ""
|
1653 |
|
1654 |
+
#: src/features/firewall.php:146
|
1655 |
msgid "Block Field Truncation Attacks"
|
1656 |
msgstr ""
|
1657 |
|
1658 |
+
#: src/features/firewall.php:147
|
1659 |
msgid "This will block field truncation attacks in application parameters."
|
1660 |
msgstr ""
|
1661 |
|
1662 |
+
#: src/features/firewall.php:151 src/processors/firewall.php:545
|
1663 |
msgid "PHP Code"
|
1664 |
msgstr ""
|
1665 |
|
1666 |
+
#: src/features/firewall.php:152
|
1667 |
#, php-format
|
1668 |
msgid "Block %s"
|
1669 |
msgstr ""
|
1670 |
|
1671 |
+
#: src/features/firewall.php:152
|
1672 |
msgid "PHP Code Includes"
|
1673 |
msgstr ""
|
1674 |
|
1675 |
+
#: src/features/firewall.php:153
|
1676 |
msgid "This will block any data that appears to try and include PHP files."
|
1677 |
msgstr ""
|
1678 |
|
1679 |
+
#: src/features/firewall.php:154
|
1680 |
msgid "Will probably block saving within the Plugin/Theme file editors."
|
1681 |
msgstr ""
|
1682 |
|
1683 |
+
#: src/features/firewall.php:158
|
1684 |
msgid "Exe File Uploads"
|
1685 |
msgstr ""
|
1686 |
|
1687 |
+
#: src/features/firewall.php:159
|
1688 |
msgid "Block Executable File Uploads"
|
1689 |
msgstr ""
|
1690 |
|
1691 |
+
#: src/features/firewall.php:160
|
1692 |
msgid "This will block executable file uploads (.php, .exe, etc.)."
|
1693 |
msgstr ""
|
1694 |
|
1695 |
+
#: src/features/firewall.php:164
|
1696 |
msgid "Leading Schemas"
|
1697 |
msgstr ""
|
1698 |
|
1699 |
+
#: src/features/firewall.php:165
|
1700 |
msgid "Block Leading Schemas (HTTPS / HTTP)"
|
1701 |
msgstr ""
|
1702 |
|
1703 |
+
#: src/features/firewall.php:166
|
1704 |
msgid ""
|
1705 |
"This will block leading schemas http:// and https:// in application "
|
1706 |
"parameters (off by default; may cause problems with other plugins)."
|
1707 |
msgstr ""
|
1708 |
|
1709 |
+
#: src/features/firewall.php:170
|
1710 |
msgid "Aggressive Scan"
|
1711 |
msgstr ""
|
1712 |
|
1713 |
+
#: src/features/firewall.php:171
|
1714 |
msgid "Aggressively Block Data"
|
1715 |
msgstr ""
|
1716 |
|
1717 |
+
#: src/features/firewall.php:172
|
1718 |
msgid ""
|
1719 |
"Employs a set of aggressive rules to detect and block malicious data "
|
1720 |
"submitted to your site."
|
1721 |
msgstr ""
|
1722 |
|
1723 |
+
#: src/features/firewall.php:173 src/features/hack_protect.php:911
|
1724 |
+
#: src/features/hack_protect.php:935 src/features/hack_protect.php:936
|
1725 |
+
#: src/features/ips.php:272 src/features/ips.php:279
|
1726 |
+
#: src/features/lockdown.php:181 src/features/lockdown.php:194
|
1727 |
+
#: src/features/plugin.php:873
|
1728 |
+
#: src/processors/hackprotect_corechecksumscan.php:244
|
1729 |
+
#: src/processors/hackprotect_filecleanerscan.php:232
|
1730 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:110
|
1731 |
+
#: src/processors/hackprotect_ptguard.php:491
|
1732 |
+
#: src/processors/hackprotect_wpvulnscan.php:220
|
1733 |
+
#: src/processors/loginprotect_wplogin.php:74
|
1734 |
+
#: src/processors/loginprotect_wplogin.php:93 src/processors/plugin.php:206
|
1735 |
+
msgid "Warning"
|
1736 |
msgstr ""
|
1737 |
|
1738 |
+
#: src/features/firewall.php:173
|
1739 |
msgid "May cause an increase in false-positive firewall blocks."
|
1740 |
msgstr ""
|
1741 |
|
1742 |
+
#: src/features/firewall.php:177
|
1743 |
msgid "Block Response"
|
1744 |
msgstr ""
|
1745 |
|
1746 |
+
#: src/features/firewall.php:178
|
1747 |
msgid "Choose how the firewall responds when it blocks a request"
|
1748 |
msgstr ""
|
1749 |
|
1750 |
+
#: src/features/firewall.php:179
|
1751 |
msgid ""
|
1752 |
"We recommend dying with a message so you know what might have occurred when "
|
1753 |
"the firewall blocks you"
|
1754 |
msgstr ""
|
1755 |
|
1756 |
+
#: src/features/firewall.php:183
|
1757 |
msgid "Send Email Report"
|
1758 |
msgstr ""
|
1759 |
|
1760 |
+
#: src/features/firewall.php:184
|
1761 |
msgid ""
|
1762 |
"When a visitor is blocked the firewall will send an email to the configured "
|
1763 |
"email address"
|
1764 |
msgstr ""
|
1765 |
|
1766 |
+
#: src/features/firewall.php:185
|
1767 |
msgid ""
|
1768 |
"Use with caution - if you get hit by automated bots you may send out too "
|
1769 |
"many emails and you could get blocked by your host"
|
1770 |
msgstr ""
|
1771 |
|
1772 |
+
#: src/features/firewall.php:189
|
1773 |
msgid "Whitelist Parameters"
|
1774 |
msgstr ""
|
1775 |
|
1776 |
+
#: src/features/firewall.php:190
|
1777 |
msgid ""
|
1778 |
"Detail pages and parameters that are whitelisted (ignored by the firewall)"
|
1779 |
msgstr ""
|
1780 |
|
1781 |
+
#: src/features/firewall.php:191
|
1782 |
msgid ""
|
1783 |
"This should be used with caution and you should only provide parameter names "
|
1784 |
"that you must have excluded"
|
1785 |
msgstr ""
|
1786 |
|
1787 |
+
#: src/features/firewall.php:195 src/features/firewall.php:196
|
1788 |
+
#: src/features/firewall.php:201
|
1789 |
#, php-format
|
1790 |
msgid "Ignore %s"
|
1791 |
msgstr ""
|
1792 |
|
1793 |
+
#: src/features/firewall.php:195 src/features/firewall.php:196
|
1794 |
+
#: src/features/login_protect.php:180
|
1795 |
msgid "Administrators"
|
1796 |
msgstr ""
|
1797 |
|
1798 |
+
#: src/features/firewall.php:197
|
1799 |
msgid ""
|
1800 |
"Authenticated administrator users will not be processed by the firewall "
|
1801 |
"rules."
|
1802 |
msgstr ""
|
1803 |
|
1804 |
+
#: src/features/firewall.php:201
|
1805 |
msgid "Search Engines"
|
1806 |
msgstr ""
|
1807 |
|
1808 |
+
#: src/features/firewall.php:202
|
1809 |
msgid "Ignore Search Engine Bot Traffic"
|
1810 |
msgstr ""
|
1811 |
|
1812 |
+
#: src/features/firewall.php:203
|
1813 |
msgid ""
|
1814 |
"The firewall will try to recognise search engine spiders/bots and not apply "
|
1815 |
"firewall rules to them."
|
1816 |
msgstr ""
|
1817 |
|
1818 |
+
#: src/features/firewall.php:207
|
1819 |
msgid "Firewall Block Message"
|
1820 |
msgstr ""
|
1821 |
|
1822 |
+
#: src/features/firewall.php:208
|
1823 |
msgid "Message Displayed To Visitor When A Firewall Block Is Triggered"
|
1824 |
msgstr ""
|
1825 |
|
1826 |
+
#: src/features/firewall.php:209
|
1827 |
msgid "This is the message displayed to visitors that trigger the firewall."
|
1828 |
msgstr ""
|
1829 |
|
1830 |
+
#: src/features/hack_protect.php:147
|
1831 |
#, php-format
|
1832 |
msgid "%s per day"
|
1833 |
msgstr ""
|
1834 |
|
1835 |
+
#: src/features/hack_protect.php:623
|
1836 |
+
msgid "Never"
|
1837 |
+
msgstr ""
|
1838 |
+
|
1839 |
+
#: src/features/hack_protect.php:624
|
1840 |
+
#, php-format
|
1841 |
+
msgid "Last Scan Time: %s"
|
1842 |
+
msgstr ""
|
1843 |
+
|
1844 |
+
#: src/features/hack_protect.php:638
|
1845 |
#, php-format
|
1846 |
msgid ""
|
1847 |
"Sorry, this feature is not available because we cannot write to disk at this "
|
1848 |
"location: \"%s\""
|
1849 |
msgstr ""
|
1850 |
|
1851 |
+
#: src/features/hack_protect.php:651
|
1852 |
+
msgid "Scans"
|
1853 |
+
msgstr ""
|
1854 |
+
|
1855 |
+
#: src/features/hack_protect.php:659
|
1856 |
+
msgid "Core File scanner is not enabled."
|
1857 |
+
msgstr ""
|
1858 |
+
|
1859 |
+
#: src/features/hack_protect.php:662
|
1860 |
+
msgid "Automatic WordPress Core File scanner should be turned-on."
|
1861 |
+
msgstr ""
|
1862 |
+
|
1863 |
+
#: src/features/hack_protect.php:668
|
1864 |
+
msgid "Modified WordPress core files found."
|
1865 |
+
msgstr ""
|
1866 |
+
|
1867 |
+
#: src/features/hack_protect.php:670 src/features/hack_protect.php:691
|
1868 |
+
#: src/features/hack_protect.php:712
|
1869 |
+
msgid "Run Scan"
|
1870 |
+
msgstr ""
|
1871 |
+
|
1872 |
+
#: src/features/hack_protect.php:671
|
1873 |
+
msgid "Scan WP core files and repair any files that are flagged as modified."
|
1874 |
+
msgstr ""
|
1875 |
+
|
1876 |
+
#: src/features/hack_protect.php:680
|
1877 |
+
msgid "Unrecognised File scanner is not enabled."
|
1878 |
+
msgstr ""
|
1879 |
+
|
1880 |
+
#: src/features/hack_protect.php:683
|
1881 |
+
msgid "Automatic scanning for non-WordPress core files is recommended."
|
1882 |
+
msgstr ""
|
1883 |
+
|
1884 |
+
#: src/features/hack_protect.php:689
|
1885 |
+
msgid "Unrecognised files found in WordPress Core directory."
|
1886 |
+
msgstr ""
|
1887 |
+
|
1888 |
+
#: src/features/hack_protect.php:692
|
1889 |
+
msgid ""
|
1890 |
+
"Scan and remove any files that are not meant to be in the WP core "
|
1891 |
+
"directories."
|
1892 |
+
msgstr ""
|
1893 |
+
|
1894 |
+
#: src/features/hack_protect.php:701
|
1895 |
+
msgid "Automatic Plugin/Themes Guard is not enabled."
|
1896 |
+
msgstr ""
|
1897 |
+
|
1898 |
+
#: src/features/hack_protect.php:704
|
1899 |
+
msgid "Automatic detection of plugin/theme modifications is recommended."
|
1900 |
+
msgstr ""
|
1901 |
+
|
1902 |
+
#: src/features/hack_protect.php:710
|
1903 |
+
msgid "A plugin/theme was found to have been modified."
|
1904 |
+
msgstr ""
|
1905 |
+
|
1906 |
+
#: src/features/hack_protect.php:713
|
1907 |
+
msgid "Reviewing modifications to your plugins/themes is recommended."
|
1908 |
+
msgstr ""
|
1909 |
+
|
1910 |
+
#: src/features/hack_protect.php:722
|
1911 |
+
msgid "Plugin Vulnerability Scanner is not enabled."
|
1912 |
+
msgstr ""
|
1913 |
+
|
1914 |
+
#: src/features/hack_protect.php:725
|
1915 |
+
msgid "Automatic detection of plugin vulnerabilities is recommended."
|
1916 |
+
msgstr ""
|
1917 |
+
|
1918 |
+
#: src/features/hack_protect.php:731
|
1919 |
+
msgid "At least 1 plugin has known vulnerabilities."
|
1920 |
+
msgstr ""
|
1921 |
+
|
1922 |
+
#: src/features/hack_protect.php:734
|
1923 |
+
msgid ""
|
1924 |
+
"Plugins with known vulnerabilities should be updated, removed, or replaced."
|
1925 |
+
msgstr ""
|
1926 |
+
|
1927 |
+
#: src/features/hack_protect.php:756 src/features/hack_protect.php:757
|
1928 |
+
msgid "Scan Options"
|
1929 |
msgstr ""
|
1930 |
|
1931 |
+
#: src/features/hack_protect.php:759
|
1932 |
msgid "Set how frequently the Hack Guard scans will run."
|
1933 |
msgstr ""
|
1934 |
|
1935 |
+
#: src/features/hack_protect.php:766
|
1936 |
msgid ""
|
1937 |
"Hack Guard is a set of tools to warn you and protect you against hacks on "
|
1938 |
"your site."
|
1939 |
msgstr ""
|
1940 |
|
1941 |
+
#: src/features/hack_protect.php:767 src/features/plugin.php:958
|
1942 |
msgid "Hack Guard"
|
1943 |
msgstr ""
|
1944 |
|
1945 |
+
#: src/features/hack_protect.php:773 src/features/hack_protect.php:779
|
1946 |
msgid "Vulnerabilities Scanner"
|
1947 |
msgstr ""
|
1948 |
|
1949 |
+
#: src/features/hack_protect.php:775
|
1950 |
msgid ""
|
1951 |
"Regularly scan your WordPress plugins and themes for known security "
|
1952 |
"vulnerabilities."
|
1953 |
msgstr ""
|
1954 |
|
1955 |
+
#: src/features/hack_protect.php:776 src/features/hack_protect.php:783
|
1956 |
+
#: src/features/hack_protect.php:786 src/features/hack_protect.php:866
|
1957 |
msgid "Plugin Vulnerabilities Scanner"
|
1958 |
msgstr ""
|
1959 |
|
1960 |
+
#: src/features/hack_protect.php:777
|
1961 |
msgid ""
|
1962 |
"Ensure this is turned on and you will always know if any of your assets have "
|
1963 |
"known security vulnerabilities."
|
1964 |
msgstr ""
|
1965 |
|
1966 |
+
#: src/features/hack_protect.php:785
|
1967 |
msgid ""
|
1968 |
"Regularly scan your plugins against a database of known vulnerabilities."
|
1969 |
msgstr ""
|
1970 |
|
1971 |
+
#: src/features/hack_protect.php:788
|
1972 |
msgid "Plugin Vulnerabilities"
|
1973 |
msgstr ""
|
1974 |
|
1975 |
+
#: src/features/hack_protect.php:792 src/features/hack_protect.php:795
|
1976 |
msgid "Core File Integrity Scanner"
|
1977 |
msgstr ""
|
1978 |
|
1979 |
+
#: src/features/hack_protect.php:794
|
1980 |
msgid ""
|
1981 |
"Regularly scan your WordPress core files for changes compared to official "
|
1982 |
"WordPress files."
|
1983 |
msgstr ""
|
1984 |
|
1985 |
+
#: src/features/hack_protect.php:797 src/features/hack_protect.php:890
|
1986 |
msgid "Core File Scanner"
|
1987 |
msgstr ""
|
1988 |
|
1989 |
+
#: src/features/hack_protect.php:801 src/features/hack_protect.php:804
|
1990 |
+
#: src/features/hack_protect.php:806 src/features/hack_protect.php:903
|
1991 |
msgid "Unrecognised Files Scanner"
|
1992 |
msgstr ""
|
1993 |
|
1994 |
+
#: src/features/hack_protect.php:803
|
1995 |
msgid "Regularly scan your WordPress core folders for files that don't belong."
|
1996 |
msgstr ""
|
1997 |
|
1998 |
+
#: src/features/hack_protect.php:810
|
1999 |
msgid "Plugins and Themes Guard"
|
2000 |
msgstr ""
|
2001 |
|
2002 |
+
#: src/features/hack_protect.php:811
|
2003 |
msgid "Plugins/Themes Guard"
|
2004 |
msgstr ""
|
2005 |
|
2006 |
+
#: src/features/hack_protect.php:813
|
2007 |
msgid "Detect malicious changes to your themes and plugins."
|
2008 |
msgstr ""
|
2009 |
|
2010 |
+
#: src/features/hack_protect.php:814
|
2011 |
msgid "Keep the Plugins/Theme Guard feature turned on."
|
2012 |
msgstr ""
|
2013 |
|
2014 |
+
#: src/features/hack_protect.php:815 src/features/user_management.php:325
|
2015 |
+
msgid "Requirements"
|
2016 |
msgstr ""
|
2017 |
|
2018 |
+
#: src/features/hack_protect.php:820 src/features/hack_protect.php:821
|
2019 |
msgid "Integrity Checks"
|
2020 |
msgstr ""
|
2021 |
|
2022 |
+
#: src/features/hack_protect.php:823
|
2023 |
msgid "Monitor for unrecognised changes to your system."
|
2024 |
msgstr ""
|
2025 |
|
2026 |
+
#: src/features/hack_protect.php:824
|
2027 |
msgid "Enable these to prevent unauthorized changes to your WordPress site."
|
2028 |
msgstr ""
|
2029 |
|
2030 |
+
#: src/features/hack_protect.php:853
|
2031 |
msgid "Daily Scan Frequency"
|
2032 |
msgstr ""
|
2033 |
|
2034 |
+
#: src/features/hack_protect.php:854
|
2035 |
msgid "Number Of Times To Automatically Run File Scan In 24hrs"
|
2036 |
msgstr ""
|
2037 |
|
2038 |
+
#: src/features/hack_protect.php:855
|
2039 |
+
msgid "Once every 24hrs."
|
2040 |
+
msgstr ""
|
2041 |
+
|
2042 |
+
#: src/features/hack_protect.php:856
|
2043 |
+
msgid "To improve security, increase the number of scans per day."
|
2044 |
+
msgstr ""
|
2045 |
+
|
2046 |
+
#: src/features/hack_protect.php:860
|
2047 |
+
msgid "Email Files List"
|
2048 |
+
msgstr ""
|
2049 |
+
|
2050 |
+
#: src/features/hack_protect.php:861
|
2051 |
+
msgid "Scan Notification Emails Should Include Full Listing Of Files"
|
2052 |
+
msgstr ""
|
2053 |
+
|
2054 |
+
#: src/features/hack_protect.php:862
|
2055 |
msgid ""
|
2056 |
+
"Scanner notification emails will include a summary list of all affected "
|
2057 |
+
"files."
|
2058 |
msgstr ""
|
2059 |
|
2060 |
+
#: src/features/hack_protect.php:867
|
2061 |
#, php-format
|
2062 |
msgid "Daily Cron - %s"
|
2063 |
msgstr ""
|
2064 |
|
2065 |
+
#: src/features/hack_protect.php:867
|
2066 |
msgid "Scans Plugins For Known Vulnerabilities"
|
2067 |
msgstr ""
|
2068 |
|
2069 |
+
#: src/features/hack_protect.php:868
|
2070 |
msgid ""
|
2071 |
"Runs a scan of all your plugins against a database of known WordPress plugin "
|
2072 |
"vulnerabilities."
|
2073 |
msgstr ""
|
2074 |
|
2075 |
+
#: src/features/hack_protect.php:872
|
2076 |
msgid "Vulnerability Scanner"
|
2077 |
msgstr ""
|
2078 |
|
2079 |
+
#: src/features/hack_protect.php:873
|
2080 |
msgid "Enable The Vulnerability Scanner"
|
2081 |
msgstr ""
|
2082 |
|
2083 |
+
#: src/features/hack_protect.php:874
|
2084 |
msgid ""
|
2085 |
"Runs a scan of all your plugins against a database of known WordPress "
|
2086 |
"vulnerabilities."
|
2087 |
msgstr ""
|
2088 |
|
2089 |
+
#: src/features/hack_protect.php:879
|
2090 |
msgid "Apply Updates Automatically To Vulnerable Plugins"
|
2091 |
msgstr ""
|
2092 |
|
2093 |
+
#: src/features/hack_protect.php:880
|
2094 |
msgid ""
|
2095 |
"When an update becomes available, automatically apply updates to items with "
|
2096 |
"known vulnerabilities."
|
2097 |
msgstr ""
|
2098 |
|
2099 |
+
#: src/features/hack_protect.php:884
|
2100 |
msgid "Highlight Plugins"
|
2101 |
msgstr ""
|
2102 |
|
2103 |
+
#: src/features/hack_protect.php:885
|
2104 |
msgid "Highlight Vulnerable Plugins Upon Display"
|
2105 |
msgstr ""
|
2106 |
|
2107 |
+
#: src/features/hack_protect.php:886
|
2108 |
msgid "Vulnerable plugins will be highlighted on the main plugins page."
|
2109 |
msgstr ""
|
2110 |
|
2111 |
+
#: src/features/hack_protect.php:891
|
2112 |
msgid "Scans WordPress Core Files For Alterations"
|
2113 |
msgstr ""
|
2114 |
|
2115 |
+
#: src/features/hack_protect.php:892
|
2116 |
msgid ""
|
2117 |
"Compares all WordPress core files on your site against the official "
|
2118 |
"WordPress files."
|
2119 |
msgstr ""
|
2120 |
|
2121 |
+
#: src/features/hack_protect.php:893
|
2122 |
msgid "WordPress Core files should never be altered for any reason."
|
2123 |
msgstr ""
|
2124 |
|
2125 |
+
#: src/features/hack_protect.php:897
|
2126 |
msgid "Auto Repair"
|
2127 |
msgstr ""
|
2128 |
|
2129 |
+
#: src/features/hack_protect.php:898
|
2130 |
msgid "Automatically Repair WordPress Core Files That Have Been Altered"
|
2131 |
msgstr ""
|
2132 |
|
2133 |
+
#: src/features/hack_protect.php:899
|
2134 |
msgid ""
|
2135 |
"Attempts to automatically repair WordPress Core files with the official "
|
2136 |
"WordPress file data, for files that have been altered or are missing."
|
2137 |
msgstr ""
|
2138 |
|
2139 |
+
#: src/features/hack_protect.php:904
|
2140 |
msgid "Daily Scan For Unrecognised Files In Core Directories"
|
2141 |
msgstr ""
|
2142 |
|
2143 |
+
#: src/features/hack_protect.php:905
|
2144 |
msgid ""
|
2145 |
"Scans for, and automatically deletes, any files in your core WordPress "
|
2146 |
"folders that are not part of your WordPress installation."
|
2147 |
msgstr ""
|
2148 |
|
2149 |
+
#: src/features/hack_protect.php:909
|
2150 |
msgid "Scan Uploads"
|
2151 |
msgstr ""
|
2152 |
|
2153 |
+
#: src/features/hack_protect.php:910
|
2154 |
msgid "Scan Uploads Folder For PHP and Javascript"
|
2155 |
msgstr ""
|
2156 |
|
2157 |
+
#: src/features/hack_protect.php:911
|
2158 |
msgid ""
|
2159 |
"Take care when turning on this option - if you are unsure, leave it disabled."
|
2160 |
msgstr ""
|
2161 |
|
2162 |
+
#: src/features/hack_protect.php:912
|
2163 |
msgid ""
|
2164 |
"The Uploads folder is primarily for media, but could be used to store "
|
2165 |
"nefarious files."
|
2166 |
msgstr ""
|
2167 |
|
2168 |
+
#: src/features/hack_protect.php:916
|
2169 |
msgid "File Exclusions"
|
2170 |
msgstr ""
|
2171 |
|
2172 |
+
#: src/features/hack_protect.php:917
|
2173 |
msgid "Provide A List Of Files To Be Excluded From The Scan"
|
2174 |
msgstr ""
|
2175 |
|
2176 |
+
#: src/features/hack_protect.php:919
|
2177 |
msgid "Take a new line for each file you wish to exclude from the scan."
|
2178 |
msgstr ""
|
2179 |
|
2180 |
+
#: src/features/hack_protect.php:920
|
2181 |
msgid "No commas are necessary."
|
2182 |
msgstr ""
|
2183 |
|
2184 |
+
#: src/features/hack_protect.php:925
|
2185 |
msgid "Enable Integrity Scan"
|
2186 |
msgstr ""
|
2187 |
|
2188 |
+
#: src/features/hack_protect.php:926
|
2189 |
msgid "Scans For Critical Changes Made To Your WordPress Site"
|
2190 |
msgstr ""
|
2191 |
|
2192 |
+
#: src/features/hack_protect.php:927
|
2193 |
msgid "Detects changes made to your WordPress site outside of WordPress."
|
2194 |
msgstr ""
|
2195 |
|
2196 |
+
#: src/features/hack_protect.php:931
|
2197 |
msgid "Monitor User Accounts"
|
2198 |
msgstr ""
|
2199 |
|
2200 |
+
#: src/features/hack_protect.php:932
|
2201 |
msgid "Scans For Critical Changes Made To User Accounts"
|
2202 |
msgstr ""
|
2203 |
|
2204 |
+
#: src/features/hack_protect.php:933
|
2205 |
msgid ""
|
2206 |
"Detects changes made to critical user account information that were made "
|
2207 |
"directly on the database and outside of the WordPress system."
|
2208 |
msgstr ""
|
2209 |
|
2210 |
+
#: src/features/hack_protect.php:934
|
2211 |
msgid "An example of this might be some form of SQL Injection attack."
|
2212 |
msgstr ""
|
2213 |
|
2214 |
+
#: src/features/hack_protect.php:935
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2215 |
msgid ""
|
2216 |
"Enabling this option for every page low may slow down your site with large "
|
2217 |
"numbers of users."
|
2218 |
msgstr ""
|
2219 |
|
2220 |
+
#: src/features/hack_protect.php:936
|
2221 |
msgid ""
|
2222 |
+
"This option may cause critical problem with 3rd party plugins that manage "
|
2223 |
"user accounts."
|
2224 |
msgstr ""
|
2225 |
|
2226 |
+
#: src/features/hack_protect.php:940 src/features/headers.php:197
|
2227 |
+
#: src/features/headers.php:198 src/features/login_protect.php:647
|
2228 |
+
#: src/features/login_protect.php:659 src/features/login_protect.php:665
|
2229 |
+
#: src/features/plugin.php:799
|
2230 |
#, php-format
|
2231 |
msgid "Enable %s"
|
2232 |
msgstr ""
|
2233 |
|
2234 |
+
#: src/features/hack_protect.php:940
|
2235 |
msgid "Guard"
|
2236 |
msgstr ""
|
2237 |
|
2238 |
+
#: src/features/hack_protect.php:941
|
2239 |
msgid "Enable The Guard For Plugin And Theme Files"
|
2240 |
msgstr ""
|
2241 |
|
2242 |
+
#: src/features/hack_protect.php:942
|
2243 |
msgid ""
|
2244 |
"When enabled the Guard will automatically scan for changes to your Plugin "
|
2245 |
"and Theme files."
|
2246 |
msgstr ""
|
2247 |
|
2248 |
+
#: src/features/hack_protect.php:946
|
2249 |
msgid "Guard/Scan Depth"
|
2250 |
msgstr ""
|
2251 |
|
2252 |
+
#: src/features/hack_protect.php:947
|
2253 |
msgid "How Deep Into The Plugin Directories To Scan And Guard"
|
2254 |
msgstr ""
|
2255 |
|
2256 |
+
#: src/features/hack_protect.php:948
|
2257 |
msgid ""
|
2258 |
"The Guard normally scans only the top level of a folder. Increasing depth "
|
2259 |
"will increase scan times."
|
2260 |
msgstr ""
|
2261 |
|
2262 |
+
#: src/features/hack_protect.php:949
|
2263 |
#, php-format
|
2264 |
msgid ""
|
2265 |
"Setting it to %s will remove this limit and all sub-folders will be scanned "
|
2266 |
"- not recommended"
|
2267 |
msgstr ""
|
2268 |
|
2269 |
+
#: src/features/hack_protect.php:953
|
2270 |
msgid "Included File Types"
|
2271 |
msgstr ""
|
2272 |
|
2273 |
+
#: src/features/hack_protect.php:954
|
2274 |
msgid "The File Types (by File Extension) Included In The Scan"
|
2275 |
msgstr ""
|
2276 |
|
2277 |
+
#: src/features/hack_protect.php:955
|
2278 |
msgid "Take a new line for each file extension."
|
2279 |
msgstr ""
|
2280 |
|
2281 |
+
#: src/features/hack_protect.php:956
|
2282 |
msgid "No commas(,) or periods(.) necessary."
|
2283 |
msgstr ""
|
2284 |
|
2285 |
+
#: src/features/hack_protect.php:957
|
2286 |
msgid "Remove all extensions to scan all file type (not recommended)."
|
2287 |
msgstr ""
|
2288 |
|
2289 |
+
#: src/features/hack_protect.php:961
|
2290 |
msgid "Show Re-Install Links"
|
2291 |
msgstr ""
|
2292 |
|
2293 |
+
#: src/features/hack_protect.php:962
|
2294 |
msgid "Show Re-Install Links For Plugins"
|
2295 |
msgstr ""
|
2296 |
|
2297 |
+
#: src/features/hack_protect.php:963
|
2298 |
msgid ""
|
2299 |
"Show links to re-install plugins and offer re-install when activating "
|
2300 |
"plugins."
|
2301 |
msgstr ""
|
2302 |
|
2303 |
+
#: src/features/headers.php:122 src/features/headers.php:131
|
2304 |
msgid ""
|
2305 |
"Protect visitors to your site by implementing increased security response "
|
2306 |
"headers."
|
2307 |
msgstr ""
|
2308 |
|
2309 |
+
#: src/features/headers.php:123 src/features/headers.php:132
|
2310 |
+
#: src/features/headers.php:141
|
2311 |
msgid ""
|
2312 |
"Enabling these features are advised, but you must test them on your site "
|
2313 |
"thoroughly."
|
2314 |
msgstr ""
|
2315 |
|
2316 |
+
#: src/features/headers.php:129
|
2317 |
msgid "Advanced Security Headers"
|
2318 |
msgstr ""
|
2319 |
|
2320 |
+
#: src/features/headers.php:134
|
2321 |
msgid "Security Headers"
|
2322 |
msgstr ""
|
2323 |
|
2324 |
+
#: src/features/headers.php:138 src/features/headers.php:143
|
2325 |
+
#: src/features/headers.php:198
|
2326 |
msgid "Content Security Policy"
|
2327 |
msgstr ""
|
2328 |
|
2329 |
+
#: src/features/headers.php:140
|
2330 |
msgid ""
|
2331 |
"Restrict the sources and types of content that may be loaded and processed "
|
2332 |
"by visitor browsers."
|
2333 |
msgstr ""
|
2334 |
|
2335 |
+
#: src/features/headers.php:172
|
2336 |
msgid "Block iFrames"
|
2337 |
msgstr ""
|
2338 |
|
2339 |
+
#: src/features/headers.php:173
|
2340 |
msgid "Block Remote iFrames Of This Site"
|
2341 |
msgstr ""
|
2342 |
|
2343 |
+
#: src/features/headers.php:174
|
2344 |
msgid ""
|
2345 |
"The setting prevents any external website from embedding your site in an "
|
2346 |
"iFrame."
|
2347 |
msgstr ""
|
2348 |
|
2349 |
+
#: src/features/headers.php:175
|
2350 |
msgid "This is useful for preventing so-called \"ClickJack attacks\"."
|
2351 |
msgstr ""
|
2352 |
|
2353 |
+
#: src/features/headers.php:179
|
2354 |
msgid "Referrer Policy"
|
2355 |
msgstr ""
|
2356 |
|
2357 |
+
#: src/features/headers.php:180
|
2358 |
msgid "Referrer Policy Header"
|
2359 |
msgstr ""
|
2360 |
|
2361 |
+
#: src/features/headers.php:181
|
2362 |
msgid ""
|
2363 |
"The Referrer Policy Header allows you to control when and what referral "
|
2364 |
"information a browser may pass along with links clicked on your site."
|
2365 |
msgstr ""
|
2366 |
|
2367 |
+
#: src/features/headers.php:185
|
2368 |
msgid "XSS Protection"
|
2369 |
msgstr ""
|
2370 |
|
2371 |
+
#: src/features/headers.php:186
|
2372 |
msgid "Employ Built-In Browser XSS Protection"
|
2373 |
msgstr ""
|
2374 |
|
2375 |
+
#: src/features/headers.php:187
|
2376 |
msgid ""
|
2377 |
"Directs compatible browsers to block what they detect as Reflective XSS "
|
2378 |
"attacks."
|
2379 |
msgstr ""
|
2380 |
|
2381 |
+
#: src/features/headers.php:191
|
2382 |
msgid "Prevent Mime-Sniff"
|
2383 |
msgstr ""
|
2384 |
|
2385 |
+
#: src/features/headers.php:192
|
2386 |
msgid "Turn-Off Browser Mime-Sniff"
|
2387 |
msgstr ""
|
2388 |
|
2389 |
+
#: src/features/headers.php:193
|
2390 |
msgid "Reduces visitor exposure to malicious user-uploaded content."
|
2391 |
msgstr ""
|
2392 |
|
2393 |
+
#: src/features/headers.php:199
|
2394 |
msgid ""
|
2395 |
"Allows for permission and restriction of all resources loaded on your site."
|
2396 |
msgstr ""
|
2397 |
|
2398 |
+
#: src/features/headers.php:203
|
2399 |
msgid "Self"
|
2400 |
msgstr ""
|
2401 |
|
2402 |
+
#: src/features/headers.php:204
|
2403 |
msgid "Allow 'self' Directive"
|
2404 |
msgstr ""
|
2405 |
|
2406 |
+
#: src/features/headers.php:205
|
2407 |
msgid "Using 'self' is generally recommended."
|
2408 |
msgstr ""
|
2409 |
|
2410 |
+
#: src/features/headers.php:206
|
2411 |
msgid ""
|
2412 |
"It essentially means that resources from your own host:protocol are "
|
2413 |
"permitted."
|
2414 |
msgstr ""
|
2415 |
|
2416 |
+
#: src/features/headers.php:210
|
2417 |
msgid "Inline Entities"
|
2418 |
msgstr ""
|
2419 |
|
2420 |
+
#: src/features/headers.php:211
|
2421 |
msgid "Allow Inline Scripts and CSS"
|
2422 |
msgstr ""
|
2423 |
|
2424 |
+
#: src/features/headers.php:212
|
2425 |
msgid ""
|
2426 |
"Allows parsing of Javascript and CSS declared in-line in your html document."
|
2427 |
msgstr ""
|
2428 |
|
2429 |
+
#: src/features/headers.php:216
|
2430 |
msgid "Embedded Data"
|
2431 |
msgstr ""
|
2432 |
|
2433 |
+
#: src/features/headers.php:217
|
2434 |
msgid "Allow \"data:\" Directives"
|
2435 |
msgstr ""
|
2436 |
|
2437 |
+
#: src/features/headers.php:218
|
2438 |
msgid ""
|
2439 |
"Allows use of embedded data directives, most commonly used for images and "
|
2440 |
"fonts."
|
2441 |
msgstr ""
|
2442 |
|
2443 |
+
#: src/features/headers.php:222
|
2444 |
msgid "Allow eval()"
|
2445 |
msgstr ""
|
2446 |
|
2447 |
+
#: src/features/headers.php:223
|
2448 |
msgid "Allow Javascript eval()"
|
2449 |
msgstr ""
|
2450 |
|
2451 |
+
#: src/features/headers.php:224
|
2452 |
msgid "Permits the use of Javascript the eval() function."
|
2453 |
msgstr ""
|
2454 |
|
2455 |
+
#: src/features/headers.php:228
|
2456 |
msgid "HTTPS"
|
2457 |
msgstr ""
|
2458 |
|
2459 |
+
#: src/features/headers.php:229
|
2460 |
msgid "HTTPS Resource Loading"
|
2461 |
msgstr ""
|
2462 |
|
2463 |
+
#: src/features/headers.php:230
|
2464 |
msgid "Allows loading of any content provided over HTTPS."
|
2465 |
msgstr ""
|
2466 |
|
2467 |
+
#: src/features/headers.php:234
|
2468 |
msgid "Permitted Hosts"
|
2469 |
msgstr ""
|
2470 |
|
2471 |
+
#: src/features/headers.php:235
|
2472 |
msgid "Permitted Hosts and Domains"
|
2473 |
msgstr ""
|
2474 |
|
2475 |
+
#: src/features/headers.php:236
|
2476 |
msgid ""
|
2477 |
"You can explicitly state which hosts/domain from which content may be loaded."
|
2478 |
msgstr ""
|
2479 |
|
2480 |
+
#: src/features/headers.php:237
|
2481 |
msgid ""
|
2482 |
"Take great care and test your site as you may block legitimate resources."
|
2483 |
msgstr ""
|
2484 |
|
2485 |
+
#: src/features/headers.php:238
|
2486 |
msgid "If in-doubt, leave blank or use \"*\" only."
|
2487 |
msgstr ""
|
2488 |
|
2489 |
+
#: src/features/headers.php:239
|
2490 |
msgid ""
|
2491 |
"You can force only HTTPS for a given domain by prefixing it with \"https://"
|
2492 |
"\"."
|
2493 |
msgstr ""
|
2494 |
|
2495 |
+
#: src/features/insights.php:118
|
2496 |
+
msgid "Sorry, Admin Notes is only available for Pro subscriptions."
|
2497 |
+
msgstr ""
|
2498 |
+
|
2499 |
+
#: src/features/insights.php:121
|
2500 |
+
msgid "Sorry, but it appears your note was empty."
|
2501 |
+
msgstr ""
|
2502 |
+
|
2503 |
+
#: src/features/insights.php:130
|
2504 |
+
msgid "Note created successfully."
|
2505 |
+
msgstr ""
|
2506 |
+
|
2507 |
+
#: src/features/insights.php:130
|
2508 |
+
msgid "Note could not be created."
|
2509 |
+
msgstr ""
|
2510 |
+
|
2511 |
+
#: src/features/insights.php:194
|
2512 |
+
#, php-format
|
2513 |
+
msgid "%s Security Insights"
|
2514 |
+
msgstr ""
|
2515 |
+
|
2516 |
+
#: src/features/insights.php:195
|
2517 |
+
msgid "recommendation"
|
2518 |
+
msgstr ""
|
2519 |
+
|
2520 |
+
#: src/features/insights.php:196
|
2521 |
+
msgid "suggestion"
|
2522 |
+
msgstr ""
|
2523 |
+
|
2524 |
+
#: src/features/insights.php:197
|
2525 |
+
#, php-format
|
2526 |
+
msgid "Welcome To %s Security Insights Dashboard"
|
2527 |
+
msgstr ""
|
2528 |
+
|
2529 |
+
#: src/features/insights.php:198
|
2530 |
+
#, php-format
|
2531 |
+
msgid "Some of the most recent %s events"
|
2532 |
+
msgstr ""
|
2533 |
+
|
2534 |
+
#: src/features/insights.php:256
|
2535 |
+
msgid "Site"
|
2536 |
+
msgstr ""
|
2537 |
+
|
2538 |
+
#: src/features/insights.php:280
|
2539 |
+
msgid "SSL certificate for this site has expired."
|
2540 |
+
msgstr ""
|
2541 |
+
|
2542 |
+
#: src/features/insights.php:283
|
2543 |
+
#, php-format
|
2544 |
+
msgid "SSL certificate will expire soon (in %s days)"
|
2545 |
+
msgstr ""
|
2546 |
+
|
2547 |
+
#: src/features/insights.php:290
|
2548 |
+
msgid "Check or renew your SSL certificate."
|
2549 |
+
msgstr ""
|
2550 |
+
|
2551 |
+
#: src/features/insights.php:313
|
2552 |
+
msgid "DB Password appears to be weak."
|
2553 |
+
msgstr ""
|
2554 |
+
|
2555 |
+
#: src/features/insights.php:315
|
2556 |
+
msgid "The database password should be strong."
|
2557 |
+
msgstr ""
|
2558 |
+
|
2559 |
+
#: src/features/insights.php:345
|
2560 |
+
#, php-format
|
2561 |
+
msgid "%s inactive plugin(s)"
|
2562 |
+
msgstr ""
|
2563 |
+
|
2564 |
+
#: src/features/insights.php:348
|
2565 |
+
msgid "Unused plugins should be removed."
|
2566 |
+
msgstr ""
|
2567 |
+
|
2568 |
+
#: src/features/insights.php:358
|
2569 |
+
#, php-format
|
2570 |
+
msgid "%s plugin update(s)"
|
2571 |
+
msgstr ""
|
2572 |
+
|
2573 |
+
#: src/features/insights.php:360 src/features/insights.php:400
|
2574 |
+
#: src/features/insights.php:426
|
2575 |
+
msgid "Updates"
|
2576 |
+
msgstr ""
|
2577 |
+
|
2578 |
+
#: src/features/insights.php:361 src/features/insights.php:401
|
2579 |
+
#: src/features/insights.php:427
|
2580 |
+
msgid "Updates should be applied as early as possible."
|
2581 |
+
msgstr ""
|
2582 |
+
|
2583 |
+
#: src/features/insights.php:385
|
2584 |
+
#, php-format
|
2585 |
+
msgid "%s inactive themes(s)"
|
2586 |
+
msgstr ""
|
2587 |
+
|
2588 |
+
#: src/features/insights.php:388
|
2589 |
+
msgid "Unused themes should be removed."
|
2590 |
+
msgstr ""
|
2591 |
+
|
2592 |
+
#: src/features/insights.php:398
|
2593 |
+
#, php-format
|
2594 |
+
msgid "%s theme update(s)"
|
2595 |
+
msgstr ""
|
2596 |
+
|
2597 |
+
#: src/features/insights.php:416
|
2598 |
+
msgid "WordPress Core"
|
2599 |
+
msgstr ""
|
2600 |
+
|
2601 |
+
#: src/features/insights.php:424
|
2602 |
+
msgid "WordPress Core has an update available."
|
2603 |
+
msgstr ""
|
2604 |
+
|
2605 |
+
#: src/features/insights.php:436
|
2606 |
+
msgid "WordPress does not automatically install updates."
|
2607 |
+
msgstr ""
|
2608 |
+
|
2609 |
+
#: src/features/insights.php:439
|
2610 |
+
msgid "Minor WordPress upgrades should be applied automatically."
|
2611 |
+
msgstr ""
|
2612 |
+
|
2613 |
+
#: src/features/insights.php:489
|
2614 |
+
msgid "Transgressions"
|
2615 |
+
msgstr ""
|
2616 |
+
|
2617 |
+
#: src/features/insights.php:491
|
2618 |
+
msgid "Total transgression against the site."
|
2619 |
+
msgstr ""
|
2620 |
+
|
2621 |
+
#: src/features/insights.php:494
|
2622 |
+
msgid "IP Blocks"
|
2623 |
+
msgstr ""
|
2624 |
+
|
2625 |
+
#: src/features/insights.php:496
|
2626 |
+
msgid "Total connections blocked/killed after too many transgressions."
|
2627 |
+
msgstr ""
|
2628 |
+
|
2629 |
+
#: src/features/insights.php:499 src/processors/statistics.php:201
|
2630 |
+
msgid "Login Blocks"
|
2631 |
+
msgstr ""
|
2632 |
+
|
2633 |
+
#: src/features/insights.php:501
|
2634 |
+
msgid "Total login attempts blocked."
|
2635 |
+
msgstr ""
|
2636 |
+
|
2637 |
+
#: src/features/insights.php:504 src/processors/statistics.php:200
|
2638 |
+
msgid "Firewall Blocks"
|
2639 |
+
msgstr ""
|
2640 |
+
|
2641 |
+
#: src/features/insights.php:506
|
2642 |
+
msgid "Total requests blocked by firewall rules."
|
2643 |
+
msgstr ""
|
2644 |
+
|
2645 |
+
#: src/features/insights.php:509 src/processors/statistics.php:199
|
2646 |
+
msgid "Comment Blocks"
|
2647 |
+
msgstr ""
|
2648 |
+
|
2649 |
+
#: src/features/insights.php:511
|
2650 |
+
msgid "Total SPAM comments blocked."
|
2651 |
+
msgstr ""
|
2652 |
+
|
2653 |
+
#: src/features/insights.php:514
|
2654 |
+
msgid "Active Sessions"
|
2655 |
+
msgstr ""
|
2656 |
+
|
2657 |
+
#: src/features/insights.php:516
|
2658 |
+
msgid "Currently active user sessions."
|
2659 |
+
msgstr ""
|
2660 |
+
|
2661 |
+
#: src/features/insights.php:519
|
2662 |
+
msgid "Blacklist IPs"
|
2663 |
+
msgstr ""
|
2664 |
+
|
2665 |
+
#: src/features/insights.php:521
|
2666 |
+
msgid "Current IP addresses with transgressions against the site."
|
2667 |
+
msgstr ""
|
2668 |
+
|
2669 |
+
#: src/features/insights.php:524
|
2670 |
+
msgid "Pro"
|
2671 |
+
msgstr ""
|
2672 |
+
|
2673 |
+
#: src/features/insights.php:525 src/features/traffic.php:334
|
2674 |
+
msgid "Yes"
|
2675 |
+
msgstr ""
|
2676 |
+
|
2677 |
+
#: src/features/insights.php:525 src/features/traffic.php:327
|
2678 |
+
#: src/features/traffic.php:334
|
2679 |
+
msgid "No"
|
2680 |
+
msgstr ""
|
2681 |
+
|
2682 |
+
#: src/features/insights.php:526
|
2683 |
+
#, php-format
|
2684 |
+
msgid "Is this site running %s Pro"
|
2685 |
+
msgstr ""
|
2686 |
+
|
2687 |
+
#: src/features/insights.php:548
|
2688 |
+
msgid "Not yet recorded"
|
2689 |
+
msgstr ""
|
2690 |
+
|
2691 |
+
#: src/features/insights.php:585
|
2692 |
+
msgid "Simple Test Cron"
|
2693 |
+
msgstr ""
|
2694 |
+
|
2695 |
+
#: src/features/insights.php:586
|
2696 |
+
msgid "Unrecognised Files Scan"
|
2697 |
+
msgstr ""
|
2698 |
+
|
2699 |
+
#: src/features/insights.php:587
|
2700 |
+
msgid "WordPress Core Files Scan"
|
2701 |
+
msgstr ""
|
2702 |
+
|
2703 |
+
#: src/features/insights.php:588
|
2704 |
+
msgid "Plugin/Themes Guard Scan"
|
2705 |
+
msgstr ""
|
2706 |
+
|
2707 |
+
#: src/features/insights.php:589
|
2708 |
+
msgid "Plugin Vulnerabilities Scan"
|
2709 |
+
msgstr ""
|
2710 |
+
|
2711 |
+
#: src/features/insights.php:590
|
2712 |
+
msgid "Successful 2-FA Login"
|
2713 |
+
msgstr ""
|
2714 |
+
|
2715 |
+
#: src/features/insights.php:591
|
2716 |
+
msgid "Login Block"
|
2717 |
+
msgstr ""
|
2718 |
+
|
2719 |
+
#: src/features/insights.php:592
|
2720 |
+
msgid "User Registration Block"
|
2721 |
+
msgstr ""
|
2722 |
+
|
2723 |
+
#: src/features/insights.php:593
|
2724 |
+
msgid "Reset Password Block"
|
2725 |
+
msgstr ""
|
2726 |
+
|
2727 |
+
#: src/features/insights.php:594
|
2728 |
+
msgid "Firewall Block"
|
2729 |
+
msgstr ""
|
2730 |
+
|
2731 |
+
#: src/features/insights.php:595
|
2732 |
+
msgid "Idle Logout"
|
2733 |
+
msgstr ""
|
2734 |
+
|
2735 |
+
#: src/features/insights.php:596
|
2736 |
+
msgid "Password Block"
|
2737 |
+
msgstr ""
|
2738 |
+
|
2739 |
+
#: src/features/insights.php:597
|
2740 |
+
msgid "Comment SPAM Block"
|
2741 |
+
msgstr ""
|
2742 |
+
|
2743 |
+
#: src/features/insights.php:598
|
2744 |
+
msgid "XML-RPC Block"
|
2745 |
+
msgstr ""
|
2746 |
+
|
2747 |
+
#: src/features/insights.php:599
|
2748 |
+
msgid "Anonymous Rest API Block"
|
2749 |
+
msgstr ""
|
2750 |
+
|
2751 |
+
#: src/features/insights.php:600
|
2752 |
+
#, php-format
|
2753 |
+
msgid "%s Transgression"
|
2754 |
+
msgstr ""
|
2755 |
+
|
2756 |
+
#: src/features/insights.php:601
|
2757 |
+
msgid "IP Connection Blocked"
|
2758 |
+
msgstr ""
|
2759 |
+
|
2760 |
+
#: src/features/ips.php:30
|
2761 |
msgid "Manage IP Lists"
|
2762 |
msgstr ""
|
2763 |
|
2764 |
+
#: src/features/ips.php:31
|
2765 |
msgid "Add/Remove IPs"
|
2766 |
msgstr ""
|
2767 |
|
2768 |
+
#: src/features/ips.php:228
|
2769 |
+
msgid "now"
|
|
|
2770 |
msgstr ""
|
2771 |
|
2772 |
+
#: src/features/ips.php:273
|
2773 |
msgid ""
|
2774 |
"Repeated login attempts that fail will result in a complete ban of your IP "
|
2775 |
"Address."
|
2776 |
msgstr ""
|
2777 |
|
2778 |
+
#: src/features/ips.php:280
|
2779 |
#, php-format
|
2780 |
msgid ""
|
2781 |
"You have %s remaining transgression(s) against this site and then you will "
|
2782 |
"be black listed."
|
2783 |
msgstr ""
|
2784 |
|
2785 |
+
#: src/features/ips.php:281
|
2786 |
msgid "Seriously, stop repeating what you are doing or you will be locked out."
|
2787 |
msgstr ""
|
2788 |
|
2789 |
+
#: src/features/ips.php:304
|
2790 |
msgid ""
|
2791 |
"The IP Manager allows you to whitelist, blacklist and configure auto-"
|
2792 |
"blacklist rules."
|
2793 |
msgstr ""
|
2794 |
|
2795 |
+
#: src/features/ips.php:305 src/features/plugin.php:961
|
2796 |
+
#: src/wizards/plugin.php:525 src/wizards/plugin.php:530
|
2797 |
msgid "IP Manager"
|
2798 |
msgstr ""
|
2799 |
|
2800 |
+
#: src/features/ips.php:306
|
2801 |
msgid "You should also carefully review the automatic black list settings."
|
2802 |
msgstr ""
|
2803 |
|
2804 |
+
#: src/features/ips.php:312 src/features/ips.php:315 src/features/ips.php:358
|
2805 |
msgid "Automatic IP Black List"
|
2806 |
msgstr ""
|
2807 |
|
2808 |
+
#: src/features/ips.php:314
|
2809 |
msgid ""
|
2810 |
"The Automatic IP Black List system will block the IP addresses of naughty "
|
2811 |
"visitors after a specified number of transgressions."
|
2812 |
msgstr ""
|
2813 |
|
2814 |
+
#: src/features/ips.php:317
|
2815 |
msgid "Auto Black List"
|
2816 |
msgstr ""
|
2817 |
|
2818 |
+
#: src/features/ips.php:321
|
2819 |
msgid "Bad Request Tracking"
|
2820 |
msgstr ""
|
2821 |
|
2822 |
+
#: src/features/ips.php:322
|
2823 |
msgid "Request Tracking"
|
2824 |
msgstr ""
|
2825 |
|
2826 |
+
#: src/features/ips.php:324
|
2827 |
msgid "Track strange behaviour to determine whether visitors are legitimate."
|
2828 |
msgstr ""
|
2829 |
|
2830 |
+
#: src/features/ips.php:325
|
2831 |
msgid ""
|
2832 |
"These aren't security issues in their own right, but may indicate probing "
|
2833 |
"bots."
|
2834 |
msgstr ""
|
2835 |
|
2836 |
+
#: src/features/ips.php:353
|
2837 |
msgid "Transgression Limit"
|
2838 |
msgstr ""
|
2839 |
|
2840 |
+
#: src/features/ips.php:354
|
2841 |
msgid ""
|
2842 |
"Visitor IP address will be Black Listed after X bad actions on your site"
|
2843 |
msgstr ""
|
2844 |
|
2845 |
+
#: src/features/ips.php:355
|
2846 |
#, php-format
|
2847 |
msgid ""
|
2848 |
"A black mark is set against an IP address each time a visitor trips the "
|
2849 |
"defenses of the %s plugin."
|
2850 |
msgstr ""
|
2851 |
|
2852 |
+
#: src/features/ips.php:357
|
2853 |
msgid ""
|
2854 |
"When the number of these transgressions exceeds specified limit, they are "
|
2855 |
"automatically blocked from accessing the site."
|
2856 |
msgstr ""
|
2857 |
|
2858 |
+
#: src/features/ips.php:358
|
2859 |
#, php-format
|
2860 |
msgid "Set this to \"0\" to turn off the %s feature."
|
2861 |
msgstr ""
|
2862 |
|
2863 |
+
#: src/features/ips.php:362
|
2864 |
msgid "Auto Block Expiration"
|
2865 |
msgstr ""
|
2866 |
|
2867 |
+
#: src/features/ips.php:363
|
2868 |
msgid "After 1 \"X\" a black listed IP will be removed from the black list"
|
2869 |
msgstr ""
|
2870 |
|
2871 |
+
#: src/features/ips.php:364
|
2872 |
msgid "Permanent and lengthy IP Black Lists are harmful to performance."
|
2873 |
msgstr ""
|
2874 |
|
2875 |
+
#: src/features/ips.php:365
|
2876 |
msgid ""
|
2877 |
"You should allow IP addresses on the black list to be eventually removed "
|
2878 |
"over time."
|
2879 |
msgstr ""
|
2880 |
|
2881 |
+
#: src/features/ips.php:366
|
2882 |
msgid ""
|
2883 |
"Shorter IP black lists are more efficient and a more intelligent use of an "
|
2884 |
"IP-based blocking system."
|
2885 |
msgstr ""
|
2886 |
|
2887 |
+
#: src/features/ips.php:370
|
2888 |
msgid "Track 404s"
|
2889 |
msgstr ""
|
2890 |
|
2891 |
+
#: src/features/ips.php:371
|
2892 |
msgid "Use 404s As An Transgression"
|
2893 |
msgstr ""
|
2894 |
|
2895 |
+
#: src/features/ips.php:372
|
2896 |
msgid "Repeated 404s may indicate a probing bot."
|
2897 |
msgstr ""
|
2898 |
|
2899 |
+
#: src/features/ips.php:376
|
2900 |
msgid "Login Failed"
|
2901 |
msgstr ""
|
2902 |
|
2903 |
+
#: src/features/ips.php:377
|
2904 |
msgid "Visitor Triggers The IP Transgression System Through A Failed Login"
|
2905 |
msgstr ""
|
2906 |
|
2907 |
+
#: src/features/ips.php:378
|
2908 |
msgid "This message is displayed if the visitor fails a login attempt."
|
2909 |
msgstr ""
|
2910 |
|
2911 |
+
#: src/features/ips.php:382
|
2912 |
msgid "Remaining Transgressions"
|
2913 |
msgstr ""
|
2914 |
|
2915 |
+
#: src/features/ips.php:383
|
2916 |
msgid "Visitor Triggers The IP Transgression System Through A Firewall Block"
|
2917 |
msgstr ""
|
2918 |
|
2919 |
+
#: src/features/ips.php:384
|
2920 |
msgid ""
|
2921 |
"This message is displayed if the visitor triggered the IP Transgression "
|
2922 |
"system and reports how many transgressions remain before being blocked."
|
2923 |
msgstr ""
|
2924 |
|
2925 |
+
#: src/features/ips.php:426
|
2926 |
#, php-format
|
2927 |
msgid ""
|
2928 |
"Sorry, the %s feature may not be disabled while there are IP addresses in "
|
2929 |
"the White List"
|
2930 |
msgstr ""
|
2931 |
|
2932 |
+
#: src/features/license.php:92
|
2933 |
msgid "Name"
|
2934 |
msgstr ""
|
2935 |
|
2936 |
+
#: src/features/license.php:93
|
2937 |
msgid "Active"
|
2938 |
msgstr ""
|
2939 |
|
2940 |
+
#: src/features/license.php:94
|
2941 |
msgid "Status"
|
2942 |
msgstr ""
|
2943 |
|
2944 |
+
#: src/features/license.php:95
|
2945 |
msgid "Key"
|
2946 |
msgstr ""
|
2947 |
|
2948 |
+
#: src/features/license.php:96
|
2949 |
msgid "Expires"
|
2950 |
msgstr ""
|
2951 |
|
2952 |
+
#: src/features/license.php:97
|
2953 |
msgid "Owner"
|
2954 |
msgstr ""
|
2955 |
|
2956 |
+
#: src/features/license.php:98
|
2957 |
msgid "Checked"
|
2958 |
msgstr ""
|
2959 |
|
2960 |
+
#: src/features/license.php:99
|
2961 |
msgid "Error"
|
2962 |
msgstr ""
|
2963 |
|
2964 |
+
#: src/features/license.php:287
|
2965 |
+
#, php-format
|
2966 |
+
msgid "Automatic license verification failed after %s days."
|
2967 |
+
msgstr ""
|
2968 |
+
|
2969 |
+
#: src/features/license.php:325
|
2970 |
+
msgid "Attempts to verify Shield Pro license has just failed."
|
2971 |
+
msgstr ""
|
2972 |
+
|
2973 |
+
#: src/features/license.php:326 src/features/license.php:343
|
2974 |
+
#, php-format
|
2975 |
+
msgid "Please check your license on-site: %s"
|
2976 |
+
msgstr ""
|
2977 |
+
|
2978 |
+
#: src/features/license.php:327 src/features/license.php:344
|
2979 |
+
#, php-format
|
2980 |
+
msgid "If this problem persists, please contact support: %s"
|
2981 |
+
msgstr ""
|
2982 |
+
|
2983 |
+
#: src/features/license.php:342
|
2984 |
+
msgid "All attempts to verify Shield Pro license have failed."
|
2985 |
+
msgstr ""
|
2986 |
+
|
2987 |
+
#: src/features/license.php:647 src/features/license.php:648
|
2988 |
msgid "License Options"
|
2989 |
msgstr ""
|
2990 |
|
2991 |
+
#: src/features/license.php:650
|
2992 |
+
#, php-format
|
2993 |
+
msgid "Activate %s Pro Extensions."
|
2994 |
msgstr ""
|
2995 |
|
2996 |
+
#: src/features/license.php:651
|
2997 |
msgid "TODO."
|
2998 |
msgstr ""
|
2999 |
|
3000 |
+
#: src/features/license.php:675 src/features/license.php:676
|
3001 |
+
#: src/features/license.php:677
|
3002 |
msgid "License Key"
|
3003 |
msgstr ""
|
3004 |
|
3005 |
+
#: src/features/lockdown.php:52 src/features/lockdown.php:88
|
3006 |
+
#: src/features/plugin.php:963
|
3007 |
+
msgid "Lockdown"
|
3008 |
+
msgstr ""
|
3009 |
+
|
3010 |
+
#: src/features/lockdown.php:60
|
3011 |
+
msgid "Direct editing of plugin/theme files is permitted."
|
3012 |
+
msgstr ""
|
3013 |
+
|
3014 |
+
#: src/features/lockdown.php:63
|
3015 |
+
msgid "WP Plugin file editing should be disabled."
|
3016 |
+
msgstr ""
|
3017 |
+
|
3018 |
+
#: src/features/lockdown.php:87
|
3019 |
msgid ""
|
3020 |
"Lockdown helps secure-up certain loosely-controlled WordPress settings on "
|
3021 |
"your site."
|
3022 |
msgstr ""
|
3023 |
|
3024 |
+
#: src/features/lockdown.php:94 src/features/lockdown.php:99
|
|
|
|
|
|
|
|
|
3025 |
msgid "API & XML-RPC"
|
3026 |
msgstr ""
|
3027 |
|
3028 |
+
#: src/features/lockdown.php:96
|
3029 |
msgid "Lockdown certain core WordPress system features."
|
3030 |
msgstr ""
|
3031 |
|
3032 |
+
#: src/features/lockdown.php:97
|
3033 |
msgid ""
|
3034 |
"This depends on your usage and needs for certain WordPress functions and "
|
3035 |
"features."
|
3036 |
msgstr ""
|
3037 |
|
3038 |
+
#: src/features/lockdown.php:103
|
3039 |
msgid "Permissions and Access Options"
|
3040 |
msgstr ""
|
3041 |
|
3042 |
+
#: src/features/lockdown.php:105
|
3043 |
msgid "Provides finer control of certain WordPress permissions."
|
3044 |
msgstr ""
|
3045 |
|
3046 |
+
#: src/features/lockdown.php:106
|
3047 |
msgid "Only enable SSL if you have a valid certificate installed."
|
3048 |
msgstr ""
|
3049 |
|
3050 |
+
#: src/features/lockdown.php:108
|
3051 |
msgid "Permissions"
|
3052 |
msgstr ""
|
3053 |
|
3054 |
+
#: src/features/lockdown.php:112
|
3055 |
msgid "WordPress Obscurity Options"
|
3056 |
msgstr ""
|
3057 |
|
3058 |
+
#: src/features/lockdown.php:114
|
3059 |
msgid "Obscures certain WordPress settings from public view."
|
3060 |
msgstr ""
|
3061 |
|
3062 |
+
#: src/features/lockdown.php:115
|
3063 |
msgid ""
|
3064 |
"Obscurity is not true security and so these settings are down to your "
|
3065 |
"personal tastes."
|
3066 |
msgstr ""
|
3067 |
|
3068 |
+
#: src/features/lockdown.php:117
|
3069 |
msgid "Obscurity"
|
3070 |
msgstr ""
|
3071 |
|
3072 |
+
#: src/features/lockdown.php:146 src/features/plugin.php:726
|
3073 |
#, php-format
|
3074 |
msgid "Disable %s"
|
3075 |
msgstr ""
|
3076 |
|
3077 |
+
#: src/features/lockdown.php:147 src/features/lockdown.php:153
|
3078 |
#, php-format
|
3079 |
msgid "Disable The %s System"
|
3080 |
msgstr ""
|
3081 |
|
3082 |
+
#: src/features/lockdown.php:148
|
3083 |
#, php-format
|
3084 |
msgid "Checking this option will completely turn off the whole %s system."
|
3085 |
msgstr ""
|
3086 |
|
3087 |
+
#: src/features/lockdown.php:152 src/features/lockdown.php:153
|
3088 |
msgid "Anonymous Rest API"
|
3089 |
msgstr ""
|
3090 |
|
3091 |
+
#: src/features/lockdown.php:154
|
3092 |
msgid "You can choose to completely disable anonymous access to the REST API."
|
3093 |
msgstr ""
|
3094 |
|
3095 |
+
#: src/features/lockdown.php:158
|
3096 |
msgid "Rest API Exclusions"
|
3097 |
msgstr ""
|
3098 |
|
3099 |
+
#: src/features/lockdown.php:159
|
3100 |
msgid "Anonymous REST API Exclusions"
|
3101 |
msgstr ""
|
3102 |
|
3103 |
+
#: src/features/lockdown.php:160
|
3104 |
msgid ""
|
3105 |
"Any namespaces provided here will be excluded from the Anonymous API "
|
3106 |
"restriction."
|
3107 |
msgstr ""
|
3108 |
|
3109 |
+
#: src/features/lockdown.php:164
|
3110 |
msgid "Disable File Editing"
|
3111 |
msgstr ""
|
3112 |
|
3113 |
+
#: src/features/lockdown.php:165
|
3114 |
msgid "Disable Ability To Edit Files From Within WordPress"
|
3115 |
msgstr ""
|
3116 |
|
3117 |
+
#: src/features/lockdown.php:166
|
3118 |
msgid ""
|
3119 |
"Removes the option to directly edit any files from within the WordPress "
|
3120 |
"admin area."
|
3121 |
msgstr ""
|
3122 |
|
3123 |
+
#: src/features/lockdown.php:167
|
3124 |
msgid "Equivalent to setting \"DISALLOW_FILE_EDIT\" to TRUE."
|
3125 |
msgstr ""
|
3126 |
|
3127 |
+
#: src/features/lockdown.php:171
|
3128 |
msgid "Force SSL Admin"
|
3129 |
msgstr ""
|
3130 |
|
3131 |
+
#: src/features/lockdown.php:172
|
3132 |
msgid "Forces WordPress Admin Dashboard To Be Delivered Over SSL"
|
3133 |
msgstr ""
|
3134 |
|
3135 |
+
#: src/features/lockdown.php:173
|
3136 |
msgid ""
|
3137 |
"Please only enable this option if you have a valid SSL certificate installed."
|
3138 |
msgstr ""
|
3139 |
|
3140 |
+
#: src/features/lockdown.php:174
|
3141 |
msgid "Equivalent to setting \"FORCE_SSL_ADMIN\" to TRUE."
|
3142 |
msgstr ""
|
3143 |
|
3144 |
+
#: src/features/lockdown.php:178
|
3145 |
msgid "Mask WordPress Version"
|
3146 |
msgstr ""
|
3147 |
|
3148 |
+
#: src/features/lockdown.php:179
|
3149 |
msgid "Prevents Public Display Of Your WordPress Version"
|
3150 |
msgstr ""
|
3151 |
|
3152 |
+
#: src/features/lockdown.php:180
|
3153 |
msgid ""
|
3154 |
"Enter how you would like your WordPress version displayed publicly. Leave "
|
3155 |
"blank to disable this feature."
|
3156 |
msgstr ""
|
3157 |
|
3158 |
+
#: src/features/lockdown.php:181
|
3159 |
msgid ""
|
3160 |
+
"This may interfere with WordPress plugins that rely on the $wp_version "
|
3161 |
+
"variable."
|
3162 |
msgstr ""
|
3163 |
|
3164 |
+
#: src/features/lockdown.php:185
|
3165 |
msgid "WP Generator Tag"
|
3166 |
msgstr ""
|
3167 |
|
3168 |
+
#: src/features/lockdown.php:186
|
3169 |
msgid "Remove WP Generator Meta Tag"
|
3170 |
msgstr ""
|
3171 |
|
3172 |
+
#: src/features/lockdown.php:187
|
3173 |
msgid ""
|
3174 |
"Remove a meta tag from your WordPress pages that publicly displays that your "
|
3175 |
"site is WordPress and its current version."
|
3176 |
msgstr ""
|
3177 |
|
3178 |
+
#: src/features/lockdown.php:191
|
3179 |
msgid "Block Username Fishing"
|
3180 |
msgstr ""
|
3181 |
|
3182 |
+
#: src/features/lockdown.php:192
|
3183 |
msgid "Block the ability to discover WordPress usernames based on author IDs"
|
3184 |
msgstr ""
|
3185 |
|
3186 |
+
#: src/features/lockdown.php:193
|
3187 |
#, php-format
|
3188 |
msgid "When enabled, any URL requests containing \"%s\" will be killed."
|
3189 |
msgstr ""
|
3190 |
|
3191 |
+
#: src/features/lockdown.php:194
|
3192 |
msgid ""
|
3193 |
"Enabling this option may interfere with expected operations of your site."
|
3194 |
msgstr ""
|
3195 |
|
3196 |
+
#: src/features/login_protect.php:25
|
3197 |
msgid "Email verification completed successfully."
|
3198 |
msgstr ""
|
3199 |
|
3200 |
+
#: src/features/login_protect.php:28
|
3201 |
msgid "Email verification could not be completed."
|
3202 |
msgstr ""
|
3203 |
|
3204 |
+
#: src/features/login_protect.php:101
|
3205 |
msgid ""
|
3206 |
"Before enabling 2-factor email authentication for your WordPress site, you "
|
3207 |
"must verify you can receive this email."
|
3208 |
msgstr ""
|
3209 |
|
3210 |
+
#: src/features/login_protect.php:102
|
3211 |
msgid ""
|
3212 |
"This verifies your website can send email and that your account can receive "
|
3213 |
"emails sent from your site."
|
3214 |
msgstr ""
|
3215 |
|
3216 |
+
#: src/features/login_protect.php:107
|
3217 |
#, php-format
|
3218 |
msgid "Click the verify link: %s"
|
3219 |
msgstr ""
|
3220 |
|
3221 |
+
#: src/features/login_protect.php:110
|
3222 |
#, php-format
|
3223 |
msgid "Here's your code for the guided wizard: %s"
|
3224 |
msgstr ""
|
3225 |
|
3226 |
+
#: src/features/login_protect.php:113
|
3227 |
msgid "Email Sending Verification"
|
3228 |
msgstr ""
|
3229 |
|
3230 |
+
#: src/features/login_protect.php:176
|
3231 |
msgid "Subscribers"
|
3232 |
msgstr ""
|
3233 |
|
3234 |
+
#: src/features/login_protect.php:177
|
3235 |
msgid "Contributors"
|
3236 |
msgstr ""
|
3237 |
|
3238 |
+
#: src/features/login_protect.php:178
|
3239 |
msgid "Authors"
|
3240 |
msgstr ""
|
3241 |
|
3242 |
+
#: src/features/login_protect.php:179
|
3243 |
msgid "Editors"
|
3244 |
msgstr ""
|
3245 |
|
3246 |
+
#: src/features/login_protect.php:437
|
3247 |
msgid "I'm a human."
|
3248 |
msgstr ""
|
3249 |
|
3250 |
+
#: src/features/login_protect.php:441
|
3251 |
msgid "Please check the box to show us you're a human."
|
3252 |
msgstr ""
|
3253 |
|
3254 |
+
#: src/features/login_protect.php:476
|
3255 |
+
#, php-format
|
3256 |
+
msgid "Support for login protection with %s is a Pro-only feature."
|
3257 |
+
msgstr ""
|
3258 |
+
|
3259 |
+
#: src/features/login_protect.php:482
|
3260 |
+
msgid ""
|
3261 |
+
"2FA by email demands that your WP site is properly configured to send email."
|
3262 |
+
msgstr ""
|
3263 |
+
|
3264 |
+
#: src/features/login_protect.php:483
|
3265 |
+
msgid ""
|
3266 |
+
"This is a common problem and you may get locked out in the future if you "
|
3267 |
+
"ignore this."
|
3268 |
+
msgstr ""
|
3269 |
+
|
3270 |
+
#: src/features/login_protect.php:484 src/processors/lockdown.php:219
|
3271 |
+
#: src/processors/plugin_tracking.php:37
|
3272 |
+
msgid "Learn More."
|
3273 |
+
msgstr ""
|
3274 |
+
|
3275 |
+
#: src/features/login_protect.php:540
|
3276 |
msgid ""
|
3277 |
"Login Guard blocks all automated and brute force attempts to log in to your "
|
3278 |
"site."
|
3279 |
msgstr ""
|
3280 |
|
3281 |
+
#: src/features/login_protect.php:541 src/features/plugin.php:965
|
3282 |
+
#: src/wizards/plugin.php:561 src/wizards/plugin.php:566
|
3283 |
msgid "Login Guard"
|
3284 |
msgstr ""
|
3285 |
|
3286 |
+
#: src/features/login_protect.php:549
|
3287 |
msgid "Adds Google reCAPTCHA to the Login Forms."
|
3288 |
msgstr ""
|
3289 |
|
3290 |
+
#: src/features/login_protect.php:556
|
3291 |
msgid "Hide WordPress Login Page"
|
3292 |
msgstr ""
|
3293 |
|
3294 |
+
#: src/features/login_protect.php:557
|
3295 |
#, php-format
|
3296 |
msgid "Rename \"%s\""
|
3297 |
msgstr ""
|
3298 |
|
3299 |
+
#: src/features/login_protect.php:558
|
3300 |
msgid "Hide Login Page"
|
3301 |
msgstr ""
|
3302 |
|
3303 |
+
#: src/features/login_protect.php:560
|
3304 |
msgid ""
|
3305 |
"To hide your wp-login.php page from brute force attacks and hacking attempts "
|
3306 |
"- if your login page cannot be found, no-one can login."
|
3307 |
msgstr ""
|
3308 |
|
3309 |
+
#: src/features/login_protect.php:561
|
3310 |
msgid ""
|
3311 |
"This is not required for complete security and if your site has irregular or "
|
3312 |
"inconsistent configuration it may not work for you."
|
3313 |
msgstr ""
|
3314 |
|
3315 |
+
#: src/features/login_protect.php:566 src/features/login_protect.php:647
|
3316 |
+
#: src/features/user_management.php:344
|
3317 |
msgid "Multi-Factor Authentication"
|
3318 |
msgstr ""
|
3319 |
|
3320 |
+
#: src/features/login_protect.php:567
|
3321 |
msgid "Multi-Factor Auth"
|
3322 |
msgstr ""
|
3323 |
|
3324 |
+
#: src/features/login_protect.php:569 src/features/user_management.php:341
|
3325 |
msgid ""
|
3326 |
"Verifies the identity of users who log in to your site - i.e. they are who "
|
3327 |
"they say they are."
|
3328 |
msgstr ""
|
3329 |
|
3330 |
+
#: src/features/login_protect.php:570 src/features/login_protect.php:580
|
3331 |
+
#: src/features/login_protect.php:589 src/features/login_protect.php:607
|
3332 |
msgid "You may combine multiple authentication factors for increased security."
|
3333 |
msgstr ""
|
3334 |
|
3335 |
+
#: src/features/login_protect.php:575
|
3336 |
msgid "Email Two-Factor Authentication"
|
3337 |
msgstr ""
|
3338 |
|
3339 |
+
#: src/features/login_protect.php:576
|
3340 |
msgid "2FA - Email"
|
3341 |
msgstr ""
|
3342 |
|
3343 |
+
#: src/features/login_protect.php:578
|
3344 |
msgid ""
|
3345 |
"Verifies the identity of users who log in to your site using email-based one-"
|
3346 |
"time-passwords."
|
3347 |
msgstr ""
|
3348 |
|
3349 |
+
#: src/features/login_protect.php:579 src/features/user_management.php:342
|
3350 |
msgid "However, if your host blocks email sending you may lock yourself out."
|
3351 |
msgstr ""
|
3352 |
|
3353 |
+
#: src/features/login_protect.php:585
|
3354 |
msgid "Google Authenticator Two-Factor Authentication"
|
3355 |
msgstr ""
|
3356 |
|
3357 |
+
#: src/features/login_protect.php:586
|
3358 |
msgid "2FA - Google Authenticator"
|
3359 |
msgstr ""
|
3360 |
|
3361 |
+
#: src/features/login_protect.php:588
|
3362 |
msgid ""
|
3363 |
"Verifies the identity of users who log in to your site using Google "
|
3364 |
"Authenticator one-time-passwords."
|
3365 |
msgstr ""
|
3366 |
|
3367 |
+
#: src/features/login_protect.php:594
|
3368 |
msgid "Brute Force Login Protection"
|
3369 |
msgstr ""
|
3370 |
|
3371 |
+
#: src/features/login_protect.php:595
|
3372 |
+
msgid "reCAPTCHA & Bots"
|
3373 |
msgstr ""
|
3374 |
|
3375 |
+
#: src/features/login_protect.php:597
|
3376 |
msgid ""
|
3377 |
"Blocks brute force hacking attacks against your login and registration pages."
|
3378 |
msgstr ""
|
3379 |
|
3380 |
+
#: src/features/login_protect.php:603
|
3381 |
msgid "Yubikey Two-Factor Authentication"
|
3382 |
msgstr ""
|
3383 |
|
3384 |
+
#: src/features/login_protect.php:604
|
3385 |
msgid "2FA -Yubikey"
|
3386 |
msgstr ""
|
3387 |
|
3388 |
+
#: src/features/login_protect.php:606
|
3389 |
msgid ""
|
3390 |
"Verifies the identity of users who log in to your site using Yubikey one-"
|
3391 |
"time-passwords."
|
3392 |
msgstr ""
|
3393 |
|
3394 |
+
#: src/features/login_protect.php:637
|
3395 |
msgid "Hide WP Login Page"
|
3396 |
msgstr ""
|
3397 |
|
3398 |
+
#: src/features/login_protect.php:638
|
3399 |
msgid "Hide The WordPress Login Page"
|
3400 |
msgstr ""
|
3401 |
|
3402 |
+
#: src/features/login_protect.php:639
|
3403 |
msgid "Creating a path here will disable your wp-login.php"
|
3404 |
msgstr ""
|
3405 |
|
3406 |
+
#: src/features/login_protect.php:641
|
3407 |
#, php-format
|
3408 |
msgid "Only letters and numbers are permitted: %s"
|
3409 |
msgstr ""
|
3410 |
|
3411 |
+
#: src/features/login_protect.php:643
|
3412 |
#, php-format
|
3413 |
msgid "Your current login URL is: %s"
|
3414 |
msgstr ""
|
3415 |
|
3416 |
+
#: src/features/login_protect.php:648
|
3417 |
msgid "Require All Active Authentication Factors"
|
3418 |
msgstr ""
|
3419 |
|
3420 |
+
#: src/features/login_protect.php:649
|
3421 |
msgid ""
|
3422 |
"When enabled, all multi-factor authentication methods will be applied to a "
|
3423 |
"user login. Disable to require only one to login."
|
3424 |
msgstr ""
|
3425 |
|
3426 |
+
#: src/features/login_protect.php:653
|
3427 |
msgid "Multi-Factor By-Pass"
|
3428 |
msgstr ""
|
3429 |
|
3430 |
+
#: src/features/login_protect.php:654
|
3431 |
msgid ""
|
3432 |
"A User Can By-Pass Multi-Factor Authentication (MFA) For The Set Number Of "
|
3433 |
"Days"
|
3434 |
msgstr ""
|
3435 |
|
3436 |
+
#: src/features/login_protect.php:655
|
3437 |
msgid ""
|
3438 |
"Enter the number of days a user can by-pass future MFA after a successful "
|
3439 |
"MFA-login. 0 to disable."
|
3440 |
msgstr ""
|
3441 |
|
3442 |
+
#: src/features/login_protect.php:659
|
3443 |
#: src/processors/loginprotect_googleauthenticator.php:41
|
3444 |
#: src/processors/loginprotect_googleauthenticator.php:45
|
3445 |
#: src/processors/loginprotect_googleauthenticator.php:47
|
3446 |
+
#: src/processors/loginprotect_googleauthenticator.php:185
|
3447 |
msgid "Google Authenticator"
|
3448 |
msgstr ""
|
3449 |
|
3450 |
+
#: src/features/login_protect.php:660
|
3451 |
msgid "Allow Users To Use Google Authenticator"
|
3452 |
msgstr ""
|
3453 |
|
3454 |
+
#: src/features/login_protect.php:661
|
3455 |
msgid ""
|
3456 |
"When enabled, users will have the option to add Google Authenticator to "
|
3457 |
"their WordPress user profile"
|
3458 |
msgstr ""
|
3459 |
|
3460 |
+
#: src/features/login_protect.php:665 src/features/login_protect.php:671
|
3461 |
+
#: src/features/login_protect.php:674
|
3462 |
+
#: src/processors/loginprotect_twofactorauth.php:201
|
3463 |
+
#: src/processors/loginprotect_twofactorauth.php:202
|
3464 |
msgid "Email Authentication"
|
3465 |
msgstr ""
|
3466 |
|
3467 |
+
#: src/features/login_protect.php:666
|
3468 |
#, php-format
|
3469 |
msgid "Two-Factor Login Authentication By %s"
|
3470 |
msgstr ""
|
3471 |
|
3472 |
+
#: src/features/login_protect.php:666 src/features/plugin.php:955
|
3473 |
+
#: src/processors/user_management.php:211
|
3474 |
msgid "Email"
|
3475 |
msgstr ""
|
3476 |
|
3477 |
+
#: src/features/login_protect.php:667
|
3478 |
msgid ""
|
3479 |
"All users will be required to verify their login by email-based two-factor "
|
3480 |
"authentication."
|
3481 |
msgstr ""
|
3482 |
|
3483 |
+
#: src/features/login_protect.php:671
|
3484 |
+
msgid "Enforce"
|
3485 |
+
msgstr ""
|
3486 |
+
|
3487 |
+
#: src/features/login_protect.php:672
|
3488 |
+
msgid "All User Roles Subject To Email Authentication"
|
3489 |
+
msgstr ""
|
3490 |
+
|
3491 |
+
#: src/features/login_protect.php:673
|
3492 |
+
msgid ""
|
3493 |
+
"Enforces email-based authentication on all users with the selected roles."
|
3494 |
+
msgstr ""
|
3495 |
+
|
3496 |
+
#: src/features/login_protect.php:674
|
3497 |
+
#, php-format
|
3498 |
+
msgid "This setting only applies to %s."
|
3499 |
+
msgstr ""
|
3500 |
+
|
3501 |
+
#: src/features/login_protect.php:678
|
3502 |
+
msgid "Google reCAPTCHA"
|
3503 |
+
msgstr ""
|
3504 |
+
|
3505 |
+
#: src/features/login_protect.php:679
|
3506 |
+
msgid "Protect WordPress Account Access Requests With Google reCAPTCHA"
|
3507 |
+
msgstr ""
|
3508 |
+
|
3509 |
+
#: src/features/login_protect.php:680
|
3510 |
+
msgid ""
|
3511 |
+
"Use Google reCAPTCHA on the user account forms such as login, register, etc."
|
3512 |
+
msgstr ""
|
3513 |
+
|
3514 |
+
#: src/features/login_protect.php:681
|
3515 |
#, php-format
|
3516 |
+
msgid "Use of any theme other than \"%s\", requires a Pro license."
|
3517 |
msgstr ""
|
3518 |
|
3519 |
+
#: src/features/login_protect.php:681
|
3520 |
+
msgid "Light Theme"
|
3521 |
msgstr ""
|
3522 |
|
3523 |
+
#: src/features/login_protect.php:682
|
3524 |
msgid ""
|
3525 |
+
"You'll need to setup your Google reCAPTCHA API Keys in 'General' settings."
|
3526 |
msgstr ""
|
3527 |
|
3528 |
+
#: src/features/login_protect.php:683
|
3529 |
+
msgid ""
|
3530 |
+
"Some forms are more dynamic than others so if you experience problems, "
|
3531 |
+
"please use non-Invisible reCAPTCHA."
|
3532 |
msgstr ""
|
3533 |
|
3534 |
+
#: src/features/login_protect.php:693
|
3535 |
+
msgid "Protection Locations"
|
3536 |
msgstr ""
|
3537 |
|
3538 |
+
#: src/features/login_protect.php:694
|
3539 |
+
msgid "Which Forms Should Be Protected"
|
3540 |
msgstr ""
|
3541 |
|
3542 |
+
#: src/features/login_protect.php:695
|
3543 |
+
msgid "Choose the forms for which bot protection measures will be deployed."
|
3544 |
msgstr ""
|
3545 |
|
3546 |
+
#: src/features/login_protect.php:696
|
3547 |
+
#, php-format
|
3548 |
+
msgid "Use with 3rd party systems such as %s, requires a Pro license."
|
3549 |
+
msgstr ""
|
3550 |
+
|
3551 |
+
#: src/features/login_protect.php:700
|
3552 |
msgid "Bot Protection"
|
3553 |
msgstr ""
|
3554 |
|
3555 |
+
#: src/features/login_protect.php:701
|
3556 |
msgid "Protect WP Login From Automated Login Attempts By Bots"
|
3557 |
msgstr ""
|
3558 |
|
3559 |
+
#: src/features/login_protect.php:702
|
3560 |
msgid ""
|
3561 |
"Adds a dynamically (Javascript) generated checkbox to the login form that "
|
3562 |
"prevents bots using automated login techniques."
|
3563 |
msgstr ""
|
3564 |
|
3565 |
+
#: src/features/login_protect.php:703
|
3566 |
msgid "ON"
|
3567 |
msgstr ""
|
3568 |
|
3569 |
+
#: src/features/login_protect.php:707
|
3570 |
+
msgid "Cooldown Period"
|
3571 |
msgstr ""
|
3572 |
|
3573 |
+
#: src/features/login_protect.php:708
|
3574 |
+
msgid "Limit account access requests to every X seconds"
|
3575 |
msgstr ""
|
3576 |
|
3577 |
+
#: src/features/login_protect.php:709
|
3578 |
msgid ""
|
3579 |
+
"WordPress will process only ONE account access attempt per number of seconds "
|
3580 |
"specified."
|
3581 |
msgstr ""
|
3582 |
|
3583 |
+
#: src/features/login_protect.php:710
|
3584 |
msgid "Zero (0) turns this off."
|
3585 |
msgstr ""
|
3586 |
|
3587 |
+
#: src/features/login_protect.php:716
|
|
|
|
|
|
|
|
|
|
|
|
|
3588 |
msgid "User Registration"
|
3589 |
msgstr ""
|
3590 |
|
3591 |
+
#: src/features/login_protect.php:717
|
3592 |
msgid "Apply Brute Force Protection To User Registration And Lost Passwords"
|
3593 |
msgstr ""
|
3594 |
|
3595 |
+
#: src/features/login_protect.php:718
|
3596 |
msgid ""
|
3597 |
"When enabled, settings in this section will also apply to new user "
|
3598 |
"registration and users trying to reset passwords."
|
3599 |
msgstr ""
|
3600 |
|
3601 |
+
#: src/features/login_protect.php:722
|
3602 |
msgid "Enable Yubikey Authentication"
|
3603 |
msgstr ""
|
3604 |
|
3605 |
+
#: src/features/login_protect.php:723
|
3606 |
msgid "Turn On / Off Yubikey Authentication On This Site"
|
3607 |
msgstr ""
|
3608 |
|
3609 |
+
#: src/features/login_protect.php:724
|
3610 |
msgid ""
|
3611 |
"Combined with your Yubikey API details this will form the basis of your "
|
3612 |
"Yubikey Authentication"
|
3613 |
msgstr ""
|
3614 |
|
3615 |
+
#: src/features/login_protect.php:728
|
3616 |
msgid "Yubikey App ID"
|
3617 |
msgstr ""
|
3618 |
|
3619 |
+
#: src/features/login_protect.php:729
|
3620 |
msgid "Your Unique Yubikey App ID"
|
3621 |
msgstr ""
|
3622 |
|
3623 |
+
#: src/features/login_protect.php:730
|
3624 |
msgid ""
|
3625 |
"Combined with your Yubikey API Key this will form the basis of your Yubikey "
|
3626 |
"Authentication"
|
3627 |
msgstr ""
|
3628 |
|
3629 |
+
#: src/features/login_protect.php:731
|
3630 |
msgid ""
|
3631 |
"Please review the info link on how to obtain your own Yubikey App ID and API "
|
3632 |
"Key."
|
3633 |
msgstr ""
|
3634 |
|
3635 |
+
#: src/features/login_protect.php:735
|
3636 |
msgid "Yubikey API Key"
|
3637 |
msgstr ""
|
3638 |
|
3639 |
+
#: src/features/login_protect.php:736
|
3640 |
msgid "Your Unique Yubikey App API Key"
|
3641 |
msgstr ""
|
3642 |
|
3643 |
+
#: src/features/login_protect.php:737
|
3644 |
msgid ""
|
3645 |
"Combined with your Yubikey App ID this will form the basis of your Yubikey "
|
3646 |
"Authentication."
|
3647 |
msgstr ""
|
3648 |
|
3649 |
+
#: src/features/login_protect.php:738
|
3650 |
msgid ""
|
3651 |
"Please review the info link on how to get your own Yubikey App ID and API "
|
3652 |
"Key."
|
3653 |
msgstr ""
|
3654 |
|
3655 |
+
#: src/features/login_protect.php:742
|
3656 |
msgid "Yubikey Unique Keys"
|
3657 |
msgstr ""
|
3658 |
|
3659 |
+
#: src/features/login_protect.php:743
|
3660 |
msgid ""
|
3661 |
"This method for Yubikeys is no longer supported. Please see your user profile"
|
3662 |
msgstr ""
|
3663 |
|
3664 |
+
#: src/features/login_protect.php:744
|
3665 |
+
msgid "Format"
|
|
|
3666 |
msgstr ""
|
3667 |
|
3668 |
+
#: src/features/login_protect.php:745
|
3669 |
msgid "Provide Username<->Yubikey Pairs that are usable for this site."
|
3670 |
msgstr ""
|
3671 |
|
3672 |
+
#: src/features/login_protect.php:746
|
3673 |
msgid ""
|
3674 |
"If a Username if not assigned a Yubikey, Yubikey Authentication is OFF for "
|
3675 |
"that user."
|
3676 |
msgstr ""
|
3677 |
|
3678 |
+
#: src/features/login_protect.php:747
|
3679 |
msgid ""
|
3680 |
"Each [Username,Key] pair should be separated by a new line: you only need to "
|
3681 |
"provide the first 12 characters of the yubikey."
|
3682 |
msgstr ""
|
3683 |
|
3684 |
+
#: src/features/login_protect.php:751
|
3685 |
msgid "GASP Checkbox Text"
|
3686 |
msgstr ""
|
3687 |
|
3688 |
+
#: src/features/login_protect.php:752
|
3689 |
msgid "The User Message Displayed Next To The GASP Checkbox"
|
3690 |
msgstr ""
|
3691 |
|
3692 |
+
#: src/features/login_protect.php:753
|
3693 |
msgid ""
|
3694 |
"You can change the text displayed to the user beside the checkbox if you "
|
3695 |
"need a custom message."
|
3696 |
msgstr ""
|
3697 |
|
3698 |
+
#: src/features/login_protect.php:758
|
3699 |
msgid "GASP Alert Text"
|
3700 |
msgstr ""
|
3701 |
|
3702 |
+
#: src/features/login_protect.php:759
|
3703 |
msgid "The Message Displayed If The User Doesn't Check The Box"
|
3704 |
msgstr ""
|
3705 |
|
3706 |
+
#: src/features/login_protect.php:760
|
3707 |
msgid ""
|
3708 |
"You can change the text displayed to the user in the alert message if they "
|
3709 |
"don't check the box."
|
3710 |
msgstr ""
|
3711 |
|
3712 |
+
#: src/features/plugin.php:234
|
3713 |
+
msgid "File could not be automatically removed."
|
3714 |
+
msgstr ""
|
3715 |
+
|
3716 |
+
#: src/features/plugin.php:297
|
3717 |
msgid "Sorry, you do not have permission to disable this plugin."
|
3718 |
msgstr ""
|
3719 |
|
3720 |
+
#: src/features/plugin.php:298
|
3721 |
msgid "You need to authenticate first."
|
3722 |
msgstr ""
|
3723 |
|
3724 |
+
#: src/features/plugin.php:648
|
3725 |
#, php-format
|
3726 |
msgid "This Site Is Protected By %s"
|
3727 |
msgstr ""
|
3728 |
|
3729 |
+
#: src/features/plugin.php:671
|
3730 |
msgid "Plugin Actions"
|
3731 |
msgstr ""
|
3732 |
|
3733 |
+
#: src/features/plugin.php:672
|
3734 |
msgid "E.g. Import/Export"
|
3735 |
msgstr ""
|
3736 |
|
3737 |
+
#: src/features/plugin.php:725
|
3738 |
msgid "Global Security Plugin Disable"
|
3739 |
msgstr ""
|
3740 |
|
3741 |
+
#: src/features/plugin.php:730 src/features/plugin.php:731
|
3742 |
msgid "Plugin Defaults"
|
3743 |
msgstr ""
|
3744 |
|
3745 |
+
#: src/features/plugin.php:733
|
3746 |
msgid "Important default settings used throughout the plugin."
|
3747 |
msgstr ""
|
3748 |
|
3749 |
+
#: src/features/plugin.php:738 src/features/plugin.php:743
|
3750 |
msgid "Import"
|
3751 |
msgstr ""
|
3752 |
|
3753 |
+
#: src/features/plugin.php:738 src/features/plugin.php:743
|
3754 |
msgid "Export"
|
3755 |
msgstr ""
|
3756 |
|
3757 |
+
#: src/features/plugin.php:740
|
3758 |
msgid ""
|
3759 |
"Automatically import options, and deploy configurations across your entire "
|
3760 |
"network."
|
3761 |
msgstr ""
|
3762 |
|
3763 |
+
#: src/features/plugin.php:741
|
3764 |
msgid "This is a Pro-only feature."
|
3765 |
msgstr ""
|
3766 |
|
3767 |
+
#: src/features/plugin.php:747
|
3768 |
msgid "General Plugin Options"
|
3769 |
msgstr ""
|
3770 |
|
3771 |
+
#: src/features/plugin.php:748
|
3772 |
msgid "General Options"
|
3773 |
msgstr ""
|
3774 |
|
3775 |
+
#: src/features/plugin.php:752 src/features/plugin.php:753
|
3776 |
msgid "Google"
|
3777 |
msgstr ""
|
3778 |
|
3779 |
+
#: src/features/plugin.php:755
|
3780 |
+
#, php-format
|
3781 |
+
msgid "Setup Google reCAPTCHA for use across %s."
|
3782 |
+
msgstr ""
|
3783 |
+
|
3784 |
+
#: src/features/plugin.php:759
|
3785 |
+
msgid "You must create your own Google reCAPTCHA API Keys."
|
3786 |
msgstr ""
|
3787 |
|
3788 |
+
#: src/features/plugin.php:761
|
3789 |
+
msgid "API Keys"
|
3790 |
msgstr ""
|
3791 |
|
3792 |
+
#: src/features/plugin.php:763
|
3793 |
+
#, php-format
|
3794 |
+
msgid "Invisible Google reCAPTCHA is available with %s Pro."
|
3795 |
msgstr ""
|
3796 |
|
3797 |
+
#: src/features/plugin.php:768 src/features/plugin.php:769
|
3798 |
msgid "Duo Security"
|
3799 |
msgstr ""
|
3800 |
|
3801 |
+
#: src/features/plugin.php:792
|
3802 |
msgid "Enable/Disable Plugin Modules"
|
3803 |
msgstr ""
|
3804 |
|
3805 |
+
#: src/features/plugin.php:793
|
3806 |
msgid "Enable/Disable All Plugin Modules"
|
3807 |
msgstr ""
|
3808 |
|
3809 |
+
#: src/features/plugin.php:794
|
3810 |
#, php-format
|
3811 |
msgid "Uncheck this option to disable all %s features."
|
3812 |
msgstr ""
|
3813 |
|
3814 |
+
#: src/features/plugin.php:799
|
3815 |
+
msgid "Admin Notes"
|
3816 |
+
msgstr ""
|
3817 |
+
|
3818 |
+
#: src/features/plugin.php:800
|
3819 |
+
msgid "Turn-On Admin Notes Section In Insights Dashboard"
|
3820 |
+
msgstr ""
|
3821 |
+
|
3822 |
+
#: src/features/plugin.php:801
|
3823 |
+
msgid ""
|
3824 |
+
"When turned-on it enables administrators to enter custom notes in the "
|
3825 |
+
"Insights Dashboard."
|
3826 |
+
msgstr ""
|
3827 |
+
|
3828 |
+
#: src/features/plugin.php:805
|
3829 |
msgid "Information Gathering"
|
3830 |
msgstr ""
|
3831 |
|
3832 |
+
#: src/features/plugin.php:806
|
3833 |
msgid "Permit Anonymous Usage Information Gathering"
|
3834 |
msgstr ""
|
3835 |
|
3836 |
+
#: src/features/plugin.php:807
|
3837 |
msgid ""
|
3838 |
"Allows us to gather information on statistics and features in-use across our "
|
3839 |
"client installations."
|
3840 |
msgstr ""
|
3841 |
|
3842 |
+
#: src/features/plugin.php:808
|
3843 |
msgid ""
|
3844 |
"This information is strictly anonymous and contains no personally, or "
|
3845 |
"otherwise, identifiable data."
|
3846 |
msgstr ""
|
3847 |
|
3848 |
+
#: src/features/plugin.php:809
|
3849 |
msgid "Click to see the exact data that would be sent."
|
3850 |
msgstr ""
|
3851 |
|
3852 |
+
#: src/features/plugin.php:813
|
3853 |
msgid "IP Source"
|
3854 |
msgstr ""
|
3855 |
|
3856 |
+
#: src/features/plugin.php:814
|
3857 |
msgid "Which IP Address Is Yours"
|
3858 |
msgstr ""
|
3859 |
|
3860 |
+
#: src/features/plugin.php:815
|
3861 |
msgid ""
|
3862 |
"There are many possible ways to detect visitor IP addresses. If Auto-Detect "
|
3863 |
"is not working, please select yours from the list."
|
3864 |
msgstr ""
|
3865 |
|
3866 |
+
#: src/features/plugin.php:816
|
3867 |
msgid ""
|
3868 |
"If the option you select becomes unavailable, we will revert to auto "
|
3869 |
"detection."
|
3870 |
msgstr ""
|
3871 |
|
3872 |
+
#: src/features/plugin.php:817
|
3873 |
#, php-format
|
3874 |
msgid "Current source is: %s"
|
3875 |
msgstr ""
|
3876 |
|
3877 |
+
#: src/features/plugin.php:822
|
3878 |
msgid "Report Email"
|
3879 |
msgstr ""
|
3880 |
|
3881 |
+
#: src/features/plugin.php:823
|
3882 |
msgid "Where to send email reports"
|
3883 |
msgstr ""
|
3884 |
|
3885 |
+
#: src/features/plugin.php:824
|
3886 |
#, php-format
|
3887 |
msgid "If this is empty, it will default to the blog admin email address: %s"
|
3888 |
msgstr ""
|
3889 |
|
3890 |
+
#: src/features/plugin.php:828
|
3891 |
msgid "In-Plugin Notices"
|
3892 |
msgstr ""
|
3893 |
|
3894 |
+
#: src/features/plugin.php:829
|
3895 |
msgid "Display Plugin Specific Notices"
|
3896 |
msgstr ""
|
3897 |
|
3898 |
+
#: src/features/plugin.php:830
|
3899 |
msgid ""
|
3900 |
"Disable this option to hide certain plugin admin notices about available "
|
3901 |
"updates and post-update notices."
|
3902 |
msgstr ""
|
3903 |
|
3904 |
+
#: src/features/plugin.php:834
|
3905 |
msgid "Show Plugin Badge"
|
3906 |
msgstr ""
|
3907 |
|
3908 |
+
#: src/features/plugin.php:835
|
3909 |
msgid "Display Plugin Badge On Your Site"
|
3910 |
msgstr ""
|
3911 |
|
3912 |
+
#: src/features/plugin.php:836
|
3913 |
msgid ""
|
3914 |
"Enabling this option helps support the plugin by spreading the word about it "
|
3915 |
"on your website."
|
3916 |
msgstr ""
|
3917 |
|
3918 |
+
#: src/features/plugin.php:837
|
3919 |
msgid ""
|
3920 |
"The plugin badge also lets visitors know your are taking your website "
|
3921 |
"security seriously."
|
3922 |
msgstr ""
|
3923 |
|
3924 |
+
#: src/features/plugin.php:838
|
3925 |
msgid "Read this carefully before enabling this option."
|
3926 |
msgstr ""
|
3927 |
|
3928 |
+
#: src/features/plugin.php:842
|
3929 |
msgid "Delete Plugin Settings"
|
3930 |
msgstr ""
|
3931 |
|
3932 |
+
#: src/features/plugin.php:843
|
3933 |
msgid "Delete All Plugin Settings Upon Plugin Deactivation"
|
3934 |
msgstr ""
|
3935 |
|
3936 |
+
#: src/features/plugin.php:844
|
3937 |
msgid "Careful: Removes all plugin options when you deactivate the plugin"
|
3938 |
msgstr ""
|
3939 |
|
3940 |
+
#: src/features/plugin.php:848
|
3941 |
msgid "XML-RPC Compatibility"
|
3942 |
msgstr ""
|
3943 |
|
3944 |
+
#: src/features/plugin.php:849
|
3945 |
msgid "Allow Login Through XML-RPC To By-Pass Accounts Management Rules"
|
3946 |
msgstr ""
|
3947 |
|
3948 |
+
#: src/features/plugin.php:850
|
3949 |
msgid ""
|
3950 |
"Enable this if you need XML-RPC functionality e.g. if you use the WordPress "
|
3951 |
"iPhone/Android App."
|
3952 |
msgstr ""
|
3953 |
|
3954 |
+
#: src/features/plugin.php:854
|
3955 |
msgid "Allow Import/Export"
|
3956 |
msgstr ""
|
3957 |
|
3958 |
+
#: src/features/plugin.php:855
|
3959 |
msgid "Allow Import And Export Of Options On This Site"
|
3960 |
msgstr ""
|
3961 |
|
3962 |
+
#: src/features/plugin.php:856
|
3963 |
msgid "Uncheck this box to completely disable import and export of options."
|
3964 |
msgstr ""
|
3965 |
|
3966 |
+
#: src/features/plugin.php:857
|
|
|
|
|
|
|
|
|
3967 |
msgid "Import/Export is a premium-only feature."
|
3968 |
msgstr ""
|
3969 |
|
3970 |
+
#: src/features/plugin.php:861
|
3971 |
msgid "Export Whitelist"
|
3972 |
msgstr ""
|
3973 |
|
3974 |
+
#: src/features/plugin.php:862
|
3975 |
msgid "Whitelisted Sites To Export Options From This Site"
|
3976 |
msgstr ""
|
3977 |
|
3978 |
+
#: src/features/plugin.php:863
|
3979 |
msgid "Whitelisted sites may export options from this site without the key."
|
3980 |
msgstr ""
|
3981 |
|
3982 |
+
#: src/features/plugin.php:864
|
3983 |
msgid "List each site URL on a new line."
|
3984 |
msgstr ""
|
3985 |
|
3986 |
+
#: src/features/plugin.php:865
|
3987 |
msgid "This is to be used in conjunction with the Master Import Site feature."
|
3988 |
msgstr ""
|
3989 |
|
3990 |
+
#: src/features/plugin.php:869
|
3991 |
msgid "Master Import Site"
|
3992 |
msgstr ""
|
3993 |
|
3994 |
+
#: src/features/plugin.php:870
|
3995 |
msgid "Automatically Import Options From This Site URL"
|
3996 |
msgstr ""
|
3997 |
|
3998 |
+
#: src/features/plugin.php:871
|
3999 |
msgid "Supplying a site URL here will make this site an 'Options Slave'."
|
4000 |
msgstr ""
|
4001 |
|
4002 |
+
#: src/features/plugin.php:872
|
4003 |
+
msgid "Options will be automatically exported from the Master site each day."
|
|
|
|
|
|
|
|
|
|
|
|
|
4004 |
msgstr ""
|
4005 |
|
4006 |
+
#: src/features/plugin.php:873
|
4007 |
msgid ""
|
4008 |
"Use of this feature will overwrite existing options and replace them with "
|
4009 |
"those from the Master Import Site."
|
4010 |
msgstr ""
|
4011 |
|
4012 |
+
#: src/features/plugin.php:877
|
4013 |
msgid "Notify Whitelist"
|
4014 |
msgstr ""
|
4015 |
|
4016 |
+
#: src/features/plugin.php:878
|
4017 |
msgid "Notify Sites On The Whitelist To Update Options From Master"
|
4018 |
msgstr ""
|
4019 |
|
4020 |
+
#: src/features/plugin.php:879
|
4021 |
msgid ""
|
4022 |
"When enabled, manual options saving will notify sites on the whitelist to "
|
4023 |
"export options from the Master site."
|
4024 |
msgstr ""
|
4025 |
|
4026 |
+
#: src/features/plugin.php:883
|
4027 |
msgid "Secret Key"
|
4028 |
msgstr ""
|
4029 |
|
4030 |
+
#: src/features/plugin.php:884
|
4031 |
msgid "Import/Export Secret Key"
|
4032 |
msgstr ""
|
4033 |
|
4034 |
+
#: src/features/plugin.php:885
|
4035 |
msgid ""
|
4036 |
"Keep this Secret Key private as it will allow the import and export of "
|
4037 |
"options."
|
4038 |
msgstr ""
|
4039 |
|
4040 |
+
#: src/features/plugin.php:889
|
4041 |
msgid "Installation ID"
|
4042 |
msgstr ""
|
4043 |
|
4044 |
+
#: src/features/plugin.php:890
|
4045 |
msgid "Unique Plugin Installation ID"
|
4046 |
msgstr ""
|
4047 |
|
4048 |
+
#: src/features/plugin.php:891
|
4049 |
msgid "Keep this ID private."
|
4050 |
msgstr ""
|
4051 |
|
4052 |
+
#: src/features/plugin.php:895
|
4053 |
msgid "reCAPTCHA Secret"
|
4054 |
msgstr ""
|
4055 |
|
4056 |
+
#: src/features/plugin.php:896
|
4057 |
msgid "Google reCAPTCHA Secret Key"
|
4058 |
msgstr ""
|
4059 |
|
4060 |
+
#: src/features/plugin.php:897
|
4061 |
msgid "Enter your Google reCAPTCHA secret key for use throughout the plugin."
|
4062 |
msgstr ""
|
4063 |
|
4064 |
+
#: src/features/plugin.php:901
|
4065 |
msgid "reCAPTCHA Site Key"
|
4066 |
msgstr ""
|
4067 |
|
4068 |
+
#: src/features/plugin.php:902
|
4069 |
msgid "Google reCAPTCHA Site Key"
|
4070 |
msgstr ""
|
4071 |
|
4072 |
+
#: src/features/plugin.php:903
|
4073 |
msgid "Enter your Google reCAPTCHA site key for use throughout the plugin"
|
4074 |
msgstr ""
|
4075 |
|
4076 |
+
#: src/features/plugin.php:908
|
4077 |
msgid "How Google reCAPTCHA Will Be Displayed By Default"
|
4078 |
msgstr ""
|
4079 |
|
4080 |
+
#: src/features/plugin.php:926
|
4081 |
msgid "IP Whitelist"
|
4082 |
msgstr ""
|
4083 |
|
4084 |
+
#: src/features/plugin.php:927
|
4085 |
msgid "IP Address White List"
|
4086 |
msgstr ""
|
4087 |
|
4088 |
+
#: src/features/plugin.php:928
|
4089 |
msgid ""
|
4090 |
"Any IP addresses on this list will by-pass all Plugin Security Checking."
|
4091 |
msgstr ""
|
4092 |
|
4093 |
+
#: src/features/plugin.php:929 src/processors/ips.php:91
|
4094 |
+
#: src/processors/plugin.php:189 src/processors/plugin_badge.php:47
|
4095 |
#, php-format
|
4096 |
msgid "Your IP address is: %s"
|
4097 |
msgstr ""
|
4098 |
|
4099 |
+
#: src/features/plugin.php:930
|
4100 |
msgid "Choose IP Addresses To Blacklist"
|
4101 |
msgstr ""
|
4102 |
|
4103 |
+
#: src/features/plugin.php:931
|
4104 |
+
#, php-format
|
4105 |
+
msgid "Recommendation - %s"
|
4106 |
+
msgstr ""
|
4107 |
+
|
4108 |
+
#: src/features/plugin.php:932
|
4109 |
msgid "Blacklist"
|
4110 |
msgstr ""
|
4111 |
|
4112 |
+
#: src/features/plugin.php:933
|
4113 |
msgid "Logging"
|
4114 |
msgstr ""
|
4115 |
|
4116 |
+
#: src/features/plugin.php:934
|
4117 |
#, php-format
|
4118 |
msgid ""
|
4119 |
"User \"%s\" was forcefully logged out as they were not verified by either "
|
4120 |
"cookie or IP address (or both)."
|
4121 |
msgstr ""
|
4122 |
|
4123 |
+
#: src/features/plugin.php:935
|
4124 |
#, php-format
|
4125 |
msgid ""
|
4126 |
"User \"%s\" was found to be un-verified at the given IP Address: \"%s\"."
|
4127 |
msgstr ""
|
4128 |
|
4129 |
+
#: src/features/plugin.php:936
|
4130 |
msgid "Cookie"
|
4131 |
msgstr ""
|
4132 |
|
4133 |
+
#: src/features/plugin.php:938 src/features/traffic.php:361
|
4134 |
msgid "IP"
|
4135 |
msgstr ""
|
4136 |
|
4137 |
+
#: src/features/plugin.php:939
|
4138 |
msgid ""
|
4139 |
"This will restrict all user login sessions to a single browser. Use this if "
|
4140 |
"your users have dynamic IP addresses."
|
4141 |
msgstr ""
|
4142 |
|
4143 |
+
#: src/features/plugin.php:940
|
4144 |
msgid ""
|
4145 |
"All users will be required to authenticate their login by email-based two-"
|
4146 |
"factor authentication, when logging in from a new IP address"
|
4147 |
msgstr ""
|
4148 |
|
4149 |
+
#: src/features/plugin.php:941
|
4150 |
msgid "2-Factor Auth"
|
4151 |
msgstr ""
|
4152 |
|
4153 |
+
#: src/features/plugin.php:942
|
4154 |
msgid "Include Logged-In Users"
|
4155 |
msgstr ""
|
4156 |
|
4157 |
+
#: src/features/plugin.php:943
|
4158 |
msgid "You may also enable GASP for logged in users"
|
4159 |
msgstr ""
|
4160 |
|
4161 |
+
#: src/features/plugin.php:944
|
4162 |
msgid ""
|
4163 |
"Since logged-in users would be expected to be vetted already, this is off by "
|
4164 |
"default."
|
4165 |
msgstr ""
|
4166 |
|
4167 |
+
#: src/features/plugin.php:946
|
4168 |
msgid "Protect your security plugin not just your WordPress site"
|
4169 |
msgstr ""
|
4170 |
|
4171 |
+
#: src/features/plugin.php:949
|
4172 |
msgid "Get a view on what happens on your site, when it happens"
|
4173 |
msgstr ""
|
4174 |
|
4175 |
+
#: src/features/plugin.php:952
|
4176 |
msgid "Take back full control of WordPress automatic updates"
|
4177 |
msgstr ""
|
4178 |
|
4179 |
+
#: src/features/plugin.php:953
|
4180 |
msgid "Comments SPAM"
|
4181 |
msgstr ""
|
4182 |
|
4183 |
+
#: src/features/plugin.php:954
|
4184 |
msgid "Block comment SPAM and retain your privacy"
|
4185 |
msgstr ""
|
4186 |
|
4187 |
+
#: src/features/plugin.php:957
|
4188 |
msgid "Automatically block malicious URLs and data sent to your site"
|
4189 |
msgstr ""
|
4190 |
|
4191 |
+
#: src/features/plugin.php:959
|
4192 |
msgid "HTTP Headers"
|
4193 |
msgstr ""
|
4194 |
|
4195 |
+
#: src/features/plugin.php:960
|
4196 |
msgid "Control HTTP Security Headers"
|
4197 |
msgstr ""
|
4198 |
|
4199 |
+
#: src/features/plugin.php:962
|
4200 |
msgid "Manage Visitor IP Address"
|
4201 |
msgstr ""
|
4202 |
|
4203 |
+
#: src/features/plugin.php:964
|
4204 |
msgid "Harden the more loosely controlled settings of your site"
|
4205 |
msgstr ""
|
4206 |
|
4207 |
+
#: src/features/plugin.php:966
|
4208 |
msgid ""
|
4209 |
"Block brute force attacks and secure user identities with Two-Factor "
|
4210 |
"Authentication"
|
4211 |
msgstr ""
|
4212 |
|
4213 |
+
#: src/features/plugin.php:967
|
4214 |
msgid "Dashboard"
|
4215 |
msgstr ""
|
4216 |
|
4217 |
+
#: src/features/plugin.php:968
|
4218 |
msgid "General Plugin Settings"
|
4219 |
msgstr ""
|
4220 |
|
4221 |
+
#: src/features/plugin.php:969
|
4222 |
msgid "Statistics"
|
4223 |
msgstr ""
|
4224 |
|
4225 |
+
#: src/features/plugin.php:970
|
4226 |
msgid "Summary of the main security actions taken by this plugin"
|
4227 |
msgstr ""
|
4228 |
|
4229 |
+
#: src/features/plugin.php:971
|
4230 |
msgid "Stats Viewer"
|
4231 |
msgstr ""
|
4232 |
|
4233 |
+
#: src/features/plugin.php:972
|
4234 |
msgid "Premium Support"
|
4235 |
msgstr ""
|
4236 |
|
4237 |
+
#: src/features/plugin.php:973
|
4238 |
msgid "Premium Plugin Support Centre"
|
4239 |
msgstr ""
|
4240 |
|
4241 |
+
#: src/features/plugin.php:974 src/features/sessions.php:54
|
4242 |
+
#: src/features/traffic.php:438 src/features/user_management.php:314
|
4243 |
msgid "User Management"
|
4244 |
msgstr ""
|
4245 |
|
4246 |
+
#: src/features/plugin.php:975
|
4247 |
msgid ""
|
4248 |
"Get true user sessions and control account sharing, session duration and "
|
4249 |
"timeouts"
|
4250 |
msgstr ""
|
4251 |
|
4252 |
+
#: src/features/plugin.php:976
|
4253 |
msgid "Two-Factor Authentication"
|
4254 |
msgstr ""
|
4255 |
|
4257 |
msgid "Creates and Manages User Sessions."
|
4258 |
msgstr ""
|
4259 |
|
4260 |
+
#: src/features/statistics.php:53
|
4261 |
msgid "Helps you see at a glance how effective the plugin has been."
|
4262 |
msgstr ""
|
4263 |
|
4264 |
+
#: src/features/statistics.php:62
|
4265 |
msgid "To track stats and issue reports."
|
4266 |
msgstr ""
|
4267 |
|
4268 |
+
#: src/features/statistics.php:69
|
4269 |
msgid "Statistics Sharing"
|
4270 |
msgstr ""
|
4271 |
|
4272 |
+
#: src/features/statistics.php:71
|
4273 |
msgid ""
|
4274 |
"Help us to provide globally accessible statistics on the effectiveness of "
|
4275 |
"the plugin."
|
4276 |
msgstr ""
|
4277 |
|
4278 |
+
#: src/features/statistics.php:72
|
4279 |
msgid "Enabling this option helps us improve our plugin over time."
|
4280 |
msgstr ""
|
4281 |
|
4282 |
+
#: src/features/statistics.php:73
|
4283 |
msgid "All statistics data collection is 100% anonymous."
|
4284 |
msgstr ""
|
4285 |
|
4286 |
+
#: src/features/statistics.php:73
|
4287 |
msgid ""
|
4288 |
"Neither we nor anyone else will be able to trace the data back to the "
|
4289 |
"originating site."
|
4290 |
msgstr ""
|
4291 |
|
4292 |
+
#: src/features/statistics.php:76
|
4293 |
msgid "Sharing"
|
4294 |
msgstr ""
|
4295 |
|
4296 |
+
#: src/features/traffic.php:66
|
4297 |
+
#, php-format
|
4298 |
+
msgid "%s is a Pro-only feature."
|
4299 |
+
msgstr ""
|
4300 |
+
|
4301 |
+
#: src/features/traffic.php:66
|
4302 |
+
msgid "Traffic Watch"
|
4303 |
+
msgstr ""
|
4304 |
+
|
4305 |
+
#: src/features/traffic.php:71
|
4306 |
+
msgid ""
|
4307 |
+
"Traffic Watcher will not run because visitor IP address detection is not "
|
4308 |
+
"correctly configured."
|
4309 |
+
msgstr ""
|
4310 |
+
|
4311 |
+
#: src/features/traffic.php:184
|
4312 |
+
msgid "Traffic Watch Viewer"
|
4313 |
+
msgstr ""
|
4314 |
+
|
4315 |
+
#: src/features/traffic.php:342
|
4316 |
+
msgid "unknown"
|
4317 |
+
msgstr ""
|
4318 |
+
|
4319 |
+
#: src/features/traffic.php:348 src/processors/firewall.php:271
|
4320 |
+
msgid "Unknown"
|
4321 |
+
msgstr ""
|
4322 |
+
|
4323 |
+
#: src/features/traffic.php:362
|
4324 |
+
msgid "Logged-In"
|
4325 |
+
msgstr ""
|
4326 |
+
|
4327 |
+
#: src/features/traffic.php:363
|
4328 |
+
msgid "Location"
|
4329 |
+
msgstr ""
|
4330 |
+
|
4331 |
+
#: src/features/traffic.php:364
|
4332 |
+
msgid "User Agent"
|
4333 |
+
msgstr ""
|
4334 |
+
|
4335 |
+
#: src/features/traffic.php:409
|
4336 |
+
msgid "Traffic Watch Log"
|
4337 |
+
msgstr ""
|
4338 |
+
|
4339 |
+
#: src/features/traffic.php:410
|
4340 |
+
msgid "Review Site Traffic Logs "
|
4341 |
+
msgstr ""
|
4342 |
+
|
4343 |
+
#: src/features/traffic.php:428
|
4344 |
+
msgid "Monitor and review all requests to your site."
|
4345 |
+
msgstr ""
|
4346 |
+
|
4347 |
+
#: src/features/traffic.php:429
|
4348 |
+
msgid ""
|
4349 |
+
"Required only if you need to review and investigate and monitor requests to "
|
4350 |
+
"your site"
|
4351 |
+
msgstr ""
|
4352 |
+
|
4353 |
+
#: src/features/traffic.php:435
|
4354 |
+
msgid "Traffic Watch Options"
|
4355 |
+
msgstr ""
|
4356 |
+
|
4357 |
+
#: src/features/traffic.php:437
|
4358 |
+
msgid "Provides finer control over the Traffic Watch system."
|
4359 |
+
msgstr ""
|
4360 |
+
|
4361 |
+
#: src/features/traffic.php:440
|
4362 |
+
msgid "Traffic Logging Options"
|
4363 |
+
msgstr ""
|
4364 |
+
|
4365 |
+
#: src/features/traffic.php:469
|
4366 |
+
msgid "Traffic Log Exclusions"
|
4367 |
+
msgstr ""
|
4368 |
+
|
4369 |
+
#: src/features/traffic.php:470
|
4370 |
+
msgid "Select Which Types Of Requests To Exclude"
|
4371 |
+
msgstr ""
|
4372 |
+
|
4373 |
+
#: src/features/traffic.php:471
|
4374 |
+
msgid ""
|
4375 |
+
"Select request types that you don't want to appear in the traffic viewer."
|
4376 |
+
msgstr ""
|
4377 |
+
|
4378 |
+
#: src/features/traffic.php:472
|
4379 |
+
msgid ""
|
4380 |
+
"If a request matches any exclusion rule, it will not show on the traffic "
|
4381 |
+
"viewer."
|
4382 |
+
msgstr ""
|
4383 |
+
|
4384 |
+
#: src/features/traffic.php:476
|
4385 |
+
msgid "Auto Expiry Cleaning"
|
4386 |
+
msgstr ""
|
4387 |
+
|
4388 |
+
#: src/features/traffic.php:477
|
4389 |
+
msgid "Enable Traffic Log Auto Expiry"
|
4390 |
+
msgstr ""
|
4391 |
+
|
4392 |
+
#: src/features/traffic.php:478
|
4393 |
+
msgid "DB cleanup will delete logs older than this maximum value (in days)."
|
4394 |
+
msgstr ""
|
4395 |
+
|
4396 |
+
#: src/features/traffic.php:482
|
4397 |
+
msgid "Max Log Length"
|
4398 |
+
msgstr ""
|
4399 |
+
|
4400 |
+
#: src/features/traffic.php:483
|
4401 |
+
msgid "Maximum Traffic Log Length To Keep"
|
4402 |
+
msgstr ""
|
4403 |
+
|
4404 |
+
#: src/features/traffic.php:484
|
4405 |
+
msgid "DB cleanup will delete logs to maintain this maximum number of records."
|
4406 |
+
msgstr ""
|
4407 |
+
|
4408 |
+
#: src/features/traffic.php:488
|
4409 |
+
msgid "Auto Disable"
|
4410 |
+
msgstr ""
|
4411 |
+
|
4412 |
+
#: src/features/traffic.php:489
|
4413 |
+
msgid "Auto Disable Traffic Logging After 1 Week"
|
4414 |
+
msgstr ""
|
4415 |
+
|
4416 |
+
#: src/features/traffic.php:492
|
4417 |
+
#, php-format
|
4418 |
+
msgid "Auto Disable At: %s"
|
4419 |
+
msgstr ""
|
4420 |
+
|
4421 |
+
#: src/features/traffic.php:497
|
4422 |
+
msgid "Turn on to prevent unnecessary long-term traffic logging."
|
4423 |
+
msgstr ""
|
4424 |
+
|
4425 |
+
#: src/features/traffic.php:498
|
4426 |
+
msgid "Timer resets after options save."
|
4427 |
+
msgstr ""
|
4428 |
+
|
4429 |
+
#: src/features/user_management.php:47
|
4430 |
+
#, php-format
|
4431 |
+
msgid "now: %s"
|
4432 |
+
msgstr ""
|
4433 |
+
|
4434 |
+
#: src/features/user_management.php:153 src/processors/statistics.php:203
|
4435 |
msgid "User Sessions"
|
4436 |
msgstr ""
|
4437 |
|
4438 |
+
#: src/features/user_management.php:154
|
4439 |
msgid "Review user sessions"
|
4440 |
msgstr ""
|
4441 |
|
4442 |
+
#: src/features/user_management.php:156
|
4443 |
msgid "Current User Sessions"
|
4444 |
msgstr ""
|
4445 |
|
4446 |
+
#: src/features/user_management.php:158
|
4447 |
msgid "Logged In At"
|
4448 |
msgstr ""
|
4449 |
|
4450 |
+
#: src/features/user_management.php:159
|
4451 |
msgid "Last Activity At"
|
4452 |
msgstr ""
|
4453 |
|
4454 |
+
#: src/features/user_management.php:160
|
4455 |
msgid "Last Activity URI"
|
4456 |
msgstr ""
|
4457 |
|
4458 |
+
#: src/features/user_management.php:161
|
4459 |
msgid "Login IP"
|
4460 |
msgstr ""
|
4461 |
|
4462 |
+
#: src/features/user_management.php:162
|
4463 |
msgid ""
|
4464 |
"You need to enable the User Management feature to view and manage user "
|
4465 |
"sessions."
|
4466 |
msgstr ""
|
4467 |
|
4468 |
+
#: src/features/user_management.php:227
|
4469 |
+
msgid "Very Weak"
|
4470 |
+
msgstr ""
|
4471 |
+
|
4472 |
+
#: src/features/user_management.php:228
|
4473 |
msgid "Weak"
|
4474 |
msgstr ""
|
4475 |
|
4476 |
+
#: src/features/user_management.php:229
|
4477 |
msgid "Medium"
|
4478 |
msgstr ""
|
4479 |
|
4480 |
+
#: src/features/user_management.php:230
|
4481 |
msgid "Strong"
|
4482 |
msgstr ""
|
4483 |
|
4484 |
+
#: src/features/user_management.php:231
|
4485 |
msgid "Very Strong"
|
4486 |
msgstr ""
|
4487 |
|
4488 |
+
#: src/features/user_management.php:275
|
4489 |
+
msgid "Default 'admin' user still available."
|
4490 |
+
msgstr ""
|
4491 |
+
|
4492 |
+
#: src/features/user_management.php:277
|
4493 |
+
msgid "Default 'admin' user should be disabled or removed."
|
4494 |
+
msgstr ""
|
4495 |
+
|
4496 |
+
#: src/features/user_management.php:286
|
4497 |
+
msgid "Strong password policies are not enforced."
|
4498 |
+
msgstr ""
|
4499 |
+
|
4500 |
+
#: src/features/user_management.php:289
|
4501 |
+
msgid "Password policies should be turned-on."
|
4502 |
+
msgstr ""
|
4503 |
+
|
4504 |
+
#: src/features/user_management.php:313
|
4505 |
msgid ""
|
4506 |
"User Management offers real user sessions, finer control over user session "
|
4507 |
"time-out, and ensures users have logged-in in a correct manner."
|
4508 |
msgstr ""
|
4509 |
|
4510 |
+
#: src/features/user_management.php:320 src/features/user_management.php:321
|
4511 |
msgid "Password Policies"
|
4512 |
msgstr ""
|
4513 |
|
4514 |
+
#: src/features/user_management.php:323
|
4515 |
msgid "Have full control over passwords used by users on the site."
|
4516 |
msgstr ""
|
4517 |
|
4518 |
+
#: src/features/user_management.php:330
|
4519 |
msgid "Admin Login Notification"
|
4520 |
msgstr ""
|
4521 |
|
4522 |
+
#: src/features/user_management.php:332
|
4523 |
msgid ""
|
4524 |
"So you can be made aware of when a WordPress administrator has logged into "
|
4525 |
"your site when you are not expecting it."
|
4526 |
msgstr ""
|
4527 |
|
4528 |
+
#: src/features/user_management.php:335
|
4529 |
msgid "Notifications"
|
4530 |
msgstr ""
|
4531 |
|
4532 |
+
#: src/features/user_management.php:339
|
4533 |
msgid "Multi-Factor User Authentication"
|
4534 |
msgstr ""
|
4535 |
|
4536 |
+
#: src/features/user_management.php:348
|
4537 |
msgid "User Session Management"
|
4538 |
msgstr ""
|
4539 |
|
4540 |
+
#: src/features/user_management.php:350
|
4541 |
msgid ""
|
4542 |
"Allows you to better control user sessions on your site and expire idle "
|
4543 |
"sessions and prevent account sharing."
|
4544 |
msgstr ""
|
4545 |
|
4546 |
+
#: src/features/user_management.php:353
|
4547 |
msgid "Session Options"
|
4548 |
msgstr ""
|
4549 |
|
4550 |
+
#: src/features/user_management.php:382
|
4551 |
msgid "Admin Login Notification Email"
|
4552 |
msgstr ""
|
4553 |
|
4554 |
+
#: src/features/user_management.php:383
|
4555 |
msgid "Send An Notification Email When Administrator Logs In"
|
4556 |
msgstr ""
|
4557 |
|
4558 |
+
#: src/features/user_management.php:384
|
4559 |
msgid ""
|
4560 |
"If you would like to be notified every time an administrator user logs into "
|
4561 |
"this WordPress site, enter a notification email address."
|
4562 |
msgstr ""
|
4563 |
|
4564 |
+
#: src/features/user_management.php:385
|
4565 |
msgid "No email address - No Notification."
|
4566 |
msgstr ""
|
4567 |
|
4568 |
+
#: src/features/user_management.php:389
|
4569 |
+
msgid "User Login Notification Email"
|
4570 |
+
msgstr ""
|
4571 |
+
|
4572 |
+
#: src/features/user_management.php:390
|
4573 |
+
msgid "Send Email Notification To Each User Upon Successful Login"
|
4574 |
+
msgstr ""
|
4575 |
+
|
4576 |
+
#: src/features/user_management.php:391
|
4577 |
+
msgid ""
|
4578 |
+
"A notification is sent to each user when a successful login occurs for their "
|
4579 |
+
"account."
|
4580 |
+
msgstr ""
|
4581 |
+
|
4582 |
+
#: src/features/user_management.php:395
|
4583 |
msgid "Session Timeout"
|
4584 |
msgstr ""
|
4585 |
|
4586 |
+
#: src/features/user_management.php:396
|
4587 |
msgid "Specify How Many Days After Login To Automatically Force Re-Login"
|
4588 |
msgstr ""
|
4589 |
|
4590 |
+
#: src/features/user_management.php:397
|
4591 |
msgid ""
|
4592 |
"WordPress default is 2 days, or 14 days if you check the \"Remember Me\" box."
|
4593 |
msgstr ""
|
4594 |
|
4595 |
+
#: src/features/user_management.php:398
|
4596 |
#, php-format
|
4597 |
msgid "This cannot be less than %s."
|
4598 |
msgstr ""
|
4599 |
|
4600 |
+
#: src/features/user_management.php:404
|
|
|
|
|
|
|
|
|
|
|
4601 |
msgid "Idle Timeout"
|
4602 |
msgstr ""
|
4603 |
|
4604 |
+
#: src/features/user_management.php:405
|
4605 |
msgid "Specify How Many Hours After Inactivity To Automatically Logout User"
|
4606 |
msgstr ""
|
4607 |
|
4608 |
+
#: src/features/user_management.php:406
|
4609 |
msgid ""
|
4610 |
"If the user is inactive for the number of hours specified, they will be "
|
4611 |
"forcefully logged out next time they return."
|
4612 |
msgstr ""
|
4613 |
|
4614 |
+
#: src/features/user_management.php:407
|
4615 |
#, php-format
|
4616 |
msgid "Set to %s to turn off this option."
|
4617 |
msgstr ""
|
4618 |
|
4619 |
+
#: src/features/user_management.php:411
|
4620 |
msgid "Lock To Location"
|
4621 |
msgstr ""
|
4622 |
|
4623 |
+
#: src/features/user_management.php:412
|
4624 |
msgid "Locks A User Session To IP address"
|
4625 |
msgstr ""
|
4626 |
|
4627 |
+
#: src/features/user_management.php:413
|
4628 |
msgid ""
|
4629 |
"When selected, a session is restricted to the same IP address as when the "
|
4630 |
"user logged in."
|
4631 |
msgstr ""
|
4632 |
|
4633 |
+
#: src/features/user_management.php:414
|
4634 |
msgid ""
|
4635 |
"If a logged-in user's IP address changes, the session will be invalidated "
|
4636 |
"and they'll be forced to re-login to WordPress."
|
4637 |
msgstr ""
|
4638 |
|
4639 |
+
#: src/features/user_management.php:418
|
4640 |
msgid "Max Simultaneous Sessions"
|
4641 |
msgstr ""
|
4642 |
|
4643 |
+
#: src/features/user_management.php:419
|
4644 |
msgid "Limit Simultaneous Sessions For The Same Username"
|
4645 |
msgstr ""
|
4646 |
|
4647 |
+
#: src/features/user_management.php:420
|
4648 |
msgid ""
|
4649 |
"The number provided here is the maximum number of simultaneous, distinct, "
|
4650 |
"sessions allowed for any given username."
|
4651 |
msgstr ""
|
4652 |
|
4653 |
+
#: src/features/user_management.php:421
|
4654 |
msgid "Zero (0) will allow unlimited simultaneous sessions."
|
4655 |
msgstr ""
|
4656 |
|
4657 |
+
#: src/features/user_management.php:425
|
4658 |
msgid "Enable Password Policies"
|
4659 |
msgstr ""
|
4660 |
|
4661 |
+
#: src/features/user_management.php:426
|
4662 |
msgid "Enable The Password Policies Detailed Below"
|
4663 |
msgstr ""
|
4664 |
|
4665 |
+
#: src/features/user_management.php:427
|
4666 |
msgid "Turn on/off all password policy settings."
|
4667 |
msgstr ""
|
4668 |
|
4669 |
+
#: src/features/user_management.php:431
|
4670 |
msgid "Prevent Pwned Passwords"
|
4671 |
msgstr ""
|
4672 |
|
4673 |
+
#: src/features/user_management.php:432
|
4674 |
+
msgid "Prevent Use Of \"Pwned\" Passwords"
|
4675 |
msgstr ""
|
4676 |
|
4677 |
+
#: src/features/user_management.php:433
|
4678 |
msgid ""
|
4679 |
"Prevents users from using any passwords found on the public available list "
|
4680 |
"of \"pwned\" passwords."
|
4681 |
msgstr ""
|
4682 |
|
4683 |
+
#: src/features/user_management.php:437
|
4684 |
msgid "Minimum Length"
|
4685 |
msgstr ""
|
4686 |
|
4687 |
+
#: src/features/user_management.php:438
|
4688 |
msgid "Minimum Password Length"
|
4689 |
msgstr ""
|
4690 |
|
4691 |
+
#: src/features/user_management.php:439
|
4692 |
msgid ""
|
4693 |
"All passwords that a user sets must be at least this many characters in "
|
4694 |
"length."
|
4695 |
msgstr ""
|
4696 |
|
4697 |
+
#: src/features/user_management.php:440 src/features/user_management.php:460
|
4698 |
+
msgid "Set to Zero(0) to disable."
|
4699 |
+
msgstr ""
|
4700 |
+
|
4701 |
+
#: src/features/user_management.php:444
|
4702 |
msgid "Minimum Strength"
|
4703 |
msgstr ""
|
4704 |
|
4705 |
+
#: src/features/user_management.php:445
|
4706 |
msgid "Minimum Password Strength"
|
4707 |
msgstr ""
|
4708 |
|
4709 |
+
#: src/features/user_management.php:446
|
4710 |
msgid "All passwords that a user sets must meet this minimum strength."
|
4711 |
msgstr ""
|
4712 |
|
4713 |
+
#: src/features/user_management.php:450
|
4714 |
+
msgid "Apply To Existing Users"
|
4715 |
msgstr ""
|
4716 |
|
4717 |
+
#: src/features/user_management.php:451
|
4718 |
msgid "Apply Password Policies To Existing Users and Their Passwords"
|
4719 |
msgstr ""
|
4720 |
|
4721 |
+
#: src/features/user_management.php:452
|
4722 |
msgid ""
|
4723 |
"Forces existing users to update their passwords if they don't meet "
|
4724 |
"requirements, after they next login."
|
4725 |
msgstr ""
|
4726 |
|
4727 |
+
#: src/features/user_management.php:453
|
4728 |
msgid "Note: You may want to warn users prior to enabling this option."
|
4729 |
msgstr ""
|
4730 |
|
4731 |
+
#: src/features/user_management.php:457
|
4732 |
msgid "Password Expiration"
|
4733 |
msgstr ""
|
4734 |
|
4735 |
+
#: src/features/user_management.php:458
|
4736 |
msgid "Passwords Expire After This Many Days"
|
4737 |
msgstr ""
|
4738 |
|
4739 |
+
#: src/features/user_management.php:459
|
4740 |
msgid ""
|
4741 |
"Users will be forced to reset their passwords after the number of days "
|
4742 |
"specified."
|
4743 |
msgstr ""
|
4744 |
|
4745 |
+
#: src/processors/admin_access_restriction.php:201
|
4746 |
+
#: src/processors/admin_access_restriction.php:237
|
|
|
|
|
|
|
|
|
4747 |
#, php-format
|
4748 |
msgid "%s Security Restrictions Applied"
|
4749 |
msgstr ""
|
4750 |
|
4751 |
+
#: src/processors/admin_access_restriction.php:202
|
4752 |
msgid ""
|
4753 |
"Altering certain options has been restricted by your WordPress security "
|
4754 |
"administrator."
|
4755 |
msgstr ""
|
4756 |
|
4757 |
+
#: src/processors/admin_access_restriction.php:203
|
4758 |
msgid ""
|
4759 |
"Repeated failed attempts to authenticate will probably lock you out of this "
|
4760 |
"site."
|
4761 |
msgstr ""
|
4762 |
|
4763 |
+
#: src/processors/admin_access_restriction.php:209
|
4764 |
msgid "Admin Access Login"
|
4765 |
msgstr ""
|
4766 |
|
4767 |
+
#: src/processors/admin_access_restriction.php:210
|
4768 |
+
#: src/processors/admin_access_restriction.php:247
|
4769 |
#, php-format
|
4770 |
msgid "Go here to manage settings and authenticate with the %s plugin."
|
4771 |
msgstr ""
|
4772 |
|
4773 |
+
#: src/processors/admin_access_restriction.php:238
|
4774 |
msgid ""
|
4775 |
"Editing existing administrators, promoting existing users to the "
|
4776 |
"administrator role, or deleting administrator users is currently restricted."
|
4777 |
msgstr ""
|
4778 |
|
4779 |
+
#: src/processors/admin_access_restriction.php:239
|
4780 |
msgid ""
|
4781 |
"Please authenticate with the Security Admin system before attempting any "
|
4782 |
"administrator user modifications."
|
4783 |
msgstr ""
|
4784 |
|
4785 |
+
#: src/processors/admin_access_restriction.php:240
|
4786 |
msgid "Unlock Now"
|
4787 |
msgstr ""
|
4788 |
|
4789 |
+
#: src/processors/admin_access_restriction.php:246
|
4790 |
+
#: src/processors/admin_access_restriction.php:483
|
4791 |
msgid "Security Admin Login"
|
4792 |
msgstr ""
|
4793 |
|
4794 |
+
#: src/processors/admin_access_restriction.php:458
|
4795 |
#: src/processors/hackprotect_ptguard.php:63
|
4796 |
msgid "Editing this option is currently restricted."
|
4797 |
msgstr ""
|
4798 |
|
4799 |
+
#: src/processors/admin_access_restriction.php:478
|
4800 |
msgid "Unlock"
|
4801 |
msgstr ""
|
4802 |
|
4803 |
+
#: src/processors/audit_trail_emails.php:32
|
4804 |
#, php-format
|
4805 |
msgid "There was an attempt to send an email using the \"%s\" function."
|
4806 |
msgstr ""
|
4807 |
|
4808 |
+
#: src/processors/audit_trail_emails.php:33
|
4809 |
#, php-format
|
4810 |
msgid "It was sent to \"%s\" with the subject \"%s\"."
|
4811 |
msgstr ""
|
4812 |
|
4813 |
+
#: src/processors/audit_trail_emails.php:36
|
4814 |
+
#, php-format
|
4815 |
+
msgid "The \"%s\" function was called from the file \"%s\" on line %s."
|
4816 |
+
msgstr ""
|
4817 |
+
|
4818 |
+
#: src/processors/audit_trail_emails.php:44
|
4819 |
+
#, php-format
|
4820 |
+
msgid "Attempting to log email, but data was not of the correct type (%s)"
|
4821 |
+
msgstr ""
|
4822 |
+
|
4823 |
#: src/processors/audit_trail_plugins.php:28
|
4824 |
#, php-format
|
4825 |
msgid "Plugin \"%s\" was activated."
|
4842 |
msgid "WordPress Post entitled \"%s\" was permanently deleted from trash."
|
4843 |
msgstr ""
|
4844 |
|
4845 |
+
#: src/processors/audit_trail_posts.php:45
|
4846 |
msgid "moved to trash"
|
4847 |
msgstr ""
|
4848 |
|
4849 |
+
#: src/processors/audit_trail_posts.php:49
|
4850 |
msgid "recovered from trash"
|
4851 |
msgstr ""
|
4852 |
|
4853 |
#: src/processors/audit_trail_posts.php:55
|
4854 |
+
#: src/processors/audit_trail_posts.php:68
|
4855 |
+
msgid "updated"
|
4856 |
msgstr ""
|
4857 |
|
4858 |
#: src/processors/audit_trail_posts.php:59
|
4859 |
+
msgid "published"
|
4860 |
msgstr ""
|
4861 |
|
4862 |
+
#: src/processors/audit_trail_posts.php:64
|
4863 |
+
msgid "unpublished"
|
4864 |
msgstr ""
|
4865 |
|
4866 |
+
#: src/processors/audit_trail_posts.php:72
|
4867 |
#, php-format
|
4868 |
msgid "Post entitled \"%s\" was %s."
|
4869 |
msgstr ""
|
4870 |
|
4871 |
+
#: src/processors/audit_trail_posts.php:73
|
4872 |
+
msgid "Post Type"
|
4873 |
+
msgstr ""
|
4874 |
+
|
4875 |
#: src/processors/audit_trail_themes.php:25
|
4876 |
#, php-format
|
4877 |
msgid "Theme \"%s\" was activated."
|
4894 |
msgid "Attempted user login by \"%s\" failed."
|
4895 |
msgstr ""
|
4896 |
|
4897 |
+
#: src/processors/audit_trail_users.php:53
|
4898 |
msgid "New WordPress user registered."
|
4899 |
msgstr ""
|
4900 |
|
4901 |
+
#: src/processors/audit_trail_users.php:55
|
4902 |
#, php-format
|
4903 |
msgid "New username is \"%s\" with email address \"%s\"."
|
4904 |
msgstr ""
|
4905 |
|
4906 |
+
#: src/processors/audit_trail_users.php:69
|
4907 |
msgid "WordPress user deleted."
|
4908 |
msgstr ""
|
4909 |
|
4910 |
+
#: src/processors/audit_trail_users.php:73
|
4911 |
+
msgid "User is unknown as it could not be loaded."
|
4912 |
+
msgstr ""
|
4913 |
+
|
4914 |
+
#: src/processors/audit_trail_users.php:76
|
4915 |
#, php-format
|
4916 |
msgid "Username was \"%s\" with email address \"%s\"."
|
4917 |
msgstr ""
|
4918 |
|
4919 |
+
#: src/processors/audit_trail_users.php:83
|
4920 |
msgid "Their posts were not reassigned to another user."
|
4921 |
msgstr ""
|
4922 |
|
4923 |
+
#: src/processors/audit_trail_users.php:86
|
4924 |
#, php-format
|
4925 |
msgid "Their posts were reassigned to user \"%s\"."
|
4926 |
msgstr ""
|
4935 |
msgid "WordPress Permalinks Structure was updated from \"%s\" to \"%s\"."
|
4936 |
msgstr ""
|
4937 |
|
4938 |
+
#: src/processors/autoupdates.php:459
|
4939 |
#, php-format
|
4940 |
msgid ""
|
4941 |
"This is a quick notification from the %s that WordPress Automatic Updates "
|
4942 |
"just completed on your site with the following results."
|
4943 |
msgstr ""
|
4944 |
|
4945 |
+
#: src/processors/autoupdates.php:471
|
4946 |
msgid "Plugins Updated:"
|
4947 |
msgstr ""
|
4948 |
|
4949 |
+
#: src/processors/autoupdates.php:479
|
4950 |
+
#, php-format
|
4951 |
+
msgid "Plugin \"%s\" auto-updated from \"%s\" to version \"%s\""
|
4952 |
+
msgstr ""
|
4953 |
+
|
4954 |
+
#: src/processors/autoupdates.php:496
|
4955 |
msgid "Themes Updated:"
|
4956 |
msgstr ""
|
4957 |
|
4958 |
+
#: src/processors/autoupdates.php:504
|
4959 |
+
#, php-format
|
4960 |
+
msgid "Theme \"%s\" auto-updated from \"%s\" to version \"%s\""
|
4961 |
+
msgstr ""
|
4962 |
+
|
4963 |
+
#: src/processors/autoupdates.php:519
|
4964 |
msgid "WordPress Core Updated:"
|
4965 |
msgstr ""
|
4966 |
|
4967 |
+
#: src/processors/autoupdates.php:538
|
4968 |
msgid "Thank you."
|
4969 |
msgstr ""
|
4970 |
|
4971 |
+
#: src/processors/autoupdates.php:540
|
4972 |
#, php-format
|
4973 |
msgid "Notice: %s"
|
4974 |
msgstr ""
|
4975 |
|
4976 |
+
#: src/processors/autoupdates.php:540
|
4977 |
msgid "Automatic Updates Completed"
|
4978 |
msgstr ""
|
4979 |
|
4980 |
+
#: src/processors/autoupdates.php:562
|
4981 |
msgid ""
|
4982 |
"Automatic updates for this plugin is controlled by another plugin or setting."
|
4983 |
msgstr ""
|
4984 |
|
4985 |
+
#: src/processors/base_commentsfilter.php:116
|
4986 |
+
#: src/processors/commentsfilter_antibotspam.php:497
|
4987 |
#, php-format
|
4988 |
msgid "%s plugin marked this comment as \"%s\"."
|
4989 |
msgstr ""
|
4990 |
|
4991 |
+
#: src/processors/base_commentsfilter.php:116
|
4992 |
+
#: src/processors/commentsfilter_antibotspam.php:497
|
4993 |
#, php-format
|
4994 |
msgid "Reason: %s"
|
4995 |
msgstr ""
|
4996 |
|
4997 |
+
#: src/processors/base_plugin.php:69
|
4998 |
msgid "I'd rather not show this support"
|
4999 |
msgstr ""
|
5000 |
|
5001 |
+
#: src/processors/base_plugin.php:69
|
5002 |
msgid "I've done this already"
|
5003 |
msgstr ""
|
5004 |
|
5005 |
+
#: src/processors/base_plugin.php:93
|
5006 |
msgid "I don't need the setup wizard just now"
|
5007 |
msgstr ""
|
5008 |
|
5009 |
+
#: src/processors/base_plugin.php:94
|
5010 |
#, php-format
|
5011 |
msgid "Get started quickly with the %s Setup Wizard"
|
5012 |
msgstr ""
|
5013 |
|
5014 |
+
#: src/processors/base_plugin.php:95
|
5015 |
#, php-format
|
5016 |
msgid ""
|
5017 |
"The welcome wizard will help you get setup quickly and become familiar with "
|
5018 |
"some of the core %s features"
|
5019 |
msgstr ""
|
5020 |
|
5021 |
+
#: src/processors/base_plugin.php:96
|
5022 |
#, php-format
|
5023 |
msgid ""
|
5024 |
"%s has a helpful setup wizard to walk you through the main features. "
|
5025 |
"Unfortunately your PHP version is reeeaally old as it needs PHP 5.4+"
|
5026 |
msgstr ""
|
5027 |
|
5028 |
+
#: src/processors/base_plugin.php:124
|
5029 |
#, php-format
|
5030 |
msgid "Your PHP version is very old: %s"
|
5031 |
msgstr ""
|
5032 |
|
5033 |
+
#: src/processors/base_plugin.php:125
|
5034 |
#, php-format
|
5035 |
msgid "Newer features of %s do not support your PHP version."
|
5036 |
msgstr ""
|
5037 |
|
5038 |
+
#: src/processors/base_plugin.php:126
|
5039 |
msgid ""
|
5040 |
"You should ask your host to upgrade or provide a much newer PHP version."
|
5041 |
msgstr ""
|
5042 |
|
5043 |
+
#: src/processors/base_plugin.php:127
|
5044 |
msgid "Please read here for further information:"
|
5045 |
msgstr ""
|
5046 |
|
5047 |
+
#: src/processors/base_plugin.php:128 src/processors/base_plugin.php:169
|
5048 |
+
#: src/processors/base_plugin.php:193
|
5049 |
msgid "Dismiss this notice"
|
5050 |
msgstr ""
|
5051 |
|
5052 |
+
#: src/processors/base_plugin.php:129
|
5053 |
msgid "Dropping support for PHP 5.2 and 5.3"
|
5054 |
msgstr ""
|
5055 |
|
5056 |
+
#: src/processors/base_plugin.php:166
|
5057 |
#, php-format
|
5058 |
msgid "Update available for the %s plugin."
|
5059 |
msgstr ""
|
5060 |
|
5061 |
+
#: src/processors/base_plugin.php:168
|
5062 |
msgid "Please click to update immediately"
|
5063 |
msgstr ""
|
5064 |
|
5065 |
+
#: src/processors/base_plugin.php:189
|
5066 |
#, php-format
|
5067 |
msgid "Can you help translate the %s plugin?"
|
5068 |
msgstr ""
|
5069 |
|
5070 |
+
#: src/processors/base_plugin.php:191
|
5071 |
#, php-format
|
5072 |
msgid "Head over to: %s"
|
5073 |
msgstr ""
|
5074 |
|
5075 |
+
#: src/processors/base_wpsf.php:99 src/processors/base_wpsf.php:107
|
5076 |
+
#: src/processors/loginprotect_googleauthenticator.php:223
|
5077 |
msgid "Whoops."
|
5078 |
msgstr ""
|
5079 |
|
5080 |
+
#: src/processors/base_wpsf.php:99
|
5081 |
msgid "Google reCAPTCHA was not submitted."
|
5082 |
msgstr ""
|
5083 |
|
5084 |
+
#: src/processors/base_wpsf.php:107
|
5085 |
msgid "Google reCAPTCHA verification failed."
|
5086 |
msgstr ""
|
5087 |
|
5088 |
+
#: src/processors/base_wpsf.php:108
|
5089 |
+
msgid "Maybe refresh the page and try again."
|
5090 |
+
msgstr ""
|
5091 |
+
|
5092 |
+
#: src/processors/comments_filter.php:70
|
5093 |
msgid ""
|
5094 |
"It appears you have Akismet Anti-SPAM running alongside the our human Anti-"
|
5095 |
"SPAM filter."
|
5096 |
msgstr ""
|
5097 |
|
5098 |
+
#: src/processors/comments_filter.php:71
|
5099 |
msgid "This is not recommended and you should disable Akismet."
|
5100 |
msgstr ""
|
5101 |
|
5102 |
+
#: src/processors/comments_filter.php:72
|
5103 |
msgid "Click to deactivate Akismet now."
|
5104 |
msgstr ""
|
5105 |
|
5106 |
+
#: src/processors/commentsfilter_antibotspam.php:182
|
5107 |
+
#: src/processors/commentsfilter_antibotspam.php:187
|
5108 |
+
#: src/processors/commentsfilter_antibotspam.php:192
|
5109 |
#, php-format
|
5110 |
msgid "Failed GASP Bot Filter Test (%s)"
|
5111 |
msgstr ""
|
5112 |
|
5113 |
+
#: src/processors/commentsfilter_antibotspam.php:182
|
5114 |
msgid "checkbox"
|
5115 |
msgstr ""
|
5116 |
|
5117 |
+
#: src/processors/commentsfilter_antibotspam.php:187
|
5118 |
msgid "honeypot"
|
5119 |
msgstr ""
|
5120 |
|
5121 |
+
#: src/processors/commentsfilter_antibotspam.php:192
|
5122 |
msgid "comment token failure"
|
5123 |
msgstr ""
|
5124 |
|
5125 |
+
#: src/processors/commentsfilter_humanspam.php:131
|
5126 |
#, php-format
|
5127 |
msgid "Human SPAM filter found \"%s\" in \"%s\""
|
5128 |
msgstr ""
|
5129 |
|
5130 |
+
#: src/processors/email.php:63
|
5131 |
msgid "Hi !"
|
5132 |
msgstr ""
|
5133 |
|
5134 |
+
#: src/processors/email.php:74
|
5135 |
#, php-format
|
5136 |
msgid "Email sent from the %s Plugin v%s, on %s."
|
5137 |
msgstr ""
|
5138 |
|
5139 |
+
#: src/processors/email.php:79
|
5140 |
msgid "Note: Email delays are caused by website hosting and email providers."
|
5141 |
msgstr ""
|
5142 |
|
5143 |
+
#: src/processors/email.php:80
|
5144 |
#, php-format
|
5145 |
msgid "Time Sent: %s"
|
5146 |
msgstr ""
|
5147 |
|
5148 |
+
#: src/processors/firewall.php:70 src/processors/firewall.php:83
|
5149 |
#, php-format
|
5150 |
msgid "Skipping firewall checking for this visit: %s."
|
5151 |
msgstr ""
|
5152 |
|
5153 |
+
#: src/processors/firewall.php:70
|
5154 |
msgid "Parsing the URI failed"
|
5155 |
msgstr ""
|
5156 |
|
5157 |
+
#: src/processors/firewall.php:83
|
5158 |
msgid "Visitor detected as Search Engine Bot"
|
5159 |
msgstr ""
|
5160 |
|
5161 |
+
#: src/processors/firewall.php:160 src/processors/firewall.php:218
|
5162 |
#, php-format
|
5163 |
msgid "Firewall Trigger: %s."
|
5164 |
msgstr ""
|
5165 |
|
5166 |
+
#: src/processors/firewall.php:160 src/processors/firewall.php:539
|
5167 |
msgid "EXE File Uploads"
|
5168 |
msgstr ""
|
5169 |
|
5170 |
+
#: src/processors/firewall.php:211
|
5171 |
msgid "Something in the URL, Form or Cookie data wasn't appropriate."
|
5172 |
msgstr ""
|
5173 |
|
5174 |
+
#: src/processors/firewall.php:212
|
5175 |
msgid "Page parameter failed firewall check."
|
5176 |
msgstr ""
|
5177 |
|
5178 |
+
#: src/processors/firewall.php:213
|
5179 |
#, php-format
|
5180 |
msgid "The offending parameter was \"%s\" with a value of \"%s\"."
|
5181 |
msgstr ""
|
5182 |
|
5183 |
+
#: src/processors/firewall.php:259
|
5184 |
msgid "Visitor connection was killed with wp_die()"
|
5185 |
msgstr ""
|
5186 |
|
5187 |
+
#: src/processors/firewall.php:262
|
5188 |
msgid "Visitor connection was killed with wp_die() and a message"
|
5189 |
msgstr ""
|
5190 |
|
5191 |
+
#: src/processors/firewall.php:265
|
5192 |
msgid "Visitor was sent HOME"
|
5193 |
msgstr ""
|
5194 |
|
5195 |
+
#: src/processors/firewall.php:268
|
5196 |
msgid "Visitor was sent 404"
|
5197 |
msgstr ""
|
5198 |
|
5199 |
+
#: src/processors/firewall.php:279
|
|
|
|
|
|
|
|
|
5200 |
#, php-format
|
5201 |
+
msgid "Successfully sent Firewall Block email alert to: %s"
|
5202 |
msgstr ""
|
5203 |
|
5204 |
+
#: src/processors/firewall.php:282
|
5205 |
#, php-format
|
5206 |
+
msgid "Failed to send Firewall Block email alert to: %s"
|
5207 |
msgstr ""
|
5208 |
|
5209 |
+
#: src/processors/firewall.php:287
|
5210 |
#, php-format
|
5211 |
+
msgid "Firewall Block Response: %s."
|
5212 |
msgstr ""
|
5213 |
|
5214 |
+
#: src/processors/firewall.php:466
|
5215 |
#, php-format
|
5216 |
msgid "%s has blocked a page visit to your site."
|
5217 |
msgstr ""
|
5218 |
|
5219 |
+
#: src/processors/firewall.php:467
|
5220 |
msgid "Log details for this visitor are below:"
|
5221 |
msgstr ""
|
5222 |
|
5223 |
+
#: src/processors/firewall.php:472
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5224 |
#, php-format
|
5225 |
msgid "You can look up the offending IP Address here: %s"
|
5226 |
msgstr ""
|
5227 |
|
5228 |
+
#: src/processors/firewall.php:473
|
5229 |
msgid "Firewall Block Alert"
|
5230 |
msgstr ""
|
5231 |
|
5232 |
+
#: src/processors/firewall.php:527
|
5233 |
msgid "Directory Traversal"
|
5234 |
msgstr ""
|
5235 |
|
5236 |
+
#: src/processors/firewall.php:542
|
5237 |
msgid "Leading Schema"
|
5238 |
msgstr ""
|
5239 |
|
5240 |
+
#: src/processors/firewall.php:548
|
5241 |
msgid "Aggressive Rules"
|
5242 |
msgstr ""
|
5243 |
|
5244 |
+
#: src/processors/firewall.php:551
|
5245 |
msgid "Unknown Rules"
|
5246 |
msgstr ""
|
5247 |
|
5250 |
msgid "%s escaped HTML the following comment due to its size: %s"
|
5251 |
msgstr ""
|
5252 |
|
5253 |
+
#: src/processors/hackprotect_corechecksumscan.php:27
|
5254 |
msgid "File was successfully replaced with an original from WordPress.org"
|
5255 |
msgstr ""
|
5256 |
|
5257 |
+
#: src/processors/hackprotect_corechecksumscan.php:30
|
5258 |
msgid "File was not replaced"
|
5259 |
msgstr ""
|
5260 |
|
5261 |
+
#: src/processors/hackprotect_corechecksumscan.php:244
|
5262 |
+
msgid "Modified Core WordPress Files Discovered"
|
|
|
5263 |
msgstr ""
|
5264 |
|
5265 |
+
#: src/processors/hackprotect_corechecksumscan.php:249
|
|
|
|
|
5266 |
#, php-format
|
5267 |
+
msgid "Sent Checksum Scan Notification email alert to: %s"
|
|
|
|
|
|
|
|
|
|
|
5268 |
msgstr ""
|
5269 |
|
5270 |
+
#: src/processors/hackprotect_corechecksumscan.php:264
|
5271 |
+
#, php-format
|
5272 |
+
msgid "The %s Core File Scanner found files with potential problems."
|
5273 |
msgstr ""
|
5274 |
|
5275 |
+
#: src/processors/hackprotect_corechecksumscan.php:265
|
5276 |
+
#: src/processors/hackprotect_filecleanerscan.php:254
|
5277 |
+
#: src/processors/hackprotect_ptguard.php:460
|
5278 |
+
#: src/processors/user_management.php:209
|
5279 |
+
#: src/processors/user_management.php:237
|
5280 |
+
msgid "Site URL"
|
5281 |
msgstr ""
|
5282 |
|
5283 |
#: src/processors/hackprotect_corechecksumscan.php:274
|
5285 |
msgid "%s has already attempted to repair the files."
|
5286 |
msgstr ""
|
5287 |
|
5288 |
+
#: src/processors/hackprotect_corechecksumscan.php:275
|
5289 |
+
msgid ""
|
5290 |
+
"But, you should always check these files to ensure everything is as you "
|
5291 |
+
"expect."
|
5292 |
+
msgstr ""
|
5293 |
+
|
5294 |
#: src/processors/hackprotect_corechecksumscan.php:278
|
|
|
5295 |
msgid ""
|
5296 |
+
"You should review these files and replace them with official versions if "
|
5297 |
+
"required."
|
5298 |
msgstr ""
|
5299 |
|
5300 |
+
#: src/processors/hackprotect_corechecksumscan.php:279
|
5301 |
+
msgid ""
|
5302 |
+
"Alternatively you can have the plugin attempt to repair/replace these files "
|
5303 |
+
"automatically."
|
5304 |
msgstr ""
|
5305 |
|
5306 |
+
#: src/processors/hackprotect_corechecksumscan.php:286
|
5307 |
+
#: src/processors/hackprotect_filecleanerscan.php:272
|
5308 |
+
msgid "We recommend you run the scanner to review your site"
|
5309 |
msgstr ""
|
5310 |
|
5311 |
+
#: src/processors/hackprotect_corechecksumscan.php:290
|
5312 |
+
#: src/processors/hackprotect_filecleanerscan.php:276
|
5313 |
msgid "Run Scanner"
|
5314 |
msgstr ""
|
5315 |
|
5316 |
+
#: src/processors/hackprotect_corechecksumscan.php:296
|
5317 |
+
#: src/processors/hackprotect_filecleanerscan.php:282
|
5318 |
+
msgid "More Info On This Scanner"
|
|
|
5319 |
msgstr ""
|
5320 |
|
5321 |
#: src/processors/hackprotect_corechecksumscan.php:327
|
5322 |
msgid ""
|
5323 |
+
"The contents of the core files listed below don't match official WordPress "
|
5324 |
+
"files:"
|
|
|
|
|
|
|
|
|
|
|
|
|
5325 |
msgstr ""
|
5326 |
|
5327 |
+
#: src/processors/hackprotect_corechecksumscan.php:333
|
5328 |
+
msgid "The WordPress Core Files listed below are missing:"
|
|
|
|
|
5329 |
msgstr ""
|
5330 |
|
5331 |
+
#: src/processors/hackprotect_corechecksumscan.php:354
|
5332 |
+
#: src/processors/hackprotect_filecleanerscan.php:312
|
5333 |
msgid "Repair file now"
|
5334 |
msgstr ""
|
5335 |
|
5336 |
+
#: src/processors/hackprotect_corechecksumscan.php:357
|
5337 |
+
#: src/processors/hackprotect_filecleanerscan.php:315
|
5338 |
msgid "WordPress.org source file"
|
5339 |
msgstr ""
|
5340 |
|
5341 |
+
#: src/processors/hackprotect_filecleanerscan.php:232
|
5342 |
+
msgid "Unrecognised WordPress Files Detected"
|
|
|
5343 |
msgstr ""
|
5344 |
|
5345 |
#: src/processors/hackprotect_filecleanerscan.php:237
|
5346 |
+
#, php-format
|
5347 |
+
msgid "Sent Unrecognised File Scan Notification email alert to: %s"
|
5348 |
msgstr ""
|
5349 |
|
5350 |
+
#: src/processors/hackprotect_filecleanerscan.php:253
|
5351 |
#, php-format
|
5352 |
+
msgid "The %s Unrecognised File Scanner found files which you need to review."
|
5353 |
+
msgstr ""
|
5354 |
+
|
5355 |
+
#: src/processors/hackprotect_filecleanerscan.php:259
|
5356 |
+
msgid "Files that were discovered"
|
5357 |
msgstr ""
|
5358 |
|
5359 |
+
#: src/processors/hackprotect_filecleanerscan.php:266
|
|
|
5360 |
#, php-format
|
5361 |
msgid "%s has attempted to delete these files based on your current settings."
|
5362 |
msgstr ""
|
5363 |
|
5364 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:82
|
5365 |
#: src/processors/hackprotect_wpvulnscan.php:177
|
5366 |
#, php-format
|
5367 |
msgid "Plugin Name: %s"
|
5368 |
msgstr ""
|
5369 |
|
5370 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:83
|
5371 |
#: src/processors/hackprotect_wpvulnscan.php:179
|
5372 |
#, php-format
|
5373 |
msgid "Vulnerability Type: %s"
|
5374 |
msgstr ""
|
5375 |
|
5376 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:84
|
5377 |
#, php-format
|
5378 |
msgid "Vulnerable Plugin Version Range: %s"
|
5379 |
msgstr ""
|
5380 |
|
5381 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:85
|
5382 |
#: src/processors/hackprotect_wpvulnscan.php:181
|
5383 |
#, php-format
|
5384 |
msgid "Further Information: %s"
|
5385 |
msgstr ""
|
5386 |
|
5387 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:102
|
5388 |
#, php-format
|
5389 |
msgid ""
|
5390 |
"%s has detected a plugin with a known security vulnerability on your site."
|
5391 |
msgstr ""
|
5392 |
|
5393 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:103
|
5394 |
+
#: src/processors/hackprotect_wpvulnscan.php:212
|
5395 |
msgid "Details for the plugin(s) are below:"
|
5396 |
msgstr ""
|
5397 |
|
5398 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:108
|
5399 |
+
#: src/processors/hackprotect_wpvulnscan.php:217
|
5400 |
msgid "You should update or remove these plugins at your earliest convenience."
|
5401 |
msgstr ""
|
5402 |
|
5403 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:110
|
5404 |
+
#: src/processors/hackprotect_wpvulnscan.php:220
|
5405 |
msgid "Plugin(s) Discovered With Known Security Vulnerabilities."
|
5406 |
msgstr ""
|
5407 |
|
5408 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:116
|
5409 |
+
#: src/processors/hackprotect_wpvulnscan.php:226
|
5410 |
#, php-format
|
5411 |
msgid "Successfully sent Plugin Vulnerability Notification email alert to: %s"
|
5412 |
msgstr ""
|
5413 |
|
5414 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:119
|
5415 |
+
#: src/processors/hackprotect_wpvulnscan.php:229
|
5416 |
#, php-format
|
5417 |
msgid "Failed to send Plugin Vulnerability Notification email alert to: %s"
|
5418 |
msgstr ""
|
5419 |
|
5420 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:152
|
5421 |
#, php-format
|
5422 |
msgid ""
|
5423 |
"%s has discovered that the currently installed version of the \"%s\" plugin "
|
5424 |
"has a known security vulnerability."
|
5425 |
msgstr ""
|
5426 |
|
5427 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:153
|
5428 |
#: src/processors/hackprotect_wpvulnscan.php:145
|
5429 |
msgid "Vulnerability Type"
|
5430 |
msgstr ""
|
5431 |
|
5432 |
+
#: src/processors/hackprotect_pluginvulnerabilities.php:155
|
5433 |
msgid "Vulnerable Versions"
|
5434 |
msgstr ""
|
5435 |
|
5436 |
+
#: src/processors/hackprotect_ptguard.php:414
|
5437 |
msgid "Silenced repeated email alert from Plugin/Theme Scan Guard"
|
5438 |
msgstr ""
|
5439 |
|
5440 |
+
#: src/processors/hackprotect_ptguard.php:456
|
5441 |
#, php-format
|
5442 |
msgid ""
|
5443 |
"%s has detected at least 1 Plugins/Themes have been modified on your site."
|
5444 |
msgstr ""
|
5445 |
|
5446 |
+
#: src/processors/hackprotect_ptguard.php:458
|
5447 |
msgid ""
|
5448 |
"You will receive only 1 email notification about these changes in a 1 week "
|
5449 |
"period."
|
5450 |
msgstr ""
|
5451 |
|
5452 |
+
#: src/processors/hackprotect_ptguard.php:462
|
5453 |
msgid "Details of the problem items are below:"
|
5454 |
msgstr ""
|
5455 |
|
5456 |
+
#: src/processors/hackprotect_ptguard.php:467
|
5457 |
msgid "Modified Plugins:"
|
5458 |
msgstr ""
|
5459 |
|
5460 |
+
#: src/processors/hackprotect_ptguard.php:475
|
5461 |
msgid "Modified Themes:"
|
5462 |
msgstr ""
|
5463 |
|
5464 |
+
#: src/processors/hackprotect_ptguard.php:485
|
5465 |
msgid "Run the scanner"
|
5466 |
msgstr ""
|
5467 |
|
5468 |
+
#: src/processors/hackprotect_ptguard.php:491
|
5469 |
msgid "Plugins/Themes Have Been Altered"
|
5470 |
msgstr ""
|
5471 |
|
5472 |
+
#: src/processors/hackprotect_ptguard.php:496
|
5473 |
#, php-format
|
5474 |
msgid "Successfully sent Plugin/Theme Guard email alert to: %s"
|
5475 |
msgstr ""
|
5476 |
|
5477 |
+
#: src/processors/hackprotect_ptguard.php:499
|
5478 |
#, php-format
|
5479 |
msgid "Failed to send Plugin/Theme Guard email alert to: %s"
|
5480 |
msgstr ""
|
5508 |
msgid "Fixed Version: %s"
|
5509 |
msgstr ""
|
5510 |
|
5511 |
+
#: src/processors/hackprotect_wpvulnscan.php:211
|
5512 |
#, php-format
|
5513 |
msgid "%s has detected plugins with known security vulnerabilities."
|
5514 |
msgstr ""
|
5515 |
|
5516 |
+
#: src/processors/hackprotect_wpvulnscan.php:218
|
5517 |
#, php-format
|
5518 |
msgid "Go To Your Plugins: %s"
|
5519 |
msgstr ""
|
5520 |
|
5521 |
+
#: src/processors/ips.php:60
|
5522 |
#, php-format
|
5523 |
msgid "404 detected at \"%s\""
|
5524 |
msgstr ""
|
5525 |
|
5526 |
+
#: src/processors/ips.php:90
|
5527 |
#, php-format
|
5528 |
msgid "%s is ignoring you"
|
5529 |
msgstr ""
|
5530 |
|
5531 |
+
#: src/processors/ips.php:92
|
5532 |
msgid ""
|
5533 |
"Your IP address is whitelisted and NO features you activate apply to you."
|
5534 |
msgstr ""
|
5535 |
|
5536 |
+
#: src/processors/ips.php:93
|
5537 |
msgid "Including the hiding the WP Login page."
|
5538 |
msgstr ""
|
5539 |
|
5540 |
+
#: src/processors/ips.php:225
|
5541 |
#, php-format
|
5542 |
msgid ""
|
5543 |
"Visitor was found to be on the Black List with IP address \"%s\" and their "
|
5544 |
"connection was killed."
|
5545 |
msgstr ""
|
5546 |
|
5547 |
+
#: src/processors/ips.php:235
|
5548 |
#, php-format
|
5549 |
msgid "You have been black listed by the %s plugin."
|
5550 |
msgstr ""
|
5551 |
|
5552 |
+
#: src/processors/ips.php:239
|
5553 |
#, php-format
|
5554 |
msgid ""
|
5555 |
"You tripped the security plugin defenses a total of %s times making you a "
|
5556 |
"suspect."
|
5557 |
msgstr ""
|
5558 |
|
5559 |
+
#: src/processors/ips.php:240
|
5560 |
msgid "If you believe this to be in error, please contact the site owner."
|
5561 |
msgstr ""
|
5562 |
|
5563 |
+
#: src/processors/ips.php:241
|
5564 |
#, php-format
|
5565 |
msgid ""
|
5566 |
"Time remaining until you are automatically removed from the black list: %s "
|
5567 |
"minute(s)"
|
5568 |
msgstr ""
|
5569 |
|
5570 |
+
#: src/processors/ips.php:242
|
5571 |
msgid ""
|
5572 |
"If you attempt to access the site within this period the counter will be "
|
5573 |
"reset."
|
5574 |
msgstr ""
|
5575 |
|
5576 |
+
#: src/processors/ips.php:293
|
5577 |
#, php-format
|
5578 |
msgid "Auto Black List transgression counter was incremented from %s to %s."
|
5579 |
msgstr ""
|
5580 |
|
5581 |
+
#: src/processors/ips.php:302
|
5582 |
msgid "Auto Black List transgression counter was started for visitor."
|
5583 |
msgstr ""
|
5584 |
|
5585 |
+
#: src/processors/ips.php:470
|
5586 |
msgid "No Label"
|
5587 |
msgstr ""
|
5588 |
|
5589 |
+
#: src/processors/lockdown.php:106
|
5590 |
#, php-format
|
5591 |
msgid "Anonymous access to the WordPress Rest API has been restricted by %s."
|
5592 |
msgstr ""
|
5593 |
|
5594 |
+
#: src/processors/lockdown.php:216
|
5595 |
#, php-format
|
5596 |
msgid ""
|
5597 |
"The \"author\" query parameter has been blocked by %s to protect against "
|
5598 |
"user login name fishing."
|
5599 |
msgstr ""
|
5600 |
|
|
|
|
|
|
|
|
|
5601 |
#: src/processors/login_protect.php:68
|
5602 |
msgid "Please verify email has been received"
|
5603 |
msgstr ""
|
5625 |
msgid "To turn this notice off, disable 2-Factor Authentication."
|
5626 |
msgstr ""
|
5627 |
|
5628 |
+
#: src/processors/loginprotect_cooldown.php:24
|
5629 |
+
msgid "Request Cooldown in effect."
|
5630 |
msgstr ""
|
5631 |
|
5632 |
+
#: src/processors/loginprotect_cooldown.php:26
|
5633 |
#, php-format
|
5634 |
+
msgid "You must wait %s seconds before attempting this action again."
|
5635 |
msgstr ""
|
5636 |
|
5637 |
+
#: src/processors/loginprotect_cooldown.php:31
|
5638 |
+
msgid ""
|
5639 |
+
"Cooldown triggered and request (login/register/lost-password) was blocked."
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5640 |
msgstr ""
|
5641 |
|
5642 |
+
#: src/processors/loginprotect_gasp.php:29
|
5643 |
msgid "You MUST enable Javascript to be able to login"
|
5644 |
msgstr ""
|
5645 |
|
5646 |
+
#: src/processors/loginprotect_gasp.php:60
|
5647 |
+
#: src/processors/loginprotect_gasp.php:104
|
5648 |
#, php-format
|
5649 |
msgid "User \"%s\" attempted to %s but GASP checkbox was not present."
|
5650 |
msgstr ""
|
5651 |
|
5652 |
+
#: src/processors/loginprotect_gasp.php:62
|
5653 |
+
#: src/processors/loginprotect_gasp.php:71
|
5654 |
+
#: src/processors/loginprotect_gasp.php:106
|
5655 |
+
#: src/processors/loginprotect_gasp.php:115
|
5656 |
msgid "Probably a BOT."
|
5657 |
msgstr ""
|
5658 |
|
5659 |
+
#: src/processors/loginprotect_gasp.php:65
|
5660 |
+
#: src/processors/loginprotect_gasp.php:109
|
5661 |
msgid "You must check that box to say you're not a bot."
|
5662 |
msgstr ""
|
5663 |
|
5664 |
+
#: src/processors/loginprotect_gasp.php:69
|
5665 |
+
#: src/processors/loginprotect_gasp.php:113
|
5666 |
#, php-format
|
5667 |
msgid "User \"%s\" attempted to %s but they were caught by the GASP honeypot."
|
5668 |
msgstr ""
|
5669 |
|
5670 |
+
#: src/processors/loginprotect_gasp.php:74
|
5671 |
+
#: src/processors/loginprotect_gasp.php:118
|
5672 |
#, php-format
|
5673 |
msgid "You appear to be a bot - terminating %s attempt."
|
5674 |
msgstr ""
|
5703 |
msgstr ""
|
5704 |
|
5705 |
#: src/processors/loginprotect_googleauthenticator.php:42
|
5706 |
+
#: src/processors/loginprotect_googleauthenticator.php:259
|
5707 |
msgid "Google Authenticator Code"
|
5708 |
msgstr ""
|
5709 |
|
5716 |
msgstr ""
|
5717 |
|
5718 |
#: src/processors/loginprotect_googleauthenticator.php:46
|
5719 |
+
#: src/processors/loginprotect_yubikey.php:46
|
5720 |
#, php-format
|
5721 |
msgid "Sorry, %s may not be added to another user's account."
|
5722 |
msgstr ""
|
5723 |
|
5724 |
#: src/processors/loginprotect_googleauthenticator.php:47
|
5725 |
+
#: src/processors/loginprotect_yubikey.php:47
|
5726 |
#, php-format
|
5727 |
msgid ""
|
5728 |
"Sorry, %s may only be removed from another user's account by a Security "
|
5730 |
msgstr ""
|
5731 |
|
5732 |
#: src/processors/loginprotect_googleauthenticator.php:48
|
5733 |
+
#: src/processors/loginprotect_twofactorauth.php:204
|
5734 |
+
#: src/processors/loginprotect_yubikey.php:48
|
5735 |
#, php-format
|
5736 |
msgid "Provided by %s"
|
5737 |
msgstr ""
|
5738 |
|
5739 |
#: src/processors/loginprotect_googleauthenticator.php:49
|
5740 |
+
#: src/processors/loginprotect_yubikey.php:49
|
5741 |
msgid "Understand how to remove Google Authenticator"
|
5742 |
msgstr ""
|
5743 |
|
5744 |
+
#: src/processors/loginprotect_googleauthenticator.php:107
|
5745 |
+
#: src/processors/loginprotect_googleauthenticator.php:153
|
5746 |
msgid "Google Authenticator was successfully removed from the account."
|
5747 |
msgstr ""
|
5748 |
|
5749 |
+
#: src/processors/loginprotect_googleauthenticator.php:110
|
5750 |
msgid ""
|
5751 |
"Google Authenticator could not be removed from the account - ensure your "
|
5752 |
"code is correct."
|
5753 |
msgstr ""
|
5754 |
|
5755 |
+
#: src/processors/loginprotect_googleauthenticator.php:145
|
5756 |
+
#: src/processors/loginprotect_yubikey.php:80
|
5757 |
msgid "One Time Password (OTP) was not valid."
|
5758 |
msgstr ""
|
5759 |
|
5760 |
+
#: src/processors/loginprotect_googleauthenticator.php:145
|
5761 |
+
#: src/processors/loginprotect_yubikey.php:80
|
5762 |
msgid "Please try again."
|
5763 |
msgstr ""
|
5764 |
|
5765 |
+
#: src/processors/loginprotect_googleauthenticator.php:158
|
5766 |
msgid ""
|
5767 |
"An email has been sent to you in order to confirm Google Authenticator "
|
5768 |
"removal"
|
5769 |
msgstr ""
|
5770 |
|
5771 |
+
#: src/processors/loginprotect_googleauthenticator.php:162
|
5772 |
msgid ""
|
5773 |
"We tried to send an email for you to confirm Google Authenticator removal "
|
5774 |
"but it failed."
|
5775 |
msgstr ""
|
5776 |
|
5777 |
+
#: src/processors/loginprotect_googleauthenticator.php:184
|
|
|
5778 |
#, php-format
|
5779 |
msgid "%s was successfully added to your account."
|
5780 |
msgstr ""
|
5781 |
|
5782 |
+
#: src/processors/loginprotect_googleauthenticator.php:223
|
5783 |
msgid "Did we forget to use the Google Authenticator?"
|
5784 |
msgstr ""
|
5785 |
|
5786 |
+
#: src/processors/loginprotect_googleauthenticator.php:230
|
5787 |
msgid "Oh dear."
|
5788 |
msgstr ""
|
5789 |
|
5790 |
+
#: src/processors/loginprotect_googleauthenticator.php:230
|
5791 |
msgid "Google Authenticator Code Failed."
|
5792 |
msgstr ""
|
5793 |
|
5794 |
+
#: src/processors/loginprotect_googleauthenticator.php:258
|
5795 |
msgid "Please use your Google Authenticator App to retrieve your code."
|
5796 |
msgstr ""
|
5797 |
|
5798 |
+
#: src/processors/loginprotect_googleauthenticator.php:277
|
5799 |
msgid ""
|
5800 |
"You have requested the removal of Google Authenticator from your WordPress "
|
5801 |
"account."
|
5802 |
msgstr ""
|
5803 |
|
5804 |
+
#: src/processors/loginprotect_googleauthenticator.php:278
|
5805 |
msgid "Please click the link below to confirm."
|
5806 |
msgstr ""
|
5807 |
|
5808 |
+
#: src/processors/loginprotect_googleauthenticator.php:283
|
5809 |
msgid "Google Authenticator Removal Confirmation"
|
5810 |
msgstr ""
|
5811 |
|
5812 |
+
#: src/processors/loginprotect_googleauthenticator.php:307
|
5813 |
msgid "Google Authenticator was successfully removed from this account."
|
5814 |
msgstr ""
|
5815 |
|
5816 |
+
#: src/processors/loginprotect_googleauthenticator.php:342
|
5817 |
#, php-format
|
5818 |
msgid ""
|
5819 |
"User \"%s\" verified their identity using Google Authenticator Two-Factor "
|
5820 |
"Authentication."
|
5821 |
msgstr ""
|
5822 |
|
5823 |
+
#: src/processors/loginprotect_googleauthenticator.php:350
|
5824 |
#, php-format
|
5825 |
msgid ""
|
5826 |
"User \"%s\" failed to verify their identity using Google Authenticator Two-"
|
5827 |
"Factor Authentication."
|
5828 |
msgstr ""
|
5829 |
|
5830 |
+
#: src/processors/loginprotect_intent.php:118
|
5831 |
msgid "Success"
|
5832 |
msgstr ""
|
5833 |
|
5834 |
+
#: src/processors/loginprotect_intent.php:118
|
5835 |
msgid "Thank you for authenticating your login."
|
5836 |
msgstr ""
|
5837 |
|
5838 |
+
#: src/processors/loginprotect_intent.php:122
|
5839 |
msgid "One or more of your authentication codes failed or was missing"
|
5840 |
msgstr ""
|
5841 |
|
5842 |
+
#: src/processors/loginprotect_intent.php:260
|
5843 |
msgid "Please supply all authentication codes"
|
5844 |
msgstr ""
|
5845 |
|
5846 |
+
#: src/processors/loginprotect_intent.php:263
|
5847 |
msgid "Please supply at least 1 authentication code"
|
5848 |
msgstr ""
|
5849 |
|
5850 |
+
#: src/processors/loginprotect_intent.php:275
|
5851 |
msgid "Cancel Login"
|
5852 |
msgstr ""
|
5853 |
|
5854 |
+
#: src/processors/loginprotect_intent.php:276
|
5855 |
msgid "Time Remaining"
|
5856 |
msgstr ""
|
5857 |
|
5858 |
+
#: src/processors/loginprotect_intent.php:277
|
5859 |
msgid "Calculating"
|
5860 |
msgstr ""
|
5861 |
|
5862 |
+
#: src/processors/loginprotect_intent.php:278
|
5863 |
msgid "Seconds"
|
5864 |
msgstr ""
|
5865 |
|
5866 |
+
#: src/processors/loginprotect_intent.php:279
|
5867 |
msgid "Login Expired"
|
5868 |
msgstr ""
|
5869 |
|
5870 |
+
#: src/processors/loginprotect_intent.php:280
|
5871 |
msgid "Verify My Login"
|
5872 |
msgstr ""
|
5873 |
|
5874 |
+
#: src/processors/loginprotect_intent.php:282
|
5875 |
msgid "What is this?"
|
5876 |
msgstr ""
|
5877 |
|
5878 |
+
#: src/processors/loginprotect_intent.php:284
|
5879 |
#, php-format
|
5880 |
msgid "%s Login Verification"
|
5881 |
msgstr ""
|
5882 |
|
5883 |
+
#: src/processors/loginprotect_intent.php:285
|
5884 |
#, php-format
|
5885 |
msgid "Don't ask again on this browser for %s day(s)"
|
5886 |
msgstr ""
|
5887 |
|
5888 |
+
#: src/processors/loginprotect_twofactorauth.php:42
|
5889 |
#, php-format
|
5890 |
msgid ""
|
5891 |
"User \"%s\" verified their identity using Email Two-Factor Authentication."
|
5892 |
msgstr ""
|
5893 |
|
5894 |
+
#: src/processors/loginprotect_twofactorauth.php:50
|
5895 |
#, php-format
|
5896 |
msgid ""
|
5897 |
"User \"%s\" failed to verify their identity using Email Two-Factor "
|
5898 |
"Authentication."
|
5899 |
msgstr ""
|
5900 |
|
5901 |
+
#: src/processors/loginprotect_twofactorauth.php:80
|
5902 |
msgid "This code was just sent to your registered Email address."
|
5903 |
msgstr ""
|
5904 |
|
5905 |
+
#: src/processors/loginprotect_twofactorauth.php:81
|
5906 |
msgid "Email OTP"
|
5907 |
msgstr ""
|
5908 |
|
5909 |
+
#: src/processors/loginprotect_twofactorauth.php:154
|
5910 |
msgid "Someone attempted to login into this WordPress site using your account."
|
5911 |
msgstr ""
|
5912 |
|
5913 |
+
#: src/processors/loginprotect_twofactorauth.php:155
|
5914 |
msgid "Login requires verification with the following code."
|
5915 |
msgstr ""
|
5916 |
|
5917 |
+
#: src/processors/loginprotect_twofactorauth.php:157
|
5918 |
#, php-format
|
5919 |
msgid "Verification Code: %s"
|
5920 |
msgstr ""
|
5921 |
|
5922 |
+
#: src/processors/loginprotect_twofactorauth.php:159
|
5923 |
msgid "Login Details"
|
5924 |
msgstr ""
|
5925 |
|
5926 |
+
#: src/processors/loginprotect_twofactorauth.php:160
|
5927 |
+
msgid "URL"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5928 |
msgstr ""
|
5929 |
|
5930 |
+
#: src/processors/loginprotect_twofactorauth.php:167
|
5931 |
msgid "Why no login link?"
|
5932 |
msgstr ""
|
5933 |
|
5934 |
+
#: src/processors/loginprotect_twofactorauth.php:171
|
5935 |
msgid "Two-Factor Login Verification"
|
5936 |
msgstr ""
|
5937 |
|
5938 |
+
#: src/processors/loginprotect_twofactorauth.php:176
|
5939 |
#, php-format
|
5940 |
msgid ""
|
5941 |
"User \"%s\" was sent an email to verify their Identity using Two-Factor "
|
5942 |
"Login Auth for IP address \"%s\"."
|
5943 |
msgstr ""
|
5944 |
|
5945 |
+
#: src/processors/loginprotect_twofactorauth.php:180
|
5946 |
#, php-format
|
5947 |
msgid ""
|
5948 |
"Tried to send email to User \"%s\" to verify their identity using Two-Factor "
|
5949 |
"Login Auth for IP address \"%s\", but email sending failed."
|
5950 |
msgstr ""
|
5951 |
|
5952 |
+
#: src/processors/loginprotect_twofactorauth.php:203
|
5953 |
msgid "Check the box to enable email-based login authentication."
|
5954 |
msgstr ""
|
5955 |
|
5986 |
"cannot parse the necessary information."
|
5987 |
msgstr ""
|
5988 |
|
5989 |
+
#: src/processors/loginprotect_yubikey.php:33
|
5990 |
msgid "This is your unique Yubikey Device ID."
|
5991 |
msgstr ""
|
5992 |
|
5993 |
+
#: src/processors/loginprotect_yubikey.php:34
|
5994 |
+
#: src/processors/loginprotect_yubikey.php:41
|
5995 |
+
msgid "Pro Only"
|
5996 |
+
msgstr ""
|
5997 |
+
|
5998 |
+
#: src/processors/loginprotect_yubikey.php:35
|
5999 |
+
msgid "Multiple Yubikey Device IDs are separated by a comma."
|
6000 |
+
msgstr ""
|
6001 |
+
|
6002 |
+
#: src/processors/loginprotect_yubikey.php:36
|
6003 |
msgid "Provide a One Time Password from your Yubikey."
|
6004 |
msgstr ""
|
6005 |
|
6006 |
+
#: src/processors/loginprotect_yubikey.php:38
|
6007 |
+
msgid "This will remove the Yubikey Device ID from your profile."
|
6008 |
msgstr ""
|
6009 |
|
6010 |
+
#: src/processors/loginprotect_yubikey.php:39
|
6011 |
+
msgid "This will add the Yubikey Device ID to your profile."
|
6012 |
msgstr ""
|
6013 |
|
6014 |
#: src/processors/loginprotect_yubikey.php:41
|
6015 |
+
msgid ""
|
6016 |
+
"If you provide a OTP from an alternative Yubikey device, it will also be "
|
6017 |
+
"added to your profile."
|
6018 |
+
msgstr ""
|
6019 |
+
|
6020 |
+
#: src/processors/loginprotect_yubikey.php:43
|
6021 |
msgid "Yubikey ID"
|
6022 |
msgstr ""
|
6023 |
|
6024 |
+
#: src/processors/loginprotect_yubikey.php:44
|
6025 |
+
#: src/processors/loginprotect_yubikey.php:264
|
6026 |
msgid "Yubikey OTP"
|
6027 |
msgstr ""
|
6028 |
|
6029 |
+
#: src/processors/loginprotect_yubikey.php:45
|
6030 |
msgid "Yubikey Authentication"
|
6031 |
msgstr ""
|
6032 |
|
6033 |
+
#: src/processors/loginprotect_yubikey.php:47
|
|
|
|
|
6034 |
msgid "Yubikey"
|
6035 |
msgstr ""
|
6036 |
|
6037 |
+
#: src/processors/loginprotect_yubikey.php:99
|
6038 |
+
#, php-format
|
6039 |
+
msgid "%s was removed from your profile."
|
6040 |
+
msgstr ""
|
6041 |
+
|
6042 |
+
#: src/processors/loginprotect_yubikey.php:100
|
6043 |
+
#: src/processors/loginprotect_yubikey.php:107
|
6044 |
+
msgid "Yubikey Device"
|
6045 |
+
msgstr ""
|
6046 |
+
|
6047 |
+
#: src/processors/loginprotect_yubikey.php:106
|
6048 |
+
#, php-format
|
6049 |
+
msgid "%s was added to your profile."
|
6050 |
+
msgstr ""
|
6051 |
+
|
6052 |
+
#: src/processors/loginprotect_yubikey.php:112
|
6053 |
+
msgid "No changes were made to your Yubikey configuration"
|
6054 |
+
msgstr ""
|
6055 |
+
|
6056 |
+
#: src/processors/loginprotect_yubikey.php:239
|
6057 |
+
#: src/processors/loginprotect_yubikey.php:359
|
6058 |
+
#, php-format
|
6059 |
+
msgid ""
|
6060 |
+
"User \"%s\" successfully logged in using a validated Yubikey One Time "
|
6061 |
+
"Password."
|
6062 |
+
msgstr ""
|
6063 |
+
|
6064 |
+
#: src/processors/loginprotect_yubikey.php:246
|
6065 |
#, php-format
|
6066 |
+
msgid ""
|
6067 |
+
"User \"%s\" failed to verify their identity using Yubikey One Time Password."
|
6068 |
+
msgstr ""
|
6069 |
+
|
6070 |
+
#: src/processors/loginprotect_yubikey.php:262
|
6071 |
+
msgid "Use your Yubikey to generate a new code."
|
6072 |
msgstr ""
|
6073 |
|
6074 |
+
#: src/processors/loginprotect_yubikey.php:339
|
6075 |
#, php-format
|
6076 |
msgid ""
|
6077 |
"User \"%s\" logged in without a Yubikey One Time Password because no "
|
6078 |
"username-yubikey pair was found for this user."
|
6079 |
msgstr ""
|
6080 |
|
6081 |
+
#: src/processors/loginprotect_yubikey.php:346
|
6082 |
#, php-format
|
6083 |
msgid ""
|
6084 |
"User \"%s\" attempted to login but Yubikey ID \"%s\" used was not in list of "
|
6085 |
"authorised keys."
|
6086 |
msgstr ""
|
6087 |
|
6088 |
+
#: src/processors/loginprotect_yubikey.php:352
|
6089 |
+
#: src/processors/loginprotect_yubikey.php:370
|
6090 |
#, php-format
|
6091 |
msgid "ERROR: %s"
|
6092 |
msgstr ""
|
6093 |
|
6094 |
+
#: src/processors/loginprotect_yubikey.php:352
|
6095 |
msgid ""
|
6096 |
"The Yubikey provided is not on the list of permitted keys for this user."
|
6097 |
msgstr ""
|
6098 |
|
6099 |
+
#: src/processors/loginprotect_yubikey.php:365
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6100 |
#, php-format
|
6101 |
msgid ""
|
6102 |
"User \"%s\" attempted to login but Yubikey One Time Password failed to "
|
6103 |
"validate due to invalid Yubi API response.\"."
|
6104 |
msgstr ""
|
6105 |
|
6106 |
+
#: src/processors/loginprotect_yubikey.php:370
|
6107 |
msgid "The Yubikey authentication was not validated successfully."
|
6108 |
msgstr ""
|
6109 |
|
6110 |
+
#: src/processors/plugin.php:206
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6111 |
#, php-format
|
6112 |
msgid "%s plugin is not currently processing requests"
|
6113 |
msgstr ""
|
6114 |
|
6115 |
+
#: src/processors/plugin.php:208
|
6116 |
#, php-format
|
6117 |
msgid "Please delete the \"%s\" file to reactivate the %s protection"
|
6118 |
msgstr ""
|
6119 |
|
6120 |
+
#: src/processors/plugin.php:212
|
6121 |
+
msgid "Click here to automatically delete the file"
|
6122 |
+
msgstr ""
|
6123 |
+
|
6124 |
+
#: src/processors/plugin.php:239
|
6125 |
msgid "Your Name"
|
6126 |
msgstr ""
|
6127 |
|
6128 |
+
#: src/processors/plugin.php:240
|
6129 |
msgid "Your Email"
|
6130 |
msgstr ""
|
6131 |
|
6132 |
+
#: src/processors/plugin_badge.php:40
|
6133 |
#, php-format
|
6134 |
msgid "%s is provided by %s"
|
6135 |
msgstr ""
|
6136 |
|
6137 |
+
#: src/processors/plugin_badge.php:45
|
6138 |
#, php-format
|
6139 |
msgid "Days Installed: %s"
|
6140 |
msgstr ""
|
6154 |
msgid "Site Secured"
|
6155 |
msgstr ""
|
6156 |
|
6157 |
+
#: src/processors/plugin_importexport.php:45
|
6158 |
+
msgid "Sent notifications to whitelisted sites for required options import."
|
6159 |
+
msgstr ""
|
6160 |
+
|
6161 |
+
#: src/processors/plugin_importexport.php:119
|
6162 |
+
msgid "Received notification that options import required."
|
6163 |
+
msgstr ""
|
6164 |
+
|
6165 |
+
#: src/processors/plugin_importexport.php:120
|
6166 |
+
#, php-format
|
6167 |
+
msgid "Current master site: %s"
|
6168 |
+
msgstr ""
|
6169 |
+
|
6170 |
+
#: src/processors/plugin_importexport.php:148
|
6171 |
#, php-format
|
6172 |
msgid "Not currently running %s Pro."
|
6173 |
msgstr ""
|
6174 |
|
6175 |
+
#: src/processors/plugin_importexport.php:152
|
6176 |
msgid "Export of options is currently disabled."
|
6177 |
msgstr ""
|
6178 |
|
6179 |
+
#: src/processors/plugin_importexport.php:156
|
6180 |
msgid "Handshake verification failed."
|
6181 |
msgstr ""
|
6182 |
|
6183 |
+
#: src/processors/plugin_importexport.php:165
|
6184 |
#, php-format
|
6185 |
msgid "Options exported to site %s."
|
6186 |
msgstr ""
|
6187 |
|
6188 |
+
#: src/processors/plugin_importexport.php:171
|
6189 |
#, php-format
|
6190 |
msgid "Site added to export white list: %s."
|
6191 |
msgstr ""
|
6192 |
|
6193 |
+
#: src/processors/plugin_importexport.php:314
|
6194 |
#, php-format
|
6195 |
msgid "Options imported from %s."
|
6196 |
msgstr ""
|
6197 |
|
6198 |
+
#: src/processors/plugin_importexport.php:329
|
6199 |
#, php-format
|
6200 |
msgid "Master Site URL set to %s."
|
6201 |
msgstr ""
|
6202 |
|
6203 |
+
#: src/processors/plugin_tracking.php:31
|
6204 |
#, php-format
|
6205 |
msgid "Make %s even better by sharing usage info?"
|
6206 |
msgstr ""
|
6207 |
|
6208 |
+
#: src/processors/plugin_tracking.php:32
|
6209 |
#, php-format
|
6210 |
msgid "We're hoping to understand how %s is configured and used."
|
6211 |
msgstr ""
|
6212 |
|
6213 |
+
#: src/processors/plugin_tracking.php:33
|
6214 |
msgid "We'd like to understand how effective it is on a global scale."
|
6215 |
msgstr ""
|
6216 |
|
6217 |
+
#: src/processors/plugin_tracking.php:34
|
6218 |
msgid ""
|
6219 |
"The data sent is always completely anonymous and we can never track you or "
|
6220 |
"your site."
|
6221 |
msgstr ""
|
6222 |
|
6223 |
+
#: src/processors/plugin_tracking.php:35
|
6224 |
msgid "It can be turned-off at any time within the plugin options."
|
6225 |
msgstr ""
|
6226 |
|
6227 |
+
#: src/processors/plugin_tracking.php:36
|
6228 |
msgid "Click to see the RAW data that would be sent"
|
6229 |
msgstr ""
|
6230 |
|
6231 |
+
#: src/processors/plugin_tracking.php:39
|
6232 |
msgid "Absolutely"
|
6233 |
msgstr ""
|
6234 |
|
6235 |
+
#: src/processors/sessions.php:107
|
6236 |
msgid "You're already logged-in."
|
6237 |
msgstr ""
|
6238 |
|
6239 |
+
#: src/processors/sessions.php:112
|
6240 |
msgid "Go To Admin"
|
6241 |
msgstr ""
|
6242 |
|
6243 |
+
#: src/processors/statistics.php:202
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6244 |
msgid "Login Verified"
|
6245 |
msgstr ""
|
6246 |
|
6247 |
+
#: src/processors/statistics.php:204
|
6248 |
msgid "IP Auto Black-Listed"
|
6249 |
msgstr ""
|
6250 |
|
6251 |
+
#: src/processors/statistics.php:205
|
6252 |
msgid "Total Transgressions"
|
6253 |
msgstr ""
|
6254 |
|
6255 |
+
#: src/processors/statistics.php:209
|
6256 |
+
#, php-format
|
6257 |
+
msgid "%s Statistics"
|
6258 |
msgstr ""
|
6259 |
|
6260 |
+
#: src/processors/user_management.php:129
|
6261 |
msgid "Last Login"
|
6262 |
msgstr ""
|
6263 |
|
6264 |
+
#: src/processors/user_management.php:151
|
6265 |
msgid "Not Recorded"
|
6266 |
msgstr ""
|
6267 |
|
6268 |
+
#: src/processors/user_management.php:201
|
6269 |
#, php-format
|
6270 |
msgid ""
|
6271 |
"As requested, %s is notifying you of a successful %s login to a WordPress "
|
6272 |
"site that you manage."
|
6273 |
msgstr ""
|
6274 |
|
6275 |
+
#: src/processors/user_management.php:206
|
6276 |
#, php-format
|
6277 |
msgid "Important: %s"
|
6278 |
msgstr ""
|
6279 |
|
6280 |
+
#: src/processors/user_management.php:206
|
6281 |
msgid ""
|
6282 |
"This user may now be subject to additional Two-Factor Authentication before "
|
6283 |
"completing their login."
|
6284 |
msgstr ""
|
6285 |
|
6286 |
+
#: src/processors/user_management.php:208
|
6287 |
msgid "Details for this user are below:"
|
6288 |
msgstr ""
|
6289 |
|
6290 |
+
#: src/processors/user_management.php:214
|
6291 |
+
#: src/processors/user_management.php:244
|
6292 |
+
msgid "Thanks."
|
6293 |
+
msgstr ""
|
6294 |
+
|
6295 |
+
#: src/processors/user_management.php:222
|
6296 |
+
#: src/processors/user_management.php:252
|
6297 |
+
msgid "Notice"
|
6298 |
+
msgstr ""
|
6299 |
+
|
6300 |
+
#: src/processors/user_management.php:222
|
6301 |
#, php-format
|
6302 |
+
msgid "%s Just Logged Into %s"
|
6303 |
msgstr ""
|
6304 |
|
6305 |
+
#: src/processors/user_management.php:233
|
6306 |
#, php-format
|
6307 |
+
msgid "%s is notifying you of a successful login to your WordPress account."
|
6308 |
msgstr ""
|
6309 |
|
6310 |
+
#: src/processors/user_management.php:236
|
6311 |
+
msgid "Details for this login are below:"
|
6312 |
msgstr ""
|
6313 |
|
6314 |
+
#: src/processors/user_management.php:242
|
6315 |
+
msgid ""
|
6316 |
+
"If this is unexpected or suspicious, please contact your site administrator "
|
6317 |
+
"immediately."
|
6318 |
+
msgstr ""
|
6319 |
+
|
6320 |
+
#: src/processors/user_management.php:252
|
6321 |
+
msgid "A login to your WordPress account just occurred"
|
6322 |
+
msgstr ""
|
6323 |
+
|
6324 |
+
#: src/processors/usermanagement_passwords.php:71
|
6325 |
+
msgid "Forcing user to update expired password."
|
6326 |
msgstr ""
|
6327 |
|
6328 |
+
#: src/processors/usermanagement_passwords.php:73
|
6329 |
#, php-format
|
6330 |
+
msgid "Your password has expired (%s days)."
|
6331 |
+
msgstr ""
|
6332 |
+
|
6333 |
+
#: src/processors/usermanagement_passwords.php:89
|
6334 |
+
msgid "Forcing user to update password that fails to meet policies."
|
6335 |
msgstr ""
|
6336 |
|
6337 |
+
#: src/processors/usermanagement_passwords.php:93
|
6338 |
msgid ""
|
6339 |
+
"Your password doesn't meet requirements set by your security administrator."
|
6340 |
+
msgstr ""
|
6341 |
+
|
6342 |
+
#: src/processors/usermanagement_passwords.php:103
|
6343 |
+
#: src/processors/usermanagement_passwords.php:126
|
6344 |
+
msgid ""
|
6345 |
+
"For your security, please use the password section below to update your "
|
6346 |
+
"password."
|
6347 |
msgstr ""
|
6348 |
|
6349 |
+
#: src/processors/usermanagement_passwords.php:153
|
6350 |
msgid ""
|
6351 |
"Your security administrator has imposed requirements for password quality."
|
6352 |
msgstr ""
|
6353 |
|
6354 |
+
#: src/processors/usermanagement_passwords.php:154
|
6355 |
+
msgid "Reason"
|
6356 |
+
msgstr ""
|
6357 |
+
|
6358 |
+
#: src/processors/usermanagement_passwords.php:162
|
6359 |
+
msgid "Blocked attempted password update that failed policy requirements."
|
6360 |
+
msgstr ""
|
6361 |
+
|
6362 |
+
#: src/processors/usermanagement_passwords.php:219
|
6363 |
#, php-format
|
6364 |
msgid "Password length (%s) too short (min: %s characters)"
|
6365 |
msgstr ""
|
6366 |
|
6367 |
+
#: src/processors/usermanagement_passwords.php:281
|
6368 |
+
#: src/processors/usermanagement_passwords.php:348
|
6369 |
msgid "Please use a different password."
|
6370 |
msgstr ""
|
6371 |
|
6372 |
+
#: src/processors/usermanagement_passwords.php:282
|
|
|
6373 |
msgid "This password has already been pwned."
|
6374 |
msgstr ""
|
6375 |
|
6376 |
+
#: src/processors/usermanagement_passwords.php:286
|
6377 |
+
#: src/processors/usermanagement_passwords.php:353
|
6378 |
#, php-format
|
6379 |
msgid "%s times"
|
6380 |
msgstr ""
|
6381 |
|
6382 |
+
#: src/processors/usermanagement_passwords.php:349
|
6383 |
+
msgid "This password has been pwned."
|
6384 |
+
msgstr ""
|
6385 |
+
|
6386 |
+
#: src/processors/usermanagement_sessions.php:279
|
6387 |
msgid "Your session has expired."
|
6388 |
msgstr ""
|
6389 |
|
6390 |
+
#: src/processors/usermanagement_sessions.php:283
|
6391 |
msgid "Your session was idle for too long."
|
6392 |
msgstr ""
|
6393 |
|
6394 |
+
#: src/processors/usermanagement_sessions.php:287
|
6395 |
msgid "Your session was locked to another IP Address."
|
6396 |
msgstr ""
|
6397 |
|
6398 |
+
#: src/processors/usermanagement_sessions.php:291
|
6399 |
#, php-format
|
6400 |
msgid "You do not currently have a %s user session."
|
6401 |
msgstr ""
|
6402 |
|
6403 |
+
#: src/processors/usermanagement_sessions.php:296
|
6404 |
msgid "An administrator has terminated this session."
|
6405 |
msgstr ""
|
6406 |
|
6407 |
+
#: src/processors/usermanagement_sessions.php:300
|
6408 |
msgid "Not a user."
|
6409 |
msgstr ""
|
6410 |
|
6411 |
+
#: src/processors/usermanagement_sessions.php:304
|
6412 |
msgid "Your session was terminated."
|
6413 |
msgstr ""
|
6414 |
|
6415 |
+
#: src/processors/usermanagement_sessions.php:308
|
6416 |
msgid "Please login again."
|
6417 |
msgstr ""
|
6418 |
|
6419 |
+
#: src/wizards/base.php:374
|
6420 |
#, php-format
|
6421 |
msgid "%s Wizard"
|
6422 |
msgstr ""
|
6423 |
|
6424 |
+
#: src/wizards/base.php:517
|
6425 |
msgid "No Access"
|
6426 |
msgstr ""
|
6427 |
|
6438 |
msgid "All changes detected have been ignored."
|
6439 |
msgstr ""
|
6440 |
|
6441 |
+
#: src/wizards/hack_protect.php:309
|
6442 |
msgid "The plugin has been deactivated."
|
6443 |
msgstr ""
|
6444 |
|
6472 |
msgid "disabled"
|
6473 |
msgstr ""
|
6474 |
|
6475 |
+
#: src/wizards/plugin.php:18
|
6476 |
#, php-format
|
6477 |
msgid "%s Welcome Wizard"
|
6478 |
msgstr ""
|
6479 |
|
6480 |
+
#: src/wizards/plugin.php:252
|
6481 |
msgid "Where to find Shield"
|
6482 |
msgstr ""
|
6483 |
|
6484 |
+
#: src/wizards/plugin.php:253
|
6485 |
msgid "Accessing Each Module"
|
6486 |
msgstr ""
|
6487 |
|
6488 |
+
#: src/wizards/plugin.php:254
|
6489 |
msgid "Accessing Options"
|
6490 |
msgstr ""
|
6491 |
|
6492 |
+
#: src/wizards/plugin.php:255
|
6493 |
msgid "Launching Wizards"
|
6494 |
msgstr ""
|
6495 |
|
6496 |
+
#: src/wizards/plugin.php:256
|
6497 |
msgid "Finding Help"
|
6498 |
msgstr ""
|
6499 |
|
6500 |
+
#: src/wizards/plugin.php:257
|
6501 |
msgid "Actions (not Options)"
|
6502 |
msgstr ""
|
6503 |
|
6504 |
+
#: src/wizards/plugin.php:258
|
6505 |
msgid "Help For Each Option"
|
6506 |
msgstr ""
|
6507 |
|
6508 |
+
#: src/wizards/plugin.php:259
|
6509 |
msgid "Module On/Off Switch"
|
6510 |
msgstr ""
|
6511 |
|
6512 |
+
#: src/wizards/plugin.php:262
|
6513 |
#, php-format
|
6514 |
msgid "You'll find the main %s settings in the left-hand WordPress menu."
|
6515 |
msgstr ""
|
6516 |
|
6517 |
+
#: src/wizards/plugin.php:263
|
6518 |
msgid ""
|
6519 |
"Shield is split up into independent modules for accessing the options of "
|
6520 |
"each feature."
|
6521 |
msgstr ""
|
6522 |
|
6523 |
+
#: src/wizards/plugin.php:264
|
6524 |
msgid ""
|
6525 |
"When you load a module, you can access the options by clicking on the "
|
6526 |
"Options Panel link."
|
6527 |
msgstr ""
|
6528 |
|
6529 |
+
#: src/wizards/plugin.php:265
|
6530 |
msgid "Launch helpful walk-through wizards for modules that have them."
|
6531 |
msgstr ""
|
6532 |
|
6533 |
+
#: src/wizards/plugin.php:266
|
6534 |
msgid ""
|
6535 |
"Each module also has a brief overview help section - there is more in-depth "
|
6536 |
"help available."
|
6537 |
msgstr ""
|
6538 |
|
6539 |
+
#: src/wizards/plugin.php:267
|
6540 |
msgid ""
|
6541 |
"Certain modules have extra actions and features, e.g. Audit Trail Viewer."
|
6542 |
msgstr ""
|
6543 |
|
6544 |
+
#: src/wizards/plugin.php:268
|
6545 |
msgid "Note: Not all modules have the actions section"
|
6546 |
msgstr ""
|
6547 |
|
6548 |
+
#: src/wizards/plugin.php:269
|
6549 |
msgid ""
|
6550 |
"Each module has an Enable/Disable checkbox to turn on/off all processing for "
|
6551 |
"that module"
|
6552 |
msgstr ""
|
6553 |
|
6554 |
+
#: src/wizards/plugin.php:270
|
6555 |
msgid ""
|
6556 |
"To help you understand each option, most of them have a more info link, and/"
|
6557 |
"or a blog link, to read more"
|
6558 |
msgstr ""
|
6559 |
|
6560 |
+
#: src/wizards/plugin.php:365
|
6561 |
msgid "Success!"
|
6562 |
msgstr ""
|
6563 |
|
6564 |
+
#: src/wizards/plugin.php:386
|
6565 |
+
msgid "License was found and successfully installed."
|
6566 |
msgstr ""
|
6567 |
|
6568 |
+
#: src/wizards/plugin.php:389
|
6569 |
+
msgid "License could not be found."
|
6570 |
msgstr ""
|
6571 |
|
6572 |
+
#: src/wizards/plugin.php:419
|
6573 |
msgid "Options imported successfully to your site."
|
6574 |
msgstr ""
|
6575 |
|
6576 |
+
#: src/wizards/plugin.php:420
|
6577 |
msgid "Secret key was empty."
|
6578 |
msgstr ""
|
6579 |
|
6580 |
+
#: src/wizards/plugin.php:421
|
6581 |
msgid "Secret key was not 40 characters long."
|
6582 |
msgstr ""
|
6583 |
|
6584 |
+
#: src/wizards/plugin.php:422
|
6585 |
msgid ""
|
6586 |
"Secret key contains invalid characters - it should be letters and numbers "
|
6587 |
"only."
|
6588 |
msgstr ""
|
6589 |
|
6590 |
+
#: src/wizards/plugin.php:423
|
6591 |
msgid "Source site URL could not be parsed correctly."
|
6592 |
msgstr ""
|
6593 |
|
6594 |
+
#: src/wizards/plugin.php:424
|
6595 |
msgid "Could not parse the response from the site."
|
6596 |
msgstr ""
|
6597 |
|
6598 |
+
#: src/wizards/plugin.php:425
|
6599 |
msgid "Check the secret key is correct for the remote site."
|
6600 |
msgstr ""
|
6601 |
|
6602 |
+
#: src/wizards/plugin.php:426
|
6603 |
msgid "Failure response returned from the site."
|
6604 |
msgstr ""
|
6605 |
|
6606 |
+
#: src/wizards/plugin.php:427
|
6607 |
#, php-format
|
6608 |
msgid "Remote site responded with - %s"
|
6609 |
msgstr ""
|
6610 |
|
6611 |
+
#: src/wizards/plugin.php:428
|
6612 |
msgid "Data returned from the site was empty."
|
6613 |
msgstr ""
|
6614 |
|
6615 |
+
#: src/wizards/plugin.php:462
|
6616 |
msgid "Security Admin setup was successful."
|
6617 |
msgstr ""
|
6618 |
|
6619 |
+
#: src/wizards/plugin.php:480 src/wizards/plugin.php:513
|
6620 |
+
#: src/wizards/plugin.php:546 src/wizards/plugin.php:584
|
6621 |
+
#: src/wizards/plugin.php:692
|
6622 |
msgid "No changes were made as no option was selected"
|
6623 |
msgstr ""
|
6624 |
|
6625 |
+
#: src/wizards/plugin.php:493 src/wizards/plugin.php:526
|
6626 |
+
#: src/wizards/plugin.php:562 src/wizards/plugin.php:708
|
6627 |
msgid "Enabled"
|
6628 |
msgstr ""
|
6629 |
|
6630 |
+
#: src/wizards/plugin.php:493 src/wizards/plugin.php:526
|
6631 |
+
#: src/wizards/plugin.php:562 src/wizards/plugin.php:708
|
6632 |
msgid "Disabled"
|
6633 |
msgstr ""
|
6634 |
|
6635 |
+
#: src/wizards/plugin.php:497 src/wizards/plugin.php:530
|
6636 |
+
#: src/wizards/plugin.php:566 src/wizards/plugin.php:712
|
6637 |
#, php-format
|
6638 |
msgid "%s setting could not be changed at this time."
|
6639 |
msgstr ""
|
6640 |
|
6641 |
+
#: src/wizards/plugin.php:594 src/wizards/plugin.php:604
|
6642 |
msgid "Preferences have been saved."
|
6643 |
msgstr ""
|
6644 |
|
6645 |
+
#: src/wizards/plugin.php:657
|
6646 |
+
msgid "Search item added."
|
6647 |
+
msgstr ""
|
6648 |
+
|
6649 |
+
#: src/wizards/plugin.php:674
|
6650 |
+
msgid "All entries were deleted"
|
6651 |
+
msgstr ""
|
6652 |
+
|
6653 |
+
#: src/wizards/plugin.php:677
|
6654 |
+
msgid "Please check the box to confirm deletion."
|
6655 |
msgstr ""
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
@@ -1,39 +1,40 @@
|
|
1 |
{
|
2 |
-
"properties":
|
3 |
-
"version":
|
4 |
-
"release_timestamp":
|
5 |
-
"slug_parent":
|
6 |
-
"slug_plugin":
|
7 |
-
"human_name":
|
8 |
-
"menu_title":
|
9 |
-
"text_domain":
|
10 |
-
"base_permissions":
|
11 |
"wpms_network_admin_only": true,
|
12 |
-
"logging_enabled":
|
13 |
-
"show_dashboard_widget":
|
14 |
-
"autoupdate":
|
15 |
-
"autoupdate_days":
|
16 |
-
"options_encoding":
|
17 |
-
"enable_premium":
|
18 |
},
|
19 |
"requirements": {
|
20 |
-
"php":
|
21 |
"wordpress": "3.5.0"
|
22 |
},
|
23 |
-
"paths":
|
24 |
-
"source":
|
25 |
-
"assets":
|
26 |
"languages": "languages",
|
27 |
"templates": "templates",
|
28 |
-
"flags":
|
29 |
},
|
30 |
-
"includes":
|
31 |
-
"admin":
|
32 |
"css": [
|
33 |
"global-plugin",
|
34 |
"featherlight"
|
35 |
],
|
36 |
-
"js":
|
|
|
37 |
"global-plugin",
|
38 |
"featherlight"
|
39 |
]
|
@@ -43,37 +44,38 @@
|
|
43 |
"bootstrap4",
|
44 |
"plugin"
|
45 |
],
|
46 |
-
"js":
|
47 |
"bootstrap4.bundle.min",
|
|
|
48 |
"plugin"
|
49 |
]
|
50 |
},
|
51 |
-
"frontend":
|
52 |
"css": null
|
53 |
}
|
54 |
},
|
55 |
-
"menu":
|
56 |
-
"show":
|
57 |
-
"title":
|
58 |
-
"top_level":
|
59 |
"do_submenu_fix": true,
|
60 |
-
"callback":
|
61 |
-
"icon_image":
|
62 |
-
"has_submenu":
|
63 |
},
|
64 |
-
"labels":
|
65 |
-
"Name":
|
66 |
-
"Description":
|
67 |
-
"Title":
|
68 |
-
"Author":
|
69 |
-
"AuthorName":
|
70 |
-
"PluginURI":
|
71 |
-
"AuthorURI":
|
72 |
-
"icon_url_16x16":
|
73 |
-
"icon_url_32x32":
|
74 |
"icon_url_128x128": "pluginlogo_128x128.png"
|
75 |
},
|
76 |
-
"plugin_meta":
|
77 |
{
|
78 |
"name": "5✩ Rate This Plugin",
|
79 |
"href": "https://icwp.io/wpsf29"
|
@@ -81,10 +83,21 @@
|
|
81 |
],
|
82 |
"action_links": {
|
83 |
"remove": null,
|
84 |
-
"add":
|
85 |
{
|
86 |
-
"name":
|
87 |
-
"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
88 |
}
|
89 |
]
|
90 |
}
|
1 |
{
|
2 |
+
"properties": {
|
3 |
+
"version": "6.9.0",
|
4 |
+
"release_timestamp": 1536235695,
|
5 |
+
"slug_parent": "icwp",
|
6 |
+
"slug_plugin": "wpsf",
|
7 |
+
"human_name": "Shield",
|
8 |
+
"menu_title": "Shield",
|
9 |
+
"text_domain": "wp-simple-firewall",
|
10 |
+
"base_permissions": "manage_options",
|
11 |
"wpms_network_admin_only": true,
|
12 |
+
"logging_enabled": true,
|
13 |
+
"show_dashboard_widget": true,
|
14 |
+
"autoupdate": "confidence",
|
15 |
+
"autoupdate_days": 3,
|
16 |
+
"options_encoding": "json",
|
17 |
+
"enable_premium": true
|
18 |
},
|
19 |
"requirements": {
|
20 |
+
"php": "5.2.4",
|
21 |
"wordpress": "3.5.0"
|
22 |
},
|
23 |
+
"paths": {
|
24 |
+
"source": "src",
|
25 |
+
"assets": "resources",
|
26 |
"languages": "languages",
|
27 |
"templates": "templates",
|
28 |
+
"flags": "flags"
|
29 |
},
|
30 |
+
"includes": {
|
31 |
+
"admin": {
|
32 |
"css": [
|
33 |
"global-plugin",
|
34 |
"featherlight"
|
35 |
],
|
36 |
+
"js": [
|
37 |
+
"jquery",
|
38 |
"global-plugin",
|
39 |
"featherlight"
|
40 |
]
|
44 |
"bootstrap4",
|
45 |
"plugin"
|
46 |
],
|
47 |
+
"js": [
|
48 |
"bootstrap4.bundle.min",
|
49 |
+
"jquery",
|
50 |
"plugin"
|
51 |
]
|
52 |
},
|
53 |
+
"frontend": {
|
54 |
"css": null
|
55 |
}
|
56 |
},
|
57 |
+
"menu": {
|
58 |
+
"show": true,
|
59 |
+
"title": "Shield Security",
|
60 |
+
"top_level": true,
|
61 |
"do_submenu_fix": true,
|
62 |
+
"callback": "onDisplayTopMenu",
|
63 |
+
"icon_image": "pluginlogo_16x16.png",
|
64 |
+
"has_submenu": true
|
65 |
},
|
66 |
+
"labels": {
|
67 |
+
"Name": "Shield",
|
68 |
+
"Description": "Ultimate WP Security Protection - Scans, 2FA, Firewall, SPAM, Audit Trail, Security Admin, and so much more.",
|
69 |
+
"Title": "Shield Security",
|
70 |
+
"Author": "One Dollar Plugin",
|
71 |
+
"AuthorName": "One Dollar Plugin",
|
72 |
+
"PluginURI": "https://icwp.io/2f",
|
73 |
+
"AuthorURI": "https://icwp.io/bv",
|
74 |
+
"icon_url_16x16": "pluginlogo_16x16.png",
|
75 |
+
"icon_url_32x32": "pluginlogo_32x32.png",
|
76 |
"icon_url_128x128": "pluginlogo_128x128.png"
|
77 |
},
|
78 |
+
"plugin_meta": [
|
79 |
{
|
80 |
"name": "5✩ Rate This Plugin",
|
81 |
"href": "https://icwp.io/wpsf29"
|
83 |
],
|
84 |
"action_links": {
|
85 |
"remove": null,
|
86 |
+
"add": [
|
87 |
{
|
88 |
+
"name": "Dashboard",
|
89 |
+
"title": "Go To Shield Dashboard",
|
90 |
+
"href": "getPluginUrl_AdminMainPage",
|
91 |
+
"target": "_top",
|
92 |
+
"show": "always"
|
93 |
+
},
|
94 |
+
{
|
95 |
+
"name": "↑ Go Pro ↑",
|
96 |
+
"title": "For just $1/month. Seriously.",
|
97 |
+
"href": "https://icwp.io/d8",
|
98 |
+
"target": "_blank",
|
99 |
+
"highlight": true,
|
100 |
+
"show": "free"
|
101 |
}
|
102 |
]
|
103 |
}
|
@@ -8,7 +8,7 @@ Requires at least: 3.5.0
|
|
8 |
Requires PHP: 5.2.4
|
9 |
Recommended PHP: 5.4
|
10 |
Tested up to: 4.9
|
11 |
-
Stable tag: 6.
|
12 |
|
13 |
Complete All-In-One Protection for your WordPress sites, that makes Security Easy for Everyone - it doesn't have to be hard anymore.
|
14 |
|
@@ -353,74 +353,32 @@ You will always be able to use Shield Security and its free features in-full.
|
|
353 |
|
354 |
[Go Pro for just $1/month](https://icwp.io/aa).
|
355 |
|
356 |
-
= 6.
|
357 |
-
*Released:
|
358 |
-
|
359 |
-
* **(v.
|
360 |
-
* **(v.
|
361 |
-
* **(v.
|
362 |
-
* **(v.
|
363 |
-
|
364 |
-
|
365 |
-
*
|
366 |
-
|
367 |
-
* **(v.
|
368 |
-
* **(v.
|
369 |
-
* **(v.
|
370 |
-
* **(v.
|
371 |
-
* **(v.
|
372 |
-
* **(v.
|
373 |
-
* **(v.0)**
|
374 |
-
* **(v.0)**
|
375 |
-
* **(v.0)** IMPROVED:
|
376 |
-
* **(v.0)** IMPROVED:
|
377 |
-
* **(v.0)** IMPROVED:
|
378 |
-
* **(v.0)** IMPROVED:
|
379 |
-
|
380 |
-
|
381 |
-
*
|
382 |
-
|
383 |
-
* **(v.2)** ADDED: [**PRO**] Admin Notes feature - Notes can now be easily deleted (editing will not be possible).
|
384 |
-
* **(v.2)** UPDATED: Some translations.
|
385 |
-
* **(v.2)** FIXED: A few bugs with the Insights Dashboard.
|
386 |
-
* **(v.2)** FIXED: Removed the dependency on jQuery with Invisible reCAPTCHA.
|
387 |
-
* **(v.1)** FIXED: A few bugs with the Insights Dashboard
|
388 |
-
* **(v.1)** ADDED: [**PRO**] Admin Notes feature - you can now add notes to the Shield plugin in the Insights Dashboard.
|
389 |
-
* **(v.0)** ADDED: All-New Insights Dashboard providing a high-level overview of your site security, with recommendations.
|
390 |
-
* **(v.0)** ADDED: Helpful, explanatory videos directly into the Guided Welcome Wizard.
|
391 |
-
* **(v.0)** ADDED: A simple test cron to demonstrate whether your site crons are running.
|
392 |
-
* **(v.0)** ADDED: [**PRO**] Full support for new WordPress GDPR Privacy Policy controls for exporting and erasing data.
|
393 |
-
* **(v.0)** ADDED: [**PRO**] New GDPR guided wizard for exporting/erasing particular data based on custom search results.
|
394 |
-
* **(v.0)** CHANGED: Guided Wizards now load through WP admin to fix ajax problems for poorly configured SSL on some sites
|
395 |
-
* **(v.0)** IMPROVED: Upgraded Bootstrap library to 4.1.1.
|
396 |
-
* **(v.0)** IMPROVED: Compatibility with AIO Events Cal - they like to force their old Twig libraries on everyone else.
|
397 |
-
|
398 |
-
= 6.6 Series =
|
399 |
-
*Released: 19th March, 2018* - [Release Notes](https://icwp.io/c3)
|
400 |
-
|
401 |
-
* **(v.7)** IMPROVED: reCAPTCHA JS is only included on pages where it's actually used by Shield.
|
402 |
-
* **(v.7)** IMPROVED: Upgrade Bootstrap library to 4.1.0.
|
403 |
-
* **(v.7)** IMPROVED: Include jQuery for the plugin badge as required
|
404 |
-
* **(v.6)** ADDED: Small exclusion in the firewall for a jetpack parameter.
|
405 |
-
* **(v.6)** ADDED: SVGs to the default list of files scanned by the plugin guard.
|
406 |
-
* **(v.6)** ADDED: Workaround for a [ridiculous NGG bug](https://wordpress.org/support/topic/forcefully-executing-wp_footer-not-compatible-with-other-plugins/).
|
407 |
-
* **(v.1-4)** FIXED: Various small fixes and improvements
|
408 |
-
* **(v.4)** FIXED: PHP Fatal Error on wp object cache.
|
409 |
-
* **(v.0)** NEW: [**PRO**] [Keyless Activation of Pro licenses](https://icwp.io/c1).
|
410 |
-
* **(v.0)** ADDED: [WordPress Password Policies](https://icwp.io/c2).
|
411 |
-
* **(v.0)** ADDED: Pwned Passwords Detection.
|
412 |
-
* **(v.0)** IMPROVED: Major rewrite of plugin AJAX handling.
|
413 |
-
* **(v.0)** IMPROVED: Notices to indicate the time of the last scans.
|
414 |
-
* **(v.0)** FIXED: A few bugs
|
415 |
-
|
416 |
-
= 6.5 Series =
|
417 |
-
*Released: 5th March, 2018* - [Release Notes](https://icwp.io/bu)
|
418 |
-
|
419 |
-
* **(v.0)** IMPROVED: [Plugin Guard](https://icwp.io/bq) better handles the case where a plugin/theme has been entirely renamed/removed.
|
420 |
-
* **(v.0)** IMPROVED: Attempts to access the XML-RPC system when it's disabled will now result in a transgression increment in the IP Black List
|
421 |
-
* **(v.0)** IMPROVED: Try to prevent black listing the server's own public IP address where visitor IP address detection is not correctly configured.
|
422 |
-
* **(v.0)** ADDED: [**PRO**] Provisional support for not processing 2FA logins for Woocommerce Social Login plugin.
|
423 |
-
* **(v.0)** FIXED: Plugin Guard better handles ignoring non-WordPress.org Plugins/Themes
|
424 |
-
* **(v.0)** FIXED: A few small bugs
|
425 |
|
426 |
#### [Full Changelog](https://ps.w.org/wp-simple-firewall/trunk/changelog.html)
|
8 |
Requires PHP: 5.2.4
|
9 |
Recommended PHP: 5.4
|
10 |
Tested up to: 4.9
|
11 |
+
Stable tag: 6.9.0
|
12 |
|
13 |
Complete All-In-One Protection for your WordPress sites, that makes Security Easy for Everyone - it doesn't have to be hard anymore.
|
14 |
|
353 |
|
354 |
[Go Pro for just $1/month](https://icwp.io/aa).
|
355 |
|
356 |
+
= 6.9.0 - Series =
|
357 |
+
*Released: 6th September, 2018* - [Release Notes](https://icwp.io/dc)
|
358 |
+
|
359 |
+
* **(v.0)** NEW: [**PRO**] [Traffic Watcher](https://icwp.io/c1) - live tracking of all requests to your site.
|
360 |
+
* **(v.0)** NEW: [**PRO**] [Yubikey](https://icwp.io/c1) - Allows for multiple Yubikeys on the same user profile.
|
361 |
+
* **(v.0)** ADDED: [**PRO**] Option to include listing of affected files within Hack Guard notification emails.
|
362 |
+
* **(v.0)** ADDED: Option to delete the Security Admin Access Key
|
363 |
+
* **(v.0)** ADDED: Option to add WooCommerce roles to 2FA-Email setting.
|
364 |
+
* **(v.0)** CHANGED: Basic Stats system now requires minimum PHP v5.4.
|
365 |
+
* **(v.0)** CHANGED: Password Policies now requires minimum WordPress v4.4.
|
366 |
+
* **(v.0)** IMPROVED: Password expiration now redirects to the 'set password' screen, instead of the user profile.
|
367 |
+
* **(v.0)** IMPROVED: Password capture for purposes of password policies is improved.
|
368 |
+
* **(v.0)** IMPROVED: You can now delete the 'forceoff' file from inside the WP Admin.
|
369 |
+
* **(v.0)** IMPROVED: Audit Trail entries for emails will identify the file that's calling the `wp_mail` function.
|
370 |
+
* **(v.0)** IMPROVED: Audit Trail entries for post editing will identify the post type wherever possible.
|
371 |
+
* **(v.0)** IMPROVED: Audit Trail entries will try to display all message text correctly.
|
372 |
+
* **(v.0)** IMPROVED: Login/Register/Password forms are only checked when visitor is not logged-in.
|
373 |
+
* **(v.0)** IMPROVED: Major database code refactoring and other code improvements.
|
374 |
+
* **(v.0)** IMPROVED: User sessions handling.
|
375 |
+
* **(v.0)** IMPROVED: Security Admin UX - ajax session checking, with admin notifications and auto-page reload.
|
376 |
+
* **(v.0)** IMPROVED: Security Admin password setting now requires a confirmation password entry.
|
377 |
+
* **(v.0)** IMPROVED: Refined Cooldown timing system.
|
378 |
+
* **(v.0)** IMPROVED: Refined Bot checkbox Javascript.
|
379 |
+
* **(v.0)** IMPROVED: Cron entry cleanup after deactivation.
|
380 |
+
* **(v.0)** UPDATED: Bootstrap libraries to latest release v4.1.3.
|
381 |
+
* **(v.0)** FIXED: Potential bug with Plugin/Themes guard scanning.
|
382 |
+
* **(v.0)** FIXED: PHP Warning(s).
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
383 |
|
384 |
#### [Full Changelog](https://ps.w.org/wp-simple-firewall/trunk/changelog.html)
|
@@ -1,5 +1,5 @@
|
|
1 |
/*!
|
2 |
-
* Bootstrap v4.1.
|
3 |
* Copyright 2011-2018 The Bootstrap Authors
|
4 |
* Copyright 2011-2018 Twitter, Inc.
|
5 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
@@ -31,7 +31,7 @@
|
|
31 |
--breakpoint-md: 768px;
|
32 |
--breakpoint-lg: 992px;
|
33 |
--breakpoint-xl: 1200px;
|
34 |
-
--font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
|
35 |
--font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
|
36 |
}
|
37 |
|
@@ -47,7 +47,7 @@ html {
|
|
47 |
-webkit-text-size-adjust: 100%;
|
48 |
-ms-text-size-adjust: 100%;
|
49 |
-ms-overflow-style: scrollbar;
|
50 |
-
-webkit-tap-highlight-color:
|
51 |
}
|
52 |
|
53 |
@-ms-viewport {
|
@@ -60,7 +60,7 @@ article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
|
|
60 |
|
61 |
body {
|
62 |
margin: 0;
|
63 |
-
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
|
64 |
font-size: 1rem;
|
65 |
font-weight: 400;
|
66 |
line-height: 1.5;
|
@@ -210,8 +210,9 @@ img {
|
|
210 |
border-style: none;
|
211 |
}
|
212 |
|
213 |
-
svg
|
214 |
overflow: hidden;
|
|
|
215 |
}
|
216 |
|
217 |
table {
|
@@ -1515,7 +1516,6 @@ pre code {
|
|
1515 |
|
1516 |
.table {
|
1517 |
width: 100%;
|
1518 |
-
max-width: 100%;
|
1519 |
margin-bottom: 1rem;
|
1520 |
background-color: transparent;
|
1521 |
}
|
@@ -1811,6 +1811,7 @@ pre code {
|
|
1811 |
.form-control {
|
1812 |
display: block;
|
1813 |
width: 100%;
|
|
|
1814 |
padding: 0.375rem 0.75rem;
|
1815 |
font-size: 1rem;
|
1816 |
line-height: 1.5;
|
@@ -1871,10 +1872,6 @@ pre code {
|
|
1871 |
opacity: 1;
|
1872 |
}
|
1873 |
|
1874 |
-
select.form-control:not([size]):not([multiple]) {
|
1875 |
-
height: calc(2.25rem + 2px);
|
1876 |
-
}
|
1877 |
-
|
1878 |
select.form-control:focus::-ms-value {
|
1879 |
color: #495057;
|
1880 |
background-color: #fff;
|
@@ -1921,55 +1918,33 @@ select.form-control:focus::-ms-value {
|
|
1921 |
border-width: 1px 0;
|
1922 |
}
|
1923 |
|
1924 |
-
.form-control-plaintext.form-control-sm, .
|
1925 |
-
.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text,
|
1926 |
-
.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text,
|
1927 |
-
.input-group-sm > .input-group-prepend > .form-control-plaintext.btn,
|
1928 |
-
.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control,
|
1929 |
-
.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text,
|
1930 |
-
.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text,
|
1931 |
-
.input-group-lg > .input-group-prepend > .form-control-plaintext.btn,
|
1932 |
-
.input-group-lg > .input-group-append > .form-control-plaintext.btn {
|
1933 |
padding-right: 0;
|
1934 |
padding-left: 0;
|
1935 |
}
|
1936 |
|
1937 |
-
.form-control-sm
|
1938 |
-
|
1939 |
-
.input-group-sm > .input-group-append > .input-group-text,
|
1940 |
-
.input-group-sm > .input-group-prepend > .btn,
|
1941 |
-
.input-group-sm > .input-group-append > .btn {
|
1942 |
padding: 0.25rem 0.5rem;
|
1943 |
font-size: 0.875rem;
|
1944 |
line-height: 1.5;
|
1945 |
border-radius: 0.2rem;
|
1946 |
}
|
1947 |
|
1948 |
-
|
1949 |
-
|
1950 |
-
.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]),
|
1951 |
-
.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]),
|
1952 |
-
.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) {
|
1953 |
-
height: calc(1.8125rem + 2px);
|
1954 |
-
}
|
1955 |
-
|
1956 |
-
.form-control-lg, .input-group-lg > .form-control,
|
1957 |
-
.input-group-lg > .input-group-prepend > .input-group-text,
|
1958 |
-
.input-group-lg > .input-group-append > .input-group-text,
|
1959 |
-
.input-group-lg > .input-group-prepend > .btn,
|
1960 |
-
.input-group-lg > .input-group-append > .btn {
|
1961 |
padding: 0.5rem 1rem;
|
1962 |
font-size: 1.25rem;
|
1963 |
line-height: 1.5;
|
1964 |
border-radius: 0.3rem;
|
1965 |
}
|
1966 |
|
1967 |
-
select.form-control
|
1968 |
-
|
1969 |
-
|
1970 |
-
|
1971 |
-
.
|
1972 |
-
height:
|
1973 |
}
|
1974 |
|
1975 |
.form-group {
|
@@ -2046,13 +2021,13 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
|
|
2046 |
z-index: 5;
|
2047 |
display: none;
|
2048 |
max-width: 100%;
|
2049 |
-
padding: .5rem;
|
2050 |
margin-top: .1rem;
|
2051 |
-
font-size: .875rem;
|
2052 |
-
line-height: 1;
|
2053 |
color: #fff;
|
2054 |
-
background-color: rgba(40, 167, 69, 0.
|
2055 |
-
border-radius: .
|
2056 |
}
|
2057 |
|
2058 |
.was-validated .form-control:valid, .form-control.is-valid, .was-validated
|
@@ -2121,7 +2096,7 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
|
|
2121 |
border-color: #28a745;
|
2122 |
}
|
2123 |
|
2124 |
-
.was-validated .custom-file-input:valid ~ .custom-file-label::
|
2125 |
border-color: inherit;
|
2126 |
}
|
2127 |
|
@@ -2149,13 +2124,13 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
|
|
2149 |
z-index: 5;
|
2150 |
display: none;
|
2151 |
max-width: 100%;
|
2152 |
-
padding: .5rem;
|
2153 |
margin-top: .1rem;
|
2154 |
-
font-size: .875rem;
|
2155 |
-
line-height: 1;
|
2156 |
color: #fff;
|
2157 |
-
background-color: rgba(220, 53, 69, 0.
|
2158 |
-
border-radius: .
|
2159 |
}
|
2160 |
|
2161 |
.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated
|
@@ -2224,7 +2199,7 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
|
|
2224 |
border-color: #dc3545;
|
2225 |
}
|
2226 |
|
2227 |
-
.was-validated .custom-file-input:invalid ~ .custom-file-label::
|
2228 |
border-color: inherit;
|
2229 |
}
|
2230 |
|
@@ -2352,10 +2327,6 @@ select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.for
|
|
2352 |
cursor: pointer;
|
2353 |
}
|
2354 |
|
2355 |
-
.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active {
|
2356 |
-
background-image: none;
|
2357 |
-
}
|
2358 |
-
|
2359 |
a.btn.disabled,
|
2360 |
fieldset:disabled a.btn {
|
2361 |
pointer-events: none;
|
@@ -3354,12 +3325,6 @@ input[type="button"].btn-block {
|
|
3354 |
margin-bottom: 0;
|
3355 |
}
|
3356 |
|
3357 |
-
.input-group > .form-control:focus,
|
3358 |
-
.input-group > .custom-select:focus,
|
3359 |
-
.input-group > .custom-file:focus {
|
3360 |
-
z-index: 3;
|
3361 |
-
}
|
3362 |
-
|
3363 |
.input-group > .form-control + .form-control,
|
3364 |
.input-group > .form-control + .custom-select,
|
3365 |
.input-group > .form-control + .custom-file,
|
@@ -3372,6 +3337,16 @@ input[type="button"].btn-block {
|
|
3372 |
margin-left: -1px;
|
3373 |
}
|
3374 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3375 |
.input-group > .form-control:not(:last-child),
|
3376 |
.input-group > .custom-select:not(:last-child) {
|
3377 |
border-top-right-radius: 0;
|
@@ -3456,6 +3431,30 @@ input[type="button"].btn-block {
|
|
3456 |
margin-top: 0;
|
3457 |
}
|
3458 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3459 |
.input-group > .input-group-prepend > .btn,
|
3460 |
.input-group > .input-group-prepend > .input-group-text,
|
3461 |
.input-group > .input-group-append:not(:last-child) > .btn,
|
@@ -3615,7 +3614,7 @@ input[type="button"].btn-block {
|
|
3615 |
.custom-select:focus {
|
3616 |
border-color: #80bdff;
|
3617 |
outline: 0;
|
3618 |
-
box-shadow:
|
3619 |
}
|
3620 |
|
3621 |
.custom-select:focus::-ms-value {
|
@@ -3678,6 +3677,10 @@ input[type="button"].btn-block {
|
|
3678 |
border-color: #80bdff;
|
3679 |
}
|
3680 |
|
|
|
|
|
|
|
|
|
3681 |
.custom-file-input:lang(en) ~ .custom-file-label::after {
|
3682 |
content: "Browse";
|
3683 |
}
|
@@ -3727,6 +3730,18 @@ input[type="button"].btn-block {
|
|
3727 |
outline: none;
|
3728 |
}
|
3729 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3730 |
.custom-range::-moz-focus-outer {
|
3731 |
border: 0;
|
3732 |
}
|
@@ -3738,13 +3753,15 @@ input[type="button"].btn-block {
|
|
3738 |
background-color: #007bff;
|
3739 |
border: 0;
|
3740 |
border-radius: 1rem;
|
|
|
3741 |
-webkit-appearance: none;
|
3742 |
appearance: none;
|
3743 |
}
|
3744 |
|
3745 |
-
|
3746 |
-
|
3747 |
-
|
|
|
3748 |
}
|
3749 |
|
3750 |
.custom-range::-webkit-slider-thumb:active {
|
@@ -3767,13 +3784,15 @@ input[type="button"].btn-block {
|
|
3767 |
background-color: #007bff;
|
3768 |
border: 0;
|
3769 |
border-radius: 1rem;
|
|
|
3770 |
-moz-appearance: none;
|
3771 |
appearance: none;
|
3772 |
}
|
3773 |
|
3774 |
-
|
3775 |
-
|
3776 |
-
|
|
|
3777 |
}
|
3778 |
|
3779 |
.custom-range::-moz-range-thumb:active {
|
@@ -3793,15 +3812,20 @@ input[type="button"].btn-block {
|
|
3793 |
.custom-range::-ms-thumb {
|
3794 |
width: 1rem;
|
3795 |
height: 1rem;
|
|
|
|
|
|
|
3796 |
background-color: #007bff;
|
3797 |
border: 0;
|
3798 |
border-radius: 1rem;
|
|
|
3799 |
appearance: none;
|
3800 |
}
|
3801 |
|
3802 |
-
|
3803 |
-
|
3804 |
-
|
|
|
3805 |
}
|
3806 |
|
3807 |
.custom-range::-ms-thumb:active {
|
@@ -3829,6 +3853,20 @@ input[type="button"].btn-block {
|
|
3829 |
border-radius: 1rem;
|
3830 |
}
|
3831 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3832 |
.nav {
|
3833 |
display: -ms-flexbox;
|
3834 |
display: flex;
|
@@ -5283,16 +5321,16 @@ input[type="button"].btn-block {
|
|
5283 |
opacity: .5;
|
5284 |
}
|
5285 |
|
5286 |
-
.close:
|
|
|
|
|
|
|
|
|
5287 |
color: #000;
|
5288 |
text-decoration: none;
|
5289 |
opacity: .75;
|
5290 |
}
|
5291 |
|
5292 |
-
.close:not(:disabled):not(.disabled) {
|
5293 |
-
cursor: pointer;
|
5294 |
-
}
|
5295 |
-
|
5296 |
button.close {
|
5297 |
padding: 0;
|
5298 |
background-color: transparent;
|
@@ -5304,6 +5342,11 @@ button.close {
|
|
5304 |
overflow: hidden;
|
5305 |
}
|
5306 |
|
|
|
|
|
|
|
|
|
|
|
5307 |
.modal {
|
5308 |
position: fixed;
|
5309 |
top: 0;
|
@@ -5316,11 +5359,6 @@ button.close {
|
|
5316 |
outline: 0;
|
5317 |
}
|
5318 |
|
5319 |
-
.modal-open .modal {
|
5320 |
-
overflow-x: hidden;
|
5321 |
-
overflow-y: auto;
|
5322 |
-
}
|
5323 |
-
|
5324 |
.modal-dialog {
|
5325 |
position: relative;
|
5326 |
width: auto;
|
@@ -5355,6 +5393,12 @@ button.close {
|
|
5355 |
min-height: calc(100% - (0.5rem * 2));
|
5356 |
}
|
5357 |
|
|
|
|
|
|
|
|
|
|
|
|
|
5358 |
.modal-content {
|
5359 |
position: relative;
|
5360 |
display: -ms-flexbox;
|
@@ -5453,6 +5497,9 @@ button.close {
|
|
5453 |
.modal-dialog-centered {
|
5454 |
min-height: calc(100% - (1.75rem * 2));
|
5455 |
}
|
|
|
|
|
|
|
5456 |
.modal-sm {
|
5457 |
max-width: 300px;
|
5458 |
}
|
@@ -5469,7 +5516,7 @@ button.close {
|
|
5469 |
z-index: 1070;
|
5470 |
display: block;
|
5471 |
margin: 0;
|
5472 |
-
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
|
5473 |
font-style: normal;
|
5474 |
font-weight: 400;
|
5475 |
line-height: 1.5;
|
@@ -5582,7 +5629,7 @@ button.close {
|
|
5582 |
z-index: 1060;
|
5583 |
display: block;
|
5584 |
max-width: 276px;
|
5585 |
-
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
|
5586 |
font-style: normal;
|
5587 |
font-weight: 400;
|
5588 |
line-height: 1.5;
|
@@ -5777,25 +5824,27 @@ button.close {
|
|
5777 |
-ms-flex-align: center;
|
5778 |
align-items: center;
|
5779 |
width: 100%;
|
5780 |
-
transition: -webkit-transform 0.6s ease;
|
5781 |
-
transition: transform 0.6s ease;
|
5782 |
-
transition: transform 0.6s ease, -webkit-transform 0.6s ease;
|
5783 |
-webkit-backface-visibility: hidden;
|
5784 |
backface-visibility: hidden;
|
5785 |
-webkit-perspective: 1000px;
|
5786 |
perspective: 1000px;
|
5787 |
}
|
5788 |
|
5789 |
-
@media screen and (prefers-reduced-motion: reduce) {
|
5790 |
-
.carousel-item {
|
5791 |
-
transition: none;
|
5792 |
-
}
|
5793 |
-
}
|
5794 |
-
|
5795 |
.carousel-item.active,
|
5796 |
.carousel-item-next,
|
5797 |
.carousel-item-prev {
|
5798 |
display: block;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5799 |
}
|
5800 |
|
5801 |
.carousel-item-next,
|
@@ -8977,5 +9026,4 @@ a.text-dark:hover, a.text-dark:focus {
|
|
8977 |
color: inherit;
|
8978 |
border-color: #dee2e6;
|
8979 |
}
|
8980 |
-
}
|
8981 |
-
/*# sourceMappingURL=bootstrap.css.map */
|
1 |
/*!
|
2 |
+
* Bootstrap v4.1.3 (https://getbootstrap.com/)
|
3 |
* Copyright 2011-2018 The Bootstrap Authors
|
4 |
* Copyright 2011-2018 Twitter, Inc.
|
5 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
31 |
--breakpoint-md: 768px;
|
32 |
--breakpoint-lg: 992px;
|
33 |
--breakpoint-xl: 1200px;
|
34 |
+
--font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
|
35 |
--font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
|
36 |
}
|
37 |
|
47 |
-webkit-text-size-adjust: 100%;
|
48 |
-ms-text-size-adjust: 100%;
|
49 |
-ms-overflow-style: scrollbar;
|
50 |
+
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
51 |
}
|
52 |
|
53 |
@-ms-viewport {
|
60 |
|
61 |
body {
|
62 |
margin: 0;
|
63 |
+
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
|
64 |
font-size: 1rem;
|
65 |
font-weight: 400;
|
66 |
line-height: 1.5;
|
210 |
border-style: none;
|
211 |
}
|
212 |
|
213 |
+
svg {
|
214 |
overflow: hidden;
|
215 |
+
vertical-align: middle;
|
216 |
}
|
217 |
|
218 |
table {
|
1516 |
|
1517 |
.table {
|
1518 |
width: 100%;
|
|
|
1519 |
margin-bottom: 1rem;
|
1520 |
background-color: transparent;
|
1521 |
}
|
1811 |
.form-control {
|
1812 |
display: block;
|
1813 |
width: 100%;
|
1814 |
+
height: calc(2.25rem + 2px);
|
1815 |
padding: 0.375rem 0.75rem;
|
1816 |
font-size: 1rem;
|
1817 |
line-height: 1.5;
|
1872 |
opacity: 1;
|
1873 |
}
|
1874 |
|
|
|
|
|
|
|
|
|
1875 |
select.form-control:focus::-ms-value {
|
1876 |
color: #495057;
|
1877 |
background-color: #fff;
|
1918 |
border-width: 1px 0;
|
1919 |
}
|
1920 |
|
1921 |
+
.form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1922 |
padding-right: 0;
|
1923 |
padding-left: 0;
|
1924 |
}
|
1925 |
|
1926 |
+
.form-control-sm {
|
1927 |
+
height: calc(1.8125rem + 2px);
|
|
|
|
|
|
|
1928 |
padding: 0.25rem 0.5rem;
|
1929 |
font-size: 0.875rem;
|
1930 |
line-height: 1.5;
|
1931 |
border-radius: 0.2rem;
|
1932 |
}
|
1933 |
|
1934 |
+
.form-control-lg {
|
1935 |
+
height: calc(2.875rem + 2px);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1936 |
padding: 0.5rem 1rem;
|
1937 |
font-size: 1.25rem;
|
1938 |
line-height: 1.5;
|
1939 |
border-radius: 0.3rem;
|
1940 |
}
|
1941 |
|
1942 |
+
select.form-control[size], select.form-control[multiple] {
|
1943 |
+
height: auto;
|
1944 |
+
}
|
1945 |
+
|
1946 |
+
textarea.form-control {
|
1947 |
+
height: auto;
|
1948 |
}
|
1949 |
|
1950 |
.form-group {
|
2021 |
z-index: 5;
|
2022 |
display: none;
|
2023 |
max-width: 100%;
|
2024 |
+
padding: 0.25rem 0.5rem;
|
2025 |
margin-top: .1rem;
|
2026 |
+
font-size: 0.875rem;
|
2027 |
+
line-height: 1.5;
|
2028 |
color: #fff;
|
2029 |
+
background-color: rgba(40, 167, 69, 0.9);
|
2030 |
+
border-radius: 0.25rem;
|
2031 |
}
|
2032 |
|
2033 |
.was-validated .form-control:valid, .form-control.is-valid, .was-validated
|
2096 |
border-color: #28a745;
|
2097 |
}
|
2098 |
|
2099 |
+
.was-validated .custom-file-input:valid ~ .custom-file-label::after, .custom-file-input.is-valid ~ .custom-file-label::after {
|
2100 |
border-color: inherit;
|
2101 |
}
|
2102 |
|
2124 |
z-index: 5;
|
2125 |
display: none;
|
2126 |
max-width: 100%;
|
2127 |
+
padding: 0.25rem 0.5rem;
|
2128 |
margin-top: .1rem;
|
2129 |
+
font-size: 0.875rem;
|
2130 |
+
line-height: 1.5;
|
2131 |
color: #fff;
|
2132 |
+
background-color: rgba(220, 53, 69, 0.9);
|
2133 |
+
border-radius: 0.25rem;
|
2134 |
}
|
2135 |
|
2136 |
.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated
|
2199 |
border-color: #dc3545;
|
2200 |
}
|
2201 |
|
2202 |
+
.was-validated .custom-file-input:invalid ~ .custom-file-label::after, .custom-file-input.is-invalid ~ .custom-file-label::after {
|
2203 |
border-color: inherit;
|
2204 |
}
|
2205 |
|
2327 |
cursor: pointer;
|
2328 |
}
|
2329 |
|
|
|
|
|
|
|
|
|
2330 |
a.btn.disabled,
|
2331 |
fieldset:disabled a.btn {
|
2332 |
pointer-events: none;
|
3325 |
margin-bottom: 0;
|
3326 |
}
|
3327 |
|
|
|
|
|
|
|
|
|
|
|
|
|
3328 |
.input-group > .form-control + .form-control,
|
3329 |
.input-group > .form-control + .custom-select,
|
3330 |
.input-group > .form-control + .custom-file,
|
3337 |
margin-left: -1px;
|
3338 |
}
|
3339 |
|
3340 |
+
.input-group > .form-control:focus,
|
3341 |
+
.input-group > .custom-select:focus,
|
3342 |
+
.input-group > .custom-file .custom-file-input:focus ~ .custom-file-label {
|
3343 |
+
z-index: 3;
|
3344 |
+
}
|
3345 |
+
|
3346 |
+
.input-group > .custom-file .custom-file-input:focus {
|
3347 |
+
z-index: 4;
|
3348 |
+
}
|
3349 |
+
|
3350 |
.input-group > .form-control:not(:last-child),
|
3351 |
.input-group > .custom-select:not(:last-child) {
|
3352 |
border-top-right-radius: 0;
|
3431 |
margin-top: 0;
|
3432 |
}
|
3433 |
|
3434 |
+
.input-group-lg > .form-control,
|
3435 |
+
.input-group-lg > .input-group-prepend > .input-group-text,
|
3436 |
+
.input-group-lg > .input-group-append > .input-group-text,
|
3437 |
+
.input-group-lg > .input-group-prepend > .btn,
|
3438 |
+
.input-group-lg > .input-group-append > .btn {
|
3439 |
+
height: calc(2.875rem + 2px);
|
3440 |
+
padding: 0.5rem 1rem;
|
3441 |
+
font-size: 1.25rem;
|
3442 |
+
line-height: 1.5;
|
3443 |
+
border-radius: 0.3rem;
|
3444 |
+
}
|
3445 |
+
|
3446 |
+
.input-group-sm > .form-control,
|
3447 |
+
.input-group-sm > .input-group-prepend > .input-group-text,
|
3448 |
+
.input-group-sm > .input-group-append > .input-group-text,
|
3449 |
+
.input-group-sm > .input-group-prepend > .btn,
|
3450 |
+
.input-group-sm > .input-group-append > .btn {
|
3451 |
+
height: calc(1.8125rem + 2px);
|
3452 |
+
padding: 0.25rem 0.5rem;
|
3453 |
+
font-size: 0.875rem;
|
3454 |
+
line-height: 1.5;
|
3455 |
+
border-radius: 0.2rem;
|
3456 |
+
}
|
3457 |
+
|
3458 |
.input-group > .input-group-prepend > .btn,
|
3459 |
.input-group > .input-group-prepend > .input-group-text,
|
3460 |
.input-group > .input-group-append:not(:last-child) > .btn,
|
3614 |
.custom-select:focus {
|
3615 |
border-color: #80bdff;
|
3616 |
outline: 0;
|
3617 |
+
box-shadow: 0 0 0 0.2rem rgba(128, 189, 255, 0.5);
|
3618 |
}
|
3619 |
|
3620 |
.custom-select:focus::-ms-value {
|
3677 |
border-color: #80bdff;
|
3678 |
}
|
3679 |
|
3680 |
+
.custom-file-input:disabled ~ .custom-file-label {
|
3681 |
+
background-color: #e9ecef;
|
3682 |
+
}
|
3683 |
+
|
3684 |
.custom-file-input:lang(en) ~ .custom-file-label::after {
|
3685 |
content: "Browse";
|
3686 |
}
|
3730 |
outline: none;
|
3731 |
}
|
3732 |
|
3733 |
+
.custom-range:focus::-webkit-slider-thumb {
|
3734 |
+
box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
|
3735 |
+
}
|
3736 |
+
|
3737 |
+
.custom-range:focus::-moz-range-thumb {
|
3738 |
+
box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
|
3739 |
+
}
|
3740 |
+
|
3741 |
+
.custom-range:focus::-ms-thumb {
|
3742 |
+
box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
|
3743 |
+
}
|
3744 |
+
|
3745 |
.custom-range::-moz-focus-outer {
|
3746 |
border: 0;
|
3747 |
}
|
3753 |
background-color: #007bff;
|
3754 |
border: 0;
|
3755 |
border-radius: 1rem;
|
3756 |
+
transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
3757 |
-webkit-appearance: none;
|
3758 |
appearance: none;
|
3759 |
}
|
3760 |
|
3761 |
+
@media screen and (prefers-reduced-motion: reduce) {
|
3762 |
+
.custom-range::-webkit-slider-thumb {
|
3763 |
+
transition: none;
|
3764 |
+
}
|
3765 |
}
|
3766 |
|
3767 |
.custom-range::-webkit-slider-thumb:active {
|
3784 |
background-color: #007bff;
|
3785 |
border: 0;
|
3786 |
border-radius: 1rem;
|
3787 |
+
transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
3788 |
-moz-appearance: none;
|
3789 |
appearance: none;
|
3790 |
}
|
3791 |
|
3792 |
+
@media screen and (prefers-reduced-motion: reduce) {
|
3793 |
+
.custom-range::-moz-range-thumb {
|
3794 |
+
transition: none;
|
3795 |
+
}
|
3796 |
}
|
3797 |
|
3798 |
.custom-range::-moz-range-thumb:active {
|
3812 |
.custom-range::-ms-thumb {
|
3813 |
width: 1rem;
|
3814 |
height: 1rem;
|
3815 |
+
margin-top: 0;
|
3816 |
+
margin-right: 0.2rem;
|
3817 |
+
margin-left: 0.2rem;
|
3818 |
background-color: #007bff;
|
3819 |
border: 0;
|
3820 |
border-radius: 1rem;
|
3821 |
+
transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
3822 |
appearance: none;
|
3823 |
}
|
3824 |
|
3825 |
+
@media screen and (prefers-reduced-motion: reduce) {
|
3826 |
+
.custom-range::-ms-thumb {
|
3827 |
+
transition: none;
|
3828 |
+
}
|
3829 |
}
|
3830 |
|
3831 |
.custom-range::-ms-thumb:active {
|
3853 |
border-radius: 1rem;
|
3854 |
}
|
3855 |
|
3856 |
+
.custom-control-label::before,
|
3857 |
+
.custom-file-label,
|
3858 |
+
.custom-select {
|
3859 |
+
transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
3860 |
+
}
|
3861 |
+
|
3862 |
+
@media screen and (prefers-reduced-motion: reduce) {
|
3863 |
+
.custom-control-label::before,
|
3864 |
+
.custom-file-label,
|
3865 |
+
.custom-select {
|
3866 |
+
transition: none;
|
3867 |
+
}
|
3868 |
+
}
|
3869 |
+
|
3870 |
.nav {
|
3871 |
display: -ms-flexbox;
|
3872 |
display: flex;
|
5321 |
opacity: .5;
|
5322 |
}
|
5323 |
|
5324 |
+
.close:not(:disabled):not(.disabled) {
|
5325 |
+
cursor: pointer;
|
5326 |
+
}
|
5327 |
+
|
5328 |
+
.close:not(:disabled):not(.disabled):hover, .close:not(:disabled):not(.disabled):focus {
|
5329 |
color: #000;
|
5330 |
text-decoration: none;
|
5331 |
opacity: .75;
|
5332 |
}
|
5333 |
|
|
|
|
|
|
|
|
|
5334 |
button.close {
|
5335 |
padding: 0;
|
5336 |
background-color: transparent;
|
5342 |
overflow: hidden;
|
5343 |
}
|
5344 |
|
5345 |
+
.modal-open .modal {
|
5346 |
+
overflow-x: hidden;
|
5347 |
+
overflow-y: auto;
|
5348 |
+
}
|
5349 |
+
|
5350 |
.modal {
|
5351 |
position: fixed;
|
5352 |
top: 0;
|
5359 |
outline: 0;
|
5360 |
}
|
5361 |
|
|
|
|
|
|
|
|
|
|
|
5362 |
.modal-dialog {
|
5363 |
position: relative;
|
5364 |
width: auto;
|
5393 |
min-height: calc(100% - (0.5rem * 2));
|
5394 |
}
|
5395 |
|
5396 |
+
.modal-dialog-centered::before {
|
5397 |
+
display: block;
|
5398 |
+
height: calc(100vh - (0.5rem * 2));
|
5399 |
+
content: "";
|
5400 |
+
}
|
5401 |
+
|
5402 |
.modal-content {
|
5403 |
position: relative;
|
5404 |
display: -ms-flexbox;
|
5497 |
.modal-dialog-centered {
|
5498 |
min-height: calc(100% - (1.75rem * 2));
|
5499 |
}
|
5500 |
+
.modal-dialog-centered::before {
|
5501 |
+
height: calc(100vh - (1.75rem * 2));
|
5502 |
+
}
|
5503 |
.modal-sm {
|
5504 |
max-width: 300px;
|
5505 |
}
|
5516 |
z-index: 1070;
|
5517 |
display: block;
|
5518 |
margin: 0;
|
5519 |
+
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
|
5520 |
font-style: normal;
|
5521 |
font-weight: 400;
|
5522 |
line-height: 1.5;
|
5629 |
z-index: 1060;
|
5630 |
display: block;
|
5631 |
max-width: 276px;
|
5632 |
+
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
|
5633 |
font-style: normal;
|
5634 |
font-weight: 400;
|
5635 |
line-height: 1.5;
|
5824 |
-ms-flex-align: center;
|
5825 |
align-items: center;
|
5826 |
width: 100%;
|
|
|
|
|
|
|
5827 |
-webkit-backface-visibility: hidden;
|
5828 |
backface-visibility: hidden;
|
5829 |
-webkit-perspective: 1000px;
|
5830 |
perspective: 1000px;
|
5831 |
}
|
5832 |
|
|
|
|
|
|
|
|
|
|
|
|
|
5833 |
.carousel-item.active,
|
5834 |
.carousel-item-next,
|
5835 |
.carousel-item-prev {
|
5836 |
display: block;
|
5837 |
+
transition: -webkit-transform 0.6s ease;
|
5838 |
+
transition: transform 0.6s ease;
|
5839 |
+
transition: transform 0.6s ease, -webkit-transform 0.6s ease;
|
5840 |
+
}
|
5841 |
+
|
5842 |
+
@media screen and (prefers-reduced-motion: reduce) {
|
5843 |
+
.carousel-item.active,
|
5844 |
+
.carousel-item-next,
|
5845 |
+
.carousel-item-prev {
|
5846 |
+
transition: none;
|
5847 |
+
}
|
5848 |
}
|
5849 |
|
5850 |
.carousel-item-next,
|
9026 |
color: inherit;
|
9027 |
border-color: #dee2e6;
|
9028 |
}
|
9029 |
+
}
|
|
@@ -1,7 +1,6 @@
|
|
1 |
/*!
|
2 |
-
* Bootstrap v4.1.
|
3 |
* Copyright 2011-2018 The Bootstrap Authors
|
4 |
* Copyright 2011-2018 Twitter, Inc.
|
5 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
6 |
-
*/:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:576px;--breakpoint-md:768px;--breakpoint-lg:992px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}*,::after,::before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;-ms-overflow-style:scrollbar;-webkit-tap-highlight-color:transparent}@-ms-viewport{width:device-width}article,aside,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0}address{margin-bottom:1rem;font-style:normal;line-height:inherit}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}dfn{font-style:italic}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;text-decoration:none;background-color:transparent;-webkit-text-decoration-skip:objects}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg:not(:root){overflow:hidden}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;font-family:inherit;font-weight:500;line-height:1.2;color:inherit}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem;font-weight:300;line-height:1.2}.display-2{font-size:5.5rem;font-weight:300;line-height:1.2}.display-3{font-size:4.5rem;font-weight:300;line-height:1.2}.display-4{font-size:3.5rem;font-weight:300;line-height:1.2}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,.1)}.small,small{font-size:80%;font-weight:400}.mark,mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer::before{content:"\2014 \00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code{font-size:87.5%;color:#e83e8c;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#212529}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-10,.col-11,.col-12,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-auto,.col-lg,.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-auto,.col-md,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-auto,.col-sm,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-auto{position:relative;width:100%;min-height:1px;padding-right:15px;padding-left:15px}.col{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-ms-flex-order:-1;order:-1}.order-last{-ms-flex-order:13;order:13}.order-0{-ms-flex-order:0;order:0}.order-1{-ms-flex-order:1;order:1}.order-2{-ms-flex-order:2;order:2}.order-3{-ms-flex-order:3;order:3}.order-4{-ms-flex-order:4;order:4}.order-5{-ms-flex-order:5;order:5}.order-6{-ms-flex-order:6;order:6}.order-7{-ms-flex-order:7;order:7}.order-8{-ms-flex-order:8;order:8}.order-9{-ms-flex-order:9;order:9}.order-10{-ms-flex-order:10;order:10}.order-11{-ms-flex-order:11;order:11}.order-12{-ms-flex-order:12;order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-sm-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-ms-flex-order:-1;order:-1}.order-sm-last{-ms-flex-order:13;order:13}.order-sm-0{-ms-flex-order:0;order:0}.order-sm-1{-ms-flex-order:1;order:1}.order-sm-2{-ms-flex-order:2;order:2}.order-sm-3{-ms-flex-order:3;order:3}.order-sm-4{-ms-flex-order:4;order:4}.order-sm-5{-ms-flex-order:5;order:5}.order-sm-6{-ms-flex-order:6;order:6}.order-sm-7{-ms-flex-order:7;order:7}.order-sm-8{-ms-flex-order:8;order:8}.order-sm-9{-ms-flex-order:9;order:9}.order-sm-10{-ms-flex-order:10;order:10}.order-sm-11{-ms-flex-order:11;order:11}.order-sm-12{-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-md-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-ms-flex-order:-1;order:-1}.order-md-last{-ms-flex-order:13;order:13}.order-md-0{-ms-flex-order:0;order:0}.order-md-1{-ms-flex-order:1;order:1}.order-md-2{-ms-flex-order:2;order:2}.order-md-3{-ms-flex-order:3;order:3}.order-md-4{-ms-flex-order:4;order:4}.order-md-5{-ms-flex-order:5;order:5}.order-md-6{-ms-flex-order:6;order:6}.order-md-7{-ms-flex-order:7;order:7}.order-md-8{-ms-flex-order:8;order:8}.order-md-9{-ms-flex-order:9;order:9}.order-md-10{-ms-flex-order:10;order:10}.order-md-11{-ms-flex-order:11;order:11}.order-md-12{-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-lg-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-ms-flex-order:-1;order:-1}.order-lg-last{-ms-flex-order:13;order:13}.order-lg-0{-ms-flex-order:0;order:0}.order-lg-1{-ms-flex-order:1;order:1}.order-lg-2{-ms-flex-order:2;order:2}.order-lg-3{-ms-flex-order:3;order:3}.order-lg-4{-ms-flex-order:4;order:4}.order-lg-5{-ms-flex-order:5;order:5}.order-lg-6{-ms-flex-order:6;order:6}.order-lg-7{-ms-flex-order:7;order:7}.order-lg-8{-ms-flex-order:8;order:8}.order-lg-9{-ms-flex-order:9;order:9}.order-lg-10{-ms-flex-order:10;order:10}.order-lg-11{-ms-flex-order:11;order:11}.order-lg-12{-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-xl-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-ms-flex-order:-1;order:-1}.order-xl-last{-ms-flex-order:13;order:13}.order-xl-0{-ms-flex-order:0;order:0}.order-xl-1{-ms-flex-order:1;order:1}.order-xl-2{-ms-flex-order:2;order:2}.order-xl-3{-ms-flex-order:3;order:3}.order-xl-4{-ms-flex-order:4;order:4}.order-xl-5{-ms-flex-order:5;order:5}.order-xl-6{-ms-flex-order:6;order:6}.order-xl-7{-ms-flex-order:7;order:7}.order-xl-8{-ms-flex-order:8;order:8}.order-xl-9{-ms-flex-order:9;order:9}.order-xl-10{-ms-flex-order:10;order:10}.order-xl-11{-ms-flex-order:11;order:11}.order-xl-12{-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.table{width:100%;max-width:100%;margin-bottom:1rem;background-color:transparent}.table td,.table th{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table .table{background-color:#fff}.table-sm td,.table-sm th{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-borderless tbody+tbody,.table-borderless td,.table-borderless th,.table-borderless thead th{border:0}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-hover .table-primary:hover{background-color:#9fcdff}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-hover .table-secondary:hover{background-color:#c8cbcf}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-hover .table-success:hover{background-color:#b1dfbb}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-hover .table-info:hover{background-color:#abdde5}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-hover .table-warning:hover{background-color:#ffe8a1}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-hover .table-danger:hover{background-color:#f1b0b7}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-hover .table-light:hover{background-color:#ececf6}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-hover .table-dark:hover{background-color:#b9bbbe}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{color:#fff;background-color:#212529;border-color:#32383e}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#212529}.table-dark td,.table-dark th,.table-dark thead th{border-color:#32383e}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,.05)}.table-dark.table-hover tbody tr:hover{background-color:rgba(255,255,255,.075)}@media (max-width:575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-md>.table-bordered{border:0}}@media (max-width:991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.form-control::-webkit-input-placeholder{color:#6c757d;opacity:1}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control:-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:not([size]):not([multiple]){height:calc(2.25rem + 2px)}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm,.input-group-lg>.form-control-plaintext.form-control,.input-group-lg>.input-group-append>.form-control-plaintext.btn,.input-group-lg>.input-group-append>.form-control-plaintext.input-group-text,.input-group-lg>.input-group-prepend>.form-control-plaintext.btn,.input-group-lg>.input-group-prepend>.form-control-plaintext.input-group-text,.input-group-sm>.form-control-plaintext.form-control,.input-group-sm>.input-group-append>.form-control-plaintext.btn,.input-group-sm>.input-group-append>.form-control-plaintext.input-group-text,.input-group-sm>.input-group-prepend>.form-control-plaintext.btn,.input-group-sm>.input-group-prepend>.form-control-plaintext.input-group-text{padding-right:0;padding-left:0}.form-control-sm,.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group-sm>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-sm>select.form-control:not([size]):not([multiple]),select.form-control-sm:not([size]):not([multiple]){height:calc(1.8125rem + 2px)}.form-control-lg,.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-lg>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-lg>select.form-control:not([size]):not([multiple]),select.form-control-lg:not([size]):not([multiple]){height:calc(2.875rem + 2px)}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class*=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:-ms-inline-flexbox;display:inline-flex;-ms-flex-align:center;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(40,167,69,.8);border-radius:.2rem}.custom-select.is-valid,.form-control.is-valid,.was-validated .custom-select:valid,.was-validated .form-control:valid{border-color:#28a745}.custom-select.is-valid:focus,.form-control.is-valid:focus,.was-validated .custom-select:valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip,.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip,.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip{display:block}.form-control-file.is-valid~.valid-feedback,.form-control-file.is-valid~.valid-tooltip,.was-validated .form-control-file:valid~.valid-feedback,.was-validated .form-control-file:valid~.valid-tooltip{display:block}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label::before,.was-validated .custom-control-input:valid~.custom-control-label::before{background-color:#71dd8a}.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip,.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid:checked~.custom-control-label::before,.was-validated .custom-control-input:valid:checked~.custom-control-label::before{background-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label::before,.was-validated .custom-control-input:valid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(40,167,69,.25)}.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid~.custom-file-label::before,.was-validated .custom-file-input:valid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip,.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip{display:block}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(220,53,69,.8);border-radius:.2rem}.custom-select.is-invalid,.form-control.is-invalid,.was-validated .custom-select:invalid,.was-validated .form-control:invalid{border-color:#dc3545}.custom-select.is-invalid:focus,.form-control.is-invalid:focus,.was-validated .custom-select:invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip,.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip,.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip{display:block}.form-control-file.is-invalid~.invalid-feedback,.form-control-file.is-invalid~.invalid-tooltip,.was-validated .form-control-file:invalid~.invalid-feedback,.was-validated .form-control-file:invalid~.invalid-tooltip{display:block}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label::before,.was-validated .custom-control-input:invalid~.custom-control-label::before{background-color:#efa2a9}.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip,.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid:checked~.custom-control-label::before,.was-validated .custom-control-input:invalid:checked~.custom-control-label::before{background-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label::before,.was-validated .custom-control-input:invalid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(220,53,69,.25)}.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid~.custom-file-label::before,.was-validated .custom-file-input:invalid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip,.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip{display:block}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{display:-ms-flexbox;display:flex;-ms-flex-flow:row wrap;flex-flow:row wrap;-ms-flex-align:center;align-items:center}.form-inline .form-check{width:100%}@media (min-width:576px){.form-inline label{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:-ms-flexbox;display:flex;-ms-flex:0 0 auto;flex:0 0 auto;-ms-flex-flow:row wrap;flex-flow:row wrap;-ms-flex-align:center;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .custom-select,.form-inline .input-group{width:auto}.form-inline .form-check{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;text-align:center;white-space:nowrap;vertical-align:middle;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:focus,.btn:hover{text-decoration:none}.btn.focus,.btn:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.btn.disabled,.btn:disabled{opacity:.65}.btn:not(:disabled):not(.disabled){cursor:pointer}.btn:not(:disabled):not(.disabled).active,.btn:not(:disabled):not(.disabled):active{background-image:none}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:hover{color:#fff;background-color:#0069d9;border-color:#0062cc}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#0062cc;border-color:#005cbf}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-primary{color:#007bff;background-color:transparent;background-image:none;border-color:#007bff}.btn-outline-primary:hover{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#007bff;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{color:#6c757d;background-color:transparent;background-image:none;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-success{color:#28a745;background-color:transparent;background-image:none;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{color:#17a2b8;background-color:transparent;background-image:none;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{color:#ffc107;background-color:transparent;background-image:none;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{color:#dc3545;background-color:transparent;background-image:none;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{color:#f8f9fa;background-color:transparent;background-image:none;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{color:#343a40;background-color:transparent;background-image:none;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{font-weight:400;color:#007bff;background-color:transparent}.btn-link:hover{color:#0056b3;text-decoration:underline;background-color:transparent;border-color:transparent}.btn-link.focus,.btn-link:focus{text-decoration:underline;border-color:transparent;box-shadow:none}.btn-link.disabled,.btn-link:disabled{color:#6c757d;pointer-events:none}.btn-group-lg>.btn,.btn-lg{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-group-sm>.btn,.btn-sm{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{transition:opacity .15s linear}@media screen and (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{position:relative;height:0;overflow:hidden;transition:height .35s ease}@media screen and (prefers-reduced-motion:reduce){.collapsing{transition:none}}.dropdown,.dropleft,.dropright,.dropup{position:relative}.dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#212529;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem}.dropdown-menu-right{right:0;left:auto}.dropup .dropdown-menu{top:auto;bottom:100%;margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{top:0;right:auto;left:100%;margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{top:0;right:100%;left:auto;margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;width:0;height:0;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-menu[x-placement^=bottom],.dropdown-menu[x-placement^=left],.dropdown-menu[x-placement^=right],.dropdown-menu[x-placement^=top]{right:auto;bottom:auto}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#007bff}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#6c757d;white-space:nowrap}.dropdown-item-text{display:block;padding:.25rem 1.5rem;color:#212529}.btn-group,.btn-group-vertical{position:relative;display:-ms-inline-flexbox;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;-ms-flex:0 1 auto;flex:0 1 auto}.btn-group-vertical>.btn:hover,.btn-group>.btn:hover{z-index:1}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus{z-index:1}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group,.btn-group-vertical .btn+.btn,.btn-group-vertical .btn+.btn-group,.btn-group-vertical .btn-group+.btn,.btn-group-vertical .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-pack:start;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropright .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropleft .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{-ms-flex-direction:column;flex-direction:column;-ms-flex-align:start;align-items:flex-start;-ms-flex-pack:center;justify-content:center}.btn-group-vertical .btn,.btn-group-vertical .btn-group{width:100%}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio],.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:stretch;align-items:stretch;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control{position:relative;-ms-flex:1 1 auto;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.custom-file:focus,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control{margin-left:-1px}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::after{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-append,.input-group-prepend{display:-ms-flexbox;display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:-ms-inline-flexbox;display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked~.custom-control-label::before{color:#fff;background-color:#007bff}.custom-control-input:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:active~.custom-control-label::before{color:#fff;background-color:#b3d7ff}.custom-control-input:disabled~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label::before{background-color:#e9ecef}.custom-control-label{position:relative;margin-bottom:0}.custom-control-label::before{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;pointer-events:none;content:"";-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#dee2e6}.custom-control-label::after{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;content:"";background-repeat:no-repeat;background-position:center center;background-size:50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-radio .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-select{display:inline-block;width:100%;height:calc(2.25rem + 2px);padding:.375rem 1.75rem .375rem .75rem;line-height:1.5;color:#495057;vertical-align:middle;background:#fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center;background-size:8px 10px;border:1px solid #ced4da;border-radius:.25rem;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-select:focus{border-color:#80bdff;outline:0;box-shadow:inset 0 1px 2px rgba(0,0,0,.075),0 0 5px rgba(128,189,255,.5)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{opacity:0}.custom-select-sm{height:calc(1.8125rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:75%}.custom-select-lg{height:calc(2.875rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:125%}.custom-file{position:relative;display:inline-block;width:100%;height:calc(2.25rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:calc(2.25rem + 2px);margin:0;opacity:0}.custom-file-input:focus~.custom-file-label{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:focus~.custom-file-label::after{border-color:#80bdff}.custom-file-input:lang(en)~.custom-file-label::after{content:"Browse"}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:calc(2.25rem + 2px);padding:.375rem .75rem;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:2.25rem;padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background-color:#e9ecef;border-left:1px solid #ced4da;border-radius:0 .25rem .25rem 0}.custom-range{width:100%;padding-left:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-range:focus{outline:0}.custom-range::-moz-focus-outer{border:0}.custom-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#007bff;border:0;border-radius:1rem;-webkit-appearance:none;appearance:none}.custom-range::-webkit-slider-thumb:focus{outline:0;box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-webkit-slider-thumb:active{background-color:#b3d7ff}.custom-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#007bff;border:0;border-radius:1rem;-moz-appearance:none;appearance:none}.custom-range::-moz-range-thumb:focus{outline:0;box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-moz-range-thumb:active{background-color:#b3d7ff}.custom-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-ms-thumb{width:1rem;height:1rem;background-color:#007bff;border:0;border-radius:1rem;appearance:none}.custom-range::-ms-thumb:focus{outline:0;box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-ms-thumb:active{background-color:#b3d7ff}.custom-range::-ms-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:transparent;border-color:transparent;border-width:.5rem}.custom-range::-ms-fill-lower{background-color:#dee2e6;border-radius:1rem}.custom-range::-ms-fill-upper{margin-right:15px;background-color:#dee2e6;border-radius:1rem}.nav{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#007bff}.nav-fill .nav-item{-ms-flex:1 1 auto;flex:1 1 auto;text-align:center}.nav-justified .nav-item{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{-ms-flex-preferred-size:100%;flex-basis:100%;-ms-flex-positive:1;flex-grow:1;-ms-flex-align:center;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler:not(:disabled):not(.disabled){cursor:pointer}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat center center;background-size:100% 100%}@media (max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:576px){.navbar-expand-sm{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-sm .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}}@media (max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:768px){.navbar-expand-md{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-md .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}}@media (max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:992px){.navbar-expand-lg{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-lg .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:1200px){.navbar-expand-xl{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-xl .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}}.navbar-expand{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-light .navbar-brand{color:rgba(0,0,0,.9)}.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,.9)}.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:rgba(255,255,255,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,.5);border-color:rgba(255,255,255,.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-dark .navbar-text{color:rgba(255,255,255,.5)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{position:relative;display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:calc(.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width:576px){.card-deck{-ms-flex-flow:row wrap;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{display:-ms-flexbox;display:flex;-ms-flex:1 0 0%;flex:1 0 0%;-ms-flex-direction:column;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width:576px){.card-group{-ms-flex-flow:row wrap;flex-flow:row wrap}.card-group>.card{-ms-flex:1 0 0%;flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:first-child .card-header,.card-group>.card:first-child .card-img-top{border-top-right-radius:0}.card-group>.card:first-child .card-footer,.card-group>.card:first-child .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:last-child .card-header,.card-group>.card:last-child .card-img-top{border-top-left-radius:0}.card-group>.card:last-child .card-footer,.card-group>.card:last-child .card-img-bottom{border-bottom-left-radius:0}.card-group>.card:only-child{border-radius:.25rem}.card-group>.card:only-child .card-header,.card-group>.card:only-child .card-img-top{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card-group>.card:only-child .card-footer,.card-group>.card:only-child .card-img-bottom{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-group>.card:not(:first-child):not(:last-child):not(:only-child){border-radius:0}.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-footer,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-header,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-top{border-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:576px){.card-columns{-webkit-column-count:3;-moz-column-count:3;column-count:3;-webkit-column-gap:1.25rem;-moz-column-gap:1.25rem;column-gap:1.25rem;orphans:1;widows:1}.card-columns .card{display:inline-block;width:100%}}.accordion .card:not(:first-of-type):not(:last-of-type){border-bottom:0;border-radius:0}.accordion .card:not(:first-of-type) .card-header:first-child{border-radius:0}.accordion .card:first-of-type{border-bottom:0;border-bottom-right-radius:0;border-bottom-left-radius:0}.accordion .card:last-of-type{border-top-left-radius:0;border-top-right-radius:0}.breadcrumb{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item{padding-left:.5rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:-ms-flexbox;display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#007bff;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{z-index:2;color:#0056b3;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.page-link:not(:disabled):not(.disabled){cursor:pointer}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#007bff;border-color:#007bff}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#007bff}.badge-primary[href]:focus,.badge-primary[href]:hover{color:#fff;text-decoration:none;background-color:#0062cc}.badge-secondary{color:#fff;background-color:#6c757d}.badge-secondary[href]:focus,.badge-secondary[href]:hover{color:#fff;text-decoration:none;background-color:#545b62}.badge-success{color:#fff;background-color:#28a745}.badge-success[href]:focus,.badge-success[href]:hover{color:#fff;text-decoration:none;background-color:#1e7e34}.badge-info{color:#fff;background-color:#17a2b8}.badge-info[href]:focus,.badge-info[href]:hover{color:#fff;text-decoration:none;background-color:#117a8b}.badge-warning{color:#212529;background-color:#ffc107}.badge-warning[href]:focus,.badge-warning[href]:hover{color:#212529;text-decoration:none;background-color:#d39e00}.badge-danger{color:#fff;background-color:#dc3545}.badge-danger[href]:focus,.badge-danger[href]:hover{color:#fff;text-decoration:none;background-color:#bd2130}.badge-light{color:#212529;background-color:#f8f9fa}.badge-light[href]:focus,.badge-light[href]:hover{color:#212529;text-decoration:none;background-color:#dae0e5}.badge-dark{color:#fff;background-color:#343a40}.badge-dark[href]:focus,.badge-dark[href]:hover{color:#fff;text-decoration:none;background-color:#1d2124}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#004085;background-color:#cce5ff;border-color:#b8daff}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@-webkit-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem}.progress-bar{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#007bff;transition:width .6s ease}@media screen and (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}.media{display:-ms-flexbox;display:flex;-ms-flex-align:start;align-items:flex-start}.media-body{-ms-flex:1;flex:1}.list-group{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#212529;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item:focus,.list-group-item:hover{z-index:1;text-decoration:none}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#007bff;border-color:#007bff}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{border-bottom:0}.list-group-item-primary{color:#004085;background-color:#b8daff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#004085;background-color:#9fcdff}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#004085;border-color:#004085}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:focus,.close:hover{color:#000;text-decoration:none;opacity:.75}.close:not(:disabled):not(.disabled){cursor:pointer}button.close{padding:0;background-color:transparent;border:0;-webkit-appearance:none}.modal-open{overflow:hidden}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;outline:0}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:-webkit-transform .3s ease-out;transition:transform .3s ease-out;transition:transform .3s ease-out,-webkit-transform .3s ease-out;-webkit-transform:translate(0,-25%);transform:translate(0,-25%)}@media screen and (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{-webkit-transform:translate(0,0);transform:translate(0,0)}.modal-dialog-centered{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;min-height:calc(100% - (.5rem * 2))}.modal-content{position:relative;display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:-ms-flexbox;display:flex;-ms-flex-align:start;align-items:flex-start;-ms-flex-pack:justify;justify-content:space-between;padding:1rem;border-bottom:1px solid #e9ecef;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem}.modal-footer{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:end;justify-content:flex-end;padding:1rem;border-top:1px solid #e9ecef}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-centered{min-height:calc(100% - (1.75rem * 2))}.modal-sm{max-width:300px}}@media (min-width:992px){.modal-lg{max-width:800px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow::before,.bs-tooltip-top .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=right] .arrow::before,.bs-tooltip-right .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow::before,.bs-tooltip-bottom .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=left] .arrow::before,.bs-tooltip-left .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::after,.popover .arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top] .arrow,.bs-popover-top .arrow{bottom:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::after,.bs-popover-top .arrow::before{border-width:.5rem .5rem 0}.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::before{bottom:0;border-top-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-top .arrow::after{bottom:1px;border-top-color:#fff}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right] .arrow,.bs-popover-right .arrow{left:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::after,.bs-popover-right .arrow::before{border-width:.5rem .5rem .5rem 0}.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::before{left:0;border-right-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-right .arrow::after{left:1px;border-right-color:#fff}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom] .arrow,.bs-popover-bottom .arrow{top:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::after,.bs-popover-bottom .arrow::before{border-width:0 .5rem .5rem .5rem}.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::before{top:0;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-bottom .arrow::after{top:1px;border-bottom-color:#fff}.bs-popover-auto[x-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left] .arrow,.bs-popover-left .arrow{right:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::after,.bs-popover-left .arrow::before{border-width:.5rem 0 .5rem .5rem}.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::before{right:0;border-left-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-left .arrow::after{right:1px;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;color:inherit;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#212529}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-item{position:relative;display:none;-ms-flex-align:center;align-items:center;width:100%;transition:-webkit-transform .6s ease;transition:transform .6s ease;transition:transform .6s ease,-webkit-transform .6s ease;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}@media screen and (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.carousel-item-next,.carousel-item-prev{position:absolute;top:0}.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.active.carousel-item-right,.carousel-item-next{-webkit-transform:translateX(100%);transform:translateX(100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-right,.carousel-item-next{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}}.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translateX(-100%);transform:translateX(-100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}}.carousel-fade .carousel-item{opacity:0;transition-duration:.6s;transition-property:opacity}.carousel-fade .carousel-item-next.carousel-item-left,.carousel-fade .carousel-item-prev.carousel-item-right,.carousel-fade .carousel-item.active{opacity:1}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{opacity:0}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-prev,.carousel-fade .carousel-item-next,.carousel-fade .carousel-item-prev,.carousel-fade .carousel-item.active{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-prev,.carousel-fade .carousel-item-next,.carousel-fade .carousel-item-prev,.carousel-fade .carousel-item.active{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:20px;height:20px;background:transparent no-repeat center center;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E")}.carousel-control-next-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E")}.carousel-indicators{position:absolute;right:0;bottom:10px;left:0;z-index:15;display:-ms-flexbox;display:flex;-ms-flex-pack:center;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{position:relative;-ms-flex:0 1 auto;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:rgba(255,255,255,.5)}.carousel-indicators li::before{position:absolute;top:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators li::after{position:absolute;bottom:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators .active{background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important;border-top-right-radius:.25rem!important}.rounded-right{border-top-right-radius:.25rem!important;border-bottom-right-radius:.25rem!important}.rounded-bottom{border-bottom-right-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-circle{border-radius:50%!important}.rounded-0{border-radius:0!important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.857143%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}@media (min-width:576px){.flex-sm-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-sm-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-sm-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-sm-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-sm-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-sm-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-sm-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:768px){.flex-md-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-md-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-md-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-md-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-md-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-md-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-md-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-lg-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-lg-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-lg-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-lg-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-lg-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-lg-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-xl-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-xl-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-xl-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-xl-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-xl-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-xl-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports ((position:-webkit-sticky) or (position:sticky)){.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-monospace{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}.text-justify{text-align:justify!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0062cc!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#545b62!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#1e7e34!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#117a8b!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#d39e00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#bd2130!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#dae0e5!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#1d2124!important}.text-body{color:#212529!important}.text-muted{color:#6c757d!important}.text-black-50{color:rgba(0,0,0,.5)!important}.text-white-50{color:rgba(255,255,255,.5)!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,::after,::before{text-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #adb5bd;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px!important}.container{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #dee2e6!important}.table-dark{color:inherit}.table-dark tbody+tbody,.table-dark td,.table-dark th,.table-dark thead th{border-color:#dee2e6}.table .thead-dark th{color:inherit;border-color:#dee2e6}}
|
7 |
-
/*# sourceMappingURL=bootstrap.min.css.map */
|
1 |
/*!
|
2 |
+
* Bootstrap v4.1.3 (https://getbootstrap.com/)
|
3 |
* Copyright 2011-2018 The Bootstrap Authors
|
4 |
* Copyright 2011-2018 Twitter, Inc.
|
5 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
6 |
+
*/:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:576px;--breakpoint-md:768px;--breakpoint-lg:992px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}*,::after,::before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;-ms-overflow-style:scrollbar;-webkit-tap-highlight-color:transparent}@-ms-viewport{width:device-width}article,aside,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0}address{margin-bottom:1rem;font-style:normal;line-height:inherit}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}dfn{font-style:italic}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;text-decoration:none;background-color:transparent;-webkit-text-decoration-skip:objects}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg{overflow:hidden;vertical-align:middle}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;font-family:inherit;font-weight:500;line-height:1.2;color:inherit}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem;font-weight:300;line-height:1.2}.display-2{font-size:5.5rem;font-weight:300;line-height:1.2}.display-3{font-size:4.5rem;font-weight:300;line-height:1.2}.display-4{font-size:3.5rem;font-weight:300;line-height:1.2}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,.1)}.small,small{font-size:80%;font-weight:400}.mark,mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer::before{content:"\2014 \00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code{font-size:87.5%;color:#e83e8c;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#212529}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-10,.col-11,.col-12,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-auto,.col-lg,.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-auto,.col-md,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-auto,.col-sm,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-auto{position:relative;width:100%;min-height:1px;padding-right:15px;padding-left:15px}.col{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-ms-flex-order:-1;order:-1}.order-last{-ms-flex-order:13;order:13}.order-0{-ms-flex-order:0;order:0}.order-1{-ms-flex-order:1;order:1}.order-2{-ms-flex-order:2;order:2}.order-3{-ms-flex-order:3;order:3}.order-4{-ms-flex-order:4;order:4}.order-5{-ms-flex-order:5;order:5}.order-6{-ms-flex-order:6;order:6}.order-7{-ms-flex-order:7;order:7}.order-8{-ms-flex-order:8;order:8}.order-9{-ms-flex-order:9;order:9}.order-10{-ms-flex-order:10;order:10}.order-11{-ms-flex-order:11;order:11}.order-12{-ms-flex-order:12;order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-sm-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-ms-flex-order:-1;order:-1}.order-sm-last{-ms-flex-order:13;order:13}.order-sm-0{-ms-flex-order:0;order:0}.order-sm-1{-ms-flex-order:1;order:1}.order-sm-2{-ms-flex-order:2;order:2}.order-sm-3{-ms-flex-order:3;order:3}.order-sm-4{-ms-flex-order:4;order:4}.order-sm-5{-ms-flex-order:5;order:5}.order-sm-6{-ms-flex-order:6;order:6}.order-sm-7{-ms-flex-order:7;order:7}.order-sm-8{-ms-flex-order:8;order:8}.order-sm-9{-ms-flex-order:9;order:9}.order-sm-10{-ms-flex-order:10;order:10}.order-sm-11{-ms-flex-order:11;order:11}.order-sm-12{-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-md-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-ms-flex-order:-1;order:-1}.order-md-last{-ms-flex-order:13;order:13}.order-md-0{-ms-flex-order:0;order:0}.order-md-1{-ms-flex-order:1;order:1}.order-md-2{-ms-flex-order:2;order:2}.order-md-3{-ms-flex-order:3;order:3}.order-md-4{-ms-flex-order:4;order:4}.order-md-5{-ms-flex-order:5;order:5}.order-md-6{-ms-flex-order:6;order:6}.order-md-7{-ms-flex-order:7;order:7}.order-md-8{-ms-flex-order:8;order:8}.order-md-9{-ms-flex-order:9;order:9}.order-md-10{-ms-flex-order:10;order:10}.order-md-11{-ms-flex-order:11;order:11}.order-md-12{-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-lg-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-ms-flex-order:-1;order:-1}.order-lg-last{-ms-flex-order:13;order:13}.order-lg-0{-ms-flex-order:0;order:0}.order-lg-1{-ms-flex-order:1;order:1}.order-lg-2{-ms-flex-order:2;order:2}.order-lg-3{-ms-flex-order:3;order:3}.order-lg-4{-ms-flex-order:4;order:4}.order-lg-5{-ms-flex-order:5;order:5}.order-lg-6{-ms-flex-order:6;order:6}.order-lg-7{-ms-flex-order:7;order:7}.order-lg-8{-ms-flex-order:8;order:8}.order-lg-9{-ms-flex-order:9;order:9}.order-lg-10{-ms-flex-order:10;order:10}.order-lg-11{-ms-flex-order:11;order:11}.order-lg-12{-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-xl-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-ms-flex-order:-1;order:-1}.order-xl-last{-ms-flex-order:13;order:13}.order-xl-0{-ms-flex-order:0;order:0}.order-xl-1{-ms-flex-order:1;order:1}.order-xl-2{-ms-flex-order:2;order:2}.order-xl-3{-ms-flex-order:3;order:3}.order-xl-4{-ms-flex-order:4;order:4}.order-xl-5{-ms-flex-order:5;order:5}.order-xl-6{-ms-flex-order:6;order:6}.order-xl-7{-ms-flex-order:7;order:7}.order-xl-8{-ms-flex-order:8;order:8}.order-xl-9{-ms-flex-order:9;order:9}.order-xl-10{-ms-flex-order:10;order:10}.order-xl-11{-ms-flex-order:11;order:11}.order-xl-12{-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.table{width:100%;margin-bottom:1rem;background-color:transparent}.table td,.table th{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table .table{background-color:#fff}.table-sm td,.table-sm th{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-borderless tbody+tbody,.table-borderless td,.table-borderless th,.table-borderless thead th{border:0}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-hover .table-primary:hover{background-color:#9fcdff}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-hover .table-secondary:hover{background-color:#c8cbcf}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-hover .table-success:hover{background-color:#b1dfbb}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-hover .table-info:hover{background-color:#abdde5}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-hover .table-warning:hover{background-color:#ffe8a1}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-hover .table-danger:hover{background-color:#f1b0b7}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-hover .table-light:hover{background-color:#ececf6}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-hover .table-dark:hover{background-color:#b9bbbe}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{color:#fff;background-color:#212529;border-color:#32383e}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#212529}.table-dark td,.table-dark th,.table-dark thead th{border-color:#32383e}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,.05)}.table-dark.table-hover tbody tr:hover{background-color:rgba(255,255,255,.075)}@media (max-width:575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-md>.table-bordered{border:0}}@media (max-width:991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;height:calc(2.25rem + 2px);padding:.375rem .75rem;font-size:1rem;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.form-control::-webkit-input-placeholder{color:#6c757d;opacity:1}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control:-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{height:calc(1.8125rem + 2px);padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.form-control-lg{height:calc(2.875rem + 2px);padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}select.form-control[multiple],select.form-control[size]{height:auto}textarea.form-control{height:auto}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class*=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:-ms-inline-flexbox;display:inline-flex;-ms-flex-align:center;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;line-height:1.5;color:#fff;background-color:rgba(40,167,69,.9);border-radius:.25rem}.custom-select.is-valid,.form-control.is-valid,.was-validated .custom-select:valid,.was-validated .form-control:valid{border-color:#28a745}.custom-select.is-valid:focus,.form-control.is-valid:focus,.was-validated .custom-select:valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip,.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip,.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip{display:block}.form-control-file.is-valid~.valid-feedback,.form-control-file.is-valid~.valid-tooltip,.was-validated .form-control-file:valid~.valid-feedback,.was-validated .form-control-file:valid~.valid-tooltip{display:block}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label::before,.was-validated .custom-control-input:valid~.custom-control-label::before{background-color:#71dd8a}.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip,.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid:checked~.custom-control-label::before,.was-validated .custom-control-input:valid:checked~.custom-control-label::before{background-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label::before,.was-validated .custom-control-input:valid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(40,167,69,.25)}.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid~.custom-file-label::after,.was-validated .custom-file-input:valid~.custom-file-label::after{border-color:inherit}.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip,.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip{display:block}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;line-height:1.5;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.25rem}.custom-select.is-invalid,.form-control.is-invalid,.was-validated .custom-select:invalid,.was-validated .form-control:invalid{border-color:#dc3545}.custom-select.is-invalid:focus,.form-control.is-invalid:focus,.was-validated .custom-select:invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip,.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip,.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip{display:block}.form-control-file.is-invalid~.invalid-feedback,.form-control-file.is-invalid~.invalid-tooltip,.was-validated .form-control-file:invalid~.invalid-feedback,.was-validated .form-control-file:invalid~.invalid-tooltip{display:block}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label::before,.was-validated .custom-control-input:invalid~.custom-control-label::before{background-color:#efa2a9}.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip,.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid:checked~.custom-control-label::before,.was-validated .custom-control-input:invalid:checked~.custom-control-label::before{background-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label::before,.was-validated .custom-control-input:invalid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(220,53,69,.25)}.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid~.custom-file-label::after,.was-validated .custom-file-input:invalid~.custom-file-label::after{border-color:inherit}.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip,.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip{display:block}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{display:-ms-flexbox;display:flex;-ms-flex-flow:row wrap;flex-flow:row wrap;-ms-flex-align:center;align-items:center}.form-inline .form-check{width:100%}@media (min-width:576px){.form-inline label{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:-ms-flexbox;display:flex;-ms-flex:0 0 auto;flex:0 0 auto;-ms-flex-flow:row wrap;flex-flow:row wrap;-ms-flex-align:center;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .custom-select,.form-inline .input-group{width:auto}.form-inline .form-check{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;text-align:center;white-space:nowrap;vertical-align:middle;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:focus,.btn:hover{text-decoration:none}.btn.focus,.btn:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.btn.disabled,.btn:disabled{opacity:.65}.btn:not(:disabled):not(.disabled){cursor:pointer}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:hover{color:#fff;background-color:#0069d9;border-color:#0062cc}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#0062cc;border-color:#005cbf}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-primary{color:#007bff;background-color:transparent;background-image:none;border-color:#007bff}.btn-outline-primary:hover{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#007bff;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{color:#6c757d;background-color:transparent;background-image:none;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-success{color:#28a745;background-color:transparent;background-image:none;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{color:#17a2b8;background-color:transparent;background-image:none;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{color:#ffc107;background-color:transparent;background-image:none;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{color:#dc3545;background-color:transparent;background-image:none;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{color:#f8f9fa;background-color:transparent;background-image:none;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{color:#343a40;background-color:transparent;background-image:none;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{font-weight:400;color:#007bff;background-color:transparent}.btn-link:hover{color:#0056b3;text-decoration:underline;background-color:transparent;border-color:transparent}.btn-link.focus,.btn-link:focus{text-decoration:underline;border-color:transparent;box-shadow:none}.btn-link.disabled,.btn-link:disabled{color:#6c757d;pointer-events:none}.btn-group-lg>.btn,.btn-lg{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-group-sm>.btn,.btn-sm{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{transition:opacity .15s linear}@media screen and (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{position:relative;height:0;overflow:hidden;transition:height .35s ease}@media screen and (prefers-reduced-motion:reduce){.collapsing{transition:none}}.dropdown,.dropleft,.dropright,.dropup{position:relative}.dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#212529;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem}.dropdown-menu-right{right:0;left:auto}.dropup .dropdown-menu{top:auto;bottom:100%;margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{top:0;right:auto;left:100%;margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{top:0;right:100%;left:auto;margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;width:0;height:0;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-menu[x-placement^=bottom],.dropdown-menu[x-placement^=left],.dropdown-menu[x-placement^=right],.dropdown-menu[x-placement^=top]{right:auto;bottom:auto}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#007bff}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#6c757d;white-space:nowrap}.dropdown-item-text{display:block;padding:.25rem 1.5rem;color:#212529}.btn-group,.btn-group-vertical{position:relative;display:-ms-inline-flexbox;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;-ms-flex:0 1 auto;flex:0 1 auto}.btn-group-vertical>.btn:hover,.btn-group>.btn:hover{z-index:1}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus{z-index:1}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group,.btn-group-vertical .btn+.btn,.btn-group-vertical .btn+.btn-group,.btn-group-vertical .btn-group+.btn,.btn-group-vertical .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-pack:start;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropright .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropleft .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{-ms-flex-direction:column;flex-direction:column;-ms-flex-align:start;align-items:flex-start;-ms-flex-pack:center;justify-content:center}.btn-group-vertical .btn,.btn-group-vertical .btn-group{width:100%}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio],.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:stretch;align-items:stretch;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control{position:relative;-ms-flex:1 1 auto;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control{margin-left:-1px}.input-group>.custom-file .custom-file-input:focus~.custom-file-label,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file .custom-file-input:focus{z-index:4}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::after{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-append,.input-group-prepend{display:-ms-flexbox;display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{height:calc(2.875rem + 2px);padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{height:calc(1.8125rem + 2px);padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:-ms-inline-flexbox;display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked~.custom-control-label::before{color:#fff;background-color:#007bff}.custom-control-input:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:active~.custom-control-label::before{color:#fff;background-color:#b3d7ff}.custom-control-input:disabled~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label::before{background-color:#e9ecef}.custom-control-label{position:relative;margin-bottom:0}.custom-control-label::before{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;pointer-events:none;content:"";-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#dee2e6}.custom-control-label::after{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;content:"";background-repeat:no-repeat;background-position:center center;background-size:50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-radio .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-select{display:inline-block;width:100%;height:calc(2.25rem + 2px);padding:.375rem 1.75rem .375rem .75rem;line-height:1.5;color:#495057;vertical-align:middle;background:#fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center;background-size:8px 10px;border:1px solid #ced4da;border-radius:.25rem;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-select:focus{border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(128,189,255,.5)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{opacity:0}.custom-select-sm{height:calc(1.8125rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:75%}.custom-select-lg{height:calc(2.875rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:125%}.custom-file{position:relative;display:inline-block;width:100%;height:calc(2.25rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:calc(2.25rem + 2px);margin:0;opacity:0}.custom-file-input:focus~.custom-file-label{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:focus~.custom-file-label::after{border-color:#80bdff}.custom-file-input:disabled~.custom-file-label{background-color:#e9ecef}.custom-file-input:lang(en)~.custom-file-label::after{content:"Browse"}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:calc(2.25rem + 2px);padding:.375rem .75rem;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:2.25rem;padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background-color:#e9ecef;border-left:1px solid #ced4da;border-radius:0 .25rem .25rem 0}.custom-range{width:100%;padding-left:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-range:focus{outline:0}.custom-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range:focus::-ms-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-moz-focus-outer{border:0}.custom-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media screen and (prefers-reduced-motion:reduce){.custom-range::-webkit-slider-thumb{transition:none}}.custom-range::-webkit-slider-thumb:active{background-color:#b3d7ff}.custom-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media screen and (prefers-reduced-motion:reduce){.custom-range::-moz-range-thumb{transition:none}}.custom-range::-moz-range-thumb:active{background-color:#b3d7ff}.custom-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-ms-thumb{width:1rem;height:1rem;margin-top:0;margin-right:.2rem;margin-left:.2rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;appearance:none}@media screen and (prefers-reduced-motion:reduce){.custom-range::-ms-thumb{transition:none}}.custom-range::-ms-thumb:active{background-color:#b3d7ff}.custom-range::-ms-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:transparent;border-color:transparent;border-width:.5rem}.custom-range::-ms-fill-lower{background-color:#dee2e6;border-radius:1rem}.custom-range::-ms-fill-upper{margin-right:15px;background-color:#dee2e6;border-radius:1rem}.custom-control-label::before,.custom-file-label,.custom-select{transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.custom-control-label::before,.custom-file-label,.custom-select{transition:none}}.nav{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#007bff}.nav-fill .nav-item{-ms-flex:1 1 auto;flex:1 1 auto;text-align:center}.nav-justified .nav-item{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{-ms-flex-preferred-size:100%;flex-basis:100%;-ms-flex-positive:1;flex-grow:1;-ms-flex-align:center;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler:not(:disabled):not(.disabled){cursor:pointer}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat center center;background-size:100% 100%}@media (max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:576px){.navbar-expand-sm{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-sm .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}}@media (max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:768px){.navbar-expand-md{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-md .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}}@media (max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:992px){.navbar-expand-lg{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-lg .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:1200px){.navbar-expand-xl{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-xl .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}}.navbar-expand{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-light .navbar-brand{color:rgba(0,0,0,.9)}.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,.9)}.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:rgba(255,255,255,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,.5);border-color:rgba(255,255,255,.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-dark .navbar-text{color:rgba(255,255,255,.5)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{position:relative;display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:calc(.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width:576px){.card-deck{-ms-flex-flow:row wrap;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{display:-ms-flexbox;display:flex;-ms-flex:1 0 0%;flex:1 0 0%;-ms-flex-direction:column;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width:576px){.card-group{-ms-flex-flow:row wrap;flex-flow:row wrap}.card-group>.card{-ms-flex:1 0 0%;flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:first-child .card-header,.card-group>.card:first-child .card-img-top{border-top-right-radius:0}.card-group>.card:first-child .card-footer,.card-group>.card:first-child .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:last-child .card-header,.card-group>.card:last-child .card-img-top{border-top-left-radius:0}.card-group>.card:last-child .card-footer,.card-group>.card:last-child .card-img-bottom{border-bottom-left-radius:0}.card-group>.card:only-child{border-radius:.25rem}.card-group>.card:only-child .card-header,.card-group>.card:only-child .card-img-top{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card-group>.card:only-child .card-footer,.card-group>.card:only-child .card-img-bottom{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-group>.card:not(:first-child):not(:last-child):not(:only-child){border-radius:0}.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-footer,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-header,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-top{border-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:576px){.card-columns{-webkit-column-count:3;-moz-column-count:3;column-count:3;-webkit-column-gap:1.25rem;-moz-column-gap:1.25rem;column-gap:1.25rem;orphans:1;widows:1}.card-columns .card{display:inline-block;width:100%}}.accordion .card:not(:first-of-type):not(:last-of-type){border-bottom:0;border-radius:0}.accordion .card:not(:first-of-type) .card-header:first-child{border-radius:0}.accordion .card:first-of-type{border-bottom:0;border-bottom-right-radius:0;border-bottom-left-radius:0}.accordion .card:last-of-type{border-top-left-radius:0;border-top-right-radius:0}.breadcrumb{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item{padding-left:.5rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:-ms-flexbox;display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#007bff;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{z-index:2;color:#0056b3;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.page-link:not(:disabled):not(.disabled){cursor:pointer}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#007bff;border-color:#007bff}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#007bff}.badge-primary[href]:focus,.badge-primary[href]:hover{color:#fff;text-decoration:none;background-color:#0062cc}.badge-secondary{color:#fff;background-color:#6c757d}.badge-secondary[href]:focus,.badge-secondary[href]:hover{color:#fff;text-decoration:none;background-color:#545b62}.badge-success{color:#fff;background-color:#28a745}.badge-success[href]:focus,.badge-success[href]:hover{color:#fff;text-decoration:none;background-color:#1e7e34}.badge-info{color:#fff;background-color:#17a2b8}.badge-info[href]:focus,.badge-info[href]:hover{color:#fff;text-decoration:none;background-color:#117a8b}.badge-warning{color:#212529;background-color:#ffc107}.badge-warning[href]:focus,.badge-warning[href]:hover{color:#212529;text-decoration:none;background-color:#d39e00}.badge-danger{color:#fff;background-color:#dc3545}.badge-danger[href]:focus,.badge-danger[href]:hover{color:#fff;text-decoration:none;background-color:#bd2130}.badge-light{color:#212529;background-color:#f8f9fa}.badge-light[href]:focus,.badge-light[href]:hover{color:#212529;text-decoration:none;background-color:#dae0e5}.badge-dark{color:#fff;background-color:#343a40}.badge-dark[href]:focus,.badge-dark[href]:hover{color:#fff;text-decoration:none;background-color:#1d2124}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#004085;background-color:#cce5ff;border-color:#b8daff}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@-webkit-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem}.progress-bar{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#007bff;transition:width .6s ease}@media screen and (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}.media{display:-ms-flexbox;display:flex;-ms-flex-align:start;align-items:flex-start}.media-body{-ms-flex:1;flex:1}.list-group{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#212529;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item:focus,.list-group-item:hover{z-index:1;text-decoration:none}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#007bff;border-color:#007bff}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{border-bottom:0}.list-group-item-primary{color:#004085;background-color:#b8daff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#004085;background-color:#9fcdff}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#004085;border-color:#004085}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:not(:disabled):not(.disabled){cursor:pointer}.close:not(:disabled):not(.disabled):focus,.close:not(:disabled):not(.disabled):hover{color:#000;text-decoration:none;opacity:.75}button.close{padding:0;background-color:transparent;border:0;-webkit-appearance:none}.modal-open{overflow:hidden}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;outline:0}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:-webkit-transform .3s ease-out;transition:transform .3s ease-out;transition:transform .3s ease-out,-webkit-transform .3s ease-out;-webkit-transform:translate(0,-25%);transform:translate(0,-25%)}@media screen and (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{-webkit-transform:translate(0,0);transform:translate(0,0)}.modal-dialog-centered{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;min-height:calc(100% - (.5rem * 2))}.modal-dialog-centered::before{display:block;height:calc(100vh - (.5rem * 2));content:""}.modal-content{position:relative;display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:-ms-flexbox;display:flex;-ms-flex-align:start;align-items:flex-start;-ms-flex-pack:justify;justify-content:space-between;padding:1rem;border-bottom:1px solid #e9ecef;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem}.modal-footer{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:end;justify-content:flex-end;padding:1rem;border-top:1px solid #e9ecef}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-centered{min-height:calc(100% - (1.75rem * 2))}.modal-dialog-centered::before{height:calc(100vh - (1.75rem * 2))}.modal-sm{max-width:300px}}@media (min-width:992px){.modal-lg{max-width:800px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow::before,.bs-tooltip-top .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=right] .arrow::before,.bs-tooltip-right .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow::before,.bs-tooltip-bottom .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=left] .arrow::before,.bs-tooltip-left .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::after,.popover .arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top] .arrow,.bs-popover-top .arrow{bottom:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::after,.bs-popover-top .arrow::before{border-width:.5rem .5rem 0}.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::before{bottom:0;border-top-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-top .arrow::after{bottom:1px;border-top-color:#fff}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right] .arrow,.bs-popover-right .arrow{left:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::after,.bs-popover-right .arrow::before{border-width:.5rem .5rem .5rem 0}.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::before{left:0;border-right-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-right .arrow::after{left:1px;border-right-color:#fff}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom] .arrow,.bs-popover-bottom .arrow{top:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::after,.bs-popover-bottom .arrow::before{border-width:0 .5rem .5rem .5rem}.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::before{top:0;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-bottom .arrow::after{top:1px;border-bottom-color:#fff}.bs-popover-auto[x-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left] .arrow,.bs-popover-left .arrow{right:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::after,.bs-popover-left .arrow::before{border-width:.5rem 0 .5rem .5rem}.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::before{right:0;border-left-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-left .arrow::after{right:1px;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;color:inherit;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#212529}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-item{position:relative;display:none;-ms-flex-align:center;align-items:center;width:100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block;transition:-webkit-transform .6s ease;transition:transform .6s ease;transition:transform .6s ease,-webkit-transform .6s ease}@media screen and (prefers-reduced-motion:reduce){.carousel-item-next,.carousel-item-prev,.carousel-item.active{transition:none}}.carousel-item-next,.carousel-item-prev{position:absolute;top:0}.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.active.carousel-item-right,.carousel-item-next{-webkit-transform:translateX(100%);transform:translateX(100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-right,.carousel-item-next{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}}.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translateX(-100%);transform:translateX(-100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}}.carousel-fade .carousel-item{opacity:0;transition-duration:.6s;transition-property:opacity}.carousel-fade .carousel-item-next.carousel-item-left,.carousel-fade .carousel-item-prev.carousel-item-right,.carousel-fade .carousel-item.active{opacity:1}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{opacity:0}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-prev,.carousel-fade .carousel-item-next,.carousel-fade .carousel-item-prev,.carousel-fade .carousel-item.active{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-prev,.carousel-fade .carousel-item-next,.carousel-fade .carousel-item-prev,.carousel-fade .carousel-item.active{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:20px;height:20px;background:transparent no-repeat center center;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E")}.carousel-control-next-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E")}.carousel-indicators{position:absolute;right:0;bottom:10px;left:0;z-index:15;display:-ms-flexbox;display:flex;-ms-flex-pack:center;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{position:relative;-ms-flex:0 1 auto;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:rgba(255,255,255,.5)}.carousel-indicators li::before{position:absolute;top:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators li::after{position:absolute;bottom:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators .active{background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important;border-top-right-radius:.25rem!important}.rounded-right{border-top-right-radius:.25rem!important;border-bottom-right-radius:.25rem!important}.rounded-bottom{border-bottom-right-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-circle{border-radius:50%!important}.rounded-0{border-radius:0!important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.857143%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}@media (min-width:576px){.flex-sm-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-sm-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-sm-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-sm-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-sm-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-sm-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-sm-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:768px){.flex-md-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-md-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-md-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-md-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-md-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-md-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-md-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-lg-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-lg-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-lg-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-lg-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-lg-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-lg-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-xl-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-xl-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-xl-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-xl-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-xl-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-xl-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports ((position:-webkit-sticky) or (position:sticky)){.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-monospace{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}.text-justify{text-align:justify!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0062cc!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#545b62!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#1e7e34!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#117a8b!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#d39e00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#bd2130!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#dae0e5!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#1d2124!important}.text-body{color:#212529!important}.text-muted{color:#6c757d!important}.text-black-50{color:rgba(0,0,0,.5)!important}.text-white-50{color:rgba(255,255,255,.5)!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,::after,::before{text-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #adb5bd;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px!important}.container{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #dee2e6!important}.table-dark{color:inherit}.table-dark tbody+tbody,.table-dark td,.table-dark th,.table-dark thead th{border-color:#dee2e6}.table .thead-dark th{color:inherit;border-color:#dee2e6}}
|
|
@@ -268,7 +268,7 @@ tr.icwp-plugin-vulnerability dd {
|
|
268 |
top: 0;
|
269 |
left: 0;
|
270 |
background: rgba(0, 0, 0, 0.2);
|
271 |
-
z-index:
|
272 |
}
|
273 |
.icwp-waiting {
|
274 |
width: 200px;
|
@@ -311,10 +311,8 @@ tr.icwp-plugin-vulnerability dd {
|
|
311 |
background-color: rgba(0, 0, 0, 0.03);
|
312 |
}
|
313 |
.icwpAjaxTableContainer table th.column-created_at {
|
314 |
-
width: 110px;
|
315 |
}
|
316 |
.icwpAjaxTableContainer table th.column-ip {
|
317 |
-
width: 110px;
|
318 |
}
|
319 |
.icwpAjaxTableContainer table th.column-wp_username {
|
320 |
width: 130px;
|
268 |
top: 0;
|
269 |
left: 0;
|
270 |
background: rgba(0, 0, 0, 0.2);
|
271 |
+
z-index: 5000;
|
272 |
}
|
273 |
.icwp-waiting {
|
274 |
width: 200px;
|
311 |
background-color: rgba(0, 0, 0, 0.03);
|
312 |
}
|
313 |
.icwpAjaxTableContainer table th.column-created_at {
|
|
|
314 |
}
|
315 |
.icwpAjaxTableContainer table th.column-ip {
|
|
|
316 |
}
|
317 |
.icwpAjaxTableContainer table th.column-wp_username {
|
318 |
width: 130px;
|
@@ -284,7 +284,6 @@ p.code-description {
|
|
284 |
width: 100%;
|
285 |
}
|
286 |
.option_section input[type=checkbox] {
|
287 |
-
margin-right: 5px;
|
288 |
}
|
289 |
.option_section label {
|
290 |
background-color: transparent;
|
@@ -599,7 +598,7 @@ label.forcheckbox .summary {
|
|
599 |
}
|
600 |
/* Hide default HTML checkbox */
|
601 |
.icwp-switch input {
|
602 |
-
|
603 |
}
|
604 |
/* The slider */
|
605 |
.icwp-slider {
|
@@ -695,7 +694,7 @@ input:checked + .icwp-slider:before {
|
|
695 |
}
|
696 |
.modules a.module {
|
697 |
font-size: 15px;
|
698 |
-
padding: 0.7rem
|
699 |
color: #222222;
|
700 |
font-weight: bolder;
|
701 |
text-shadow: 0 0 0 rgba(255, 255, 255, 0.5);
|
@@ -811,7 +810,7 @@ input:checked + .icwp-slider:before {
|
|
811 |
|
812 |
@media (max-width: 848px) {
|
813 |
#ColumnModules {
|
814 |
-
max-width:
|
815 |
}
|
816 |
#TopPluginIcon {
|
817 |
height: 76px;
|
@@ -855,4 +854,42 @@ input:checked + .icwp-slider:before {
|
|
855 |
margin: 0;
|
856 |
line-height: 20px;
|
857 |
text-align: left;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
858 |
}
|
284 |
width: 100%;
|
285 |
}
|
286 |
.option_section input[type=checkbox] {
|
|
|
287 |
}
|
288 |
.option_section label {
|
289 |
background-color: transparent;
|
598 |
}
|
599 |
/* Hide default HTML checkbox */
|
600 |
.icwp-switch input {
|
601 |
+
opacity: 0;
|
602 |
}
|
603 |
/* The slider */
|
604 |
.icwp-slider {
|
694 |
}
|
695 |
.modules a.module {
|
696 |
font-size: 15px;
|
697 |
+
padding: 0.7rem 0.9rem 0.7rem 1.2rem;
|
698 |
color: #222222;
|
699 |
font-weight: bolder;
|
700 |
text-shadow: 0 0 0 rgba(255, 255, 255, 0.5);
|
810 |
|
811 |
@media (max-width: 848px) {
|
812 |
#ColumnModules {
|
813 |
+
max-width: 81px;
|
814 |
}
|
815 |
#TopPluginIcon {
|
816 |
height: 76px;
|
854 |
margin: 0;
|
855 |
line-height: 20px;
|
856 |
text-align: left;
|
857 |
+
}
|
858 |
+
|
859 |
+
.icon-flag {
|
860 |
+
width: 16px;
|
861 |
+
height: 12px;
|
862 |
+
border: 1px solid black;
|
863 |
+
vertical-align: unset;
|
864 |
+
}
|
865 |
+
|
866 |
+
/** TABLE: Audit trail **/
|
867 |
+
td.column-message textarea {
|
868 |
+
width: 100%;
|
869 |
+
background: transparent;
|
870 |
+
box-shadow: none;
|
871 |
+
border-color: rgba(0,0,0,0.05);
|
872 |
+
}
|
873 |
+
|
874 |
+
/** TABLE: TRAFFIC **/
|
875 |
+
th.column-visitor {
|
876 |
+
width: 250px;
|
877 |
+
}
|
878 |
+
th.column-path {
|
879 |
+
width: 100px;
|
880 |
+
}
|
881 |
+
td.column-path code {
|
882 |
+
color: #4120a2;
|
883 |
+
display: block;
|
884 |
+
font-size: 0.9rem;
|
885 |
+
background-color: transparent; /* rgba(245, 245, 245, 0.8); */
|
886 |
+
}
|
887 |
+
th.column-code {
|
888 |
+
width: 84px;
|
889 |
+
}
|
890 |
+
th.column-trans {
|
891 |
+
width: 114px;
|
892 |
+
}
|
893 |
+
th.column-request_info {
|
894 |
+
width: 100px;
|
895 |
}
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
Binary file
|
@@ -1,5 +1,5 @@
|
|
1 |
/*!
|
2 |
-
* Bootstrap v4.1.
|
3 |
* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
|
4 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5 |
*/
|
@@ -69,7 +69,7 @@
|
|
69 |
|
70 |
/**
|
71 |
* --------------------------------------------------------------------------
|
72 |
-
* Bootstrap (v4.1.
|
73 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
74 |
* --------------------------------------------------------------------------
|
75 |
*/
|
@@ -146,8 +146,7 @@
|
|
146 |
}
|
147 |
|
148 |
try {
|
149 |
-
|
150 |
-
return $selector.length > 0 ? selector : null;
|
151 |
} catch (err) {
|
152 |
return null;
|
153 |
}
|
@@ -202,7 +201,7 @@
|
|
202 |
|
203 |
/**
|
204 |
* --------------------------------------------------------------------------
|
205 |
-
* Bootstrap (v4.1.
|
206 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
207 |
* --------------------------------------------------------------------------
|
208 |
*/
|
@@ -214,7 +213,7 @@
|
|
214 |
* ------------------------------------------------------------------------
|
215 |
*/
|
216 |
var NAME = 'alert';
|
217 |
-
var VERSION = '4.1.
|
218 |
var DATA_KEY = 'bs.alert';
|
219 |
var EVENT_KEY = "." + DATA_KEY;
|
220 |
var DATA_API_KEY = '.data-api';
|
@@ -277,7 +276,7 @@
|
|
277 |
var parent = false;
|
278 |
|
279 |
if (selector) {
|
280 |
-
parent =
|
281 |
}
|
282 |
|
283 |
if (!parent) {
|
@@ -377,7 +376,7 @@
|
|
377 |
|
378 |
/**
|
379 |
* --------------------------------------------------------------------------
|
380 |
-
* Bootstrap (v4.1.
|
381 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
382 |
* --------------------------------------------------------------------------
|
383 |
*/
|
@@ -389,7 +388,7 @@
|
|
389 |
* ------------------------------------------------------------------------
|
390 |
*/
|
391 |
var NAME = 'button';
|
392 |
-
var VERSION = '4.1.
|
393 |
var DATA_KEY = 'bs.button';
|
394 |
var EVENT_KEY = "." + DATA_KEY;
|
395 |
var DATA_API_KEY = '.data-api';
|
@@ -434,14 +433,14 @@
|
|
434 |
var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
|
435 |
|
436 |
if (rootElement) {
|
437 |
-
var input =
|
438 |
|
439 |
if (input) {
|
440 |
if (input.type === 'radio') {
|
441 |
-
if (input.checked &&
|
442 |
triggerChangeEvent = false;
|
443 |
} else {
|
444 |
-
var activeElement =
|
445 |
|
446 |
if (activeElement) {
|
447 |
$$$1(activeElement).removeClass(ClassName.ACTIVE);
|
@@ -454,7 +453,7 @@
|
|
454 |
return;
|
455 |
}
|
456 |
|
457 |
-
input.checked =
|
458 |
$$$1(input).trigger('change');
|
459 |
}
|
460 |
|
@@ -464,7 +463,7 @@
|
|
464 |
}
|
465 |
|
466 |
if (addAriaPressed) {
|
467 |
-
this._element.setAttribute('aria-pressed',
|
468 |
}
|
469 |
|
470 |
if (triggerChangeEvent) {
|
@@ -541,7 +540,7 @@
|
|
541 |
|
542 |
/**
|
543 |
* --------------------------------------------------------------------------
|
544 |
-
* Bootstrap (v4.1.
|
545 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
546 |
* --------------------------------------------------------------------------
|
547 |
*/
|
@@ -553,7 +552,7 @@
|
|
553 |
* ------------------------------------------------------------------------
|
554 |
*/
|
555 |
var NAME = 'carousel';
|
556 |
-
var VERSION = '4.1.
|
557 |
var DATA_KEY = 'bs.carousel';
|
558 |
var EVENT_KEY = "." + DATA_KEY;
|
559 |
var DATA_API_KEY = '.data-api';
|
@@ -632,7 +631,7 @@
|
|
632 |
this.touchTimeout = null;
|
633 |
this._config = this._getConfig(config);
|
634 |
this._element = $$$1(element)[0];
|
635 |
-
this._indicatorsElement =
|
636 |
|
637 |
this._addEventListeners();
|
638 |
} // Getters
|
@@ -666,7 +665,7 @@
|
|
666 |
this._isPaused = true;
|
667 |
}
|
668 |
|
669 |
-
if (
|
670 |
Util.triggerTransitionEnd(this._element);
|
671 |
this.cycle(true);
|
672 |
}
|
@@ -693,7 +692,7 @@
|
|
693 |
_proto.to = function to(index) {
|
694 |
var _this = this;
|
695 |
|
696 |
-
this._activeElement =
|
697 |
|
698 |
var activeIndex = this._getItemIndex(this._activeElement);
|
699 |
|
@@ -799,7 +798,7 @@
|
|
799 |
};
|
800 |
|
801 |
_proto._getItemIndex = function _getItemIndex(element) {
|
802 |
-
this._items =
|
803 |
return this._items.indexOf(element);
|
804 |
};
|
805 |
|
@@ -824,7 +823,7 @@
|
|
824 |
_proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
|
825 |
var targetIndex = this._getItemIndex(relatedTarget);
|
826 |
|
827 |
-
var fromIndex = this._getItemIndex(
|
828 |
|
829 |
var slideEvent = $$$1.Event(Event.SLIDE, {
|
830 |
relatedTarget: relatedTarget,
|
@@ -838,7 +837,8 @@
|
|
838 |
|
839 |
_proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
|
840 |
if (this._indicatorsElement) {
|
841 |
-
|
|
|
842 |
|
843 |
var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
|
844 |
|
@@ -851,7 +851,7 @@
|
|
851 |
_proto._slide = function _slide(direction, element) {
|
852 |
var _this3 = this;
|
853 |
|
854 |
-
var activeElement =
|
855 |
|
856 |
var activeElementIndex = this._getItemIndex(activeElement);
|
857 |
|
@@ -1017,11 +1017,13 @@
|
|
1017 |
|
1018 |
$$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
|
1019 |
$$$1(window).on(Event.LOAD_DATA_API, function () {
|
1020 |
-
|
1021 |
-
|
|
|
|
|
1022 |
|
1023 |
Carousel._jQueryInterface.call($carousel, $carousel.data());
|
1024 |
-
}
|
1025 |
});
|
1026 |
/**
|
1027 |
* ------------------------------------------------------------------------
|
@@ -1042,7 +1044,7 @@
|
|
1042 |
|
1043 |
/**
|
1044 |
* --------------------------------------------------------------------------
|
1045 |
-
* Bootstrap (v4.1.
|
1046 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
1047 |
* --------------------------------------------------------------------------
|
1048 |
*/
|
@@ -1054,7 +1056,7 @@
|
|
1054 |
* ------------------------------------------------------------------------
|
1055 |
*/
|
1056 |
var NAME = 'collapse';
|
1057 |
-
var VERSION = '4.1.
|
1058 |
var DATA_KEY = 'bs.collapse';
|
1059 |
var EVENT_KEY = "." + DATA_KEY;
|
1060 |
var DATA_API_KEY = '.data-api';
|
@@ -1102,14 +1104,17 @@
|
|
1102 |
this._isTransitioning = false;
|
1103 |
this._element = element;
|
1104 |
this._config = this._getConfig(config);
|
1105 |
-
this._triggerArray = $$$1.makeArray(
|
1106 |
-
var
|
1107 |
|
1108 |
-
for (var i = 0; i <
|
1109 |
-
var elem =
|
1110 |
var selector = Util.getSelectorFromElement(elem);
|
|
|
|
|
|
|
1111 |
|
1112 |
-
if (selector !== null &&
|
1113 |
this._selector = selector;
|
1114 |
|
1115 |
this._triggerArray.push(elem);
|
@@ -1150,7 +1155,9 @@
|
|
1150 |
var activesData;
|
1151 |
|
1152 |
if (this._parent) {
|
1153 |
-
actives =
|
|
|
|
|
1154 |
|
1155 |
if (actives.length === 0) {
|
1156 |
actives = null;
|
@@ -1185,7 +1192,7 @@
|
|
1185 |
$$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
|
1186 |
this._element.style[dimension] = 0;
|
1187 |
|
1188 |
-
if (this._triggerArray.length
|
1189 |
$$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
|
1190 |
}
|
1191 |
|
@@ -1226,14 +1233,15 @@
|
|
1226 |
this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
|
1227 |
Util.reflow(this._element);
|
1228 |
$$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
|
|
|
1229 |
|
1230 |
-
if (
|
1231 |
-
for (var i = 0; i <
|
1232 |
var trigger = this._triggerArray[i];
|
1233 |
var selector = Util.getSelectorFromElement(trigger);
|
1234 |
|
1235 |
if (selector !== null) {
|
1236 |
-
var $elem = $$$1(selector);
|
1237 |
|
1238 |
if (!$elem.hasClass(ClassName.SHOW)) {
|
1239 |
$$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
|
@@ -1294,11 +1302,12 @@
|
|
1294 |
parent = this._config.parent[0];
|
1295 |
}
|
1296 |
} else {
|
1297 |
-
parent =
|
1298 |
}
|
1299 |
|
1300 |
var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
|
1301 |
-
|
|
|
1302 |
_this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
|
1303 |
});
|
1304 |
return parent;
|
@@ -1308,7 +1317,7 @@
|
|
1308 |
if (element) {
|
1309 |
var isOpen = $$$1(element).hasClass(ClassName.SHOW);
|
1310 |
|
1311 |
-
if (triggerArray.length
|
1312 |
$$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
|
1313 |
}
|
1314 |
}
|
@@ -1317,7 +1326,7 @@
|
|
1317 |
|
1318 |
Collapse._getTargetFromElement = function _getTargetFromElement(element) {
|
1319 |
var selector = Util.getSelectorFromElement(element);
|
1320 |
-
return selector ?
|
1321 |
};
|
1322 |
|
1323 |
Collapse._jQueryInterface = function _jQueryInterface(config) {
|
@@ -1375,7 +1384,8 @@
|
|
1375 |
|
1376 |
var $trigger = $$$1(this);
|
1377 |
var selector = Util.getSelectorFromElement(this);
|
1378 |
-
|
|
|
1379 |
var $target = $$$1(this);
|
1380 |
var data = $target.data(DATA_KEY);
|
1381 |
var config = data ? 'toggle' : $trigger.data();
|
@@ -3920,7 +3930,7 @@
|
|
3920 |
|
3921 |
/**
|
3922 |
* --------------------------------------------------------------------------
|
3923 |
-
* Bootstrap (v4.1.
|
3924 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3925 |
* --------------------------------------------------------------------------
|
3926 |
*/
|
@@ -3932,7 +3942,7 @@
|
|
3932 |
* ------------------------------------------------------------------------
|
3933 |
*/
|
3934 |
var NAME = 'dropdown';
|
3935 |
-
var VERSION = '4.1.
|
3936 |
var DATA_KEY = 'bs.dropdown';
|
3937 |
var EVENT_KEY = "." + DATA_KEY;
|
3938 |
var DATA_API_KEY = '.data-api';
|
@@ -4141,14 +4151,16 @@
|
|
4141 |
if (!this._menu) {
|
4142 |
var parent = Dropdown._getParentFromElement(this._element);
|
4143 |
|
4144 |
-
|
|
|
|
|
4145 |
}
|
4146 |
|
4147 |
return this._menu;
|
4148 |
};
|
4149 |
|
4150 |
_proto._getPlacement = function _getPlacement() {
|
4151 |
-
var $parentDropdown = $$$1(this._element
|
4152 |
var placement = AttachmentMap.BOTTOM; // Handle dropup
|
4153 |
|
4154 |
if ($parentDropdown.hasClass(ClassName.DROPUP)) {
|
@@ -4236,9 +4248,9 @@
|
|
4236 |
return;
|
4237 |
}
|
4238 |
|
4239 |
-
var toggles =
|
4240 |
|
4241 |
-
for (var i = 0
|
4242 |
var parent = Dropdown._getParentFromElement(toggles[i]);
|
4243 |
|
4244 |
var context = $$$1(toggles[i]).data(DATA_KEY);
|
@@ -4246,6 +4258,10 @@
|
|
4246 |
relatedTarget: toggles[i]
|
4247 |
};
|
4248 |
|
|
|
|
|
|
|
|
|
4249 |
if (!context) {
|
4250 |
continue;
|
4251 |
}
|
@@ -4284,7 +4300,7 @@
|
|
4284 |
var selector = Util.getSelectorFromElement(element);
|
4285 |
|
4286 |
if (selector) {
|
4287 |
-
parent =
|
4288 |
}
|
4289 |
|
4290 |
return parent || element.parentNode;
|
@@ -4316,7 +4332,7 @@
|
|
4316 |
|
4317 |
if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
|
4318 |
if (event.which === ESCAPE_KEYCODE) {
|
4319 |
-
var toggle =
|
4320 |
$$$1(toggle).trigger('focus');
|
4321 |
}
|
4322 |
|
@@ -4324,7 +4340,7 @@
|
|
4324 |
return;
|
4325 |
}
|
4326 |
|
4327 |
-
var items =
|
4328 |
|
4329 |
if (items.length === 0) {
|
4330 |
return;
|
@@ -4402,7 +4418,7 @@
|
|
4402 |
|
4403 |
/**
|
4404 |
* --------------------------------------------------------------------------
|
4405 |
-
* Bootstrap (v4.1.
|
4406 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
4407 |
* --------------------------------------------------------------------------
|
4408 |
*/
|
@@ -4414,7 +4430,7 @@
|
|
4414 |
* ------------------------------------------------------------------------
|
4415 |
*/
|
4416 |
var NAME = 'modal';
|
4417 |
-
var VERSION = '4.1.
|
4418 |
var DATA_KEY = 'bs.modal';
|
4419 |
var EVENT_KEY = "." + DATA_KEY;
|
4420 |
var DATA_API_KEY = '.data-api';
|
@@ -4458,8 +4474,7 @@
|
|
4458 |
DATA_TOGGLE: '[data-toggle="modal"]',
|
4459 |
DATA_DISMISS: '[data-dismiss="modal"]',
|
4460 |
FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
|
4461 |
-
STICKY_CONTENT: '.sticky-top'
|
4462 |
-
NAVBAR_TOGGLER: '.navbar-toggler'
|
4463 |
/**
|
4464 |
* ------------------------------------------------------------------------
|
4465 |
* Class Definition
|
@@ -4474,7 +4489,7 @@
|
|
4474 |
function Modal(element, config) {
|
4475 |
this._config = this._getConfig(config);
|
4476 |
this._element = element;
|
4477 |
-
this._dialog =
|
4478 |
this._backdrop = null;
|
4479 |
this._isShown = false;
|
4480 |
this._isBodyOverflowing = false;
|
@@ -4731,7 +4746,7 @@
|
|
4731 |
this._backdrop.className = ClassName.BACKDROP;
|
4732 |
|
4733 |
if (animate) {
|
4734 |
-
|
4735 |
}
|
4736 |
|
4737 |
$$$1(this._backdrop).appendTo(document.body);
|
@@ -4825,23 +4840,19 @@
|
|
4825 |
if (this._isBodyOverflowing) {
|
4826 |
// Note: DOMNode.style.paddingRight returns the actual value or '' if not set
|
4827 |
// while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
|
4828 |
-
|
4829 |
-
|
4830 |
-
|
|
|
|
|
4831 |
var calculatedPadding = $$$1(element).css('padding-right');
|
4832 |
$$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
|
4833 |
}); // Adjust sticky content margin
|
4834 |
|
4835 |
-
$$$1(
|
4836 |
-
var actualMargin =
|
4837 |
var calculatedMargin = $$$1(element).css('margin-right');
|
4838 |
$$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
|
4839 |
-
}); // Adjust navbar-toggler margin
|
4840 |
-
|
4841 |
-
$$$1(Selector.NAVBAR_TOGGLER).each(function (index, element) {
|
4842 |
-
var actualMargin = $$$1(element)[0].style.marginRight;
|
4843 |
-
var calculatedMargin = $$$1(element).css('margin-right');
|
4844 |
-
$$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) + _this9._scrollbarWidth + "px");
|
4845 |
}); // Adjust body padding
|
4846 |
|
4847 |
var actualPadding = document.body.style.paddingRight;
|
@@ -4852,15 +4863,15 @@
|
|
4852 |
|
4853 |
_proto._resetScrollbar = function _resetScrollbar() {
|
4854 |
// Restore fixed content padding
|
4855 |
-
|
|
|
4856 |
var padding = $$$1(element).data('padding-right');
|
|
|
|
|
|
|
4857 |
|
4858 |
-
|
4859 |
-
|
4860 |
-
}
|
4861 |
-
}); // Restore sticky content and navbar-toggler margin
|
4862 |
-
|
4863 |
-
$$$1(Selector.STICKY_CONTENT + ", " + Selector.NAVBAR_TOGGLER).each(function (index, element) {
|
4864 |
var margin = $$$1(element).data('margin-right');
|
4865 |
|
4866 |
if (typeof margin !== 'undefined') {
|
@@ -4869,10 +4880,8 @@
|
|
4869 |
}); // Restore body padding
|
4870 |
|
4871 |
var padding = $$$1(document.body).data('padding-right');
|
4872 |
-
|
4873 |
-
|
4874 |
-
$$$1(document.body).css('padding-right', padding).removeData('padding-right');
|
4875 |
-
}
|
4876 |
};
|
4877 |
|
4878 |
_proto._getScrollbarWidth = function _getScrollbarWidth() {
|
@@ -4937,7 +4946,7 @@
|
|
4937 |
var selector = Util.getSelectorFromElement(this);
|
4938 |
|
4939 |
if (selector) {
|
4940 |
-
target =
|
4941 |
}
|
4942 |
|
4943 |
var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _objectSpread({}, $$$1(target).data(), $$$1(this).data());
|
@@ -4980,7 +4989,7 @@
|
|
4980 |
|
4981 |
/**
|
4982 |
* --------------------------------------------------------------------------
|
4983 |
-
* Bootstrap (v4.1.
|
4984 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
4985 |
* --------------------------------------------------------------------------
|
4986 |
*/
|
@@ -4992,7 +5001,7 @@
|
|
4992 |
* ------------------------------------------------------------------------
|
4993 |
*/
|
4994 |
var NAME = 'tooltip';
|
4995 |
-
var VERSION = '4.1.
|
4996 |
var DATA_KEY = 'bs.tooltip';
|
4997 |
var EVENT_KEY = "." + DATA_KEY;
|
4998 |
var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
|
@@ -5202,7 +5211,7 @@
|
|
5202 |
var attachment = this._getAttachment(placement);
|
5203 |
|
5204 |
this.addAttachmentClass(attachment);
|
5205 |
-
var container = this.config.container === false ? document.body : $$$1(this.config.container);
|
5206 |
$$$1(tip).data(this.constructor.DATA_KEY, this);
|
5207 |
|
5208 |
if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) {
|
@@ -5341,9 +5350,9 @@
|
|
5341 |
};
|
5342 |
|
5343 |
_proto.setContent = function setContent() {
|
5344 |
-
var
|
5345 |
-
this.setElementContent(
|
5346 |
-
|
5347 |
};
|
5348 |
|
5349 |
_proto.setElementContent = function setElementContent($element, content) {
|
@@ -5536,15 +5545,18 @@
|
|
5536 |
var $tip = $$$1(this.getTipElement());
|
5537 |
var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
|
5538 |
|
5539 |
-
if (tabClass !== null && tabClass.length
|
5540 |
$tip.removeClass(tabClass.join(''));
|
5541 |
}
|
5542 |
};
|
5543 |
|
5544 |
-
_proto._handlePopperPlacementChange = function _handlePopperPlacementChange(
|
|
|
|
|
|
|
5545 |
this._cleanTipClass();
|
5546 |
|
5547 |
-
this.addAttachmentClass(this._getAttachment(
|
5548 |
};
|
5549 |
|
5550 |
_proto._fixTransition = function _fixTransition() {
|
@@ -5647,7 +5659,7 @@
|
|
5647 |
|
5648 |
/**
|
5649 |
* --------------------------------------------------------------------------
|
5650 |
-
* Bootstrap (v4.1.
|
5651 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5652 |
* --------------------------------------------------------------------------
|
5653 |
*/
|
@@ -5659,7 +5671,7 @@
|
|
5659 |
* ------------------------------------------------------------------------
|
5660 |
*/
|
5661 |
var NAME = 'popover';
|
5662 |
-
var VERSION = '4.1.
|
5663 |
var DATA_KEY = 'bs.popover';
|
5664 |
var EVENT_KEY = "." + DATA_KEY;
|
5665 |
var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
|
@@ -5844,7 +5856,7 @@
|
|
5844 |
|
5845 |
/**
|
5846 |
* --------------------------------------------------------------------------
|
5847 |
-
* Bootstrap (v4.1.
|
5848 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5849 |
* --------------------------------------------------------------------------
|
5850 |
*/
|
@@ -5856,7 +5868,7 @@
|
|
5856 |
* ------------------------------------------------------------------------
|
5857 |
*/
|
5858 |
var NAME = 'scrollspy';
|
5859 |
-
var VERSION = '4.1.
|
5860 |
var DATA_KEY = 'bs.scrollspy';
|
5861 |
var EVENT_KEY = "." + DATA_KEY;
|
5862 |
var DATA_API_KEY = '.data-api';
|
@@ -5938,13 +5950,13 @@
|
|
5938 |
this._offsets = [];
|
5939 |
this._targets = [];
|
5940 |
this._scrollHeight = this._getScrollHeight();
|
5941 |
-
var targets =
|
5942 |
targets.map(function (element) {
|
5943 |
var target;
|
5944 |
var targetSelector = Util.getSelectorFromElement(element);
|
5945 |
|
5946 |
if (targetSelector) {
|
5947 |
-
target =
|
5948 |
}
|
5949 |
|
5950 |
if (target) {
|
@@ -6041,7 +6053,9 @@
|
|
6041 |
return;
|
6042 |
}
|
6043 |
|
6044 |
-
|
|
|
|
|
6045 |
var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
|
6046 |
|
6047 |
if (isActiveTarget) {
|
@@ -6061,7 +6075,7 @@
|
|
6061 |
queries = queries.map(function (selector) {
|
6062 |
return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]");
|
6063 |
});
|
6064 |
-
var $link = $$$1(queries.join(','));
|
6065 |
|
6066 |
if ($link.hasClass(ClassName.DROPDOWN_ITEM)) {
|
6067 |
$link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
|
@@ -6082,7 +6096,8 @@
|
|
6082 |
};
|
6083 |
|
6084 |
_proto._clear = function _clear() {
|
6085 |
-
|
|
|
6086 |
}; // Static
|
6087 |
|
6088 |
|
@@ -6129,9 +6144,10 @@
|
|
6129 |
|
6130 |
|
6131 |
$$$1(window).on(Event.LOAD_DATA_API, function () {
|
6132 |
-
var scrollSpys =
|
|
|
6133 |
|
6134 |
-
for (var i =
|
6135 |
var $spy = $$$1(scrollSpys[i]);
|
6136 |
|
6137 |
ScrollSpy._jQueryInterface.call($spy, $spy.data());
|
@@ -6156,7 +6172,7 @@
|
|
6156 |
|
6157 |
/**
|
6158 |
* --------------------------------------------------------------------------
|
6159 |
-
* Bootstrap (v4.1.
|
6160 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
6161 |
* --------------------------------------------------------------------------
|
6162 |
*/
|
@@ -6168,7 +6184,7 @@
|
|
6168 |
* ------------------------------------------------------------------------
|
6169 |
*/
|
6170 |
var NAME = 'tab';
|
6171 |
-
var VERSION = '4.1.
|
6172 |
var DATA_KEY = 'bs.tab';
|
6173 |
var EVENT_KEY = "." + DATA_KEY;
|
6174 |
var DATA_API_KEY = '.data-api';
|
@@ -6250,7 +6266,7 @@
|
|
6250 |
}
|
6251 |
|
6252 |
if (selector) {
|
6253 |
-
target =
|
6254 |
}
|
6255 |
|
6256 |
this._activate(this._element, listElement);
|
@@ -6332,7 +6348,8 @@
|
|
6332 |
var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0];
|
6333 |
|
6334 |
if (dropdownElement) {
|
6335 |
-
|
|
|
6336 |
}
|
6337 |
|
6338 |
element.setAttribute('aria-expanded', true);
|
@@ -6404,7 +6421,7 @@
|
|
6404 |
|
6405 |
/**
|
6406 |
* --------------------------------------------------------------------------
|
6407 |
-
* Bootstrap (v4.1.
|
6408 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
6409 |
* --------------------------------------------------------------------------
|
6410 |
*/
|
@@ -6440,5 +6457,4 @@
|
|
6440 |
|
6441 |
Object.defineProperty(exports, '__esModule', { value: true });
|
6442 |
|
6443 |
-
})));
|
6444 |
-
//# sourceMappingURL=bootstrap.bundle.js.map
|
1 |
/*!
|
2 |
+
* Bootstrap v4.1.3 (https://getbootstrap.com/)
|
3 |
* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
|
4 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5 |
*/
|
69 |
|
70 |
/**
|
71 |
* --------------------------------------------------------------------------
|
72 |
+
* Bootstrap (v4.1.3): util.js
|
73 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
74 |
* --------------------------------------------------------------------------
|
75 |
*/
|
146 |
}
|
147 |
|
148 |
try {
|
149 |
+
return document.querySelector(selector) ? selector : null;
|
|
|
150 |
} catch (err) {
|
151 |
return null;
|
152 |
}
|
201 |
|
202 |
/**
|
203 |
* --------------------------------------------------------------------------
|
204 |
+
* Bootstrap (v4.1.3): alert.js
|
205 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
206 |
* --------------------------------------------------------------------------
|
207 |
*/
|
213 |
* ------------------------------------------------------------------------
|
214 |
*/
|
215 |
var NAME = 'alert';
|
216 |
+
var VERSION = '4.1.3';
|
217 |
var DATA_KEY = 'bs.alert';
|
218 |
var EVENT_KEY = "." + DATA_KEY;
|
219 |
var DATA_API_KEY = '.data-api';
|
276 |
var parent = false;
|
277 |
|
278 |
if (selector) {
|
279 |
+
parent = document.querySelector(selector);
|
280 |
}
|
281 |
|
282 |
if (!parent) {
|
376 |
|
377 |
/**
|
378 |
* --------------------------------------------------------------------------
|
379 |
+
* Bootstrap (v4.1.3): button.js
|
380 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
381 |
* --------------------------------------------------------------------------
|
382 |
*/
|
388 |
* ------------------------------------------------------------------------
|
389 |
*/
|
390 |
var NAME = 'button';
|
391 |
+
var VERSION = '4.1.3';
|
392 |
var DATA_KEY = 'bs.button';
|
393 |
var EVENT_KEY = "." + DATA_KEY;
|
394 |
var DATA_API_KEY = '.data-api';
|
433 |
var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
|
434 |
|
435 |
if (rootElement) {
|
436 |
+
var input = this._element.querySelector(Selector.INPUT);
|
437 |
|
438 |
if (input) {
|
439 |
if (input.type === 'radio') {
|
440 |
+
if (input.checked && this._element.classList.contains(ClassName.ACTIVE)) {
|
441 |
triggerChangeEvent = false;
|
442 |
} else {
|
443 |
+
var activeElement = rootElement.querySelector(Selector.ACTIVE);
|
444 |
|
445 |
if (activeElement) {
|
446 |
$$$1(activeElement).removeClass(ClassName.ACTIVE);
|
453 |
return;
|
454 |
}
|
455 |
|
456 |
+
input.checked = !this._element.classList.contains(ClassName.ACTIVE);
|
457 |
$$$1(input).trigger('change');
|
458 |
}
|
459 |
|
463 |
}
|
464 |
|
465 |
if (addAriaPressed) {
|
466 |
+
this._element.setAttribute('aria-pressed', !this._element.classList.contains(ClassName.ACTIVE));
|
467 |
}
|
468 |
|
469 |
if (triggerChangeEvent) {
|
540 |
|
541 |
/**
|
542 |
* --------------------------------------------------------------------------
|
543 |
+
* Bootstrap (v4.1.3): carousel.js
|
544 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
545 |
* --------------------------------------------------------------------------
|
546 |
*/
|
552 |
* ------------------------------------------------------------------------
|
553 |
*/
|
554 |
var NAME = 'carousel';
|
555 |
+
var VERSION = '4.1.3';
|
556 |
var DATA_KEY = 'bs.carousel';
|
557 |
var EVENT_KEY = "." + DATA_KEY;
|
558 |
var DATA_API_KEY = '.data-api';
|
631 |
this.touchTimeout = null;
|
632 |
this._config = this._getConfig(config);
|
633 |
this._element = $$$1(element)[0];
|
634 |
+
this._indicatorsElement = this._element.querySelector(Selector.INDICATORS);
|
635 |
|
636 |
this._addEventListeners();
|
637 |
} // Getters
|
665 |
this._isPaused = true;
|
666 |
}
|
667 |
|
668 |
+
if (this._element.querySelector(Selector.NEXT_PREV)) {
|
669 |
Util.triggerTransitionEnd(this._element);
|
670 |
this.cycle(true);
|
671 |
}
|
692 |
_proto.to = function to(index) {
|
693 |
var _this = this;
|
694 |
|
695 |
+
this._activeElement = this._element.querySelector(Selector.ACTIVE_ITEM);
|
696 |
|
697 |
var activeIndex = this._getItemIndex(this._activeElement);
|
698 |
|
798 |
};
|
799 |
|
800 |
_proto._getItemIndex = function _getItemIndex(element) {
|
801 |
+
this._items = element && element.parentNode ? [].slice.call(element.parentNode.querySelectorAll(Selector.ITEM)) : [];
|
802 |
return this._items.indexOf(element);
|
803 |
};
|
804 |
|
823 |
_proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
|
824 |
var targetIndex = this._getItemIndex(relatedTarget);
|
825 |
|
826 |
+
var fromIndex = this._getItemIndex(this._element.querySelector(Selector.ACTIVE_ITEM));
|
827 |
|
828 |
var slideEvent = $$$1.Event(Event.SLIDE, {
|
829 |
relatedTarget: relatedTarget,
|
837 |
|
838 |
_proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
|
839 |
if (this._indicatorsElement) {
|
840 |
+
var indicators = [].slice.call(this._indicatorsElement.querySelectorAll(Selector.ACTIVE));
|
841 |
+
$$$1(indicators).removeClass(ClassName.ACTIVE);
|
842 |
|
843 |
var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
|
844 |
|
851 |
_proto._slide = function _slide(direction, element) {
|
852 |
var _this3 = this;
|
853 |
|
854 |
+
var activeElement = this._element.querySelector(Selector.ACTIVE_ITEM);
|
855 |
|
856 |
var activeElementIndex = this._getItemIndex(activeElement);
|
857 |
|
1017 |
|
1018 |
$$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
|
1019 |
$$$1(window).on(Event.LOAD_DATA_API, function () {
|
1020 |
+
var carousels = [].slice.call(document.querySelectorAll(Selector.DATA_RIDE));
|
1021 |
+
|
1022 |
+
for (var i = 0, len = carousels.length; i < len; i++) {
|
1023 |
+
var $carousel = $$$1(carousels[i]);
|
1024 |
|
1025 |
Carousel._jQueryInterface.call($carousel, $carousel.data());
|
1026 |
+
}
|
1027 |
});
|
1028 |
/**
|
1029 |
* ------------------------------------------------------------------------
|
1044 |
|
1045 |
/**
|
1046 |
* --------------------------------------------------------------------------
|
1047 |
+
* Bootstrap (v4.1.3): collapse.js
|
1048 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
1049 |
* --------------------------------------------------------------------------
|
1050 |
*/
|
1056 |
* ------------------------------------------------------------------------
|
1057 |
*/
|
1058 |
var NAME = 'collapse';
|
1059 |
+
var VERSION = '4.1.3';
|
1060 |
var DATA_KEY = 'bs.collapse';
|
1061 |
var EVENT_KEY = "." + DATA_KEY;
|
1062 |
var DATA_API_KEY = '.data-api';
|
1104 |
this._isTransitioning = false;
|
1105 |
this._element = element;
|
1106 |
this._config = this._getConfig(config);
|
1107 |
+
this._triggerArray = $$$1.makeArray(document.querySelectorAll("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
|
1108 |
+
var toggleList = [].slice.call(document.querySelectorAll(Selector.DATA_TOGGLE));
|
1109 |
|
1110 |
+
for (var i = 0, len = toggleList.length; i < len; i++) {
|
1111 |
+
var elem = toggleList[i];
|
1112 |
var selector = Util.getSelectorFromElement(elem);
|
1113 |
+
var filterElement = [].slice.call(document.querySelectorAll(selector)).filter(function (foundElem) {
|
1114 |
+
return foundElem === element;
|
1115 |
+
});
|
1116 |
|
1117 |
+
if (selector !== null && filterElement.length > 0) {
|
1118 |
this._selector = selector;
|
1119 |
|
1120 |
this._triggerArray.push(elem);
|
1155 |
var activesData;
|
1156 |
|
1157 |
if (this._parent) {
|
1158 |
+
actives = [].slice.call(this._parent.querySelectorAll(Selector.ACTIVES)).filter(function (elem) {
|
1159 |
+
return elem.getAttribute('data-parent') === _this._config.parent;
|
1160 |
+
});
|
1161 |
|
1162 |
if (actives.length === 0) {
|
1163 |
actives = null;
|
1192 |
$$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
|
1193 |
this._element.style[dimension] = 0;
|
1194 |
|
1195 |
+
if (this._triggerArray.length) {
|
1196 |
$$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
|
1197 |
}
|
1198 |
|
1233 |
this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
|
1234 |
Util.reflow(this._element);
|
1235 |
$$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
|
1236 |
+
var triggerArrayLength = this._triggerArray.length;
|
1237 |
|
1238 |
+
if (triggerArrayLength > 0) {
|
1239 |
+
for (var i = 0; i < triggerArrayLength; i++) {
|
1240 |
var trigger = this._triggerArray[i];
|
1241 |
var selector = Util.getSelectorFromElement(trigger);
|
1242 |
|
1243 |
if (selector !== null) {
|
1244 |
+
var $elem = $$$1([].slice.call(document.querySelectorAll(selector)));
|
1245 |
|
1246 |
if (!$elem.hasClass(ClassName.SHOW)) {
|
1247 |
$$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
|
1302 |
parent = this._config.parent[0];
|
1303 |
}
|
1304 |
} else {
|
1305 |
+
parent = document.querySelector(this._config.parent);
|
1306 |
}
|
1307 |
|
1308 |
var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
|
1309 |
+
var children = [].slice.call(parent.querySelectorAll(selector));
|
1310 |
+
$$$1(children).each(function (i, element) {
|
1311 |
_this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
|
1312 |
});
|
1313 |
return parent;
|
1317 |
if (element) {
|
1318 |
var isOpen = $$$1(element).hasClass(ClassName.SHOW);
|
1319 |
|
1320 |
+
if (triggerArray.length) {
|
1321 |
$$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
|
1322 |
}
|
1323 |
}
|
1326 |
|
1327 |
Collapse._getTargetFromElement = function _getTargetFromElement(element) {
|
1328 |
var selector = Util.getSelectorFromElement(element);
|
1329 |
+
return selector ? document.querySelector(selector) : null;
|
1330 |
};
|
1331 |
|
1332 |
Collapse._jQueryInterface = function _jQueryInterface(config) {
|
1384 |
|
1385 |
var $trigger = $$$1(this);
|
1386 |
var selector = Util.getSelectorFromElement(this);
|
1387 |
+
var selectors = [].slice.call(document.querySelectorAll(selector));
|
1388 |
+
$$$1(selectors).each(function () {
|
1389 |
var $target = $$$1(this);
|
1390 |
var data = $target.data(DATA_KEY);
|
1391 |
var config = data ? 'toggle' : $trigger.data();
|
3930 |
|
3931 |
/**
|
3932 |
* --------------------------------------------------------------------------
|
3933 |
+
* Bootstrap (v4.1.3): dropdown.js
|
3934 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3935 |
* --------------------------------------------------------------------------
|
3936 |
*/
|
3942 |
* ------------------------------------------------------------------------
|
3943 |
*/
|
3944 |
var NAME = 'dropdown';
|
3945 |
+
var VERSION = '4.1.3';
|
3946 |
var DATA_KEY = 'bs.dropdown';
|
3947 |
var EVENT_KEY = "." + DATA_KEY;
|
3948 |
var DATA_API_KEY = '.data-api';
|
4151 |
if (!this._menu) {
|
4152 |
var parent = Dropdown._getParentFromElement(this._element);
|
4153 |
|
4154 |
+
if (parent) {
|
4155 |
+
this._menu = parent.querySelector(Selector.MENU);
|
4156 |
+
}
|
4157 |
}
|
4158 |
|
4159 |
return this._menu;
|
4160 |
};
|
4161 |
|
4162 |
_proto._getPlacement = function _getPlacement() {
|
4163 |
+
var $parentDropdown = $$$1(this._element.parentNode);
|
4164 |
var placement = AttachmentMap.BOTTOM; // Handle dropup
|
4165 |
|
4166 |
if ($parentDropdown.hasClass(ClassName.DROPUP)) {
|
4248 |
return;
|
4249 |
}
|
4250 |
|
4251 |
+
var toggles = [].slice.call(document.querySelectorAll(Selector.DATA_TOGGLE));
|
4252 |
|
4253 |
+
for (var i = 0, len = toggles.length; i < len; i++) {
|
4254 |
var parent = Dropdown._getParentFromElement(toggles[i]);
|
4255 |
|
4256 |
var context = $$$1(toggles[i]).data(DATA_KEY);
|
4258 |
relatedTarget: toggles[i]
|
4259 |
};
|
4260 |
|
4261 |
+
if (event && event.type === 'click') {
|
4262 |
+
relatedTarget.clickEvent = event;
|
4263 |
+
}
|
4264 |
+
|
4265 |
if (!context) {
|
4266 |
continue;
|
4267 |
}
|
4300 |
var selector = Util.getSelectorFromElement(element);
|
4301 |
|
4302 |
if (selector) {
|
4303 |
+
parent = document.querySelector(selector);
|
4304 |
}
|
4305 |
|
4306 |
return parent || element.parentNode;
|
4332 |
|
4333 |
if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
|
4334 |
if (event.which === ESCAPE_KEYCODE) {
|
4335 |
+
var toggle = parent.querySelector(Selector.DATA_TOGGLE);
|
4336 |
$$$1(toggle).trigger('focus');
|
4337 |
}
|
4338 |
|
4340 |
return;
|
4341 |
}
|
4342 |
|
4343 |
+
var items = [].slice.call(parent.querySelectorAll(Selector.VISIBLE_ITEMS));
|
4344 |
|
4345 |
if (items.length === 0) {
|
4346 |
return;
|
4418 |
|
4419 |
/**
|
4420 |
* --------------------------------------------------------------------------
|
4421 |
+
* Bootstrap (v4.1.3): modal.js
|
4422 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
4423 |
* --------------------------------------------------------------------------
|
4424 |
*/
|
4430 |
* ------------------------------------------------------------------------
|
4431 |
*/
|
4432 |
var NAME = 'modal';
|
4433 |
+
var VERSION = '4.1.3';
|
4434 |
var DATA_KEY = 'bs.modal';
|
4435 |
var EVENT_KEY = "." + DATA_KEY;
|
4436 |
var DATA_API_KEY = '.data-api';
|
4474 |
DATA_TOGGLE: '[data-toggle="modal"]',
|
4475 |
DATA_DISMISS: '[data-dismiss="modal"]',
|
4476 |
FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
|
4477 |
+
STICKY_CONTENT: '.sticky-top'
|
|
|
4478 |
/**
|
4479 |
* ------------------------------------------------------------------------
|
4480 |
* Class Definition
|
4489 |
function Modal(element, config) {
|
4490 |
this._config = this._getConfig(config);
|
4491 |
this._element = element;
|
4492 |
+
this._dialog = element.querySelector(Selector.DIALOG);
|
4493 |
this._backdrop = null;
|
4494 |
this._isShown = false;
|
4495 |
this._isBodyOverflowing = false;
|
4746 |
this._backdrop.className = ClassName.BACKDROP;
|
4747 |
|
4748 |
if (animate) {
|
4749 |
+
this._backdrop.classList.add(animate);
|
4750 |
}
|
4751 |
|
4752 |
$$$1(this._backdrop).appendTo(document.body);
|
4840 |
if (this._isBodyOverflowing) {
|
4841 |
// Note: DOMNode.style.paddingRight returns the actual value or '' if not set
|
4842 |
// while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
|
4843 |
+
var fixedContent = [].slice.call(document.querySelectorAll(Selector.FIXED_CONTENT));
|
4844 |
+
var stickyContent = [].slice.call(document.querySelectorAll(Selector.STICKY_CONTENT)); // Adjust fixed content padding
|
4845 |
+
|
4846 |
+
$$$1(fixedContent).each(function (index, element) {
|
4847 |
+
var actualPadding = element.style.paddingRight;
|
4848 |
var calculatedPadding = $$$1(element).css('padding-right');
|
4849 |
$$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
|
4850 |
}); // Adjust sticky content margin
|
4851 |
|
4852 |
+
$$$1(stickyContent).each(function (index, element) {
|
4853 |
+
var actualMargin = element.style.marginRight;
|
4854 |
var calculatedMargin = $$$1(element).css('margin-right');
|
4855 |
$$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
|
|
|
|
|
|
|
|
|
|
|
|
|
4856 |
}); // Adjust body padding
|
4857 |
|
4858 |
var actualPadding = document.body.style.paddingRight;
|
4863 |
|
4864 |
_proto._resetScrollbar = function _resetScrollbar() {
|
4865 |
// Restore fixed content padding
|
4866 |
+
var fixedContent = [].slice.call(document.querySelectorAll(Selector.FIXED_CONTENT));
|
4867 |
+
$$$1(fixedContent).each(function (index, element) {
|
4868 |
var padding = $$$1(element).data('padding-right');
|
4869 |
+
$$$1(element).removeData('padding-right');
|
4870 |
+
element.style.paddingRight = padding ? padding : '';
|
4871 |
+
}); // Restore sticky content
|
4872 |
|
4873 |
+
var elements = [].slice.call(document.querySelectorAll("" + Selector.STICKY_CONTENT));
|
4874 |
+
$$$1(elements).each(function (index, element) {
|
|
|
|
|
|
|
|
|
4875 |
var margin = $$$1(element).data('margin-right');
|
4876 |
|
4877 |
if (typeof margin !== 'undefined') {
|
4880 |
}); // Restore body padding
|
4881 |
|
4882 |
var padding = $$$1(document.body).data('padding-right');
|
4883 |
+
$$$1(document.body).removeData('padding-right');
|
4884 |
+
document.body.style.paddingRight = padding ? padding : '';
|
|
|
|
|
4885 |
};
|
4886 |
|
4887 |
_proto._getScrollbarWidth = function _getScrollbarWidth() {
|
4946 |
var selector = Util.getSelectorFromElement(this);
|
4947 |
|
4948 |
if (selector) {
|
4949 |
+
target = document.querySelector(selector);
|
4950 |
}
|
4951 |
|
4952 |
var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _objectSpread({}, $$$1(target).data(), $$$1(this).data());
|
4989 |
|
4990 |
/**
|
4991 |
* --------------------------------------------------------------------------
|
4992 |
+
* Bootstrap (v4.1.3): tooltip.js
|
4993 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
4994 |
* --------------------------------------------------------------------------
|
4995 |
*/
|
5001 |
* ------------------------------------------------------------------------
|
5002 |
*/
|
5003 |
var NAME = 'tooltip';
|
5004 |
+
var VERSION = '4.1.3';
|
5005 |
var DATA_KEY = 'bs.tooltip';
|
5006 |
var EVENT_KEY = "." + DATA_KEY;
|
5007 |
var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
|
5211 |
var attachment = this._getAttachment(placement);
|
5212 |
|
5213 |
this.addAttachmentClass(attachment);
|
5214 |
+
var container = this.config.container === false ? document.body : $$$1(document).find(this.config.container);
|
5215 |
$$$1(tip).data(this.constructor.DATA_KEY, this);
|
5216 |
|
5217 |
if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) {
|
5350 |
};
|
5351 |
|
5352 |
_proto.setContent = function setContent() {
|
5353 |
+
var tip = this.getTipElement();
|
5354 |
+
this.setElementContent($$$1(tip.querySelectorAll(Selector.TOOLTIP_INNER)), this.getTitle());
|
5355 |
+
$$$1(tip).removeClass(ClassName.FADE + " " + ClassName.SHOW);
|
5356 |
};
|
5357 |
|
5358 |
_proto.setElementContent = function setElementContent($element, content) {
|
5545 |
var $tip = $$$1(this.getTipElement());
|
5546 |
var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
|
5547 |
|
5548 |
+
if (tabClass !== null && tabClass.length) {
|
5549 |
$tip.removeClass(tabClass.join(''));
|
5550 |
}
|
5551 |
};
|
5552 |
|
5553 |
+
_proto._handlePopperPlacementChange = function _handlePopperPlacementChange(popperData) {
|
5554 |
+
var popperInstance = popperData.instance;
|
5555 |
+
this.tip = popperInstance.popper;
|
5556 |
+
|
5557 |
this._cleanTipClass();
|
5558 |
|
5559 |
+
this.addAttachmentClass(this._getAttachment(popperData.placement));
|
5560 |
};
|
5561 |
|
5562 |
_proto._fixTransition = function _fixTransition() {
|
5659 |
|
5660 |
/**
|
5661 |
* --------------------------------------------------------------------------
|
5662 |
+
* Bootstrap (v4.1.3): popover.js
|
5663 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5664 |
* --------------------------------------------------------------------------
|
5665 |
*/
|
5671 |
* ------------------------------------------------------------------------
|
5672 |
*/
|
5673 |
var NAME = 'popover';
|
5674 |
+
var VERSION = '4.1.3';
|
5675 |
var DATA_KEY = 'bs.popover';
|
5676 |
var EVENT_KEY = "." + DATA_KEY;
|
5677 |
var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
|
5856 |
|
5857 |
/**
|
5858 |
* --------------------------------------------------------------------------
|
5859 |
+
* Bootstrap (v4.1.3): scrollspy.js
|
5860 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5861 |
* --------------------------------------------------------------------------
|
5862 |
*/
|
5868 |
* ------------------------------------------------------------------------
|
5869 |
*/
|
5870 |
var NAME = 'scrollspy';
|
5871 |
+
var VERSION = '4.1.3';
|
5872 |
var DATA_KEY = 'bs.scrollspy';
|
5873 |
var EVENT_KEY = "." + DATA_KEY;
|
5874 |
var DATA_API_KEY = '.data-api';
|
5950 |
this._offsets = [];
|
5951 |
this._targets = [];
|
5952 |
this._scrollHeight = this._getScrollHeight();
|
5953 |
+
var targets = [].slice.call(document.querySelectorAll(this._selector));
|
5954 |
targets.map(function (element) {
|
5955 |
var target;
|
5956 |
var targetSelector = Util.getSelectorFromElement(element);
|
5957 |
|
5958 |
if (targetSelector) {
|
5959 |
+
target = document.querySelector(targetSelector);
|
5960 |
}
|
5961 |
|
5962 |
if (target) {
|
6053 |
return;
|
6054 |
}
|
6055 |
|
6056 |
+
var offsetLength = this._offsets.length;
|
6057 |
+
|
6058 |
+
for (var i = offsetLength; i--;) {
|
6059 |
var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
|
6060 |
|
6061 |
if (isActiveTarget) {
|
6075 |
queries = queries.map(function (selector) {
|
6076 |
return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]");
|
6077 |
});
|
6078 |
+
var $link = $$$1([].slice.call(document.querySelectorAll(queries.join(','))));
|
6079 |
|
6080 |
if ($link.hasClass(ClassName.DROPDOWN_ITEM)) {
|
6081 |
$link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
|
6096 |
};
|
6097 |
|
6098 |
_proto._clear = function _clear() {
|
6099 |
+
var nodes = [].slice.call(document.querySelectorAll(this._selector));
|
6100 |
+
$$$1(nodes).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
|
6101 |
}; // Static
|
6102 |
|
6103 |
|
6144 |
|
6145 |
|
6146 |
$$$1(window).on(Event.LOAD_DATA_API, function () {
|
6147 |
+
var scrollSpys = [].slice.call(document.querySelectorAll(Selector.DATA_SPY));
|
6148 |
+
var scrollSpysLength = scrollSpys.length;
|
6149 |
|
6150 |
+
for (var i = scrollSpysLength; i--;) {
|
6151 |
var $spy = $$$1(scrollSpys[i]);
|
6152 |
|
6153 |
ScrollSpy._jQueryInterface.call($spy, $spy.data());
|
6172 |
|
6173 |
/**
|
6174 |
* --------------------------------------------------------------------------
|
6175 |
+
* Bootstrap (v4.1.3): tab.js
|
6176 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
6177 |
* --------------------------------------------------------------------------
|
6178 |
*/
|
6184 |
* ------------------------------------------------------------------------
|
6185 |
*/
|
6186 |
var NAME = 'tab';
|
6187 |
+
var VERSION = '4.1.3';
|
6188 |
var DATA_KEY = 'bs.tab';
|
6189 |
var EVENT_KEY = "." + DATA_KEY;
|
6190 |
var DATA_API_KEY = '.data-api';
|
6266 |
}
|
6267 |
|
6268 |
if (selector) {
|
6269 |
+
target = document.querySelector(selector);
|
6270 |
}
|
6271 |
|
6272 |
this._activate(this._element, listElement);
|
6348 |
var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0];
|
6349 |
|
6350 |
if (dropdownElement) {
|
6351 |
+
var dropdownToggleList = [].slice.call(dropdownElement.querySelectorAll(Selector.DROPDOWN_TOGGLE));
|
6352 |
+
$$$1(dropdownToggleList).addClass(ClassName.ACTIVE);
|
6353 |
}
|
6354 |
|
6355 |
element.setAttribute('aria-expanded', true);
|
6421 |
|
6422 |
/**
|
6423 |
* --------------------------------------------------------------------------
|
6424 |
+
* Bootstrap (v4.1.3): index.js
|
6425 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
6426 |
* --------------------------------------------------------------------------
|
6427 |
*/
|
6457 |
|
6458 |
Object.defineProperty(exports, '__esModule', { value: true });
|
6459 |
|
6460 |
+
})));
|
|
@@ -1,7 +1,6 @@
|
|
1 |
/*!
|
2 |
-
* Bootstrap v4.1.
|
3 |
* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
|
4 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5 |
*/
|
6 |
-
!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function c(r){for(var t=1;t<arguments.length;t++){var o=null!=arguments[t]?arguments[t]:{},e=Object.keys(o);"function"==typeof Object.getOwnPropertySymbols&&(e=e.concat(Object.getOwnPropertySymbols(o).filter(function(t){return Object.getOwnPropertyDescriptor(o,t).enumerable}))),e.forEach(function(t){var e,n,i;e=r,i=o[n=t],n in e?Object.defineProperty(e,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):e[n]=i})}return r}for(var r,n,o,a,l,f,h,u,d,p,g,m,_,v,E,y,b,T,C,w,I,D,A,S,O,N,k,L,P,x,j,M,R,H,W,F,U,B,K,V,Q,Y,G,q,z,X,J,Z,$,tt,et,nt,it,rt,ot,st,at,lt,ct,ft,ht,ut,dt,pt,gt=function(i){var e="transitionend";function t(t){var e=this,n=!1;return i(this).one(l.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||l.triggerTransitionEnd(e)},t),this}var l={TRANSITION_END:"bsTransitionEnd",getUID:function(t){for(;t+=~~(1e6*Math.random()),document.getElementById(t););return t},getSelectorFromElement:function(t){var e=t.getAttribute("data-target");e&&"#"!==e||(e=t.getAttribute("href")||"");try{return 0<i(document).find(e).length?e:null}catch(t){return null}},getTransitionDurationFromElement:function(t){if(!t)return 0;var e=i(t).css("transition-duration");return parseFloat(e)?(e=e.split(",")[0],1e3*parseFloat(e)):0},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(t){i(t).trigger(e)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var r=n[i],o=e[i],s=o&&l.isElement(o)?"element":(a=o,{}.toString.call(a).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(r).test(s))throw new Error(t.toUpperCase()+': Option "'+i+'" provided type "'+s+'" but expected type "'+r+'".')}var a}};return i.fn.emulateTransitionEnd=t,i.event.special[l.TRANSITION_END]={bindType:e,delegateType:e,handle:function(t){if(i(t.target).is(this))return t.handleObj.handler.apply(this,arguments)}},l}(e=e&&e.hasOwnProperty("default")?e.default:e),mt=(n="alert",a="."+(o="bs.alert"),l=(r=e).fn[n],f={CLOSE:"close"+a,CLOSED:"closed"+a,CLICK_DATA_API:"click"+a+".data-api"},h="alert",u="fade",d="show",p=function(){function i(t){this._element=t}var t=i.prototype;return t.close=function(t){var e=this._element;t&&(e=this._getRootElement(t)),this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},t.dispose=function(){r.removeData(this._element,o),this._element=null},t._getRootElement=function(t){var e=gt.getSelectorFromElement(t),n=!1;return e&&(n=r(e)[0]),n||(n=r(t).closest("."+h)[0]),n},t._triggerCloseEvent=function(t){var e=r.Event(f.CLOSE);return r(t).trigger(e),e},t._removeElement=function(e){var n=this;if(r(e).removeClass(d),r(e).hasClass(u)){var t=gt.getTransitionDurationFromElement(e);r(e).one(gt.TRANSITION_END,function(t){return n._destroyElement(e,t)}).emulateTransitionEnd(t)}else this._destroyElement(e)},t._destroyElement=function(t){r(t).detach().trigger(f.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var t=r(this),e=t.data(o);e||(e=new i(this),t.data(o,e)),"close"===n&&e[n](this)})},i._handleDismiss=function(e){return function(t){t&&t.preventDefault(),e.close(this)}},s(i,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),i}(),r(document).on(f.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),r.fn[n]=p._jQueryInterface,r.fn[n].Constructor=p,r.fn[n].noConflict=function(){return r.fn[n]=l,p._jQueryInterface},p),_t=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',D="input",A=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:(C="focus")+v+E+" blur"+v+E},N=function(){function n(t){this._element=t}var t=n.prototype;return t.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(D)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(A)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},t.dispose=function(){g.removeData(this._element,_),this._element=null},n._jQueryInterface=function(e){return this.each(function(){var t=g(this).data(_);t||(t=new n(this),g(this).data(_,t)),"toggle"===e&&t[e]()})},s(n,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),n}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)||(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),vt=(L="carousel",x="."+(P="bs.carousel"),j=".data-api",M=(k=e).fn[L],R={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},H={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},W="next",F="prev",U="left",B="right",K={SLIDE:"slide"+x,SLID:"slid"+x,KEYDOWN:"keydown"+x,MOUSEENTER:"mouseenter"+x,MOUSELEAVE:"mouseleave"+x,TOUCHEND:"touchend"+x,LOAD_DATA_API:"load"+x+j,CLICK_DATA_API:"click"+x+j},V="carousel",Q="active",Y="slide",G="carousel-item-right",q="carousel-item-left",z="carousel-item-next",X="carousel-item-prev",J={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},Z=function(){function o(t,e){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(e),this._element=k(t)[0],this._indicatorsElement=k(this._element).find(J.INDICATORS)[0],this._addEventListeners()}var t=o.prototype;return t.next=function(){this._isSliding||this._slide(W)},t.nextWhenVisible=function(){!document.hidden&&k(this._element).is(":visible")&&"hidden"!==k(this._element).css("visibility")&&this.next()},t.prev=function(){this._isSliding||this._slide(F)},t.pause=function(t){t||(this._isPaused=!0),k(this._element).find(J.NEXT_PREV)[0]&&(gt.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},t.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},t.to=function(t){var e=this;this._activeElement=k(this._element).find(J.ACTIVE_ITEM)[0];var n=this._getItemIndex(this._activeElement);if(!(t>this._items.length-1||t<0))if(this._isSliding)k(this._element).one(K.SLID,function(){return e.to(t)});else{if(n===t)return this.pause(),void this.cycle();var i=n<t?W:F;this._slide(i,this._items[t])}},t.dispose=function(){k(this._element).off(x),k.removeData(this._element,P),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},t._getConfig=function(t){return t=c({},R,t),gt.typeCheckConfig(L,t,H),t},t._addEventListeners=function(){var e=this;this._config.keyboard&&k(this._element).on(K.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(k(this._element).on(K.MOUSEENTER,function(t){return e.pause(t)}).on(K.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&k(this._element).on(K.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},t._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},t._getItemIndex=function(t){return this._items=k.makeArray(k(t).parent().find(J.ITEM)),this._items.indexOf(t)},t._getItemByDirection=function(t,e){var n=t===W,i=t===F,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===F?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},t._triggerSlideEvent=function(t,e){var n=this._getItemIndex(t),i=this._getItemIndex(k(this._element).find(J.ACTIVE_ITEM)[0]),r=k.Event(K.SLIDE,{relatedTarget:t,direction:e,from:i,to:n});return k(this._element).trigger(r),r},t._setActiveIndicatorElement=function(t){if(this._indicatorsElement){k(this._indicatorsElement).find(J.ACTIVE).removeClass(Q);var e=this._indicatorsElement.children[this._getItemIndex(t)];e&&k(e).addClass(Q)}},t._slide=function(t,e){var n,i,r,o=this,s=k(this._element).find(J.ACTIVE_ITEM)[0],a=this._getItemIndex(s),l=e||s&&this._getItemByDirection(t,s),c=this._getItemIndex(l),f=Boolean(this._interval);if(t===W?(n=q,i=z,r=U):(n=G,i=X,r=B),l&&k(l).hasClass(Q))this._isSliding=!1;else if(!this._triggerSlideEvent(l,r).isDefaultPrevented()&&s&&l){this._isSliding=!0,f&&this.pause(),this._setActiveIndicatorElement(l);var h=k.Event(K.SLID,{relatedTarget:l,direction:r,from:a,to:c});if(k(this._element).hasClass(Y)){k(l).addClass(i),gt.reflow(l),k(s).addClass(n),k(l).addClass(n);var u=gt.getTransitionDurationFromElement(s);k(s).one(gt.TRANSITION_END,function(){k(l).removeClass(n+" "+i).addClass(Q),k(s).removeClass(Q+" "+i+" "+n),o._isSliding=!1,setTimeout(function(){return k(o._element).trigger(h)},0)}).emulateTransitionEnd(u)}else k(s).removeClass(Q),k(l).addClass(Q),this._isSliding=!1,k(this._element).trigger(h);f&&this.cycle()}},o._jQueryInterface=function(i){return this.each(function(){var t=k(this).data(P),e=c({},R,k(this).data());"object"==typeof i&&(e=c({},e,i));var n="string"==typeof i?i:e.slide;if(t||(t=new o(this,e),k(this).data(P,t)),"number"==typeof i)t.to(i);else if("string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}else e.interval&&(t.pause(),t.cycle())})},o._dataApiClickHandler=function(t){var e=gt.getSelectorFromElement(this);if(e){var n=k(e)[0];if(n&&k(n).hasClass(V)){var i=c({},k(n).data(),k(this).data()),r=this.getAttribute("data-slide-to");r&&(i.interval=!1),o._jQueryInterface.call(k(n),i),r&&k(n).data(P).to(r),t.preventDefault()}}},s(o,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return R}}]),o}(),k(document).on(K.CLICK_DATA_API,J.DATA_SLIDE,Z._dataApiClickHandler),k(window).on(K.LOAD_DATA_API,function(){k(J.DATA_RIDE).each(function(){var t=k(this);Z._jQueryInterface.call(t,t.data())})}),k.fn[L]=Z._jQueryInterface,k.fn[L].Constructor=Z,k.fn[L].noConflict=function(){return k.fn[L]=M,Z._jQueryInterface},Z),Et=(tt="collapse",nt="."+(et="bs.collapse"),it=($=e).fn[tt],rt={toggle:!0,parent:""},ot={toggle:"boolean",parent:"(string|element)"},st={SHOW:"show"+nt,SHOWN:"shown"+nt,HIDE:"hide"+nt,HIDDEN:"hidden"+nt,CLICK_DATA_API:"click"+nt+".data-api"},at="show",lt="collapse",ct="collapsing",ft="collapsed",ht="width",ut="height",dt={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},pt=function(){function a(t,e){this._isTransitioning=!1,this._element=t,this._config=this._getConfig(e),this._triggerArray=$.makeArray($('[data-toggle="collapse"][href="#'+t.id+'"],[data-toggle="collapse"][data-target="#'+t.id+'"]'));for(var n=$(dt.DATA_TOGGLE),i=0;i<n.length;i++){var r=n[i],o=gt.getSelectorFromElement(r);null!==o&&0<$(o).filter(t).length&&(this._selector=o,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var t=a.prototype;return t.toggle=function(){$(this._element).hasClass(at)?this.hide():this.show()},t.show=function(){var t,e,n=this;if(!this._isTransitioning&&!$(this._element).hasClass(at)&&(this._parent&&0===(t=$.makeArray($(this._parent).find(dt.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(t=null),!(t&&(e=$(t).not(this._selector).data(et))&&e._isTransitioning))){var i=$.Event(st.SHOW);if($(this._element).trigger(i),!i.isDefaultPrevented()){t&&(a._jQueryInterface.call($(t).not(this._selector),"hide"),e||$(t).data(et,null));var r=this._getDimension();$(this._element).removeClass(lt).addClass(ct),(this._element.style[r]=0)<this._triggerArray.length&&$(this._triggerArray).removeClass(ft).attr("aria-expanded",!0),this.setTransitioning(!0);var o="scroll"+(r[0].toUpperCase()+r.slice(1)),s=gt.getTransitionDurationFromElement(this._element);$(this._element).one(gt.TRANSITION_END,function(){$(n._element).removeClass(ct).addClass(lt).addClass(at),n._element.style[r]="",n.setTransitioning(!1),$(n._element).trigger(st.SHOWN)}).emulateTransitionEnd(s),this._element.style[r]=this._element[o]+"px"}}},t.hide=function(){var t=this;if(!this._isTransitioning&&$(this._element).hasClass(at)){var e=$.Event(st.HIDE);if($(this._element).trigger(e),!e.isDefaultPrevented()){var n=this._getDimension();if(this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",gt.reflow(this._element),$(this._element).addClass(ct).removeClass(lt).removeClass(at),0<this._triggerArray.length)for(var i=0;i<this._triggerArray.length;i++){var r=this._triggerArray[i],o=gt.getSelectorFromElement(r);if(null!==o)$(o).hasClass(at)||$(r).addClass(ft).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var s=gt.getTransitionDurationFromElement(this._element);$(this._element).one(gt.TRANSITION_END,function(){t.setTransitioning(!1),$(t._element).removeClass(ct).addClass(lt).trigger(st.HIDDEN)}).emulateTransitionEnd(s)}}},t.setTransitioning=function(t){this._isTransitioning=t},t.dispose=function(){$.removeData(this._element,et),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},t._getConfig=function(t){return(t=c({},rt,t)).toggle=Boolean(t.toggle),gt.typeCheckConfig(tt,t,ot),t},t._getDimension=function(){return $(this._element).hasClass(ht)?ht:ut},t._getParent=function(){var n=this,t=null;gt.isElement(this._config.parent)?(t=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(t=this._config.parent[0])):t=$(this._config.parent)[0];var e='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return $(t).find(e).each(function(t,e){n._addAriaAndCollapsedClass(a._getTargetFromElement(e),[e])}),t},t._addAriaAndCollapsedClass=function(t,e){if(t){var n=$(t).hasClass(at);0<e.length&&$(e).toggleClass(ft,!n).attr("aria-expanded",n)}},a._getTargetFromElement=function(t){var e=gt.getSelectorFromElement(t);return e?$(e)[0]:null},a._jQueryInterface=function(i){return this.each(function(){var t=$(this),e=t.data(et),n=c({},rt,t.data(),"object"==typeof i&&i?i:{});if(!e&&n.toggle&&/show|hide/.test(i)&&(n.toggle=!1),e||(e=new a(this,n),t.data(et,e)),"string"==typeof i){if("undefined"==typeof e[i])throw new TypeError('No method named "'+i+'"');e[i]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return rt}}]),a}(),$(document).on(st.CLICK_DATA_API,dt.DATA_TOGGLE,function(t){"A"===t.currentTarget.tagName&&t.preventDefault();var n=$(this),e=gt.getSelectorFromElement(this);$(e).each(function(){var t=$(this),e=t.data(et)?"toggle":n.data();pt._jQueryInterface.call(t,e)})}),$.fn[tt]=pt._jQueryInterface,$.fn[tt].Constructor=pt,$.fn[tt].noConflict=function(){return $.fn[tt]=it,pt._jQueryInterface},pt),yt="undefined"!=typeof window&&"undefined"!=typeof document,bt=["Edge","Trident","Firefox"],Tt=0,Ct=0;Ct<bt.length;Ct+=1)if(yt&&0<=navigator.userAgent.indexOf(bt[Ct])){Tt=1;break}var wt=yt&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},Tt))}};function It(t){return t&&"[object Function]"==={}.toString.call(t)}function Dt(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function At(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function St(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=Dt(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto|scroll|overlay)/.test(n+r+i)?t:St(At(t))}var Ot=yt&&!(!window.MSInputMethodContext||!document.documentMode),Nt=yt&&/MSIE 10/.test(navigator.userAgent);function kt(t){return 11===t?Ot:10===t?Nt:Ot||Nt}function Lt(t){if(!t)return document.documentElement;for(var e=kt(10)?document.body:null,n=t.offsetParent;n===e&&t.nextElementSibling;)n=(t=t.nextElementSibling).offsetParent;var i=n&&n.nodeName;return i&&"BODY"!==i&&"HTML"!==i?-1!==["TD","TABLE"].indexOf(n.nodeName)&&"static"===Dt(n,"position")?Lt(n):n:t?t.ownerDocument.documentElement:document.documentElement}function Pt(t){return null!==t.parentNode?Pt(t.parentNode):t}function xt(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l||i.contains(r))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&Lt(s.firstElementChild)!==s?Lt(l):l;var c=Pt(t);return c.host?xt(c.host,e):xt(t,Pt(e).host)}function jt(t){var e="top"===(1<arguments.length&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n||"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}return t[e]}function Mt(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}function Rt(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],kt(10)?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function Ht(){var t=document.body,e=document.documentElement,n=kt(10)&&getComputedStyle(e);return{height:Rt("Height",t,e,n),width:Rt("Width",t,e,n)}}var Wt=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},Ft=function(){function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}}(),Ut=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},Bt=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function Kt(t){return Bt({},t,{right:t.left+t.width,bottom:t.top+t.height})}function Vt(t){var e={};try{if(kt(10)){e=t.getBoundingClientRect();var n=jt(t,"top"),i=jt(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}else e=t.getBoundingClientRect()}catch(t){}var r={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},o="HTML"===t.nodeName?Ht():{},s=o.width||t.clientWidth||r.right-r.left,a=o.height||t.clientHeight||r.bottom-r.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l||c){var f=Dt(t);l-=Mt(f,"x"),c-=Mt(f,"y"),r.width-=l,r.height-=c}return Kt(r)}function Qt(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=kt(10),r="HTML"===e.nodeName,o=Vt(t),s=Vt(e),a=St(t),l=Dt(e),c=parseFloat(l.borderTopWidth,10),f=parseFloat(l.borderLeftWidth,10);n&&"HTML"===e.nodeName&&(s.top=Math.max(s.top,0),s.left=Math.max(s.left,0));var h=Kt({top:o.top-s.top-c,left:o.left-s.left-f,width:o.width,height:o.height});if(h.marginTop=0,h.marginLeft=0,!i&&r){var u=parseFloat(l.marginTop,10),d=parseFloat(l.marginLeft,10);h.top-=c-u,h.bottom-=c-u,h.left-=f-d,h.right-=f-d,h.marginTop=u,h.marginLeft=d}return(i&&!n?e.contains(a):e===a&&"BODY"!==a.nodeName)&&(h=function(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=jt(e,"top"),r=jt(e,"left"),o=n?-1:1;return t.top+=i*o,t.bottom+=i*o,t.left+=r*o,t.right+=r*o,t}(h,e)),h}function Yt(t){if(!t||!t.parentElement||kt())return document.documentElement;for(var e=t.parentElement;e&&"none"===Dt(e,"transform");)e=e.parentElement;return e||document.documentElement}function Gt(t,e,n,i){var r=4<arguments.length&&void 0!==arguments[4]&&arguments[4],o={top:0,left:0},s=r?Yt(t):xt(t,e);if("viewport"===i)o=function(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=t.ownerDocument.documentElement,i=Qt(t,n),r=Math.max(n.clientWidth,window.innerWidth||0),o=Math.max(n.clientHeight,window.innerHeight||0),s=e?0:jt(n),a=e?0:jt(n,"left");return Kt({top:s-i.top+i.marginTop,left:a-i.left+i.marginLeft,width:r,height:o})}(s,r);else{var a=void 0;"scrollParent"===i?"BODY"===(a=St(At(e))).nodeName&&(a=t.ownerDocument.documentElement):a="window"===i?t.ownerDocument.documentElement:i;var l=Qt(a,s,r);if("HTML"!==a.nodeName||function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===Dt(e,"position")||t(At(e)))}(s))o=l;else{var c=Ht(),f=c.height,h=c.width;o.top+=l.top-l.marginTop,o.bottom=f+l.top,o.left+=l.left-l.marginLeft,o.right=h+l.left}}return o.left+=n,o.top+=n,o.right-=n,o.bottom-=n,o}function qt(t,e,i,n,r){var o=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=Gt(i,n,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return Bt({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,n=t.height;return e>=i.clientWidth&&n>=i.clientHeight}),f=0<c.length?c[0].key:l[0].key,h=t.split("-")[1];return f+(h?"-"+h:"")}function zt(t,e,n){var i=3<arguments.length&&void 0!==arguments[3]?arguments[3]:null;return Qt(n,i?Yt(e):xt(e,n),i)}function Xt(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function Jt(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function Zt(t,e,n){n=n.split("-")[0];var i=Xt(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[Jt(a)],r}function $t(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function te(t,n,e){return(void 0===e?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=$t(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",e))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var e=t.function||t.fn;t.enabled&&It(e)&&(n.offsets.popper=Kt(n.offsets.popper),n.offsets.reference=Kt(n.offsets.reference),n=e(n,t))}),n}function ee(t,n){return t.some(function(t){var e=t.name;return t.enabled&&e===n})}function ne(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length;i++){var r=e[i],o=r?""+r+n:t;if("undefined"!=typeof document.body.style[o])return o}return null}function ie(t){var e=t.ownerDocument;return e?e.defaultView:window}function re(t,e,n,i){n.updateBound=i,ie(t).addEventListener("resize",n.updateBound,{passive:!0});var r=St(t);return function t(e,n,i,r){var o="BODY"===e.nodeName,s=o?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),o||t(St(s.parentNode),n,i,r),r.push(s)}(r,"scroll",n.updateBound,n.scrollParents),n.scrollElement=r,n.eventsEnabled=!0,n}function oe(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,ie(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function se(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function ae(n,i){Object.keys(i).forEach(function(t){var e="";-1!==["width","height","top","right","bottom","left"].indexOf(t)&&se(i[t])&&(e="px"),n.style[t]=i[t]+e})}function le(t,e,n){var i=$t(t,function(t){return t.name===e}),r=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!r){var o="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return r}var ce=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],fe=ce.slice(3);function he(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=fe.indexOf(t),i=fe.slice(n+1).concat(fe.slice(0,n));return e?i.reverse():i}var ue={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function de(t,r,o,e){var s=[0,0],a=-1!==["right","left"].indexOf(e),n=t.split(/(\+|\-)/).map(function(t){return t.trim()}),i=n.indexOf($t(n,function(t){return-1!==t.search(/,|\s/)}));n[i]&&-1===n[i].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==i?[n.slice(0,i).concat([n[i].split(l)[0]]),[n[i].split(l)[1]].concat(n.slice(i+1))]:[n];return(c=c.map(function(t,e){var n=(1===e?!a:a)?"height":"width",i=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,i=!0,t):i?(t[t.length-1]+=e,i=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return Kt(a)[e]/100*o}if("vh"===s||"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(t,n,r,o)})})).forEach(function(n,i){n.forEach(function(t,e){se(t)&&(s[i]+=t*("-"===n[e-1]?-1:1))})}),s}var pe={placement:"bottom",positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",f={start:Ut({},l,o[l]),end:Ut({},l,o[l]+o[c]-s[c])};t.offsets.popper=Bt({},s,f[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=se(+n)?[+n,0]:de(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,i){var e=i.boundariesElement||Lt(t.instance.popper);t.instance.reference===e&&(e=Lt(e));var n=ne("transform"),r=t.instance.popper.style,o=r.top,s=r.left,a=r[n];r.top="",r.left="",r[n]="";var l=Gt(t.instance.popper,t.instance.reference,i.padding,e,t.positionFixed);r.top=o,r.left=s,r[n]=a,i.boundaries=l;var c=i.priority,f=t.offsets.popper,h={primary:function(t){var e=f[t];return f[t]<l[t]&&!i.escapeWithReference&&(e=Math.max(f[t],l[t])),Ut({},t,e)},secondary:function(t){var e="right"===t?"left":"top",n=f[e];return f[t]>l[t]&&!i.escapeWithReference&&(n=Math.min(f[e],l[t]-("right"===t?f.width:f.height))),Ut({},e,n)}};return c.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";f=Bt({},f,h[e](t))}),t.offsets.popper=f,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<o(i[l])&&(t.offsets.popper[l]=o(i[l])-n[c]),n[l]>o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!le(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",f=l?"Top":"Left",h=f.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=Xt(i)[c];a[d]-p<s[h]&&(t.offsets.popper[h]-=s[h]-(a[d]-p)),a[h]+p>s[d]&&(t.offsets.popper[h]+=a[h]+p-s[d]),t.offsets.popper=Kt(t.offsets.popper);var g=a[h]+a[c]/2-p/2,m=Dt(t.instance.popper),_=parseFloat(m["margin"+f],10),v=parseFloat(m["border"+f+"Width"],10),E=g-t.offsets.popper[h]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(Ut(n={},h,Math.round(E)),Ut(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(p,g){if(ee(p.instance.modifiers,"inner"))return p;if(p.flipped&&p.placement===p.originalPlacement)return p;var m=Gt(p.instance.popper,p.instance.reference,g.padding,g.boundariesElement,p.positionFixed),_=p.placement.split("-")[0],v=Jt(_),E=p.placement.split("-")[1]||"",y=[];switch(g.behavior){case ue.FLIP:y=[_,v];break;case ue.CLOCKWISE:y=he(_);break;case ue.COUNTERCLOCKWISE:y=he(_,!0);break;default:y=g.behavior}return y.forEach(function(t,e){if(_!==t||y.length===e+1)return p;_=p.placement.split("-")[0],v=Jt(_);var n,i=p.offsets.popper,r=p.offsets.reference,o=Math.floor,s="left"===_&&o(i.right)>o(r.left)||"right"===_&&o(i.left)<o(r.right)||"top"===_&&o(i.bottom)>o(r.top)||"bottom"===_&&o(i.top)<o(r.bottom),a=o(i.left)<o(m.left),l=o(i.right)>o(m.right),c=o(i.top)<o(m.top),f=o(i.bottom)>o(m.bottom),h="left"===_&&a||"right"===_&&l||"top"===_&&c||"bottom"===_&&f,u=-1!==["top","bottom"].indexOf(_),d=!!g.flipVariations&&(u&&"start"===E&&a||u&&"end"===E&&l||!u&&"start"===E&&c||!u&&"end"===E&&f);(s||h||d)&&(p.flipped=!0,(s||h)&&(_=y[e+1]),d&&(E="end"===(n=E)?"start":"start"===n?"end":n),p.placement=_+(E?"-"+E:""),p.offsets.popper=Bt({},p.offsets.popper,Zt(p.instance.popper,p.offsets.reference,p.placement)),p=te(p.instance.modifiers,p,"flip"))}),p},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=Jt(e),t.offsets.popper=Kt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!le(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=$t(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top||e.left>n.right||e.top>n.bottom||e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,r=t.offsets.popper,o=$t(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s=void 0!==o?o:e.gpuAcceleration,a=Vt(Lt(t.instance.popper)),l={position:r.position},c={left:Math.floor(r.left),top:Math.round(r.top),bottom:Math.round(r.bottom),right:Math.floor(r.right)},f="bottom"===n?"top":"bottom",h="right"===i?"left":"right",u=ne("transform"),d=void 0,p=void 0;if(p="bottom"===f?-a.height+c.bottom:c.top,d="right"===h?-a.width+c.right:c.left,s&&u)l[u]="translate3d("+d+"px, "+p+"px, 0)",l[f]=0,l[h]=0,l.willChange="transform";else{var g="bottom"===f?-1:1,m="right"===h?-1:1;l[f]=p*g,l[h]=d*m,l.willChange=f+", "+h}var _={"x-placement":t.placement};return t.attributes=Bt({},_,t.attributes),t.styles=Bt({},l,t.styles),t.arrowStyles=Bt({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return ae(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&ae(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,r){var o=zt(r,e,t,n.positionFixed),s=qt(n.placement,o,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),ae(e,{position:n.positionFixed?"fixed":"absolute"}),n},gpuAcceleration:void 0}}},ge=function(){function o(t,e){var n=this,i=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};Wt(this,o),this.scheduleUpdate=function(){return requestAnimationFrame(n.update)},this.update=wt(this.update.bind(this)),this.options=Bt({},o.Defaults,i),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=t&&t.jquery?t[0]:t,this.popper=e&&e.jquery?e[0]:e,this.options.modifiers={},Object.keys(Bt({},o.Defaults.modifiers,i.modifiers)).forEach(function(t){n.options.modifiers[t]=Bt({},o.Defaults.modifiers[t]||{},i.modifiers?i.modifiers[t]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return Bt({name:t},n.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&It(t.onLoad)&&t.onLoad(n.reference,n.popper,n.options,t,n.state)}),this.update();var r=this.options.eventsEnabled;r&&this.enableEventListeners(),this.state.eventsEnabled=r}return Ft(o,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=zt(this.state,this.popper,this.reference,this.options.positionFixed),t.placement=qt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.positionFixed=this.options.positionFixed,t.offsets.popper=Zt(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position=this.options.positionFixed?"fixed":"absolute",t=te(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,ee(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.position="",this.popper.style.top="",this.popper.style.left="",this.popper.style.right="",this.popper.style.bottom="",this.popper.style.willChange="",this.popper.style[ne("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=re(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return oe.call(this)}}]),o}();ge.Utils=("undefined"!=typeof window?window:global).PopperUtils,ge.placements=ce,ge.Defaults=pe;var me,_e,ve,Ee,ye,be,Te,Ce,we,Ie,De,Ae,Se,Oe,Ne,ke,Le,Pe,xe,je,Me,Re,He,We,Fe,Ue,Be,Ke,Ve,Qe,Ye,Ge,qe,ze,Xe,Je,Ze,$e,tn,en,nn,rn,on,sn,an,ln,cn,fn,hn,un,dn,pn,gn,mn,_n,vn,En,yn,bn,Tn,Cn,wn,In,Dn,An,Sn,On,Nn,kn,Ln,Pn,xn,jn,Mn,Rn,Hn,Wn,Fn,Un,Bn,Kn,Vn,Qn,Yn,Gn,qn,zn,Xn,Jn,Zn,$n,ti,ei,ni,ii,ri,oi,si,ai,li,ci,fi,hi,ui,di,pi,gi,mi,_i,vi,Ei,yi,bi,Ti=(_e="dropdown",Ee="."+(ve="bs.dropdown"),ye=".data-api",be=(me=e).fn[_e],Te=new RegExp("38|40|27"),Ce={HIDE:"hide"+Ee,HIDDEN:"hidden"+Ee,SHOW:"show"+Ee,SHOWN:"shown"+Ee,CLICK:"click"+Ee,CLICK_DATA_API:"click"+Ee+ye,KEYDOWN_DATA_API:"keydown"+Ee+ye,KEYUP_DATA_API:"keyup"+Ee+ye},we="disabled",Ie="show",De="dropup",Ae="dropright",Se="dropleft",Oe="dropdown-menu-right",Ne="position-static",ke='[data-toggle="dropdown"]',Le=".dropdown form",Pe=".dropdown-menu",xe=".navbar-nav",je=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",Me="top-start",Re="top-end",He="bottom-start",We="bottom-end",Fe="right-start",Ue="left-start",Be={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},Ke={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Ve=function(){function l(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var t=l.prototype;return t.toggle=function(){if(!this._element.disabled&&!me(this._element).hasClass(we)){var t=l._getParentFromElement(this._element),e=me(this._menu).hasClass(Ie);if(l._clearMenus(),!e){var n={relatedTarget:this._element},i=me.Event(Ce.SHOW,n);if(me(t).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof ge)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var r=this._element;"parent"===this._config.reference?r=t:gt.isElement(this._config.reference)&&(r=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(r=this._config.reference[0])),"scrollParent"!==this._config.boundary&&me(t).addClass(Ne),this._popper=new ge(r,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===me(t).closest(xe).length&&me(document.body).children().on("mouseover",null,me.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),me(this._menu).toggleClass(Ie),me(t).toggleClass(Ie).trigger(me.Event(Ce.SHOWN,n))}}}},t.dispose=function(){me.removeData(this._element,ve),me(this._element).off(Ee),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},t.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},t._addEventListeners=function(){var e=this;me(this._element).on(Ce.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},t._getConfig=function(t){return t=c({},this.constructor.Default,me(this._element).data(),t),gt.typeCheckConfig(_e,t,this.constructor.DefaultType),t},t._getMenuElement=function(){if(!this._menu){var t=l._getParentFromElement(this._element);this._menu=me(t).find(Pe)[0]}return this._menu},t._getPlacement=function(){var t=me(this._element).parent(),e=He;return t.hasClass(De)?(e=Me,me(this._menu).hasClass(Oe)&&(e=Re)):t.hasClass(Ae)?e=Fe:t.hasClass(Se)?e=Ue:me(this._menu).hasClass(Oe)&&(e=We),e},t._detectNavbar=function(){return 0<me(this._element).closest(".navbar").length},t._getPopperConfig=function(){var e=this,t={};"function"==typeof this._config.offset?t.fn=function(t){return t.offsets=c({},t.offsets,e._config.offset(t.offsets)||{}),t}:t.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:t,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},l._jQueryInterface=function(e){return this.each(function(){var t=me(this).data(ve);if(t||(t=new l(this,"object"==typeof e?e:null),me(this).data(ve,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},l._clearMenus=function(t){if(!t||3!==t.which&&("keyup"!==t.type||9===t.which))for(var e=me.makeArray(me(ke)),n=0;n<e.length;n++){var i=l._getParentFromElement(e[n]),r=me(e[n]).data(ve),o={relatedTarget:e[n]};if(r){var s=r._menu;if(me(i).hasClass(Ie)&&!(t&&("click"===t.type&&/input|textarea/i.test(t.target.tagName)||"keyup"===t.type&&9===t.which)&&me.contains(i,t.target))){var a=me.Event(Ce.HIDE,o);me(i).trigger(a),a.isDefaultPrevented()||("ontouchstart"in document.documentElement&&me(document.body).children().off("mouseover",null,me.noop),e[n].setAttribute("aria-expanded","false"),me(s).removeClass(Ie),me(i).removeClass(Ie).trigger(me.Event(Ce.HIDDEN,o)))}}}},l._getParentFromElement=function(t){var e,n=gt.getSelectorFromElement(t);return n&&(e=me(n)[0]),e||t.parentNode},l._dataApiKeydownHandler=function(t){if((/input|textarea/i.test(t.target.tagName)?!(32===t.which||27!==t.which&&(40!==t.which&&38!==t.which||me(t.target).closest(Pe).length)):Te.test(t.which))&&(t.preventDefault(),t.stopPropagation(),!this.disabled&&!me(this).hasClass(we))){var e=l._getParentFromElement(this),n=me(e).hasClass(Ie);if((n||27===t.which&&32===t.which)&&(!n||27!==t.which&&32!==t.which)){var i=me(e).find(je).get();if(0!==i.length){var r=i.indexOf(t.target);38===t.which&&0<r&&r--,40===t.which&&r<i.length-1&&r++,r<0&&(r=0),i[r].focus()}}else{if(27===t.which){var o=me(e).find(ke)[0];me(o).trigger("focus")}me(this).trigger("click")}}},s(l,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Be}},{key:"DefaultType",get:function(){return Ke}}]),l}(),me(document).on(Ce.KEYDOWN_DATA_API,ke,Ve._dataApiKeydownHandler).on(Ce.KEYDOWN_DATA_API,Pe,Ve._dataApiKeydownHandler).on(Ce.CLICK_DATA_API+" "+Ce.KEYUP_DATA_API,Ve._clearMenus).on(Ce.CLICK_DATA_API,ke,function(t){t.preventDefault(),t.stopPropagation(),Ve._jQueryInterface.call(me(this),"toggle")}).on(Ce.CLICK_DATA_API,Le,function(t){t.stopPropagation()}),me.fn[_e]=Ve._jQueryInterface,me.fn[_e].Constructor=Ve,me.fn[_e].noConflict=function(){return me.fn[_e]=be,Ve._jQueryInterface},Ve),Ci=(Ye="modal",qe="."+(Ge="bs.modal"),ze=(Qe=e).fn[Ye],Xe={backdrop:!0,keyboard:!0,focus:!0,show:!0},Je={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},Ze={HIDE:"hide"+qe,HIDDEN:"hidden"+qe,SHOW:"show"+qe,SHOWN:"shown"+qe,FOCUSIN:"focusin"+qe,RESIZE:"resize"+qe,CLICK_DISMISS:"click.dismiss"+qe,KEYDOWN_DISMISS:"keydown.dismiss"+qe,MOUSEUP_DISMISS:"mouseup.dismiss"+qe,MOUSEDOWN_DISMISS:"mousedown.dismiss"+qe,CLICK_DATA_API:"click"+qe+".data-api"},$e="modal-scrollbar-measure",tn="modal-backdrop",en="modal-open",nn="fade",rn="show",on={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},sn=function(){function r(t,e){this._config=this._getConfig(e),this._element=t,this._dialog=Qe(t).find(on.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._scrollbarWidth=0}var t=r.prototype;return t.toggle=function(t){return this._isShown?this.hide():this.show(t)},t.show=function(t){var e=this;if(!this._isTransitioning&&!this._isShown){Qe(this._element).hasClass(nn)&&(this._isTransitioning=!0);var n=Qe.Event(Ze.SHOW,{relatedTarget:t});Qe(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),Qe(document.body).addClass(en),this._setEscapeEvent(),this._setResizeEvent(),Qe(this._element).on(Ze.CLICK_DISMISS,on.DATA_DISMISS,function(t){return e.hide(t)}),Qe(this._dialog).on(Ze.MOUSEDOWN_DISMISS,function(){Qe(e._element).one(Ze.MOUSEUP_DISMISS,function(t){Qe(t.target).is(e._element)&&(e._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return e._showElement(t)}))}},t.hide=function(t){var e=this;if(t&&t.preventDefault(),!this._isTransitioning&&this._isShown){var n=Qe.Event(Ze.HIDE);if(Qe(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=Qe(this._element).hasClass(nn);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),Qe(document).off(Ze.FOCUSIN),Qe(this._element).removeClass(rn),Qe(this._element).off(Ze.CLICK_DISMISS),Qe(this._dialog).off(Ze.MOUSEDOWN_DISMISS),i){var r=gt.getTransitionDurationFromElement(this._element);Qe(this._element).one(gt.TRANSITION_END,function(t){return e._hideModal(t)}).emulateTransitionEnd(r)}else this._hideModal()}}},t.dispose=function(){Qe.removeData(this._element,Ge),Qe(window,document,this._element,this._backdrop).off(qe),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},t.handleUpdate=function(){this._adjustDialog()},t._getConfig=function(t){return t=c({},Xe,t),gt.typeCheckConfig(Ye,t,Je),t},t._showElement=function(t){var e=this,n=Qe(this._element).hasClass(nn);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,n&>.reflow(this._element),Qe(this._element).addClass(rn),this._config.focus&&this._enforceFocus();var i=Qe.Event(Ze.SHOWN,{relatedTarget:t}),r=function(){e._config.focus&&e._element.focus(),e._isTransitioning=!1,Qe(e._element).trigger(i)};if(n){var o=gt.getTransitionDurationFromElement(this._element);Qe(this._dialog).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r()},t._enforceFocus=function(){var e=this;Qe(document).off(Ze.FOCUSIN).on(Ze.FOCUSIN,function(t){document!==t.target&&e._element!==t.target&&0===Qe(e._element).has(t.target).length&&e._element.focus()})},t._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?Qe(this._element).on(Ze.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||Qe(this._element).off(Ze.KEYDOWN_DISMISS)},t._setResizeEvent=function(){var e=this;this._isShown?Qe(window).on(Ze.RESIZE,function(t){return e.handleUpdate(t)}):Qe(window).off(Ze.RESIZE)},t._hideModal=function(){var t=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){Qe(document.body).removeClass(en),t._resetAdjustments(),t._resetScrollbar(),Qe(t._element).trigger(Ze.HIDDEN)})},t._removeBackdrop=function(){this._backdrop&&(Qe(this._backdrop).remove(),this._backdrop=null)},t._showBackdrop=function(t){var e=this,n=Qe(this._element).hasClass(nn)?nn:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=tn,n&&Qe(this._backdrop).addClass(n),Qe(this._backdrop).appendTo(document.body),Qe(this._element).on(Ze.CLICK_DISMISS,function(t){e._ignoreBackdropClick?e._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===e._config.backdrop?e._element.focus():e.hide())}),n&>.reflow(this._backdrop),Qe(this._backdrop).addClass(rn),!t)return;if(!n)return void t();var i=gt.getTransitionDurationFromElement(this._backdrop);Qe(this._backdrop).one(gt.TRANSITION_END,t).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){Qe(this._backdrop).removeClass(rn);var r=function(){e._removeBackdrop(),t&&t()};if(Qe(this._element).hasClass(nn)){var o=gt.getTransitionDurationFromElement(this._backdrop);Qe(this._backdrop).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r()}else t&&t()},t._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},t._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},t._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},t._setScrollbar=function(){var r=this;if(this._isBodyOverflowing){Qe(on.FIXED_CONTENT).each(function(t,e){var n=Qe(e)[0].style.paddingRight,i=Qe(e).css("padding-right");Qe(e).data("padding-right",n).css("padding-right",parseFloat(i)+r._scrollbarWidth+"px")}),Qe(on.STICKY_CONTENT).each(function(t,e){var n=Qe(e)[0].style.marginRight,i=Qe(e).css("margin-right");Qe(e).data("margin-right",n).css("margin-right",parseFloat(i)-r._scrollbarWidth+"px")}),Qe(on.NAVBAR_TOGGLER).each(function(t,e){var n=Qe(e)[0].style.marginRight,i=Qe(e).css("margin-right");Qe(e).data("margin-right",n).css("margin-right",parseFloat(i)+r._scrollbarWidth+"px")});var t=document.body.style.paddingRight,e=Qe(document.body).css("padding-right");Qe(document.body).data("padding-right",t).css("padding-right",parseFloat(e)+this._scrollbarWidth+"px")}},t._resetScrollbar=function(){Qe(on.FIXED_CONTENT).each(function(t,e){var n=Qe(e).data("padding-right");"undefined"!=typeof n&&Qe(e).css("padding-right",n).removeData("padding-right")}),Qe(on.STICKY_CONTENT+", "+on.NAVBAR_TOGGLER).each(function(t,e){var n=Qe(e).data("margin-right");"undefined"!=typeof n&&Qe(e).css("margin-right",n).removeData("margin-right")});var t=Qe(document.body).data("padding-right");"undefined"!=typeof t&&Qe(document.body).css("padding-right",t).removeData("padding-right")},t._getScrollbarWidth=function(){var t=document.createElement("div");t.className=$e,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},r._jQueryInterface=function(n,i){return this.each(function(){var t=Qe(this).data(Ge),e=c({},Xe,Qe(this).data(),"object"==typeof n&&n?n:{});if(t||(t=new r(this,e),Qe(this).data(Ge,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},s(r,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Xe}}]),r}(),Qe(document).on(Ze.CLICK_DATA_API,on.DATA_TOGGLE,function(t){var e,n=this,i=gt.getSelectorFromElement(this);i&&(e=Qe(i)[0]);var r=Qe(e).data(Ge)?"toggle":c({},Qe(e).data(),Qe(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||t.preventDefault();var o=Qe(e).one(Ze.SHOW,function(t){t.isDefaultPrevented()||o.one(Ze.HIDDEN,function(){Qe(n).is(":visible")&&n.focus()})});sn._jQueryInterface.call(Qe(e),r,this)}),Qe.fn[Ye]=sn._jQueryInterface,Qe.fn[Ye].Constructor=sn,Qe.fn[Ye].noConflict=function(){return Qe.fn[Ye]=ze,sn._jQueryInterface},sn),wi=(ln="tooltip",fn="."+(cn="bs.tooltip"),hn=(an=e).fn[ln],un="bs-tooltip",dn=new RegExp("(^|\\s)"+un+"\\S+","g"),mn={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!(gn={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"}),selector:!(pn={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"}),placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},vn="out",En={HIDE:"hide"+fn,HIDDEN:"hidden"+fn,SHOW:(_n="show")+fn,SHOWN:"shown"+fn,INSERTED:"inserted"+fn,CLICK:"click"+fn,FOCUSIN:"focusin"+fn,FOCUSOUT:"focusout"+fn,MOUSEENTER:"mouseenter"+fn,MOUSELEAVE:"mouseleave"+fn},yn="fade",bn="show",Tn=".tooltip-inner",Cn=".arrow",wn="hover",In="focus",Dn="click",An="manual",Sn=function(){function i(t,e){if("undefined"==typeof ge)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var t=i.prototype;return t.enable=function(){this._isEnabled=!0},t.disable=function(){this._isEnabled=!1},t.toggleEnabled=function(){this._isEnabled=!this._isEnabled},t.toggle=function(t){if(this._isEnabled)if(t){var e=this.constructor.DATA_KEY,n=an(t.currentTarget).data(e);n||(n=new this.constructor(t.currentTarget,this._getDelegateConfig()),an(t.currentTarget).data(e,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(an(this.getTipElement()).hasClass(bn))return void this._leave(null,this);this._enter(null,this)}},t.dispose=function(){clearTimeout(this._timeout),an.removeData(this.element,this.constructor.DATA_KEY),an(this.element).off(this.constructor.EVENT_KEY),an(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&an(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},t.show=function(){var e=this;if("none"===an(this.element).css("display"))throw new Error("Please use show on visible elements");var t=an.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){an(this.element).trigger(t);var n=an.contains(this.element.ownerDocument.documentElement,this.element);if(t.isDefaultPrevented()||!n)return;var i=this.getTipElement(),r=gt.getUID(this.constructor.NAME);i.setAttribute("id",r),this.element.setAttribute("aria-describedby",r),this.setContent(),this.config.animation&&an(i).addClass(yn);var o="function"==typeof this.config.placement?this.config.placement.call(this,i,this.element):this.config.placement,s=this._getAttachment(o);this.addAttachmentClass(s);var a=!1===this.config.container?document.body:an(this.config.container);an(i).data(this.constructor.DATA_KEY,this),an.contains(this.element.ownerDocument.documentElement,this.tip)||an(i).appendTo(a),an(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new ge(this.element,i,{placement:s,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:Cn},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),an(i).addClass(bn),"ontouchstart"in document.documentElement&&an(document.body).children().on("mouseover",null,an.noop);var l=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,an(e.element).trigger(e.constructor.Event.SHOWN),t===vn&&e._leave(null,e)};if(an(this.tip).hasClass(yn)){var c=gt.getTransitionDurationFromElement(this.tip);an(this.tip).one(gt.TRANSITION_END,l).emulateTransitionEnd(c)}else l()}},t.hide=function(t){var e=this,n=this.getTipElement(),i=an.Event(this.constructor.Event.HIDE),r=function(){e._hoverState!==_n&&n.parentNode&&n.parentNode.removeChild(n),e._cleanTipClass(),e.element.removeAttribute("aria-describedby"),an(e.element).trigger(e.constructor.Event.HIDDEN),null!==e._popper&&e._popper.destroy(),t&&t()};if(an(this.element).trigger(i),!i.isDefaultPrevented()){if(an(n).removeClass(bn),"ontouchstart"in document.documentElement&&an(document.body).children().off("mouseover",null,an.noop),this._activeTrigger[Dn]=!1,this._activeTrigger[In]=!1,this._activeTrigger[wn]=!1,an(this.tip).hasClass(yn)){var o=gt.getTransitionDurationFromElement(n);an(n).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r();this._hoverState=""}},t.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},t.isWithContent=function(){return Boolean(this.getTitle())},t.addAttachmentClass=function(t){an(this.getTipElement()).addClass(un+"-"+t)},t.getTipElement=function(){return this.tip=this.tip||an(this.config.template)[0],this.tip},t.setContent=function(){var t=an(this.getTipElement());this.setElementContent(t.find(Tn),this.getTitle()),t.removeClass(yn+" "+bn)},t.setElementContent=function(t,e){var n=this.config.html;"object"==typeof e&&(e.nodeType||e.jquery)?n?an(e).parent().is(t)||t.empty().append(e):t.text(an(e).text()):t[n?"html":"text"](e)},t.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},t._getAttachment=function(t){return gn[t.toUpperCase()]},t._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(t){if("click"===t)an(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(t){return i.toggle(t)});else if(t!==An){var e=t===wn?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=t===wn?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;an(i.element).on(e,i.config.selector,function(t){return i._enter(t)}).on(n,i.config.selector,function(t){return i._leave(t)})}an(i.element).closest(".modal").on("hide.bs.modal",function(){return i.hide()})}),this.config.selector?this.config=c({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},t._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},t._enter=function(t,e){var n=this.constructor.DATA_KEY;(e=e||an(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),an(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusin"===t.type?In:wn]=!0),an(e.getTipElement()).hasClass(bn)||e._hoverState===_n?e._hoverState=_n:(clearTimeout(e._timeout),e._hoverState=_n,e.config.delay&&e.config.delay.show?e._timeout=setTimeout(function(){e._hoverState===_n&&e.show()},e.config.delay.show):e.show())},t._leave=function(t,e){var n=this.constructor.DATA_KEY;(e=e||an(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),an(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusout"===t.type?In:wn]=!1),e._isWithActiveTrigger()||(clearTimeout(e._timeout),e._hoverState=vn,e.config.delay&&e.config.delay.hide?e._timeout=setTimeout(function(){e._hoverState===vn&&e.hide()},e.config.delay.hide):e.hide())},t._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},t._getConfig=function(t){return"number"==typeof(t=c({},this.constructor.Default,an(this.element).data(),"object"==typeof t&&t?t:{})).delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),gt.typeCheckConfig(ln,t,this.constructor.DefaultType),t},t._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},t._cleanTipClass=function(){var t=an(this.getTipElement()),e=t.attr("class").match(dn);null!==e&&0<e.length&&t.removeClass(e.join(""))},t._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},t._fixTransition=function(){var t=this.getTipElement(),e=this.config.animation;null===t.getAttribute("x-placement")&&(an(t).removeClass(yn),this.config.animation=!1,this.hide(),this.show(),this.config.animation=e)},i._jQueryInterface=function(n){return this.each(function(){var t=an(this).data(cn),e="object"==typeof n&&n;if((t||!/dispose|hide/.test(n))&&(t||(t=new i(this,e),an(this).data(cn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return mn}},{key:"NAME",get:function(){return ln}},{key:"DATA_KEY",get:function(){return cn}},{key:"Event",get:function(){return En}},{key:"EVENT_KEY",get:function(){return fn}},{key:"DefaultType",get:function(){return pn}}]),i}(),an.fn[ln]=Sn._jQueryInterface,an.fn[ln].Constructor=Sn,an.fn[ln].noConflict=function(){return an.fn[ln]=hn,Sn._jQueryInterface},Sn),Ii=(Nn="popover",Ln="."+(kn="bs.popover"),Pn=(On=e).fn[Nn],xn="bs-popover",jn=new RegExp("(^|\\s)"+xn+"\\S+","g"),Mn=c({},wi.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),Rn=c({},wi.DefaultType,{content:"(string|element|function)"}),Hn="fade",Fn=".popover-header",Un=".popover-body",Bn={HIDE:"hide"+Ln,HIDDEN:"hidden"+Ln,SHOW:(Wn="show")+Ln,SHOWN:"shown"+Ln,INSERTED:"inserted"+Ln,CLICK:"click"+Ln,FOCUSIN:"focusin"+Ln,FOCUSOUT:"focusout"+Ln,MOUSEENTER:"mouseenter"+Ln,MOUSELEAVE:"mouseleave"+Ln},Kn=function(t){var e,n;function i(){return t.apply(this,arguments)||this}n=t,(e=i).prototype=Object.create(n.prototype),(e.prototype.constructor=e).__proto__=n;var r=i.prototype;return r.isWithContent=function(){return this.getTitle()||this._getContent()},r.addAttachmentClass=function(t){On(this.getTipElement()).addClass(xn+"-"+t)},r.getTipElement=function(){return this.tip=this.tip||On(this.config.template)[0],this.tip},r.setContent=function(){var t=On(this.getTipElement());this.setElementContent(t.find(Fn),this.getTitle());var e=this._getContent();"function"==typeof e&&(e=e.call(this.element)),this.setElementContent(t.find(Un),e),t.removeClass(Hn+" "+Wn)},r._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},r._cleanTipClass=function(){var t=On(this.getTipElement()),e=t.attr("class").match(jn);null!==e&&0<e.length&&t.removeClass(e.join(""))},i._jQueryInterface=function(n){return this.each(function(){var t=On(this).data(kn),e="object"==typeof n?n:null;if((t||!/destroy|hide/.test(n))&&(t||(t=new i(this,e),On(this).data(kn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Mn}},{key:"NAME",get:function(){return Nn}},{key:"DATA_KEY",get:function(){return kn}},{key:"Event",get:function(){return Bn}},{key:"EVENT_KEY",get:function(){return Ln}},{key:"DefaultType",get:function(){return Rn}}]),i}(wi),On.fn[Nn]=Kn._jQueryInterface,On.fn[Nn].Constructor=Kn,On.fn[Nn].noConflict=function(){return On.fn[Nn]=Pn,Kn._jQueryInterface},Kn),Di=(Qn="scrollspy",Gn="."+(Yn="bs.scrollspy"),qn=(Vn=e).fn[Qn],zn={offset:10,method:"auto",target:""},Xn={offset:"number",method:"string",target:"(string|element)"},Jn={ACTIVATE:"activate"+Gn,SCROLL:"scroll"+Gn,LOAD_DATA_API:"load"+Gn+".data-api"},Zn="dropdown-item",$n="active",ti={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},ei="offset",ni="position",ii=function(){function n(t,e){var n=this;this._element=t,this._scrollElement="BODY"===t.tagName?window:t,this._config=this._getConfig(e),this._selector=this._config.target+" "+ti.NAV_LINKS+","+this._config.target+" "+ti.LIST_ITEMS+","+this._config.target+" "+ti.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,Vn(this._scrollElement).on(Jn.SCROLL,function(t){return n._process(t)}),this.refresh(),this._process()}var t=n.prototype;return t.refresh=function(){var e=this,t=this._scrollElement===this._scrollElement.window?ei:ni,r="auto"===this._config.method?t:this._config.method,o=r===ni?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),Vn.makeArray(Vn(this._selector)).map(function(t){var e,n=gt.getSelectorFromElement(t);if(n&&(e=Vn(n)[0]),e){var i=e.getBoundingClientRect();if(i.width||i.height)return[Vn(e)[r]().top+o,n]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},t.dispose=function(){Vn.removeData(this._element,Yn),Vn(this._scrollElement).off(Gn),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},t._getConfig=function(t){if("string"!=typeof(t=c({},zn,"object"==typeof t&&t?t:{})).target){var e=Vn(t.target).attr("id");e||(e=gt.getUID(Qn),Vn(t.target).attr("id",e)),t.target="#"+e}return gt.typeCheckConfig(Qn,t,Xn),t},t._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},t._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},t._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},t._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),n<=t){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t<this._offsets[r+1])&&this._activate(this._targets[r])}}},t._activate=function(e){this._activeTarget=e,this._clear();var t=this._selector.split(",");t=t.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var n=Vn(t.join(","));n.hasClass(Zn)?(n.closest(ti.DROPDOWN).find(ti.DROPDOWN_TOGGLE).addClass($n),n.addClass($n)):(n.addClass($n),n.parents(ti.NAV_LIST_GROUP).prev(ti.NAV_LINKS+", "+ti.LIST_ITEMS).addClass($n),n.parents(ti.NAV_LIST_GROUP).prev(ti.NAV_ITEMS).children(ti.NAV_LINKS).addClass($n)),Vn(this._scrollElement).trigger(Jn.ACTIVATE,{relatedTarget:e})},t._clear=function(){Vn(this._selector).filter(ti.ACTIVE).removeClass($n)},n._jQueryInterface=function(e){return this.each(function(){var t=Vn(this).data(Yn);if(t||(t=new n(this,"object"==typeof e&&e),Vn(this).data(Yn,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return zn}}]),n}(),Vn(window).on(Jn.LOAD_DATA_API,function(){for(var t=Vn.makeArray(Vn(ti.DATA_SPY)),e=t.length;e--;){var n=Vn(t[e]);ii._jQueryInterface.call(n,n.data())}}),Vn.fn[Qn]=ii._jQueryInterface,Vn.fn[Qn].Constructor=ii,Vn.fn[Qn].noConflict=function(){return Vn.fn[Qn]=qn,ii._jQueryInterface},ii),Ai=(si="."+(oi="bs.tab"),ai=(ri=e).fn.tab,li={HIDE:"hide"+si,HIDDEN:"hidden"+si,SHOW:"show"+si,SHOWN:"shown"+si,CLICK_DATA_API:"click"+si+".data-api"},ci="dropdown-menu",fi="active",hi="disabled",ui="fade",di="show",pi=".dropdown",gi=".nav, .list-group",mi=".active",_i="> li > .active",vi='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',Ei=".dropdown-toggle",yi="> .dropdown-menu .active",bi=function(){function i(t){this._element=t}var t=i.prototype;return t.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&ri(this._element).hasClass(fi)||ri(this._element).hasClass(hi))){var t,i,e=ri(this._element).closest(gi)[0],r=gt.getSelectorFromElement(this._element);if(e){var o="UL"===e.nodeName?_i:mi;i=(i=ri.makeArray(ri(e).find(o)))[i.length-1]}var s=ri.Event(li.HIDE,{relatedTarget:this._element}),a=ri.Event(li.SHOW,{relatedTarget:i});if(i&&ri(i).trigger(s),ri(this._element).trigger(a),!a.isDefaultPrevented()&&!s.isDefaultPrevented()){r&&(t=ri(r)[0]),this._activate(this._element,e);var l=function(){var t=ri.Event(li.HIDDEN,{relatedTarget:n._element}),e=ri.Event(li.SHOWN,{relatedTarget:i});ri(i).trigger(t),ri(n._element).trigger(e)};t?this._activate(t,t.parentNode,l):l()}}},t.dispose=function(){ri.removeData(this._element,oi),this._element=null},t._activate=function(t,e,n){var i=this,r=("UL"===e.nodeName?ri(e).find(_i):ri(e).children(mi))[0],o=n&&r&&ri(r).hasClass(ui),s=function(){return i._transitionComplete(t,r,n)};if(r&&o){var a=gt.getTransitionDurationFromElement(r);ri(r).one(gt.TRANSITION_END,s).emulateTransitionEnd(a)}else s()},t._transitionComplete=function(t,e,n){if(e){ri(e).removeClass(di+" "+fi);var i=ri(e.parentNode).find(yi)[0];i&&ri(i).removeClass(fi),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!1)}if(ri(t).addClass(fi),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!0),gt.reflow(t),ri(t).addClass(di),t.parentNode&&ri(t.parentNode).hasClass(ci)){var r=ri(t).closest(pi)[0];r&&ri(r).find(Ei).addClass(fi),t.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var t=ri(this),e=t.data(oi);if(e||(e=new i(this),t.data(oi,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),i}(),ri(document).on(li.CLICK_DATA_API,vi,function(t){t.preventDefault(),bi._jQueryInterface.call(ri(this),"show")}),ri.fn.tab=bi._jQueryInterface,ri.fn.tab.Constructor=bi,ri.fn.tab.noConflict=function(){return ri.fn.tab=ai,bi._jQueryInterface},bi);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||4<=e[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=gt,t.Alert=mt,t.Button=_t,t.Carousel=vt,t.Collapse=Et,t.Dropdown=Ti,t.Modal=Ci,t.Popover=Ii,t.Scrollspy=Di,t.Tab=Ai,t.Tooltip=wi,Object.defineProperty(t,"__esModule",{value:!0})});
|
7 |
-
//# sourceMappingURL=bootstrap.bundle.min.js.map
|
1 |
/*!
|
2 |
+
* Bootstrap v4.1.3 (https://getbootstrap.com/)
|
3 |
* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
|
4 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5 |
*/
|
6 |
+
!function(e,t){"object"==typeof exports&&"undefined"!=typeof module?t(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],t):t(e.bootstrap={},e.jQuery)}(this,function(e,t){"use strict";function i(e,t){for(var n=0;n<t.length;n++){var i=t[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(e,i.key,i)}}function s(e,t,n){return t&&i(e.prototype,t),n&&i(e,n),e}function l(r){for(var e=1;e<arguments.length;e++){var o=null!=arguments[e]?arguments[e]:{},t=Object.keys(o);"function"==typeof Object.getOwnPropertySymbols&&(t=t.concat(Object.getOwnPropertySymbols(o).filter(function(e){return Object.getOwnPropertyDescriptor(o,e).enumerable}))),t.forEach(function(e){var t,n,i;t=r,i=o[n=e],n in t?Object.defineProperty(t,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):t[n]=i})}return r}for(var r,n,o,a,c,u,f,h,d,p,m,g,_,v,y,E,b,w,C,T,S,D,A,I,O,N,k,x,P,L,j,H,M,F,W,R,U,B,q,K,Q,Y,V,z,G,J,Z,X,$,ee,te,ne,ie,re,oe,se,ae,le,ce,ue,fe,he,de,pe,me,ge,_e,ve,ye,Ee,be,we=function(i){var t="transitionend";function e(e){var t=this,n=!1;return i(this).one(l.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||l.triggerTransitionEnd(t)},e),this}var l={TRANSITION_END:"bsTransitionEnd",getUID:function(e){for(;e+=~~(1e6*Math.random()),document.getElementById(e););return e},getSelectorFromElement:function(e){var t=e.getAttribute("data-target");t&&"#"!==t||(t=e.getAttribute("href")||"");try{return document.querySelector(t)?t:null}catch(e){return null}},getTransitionDurationFromElement:function(e){if(!e)return 0;var t=i(e).css("transition-duration");return parseFloat(t)?(t=t.split(",")[0],1e3*parseFloat(t)):0},reflow:function(e){return e.offsetHeight},triggerTransitionEnd:function(e){i(e).trigger(t)},supportsTransitionEnd:function(){return Boolean(t)},isElement:function(e){return(e[0]||e).nodeType},typeCheckConfig:function(e,t,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var r=n[i],o=t[i],s=o&&l.isElement(o)?"element":(a=o,{}.toString.call(a).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(r).test(s))throw new Error(e.toUpperCase()+': Option "'+i+'" provided type "'+s+'" but expected type "'+r+'".')}var a}};return i.fn.emulateTransitionEnd=e,i.event.special[l.TRANSITION_END]={bindType:t,delegateType:t,handle:function(e){if(i(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}},l}(t=t&&t.hasOwnProperty("default")?t.default:t),Ce=(n="alert",a="."+(o="bs.alert"),c=(r=t).fn[n],u={CLOSE:"close"+a,CLOSED:"closed"+a,CLICK_DATA_API:"click"+a+".data-api"},f="alert",h="fade",d="show",p=function(){function i(e){this._element=e}var e=i.prototype;return e.close=function(e){var t=this._element;e&&(t=this._getRootElement(e)),this._triggerCloseEvent(t).isDefaultPrevented()||this._removeElement(t)},e.dispose=function(){r.removeData(this._element,o),this._element=null},e._getRootElement=function(e){var t=we.getSelectorFromElement(e),n=!1;return t&&(n=document.querySelector(t)),n||(n=r(e).closest("."+f)[0]),n},e._triggerCloseEvent=function(e){var t=r.Event(u.CLOSE);return r(e).trigger(t),t},e._removeElement=function(t){var n=this;if(r(t).removeClass(d),r(t).hasClass(h)){var e=we.getTransitionDurationFromElement(t);r(t).one(we.TRANSITION_END,function(e){return n._destroyElement(t,e)}).emulateTransitionEnd(e)}else this._destroyElement(t)},e._destroyElement=function(e){r(e).detach().trigger(u.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var e=r(this),t=e.data(o);t||(t=new i(this),e.data(o,t)),"close"===n&&t[n](this)})},i._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},s(i,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),i}(),r(document).on(u.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),r.fn[n]=p._jQueryInterface,r.fn[n].Constructor=p,r.fn[n].noConflict=function(){return r.fn[n]=c,p._jQueryInterface},p),Te=(g="button",v="."+(_="bs.button"),y=".data-api",E=(m=t).fn[g],b="active",w="btn",T='[data-toggle^="button"]',S='[data-toggle="buttons"]',D="input",A=".active",I=".btn",O={CLICK_DATA_API:"click"+v+y,FOCUS_BLUR_DATA_API:(C="focus")+v+y+" blur"+v+y},N=function(){function n(e){this._element=e}var e=n.prototype;return e.toggle=function(){var e=!0,t=!0,n=m(this._element).closest(S)[0];if(n){var i=this._element.querySelector(D);if(i){if("radio"===i.type)if(i.checked&&this._element.classList.contains(b))e=!1;else{var r=n.querySelector(A);r&&m(r).removeClass(b)}if(e){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!this._element.classList.contains(b),m(i).trigger("change")}i.focus(),t=!1}}t&&this._element.setAttribute("aria-pressed",!this._element.classList.contains(b)),e&&m(this._element).toggleClass(b)},e.dispose=function(){m.removeData(this._element,_),this._element=null},n._jQueryInterface=function(t){return this.each(function(){var e=m(this).data(_);e||(e=new n(this),m(this).data(_,e)),"toggle"===t&&e[t]()})},s(n,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),n}(),m(document).on(O.CLICK_DATA_API,T,function(e){e.preventDefault();var t=e.target;m(t).hasClass(w)||(t=m(t).closest(I)),N._jQueryInterface.call(m(t),"toggle")}).on(O.FOCUS_BLUR_DATA_API,T,function(e){var t=m(e.target).closest(I)[0];m(t).toggleClass(C,/^focus(in)?$/.test(e.type))}),m.fn[g]=N._jQueryInterface,m.fn[g].Constructor=N,m.fn[g].noConflict=function(){return m.fn[g]=E,N._jQueryInterface},N),Se=(x="carousel",L="."+(P="bs.carousel"),j=".data-api",H=(k=t).fn[x],M={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},F={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},W="next",R="prev",U="left",B="right",q={SLIDE:"slide"+L,SLID:"slid"+L,KEYDOWN:"keydown"+L,MOUSEENTER:"mouseenter"+L,MOUSELEAVE:"mouseleave"+L,TOUCHEND:"touchend"+L,LOAD_DATA_API:"load"+L+j,CLICK_DATA_API:"click"+L+j},K="carousel",Q="active",Y="slide",V="carousel-item-right",z="carousel-item-left",G="carousel-item-next",J="carousel-item-prev",Z=".active",X=".active.carousel-item",$=".carousel-item",ee=".carousel-item-next, .carousel-item-prev",te=".carousel-indicators",ne="[data-slide], [data-slide-to]",ie='[data-ride="carousel"]',re=function(){function o(e,t){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(t),this._element=k(e)[0],this._indicatorsElement=this._element.querySelector(te),this._addEventListeners()}var e=o.prototype;return e.next=function(){this._isSliding||this._slide(W)},e.nextWhenVisible=function(){!document.hidden&&k(this._element).is(":visible")&&"hidden"!==k(this._element).css("visibility")&&this.next()},e.prev=function(){this._isSliding||this._slide(R)},e.pause=function(e){e||(this._isPaused=!0),this._element.querySelector(ee)&&(we.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},e.cycle=function(e){e||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},e.to=function(e){var t=this;this._activeElement=this._element.querySelector(X);var n=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)k(this._element).one(q.SLID,function(){return t.to(e)});else{if(n===e)return this.pause(),void this.cycle();var i=n<e?W:R;this._slide(i,this._items[e])}},e.dispose=function(){k(this._element).off(L),k.removeData(this._element,P),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},e._getConfig=function(e){return e=l({},M,e),we.typeCheckConfig(x,e,F),e},e._addEventListeners=function(){var t=this;this._config.keyboard&&k(this._element).on(q.KEYDOWN,function(e){return t._keydown(e)}),"hover"===this._config.pause&&(k(this._element).on(q.MOUSEENTER,function(e){return t.pause(e)}).on(q.MOUSELEAVE,function(e){return t.cycle(e)}),"ontouchstart"in document.documentElement&&k(this._element).on(q.TOUCHEND,function(){t.pause(),t.touchTimeout&&clearTimeout(t.touchTimeout),t.touchTimeout=setTimeout(function(e){return t.cycle(e)},500+t._config.interval)}))},e._keydown=function(e){if(!/input|textarea/i.test(e.target.tagName))switch(e.which){case 37:e.preventDefault(),this.prev();break;case 39:e.preventDefault(),this.next()}},e._getItemIndex=function(e){return this._items=e&&e.parentNode?[].slice.call(e.parentNode.querySelectorAll($)):[],this._items.indexOf(e)},e._getItemByDirection=function(e,t){var n=e===W,i=e===R,r=this._getItemIndex(t),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return t;var s=(r+(e===R?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},e._triggerSlideEvent=function(e,t){var n=this._getItemIndex(e),i=this._getItemIndex(this._element.querySelector(X)),r=k.Event(q.SLIDE,{relatedTarget:e,direction:t,from:i,to:n});return k(this._element).trigger(r),r},e._setActiveIndicatorElement=function(e){if(this._indicatorsElement){var t=[].slice.call(this._indicatorsElement.querySelectorAll(Z));k(t).removeClass(Q);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&k(n).addClass(Q)}},e._slide=function(e,t){var n,i,r,o=this,s=this._element.querySelector(X),a=this._getItemIndex(s),l=t||s&&this._getItemByDirection(e,s),c=this._getItemIndex(l),u=Boolean(this._interval);if(e===W?(n=z,i=G,r=U):(n=V,i=J,r=B),l&&k(l).hasClass(Q))this._isSliding=!1;else if(!this._triggerSlideEvent(l,r).isDefaultPrevented()&&s&&l){this._isSliding=!0,u&&this.pause(),this._setActiveIndicatorElement(l);var f=k.Event(q.SLID,{relatedTarget:l,direction:r,from:a,to:c});if(k(this._element).hasClass(Y)){k(l).addClass(i),we.reflow(l),k(s).addClass(n),k(l).addClass(n);var h=we.getTransitionDurationFromElement(s);k(s).one(we.TRANSITION_END,function(){k(l).removeClass(n+" "+i).addClass(Q),k(s).removeClass(Q+" "+i+" "+n),o._isSliding=!1,setTimeout(function(){return k(o._element).trigger(f)},0)}).emulateTransitionEnd(h)}else k(s).removeClass(Q),k(l).addClass(Q),this._isSliding=!1,k(this._element).trigger(f);u&&this.cycle()}},o._jQueryInterface=function(i){return this.each(function(){var e=k(this).data(P),t=l({},M,k(this).data());"object"==typeof i&&(t=l({},t,i));var n="string"==typeof i?i:t.slide;if(e||(e=new o(this,t),k(this).data(P,e)),"number"==typeof i)e.to(i);else if("string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}else t.interval&&(e.pause(),e.cycle())})},o._dataApiClickHandler=function(e){var t=we.getSelectorFromElement(this);if(t){var n=k(t)[0];if(n&&k(n).hasClass(K)){var i=l({},k(n).data(),k(this).data()),r=this.getAttribute("data-slide-to");r&&(i.interval=!1),o._jQueryInterface.call(k(n),i),r&&k(n).data(P).to(r),e.preventDefault()}}},s(o,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return M}}]),o}(),k(document).on(q.CLICK_DATA_API,ne,re._dataApiClickHandler),k(window).on(q.LOAD_DATA_API,function(){for(var e=[].slice.call(document.querySelectorAll(ie)),t=0,n=e.length;t<n;t++){var i=k(e[t]);re._jQueryInterface.call(i,i.data())}}),k.fn[x]=re._jQueryInterface,k.fn[x].Constructor=re,k.fn[x].noConflict=function(){return k.fn[x]=H,re._jQueryInterface},re),De=(se="collapse",le="."+(ae="bs.collapse"),ce=(oe=t).fn[se],ue={toggle:!0,parent:""},fe={toggle:"boolean",parent:"(string|element)"},he={SHOW:"show"+le,SHOWN:"shown"+le,HIDE:"hide"+le,HIDDEN:"hidden"+le,CLICK_DATA_API:"click"+le+".data-api"},de="show",pe="collapse",me="collapsing",ge="collapsed",_e="width",ve="height",ye=".show, .collapsing",Ee='[data-toggle="collapse"]',be=function(){function a(t,e){this._isTransitioning=!1,this._element=t,this._config=this._getConfig(e),this._triggerArray=oe.makeArray(document.querySelectorAll('[data-toggle="collapse"][href="#'+t.id+'"],[data-toggle="collapse"][data-target="#'+t.id+'"]'));for(var n=[].slice.call(document.querySelectorAll(Ee)),i=0,r=n.length;i<r;i++){var o=n[i],s=we.getSelectorFromElement(o),a=[].slice.call(document.querySelectorAll(s)).filter(function(e){return e===t});null!==s&&0<a.length&&(this._selector=s,this._triggerArray.push(o))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var e=a.prototype;return e.toggle=function(){oe(this._element).hasClass(de)?this.hide():this.show()},e.show=function(){var e,t,n=this;if(!this._isTransitioning&&!oe(this._element).hasClass(de)&&(this._parent&&0===(e=[].slice.call(this._parent.querySelectorAll(ye)).filter(function(e){return e.getAttribute("data-parent")===n._config.parent})).length&&(e=null),!(e&&(t=oe(e).not(this._selector).data(ae))&&t._isTransitioning))){var i=oe.Event(he.SHOW);if(oe(this._element).trigger(i),!i.isDefaultPrevented()){e&&(a._jQueryInterface.call(oe(e).not(this._selector),"hide"),t||oe(e).data(ae,null));var r=this._getDimension();oe(this._element).removeClass(pe).addClass(me),this._element.style[r]=0,this._triggerArray.length&&oe(this._triggerArray).removeClass(ge).attr("aria-expanded",!0),this.setTransitioning(!0);var o="scroll"+(r[0].toUpperCase()+r.slice(1)),s=we.getTransitionDurationFromElement(this._element);oe(this._element).one(we.TRANSITION_END,function(){oe(n._element).removeClass(me).addClass(pe).addClass(de),n._element.style[r]="",n.setTransitioning(!1),oe(n._element).trigger(he.SHOWN)}).emulateTransitionEnd(s),this._element.style[r]=this._element[o]+"px"}}},e.hide=function(){var e=this;if(!this._isTransitioning&&oe(this._element).hasClass(de)){var t=oe.Event(he.HIDE);if(oe(this._element).trigger(t),!t.isDefaultPrevented()){var n=this._getDimension();this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",we.reflow(this._element),oe(this._element).addClass(me).removeClass(pe).removeClass(de);var i=this._triggerArray.length;if(0<i)for(var r=0;r<i;r++){var o=this._triggerArray[r],s=we.getSelectorFromElement(o);if(null!==s)oe([].slice.call(document.querySelectorAll(s))).hasClass(de)||oe(o).addClass(ge).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var a=we.getTransitionDurationFromElement(this._element);oe(this._element).one(we.TRANSITION_END,function(){e.setTransitioning(!1),oe(e._element).removeClass(me).addClass(pe).trigger(he.HIDDEN)}).emulateTransitionEnd(a)}}},e.setTransitioning=function(e){this._isTransitioning=e},e.dispose=function(){oe.removeData(this._element,ae),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},e._getConfig=function(e){return(e=l({},ue,e)).toggle=Boolean(e.toggle),we.typeCheckConfig(se,e,fe),e},e._getDimension=function(){return oe(this._element).hasClass(_e)?_e:ve},e._getParent=function(){var n=this,e=null;we.isElement(this._config.parent)?(e=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(e=this._config.parent[0])):e=document.querySelector(this._config.parent);var t='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]',i=[].slice.call(e.querySelectorAll(t));return oe(i).each(function(e,t){n._addAriaAndCollapsedClass(a._getTargetFromElement(t),[t])}),e},e._addAriaAndCollapsedClass=function(e,t){if(e){var n=oe(e).hasClass(de);t.length&&oe(t).toggleClass(ge,!n).attr("aria-expanded",n)}},a._getTargetFromElement=function(e){var t=we.getSelectorFromElement(e);return t?document.querySelector(t):null},a._jQueryInterface=function(i){return this.each(function(){var e=oe(this),t=e.data(ae),n=l({},ue,e.data(),"object"==typeof i&&i?i:{});if(!t&&n.toggle&&/show|hide/.test(i)&&(n.toggle=!1),t||(t=new a(this,n),e.data(ae,t)),"string"==typeof i){if("undefined"==typeof t[i])throw new TypeError('No method named "'+i+'"');t[i]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return ue}}]),a}(),oe(document).on(he.CLICK_DATA_API,Ee,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var n=oe(this),t=we.getSelectorFromElement(this),i=[].slice.call(document.querySelectorAll(t));oe(i).each(function(){var e=oe(this),t=e.data(ae)?"toggle":n.data();be._jQueryInterface.call(e,t)})}),oe.fn[se]=be._jQueryInterface,oe.fn[se].Constructor=be,oe.fn[se].noConflict=function(){return oe.fn[se]=ce,be._jQueryInterface},be),Ae="undefined"!=typeof window&&"undefined"!=typeof document,Ie=["Edge","Trident","Firefox"],Oe=0,Ne=0;Ne<Ie.length;Ne+=1)if(Ae&&0<=navigator.userAgent.indexOf(Ie[Ne])){Oe=1;break}var ke=Ae&&window.Promise?function(e){var t=!1;return function(){t||(t=!0,window.Promise.resolve().then(function(){t=!1,e()}))}}:function(e){var t=!1;return function(){t||(t=!0,setTimeout(function(){t=!1,e()},Oe))}};function xe(e){return e&&"[object Function]"==={}.toString.call(e)}function Pe(e,t){if(1!==e.nodeType)return[];var n=getComputedStyle(e,null);return t?n[t]:n}function Le(e){return"HTML"===e.nodeName?e:e.parentNode||e.host}function je(e){if(!e)return document.body;switch(e.nodeName){case"HTML":case"BODY":return e.ownerDocument.body;case"#document":return e.body}var t=Pe(e),n=t.overflow,i=t.overflowX,r=t.overflowY;return/(auto|scroll|overlay)/.test(n+r+i)?e:je(Le(e))}var He=Ae&&!(!window.MSInputMethodContext||!document.documentMode),Me=Ae&&/MSIE 10/.test(navigator.userAgent);function Fe(e){return 11===e?He:10===e?Me:He||Me}function We(e){if(!e)return document.documentElement;for(var t=Fe(10)?document.body:null,n=e.offsetParent;n===t&&e.nextElementSibling;)n=(e=e.nextElementSibling).offsetParent;var i=n&&n.nodeName;return i&&"BODY"!==i&&"HTML"!==i?-1!==["TD","TABLE"].indexOf(n.nodeName)&&"static"===Pe(n,"position")?We(n):n:e?e.ownerDocument.documentElement:document.documentElement}function Re(e){return null!==e.parentNode?Re(e.parentNode):e}function Ue(e,t){if(!(e&&e.nodeType&&t&&t.nodeType))return document.documentElement;var n=e.compareDocumentPosition(t)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?e:t,r=n?t:e,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(e!==l&&t!==l||i.contains(r))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&We(s.firstElementChild)!==s?We(l):l;var c=Re(e);return c.host?Ue(c.host,t):Ue(e,Re(t).host)}function Be(e){var t="top"===(1<arguments.length&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=e.nodeName;if("BODY"===n||"HTML"===n){var i=e.ownerDocument.documentElement;return(e.ownerDocument.scrollingElement||i)[t]}return e[t]}function qe(e,t){var n="x"===t?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(e["border"+n+"Width"],10)+parseFloat(e["border"+i+"Width"],10)}function Ke(e,t,n,i){return Math.max(t["offset"+e],t["scroll"+e],n["client"+e],n["offset"+e],n["scroll"+e],Fe(10)?n["offset"+e]+i["margin"+("Height"===e?"Top":"Left")]+i["margin"+("Height"===e?"Bottom":"Right")]:0)}function Qe(){var e=document.body,t=document.documentElement,n=Fe(10)&&getComputedStyle(t);return{height:Ke("Height",e,t,n),width:Ke("Width",e,t,n)}}var Ye=function(){function i(e,t){for(var n=0;n<t.length;n++){var i=t[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(e,i.key,i)}}return function(e,t,n){return t&&i(e.prototype,t),n&&i(e,n),e}}(),Ve=function(e,t,n){return t in e?Object.defineProperty(e,t,{value:n,enumerable:!0,configurable:!0,writable:!0}):e[t]=n,e},ze=Object.assign||function(e){for(var t=1;t<arguments.length;t++){var n=arguments[t];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(e[i]=n[i])}return e};function Ge(e){return ze({},e,{right:e.left+e.width,bottom:e.top+e.height})}function Je(e){var t={};try{if(Fe(10)){t=e.getBoundingClientRect();var n=Be(e,"top"),i=Be(e,"left");t.top+=n,t.left+=i,t.bottom+=n,t.right+=i}else t=e.getBoundingClientRect()}catch(e){}var r={left:t.left,top:t.top,width:t.right-t.left,height:t.bottom-t.top},o="HTML"===e.nodeName?Qe():{},s=o.width||e.clientWidth||r.right-r.left,a=o.height||e.clientHeight||r.bottom-r.top,l=e.offsetWidth-s,c=e.offsetHeight-a;if(l||c){var u=Pe(e);l-=qe(u,"x"),c-=qe(u,"y"),r.width-=l,r.height-=c}return Ge(r)}function Ze(e,t){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=Fe(10),r="HTML"===t.nodeName,o=Je(e),s=Je(t),a=je(e),l=Pe(t),c=parseFloat(l.borderTopWidth,10),u=parseFloat(l.borderLeftWidth,10);n&&"HTML"===t.nodeName&&(s.top=Math.max(s.top,0),s.left=Math.max(s.left,0));var f=Ge({top:o.top-s.top-c,left:o.left-s.left-u,width:o.width,height:o.height});if(f.marginTop=0,f.marginLeft=0,!i&&r){var h=parseFloat(l.marginTop,10),d=parseFloat(l.marginLeft,10);f.top-=c-h,f.bottom-=c-h,f.left-=u-d,f.right-=u-d,f.marginTop=h,f.marginLeft=d}return(i&&!n?t.contains(a):t===a&&"BODY"!==a.nodeName)&&(f=function(e,t){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=Be(t,"top"),r=Be(t,"left"),o=n?-1:1;return e.top+=i*o,e.bottom+=i*o,e.left+=r*o,e.right+=r*o,e}(f,t)),f}function Xe(e){if(!e||!e.parentElement||Fe())return document.documentElement;for(var t=e.parentElement;t&&"none"===Pe(t,"transform");)t=t.parentElement;return t||document.documentElement}function $e(e,t,n,i){var r=4<arguments.length&&void 0!==arguments[4]&&arguments[4],o={top:0,left:0},s=r?Xe(e):Ue(e,t);if("viewport"===i)o=function(e){var t=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=e.ownerDocument.documentElement,i=Ze(e,n),r=Math.max(n.clientWidth,window.innerWidth||0),o=Math.max(n.clientHeight,window.innerHeight||0),s=t?0:Be(n),a=t?0:Be(n,"left");return Ge({top:s-i.top+i.marginTop,left:a-i.left+i.marginLeft,width:r,height:o})}(s,r);else{var a=void 0;"scrollParent"===i?"BODY"===(a=je(Le(t))).nodeName&&(a=e.ownerDocument.documentElement):a="window"===i?e.ownerDocument.documentElement:i;var l=Ze(a,s,r);if("HTML"!==a.nodeName||function e(t){var n=t.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===Pe(t,"position")||e(Le(t)))}(s))o=l;else{var c=Qe(),u=c.height,f=c.width;o.top+=l.top-l.marginTop,o.bottom=u+l.top,o.left+=l.left-l.marginLeft,o.right=f+l.left}}return o.left+=n,o.top+=n,o.right-=n,o.bottom-=n,o}function et(e,t,i,n,r){var o=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===e.indexOf("auto"))return e;var s=$e(i,n,o,r),a={top:{width:s.width,height:t.top-s.top},right:{width:s.right-t.right,height:s.height},bottom:{width:s.width,height:s.bottom-t.bottom},left:{width:t.left-s.left,height:s.height}},l=Object.keys(a).map(function(e){return ze({key:e},a[e],{area:(t=a[e],t.width*t.height)});var t}).sort(function(e,t){return t.area-e.area}),c=l.filter(function(e){var t=e.width,n=e.height;return t>=i.clientWidth&&n>=i.clientHeight}),u=0<c.length?c[0].key:l[0].key,f=e.split("-")[1];return u+(f?"-"+f:"")}function tt(e,t,n){var i=3<arguments.length&&void 0!==arguments[3]?arguments[3]:null;return Ze(n,i?Xe(t):Ue(t,n),i)}function nt(e){var t=getComputedStyle(e),n=parseFloat(t.marginTop)+parseFloat(t.marginBottom),i=parseFloat(t.marginLeft)+parseFloat(t.marginRight);return{width:e.offsetWidth+i,height:e.offsetHeight+n}}function it(e){var t={left:"right",right:"left",bottom:"top",top:"bottom"};return e.replace(/left|right|bottom|top/g,function(e){return t[e]})}function rt(e,t,n){n=n.split("-")[0];var i=nt(e),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=t[s]+t[l]/2-i[l]/2,r[a]=n===a?t[a]-i[c]:t[it(a)],r}function ot(e,t){return Array.prototype.find?e.find(t):e.filter(t)[0]}function st(e,n,t){return(void 0===t?e:e.slice(0,function(e,t,n){if(Array.prototype.findIndex)return e.findIndex(function(e){return e[t]===n});var i=ot(e,function(e){return e[t]===n});return e.indexOf(i)}(e,"name",t))).forEach(function(e){e.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var t=e.function||e.fn;e.enabled&&xe(t)&&(n.offsets.popper=Ge(n.offsets.popper),n.offsets.reference=Ge(n.offsets.reference),n=t(n,e))}),n}function at(e,n){return e.some(function(e){var t=e.name;return e.enabled&&t===n})}function lt(e){for(var t=[!1,"ms","Webkit","Moz","O"],n=e.charAt(0).toUpperCase()+e.slice(1),i=0;i<t.length;i++){var r=t[i],o=r?""+r+n:e;if("undefined"!=typeof document.body.style[o])return o}return null}function ct(e){var t=e.ownerDocument;return t?t.defaultView:window}function ut(e,t,n,i){n.updateBound=i,ct(e).addEventListener("resize",n.updateBound,{passive:!0});var r=je(e);return function e(t,n,i,r){var o="BODY"===t.nodeName,s=o?t.ownerDocument.defaultView:t;s.addEventListener(n,i,{passive:!0}),o||e(je(s.parentNode),n,i,r),r.push(s)}(r,"scroll",n.updateBound,n.scrollParents),n.scrollElement=r,n.eventsEnabled=!0,n}function ft(){var e,t;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(e=this.reference,t=this.state,ct(e).removeEventListener("resize",t.updateBound),t.scrollParents.forEach(function(e){e.removeEventListener("scroll",t.updateBound)}),t.updateBound=null,t.scrollParents=[],t.scrollElement=null,t.eventsEnabled=!1,t))}function ht(e){return""!==e&&!isNaN(parseFloat(e))&&isFinite(e)}function dt(n,i){Object.keys(i).forEach(function(e){var t="";-1!==["width","height","top","right","bottom","left"].indexOf(e)&&ht(i[e])&&(t="px"),n.style[e]=i[e]+t})}function pt(e,t,n){var i=ot(e,function(e){return e.name===t}),r=!!i&&e.some(function(e){return e.name===n&&e.enabled&&e.order<i.order});if(!r){var o="`"+t+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return r}var mt=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],gt=mt.slice(3);function _t(e){var t=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=gt.indexOf(e),i=gt.slice(n+1).concat(gt.slice(0,n));return t?i.reverse():i}var vt="flip",yt="clockwise",Et="counterclockwise";function bt(e,r,o,t){var s=[0,0],a=-1!==["right","left"].indexOf(t),n=e.split(/(\+|\-)/).map(function(e){return e.trim()}),i=n.indexOf(ot(n,function(e){return-1!==e.search(/,|\s/)}));n[i]&&-1===n[i].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==i?[n.slice(0,i).concat([n[i].split(l)[0]]),[n[i].split(l)[1]].concat(n.slice(i+1))]:[n];return(c=c.map(function(e,t){var n=(1===t?!a:a)?"height":"width",i=!1;return e.reduce(function(e,t){return""===e[e.length-1]&&-1!==["+","-"].indexOf(t)?(e[e.length-1]=t,i=!0,e):i?(e[e.length-1]+=t,i=!1,e):e.concat(t)},[]).map(function(e){return function(e,t,n,i){var r=e.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+r[1],s=r[2];if(!o)return e;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return Ge(a)[t]/100*o}if("vh"===s||"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(e,n,r,o)})})).forEach(function(n,i){n.forEach(function(e,t){ht(e)&&(s[i]+=e*("-"===n[t-1]?-1:1))})}),s}var wt={placement:"bottom",positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(e){var t=e.placement,n=t.split("-")[0],i=t.split("-")[1];if(i){var r=e.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",u={start:Ve({},l,o[l]),end:Ve({},l,o[l]+o[c]-s[c])};e.offsets.popper=ze({},s,u[i])}return e}},offset:{order:200,enabled:!0,fn:function(e,t){var n=t.offset,i=e.placement,r=e.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=ht(+n)?[+n,0]:bt(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),e.popper=o,e},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(e,i){var t=i.boundariesElement||We(e.instance.popper);e.instance.reference===t&&(t=We(t));var n=lt("transform"),r=e.instance.popper.style,o=r.top,s=r.left,a=r[n];r.top="",r.left="",r[n]="";var l=$e(e.instance.popper,e.instance.reference,i.padding,t,e.positionFixed);r.top=o,r.left=s,r[n]=a,i.boundaries=l;var c=i.priority,u=e.offsets.popper,f={primary:function(e){var t=u[e];return u[e]<l[e]&&!i.escapeWithReference&&(t=Math.max(u[e],l[e])),Ve({},e,t)},secondary:function(e){var t="right"===e?"left":"top",n=u[t];return u[e]>l[e]&&!i.escapeWithReference&&(n=Math.min(u[t],l[e]-("right"===e?u.width:u.height))),Ve({},t,n)}};return c.forEach(function(e){var t=-1!==["left","top"].indexOf(e)?"primary":"secondary";u=ze({},u,f[t](e))}),e.offsets.popper=u,e},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(e){var t=e.offsets,n=t.popper,i=t.reference,r=e.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<o(i[l])&&(e.offsets.popper[l]=o(i[l])-n[c]),n[l]>o(i[a])&&(e.offsets.popper[l]=o(i[a])),e}},arrow:{order:500,enabled:!0,fn:function(e,t){var n;if(!pt(e.instance.modifiers,"arrow","keepTogether"))return e;var i=t.element;if("string"==typeof i){if(!(i=e.instance.popper.querySelector(i)))return e}else if(!e.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),e;var r=e.placement.split("-")[0],o=e.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",u=l?"Top":"Left",f=u.toLowerCase(),h=l?"left":"top",d=l?"bottom":"right",p=nt(i)[c];a[d]-p<s[f]&&(e.offsets.popper[f]-=s[f]-(a[d]-p)),a[f]+p>s[d]&&(e.offsets.popper[f]+=a[f]+p-s[d]),e.offsets.popper=Ge(e.offsets.popper);var m=a[f]+a[c]/2-p/2,g=Pe(e.instance.popper),_=parseFloat(g["margin"+u],10),v=parseFloat(g["border"+u+"Width"],10),y=m-e.offsets.popper[f]-_-v;return y=Math.max(Math.min(s[c]-p,y),0),e.arrowElement=i,e.offsets.arrow=(Ve(n={},f,Math.round(y)),Ve(n,h,""),n),e},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(p,m){if(at(p.instance.modifiers,"inner"))return p;if(p.flipped&&p.placement===p.originalPlacement)return p;var g=$e(p.instance.popper,p.instance.reference,m.padding,m.boundariesElement,p.positionFixed),_=p.placement.split("-")[0],v=it(_),y=p.placement.split("-")[1]||"",E=[];switch(m.behavior){case vt:E=[_,v];break;case yt:E=_t(_);break;case Et:E=_t(_,!0);break;default:E=m.behavior}return E.forEach(function(e,t){if(_!==e||E.length===t+1)return p;_=p.placement.split("-")[0],v=it(_);var n,i=p.offsets.popper,r=p.offsets.reference,o=Math.floor,s="left"===_&&o(i.right)>o(r.left)||"right"===_&&o(i.left)<o(r.right)||"top"===_&&o(i.bottom)>o(r.top)||"bottom"===_&&o(i.top)<o(r.bottom),a=o(i.left)<o(g.left),l=o(i.right)>o(g.right),c=o(i.top)<o(g.top),u=o(i.bottom)>o(g.bottom),f="left"===_&&a||"right"===_&&l||"top"===_&&c||"bottom"===_&&u,h=-1!==["top","bottom"].indexOf(_),d=!!m.flipVariations&&(h&&"start"===y&&a||h&&"end"===y&&l||!h&&"start"===y&&c||!h&&"end"===y&&u);(s||f||d)&&(p.flipped=!0,(s||f)&&(_=E[t+1]),d&&(y="end"===(n=y)?"start":"start"===n?"end":n),p.placement=_+(y?"-"+y:""),p.offsets.popper=ze({},p.offsets.popper,rt(p.instance.popper,p.offsets.reference,p.placement)),p=st(p.instance.modifiers,p,"flip"))}),p},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(e){var t=e.placement,n=t.split("-")[0],i=e.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),e.placement=it(t),e.offsets.popper=Ge(r),e}},hide:{order:800,enabled:!0,fn:function(e){if(!pt(e.instance.modifiers,"hide","preventOverflow"))return e;var t=e.offsets.reference,n=ot(e.instance.modifiers,function(e){return"preventOverflow"===e.name}).boundaries;if(t.bottom<n.top||t.left>n.right||t.top>n.bottom||t.right<n.left){if(!0===e.hide)return e;e.hide=!0,e.attributes["x-out-of-boundaries"]=""}else{if(!1===e.hide)return e;e.hide=!1,e.attributes["x-out-of-boundaries"]=!1}return e}},computeStyle:{order:850,enabled:!0,fn:function(e,t){var n=t.x,i=t.y,r=e.offsets.popper,o=ot(e.instance.modifiers,function(e){return"applyStyle"===e.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s=void 0!==o?o:t.gpuAcceleration,a=Je(We(e.instance.popper)),l={position:r.position},c={left:Math.floor(r.left),top:Math.round(r.top),bottom:Math.round(r.bottom),right:Math.floor(r.right)},u="bottom"===n?"top":"bottom",f="right"===i?"left":"right",h=lt("transform"),d=void 0,p=void 0;if(p="bottom"===u?-a.height+c.bottom:c.top,d="right"===f?-a.width+c.right:c.left,s&&h)l[h]="translate3d("+d+"px, "+p+"px, 0)",l[u]=0,l[f]=0,l.willChange="transform";else{var m="bottom"===u?-1:1,g="right"===f?-1:1;l[u]=p*m,l[f]=d*g,l.willChange=u+", "+f}var _={"x-placement":e.placement};return e.attributes=ze({},_,e.attributes),e.styles=ze({},l,e.styles),e.arrowStyles=ze({},e.offsets.arrow,e.arrowStyles),e},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(e){var t,n;return dt(e.instance.popper,e.styles),t=e.instance.popper,n=e.attributes,Object.keys(n).forEach(function(e){!1!==n[e]?t.setAttribute(e,n[e]):t.removeAttribute(e)}),e.arrowElement&&Object.keys(e.arrowStyles).length&&dt(e.arrowElement,e.arrowStyles),e},onLoad:function(e,t,n,i,r){var o=tt(r,t,e,n.positionFixed),s=et(n.placement,o,t,e,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return t.setAttribute("x-placement",s),dt(t,{position:n.positionFixed?"fixed":"absolute"}),n},gpuAcceleration:void 0}}},Ct=function(){function o(e,t){var n=this,i=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};!function(e,t){if(!(e instanceof t))throw new TypeError("Cannot call a class as a function")}(this,o),this.scheduleUpdate=function(){return requestAnimationFrame(n.update)},this.update=ke(this.update.bind(this)),this.options=ze({},o.Defaults,i),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=e&&e.jquery?e[0]:e,this.popper=t&&t.jquery?t[0]:t,this.options.modifiers={},Object.keys(ze({},o.Defaults.modifiers,i.modifiers)).forEach(function(e){n.options.modifiers[e]=ze({},o.Defaults.modifiers[e]||{},i.modifiers?i.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(e){return ze({name:e},n.options.modifiers[e])}).sort(function(e,t){return e.order-t.order}),this.modifiers.forEach(function(e){e.enabled&&xe(e.onLoad)&&e.onLoad(n.reference,n.popper,n.options,e,n.state)}),this.update();var r=this.options.eventsEnabled;r&&this.enableEventListeners(),this.state.eventsEnabled=r}return Ye(o,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var e={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};e.offsets.reference=tt(this.state,this.popper,this.reference,this.options.positionFixed),e.placement=et(this.options.placement,e.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),e.originalPlacement=e.placement,e.positionFixed=this.options.positionFixed,e.offsets.popper=rt(this.popper,e.offsets.reference,e.placement),e.offsets.popper.position=this.options.positionFixed?"fixed":"absolute",e=st(this.modifiers,e),this.state.isCreated?this.options.onUpdate(e):(this.state.isCreated=!0,this.options.onCreate(e))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,at(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.position="",this.popper.style.top="",this.popper.style.left="",this.popper.style.right="",this.popper.style.bottom="",this.popper.style.willChange="",this.popper.style[lt("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=ut(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return ft.call(this)}}]),o}();Ct.Utils=("undefined"!=typeof window?window:global).PopperUtils,Ct.placements=mt,Ct.Defaults=wt;var Tt,St,Dt,At,It,Ot,Nt,kt,xt,Pt,Lt,jt,Ht,Mt,Ft,Wt,Rt,Ut,Bt,qt,Kt,Qt,Yt,Vt,zt,Gt,Jt,Zt,Xt,$t,en,tn,nn,rn,on,sn,an,ln,cn,un,fn,hn,dn,pn,mn,gn,_n,vn,yn,En,bn,wn,Cn,Tn,Sn,Dn,An,In,On,Nn,kn,xn,Pn,Ln,jn,Hn,Mn,Fn,Wn,Rn,Un,Bn,qn,Kn,Qn,Yn,Vn,zn,Gn,Jn,Zn,Xn,$n,ei,ti,ni,ii,ri,oi,si,ai,li,ci,ui,fi,hi,di,pi,mi,gi,_i,vi,yi,Ei,bi,wi,Ci,Ti,Si,Di,Ai,Ii,Oi,Ni,ki,xi,Pi,Li,ji,Hi,Mi,Fi,Wi,Ri,Ui,Bi=(St="dropdown",At="."+(Dt="bs.dropdown"),It=".data-api",Ot=(Tt=t).fn[St],Nt=new RegExp("38|40|27"),kt={HIDE:"hide"+At,HIDDEN:"hidden"+At,SHOW:"show"+At,SHOWN:"shown"+At,CLICK:"click"+At,CLICK_DATA_API:"click"+At+It,KEYDOWN_DATA_API:"keydown"+At+It,KEYUP_DATA_API:"keyup"+At+It},xt="disabled",Pt="show",Lt="dropup",jt="dropright",Ht="dropleft",Mt="dropdown-menu-right",Ft="position-static",Wt='[data-toggle="dropdown"]',Rt=".dropdown form",Ut=".dropdown-menu",Bt=".navbar-nav",qt=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",Kt="top-start",Qt="top-end",Yt="bottom-start",Vt="bottom-end",zt="right-start",Gt="left-start",Jt={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},Zt={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Xt=function(){function c(e,t){this._element=e,this._popper=null,this._config=this._getConfig(t),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var e=c.prototype;return e.toggle=function(){if(!this._element.disabled&&!Tt(this._element).hasClass(xt)){var e=c._getParentFromElement(this._element),t=Tt(this._menu).hasClass(Pt);if(c._clearMenus(),!t){var n={relatedTarget:this._element},i=Tt.Event(kt.SHOW,n);if(Tt(e).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof Ct)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var r=this._element;"parent"===this._config.reference?r=e:we.isElement(this._config.reference)&&(r=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(r=this._config.reference[0])),"scrollParent"!==this._config.boundary&&Tt(e).addClass(Ft),this._popper=new Ct(r,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===Tt(e).closest(Bt).length&&Tt(document.body).children().on("mouseover",null,Tt.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),Tt(this._menu).toggleClass(Pt),Tt(e).toggleClass(Pt).trigger(Tt.Event(kt.SHOWN,n))}}}},e.dispose=function(){Tt.removeData(this._element,Dt),Tt(this._element).off(At),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},e.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},e._addEventListeners=function(){var t=this;Tt(this._element).on(kt.CLICK,function(e){e.preventDefault(),e.stopPropagation(),t.toggle()})},e._getConfig=function(e){return e=l({},this.constructor.Default,Tt(this._element).data(),e),we.typeCheckConfig(St,e,this.constructor.DefaultType),e},e._getMenuElement=function(){if(!this._menu){var e=c._getParentFromElement(this._element);e&&(this._menu=e.querySelector(Ut))}return this._menu},e._getPlacement=function(){var e=Tt(this._element.parentNode),t=Yt;return e.hasClass(Lt)?(t=Kt,Tt(this._menu).hasClass(Mt)&&(t=Qt)):e.hasClass(jt)?t=zt:e.hasClass(Ht)?t=Gt:Tt(this._menu).hasClass(Mt)&&(t=Vt),t},e._detectNavbar=function(){return 0<Tt(this._element).closest(".navbar").length},e._getPopperConfig=function(){var t=this,e={};"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=l({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},c._jQueryInterface=function(t){return this.each(function(){var e=Tt(this).data(Dt);if(e||(e=new c(this,"object"==typeof t?t:null),Tt(this).data(Dt,e)),"string"==typeof t){if("undefined"==typeof e[t])throw new TypeError('No method named "'+t+'"');e[t]()}})},c._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var t=[].slice.call(document.querySelectorAll(Wt)),n=0,i=t.length;n<i;n++){var r=c._getParentFromElement(t[n]),o=Tt(t[n]).data(Dt),s={relatedTarget:t[n]};if(e&&"click"===e.type&&(s.clickEvent=e),o){var a=o._menu;if(Tt(r).hasClass(Pt)&&!(e&&("click"===e.type&&/input|textarea/i.test(e.target.tagName)||"keyup"===e.type&&9===e.which)&&Tt.contains(r,e.target))){var l=Tt.Event(kt.HIDE,s);Tt(r).trigger(l),l.isDefaultPrevented()||("ontouchstart"in document.documentElement&&Tt(document.body).children().off("mouseover",null,Tt.noop),t[n].setAttribute("aria-expanded","false"),Tt(a).removeClass(Pt),Tt(r).removeClass(Pt).trigger(Tt.Event(kt.HIDDEN,s)))}}}},c._getParentFromElement=function(e){var t,n=we.getSelectorFromElement(e);return n&&(t=document.querySelector(n)),t||e.parentNode},c._dataApiKeydownHandler=function(e){if((/input|textarea/i.test(e.target.tagName)?!(32===e.which||27!==e.which&&(40!==e.which&&38!==e.which||Tt(e.target).closest(Ut).length)):Nt.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!Tt(this).hasClass(xt))){var t=c._getParentFromElement(this),n=Tt(t).hasClass(Pt);if((n||27===e.which&&32===e.which)&&(!n||27!==e.which&&32!==e.which)){var i=[].slice.call(t.querySelectorAll(qt));if(0!==i.length){var r=i.indexOf(e.target);38===e.which&&0<r&&r--,40===e.which&&r<i.length-1&&r++,r<0&&(r=0),i[r].focus()}}else{if(27===e.which){var o=t.querySelector(Wt);Tt(o).trigger("focus")}Tt(this).trigger("click")}}},s(c,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return Jt}},{key:"DefaultType",get:function(){return Zt}}]),c}(),Tt(document).on(kt.KEYDOWN_DATA_API,Wt,Xt._dataApiKeydownHandler).on(kt.KEYDOWN_DATA_API,Ut,Xt._dataApiKeydownHandler).on(kt.CLICK_DATA_API+" "+kt.KEYUP_DATA_API,Xt._clearMenus).on(kt.CLICK_DATA_API,Wt,function(e){e.preventDefault(),e.stopPropagation(),Xt._jQueryInterface.call(Tt(this),"toggle")}).on(kt.CLICK_DATA_API,Rt,function(e){e.stopPropagation()}),Tt.fn[St]=Xt._jQueryInterface,Tt.fn[St].Constructor=Xt,Tt.fn[St].noConflict=function(){return Tt.fn[St]=Ot,Xt._jQueryInterface},Xt),qi=(en="modal",nn="."+(tn="bs.modal"),rn=($t=t).fn[en],on={backdrop:!0,keyboard:!0,focus:!0,show:!0},sn={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},an={HIDE:"hide"+nn,HIDDEN:"hidden"+nn,SHOW:"show"+nn,SHOWN:"shown"+nn,FOCUSIN:"focusin"+nn,RESIZE:"resize"+nn,CLICK_DISMISS:"click.dismiss"+nn,KEYDOWN_DISMISS:"keydown.dismiss"+nn,MOUSEUP_DISMISS:"mouseup.dismiss"+nn,MOUSEDOWN_DISMISS:"mousedown.dismiss"+nn,CLICK_DATA_API:"click"+nn+".data-api"},ln="modal-scrollbar-measure",cn="modal-backdrop",un="modal-open",fn="fade",hn="show",dn=".modal-dialog",pn='[data-toggle="modal"]',mn='[data-dismiss="modal"]',gn=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",_n=".sticky-top",vn=function(){function r(e,t){this._config=this._getConfig(t),this._element=e,this._dialog=e.querySelector(dn),this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._scrollbarWidth=0}var e=r.prototype;return e.toggle=function(e){return this._isShown?this.hide():this.show(e)},e.show=function(e){var t=this;if(!this._isTransitioning&&!this._isShown){$t(this._element).hasClass(fn)&&(this._isTransitioning=!0);var n=$t.Event(an.SHOW,{relatedTarget:e});$t(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),$t(document.body).addClass(un),this._setEscapeEvent(),this._setResizeEvent(),$t(this._element).on(an.CLICK_DISMISS,mn,function(e){return t.hide(e)}),$t(this._dialog).on(an.MOUSEDOWN_DISMISS,function(){$t(t._element).one(an.MOUSEUP_DISMISS,function(e){$t(e.target).is(t._element)&&(t._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return t._showElement(e)}))}},e.hide=function(e){var t=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var n=$t.Event(an.HIDE);if($t(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=$t(this._element).hasClass(fn);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),$t(document).off(an.FOCUSIN),$t(this._element).removeClass(hn),$t(this._element).off(an.CLICK_DISMISS),$t(this._dialog).off(an.MOUSEDOWN_DISMISS),i){var r=we.getTransitionDurationFromElement(this._element);$t(this._element).one(we.TRANSITION_END,function(e){return t._hideModal(e)}).emulateTransitionEnd(r)}else this._hideModal()}}},e.dispose=function(){$t.removeData(this._element,tn),$t(window,document,this._element,this._backdrop).off(nn),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},e.handleUpdate=function(){this._adjustDialog()},e._getConfig=function(e){return e=l({},on,e),we.typeCheckConfig(en,e,sn),e},e._showElement=function(e){var t=this,n=$t(this._element).hasClass(fn);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,n&&we.reflow(this._element),$t(this._element).addClass(hn),this._config.focus&&this._enforceFocus();var i=$t.Event(an.SHOWN,{relatedTarget:e}),r=function(){t._config.focus&&t._element.focus(),t._isTransitioning=!1,$t(t._element).trigger(i)};if(n){var o=we.getTransitionDurationFromElement(this._element);$t(this._dialog).one(we.TRANSITION_END,r).emulateTransitionEnd(o)}else r()},e._enforceFocus=function(){var t=this;$t(document).off(an.FOCUSIN).on(an.FOCUSIN,function(e){document!==e.target&&t._element!==e.target&&0===$t(t._element).has(e.target).length&&t._element.focus()})},e._setEscapeEvent=function(){var t=this;this._isShown&&this._config.keyboard?$t(this._element).on(an.KEYDOWN_DISMISS,function(e){27===e.which&&(e.preventDefault(),t.hide())}):this._isShown||$t(this._element).off(an.KEYDOWN_DISMISS)},e._setResizeEvent=function(){var t=this;this._isShown?$t(window).on(an.RESIZE,function(e){return t.handleUpdate(e)}):$t(window).off(an.RESIZE)},e._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){$t(document.body).removeClass(un),e._resetAdjustments(),e._resetScrollbar(),$t(e._element).trigger(an.HIDDEN)})},e._removeBackdrop=function(){this._backdrop&&($t(this._backdrop).remove(),this._backdrop=null)},e._showBackdrop=function(e){var t=this,n=$t(this._element).hasClass(fn)?fn:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=cn,n&&this._backdrop.classList.add(n),$t(this._backdrop).appendTo(document.body),$t(this._element).on(an.CLICK_DISMISS,function(e){t._ignoreBackdropClick?t._ignoreBackdropClick=!1:e.target===e.currentTarget&&("static"===t._config.backdrop?t._element.focus():t.hide())}),n&&we.reflow(this._backdrop),$t(this._backdrop).addClass(hn),!e)return;if(!n)return void e();var i=we.getTransitionDurationFromElement(this._backdrop);$t(this._backdrop).one(we.TRANSITION_END,e).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){$t(this._backdrop).removeClass(hn);var r=function(){t._removeBackdrop(),e&&e()};if($t(this._element).hasClass(fn)){var o=we.getTransitionDurationFromElement(this._backdrop);$t(this._backdrop).one(we.TRANSITION_END,r).emulateTransitionEnd(o)}else r()}else e&&e()},e._adjustDialog=function(){var e=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&e&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!e&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},e._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},e._checkScrollbar=function(){var e=document.body.getBoundingClientRect();this._isBodyOverflowing=e.left+e.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},e._setScrollbar=function(){var r=this;if(this._isBodyOverflowing){var e=[].slice.call(document.querySelectorAll(gn)),t=[].slice.call(document.querySelectorAll(_n));$t(e).each(function(e,t){var n=t.style.paddingRight,i=$t(t).css("padding-right");$t(t).data("padding-right",n).css("padding-right",parseFloat(i)+r._scrollbarWidth+"px")}),$t(t).each(function(e,t){var n=t.style.marginRight,i=$t(t).css("margin-right");$t(t).data("margin-right",n).css("margin-right",parseFloat(i)-r._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=$t(document.body).css("padding-right");$t(document.body).data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},e._resetScrollbar=function(){var e=[].slice.call(document.querySelectorAll(gn));$t(e).each(function(e,t){var n=$t(t).data("padding-right");$t(t).removeData("padding-right"),t.style.paddingRight=n||""});var t=[].slice.call(document.querySelectorAll(""+_n));$t(t).each(function(e,t){var n=$t(t).data("margin-right");"undefined"!=typeof n&&$t(t).css("margin-right",n).removeData("margin-right")});var n=$t(document.body).data("padding-right");$t(document.body).removeData("padding-right"),document.body.style.paddingRight=n||""},e._getScrollbarWidth=function(){var e=document.createElement("div");e.className=ln,document.body.appendChild(e);var t=e.getBoundingClientRect().width-e.clientWidth;return document.body.removeChild(e),t},r._jQueryInterface=function(n,i){return this.each(function(){var e=$t(this).data(tn),t=l({},on,$t(this).data(),"object"==typeof n&&n?n:{});if(e||(e=new r(this,t),$t(this).data(tn,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n](i)}else t.show&&e.show(i)})},s(r,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return on}}]),r}(),$t(document).on(an.CLICK_DATA_API,pn,function(e){var t,n=this,i=we.getSelectorFromElement(this);i&&(t=document.querySelector(i));var r=$t(t).data(tn)?"toggle":l({},$t(t).data(),$t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||e.preventDefault();var o=$t(t).one(an.SHOW,function(e){e.isDefaultPrevented()||o.one(an.HIDDEN,function(){$t(n).is(":visible")&&n.focus()})});vn._jQueryInterface.call($t(t),r,this)}),$t.fn[en]=vn._jQueryInterface,$t.fn[en].Constructor=vn,$t.fn[en].noConflict=function(){return $t.fn[en]=rn,vn._jQueryInterface},vn),Ki=(En="tooltip",wn="."+(bn="bs.tooltip"),Cn=(yn=t).fn[En],Tn="bs-tooltip",Sn=new RegExp("(^|\\s)"+Tn+"\\S+","g"),In={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!(An={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"}),selector:!(Dn={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"}),placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},Nn="out",kn={HIDE:"hide"+wn,HIDDEN:"hidden"+wn,SHOW:(On="show")+wn,SHOWN:"shown"+wn,INSERTED:"inserted"+wn,CLICK:"click"+wn,FOCUSIN:"focusin"+wn,FOCUSOUT:"focusout"+wn,MOUSEENTER:"mouseenter"+wn,MOUSELEAVE:"mouseleave"+wn},xn="fade",Pn="show",Ln=".tooltip-inner",jn=".arrow",Hn="hover",Mn="focus",Fn="click",Wn="manual",Rn=function(){function i(e,t){if("undefined"==typeof Ct)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=e,this.config=this._getConfig(t),this.tip=null,this._setListeners()}var e=i.prototype;return e.enable=function(){this._isEnabled=!0},e.disable=function(){this._isEnabled=!1},e.toggleEnabled=function(){this._isEnabled=!this._isEnabled},e.toggle=function(e){if(this._isEnabled)if(e){var t=this.constructor.DATA_KEY,n=yn(e.currentTarget).data(t);n||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),yn(e.currentTarget).data(t,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(yn(this.getTipElement()).hasClass(Pn))return void this._leave(null,this);this._enter(null,this)}},e.dispose=function(){clearTimeout(this._timeout),yn.removeData(this.element,this.constructor.DATA_KEY),yn(this.element).off(this.constructor.EVENT_KEY),yn(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&yn(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},e.show=function(){var t=this;if("none"===yn(this.element).css("display"))throw new Error("Please use show on visible elements");var e=yn.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){yn(this.element).trigger(e);var n=yn.contains(this.element.ownerDocument.documentElement,this.element);if(e.isDefaultPrevented()||!n)return;var i=this.getTipElement(),r=we.getUID(this.constructor.NAME);i.setAttribute("id",r),this.element.setAttribute("aria-describedby",r),this.setContent(),this.config.animation&&yn(i).addClass(xn);var o="function"==typeof this.config.placement?this.config.placement.call(this,i,this.element):this.config.placement,s=this._getAttachment(o);this.addAttachmentClass(s);var a=!1===this.config.container?document.body:yn(document).find(this.config.container);yn(i).data(this.constructor.DATA_KEY,this),yn.contains(this.element.ownerDocument.documentElement,this.tip)||yn(i).appendTo(a),yn(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new Ct(this.element,i,{placement:s,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:jn},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(e){e.originalPlacement!==e.placement&&t._handlePopperPlacementChange(e)},onUpdate:function(e){t._handlePopperPlacementChange(e)}}),yn(i).addClass(Pn),"ontouchstart"in document.documentElement&&yn(document.body).children().on("mouseover",null,yn.noop);var l=function(){t.config.animation&&t._fixTransition();var e=t._hoverState;t._hoverState=null,yn(t.element).trigger(t.constructor.Event.SHOWN),e===Nn&&t._leave(null,t)};if(yn(this.tip).hasClass(xn)){var c=we.getTransitionDurationFromElement(this.tip);yn(this.tip).one(we.TRANSITION_END,l).emulateTransitionEnd(c)}else l()}},e.hide=function(e){var t=this,n=this.getTipElement(),i=yn.Event(this.constructor.Event.HIDE),r=function(){t._hoverState!==On&&n.parentNode&&n.parentNode.removeChild(n),t._cleanTipClass(),t.element.removeAttribute("aria-describedby"),yn(t.element).trigger(t.constructor.Event.HIDDEN),null!==t._popper&&t._popper.destroy(),e&&e()};if(yn(this.element).trigger(i),!i.isDefaultPrevented()){if(yn(n).removeClass(Pn),"ontouchstart"in document.documentElement&&yn(document.body).children().off("mouseover",null,yn.noop),this._activeTrigger[Fn]=!1,this._activeTrigger[Mn]=!1,this._activeTrigger[Hn]=!1,yn(this.tip).hasClass(xn)){var o=we.getTransitionDurationFromElement(n);yn(n).one(we.TRANSITION_END,r).emulateTransitionEnd(o)}else r();this._hoverState=""}},e.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},e.isWithContent=function(){return Boolean(this.getTitle())},e.addAttachmentClass=function(e){yn(this.getTipElement()).addClass(Tn+"-"+e)},e.getTipElement=function(){return this.tip=this.tip||yn(this.config.template)[0],this.tip},e.setContent=function(){var e=this.getTipElement();this.setElementContent(yn(e.querySelectorAll(Ln)),this.getTitle()),yn(e).removeClass(xn+" "+Pn)},e.setElementContent=function(e,t){var n=this.config.html;"object"==typeof t&&(t.nodeType||t.jquery)?n?yn(t).parent().is(e)||e.empty().append(t):e.text(yn(t).text()):e[n?"html":"text"](t)},e.getTitle=function(){var e=this.element.getAttribute("data-original-title");return e||(e="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),e},e._getAttachment=function(e){return An[e.toUpperCase()]},e._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(e){if("click"===e)yn(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(e){return i.toggle(e)});else if(e!==Wn){var t=e===Hn?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=e===Hn?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;yn(i.element).on(t,i.config.selector,function(e){return i._enter(e)}).on(n,i.config.selector,function(e){return i._leave(e)})}yn(i.element).closest(".modal").on("hide.bs.modal",function(){return i.hide()})}),this.config.selector?this.config=l({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},e._fixTitle=function(){var e=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==e)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},e._enter=function(e,t){var n=this.constructor.DATA_KEY;(t=t||yn(e.currentTarget).data(n))||(t=new this.constructor(e.currentTarget,this._getDelegateConfig()),yn(e.currentTarget).data(n,t)),e&&(t._activeTrigger["focusin"===e.type?Mn:Hn]=!0),yn(t.getTipElement()).hasClass(Pn)||t._hoverState===On?t._hoverState=On:(clearTimeout(t._timeout),t._hoverState=On,t.config.delay&&t.config.delay.show?t._timeout=setTimeout(function(){t._hoverState===On&&t.show()},t.config.delay.show):t.show())},e._leave=function(e,t){var n=this.constructor.DATA_KEY;(t=t||yn(e.currentTarget).data(n))||(t=new this.constructor(e.currentTarget,this._getDelegateConfig()),yn(e.currentTarget).data(n,t)),e&&(t._activeTrigger["focusout"===e.type?Mn:Hn]=!1),t._isWithActiveTrigger()||(clearTimeout(t._timeout),t._hoverState=Nn,t.config.delay&&t.config.delay.hide?t._timeout=setTimeout(function(){t._hoverState===Nn&&t.hide()},t.config.delay.hide):t.hide())},e._isWithActiveTrigger=function(){for(var e in this._activeTrigger)if(this._activeTrigger[e])return!0;return!1},e._getConfig=function(e){return"number"==typeof(e=l({},this.constructor.Default,yn(this.element).data(),"object"==typeof e&&e?e:{})).delay&&(e.delay={show:e.delay,hide:e.delay}),"number"==typeof e.title&&(e.title=e.title.toString()),"number"==typeof e.content&&(e.content=e.content.toString()),we.typeCheckConfig(En,e,this.constructor.DefaultType),e},e._getDelegateConfig=function(){var e={};if(this.config)for(var t in this.config)this.constructor.Default[t]!==this.config[t]&&(e[t]=this.config[t]);return e},e._cleanTipClass=function(){var e=yn(this.getTipElement()),t=e.attr("class").match(Sn);null!==t&&t.length&&e.removeClass(t.join(""))},e._handlePopperPlacementChange=function(e){var t=e.instance;this.tip=t.popper,this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(e.placement))},e._fixTransition=function(){var e=this.getTipElement(),t=this.config.animation;null===e.getAttribute("x-placement")&&(yn(e).removeClass(xn),this.config.animation=!1,this.hide(),this.show(),this.config.animation=t)},i._jQueryInterface=function(n){return this.each(function(){var e=yn(this).data(bn),t="object"==typeof n&&n;if((e||!/dispose|hide/.test(n))&&(e||(e=new i(this,t),yn(this).data(bn,e)),"string"==typeof n)){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return In}},{key:"NAME",get:function(){return En}},{key:"DATA_KEY",get:function(){return bn}},{key:"Event",get:function(){return kn}},{key:"EVENT_KEY",get:function(){return wn}},{key:"DefaultType",get:function(){return Dn}}]),i}(),yn.fn[En]=Rn._jQueryInterface,yn.fn[En].Constructor=Rn,yn.fn[En].noConflict=function(){return yn.fn[En]=Cn,Rn._jQueryInterface},Rn),Qi=(Bn="popover",Kn="."+(qn="bs.popover"),Qn=(Un=t).fn[Bn],Yn="bs-popover",Vn=new RegExp("(^|\\s)"+Yn+"\\S+","g"),zn=l({},Ki.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),Gn=l({},Ki.DefaultType,{content:"(string|element|function)"}),Jn="fade",Xn=".popover-header",$n=".popover-body",ei={HIDE:"hide"+Kn,HIDDEN:"hidden"+Kn,SHOW:(Zn="show")+Kn,SHOWN:"shown"+Kn,INSERTED:"inserted"+Kn,CLICK:"click"+Kn,FOCUSIN:"focusin"+Kn,FOCUSOUT:"focusout"+Kn,MOUSEENTER:"mouseenter"+Kn,MOUSELEAVE:"mouseleave"+Kn},ti=function(e){var t,n;function i(){return e.apply(this,arguments)||this}n=e,(t=i).prototype=Object.create(n.prototype),(t.prototype.constructor=t).__proto__=n;var r=i.prototype;return r.isWithContent=function(){return this.getTitle()||this._getContent()},r.addAttachmentClass=function(e){Un(this.getTipElement()).addClass(Yn+"-"+e)},r.getTipElement=function(){return this.tip=this.tip||Un(this.config.template)[0],this.tip},r.setContent=function(){var e=Un(this.getTipElement());this.setElementContent(e.find(Xn),this.getTitle());var t=this._getContent();"function"==typeof t&&(t=t.call(this.element)),this.setElementContent(e.find($n),t),e.removeClass(Jn+" "+Zn)},r._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},r._cleanTipClass=function(){var e=Un(this.getTipElement()),t=e.attr("class").match(Vn);null!==t&&0<t.length&&e.removeClass(t.join(""))},i._jQueryInterface=function(n){return this.each(function(){var e=Un(this).data(qn),t="object"==typeof n?n:null;if((e||!/destroy|hide/.test(n))&&(e||(e=new i(this,t),Un(this).data(qn,e)),"string"==typeof n)){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return zn}},{key:"NAME",get:function(){return Bn}},{key:"DATA_KEY",get:function(){return qn}},{key:"Event",get:function(){return ei}},{key:"EVENT_KEY",get:function(){return Kn}},{key:"DefaultType",get:function(){return Gn}}]),i}(Ki),Un.fn[Bn]=ti._jQueryInterface,Un.fn[Bn].Constructor=ti,Un.fn[Bn].noConflict=function(){return Un.fn[Bn]=Qn,ti._jQueryInterface},ti),Yi=(ii="scrollspy",oi="."+(ri="bs.scrollspy"),si=(ni=t).fn[ii],ai={offset:10,method:"auto",target:""},li={offset:"number",method:"string",target:"(string|element)"},ci={ACTIVATE:"activate"+oi,SCROLL:"scroll"+oi,LOAD_DATA_API:"load"+oi+".data-api"},ui="dropdown-item",fi="active",hi='[data-spy="scroll"]',di=".active",pi=".nav, .list-group",mi=".nav-link",gi=".nav-item",_i=".list-group-item",vi=".dropdown",yi=".dropdown-item",Ei=".dropdown-toggle",bi="offset",wi="position",Ci=function(){function n(e,t){var n=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(t),this._selector=this._config.target+" "+mi+","+this._config.target+" "+_i+","+this._config.target+" "+yi,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,ni(this._scrollElement).on(ci.SCROLL,function(e){return n._process(e)}),this.refresh(),this._process()}var e=n.prototype;return e.refresh=function(){var t=this,e=this._scrollElement===this._scrollElement.window?bi:wi,r="auto"===this._config.method?e:this._config.method,o=r===wi?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),[].slice.call(document.querySelectorAll(this._selector)).map(function(e){var t,n=we.getSelectorFromElement(e);if(n&&(t=document.querySelector(n)),t){var i=t.getBoundingClientRect();if(i.width||i.height)return[ni(t)[r]().top+o,n]}return null}).filter(function(e){return e}).sort(function(e,t){return e[0]-t[0]}).forEach(function(e){t._offsets.push(e[0]),t._targets.push(e[1])})},e.dispose=function(){ni.removeData(this._element,ri),ni(this._scrollElement).off(oi),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},e._getConfig=function(e){if("string"!=typeof(e=l({},ai,"object"==typeof e&&e?e:{})).target){var t=ni(e.target).attr("id");t||(t=we.getUID(ii),ni(e.target).attr("id",t)),e.target="#"+t}return we.typeCheckConfig(ii,e,li),e},e._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},e._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},e._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},e._process=function(){var e=this._getScrollTop()+this._config.offset,t=this._getScrollHeight(),n=this._config.offset+t-this._getOffsetHeight();if(this._scrollHeight!==t&&this.refresh(),n<=e){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&e<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&e>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||e<this._offsets[r+1])&&this._activate(this._targets[r])}}},e._activate=function(t){this._activeTarget=t,this._clear();var e=this._selector.split(",");e=e.map(function(e){return e+'[data-target="'+t+'"],'+e+'[href="'+t+'"]'});var n=ni([].slice.call(document.querySelectorAll(e.join(","))));n.hasClass(ui)?(n.closest(vi).find(Ei).addClass(fi),n.addClass(fi)):(n.addClass(fi),n.parents(pi).prev(mi+", "+_i).addClass(fi),n.parents(pi).prev(gi).children(mi).addClass(fi)),ni(this._scrollElement).trigger(ci.ACTIVATE,{relatedTarget:t})},e._clear=function(){var e=[].slice.call(document.querySelectorAll(this._selector));ni(e).filter(di).removeClass(fi)},n._jQueryInterface=function(t){return this.each(function(){var e=ni(this).data(ri);if(e||(e=new n(this,"object"==typeof t&&t),ni(this).data(ri,e)),"string"==typeof t){if("undefined"==typeof e[t])throw new TypeError('No method named "'+t+'"');e[t]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return ai}}]),n}(),ni(window).on(ci.LOAD_DATA_API,function(){for(var e=[].slice.call(document.querySelectorAll(hi)),t=e.length;t--;){var n=ni(e[t]);Ci._jQueryInterface.call(n,n.data())}}),ni.fn[ii]=Ci._jQueryInterface,ni.fn[ii].Constructor=Ci,ni.fn[ii].noConflict=function(){return ni.fn[ii]=si,Ci._jQueryInterface},Ci),Vi=(Di="."+(Si="bs.tab"),Ai=(Ti=t).fn.tab,Ii={HIDE:"hide"+Di,HIDDEN:"hidden"+Di,SHOW:"show"+Di,SHOWN:"shown"+Di,CLICK_DATA_API:"click"+Di+".data-api"},Oi="dropdown-menu",Ni="active",ki="disabled",xi="fade",Pi="show",Li=".dropdown",ji=".nav, .list-group",Hi=".active",Mi="> li > .active",Fi='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',Wi=".dropdown-toggle",Ri="> .dropdown-menu .active",Ui=function(){function i(e){this._element=e}var e=i.prototype;return e.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&Ti(this._element).hasClass(Ni)||Ti(this._element).hasClass(ki))){var e,i,t=Ti(this._element).closest(ji)[0],r=we.getSelectorFromElement(this._element);if(t){var o="UL"===t.nodeName?Mi:Hi;i=(i=Ti.makeArray(Ti(t).find(o)))[i.length-1]}var s=Ti.Event(Ii.HIDE,{relatedTarget:this._element}),a=Ti.Event(Ii.SHOW,{relatedTarget:i});if(i&&Ti(i).trigger(s),Ti(this._element).trigger(a),!a.isDefaultPrevented()&&!s.isDefaultPrevented()){r&&(e=document.querySelector(r)),this._activate(this._element,t);var l=function(){var e=Ti.Event(Ii.HIDDEN,{relatedTarget:n._element}),t=Ti.Event(Ii.SHOWN,{relatedTarget:i});Ti(i).trigger(e),Ti(n._element).trigger(t)};e?this._activate(e,e.parentNode,l):l()}}},e.dispose=function(){Ti.removeData(this._element,Si),this._element=null},e._activate=function(e,t,n){var i=this,r=("UL"===t.nodeName?Ti(t).find(Mi):Ti(t).children(Hi))[0],o=n&&r&&Ti(r).hasClass(xi),s=function(){return i._transitionComplete(e,r,n)};if(r&&o){var a=we.getTransitionDurationFromElement(r);Ti(r).one(we.TRANSITION_END,s).emulateTransitionEnd(a)}else s()},e._transitionComplete=function(e,t,n){if(t){Ti(t).removeClass(Pi+" "+Ni);var i=Ti(t.parentNode).find(Ri)[0];i&&Ti(i).removeClass(Ni),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!1)}if(Ti(e).addClass(Ni),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),we.reflow(e),Ti(e).addClass(Pi),e.parentNode&&Ti(e.parentNode).hasClass(Oi)){var r=Ti(e).closest(Li)[0];if(r){var o=[].slice.call(r.querySelectorAll(Wi));Ti(o).addClass(Ni)}e.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var e=Ti(this),t=e.data(Si);if(t||(t=new i(this),e.data(Si,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),i}(),Ti(document).on(Ii.CLICK_DATA_API,Fi,function(e){e.preventDefault(),Ui._jQueryInterface.call(Ti(this),"show")}),Ti.fn.tab=Ui._jQueryInterface,Ti.fn.tab.Constructor=Ui,Ti.fn.tab.noConflict=function(){return Ti.fn.tab=Ai,Ui._jQueryInterface},Ui);!function(e){if("undefined"==typeof e)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var t=e.fn.jquery.split(" ")[0].split(".");if(t[0]<2&&t[1]<9||1===t[0]&&9===t[1]&&t[2]<1||4<=t[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(t),e.Util=we,e.Alert=Ce,e.Button=Te,e.Carousel=Se,e.Collapse=De,e.Dropdown=Bi,e.Modal=qi,e.Popover=Qi,e.Scrollspy=Yi,e.Tab=Vi,e.Tooltip=Ki,Object.defineProperty(e,"__esModule",{value:!0})});
|
|
@@ -1,5 +1,5 @@
|
|
1 |
/*!
|
2 |
-
* Bootstrap v4.1.
|
3 |
* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
|
4 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5 |
*/
|
@@ -70,7 +70,7 @@
|
|
70 |
|
71 |
/**
|
72 |
* --------------------------------------------------------------------------
|
73 |
-
* Bootstrap (v4.1.
|
74 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
75 |
* --------------------------------------------------------------------------
|
76 |
*/
|
@@ -147,8 +147,7 @@
|
|
147 |
}
|
148 |
|
149 |
try {
|
150 |
-
|
151 |
-
return $selector.length > 0 ? selector : null;
|
152 |
} catch (err) {
|
153 |
return null;
|
154 |
}
|
@@ -203,7 +202,7 @@
|
|
203 |
|
204 |
/**
|
205 |
* --------------------------------------------------------------------------
|
206 |
-
* Bootstrap (v4.1.
|
207 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
208 |
* --------------------------------------------------------------------------
|
209 |
*/
|
@@ -215,7 +214,7 @@
|
|
215 |
* ------------------------------------------------------------------------
|
216 |
*/
|
217 |
var NAME = 'alert';
|
218 |
-
var VERSION = '4.1.
|
219 |
var DATA_KEY = 'bs.alert';
|
220 |
var EVENT_KEY = "." + DATA_KEY;
|
221 |
var DATA_API_KEY = '.data-api';
|
@@ -278,7 +277,7 @@
|
|
278 |
var parent = false;
|
279 |
|
280 |
if (selector) {
|
281 |
-
parent =
|
282 |
}
|
283 |
|
284 |
if (!parent) {
|
@@ -378,7 +377,7 @@
|
|
378 |
|
379 |
/**
|
380 |
* --------------------------------------------------------------------------
|
381 |
-
* Bootstrap (v4.1.
|
382 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
383 |
* --------------------------------------------------------------------------
|
384 |
*/
|
@@ -390,7 +389,7 @@
|
|
390 |
* ------------------------------------------------------------------------
|
391 |
*/
|
392 |
var NAME = 'button';
|
393 |
-
var VERSION = '4.1.
|
394 |
var DATA_KEY = 'bs.button';
|
395 |
var EVENT_KEY = "." + DATA_KEY;
|
396 |
var DATA_API_KEY = '.data-api';
|
@@ -435,14 +434,14 @@
|
|
435 |
var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
|
436 |
|
437 |
if (rootElement) {
|
438 |
-
var input =
|
439 |
|
440 |
if (input) {
|
441 |
if (input.type === 'radio') {
|
442 |
-
if (input.checked &&
|
443 |
triggerChangeEvent = false;
|
444 |
} else {
|
445 |
-
var activeElement =
|
446 |
|
447 |
if (activeElement) {
|
448 |
$$$1(activeElement).removeClass(ClassName.ACTIVE);
|
@@ -455,7 +454,7 @@
|
|
455 |
return;
|
456 |
}
|
457 |
|
458 |
-
input.checked =
|
459 |
$$$1(input).trigger('change');
|
460 |
}
|
461 |
|
@@ -465,7 +464,7 @@
|
|
465 |
}
|
466 |
|
467 |
if (addAriaPressed) {
|
468 |
-
this._element.setAttribute('aria-pressed',
|
469 |
}
|
470 |
|
471 |
if (triggerChangeEvent) {
|
@@ -542,7 +541,7 @@
|
|
542 |
|
543 |
/**
|
544 |
* --------------------------------------------------------------------------
|
545 |
-
* Bootstrap (v4.1.
|
546 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
547 |
* --------------------------------------------------------------------------
|
548 |
*/
|
@@ -554,7 +553,7 @@
|
|
554 |
* ------------------------------------------------------------------------
|
555 |
*/
|
556 |
var NAME = 'carousel';
|
557 |
-
var VERSION = '4.1.
|
558 |
var DATA_KEY = 'bs.carousel';
|
559 |
var EVENT_KEY = "." + DATA_KEY;
|
560 |
var DATA_API_KEY = '.data-api';
|
@@ -633,7 +632,7 @@
|
|
633 |
this.touchTimeout = null;
|
634 |
this._config = this._getConfig(config);
|
635 |
this._element = $$$1(element)[0];
|
636 |
-
this._indicatorsElement =
|
637 |
|
638 |
this._addEventListeners();
|
639 |
} // Getters
|
@@ -667,7 +666,7 @@
|
|
667 |
this._isPaused = true;
|
668 |
}
|
669 |
|
670 |
-
if (
|
671 |
Util.triggerTransitionEnd(this._element);
|
672 |
this.cycle(true);
|
673 |
}
|
@@ -694,7 +693,7 @@
|
|
694 |
_proto.to = function to(index) {
|
695 |
var _this = this;
|
696 |
|
697 |
-
this._activeElement =
|
698 |
|
699 |
var activeIndex = this._getItemIndex(this._activeElement);
|
700 |
|
@@ -800,7 +799,7 @@
|
|
800 |
};
|
801 |
|
802 |
_proto._getItemIndex = function _getItemIndex(element) {
|
803 |
-
this._items =
|
804 |
return this._items.indexOf(element);
|
805 |
};
|
806 |
|
@@ -825,7 +824,7 @@
|
|
825 |
_proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
|
826 |
var targetIndex = this._getItemIndex(relatedTarget);
|
827 |
|
828 |
-
var fromIndex = this._getItemIndex(
|
829 |
|
830 |
var slideEvent = $$$1.Event(Event.SLIDE, {
|
831 |
relatedTarget: relatedTarget,
|
@@ -839,7 +838,8 @@
|
|
839 |
|
840 |
_proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
|
841 |
if (this._indicatorsElement) {
|
842 |
-
|
|
|
843 |
|
844 |
var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
|
845 |
|
@@ -852,7 +852,7 @@
|
|
852 |
_proto._slide = function _slide(direction, element) {
|
853 |
var _this3 = this;
|
854 |
|
855 |
-
var activeElement =
|
856 |
|
857 |
var activeElementIndex = this._getItemIndex(activeElement);
|
858 |
|
@@ -1018,11 +1018,13 @@
|
|
1018 |
|
1019 |
$$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
|
1020 |
$$$1(window).on(Event.LOAD_DATA_API, function () {
|
1021 |
-
|
1022 |
-
|
|
|
|
|
1023 |
|
1024 |
Carousel._jQueryInterface.call($carousel, $carousel.data());
|
1025 |
-
}
|
1026 |
});
|
1027 |
/**
|
1028 |
* ------------------------------------------------------------------------
|
@@ -1043,7 +1045,7 @@
|
|
1043 |
|
1044 |
/**
|
1045 |
* --------------------------------------------------------------------------
|
1046 |
-
* Bootstrap (v4.1.
|
1047 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
1048 |
* --------------------------------------------------------------------------
|
1049 |
*/
|
@@ -1055,7 +1057,7 @@
|
|
1055 |
* ------------------------------------------------------------------------
|
1056 |
*/
|
1057 |
var NAME = 'collapse';
|
1058 |
-
var VERSION = '4.1.
|
1059 |
var DATA_KEY = 'bs.collapse';
|
1060 |
var EVENT_KEY = "." + DATA_KEY;
|
1061 |
var DATA_API_KEY = '.data-api';
|
@@ -1103,14 +1105,17 @@
|
|
1103 |
this._isTransitioning = false;
|
1104 |
this._element = element;
|
1105 |
this._config = this._getConfig(config);
|
1106 |
-
this._triggerArray = $$$1.makeArray(
|
1107 |
-
var
|
1108 |
|
1109 |
-
for (var i = 0; i <
|
1110 |
-
var elem =
|
1111 |
var selector = Util.getSelectorFromElement(elem);
|
|
|
|
|
|
|
1112 |
|
1113 |
-
if (selector !== null &&
|
1114 |
this._selector = selector;
|
1115 |
|
1116 |
this._triggerArray.push(elem);
|
@@ -1151,7 +1156,9 @@
|
|
1151 |
var activesData;
|
1152 |
|
1153 |
if (this._parent) {
|
1154 |
-
actives =
|
|
|
|
|
1155 |
|
1156 |
if (actives.length === 0) {
|
1157 |
actives = null;
|
@@ -1186,7 +1193,7 @@
|
|
1186 |
$$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
|
1187 |
this._element.style[dimension] = 0;
|
1188 |
|
1189 |
-
if (this._triggerArray.length
|
1190 |
$$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
|
1191 |
}
|
1192 |
|
@@ -1227,14 +1234,15 @@
|
|
1227 |
this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
|
1228 |
Util.reflow(this._element);
|
1229 |
$$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
|
|
|
1230 |
|
1231 |
-
if (
|
1232 |
-
for (var i = 0; i <
|
1233 |
var trigger = this._triggerArray[i];
|
1234 |
var selector = Util.getSelectorFromElement(trigger);
|
1235 |
|
1236 |
if (selector !== null) {
|
1237 |
-
var $elem = $$$1(selector);
|
1238 |
|
1239 |
if (!$elem.hasClass(ClassName.SHOW)) {
|
1240 |
$$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
|
@@ -1295,11 +1303,12 @@
|
|
1295 |
parent = this._config.parent[0];
|
1296 |
}
|
1297 |
} else {
|
1298 |
-
parent =
|
1299 |
}
|
1300 |
|
1301 |
var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
|
1302 |
-
|
|
|
1303 |
_this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
|
1304 |
});
|
1305 |
return parent;
|
@@ -1309,7 +1318,7 @@
|
|
1309 |
if (element) {
|
1310 |
var isOpen = $$$1(element).hasClass(ClassName.SHOW);
|
1311 |
|
1312 |
-
if (triggerArray.length
|
1313 |
$$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
|
1314 |
}
|
1315 |
}
|
@@ -1318,7 +1327,7 @@
|
|
1318 |
|
1319 |
Collapse._getTargetFromElement = function _getTargetFromElement(element) {
|
1320 |
var selector = Util.getSelectorFromElement(element);
|
1321 |
-
return selector ?
|
1322 |
};
|
1323 |
|
1324 |
Collapse._jQueryInterface = function _jQueryInterface(config) {
|
@@ -1376,7 +1385,8 @@
|
|
1376 |
|
1377 |
var $trigger = $$$1(this);
|
1378 |
var selector = Util.getSelectorFromElement(this);
|
1379 |
-
|
|
|
1380 |
var $target = $$$1(this);
|
1381 |
var data = $target.data(DATA_KEY);
|
1382 |
var config = data ? 'toggle' : $trigger.data();
|
@@ -1403,7 +1413,7 @@
|
|
1403 |
|
1404 |
/**
|
1405 |
* --------------------------------------------------------------------------
|
1406 |
-
* Bootstrap (v4.1.
|
1407 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
1408 |
* --------------------------------------------------------------------------
|
1409 |
*/
|
@@ -1415,7 +1425,7 @@
|
|
1415 |
* ------------------------------------------------------------------------
|
1416 |
*/
|
1417 |
var NAME = 'dropdown';
|
1418 |
-
var VERSION = '4.1.
|
1419 |
var DATA_KEY = 'bs.dropdown';
|
1420 |
var EVENT_KEY = "." + DATA_KEY;
|
1421 |
var DATA_API_KEY = '.data-api';
|
@@ -1624,14 +1634,16 @@
|
|
1624 |
if (!this._menu) {
|
1625 |
var parent = Dropdown._getParentFromElement(this._element);
|
1626 |
|
1627 |
-
|
|
|
|
|
1628 |
}
|
1629 |
|
1630 |
return this._menu;
|
1631 |
};
|
1632 |
|
1633 |
_proto._getPlacement = function _getPlacement() {
|
1634 |
-
var $parentDropdown = $$$1(this._element
|
1635 |
var placement = AttachmentMap.BOTTOM; // Handle dropup
|
1636 |
|
1637 |
if ($parentDropdown.hasClass(ClassName.DROPUP)) {
|
@@ -1719,9 +1731,9 @@
|
|
1719 |
return;
|
1720 |
}
|
1721 |
|
1722 |
-
var toggles =
|
1723 |
|
1724 |
-
for (var i = 0
|
1725 |
var parent = Dropdown._getParentFromElement(toggles[i]);
|
1726 |
|
1727 |
var context = $$$1(toggles[i]).data(DATA_KEY);
|
@@ -1729,6 +1741,10 @@
|
|
1729 |
relatedTarget: toggles[i]
|
1730 |
};
|
1731 |
|
|
|
|
|
|
|
|
|
1732 |
if (!context) {
|
1733 |
continue;
|
1734 |
}
|
@@ -1767,7 +1783,7 @@
|
|
1767 |
var selector = Util.getSelectorFromElement(element);
|
1768 |
|
1769 |
if (selector) {
|
1770 |
-
parent =
|
1771 |
}
|
1772 |
|
1773 |
return parent || element.parentNode;
|
@@ -1799,7 +1815,7 @@
|
|
1799 |
|
1800 |
if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
|
1801 |
if (event.which === ESCAPE_KEYCODE) {
|
1802 |
-
var toggle =
|
1803 |
$$$1(toggle).trigger('focus');
|
1804 |
}
|
1805 |
|
@@ -1807,7 +1823,7 @@
|
|
1807 |
return;
|
1808 |
}
|
1809 |
|
1810 |
-
var items =
|
1811 |
|
1812 |
if (items.length === 0) {
|
1813 |
return;
|
@@ -1885,7 +1901,7 @@
|
|
1885 |
|
1886 |
/**
|
1887 |
* --------------------------------------------------------------------------
|
1888 |
-
* Bootstrap (v4.1.
|
1889 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
1890 |
* --------------------------------------------------------------------------
|
1891 |
*/
|
@@ -1897,7 +1913,7 @@
|
|
1897 |
* ------------------------------------------------------------------------
|
1898 |
*/
|
1899 |
var NAME = 'modal';
|
1900 |
-
var VERSION = '4.1.
|
1901 |
var DATA_KEY = 'bs.modal';
|
1902 |
var EVENT_KEY = "." + DATA_KEY;
|
1903 |
var DATA_API_KEY = '.data-api';
|
@@ -1941,8 +1957,7 @@
|
|
1941 |
DATA_TOGGLE: '[data-toggle="modal"]',
|
1942 |
DATA_DISMISS: '[data-dismiss="modal"]',
|
1943 |
FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
|
1944 |
-
STICKY_CONTENT: '.sticky-top'
|
1945 |
-
NAVBAR_TOGGLER: '.navbar-toggler'
|
1946 |
/**
|
1947 |
* ------------------------------------------------------------------------
|
1948 |
* Class Definition
|
@@ -1957,7 +1972,7 @@
|
|
1957 |
function Modal(element, config) {
|
1958 |
this._config = this._getConfig(config);
|
1959 |
this._element = element;
|
1960 |
-
this._dialog =
|
1961 |
this._backdrop = null;
|
1962 |
this._isShown = false;
|
1963 |
this._isBodyOverflowing = false;
|
@@ -2214,7 +2229,7 @@
|
|
2214 |
this._backdrop.className = ClassName.BACKDROP;
|
2215 |
|
2216 |
if (animate) {
|
2217 |
-
|
2218 |
}
|
2219 |
|
2220 |
$$$1(this._backdrop).appendTo(document.body);
|
@@ -2308,23 +2323,19 @@
|
|
2308 |
if (this._isBodyOverflowing) {
|
2309 |
// Note: DOMNode.style.paddingRight returns the actual value or '' if not set
|
2310 |
// while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
|
2311 |
-
|
2312 |
-
|
2313 |
-
|
|
|
|
|
2314 |
var calculatedPadding = $$$1(element).css('padding-right');
|
2315 |
$$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
|
2316 |
}); // Adjust sticky content margin
|
2317 |
|
2318 |
-
$$$1(
|
2319 |
-
var actualMargin =
|
2320 |
var calculatedMargin = $$$1(element).css('margin-right');
|
2321 |
$$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
|
2322 |
-
}); // Adjust navbar-toggler margin
|
2323 |
-
|
2324 |
-
$$$1(Selector.NAVBAR_TOGGLER).each(function (index, element) {
|
2325 |
-
var actualMargin = $$$1(element)[0].style.marginRight;
|
2326 |
-
var calculatedMargin = $$$1(element).css('margin-right');
|
2327 |
-
$$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) + _this9._scrollbarWidth + "px");
|
2328 |
}); // Adjust body padding
|
2329 |
|
2330 |
var actualPadding = document.body.style.paddingRight;
|
@@ -2335,15 +2346,15 @@
|
|
2335 |
|
2336 |
_proto._resetScrollbar = function _resetScrollbar() {
|
2337 |
// Restore fixed content padding
|
2338 |
-
|
|
|
2339 |
var padding = $$$1(element).data('padding-right');
|
|
|
|
|
|
|
2340 |
|
2341 |
-
|
2342 |
-
|
2343 |
-
}
|
2344 |
-
}); // Restore sticky content and navbar-toggler margin
|
2345 |
-
|
2346 |
-
$$$1(Selector.STICKY_CONTENT + ", " + Selector.NAVBAR_TOGGLER).each(function (index, element) {
|
2347 |
var margin = $$$1(element).data('margin-right');
|
2348 |
|
2349 |
if (typeof margin !== 'undefined') {
|
@@ -2352,10 +2363,8 @@
|
|
2352 |
}); // Restore body padding
|
2353 |
|
2354 |
var padding = $$$1(document.body).data('padding-right');
|
2355 |
-
|
2356 |
-
|
2357 |
-
$$$1(document.body).css('padding-right', padding).removeData('padding-right');
|
2358 |
-
}
|
2359 |
};
|
2360 |
|
2361 |
_proto._getScrollbarWidth = function _getScrollbarWidth() {
|
@@ -2420,7 +2429,7 @@
|
|
2420 |
var selector = Util.getSelectorFromElement(this);
|
2421 |
|
2422 |
if (selector) {
|
2423 |
-
target =
|
2424 |
}
|
2425 |
|
2426 |
var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _objectSpread({}, $$$1(target).data(), $$$1(this).data());
|
@@ -2463,7 +2472,7 @@
|
|
2463 |
|
2464 |
/**
|
2465 |
* --------------------------------------------------------------------------
|
2466 |
-
* Bootstrap (v4.1.
|
2467 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
2468 |
* --------------------------------------------------------------------------
|
2469 |
*/
|
@@ -2475,7 +2484,7 @@
|
|
2475 |
* ------------------------------------------------------------------------
|
2476 |
*/
|
2477 |
var NAME = 'tooltip';
|
2478 |
-
var VERSION = '4.1.
|
2479 |
var DATA_KEY = 'bs.tooltip';
|
2480 |
var EVENT_KEY = "." + DATA_KEY;
|
2481 |
var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
|
@@ -2685,7 +2694,7 @@
|
|
2685 |
var attachment = this._getAttachment(placement);
|
2686 |
|
2687 |
this.addAttachmentClass(attachment);
|
2688 |
-
var container = this.config.container === false ? document.body : $$$1(this.config.container);
|
2689 |
$$$1(tip).data(this.constructor.DATA_KEY, this);
|
2690 |
|
2691 |
if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) {
|
@@ -2824,9 +2833,9 @@
|
|
2824 |
};
|
2825 |
|
2826 |
_proto.setContent = function setContent() {
|
2827 |
-
var
|
2828 |
-
this.setElementContent(
|
2829 |
-
|
2830 |
};
|
2831 |
|
2832 |
_proto.setElementContent = function setElementContent($element, content) {
|
@@ -3019,15 +3028,18 @@
|
|
3019 |
var $tip = $$$1(this.getTipElement());
|
3020 |
var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
|
3021 |
|
3022 |
-
if (tabClass !== null && tabClass.length
|
3023 |
$tip.removeClass(tabClass.join(''));
|
3024 |
}
|
3025 |
};
|
3026 |
|
3027 |
-
_proto._handlePopperPlacementChange = function _handlePopperPlacementChange(
|
|
|
|
|
|
|
3028 |
this._cleanTipClass();
|
3029 |
|
3030 |
-
this.addAttachmentClass(this._getAttachment(
|
3031 |
};
|
3032 |
|
3033 |
_proto._fixTransition = function _fixTransition() {
|
@@ -3130,7 +3142,7 @@
|
|
3130 |
|
3131 |
/**
|
3132 |
* --------------------------------------------------------------------------
|
3133 |
-
* Bootstrap (v4.1.
|
3134 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3135 |
* --------------------------------------------------------------------------
|
3136 |
*/
|
@@ -3142,7 +3154,7 @@
|
|
3142 |
* ------------------------------------------------------------------------
|
3143 |
*/
|
3144 |
var NAME = 'popover';
|
3145 |
-
var VERSION = '4.1.
|
3146 |
var DATA_KEY = 'bs.popover';
|
3147 |
var EVENT_KEY = "." + DATA_KEY;
|
3148 |
var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
|
@@ -3327,7 +3339,7 @@
|
|
3327 |
|
3328 |
/**
|
3329 |
* --------------------------------------------------------------------------
|
3330 |
-
* Bootstrap (v4.1.
|
3331 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3332 |
* --------------------------------------------------------------------------
|
3333 |
*/
|
@@ -3339,7 +3351,7 @@
|
|
3339 |
* ------------------------------------------------------------------------
|
3340 |
*/
|
3341 |
var NAME = 'scrollspy';
|
3342 |
-
var VERSION = '4.1.
|
3343 |
var DATA_KEY = 'bs.scrollspy';
|
3344 |
var EVENT_KEY = "." + DATA_KEY;
|
3345 |
var DATA_API_KEY = '.data-api';
|
@@ -3421,13 +3433,13 @@
|
|
3421 |
this._offsets = [];
|
3422 |
this._targets = [];
|
3423 |
this._scrollHeight = this._getScrollHeight();
|
3424 |
-
var targets =
|
3425 |
targets.map(function (element) {
|
3426 |
var target;
|
3427 |
var targetSelector = Util.getSelectorFromElement(element);
|
3428 |
|
3429 |
if (targetSelector) {
|
3430 |
-
target =
|
3431 |
}
|
3432 |
|
3433 |
if (target) {
|
@@ -3524,7 +3536,9 @@
|
|
3524 |
return;
|
3525 |
}
|
3526 |
|
3527 |
-
|
|
|
|
|
3528 |
var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
|
3529 |
|
3530 |
if (isActiveTarget) {
|
@@ -3544,7 +3558,7 @@
|
|
3544 |
queries = queries.map(function (selector) {
|
3545 |
return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]");
|
3546 |
});
|
3547 |
-
var $link = $$$1(queries.join(','));
|
3548 |
|
3549 |
if ($link.hasClass(ClassName.DROPDOWN_ITEM)) {
|
3550 |
$link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
|
@@ -3565,7 +3579,8 @@
|
|
3565 |
};
|
3566 |
|
3567 |
_proto._clear = function _clear() {
|
3568 |
-
|
|
|
3569 |
}; // Static
|
3570 |
|
3571 |
|
@@ -3612,9 +3627,10 @@
|
|
3612 |
|
3613 |
|
3614 |
$$$1(window).on(Event.LOAD_DATA_API, function () {
|
3615 |
-
var scrollSpys =
|
|
|
3616 |
|
3617 |
-
for (var i =
|
3618 |
var $spy = $$$1(scrollSpys[i]);
|
3619 |
|
3620 |
ScrollSpy._jQueryInterface.call($spy, $spy.data());
|
@@ -3639,7 +3655,7 @@
|
|
3639 |
|
3640 |
/**
|
3641 |
* --------------------------------------------------------------------------
|
3642 |
-
* Bootstrap (v4.1.
|
3643 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3644 |
* --------------------------------------------------------------------------
|
3645 |
*/
|
@@ -3651,7 +3667,7 @@
|
|
3651 |
* ------------------------------------------------------------------------
|
3652 |
*/
|
3653 |
var NAME = 'tab';
|
3654 |
-
var VERSION = '4.1.
|
3655 |
var DATA_KEY = 'bs.tab';
|
3656 |
var EVENT_KEY = "." + DATA_KEY;
|
3657 |
var DATA_API_KEY = '.data-api';
|
@@ -3733,7 +3749,7 @@
|
|
3733 |
}
|
3734 |
|
3735 |
if (selector) {
|
3736 |
-
target =
|
3737 |
}
|
3738 |
|
3739 |
this._activate(this._element, listElement);
|
@@ -3815,7 +3831,8 @@
|
|
3815 |
var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0];
|
3816 |
|
3817 |
if (dropdownElement) {
|
3818 |
-
|
|
|
3819 |
}
|
3820 |
|
3821 |
element.setAttribute('aria-expanded', true);
|
@@ -3887,7 +3904,7 @@
|
|
3887 |
|
3888 |
/**
|
3889 |
* --------------------------------------------------------------------------
|
3890 |
-
* Bootstrap (v4.1.
|
3891 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3892 |
* --------------------------------------------------------------------------
|
3893 |
*/
|
@@ -3923,5 +3940,4 @@
|
|
3923 |
|
3924 |
Object.defineProperty(exports, '__esModule', { value: true });
|
3925 |
|
3926 |
-
})));
|
3927 |
-
//# sourceMappingURL=bootstrap.js.map
|
1 |
/*!
|
2 |
+
* Bootstrap v4.1.3 (https://getbootstrap.com/)
|
3 |
* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
|
4 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5 |
*/
|
70 |
|
71 |
/**
|
72 |
* --------------------------------------------------------------------------
|
73 |
+
* Bootstrap (v4.1.3): util.js
|
74 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
75 |
* --------------------------------------------------------------------------
|
76 |
*/
|
147 |
}
|
148 |
|
149 |
try {
|
150 |
+
return document.querySelector(selector) ? selector : null;
|
|
|
151 |
} catch (err) {
|
152 |
return null;
|
153 |
}
|
202 |
|
203 |
/**
|
204 |
* --------------------------------------------------------------------------
|
205 |
+
* Bootstrap (v4.1.3): alert.js
|
206 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
207 |
* --------------------------------------------------------------------------
|
208 |
*/
|
214 |
* ------------------------------------------------------------------------
|
215 |
*/
|
216 |
var NAME = 'alert';
|
217 |
+
var VERSION = '4.1.3';
|
218 |
var DATA_KEY = 'bs.alert';
|
219 |
var EVENT_KEY = "." + DATA_KEY;
|
220 |
var DATA_API_KEY = '.data-api';
|
277 |
var parent = false;
|
278 |
|
279 |
if (selector) {
|
280 |
+
parent = document.querySelector(selector);
|
281 |
}
|
282 |
|
283 |
if (!parent) {
|
377 |
|
378 |
/**
|
379 |
* --------------------------------------------------------------------------
|
380 |
+
* Bootstrap (v4.1.3): button.js
|
381 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
382 |
* --------------------------------------------------------------------------
|
383 |
*/
|
389 |
* ------------------------------------------------------------------------
|
390 |
*/
|
391 |
var NAME = 'button';
|
392 |
+
var VERSION = '4.1.3';
|
393 |
var DATA_KEY = 'bs.button';
|
394 |
var EVENT_KEY = "." + DATA_KEY;
|
395 |
var DATA_API_KEY = '.data-api';
|
434 |
var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
|
435 |
|
436 |
if (rootElement) {
|
437 |
+
var input = this._element.querySelector(Selector.INPUT);
|
438 |
|
439 |
if (input) {
|
440 |
if (input.type === 'radio') {
|
441 |
+
if (input.checked && this._element.classList.contains(ClassName.ACTIVE)) {
|
442 |
triggerChangeEvent = false;
|
443 |
} else {
|
444 |
+
var activeElement = rootElement.querySelector(Selector.ACTIVE);
|
445 |
|
446 |
if (activeElement) {
|
447 |
$$$1(activeElement).removeClass(ClassName.ACTIVE);
|
454 |
return;
|
455 |
}
|
456 |
|
457 |
+
input.checked = !this._element.classList.contains(ClassName.ACTIVE);
|
458 |
$$$1(input).trigger('change');
|
459 |
}
|
460 |
|
464 |
}
|
465 |
|
466 |
if (addAriaPressed) {
|
467 |
+
this._element.setAttribute('aria-pressed', !this._element.classList.contains(ClassName.ACTIVE));
|
468 |
}
|
469 |
|
470 |
if (triggerChangeEvent) {
|
541 |
|
542 |
/**
|
543 |
* --------------------------------------------------------------------------
|
544 |
+
* Bootstrap (v4.1.3): carousel.js
|
545 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
546 |
* --------------------------------------------------------------------------
|
547 |
*/
|
553 |
* ------------------------------------------------------------------------
|
554 |
*/
|
555 |
var NAME = 'carousel';
|
556 |
+
var VERSION = '4.1.3';
|
557 |
var DATA_KEY = 'bs.carousel';
|
558 |
var EVENT_KEY = "." + DATA_KEY;
|
559 |
var DATA_API_KEY = '.data-api';
|
632 |
this.touchTimeout = null;
|
633 |
this._config = this._getConfig(config);
|
634 |
this._element = $$$1(element)[0];
|
635 |
+
this._indicatorsElement = this._element.querySelector(Selector.INDICATORS);
|
636 |
|
637 |
this._addEventListeners();
|
638 |
} // Getters
|
666 |
this._isPaused = true;
|
667 |
}
|
668 |
|
669 |
+
if (this._element.querySelector(Selector.NEXT_PREV)) {
|
670 |
Util.triggerTransitionEnd(this._element);
|
671 |
this.cycle(true);
|
672 |
}
|
693 |
_proto.to = function to(index) {
|
694 |
var _this = this;
|
695 |
|
696 |
+
this._activeElement = this._element.querySelector(Selector.ACTIVE_ITEM);
|
697 |
|
698 |
var activeIndex = this._getItemIndex(this._activeElement);
|
699 |
|
799 |
};
|
800 |
|
801 |
_proto._getItemIndex = function _getItemIndex(element) {
|
802 |
+
this._items = element && element.parentNode ? [].slice.call(element.parentNode.querySelectorAll(Selector.ITEM)) : [];
|
803 |
return this._items.indexOf(element);
|
804 |
};
|
805 |
|
824 |
_proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
|
825 |
var targetIndex = this._getItemIndex(relatedTarget);
|
826 |
|
827 |
+
var fromIndex = this._getItemIndex(this._element.querySelector(Selector.ACTIVE_ITEM));
|
828 |
|
829 |
var slideEvent = $$$1.Event(Event.SLIDE, {
|
830 |
relatedTarget: relatedTarget,
|
838 |
|
839 |
_proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
|
840 |
if (this._indicatorsElement) {
|
841 |
+
var indicators = [].slice.call(this._indicatorsElement.querySelectorAll(Selector.ACTIVE));
|
842 |
+
$$$1(indicators).removeClass(ClassName.ACTIVE);
|
843 |
|
844 |
var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
|
845 |
|
852 |
_proto._slide = function _slide(direction, element) {
|
853 |
var _this3 = this;
|
854 |
|
855 |
+
var activeElement = this._element.querySelector(Selector.ACTIVE_ITEM);
|
856 |
|
857 |
var activeElementIndex = this._getItemIndex(activeElement);
|
858 |
|
1018 |
|
1019 |
$$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
|
1020 |
$$$1(window).on(Event.LOAD_DATA_API, function () {
|
1021 |
+
var carousels = [].slice.call(document.querySelectorAll(Selector.DATA_RIDE));
|
1022 |
+
|
1023 |
+
for (var i = 0, len = carousels.length; i < len; i++) {
|
1024 |
+
var $carousel = $$$1(carousels[i]);
|
1025 |
|
1026 |
Carousel._jQueryInterface.call($carousel, $carousel.data());
|
1027 |
+
}
|
1028 |
});
|
1029 |
/**
|
1030 |
* ------------------------------------------------------------------------
|
1045 |
|
1046 |
/**
|
1047 |
* --------------------------------------------------------------------------
|
1048 |
+
* Bootstrap (v4.1.3): collapse.js
|
1049 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
1050 |
* --------------------------------------------------------------------------
|
1051 |
*/
|
1057 |
* ------------------------------------------------------------------------
|
1058 |
*/
|
1059 |
var NAME = 'collapse';
|
1060 |
+
var VERSION = '4.1.3';
|
1061 |
var DATA_KEY = 'bs.collapse';
|
1062 |
var EVENT_KEY = "." + DATA_KEY;
|
1063 |
var DATA_API_KEY = '.data-api';
|
1105 |
this._isTransitioning = false;
|
1106 |
this._element = element;
|
1107 |
this._config = this._getConfig(config);
|
1108 |
+
this._triggerArray = $$$1.makeArray(document.querySelectorAll("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
|
1109 |
+
var toggleList = [].slice.call(document.querySelectorAll(Selector.DATA_TOGGLE));
|
1110 |
|
1111 |
+
for (var i = 0, len = toggleList.length; i < len; i++) {
|
1112 |
+
var elem = toggleList[i];
|
1113 |
var selector = Util.getSelectorFromElement(elem);
|
1114 |
+
var filterElement = [].slice.call(document.querySelectorAll(selector)).filter(function (foundElem) {
|
1115 |
+
return foundElem === element;
|
1116 |
+
});
|
1117 |
|
1118 |
+
if (selector !== null && filterElement.length > 0) {
|
1119 |
this._selector = selector;
|
1120 |
|
1121 |
this._triggerArray.push(elem);
|
1156 |
var activesData;
|
1157 |
|
1158 |
if (this._parent) {
|
1159 |
+
actives = [].slice.call(this._parent.querySelectorAll(Selector.ACTIVES)).filter(function (elem) {
|
1160 |
+
return elem.getAttribute('data-parent') === _this._config.parent;
|
1161 |
+
});
|
1162 |
|
1163 |
if (actives.length === 0) {
|
1164 |
actives = null;
|
1193 |
$$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
|
1194 |
this._element.style[dimension] = 0;
|
1195 |
|
1196 |
+
if (this._triggerArray.length) {
|
1197 |
$$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
|
1198 |
}
|
1199 |
|
1234 |
this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
|
1235 |
Util.reflow(this._element);
|
1236 |
$$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
|
1237 |
+
var triggerArrayLength = this._triggerArray.length;
|
1238 |
|
1239 |
+
if (triggerArrayLength > 0) {
|
1240 |
+
for (var i = 0; i < triggerArrayLength; i++) {
|
1241 |
var trigger = this._triggerArray[i];
|
1242 |
var selector = Util.getSelectorFromElement(trigger);
|
1243 |
|
1244 |
if (selector !== null) {
|
1245 |
+
var $elem = $$$1([].slice.call(document.querySelectorAll(selector)));
|
1246 |
|
1247 |
if (!$elem.hasClass(ClassName.SHOW)) {
|
1248 |
$$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
|
1303 |
parent = this._config.parent[0];
|
1304 |
}
|
1305 |
} else {
|
1306 |
+
parent = document.querySelector(this._config.parent);
|
1307 |
}
|
1308 |
|
1309 |
var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
|
1310 |
+
var children = [].slice.call(parent.querySelectorAll(selector));
|
1311 |
+
$$$1(children).each(function (i, element) {
|
1312 |
_this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
|
1313 |
});
|
1314 |
return parent;
|
1318 |
if (element) {
|
1319 |
var isOpen = $$$1(element).hasClass(ClassName.SHOW);
|
1320 |
|
1321 |
+
if (triggerArray.length) {
|
1322 |
$$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
|
1323 |
}
|
1324 |
}
|
1327 |
|
1328 |
Collapse._getTargetFromElement = function _getTargetFromElement(element) {
|
1329 |
var selector = Util.getSelectorFromElement(element);
|
1330 |
+
return selector ? document.querySelector(selector) : null;
|
1331 |
};
|
1332 |
|
1333 |
Collapse._jQueryInterface = function _jQueryInterface(config) {
|
1385 |
|
1386 |
var $trigger = $$$1(this);
|
1387 |
var selector = Util.getSelectorFromElement(this);
|
1388 |
+
var selectors = [].slice.call(document.querySelectorAll(selector));
|
1389 |
+
$$$1(selectors).each(function () {
|
1390 |
var $target = $$$1(this);
|
1391 |
var data = $target.data(DATA_KEY);
|
1392 |
var config = data ? 'toggle' : $trigger.data();
|
1413 |
|
1414 |
/**
|
1415 |
* --------------------------------------------------------------------------
|
1416 |
+
* Bootstrap (v4.1.3): dropdown.js
|
1417 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
1418 |
* --------------------------------------------------------------------------
|
1419 |
*/
|
1425 |
* ------------------------------------------------------------------------
|
1426 |
*/
|
1427 |
var NAME = 'dropdown';
|
1428 |
+
var VERSION = '4.1.3';
|
1429 |
var DATA_KEY = 'bs.dropdown';
|
1430 |
var EVENT_KEY = "." + DATA_KEY;
|
1431 |
var DATA_API_KEY = '.data-api';
|
1634 |
if (!this._menu) {
|
1635 |
var parent = Dropdown._getParentFromElement(this._element);
|
1636 |
|
1637 |
+
if (parent) {
|
1638 |
+
this._menu = parent.querySelector(Selector.MENU);
|
1639 |
+
}
|
1640 |
}
|
1641 |
|
1642 |
return this._menu;
|
1643 |
};
|
1644 |
|
1645 |
_proto._getPlacement = function _getPlacement() {
|
1646 |
+
var $parentDropdown = $$$1(this._element.parentNode);
|
1647 |
var placement = AttachmentMap.BOTTOM; // Handle dropup
|
1648 |
|
1649 |
if ($parentDropdown.hasClass(ClassName.DROPUP)) {
|
1731 |
return;
|
1732 |
}
|
1733 |
|
1734 |
+
var toggles = [].slice.call(document.querySelectorAll(Selector.DATA_TOGGLE));
|
1735 |
|
1736 |
+
for (var i = 0, len = toggles.length; i < len; i++) {
|
1737 |
var parent = Dropdown._getParentFromElement(toggles[i]);
|
1738 |
|
1739 |
var context = $$$1(toggles[i]).data(DATA_KEY);
|
1741 |
relatedTarget: toggles[i]
|
1742 |
};
|
1743 |
|
1744 |
+
if (event && event.type === 'click') {
|
1745 |
+
relatedTarget.clickEvent = event;
|
1746 |
+
}
|
1747 |
+
|
1748 |
if (!context) {
|
1749 |
continue;
|
1750 |
}
|
1783 |
var selector = Util.getSelectorFromElement(element);
|
1784 |
|
1785 |
if (selector) {
|
1786 |
+
parent = document.querySelector(selector);
|
1787 |
}
|
1788 |
|
1789 |
return parent || element.parentNode;
|
1815 |
|
1816 |
if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
|
1817 |
if (event.which === ESCAPE_KEYCODE) {
|
1818 |
+
var toggle = parent.querySelector(Selector.DATA_TOGGLE);
|
1819 |
$$$1(toggle).trigger('focus');
|
1820 |
}
|
1821 |
|
1823 |
return;
|
1824 |
}
|
1825 |
|
1826 |
+
var items = [].slice.call(parent.querySelectorAll(Selector.VISIBLE_ITEMS));
|
1827 |
|
1828 |
if (items.length === 0) {
|
1829 |
return;
|
1901 |
|
1902 |
/**
|
1903 |
* --------------------------------------------------------------------------
|
1904 |
+
* Bootstrap (v4.1.3): modal.js
|
1905 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
1906 |
* --------------------------------------------------------------------------
|
1907 |
*/
|
1913 |
* ------------------------------------------------------------------------
|
1914 |
*/
|
1915 |
var NAME = 'modal';
|
1916 |
+
var VERSION = '4.1.3';
|
1917 |
var DATA_KEY = 'bs.modal';
|
1918 |
var EVENT_KEY = "." + DATA_KEY;
|
1919 |
var DATA_API_KEY = '.data-api';
|
1957 |
DATA_TOGGLE: '[data-toggle="modal"]',
|
1958 |
DATA_DISMISS: '[data-dismiss="modal"]',
|
1959 |
FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
|
1960 |
+
STICKY_CONTENT: '.sticky-top'
|
|
|
1961 |
/**
|
1962 |
* ------------------------------------------------------------------------
|
1963 |
* Class Definition
|
1972 |
function Modal(element, config) {
|
1973 |
this._config = this._getConfig(config);
|
1974 |
this._element = element;
|
1975 |
+
this._dialog = element.querySelector(Selector.DIALOG);
|
1976 |
this._backdrop = null;
|
1977 |
this._isShown = false;
|
1978 |
this._isBodyOverflowing = false;
|
2229 |
this._backdrop.className = ClassName.BACKDROP;
|
2230 |
|
2231 |
if (animate) {
|
2232 |
+
this._backdrop.classList.add(animate);
|
2233 |
}
|
2234 |
|
2235 |
$$$1(this._backdrop).appendTo(document.body);
|
2323 |
if (this._isBodyOverflowing) {
|
2324 |
// Note: DOMNode.style.paddingRight returns the actual value or '' if not set
|
2325 |
// while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
|
2326 |
+
var fixedContent = [].slice.call(document.querySelectorAll(Selector.FIXED_CONTENT));
|
2327 |
+
var stickyContent = [].slice.call(document.querySelectorAll(Selector.STICKY_CONTENT)); // Adjust fixed content padding
|
2328 |
+
|
2329 |
+
$$$1(fixedContent).each(function (index, element) {
|
2330 |
+
var actualPadding = element.style.paddingRight;
|
2331 |
var calculatedPadding = $$$1(element).css('padding-right');
|
2332 |
$$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
|
2333 |
}); // Adjust sticky content margin
|
2334 |
|
2335 |
+
$$$1(stickyContent).each(function (index, element) {
|
2336 |
+
var actualMargin = element.style.marginRight;
|
2337 |
var calculatedMargin = $$$1(element).css('margin-right');
|
2338 |
$$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
|
|
|
|
|
|
|
|
|
|
|
|
|
2339 |
}); // Adjust body padding
|
2340 |
|
2341 |
var actualPadding = document.body.style.paddingRight;
|
2346 |
|
2347 |
_proto._resetScrollbar = function _resetScrollbar() {
|
2348 |
// Restore fixed content padding
|
2349 |
+
var fixedContent = [].slice.call(document.querySelectorAll(Selector.FIXED_CONTENT));
|
2350 |
+
$$$1(fixedContent).each(function (index, element) {
|
2351 |
var padding = $$$1(element).data('padding-right');
|
2352 |
+
$$$1(element).removeData('padding-right');
|
2353 |
+
element.style.paddingRight = padding ? padding : '';
|
2354 |
+
}); // Restore sticky content
|
2355 |
|
2356 |
+
var elements = [].slice.call(document.querySelectorAll("" + Selector.STICKY_CONTENT));
|
2357 |
+
$$$1(elements).each(function (index, element) {
|
|
|
|
|
|
|
|
|
2358 |
var margin = $$$1(element).data('margin-right');
|
2359 |
|
2360 |
if (typeof margin !== 'undefined') {
|
2363 |
}); // Restore body padding
|
2364 |
|
2365 |
var padding = $$$1(document.body).data('padding-right');
|
2366 |
+
$$$1(document.body).removeData('padding-right');
|
2367 |
+
document.body.style.paddingRight = padding ? padding : '';
|
|
|
|
|
2368 |
};
|
2369 |
|
2370 |
_proto._getScrollbarWidth = function _getScrollbarWidth() {
|
2429 |
var selector = Util.getSelectorFromElement(this);
|
2430 |
|
2431 |
if (selector) {
|
2432 |
+
target = document.querySelector(selector);
|
2433 |
}
|
2434 |
|
2435 |
var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _objectSpread({}, $$$1(target).data(), $$$1(this).data());
|
2472 |
|
2473 |
/**
|
2474 |
* --------------------------------------------------------------------------
|
2475 |
+
* Bootstrap (v4.1.3): tooltip.js
|
2476 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
2477 |
* --------------------------------------------------------------------------
|
2478 |
*/
|
2484 |
* ------------------------------------------------------------------------
|
2485 |
*/
|
2486 |
var NAME = 'tooltip';
|
2487 |
+
var VERSION = '4.1.3';
|
2488 |
var DATA_KEY = 'bs.tooltip';
|
2489 |
var EVENT_KEY = "." + DATA_KEY;
|
2490 |
var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
|
2694 |
var attachment = this._getAttachment(placement);
|
2695 |
|
2696 |
this.addAttachmentClass(attachment);
|
2697 |
+
var container = this.config.container === false ? document.body : $$$1(document).find(this.config.container);
|
2698 |
$$$1(tip).data(this.constructor.DATA_KEY, this);
|
2699 |
|
2700 |
if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) {
|
2833 |
};
|
2834 |
|
2835 |
_proto.setContent = function setContent() {
|
2836 |
+
var tip = this.getTipElement();
|
2837 |
+
this.setElementContent($$$1(tip.querySelectorAll(Selector.TOOLTIP_INNER)), this.getTitle());
|
2838 |
+
$$$1(tip).removeClass(ClassName.FADE + " " + ClassName.SHOW);
|
2839 |
};
|
2840 |
|
2841 |
_proto.setElementContent = function setElementContent($element, content) {
|
3028 |
var $tip = $$$1(this.getTipElement());
|
3029 |
var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
|
3030 |
|
3031 |
+
if (tabClass !== null && tabClass.length) {
|
3032 |
$tip.removeClass(tabClass.join(''));
|
3033 |
}
|
3034 |
};
|
3035 |
|
3036 |
+
_proto._handlePopperPlacementChange = function _handlePopperPlacementChange(popperData) {
|
3037 |
+
var popperInstance = popperData.instance;
|
3038 |
+
this.tip = popperInstance.popper;
|
3039 |
+
|
3040 |
this._cleanTipClass();
|
3041 |
|
3042 |
+
this.addAttachmentClass(this._getAttachment(popperData.placement));
|
3043 |
};
|
3044 |
|
3045 |
_proto._fixTransition = function _fixTransition() {
|
3142 |
|
3143 |
/**
|
3144 |
* --------------------------------------------------------------------------
|
3145 |
+
* Bootstrap (v4.1.3): popover.js
|
3146 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3147 |
* --------------------------------------------------------------------------
|
3148 |
*/
|
3154 |
* ------------------------------------------------------------------------
|
3155 |
*/
|
3156 |
var NAME = 'popover';
|
3157 |
+
var VERSION = '4.1.3';
|
3158 |
var DATA_KEY = 'bs.popover';
|
3159 |
var EVENT_KEY = "." + DATA_KEY;
|
3160 |
var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
|
3339 |
|
3340 |
/**
|
3341 |
* --------------------------------------------------------------------------
|
3342 |
+
* Bootstrap (v4.1.3): scrollspy.js
|
3343 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3344 |
* --------------------------------------------------------------------------
|
3345 |
*/
|
3351 |
* ------------------------------------------------------------------------
|
3352 |
*/
|
3353 |
var NAME = 'scrollspy';
|
3354 |
+
var VERSION = '4.1.3';
|
3355 |
var DATA_KEY = 'bs.scrollspy';
|
3356 |
var EVENT_KEY = "." + DATA_KEY;
|
3357 |
var DATA_API_KEY = '.data-api';
|
3433 |
this._offsets = [];
|
3434 |
this._targets = [];
|
3435 |
this._scrollHeight = this._getScrollHeight();
|
3436 |
+
var targets = [].slice.call(document.querySelectorAll(this._selector));
|
3437 |
targets.map(function (element) {
|
3438 |
var target;
|
3439 |
var targetSelector = Util.getSelectorFromElement(element);
|
3440 |
|
3441 |
if (targetSelector) {
|
3442 |
+
target = document.querySelector(targetSelector);
|
3443 |
}
|
3444 |
|
3445 |
if (target) {
|
3536 |
return;
|
3537 |
}
|
3538 |
|
3539 |
+
var offsetLength = this._offsets.length;
|
3540 |
+
|
3541 |
+
for (var i = offsetLength; i--;) {
|
3542 |
var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
|
3543 |
|
3544 |
if (isActiveTarget) {
|
3558 |
queries = queries.map(function (selector) {
|
3559 |
return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]");
|
3560 |
});
|
3561 |
+
var $link = $$$1([].slice.call(document.querySelectorAll(queries.join(','))));
|
3562 |
|
3563 |
if ($link.hasClass(ClassName.DROPDOWN_ITEM)) {
|
3564 |
$link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
|
3579 |
};
|
3580 |
|
3581 |
_proto._clear = function _clear() {
|
3582 |
+
var nodes = [].slice.call(document.querySelectorAll(this._selector));
|
3583 |
+
$$$1(nodes).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
|
3584 |
}; // Static
|
3585 |
|
3586 |
|
3627 |
|
3628 |
|
3629 |
$$$1(window).on(Event.LOAD_DATA_API, function () {
|
3630 |
+
var scrollSpys = [].slice.call(document.querySelectorAll(Selector.DATA_SPY));
|
3631 |
+
var scrollSpysLength = scrollSpys.length;
|
3632 |
|
3633 |
+
for (var i = scrollSpysLength; i--;) {
|
3634 |
var $spy = $$$1(scrollSpys[i]);
|
3635 |
|
3636 |
ScrollSpy._jQueryInterface.call($spy, $spy.data());
|
3655 |
|
3656 |
/**
|
3657 |
* --------------------------------------------------------------------------
|
3658 |
+
* Bootstrap (v4.1.3): tab.js
|
3659 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3660 |
* --------------------------------------------------------------------------
|
3661 |
*/
|
3667 |
* ------------------------------------------------------------------------
|
3668 |
*/
|
3669 |
var NAME = 'tab';
|
3670 |
+
var VERSION = '4.1.3';
|
3671 |
var DATA_KEY = 'bs.tab';
|
3672 |
var EVENT_KEY = "." + DATA_KEY;
|
3673 |
var DATA_API_KEY = '.data-api';
|
3749 |
}
|
3750 |
|
3751 |
if (selector) {
|
3752 |
+
target = document.querySelector(selector);
|
3753 |
}
|
3754 |
|
3755 |
this._activate(this._element, listElement);
|
3831 |
var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0];
|
3832 |
|
3833 |
if (dropdownElement) {
|
3834 |
+
var dropdownToggleList = [].slice.call(dropdownElement.querySelectorAll(Selector.DROPDOWN_TOGGLE));
|
3835 |
+
$$$1(dropdownToggleList).addClass(ClassName.ACTIVE);
|
3836 |
}
|
3837 |
|
3838 |
element.setAttribute('aria-expanded', true);
|
3904 |
|
3905 |
/**
|
3906 |
* --------------------------------------------------------------------------
|
3907 |
+
* Bootstrap (v4.1.3): index.js
|
3908 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
3909 |
* --------------------------------------------------------------------------
|
3910 |
*/
|
3940 |
|
3941 |
Object.defineProperty(exports, '__esModule', { value: true });
|
3942 |
|
3943 |
+
})));
|
|
@@ -1,7 +1,6 @@
|
|
1 |
/*!
|
2 |
-
* Bootstrap v4.1.
|
3 |
* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
|
4 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5 |
*/
|
6 |
-
!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery"),require("popper.js")):"function"==typeof define&&define.amd?define(["exports","jquery","popper.js"],e):e(t.bootstrap={},t.jQuery,t.Popper)}(this,function(t,e,c){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function o(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function h(r){for(var t=1;t<arguments.length;t++){var s=null!=arguments[t]?arguments[t]:{},e=Object.keys(s);"function"==typeof Object.getOwnPropertySymbols&&(e=e.concat(Object.getOwnPropertySymbols(s).filter(function(t){return Object.getOwnPropertyDescriptor(s,t).enumerable}))),e.forEach(function(t){var e,n,i;e=r,i=s[n=t],n in e?Object.defineProperty(e,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):e[n]=i})}return r}e=e&&e.hasOwnProperty("default")?e.default:e,c=c&&c.hasOwnProperty("default")?c.default:c;var r,n,s,a,l,u,f,d,_,g,m,p,v,E,y,T,C,I,A,D,b,S,w,N,O,k,P,L,j,R,H,W,M,x,U,K,F,V,Q,B,Y,G,q,z,X,J,Z,$,tt,et,nt,it,rt,st,ot,at,lt,ht,ct,ut,ft,dt,_t,gt,mt,pt,vt,Et,yt,Tt,Ct,It,At,Dt,bt,St,wt,Nt,Ot,kt,Pt,Lt,jt,Rt,Ht,Wt,Mt,xt,Ut,Kt,Ft,Vt,Qt,Bt,Yt,Gt,qt,zt,Xt,Jt,Zt,$t,te,ee,ne,ie,re,se,oe,ae,le,he,ce,ue,fe,de,_e,ge,me,pe,ve,Ee,ye,Te,Ce,Ie,Ae,De,be,Se,we,Ne,Oe,ke,Pe,Le,je,Re,He,We,Me,xe,Ue,Ke,Fe,Ve,Qe,Be,Ye,Ge,qe,ze,Xe,Je,Ze,$e,tn,en,nn,rn,sn,on,an,ln,hn,cn,un,fn,dn,_n,gn,mn,pn,vn,En,yn,Tn,Cn=function(i){var e="transitionend";function t(t){var e=this,n=!1;return i(this).one(l.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||l.triggerTransitionEnd(e)},t),this}var l={TRANSITION_END:"bsTransitionEnd",getUID:function(t){for(;t+=~~(1e6*Math.random()),document.getElementById(t););return t},getSelectorFromElement:function(t){var e=t.getAttribute("data-target");e&&"#"!==e||(e=t.getAttribute("href")||"");try{return 0<i(document).find(e).length?e:null}catch(t){return null}},getTransitionDurationFromElement:function(t){if(!t)return 0;var e=i(t).css("transition-duration");return parseFloat(e)?(e=e.split(",")[0],1e3*parseFloat(e)):0},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(t){i(t).trigger(e)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var r=n[i],s=e[i],o=s&&l.isElement(s)?"element":(a=s,{}.toString.call(a).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(r).test(o))throw new Error(t.toUpperCase()+': Option "'+i+'" provided type "'+o+'" but expected type "'+r+'".')}var a}};return i.fn.emulateTransitionEnd=t,i.event.special[l.TRANSITION_END]={bindType:e,delegateType:e,handle:function(t){if(i(t.target).is(this))return t.handleObj.handler.apply(this,arguments)}},l}(e),In=(n="alert",a="."+(s="bs.alert"),l=(r=e).fn[n],u={CLOSE:"close"+a,CLOSED:"closed"+a,CLICK_DATA_API:"click"+a+".data-api"},f="alert",d="fade",_="show",g=function(){function i(t){this._element=t}var t=i.prototype;return t.close=function(t){var e=this._element;t&&(e=this._getRootElement(t)),this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},t.dispose=function(){r.removeData(this._element,s),this._element=null},t._getRootElement=function(t){var e=Cn.getSelectorFromElement(t),n=!1;return e&&(n=r(e)[0]),n||(n=r(t).closest("."+f)[0]),n},t._triggerCloseEvent=function(t){var e=r.Event(u.CLOSE);return r(t).trigger(e),e},t._removeElement=function(e){var n=this;if(r(e).removeClass(_),r(e).hasClass(d)){var t=Cn.getTransitionDurationFromElement(e);r(e).one(Cn.TRANSITION_END,function(t){return n._destroyElement(e,t)}).emulateTransitionEnd(t)}else this._destroyElement(e)},t._destroyElement=function(t){r(t).detach().trigger(u.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var t=r(this),e=t.data(s);e||(e=new i(this),t.data(s,e)),"close"===n&&e[n](this)})},i._handleDismiss=function(e){return function(t){t&&t.preventDefault(),e.close(this)}},o(i,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),i}(),r(document).on(u.CLICK_DATA_API,'[data-dismiss="alert"]',g._handleDismiss(new g)),r.fn[n]=g._jQueryInterface,r.fn[n].Constructor=g,r.fn[n].noConflict=function(){return r.fn[n]=l,g._jQueryInterface},g),An=(p="button",E="."+(v="bs.button"),y=".data-api",T=(m=e).fn[p],C="active",I="btn",D='[data-toggle^="button"]',b='[data-toggle="buttons"]',S="input",w=".active",N=".btn",O={CLICK_DATA_API:"click"+E+y,FOCUS_BLUR_DATA_API:(A="focus")+E+y+" blur"+E+y},k=function(){function n(t){this._element=t}var t=n.prototype;return t.toggle=function(){var t=!0,e=!0,n=m(this._element).closest(b)[0];if(n){var i=m(this._element).find(S)[0];if(i){if("radio"===i.type)if(i.checked&&m(this._element).hasClass(C))t=!1;else{var r=m(n).find(w)[0];r&&m(r).removeClass(C)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!m(this._element).hasClass(C),m(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!m(this._element).hasClass(C)),t&&m(this._element).toggleClass(C)},t.dispose=function(){m.removeData(this._element,v),this._element=null},n._jQueryInterface=function(e){return this.each(function(){var t=m(this).data(v);t||(t=new n(this),m(this).data(v,t)),"toggle"===e&&t[e]()})},o(n,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),n}(),m(document).on(O.CLICK_DATA_API,D,function(t){t.preventDefault();var e=t.target;m(e).hasClass(I)||(e=m(e).closest(N)),k._jQueryInterface.call(m(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,D,function(t){var e=m(t.target).closest(N)[0];m(e).toggleClass(A,/^focus(in)?$/.test(t.type))}),m.fn[p]=k._jQueryInterface,m.fn[p].Constructor=k,m.fn[p].noConflict=function(){return m.fn[p]=T,k._jQueryInterface},k),Dn=(L="carousel",R="."+(j="bs.carousel"),H=".data-api",W=(P=e).fn[L],M={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},x={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},U="next",K="prev",F="left",V="right",Q={SLIDE:"slide"+R,SLID:"slid"+R,KEYDOWN:"keydown"+R,MOUSEENTER:"mouseenter"+R,MOUSELEAVE:"mouseleave"+R,TOUCHEND:"touchend"+R,LOAD_DATA_API:"load"+R+H,CLICK_DATA_API:"click"+R+H},B="carousel",Y="active",G="slide",q="carousel-item-right",z="carousel-item-left",X="carousel-item-next",J="carousel-item-prev",Z={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},$=function(){function s(t,e){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(e),this._element=P(t)[0],this._indicatorsElement=P(this._element).find(Z.INDICATORS)[0],this._addEventListeners()}var t=s.prototype;return t.next=function(){this._isSliding||this._slide(U)},t.nextWhenVisible=function(){!document.hidden&&P(this._element).is(":visible")&&"hidden"!==P(this._element).css("visibility")&&this.next()},t.prev=function(){this._isSliding||this._slide(K)},t.pause=function(t){t||(this._isPaused=!0),P(this._element).find(Z.NEXT_PREV)[0]&&(Cn.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},t.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},t.to=function(t){var e=this;this._activeElement=P(this._element).find(Z.ACTIVE_ITEM)[0];var n=this._getItemIndex(this._activeElement);if(!(t>this._items.length-1||t<0))if(this._isSliding)P(this._element).one(Q.SLID,function(){return e.to(t)});else{if(n===t)return this.pause(),void this.cycle();var i=n<t?U:K;this._slide(i,this._items[t])}},t.dispose=function(){P(this._element).off(R),P.removeData(this._element,j),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},t._getConfig=function(t){return t=h({},M,t),Cn.typeCheckConfig(L,t,x),t},t._addEventListeners=function(){var e=this;this._config.keyboard&&P(this._element).on(Q.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(P(this._element).on(Q.MOUSEENTER,function(t){return e.pause(t)}).on(Q.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&P(this._element).on(Q.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},t._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},t._getItemIndex=function(t){return this._items=P.makeArray(P(t).parent().find(Z.ITEM)),this._items.indexOf(t)},t._getItemByDirection=function(t,e){var n=t===U,i=t===K,r=this._getItemIndex(e),s=this._items.length-1;if((i&&0===r||n&&r===s)&&!this._config.wrap)return e;var o=(r+(t===K?-1:1))%this._items.length;return-1===o?this._items[this._items.length-1]:this._items[o]},t._triggerSlideEvent=function(t,e){var n=this._getItemIndex(t),i=this._getItemIndex(P(this._element).find(Z.ACTIVE_ITEM)[0]),r=P.Event(Q.SLIDE,{relatedTarget:t,direction:e,from:i,to:n});return P(this._element).trigger(r),r},t._setActiveIndicatorElement=function(t){if(this._indicatorsElement){P(this._indicatorsElement).find(Z.ACTIVE).removeClass(Y);var e=this._indicatorsElement.children[this._getItemIndex(t)];e&&P(e).addClass(Y)}},t._slide=function(t,e){var n,i,r,s=this,o=P(this._element).find(Z.ACTIVE_ITEM)[0],a=this._getItemIndex(o),l=e||o&&this._getItemByDirection(t,o),h=this._getItemIndex(l),c=Boolean(this._interval);if(t===U?(n=z,i=X,r=F):(n=q,i=J,r=V),l&&P(l).hasClass(Y))this._isSliding=!1;else if(!this._triggerSlideEvent(l,r).isDefaultPrevented()&&o&&l){this._isSliding=!0,c&&this.pause(),this._setActiveIndicatorElement(l);var u=P.Event(Q.SLID,{relatedTarget:l,direction:r,from:a,to:h});if(P(this._element).hasClass(G)){P(l).addClass(i),Cn.reflow(l),P(o).addClass(n),P(l).addClass(n);var f=Cn.getTransitionDurationFromElement(o);P(o).one(Cn.TRANSITION_END,function(){P(l).removeClass(n+" "+i).addClass(Y),P(o).removeClass(Y+" "+i+" "+n),s._isSliding=!1,setTimeout(function(){return P(s._element).trigger(u)},0)}).emulateTransitionEnd(f)}else P(o).removeClass(Y),P(l).addClass(Y),this._isSliding=!1,P(this._element).trigger(u);c&&this.cycle()}},s._jQueryInterface=function(i){return this.each(function(){var t=P(this).data(j),e=h({},M,P(this).data());"object"==typeof i&&(e=h({},e,i));var n="string"==typeof i?i:e.slide;if(t||(t=new s(this,e),P(this).data(j,t)),"number"==typeof i)t.to(i);else if("string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}else e.interval&&(t.pause(),t.cycle())})},s._dataApiClickHandler=function(t){var e=Cn.getSelectorFromElement(this);if(e){var n=P(e)[0];if(n&&P(n).hasClass(B)){var i=h({},P(n).data(),P(this).data()),r=this.getAttribute("data-slide-to");r&&(i.interval=!1),s._jQueryInterface.call(P(n),i),r&&P(n).data(j).to(r),t.preventDefault()}}},o(s,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return M}}]),s}(),P(document).on(Q.CLICK_DATA_API,Z.DATA_SLIDE,$._dataApiClickHandler),P(window).on(Q.LOAD_DATA_API,function(){P(Z.DATA_RIDE).each(function(){var t=P(this);$._jQueryInterface.call(t,t.data())})}),P.fn[L]=$._jQueryInterface,P.fn[L].Constructor=$,P.fn[L].noConflict=function(){return P.fn[L]=W,$._jQueryInterface},$),bn=(et="collapse",it="."+(nt="bs.collapse"),rt=(tt=e).fn[et],st={toggle:!0,parent:""},ot={toggle:"boolean",parent:"(string|element)"},at={SHOW:"show"+it,SHOWN:"shown"+it,HIDE:"hide"+it,HIDDEN:"hidden"+it,CLICK_DATA_API:"click"+it+".data-api"},lt="show",ht="collapse",ct="collapsing",ut="collapsed",ft="width",dt="height",_t={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},gt=function(){function a(t,e){this._isTransitioning=!1,this._element=t,this._config=this._getConfig(e),this._triggerArray=tt.makeArray(tt('[data-toggle="collapse"][href="#'+t.id+'"],[data-toggle="collapse"][data-target="#'+t.id+'"]'));for(var n=tt(_t.DATA_TOGGLE),i=0;i<n.length;i++){var r=n[i],s=Cn.getSelectorFromElement(r);null!==s&&0<tt(s).filter(t).length&&(this._selector=s,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var t=a.prototype;return t.toggle=function(){tt(this._element).hasClass(lt)?this.hide():this.show()},t.show=function(){var t,e,n=this;if(!this._isTransitioning&&!tt(this._element).hasClass(lt)&&(this._parent&&0===(t=tt.makeArray(tt(this._parent).find(_t.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(t=null),!(t&&(e=tt(t).not(this._selector).data(nt))&&e._isTransitioning))){var i=tt.Event(at.SHOW);if(tt(this._element).trigger(i),!i.isDefaultPrevented()){t&&(a._jQueryInterface.call(tt(t).not(this._selector),"hide"),e||tt(t).data(nt,null));var r=this._getDimension();tt(this._element).removeClass(ht).addClass(ct),(this._element.style[r]=0)<this._triggerArray.length&&tt(this._triggerArray).removeClass(ut).attr("aria-expanded",!0),this.setTransitioning(!0);var s="scroll"+(r[0].toUpperCase()+r.slice(1)),o=Cn.getTransitionDurationFromElement(this._element);tt(this._element).one(Cn.TRANSITION_END,function(){tt(n._element).removeClass(ct).addClass(ht).addClass(lt),n._element.style[r]="",n.setTransitioning(!1),tt(n._element).trigger(at.SHOWN)}).emulateTransitionEnd(o),this._element.style[r]=this._element[s]+"px"}}},t.hide=function(){var t=this;if(!this._isTransitioning&&tt(this._element).hasClass(lt)){var e=tt.Event(at.HIDE);if(tt(this._element).trigger(e),!e.isDefaultPrevented()){var n=this._getDimension();if(this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",Cn.reflow(this._element),tt(this._element).addClass(ct).removeClass(ht).removeClass(lt),0<this._triggerArray.length)for(var i=0;i<this._triggerArray.length;i++){var r=this._triggerArray[i],s=Cn.getSelectorFromElement(r);if(null!==s)tt(s).hasClass(lt)||tt(r).addClass(ut).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var o=Cn.getTransitionDurationFromElement(this._element);tt(this._element).one(Cn.TRANSITION_END,function(){t.setTransitioning(!1),tt(t._element).removeClass(ct).addClass(ht).trigger(at.HIDDEN)}).emulateTransitionEnd(o)}}},t.setTransitioning=function(t){this._isTransitioning=t},t.dispose=function(){tt.removeData(this._element,nt),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},t._getConfig=function(t){return(t=h({},st,t)).toggle=Boolean(t.toggle),Cn.typeCheckConfig(et,t,ot),t},t._getDimension=function(){return tt(this._element).hasClass(ft)?ft:dt},t._getParent=function(){var n=this,t=null;Cn.isElement(this._config.parent)?(t=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(t=this._config.parent[0])):t=tt(this._config.parent)[0];var e='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return tt(t).find(e).each(function(t,e){n._addAriaAndCollapsedClass(a._getTargetFromElement(e),[e])}),t},t._addAriaAndCollapsedClass=function(t,e){if(t){var n=tt(t).hasClass(lt);0<e.length&&tt(e).toggleClass(ut,!n).attr("aria-expanded",n)}},a._getTargetFromElement=function(t){var e=Cn.getSelectorFromElement(t);return e?tt(e)[0]:null},a._jQueryInterface=function(i){return this.each(function(){var t=tt(this),e=t.data(nt),n=h({},st,t.data(),"object"==typeof i&&i?i:{});if(!e&&n.toggle&&/show|hide/.test(i)&&(n.toggle=!1),e||(e=new a(this,n),t.data(nt,e)),"string"==typeof i){if("undefined"==typeof e[i])throw new TypeError('No method named "'+i+'"');e[i]()}})},o(a,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return st}}]),a}(),tt(document).on(at.CLICK_DATA_API,_t.DATA_TOGGLE,function(t){"A"===t.currentTarget.tagName&&t.preventDefault();var n=tt(this),e=Cn.getSelectorFromElement(this);tt(e).each(function(){var t=tt(this),e=t.data(nt)?"toggle":n.data();gt._jQueryInterface.call(t,e)})}),tt.fn[et]=gt._jQueryInterface,tt.fn[et].Constructor=gt,tt.fn[et].noConflict=function(){return tt.fn[et]=rt,gt._jQueryInterface},gt),Sn=(pt="dropdown",Et="."+(vt="bs.dropdown"),yt=".data-api",Tt=(mt=e).fn[pt],Ct=new RegExp("38|40|27"),It={HIDE:"hide"+Et,HIDDEN:"hidden"+Et,SHOW:"show"+Et,SHOWN:"shown"+Et,CLICK:"click"+Et,CLICK_DATA_API:"click"+Et+yt,KEYDOWN_DATA_API:"keydown"+Et+yt,KEYUP_DATA_API:"keyup"+Et+yt},At="disabled",Dt="show",bt="dropup",St="dropright",wt="dropleft",Nt="dropdown-menu-right",Ot="position-static",kt='[data-toggle="dropdown"]',Pt=".dropdown form",Lt=".dropdown-menu",jt=".navbar-nav",Rt=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",Ht="top-start",Wt="top-end",Mt="bottom-start",xt="bottom-end",Ut="right-start",Kt="left-start",Ft={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},Vt={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Qt=function(){function l(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var t=l.prototype;return t.toggle=function(){if(!this._element.disabled&&!mt(this._element).hasClass(At)){var t=l._getParentFromElement(this._element),e=mt(this._menu).hasClass(Dt);if(l._clearMenus(),!e){var n={relatedTarget:this._element},i=mt.Event(It.SHOW,n);if(mt(t).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof c)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var r=this._element;"parent"===this._config.reference?r=t:Cn.isElement(this._config.reference)&&(r=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(r=this._config.reference[0])),"scrollParent"!==this._config.boundary&&mt(t).addClass(Ot),this._popper=new c(r,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===mt(t).closest(jt).length&&mt(document.body).children().on("mouseover",null,mt.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),mt(this._menu).toggleClass(Dt),mt(t).toggleClass(Dt).trigger(mt.Event(It.SHOWN,n))}}}},t.dispose=function(){mt.removeData(this._element,vt),mt(this._element).off(Et),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},t.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},t._addEventListeners=function(){var e=this;mt(this._element).on(It.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},t._getConfig=function(t){return t=h({},this.constructor.Default,mt(this._element).data(),t),Cn.typeCheckConfig(pt,t,this.constructor.DefaultType),t},t._getMenuElement=function(){if(!this._menu){var t=l._getParentFromElement(this._element);this._menu=mt(t).find(Lt)[0]}return this._menu},t._getPlacement=function(){var t=mt(this._element).parent(),e=Mt;return t.hasClass(bt)?(e=Ht,mt(this._menu).hasClass(Nt)&&(e=Wt)):t.hasClass(St)?e=Ut:t.hasClass(wt)?e=Kt:mt(this._menu).hasClass(Nt)&&(e=xt),e},t._detectNavbar=function(){return 0<mt(this._element).closest(".navbar").length},t._getPopperConfig=function(){var e=this,t={};"function"==typeof this._config.offset?t.fn=function(t){return t.offsets=h({},t.offsets,e._config.offset(t.offsets)||{}),t}:t.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:t,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},l._jQueryInterface=function(e){return this.each(function(){var t=mt(this).data(vt);if(t||(t=new l(this,"object"==typeof e?e:null),mt(this).data(vt,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},l._clearMenus=function(t){if(!t||3!==t.which&&("keyup"!==t.type||9===t.which))for(var e=mt.makeArray(mt(kt)),n=0;n<e.length;n++){var i=l._getParentFromElement(e[n]),r=mt(e[n]).data(vt),s={relatedTarget:e[n]};if(r){var o=r._menu;if(mt(i).hasClass(Dt)&&!(t&&("click"===t.type&&/input|textarea/i.test(t.target.tagName)||"keyup"===t.type&&9===t.which)&&mt.contains(i,t.target))){var a=mt.Event(It.HIDE,s);mt(i).trigger(a),a.isDefaultPrevented()||("ontouchstart"in document.documentElement&&mt(document.body).children().off("mouseover",null,mt.noop),e[n].setAttribute("aria-expanded","false"),mt(o).removeClass(Dt),mt(i).removeClass(Dt).trigger(mt.Event(It.HIDDEN,s)))}}}},l._getParentFromElement=function(t){var e,n=Cn.getSelectorFromElement(t);return n&&(e=mt(n)[0]),e||t.parentNode},l._dataApiKeydownHandler=function(t){if((/input|textarea/i.test(t.target.tagName)?!(32===t.which||27!==t.which&&(40!==t.which&&38!==t.which||mt(t.target).closest(Lt).length)):Ct.test(t.which))&&(t.preventDefault(),t.stopPropagation(),!this.disabled&&!mt(this).hasClass(At))){var e=l._getParentFromElement(this),n=mt(e).hasClass(Dt);if((n||27===t.which&&32===t.which)&&(!n||27!==t.which&&32!==t.which)){var i=mt(e).find(Rt).get();if(0!==i.length){var r=i.indexOf(t.target);38===t.which&&0<r&&r--,40===t.which&&r<i.length-1&&r++,r<0&&(r=0),i[r].focus()}}else{if(27===t.which){var s=mt(e).find(kt)[0];mt(s).trigger("focus")}mt(this).trigger("click")}}},o(l,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Ft}},{key:"DefaultType",get:function(){return Vt}}]),l}(),mt(document).on(It.KEYDOWN_DATA_API,kt,Qt._dataApiKeydownHandler).on(It.KEYDOWN_DATA_API,Lt,Qt._dataApiKeydownHandler).on(It.CLICK_DATA_API+" "+It.KEYUP_DATA_API,Qt._clearMenus).on(It.CLICK_DATA_API,kt,function(t){t.preventDefault(),t.stopPropagation(),Qt._jQueryInterface.call(mt(this),"toggle")}).on(It.CLICK_DATA_API,Pt,function(t){t.stopPropagation()}),mt.fn[pt]=Qt._jQueryInterface,mt.fn[pt].Constructor=Qt,mt.fn[pt].noConflict=function(){return mt.fn[pt]=Tt,Qt._jQueryInterface},Qt),wn=(Yt="modal",qt="."+(Gt="bs.modal"),zt=(Bt=e).fn[Yt],Xt={backdrop:!0,keyboard:!0,focus:!0,show:!0},Jt={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},Zt={HIDE:"hide"+qt,HIDDEN:"hidden"+qt,SHOW:"show"+qt,SHOWN:"shown"+qt,FOCUSIN:"focusin"+qt,RESIZE:"resize"+qt,CLICK_DISMISS:"click.dismiss"+qt,KEYDOWN_DISMISS:"keydown.dismiss"+qt,MOUSEUP_DISMISS:"mouseup.dismiss"+qt,MOUSEDOWN_DISMISS:"mousedown.dismiss"+qt,CLICK_DATA_API:"click"+qt+".data-api"},$t="modal-scrollbar-measure",te="modal-backdrop",ee="modal-open",ne="fade",ie="show",re={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},se=function(){function r(t,e){this._config=this._getConfig(e),this._element=t,this._dialog=Bt(t).find(re.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._scrollbarWidth=0}var t=r.prototype;return t.toggle=function(t){return this._isShown?this.hide():this.show(t)},t.show=function(t){var e=this;if(!this._isTransitioning&&!this._isShown){Bt(this._element).hasClass(ne)&&(this._isTransitioning=!0);var n=Bt.Event(Zt.SHOW,{relatedTarget:t});Bt(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),Bt(document.body).addClass(ee),this._setEscapeEvent(),this._setResizeEvent(),Bt(this._element).on(Zt.CLICK_DISMISS,re.DATA_DISMISS,function(t){return e.hide(t)}),Bt(this._dialog).on(Zt.MOUSEDOWN_DISMISS,function(){Bt(e._element).one(Zt.MOUSEUP_DISMISS,function(t){Bt(t.target).is(e._element)&&(e._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return e._showElement(t)}))}},t.hide=function(t){var e=this;if(t&&t.preventDefault(),!this._isTransitioning&&this._isShown){var n=Bt.Event(Zt.HIDE);if(Bt(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=Bt(this._element).hasClass(ne);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),Bt(document).off(Zt.FOCUSIN),Bt(this._element).removeClass(ie),Bt(this._element).off(Zt.CLICK_DISMISS),Bt(this._dialog).off(Zt.MOUSEDOWN_DISMISS),i){var r=Cn.getTransitionDurationFromElement(this._element);Bt(this._element).one(Cn.TRANSITION_END,function(t){return e._hideModal(t)}).emulateTransitionEnd(r)}else this._hideModal()}}},t.dispose=function(){Bt.removeData(this._element,Gt),Bt(window,document,this._element,this._backdrop).off(qt),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},t.handleUpdate=function(){this._adjustDialog()},t._getConfig=function(t){return t=h({},Xt,t),Cn.typeCheckConfig(Yt,t,Jt),t},t._showElement=function(t){var e=this,n=Bt(this._element).hasClass(ne);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,n&&Cn.reflow(this._element),Bt(this._element).addClass(ie),this._config.focus&&this._enforceFocus();var i=Bt.Event(Zt.SHOWN,{relatedTarget:t}),r=function(){e._config.focus&&e._element.focus(),e._isTransitioning=!1,Bt(e._element).trigger(i)};if(n){var s=Cn.getTransitionDurationFromElement(this._element);Bt(this._dialog).one(Cn.TRANSITION_END,r).emulateTransitionEnd(s)}else r()},t._enforceFocus=function(){var e=this;Bt(document).off(Zt.FOCUSIN).on(Zt.FOCUSIN,function(t){document!==t.target&&e._element!==t.target&&0===Bt(e._element).has(t.target).length&&e._element.focus()})},t._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?Bt(this._element).on(Zt.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||Bt(this._element).off(Zt.KEYDOWN_DISMISS)},t._setResizeEvent=function(){var e=this;this._isShown?Bt(window).on(Zt.RESIZE,function(t){return e.handleUpdate(t)}):Bt(window).off(Zt.RESIZE)},t._hideModal=function(){var t=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){Bt(document.body).removeClass(ee),t._resetAdjustments(),t._resetScrollbar(),Bt(t._element).trigger(Zt.HIDDEN)})},t._removeBackdrop=function(){this._backdrop&&(Bt(this._backdrop).remove(),this._backdrop=null)},t._showBackdrop=function(t){var e=this,n=Bt(this._element).hasClass(ne)?ne:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=te,n&&Bt(this._backdrop).addClass(n),Bt(this._backdrop).appendTo(document.body),Bt(this._element).on(Zt.CLICK_DISMISS,function(t){e._ignoreBackdropClick?e._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===e._config.backdrop?e._element.focus():e.hide())}),n&&Cn.reflow(this._backdrop),Bt(this._backdrop).addClass(ie),!t)return;if(!n)return void t();var i=Cn.getTransitionDurationFromElement(this._backdrop);Bt(this._backdrop).one(Cn.TRANSITION_END,t).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){Bt(this._backdrop).removeClass(ie);var r=function(){e._removeBackdrop(),t&&t()};if(Bt(this._element).hasClass(ne)){var s=Cn.getTransitionDurationFromElement(this._backdrop);Bt(this._backdrop).one(Cn.TRANSITION_END,r).emulateTransitionEnd(s)}else r()}else t&&t()},t._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},t._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},t._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},t._setScrollbar=function(){var r=this;if(this._isBodyOverflowing){Bt(re.FIXED_CONTENT).each(function(t,e){var n=Bt(e)[0].style.paddingRight,i=Bt(e).css("padding-right");Bt(e).data("padding-right",n).css("padding-right",parseFloat(i)+r._scrollbarWidth+"px")}),Bt(re.STICKY_CONTENT).each(function(t,e){var n=Bt(e)[0].style.marginRight,i=Bt(e).css("margin-right");Bt(e).data("margin-right",n).css("margin-right",parseFloat(i)-r._scrollbarWidth+"px")}),Bt(re.NAVBAR_TOGGLER).each(function(t,e){var n=Bt(e)[0].style.marginRight,i=Bt(e).css("margin-right");Bt(e).data("margin-right",n).css("margin-right",parseFloat(i)+r._scrollbarWidth+"px")});var t=document.body.style.paddingRight,e=Bt(document.body).css("padding-right");Bt(document.body).data("padding-right",t).css("padding-right",parseFloat(e)+this._scrollbarWidth+"px")}},t._resetScrollbar=function(){Bt(re.FIXED_CONTENT).each(function(t,e){var n=Bt(e).data("padding-right");"undefined"!=typeof n&&Bt(e).css("padding-right",n).removeData("padding-right")}),Bt(re.STICKY_CONTENT+", "+re.NAVBAR_TOGGLER).each(function(t,e){var n=Bt(e).data("margin-right");"undefined"!=typeof n&&Bt(e).css("margin-right",n).removeData("margin-right")});var t=Bt(document.body).data("padding-right");"undefined"!=typeof t&&Bt(document.body).css("padding-right",t).removeData("padding-right")},t._getScrollbarWidth=function(){var t=document.createElement("div");t.className=$t,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},r._jQueryInterface=function(n,i){return this.each(function(){var t=Bt(this).data(Gt),e=h({},Xt,Bt(this).data(),"object"==typeof n&&n?n:{});if(t||(t=new r(this,e),Bt(this).data(Gt,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},o(r,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Xt}}]),r}(),Bt(document).on(Zt.CLICK_DATA_API,re.DATA_TOGGLE,function(t){var e,n=this,i=Cn.getSelectorFromElement(this);i&&(e=Bt(i)[0]);var r=Bt(e).data(Gt)?"toggle":h({},Bt(e).data(),Bt(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||t.preventDefault();var s=Bt(e).one(Zt.SHOW,function(t){t.isDefaultPrevented()||s.one(Zt.HIDDEN,function(){Bt(n).is(":visible")&&n.focus()})});se._jQueryInterface.call(Bt(e),r,this)}),Bt.fn[Yt]=se._jQueryInterface,Bt.fn[Yt].Constructor=se,Bt.fn[Yt].noConflict=function(){return Bt.fn[Yt]=zt,se._jQueryInterface},se),Nn=(ae="tooltip",he="."+(le="bs.tooltip"),ce=(oe=e).fn[ae],ue="bs-tooltip",fe=new RegExp("(^|\\s)"+ue+"\\S+","g"),ge={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!(_e={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"}),selector:!(de={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"}),placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},pe="out",ve={HIDE:"hide"+he,HIDDEN:"hidden"+he,SHOW:(me="show")+he,SHOWN:"shown"+he,INSERTED:"inserted"+he,CLICK:"click"+he,FOCUSIN:"focusin"+he,FOCUSOUT:"focusout"+he,MOUSEENTER:"mouseenter"+he,MOUSELEAVE:"mouseleave"+he},Ee="fade",ye="show",Te=".tooltip-inner",Ce=".arrow",Ie="hover",Ae="focus",De="click",be="manual",Se=function(){function i(t,e){if("undefined"==typeof c)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var t=i.prototype;return t.enable=function(){this._isEnabled=!0},t.disable=function(){this._isEnabled=!1},t.toggleEnabled=function(){this._isEnabled=!this._isEnabled},t.toggle=function(t){if(this._isEnabled)if(t){var e=this.constructor.DATA_KEY,n=oe(t.currentTarget).data(e);n||(n=new this.constructor(t.currentTarget,this._getDelegateConfig()),oe(t.currentTarget).data(e,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(oe(this.getTipElement()).hasClass(ye))return void this._leave(null,this);this._enter(null,this)}},t.dispose=function(){clearTimeout(this._timeout),oe.removeData(this.element,this.constructor.DATA_KEY),oe(this.element).off(this.constructor.EVENT_KEY),oe(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&oe(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},t.show=function(){var e=this;if("none"===oe(this.element).css("display"))throw new Error("Please use show on visible elements");var t=oe.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){oe(this.element).trigger(t);var n=oe.contains(this.element.ownerDocument.documentElement,this.element);if(t.isDefaultPrevented()||!n)return;var i=this.getTipElement(),r=Cn.getUID(this.constructor.NAME);i.setAttribute("id",r),this.element.setAttribute("aria-describedby",r),this.setContent(),this.config.animation&&oe(i).addClass(Ee);var s="function"==typeof this.config.placement?this.config.placement.call(this,i,this.element):this.config.placement,o=this._getAttachment(s);this.addAttachmentClass(o);var a=!1===this.config.container?document.body:oe(this.config.container);oe(i).data(this.constructor.DATA_KEY,this),oe.contains(this.element.ownerDocument.documentElement,this.tip)||oe(i).appendTo(a),oe(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new c(this.element,i,{placement:o,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:Ce},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),oe(i).addClass(ye),"ontouchstart"in document.documentElement&&oe(document.body).children().on("mouseover",null,oe.noop);var l=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,oe(e.element).trigger(e.constructor.Event.SHOWN),t===pe&&e._leave(null,e)};if(oe(this.tip).hasClass(Ee)){var h=Cn.getTransitionDurationFromElement(this.tip);oe(this.tip).one(Cn.TRANSITION_END,l).emulateTransitionEnd(h)}else l()}},t.hide=function(t){var e=this,n=this.getTipElement(),i=oe.Event(this.constructor.Event.HIDE),r=function(){e._hoverState!==me&&n.parentNode&&n.parentNode.removeChild(n),e._cleanTipClass(),e.element.removeAttribute("aria-describedby"),oe(e.element).trigger(e.constructor.Event.HIDDEN),null!==e._popper&&e._popper.destroy(),t&&t()};if(oe(this.element).trigger(i),!i.isDefaultPrevented()){if(oe(n).removeClass(ye),"ontouchstart"in document.documentElement&&oe(document.body).children().off("mouseover",null,oe.noop),this._activeTrigger[De]=!1,this._activeTrigger[Ae]=!1,this._activeTrigger[Ie]=!1,oe(this.tip).hasClass(Ee)){var s=Cn.getTransitionDurationFromElement(n);oe(n).one(Cn.TRANSITION_END,r).emulateTransitionEnd(s)}else r();this._hoverState=""}},t.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},t.isWithContent=function(){return Boolean(this.getTitle())},t.addAttachmentClass=function(t){oe(this.getTipElement()).addClass(ue+"-"+t)},t.getTipElement=function(){return this.tip=this.tip||oe(this.config.template)[0],this.tip},t.setContent=function(){var t=oe(this.getTipElement());this.setElementContent(t.find(Te),this.getTitle()),t.removeClass(Ee+" "+ye)},t.setElementContent=function(t,e){var n=this.config.html;"object"==typeof e&&(e.nodeType||e.jquery)?n?oe(e).parent().is(t)||t.empty().append(e):t.text(oe(e).text()):t[n?"html":"text"](e)},t.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},t._getAttachment=function(t){return _e[t.toUpperCase()]},t._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(t){if("click"===t)oe(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(t){return i.toggle(t)});else if(t!==be){var e=t===Ie?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=t===Ie?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;oe(i.element).on(e,i.config.selector,function(t){return i._enter(t)}).on(n,i.config.selector,function(t){return i._leave(t)})}oe(i.element).closest(".modal").on("hide.bs.modal",function(){return i.hide()})}),this.config.selector?this.config=h({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},t._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},t._enter=function(t,e){var n=this.constructor.DATA_KEY;(e=e||oe(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),oe(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusin"===t.type?Ae:Ie]=!0),oe(e.getTipElement()).hasClass(ye)||e._hoverState===me?e._hoverState=me:(clearTimeout(e._timeout),e._hoverState=me,e.config.delay&&e.config.delay.show?e._timeout=setTimeout(function(){e._hoverState===me&&e.show()},e.config.delay.show):e.show())},t._leave=function(t,e){var n=this.constructor.DATA_KEY;(e=e||oe(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),oe(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusout"===t.type?Ae:Ie]=!1),e._isWithActiveTrigger()||(clearTimeout(e._timeout),e._hoverState=pe,e.config.delay&&e.config.delay.hide?e._timeout=setTimeout(function(){e._hoverState===pe&&e.hide()},e.config.delay.hide):e.hide())},t._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},t._getConfig=function(t){return"number"==typeof(t=h({},this.constructor.Default,oe(this.element).data(),"object"==typeof t&&t?t:{})).delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),Cn.typeCheckConfig(ae,t,this.constructor.DefaultType),t},t._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},t._cleanTipClass=function(){var t=oe(this.getTipElement()),e=t.attr("class").match(fe);null!==e&&0<e.length&&t.removeClass(e.join(""))},t._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},t._fixTransition=function(){var t=this.getTipElement(),e=this.config.animation;null===t.getAttribute("x-placement")&&(oe(t).removeClass(Ee),this.config.animation=!1,this.hide(),this.show(),this.config.animation=e)},i._jQueryInterface=function(n){return this.each(function(){var t=oe(this).data(le),e="object"==typeof n&&n;if((t||!/dispose|hide/.test(n))&&(t||(t=new i(this,e),oe(this).data(le,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},o(i,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return ge}},{key:"NAME",get:function(){return ae}},{key:"DATA_KEY",get:function(){return le}},{key:"Event",get:function(){return ve}},{key:"EVENT_KEY",get:function(){return he}},{key:"DefaultType",get:function(){return de}}]),i}(),oe.fn[ae]=Se._jQueryInterface,oe.fn[ae].Constructor=Se,oe.fn[ae].noConflict=function(){return oe.fn[ae]=ce,Se._jQueryInterface},Se),On=(Ne="popover",ke="."+(Oe="bs.popover"),Pe=(we=e).fn[Ne],Le="bs-popover",je=new RegExp("(^|\\s)"+Le+"\\S+","g"),Re=h({},Nn.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),He=h({},Nn.DefaultType,{content:"(string|element|function)"}),We="fade",xe=".popover-header",Ue=".popover-body",Ke={HIDE:"hide"+ke,HIDDEN:"hidden"+ke,SHOW:(Me="show")+ke,SHOWN:"shown"+ke,INSERTED:"inserted"+ke,CLICK:"click"+ke,FOCUSIN:"focusin"+ke,FOCUSOUT:"focusout"+ke,MOUSEENTER:"mouseenter"+ke,MOUSELEAVE:"mouseleave"+ke},Fe=function(t){var e,n;function i(){return t.apply(this,arguments)||this}n=t,(e=i).prototype=Object.create(n.prototype),(e.prototype.constructor=e).__proto__=n;var r=i.prototype;return r.isWithContent=function(){return this.getTitle()||this._getContent()},r.addAttachmentClass=function(t){we(this.getTipElement()).addClass(Le+"-"+t)},r.getTipElement=function(){return this.tip=this.tip||we(this.config.template)[0],this.tip},r.setContent=function(){var t=we(this.getTipElement());this.setElementContent(t.find(xe),this.getTitle());var e=this._getContent();"function"==typeof e&&(e=e.call(this.element)),this.setElementContent(t.find(Ue),e),t.removeClass(We+" "+Me)},r._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},r._cleanTipClass=function(){var t=we(this.getTipElement()),e=t.attr("class").match(je);null!==e&&0<e.length&&t.removeClass(e.join(""))},i._jQueryInterface=function(n){return this.each(function(){var t=we(this).data(Oe),e="object"==typeof n?n:null;if((t||!/destroy|hide/.test(n))&&(t||(t=new i(this,e),we(this).data(Oe,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},o(i,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Re}},{key:"NAME",get:function(){return Ne}},{key:"DATA_KEY",get:function(){return Oe}},{key:"Event",get:function(){return Ke}},{key:"EVENT_KEY",get:function(){return ke}},{key:"DefaultType",get:function(){return He}}]),i}(Nn),we.fn[Ne]=Fe._jQueryInterface,we.fn[Ne].Constructor=Fe,we.fn[Ne].noConflict=function(){return we.fn[Ne]=Pe,Fe._jQueryInterface},Fe),kn=(Qe="scrollspy",Ye="."+(Be="bs.scrollspy"),Ge=(Ve=e).fn[Qe],qe={offset:10,method:"auto",target:""},ze={offset:"number",method:"string",target:"(string|element)"},Xe={ACTIVATE:"activate"+Ye,SCROLL:"scroll"+Ye,LOAD_DATA_API:"load"+Ye+".data-api"},Je="dropdown-item",Ze="active",$e={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},tn="offset",en="position",nn=function(){function n(t,e){var n=this;this._element=t,this._scrollElement="BODY"===t.tagName?window:t,this._config=this._getConfig(e),this._selector=this._config.target+" "+$e.NAV_LINKS+","+this._config.target+" "+$e.LIST_ITEMS+","+this._config.target+" "+$e.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,Ve(this._scrollElement).on(Xe.SCROLL,function(t){return n._process(t)}),this.refresh(),this._process()}var t=n.prototype;return t.refresh=function(){var e=this,t=this._scrollElement===this._scrollElement.window?tn:en,r="auto"===this._config.method?t:this._config.method,s=r===en?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),Ve.makeArray(Ve(this._selector)).map(function(t){var e,n=Cn.getSelectorFromElement(t);if(n&&(e=Ve(n)[0]),e){var i=e.getBoundingClientRect();if(i.width||i.height)return[Ve(e)[r]().top+s,n]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},t.dispose=function(){Ve.removeData(this._element,Be),Ve(this._scrollElement).off(Ye),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},t._getConfig=function(t){if("string"!=typeof(t=h({},qe,"object"==typeof t&&t?t:{})).target){var e=Ve(t.target).attr("id");e||(e=Cn.getUID(Qe),Ve(t.target).attr("id",e)),t.target="#"+e}return Cn.typeCheckConfig(Qe,t,ze),t},t._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},t._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},t._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},t._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),n<=t){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t<this._offsets[r+1])&&this._activate(this._targets[r])}}},t._activate=function(e){this._activeTarget=e,this._clear();var t=this._selector.split(",");t=t.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var n=Ve(t.join(","));n.hasClass(Je)?(n.closest($e.DROPDOWN).find($e.DROPDOWN_TOGGLE).addClass(Ze),n.addClass(Ze)):(n.addClass(Ze),n.parents($e.NAV_LIST_GROUP).prev($e.NAV_LINKS+", "+$e.LIST_ITEMS).addClass(Ze),n.parents($e.NAV_LIST_GROUP).prev($e.NAV_ITEMS).children($e.NAV_LINKS).addClass(Ze)),Ve(this._scrollElement).trigger(Xe.ACTIVATE,{relatedTarget:e})},t._clear=function(){Ve(this._selector).filter($e.ACTIVE).removeClass(Ze)},n._jQueryInterface=function(e){return this.each(function(){var t=Ve(this).data(Be);if(t||(t=new n(this,"object"==typeof e&&e),Ve(this).data(Be,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},o(n,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return qe}}]),n}(),Ve(window).on(Xe.LOAD_DATA_API,function(){for(var t=Ve.makeArray(Ve($e.DATA_SPY)),e=t.length;e--;){var n=Ve(t[e]);nn._jQueryInterface.call(n,n.data())}}),Ve.fn[Qe]=nn._jQueryInterface,Ve.fn[Qe].Constructor=nn,Ve.fn[Qe].noConflict=function(){return Ve.fn[Qe]=Ge,nn._jQueryInterface},nn),Pn=(on="."+(sn="bs.tab"),an=(rn=e).fn.tab,ln={HIDE:"hide"+on,HIDDEN:"hidden"+on,SHOW:"show"+on,SHOWN:"shown"+on,CLICK_DATA_API:"click"+on+".data-api"},hn="dropdown-menu",cn="active",un="disabled",fn="fade",dn="show",_n=".dropdown",gn=".nav, .list-group",mn=".active",pn="> li > .active",vn='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',En=".dropdown-toggle",yn="> .dropdown-menu .active",Tn=function(){function i(t){this._element=t}var t=i.prototype;return t.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&rn(this._element).hasClass(cn)||rn(this._element).hasClass(un))){var t,i,e=rn(this._element).closest(gn)[0],r=Cn.getSelectorFromElement(this._element);if(e){var s="UL"===e.nodeName?pn:mn;i=(i=rn.makeArray(rn(e).find(s)))[i.length-1]}var o=rn.Event(ln.HIDE,{relatedTarget:this._element}),a=rn.Event(ln.SHOW,{relatedTarget:i});if(i&&rn(i).trigger(o),rn(this._element).trigger(a),!a.isDefaultPrevented()&&!o.isDefaultPrevented()){r&&(t=rn(r)[0]),this._activate(this._element,e);var l=function(){var t=rn.Event(ln.HIDDEN,{relatedTarget:n._element}),e=rn.Event(ln.SHOWN,{relatedTarget:i});rn(i).trigger(t),rn(n._element).trigger(e)};t?this._activate(t,t.parentNode,l):l()}}},t.dispose=function(){rn.removeData(this._element,sn),this._element=null},t._activate=function(t,e,n){var i=this,r=("UL"===e.nodeName?rn(e).find(pn):rn(e).children(mn))[0],s=n&&r&&rn(r).hasClass(fn),o=function(){return i._transitionComplete(t,r,n)};if(r&&s){var a=Cn.getTransitionDurationFromElement(r);rn(r).one(Cn.TRANSITION_END,o).emulateTransitionEnd(a)}else o()},t._transitionComplete=function(t,e,n){if(e){rn(e).removeClass(dn+" "+cn);var i=rn(e.parentNode).find(yn)[0];i&&rn(i).removeClass(cn),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!1)}if(rn(t).addClass(cn),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!0),Cn.reflow(t),rn(t).addClass(dn),t.parentNode&&rn(t.parentNode).hasClass(hn)){var r=rn(t).closest(_n)[0];r&&rn(r).find(En).addClass(cn),t.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var t=rn(this),e=t.data(sn);if(e||(e=new i(this),t.data(sn,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},o(i,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),i}(),rn(document).on(ln.CLICK_DATA_API,vn,function(t){t.preventDefault(),Tn._jQueryInterface.call(rn(this),"show")}),rn.fn.tab=Tn._jQueryInterface,rn.fn.tab.Constructor=Tn,rn.fn.tab.noConflict=function(){return rn.fn.tab=an,Tn._jQueryInterface},Tn);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||4<=e[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=Cn,t.Alert=In,t.Button=An,t.Carousel=Dn,t.Collapse=bn,t.Dropdown=Sn,t.Modal=wn,t.Popover=On,t.Scrollspy=kn,t.Tab=Pn,t.Tooltip=Nn,Object.defineProperty(t,"__esModule",{value:!0})});
|
7 |
-
//# sourceMappingURL=bootstrap.min.js.map
|
1 |
/*!
|
2 |
+
* Bootstrap v4.1.3 (https://getbootstrap.com/)
|
3 |
* Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
|
4 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
5 |
*/
|
6 |
+
!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery"),require("popper.js")):"function"==typeof define&&define.amd?define(["exports","jquery","popper.js"],e):e(t.bootstrap={},t.jQuery,t.Popper)}(this,function(t,e,h){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function l(r){for(var t=1;t<arguments.length;t++){var o=null!=arguments[t]?arguments[t]:{},e=Object.keys(o);"function"==typeof Object.getOwnPropertySymbols&&(e=e.concat(Object.getOwnPropertySymbols(o).filter(function(t){return Object.getOwnPropertyDescriptor(o,t).enumerable}))),e.forEach(function(t){var e,n,i;e=r,i=o[n=t],n in e?Object.defineProperty(e,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):e[n]=i})}return r}e=e&&e.hasOwnProperty("default")?e.default:e,h=h&&h.hasOwnProperty("default")?h.default:h;var r,n,o,a,c,u,f,d,g,_,m,p,v,y,E,C,T,b,S,I,A,D,w,N,O,k,P,j,H,L,R,x,W,U,q,F,K,M,Q,B,V,Y,z,J,Z,G,$,X,tt,et,nt,it,rt,ot,st,at,lt,ct,ht,ut,ft,dt,gt,_t,mt,pt,vt,yt,Et,Ct,Tt,bt,St,It,At,Dt,wt,Nt,Ot,kt,Pt,jt,Ht,Lt,Rt,xt,Wt,Ut,qt,Ft,Kt,Mt,Qt,Bt,Vt,Yt,zt,Jt,Zt,Gt,$t,Xt,te,ee,ne,ie,re,oe,se,ae,le,ce,he,ue,fe,de,ge,_e,me,pe,ve,ye,Ee,Ce,Te,be,Se,Ie,Ae,De,we,Ne,Oe,ke,Pe,je,He,Le,Re,xe,We,Ue,qe,Fe,Ke,Me,Qe,Be,Ve,Ye,ze,Je,Ze,Ge,$e,Xe,tn,en,nn,rn,on,sn,an,ln,cn,hn,un,fn,dn,gn,_n,mn,pn,vn,yn,En,Cn,Tn,bn,Sn,In,An,Dn,wn,Nn,On,kn,Pn,jn,Hn,Ln,Rn,xn,Wn,Un,qn,Fn=function(i){var e="transitionend";function t(t){var e=this,n=!1;return i(this).one(l.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||l.triggerTransitionEnd(e)},t),this}var l={TRANSITION_END:"bsTransitionEnd",getUID:function(t){for(;t+=~~(1e6*Math.random()),document.getElementById(t););return t},getSelectorFromElement:function(t){var e=t.getAttribute("data-target");e&&"#"!==e||(e=t.getAttribute("href")||"");try{return document.querySelector(e)?e:null}catch(t){return null}},getTransitionDurationFromElement:function(t){if(!t)return 0;var e=i(t).css("transition-duration");return parseFloat(e)?(e=e.split(",")[0],1e3*parseFloat(e)):0},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(t){i(t).trigger(e)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var r=n[i],o=e[i],s=o&&l.isElement(o)?"element":(a=o,{}.toString.call(a).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(r).test(s))throw new Error(t.toUpperCase()+': Option "'+i+'" provided type "'+s+'" but expected type "'+r+'".')}var a}};return i.fn.emulateTransitionEnd=t,i.event.special[l.TRANSITION_END]={bindType:e,delegateType:e,handle:function(t){if(i(t.target).is(this))return t.handleObj.handler.apply(this,arguments)}},l}(e),Kn=(n="alert",a="."+(o="bs.alert"),c=(r=e).fn[n],u={CLOSE:"close"+a,CLOSED:"closed"+a,CLICK_DATA_API:"click"+a+".data-api"},f="alert",d="fade",g="show",_=function(){function i(t){this._element=t}var t=i.prototype;return t.close=function(t){var e=this._element;t&&(e=this._getRootElement(t)),this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},t.dispose=function(){r.removeData(this._element,o),this._element=null},t._getRootElement=function(t){var e=Fn.getSelectorFromElement(t),n=!1;return e&&(n=document.querySelector(e)),n||(n=r(t).closest("."+f)[0]),n},t._triggerCloseEvent=function(t){var e=r.Event(u.CLOSE);return r(t).trigger(e),e},t._removeElement=function(e){var n=this;if(r(e).removeClass(g),r(e).hasClass(d)){var t=Fn.getTransitionDurationFromElement(e);r(e).one(Fn.TRANSITION_END,function(t){return n._destroyElement(e,t)}).emulateTransitionEnd(t)}else this._destroyElement(e)},t._destroyElement=function(t){r(t).detach().trigger(u.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var t=r(this),e=t.data(o);e||(e=new i(this),t.data(o,e)),"close"===n&&e[n](this)})},i._handleDismiss=function(e){return function(t){t&&t.preventDefault(),e.close(this)}},s(i,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),i}(),r(document).on(u.CLICK_DATA_API,'[data-dismiss="alert"]',_._handleDismiss(new _)),r.fn[n]=_._jQueryInterface,r.fn[n].Constructor=_,r.fn[n].noConflict=function(){return r.fn[n]=c,_._jQueryInterface},_),Mn=(p="button",y="."+(v="bs.button"),E=".data-api",C=(m=e).fn[p],T="active",b="btn",I='[data-toggle^="button"]',A='[data-toggle="buttons"]',D="input",w=".active",N=".btn",O={CLICK_DATA_API:"click"+y+E,FOCUS_BLUR_DATA_API:(S="focus")+y+E+" blur"+y+E},k=function(){function n(t){this._element=t}var t=n.prototype;return t.toggle=function(){var t=!0,e=!0,n=m(this._element).closest(A)[0];if(n){var i=this._element.querySelector(D);if(i){if("radio"===i.type)if(i.checked&&this._element.classList.contains(T))t=!1;else{var r=n.querySelector(w);r&&m(r).removeClass(T)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!this._element.classList.contains(T),m(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!this._element.classList.contains(T)),t&&m(this._element).toggleClass(T)},t.dispose=function(){m.removeData(this._element,v),this._element=null},n._jQueryInterface=function(e){return this.each(function(){var t=m(this).data(v);t||(t=new n(this),m(this).data(v,t)),"toggle"===e&&t[e]()})},s(n,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),n}(),m(document).on(O.CLICK_DATA_API,I,function(t){t.preventDefault();var e=t.target;m(e).hasClass(b)||(e=m(e).closest(N)),k._jQueryInterface.call(m(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,I,function(t){var e=m(t.target).closest(N)[0];m(e).toggleClass(S,/^focus(in)?$/.test(t.type))}),m.fn[p]=k._jQueryInterface,m.fn[p].Constructor=k,m.fn[p].noConflict=function(){return m.fn[p]=C,k._jQueryInterface},k),Qn=(j="carousel",L="."+(H="bs.carousel"),R=".data-api",x=(P=e).fn[j],W={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},U={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},q="next",F="prev",K="left",M="right",Q={SLIDE:"slide"+L,SLID:"slid"+L,KEYDOWN:"keydown"+L,MOUSEENTER:"mouseenter"+L,MOUSELEAVE:"mouseleave"+L,TOUCHEND:"touchend"+L,LOAD_DATA_API:"load"+L+R,CLICK_DATA_API:"click"+L+R},B="carousel",V="active",Y="slide",z="carousel-item-right",J="carousel-item-left",Z="carousel-item-next",G="carousel-item-prev",$=".active",X=".active.carousel-item",tt=".carousel-item",et=".carousel-item-next, .carousel-item-prev",nt=".carousel-indicators",it="[data-slide], [data-slide-to]",rt='[data-ride="carousel"]',ot=function(){function o(t,e){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(e),this._element=P(t)[0],this._indicatorsElement=this._element.querySelector(nt),this._addEventListeners()}var t=o.prototype;return t.next=function(){this._isSliding||this._slide(q)},t.nextWhenVisible=function(){!document.hidden&&P(this._element).is(":visible")&&"hidden"!==P(this._element).css("visibility")&&this.next()},t.prev=function(){this._isSliding||this._slide(F)},t.pause=function(t){t||(this._isPaused=!0),this._element.querySelector(et)&&(Fn.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},t.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},t.to=function(t){var e=this;this._activeElement=this._element.querySelector(X);var n=this._getItemIndex(this._activeElement);if(!(t>this._items.length-1||t<0))if(this._isSliding)P(this._element).one(Q.SLID,function(){return e.to(t)});else{if(n===t)return this.pause(),void this.cycle();var i=n<t?q:F;this._slide(i,this._items[t])}},t.dispose=function(){P(this._element).off(L),P.removeData(this._element,H),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},t._getConfig=function(t){return t=l({},W,t),Fn.typeCheckConfig(j,t,U),t},t._addEventListeners=function(){var e=this;this._config.keyboard&&P(this._element).on(Q.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(P(this._element).on(Q.MOUSEENTER,function(t){return e.pause(t)}).on(Q.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&P(this._element).on(Q.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},t._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},t._getItemIndex=function(t){return this._items=t&&t.parentNode?[].slice.call(t.parentNode.querySelectorAll(tt)):[],this._items.indexOf(t)},t._getItemByDirection=function(t,e){var n=t===q,i=t===F,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===F?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},t._triggerSlideEvent=function(t,e){var n=this._getItemIndex(t),i=this._getItemIndex(this._element.querySelector(X)),r=P.Event(Q.SLIDE,{relatedTarget:t,direction:e,from:i,to:n});return P(this._element).trigger(r),r},t._setActiveIndicatorElement=function(t){if(this._indicatorsElement){var e=[].slice.call(this._indicatorsElement.querySelectorAll($));P(e).removeClass(V);var n=this._indicatorsElement.children[this._getItemIndex(t)];n&&P(n).addClass(V)}},t._slide=function(t,e){var n,i,r,o=this,s=this._element.querySelector(X),a=this._getItemIndex(s),l=e||s&&this._getItemByDirection(t,s),c=this._getItemIndex(l),h=Boolean(this._interval);if(t===q?(n=J,i=Z,r=K):(n=z,i=G,r=M),l&&P(l).hasClass(V))this._isSliding=!1;else if(!this._triggerSlideEvent(l,r).isDefaultPrevented()&&s&&l){this._isSliding=!0,h&&this.pause(),this._setActiveIndicatorElement(l);var u=P.Event(Q.SLID,{relatedTarget:l,direction:r,from:a,to:c});if(P(this._element).hasClass(Y)){P(l).addClass(i),Fn.reflow(l),P(s).addClass(n),P(l).addClass(n);var f=Fn.getTransitionDurationFromElement(s);P(s).one(Fn.TRANSITION_END,function(){P(l).removeClass(n+" "+i).addClass(V),P(s).removeClass(V+" "+i+" "+n),o._isSliding=!1,setTimeout(function(){return P(o._element).trigger(u)},0)}).emulateTransitionEnd(f)}else P(s).removeClass(V),P(l).addClass(V),this._isSliding=!1,P(this._element).trigger(u);h&&this.cycle()}},o._jQueryInterface=function(i){return this.each(function(){var t=P(this).data(H),e=l({},W,P(this).data());"object"==typeof i&&(e=l({},e,i));var n="string"==typeof i?i:e.slide;if(t||(t=new o(this,e),P(this).data(H,t)),"number"==typeof i)t.to(i);else if("string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}else e.interval&&(t.pause(),t.cycle())})},o._dataApiClickHandler=function(t){var e=Fn.getSelectorFromElement(this);if(e){var n=P(e)[0];if(n&&P(n).hasClass(B)){var i=l({},P(n).data(),P(this).data()),r=this.getAttribute("data-slide-to");r&&(i.interval=!1),o._jQueryInterface.call(P(n),i),r&&P(n).data(H).to(r),t.preventDefault()}}},s(o,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return W}}]),o}(),P(document).on(Q.CLICK_DATA_API,it,ot._dataApiClickHandler),P(window).on(Q.LOAD_DATA_API,function(){for(var t=[].slice.call(document.querySelectorAll(rt)),e=0,n=t.length;e<n;e++){var i=P(t[e]);ot._jQueryInterface.call(i,i.data())}}),P.fn[j]=ot._jQueryInterface,P.fn[j].Constructor=ot,P.fn[j].noConflict=function(){return P.fn[j]=x,ot._jQueryInterface},ot),Bn=(at="collapse",ct="."+(lt="bs.collapse"),ht=(st=e).fn[at],ut={toggle:!0,parent:""},ft={toggle:"boolean",parent:"(string|element)"},dt={SHOW:"show"+ct,SHOWN:"shown"+ct,HIDE:"hide"+ct,HIDDEN:"hidden"+ct,CLICK_DATA_API:"click"+ct+".data-api"},gt="show",_t="collapse",mt="collapsing",pt="collapsed",vt="width",yt="height",Et=".show, .collapsing",Ct='[data-toggle="collapse"]',Tt=function(){function a(e,t){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(t),this._triggerArray=st.makeArray(document.querySelectorAll('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var n=[].slice.call(document.querySelectorAll(Ct)),i=0,r=n.length;i<r;i++){var o=n[i],s=Fn.getSelectorFromElement(o),a=[].slice.call(document.querySelectorAll(s)).filter(function(t){return t===e});null!==s&&0<a.length&&(this._selector=s,this._triggerArray.push(o))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var t=a.prototype;return t.toggle=function(){st(this._element).hasClass(gt)?this.hide():this.show()},t.show=function(){var t,e,n=this;if(!this._isTransitioning&&!st(this._element).hasClass(gt)&&(this._parent&&0===(t=[].slice.call(this._parent.querySelectorAll(Et)).filter(function(t){return t.getAttribute("data-parent")===n._config.parent})).length&&(t=null),!(t&&(e=st(t).not(this._selector).data(lt))&&e._isTransitioning))){var i=st.Event(dt.SHOW);if(st(this._element).trigger(i),!i.isDefaultPrevented()){t&&(a._jQueryInterface.call(st(t).not(this._selector),"hide"),e||st(t).data(lt,null));var r=this._getDimension();st(this._element).removeClass(_t).addClass(mt),this._element.style[r]=0,this._triggerArray.length&&st(this._triggerArray).removeClass(pt).attr("aria-expanded",!0),this.setTransitioning(!0);var o="scroll"+(r[0].toUpperCase()+r.slice(1)),s=Fn.getTransitionDurationFromElement(this._element);st(this._element).one(Fn.TRANSITION_END,function(){st(n._element).removeClass(mt).addClass(_t).addClass(gt),n._element.style[r]="",n.setTransitioning(!1),st(n._element).trigger(dt.SHOWN)}).emulateTransitionEnd(s),this._element.style[r]=this._element[o]+"px"}}},t.hide=function(){var t=this;if(!this._isTransitioning&&st(this._element).hasClass(gt)){var e=st.Event(dt.HIDE);if(st(this._element).trigger(e),!e.isDefaultPrevented()){var n=this._getDimension();this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",Fn.reflow(this._element),st(this._element).addClass(mt).removeClass(_t).removeClass(gt);var i=this._triggerArray.length;if(0<i)for(var r=0;r<i;r++){var o=this._triggerArray[r],s=Fn.getSelectorFromElement(o);if(null!==s)st([].slice.call(document.querySelectorAll(s))).hasClass(gt)||st(o).addClass(pt).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var a=Fn.getTransitionDurationFromElement(this._element);st(this._element).one(Fn.TRANSITION_END,function(){t.setTransitioning(!1),st(t._element).removeClass(mt).addClass(_t).trigger(dt.HIDDEN)}).emulateTransitionEnd(a)}}},t.setTransitioning=function(t){this._isTransitioning=t},t.dispose=function(){st.removeData(this._element,lt),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},t._getConfig=function(t){return(t=l({},ut,t)).toggle=Boolean(t.toggle),Fn.typeCheckConfig(at,t,ft),t},t._getDimension=function(){return st(this._element).hasClass(vt)?vt:yt},t._getParent=function(){var n=this,t=null;Fn.isElement(this._config.parent)?(t=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(t=this._config.parent[0])):t=document.querySelector(this._config.parent);var e='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]',i=[].slice.call(t.querySelectorAll(e));return st(i).each(function(t,e){n._addAriaAndCollapsedClass(a._getTargetFromElement(e),[e])}),t},t._addAriaAndCollapsedClass=function(t,e){if(t){var n=st(t).hasClass(gt);e.length&&st(e).toggleClass(pt,!n).attr("aria-expanded",n)}},a._getTargetFromElement=function(t){var e=Fn.getSelectorFromElement(t);return e?document.querySelector(e):null},a._jQueryInterface=function(i){return this.each(function(){var t=st(this),e=t.data(lt),n=l({},ut,t.data(),"object"==typeof i&&i?i:{});if(!e&&n.toggle&&/show|hide/.test(i)&&(n.toggle=!1),e||(e=new a(this,n),t.data(lt,e)),"string"==typeof i){if("undefined"==typeof e[i])throw new TypeError('No method named "'+i+'"');e[i]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return ut}}]),a}(),st(document).on(dt.CLICK_DATA_API,Ct,function(t){"A"===t.currentTarget.tagName&&t.preventDefault();var n=st(this),e=Fn.getSelectorFromElement(this),i=[].slice.call(document.querySelectorAll(e));st(i).each(function(){var t=st(this),e=t.data(lt)?"toggle":n.data();Tt._jQueryInterface.call(t,e)})}),st.fn[at]=Tt._jQueryInterface,st.fn[at].Constructor=Tt,st.fn[at].noConflict=function(){return st.fn[at]=ht,Tt._jQueryInterface},Tt),Vn=(St="dropdown",At="."+(It="bs.dropdown"),Dt=".data-api",wt=(bt=e).fn[St],Nt=new RegExp("38|40|27"),Ot={HIDE:"hide"+At,HIDDEN:"hidden"+At,SHOW:"show"+At,SHOWN:"shown"+At,CLICK:"click"+At,CLICK_DATA_API:"click"+At+Dt,KEYDOWN_DATA_API:"keydown"+At+Dt,KEYUP_DATA_API:"keyup"+At+Dt},kt="disabled",Pt="show",jt="dropup",Ht="dropright",Lt="dropleft",Rt="dropdown-menu-right",xt="position-static",Wt='[data-toggle="dropdown"]',Ut=".dropdown form",qt=".dropdown-menu",Ft=".navbar-nav",Kt=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",Mt="top-start",Qt="top-end",Bt="bottom-start",Vt="bottom-end",Yt="right-start",zt="left-start",Jt={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},Zt={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Gt=function(){function c(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var t=c.prototype;return t.toggle=function(){if(!this._element.disabled&&!bt(this._element).hasClass(kt)){var t=c._getParentFromElement(this._element),e=bt(this._menu).hasClass(Pt);if(c._clearMenus(),!e){var n={relatedTarget:this._element},i=bt.Event(Ot.SHOW,n);if(bt(t).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof h)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var r=this._element;"parent"===this._config.reference?r=t:Fn.isElement(this._config.reference)&&(r=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(r=this._config.reference[0])),"scrollParent"!==this._config.boundary&&bt(t).addClass(xt),this._popper=new h(r,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===bt(t).closest(Ft).length&&bt(document.body).children().on("mouseover",null,bt.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),bt(this._menu).toggleClass(Pt),bt(t).toggleClass(Pt).trigger(bt.Event(Ot.SHOWN,n))}}}},t.dispose=function(){bt.removeData(this._element,It),bt(this._element).off(At),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},t.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},t._addEventListeners=function(){var e=this;bt(this._element).on(Ot.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},t._getConfig=function(t){return t=l({},this.constructor.Default,bt(this._element).data(),t),Fn.typeCheckConfig(St,t,this.constructor.DefaultType),t},t._getMenuElement=function(){if(!this._menu){var t=c._getParentFromElement(this._element);t&&(this._menu=t.querySelector(qt))}return this._menu},t._getPlacement=function(){var t=bt(this._element.parentNode),e=Bt;return t.hasClass(jt)?(e=Mt,bt(this._menu).hasClass(Rt)&&(e=Qt)):t.hasClass(Ht)?e=Yt:t.hasClass(Lt)?e=zt:bt(this._menu).hasClass(Rt)&&(e=Vt),e},t._detectNavbar=function(){return 0<bt(this._element).closest(".navbar").length},t._getPopperConfig=function(){var e=this,t={};"function"==typeof this._config.offset?t.fn=function(t){return t.offsets=l({},t.offsets,e._config.offset(t.offsets)||{}),t}:t.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:t,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},c._jQueryInterface=function(e){return this.each(function(){var t=bt(this).data(It);if(t||(t=new c(this,"object"==typeof e?e:null),bt(this).data(It,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},c._clearMenus=function(t){if(!t||3!==t.which&&("keyup"!==t.type||9===t.which))for(var e=[].slice.call(document.querySelectorAll(Wt)),n=0,i=e.length;n<i;n++){var r=c._getParentFromElement(e[n]),o=bt(e[n]).data(It),s={relatedTarget:e[n]};if(t&&"click"===t.type&&(s.clickEvent=t),o){var a=o._menu;if(bt(r).hasClass(Pt)&&!(t&&("click"===t.type&&/input|textarea/i.test(t.target.tagName)||"keyup"===t.type&&9===t.which)&&bt.contains(r,t.target))){var l=bt.Event(Ot.HIDE,s);bt(r).trigger(l),l.isDefaultPrevented()||("ontouchstart"in document.documentElement&&bt(document.body).children().off("mouseover",null,bt.noop),e[n].setAttribute("aria-expanded","false"),bt(a).removeClass(Pt),bt(r).removeClass(Pt).trigger(bt.Event(Ot.HIDDEN,s)))}}}},c._getParentFromElement=function(t){var e,n=Fn.getSelectorFromElement(t);return n&&(e=document.querySelector(n)),e||t.parentNode},c._dataApiKeydownHandler=function(t){if((/input|textarea/i.test(t.target.tagName)?!(32===t.which||27!==t.which&&(40!==t.which&&38!==t.which||bt(t.target).closest(qt).length)):Nt.test(t.which))&&(t.preventDefault(),t.stopPropagation(),!this.disabled&&!bt(this).hasClass(kt))){var e=c._getParentFromElement(this),n=bt(e).hasClass(Pt);if((n||27===t.which&&32===t.which)&&(!n||27!==t.which&&32!==t.which)){var i=[].slice.call(e.querySelectorAll(Kt));if(0!==i.length){var r=i.indexOf(t.target);38===t.which&&0<r&&r--,40===t.which&&r<i.length-1&&r++,r<0&&(r=0),i[r].focus()}}else{if(27===t.which){var o=e.querySelector(Wt);bt(o).trigger("focus")}bt(this).trigger("click")}}},s(c,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return Jt}},{key:"DefaultType",get:function(){return Zt}}]),c}(),bt(document).on(Ot.KEYDOWN_DATA_API,Wt,Gt._dataApiKeydownHandler).on(Ot.KEYDOWN_DATA_API,qt,Gt._dataApiKeydownHandler).on(Ot.CLICK_DATA_API+" "+Ot.KEYUP_DATA_API,Gt._clearMenus).on(Ot.CLICK_DATA_API,Wt,function(t){t.preventDefault(),t.stopPropagation(),Gt._jQueryInterface.call(bt(this),"toggle")}).on(Ot.CLICK_DATA_API,Ut,function(t){t.stopPropagation()}),bt.fn[St]=Gt._jQueryInterface,bt.fn[St].Constructor=Gt,bt.fn[St].noConflict=function(){return bt.fn[St]=wt,Gt._jQueryInterface},Gt),Yn=(Xt="modal",ee="."+(te="bs.modal"),ne=($t=e).fn[Xt],ie={backdrop:!0,keyboard:!0,focus:!0,show:!0},re={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},oe={HIDE:"hide"+ee,HIDDEN:"hidden"+ee,SHOW:"show"+ee,SHOWN:"shown"+ee,FOCUSIN:"focusin"+ee,RESIZE:"resize"+ee,CLICK_DISMISS:"click.dismiss"+ee,KEYDOWN_DISMISS:"keydown.dismiss"+ee,MOUSEUP_DISMISS:"mouseup.dismiss"+ee,MOUSEDOWN_DISMISS:"mousedown.dismiss"+ee,CLICK_DATA_API:"click"+ee+".data-api"},se="modal-scrollbar-measure",ae="modal-backdrop",le="modal-open",ce="fade",he="show",ue=".modal-dialog",fe='[data-toggle="modal"]',de='[data-dismiss="modal"]',ge=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",_e=".sticky-top",me=function(){function r(t,e){this._config=this._getConfig(e),this._element=t,this._dialog=t.querySelector(ue),this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._scrollbarWidth=0}var t=r.prototype;return t.toggle=function(t){return this._isShown?this.hide():this.show(t)},t.show=function(t){var e=this;if(!this._isTransitioning&&!this._isShown){$t(this._element).hasClass(ce)&&(this._isTransitioning=!0);var n=$t.Event(oe.SHOW,{relatedTarget:t});$t(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),$t(document.body).addClass(le),this._setEscapeEvent(),this._setResizeEvent(),$t(this._element).on(oe.CLICK_DISMISS,de,function(t){return e.hide(t)}),$t(this._dialog).on(oe.MOUSEDOWN_DISMISS,function(){$t(e._element).one(oe.MOUSEUP_DISMISS,function(t){$t(t.target).is(e._element)&&(e._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return e._showElement(t)}))}},t.hide=function(t){var e=this;if(t&&t.preventDefault(),!this._isTransitioning&&this._isShown){var n=$t.Event(oe.HIDE);if($t(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=$t(this._element).hasClass(ce);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),$t(document).off(oe.FOCUSIN),$t(this._element).removeClass(he),$t(this._element).off(oe.CLICK_DISMISS),$t(this._dialog).off(oe.MOUSEDOWN_DISMISS),i){var r=Fn.getTransitionDurationFromElement(this._element);$t(this._element).one(Fn.TRANSITION_END,function(t){return e._hideModal(t)}).emulateTransitionEnd(r)}else this._hideModal()}}},t.dispose=function(){$t.removeData(this._element,te),$t(window,document,this._element,this._backdrop).off(ee),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},t.handleUpdate=function(){this._adjustDialog()},t._getConfig=function(t){return t=l({},ie,t),Fn.typeCheckConfig(Xt,t,re),t},t._showElement=function(t){var e=this,n=$t(this._element).hasClass(ce);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,n&&Fn.reflow(this._element),$t(this._element).addClass(he),this._config.focus&&this._enforceFocus();var i=$t.Event(oe.SHOWN,{relatedTarget:t}),r=function(){e._config.focus&&e._element.focus(),e._isTransitioning=!1,$t(e._element).trigger(i)};if(n){var o=Fn.getTransitionDurationFromElement(this._element);$t(this._dialog).one(Fn.TRANSITION_END,r).emulateTransitionEnd(o)}else r()},t._enforceFocus=function(){var e=this;$t(document).off(oe.FOCUSIN).on(oe.FOCUSIN,function(t){document!==t.target&&e._element!==t.target&&0===$t(e._element).has(t.target).length&&e._element.focus()})},t._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?$t(this._element).on(oe.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||$t(this._element).off(oe.KEYDOWN_DISMISS)},t._setResizeEvent=function(){var e=this;this._isShown?$t(window).on(oe.RESIZE,function(t){return e.handleUpdate(t)}):$t(window).off(oe.RESIZE)},t._hideModal=function(){var t=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){$t(document.body).removeClass(le),t._resetAdjustments(),t._resetScrollbar(),$t(t._element).trigger(oe.HIDDEN)})},t._removeBackdrop=function(){this._backdrop&&($t(this._backdrop).remove(),this._backdrop=null)},t._showBackdrop=function(t){var e=this,n=$t(this._element).hasClass(ce)?ce:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=ae,n&&this._backdrop.classList.add(n),$t(this._backdrop).appendTo(document.body),$t(this._element).on(oe.CLICK_DISMISS,function(t){e._ignoreBackdropClick?e._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===e._config.backdrop?e._element.focus():e.hide())}),n&&Fn.reflow(this._backdrop),$t(this._backdrop).addClass(he),!t)return;if(!n)return void t();var i=Fn.getTransitionDurationFromElement(this._backdrop);$t(this._backdrop).one(Fn.TRANSITION_END,t).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){$t(this._backdrop).removeClass(he);var r=function(){e._removeBackdrop(),t&&t()};if($t(this._element).hasClass(ce)){var o=Fn.getTransitionDurationFromElement(this._backdrop);$t(this._backdrop).one(Fn.TRANSITION_END,r).emulateTransitionEnd(o)}else r()}else t&&t()},t._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},t._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},t._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},t._setScrollbar=function(){var r=this;if(this._isBodyOverflowing){var t=[].slice.call(document.querySelectorAll(ge)),e=[].slice.call(document.querySelectorAll(_e));$t(t).each(function(t,e){var n=e.style.paddingRight,i=$t(e).css("padding-right");$t(e).data("padding-right",n).css("padding-right",parseFloat(i)+r._scrollbarWidth+"px")}),$t(e).each(function(t,e){var n=e.style.marginRight,i=$t(e).css("margin-right");$t(e).data("margin-right",n).css("margin-right",parseFloat(i)-r._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=$t(document.body).css("padding-right");$t(document.body).data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},t._resetScrollbar=function(){var t=[].slice.call(document.querySelectorAll(ge));$t(t).each(function(t,e){var n=$t(e).data("padding-right");$t(e).removeData("padding-right"),e.style.paddingRight=n||""});var e=[].slice.call(document.querySelectorAll(""+_e));$t(e).each(function(t,e){var n=$t(e).data("margin-right");"undefined"!=typeof n&&$t(e).css("margin-right",n).removeData("margin-right")});var n=$t(document.body).data("padding-right");$t(document.body).removeData("padding-right"),document.body.style.paddingRight=n||""},t._getScrollbarWidth=function(){var t=document.createElement("div");t.className=se,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},r._jQueryInterface=function(n,i){return this.each(function(){var t=$t(this).data(te),e=l({},ie,$t(this).data(),"object"==typeof n&&n?n:{});if(t||(t=new r(this,e),$t(this).data(te,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},s(r,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return ie}}]),r}(),$t(document).on(oe.CLICK_DATA_API,fe,function(t){var e,n=this,i=Fn.getSelectorFromElement(this);i&&(e=document.querySelector(i));var r=$t(e).data(te)?"toggle":l({},$t(e).data(),$t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||t.preventDefault();var o=$t(e).one(oe.SHOW,function(t){t.isDefaultPrevented()||o.one(oe.HIDDEN,function(){$t(n).is(":visible")&&n.focus()})});me._jQueryInterface.call($t(e),r,this)}),$t.fn[Xt]=me._jQueryInterface,$t.fn[Xt].Constructor=me,$t.fn[Xt].noConflict=function(){return $t.fn[Xt]=ne,me._jQueryInterface},me),zn=(ve="tooltip",Ee="."+(ye="bs.tooltip"),Ce=(pe=e).fn[ve],Te="bs-tooltip",be=new RegExp("(^|\\s)"+Te+"\\S+","g"),Ae={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!(Ie={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"}),selector:!(Se={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"}),placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},we="out",Ne={HIDE:"hide"+Ee,HIDDEN:"hidden"+Ee,SHOW:(De="show")+Ee,SHOWN:"shown"+Ee,INSERTED:"inserted"+Ee,CLICK:"click"+Ee,FOCUSIN:"focusin"+Ee,FOCUSOUT:"focusout"+Ee,MOUSEENTER:"mouseenter"+Ee,MOUSELEAVE:"mouseleave"+Ee},Oe="fade",ke="show",Pe=".tooltip-inner",je=".arrow",He="hover",Le="focus",Re="click",xe="manual",We=function(){function i(t,e){if("undefined"==typeof h)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var t=i.prototype;return t.enable=function(){this._isEnabled=!0},t.disable=function(){this._isEnabled=!1},t.toggleEnabled=function(){this._isEnabled=!this._isEnabled},t.toggle=function(t){if(this._isEnabled)if(t){var e=this.constructor.DATA_KEY,n=pe(t.currentTarget).data(e);n||(n=new this.constructor(t.currentTarget,this._getDelegateConfig()),pe(t.currentTarget).data(e,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(pe(this.getTipElement()).hasClass(ke))return void this._leave(null,this);this._enter(null,this)}},t.dispose=function(){clearTimeout(this._timeout),pe.removeData(this.element,this.constructor.DATA_KEY),pe(this.element).off(this.constructor.EVENT_KEY),pe(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&pe(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},t.show=function(){var e=this;if("none"===pe(this.element).css("display"))throw new Error("Please use show on visible elements");var t=pe.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){pe(this.element).trigger(t);var n=pe.contains(this.element.ownerDocument.documentElement,this.element);if(t.isDefaultPrevented()||!n)return;var i=this.getTipElement(),r=Fn.getUID(this.constructor.NAME);i.setAttribute("id",r),this.element.setAttribute("aria-describedby",r),this.setContent(),this.config.animation&&pe(i).addClass(Oe);var o="function"==typeof this.config.placement?this.config.placement.call(this,i,this.element):this.config.placement,s=this._getAttachment(o);this.addAttachmentClass(s);var a=!1===this.config.container?document.body:pe(document).find(this.config.container);pe(i).data(this.constructor.DATA_KEY,this),pe.contains(this.element.ownerDocument.documentElement,this.tip)||pe(i).appendTo(a),pe(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new h(this.element,i,{placement:s,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:je},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),pe(i).addClass(ke),"ontouchstart"in document.documentElement&&pe(document.body).children().on("mouseover",null,pe.noop);var l=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,pe(e.element).trigger(e.constructor.Event.SHOWN),t===we&&e._leave(null,e)};if(pe(this.tip).hasClass(Oe)){var c=Fn.getTransitionDurationFromElement(this.tip);pe(this.tip).one(Fn.TRANSITION_END,l).emulateTransitionEnd(c)}else l()}},t.hide=function(t){var e=this,n=this.getTipElement(),i=pe.Event(this.constructor.Event.HIDE),r=function(){e._hoverState!==De&&n.parentNode&&n.parentNode.removeChild(n),e._cleanTipClass(),e.element.removeAttribute("aria-describedby"),pe(e.element).trigger(e.constructor.Event.HIDDEN),null!==e._popper&&e._popper.destroy(),t&&t()};if(pe(this.element).trigger(i),!i.isDefaultPrevented()){if(pe(n).removeClass(ke),"ontouchstart"in document.documentElement&&pe(document.body).children().off("mouseover",null,pe.noop),this._activeTrigger[Re]=!1,this._activeTrigger[Le]=!1,this._activeTrigger[He]=!1,pe(this.tip).hasClass(Oe)){var o=Fn.getTransitionDurationFromElement(n);pe(n).one(Fn.TRANSITION_END,r).emulateTransitionEnd(o)}else r();this._hoverState=""}},t.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},t.isWithContent=function(){return Boolean(this.getTitle())},t.addAttachmentClass=function(t){pe(this.getTipElement()).addClass(Te+"-"+t)},t.getTipElement=function(){return this.tip=this.tip||pe(this.config.template)[0],this.tip},t.setContent=function(){var t=this.getTipElement();this.setElementContent(pe(t.querySelectorAll(Pe)),this.getTitle()),pe(t).removeClass(Oe+" "+ke)},t.setElementContent=function(t,e){var n=this.config.html;"object"==typeof e&&(e.nodeType||e.jquery)?n?pe(e).parent().is(t)||t.empty().append(e):t.text(pe(e).text()):t[n?"html":"text"](e)},t.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},t._getAttachment=function(t){return Ie[t.toUpperCase()]},t._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(t){if("click"===t)pe(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(t){return i.toggle(t)});else if(t!==xe){var e=t===He?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=t===He?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;pe(i.element).on(e,i.config.selector,function(t){return i._enter(t)}).on(n,i.config.selector,function(t){return i._leave(t)})}pe(i.element).closest(".modal").on("hide.bs.modal",function(){return i.hide()})}),this.config.selector?this.config=l({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},t._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},t._enter=function(t,e){var n=this.constructor.DATA_KEY;(e=e||pe(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),pe(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusin"===t.type?Le:He]=!0),pe(e.getTipElement()).hasClass(ke)||e._hoverState===De?e._hoverState=De:(clearTimeout(e._timeout),e._hoverState=De,e.config.delay&&e.config.delay.show?e._timeout=setTimeout(function(){e._hoverState===De&&e.show()},e.config.delay.show):e.show())},t._leave=function(t,e){var n=this.constructor.DATA_KEY;(e=e||pe(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),pe(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusout"===t.type?Le:He]=!1),e._isWithActiveTrigger()||(clearTimeout(e._timeout),e._hoverState=we,e.config.delay&&e.config.delay.hide?e._timeout=setTimeout(function(){e._hoverState===we&&e.hide()},e.config.delay.hide):e.hide())},t._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},t._getConfig=function(t){return"number"==typeof(t=l({},this.constructor.Default,pe(this.element).data(),"object"==typeof t&&t?t:{})).delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),Fn.typeCheckConfig(ve,t,this.constructor.DefaultType),t},t._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},t._cleanTipClass=function(){var t=pe(this.getTipElement()),e=t.attr("class").match(be);null!==e&&e.length&&t.removeClass(e.join(""))},t._handlePopperPlacementChange=function(t){var e=t.instance;this.tip=e.popper,this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},t._fixTransition=function(){var t=this.getTipElement(),e=this.config.animation;null===t.getAttribute("x-placement")&&(pe(t).removeClass(Oe),this.config.animation=!1,this.hide(),this.show(),this.config.animation=e)},i._jQueryInterface=function(n){return this.each(function(){var t=pe(this).data(ye),e="object"==typeof n&&n;if((t||!/dispose|hide/.test(n))&&(t||(t=new i(this,e),pe(this).data(ye,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return Ae}},{key:"NAME",get:function(){return ve}},{key:"DATA_KEY",get:function(){return ye}},{key:"Event",get:function(){return Ne}},{key:"EVENT_KEY",get:function(){return Ee}},{key:"DefaultType",get:function(){return Se}}]),i}(),pe.fn[ve]=We._jQueryInterface,pe.fn[ve].Constructor=We,pe.fn[ve].noConflict=function(){return pe.fn[ve]=Ce,We._jQueryInterface},We),Jn=(qe="popover",Ke="."+(Fe="bs.popover"),Me=(Ue=e).fn[qe],Qe="bs-popover",Be=new RegExp("(^|\\s)"+Qe+"\\S+","g"),Ve=l({},zn.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),Ye=l({},zn.DefaultType,{content:"(string|element|function)"}),ze="fade",Ze=".popover-header",Ge=".popover-body",$e={HIDE:"hide"+Ke,HIDDEN:"hidden"+Ke,SHOW:(Je="show")+Ke,SHOWN:"shown"+Ke,INSERTED:"inserted"+Ke,CLICK:"click"+Ke,FOCUSIN:"focusin"+Ke,FOCUSOUT:"focusout"+Ke,MOUSEENTER:"mouseenter"+Ke,MOUSELEAVE:"mouseleave"+Ke},Xe=function(t){var e,n;function i(){return t.apply(this,arguments)||this}n=t,(e=i).prototype=Object.create(n.prototype),(e.prototype.constructor=e).__proto__=n;var r=i.prototype;return r.isWithContent=function(){return this.getTitle()||this._getContent()},r.addAttachmentClass=function(t){Ue(this.getTipElement()).addClass(Qe+"-"+t)},r.getTipElement=function(){return this.tip=this.tip||Ue(this.config.template)[0],this.tip},r.setContent=function(){var t=Ue(this.getTipElement());this.setElementContent(t.find(Ze),this.getTitle());var e=this._getContent();"function"==typeof e&&(e=e.call(this.element)),this.setElementContent(t.find(Ge),e),t.removeClass(ze+" "+Je)},r._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},r._cleanTipClass=function(){var t=Ue(this.getTipElement()),e=t.attr("class").match(Be);null!==e&&0<e.length&&t.removeClass(e.join(""))},i._jQueryInterface=function(n){return this.each(function(){var t=Ue(this).data(Fe),e="object"==typeof n?n:null;if((t||!/destroy|hide/.test(n))&&(t||(t=new i(this,e),Ue(this).data(Fe,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return Ve}},{key:"NAME",get:function(){return qe}},{key:"DATA_KEY",get:function(){return Fe}},{key:"Event",get:function(){return $e}},{key:"EVENT_KEY",get:function(){return Ke}},{key:"DefaultType",get:function(){return Ye}}]),i}(zn),Ue.fn[qe]=Xe._jQueryInterface,Ue.fn[qe].Constructor=Xe,Ue.fn[qe].noConflict=function(){return Ue.fn[qe]=Me,Xe._jQueryInterface},Xe),Zn=(en="scrollspy",rn="."+(nn="bs.scrollspy"),on=(tn=e).fn[en],sn={offset:10,method:"auto",target:""},an={offset:"number",method:"string",target:"(string|element)"},ln={ACTIVATE:"activate"+rn,SCROLL:"scroll"+rn,LOAD_DATA_API:"load"+rn+".data-api"},cn="dropdown-item",hn="active",un='[data-spy="scroll"]',fn=".active",dn=".nav, .list-group",gn=".nav-link",_n=".nav-item",mn=".list-group-item",pn=".dropdown",vn=".dropdown-item",yn=".dropdown-toggle",En="offset",Cn="position",Tn=function(){function n(t,e){var n=this;this._element=t,this._scrollElement="BODY"===t.tagName?window:t,this._config=this._getConfig(e),this._selector=this._config.target+" "+gn+","+this._config.target+" "+mn+","+this._config.target+" "+vn,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,tn(this._scrollElement).on(ln.SCROLL,function(t){return n._process(t)}),this.refresh(),this._process()}var t=n.prototype;return t.refresh=function(){var e=this,t=this._scrollElement===this._scrollElement.window?En:Cn,r="auto"===this._config.method?t:this._config.method,o=r===Cn?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),[].slice.call(document.querySelectorAll(this._selector)).map(function(t){var e,n=Fn.getSelectorFromElement(t);if(n&&(e=document.querySelector(n)),e){var i=e.getBoundingClientRect();if(i.width||i.height)return[tn(e)[r]().top+o,n]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},t.dispose=function(){tn.removeData(this._element,nn),tn(this._scrollElement).off(rn),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},t._getConfig=function(t){if("string"!=typeof(t=l({},sn,"object"==typeof t&&t?t:{})).target){var e=tn(t.target).attr("id");e||(e=Fn.getUID(en),tn(t.target).attr("id",e)),t.target="#"+e}return Fn.typeCheckConfig(en,t,an),t},t._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},t._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},t._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},t._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),n<=t){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t<this._offsets[r+1])&&this._activate(this._targets[r])}}},t._activate=function(e){this._activeTarget=e,this._clear();var t=this._selector.split(",");t=t.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var n=tn([].slice.call(document.querySelectorAll(t.join(","))));n.hasClass(cn)?(n.closest(pn).find(yn).addClass(hn),n.addClass(hn)):(n.addClass(hn),n.parents(dn).prev(gn+", "+mn).addClass(hn),n.parents(dn).prev(_n).children(gn).addClass(hn)),tn(this._scrollElement).trigger(ln.ACTIVATE,{relatedTarget:e})},t._clear=function(){var t=[].slice.call(document.querySelectorAll(this._selector));tn(t).filter(fn).removeClass(hn)},n._jQueryInterface=function(e){return this.each(function(){var t=tn(this).data(nn);if(t||(t=new n(this,"object"==typeof e&&e),tn(this).data(nn,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return sn}}]),n}(),tn(window).on(ln.LOAD_DATA_API,function(){for(var t=[].slice.call(document.querySelectorAll(un)),e=t.length;e--;){var n=tn(t[e]);Tn._jQueryInterface.call(n,n.data())}}),tn.fn[en]=Tn._jQueryInterface,tn.fn[en].Constructor=Tn,tn.fn[en].noConflict=function(){return tn.fn[en]=on,Tn._jQueryInterface},Tn),Gn=(In="."+(Sn="bs.tab"),An=(bn=e).fn.tab,Dn={HIDE:"hide"+In,HIDDEN:"hidden"+In,SHOW:"show"+In,SHOWN:"shown"+In,CLICK_DATA_API:"click"+In+".data-api"},wn="dropdown-menu",Nn="active",On="disabled",kn="fade",Pn="show",jn=".dropdown",Hn=".nav, .list-group",Ln=".active",Rn="> li > .active",xn='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',Wn=".dropdown-toggle",Un="> .dropdown-menu .active",qn=function(){function i(t){this._element=t}var t=i.prototype;return t.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&bn(this._element).hasClass(Nn)||bn(this._element).hasClass(On))){var t,i,e=bn(this._element).closest(Hn)[0],r=Fn.getSelectorFromElement(this._element);if(e){var o="UL"===e.nodeName?Rn:Ln;i=(i=bn.makeArray(bn(e).find(o)))[i.length-1]}var s=bn.Event(Dn.HIDE,{relatedTarget:this._element}),a=bn.Event(Dn.SHOW,{relatedTarget:i});if(i&&bn(i).trigger(s),bn(this._element).trigger(a),!a.isDefaultPrevented()&&!s.isDefaultPrevented()){r&&(t=document.querySelector(r)),this._activate(this._element,e);var l=function(){var t=bn.Event(Dn.HIDDEN,{relatedTarget:n._element}),e=bn.Event(Dn.SHOWN,{relatedTarget:i});bn(i).trigger(t),bn(n._element).trigger(e)};t?this._activate(t,t.parentNode,l):l()}}},t.dispose=function(){bn.removeData(this._element,Sn),this._element=null},t._activate=function(t,e,n){var i=this,r=("UL"===e.nodeName?bn(e).find(Rn):bn(e).children(Ln))[0],o=n&&r&&bn(r).hasClass(kn),s=function(){return i._transitionComplete(t,r,n)};if(r&&o){var a=Fn.getTransitionDurationFromElement(r);bn(r).one(Fn.TRANSITION_END,s).emulateTransitionEnd(a)}else s()},t._transitionComplete=function(t,e,n){if(e){bn(e).removeClass(Pn+" "+Nn);var i=bn(e.parentNode).find(Un)[0];i&&bn(i).removeClass(Nn),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!1)}if(bn(t).addClass(Nn),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!0),Fn.reflow(t),bn(t).addClass(Pn),t.parentNode&&bn(t.parentNode).hasClass(wn)){var r=bn(t).closest(jn)[0];if(r){var o=[].slice.call(r.querySelectorAll(Wn));bn(o).addClass(Nn)}t.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var t=bn(this),e=t.data(Sn);if(e||(e=new i(this),t.data(Sn,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),i}(),bn(document).on(Dn.CLICK_DATA_API,xn,function(t){t.preventDefault(),qn._jQueryInterface.call(bn(this),"show")}),bn.fn.tab=qn._jQueryInterface,bn.fn.tab.Constructor=qn,bn.fn.tab.noConflict=function(){return bn.fn.tab=An,qn._jQueryInterface},qn);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||4<=e[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=Fn,t.Alert=Kn,t.Button=Mn,t.Carousel=Qn,t.Collapse=Bn,t.Dropdown=Vn,t.Modal=Yn,t.Popover=Jn,t.Scrollspy=Zn,t.Tab=Gn,t.Tooltip=zn,Object.defineProperty(t,"__esModule",{value:!0})});
|
|
@@ -195,11 +195,12 @@ var iCWP_WPSF_Growl = new function () {
|
|
195 |
}, 380 );
|
196 |
setTimeout( function () {
|
197 |
$oDiv.css( 'width', 0 );
|
|
|
|
|
|
|
|
|
|
|
198 |
}, 4000 );
|
199 |
-
setTimeout( function () {
|
200 |
-
$oDiv.html( '' )
|
201 |
-
.fadeOut();
|
202 |
-
}, 4500 );
|
203 |
};
|
204 |
|
205 |
/**
|
195 |
}, 380 );
|
196 |
setTimeout( function () {
|
197 |
$oDiv.css( 'width', 0 );
|
198 |
+
|
199 |
+
setTimeout( function () {
|
200 |
+
$oDiv.html( '' )
|
201 |
+
.fadeOut();
|
202 |
+
}, 500 );
|
203 |
}, 4000 );
|
|
|
|
|
|
|
|
|
204 |
};
|
205 |
|
206 |
/**
|
@@ -76,22 +76,45 @@ var iCWP_WPSF_OptionsFormSubmit = new function () {
|
|
76 |
event.preventDefault();
|
77 |
|
78 |
var $oForm = jQuery( this );
|
79 |
-
|
80 |
-
|
81 |
-
|
82 |
-
|
83 |
-
|
84 |
-
|
85 |
-
|
86 |
-
|
|
|
|
|
87 |
}
|
88 |
-
iCWP_WPSF_Growl.showMessage( sMessage, oResponse.success );
|
89 |
}
|
90 |
-
|
91 |
-
|
92 |
-
|
93 |
-
|
94 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95 |
};
|
96 |
|
97 |
this.initialise = function () {
|
@@ -203,7 +226,74 @@ var iCWP_WPSF_InsightsAdminNotes = new function () {
|
|
203 |
} );
|
204 |
};
|
205 |
}();
|
206 |
-
|
207 |
iCWP_WPSF_OptionsPages.initialise();
|
208 |
iCWP_WPSF_OptionsFormSubmit.initialise();
|
209 |
iCWP_WPSF_InsightsAdminNotes.initialise();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
76 |
event.preventDefault();
|
77 |
|
78 |
var $oForm = jQuery( this );
|
79 |
+
|
80 |
+
var $bPasswordsReady = true;
|
81 |
+
jQuery( 'input[type=password]', $oForm ).each( function () {
|
82 |
+
var $oPass = jQuery( this );
|
83 |
+
var $oConfirm = jQuery( '#' + $oPass.attr( 'id' ) + '_confirm', $oForm );
|
84 |
+
if ( typeof $oConfirm.attr( 'id' ) !== 'undefined' ) {
|
85 |
+
if ( $oPass.val() && !$oConfirm.val() ) {
|
86 |
+
$oConfirm.addClass( 'is-invalid' );
|
87 |
+
alert( 'Form not submitted due to error: password confirmation field not provided.' );
|
88 |
+
$bPasswordsReady = false;
|
89 |
}
|
|
|
90 |
}
|
91 |
+
} );
|
92 |
+
|
93 |
+
if ( $bPasswordsReady ) {
|
94 |
+
jQuery.post( ajaxurl, $oForm.serialize(),
|
95 |
+
function ( oResponse ) {
|
96 |
+
var sMessage;
|
97 |
+
if ( oResponse === null || typeof oResponse.data === 'undefined'
|
98 |
+
|| typeof oResponse.data.message === 'undefined' ) {
|
99 |
+
sMessage = oResponse.success ? 'Success' : 'Failure';
|
100 |
+
}
|
101 |
+
else {
|
102 |
+
sMessage = oResponse.data.message;
|
103 |
+
}
|
104 |
+
iCWP_WPSF_Growl.showMessage( sMessage, oResponse.success );
|
105 |
+
}
|
106 |
+
).always( function () {
|
107 |
+
bRequestCurrentlyRunning = false;
|
108 |
+
setTimeout( function () {
|
109 |
+
location.reload( true );
|
110 |
+
}, 2000 );
|
111 |
+
}
|
112 |
+
);
|
113 |
+
}
|
114 |
+
else {
|
115 |
+
bRequestCurrentlyRunning = false;
|
116 |
+
iCWP_WPSF_BodyOverlay.hide();
|
117 |
+
}
|
118 |
};
|
119 |
|
120 |
this.initialise = function () {
|
226 |
} );
|
227 |
};
|
228 |
}();
|
|
|
229 |
iCWP_WPSF_OptionsPages.initialise();
|
230 |
iCWP_WPSF_OptionsFormSubmit.initialise();
|
231 |
iCWP_WPSF_InsightsAdminNotes.initialise();
|
232 |
+
|
233 |
+
if ( typeof icwp_wpsf_vars_secadmin !== 'undefined' && icwp_wpsf_vars_secadmin.timeleft > 0 ) {
|
234 |
+
|
235 |
+
var iCWP_WPSF_SecurityAdminCheck = new function () {
|
236 |
+
|
237 |
+
var bCheckInPlace = false;
|
238 |
+
var bWarningShown = false;
|
239 |
+
var nIntervalTimeout = 500 * icwp_wpsf_vars_secadmin.timeleft;
|
240 |
+
|
241 |
+
/**
|
242 |
+
*/
|
243 |
+
var checkSecAdmin = function () {
|
244 |
+
|
245 |
+
bCheckInPlace = false;
|
246 |
+
|
247 |
+
jQuery.post( ajaxurl, icwp_wpsf_vars_secadmin.reqajax,
|
248 |
+
function ( oResponse ) {
|
249 |
+
if ( oResponse.data.success ) {
|
250 |
+
var nLeft = oResponse.data.timeleft;
|
251 |
+
nIntervalTimeout = Math.max( 3, (nLeft / 2) ) * 1000;
|
252 |
+
|
253 |
+
if ( !bWarningShown && nLeft < 20 && nLeft > 8 ) {
|
254 |
+
bWarningShown = true;
|
255 |
+
iCWP_WPSF_Growl.showMessage( icwp_wpsf_vars_secadmin.strings.nearly, false );
|
256 |
+
}
|
257 |
+
|
258 |
+
scheduleSecAdminCheck();
|
259 |
+
}
|
260 |
+
else {
|
261 |
+
iCWP_WPSF_BodyOverlay.show();
|
262 |
+
setTimeout( function () {
|
263 |
+
if ( confirm( icwp_wpsf_vars_secadmin.strings.confirm ) ) {
|
264 |
+
window.location.reload( true );
|
265 |
+
}
|
266 |
+
else {
|
267 |
+
iCWP_WPSF_BodyOverlay.hide();
|
268 |
+
// Do nothing!
|
269 |
+
}
|
270 |
+
}, 1500 );
|
271 |
+
iCWP_WPSF_Growl.showMessage( icwp_wpsf_vars_secadmin.strings.expired, oResponse.success );
|
272 |
+
}
|
273 |
+
|
274 |
+
}
|
275 |
+
).always( function () {
|
276 |
+
}
|
277 |
+
);
|
278 |
+
};
|
279 |
+
|
280 |
+
/**
|
281 |
+
*/
|
282 |
+
var scheduleSecAdminCheck = function () {
|
283 |
+
if ( !bCheckInPlace ) {
|
284 |
+
setTimeout( function () {
|
285 |
+
checkSecAdmin();
|
286 |
+
}, nIntervalTimeout );
|
287 |
+
bCheckInPlace = true;
|
288 |
+
}
|
289 |
+
};
|
290 |
+
|
291 |
+
this.initialise = function () {
|
292 |
+
jQuery( document ).ready( function () {
|
293 |
+
scheduleSecAdminCheck();
|
294 |
+
} );
|
295 |
+
};
|
296 |
+
}();
|
297 |
+
|
298 |
+
iCWP_WPSF_SecurityAdminCheck.initialise();
|
299 |
+
}
|
Binary file
|
@@ -11,6 +11,17 @@ class AuditTrailTable extends ICWP_BaseTable {
|
|
11 |
*/
|
12 |
protected $sAuditContext;
|
13 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14 |
protected function extra_tablenav( $which ) {
|
15 |
echo sprintf( '<a href="#" data-tableaction="refresh" class="btn tableActionRefresh">%s</a>', _wpsf__( 'Refresh' ) );
|
16 |
}
|
11 |
*/
|
12 |
protected $sAuditContext;
|
13 |
|
14 |
+
/**
|
15 |
+
* @param array $aItem
|
16 |
+
* @return string
|
17 |
+
*/
|
18 |
+
public function column_message( $aItem ) {
|
19 |
+
return sprintf( '<textarea readonly rows="%s">%s</textarea>',
|
20 |
+
max( 2, (int)( strlen( $aItem[ 'message' ] )/50 ) ),
|
21 |
+
sanitize_textarea_field( $aItem[ 'message' ] )
|
22 |
+
);
|
23 |
+
}
|
24 |
+
|
25 |
protected function extra_tablenav( $which ) {
|
26 |
echo sprintf( '<a href="#" data-tableaction="refresh" class="btn tableActionRefresh">%s</a>', _wpsf__( 'Refresh' ) );
|
27 |
}
|
@@ -0,0 +1,29 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
|
3 |
+
if ( !class_exists( 'ICWP_BaseTable.php' ) ) {
|
4 |
+
require_once( dirname( __FILE__ ).'/ICWP_BaseTable.php' );
|
5 |
+
}
|
6 |
+
|
7 |
+
class LiveTrafficTable extends ICWP_BaseTable {
|
8 |
+
|
9 |
+
/*
|
10 |
+
public function column_payload( $item ) {
|
11 |
+
return 'customize';
|
12 |
+
} */
|
13 |
+
|
14 |
+
protected function extra_tablenav( $which ) {
|
15 |
+
echo sprintf( '<a href="#" data-tableaction="refresh" class="btn tableActionRefresh">%s</a>', _
|