WP Video Lightbox - Version 1.8.5

Version Description

Video Lightbox is now compatible with WordPress 4.9.

Release Info

Developer	wptipsntricks
Plugin	WP Video Lightbox
Version	1.8.5
Comparing to
See all releases

Code changes from version 1.8.4 to 1.8.5

Files changed (9) hide show

css/jquery.fancybox.css +616 -0
css/jquery.fancybox.min.css +1 -0
js/jquery.fancybox.js +4346 -0
js/jquery.fancybox.min.js +12 -0
misc_functions.php +208 -5
readme.txt +5 -2
wp-video-lightbox.css +15 -1
wp-video-lightbox.php +36 -5
wpvl-settings.php +52 -1

css/jquery.fancybox.css ADDED Viewed

	@@ -0,0 +1,616 @@


1	+ @charset "UTF-8";
2	+ .fancybox-enabled {
3	+ overflow: hidden; }
4	+
5	+ .fancybox-enabled body {
6	+ overflow: visible;
7	+ height: 100%; }
8	+
9	+ .fancybox-container {
10	+ position: fixed;
11	+ top: 0;
12	+ left: 0;
13	+ width: 100%;
14	+ height: 100%;
15	+ z-index: 99993;
16	+ -webkit-backface-visibility: hidden;
17	+ backface-visibility: hidden; }
18	+
19	+ /* Make sure that the first one is on the top */
20	+ .fancybox-container ~ .fancybox-container {
21	+ z-index: 99992; }
22	+
23	+ .fancybox-bg {
24	+ position: absolute;
25	+ top: 0;
26	+ right: 0;
27	+ bottom: 0;
28	+ left: 0;
29	+ background: #0f0f11;
30	+ opacity: 0;
31	+ transition-timing-function: cubic-bezier(0.55, 0.06, 0.68, 0.19);
32	+ -webkit-backface-visibility: hidden;
33	+ backface-visibility: hidden; }
34	+
35	+ .fancybox-container--ready .fancybox-bg {
36	+ opacity: 0.87;
37	+ transition-timing-function: cubic-bezier(0.22, 0.61, 0.36, 1); }
38	+
39	+ .fancybox-controls {
40	+ position: absolute;
41	+ top: 0;
42	+ left: 0;
43	+ right: 0;
44	+ text-align: center;
45	+ opacity: 0;
46	+ z-index: 99994;
47	+ transition: opacity .2s;
48	+ pointer-events: none;
49	+ -webkit-backface-visibility: hidden;
50	+ backface-visibility: hidden;
51	+ direction: ltr; }
52	+
53	+ .fancybox-show-controls .fancybox-controls {
54	+ opacity: 1; }
55	+
56	+ .fancybox-infobar {
57	+ display: none; }
58	+
59	+ .fancybox-show-infobar .fancybox-infobar {
60	+ display: inline-block;
61	+ pointer-events: all; }
62	+
63	+ .fancybox-infobar__body {
64	+ display: inline-block;
65	+ width: 70px;
66	+ line-height: 44px;
67	+ font-size: 13px;
68	+ font-family: "Helvetica Neue",Helvetica,Arial,sans-serif;
69	+ text-align: center;
70	+ color: #ddd;
71	+ background-color: rgba(30, 30, 30, 0.7);
72	+ pointer-events: none;
73	+ -webkit-user-select: none;
74	+ -moz-user-select: none;
75	+ -ms-user-select: none;
76	+ user-select: none;
77	+ -webkit-touch-callout: none;
78	+ -webkit-tap-highlight-color: transparent;
79	+ -webkit-font-smoothing: subpixel-antialiased; }
80	+
81	+ .fancybox-buttons {
82	+ position: absolute;
83	+ top: 0;
84	+ right: 0;
85	+ display: none;
86	+ pointer-events: all; }
87	+
88	+ .fancybox-show-buttons .fancybox-buttons {
89	+ display: block; }
90	+
91	+ .fancybox-slider-wrap {
92	+ overflow: hidden;
93	+ direction: ltr; }
94	+
95	+ .fancybox-slider-wrap,
96	+ .fancybox-slider {
97	+ position: absolute;
98	+ top: 0;
99	+ left: 0;
100	+ bottom: 0;
101	+ right: 0;
102	+ padding: 0;
103	+ margin: 0;
104	+ z-index: 99993;
105	+ -webkit-backface-visibility: hidden;
106	+ backface-visibility: hidden;
107	+ -webkit-tap-highlight-color: transparent; }
108	+
109	+ .fancybox-slide {
110	+ position: absolute;
111	+ top: 0;
112	+ left: 0;
113	+ width: 100%;
114	+ height: 100%;
115	+ margin: 0;
116	+ padding: 0;
117	+ overflow: auto;
118	+ outline: none;
119	+ white-space: normal;
120	+ box-sizing: border-box;
121	+ text-align: center;
122	+ z-index: 99994;
123	+ -webkit-overflow-scrolling: touch; }
124	+
125	+ .fancybox-slide::before {
126	+ content: '';
127	+ display: inline-block;
128	+ vertical-align: middle;
129	+ height: 100%;
130	+ width: 0; }
131	+
132	+ .fancybox-slide > * {
133	+ display: inline-block;
134	+ position: relative;
135	+ padding: 24px;
136	+ margin: 44px 0 44px;
137	+ border-width: 0;
138	+ vertical-align: middle;
139	+ text-align: left;
140	+ background-color: #fff;
141	+ overflow: auto;
142	+ box-sizing: border-box; }
143	+
144	+ .fancybox-slide--image {
145	+ overflow: hidden; }
146	+
147	+ .fancybox-slide--image::before {
148	+ display: none; }
149	+
150	+ .fancybox-content {
151	+ display: inline-block;
152	+ position: relative;
153	+ margin: 44px auto;
154	+ padding: 0;
155	+ border: 0;
156	+ width: 80%;
157	+ height: calc(100% - 88px);
158	+ vertical-align: middle;
159	+ line-height: normal;
160	+ text-align: left;
161	+ white-space: normal;
162	+ outline: none;
163	+ font-size: 16px;
164	+ font-family: Arial, sans-serif;
165	+ box-sizing: border-box;
166	+ -webkit-tap-highlight-color: transparent;
167	+ -webkit-overflow-scrolling: touch; }
168	+
169	+ .fancybox-iframe {
170	+ display: block;
171	+ margin: 0;
172	+ padding: 0;
173	+ border: 0;
174	+ width: 100%;
175	+ height: 100%;
176	+ background: #fff; }
177	+
178	+ .fancybox-slide--video .fancybox-content,
179	+ .fancybox-slide--video .fancybox-iframe {
180	+ background: transparent; }
181	+
182	+ .fancybox-placeholder {
183	+ position: absolute;
184	+ top: 0;
185	+ left: 0;
186	+ margin: 0;
187	+ padding: 0;
188	+ border: 0;
189	+ z-index: 99995;
190	+ background: transparent;
191	+ cursor: default;
192	+ overflow: visible;
193	+ -webkit-transform-origin: top left;
194	+ -ms-transform-origin: top left;
195	+ transform-origin: top left;
196	+ background-size: 100% 100%;
197	+ background-repeat: no-repeat;
198	+ -webkit-backface-visibility: hidden;
199	+ backface-visibility: hidden; }
200	+
201	+ .fancybox-image,
202	+ .fancybox-spaceball {
203	+ position: absolute;
204	+ top: 0;
205	+ left: 0;
206	+ width: 100%;
207	+ height: 100%;
208	+ margin: 0;
209	+ padding: 0;
210	+ border: 0;
211	+ max-width: none;
212	+ max-height: none;
213	+ background: transparent;
214	+ background-size: 100% 100%; }
215	+
216	+ .fancybox-controls--canzoomOut .fancybox-placeholder {
217	+ cursor: -webkit-zoom-out;
218	+ cursor: zoom-out; }
219	+
220	+ .fancybox-controls--canzoomIn .fancybox-placeholder {
221	+ cursor: -webkit-zoom-in;
222	+ cursor: zoom-in; }
223	+
224	+ .fancybox-controls--canGrab .fancybox-placeholder {
225	+ cursor: -webkit-grab;
226	+ cursor: grab; }
227	+
228	+ .fancybox-controls--isGrabbing .fancybox-placeholder {
229	+ cursor: -webkit-grabbing;
230	+ cursor: grabbing; }
231	+
232	+ .fancybox-spaceball {
233	+ z-index: 1; }
234	+
235	+ .fancybox-tmp {
236	+ position: absolute;
237	+ top: -9999px;
238	+ left: -9999px;
239	+ visibility: hidden; }
240	+
241	+ .fancybox-error {
242	+ position: absolute;
243	+ margin: 0;
244	+ padding: 40px;
245	+ top: 50%;
246	+ left: 50%;
247	+ width: 380px;
248	+ max-width: 100%;
249	+ -webkit-transform: translate(-50%, -50%);
250	+ -ms-transform: translate(-50%, -50%);
251	+ transform: translate(-50%, -50%);
252	+ background: #fff;
253	+ cursor: default; }
254	+
255	+ .fancybox-error p {
256	+ margin: 0;
257	+ padding: 0;
258	+ color: #444;
259	+ font: 16px/20px "Helvetica Neue",Helvetica,Arial,sans-serif; }
260	+
261	+ .fancybox-close-small {
262	+ position: absolute;
263	+ top: 0;
264	+ right: 0;
265	+ width: 44px;
266	+ height: 44px;
267	+ padding: 0;
268	+ margin: 0;
269	+ border: 0;
270	+ border-radius: 0;
271	+ outline: none;
272	+ background: transparent;
273	+ z-index: 10;
274	+ cursor: pointer; }
275	+
276	+ .fancybox-close-small:after {
277	+ content: '×';
278	+ position: absolute;
279	+ top: 5px;
280	+ right: 5px;
281	+ width: 30px;
282	+ height: 30px;
283	+ font: 20px/30px Arial,"Helvetica Neue",Helvetica,sans-serif;
284	+ color: #888;
285	+ font-weight: 300;
286	+ text-align: center;
287	+ border-radius: 50%;
288	+ border-width: 0;
289	+ background: #fff;
290	+ transition: background .2s;
291	+ box-sizing: border-box;
292	+ z-index: 2; }
293	+
294	+ .fancybox-close-small:focus:after {
295	+ outline: 1px dotted #888; }
296	+
297	+ .fancybox-slide--video .fancybox-close-small {
298	+ top: -36px;
299	+ right: -36px;
300	+ background: transparent; }
301	+
302	+ .fancybox-close-small:hover:after {
303	+ color: #555;
304	+ background: #eee; }
305	+
306	+ /* Caption */
307	+ .fancybox-caption-wrap {
308	+ position: absolute;
309	+ bottom: 0;
310	+ left: 0;
311	+ right: 0;
312	+ padding: 60px 30px 0 30px;
313	+ z-index: 99998;
314	+ -webkit-backface-visibility: hidden;
315	+ backface-visibility: hidden;
316	+ box-sizing: border-box;
317	+ background: linear-gradient(to bottom, transparent 0%, rgba(0, 0, 0, 0.1) 20%, rgba(0, 0, 0, 0.2) 40%, rgba(0, 0, 0, 0.6) 80%, rgba(0, 0, 0, 0.8) 100%);
318	+ opacity: 0;
319	+ transition: opacity .2s;
320	+ pointer-events: none; }
321	+
322	+ .fancybox-show-caption .fancybox-caption-wrap {
323	+ opacity: 1; }
324	+
325	+ .fancybox-caption {
326	+ padding: 30px 0;
327	+ border-top: 1px solid rgba(255, 255, 255, 0.4);
328	+ font-size: 14px;
329	+ font-family: "Helvetica Neue",Helvetica,Arial,sans-serif;
330	+ color: #fff;
331	+ line-height: 20px;
332	+ -webkit-text-size-adjust: none; }
333	+
334	+ .fancybox-caption a,
335	+ .fancybox-caption button {
336	+ pointer-events: all; }
337	+
338	+ .fancybox-caption a {
339	+ color: #fff;
340	+ text-decoration: underline; }
341	+
342	+ /* Buttons */
343	+ .fancybox-button {
344	+ display: inline-block;
345	+ position: relative;
346	+ width: 44px;
347	+ height: 44px;
348	+ line-height: 44px;
349	+ margin: 0;
350	+ padding: 0;
351	+ border: 0;
352	+ border-radius: 0;
353	+ cursor: pointer;
354	+ background: transparent;
355	+ color: #fff;
356	+ box-sizing: border-box;
357	+ vertical-align: top;
358	+ outline: none; }
359	+
360	+ .fancybox-button--disabled {
361	+ cursor: default;
362	+ pointer-events: none; }
363	+
364	+ .fancybox-infobar__body, .fancybox-button {
365	+ background: rgba(30, 30, 30, 0.6); }
366	+
367	+ .fancybox-button:hover {
368	+ background: rgba(0, 0, 0, 0.8); }
369	+
370	+ .fancybox-button::before,
371	+ .fancybox-button::after {
372	+ content: '';
373	+ pointer-events: none;
374	+ position: absolute;
375	+ border-color: #fff;
376	+ background-color: currentColor;
377	+ color: currentColor;
378	+ opacity: 0.9;
379	+ box-sizing: border-box;
380	+ display: inline-block; }
381	+
382	+ .fancybox-button--disabled::before,
383	+ .fancybox-button--disabled::after {
384	+ opacity: 0.5; }
385	+
386	+ .fancybox-button--left::after {
387	+ left: 20px;
388	+ top: 18px;
389	+ width: 6px;
390	+ height: 6px;
391	+ background: transparent;
392	+ border-top: solid 2px currentColor;
393	+ border-right: solid 2px currentColor;
394	+ -webkit-transform: rotate(-135deg);
395	+ -ms-transform: rotate(-135deg);
396	+ transform: rotate(-135deg); }
397	+
398	+ .fancybox-button--right::after {
399	+ right: 20px;
400	+ top: 18px;
401	+ width: 6px;
402	+ height: 6px;
403	+ background: transparent;
404	+ border-top: solid 2px currentColor;
405	+ border-right: solid 2px currentColor;
406	+ -webkit-transform: rotate(45deg);
407	+ -ms-transform: rotate(45deg);
408	+ transform: rotate(45deg); }
409	+
410	+ .fancybox-button--left {
411	+ border-bottom-left-radius: 5px; }
412	+
413	+ .fancybox-button--right {
414	+ border-bottom-right-radius: 5px; }
415	+
416	+ .fancybox-button--close {
417	+ float: right; }
418	+
419	+ .fancybox-button--close::before, .fancybox-button--close::after {
420	+ content: '';
421	+ display: inline-block;
422	+ position: absolute;
423	+ height: 2px;
424	+ width: 16px;
425	+ top: calc(50% - 1px);
426	+ left: calc(50% - 8px); }
427	+
428	+ .fancybox-button--close::before {
429	+ -webkit-transform: rotate(45deg);
430	+ -ms-transform: rotate(45deg);
431	+ transform: rotate(45deg); }
432	+
433	+ .fancybox-button--close::after {
434	+ -webkit-transform: rotate(-45deg);
435	+ -ms-transform: rotate(-45deg);
436	+ transform: rotate(-45deg); }
437	+
438	+ /* Loading spinner */
439	+ .fancybox-loading {
440	+ border: 6px solid rgba(100, 100, 100, 0.4);
441	+ border-top: 6px solid rgba(255, 255, 255, 0.6);
442	+ border-radius: 100%;
443	+ height: 50px;
444	+ width: 50px;
445	+ -webkit-animation: fancybox-rotate .8s infinite linear;
446	+ animation: fancybox-rotate .8s infinite linear;
447	+ background: transparent;
448	+ position: absolute;
449	+ top: 50%;
450	+ left: 50%;
451	+ margin-top: -25px;
452	+ margin-left: -25px;
453	+ z-index: 99999; }
454	+
455	+ @-webkit-keyframes fancybox-rotate {
456	+ from {
457	+ -webkit-transform: rotate(0deg);
458	+ transform: rotate(0deg); }
459	+ to {
460	+ -webkit-transform: rotate(359deg);
461	+ transform: rotate(359deg); } }
462	+
463	+ @keyframes fancybox-rotate {
464	+ from {
465	+ -webkit-transform: rotate(0deg);
466	+ transform: rotate(0deg); }
467	+ to {
468	+ -webkit-transform: rotate(359deg);
469	+ transform: rotate(359deg); } }
470	+
471	+ /* Styling for Small-Screen Devices */
472	+ @media all and (max-width: 800px) {
473	+ .fancybox-controls {
474	+ text-align: left; }
475	+ .fancybox-button--left,
476	+ .fancybox-button--right,
477	+ .fancybox-buttons button:not(.fancybox-button--close) {
478	+ display: none !important; }
479	+ .fancybox-caption {
480	+ padding: 20px 0;
481	+ margin: 0; } }
482	+
483	+ /* Fullscreen */
484	+ .fancybox-button--fullscreen::before {
485	+ width: 15px;
486	+ height: 11px;
487	+ left: 15px;
488	+ top: 16px;
489	+ border: 2px solid;
490	+ background: none; }
491	+
492	+ /* Slideshow button */
493	+ .fancybox-button--play::before {
494	+ top: 16px;
495	+ left: 18px;
496	+ width: 0;
497	+ height: 0;
498	+ border-top: 6px inset transparent;
499	+ border-bottom: 6px inset transparent;
500	+ border-left: 10px solid;
501	+ border-radius: 1px;
502	+ background: transparent; }
503	+
504	+ .fancybox-button--pause::before {
505	+ top: 16px;
506	+ left: 18px;
507	+ width: 7px;
508	+ height: 11px;
509	+ border-style: solid;
510	+ border-width: 0 2px 0 2px;
511	+ background: transparent; }
512	+
513	+ /* Thumbs */
514	+ .fancybox-button--thumbs span {
515	+ font-size: 23px; }
516	+
517	+ .fancybox-button--thumbs::before {
518	+ top: 20px;
519	+ left: 21px;
520	+ width: 3px;
521	+ height: 3px;
522	+ box-shadow: 0 -4px 0, -4px -4px 0, 4px -4px 0, 0 0 0 32px inset, -4px 0 0, 4px 0 0, 0 4px 0, -4px 4px 0, 4px 4px 0; }
523	+
524	+ .fancybox-container--thumbs .fancybox-controls,
525	+ .fancybox-container--thumbs .fancybox-slider-wrap,
526	+ .fancybox-container--thumbs .fancybox-caption-wrap {
527	+ right: 220px; }
528	+
529	+ .fancybox-thumbs {
530	+ position: absolute;
531	+ top: 0;
532	+ right: 0;
533	+ bottom: 0;
534	+ left: auto;
535	+ width: 220px;
536	+ margin: 0;
537	+ padding: 5px 5px 0 0;
538	+ background: #fff;
539	+ z-index: 99993;
540	+ word-break: normal;
541	+ -webkit-overflow-scrolling: touch;
542	+ -webkit-tap-highlight-color: transparent;
543	+ box-sizing: border-box; }
544	+
545	+ .fancybox-thumbs > ul {
546	+ list-style: none;
547	+ position: absolute;
548	+ position: relative;
549	+ width: 100%;
550	+ height: 100%;
551	+ margin: 0;
552	+ padding: 0;
553	+ overflow-x: hidden;
554	+ overflow-y: auto;
555	+ font-size: 0; }
556	+
557	+ .fancybox-thumbs > ul > li {
558	+ float: left;
559	+ overflow: hidden;
560	+ max-width: 50%;
561	+ padding: 0;
562	+ margin: 0;
563	+ width: 105px;
564	+ height: 75px;
565	+ position: relative;
566	+ cursor: pointer;
567	+ outline: none;
568	+ border: 5px solid #fff;
569	+ border-top-width: 0;
570	+ border-right-width: 0;
571	+ -webkit-tap-highlight-color: transparent;
572	+ -webkit-backface-visibility: hidden;
573	+ backface-visibility: hidden;
574	+ box-sizing: border-box; }
575	+
576	+ li.fancybox-thumbs-loading {
577	+ background: rgba(0, 0, 0, 0.1); }
578	+
579	+ .fancybox-thumbs > ul > li > img {
580	+ position: absolute;
581	+ top: 0;
582	+ left: 0;
583	+ min-width: 100%;
584	+ min-height: 100%;
585	+ max-width: none;
586	+ max-height: none;
587	+ -webkit-touch-callout: none;
588	+ -webkit-user-select: none;
589	+ -moz-user-select: none;
590	+ -ms-user-select: none;
591	+ user-select: none; }
592	+
593	+ .fancybox-thumbs > ul > li:before {
594	+ content: '';
595	+ position: absolute;
596	+ top: 0;
597	+ right: 0;
598	+ bottom: 0;
599	+ left: 0;
600	+ border-radius: 2px;
601	+ border: 4px solid #4ea7f9;
602	+ z-index: 99991;
603	+ opacity: 0;
604	+ transition: all 0.2s cubic-bezier(0.25, 0.46, 0.45, 0.94); }
605	+
606	+ .fancybox-thumbs > ul > li.fancybox-thumbs-active:before {
607	+ opacity: 1; }
608	+
609	+ /* Styling for Small-Screen Devices */
610	+ @media all and (max-width: 800px) {
611	+ .fancybox-thumbs {
612	+ display: none !important; }
613	+ .fancybox-container--thumbs .fancybox-controls,
614	+ .fancybox-container--thumbs .fancybox-slider-wrap,
615	+ .fancybox-container--thumbs .fancybox-caption-wrap {
616	+ right: 0; } }

css/jquery.fancybox.min.css ADDED Viewed

	@@ -0,0 +1 @@

+ @charset "UTF-8";.fancybox-enabled{overflow:hidden}.fancybox-enabled body{overflow:visible;height:100%}.fancybox-container{position:fixed;top:0;left:0;width:100%;height:100%;z-index:99993;-webkit-backface-visibility:hidden;backface-visibility:hidden}.fancybox-container~.fancybox-container{z-index:99992}.fancybox-bg{position:absolute;top:0;right:0;bottom:0;left:0;background:#0f0f11;opacity:0;transition-timing-function:cubic-bezier(.55,.06,.68,.19);-webkit-backface-visibility:hidden;backface-visibility:hidden}.fancybox-container--ready .fancybox-bg{opacity:.87;transition-timing-function:cubic-bezier(.22,.61,.36,1)}.fancybox-controls{position:absolute;top:0;left:0;right:0;text-align:center;opacity:0;z-index:99994;transition:opacity .2s;pointer-events:none;-webkit-backface-visibility:hidden;backface-visibility:hidden;direction:ltr}.fancybox-show-controls .fancybox-controls{opacity:1}.fancybox-infobar{display:none}.fancybox-show-infobar .fancybox-infobar{display:inline-block;pointer-events:all}.fancybox-infobar__body{display:inline-block;width:70px;line-height:44px;font-size:13px;font-family:Helvetica Neue,Helvetica,Arial,sans-serif;text-align:center;color:#ddd;background-color:rgba(30,30,30,.7);pointer-events:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-touch-callout:none;-webkit-tap-highlight-color:transparent;-webkit-font-smoothing:subpixel-antialiased}.fancybox-buttons{position:absolute;top:0;right:0;display:none;pointer-events:all}.fancybox-show-buttons .fancybox-buttons{display:block}.fancybox-slider-wrap{overflow:hidden;direction:ltr}.fancybox-slider,.fancybox-slider-wrap{position:absolute;top:0;left:0;bottom:0;right:0;padding:0;margin:0;z-index:99993;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-tap-highlight-color:transparent}.fancybox-slide{position:absolute;top:0;left:0;width:100%;height:100%;margin:0;padding:0;overflow:auto;outline:none;white-space:normal;box-sizing:border-box;text-align:center;z-index:99994;-webkit-overflow-scrolling:touch}.fancybox-slide:before{content:"";height:100%;width:0}.fancybox-slide:before,.fancybox-slide>*{display:inline-block;vertical-align:middle}.fancybox-slide>*{position:relative;padding:24px;margin:44px 0;border-width:0;text-align:left;background-color:#fff;overflow:auto;box-sizing:border-box}.fancybox-slide--image{overflow:hidden}.fancybox-slide--image:before{display:none}.fancybox-content{display:inline-block;position:relative;margin:44px auto;padding:0;border:0;width:80%;height:calc(100% - 88px);vertical-align:middle;line-height:normal;text-align:left;white-space:normal;outline:none;font-size:16px;font-family:Arial,sans-serif;box-sizing:border-box;-webkit-tap-highlight-color:transparent;-webkit-overflow-scrolling:touch}.fancybox-iframe{display:block;margin:0;padding:0;border:0;width:100%;height:100%;background:#fff}.fancybox-slide--video .fancybox-content,.fancybox-slide--video .fancybox-iframe{background:transparent}.fancybox-placeholder{z-index:99995;background:transparent;cursor:default;overflow:visible;-webkit-transform-origin:top left;transform-origin:top left;background-size:100% 100%;background-repeat:no-repeat;-webkit-backface-visibility:hidden;backface-visibility:hidden}.fancybox-image,.fancybox-placeholder,.fancybox-spaceball{position:absolute;top:0;left:0;margin:0;padding:0;border:0}.fancybox-image,.fancybox-spaceball{width:100%;height:100%;max-width:none;max-height:none;background:transparent;background-size:100% 100%}.fancybox-controls--canzoomOut .fancybox-placeholder{cursor:zoom-out}.fancybox-controls--canzoomIn .fancybox-placeholder{cursor:zoom-in}.fancybox-controls--canGrab .fancybox-placeholder{cursor:-webkit-grab;cursor:grab}.fancybox-controls--isGrabbing .fancybox-placeholder{cursor:-webkit-grabbing;cursor:grabbing}.fancybox-spaceball{z-index:1}.fancybox-tmp{position:absolute;top:-9999px;left:-9999px;visibility:hidden}.fancybox-error{position:absolute;margin:0;padding:40px;top:50%;left:50%;width:380px;max-width:100%;-webkit-transform:translate(-50%,-50%);transform:translate(-50%,-50%);background:#fff;cursor:default}.fancybox-error p{margin:0;padding:0;color:#444;font:16px/20px Helvetica Neue,Helvetica,Arial,sans-serif}.fancybox-close-small{position:absolute;top:0;right:0;width:44px;height:44px;padding:0;margin:0;border:0;border-radius:0;outline:none;background:transparent;z-index:10;cursor:pointer}.fancybox-close-small:after{content:"×";position:absolute;top:5px;right:5px;width:30px;height:30px;font:20px/30px Arial,Helvetica Neue,Helvetica,sans-serif;color:#888;font-weight:300;text-align:center;border-radius:50%;border-width:0;background:#fff;transition:background .2s;box-sizing:border-box;z-index:2}.fancybox-close-small:focus:after{outline:1px dotted #888}.fancybox-slide--video .fancybox-close-small{top:-36px;right:-36px;background:transparent}.fancybox-close-small:hover:after{color:#555;background:#eee}.fancybox-caption-wrap{position:absolute;bottom:0;left:0;right:0;padding:60px 30px 0;z-index:99998;-webkit-backface-visibility:hidden;backface-visibility:hidden;box-sizing:border-box;background:linear-gradient(180deg,transparent 0,rgba(0,0,0,.1) 20%,rgba(0,0,0,.2) 40%,rgba(0,0,0,.6) 80%,rgba(0,0,0,.8));opacity:0;transition:opacity .2s;pointer-events:none}.fancybox-show-caption .fancybox-caption-wrap{opacity:1}.fancybox-caption{padding:30px 0;border-top:1px solid hsla(0,0%,100%,.4);font-size:14px;font-family:Helvetica Neue,Helvetica,Arial,sans-serif;color:#fff;line-height:20px;-webkit-text-size-adjust:none}.fancybox-caption a,.fancybox-caption button{pointer-events:all}.fancybox-caption a{color:#fff;text-decoration:underline}.fancybox-button{display:inline-block;position:relative;width:44px;height:44px;line-height:44px;margin:0;padding:0;border:0;border-radius:0;cursor:pointer;background:transparent;color:#fff;box-sizing:border-box;vertical-align:top;outline:none}.fancybox-button--disabled{cursor:default;pointer-events:none}.fancybox-button,.fancybox-infobar__body{background:rgba(30,30,30,.6)}.fancybox-button:hover{background:rgba(0,0,0,.8)}.fancybox-button:after,.fancybox-button:before{content:"";pointer-events:none;position:absolute;border-color:#fff;background-color:currentColor;color:currentColor;opacity:.9;box-sizing:border-box;display:inline-block}.fancybox-button--disabled:after,.fancybox-button--disabled:before{opacity:.5}.fancybox-button--left:after{left:20px;-webkit-transform:rotate(-135deg);transform:rotate(-135deg)}.fancybox-button--left:after,.fancybox-button--right:after{top:18px;width:6px;height:6px;background:transparent;border-top:2px solid currentColor;border-right:2px solid currentColor}.fancybox-button--right:after{right:20px;-webkit-transform:rotate(45deg);transform:rotate(45deg)}.fancybox-button--left{border-bottom-left-radius:5px}.fancybox-button--right{border-bottom-right-radius:5px}.fancybox-button--close{float:right}.fancybox-button--close:after,.fancybox-button--close:before{content:"";display:inline-block;position:absolute;height:2px;width:16px;top:calc(50% - 1px);left:calc(50% - 8px)}.fancybox-button--close:before{-webkit-transform:rotate(45deg);transform:rotate(45deg)}.fancybox-button--close:after{-webkit-transform:rotate(-45deg);transform:rotate(-45deg)}.fancybox-loading{border:6px solid hsla(0,0%,39%,.4);border-top:6px solid hsla(0,0%,100%,.6);border-radius:100%;height:50px;width:50px;-webkit-animation:a .8s infinite linear;animation:a .8s infinite linear;background:transparent;position:absolute;top:50%;left:50%;margin-top:-25px;margin-left:-25px;z-index:99999}@-webkit-keyframes a{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@keyframes a{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@media (max-width:800px){.fancybox-controls{text-align:left}.fancybox-button--left,.fancybox-button--right,.fancybox-buttons button:not(.fancybox-button--close){display:none!important}.fancybox-caption{padding:20px 0;margin:0}}.fancybox-button--fullscreen:before{width:15px;height:11px;left:15px;top:16px;border:2px solid;background:none}.fancybox-button--play:before{top:16px;left:18px;width:0;height:0;border-top:6px inset transparent;border-bottom:6px inset transparent;border-left:10px solid;border-radius:1px;background:transparent}.fancybox-button--pause:before{top:16px;left:18px;width:7px;height:11px;border-style:solid;border-width:0 2px;background:transparent}.fancybox-button--thumbs span{font-size:23px}.fancybox-button--thumbs:before{top:20px;left:21px;width:3px;height:3px;box-shadow:0 -4px 0,-4px -4px 0,4px -4px 0,inset 0 0 0 32px,-4px 0 0,4px 0 0,0 4px 0,-4px 4px 0,4px 4px 0}.fancybox-container--thumbs .fancybox-caption-wrap,.fancybox-container--thumbs .fancybox-controls,.fancybox-container--thumbs .fancybox-slider-wrap{right:220px}.fancybox-thumbs{position:absolute;top:0;right:0;bottom:0;left:auto;width:220px;margin:0;padding:5px 5px 0 0;background:#fff;z-index:99993;word-break:normal;-webkit-overflow-scrolling:touch;-webkit-tap-highlight-color:transparent;box-sizing:border-box}.fancybox-thumbs>ul{list-style:none;position:absolute;position:relative;width:100%;height:100%;margin:0;padding:0;overflow-x:hidden;overflow-y:auto;font-size:0}.fancybox-thumbs>ul>li{float:left;overflow:hidden;max-width:50%;padding:0;margin:0;width:105px;height:75px;position:relative;cursor:pointer;outline:none;border:5px solid #fff;border-top-width:0;border-right-width:0;-webkit-tap-highlight-color:transparent;-webkit-backface-visibility:hidden;backface-visibility:hidden;box-sizing:border-box}li.fancybox-thumbs-loading{background:rgba(0,0,0,.1)}.fancybox-thumbs>ul>li>img{position:absolute;top:0;left:0;min-width:100%;min-height:100%;max-width:none;max-height:none;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-thumbs>ul>li:before{content:"";position:absolute;top:0;right:0;bottom:0;left:0;border-radius:2px;border:4px solid #4ea7f9;z-index:99991;opacity:0;transition:all .2s cubic-bezier(.25,.46,.45,.94)}.fancybox-thumbs>ul>li.fancybox-thumbs-active:before{opacity:1}@media (max-width:800px){.fancybox-thumbs{display:none!important}.fancybox-container--thumbs .fancybox-caption-wrap,.fancybox-container--thumbs .fancybox-controls,.fancybox-container--thumbs .fancybox-slider-wrap{right:0}}

js/jquery.fancybox.js ADDED Viewed

	@@ -0,0 +1,4346 @@


1	+ // ==================================================
2	+ // fancyBox v3.0.47
3	+ //
4	+ // Licensed GPLv3 for open source use
5	+ // or fancyBox Commercial License for commercial use
6	+ //
7	+ // http://fancyapps.com/fancybox/
8	+ // Copyright 2017 fancyApps
9	+ //
10	+ // ==================================================
11	+ ;(function (window, document, $, undefined) {
12	+ 'use strict';
13	+
14	+ // If there's no jQuery, fancyBox can't work
15	+ // =========================================
16	+
17	+ if ( !$ ) {
18	+ return undefined;
19	+ }
20	+
21	+ // Private default settings
22	+ // ========================
23	+
24	+ var defaults = {
25	+
26	+ // Animation duration in ms
27	+ speed : 330,
28	+
29	+ // Enable infinite gallery navigation
30	+ loop : true,
31	+
32	+ // Should zoom animation change opacity, too
33	+ // If opacity is 'auto', then fade-out if image and thumbnail have different aspect ratios
34	+ opacity : 'auto',
35	+
36	+ // Space around image, ignored if zoomed-in or viewport smaller than 800px
37	+ margin : [44, 0],
38	+
39	+ // Horizontal space between slides
40	+ gutter : 30,
41	+
42	+ // Should display toolbars
43	+ infobar : true,
44	+ buttons : true,
45	+
46	+ // What buttons should appear in the toolbar
47	+ slideShow : true,
48	+ fullScreen : true,
49	+ thumbs : true,
50	+ closeBtn : true,
51	+
52	+ // Should apply small close button at top right corner of the content
53	+ // If 'auto' - will be set for content having type 'html', 'inline' or 'ajax'
54	+ smallBtn : 'auto',
55	+
56	+ image : {
57	+
58	+ // Wait for images to load before displaying
59	+ // Requires predefined image dimensions
60	+ // If 'auto' - will zoom in thumbnail if 'width' and 'height' attributes are found
61	+ preload : "auto",
62	+
63	+ // Protect an image from downloading by right-click
64	+ protect : false
65	+
66	+ },
67	+
68	+ ajax : {
69	+
70	+ // Object containing settings for ajax request
71	+ settings : {
72	+
73	+ // This helps to indicate that request comes from the modal
74	+ // Feel free to change naming
75	+ data : {
76	+ fancybox : true
77	+ }
78	+ }
79	+
80	+ },
81	+
82	+ iframe : {
83	+
84	+ // Iframe template
85	+ tpl : '<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" webkitAllowFullScreen mozallowfullscreen allowFullScreen allowtransparency="true" src=""></iframe>',
86	+
87	+ // Preload iframe before displaying it
88	+ // This allows to calculate iframe content width and height
89	+ // (note: Due to "Same Origin Policy", you can't get cross domain data).
90	+ preload : true,
91	+
92	+ // Scrolling attribute for iframe tag
93	+ scrolling : 'no',
94	+
95	+ // Custom CSS styling for iframe wrapping element
96	+ css : {}
97	+
98	+ },
99	+
100	+ // Custom CSS class for layout
101	+ baseClass : '',
102	+
103	+ // Custom CSS class for slide element
104	+ slideClass : '',
105	+
106	+ // Base template for layout
107	+ baseTpl : '<div class="fancybox-container" role="dialog" tabindex="-1">' +
108	+ '<div class="fancybox-bg"></div>' +
109	+ '<div class="fancybox-controls">' +
110	+ '<div class="fancybox-infobar">' +
111	+ '<button data-fancybox-previous class="fancybox-button fancybox-button--left" title="Previous"></button>' +
112	+ '<div class="fancybox-infobar__body">' +
113	+ '<span class="js-fancybox-index"></span> / <span class="js-fancybox-count"></span>' +
114	+ '</div>' +
115	+ '<button data-fancybox-next class="fancybox-button fancybox-button--right" title="Next"></button>' +
116	+ '</div>' +
117	+ '<div class="fancybox-buttons">' +
118	+ '<button data-fancybox-close class="fancybox-button fancybox-button--close" title="Close (Esc)"></button>' +
119	+ '</div>' +
120	+ '</div>' +
121	+ '<div class="fancybox-slider-wrap">' +
122	+ '<div class="fancybox-slider"></div>' +
123	+ '</div>' +
124	+ '<div class="fancybox-caption-wrap"><div class="fancybox-caption"></div></div>' +
125	+ '</div>',
126	+
127	+ // Loading indicator template
128	+ spinnerTpl : '<div class="fancybox-loading"></div>',
129	+
130	+ // Error message template
131	+ errorTpl : '<div class="fancybox-error"><p>The requested content cannot be loaded. <br /> Please try again later.<p></div>',
132	+
133	+ // This will be appended to html content, if "smallBtn" option is not set to false
134	+ closeTpl : '<button data-fancybox-close class="fancybox-close-small"></button>',
135	+
136	+ // Container is injected into this element
137	+ parentEl : 'body',
138	+
139	+ // Enable gestures (tap, zoom, pan and pinch)
140	+ touch : true,
141	+
142	+ // Enable keyboard navigation
143	+ keyboard : true,
144	+
145	+ // Try to focus on first focusable element after opening
146	+ focus : true,
147	+
148	+ // Close when clicked outside of the content
149	+ closeClickOutside : true,
150	+
151	+ // Callbacks
152	+ beforeLoad : $.noop,
153	+ afterLoad : $.noop,
154	+ beforeMove : $.noop,
155	+ afterMove : $.noop,
156	+ onComplete : $.noop,
157	+
158	+ onInit : $.noop,
159	+ beforeClose : $.noop,
160	+ afterClose : $.noop,
161	+ onActivate : $.noop,
162	+ onDeactivate : $.noop
163	+
164	+ };
165	+
166	+ var $W = $(window);
167	+ var $D = $(document);
168	+
169	+ var called = 0;
170	+
171	+ // Check if an object is a jQuery object and not a native JavaScript object
172	+ // ========================================================================
173	+
174	+ var isQuery = function (obj) {
175	+ return obj && obj.hasOwnProperty && obj instanceof $;
176	+ };
177	+
178	+ // Handle multiple browsers for requestAnimationFrame()
179	+ // ====================================================
180	+
181	+ var requestAFrame = (function() {
182	+ return window.requestAnimationFrame \|\|
183	+ window.webkitRequestAnimationFrame \|\|
184	+ window.mozRequestAnimationFrame \|\|
185	+ function( callback ) {
186	+ window.setTimeout(callback, 1000 / 60); };
187	+ })();
188	+
189	+
190	+ // Check if element is inside the viewport by at least 1 pixel
191	+ // ===========================================================
192	+
193	+ var isElementInViewport = function( el ) {
194	+ var rect;
195	+
196	+ if ( typeof $ === "function" && el instanceof $ ) {
197	+ el = el[0];
198	+ }
199	+
200	+ rect = el.getBoundingClientRect();
201	+
202	+ return rect.bottom > 0 && rect.right > 0 &&
203	+ rect.left < (window.innerWidth \|\| document.documentElement.clientWidth) &&
204	+ rect.top < (window.innerHeight \|\| document.documentElement.clientHeight);
205	+ };
206	+
207	+
208	+ // Class definition
209	+ // ================
210	+
211	+ var FancyBox = function( content, opts, index ) {
212	+ var self = this;
213	+
214	+ self.opts = $.extend( true, { index : index }, defaults, opts \|\| {} );
215	+ self.id = self.opts.id \|\| ++called;
216	+ self.group = [];
217	+
218	+ self.currIndex = parseInt( self.opts.index, 10 ) \|\| 0;
219	+ self.prevIndex = null;
220	+
221	+ self.prevPos = null;
222	+ self.currPos = 0;
223	+
224	+ self.firstRun = null;
225	+
226	+ // Create group elements from original item collection
227	+ self.createGroup( content );
228	+
229	+ if ( !self.group.length ) {
230	+ return;
231	+ }
232	+
233	+ // Save last active element and current scroll position
234	+ self.$lastFocus = $(document.activeElement).blur();
235	+
236	+ // Collection of gallery objects
237	+ self.slides = {};
238	+
239	+ self.init( content );
240	+
241	+ };
242	+
243	+ $.extend(FancyBox.prototype, {
244	+
245	+ // Create DOM structure
246	+ // ====================
247	+
248	+ init : function() {
249	+ var self = this;
250	+
251	+ var galleryHasHtml = false;
252	+
253	+ var testWidth;
254	+ var $container;
255	+
256	+ self.scrollTop = $D.scrollTop();
257	+ self.scrollLeft = $D.scrollLeft();
258	+
259	+ if ( !$.fancybox.getInstance() ) {
260	+ testWidth = $( 'body' ).width();
261	+
262	+ $( 'html' ).addClass( 'fancybox-enabled' );
263	+
264	+ if ( $.fancybox.isTouch ) {
265	+
266	+ // Ugly workaround for iOS page shifting issue (when inputs get focus)
267	+ // Do not apply for images, otherwise top/bottom bars will appear
268	+ $.each( self.group, function( key, item ) {
269	+ if ( item.type !== 'image' && item.type !== 'iframe' ) {
270	+ galleryHasHtml = true;
271	+ return false;
272	+ }
273	+ });
274	+
275	+ if ( galleryHasHtml ) {
276	+ $('body').css({
277	+ position : 'fixed',
278	+ width : testWidth,
279	+ top : self.scrollTop * -1
280	+ });
281	+ }
282	+
283	+ } else {
284	+
285	+ // Compare page width after adding "overflow:hidden"
286	+ testWidth = $( 'body' ).width() - testWidth;
287	+
288	+ // Width has changed - compensate missing scrollbars
289	+ if ( testWidth > 1 ) {
290	+ $( '<style id="fancybox-noscroll" type="text/css">' ).html( '.compensate-for-scrollbar, .fancybox-enabled body { margin-right: ' + testWidth + 'px; }' ).appendTo( 'head' );
291	+ }
292	+
293	+ }
294	+ }
295	+
296	+ $container = $( self.opts.baseTpl )
297	+ .attr('id', 'fancybox-container-' + self.id)
298	+ .data( 'FancyBox', self )
299	+ .addClass( self.opts.baseClass )
300	+ .hide()
301	+ .prependTo( self.opts.parentEl );
302	+
303	+ // Create object holding references to jQuery wrapped nodes
304	+ self.$refs = {
305	+ container : $container,
306	+ bg : $container.find('.fancybox-bg'),
307	+ controls : $container.find('.fancybox-controls'),
308	+ buttons : $container.find('.fancybox-buttons'),
309	+ slider_wrap : $container.find('.fancybox-slider-wrap'),
310	+ slider : $container.find('.fancybox-slider'),
311	+ caption : $container.find('.fancybox-caption')
312	+ };
313	+
314	+ self.trigger( 'onInit' );
315	+
316	+ // Bring to front and enable events
317	+ self.activate();
318	+
319	+ // Try to avoid running multiple times
320	+ if ( self.current ) {
321	+ return;
322	+ }
323	+
324	+ self.jumpTo( self.currIndex );
325	+
326	+ },
327	+
328	+
329	+ // Create array of gally item objects
330	+ // Check if each object has valid type and content
331	+ // ===============================================
332	+
333	+ createGroup : function ( content ) {
334	+ var self = this;
335	+ var items = $.makeArray( content );
336	+
337	+ $.each(items, function( i, item ) {
338	+ var obj = {},
339	+ opts = {},
340	+ data = [],
341	+ $item,
342	+ type,
343	+ src,
344	+ srcParts;
345	+
346	+ // Step 1 - Make sure we have an object
347	+
348	+ if ( $.isPlainObject( item ) ) {
349	+
350	+ obj = item;
351	+ opts = item.opts \|\| {};
352	+
353	+ } else if ( $.type( item ) === 'object' && $( item ).length ) {
354	+
355	+ $item = $( item );
356	+ data = $item.data();
357	+
358	+ opts = 'options' in data ? data.options : {};
359	+
360	+ opts = $.type( opts ) === 'object' ? opts : {};
361	+
362	+ obj.type = 'type' in data ? data.type : opts.type;
363	+ obj.src = 'src' in data ? data.src : ( opts.src \|\| $item.attr( 'href' ) );
364	+
365	+ opts.width = 'width' in data ? data.width : opts.width;
366	+ opts.height = 'height' in data ? data.height : opts.height;
367	+ opts.thumb = 'thumb' in data ? data.thumb : opts.thumb;
368	+
369	+ opts.selector = 'selector' in data ? data.selector : opts.selector;
370	+
371	+ if ( 'srcset' in data ) {
372	+ opts.image = { srcset : data.srcset };
373	+ }
374	+
375	+ opts.$orig = $item;
376	+
377	+ } else {
378	+
379	+ obj = {
380	+ type : 'html',
381	+ content : item + ''
382	+ };
383	+
384	+ }
385	+
386	+ obj.opts = $.extend( true, {}, self.opts, opts );
387	+
388	+ // Step 2 - Make sure we have supported content type
389	+
390	+ type = obj.type;
391	+ src = obj.src \|\| '';
392	+
393	+ if ( !type ) {
394	+
395	+ if ( obj.content ) {
396	+ type = 'html';
397	+
398	+ } else if ( src.match(/(^data:image\/[a-z0-9+\/=],)\|(\.(jp(e\|g\|eg)\|gif\|png\|bmp\|webp\|svg\|ico)((\?\|#).)?$)/i) ) {
399	+ type = 'image';
400	+
401	+ } else if ( src.match(/\.(pdf)((\?\|#).*)?$/i) ) {
402	+ type = 'pdf';
403	+
404	+ } else if ( src.charAt(0) === '#' ) {
405	+ type = 'inline';
406	+
407	+ }
408	+
409	+ obj.type = type;
410	+
411	+ }
412	+
413	+ // Step 3 - Some adjustments
414	+
415	+ obj.index = self.group.length;
416	+
417	+ // Check if $orig and $thumb objects exist
418	+ if ( obj.opts.$orig && !obj.opts.$orig.length ) {
419	+ delete obj.opts.$orig;
420	+ }
421	+
422	+ if ( !obj.opts.$thumb && obj.opts.$orig ) {
423	+ obj.opts.$thumb = obj.opts.$orig.find( 'img:first' );
424	+ }
425	+
426	+ if ( obj.opts.$thumb && !obj.opts.$thumb.length ) {
427	+ delete obj.opts.$thumb;
428	+ }
429	+
430	+ // Caption is a "special" option, it can be passed as a method
431	+ if ( $.type( obj.opts.caption ) === 'function' ) {
432	+ obj.opts.caption = obj.opts.caption.apply( item, [ self, obj ] );
433	+
434	+ } else if ( 'caption' in data ) {
435	+ obj.opts.caption = data.caption;
436	+
437	+ } else if ( opts.$orig ) {
438	+ obj.opts.caption = $item.attr( 'title' );
439	+ }
440	+
441	+ // Make sure we have caption as a string
442	+ obj.opts.caption = obj.opts.caption === undefined ? '' : obj.opts.caption + '';
443	+
444	+ // Check if url contains selector used to filter the content
445	+ // Example: "ajax.html #something"
446	+ if ( type === 'ajax' ) {
447	+ srcParts = src.split(/\s+/, 2);
448	+
449	+ if ( srcParts.length > 1 ) {
450	+ obj.src = srcParts.shift();
451	+
452	+ obj.opts.selector = srcParts.shift();
453	+ }
454	+ }
455	+
456	+ if ( obj.opts.smallBtn == 'auto' ) {
457	+
458	+ if ( $.inArray( type, ['html', 'inline', 'ajax'] ) > -1 ) {
459	+ obj.opts.buttons = false;
460	+ obj.opts.smallBtn = true;
461	+
462	+ } else {
463	+ obj.opts.smallBtn = false;
464	+ }
465	+
466	+ }
467	+
468	+ if ( type === 'pdf' ) {
469	+
470	+ obj.type = 'iframe';
471	+
472	+ obj.opts.closeBtn = true;
473	+ obj.opts.smallBtn = false;
474	+
475	+ obj.opts.iframe.preload = false;
476	+
477	+ }
478	+
479	+ if ( obj.opts.modal ) {
480	+
481	+ $.extend(true, obj.opts, {
482	+ infobar : 0,
483	+ buttons : 0,
484	+ keyboard : 0,
485	+ slideShow : 0,
486	+ fullScreen : 0,
487	+ closeClickOutside : 0
488	+ });
489	+
490	+ }
491	+
492	+ self.group.push( obj );
493	+
494	+ });
495	+
496	+ },
497	+
498	+
499	+ // Attach an event handler functions for:
500	+ // - navigation elements
501	+ // - browser scrolling, resizing;
502	+ // - focusing
503	+ // - keyboard
504	+ // =================
505	+
506	+ addEvents : function() {
507	+ var self = this;
508	+
509	+ self.removeEvents();
510	+
511	+ // Make navigation elements clickable
512	+
513	+ self.$refs.container.on('click.fb-close', '[data-fancybox-close]', function(e) {
514	+ e.stopPropagation();
515	+ e.preventDefault();
516	+
517	+ self.close( e );
518	+
519	+ }).on('click.fb-previous', '[data-fancybox-previous]', function(e) {
520	+ e.stopPropagation();
521	+ e.preventDefault();
522	+
523	+ self.previous();
524	+
525	+ }).on('click.fb-next', '[data-fancybox-next]', function(e) {
526	+ e.stopPropagation();
527	+ e.preventDefault();
528	+
529	+ self.next();
530	+ });
531	+
532	+
533	+ // Handle page scrolling and browser resizing
534	+
535	+ $( window ).on('orientationchange.fb resize.fb', function(e) {
536	+ requestAFrame(function() {
537	+
538	+ if ( e && e.originalEvent && e.originalEvent.type === "resize" ) {
539	+ self.update();
540	+
541	+ } else {
542	+ self.$refs.slider_wrap.hide();
543	+
544	+ requestAFrame(function () {
545	+ self.$refs.slider_wrap.show();
546	+
547	+ self.update();
548	+ });
549	+
550	+ }
551	+
552	+ });
553	+ });
554	+
555	+
556	+ // Trap focus
557	+
558	+ $D.on('focusin.fb', function(e) {
559	+ var instance = $.fancybox ? $.fancybox.getInstance() : null;
560	+
561	+ if ( instance && !$( e.target ).hasClass( 'fancybox-container' ) && !$.contains( instance.$refs.container[0], e.target ) ) {
562	+ e.stopPropagation();
563	+
564	+ instance.focus();
565	+
566	+ // Sometimes page gets scrolled, set it back
567	+ $W.scrollTop( self.scrollTop ).scrollLeft( self.scrollLeft );
568	+ }
569	+
570	+ });
571	+
572	+ // Enable keyboard navigation
573	+
574	+ $D.on('keydown.fb', function (e) {
575	+ var current = self.current,
576	+ keycode = e.keyCode \|\| e.which;
577	+
578	+ if ( !current \|\| !current.opts.keyboard ) {
579	+ return;
580	+ }
581	+
582	+ if ( $(e.target).is('input') \|\| $(e.target).is('textarea') ) {
583	+ return;
584	+ }
585	+
586	+ // Backspace and Esc keys
587	+ if ( keycode === 8 \|\| keycode === 27 ) {
588	+ e.preventDefault();
589	+
590	+ self.close( e );
591	+
592	+ return;
593	+ }
594	+
595	+ switch ( keycode ) {
596	+
597	+ case 37: // Left arrow
598	+ case 38: // Up arrow
599	+
600	+ e.preventDefault();
601	+
602	+ self.previous();
603	+
604	+ break;
605	+
606	+ case 39: // Right arrow
607	+ case 40: // Down arrow
608	+
609	+ e.preventDefault();
610	+
611	+ self.next();
612	+
613	+ break;
614	+
615	+ case 80: // "P"
616	+ case 32: // Spacebar
617	+
618	+ e.preventDefault();
619	+
620	+ if ( self.SlideShow ) {
621	+ e.preventDefault();
622	+
623	+ self.SlideShow.toggle();
624	+ }
625	+
626	+ break;
627	+
628	+ case 70: // "F"
629	+
630	+ if ( self.FullScreen ) {
631	+ e.preventDefault();
632	+
633	+ self.FullScreen.toggle();
634	+ }
635	+
636	+ break;
637	+
638	+ case 71: // "G"
639	+
640	+ if ( self.Thumbs ) {
641	+ e.preventDefault();
642	+
643	+ self.Thumbs.toggle();
644	+ }
645	+
646	+ break;
647	+ }
648	+ });
649	+
650	+
651	+ },
652	+
653	+
654	+ // Remove events added by the core
655	+ // ===============================
656	+
657	+ removeEvents : function () {
658	+
659	+ $W.off( 'scroll.fb resize.fb orientationchange.fb' );
660	+ $D.off( 'keydown.fb focusin.fb click.fb-close' );
661	+
662	+ this.$refs.container.off('click.fb-close click.fb-previous click.fb-next');
663	+ },
664	+
665	+
666	+ // Slide to left
667	+ // ==================
668	+
669	+ previous : function( duration ) {
670	+ this.jumpTo( this.currIndex - 1, duration );
671	+ },
672	+
673	+
674	+ // Slide to right
675	+ // ===================
676	+
677	+ next : function( duration ) {
678	+ this.jumpTo( this.currIndex + 1, duration );
679	+ },
680	+
681	+
682	+ // Display current gallery item, move slider to current position
683	+ // =============================================================
684	+
685	+ jumpTo : function ( to, duration ) {
686	+ var self = this,
687	+ firstRun,
688	+ index,
689	+ pos,
690	+ loop;
691	+
692	+ firstRun = self.firstRun = ( self.firstRun === null );
693	+
694	+ index = pos = to = parseInt( to, 10 );
695	+ loop = self.current ? self.current.opts.loop : false;
696	+
697	+ if ( self.isAnimating \|\| ( index == self.currIndex && !firstRun ) ) {
698	+ return;
699	+ }
700	+
701	+ if ( self.group.length > 1 && loop ) {
702	+
703	+ index = index % self.group.length;
704	+ index = index < 0 ? self.group.length + index : index;
705	+
706	+ // Calculate closest position of upcoming item from the current one
707	+ if ( self.group.length == 2 ) {
708	+ pos = to - self.currIndex + self.currPos;
709	+
710	+ } else {
711	+ pos = index - self.currIndex + self.currPos;
712	+
713	+ if ( Math.abs( self.currPos - ( pos + self.group.length ) ) < Math.abs( self.currPos - pos ) ) {
714	+ pos = pos + self.group.length;
715	+
716	+ } else if ( Math.abs( self.currPos - ( pos - self.group.length ) ) < Math.abs( self.currPos - pos ) ) {
717	+ pos = pos - self.group.length;
718	+
719	+ }
720	+ }
721	+
722	+ } else if ( !self.group[ index ] ) {
723	+ self.update( false, false, duration );
724	+
725	+ return;
726	+ }
727	+
728	+ if ( self.current ) {
729	+ self.current.$slide.removeClass('fancybox-slide--current fancybox-slide--complete');
730	+
731	+ self.updateSlide( self.current, true );
732	+ }
733	+
734	+ self.prevIndex = self.currIndex;
735	+ self.prevPos = self.currPos;
736	+
737	+ self.currIndex = index;
738	+ self.currPos = pos;
739	+
740	+ // Create slides
741	+
742	+ self.current = self.createSlide( pos );
743	+
744	+ if ( self.group.length > 1 ) {
745	+
746	+ if ( self.opts.loop \|\| pos - 1 >= 0 ) {
747	+ self.createSlide( pos - 1 );
748	+ }
749	+
750	+ if ( self.opts.loop \|\| pos + 1 < self.group.length ) {
751	+ self.createSlide( pos + 1 );
752	+ }
753	+ }
754	+
755	+ self.current.isMoved = false;
756	+ self.current.isComplete = false;
757	+
758	+ duration = parseInt( duration === undefined ? self.current.opts.speed * 1.5 : duration, 10 );
759	+
760	+ // Move slider to the next position
761	+ // Note: the content might still be loading
762	+ self.trigger( 'beforeMove' );
763	+
764	+ self.updateControls();
765	+
766	+ if ( firstRun ) {
767	+ self.current.$slide.addClass('fancybox-slide--current');
768	+
769	+ self.$refs.container.show();
770	+
771	+ requestAFrame(function() {
772	+ self.$refs.bg.css('transition-duration', self.current.opts.speed + 'ms');
773	+
774	+ self.$refs.container.addClass( 'fancybox-container--ready' );
775	+ });
776	+ }
777	+
778	+ // Set position immediately on first opening
779	+ self.update( true, false, firstRun ? 0 : duration, function() {
780	+ self.afterMove();
781	+ });
782	+
783	+ self.loadSlide( self.current );
784	+
785	+ if ( !( firstRun && self.current.$ghost ) ) {
786	+ self.preload();
787	+ }
788	+
789	+ },
790	+
791	+
792	+ // Create new "slide" element
793	+ // These are gallery items that are actually added to DOM
794	+ // =======================================================
795	+
796	+ createSlide : function( pos ) {
797	+
798	+ var self = this;
799	+ var $slide;
800	+ var index;
801	+ var found;
802	+
803	+ index = pos % self.group.length;
804	+ index = index < 0 ? self.group.length + index : index;
805	+
806	+ if ( !self.slides[ pos ] && self.group[ index ] ) {
807	+
808	+ // If we are looping and slide with that index already exists, then reuse it
809	+ if ( self.opts.loop && self.group.length > 2 ) {
810	+ for (var key in self.slides) {
811	+ if ( self.slides[ key ].index === index ) {
812	+ found = self.slides[ key ];
813	+ found.pos = pos;
814	+
815	+ self.slides[ pos ] = found;
816	+
817	+ delete self.slides[ key ];
818	+
819	+ self.updateSlide( found );
820	+
821	+ return found;
822	+ }
823	+ }
824	+ }
825	+
826	+ $slide = $('<div class="fancybox-slide"></div>').appendTo( self.$refs.slider );
827	+
828	+ self.slides[ pos ] = $.extend( true, {}, self.group[ index ], {
829	+ pos : pos,
830	+ $slide : $slide,
831	+ isMoved : false,
832	+ isLoaded : false
833	+ });
834	+
835	+ }
836	+
837	+ return self.slides[ pos ];
838	+
839	+ },
840	+
841	+ zoomInOut : function( type, duration, callback ) {
842	+
843	+ var self = this;
844	+ var current = self.current;
845	+ var $what = current.$placeholder;
846	+ var opacity = current.opts.opacity;
847	+ var $thumb = current.opts.$thumb;
848	+ var thumbPos = $thumb ? $thumb.offset() : 0;
849	+ var slidePos = current.$slide.offset();
850	+ var props;
851	+ var start;
852	+ var end;
853	+
854	+ if ( !$what \|\| !current.isMoved \|\| !thumbPos \|\| !isElementInViewport( $thumb ) ) {
855	+ return false;
856	+ }
857	+
858	+ if ( type === 'In' && !self.firstRun ) {
859	+ return false;
860	+ }
861	+
862	+ $.fancybox.stop( $what );
863	+
864	+ self.isAnimating = true;
865	+
866	+ props = {
867	+ top : thumbPos.top - slidePos.top + parseFloat( $thumb.css( "border-top-width" ) \|\| 0 ),
868	+ left : thumbPos.left - slidePos.left + parseFloat( $thumb.css( "border-left-width" ) \|\| 0 ),
869	+ width : $thumb.width(),
870	+ height : $thumb.height(),
871	+ scaleX : 1,
872	+ scaleY : 1
873	+ };
874	+
875	+ // Check if we need to animate opacity
876	+ if ( opacity == 'auto' ) {
877	+ opacity = Math.abs( current.width / current.height - props.width / props.height ) > 0.1;
878	+ }
879	+
880	+ if ( type === 'In' ) {
881	+ start = props;
882	+ end = self.getFitPos( current );
883	+
884	+ end.scaleX = end.width / start.width;
885	+ end.scaleY = end.height / start.height;
886	+
887	+ if ( opacity ) {
888	+ start.opacity = 0.1;
889	+ end.opacity = 1;
890	+ }
891	+
892	+ } else {
893	+
894	+ start = $.fancybox.getTranslate( $what );
895	+ end = props;
896	+
897	+ // Switch to thumbnail image to improve animation performance
898	+ if ( current.$ghost ) {
899	+ current.$ghost.show();
900	+
901	+ if ( current.$image ) {
902	+ current.$image.remove();
903	+ }
904	+ }
905	+
906	+ start.scaleX = start.width / end.width;
907	+ start.scaleY = start.height / end.height;
908	+
909	+ start.width = end.width;
910	+ start.height = end.height;
911	+
912	+ if ( opacity ) {
913	+ end.opacity = 0;
914	+ }
915	+
916	+ }
917	+
918	+ self.updateCursor( end.width, end.height );
919	+
920	+ // There is no need to animate width/height properties
921	+ delete end.width;
922	+ delete end.height;
923	+
924	+ $.fancybox.setTranslate( $what, start );
925	+
926	+ $what.show();
927	+
928	+ self.trigger( 'beforeZoom' + type );
929	+
930	+ $what.css( 'transition', 'all ' + duration + 'ms' );
931	+
932	+ $.fancybox.setTranslate( $what, end );
933	+
934	+ setTimeout(function() {
935	+ var reset;
936	+
937	+ $what.css( 'transition', 'none' );
938	+
939	+ reset = $.fancybox.getTranslate( $what );
940	+
941	+ reset.scaleX = 1;
942	+ reset.scaleY = 1;
943	+
944	+ // Reset scalex/scaleY values; this helps for perfomance
945	+ $.fancybox.setTranslate( $what, reset );
946	+
947	+ self.trigger( 'afterZoom' + type );
948	+
949	+ callback.apply( self );
950	+
951	+ self.isAnimating = false;
952	+
953	+ }, duration);
954	+
955	+
956	+ return true;
957	+
958	+ },
959	+
960	+ // Check if image dimensions exceed parent element
961	+ // ===============================================
962	+
963	+ canPan : function() {
964	+
965	+ var self = this;
966	+
967	+ var current = self.current;
968	+ var $what = current.$placeholder;
969	+
970	+ var rez = false;
971	+
972	+ if ( $what ) {
973	+ rez = self.getFitPos( current );
974	+ rez = Math.abs( $what.width() - rez.width ) > 1 \|\| Math.abs( $what.height() - rez.height ) > 1;
975	+
976	+ }
977	+
978	+ return rez;
979	+
980	+ },
981	+
982	+
983	+ // Check if current image dimensions are smaller than actual
984	+ // =========================================================
985	+
986	+ isScaledDown : function() {
987	+
988	+ var self = this;
989	+
990	+ var current = self.current;
991	+ var $what = current.$placeholder;
992	+
993	+ var rez = false;
994	+
995	+ if ( $what ) {
996	+ rez = $.fancybox.getTranslate( $what );
997	+ rez = rez.width < current.width \|\| rez.height < current.height;
998	+ }
999	+
1000	+ return rez;
1001	+
1002	+ },
1003	+
1004	+
1005	+ // Scale image to the actual size of the image
1006	+ // ===========================================
1007	+
1008	+ scaleToActual : function( x, y, duration ) {
1009	+
1010	+ var self = this;
1011	+
1012	+ var current = self.current;
1013	+ var $what = current.$placeholder;
1014	+
1015	+ var imgPos, posX, posY, scaleX, scaleY;
1016	+
1017	+ var canvasWidth = parseInt( current.$slide.width(), 10 );
1018	+ var canvasHeight = parseInt( current.$slide.height(), 10 );
1019	+
1020	+ var newImgWidth = current.width;
1021	+ var newImgHeight = current.height;
1022	+
1023	+ if ( !$what ) {
1024	+ return;
1025	+ }
1026	+
1027	+ self.isAnimating = true;
1028	+
1029	+ x = x === undefined ? canvasWidth * 0.5 : x;
1030	+ y = y === undefined ? canvasHeight * 0.5 : y;
1031	+
1032	+ imgPos = $.fancybox.getTranslate( $what );
1033	+
1034	+ scaleX = newImgWidth / imgPos.width;
1035	+ scaleY = newImgHeight / imgPos.height;
1036	+
1037	+ // Get center position for original image
1038	+ posX = ( canvasWidth * 0.5 - newImgWidth * 0.5 );
1039	+ posY = ( canvasHeight * 0.5 - newImgHeight * 0.5 );
1040	+
1041	+ // Make sure image does not move away from edges
1042	+
1043	+ if ( newImgWidth > canvasWidth ) {
1044	+ posX = imgPos.left * scaleX - ( ( x * scaleX ) - x );
1045	+
1046	+ if ( posX > 0 ) {
1047	+ posX = 0;
1048	+ }
1049	+
1050	+ if ( posX < canvasWidth - newImgWidth ) {
1051	+ posX = canvasWidth - newImgWidth;
1052	+ }
1053	+ }
1054	+
1055	+ if ( newImgHeight > canvasHeight) {
1056	+ posY = imgPos.top * scaleY - ( ( y * scaleY ) - y );
1057	+
1058	+ if ( posY > 0 ) {
1059	+ posY = 0;
1060	+ }
1061	+
1062	+ if ( posY < canvasHeight - newImgHeight ) {
1063	+ posY = canvasHeight - newImgHeight;
1064	+ }
1065	+ }
1066	+
1067	+ self.updateCursor( newImgWidth, newImgHeight );
1068	+
1069	+ $.fancybox.animate( $what, null, {
1070	+ top : posY,
1071	+ left : posX,
1072	+ scaleX : scaleX,
1073	+ scaleY : scaleY
1074	+ }, duration \|\| current.opts.speed, function() {
1075	+ self.isAnimating = false;
1076	+ });
1077	+
1078	+ },
1079	+
1080	+
1081	+ // Scale image to fit inside parent element
1082	+ // ========================================
1083	+
1084	+ scaleToFit : function( duration ) {
1085	+
1086	+ var self = this;
1087	+
1088	+ var current = self.current;
1089	+ var $what = current.$placeholder;
1090	+ var end;
1091	+
1092	+ if ( !$what ) {
1093	+ return;
1094	+ }
1095	+
1096	+ self.isAnimating = true;
1097	+
1098	+ end = self.getFitPos( current );
1099	+
1100	+ self.updateCursor( end.width, end.height );
1101	+
1102	+ $.fancybox.animate( $what, null, {
1103	+ top : end.top,
1104	+ left : end.left,
1105	+ scaleX : end.width / $what.width(),
1106	+ scaleY : end.height / $what.height()
1107	+ }, duration \|\| current.opts.speed, function() {
1108	+ self.isAnimating = false;
1109	+ });
1110	+
1111	+ },
1112	+
1113	+ // Calculate image size to fit inside viewport
1114	+ // ===========================================
1115	+
1116	+ getFitPos : function( slide ) {
1117	+ var $what = slide.$placeholder \|\| slide.$content;
1118	+
1119	+ var imgWidth = slide.width;
1120	+ var imgHeight = slide.height;
1121	+
1122	+ var margin = slide.opts.margin;
1123	+
1124	+ var canvasWidth, canvasHeight, minRatio, top, left, width, height;
1125	+
1126	+ if ( !$what \|\| !$what.length \|\| ( !imgWidth && !imgHeight) ) {
1127	+ return false;
1128	+ }
1129	+
1130	+ // Convert "margin to CSS style: [ top, right, bottom, left ]
1131	+ if ( $.type( margin ) === "number" ) {
1132	+ margin = [ margin, margin ];
1133	+ }
1134	+
1135	+ if ( margin.length == 2 ) {
1136	+ margin = [ margin[0], margin[1], margin[0], margin[1] ];
1137	+ }
1138	+
1139	+ if ( $W.width() < 800 ) {
1140	+ margin = [0, 0, 0, 0];
1141	+ }
1142	+
1143	+ canvasWidth = parseInt( slide.$slide.width(), 10 ) - ( margin[ 1 ] + margin[ 3 ] );
1144	+ canvasHeight = parseInt( slide.$slide.height(), 10 ) - ( margin[ 0 ] + margin[ 2 ] );
1145	+
1146	+ minRatio = Math.min(1, canvasWidth / imgWidth, canvasHeight / imgHeight );
1147	+
1148	+ // Use floor rounding to make sure it really fits
1149	+
1150	+ width = Math.floor( minRatio * imgWidth );
1151	+ height = Math.floor( minRatio * imgHeight );
1152	+
1153	+ top = Math.floor( ( canvasHeight - height ) * 0.5 ) + margin[ 0 ];
1154	+ left = Math.floor( ( canvasWidth - width ) * 0.5 ) + margin[ 3 ];
1155	+
1156	+ return {
1157	+ top : top,
1158	+ left : left,
1159	+ width : width,
1160	+ height : height
1161	+ };
1162	+
1163	+ },
1164	+
1165	+ // Move slider to current position
1166	+ // Update all slides (and their content)
1167	+ // =====================================
1168	+
1169	+ update : function( andSlides, andContent, duration, callback ) {
1170	+
1171	+ var self = this;
1172	+ var leftValue;
1173	+
1174	+ if ( self.isAnimating === true \|\| !self.current ) {
1175	+ return;
1176	+ }
1177	+
1178	+ leftValue = ( self.current.pos * Math.floor( self.current.$slide.width() ) * -1 ) - ( self.current.pos * self.current.opts.gutter );
1179	+ duration = parseInt( duration, 10 ) \|\| 0;
1180	+
1181	+ $.fancybox.stop( self.$refs.slider );
1182	+
1183	+ if ( andSlides === false ) {
1184	+ self.updateSlide( self.current, andContent );
1185	+
1186	+ } else {
1187	+
1188	+ $.each( self.slides, function( key, slide ) {
1189	+ self.updateSlide( slide, andContent );
1190	+ });
1191	+
1192	+ }
1193	+
1194	+ if ( duration ) {
1195	+
1196	+ $.fancybox.animate( self.$refs.slider, null, {
1197	+ top : 0,
1198	+ left : leftValue
1199	+ }, duration, function() {
1200	+ self.current.isMoved = true;
1201	+
1202	+ if ( $.type( callback ) === 'function' ) {
1203	+ callback.apply( self );
1204	+ }
1205	+
1206	+ });
1207	+
1208	+ } else {
1209	+
1210	+ $.fancybox.setTranslate( self.$refs.slider, { top : 0, left : leftValue } );
1211	+
1212	+ self.current.isMoved = true;
1213	+
1214	+ if ( $.type( callback ) === 'function' ) {
1215	+ callback.apply( self );
1216	+ }
1217	+
1218	+ }
1219	+
1220	+ },
1221	+
1222	+
1223	+ // Update slide position and scale content to fit
1224	+ // ==============================================
1225	+
1226	+ updateSlide : function( slide, andContent ) {
1227	+
1228	+ var self = this;
1229	+ var $what = slide.$placeholder;
1230	+ var leftPos;
1231	+
1232	+ slide = slide \|\| self.current;
1233	+
1234	+ if ( !slide \|\| self.isClosing ) {
1235	+ return;
1236	+ }
1237	+
1238	+ leftPos = ( slide.pos * Math.floor( slide.$slide.width() ) ) + ( slide.pos * slide.opts.gutter);
1239	+
1240	+ if ( leftPos !== slide.leftPos ) {
1241	+ $.fancybox.setTranslate( slide.$slide, { top: 0, left : leftPos } );
1242	+
1243	+ slide.leftPos = leftPos;
1244	+ }
1245	+
1246	+ if ( andContent !== false && $what ) {
1247	+ $.fancybox.setTranslate( $what, self.getFitPos( slide ) );
1248	+
1249	+ if ( slide.pos === self.currPos ) {
1250	+ self.updateCursor();
1251	+ }
1252	+ }
1253	+
1254	+ slide.$slide.trigger( 'refresh' );
1255	+
1256	+ self.trigger( 'onUpdate', slide );
1257	+ },
1258	+
1259	+ // Update cursor style depending if content can be zoomed
1260	+ // ======================================================
1261	+
1262	+ updateCursor : function( nextWidth, nextHeight ) {
1263	+
1264	+ var self = this;
1265	+ var canScale;
1266	+
1267	+ var $container = self.$refs.container.removeClass('fancybox-controls--canzoomIn fancybox-controls--canzoomOut fancybox-controls--canGrab');
1268	+
1269	+ if ( self.isClosing \|\| !self.opts.touch ) {
1270	+ return;
1271	+ }
1272	+
1273	+ if ( nextWidth !== undefined && nextHeight !== undefined ) {
1274	+ canScale = nextWidth < self.current.width && nextHeight < self.current.height;
1275	+
1276	+ } else {
1277	+ canScale = self.isScaledDown();
1278	+ }
1279	+
1280	+ if ( canScale ) {
1281	+ $container.addClass('fancybox-controls--canzoomIn');
1282	+
1283	+ } else if ( self.group.length < 2 ) {
1284	+ $container.addClass('fancybox-controls--canzoomOut');
1285	+
1286	+ } else {
1287	+ $container.addClass('fancybox-controls--canGrab');
1288	+ }
1289	+
1290	+ },
1291	+
1292	+ // Load content into the slide
1293	+ // ===========================
1294	+
1295	+ loadSlide : function( slide ) {
1296	+
1297	+ var self = this, type, $slide;
1298	+ var ajaxLoad;
1299	+
1300	+ if ( !slide \|\| slide.isLoaded \|\| slide.isLoading ) {
1301	+ return;
1302	+ }
1303	+
1304	+ slide.isLoading = true;
1305	+
1306	+ self.trigger( 'beforeLoad', slide );
1307	+
1308	+ type = slide.type;
1309	+ $slide = slide.$slide;
1310	+
1311	+ $slide
1312	+ .off( 'refresh' )
1313	+ .trigger( 'onReset' )
1314	+ .addClass( 'fancybox-slide--' + ( type \|\| 'unknown' ) )
1315	+ .addClass( slide.opts.slideClass );
1316	+
1317	+ // Create content depending on the type
1318	+
1319	+ switch ( type ) {
1320	+
1321	+ case 'image':
1322	+
1323	+ self.setImage( slide );
1324	+
1325	+ break;
1326	+
1327	+ case 'iframe':
1328	+
1329	+ self.setIframe( slide );
1330	+
1331	+ break;
1332	+
1333	+ case 'html':
1334	+
1335	+ self.setContent( slide, slide.content );
1336	+
1337	+ break;
1338	+
1339	+ case 'inline':
1340	+
1341	+ if ( $( slide.src ).length ) {
1342	+ self.setContent( slide, $( slide.src ) );
1343	+
1344	+ } else {
1345	+ self.setError( slide );
1346	+ }
1347	+
1348	+ break;
1349	+
1350	+ case 'ajax':
1351	+
1352	+ self.showLoading( slide );
1353	+
1354	+ ajaxLoad = $.ajax( $.extend( {}, slide.opts.ajax.settings, {
1355	+
1356	+ url: slide.src,
1357	+
1358	+ success: function ( data, textStatus ) {
1359	+
1360	+ if ( textStatus === 'success' ) {
1361	+ self.setContent( slide, data );
1362	+ }
1363	+
1364	+ },
1365	+
1366	+ error: function ( jqXHR, textStatus ) {
1367	+
1368	+ if ( jqXHR && textStatus !== 'abort' ) {
1369	+ self.setError( slide );
1370	+ }
1371	+
1372	+ }
1373	+
1374	+ }));
1375	+
1376	+ $slide.one( 'onReset', function () {
1377	+ ajaxLoad.abort();
1378	+ });
1379	+
1380	+ break;
1381	+
1382	+ default:
1383	+
1384	+ self.setError( slide );
1385	+
1386	+ break;
1387	+
1388	+ }
1389	+
1390	+ return true;
1391	+
1392	+ },
1393	+
1394	+
1395	+ // Use thumbnail image, if possible
1396	+ // ================================
1397	+
1398	+ setImage : function( slide ) {
1399	+
1400	+ var self = this;
1401	+ var srcset = slide.opts.image.srcset;
1402	+
1403	+ var found, temp, pxRatio, windowWidth;
1404	+
1405	+ if ( slide.isLoaded && !slide.hasError ) {
1406	+ self.afterLoad( slide );
1407	+
1408	+ return;
1409	+ }
1410	+
1411	+ // If we have "srcset", then we need to find matching "src" value.
1412	+ // This is necessary, because when you set an src attribute, the browser will preload the image
1413	+ // before any javascript or even CSS is applied.
1414	+ if ( srcset ) {
1415	+ pxRatio = window.devicePixelRatio \|\| 1;
1416	+ windowWidth = window.innerWidth * pxRatio;
1417	+
1418	+ temp = srcset.split(',').map(function (el) {
1419	+ var ret = {};
1420	+
1421	+ el.trim().split(/\s+/).forEach(function (el, i) {
1422	+ var value = parseInt(el.substring(0, el.length - 1), 10);
1423	+
1424	+ if ( i === 0 ) {
1425	+ return (ret.url = el);
1426	+ }
1427	+
1428	+ if ( value ) {
1429	+ ret.value = value;
1430	+ ret.postfix = el[el.length - 1];
1431	+ }
1432	+
1433	+ });
1434	+
1435	+ return ret;
1436	+ });
1437	+
1438	+ // Sort by value
1439	+ temp.sort(function (a, b) {
1440	+ return a.value - b.value;
1441	+ });
1442	+
1443	+ // Ok, now we have an array of all srcset values
1444	+ for ( var j = 0; j < temp.length; j++ ) {
1445	+ var el = temp[ j ];
1446	+
1447	+ if ( ( el.postfix === 'w' && el.value >= windowWidth ) \|\| ( el.postfix === 'x' && el.value >= pxRatio ) ) {
1448	+ found = el;
1449	+ break;
1450	+ }
1451	+ }
1452	+
1453	+ // If not found, take the last one
1454	+ if ( !found && temp.length ) {
1455	+ found = temp[ temp.length - 1 ];
1456	+ }
1457	+
1458	+ if ( found ) {
1459	+ slide.src = found.url;
1460	+
1461	+ // If we have default width/height values, we can calculate height for matching source
1462	+ if ( slide.width && slide.height && found.postfix == 'w' ) {
1463	+ slide.height = ( slide.width / slide.height ) * found.value;
1464	+ slide.width = found.value;
1465	+ }
1466	+ }
1467	+ }
1468	+
1469	+ slide.$placeholder = $('<div class="fancybox-placeholder"></div>')
1470	+ .hide()
1471	+ .appendTo( slide.$slide );
1472	+
1473	+ if ( slide.opts.preload !== false && slide.opts.width && slide.opts.height && ( slide.opts.thumb \|\| slide.opts.$thumb ) ) {
1474	+
1475	+ slide.width = slide.opts.width;
1476	+ slide.height = slide.opts.height;
1477	+
1478	+ slide.$ghost = $('<img />')
1479	+ .one('load error', function() {
1480	+
1481	+ if ( self.isClosing ) {
1482	+ return;
1483	+ }
1484	+
1485	+ // Start preloading full size image
1486	+ $('<img/>')[0].src = slide.src;
1487	+
1488	+ // zoomIn or just show
1489	+ self.revealImage( slide, function() {
1490	+
1491	+ self.setBigImage( slide );
1492	+
1493	+ if ( self.firstRun && slide.index === self.currIndex ) {
1494	+ self.preload();
1495	+ }
1496	+ });
1497	+
1498	+ })
1499	+ .addClass( 'fancybox-image' )
1500	+ .appendTo( slide.$placeholder )
1501	+ .attr( 'src', slide.opts.thumb \|\| slide.opts.$thumb.attr( 'src' ) );
1502	+
1503	+ } else {
1504	+
1505	+ self.setBigImage( slide );
1506	+
1507	+ }
1508	+
1509	+ },
1510	+
1511	+
1512	+ // Create full-size image
1513	+ // ======================
1514	+
1515	+ setBigImage : function ( slide ) {
1516	+ var self = this;
1517	+ var $img = $('<img />');
1518	+
1519	+ slide.$image = $img
1520	+ .one('error', function() {
1521	+
1522	+ self.setError( slide );
1523	+
1524	+ })
1525	+ .one('load', function() {
1526	+
1527	+ // Clear timeout that checks if loading icon needs to be displayed
1528	+ clearTimeout( slide.timouts );
1529	+
1530	+ slide.timouts = null;
1531	+
1532	+ if ( self.isClosing ) {
1533	+ return;
1534	+ }
1535	+
1536	+ slide.width = this.naturalWidth;
1537	+ slide.height = this.naturalHeight;
1538	+
1539	+ if ( slide.opts.image.srcset ) {
1540	+ $img.attr('sizes', '100vw').attr('srcset', slide.opts.image.srcset);
1541	+ }
1542	+
1543	+ self.afterLoad( slide );
1544	+
1545	+ if ( slide.$ghost ) {
1546	+ slide.timouts = setTimeout(function() {
1547	+ slide.$ghost.hide();
1548	+
1549	+ }, 350);
1550	+ }
1551	+
1552	+ })
1553	+ .addClass('fancybox-image')
1554	+ .attr('src', slide.src)
1555	+ .appendTo( slide.$placeholder );
1556	+
1557	+ if ( $img[0].complete ) {
1558	+ $img.trigger('load');
1559	+
1560	+ } else if( $img[0].error ) {
1561	+ $img.trigger('error');
1562	+
1563	+ } else {
1564	+
1565	+ slide.timouts = setTimeout(function() {
1566	+ if ( !$img[0].complete && !slide.hasError ) {
1567	+ self.showLoading( slide );
1568	+ }
1569	+
1570	+ }, 150);
1571	+
1572	+ }
1573	+
1574	+ if ( slide.opts.image.protect ) {
1575	+ $('<div class="fancybox-spaceball"></div>').appendTo( slide.$placeholder ).on('contextmenu.fb',function(e){
1576	+ if ( e.button == 2 ) {
1577	+ e.preventDefault();
1578	+ }
1579	+
1580	+ return true;
1581	+ });
1582	+ }
1583	+
1584	+ },
1585	+
1586	+ // Simply show image holder without animation
1587	+ // It has been hidden initially to avoid flickering
1588	+ // ================================================
1589	+
1590	+ revealImage : function( slide, callback ) {
1591	+
1592	+ var self = this;
1593	+
1594	+ callback = callback \|\| $.noop;
1595	+
1596	+ if ( slide.type !== 'image' \|\| slide.hasError \|\| slide.isRevealed === true ) {
1597	+
1598	+ callback.apply( self );
1599	+
1600	+ return;
1601	+ }
1602	+
1603	+ slide.isRevealed = true;
1604	+
1605	+ if ( !( slide.pos === self.currPos && self.zoomInOut( 'In', slide.opts.speed, callback ) ) ) {
1606	+
1607	+ if ( slide.$ghost && !slide.isLoaded ) {
1608	+ self.updateSlide( slide, true );
1609	+ }
1610	+
1611	+ if ( slide.pos === self.currPos ) {
1612	+ $.fancybox.animate( slide.$placeholder, { opacity: 0 }, { opacity: 1 }, 300, callback );
1613	+
1614	+ } else {
1615	+ slide.$placeholder.show();
1616	+ }
1617	+
1618	+ callback.apply( self );
1619	+
1620	+ }
1621	+
1622	+ },
1623	+
1624	+ // Create iframe wrapper, iframe and bindings
1625	+ // ==========================================
1626	+
1627	+ setIframe : function( slide ) {
1628	+ var self = this,
1629	+ opts = slide.opts.iframe,
1630	+ $slide = slide.$slide,
1631	+ $iframe;
1632	+
1633	+ slide.$content = $('<div class="fancybox-content"></div>')
1634	+ .css( opts.css )
1635	+ .appendTo( $slide );
1636	+
1637	+ $iframe = $( opts.tpl.replace(/\{rnd\}/g, new Date().getTime()) )
1638	+ .attr('scrolling', $.fancybox.isTouch ? 'auto' : opts.scrolling)
1639	+ .appendTo( slide.$content );
1640	+
1641	+ if ( opts.preload ) {
1642	+ slide.$content.addClass( 'fancybox-tmp' );
1643	+
1644	+ self.showLoading( slide );
1645	+
1646	+ // Unfortunately, it is not always possible to determine if iframe is successfully loaded
1647	+ // (due to browser security policy)
1648	+
1649	+ $iframe.on('load.fb error.fb', function(e) {
1650	+ this.isReady = 1;
1651	+
1652	+ slide.$slide.trigger( 'refresh' );
1653	+
1654	+ self.afterLoad( slide );
1655	+
1656	+ });
1657	+
1658	+ // Recalculate iframe content size
1659	+
1660	+ $slide.on('refresh.fb', function() {
1661	+ var $wrap = slide.$content,
1662	+ $contents,
1663	+ $body,
1664	+ scrollWidth,
1665	+ frameWidth,
1666	+ frameHeight;
1667	+
1668	+ if ( $iframe[0].isReady !== 1 ) {
1669	+ return;
1670	+ }
1671	+
1672	+ // Check if content is accessible,
1673	+ // it will fail if frame is not with the same origin
1674	+
1675	+ try {
1676	+ $contents = $iframe.contents();
1677	+ $body = $contents.find('body');
1678	+
1679	+ } catch (ignore) {}
1680	+
1681	+ // Calculate dimensions for the wrapper
1682	+
1683	+ if ( $body && $body.length && !( opts.css.width !== undefined && opts.css.height !== undefined ) ) {
1684	+
1685	+ scrollWidth = $iframe[0].contentWindow.document.documentElement.scrollWidth;
1686	+
1687	+ frameWidth = Math.ceil( $body.outerWidth(true) + ( $wrap.width() - scrollWidth ) );
1688	+ frameHeight = Math.ceil( $body.outerHeight(true) );
1689	+
1690	+ // Resize wrapper to fit iframe content
1691	+
1692	+ $wrap.css({
1693	+ 'width' : opts.css.width === undefined ? frameWidth + ( $wrap.outerWidth() - $wrap.innerWidth() ) : opts.css.width,
1694	+ 'height' : opts.css.height === undefined ? frameHeight + ( $wrap.outerHeight() - $wrap.innerHeight() ) : opts.css.height
1695	+ });
1696	+
1697	+ }
1698	+
1699	+ $wrap.removeClass( 'fancybox-tmp' );
1700	+
1701	+ });
1702	+
1703	+ } else {
1704	+
1705	+ this.afterLoad( slide );
1706	+
1707	+ }
1708	+
1709	+ $iframe.attr( 'src', slide.src );
1710	+
1711	+ if ( slide.opts.smallBtn ) {
1712	+ slide.$content.prepend( slide.opts.closeTpl );
1713	+ }
1714	+
1715	+ // Remove iframe if closing or changing gallery item
1716	+
1717	+ $slide.one('onReset', function () {
1718	+
1719	+ // This helps IE not to throw errors when closing
1720	+
1721	+ try {
1722	+
1723	+ $(this).find('iframe').hide().attr('src', '//about:blank');
1724	+
1725	+ } catch (ignore) {}
1726	+
1727	+ $(this).empty();
1728	+
1729	+ slide.isLoaded = false;
1730	+
1731	+ });
1732	+
1733	+ },
1734	+
1735	+
1736	+ // Wrap and append content to the slide
1737	+ // ======================================
1738	+
1739	+ setContent : function ( slide, content ) {
1740	+
1741	+ var self = this;
1742	+
1743	+ if ( self.isClosing ) {
1744	+ return;
1745	+ }
1746	+
1747	+ self.hideLoading( slide );
1748	+
1749	+ slide.$slide.empty();
1750	+
1751	+ if ( isQuery( content ) && content.parent().length ) {
1752	+
1753	+ // If it is a jQuery object, then it will be moved to the box.
1754	+ // The placeholder is created so we will know where to put it back.
1755	+ // If user is navigating gallery fast, then the content might be already moved to the box
1756	+
1757	+ if ( content.data( 'placeholder' ) ) {
1758	+ content.parents('.fancybox-slide').trigger( 'onReset' );
1759	+ }
1760	+
1761	+ content.data({'placeholder' : $('<div></div>' ).hide().insertAfter( content ) }).css('display', 'inline-block');
1762	+
1763	+ } else {
1764	+
1765	+ if ( $.type( content ) === 'string' ) {
1766	+
1767	+ content = $('<div>').append( content ).contents();
1768	+
1769	+ if ( content[0].nodeType === 3 ) {
1770	+ content = $('<div>').html( content );
1771	+ }
1772	+
1773	+ }
1774	+
1775	+ if ( slide.opts.selector ) {
1776	+ content = $('<div>').html( content ).find( slide.opts.selector );
1777	+ }
1778	+
1779	+ }
1780	+
1781	+ slide.$slide.one('onReset', function () {
1782	+ var placeholder = isQuery( content ) ? content.data('placeholder') : 0;
1783	+
1784	+ if ( placeholder ) {
1785	+ content.hide().replaceAll( placeholder );
1786	+
1787	+ content.data( 'placeholder', null );
1788	+ }
1789	+
1790	+ if ( !slide.hasError ) {
1791	+ $(this).empty();
1792	+
1793	+ slide.isLoaded = false;
1794	+ }
1795	+
1796	+ });
1797	+
1798	+ slide.$content = $( content ).appendTo( slide.$slide );
1799	+
1800	+ if ( slide.opts.smallBtn === true ) {
1801	+ slide.$content.find( '.fancybox-close-small' ).remove().end().eq(0).append( slide.opts.closeTpl );
1802	+ }
1803	+
1804	+ this.afterLoad( slide );
1805	+
1806	+ },
1807	+
1808	+ // Display error message
1809	+ // =====================
1810	+
1811	+ setError : function ( slide ) {
1812	+
1813	+ slide.hasError = true;
1814	+
1815	+ this.setContent( slide, slide.opts.errorTpl );
1816	+
1817	+ },
1818	+
1819	+
1820	+ showLoading : function( slide ) {
1821	+ var self = this;
1822	+
1823	+ slide = slide \|\| self.current;
1824	+
1825	+ if ( slide && !slide.$spinner ) {
1826	+ slide.$spinner = $( self.opts.spinnerTpl ).appendTo( slide.$slide );
1827	+ }
1828	+
1829	+ },
1830	+
1831	+ hideLoading : function( slide ) {
1832	+
1833	+ var self = this;
1834	+
1835	+ slide = slide \|\| self.current;
1836	+
1837	+ if ( slide && slide.$spinner ) {
1838	+ slide.$spinner.remove();
1839	+
1840	+ delete slide.$spinner;
1841	+ }
1842	+
1843	+ },
1844	+
1845	+ afterMove : function() {
1846	+
1847	+ var self = this;
1848	+ var current = self.current;
1849	+ var slides = {};
1850	+
1851	+ if ( !current ) {
1852	+ return;
1853	+ }
1854	+
1855	+ current.$slide.siblings().trigger( 'onReset' );
1856	+
1857	+ // Remove unnecessary slides
1858	+ $.each( self.slides, function( key, slide ) {
1859	+
1860	+ if ( slide.pos >= self.currPos - 1 && slide.pos <= self.currPos + 1 ) {
1861	+ slides[ slide.pos ] = slide;
1862	+
1863	+ } else if ( slide ) {
1864	+ slide.$slide.remove();
1865	+ }
1866	+
1867	+ });
1868	+
1869	+ self.slides = slides;
1870	+
1871	+ self.trigger( 'afterMove' );
1872	+
1873	+ if ( current.isLoaded ) {
1874	+ self.complete();
1875	+ }
1876	+
1877	+ },
1878	+
1879	+ // Adjustments after slide has been loaded
1880	+ // =======================================
1881	+
1882	+ afterLoad : function( slide ) {
1883	+
1884	+ var self = this;
1885	+
1886	+ if ( self.isClosing ) {
1887	+ return;
1888	+ }
1889	+
1890	+ slide.isLoading = false;
1891	+ slide.isLoaded = true;
1892	+
1893	+ self.trigger( 'afterLoad', slide );
1894	+
1895	+ self.hideLoading( slide );
1896	+
1897	+ // Resize content to fit inside slide
1898	+ // Skip if slide has an $ghost element, because then it has been already processed
1899	+ if ( !slide.$ghost ) {
1900	+ self.updateSlide( slide, true );
1901	+ }
1902	+
1903	+ if ( slide.index === self.currIndex && slide.isMoved ) {
1904	+ self.complete();
1905	+
1906	+ } else if ( !slide.$ghost ) {
1907	+ self.revealImage( slide );
1908	+ }
1909	+
1910	+ },
1911	+
1912	+
1913	+ // Final adjustments after current gallery item is moved to position
1914	+ // and it`s content is loaded
1915	+ // ==================================================================
1916	+
1917	+ complete : function() {
1918	+
1919	+ var self = this;
1920	+
1921	+ var current = self.current;
1922	+
1923	+ self.revealImage( current, function() {
1924	+ current.isComplete = true;
1925	+
1926	+ current.$slide.addClass('fancybox-slide--complete');
1927	+
1928	+ self.updateCursor();
1929	+
1930	+ self.trigger( 'onComplete' );
1931	+
1932	+ // Try to focus on the first focusable element, skip for images and iframes
1933	+ if ( current.opts.focus && !( current.type === 'image' \|\| current.type === 'iframe' ) ) {
1934	+ self.focus();
1935	+ }
1936	+
1937	+ });
1938	+
1939	+ },
1940	+
1941	+
1942	+ // Preload next and previous slides
1943	+ // ================================
1944	+
1945	+ preload : function() {
1946	+ var self = this;
1947	+ var next, prev;
1948	+
1949	+ if ( self.group.length < 2 ) {
1950	+ return;
1951	+ }
1952	+
1953	+ next = self.slides[ self.currPos + 1 ];
1954	+ prev = self.slides[ self.currPos - 1 ];
1955	+
1956	+ if ( next && next.type === 'image' ) {
1957	+ self.loadSlide( next );
1958	+ }
1959	+
1960	+ if ( prev && prev.type === 'image' ) {
1961	+ self.loadSlide( prev );
1962	+ }
1963	+
1964	+ },
1965	+
1966	+
1967	+ // Try to find and focus on the first focusable element
1968	+ // ====================================================
1969	+
1970	+ focus : function() {
1971	+ var current = this.current;
1972	+ var $el;
1973	+
1974	+ $el = current && current.isComplete ? current.$slide.find('button,:input,[tabindex],a:not(".disabled")').filter(':visible:first') : null;
1975	+
1976	+ if ( !$el \|\| !$el.length ) {
1977	+ $el = this.$refs.container;
1978	+ }
1979	+
1980	+ $el.focus();
1981	+
1982	+ // Scroll position of wrapper element sometimes changes after focusing (IE)
1983	+ this.$refs.slider_wrap.scrollLeft(0);
1984	+
1985	+ // And the same goes for slide element
1986	+ if ( current ) {
1987	+ current.$slide.scrollTop(0);
1988	+ }
1989	+
1990	+ },
1991	+
1992	+
1993	+ // Activates current instance - brings container to the front and enables keyboard,
1994	+ // notifies other instances about deactivating
1995	+ // =================================================================================
1996	+
1997	+ activate : function () {
1998	+ var self = this;
1999	+
2000	+ // Deactivate all instances
2001	+
2002	+ $( '.fancybox-container' ).each(function () {
2003	+ var instance = $(this).data( 'FancyBox' );
2004	+
2005	+ // Skip self and closing instances
2006	+
2007	+ if (instance && instance.uid !== self.uid && !instance.isClosing) {
2008	+ instance.trigger( 'onDeactivate' );
2009	+ }
2010	+
2011	+ });
2012	+
2013	+ if ( self.current ) {
2014	+
2015	+ if ( self.$refs.container.index() > 0 ) {
2016	+ self.$refs.container.prependTo( document.body );
2017	+ }
2018	+
2019	+ self.updateControls();
2020	+ }
2021	+
2022	+ self.trigger( 'onActivate' );
2023	+
2024	+ self.addEvents();
2025	+
2026	+ },
2027	+
2028	+
2029	+ // Start closing procedure
2030	+ // This will start "zoom-out" animation if needed and clean everything up afterwards
2031	+ // =================================================================================
2032	+
2033	+ close : function( e ) {
2034	+
2035	+ var self = this;
2036	+ var current = self.current;
2037	+ var duration = current.opts.speed;
2038	+
2039	+ var done = $.proxy(function() {
2040	+
2041	+ self.cleanUp( e ); // Now "this" is again our instance
2042	+
2043	+ }, this);
2044	+
2045	+ if ( self.isAnimating \|\| self.isClosing ) {
2046	+ return false;
2047	+ }
2048	+
2049	+ // If beforeClose callback prevents closing, make sure content is centered
2050	+ if ( self.trigger( 'beforeClose', e ) === false ) {
2051	+ $.fancybox.stop( self.$refs.slider );
2052	+
2053	+ requestAFrame(function() {
2054	+ self.update( true, true, 150 );
2055	+ });
2056	+
2057	+ return;
2058	+ }
2059	+
2060	+ self.isClosing = true;
2061	+
2062	+ if ( current.timouts ) {
2063	+ clearTimeout( current.timouts );
2064	+ }
2065	+
2066	+ if ( e !== true) {
2067	+ $.fancybox.stop( self.$refs.slider );
2068	+ }
2069	+
2070	+ self.$refs.container
2071	+ .removeClass('fancybox-container--active')
2072	+ .addClass('fancybox-container--closing');
2073	+
2074	+ current.$slide
2075	+ .removeClass('fancybox-slide--complete')
2076	+ .siblings()
2077	+ .remove();
2078	+
2079	+
2080	+ if ( !current.isMoved ) {
2081	+ current.$slide.css('overflow', 'visible');
2082	+ }
2083	+
2084	+ // Remove all events
2085	+ // If there are multiple instances, they will be set again by "activate" method
2086	+
2087	+ self.removeEvents();
2088	+
2089	+ // Clean up
2090	+
2091	+ self.hideLoading( current );
2092	+
2093	+ self.hideControls();
2094	+
2095	+ self.updateCursor();
2096	+
2097	+ self.$refs.bg.css('transition-duration', duration + 'ms');
2098	+
2099	+ this.$refs.container.removeClass( 'fancybox-container--ready' );
2100	+
2101	+ if ( e === true ) {
2102	+ setTimeout( done, duration );
2103	+
2104	+ } else if ( !self.zoomInOut( 'Out', duration, done ) ) {
2105	+ $.fancybox.animate( self.$refs.container, null, { opacity : 0 }, duration, "easeInSine", done );
2106	+ }
2107	+
2108	+ },
2109	+
2110	+
2111	+ // Final adjustments after removing the instance
2112	+ // =============================================
2113	+
2114	+ cleanUp : function( e ) {
2115	+ var self = this,
2116	+ instance;
2117	+
2118	+ self.$refs.slider.children().trigger( 'onReset' );
2119	+
2120	+ self.$refs.container.empty().remove();
2121	+
2122	+ self.trigger( 'afterClose', e );
2123	+
2124	+ self.current = null;
2125	+
2126	+ // Check if there are other instances
2127	+ instance = $.fancybox.getInstance();
2128	+
2129	+ if ( instance ) {
2130	+ instance.activate();
2131	+
2132	+ } else {
2133	+
2134	+ $( 'html' ).removeClass( 'fancybox-enabled' );
2135	+ $( 'body' ).removeAttr( 'style' );
2136	+
2137	+ $W.scrollTop( self.scrollTop ).scrollLeft( self.scrollLeft );
2138	+
2139	+ $( '#fancybox-noscroll' ).remove();
2140	+
2141	+ }
2142	+
2143	+ // Place back focus
2144	+ if ( self.$lastFocus ) {
2145	+ self.$lastFocus.focus();
2146	+ }
2147	+
2148	+ },
2149	+
2150	+
2151	+ // Call callback and trigger an event
2152	+ // ==================================
2153	+
2154	+ trigger : function( name, slide ) {
2155	+ var args = Array.prototype.slice.call(arguments, 1),
2156	+ self = this,
2157	+ obj = slide && slide.opts ? slide : self.current,
2158	+ rez;
2159	+
2160	+ if ( obj ) {
2161	+ args.unshift( obj );
2162	+
2163	+ } else {
2164	+ obj = self;
2165	+ }
2166	+
2167	+ args.unshift( self );
2168	+
2169	+ if ( $.isFunction( obj.opts[ name ] ) ) {
2170	+ rez = obj.opts[ name ].apply( obj, args );
2171	+ }
2172	+
2173	+ if ( rez === false ) {
2174	+ return rez;
2175	+ }
2176	+
2177	+ if ( name === 'afterClose' ) {
2178	+ $( document ).trigger( name + '.fb', args );
2179	+
2180	+ } else {
2181	+ self.$refs.container.trigger( name + '.fb', args );
2182	+ }
2183	+
2184	+ },
2185	+
2186	+
2187	+ // Toggle toolbar and caption
2188	+ // ==========================
2189	+
2190	+ toggleControls : function( force ) {
2191	+
2192	+ if ( this.isHiddenControls ) {
2193	+ this.updateControls( force );
2194	+
2195	+ } else {
2196	+ this.hideControls();
2197	+ }
2198	+
2199	+
2200	+ },
2201	+
2202	+
2203	+ // Hide toolbar and caption
2204	+ // ========================
2205	+
2206	+ hideControls : function () {
2207	+
2208	+ this.isHiddenControls = true;
2209	+
2210	+ this.$refs.container.removeClass('fancybox-show-controls');
2211	+
2212	+ this.$refs.container.removeClass('fancybox-show-caption');
2213	+
2214	+ },
2215	+
2216	+
2217	+ // Update infobar values, navigation button states and reveal caption
2218	+ // ==================================================================
2219	+
2220	+ updateControls : function ( force ) {
2221	+
2222	+ var self = this;
2223	+
2224	+ var $container = self.$refs.container;
2225	+ var $caption = self.$refs.caption;
2226	+
2227	+ // Toggle infobar and buttons
2228	+
2229	+ var current = self.current;
2230	+ var index = current.index;
2231	+ var opts = current.opts;
2232	+ var caption = opts.caption;
2233	+
2234	+ if ( this.isHiddenControls && force !== true ) {
2235	+ return;
2236	+ }
2237	+
2238	+ this.isHiddenControls = false;
2239	+
2240	+ $container
2241	+ .addClass('fancybox-show-controls')
2242	+ .toggleClass('fancybox-show-infobar', !!opts.infobar && self.group.length > 1)
2243	+ .toggleClass('fancybox-show-buttons', !!opts.buttons )
2244	+ .toggleClass('fancybox-is-modal', !!opts.modal );
2245	+
2246	+ $('.fancybox-button--left', $container).toggleClass( 'fancybox-button--disabled', (!opts.loop && index <= 0 ) );
2247	+ $('.fancybox-button--right', $container).toggleClass( 'fancybox-button--disabled', (!opts.loop && index >= self.group.length - 1) );
2248	+
2249	+ $('.fancybox-button--play', $container).toggle( !!( opts.slideShow && self.group.length > 1) );
2250	+ $('.fancybox-button--close', $container).toggle( !!opts.closeBtn );
2251	+
2252	+ // Update infobar values
2253	+
2254	+ $('.js-fancybox-count', $container).html( self.group.length );
2255	+ $('.js-fancybox-index', $container).html( index + 1 );
2256	+
2257	+ // Recalculate content dimensions
2258	+ current.$slide.trigger( 'refresh' );
2259	+
2260	+ // Reveal or create new caption
2261	+ if ( $caption ) {
2262	+ $caption.empty();
2263	+ }
2264	+
2265	+ if ( caption && caption.length ) {
2266	+ $caption.html( caption );
2267	+
2268	+ this.$refs.container.addClass( 'fancybox-show-caption ');
2269	+
2270	+ self.$caption = $caption;
2271	+
2272	+ } else {
2273	+ this.$refs.container.removeClass( 'fancybox-show-caption' );
2274	+ }
2275	+
2276	+ }
2277	+
2278	+ });
2279	+
2280	+
2281	+ $.fancybox = {
2282	+
2283	+ version : "3.0.47",
2284	+ defaults : defaults,
2285	+
2286	+
2287	+ // Get current instance and execute a command.
2288	+ //
2289	+ // Examples of usage:
2290	+ //
2291	+ // $instance = $.fancybox.getInstance();
2292	+ // $.fancybox.getInstance().jumpTo( 1 );
2293	+ // $.fancybox.getInstance( 'jumpTo', 1 );
2294	+ // $.fancybox.getInstance( function() {
2295	+ // console.info( this.currIndex );
2296	+ // });
2297	+ // ======================================================
2298	+
2299	+ getInstance : function ( command ) {
2300	+ var instance = $('.fancybox-container:not(".fancybox-container--closing"):first').data( 'FancyBox' );
2301	+ var args = Array.prototype.slice.call(arguments, 1);
2302	+
2303	+ if ( instance instanceof FancyBox ) {
2304	+
2305	+ if ( $.type( command ) === 'string' ) {
2306	+ instance[ command ].apply( instance, args );
2307	+
2308	+ } else if ( $.type( command ) === 'function' ) {
2309	+ command.apply( instance, args );
2310	+
2311	+ }
2312	+
2313	+ return instance;
2314	+ }
2315	+
2316	+ return false;
2317	+
2318	+ },
2319	+
2320	+
2321	+ // Create new instance
2322	+ // ===================
2323	+
2324	+ open : function ( items, opts, index ) {
2325	+ return new FancyBox( items, opts, index );
2326	+ },
2327	+
2328	+
2329	+ // Close current or all instances
2330	+ // ==============================
2331	+
2332	+ close : function ( all ) {
2333	+ var instance = this.getInstance();
2334	+
2335	+ if ( instance ) {
2336	+ instance.close();
2337	+
2338	+ // Try to find and close next instance
2339	+
2340	+ if ( all === true ) {
2341	+ this.close();
2342	+ }
2343	+ }
2344	+
2345	+ },
2346	+
2347	+
2348	+ // Test for the existence of touch events in the browser
2349	+ // Limit to mobile devices
2350	+ // ====================================================
2351	+
2352	+ isTouch : document.createTouch !== undefined && /Android\|webOS\|iPhone\|iPad\|iPod\|BlackBerry/i.test(navigator.userAgent),
2353	+
2354	+
2355	+ // Detect if 'translate3d' support is available
2356	+ // ============================================
2357	+
2358	+ use3d : (function() {
2359	+ var div = document.createElement('div');
2360	+
2361	+ return window.getComputedStyle( div ).getPropertyValue('transform') && !(document.documentMode && document.documentMode <= 11);
2362	+ }()),
2363	+
2364	+
2365	+ // Helper function to get current visual state of an element
2366	+ // returns array[ top, left, horizontal-scale, vertical-scale, opacity ]
2367	+ // =====================================================================
2368	+
2369	+ getTranslate : function( $el ) {
2370	+ var position, matrix;
2371	+
2372	+ if ( !$el \|\| !$el.length ) {
2373	+ return false;
2374	+ }
2375	+
2376	+ position = $el.get( 0 ).getBoundingClientRect();
2377	+ matrix = $el.eq( 0 ).css('transform');
2378	+
2379	+ if ( matrix && matrix.indexOf( 'matrix' ) !== -1 ) {
2380	+ matrix = matrix.split('(')[1];
2381	+ matrix = matrix.split(')')[0];
2382	+ matrix = matrix.split(',');
2383	+ } else {
2384	+ matrix = [];
2385	+ }
2386	+
2387	+ if ( matrix.length ) {
2388	+
2389	+ // If IE
2390	+ if ( matrix.length > 10 ) {
2391	+ matrix = [ matrix[13], matrix[12], matrix[0], matrix[5] ];
2392	+
2393	+ } else {
2394	+ matrix = [ matrix[5], matrix[4], matrix[0], matrix[3]];
2395	+ }
2396	+
2397	+ matrix = matrix.map(parseFloat);
2398	+
2399	+ } else {
2400	+ matrix = [ 0, 0, 1, 1 ];
2401	+ }
2402	+
2403	+ return {
2404	+ top : matrix[ 0 ],
2405	+ left : matrix[ 1 ],
2406	+ scaleX : matrix[ 2 ],
2407	+ scaleY : matrix[ 3 ],
2408	+ opacity : parseFloat( $el.css('opacity') ),
2409	+ width : position.width,
2410	+ height : position.height
2411	+ };
2412	+
2413	+ },
2414	+
2415	+
2416	+ // Shortcut for setting "translate3d" properties for element
2417	+ // Can set be used to set opacity, too
2418	+ // ========================================================
2419	+
2420	+ setTranslate : function( $el, props ) {
2421	+ var str = '';
2422	+ var css = {};
2423	+
2424	+ if ( !$el \|\| !props ) {
2425	+ return;
2426	+ }
2427	+
2428	+ if ( props.left !== undefined \|\| props.top !== undefined ) {
2429	+
2430	+ str = ( props.left === undefined ? $el.position().top : props.left ) + 'px, ' + ( props.top === undefined ? $el.position().top : props.top ) + 'px';
2431	+
2432	+ if ( this.use3d ) {
2433	+ str = 'translate3d(' + str + ', 0px)';
2434	+
2435	+ } else {
2436	+ str = 'translate(' + str + ')';
2437	+ }
2438	+
2439	+ }
2440	+
2441	+ if ( props.scaleX !== undefined && props.scaleY !== undefined ) {
2442	+ str = (str.length ? str + ' ' : '') + 'scale(' + props.scaleX + ', ' + props.scaleY + ')';
2443	+ }
2444	+
2445	+ if ( str.length ) {
2446	+ css.transform = str;
2447	+ }
2448	+
2449	+ if ( props.opacity !== undefined ) {
2450	+ css.opacity = props.opacity;
2451	+ }
2452	+
2453	+ if ( props.width !== undefined ) {
2454	+ css.width = props.width;
2455	+ }
2456	+
2457	+ if ( props.height !== undefined ) {
2458	+ css.height = props.height;
2459	+ }
2460	+
2461	+ return $el.css( css );
2462	+
2463	+ },
2464	+
2465	+
2466	+ // Common easings for entrances and exits
2467	+ // t: current time, b: begInnIng value, c: change In value, d: duration
2468	+ // ====================================================================
2469	+
2470	+ easing : {
2471	+ easeOutCubic : function (t, b, c, d) {
2472	+ return c * ((t=t/d-1)tt + 1) + b;
2473	+ },
2474	+ easeInCubic : function (t, b, c, d) {
2475	+ return c * (t/=d)tt + b;
2476	+ },
2477	+ easeOutSine : function (t, b, c, d) {
2478	+ return c * Math.sin(t/d * (Math.PI/2)) + b;
2479	+ },
2480	+ easeInSine : function (t, b, c, d) {
2481	+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
2482	+ }
2483	+ },
2484	+
2485	+
2486	+ // Stop fancyBox animation
2487	+ // =======================
2488	+
2489	+ stop : function( $el ) {
2490	+
2491	+ $el.removeData( 'animateID' );
2492	+
2493	+ },
2494	+
2495	+ // Animate element using "translate3d"
2496	+ // Usage:
2497	+ // animate( element, start properties, end properties, duration, easing, callback )
2498	+ // or
2499	+ // animate( element, start properties, end properties, duration, callback )
2500	+ // =================================================================================
2501	+
2502	+ animate : function( $el, from, to, duration, easing, done ) {
2503	+
2504	+ var self = this;
2505	+
2506	+ var lastTime = null;
2507	+ var animTime = 0;
2508	+
2509	+ var curr;
2510	+ var diff;
2511	+ var id;
2512	+
2513	+ var finish = function() {
2514	+ if ( to.scaleX !== undefined && to.scaleY !== undefined && from && from.width !== undefined && from.height !== undefined ) {
2515	+ to.width = from.width * to.scaleX;
2516	+ to.height = from.height * to.scaleY;
2517	+
2518	+ to.scaleX = 1;
2519	+ to.scaleY = 1;
2520	+ }
2521	+
2522	+ self.setTranslate( $el, to );
2523	+
2524	+ done();
2525	+ };
2526	+
2527	+ var frame = function ( timestamp ) {
2528	+ curr = [];
2529	+ diff = 0;
2530	+
2531	+ // If "stop" method has been called on this element, then just stop
2532	+ if ( !$el.length \|\| $el.data( 'animateID' ) !== id ) {
2533	+ return;
2534	+ }
2535	+
2536	+ timestamp = timestamp \|\| Date.now();
2537	+
2538	+ if ( lastTime ) {
2539	+ diff = timestamp - lastTime;
2540	+ }
2541	+
2542	+ lastTime = timestamp;
2543	+ animTime += diff;
2544	+
2545	+ // Are we done?
2546	+ if ( animTime >= duration ) {
2547	+
2548	+ finish();
2549	+
2550	+ return;
2551	+ }
2552	+
2553	+ for ( var prop in to ) {
2554	+
2555	+ if ( to.hasOwnProperty( prop ) && from[ prop ] !== undefined ) {
2556	+
2557	+ if ( from[ prop ] == to[ prop ] ) {
2558	+ curr[ prop ] = to[ prop ];
2559	+
2560	+ } else {
2561	+ curr[ prop ] = self.easing[ easing ]( animTime, from[ prop ], to[ prop ] - from[ prop ], duration );
2562	+ }
2563	+
2564	+ }
2565	+ }
2566	+
2567	+ self.setTranslate( $el, curr );
2568	+
2569	+ requestAFrame( frame );
2570	+ };
2571	+
2572	+ self.animateID = id = self.animateID === undefined ? 1 : self.animateID + 1;
2573	+
2574	+ $el.data( 'animateID', id );
2575	+
2576	+ if ( done === undefined && $.type(easing) == 'function' ) {
2577	+ done = easing;
2578	+ easing = undefined;
2579	+ }
2580	+
2581	+ if ( !easing ) {
2582	+ easing = "easeOutCubic";
2583	+ }
2584	+
2585	+ done = done \|\| $.noop;
2586	+
2587	+ if ( from ) {
2588	+ this.setTranslate( $el, from );
2589	+
2590	+ } else {
2591	+
2592	+ // We need current values to calculate change in time
2593	+ from = this.getTranslate( $el );
2594	+ }
2595	+
2596	+ if ( duration ) {
2597	+ $el.show();
2598	+
2599	+ requestAFrame( frame );
2600	+
2601	+ } else {
2602	+ finish();
2603	+ }
2604	+
2605	+ }
2606	+
2607	+ };
2608	+
2609	+
2610	+ // Event handler for click event to "fancyboxed" links
2611	+ // ===================================================
2612	+
2613	+ function _run( e ) {
2614	+ var target = e.currentTarget,
2615	+ opts = e.data ? e.data.options : {},
2616	+ items = e.data ? e.data.items : [],
2617	+ value = '',
2618	+ index = 0;
2619	+
2620	+ e.preventDefault();
2621	+ e.stopPropagation();
2622	+
2623	+ // Get all related items and find index for clicked one
2624	+
2625	+ if ( $(target).attr( 'data-fancybox' ) ) {
2626	+ value = $(target).data( 'fancybox' );
2627	+ }
2628	+
2629	+ if ( value ) {
2630	+ items = items.length ? items.filter( '[data-fancybox="' + value + '"]' ) : $( '[data-fancybox=' + value + ']' );
2631	+ index = items.index( target );
2632	+
2633	+ } else {
2634	+ items = [ target ];
2635	+ }
2636	+
2637	+ $.fancybox.open( items, opts, index );
2638	+ }
2639	+
2640	+
2641	+ // Create a jQuery plugin
2642	+ // ======================
2643	+
2644	+ $.fn.fancybox = function (options) {
2645	+
2646	+ this.off('click.fb-start').on('click.fb-start', {
2647	+ items : this,
2648	+ options : options \|\| {}
2649	+ }, _run);
2650	+
2651	+ return this;
2652	+
2653	+ };
2654	+
2655	+
2656	+ // Self initializing plugin
2657	+ // ========================
2658	+
2659	+ $(document).on('click.fb-start', '[data-fancybox]', _run);
2660	+
2661	+ }(window, document, window.jQuery));
2662	+
2663	+ // ==========================================================================
2664	+ //
2665	+ // Media
2666	+ // Adds additional media type support
2667	+ //
2668	+ // ==========================================================================
2669	+ ;(function ($) {
2670	+
2671	+ 'use strict';
2672	+
2673	+ // Formats matching url to final form
2674	+
2675	+ var format = function (url, rez, params) {
2676	+ if ( !url ) {
2677	+ return;
2678	+ }
2679	+
2680	+ params = params \|\| '';
2681	+
2682	+ if ( $.type(params) === "object" ) {
2683	+ params = $.param(params, true);
2684	+ }
2685	+
2686	+ $.each(rez, function (key, value) {
2687	+ url = url.replace('$' + key, value \|\| '');
2688	+ });
2689	+
2690	+ if (params.length) {
2691	+ url += (url.indexOf('?') > 0 ? '&' : '?') + params;
2692	+ }
2693	+
2694	+ return url;
2695	+ };
2696	+
2697	+ // Object containing properties for each media type
2698	+
2699	+ var media = {
2700	+ youtube: {
2701	+ matcher: /(youtube\.com\|youtu\.be\|youtube\-nocookie\.com)\/(watch\?(.&)?v=\|v\/\|u\/\|embed\/?)?(videoseries\?list=(.)\|[\w-]{11}\|\?listType=(.)&list=(.))(.*)/i,
2702	+ params: {
2703	+ autoplay: 1,
2704	+ autohide: 1,
2705	+ fs: 1,
2706	+ rel: 0,
2707	+ hd: 1,
2708	+ wmode: 'transparent',
2709	+ enablejsapi: 1,
2710	+ html5: 1
2711	+ },
2712	+ paramPlace : 8,
2713	+ type: 'iframe',
2714	+ url: '//www.youtube.com/embed/$4',
2715	+ thumb: '//img.youtube.com/vi/$4/hqdefault.jpg'
2716	+ },
2717	+
2718	+ vimeo: {
2719	+ matcher: /^.+vimeo.com\/(.\/)?([\d]+)(.)?/,
2720	+ params: {
2721	+ autoplay: 1,
2722	+ hd: 1,
2723	+ show_title: 1,
2724	+ show_byline: 1,
2725	+ show_portrait: 0,
2726	+ fullscreen: 1,
2727	+ api: 1
2728	+ },
2729	+ paramPlace : 3,
2730	+ type: 'iframe',
2731	+ url: '//player.vimeo.com/video/$2'
2732	+ },
2733	+
2734	+ metacafe: {
2735	+ matcher: /metacafe.com\/watch\/(\d+)\/(.*)?/,
2736	+ type: 'iframe',
2737	+ url: '//www.metacafe.com/embed/$1/?ap=1'
2738	+ },
2739	+
2740	+ dailymotion: {
2741	+ matcher: /dailymotion.com\/video\/(.)\/?(.)/,
2742	+ params: {
2743	+ additionalInfos: 0,
2744	+ autoStart: 1
2745	+ },
2746	+ type: 'iframe',
2747	+ url: '//www.dailymotion.com/embed/video/$1'
2748	+ },
2749	+
2750	+ vine: {
2751	+ matcher: /vine.co\/v\/([a-zA-Z0-9\?\=\-]+)/,
2752	+ type: 'iframe',
2753	+ url: '//vine.co/v/$1/embed/simple'
2754	+ },
2755	+
2756	+ instagram: {
2757	+ matcher: /(instagr\.am\|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,
2758	+ type: 'image',
2759	+ url: '//$1/p/$2/media/?size=l'
2760	+ },
2761	+
2762	+ // Examples:
2763	+ // http://maps.google.com/?ll=48.857995,2.294297&spn=0.007666,0.021136&t=m&z=16
2764	+ // http://maps.google.com/?ll=48.857995,2.294297&spn=0.007666,0.021136&t=m&z=16
2765	+ // https://www.google.lv/maps/place/Googleplex/@37.4220041,-122.0833494,17z/data=!4m5!3m4!1s0x0:0x6c296c66619367e0!8m2!3d37.4219998!4d-122.0840572
2766	+ google_maps: {
2767	+ matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.)\/)?\@(.),(\d+.?\d+?)z))\|(\?ll=))(.*)?/i,
2768	+ type: 'iframe',
2769	+ url: function (rez) {
2770	+ return '//maps.google.' + rez[2] + '/?ll=' + ( rez[9] ? rez[9] + '&z=' + Math.floor( rez[10] ) + ( rez[12] ? rez[12].replace(/^\//, "&") : '' ) : rez[12] ) + '&output=' + ( rez[12] && rez[12].indexOf('layer=c') > 0 ? 'svembed' : 'embed' );
2771	+ }
2772	+ }
2773	+ };
2774	+
2775	+ $(document).on('onInit.fb', function (e, instance) {
2776	+
2777	+ $.each(instance.group, function( i, item ) {
2778	+
2779	+ var url = item.src \|\| '',
2780	+ type = false,
2781	+ thumb,
2782	+ rez,
2783	+ params,
2784	+ urlParams,
2785	+ o,
2786	+ provider;
2787	+
2788	+ // Skip items that already have content type
2789	+ if ( item.type ) {
2790	+ return;
2791	+ }
2792	+
2793	+ // Look for any matching media type
2794	+
2795	+ $.each(media, function ( n, el ) {
2796	+ rez = url.match(el.matcher);
2797	+ o = {};
2798	+ provider = n;
2799	+
2800	+ if (!rez) {
2801	+ return;
2802	+ }
2803	+
2804	+ type = el.type;
2805	+
2806	+ if ( el.paramPlace && rez[ el.paramPlace ] ) {
2807	+ urlParams = rez[ el.paramPlace ];
2808	+
2809	+ if ( urlParams[ 0 ] == '?' ) {
2810	+ urlParams = urlParams.substring(1);
2811	+ }
2812	+
2813	+ urlParams = urlParams.split('&');
2814	+
2815	+ for ( var m = 0; m < urlParams.length; ++m ) {
2816	+ var p = urlParams[ m ].split('=', 2);
2817	+
2818	+ if ( p.length == 2 ) {
2819	+ o[ p[0] ] = decodeURIComponent( p[1].replace(/\+/g, " ") );
2820	+ }
2821	+ }
2822	+ }
2823	+
2824	+ params = $.extend( true, {}, el.params, item.opts[ n ], o );
2825	+
2826	+ url = $.type(el.url) === "function" ? el.url.call(this, rez, params, item) : format(el.url, rez, params);
2827	+ thumb = $.type(el.thumb) === "function" ? el.thumb.call(this, rez, params, item) : format(el.thumb, rez);
2828	+
2829	+ if ( provider === 'vimeo' ) {
2830	+ url = url.replace('&%23', '#');
2831	+ }
2832	+
2833	+ return false;
2834	+ });
2835	+
2836	+ // If it is found, then change content type and update the url
2837	+
2838	+ if ( type ) {
2839	+ item.src = url;
2840	+ item.type = type;
2841	+
2842	+ if ( !item.opts.thumb && !(item.opts.$thumb && item.opts.$thumb.length ) ) {
2843	+ item.opts.thumb = thumb;
2844	+ }
2845	+
2846	+ if ( type === 'iframe' ) {
2847	+ $.extend(true, item.opts, {
2848	+ iframe : {
2849	+ preload : false,
2850	+ scrolling : "no"
2851	+ },
2852	+ smallBtn : false,
2853	+ closeBtn : true,
2854	+ fullScreen : false,
2855	+ slideShow : false
2856	+ });
2857	+
2858	+ item.opts.slideClass += ' fancybox-slide--video';
2859	+ }
2860	+
2861	+ } else {
2862	+
2863	+ // If no content type is found, then set it to `iframe` as fallback
2864	+ item.type = 'iframe';
2865	+
2866	+ }
2867	+
2868	+ });
2869	+
2870	+ });
2871	+
2872	+ }(window.jQuery));
2873	+
2874	+ // ==========================================================================
2875	+ //
2876	+ // Guestures
2877	+ // Adds touch guestures, handles click and tap events
2878	+ //
2879	+ // ==========================================================================
2880	+ ;(function (window, document, $) {
2881	+ 'use strict';
2882	+
2883	+ var requestAFrame = (function() {
2884	+ return window.requestAnimationFrame \|\|
2885	+ window.webkitRequestAnimationFrame \|\|
2886	+ window.mozRequestAnimationFrame \|\|
2887	+ function( callback ) {
2888	+ window.setTimeout(callback, 1000 / 60); };
2889	+ })();
2890	+
2891	+
2892	+ var pointers = function( e ) {
2893	+ var result = [];
2894	+
2895	+ e = e.originalEvent \|\| e \|\| window.e;
2896	+ e = e.touches && e.touches.length ? e.touches : ( e.changedTouches && e.changedTouches.length ? e.changedTouches : [ e ] );
2897	+
2898	+ for ( var key in e ) {
2899	+
2900	+ if ( e[ key ].pageX ) {
2901	+ result.push( { x : e[ key ].pageX, y : e[ key ].pageY } );
2902	+
2903	+ } else if ( e[ key ].clientX ) {
2904	+ result.push( { x : e[ key ].clientX, y : e[ key ].clientY } );
2905	+ }
2906	+ }
2907	+
2908	+ return result;
2909	+ };
2910	+
2911	+ var distance = function( point2, point1, what ) {
2912	+
2913	+ if ( !point1 \|\| !point2 ) {
2914	+ return 0;
2915	+ }
2916	+
2917	+ if ( what === 'x' ) {
2918	+ return point2.x - point1.x;
2919	+
2920	+ } else if ( what === 'y' ) {
2921	+ return point2.y - point1.y;
2922	+ }
2923	+
2924	+ return Math.sqrt( Math.pow( point2.x - point1.x, 2 ) + Math.pow( point2.y - point1.y, 2 ) );
2925	+
2926	+ };
2927	+
2928	+ var isClickable = function( $el ) {
2929	+
2930	+ return $el.is('a') \|\| $el.is('button') \|\| $el.is('input') \|\| $el.is('select') \|\| $el.is('textarea') \|\| $.isFunction( $el.get(0).onclick );
2931	+
2932	+ };
2933	+
2934	+ var hasScrollbars = function( el ) {
2935	+ var overflowY = window.getComputedStyle( el )['overflow-y'];
2936	+ var overflowX = window.getComputedStyle( el )['overflow-x'];
2937	+
2938	+ var vertical = (overflowY === 'scroll' \|\| overflowY === 'auto') && el.scrollHeight > el.clientHeight;
2939	+ var horizontal = (overflowX === 'scroll' \|\| overflowX === 'auto') && el.scrollWidth > el.clientWidth;
2940	+
2941	+ return vertical \|\| horizontal;
2942	+ };
2943	+
2944	+ var isScrollable = function ( $el ) {
2945	+
2946	+ var rez = false;
2947	+
2948	+ while ( true ) {
2949	+ rez = hasScrollbars( $el.get(0) );
2950	+
2951	+ if ( rez ) {
2952	+ break;
2953	+ }
2954	+
2955	+ $el = $el.parent();
2956	+
2957	+ if ( !$el.length \|\| $el.hasClass('fancybox-slider') \|\| $el.is('body') ) {
2958	+ break;
2959	+ }
2960	+
2961	+ }
2962	+
2963	+ return rez;
2964	+
2965	+ };
2966	+
2967	+
2968	+ var Guestures = function ( instance ) {
2969	+
2970	+ var self = this;
2971	+
2972	+ self.instance = instance;
2973	+
2974	+ self.$wrap = instance.$refs.slider_wrap;
2975	+ self.$slider = instance.$refs.slider;
2976	+ self.$container = instance.$refs.container;
2977	+
2978	+ self.destroy();
2979	+
2980	+ self.$wrap.on('touchstart.fb mousedown.fb', $.proxy(self, "ontouchstart"));
2981	+
2982	+ };
2983	+
2984	+ Guestures.prototype.destroy = function() {
2985	+
2986	+ this.$wrap.off('touchstart.fb mousedown.fb touchmove.fb mousemove.fb touchend.fb touchcancel.fb mouseup.fb mouseleave.fb');
2987	+
2988	+ };
2989	+
2990	+ Guestures.prototype.ontouchstart = function( e ) {
2991	+
2992	+ var self = this;
2993	+
2994	+ var $target = $( e.target );
2995	+ var instance = self.instance;
2996	+ var current = instance.current;
2997	+ var $content = current.$content \|\| current.$placeholder;
2998	+
2999	+ self.startPoints = pointers( e );
3000	+
3001	+ self.$target = $target;
3002	+ self.$content = $content;
3003	+
3004	+ self.canvasWidth = Math.round( current.$slide[0].clientWidth );
3005	+ self.canvasHeight = Math.round( current.$slide[0].clientHeight );
3006	+
3007	+ self.startEvent = e;
3008	+
3009	+ // Skip if clicked on the scrollbar
3010	+ if ( e.originalEvent.clientX > self.canvasWidth + current.$slide.offset().left ) {
3011	+ return true;
3012	+ }
3013	+
3014	+ // Ignore taping on links, buttons and scrollable items
3015	+ if ( isClickable( $target ) \|\| isClickable( $target.parent() ) \|\| ( isScrollable( $target ) ) ) {
3016	+ return;
3017	+ }
3018	+
3019	+ // If "touch" is disabled, then handle click event
3020	+ if ( !current.opts.touch ) {
3021	+ self.endPoints = self.startPoints;
3022	+
3023	+ return self.ontap();
3024	+ }
3025	+
3026	+ // Ignore right click
3027	+ if ( e.originalEvent && e.originalEvent.button == 2 ) {
3028	+ return;
3029	+ }
3030	+
3031	+ e.stopPropagation();
3032	+ e.preventDefault();
3033	+
3034	+ if ( !current \|\| self.instance.isAnimating \|\| self.instance.isClosing ) {
3035	+ return;
3036	+ }
3037	+
3038	+ // Prevent zooming if already swiping
3039	+ if ( !self.startPoints \|\| ( self.startPoints.length > 1 && !current.isMoved ) ) {
3040	+ return;
3041	+ }
3042	+
3043	+ self.$wrap.off('touchmove.fb mousemove.fb', $.proxy(self, "ontouchmove"));
3044	+ self.$wrap.off('touchend.fb touchcancel.fb mouseup.fb mouseleave.fb', $.proxy(self, "ontouchend"));
3045	+
3046	+ self.$wrap.on('touchend.fb touchcancel.fb mouseup.fb mouseleave.fb', $.proxy(self, "ontouchend"));
3047	+ self.$wrap.on('touchmove.fb mousemove.fb', $.proxy(self, "ontouchmove"));
3048	+
3049	+ self.startTime = new Date().getTime();
3050	+ self.distanceX = self.distanceY = self.distance = 0;
3051	+
3052	+ self.canTap = false;
3053	+ self.isPanning = false;
3054	+ self.isSwiping = false;
3055	+ self.isZooming = false;
3056	+
3057	+ self.sliderStartPos = $.fancybox.getTranslate( self.$slider );
3058	+
3059	+ self.contentStartPos = $.fancybox.getTranslate( self.$content );
3060	+ self.contentLastPos = null;
3061	+
3062	+ if ( self.startPoints.length === 1 && !self.isZooming ) {
3063	+ self.canTap = current.isMoved;
3064	+
3065	+ if ( current.type === 'image' && ( self.contentStartPos.width > self.canvasWidth + 1 \|\| self.contentStartPos.height > self.canvasHeight + 1 ) ) {
3066	+
3067	+ $.fancybox.stop( self.$content );
3068	+
3069	+ self.isPanning = true;
3070	+
3071	+ } else {
3072	+
3073	+ $.fancybox.stop( self.$slider );
3074	+
3075	+ self.isSwiping = true;
3076	+ }
3077	+
3078	+ self.$container.addClass('fancybox-controls--isGrabbing');
3079	+
3080	+ }
3081	+
3082	+ if ( self.startPoints.length === 2 && current.isMoved && !current.hasError && current.type === 'image' && ( current.isLoaded \|\| current.$ghost ) ) {
3083	+
3084	+ self.isZooming = true;
3085	+
3086	+ self.isSwiping = false;
3087	+ self.isPanning = false;
3088	+
3089	+ $.fancybox.stop( self.$content );
3090	+
3091	+ self.centerPointStartX = ( ( self.startPoints[0].x + self.startPoints[1].x ) * 0.5 ) - $(window).scrollLeft();
3092	+ self.centerPointStartY = ( ( self.startPoints[0].y + self.startPoints[1].y ) * 0.5 ) - $(window).scrollTop();
3093	+
3094	+ self.percentageOfImageAtPinchPointX = ( self.centerPointStartX - self.contentStartPos.left ) / self.contentStartPos.width;
3095	+ self.percentageOfImageAtPinchPointY = ( self.centerPointStartY - self.contentStartPos.top ) / self.contentStartPos.height;
3096	+
3097	+ self.startDistanceBetweenFingers = distance( self.startPoints[0], self.startPoints[1] );
3098	+ }
3099	+
3100	+ };
3101	+
3102	+ Guestures.prototype.ontouchmove = function( e ) {
3103	+
3104	+ var self = this;
3105	+
3106	+ e.preventDefault();
3107	+
3108	+ self.newPoints = pointers( e );
3109	+
3110	+ if ( !self.newPoints \|\| !self.newPoints.length ) {
3111	+ return;
3112	+ }
3113	+
3114	+ self.distanceX = distance( self.newPoints[0], self.startPoints[0], 'x' );
3115	+ self.distanceY = distance( self.newPoints[0], self.startPoints[0], 'y' );
3116	+
3117	+ self.distance = distance( self.newPoints[0], self.startPoints[0] );
3118	+
3119	+ // Skip false ontouchmove events (Chrome)
3120	+ if ( self.distance > 0 ) {
3121	+
3122	+ if ( self.isSwiping ) {
3123	+ self.onSwipe();
3124	+
3125	+ } else if ( self.isPanning ) {
3126	+ self.onPan();
3127	+
3128	+ } else if ( self.isZooming ) {
3129	+ self.onZoom();
3130	+ }
3131	+
3132	+ }
3133	+
3134	+ };
3135	+
3136	+ Guestures.prototype.onSwipe = function() {
3137	+
3138	+ var self = this;
3139	+
3140	+ var swiping = self.isSwiping;
3141	+ var left = self.sliderStartPos.left;
3142	+ var angle;
3143	+
3144	+ if ( swiping === true ) {
3145	+
3146	+ if ( Math.abs( self.distance ) > 10 ) {
3147	+
3148	+ if ( self.instance.group.length < 2 ) {
3149	+ self.isSwiping = 'y';
3150	+
3151	+ } else if ( !self.instance.current.isMoved \|\| self.instance.opts.touch.vertical === false \|\| ( self.instance.opts.touch.vertical === 'auto' && $( window ).width() > 800 ) ) {
3152	+ self.isSwiping = 'x';
3153	+
3154	+ } else {
3155	+ angle = Math.abs( Math.atan2( self.distanceY, self.distanceX ) * 180 / Math.PI );
3156	+
3157	+ self.isSwiping = ( angle > 45 && angle < 135 ) ? 'y' : 'x';
3158	+ }
3159	+
3160	+ self.canTap = false;
3161	+
3162	+ self.instance.current.isMoved = false;
3163	+
3164	+ // Reset points to avoid jumping, because we dropped first swipes to calculate the angle
3165	+ self.startPoints = self.newPoints;
3166	+ }
3167	+
3168	+ } else {
3169	+
3170	+ if ( swiping == 'x' ) {
3171	+
3172	+ // Sticky edges
3173	+ if ( !self.instance.current.opts.loop && self.instance.current.index === 0 && self.distanceX > 0 ) {
3174	+ left = left + Math.pow( self.distanceX, 0.8 );
3175	+
3176	+ } else if ( !self.instance.current.opts.loop &&self.instance.current.index === self.instance.group.length - 1 && self.distanceX < 0 ) {
3177	+ left = left - Math.pow( -self.distanceX, 0.8 );
3178	+
3179	+ } else {
3180	+ left = left + self.distanceX;
3181	+ }
3182	+
3183	+ }
3184	+
3185	+ self.sliderLastPos = {
3186	+ top : swiping == 'x' ? 0 : self.sliderStartPos.top + self.distanceY,
3187	+ left : left
3188	+ };
3189	+
3190	+ requestAFrame(function() {
3191	+ $.fancybox.setTranslate( self.$slider, self.sliderLastPos );
3192	+ });
3193	+ }
3194	+
3195	+ };
3196	+
3197	+ Guestures.prototype.onPan = function() {
3198	+
3199	+ var self = this;
3200	+
3201	+ var newOffsetX, newOffsetY, newPos;
3202	+
3203	+ self.canTap = false;
3204	+
3205	+ if ( self.contentStartPos.width > self.canvasWidth ) {
3206	+ newOffsetX = self.contentStartPos.left + self.distanceX;
3207	+
3208	+ } else {
3209	+ newOffsetX = self.contentStartPos.left;
3210	+ }
3211	+
3212	+ newOffsetY = self.contentStartPos.top + self.distanceY;
3213	+
3214	+ newPos = self.limitMovement( newOffsetX, newOffsetY, self.contentStartPos.width, self.contentStartPos.height );
3215	+
3216	+ newPos.scaleX = self.contentStartPos.scaleX;
3217	+ newPos.scaleY = self.contentStartPos.scaleY;
3218	+
3219	+ self.contentLastPos = newPos;
3220	+
3221	+ requestAFrame(function() {
3222	+ $.fancybox.setTranslate( self.$content, self.contentLastPos );
3223	+ });
3224	+ };
3225	+
3226	+ // Make panning sticky to the edges
3227	+ Guestures.prototype.limitMovement = function( newOffsetX, newOffsetY, newWidth, newHeight ) {
3228	+
3229	+ var self = this;
3230	+
3231	+ var minTranslateX, minTranslateY, maxTranslateX, maxTranslateY;
3232	+
3233	+ var canvasWidth = self.canvasWidth;
3234	+ var canvasHeight = self.canvasHeight;
3235	+
3236	+ var currentOffsetX = self.contentStartPos.left;
3237	+ var currentOffsetY = self.contentStartPos.top;
3238	+
3239	+ var distanceX = self.distanceX;
3240	+ var distanceY = self.distanceY;
3241	+
3242	+ // Slow down proportionally to traveled distance
3243	+
3244	+ minTranslateX = Math.max(0, canvasWidth * 0.5 - newWidth * 0.5 );
3245	+ minTranslateY = Math.max(0, canvasHeight * 0.5 - newHeight * 0.5 );
3246	+
3247	+ maxTranslateX = Math.min( canvasWidth - newWidth, canvasWidth * 0.5 - newWidth * 0.5 );
3248	+ maxTranslateY = Math.min( canvasHeight - newHeight, canvasHeight * 0.5 - newHeight * 0.5 );
3249	+
3250	+ if ( newWidth > canvasWidth ) {
3251	+
3252	+ // ->
3253	+ if ( distanceX > 0 && newOffsetX > minTranslateX ) {
3254	+ newOffsetX = minTranslateX - 1 + Math.pow( -minTranslateX + currentOffsetX + distanceX, 0.8 ) \|\| 0;
3255	+ }
3256	+
3257	+ // <-
3258	+ if ( distanceX < 0 && newOffsetX < maxTranslateX ) {
3259	+ newOffsetX = maxTranslateX + 1 - Math.pow( maxTranslateX - currentOffsetX - distanceX, 0.8 ) \|\| 0;
3260	+ }
3261	+
3262	+ }
3263	+
3264	+ if ( newHeight > canvasHeight ) {
3265	+
3266	+ // \/
3267	+ if ( distanceY > 0 && newOffsetY > minTranslateY ) {
3268	+ newOffsetY = minTranslateY - 1 + Math.pow(-minTranslateY + currentOffsetY + distanceY, 0.8 ) \|\| 0;
3269	+ }
3270	+
3271	+ // /\
3272	+ if ( distanceY < 0 && newOffsetY < maxTranslateY ) {
3273	+ newOffsetY = maxTranslateY + 1 - Math.pow ( maxTranslateY - currentOffsetY - distanceY, 0.8 ) \|\| 0;
3274	+ }
3275	+
3276	+ }
3277	+
3278	+ return {
3279	+ top : newOffsetY,
3280	+ left : newOffsetX
3281	+ };
3282	+
3283	+ };
3284	+
3285	+
3286	+ Guestures.prototype.limitPosition = function( newOffsetX, newOffsetY, newWidth, newHeight ) {
3287	+
3288	+ var self = this;
3289	+
3290	+ var canvasWidth = self.canvasWidth;
3291	+ var canvasHeight = self.canvasHeight;
3292	+
3293	+ if ( newWidth > canvasWidth ) {
3294	+ newOffsetX = newOffsetX > 0 ? 0 : newOffsetX;
3295	+ newOffsetX = newOffsetX < canvasWidth - newWidth ? canvasWidth - newWidth : newOffsetX;
3296	+
3297	+ } else {
3298	+
3299	+ // Center horizontally
3300	+ newOffsetX = Math.max( 0, canvasWidth / 2 - newWidth / 2 );
3301	+
3302	+ }
3303	+
3304	+ if ( newHeight > canvasHeight ) {
3305	+ newOffsetY = newOffsetY > 0 ? 0 : newOffsetY;
3306	+ newOffsetY = newOffsetY < canvasHeight - newHeight ? canvasHeight - newHeight : newOffsetY;
3307	+
3308	+ } else {
3309	+
3310	+ // Center vertically
3311	+ newOffsetY = Math.max( 0, canvasHeight / 2 - newHeight / 2 );
3312	+
3313	+ }
3314	+
3315	+ return {
3316	+ top : newOffsetY,
3317	+ left : newOffsetX
3318	+ };
3319	+
3320	+ };
3321	+
3322	+ Guestures.prototype.onZoom = function() {
3323	+
3324	+ var self = this;
3325	+
3326	+ // Calculate current distance between points to get pinch ratio and new width and height
3327	+
3328	+ var currentWidth = self.contentStartPos.width;
3329	+ var currentHeight = self.contentStartPos.height;
3330	+
3331	+ var currentOffsetX = self.contentStartPos.left;
3332	+ var currentOffsetY = self.contentStartPos.top;
3333	+
3334	+ var endDistanceBetweenFingers = distance( self.newPoints[0], self.newPoints[1] );
3335	+
3336	+ var pinchRatio = endDistanceBetweenFingers / self.startDistanceBetweenFingers;
3337	+
3338	+ var newWidth = Math.floor( currentWidth * pinchRatio );
3339	+ var newHeight = Math.floor( currentHeight * pinchRatio );
3340	+
3341	+ // This is the translation due to pinch-zooming
3342	+ var translateFromZoomingX = (currentWidth - newWidth) * self.percentageOfImageAtPinchPointX;
3343	+ var translateFromZoomingY = (currentHeight - newHeight) * self.percentageOfImageAtPinchPointY;
3344	+
3345	+ //Point between the two touches
3346	+
3347	+ var centerPointEndX = ((self.newPoints[0].x + self.newPoints[1].x) / 2) - $(window).scrollLeft();
3348	+ var centerPointEndY = ((self.newPoints[0].y + self.newPoints[1].y) / 2) - $(window).scrollTop();
3349	+
3350	+ // And this is the translation due to translation of the centerpoint
3351	+ // between the two fingers
3352	+
3353	+ var translateFromTranslatingX = centerPointEndX - self.centerPointStartX;
3354	+ var translateFromTranslatingY = centerPointEndY - self.centerPointStartY;
3355	+
3356	+ // The new offset is the old/current one plus the total translation
3357	+
3358	+ var newOffsetX = currentOffsetX + ( translateFromZoomingX + translateFromTranslatingX );
3359	+ var newOffsetY = currentOffsetY + ( translateFromZoomingY + translateFromTranslatingY );
3360	+
3361	+ var newPos = {
3362	+ top : newOffsetY,
3363	+ left : newOffsetX,
3364	+ scaleX : self.contentStartPos.scaleX * pinchRatio,
3365	+ scaleY : self.contentStartPos.scaleY * pinchRatio
3366	+ };
3367	+
3368	+ self.canTap = false;
3369	+
3370	+ self.newWidth = newWidth;
3371	+ self.newHeight = newHeight;
3372	+
3373	+ self.contentLastPos = newPos;
3374	+
3375	+ requestAFrame(function() {
3376	+ $.fancybox.setTranslate( self.$content, self.contentLastPos );
3377	+ });
3378	+
3379	+ };
3380	+
3381	+ Guestures.prototype.ontouchend = function( e ) {
3382	+
3383	+ var self = this;
3384	+
3385	+ var current = self.instance.current;
3386	+
3387	+ var dMs = Math.max( (new Date().getTime() ) - self.startTime, 1);
3388	+
3389	+ var swiping = self.isSwiping;
3390	+ var panning = self.isPanning;
3391	+ var zooming = self.isZooming;
3392	+
3393	+ self.endPoints = pointers( e );
3394	+
3395	+ self.$container.removeClass('fancybox-controls--isGrabbing');
3396	+
3397	+ self.$wrap.off('touchmove.fb mousemove.fb', $.proxy(this, "ontouchmove"));
3398	+ self.$wrap.off('touchend.fb touchcancel.fb mouseup.fb mouseleave.fb', $.proxy(this, "ontouchend"));
3399	+
3400	+ self.isSwiping = false;
3401	+ self.isPanning = false;
3402	+ self.isZooming = false;
3403	+
3404	+ if ( self.canTap ) {
3405	+ return self.ontap();
3406	+ }
3407	+
3408	+ // Speed in px/ms
3409	+ self.velocityX = self.distanceX / dMs * 0.5;
3410	+ self.velocityY = self.distanceY / dMs * 0.5;
3411	+
3412	+ self.speed = current.opts.speed \|\| 330;
3413	+
3414	+ self.speedX = Math.max( self.speed * 0.75, Math.min( self.speed * 1.5, ( 1 / Math.abs( self.velocityX ) ) * self.speed ) );
3415	+ self.speedY = Math.max( self.speed * 0.75, Math.min( self.speed * 1.5, ( 1 / Math.abs( self.velocityY ) ) * self.speed ) );
3416	+
3417	+ if ( panning ) {
3418	+ self.endPanning();
3419	+
3420	+ } else if ( zooming ) {
3421	+ self.endZooming();
3422	+
3423	+ } else {
3424	+ self.endSwiping( swiping );
3425	+ }
3426	+
3427	+ return;
3428	+ };
3429	+
3430	+ Guestures.prototype.endSwiping = function( swiping ) {
3431	+
3432	+ var self = this;
3433	+
3434	+ // Close if swiped vertically / navigate if horizontally
3435	+
3436	+ if ( swiping == 'y' && Math.abs( self.distanceY ) > 50 ) {
3437	+
3438	+ // Continue vertical movement
3439	+
3440	+ $.fancybox.animate( self.$slider, null, {
3441	+ top : self.sliderStartPos.top + self.distanceY + self.velocityY * 150,
3442	+ left : self.sliderStartPos.left,
3443	+ opacity : 0
3444	+ }, self.speedY );
3445	+
3446	+ self.instance.close( true );
3447	+
3448	+ } else if ( swiping == 'x' && self.distanceX > 50 ) {
3449	+ self.instance.previous( self.speedX );
3450	+
3451	+ } else if ( swiping == 'x' && self.distanceX < -50 ) {
3452	+ self.instance.next( self.speedX );
3453	+
3454	+ } else {
3455	+
3456	+ // Move back to center
3457	+ self.instance.update( false, true, 150 );
3458	+
3459	+ }
3460	+
3461	+ };
3462	+
3463	+ Guestures.prototype.endPanning = function() {
3464	+
3465	+ var self = this;
3466	+ var newOffsetX, newOffsetY, newPos;
3467	+
3468	+ if ( !self.contentLastPos ) {
3469	+ return;
3470	+ }
3471	+
3472	+ newOffsetX = self.contentLastPos.left + ( self.velocityX * self.speed * 2 );
3473	+ newOffsetY = self.contentLastPos.top + ( self.velocityY * self.speed * 2 );
3474	+
3475	+ newPos = self.limitPosition( newOffsetX, newOffsetY, self.contentStartPos.width, self.contentStartPos.height );
3476	+
3477	+ newPos.width = self.contentStartPos.width;
3478	+ newPos.height = self.contentStartPos.height;
3479	+
3480	+ $.fancybox.animate( self.$content, null, newPos, self.speed, "easeOutSine" );
3481	+
3482	+ };
3483	+
3484	+
3485	+ Guestures.prototype.endZooming = function() {
3486	+
3487	+ var self = this;
3488	+
3489	+ var current = self.instance.current;
3490	+
3491	+ var newOffsetX, newOffsetY, newPos, reset;
3492	+
3493	+ var newWidth = self.newWidth;
3494	+ var newHeight = self.newHeight;
3495	+
3496	+ if ( !self.contentLastPos ) {
3497	+ return;
3498	+ }
3499	+
3500	+ newOffsetX = self.contentLastPos.left;
3501	+ newOffsetY = self.contentLastPos.top;
3502	+
3503	+ reset = {
3504	+ top : newOffsetY,
3505	+ left : newOffsetX,
3506	+ width : newWidth,
3507	+ height : newHeight,
3508	+ scaleX : 1,
3509	+ scaleY : 1
3510	+ };
3511	+
3512	+ // Reset scalex/scaleY values; this helps for perfomance and does not break animation
3513	+ $.fancybox.setTranslate( self.$content, reset );
3514	+
3515	+ if ( newWidth < self.canvasWidth && newHeight < self.canvasHeight ) {
3516	+ self.instance.scaleToFit( 150 );
3517	+
3518	+ } else if ( newWidth > current.width \|\| newHeight > current.height ) {
3519	+ self.instance.scaleToActual( self.centerPointStartX, self.centerPointStartY, 150 );
3520	+
3521	+ } else {
3522	+
3523	+ newPos = self.limitPosition( newOffsetX, newOffsetY, newWidth, newHeight );
3524	+
3525	+ $.fancybox.animate( self.$content, null, newPos, self.speed, "easeOutSine" );
3526	+
3527	+ }
3528	+
3529	+ };
3530	+
3531	+ Guestures.prototype.ontap = function() {
3532	+
3533	+ var self = this;
3534	+
3535	+ var instance = self.instance;
3536	+ var current = instance.current;
3537	+
3538	+ var x = self.endPoints[0].x;
3539	+ var y = self.endPoints[0].y;
3540	+
3541	+ x = x - self.$wrap.offset().left;
3542	+ y = y - self.$wrap.offset().top;
3543	+
3544	+ // Stop slideshow
3545	+ if ( instance.SlideShow && instance.SlideShow.isActive ) {
3546	+ instance.SlideShow.stop();
3547	+ }
3548	+
3549	+ if ( !$.fancybox.isTouch ) {
3550	+
3551	+ if ( current.opts.closeClickOutside && self.$target.is('.fancybox-slide') ) {
3552	+ instance.close( self.startEvent );
3553	+
3554	+ return;
3555	+ }
3556	+
3557	+ if ( current.type == 'image' && current.isMoved ) {
3558	+
3559	+ if ( instance.canPan() ) {
3560	+ instance.scaleToFit();
3561	+
3562	+ } else if ( instance.isScaledDown() ) {
3563	+ instance.scaleToActual( x, y );
3564	+
3565	+ } else if ( instance.group.length < 2 ) {
3566	+ instance.close( self.startEvent );
3567	+ }
3568	+
3569	+ }
3570	+
3571	+ return;
3572	+ }
3573	+
3574	+
3575	+ // Double tap
3576	+ if ( self.tapped ) {
3577	+
3578	+ clearTimeout( self.tapped );
3579	+
3580	+ self.tapped = null;
3581	+
3582	+ if ( Math.abs( x - self.x ) > 50 \|\| Math.abs( y - self.y ) > 50 \|\| !current.isMoved ) {
3583	+ return this;
3584	+ }
3585	+
3586	+ if ( current.type == 'image' && ( current.isLoaded \|\| current.$ghost ) ) {
3587	+
3588	+ if ( instance.canPan() ) {
3589	+ instance.scaleToFit();
3590	+
3591	+ } else if ( instance.isScaledDown() ) {
3592	+ instance.scaleToActual( x, y );
3593	+
3594	+ }
3595	+
3596	+ }
3597	+
3598	+ } else {
3599	+
3600	+ // Single tap
3601	+
3602	+ self.x = x;
3603	+ self.y = y;
3604	+
3605	+ self.tapped = setTimeout(function() {
3606	+ self.tapped = null;
3607	+
3608	+ instance.toggleControls( true );
3609	+
3610	+ }, 300);
3611	+ }
3612	+
3613	+ return this;
3614	+ };
3615	+
3616	+ $(document).on('onActivate.fb', function (e, instance) {
3617	+
3618	+ if ( instance && !instance.Guestures ) {
3619	+ instance.Guestures = new Guestures( instance );
3620	+ }
3621	+
3622	+ });
3623	+
3624	+ $(document).on('beforeClose.fb', function (e, instance) {
3625	+
3626	+ if ( instance && instance.Guestures ) {
3627	+ instance.Guestures.destroy();
3628	+ }
3629	+
3630	+ });
3631	+
3632	+
3633	+ }(window, document, window.jQuery));
3634	+
3635	+ // ==========================================================================
3636	+ //
3637	+ // SlideShow
3638	+ // Enables slideshow functionality
3639	+ //
3640	+ // Example of usage:
3641	+ // $.fancybox.getInstance().slideShow.start()
3642	+ //
3643	+ // ==========================================================================
3644	+ ;(function (document, $) {
3645	+ 'use strict';
3646	+
3647	+ var SlideShow = function( instance ) {
3648	+
3649	+ this.instance = instance;
3650	+
3651	+ this.init();
3652	+
3653	+ };
3654	+
3655	+ $.extend( SlideShow.prototype, {
3656	+ timer : null,
3657	+ isActive : false,
3658	+ $button : null,
3659	+ speed : 3000,
3660	+
3661	+ init : function() {
3662	+ var self = this;
3663	+
3664	+ self.$button = $('<button data-fancybox-play class="fancybox-button fancybox-button--play" title="Slideshow (P)"></button>')
3665	+ .appendTo( self.instance.$refs.buttons );
3666	+
3667	+ self.instance.$refs.container.on('click', '[data-fancybox-play]', function() {
3668	+ self.toggle();
3669	+ });
3670	+
3671	+ },
3672	+
3673	+ set : function() {
3674	+ var self = this;
3675	+
3676	+ // Check if reached last element
3677	+ if ( self.instance && self.instance.current && (self.instance.current.opts.loop \|\| self.instance.currIndex < self.instance.group.length - 1 )) {
3678	+
3679	+ self.timer = setTimeout(function() {
3680	+ self.instance.next();
3681	+
3682	+ }, self.instance.current.opts.slideShow.speed \|\| self.speed);
3683	+
3684	+ } else {
3685	+ self.stop();
3686	+ }
3687	+ },
3688	+
3689	+ clear : function() {
3690	+ var self = this;
3691	+
3692	+ clearTimeout( self.timer );
3693	+
3694	+ self.timer = null;
3695	+ },
3696	+
3697	+ start : function() {
3698	+ var self = this;
3699	+
3700	+ self.stop();
3701	+
3702	+ if ( self.instance && self.instance.current && ( self.instance.current.opts.loop \|\| self.instance.currIndex < self.instance.group.length - 1 )) {
3703	+
3704	+ self.instance.$refs.container.on({
3705	+ 'beforeLoad.fb.player' : $.proxy(self, "clear"),
3706	+ 'onComplete.fb.player' : $.proxy(self, "set"),
3707	+ });
3708	+
3709	+ self.isActive = true;
3710	+
3711	+ if ( self.instance.current.isComplete ) {
3712	+ self.set();
3713	+ }
3714	+
3715	+ self.instance.$refs.container.trigger('onPlayStart');
3716	+
3717	+ self.$button.addClass('fancybox-button--pause');
3718	+ }
3719	+
3720	+ },
3721	+
3722	+ stop: function() {
3723	+ var self = this;
3724	+
3725	+ self.clear();
3726	+
3727	+ self.instance.$refs.container
3728	+ .trigger('onPlayEnd')
3729	+ .off('.player');
3730	+
3731	+ self.$button.removeClass('fancybox-button--pause');
3732	+
3733	+ self.isActive = false;
3734	+ },
3735	+
3736	+ toggle : function() {
3737	+ var self = this;
3738	+
3739	+ if ( self.isActive ) {
3740	+ self.stop();
3741	+
3742	+ } else {
3743	+ self.start();
3744	+ }
3745	+ }
3746	+
3747	+ });
3748	+
3749	+ $(document).on('onInit.fb', function(e, instance) {
3750	+
3751	+ if ( instance && instance.group.length > 1 && !!instance.opts.slideShow && !instance.SlideShow ) {
3752	+ instance.SlideShow = new SlideShow( instance );
3753	+ }
3754	+
3755	+ });
3756	+
3757	+ $(document).on('beforeClose.fb onDeactivate.fb', function(e, instance) {
3758	+
3759	+ if ( instance && instance.SlideShow ) {
3760	+ instance.SlideShow.stop();
3761	+ }
3762	+
3763	+ });
3764	+
3765	+ }(document, window.jQuery));
3766	+
3767	+ // ==========================================================================
3768	+ //
3769	+ // FullScreen
3770	+ // Adds fullscreen functionality
3771	+ //
3772	+ // ==========================================================================
3773	+ ;(function (document, $) {
3774	+ 'use strict';
3775	+
3776	+ // Collection of methods supported by user browser
3777	+ var fn = (function () {
3778	+
3779	+ var fnMap = [
3780	+ [
3781	+ 'requestFullscreen',
3782	+ 'exitFullscreen',
3783	+ 'fullscreenElement',
3784	+ 'fullscreenEnabled',
3785	+ 'fullscreenchange',
3786	+ 'fullscreenerror'
3787	+ ],
3788	+ // new WebKit
3789	+ [
3790	+ 'webkitRequestFullscreen',
3791	+ 'webkitExitFullscreen',
3792	+ 'webkitFullscreenElement',
3793	+ 'webkitFullscreenEnabled',
3794	+ 'webkitfullscreenchange',
3795	+ 'webkitfullscreenerror'
3796	+
3797	+ ],
3798	+ // old WebKit (Safari 5.1)
3799	+ [
3800	+ 'webkitRequestFullScreen',
3801	+ 'webkitCancelFullScreen',
3802	+ 'webkitCurrentFullScreenElement',
3803	+ 'webkitCancelFullScreen',
3804	+ 'webkitfullscreenchange',
3805	+ 'webkitfullscreenerror'
3806	+
3807	+ ],
3808	+ [
3809	+ 'mozRequestFullScreen',
3810	+ 'mozCancelFullScreen',
3811	+ 'mozFullScreenElement',
3812	+ 'mozFullScreenEnabled',
3813	+ 'mozfullscreenchange',
3814	+ 'mozfullscreenerror'
3815	+ ],
3816	+ [
3817	+ 'msRequestFullscreen',
3818	+ 'msExitFullscreen',
3819	+ 'msFullscreenElement',
3820	+ 'msFullscreenEnabled',
3821	+ 'MSFullscreenChange',
3822	+ 'MSFullscreenError'
3823	+ ]
3824	+ ];
3825	+
3826	+ var val;
3827	+ var ret = {};
3828	+ var i, j;
3829	+
3830	+ for ( i = 0; i < fnMap.length; i++ ) {
3831	+ val = fnMap[ i ];
3832	+
3833	+ if ( val && val[ 1 ] in document ) {
3834	+ for ( j = 0; j < val.length; j++ ) {
3835	+ ret[ fnMap[ 0 ][ j ] ] = val[ j ];
3836	+ }
3837	+
3838	+ return ret;
3839	+ }
3840	+ }
3841	+
3842	+ return false;
3843	+ })();
3844	+
3845	+ if ( !fn ) {
3846	+ return;
3847	+ }
3848	+
3849	+ var FullScreen = {
3850	+ request : function ( elem ) {
3851	+
3852	+ elem = elem \|\| document.documentElement;
3853	+
3854	+ elem[ fn.requestFullscreen ]( elem.ALLOW_KEYBOARD_INPUT );
3855	+
3856	+ },
3857	+ exit : function () {
3858	+ document[ fn.exitFullscreen ]();
3859	+ },
3860	+ toggle : function ( elem ) {
3861	+
3862	+ if ( this.isFullscreen() ) {
3863	+ this.exit();
3864	+ } else {
3865	+ this.request( elem );
3866	+ }
3867	+
3868	+ },
3869	+ isFullscreen : function() {
3870	+ return Boolean( document[ fn.fullscreenElement ] );
3871	+ },
3872	+ enabled : function() {
3873	+ return Boolean( document[ fn.fullscreenEnabled ] );
3874	+ }
3875	+ };
3876	+
3877	+ $(document).on({
3878	+ 'onInit.fb' : function(e, instance) {
3879	+ var $container;
3880	+
3881	+ if ( instance && !!instance.opts.fullScreen && !instance.FullScreen) {
3882	+ $container = instance.$refs.container;
3883	+
3884	+ instance.$refs.button_fs = $('<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fullscreen" title="Full screen (F)"></button>')
3885	+ .appendTo( instance.$refs.buttons );
3886	+
3887	+ $container.on('click.fb-fullscreen', '[data-fancybox-fullscreen]', function(e) {
3888	+
3889	+ e.stopPropagation();
3890	+ e.preventDefault();
3891	+
3892	+ FullScreen.toggle( $container[ 0 ] );
3893	+
3894	+ });
3895	+
3896	+ if ( instance.opts.fullScreen.requestOnStart === true ) {
3897	+ FullScreen.request( $container[ 0 ] );
3898	+ }
3899	+
3900	+ }
3901	+
3902	+ }, 'beforeMove.fb' : function(e, instance) {
3903	+
3904	+ if ( instance && instance.$refs.button_fs ) {
3905	+ instance.$refs.button_fs.toggle( !!instance.current.opts.fullScreen );
3906	+ }
3907	+
3908	+ }, 'beforeClose.fb': function() {
3909	+ FullScreen.exit();
3910	+ }
3911	+ });
3912	+
3913	+ $(document).on(fn.fullscreenchange, function() {
3914	+ var instance = $.fancybox.getInstance();
3915	+ var $what = instance ? instance.current.$placeholder : null;
3916	+
3917	+ if ( $what ) {
3918	+
3919	+ // If image is zooming, then this will force it to stop and reposition properly
3920	+ $what.css( 'transition', 'none' );
3921	+
3922	+ instance.isAnimating = false;
3923	+
3924	+ instance.update( true, true, 0 );
3925	+ }
3926	+
3927	+ });
3928	+
3929	+ }(document, window.jQuery));
3930	+
3931	+ // ==========================================================================
3932	+ //
3933	+ // Thumbs
3934	+ // Displays thumbnails in a grid
3935	+ //
3936	+ // ==========================================================================
3937	+ ;(function (document, $) {
3938	+ 'use strict';
3939	+
3940	+ var FancyThumbs = function( instance ) {
3941	+
3942	+ this.instance = instance;
3943	+
3944	+ this.init();
3945	+
3946	+ };
3947	+
3948	+ $.extend( FancyThumbs.prototype, {
3949	+
3950	+ $button : null,
3951	+ $grid : null,
3952	+ $list : null,
3953	+ isVisible : false,
3954	+
3955	+ init : function() {
3956	+ var self = this;
3957	+
3958	+ self.$button = $('<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="Thumbnails (G)"></button>')
3959	+ .appendTo( this.instance.$refs.buttons )
3960	+ .on('touchend click', function(e) {
3961	+ e.stopPropagation();
3962	+ e.preventDefault();
3963	+
3964	+ self.toggle();
3965	+ });
3966	+
3967	+ },
3968	+
3969	+ create : function() {
3970	+ var instance = this.instance,
3971	+ list,
3972	+ src;
3973	+
3974	+ this.$grid = $('<div class="fancybox-thumbs"></div>').appendTo( instance.$refs.container );
3975	+
3976	+ list = '<ul>';
3977	+
3978	+ $.each(instance.group, function( i, item ) {
3979	+
3980	+ src = item.opts.thumb \|\| ( item.opts.$thumb ? item.opts.$thumb.attr('src') : null );
3981	+
3982	+ if ( !src && item.type === 'image' ) {
3983	+ src = item.src;
3984	+ }
3985	+
3986	+ if ( src && src.length ) {
3987	+ list += '<li data-index="' + i + '" tabindex="0" class="fancybox-thumbs-loading"><img data-src="' + src + '" /></li>';
3988	+ }
3989	+
3990	+ });
3991	+
3992	+ list += '</ul>';
3993	+
3994	+ this.$list = $( list ).appendTo( this.$grid ).on('click touchstart', 'li', function() {
3995	+
3996	+ instance.jumpTo( $(this).data('index') );
3997	+
3998	+ });
3999	+
4000	+ this.$list.find('img').hide().one('load', function() {
4001	+
4002	+ var $parent = $(this).parent().removeClass('fancybox-thumbs-loading'),
4003	+ thumbWidth = $parent.outerWidth(),
4004	+ thumbHeight = $parent.outerHeight(),
4005	+ width,
4006	+ height,
4007	+ widthRatio,
4008	+ heightRatio;
4009	+
4010	+ width = this.naturalWidth \|\| this.width;
4011	+ height = this.naturalHeight \|\| this.height;
4012	+
4013	+ //Calculate thumbnail width/height and center it
4014	+
4015	+ widthRatio = width / thumbWidth;
4016	+ heightRatio = height / thumbHeight;
4017	+
4018	+ if (widthRatio >= 1 && heightRatio >= 1) {
4019	+ if (widthRatio > heightRatio) {
4020	+ width = width / heightRatio;
4021	+ height = thumbHeight;
4022	+
4023	+ } else {
4024	+ width = thumbWidth;
4025	+ height = height / widthRatio;
4026	+ }
4027	+ }
4028	+
4029	+ $(this).css({
4030	+ width : Math.floor(width),
4031	+ height : Math.floor(height),
4032	+ 'margin-top' : Math.min( 0, Math.floor(thumbHeight * 0.3 - height * 0.3 ) ),
4033	+ 'margin-left' : Math.min( 0, Math.floor(thumbWidth * 0.5 - width * 0.5 ) )
4034	+ }).show();
4035	+
4036	+ })
4037	+ .each(function() {
4038	+ this.src = $( this ).data( 'src' );
4039	+ });
4040	+
4041	+ },
4042	+
4043	+ focus : function() {
4044	+
4045	+ if ( this.instance.current ) {
4046	+ this.$list
4047	+ .children()
4048	+ .removeClass('fancybox-thumbs-active')
4049	+ .filter('[data-index="' + this.instance.current.index + '"]')
4050	+ .addClass('fancybox-thumbs-active')
4051	+ .focus();
4052	+ }
4053	+
4054	+ },
4055	+
4056	+ close : function() {
4057	+
4058	+ this.$grid.hide();
4059	+
4060	+ },
4061	+
4062	+ update : function() {
4063	+
4064	+ this.instance.$refs.container.toggleClass('fancybox-container--thumbs', this.isVisible);
4065	+
4066	+ if ( this.isVisible ) {
4067	+
4068	+ if ( !this.$grid ) {
4069	+ this.create();
4070	+ }
4071	+
4072	+ this.$grid.show();
4073	+
4074	+ this.focus();
4075	+
4076	+ } else if ( this.$grid ) {
4077	+ this.$grid.hide();
4078	+ }
4079	+
4080	+ this.instance.update();
4081	+
4082	+ },
4083	+
4084	+ hide : function() {
4085	+
4086	+ this.isVisible = false;
4087	+
4088	+ this.update();
4089	+
4090	+ },
4091	+
4092	+ show : function() {
4093	+
4094	+ this.isVisible = true;
4095	+
4096	+ this.update();
4097	+
4098	+ },
4099	+
4100	+ toggle : function() {
4101	+
4102	+ if ( this.isVisible ) {
4103	+ this.hide();
4104	+
4105	+ } else {
4106	+ this.show();
4107	+ }
4108	+ }
4109	+
4110	+ });
4111	+
4112	+ $(document).on('onInit.fb', function(e, instance) {
4113	+ var first = instance.group[0],
4114	+ second = instance.group[1];
4115	+
4116	+ if ( !!instance.opts.thumbs && !instance.Thumbs && instance.group.length > 1 && (
4117	+ ( first.type == 'image' \|\| first.opts.thumb \|\| first.opts.$thumb ) &&
4118	+ ( second.type == 'image' \|\| second.opts.thumb \|\| second.opts.$thumb )
4119	+ )
4120	+ ) {
4121	+
4122	+ instance.Thumbs = new FancyThumbs( instance );
4123	+ }
4124	+
4125	+ });
4126	+
4127	+ $(document).on('beforeMove.fb', function(e, instance, item) {
4128	+ var self = instance && instance.Thumbs;
4129	+
4130	+ if ( !self ) {
4131	+ return;
4132	+ }
4133	+
4134	+ if ( item.modal ) {
4135	+
4136	+ self.$button.hide();
4137	+
4138	+ self.hide();
4139	+
4140	+ } else {
4141	+
4142	+ if ( instance.opts.thumbs.showOnStart === true && instance.firstRun ) {
4143	+ self.show();
4144	+
4145	+ }
4146	+
4147	+ self.$button.show();
4148	+
4149	+ if ( self.isVisible ) {
4150	+ self.focus();
4151	+ }
4152	+
4153	+ }
4154	+
4155	+ });
4156	+
4157	+ $(document).on('beforeClose.fb', function(e, instance) {
4158	+
4159	+ if ( instance && instance.Thumbs) {
4160	+ if ( instance.Thumbs.isVisible && instance.opts.thumbs.hideOnClosing !== false ) {
4161	+ instance.Thumbs.close();
4162	+ }
4163	+
4164	+ instance.Thumbs = null;
4165	+ }
4166	+
4167	+ });
4168	+
4169	+ }(document, window.jQuery));
4170	+
4171	+ // ==========================================================================
4172	+ //
4173	+ // Hash
4174	+ // Enables linking to each modal
4175	+ //
4176	+ // ==========================================================================
4177	+ ;(function (document, window, $) {
4178	+ 'use strict';
4179	+
4180	+ // Simple $.escapeSelector polyfill (for jQuery prior v3)
4181	+ if ( !$.escapeSelector ) {
4182	+ $.escapeSelector = function( sel ) {
4183	+ var rcssescape = /([\0-\x1f\x7f]\|^-?\d)\|^-$\|[^\x80-\uFFFF\w-]/g;
4184	+ var fcssescape = function( ch, asCodePoint ) {
4185	+ if ( asCodePoint ) {
4186	+ // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
4187	+ if ( ch === "\0" ) {
4188	+ return "\uFFFD";
4189	+ }
4190	+
4191	+ // Control characters and (dependent upon position) numbers get escaped as code points
4192	+ return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " ";
4193	+ }
4194	+
4195	+ // Other potentially-special ASCII characters get backslash-escaped
4196	+ return "\\" + ch;
4197	+ };
4198	+
4199	+ return ( sel + "" ).replace( rcssescape, fcssescape );
4200	+ };
4201	+ }
4202	+
4203	+ // Variable containing last hash value set by fancyBox
4204	+ // It will be used to determine if fancyBox needs to close after hash change is detected
4205	+ var currentHash = null;
4206	+
4207	+ // Get info about gallery name and current index from url
4208	+ function parseUrl() {
4209	+ var hash = window.location.hash.substr( 1 );
4210	+ var rez = hash.split( '-' );
4211	+ var index = rez.length > 1 && /^\+?\d+$/.test( rez[ rez.length - 1 ] ) ? parseInt( rez.pop( -1 ), 10 ) \|\| 1 : 1;
4212	+ var gallery = rez.join( '-' );
4213	+
4214	+ // Index is starting from 1
4215	+ if ( index < 1 ) {
4216	+ index = 1;
4217	+ }
4218	+
4219	+ return {
4220	+ hash : hash,
4221	+ index : index,
4222	+ gallery : gallery
4223	+ };
4224	+ }
4225	+
4226	+ // Trigger click evnt on links to open new fancyBox instance
4227	+ function triggerFromUrl( url ) {
4228	+ var $el;
4229	+
4230	+ if ( url.gallery !== '' ) {
4231	+
4232	+ // If we can find element matching 'data-fancybox' atribute, then trigger click event for that ..
4233	+ $el = $( "[data-fancybox='" + $.escapeSelector( url.gallery ) + "']" ).eq( url.index - 1 );
4234	+
4235	+ if ( $el.length ) {
4236	+ $el.trigger( 'click' );
4237	+
4238	+ } else {
4239	+
4240	+ // .. if not, try finding element by ID
4241	+ $( "#" + $.escapeSelector( url.gallery ) + "" ).trigger( 'click' );
4242	+
4243	+ }
4244	+
4245	+ }
4246	+ }
4247	+
4248	+ // Get gallery name from current instance
4249	+ function getGallery( instance ) {
4250	+ var opts;
4251	+
4252	+ if ( !instance ) {
4253	+ return false;
4254	+ }
4255	+
4256	+ opts = instance.current ? instance.current.opts : instance.opts;
4257	+
4258	+ return opts.$orig ? opts.$orig.data( 'fancybox' ) : ( opts.hash \|\| '' );
4259	+ }
4260	+
4261	+ // Star when DOM becomes ready
4262	+ $(function() {
4263	+
4264	+ // Small delay is used to allow other scripts to process "dom ready" event
4265	+ setTimeout(function() {
4266	+
4267	+ // Check if this module is not disabled
4268	+ if ( $.fancybox.defaults.hash === false ) {
4269	+ return;
4270	+ }
4271	+
4272	+ // Check if need to close after url has changed
4273	+ $(window).on('hashchange.fb', function() {
4274	+ var url = parseUrl();
4275	+
4276	+ if ( $.fancybox.getInstance() ) {
4277	+ if ( currentHash && currentHash !== url.gallery + '-' + url.index ) {
4278	+ currentHash = null;
4279	+
4280	+ $.fancybox.close();
4281	+ }
4282	+
4283	+ } else if ( url.gallery !== '' ) {
4284	+ triggerFromUrl( url );
4285	+ }
4286	+
4287	+ });
4288	+
4289	+ // Update hash when opening/closing fancyBox
4290	+ $(document).on({
4291	+ 'onInit.fb' : function( e, instance ) {
4292	+ var url = parseUrl();
4293	+ var gallery = getGallery( instance );
4294	+
4295	+ // Make sure gallery start index matches index from hash
4296	+ if ( gallery && url.gallery && gallery == url.gallery ) {
4297	+ instance.currIndex = url.index - 1;
4298	+ }
4299	+
4300	+ }, 'beforeMove.fb' : function( e, instance, current ) {
4301	+ var gallery = getGallery( instance );
4302	+
4303	+ // Update window hash
4304	+ if ( gallery && gallery !== '' ) {
4305	+
4306	+ if ( window.location.hash.indexOf( gallery ) < 0 ) {
4307	+ instance.opts.origHash = window.location.hash;
4308	+ }
4309	+
4310	+ currentHash = gallery + ( instance.group.length > 1 ? '-' + ( current.index + 1 ) : '' );
4311	+
4312	+ if ( "pushState" in history ) {
4313	+ history.pushState( '', document.title, window.location.pathname + window.location.search + '#' + currentHash );
4314	+
4315	+ } else {
4316	+ window.location.hash = currentHash;
4317	+ }
4318	+
4319	+ }
4320	+
4321	+ }, 'beforeClose.fb' : function( e, instance, current ) {
4322	+ var gallery = getGallery( instance );
4323	+ var origHash = instance && instance.opts.origHash ? instance.opts.origHash : '';
4324	+
4325	+ // Remove hash from location bar
4326	+ if ( gallery && gallery !== '' ) {
4327	+ if ( "pushState" in history ) {
4328	+ history.pushState( '', document.title, window.location.pathname + window.location.search + origHash );
4329	+
4330	+ } else {
4331	+ window.location.hash = origHash;
4332	+ }
4333	+ }
4334	+
4335	+ currentHash = null;
4336	+ }
4337	+ });
4338	+
4339	+ // Check current hash and trigger click event on matching element to start fancyBox, if needed
4340	+ triggerFromUrl( parseUrl() );
4341	+
4342	+ }, 50);
4343	+ });
4344	+
4345	+
4346	+ }(document, window, window.jQuery));

js/jquery.fancybox.min.js ADDED Viewed

	@@ -0,0 +1,12 @@


1	+ // ==================================================
2	+ // fancyBox v3.0.47
3	+ //
4	+ // Licensed GPLv3 for open source use
5	+ // or fancyBox Commercial License for commercial use
6	+ //
7	+ // http://fancyapps.com/fancybox/
8	+ // Copyright 2017 fancyApps
9	+ //
10	+ // ==================================================
11	+ !function(t,e,n,o){"use strict";function s(t){var e=t.currentTarget,o=t.data?t.data.options:{},s=t.data?t.data.items:[],i="",a=0;t.preventDefault(),t.stopPropagation(),n(e).attr("data-fancybox")&&(i=n(e).data("fancybox")),i?(s=s.length?s.filter('[data-fancybox="'+i+'"]'):n("[data-fancybox="+i+"]"),a=s.index(e)):s=[e],n.fancybox.open(s,o,a)}if(!n)return o;var i={speed:330,loop:!0,opacity:"auto",margin:[44,0],gutter:30,infobar:!0,buttons:!0,slideShow:!0,fullScreen:!0,thumbs:!0,closeBtn:!0,smallBtn:"auto",image:{preload:"auto",protect:!1},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" webkitAllowFullScreen mozallowfullscreen allowFullScreen allowtransparency="true" src=""></iframe>',preload:!0,scrolling:"no",css:{}},baseClass:"",slideClass:"",baseTpl:'<div class="fancybox-container" role="dialog" tabindex="-1"><div class="fancybox-bg"></div><div class="fancybox-controls"><div class="fancybox-infobar"><button data-fancybox-previous class="fancybox-button fancybox-button--left" title="Previous"></button><div class="fancybox-infobar__body"><span class="js-fancybox-index"></span> / <span class="js-fancybox-count"></span></div><button data-fancybox-next class="fancybox-button fancybox-button--right" title="Next"></button></div><div class="fancybox-buttons"><button data-fancybox-close class="fancybox-button fancybox-button--close" title="Close (Esc)"></button></div></div><div class="fancybox-slider-wrap"><div class="fancybox-slider"></div></div><div class="fancybox-caption-wrap"><div class="fancybox-caption"></div></div></div>',spinnerTpl:'<div class="fancybox-loading"></div>',errorTpl:'<div class="fancybox-error"><p>The requested content cannot be loaded. <br /> Please try again later.<p></div>',closeTpl:'<button data-fancybox-close class="fancybox-close-small"></button>',parentEl:"body",touch:!0,keyboard:!0,focus:!0,closeClickOutside:!0,beforeLoad:n.noop,afterLoad:n.noop,beforeMove:n.noop,afterMove:n.noop,onComplete:n.noop,onInit:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop},a=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},u=function(){return t.requestAnimationFrame\|\|t.webkitRequestAnimationFrame\|\|t.mozRequestAnimationFrame\|\|function(e){t.setTimeout(e,1e3/60)}}(),d=function(o){var s;return"function"==typeof n&&o instanceof n&&(o=o[0]),s=o.getBoundingClientRect(),s.bottom>0&&s.right>0&&s.left<(t.innerWidth\|\|e.documentElement.clientWidth)&&s.top<(t.innerHeight\|\|e.documentElement.clientHeight)},p=function(t,o,s){var a=this;a.opts=n.extend(!0,{index:s},i,o\|\|{}),a.id=a.opts.id\|\|++c,a.group=[],a.currIndex=parseInt(a.opts.index,10)\|\|0,a.prevIndex=null,a.prevPos=null,a.currPos=0,a.firstRun=null,a.createGroup(t),a.group.length&&(a.$lastFocus=n(e.activeElement).blur(),a.slides={},a.init(t))};n.extend(p.prototype,{init:function(){var t,e,o=this,s=!1;o.scrollTop=r.scrollTop(),o.scrollLeft=r.scrollLeft(),n.fancybox.getInstance()\|\|(t=n("body").width(),n("html").addClass("fancybox-enabled"),n.fancybox.isTouch?(n.each(o.group,function(t,e){if("image"!==e.type&&"iframe"!==e.type)return s=!0,!1}),s&&n("body").css({position:"fixed",width:t,top:o.scrollTop-1})):(t=n("body").width()-t,t>1&&n('<style id="fancybox-noscroll" type="text/css">').html(".compensate-for-scrollbar, .fancybox-enabled body { margin-right: "+t+"px; }").appendTo("head"))),e=n(o.opts.baseTpl).attr("id","fancybox-container-"+o.id).data("FancyBox",o).addClass(o.opts.baseClass).hide().prependTo(o.opts.parentEl),o.$refs={container:e,bg:e.find(".fancybox-bg"),controls:e.find(".fancybox-controls"),buttons:e.find(".fancybox-buttons"),slider_wrap:e.find(".fancybox-slider-wrap"),slider:e.find(".fancybox-slider"),caption:e.find(".fancybox-caption")},o.trigger("onInit"),o.activate(),o.current\|\|o.jumpTo(o.currIndex)},createGroup:function(t){var e=this,s=n.makeArray(t);n.each(s,function(t,s){var i,a,r,c,l={},u={},d=[];n.isPlainObject(s)?(l=s,u=s.opts\|\|{}):"object"===n.type(s)&&n(s).length?(i=n(s),d=i.data(),u="options"in d?d.options:{},u="object"===n.type(u)?u:{},l.type="type"in d?d.type:u.type,l.src="src"in d?d.src:u.src\|\|i.attr("href"),u.width="width"in d?d.width:u.width,u.height="height"in d?d.height:u.height,u.thumb="thumb"in d?d.thumb:u.thumb,u.selector="selector"in d?d.selector:u.selector,"srcset"in d&&(u.image={srcset:d.srcset}),u.$orig=i):l={type:"html",content:s+""},l.opts=n.extend(!0,{},e.opts,u),a=l.type,r=l.src\|\|"",a\|\|(l.content?a="html":r.match(/(^data:image\/[a-z0-9+\/=],)\|(\.(jp(e\|g\|eg)\|gif\|png\|bmp\|webp\|svg\|ico)((\?\|#).)?$)/i)?a="image":r.match(/\.(pdf)((\?\|#).)?$/i)?a="pdf":"#"===r.charAt(0)&&(a="inline"),l.type=a),l.index=e.group.length,l.opts.$orig&&!l.opts.$orig.length&&delete l.opts.$orig,!l.opts.$thumb&&l.opts.$orig&&(l.opts.$thumb=l.opts.$orig.find("img:first")),l.opts.$thumb&&!l.opts.$thumb.length&&delete l.opts.$thumb,"function"===n.type(l.opts.caption)?l.opts.caption=l.opts.caption.apply(s,[e,l]):"caption"in d?l.opts.caption=d.caption:u.$orig&&(l.opts.caption=i.attr("title")),l.opts.caption=l.opts.caption===o?"":l.opts.caption+"","ajax"===a&&(c=r.split(/\s+/,2),c.length>1&&(l.src=c.shift(),l.opts.selector=c.shift())),"auto"==l.opts.smallBtn&&(n.inArray(a,["html","inline","ajax"])>-1?(l.opts.buttons=!1,l.opts.smallBtn=!0):l.opts.smallBtn=!1),"pdf"===a&&(l.type="iframe",l.opts.closeBtn=!0,l.opts.smallBtn=!1,l.opts.iframe.preload=!1),l.opts.modal&&n.extend(!0,l.opts,{infobar:0,buttons:0,keyboard:0,slideShow:0,fullScreen:0,closeClickOutside:0}),e.group.push(l)})},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),e.close(t)}).on("click.fb-previous","[data-fancybox-previous]",function(t){t.stopPropagation(),t.preventDefault(),e.previous()}).on("click.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),e.next()}),n(t).on("orientationchange.fb resize.fb",function(t){u(function(){t&&t.originalEvent&&"resize"===t.originalEvent.type?e.update():(e.$refs.slider_wrap.hide(),u(function(){e.$refs.slider_wrap.show(),e.update()}))})}),r.on("focusin.fb",function(t){var o=n.fancybox?n.fancybox.getInstance():null;!o\|\|n(t.target).hasClass("fancybox-container")\|\|n.contains(o.$refs.container[0],t.target)\|\|(t.stopPropagation(),o.focus(),a.scrollTop(e.scrollTop).scrollLeft(e.scrollLeft))}),r.on("keydown.fb",function(t){var o=e.current,s=t.keyCode\|\|t.which;if(o&&o.opts.keyboard&&!n(t.target).is("input")&&!n(t.target).is("textarea")){if(8===s\|\|27===s)return t.preventDefault(),void e.close(t);switch(s){case 37:case 38:t.preventDefault(),e.previous();break;case 39:case 40:t.preventDefault(),e.next();break;case 80:case 32:t.preventDefault(),e.SlideShow&&(t.preventDefault(),e.SlideShow.toggle());break;case 70:e.FullScreen&&(t.preventDefault(),e.FullScreen.toggle());break;case 71:e.Thumbs&&(t.preventDefault(),e.Thumbs.toggle())}}})},removeEvents:function(){a.off("scroll.fb resize.fb orientationchange.fb"),r.off("keydown.fb focusin.fb click.fb-close"),this.$refs.container.off("click.fb-close click.fb-previous click.fb-next")},previous:function(t){this.jumpTo(this.currIndex-1,t)},next:function(t){this.jumpTo(this.currIndex+1,t)},jumpTo:function(t,e){var n,s,i,a,r=this;if(n=r.firstRun=null===r.firstRun,s=i=t=parseInt(t,10),a=!!r.current&&r.current.opts.loop,!r.isAnimating&&(s!=r.currIndex\|\|n)){if(r.group.length>1&&a)s%=r.group.length,s=s<0?r.group.length+s:s,2==r.group.length?i=t-r.currIndex+r.currPos:(i=s-r.currIndex+r.currPos,Math.abs(r.currPos-(i+r.group.length))<Math.abs(r.currPos-i)?i+=r.group.length:Math.abs(r.currPos-(i-r.group.length))<Math.abs(r.currPos-i)&&(i-=r.group.length));else if(!r.group[s])return void r.update(!1,!1,e);r.current&&(r.current.$slide.removeClass("fancybox-slide--current fancybox-slide--complete"),r.updateSlide(r.current,!0)),r.prevIndex=r.currIndex,r.prevPos=r.currPos,r.currIndex=s,r.currPos=i,r.current=r.createSlide(i),r.group.length>1&&((r.opts.loop\|\|i-1>=0)&&r.createSlide(i-1),(r.opts.loop\|\|i+1<r.group.length)&&r.createSlide(i+1)),r.current.isMoved=!1,r.current.isComplete=!1,e=parseInt(e===o?1.5r.current.opts.speed:e,10),r.trigger("beforeMove"),r.updateControls(),n&&(r.current.$slide.addClass("fancybox-slide--current"),r.$refs.container.show(),u(function(){r.$refs.bg.css("transition-duration",r.current.opts.speed+"ms"),r.$refs.container.addClass("fancybox-container--ready")})),r.update(!0,!1,n?0:e,function(){r.afterMove()}),r.loadSlide(r.current),n&&r.current.$ghost\|\|r.preload()}},createSlide:function(t){var e,o,s,i=this;if(o=t%i.group.length,o=o<0?i.group.length+o:o,!i.slides[t]&&i.group[o]){if(i.opts.loop&&i.group.length>2)for(var a in i.slides)if(i.slides[a].index===o)return s=i.slides[a],s.pos=t,i.slides[t]=s,delete i.slides[a],i.updateSlide(s),s;e=n('<div class="fancybox-slide"></div>').appendTo(i.$refs.slider),i.slides[t]=n.extend(!0,{},i.group[o],{pos:t,$slide:e,isMoved:!1,isLoaded:!1})}return i.slides[t]},zoomInOut:function(t,e,o){var s,i,a,r=this,c=r.current,l=c.$placeholder,u=c.opts.opacity,p=c.opts.$thumb,h=p?p.offset():0,f=c.$slide.offset();return!!(l&&c.isMoved&&h&&d(p))&&(!("In"===t&&!r.firstRun)&&(n.fancybox.stop(l),r.isAnimating=!0,s={top:h.top-f.top+parseFloat(p.css("border-top-width")\|\|0),left:h.left-f.left+parseFloat(p.css("border-left-width")\|\|0),width:p.width(),height:p.height(),scaleX:1,scaleY:1},"auto"==u&&(u=Math.abs(c.width/c.height-s.width/s.height)>.1),"In"===t?(i=s,a=r.getFitPos(c),a.scaleX=a.width/i.width,a.scaleY=a.height/i.height,u&&(i.opacity=.1,a.opacity=1)):(i=n.fancybox.getTranslate(l),a=s,c.$ghost&&(c.$ghost.show(),c.$image&&c.$image.remove()),i.scaleX=i.width/a.width,i.scaleY=i.height/a.height,i.width=a.width,i.height=a.height,u&&(a.opacity=0)),r.updateCursor(a.width,a.height),delete a.width,delete a.height,n.fancybox.setTranslate(l,i),l.show(),r.trigger("beforeZoom"+t),l.css("transition","all "+e+"ms"),n.fancybox.setTranslate(l,a),setTimeout(function(){var e;l.css("transition","none"),e=n.fancybox.getTranslate(l),e.scaleX=1,e.scaleY=1,n.fancybox.setTranslate(l,e),r.trigger("afterZoom"+t),o.apply(r),r.isAnimating=!1},e),!0))},canPan:function(){var t=this,e=t.current,n=e.$placeholder,o=!1;return n&&(o=t.getFitPos(e),o=Math.abs(n.width()-o.width)>1\|\|Math.abs(n.height()-o.height)>1),o},isScaledDown:function(){var t=this,e=t.current,o=e.$placeholder,s=!1;return o&&(s=n.fancybox.getTranslate(o),s=s.width<e.width\|\|s.height<e.height),s},scaleToActual:function(t,e,s){var i,a,r,c,l,u=this,d=u.current,p=d.$placeholder,h=parseInt(d.$slide.width(),10),f=parseInt(d.$slide.height(),10),g=d.width,b=d.height;p&&(u.isAnimating=!0,t=t===o?.5h:t,e=e===o?.5f:e,i=n.fancybox.getTranslate(p),c=g/i.width,l=b/i.height,a=.5h-.5g,r=.5f-.5b,g>h&&(a=i.leftc-(tc-t),a>0&&(a=0),a<h-g&&(a=h-g)),b>f&&(r=i.topl-(el-e),r>0&&(r=0),r<f-b&&(r=f-b)),u.updateCursor(g,b),n.fancybox.animate(p,null,{top:r,left:a,scaleX:c,scaleY:l},s\|\|d.opts.speed,function(){u.isAnimating=!1}))},scaleToFit:function(t){var e,o=this,s=o.current,i=s.$placeholder;i&&(o.isAnimating=!0,e=o.getFitPos(s),o.updateCursor(e.width,e.height),n.fancybox.animate(i,null,{top:e.top,left:e.left,scaleX:e.width/i.width(),scaleY:e.height/i.height()},t\|\|s.opts.speed,function(){o.isAnimating=!1}))},getFitPos:function(t){var e,o,s,i,r,c,l,u=t.$placeholder\|\|t.$content,d=t.width,p=t.height,h=t.opts.margin;return!(!u\|\|!u.length\|\|!d&&!p)&&("number"===n.type(h)&&(h=[h,h]),2==h.length&&(h=[h[0],h[1],h[0],h[1]]),a.width()<800&&(h=[0,0,0,0]),e=parseInt(t.$slide.width(),10)-(h[1]+h[3]),o=parseInt(t.$slide.height(),10)-(h[0]+h[2]),s=Math.min(1,e/d,o/p),c=Math.floor(sd),l=Math.floor(sp),i=Math.floor(.5(o-l))+h[0],r=Math.floor(.5(e-c))+h[3],{top:i,left:r,width:c,height:l})},update:function(t,e,o,s){var i,a=this;a.isAnimating!==!0&&a.current&&(i=a.current.posMath.floor(a.current.$slide.width())-1-a.current.posa.current.opts.gutter,o=parseInt(o,10)\|\|0,n.fancybox.stop(a.$refs.slider),t===!1?a.updateSlide(a.current,e):n.each(a.slides,function(t,n){a.updateSlide(n,e)}),o?n.fancybox.animate(a.$refs.slider,null,{top:0,left:i},o,function(){a.current.isMoved=!0,"function"===n.type(s)&&s.apply(a)}):(n.fancybox.setTranslate(a.$refs.slider,{top:0,left:i}),a.current.isMoved=!0,"function"===n.type(s)&&s.apply(a)))},updateSlide:function(t,e){var o,s=this,i=t.$placeholder;t=t\|\|s.current,t&&!s.isClosing&&(o=t.posMath.floor(t.$slide.width())+t.post.opts.gutter,o!==t.leftPos&&(n.fancybox.setTranslate(t.$slide,{top:0,left:o}),t.leftPos=o),e!==!1&&i&&(n.fancybox.setTranslate(i,s.getFitPos(t)),t.pos===s.currPos&&s.updateCursor()),t.$slide.trigger("refresh"),s.trigger("onUpdate",t))},updateCursor:function(t,e){var n,s=this,i=s.$refs.container.removeClass("fancybox-controls--canzoomIn fancybox-controls--canzoomOut fancybox-controls--canGrab");!s.isClosing&&s.opts.touch&&(n=t!==o&&e!==o?t<s.current.width&&e<s.current.height:s.isScaledDown(),n?i.addClass("fancybox-controls--canzoomIn"):s.group.length<2?i.addClass("fancybox-controls--canzoomOut"):i.addClass("fancybox-controls--canGrab"))},loadSlide:function(t){var e,o,s,i=this;if(t&&!t.isLoaded&&!t.isLoading){switch(t.isLoading=!0,i.trigger("beforeLoad",t),e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass("fancybox-slide--"+(e\|\|"unknown")).addClass(t.opts.slideClass),e){case"image":i.setImage(t);break;case"iframe":i.setIframe(t);break;case"html":i.setContent(t,t.content);break;case"inline":n(t.src).length?i.setContent(t,n(t.src)):i.setError(t);break;case"ajax":i.showLoading(t),s=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&i.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&i.setError(t)}})),o.one("onReset",function(){s.abort()});break;default:i.setError(t)}return!0}},setImage:function(e){var o,s,i,a,r=this,c=e.opts.image.srcset;if(e.isLoaded&&!e.hasError)return void r.afterLoad(e);if(c){i=t.devicePixelRatio\|\|1,a=t.innerWidthi,s=c.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);return 0===n?e.url=t:void(o&&(e.value=o,e.postfix=t[t.length-1]))}),e}),s.sort(function(t,e){return t.value-e.value});for(var l=0;l<s.length;l++){var u=s[l];if("w"===u.postfix&&u.value>=a\|\|"x"===u.postfix&&u.value>=i){o=u;break}}!o&&s.length&&(o=s[s.length-1]),o&&(e.src=o.url,e.width&&e.height&&"w"==o.postfix&&(e.height=e.width/e.heighto.value,e.width=o.value))}e.$placeholder=n('<div class="fancybox-placeholder"></div>').hide().appendTo(e.$slide),e.opts.preload!==!1&&e.opts.width&&e.opts.height&&(e.opts.thumb\|\|e.opts.$thumb)?(e.width=e.opts.width,e.height=e.opts.height,e.$ghost=n("<img />").one("load error",function(){r.isClosing\|\|(n("<img/>")[0].src=e.src,r.revealImage(e,function(){r.setBigImage(e),r.firstRun&&e.index===r.currIndex&&r.preload()}))}).addClass("fancybox-image").appendTo(e.$placeholder).attr("src",e.opts.thumb\|\|e.opts.$thumb.attr("src"))):r.setBigImage(e)},setBigImage:function(t){var e=this,o=n("<img />");t.$image=o.one("error",function(){e.setError(t)}).one("load",function(){clearTimeout(t.timouts),t.timouts=null,e.isClosing\|\|(t.width=this.naturalWidth,t.height=this.naturalHeight,t.opts.image.srcset&&o.attr("sizes","100vw").attr("srcset",t.opts.image.srcset),e.afterLoad(t),t.$ghost&&(t.timouts=setTimeout(function(){t.$ghost.hide()},350)))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$placeholder),o[0].complete?o.trigger("load"):o[0].error?o.trigger("error"):t.timouts=setTimeout(function(){o[0].complete\|\|t.hasError\|\|e.showLoading(t)},150),t.opts.image.protect&&n('<div class="fancybox-spaceball"></div>').appendTo(t.$placeholder).on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0})},revealImage:function(t,e){var o=this;return e=e\|\|n.noop,"image"!==t.type\|\|t.hasError\|\|t.isRevealed===!0?void e.apply(o):(t.isRevealed=!0,void(t.pos===o.currPos&&o.zoomInOut("In",t.opts.speed,e)\|\|(t.$ghost&&!t.isLoaded&&o.updateSlide(t,!0),t.pos===o.currPos?n.fancybox.animate(t.$placeholder,{opacity:0},{opacity:1},300,e):t.$placeholder.show(),e.apply(o))))},setIframe:function(t){var e,s=this,i=t.opts.iframe,a=t.$slide;t.$content=n('<div class="fancybox-content"></div>').css(i.css).appendTo(a),e=n(i.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr("scrolling",n.fancybox.isTouch?"auto":i.scrolling).appendTo(t.$content),i.preload?(t.$content.addClass("fancybox-tmp"),s.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),s.afterLoad(t)}),a.on("refresh.fb",function(){var n,s,a,r,c,l=t.$content;if(1===e[0].isReady){try{n=e.contents(),s=n.find("body")}catch(t){}s&&s.length&&(i.css.width===o\|\|i.css.height===o)&&(a=e[0].contentWindow.document.documentElement.scrollWidth,r=Math.ceil(s.outerWidth(!0)+(l.width()-a)),c=Math.ceil(s.outerHeight(!0)),l.css({width:i.css.width===o?r+(l.outerWidth()-l.innerWidth()):i.css.width,height:i.css.height===o?c+(l.outerHeight()-l.innerHeight()):i.css.height})),l.removeClass("fancybox-tmp")}})):this.afterLoad(t),e.attr("src",t.src),t.opts.smallBtn&&t.$content.prepend(t.opts.closeTpl),a.one("onReset",function(){try{n(this).find("iframe").hide().attr("src","//about:blank")}catch(t){}n(this).empty(),t.isLoaded=!1})},setContent:function(t,e){var o=this;o.isClosing\|\|(o.hideLoading(t),t.$slide.empty(),l(e)&&e.parent().length?(e.data("placeholder")&&e.parents(".fancybox-slide").trigger("onReset"),e.data({placeholder:n("<div></div>").hide().insertAfter(e)}).css("display","inline-block")):("string"===n.type(e)&&(e=n("<div>").append(e).contents(),3===e[0].nodeType&&(e=n("<div>").html(e))),t.opts.selector&&(e=n("<div>").html(e).find(t.opts.selector))),t.$slide.one("onReset",function(){var o=l(e)?e.data("placeholder"):0;o&&(e.hide().replaceAll(o),e.data("placeholder",null)),t.hasError\|\|(n(this).empty(),t.isLoaded=!1)}),t.$content=n(e).appendTo(t.$slide),t.opts.smallBtn===!0&&t.$content.find(".fancybox-close-small").remove().end().eq(0).append(t.opts.closeTpl),this.afterLoad(t))},setError:function(t){t.hasError=!0,this.setContent(t,t.opts.errorTpl)},showLoading:function(t){var e=this;t=t\|\|e.current,t&&!t.$spinner&&(t.$spinner=n(e.opts.spinnerTpl).appendTo(t.$slide))},hideLoading:function(t){var e=this;t=t\|\|e.current,t&&t.$spinner&&(t.$spinner.remove(),delete t.$spinner)},afterMove:function(){var t=this,e=t.current,o={};e&&(e.$slide.siblings().trigger("onReset"),n.each(t.slides,function(e,n){n.pos>=t.currPos-1&&n.pos<=t.currPos+1?o[n.pos]=n:n&&n.$slide.remove()}),t.slides=o,t.trigger("afterMove"),e.isLoaded&&t.complete())},afterLoad:function(t){var e=this;e.isClosing\|\|(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),t.$ghost\|\|e.updateSlide(t,!0),t.index===e.currIndex&&t.isMoved?e.complete():t.$ghost\|\|e.revealImage(t))},complete:function(){var t=this,e=t.current;t.revealImage(e,function(){e.isComplete=!0,e.$slide.addClass("fancybox-slide--complete"),t.updateCursor(),t.trigger("onComplete"),e.opts.focus&&"image"!==e.type&&"iframe"!==e.type&&t.focus()})},preload:function(){var t,e,n=this;n.group.length<2\|\|(t=n.slides[n.currPos+1],e=n.slides[n.currPos-1],t&&"image"===t.type&&n.loadSlide(t),e&&"image"===e.type&&n.loadSlide(e))},focus:function(){var t,e=this.current;t=e&&e.isComplete?e.$slide.find('button,:input,[tabindex],a:not(".disabled")').filter(":visible:first"):null,t&&t.length\|\|(t=this.$refs.container),t.focus(),this.$refs.slider_wrap.scrollLeft(0),e&&e.$slide.scrollTop(0)},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.uid!==t.uid&&!e.isClosing&&e.trigger("onDeactivate")}),t.current&&(t.$refs.container.index()>0&&t.$refs.container.prependTo(e.body),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t){var e=this,o=e.current,s=o.opts.speed,i=n.proxy(function(){e.cleanUp(t)},this);return!e.isAnimating&&!e.isClosing&&(e.trigger("beforeClose",t)===!1?(n.fancybox.stop(e.$refs.slider),void u(function(){e.update(!0,!0,150)})):(e.isClosing=!0,o.timouts&&clearTimeout(o.timouts),t!==!0&&n.fancybox.stop(e.$refs.slider),e.$refs.container.removeClass("fancybox-container--active").addClass("fancybox-container--closing"),o.$slide.removeClass("fancybox-slide--complete").siblings().remove(),o.isMoved\|\|o.$slide.css("overflow","visible"),e.removeEvents(),e.hideLoading(o),e.hideControls(),e.updateCursor(),e.$refs.bg.css("transition-duration",s+"ms"),this.$refs.container.removeClass("fancybox-container--ready"),void(t===!0?setTimeout(i,s):e.zoomInOut("Out",s,i)\|\|n.fancybox.animate(e.$refs.container,null,{opacity:0},s,"easeInSine",i))))},cleanUp:function(t){var e,o=this;o.$refs.slider.children().trigger("onReset"),o.$refs.container.empty().remove(),o.trigger("afterClose",t),o.current=null,e=n.fancybox.getInstance(),e?e.activate():(n("html").removeClass("fancybox-enabled"),n("body").removeAttr("style"),a.scrollTop(o.scrollTop).scrollLeft(o.scrollLeft),n("#fancybox-noscroll").remove()),o.$lastFocus&&o.$lastFocus.focus()},trigger:function(t,o){var s,i=Array.prototype.slice.call(arguments,1),a=this,r=o&&o.opts?o:a.current;return r?i.unshift(r):r=a,i.unshift(a),n.isFunction(r.opts[t])&&(s=r.opts[t].apply(r,i)),s===!1?s:void("afterClose"===t?n(e).trigger(t+".fb",i):a.$refs.container.trigger(t+".fb",i))},toggleControls:function(t){this.isHiddenControls?this.updateControls(t):this.hideControls()},hideControls:function(){this.isHiddenControls=!0,this.$refs.container.removeClass("fancybox-show-controls"),this.$refs.container.removeClass("fancybox-show-caption")},updateControls:function(t){var e=this,o=e.$refs.container,s=e.$refs.caption,i=e.current,a=i.index,r=i.opts,c=r.caption;this.isHiddenControls&&t!==!0\|\|(this.isHiddenControls=!1,o.addClass("fancybox-show-controls").toggleClass("fancybox-show-infobar",!!r.infobar&&e.group.length>1).toggleClass("fancybox-show-buttons",!!r.buttons).toggleClass("fancybox-is-modal",!!r.modal),n(".fancybox-button--left",o).toggleClass("fancybox-button--disabled",!r.loop&&a<=0),n(".fancybox-button--right",o).toggleClass("fancybox-button--disabled",!r.loop&&a>=e.group.length-1),n(".fancybox-button--play",o).toggle(!!(r.slideShow&&e.group.length>1)),n(".fancybox-button--close",o).toggle(!!r.closeBtn),n(".js-fancybox-count",o).html(e.group.length),n(".js-fancybox-index",o).html(a+1),i.$slide.trigger("refresh"),s&&s.empty(),c&&c.length?(s.html(c),this.$refs.container.addClass("fancybox-show-caption "),e.$caption=s):this.$refs.container.removeClass("fancybox-show-caption"))}}),n.fancybox={version:"3.0.47",defaults:i,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-container--closing"):first').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof p&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new p(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),t===!0&&this.close())},isTouch:e.createTouch!==o&&/Android\|webOS\|iPhone\|iPad\|iPod\|BlackBerry/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<=11)}(),getTranslate:function(t){var e,n;return!(!t\|\|!t.length)&&(e=t.get(0).getBoundingClientRect(),n=t.eq(0).css("transform"),n&&n.indexOf("matrix")!==-1?(n=n.split("(")[1],n=n.split(")")[0],n=n.split(",")):n=[],n.length?(n=n.length>10?[n[13],n[12],n[0],n[5]]:[n[5],n[4],n[0],n[3]],n=n.map(parseFloat)):n=[0,0,1,1],{top:n[0],left:n[1],scaleX:n[2],scaleY:n[3],opacity:parseFloat(t.css("opacity")),width:e.width,height:e.height})},setTranslate:function(t,e){var n="",s={};if(t&&e)return e.left===o&&e.top===o\|\|(n=(e.left===o?t.position().top:e.left)+"px, "+(e.top===o?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),e.scaleX!==o&&e.scaleY!==o&&(n=(n.length?n+" ":"")+"scale("+e.scaleX+", "+e.scaleY+")"),n.length&&(s.transform=n),e.opacity!==o&&(s.opacity=e.opacity),e.width!==o&&(s.width=e.width),e.height!==o&&(s.height=e.height),t.css(s)},easing:{easeOutCubic:function(t,e,n,o){return n((t=t/o-1)tt+1)+e},easeInCubic:function(t,e,n,o){return n(t/=o)tt+e},easeOutSine:function(t,e,n,o){return nMath.sin(t/o(Math.PI/2))+e},easeInSine:function(t,e,n,o){return-nMath.cos(t/o(Math.PI/2))+n+e}},stop:function(t){t.removeData("animateID")},animate:function(t,e,s,i,a,r){var c,l,d,p=this,h=null,f=0,g=function(){s.scaleX!==o&&s.scaleY!==o&&e&&e.width!==o&&e.height!==o&&(s.width=e.widths.scaleX,s.height=e.heights.scaleY,s.scaleX=1,s.scaleY=1),p.setTranslate(t,s),r()},b=function(n){if(c=[],l=0,t.length&&t.data("animateID")===d){if(n=n\|\|Date.now(),h&&(l=n-h),h=n,f+=l,f>=i)return void g();for(var r in s)s.hasOwnProperty(r)&&e[r]!==o&&(e[r]==s[r]?c[r]=s[r]:c[r]=p.easing[a](f,e[r],s[r]-e[r],i));p.setTranslate(t,c),u(b)}};p.animateID=d=p.animateID===o?1:p.animateID+1,t.data("animateID",d),r===o&&"function"==n.type(a)&&(r=a,a=o),a\|\|(a="easeOutCubic"),r=r\|\|n.noop,e?this.setTranslate(t,e):e=this.getTranslate(t),i?(t.show(),u(b)):g()}},n.fn.fancybox=function(t){return this.off("click.fb-start").on("click.fb-start",{items:this,options:t\|\|{}},s),this},n(e).on("click.fb-start","[data-fancybox]",s)}(window,document,window.jQuery),function(t){"use strict";var e=function(e,n,o){if(e)return o=o\|\|"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n\|\|"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e},n={youtube:{matcher:/(youtube\.com\|youtu\.be\|youtube\-nocookie\.com)\/(watch\?(.&)?v=\|v\/\|u\/\|embed\/?)?(videoseries\?list=(.)\|[\w-]{11}\|\?listType=(.)&list=(.))(.)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"//www.youtube.com/embed/$4",thumb:"//img.youtube.com/vi/$4/hqdefault.jpg"},vimeo:{matcher:/^.+vimeo.com\/(.\/)?([\d]+)(.)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1,api:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},metacafe:{matcher:/metacafe.com\/watch\/(\d+)\/(.)?/,type:"iframe",url:"//www.metacafe.com/embed/$1/?ap=1"},dailymotion:{matcher:/dailymotion.com\/video\/(.)\/?(.)/,params:{additionalInfos:0,autoStart:1},type:"iframe",url:"//www.dailymotion.com/embed/video/$1"},vine:{matcher:/vine.co\/v\/([a-zA-Z0-9\?\=\-]+)/,type:"iframe",url:"//vine.co/v/$1/embed/simple"},instagram:{matcher:/(instagr\.am\|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},google_maps:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.)\/)?\@(.),(\d+.?\d+?)z))\|(\?ll=))(.)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12])+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}}};t(document).on("onInit.fb",function(o,s){t.each(s.group,function(o,s){var i,a,r,c,l,u,d=s.src\|\|"",p=!1;s.type\|\|(t.each(n,function(n,o){if(a=d.match(o.matcher),l={},u=n,a){if(p=o.type,o.paramPlace&&a[o.paramPlace]){c=a[o.paramPlace],"?"==c[0]&&(c=c.substring(1)),c=c.split("&");for(var h=0;h<c.length;++h){var f=c[h].split("=",2);2==f.length&&(l[f[0]]=decodeURIComponent(f[1].replace(/\+/g," ")))}}return r=t.extend(!0,{},o.params,s.opts[n],l),d="function"===t.type(o.url)?o.url.call(this,a,r,s):e(o.url,a,r),i="function"===t.type(o.thumb)?o.thumb.call(this,a,r,s):e(o.thumb,a),"vimeo"===u&&(d=d.replace("&%23","#")),!1}}),p?(s.src=d,s.type=p,s.opts.thumb\|\|s.opts.$thumb&&s.opts.$thumb.length\|\|(s.opts.thumb=i),"iframe"===p&&(t.extend(!0,s.opts,{iframe:{preload:!1,scrolling:"no"},smallBtn:!1,closeBtn:!0,fullScreen:!1,slideShow:!1}),s.opts.slideClass+=" fancybox-slide--video")):s.type="iframe")})})}(window.jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame\|\|t.webkitRequestAnimationFrame\|\|t.mozRequestAnimationFrame\|\|function(e){t.setTimeout(e,1e3/60)}}(),s=function(e){var n=[];e=e.originalEvent\|\|e\|\|t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},i=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},a=function(t){return t.is("a")\|\|t.is("button")\|\|t.is("input")\|\|t.is("select")\|\|t.is("textarea")\|\|n.isFunction(t.get(0).onclick)},r=function(e){var n=t.getComputedStyle(e)["overflow-y"],o=t.getComputedStyle(e)["overflow-x"],s=("scroll"===n\|\|"auto"===n)&&e.scrollHeight>e.clientHeight,i=("scroll"===o\|\|"auto"===o)&&e.scrollWidth>e.clientWidth;return s\|\|i},c=function(t){for(var e=!1;;){if(e=r(t.get(0)))break;if(t=t.parent(),!t.length\|\|t.hasClass("fancybox-slider")\|\|t.is("body"))break}return e},l=function(t){var e=this;e.instance=t,e.$wrap=t.$refs.slider_wrap,e.$slider=t.$refs.slider,e.$container=t.$refs.container,e.destroy(),e.$wrap.on("touchstart.fb mousedown.fb",n.proxy(e,"ontouchstart"))};l.prototype.destroy=function(){this.$wrap.off("touchstart.fb mousedown.fb touchmove.fb mousemove.fb touchend.fb touchcancel.fb mouseup.fb mouseleave.fb")},l.prototype.ontouchstart=function(e){var o=this,r=n(e.target),l=o.instance,u=l.current,d=u.$content\|\|u.$placeholder;return o.startPoints=s(e),o.$target=r,o.$content=d,o.canvasWidth=Math.round(u.$slide[0].clientWidth),o.canvasHeight=Math.round(u.$slide[0].clientHeight),o.startEvent=e,e.originalEvent.clientX>o.canvasWidth+u.$slide.offset().left\|\|(a(r)\|\|a(r.parent())\|\|c(r)?void 0:u.opts.touch?void(e.originalEvent&&2==e.originalEvent.button\|\|(e.stopPropagation(),e.preventDefault(),!u\|\|o.instance.isAnimating\|\|o.instance.isClosing\|\|!o.startPoints\|\|o.startPoints.length>1&&!u.isMoved\|\|(o.$wrap.off("touchmove.fb mousemove.fb",n.proxy(o,"ontouchmove")),o.$wrap.off("touchend.fb touchcancel.fb mouseup.fb mouseleave.fb",n.proxy(o,"ontouchend")),o.$wrap.on("touchend.fb touchcancel.fb mouseup.fb mouseleave.fb",n.proxy(o,"ontouchend")),o.$wrap.on("touchmove.fb mousemove.fb",n.proxy(o,"ontouchmove")),o.startTime=(new Date).getTime(),o.distanceX=o.distanceY=o.distance=0,o.canTap=!1,o.isPanning=!1,o.isSwiping=!1,o.isZooming=!1,o.sliderStartPos=n.fancybox.getTranslate(o.$slider),o.contentStartPos=n.fancybox.getTranslate(o.$content),o.contentLastPos=null,1!==o.startPoints.length\|\|o.isZooming\|\|(o.canTap=u.isMoved,"image"===u.type&&(o.contentStartPos.width>o.canvasWidth+1\|\|o.contentStartPos.height>o.canvasHeight+1)?(n.fancybox.stop(o.$content),o.isPanning=!0):(n.fancybox.stop(o.$slider),o.isSwiping=!0),o.$container.addClass("fancybox-controls--isGrabbing")),2===o.startPoints.length&&u.isMoved&&!u.hasError&&"image"===u.type&&(u.isLoaded\|\|u.$ghost)&&(o.isZooming=!0,o.isSwiping=!1,o.isPanning=!1,n.fancybox.stop(o.$content),o.centerPointStartX=.5(o.startPoints[0].x+o.startPoints[1].x)-n(t).scrollLeft(),o.centerPointStartY=.5(o.startPoints[0].y+o.startPoints[1].y)-n(t).scrollTop(),o.percentageOfImageAtPinchPointX=(o.centerPointStartX-o.contentStartPos.left)/o.contentStartPos.width,o.percentageOfImageAtPinchPointY=(o.centerPointStartY-o.contentStartPos.top)/o.contentStartPos.height,o.startDistanceBetweenFingers=i(o.startPoints[0],o.startPoints[1]))))):(o.endPoints=o.startPoints,o.ontap()))},l.prototype.ontouchmove=function(t){var e=this;t.preventDefault(),e.newPoints=s(t),e.newPoints&&e.newPoints.length&&(e.distanceX=i(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=i(e.newPoints[0],e.startPoints[0],"y"),e.distance=i(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe():e.isPanning?e.onPan():e.isZooming&&e.onZoom()))},l.prototype.onSwipe=function(){var e,s=this,i=s.isSwiping,a=s.sliderStartPos.left;i===!0?Math.abs(s.distance)>10&&(s.instance.group.length<2?s.isSwiping="y":!s.instance.current.isMoved\|\|s.instance.opts.touch.vertical===!1\|\|"auto"===s.instance.opts.touch.vertical&&n(t).width()>800?s.isSwiping="x":(e=Math.abs(180Math.atan2(s.distanceY,s.distanceX)/Math.PI),
12	+ s.isSwiping=e>45&&e<135?"y":"x"),s.canTap=!1,s.instance.current.isMoved=!1,s.startPoints=s.newPoints):("x"==i&&(!s.instance.current.opts.loop&&0===s.instance.current.index&&s.distanceX>0?a+=Math.pow(s.distanceX,.8):!s.instance.current.opts.loop&&s.instance.current.index===s.instance.group.length-1&&s.distanceX<0?a-=Math.pow(-s.distanceX,.8):a+=s.distanceX),s.sliderLastPos={top:"x"==i?0:s.sliderStartPos.top+s.distanceY,left:a},o(function(){n.fancybox.setTranslate(s.$slider,s.sliderLastPos)}))},l.prototype.onPan=function(){var t,e,s,i=this;i.canTap=!1,t=i.contentStartPos.width>i.canvasWidth?i.contentStartPos.left+i.distanceX:i.contentStartPos.left,e=i.contentStartPos.top+i.distanceY,s=i.limitMovement(t,e,i.contentStartPos.width,i.contentStartPos.height),s.scaleX=i.contentStartPos.scaleX,s.scaleY=i.contentStartPos.scaleY,i.contentLastPos=s,o(function(){n.fancybox.setTranslate(i.$content,i.contentLastPos)})},l.prototype.limitMovement=function(t,e,n,o){var s,i,a,r,c=this,l=c.canvasWidth,u=c.canvasHeight,d=c.contentStartPos.left,p=c.contentStartPos.top,h=c.distanceX,f=c.distanceY;return s=Math.max(0,.5l-.5n),i=Math.max(0,.5u-.5o),a=Math.min(l-n,.5l-.5n),r=Math.min(u-o,.5u-.5o),n>l&&(h>0&&t>s&&(t=s-1+Math.pow(-s+d+h,.8)\|\|0),h<0&&t<a&&(t=a+1-Math.pow(a-d-h,.8)\|\|0)),o>u&&(f>0&&e>i&&(e=i-1+Math.pow(-i+p+f,.8)\|\|0),f<0&&e<r&&(e=r+1-Math.pow(r-p-f,.8)\|\|0)),{top:e,left:t}},l.prototype.limitPosition=function(t,e,n,o){var s=this,i=s.canvasWidth,a=s.canvasHeight;return n>i?(t=t>0?0:t,t=t<i-n?i-n:t):t=Math.max(0,i/2-n/2),o>a?(e=e>0?0:e,e=e<a-o?a-o:e):e=Math.max(0,a/2-o/2),{top:e,left:t}},l.prototype.onZoom=function(){var e=this,s=e.contentStartPos.width,a=e.contentStartPos.height,r=e.contentStartPos.left,c=e.contentStartPos.top,l=i(e.newPoints[0],e.newPoints[1]),u=l/e.startDistanceBetweenFingers,d=Math.floor(su),p=Math.floor(au),h=(s-d)e.percentageOfImageAtPinchPointX,f=(a-p)e.percentageOfImageAtPinchPointY,g=(e.newPoints[0].x+e.newPoints[1].x)/2-n(t).scrollLeft(),b=(e.newPoints[0].y+e.newPoints[1].y)/2-n(t).scrollTop(),m=g-e.centerPointStartX,y=b-e.centerPointStartY,v=r+(h+m),x=c+(f+y),w={top:x,left:v,scaleX:e.contentStartPos.scaleXu,scaleY:e.contentStartPos.scaleYu};e.canTap=!1,e.newWidth=d,e.newHeight=p,e.contentLastPos=w,o(function(){n.fancybox.setTranslate(e.$content,e.contentLastPos)})},l.prototype.ontouchend=function(t){var e=this,o=e.instance.current,i=Math.max((new Date).getTime()-e.startTime,1),a=e.isSwiping,r=e.isPanning,c=e.isZooming;return e.endPoints=s(t),e.$container.removeClass("fancybox-controls--isGrabbing"),e.$wrap.off("touchmove.fb mousemove.fb",n.proxy(this,"ontouchmove")),e.$wrap.off("touchend.fb touchcancel.fb mouseup.fb mouseleave.fb",n.proxy(this,"ontouchend")),e.isSwiping=!1,e.isPanning=!1,e.isZooming=!1,e.canTap?e.ontap():(e.velocityX=e.distanceX/i.5,e.velocityY=e.distanceY/i.5,e.speed=o.opts.speed\|\|330,e.speedX=Math.max(.75e.speed,Math.min(1.5e.speed,1/Math.abs(e.velocityX)e.speed)),e.speedY=Math.max(.75e.speed,Math.min(1.5e.speed,1/Math.abs(e.velocityY)e.speed)),void(r?e.endPanning():c?e.endZooming():e.endSwiping(a)))},l.prototype.endSwiping=function(t){var e=this;"y"==t&&Math.abs(e.distanceY)>50?(n.fancybox.animate(e.$slider,null,{top:e.sliderStartPos.top+e.distanceY+150e.velocityY,left:e.sliderStartPos.left,opacity:0},e.speedY),e.instance.close(!0)):"x"==t&&e.distanceX>50?e.instance.previous(e.speedX):"x"==t&&e.distanceX<-50?e.instance.next(e.speedX):e.instance.update(!1,!0,150)},l.prototype.endPanning=function(){var t,e,o,s=this;s.contentLastPos&&(t=s.contentLastPos.left+s.velocityXs.speed2,e=s.contentLastPos.top+s.velocityYs.speed2,o=s.limitPosition(t,e,s.contentStartPos.width,s.contentStartPos.height),o.width=s.contentStartPos.width,o.height=s.contentStartPos.height,n.fancybox.animate(s.$content,null,o,s.speed,"easeOutSine"))},l.prototype.endZooming=function(){var t,e,o,s,i=this,a=i.instance.current,r=i.newWidth,c=i.newHeight;i.contentLastPos&&(t=i.contentLastPos.left,e=i.contentLastPos.top,s={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(i.$content,s),r<i.canvasWidth&&c<i.canvasHeight?i.instance.scaleToFit(150):r>a.width\|\|c>a.height?i.instance.scaleToActual(i.centerPointStartX,i.centerPointStartY,150):(o=i.limitPosition(t,e,r,c),n.fancybox.animate(i.$content,null,o,i.speed,"easeOutSine")))},l.prototype.ontap=function(){var t=this,e=t.instance,o=e.current,s=t.endPoints[0].x,i=t.endPoints[0].y;if(s-=t.$wrap.offset().left,i-=t.$wrap.offset().top,e.SlideShow&&e.SlideShow.isActive&&e.SlideShow.stop(),!n.fancybox.isTouch)return o.opts.closeClickOutside&&t.$target.is(".fancybox-slide")?void e.close(t.startEvent):void("image"==o.type&&o.isMoved&&(e.canPan()?e.scaleToFit():e.isScaledDown()?e.scaleToActual(s,i):e.group.length<2&&e.close(t.startEvent)));if(t.tapped){if(clearTimeout(t.tapped),t.tapped=null,Math.abs(s-t.x)>50\|\|Math.abs(i-t.y)>50\|\|!o.isMoved)return this;"image"==o.type&&(o.isLoaded\|\|o.$ghost)&&(e.canPan()?e.scaleToFit():e.isScaledDown()&&e.scaleToActual(s,i))}else t.x=s,t.y=i,t.tapped=setTimeout(function(){t.tapped=null,e.toggleControls(!0)},300);return this},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new l(e))}),n(e).on("beforeClose.fb",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,window.jQuery),function(t,e){"use strict";var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,speed:3e3,init:function(){var t=this;t.$button=e('<button data-fancybox-play class="fancybox-button fancybox-button--play" title="Slideshow (P)"></button>').appendTo(t.instance.$refs.buttons),t.instance.$refs.container.on("click","[data-fancybox-play]",function(){t.toggle()})},set:function(){var t=this;t.instance&&t.instance.current&&(t.instance.current.opts.loop\|\|t.instance.currIndex<t.instance.group.length-1)?t.timer=setTimeout(function(){t.instance.next()},t.instance.current.opts.slideShow.speed\|\|t.speed):t.stop()},clear:function(){var t=this;clearTimeout(t.timer),t.timer=null},start:function(){var t=this;t.stop(),t.instance&&t.instance.current&&(t.instance.current.opts.loop\|\|t.instance.currIndex<t.instance.group.length-1)&&(t.instance.$refs.container.on({"beforeLoad.fb.player":e.proxy(t,"clear"),"onComplete.fb.player":e.proxy(t,"set")}),t.isActive=!0,t.instance.current.isComplete&&t.set(),t.instance.$refs.container.trigger("onPlayStart"),t.$button.addClass("fancybox-button--pause"))},stop:function(){var t=this;t.clear(),t.instance.$refs.container.trigger("onPlayEnd").off(".player"),t.$button.removeClass("fancybox-button--pause"),t.isActive=!1},toggle:function(){var t=this;t.isActive?t.stop():t.start()}}),e(t).on("onInit.fb",function(t,e){e&&e.group.length>1&&e.opts.slideShow&&!e.SlideShow&&(e.SlideShow=new n(e))}),e(t).on("beforeClose.fb onDeactivate.fb",function(t,e){e&&e.SlideShow&&e.SlideShow.stop()})}(document,window.jQuery),function(t,e){"use strict";var n=function(){var e,n,o,s=[["requestFullscreen","exitFullscreen","fullscreenElement","fullscreenEnabled","fullscreenchange","fullscreenerror"],["webkitRequestFullscreen","webkitExitFullscreen","webkitFullscreenElement","webkitFullscreenEnabled","webkitfullscreenchange","webkitfullscreenerror"],["webkitRequestFullScreen","webkitCancelFullScreen","webkitCurrentFullScreenElement","webkitCancelFullScreen","webkitfullscreenchange","webkitfullscreenerror"],["mozRequestFullScreen","mozCancelFullScreen","mozFullScreenElement","mozFullScreenEnabled","mozfullscreenchange","mozfullscreenerror"],["msRequestFullscreen","msExitFullscreen","msFullscreenElement","msFullscreenEnabled","MSFullscreenChange","MSFullscreenError"]],i={};for(n=0;n<s.length;n++)if(e=s[n],e&&e[1]in t){for(o=0;o<e.length;o++)i[s[0][o]]=e[o];return i}return!1}();if(n){var o={request:function(e){e=e\|\|t.documentElement,e[n.requestFullscreen](e.ALLOW_KEYBOARD_INPUT)},exit:function(){t[n.exitFullscreen]()},toggle:function(t){this.isFullscreen()?this.exit():this.request(t)},isFullscreen:function(){return Boolean(t[n.fullscreenElement])},enabled:function(){return Boolean(t[n.fullscreenEnabled])}};e(t).on({"onInit.fb":function(t,n){var s;n&&n.opts.fullScreen&&!n.FullScreen&&(s=n.$refs.container,n.$refs.button_fs=e('<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fullscreen" title="Full screen (F)"></button>').appendTo(n.$refs.buttons),s.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle(s[0])}),n.opts.fullScreen.requestOnStart===!0&&o.request(s[0]))},"beforeMove.fb":function(t,e){e&&e.$refs.button_fs&&e.$refs.button_fs.toggle(!!e.current.opts.fullScreen)},"beforeClose.fb":function(){o.exit()}}),e(t).on(n.fullscreenchange,function(){var t=e.fancybox.getInstance(),n=t?t.current.$placeholder:null;n&&(n.css("transition","none"),t.isAnimating=!1,t.update(!0,!0,0))})}}(document,window.jQuery),function(t,e){"use strict";var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,init:function(){var t=this;t.$button=e('<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="Thumbnails (G)"></button>').appendTo(this.instance.$refs.buttons).on("touchend click",function(e){e.stopPropagation(),e.preventDefault(),t.toggle()})},create:function(){var t,n,o=this.instance;this.$grid=e('<div class="fancybox-thumbs"></div>').appendTo(o.$refs.container),t="<ul>",e.each(o.group,function(e,o){n=o.opts.thumb\|\|(o.opts.$thumb?o.opts.$thumb.attr("src"):null),n\|\|"image"!==o.type\|\|(n=o.src),n&&n.length&&(t+='<li data-index="'+e+'" tabindex="0" class="fancybox-thumbs-loading"><img data-src="'+n+'" /></li>')}),t+="</ul>",this.$list=e(t).appendTo(this.$grid).on("click touchstart","li",function(){o.jumpTo(e(this).data("index"))}),this.$list.find("img").hide().one("load",function(){var t,n,o,s,i=e(this).parent().removeClass("fancybox-thumbs-loading"),a=i.outerWidth(),r=i.outerHeight();t=this.naturalWidth\|\|this.width,n=this.naturalHeight\|\|this.height,o=t/a,s=n/r,o>=1&&s>=1&&(o>s?(t/=s,n=r):(t=a,n/=o)),e(this).css({width:Math.floor(t),height:Math.floor(n),"margin-top":Math.min(0,Math.floor(.3r-.3n)),"margin-left":Math.min(0,Math.floor(.5a-.5*t))}).show()}).each(function(){this.src=e(this).data("src")})},focus:function(){this.instance.current&&this.$list.children().removeClass("fancybox-thumbs-active").filter('[data-index="'+this.instance.current.index+'"]').addClass("fancybox-thumbs-active").focus()},close:function(){this.$grid.hide()},update:function(){this.instance.$refs.container.toggleClass("fancybox-container--thumbs",this.isVisible),this.isVisible?(this.$grid\|\|this.create(),this.$grid.show(),this.focus()):this.$grid&&this.$grid.hide(),this.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible?this.hide():this.show()}}),e(t).on("onInit.fb",function(t,e){var o=e.group[0],s=e.group[1];e.opts.thumbs&&!e.Thumbs&&e.group.length>1&&("image"==o.type\|\|o.opts.thumb\|\|o.opts.$thumb)&&("image"==s.type\|\|s.opts.thumb\|\|s.opts.$thumb)&&(e.Thumbs=new n(e))}),e(t).on("beforeMove.fb",function(t,e,n){var o=e&&e.Thumbs;o&&(n.modal?(o.$button.hide(),o.hide()):(e.opts.thumbs.showOnStart===!0&&e.firstRun&&o.show(),o.$button.show(),o.isVisible&&o.focus()))}),e(t).on("beforeClose.fb",function(t,e){e&&e.Thumbs&&(e.Thumbs.isVisible&&e.opts.thumbs.hideOnClosing!==!1&&e.Thumbs.close(),e.Thumbs=null)})}(document,window.jQuery),function(t,e,n){"use strict";function o(){var t=e.location.hash.substr(1),n=t.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)\|\|1:1,s=n.join("-");return o<1&&(o=1),{hash:t,index:o,gallery:s}}function s(t){var e;""!==t.gallery&&(e=n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1),e.length?e.trigger("click"):n("#"+n.escapeSelector(t.gallery)).trigger("click"))}function i(t){var e;return!!t&&(e=t.current?t.current.opts:t.opts,e.$orig?e.$orig.data("fancybox"):e.hash\|\|"")}n.escapeSelector\|\|(n.escapeSelector=function(t){var e=/([\0-\x1f\x7f]\|^-?\d)\|^-$\|[^\x80-\uFFFF\w-]/g,n=function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t};return(t+"").replace(e,n)});var a=null;n(function(){setTimeout(function(){n.fancybox.defaults.hash!==!1&&(n(e).on("hashchange.fb",function(){var t=o();n.fancybox.getInstance()?a&&a!==t.gallery+"-"+t.index&&(a=null,n.fancybox.close()):""!==t.gallery&&s(t)}),n(t).on({"onInit.fb":function(t,e){var n=o(),s=i(e);s&&n.gallery&&s==n.gallery&&(e.currIndex=n.index-1)},"beforeMove.fb":function(n,o,s){var r=i(o);r&&""!==r&&(e.location.hash.indexOf(r)<0&&(o.opts.origHash=e.location.hash),a=r+(o.group.length>1?"-"+(s.index+1):""),"pushState"in history?history.pushState("",t.title,e.location.pathname+e.location.search+"#"+a):e.location.hash=a)},"beforeClose.fb":function(n,o,s){var r=i(o),c=o&&o.opts.origHash?o.opts.origHash:"";r&&""!==r&&("pushState"in history?history.pushState("",t.title,e.location.pathname+e.location.search+c):e.location.hash=c),a=null}}),s(o()))},50)})}(document,window,window.jQuery);

misc_functions.php CHANGED Viewed

@@ -1,6 +1,8 @@
             <?php
             add_shortcode('video_lightbox_vimeo5', 'wp_vid_lightbox_vimeo5_handler');
             add_shortcode('video_lightbox_youtube', 'wp_vid_lightbox_youtube_handler');
             function wp_vid_lightbox_vimeo5_handler($atts)
+            {
@@ -30,10 +32,36 @@ function wp_vid_lightbox_vimeo5_handler($atts)
+                }
                 else    {
                 	$anchor_replacement = $anchor;
-            -
                }
-            -
                $href_content = 'https://vimeo.com/'.$video_id.'?width='.$width.'&amp;height='.$height;
                 $output = "";
-            -
                $output .= '<a rel="'.WPVL_PRETTYPHOTO_REL.'" href="'.$href_content.'" title="'.$description.'">'.$anchor_replacement.'</a>';
                 return $output;
+            }
@@ -66,11 +94,179 @@ function wp_vid_lightbox_youtube_handler($atts)
                 else{
                 	$anchor_replacement = $anchor;
+                }
-            -
                $href_content = 'https://www.youtube.com/watch?v='.$video_id.'&amp;width='.$width.'&amp;height='.$height;
-            -
                $output = '<a rel="'.WPVL_PRETTYPHOTO_REL.'" href="'.$href_content.'" title="'.$description.'">'.$anchor_replacement.'</a>';
                 return $output;
+            }
             function wp_vid_lightbox_get_auto_thumb($atts)
+            {
                 $video_id = $atts['video_id'];
@@ -163,4 +359,11 @@ function wp_vid_lightbox_enqueue_script()
+                        )
                     );
+                }
+            }


1	<?php
2	add_shortcode('video_lightbox_vimeo5', 'wp_vid_lightbox_vimeo5_handler');
3	add_shortcode('video_lightbox_youtube', 'wp_vid_lightbox_youtube_handler');
4	+ add_shortcode('video_lightbox_fb_vimeo', 'wp_vid_lightbox_fb_vimeo_handler');
5	+ add_shortcode('video_lightbox_fb_youtube', 'wp_vid_lightbox_fb_youtube_handler');
6
7	function wp_vid_lightbox_vimeo5_handler($atts)
8	{

32	}
33	else {
34	$anchor_replacement = $anchor;
35	+ }
36	+ $href_content = 'https://vimeo.com/'.$video_id.'?width='.$width.'&height='.$height;
37	+ $id = uniqid();
38	+ $aspect_ratio = $height/$width;
39	$output = "";
40	+ $output .= '<a id="'.$id.'" rel="'.WPVL_PRETTYPHOTO_REL.'" href="'.$href_content.'" title="'.$description.'">'.$anchor_replacement.'</a>';
41	+ $output .= <<<EOT
42	+ <script>
43	+ /* <![CDATA[ */
44	+ jQuery(document).ready(function($){
45	+ $(function(){
46	+ var width = $(window).innerWidth();
47	+ var setwidth = $width;
48	+ var ratio = $aspect_ratio;
49	+ var height = $height;
50	+ var link = '$href_content';
51	+ if(width < setwidth)
52	+ {
53	+ height = Math.floor(width * $aspect_ratio);
54	+ //console.log("device width "+width+", set width "+$width+", ratio "+$aspect_ratio+", new height "+ height);
55	+ var new_url = wpvl_paramReplace('width', link, width);
56	+ var new_url = wpvl_paramReplace('height', new_url, height);
57	+ $("a#$id").attr('href', new_url);
58	+ //console.log(new_url);
59	+ }
60	+ });
61	+ });
62	+ /* ]]> */
63	+ </script>
64	+ EOT;
65	return $output;
66	}
67

94	else{
95	$anchor_replacement = $anchor;
96	}
97	+ $href_content = 'https://www.youtube.com/watch?v='.$video_id.'&width='.$width.'&height='.$height;
98	+ $id = uniqid();
99	+ $aspect_ratio = $height/$width;
100	+ $output = '<a id="'.$id.'" rel="'.WPVL_PRETTYPHOTO_REL.'" href="'.$href_content.'" title="'.$description.'">'.$anchor_replacement.'</a>';
101	+ $output .= <<<EOT
102	+ <script>
103	+ /* <![CDATA[ */
104	+ jQuery(document).ready(function($){
105	+ $(function(){
106	+ var width = $(window).innerWidth();
107	+ var setwidth = $width;
108	+ var ratio = $aspect_ratio;
109	+ var height = $height;
110	+ var link = '$href_content';
111	+ if(width < setwidth)
112	+ {
113	+ height = Math.floor(width * $aspect_ratio);
114	+ //console.log("device width "+width+", set width "+$width+", ratio "+$aspect_ratio+", new height "+ height);
115	+ var new_url = wpvl_paramReplace('width', link, width);
116	+ var new_url = wpvl_paramReplace('height', new_url, height);
117	+ $("a#$id").attr('href', new_url);
118	+ //console.log(new_url);
119	+ }
120	+ });
121	+ });
122	+ /* ]]> */
123	+ </script>
124	+ EOT;
125	return $output;
126	}
127
128	+ function wp_vid_lightbox_fb_vimeo_handler($atts)
129	+ {
130	+ extract(shortcode_atts(array(
131	+ 'video_id' => '',
132	+ 'width' => '',
133	+ 'height' => '',
134	+ 'caption' => '',
135	+ 'anchor' => '',
136	+ 'alt' => '',
137	+ 'auto_thumb' => '',
138	+ ), $atts));
139	+ $enable_fancyBox = get_option('wpvl_enable_fancyBox');
140	+ if(!isset($enable_fancyBox) \|\| empty($enable_fancyBox)){
141	+ return '<p>'.__('Error! You need to enable the fancyBox library in the settings!', 'wp-video-lightbox').'</p>';
142	+ }
143	+ if(empty($video_id) \|\| empty($width) \|\| empty($height)){
144	+ return '<p>'.__('Error! You must specify a value for the Video ID, Width, Height and Anchor parameters to use this shortcode!', 'wp-video-lightbox').'</p>';
145	+ }
146	+ if(empty($auto_thumb) && empty($anchor)){
147	+ return '<p>'.__('Error! You must specify an anchor parameter if you are not using the auto_thumb option.', 'wp-video-lightbox').'</p>';
148	+ }
149	+
150	+ $atts['vid_type'] = "vimeo";
151	+ if (preg_match("/http/", $anchor)){ // Use the image as the anchor
152	+ $anchor_replacement = '<img src="'.$anchor.'" class="video_lightbox_anchor_image" alt="'.$alt.'" />';
153	+ }
154	+ else if($auto_thumb == "1")
155	+ {
156	+ $anchor_replacement = wp_vid_lightbox_get_auto_thumb($atts);
157	+ }
158	+ else {
159	+ $anchor_replacement = $anchor;
160	+ }
161	+ $args = array();
162	+ $id = uniqid();
163	+ $args['id'] = $id;
164	+ $args['width'] = $width;
165	+ $args['height'] = $height;
166	+ $href_content = 'https://vimeo.com/'.$video_id;
167	+ $output = "";
168	+ $output .= '<a href="'.$href_content.'" data-fancybox="'.$id.'" data-caption="'.$caption.'">'.$anchor_replacement.'</a>';
169	+ $video_popup_code = wp_vid_lightbox_get_video_popup_code($args);
170	+ $output .= $video_popup_code;
171	+ return $output;
172	+ }
173	+
174	+ function wp_vid_lightbox_fb_youtube_handler($atts)
175	+ {
176	+ extract(shortcode_atts(array(
177	+ 'video_id' => '',
178	+ 'width' => '',
179	+ 'height' => '',
180	+ 'caption' => '',
181	+ 'anchor' => '',
182	+ 'alt' => '',
183	+ 'auto_thumb' => '',
184	+ ), $atts));
185	+ $enable_fancyBox = get_option('wpvl_enable_fancyBox');
186	+ if(!isset($enable_fancyBox) \|\| empty($enable_fancyBox)){
187	+ return '<p>'.__('Error! You need to enable the fancyBox library in the settings!', 'wp-video-lightbox').'</p>';
188	+ }
189	+ if(empty($video_id) \|\| empty($width) \|\| empty($height)){
190	+ return '<p>'.__('Error! You must specify a value for the Video ID, Width, Height parameters to use this shortcode!', 'wp-video-lightbox').'</p>';
191	+ }
192	+ if(empty($auto_thumb) && empty($anchor)){
193	+ return '<p>'.__('Error! You must specify an anchor parameter if you are not using the auto_thumb option.', 'wp-video-lightbox').'</p>';
194	+ }
195	+
196	+ $atts['vid_type'] = "youtube";
197	+ if(preg_match("/http/", $anchor)){ // Use the image as the anchor
198	+ $anchor_replacement = '<img src="'.$anchor.'" class="video_lightbox_anchor_image" alt="'.$alt.'" />';
199	+ }
200	+ else if($auto_thumb == "1")
201	+ {
202	+ $anchor_replacement = wp_vid_lightbox_get_auto_thumb($atts);
203	+ }
204	+ else{
205	+ $anchor_replacement = $anchor;
206	+ }
207	+ $args = array();
208	+ $id = uniqid();
209	+ $args['id'] = $id;
210	+ $args['width'] = $width;
211	+ $args['height'] = $height;
212	+ $href_content = 'https://www.youtube.com/watch?v='.$video_id;
213	+ $output = "";
214	+ $output .= '<a href="'.$href_content.'" data-fancybox="'.$id.'" data-caption="'.$caption.'">'.$anchor_replacement.'</a>';
215	+ $video_popup_code = wp_vid_lightbox_get_video_popup_code($args);
216	+ $output .= $video_popup_code;
217	+ return $output;
218	+ }
219	+
220	+ function wp_vid_lightbox_get_video_popup_code($args)
221	+ {
222	+ $width = $args['width'];
223	+ $height = $args['height'];
224	+ $content = '$content';
225	+ $aspect_ratio = $height/$width;
226	+ $output = <<<EOT
227	+ <script>
228	+ /* <![CDATA[ */
229	+ jQuery(document).ready(function($){
230	+ $(function(){
231	+ $('[data-fancybox="{$args['id']}"]').fancybox({
232	+ afterLoad : function( instance, current ) {
233	+ // Remove scrollbars and change background
234	+ current.$content.css({
235	+ width : '$width',
236	+ height : '$height',
237	+ overflow: 'visible',
238	+ background : '#000'
239	+ });
240	+ },
241	+ onUpdate : function( instance, current ) {
242	+ var width = $(window).innerWidth(),
243	+ height = $height,
244	+ setwidth = $width,
245	+ ratio = $aspect_ratio,
246	+ video = current.$content;
247	+
248	+ if ( video && width < setwidth) {
249	+ video.hide();
250	+ height = Math.floor(width * $aspect_ratio);
251	+ //console.log("width: "+width+", height:"+height);
252	+
253	+ video.css({
254	+ width : width,
255	+ height : height
256	+ }).show();
257	+
258	+ }
259	+ }
260	+ })
261	+ });
262	+ });
263	+ /* ]]> */
264	+ </script>
265	+ EOT;
266	+
267	+ return $output;
268	+ }
269	+
270	function wp_vid_lightbox_get_auto_thumb($atts)
271	{
272	$video_id = $atts['video_id'];

359	)
360	);
361	}
362	+ if(get_option('wpvl_enable_fancyBox')=='1')
363	+ {
364	+ wp_register_script('jquery.fancybox', WP_VID_LIGHTBOX_URL.'/js/jquery.fancybox.min.js', array('jquery'), WPVL_FANCYBOX_VERSION);
365	+ wp_enqueue_script('jquery.fancybox');
366	+ wp_register_style('jquery.fancybox', WP_VID_LIGHTBOX_URL.'/css/jquery.fancybox.min.css');
367	+ wp_enqueue_style('jquery.fancybox');
368	+ }
369	}

readme.txt CHANGED Viewed

	@@ -3,8 +3,8 @@ Contributors: Tips and Tricks HQ, Ruhul Amin, wptipsntricks
3	Donate link: https://www.tipsandtricks-hq.com/
4	Tags: wordpress lightbox, wordpress video lightbox, video lightbox, wp video lightbox, wordpress video embed, add video to wordpress, gallery, image, images, lightbox, lightview, overlay, photo, photos, picture, video
5	Requires at least: 3.0
6	- Tested up to: 4.8
7	- Stable tag: 1.8.4
8	License: GPLv2 or later
9
10	Very easy to use WordPress lightbox plugin to display YouTube and Vimeo videos in an elegant lightbox overlay.
	@@ -114,6 +114,9 @@ None
114
115	== Changelog ==
116



117	= 1.8.4 =
118	* Fixed a deprecated constructor warning in the class-prettyphoto.php file.
119


3	Donate link: https://www.tipsandtricks-hq.com/
4	Tags: wordpress lightbox, wordpress video lightbox, video lightbox, wp video lightbox, wordpress video embed, add video to wordpress, gallery, image, images, lightbox, lightview, overlay, photo, photos, picture, video
5	Requires at least: 3.0
6	+ Tested up to: 4.9
7	+ Stable tag: 1.8.5
8	License: GPLv2 or later
9
10	Very easy to use WordPress lightbox plugin to display YouTube and Vimeo videos in an elegant lightbox overlay.

114
115	== Changelog ==
116
117	+ = 1.8.5 =
118	+ * Video Lightbox is now compatible with WordPress 4.9.
119	+
120	= 1.8.4 =
121	* Fixed a deprecated constructor warning in the class-prettyphoto.php file.
122

wp-video-lightbox.css CHANGED Viewed

@@ -14,4 +14,18 @@
             .video_lightbox_auto_anchor_image{
             	width: 200px;
             	height: 150px;
-            -
            }


14	.video_lightbox_auto_anchor_image{
15	width: 200px;
16	height: 150px;
17	+ }
18	+
19	+ /* CSS Tweak for prettyPhoto */
20	+ @media only screen and (max-width: 767px) {
21	+ .pp_pic_holder.pp_default { width: 100%!important; left: 0!important; overflow: hidden; }
22	+ div.pp_default .pp_content_container .pp_left { padding-left: 0!important; }
23	+ div.pp_default .pp_content_container .pp_right { padding-right: 0!important; }
24	+ .pp_content { width: 100%!important; height: auto!important; }
25	+ .pp_fade { width: 100%!important; height: 100%!important; }
26	+ a.pp_expand, a.pp_contract, .pp_hoverContainer, .pp_gallery, .pp_top, .pp_bottom { display: none!important; }
27	+ #pp_full_res img { width: 100%!important; height: auto!important; }
28	+ .pp_details { width: 100%!important; padding-left: 3%; padding-right: 4%; padding-top: 10px; padding-bottom: 10px; background-color: #fff; margin-top: -2px!important; }
29	+ a.pp_close { right: 7%!important; top: 10px!important; }
30	+ }
31	+ /End of CSS Tweak /

wp-video-lightbox.php CHANGED Viewed

	@@ -1,7 +1,7 @@
1	<?php
2	/*
3	Plugin Name: WP Video Lightbox
4	- Version: 1.8.4
5	Plugin URI: https://www.tipsandtricks-hq.com/?p=2700
6	Author: Tips and Tricks HQ, Ruhul Amin
7	Author URI: https://www.tipsandtricks-hq.com/
	@@ -15,7 +15,7 @@ if (!class_exists('WP_Video_Lightbox'))
15	{
16	class WP_Video_Lightbox
17	{
18	- var $version = '1.8.4';
19	var $db_version = '1.0';
20	var $plugin_url;
21	var $plugin_path;
	@@ -28,9 +28,10 @@ if (!class_exists('WP_Video_Lightbox'))
28	$this->loader_operations();
29	//Handle any db install and upgrade task
30
31	- add_action( 'init', array( &$this, 'plugin_init' ), 0 );
32	- add_action( 'wp_enqueue_scripts', array( &$this, 'plugin_scripts' ), 0 );
33	- add_action( '~~wp_footer~~', array( &$this, '~~plugin_footer~~' )~~, 0~~ );

34	}
35
36	function define_constants(){
	@@ -40,6 +41,7 @@ if (!class_exists('WP_Video_Lightbox'))
40	define('WP_VIDEO_LIGHTBOX_DB_VERSION', $this->db_version);
41	define('WPVL_PRETTYPHOTO_REL', 'wp-video-lightbox');
42	define('WPVL_PRETTYPHOTO_VERSION', '3.1.6');

43	}
44
45	function includes() {
	@@ -103,6 +105,35 @@ if (!class_exists('WP_Video_Lightbox'))
103	wp_vid_lightbox_enqueue_script();
104	}
105	}





























106
107	function plugin_footer()
108	{


1	<?php
2	/*
3	Plugin Name: WP Video Lightbox
4	+ Version: 1.8.5
5	Plugin URI: https://www.tipsandtricks-hq.com/?p=2700
6	Author: Tips and Tricks HQ, Ruhul Amin
7	Author URI: https://www.tipsandtricks-hq.com/

15	{
16	class WP_Video_Lightbox
17	{
18	+ var $version = '1.8.5';
19	var $db_version = '1.0';
20	var $plugin_url;
21	var $plugin_path;

28	$this->loader_operations();
29	//Handle any db install and upgrade task
30
31	+ add_action( 'init', array( $this, 'plugin_init' ), 0 );
32	+ add_action( 'wp_enqueue_scripts', array( $this, 'plugin_scripts' ), 0 );
33	+ add_action( 'wp_head', array( $this, 'plugin_header' ));
34	+ add_action( 'wp_footer', array( $this, 'plugin_footer' ), 0 );
35	}
36
37	function define_constants(){

41	define('WP_VIDEO_LIGHTBOX_DB_VERSION', $this->db_version);
42	define('WPVL_PRETTYPHOTO_REL', 'wp-video-lightbox');
43	define('WPVL_PRETTYPHOTO_VERSION', '3.1.6');
44	+ define('WPVL_FANCYBOX_VERSION', '3.0.47');
45	}
46
47	function includes() {

105	wp_vid_lightbox_enqueue_script();
106	}
107	}
108	+
109	+ function plugin_header()
110	+ {
111	+ $custom_function = <<<EOT
112	+ function wpvl_paramReplace(name, string, value) {
113	+ // Find the param with regex
114	+ // Grab the first character in the returned string (should be ? or &)
115	+ // Replace our href string with our new value, passing on the name and delimeter
116	+
117	+ var re = new RegExp("[\\?&]" + name + "=([^&#]*)");
118	+ var matches = re.exec(string);
119	+ var newString;
120	+
121	+ if (matches === null) {
122	+ // if there are no params, append the parameter
123	+ newString = string + '?' + name + '=' + value;
124	+ } else {
125	+ var delimeter = matches[0].charAt(0);
126	+ newString = string.replace(re, delimeter + name + "=" + value);
127	+ }
128	+ return newString;
129	+ }
130	+ EOT;
131	+ echo '<script>
132	+ WP_VIDEO_LIGHTBOX_VERSION="'.WP_VIDEO_LIGHTBOX_VERSION.'";
133	+ WP_VID_LIGHTBOX_URL="'.WP_VID_LIGHTBOX_URL.'";
134	+ '.$custom_function.'
135	+ </script>';
136	+ }
137
138	function plugin_footer()
139	{

wpvl-settings.php CHANGED Viewed

@@ -15,7 +15,8 @@ class Video_Lightbox_Settings_Page
+                {
                     $wpvl_plugin_tabs = array(
                         'wp_video_lightbox' => __('General', 'wp-video-lightbox'),
-            -
                        'wp_video_lightbox&action=prettyPhoto' => __('prettyPhoto', 'wp-video-lightbox')
                     );
                     echo '<div class="wrap"><h1>WP Video Lightbox v'.WP_VIDEO_LIGHTBOX_VERSION.'</h1>';
                     echo '<div id="poststuff"><div id="post-body">';
@@ -47,6 +48,9 @@ class Video_Lightbox_Settings_Page
                            case 'prettyPhoto':
                                $this->prettyPhoto_settings_section();
                                break;
+                        }
+                    }
                     else
@@ -342,6 +346,53 @@ class Video_Lightbox_Settings_Page
                     <?php
+                }
                 function current_tab() {
                         $tab = isset( $_GET['tab'] ) ? $_GET['tab'] : $this->plugin_settings_page_key;


15	{
16	$wpvl_plugin_tabs = array(
17	'wp_video_lightbox' => __('General', 'wp-video-lightbox'),
18	+ 'wp_video_lightbox&action=prettyPhoto' => __('prettyPhoto', 'wp-video-lightbox'),
19	+ //'wp_video_lightbox&action=fancyBox' => __('fancyBox', 'wp-video-lightbox')
20	);
21	echo '<div class="wrap"><h1>WP Video Lightbox v'.WP_VIDEO_LIGHTBOX_VERSION.'</h1>';
22	echo '<div id="poststuff"><div id="post-body">';

48	case 'prettyPhoto':
49	$this->prettyPhoto_settings_section();
50	break;
51	+ case 'fancyBox':
52	+ $this->fancyBox_settings_section();
53	+ break;
54	}
55	}
56	else

346
347	<?php
348	}
349	+
350	+ function fancyBox_settings_section()
351	+ {
352	+ if (isset($_POST['wpvl_fancyBox_update_settings']))
353	+ {
354	+ $nonce = $_REQUEST['_wpnonce'];
355	+ if ( !wp_verify_nonce($nonce, 'wpvl_fancyBox_settings')){
356	+ wp_die('Error! Nonce Security Check Failed! Go back to fancyBox menu and save the settings again.');
357	+ }
358	+
359	+ update_option('wpvl_enable_fancyBox', ($_POST["enable_fancyBox"]=='1')?'1':'');
360	+
361	+ echo '<div id="message" class="updated fade"><p><strong>';
362	+ _e('fancyBox Settings Updated!', 'wp-video-lightbox');
363	+ echo '</strong></p></div>';
364	+ }
365	+
366	+ ?>
367	+
368	+ <div style="background: none repeat scroll 0 0 #FFF6D5;border: 1px solid #D1B655;color: #3F2502;margin: 10px 0;padding: 5px 5px 5px 10px;text-shadow: 1px 1px #FFFFFF;">
369	+ <p><?php _e("For more information, updates, detailed documentation and video tutorial, please visit:", "wp-video-lightbox"); ?><br />
370	+ <a href="https://www.tipsandtricks-hq.com/wordpress-video-lightbox-plugin-display-videos-in-a-fancy-lightbox-overlay-2700" target="_blank"><?php _e("WP Video Lightbox Homepage", "wp-video-lightbox"); ?></a></p>
371	+ </div>
372	+
373	+ <form method="post" action="<?php echo $_SERVER["REQUEST_URI"]; ?>">
374	+ <?php wp_nonce_field('wpvl_fancyBox_settings'); ?>
375	+
376	+ <table class="form-table">
377	+
378	+ <tbody>
379	+
380	+ <tr valign="top">
381	+ <th scope="row"><?php _e('Enable fancyBox', 'wp-video-lightbox')?></th>
382	+ <td> <fieldset><legend class="screen-reader-text"><span><?php _e('Enable fancyBox', 'wp-video-lightbox')?></span></legend><label for="enable_fancyBox">
383	+ <input name="enable_fancyBox" type="checkbox" id="enable_fancyBox" <?php if(get_option('wpvl_enable_fancyBox')=='1') echo ' checked="checked"';?> value="1">
384	+ <?php _e('Check this option if you want to enable fancyBox library', 'wp-video-lightbox')?></label>
385	+ </fieldset></td>
386	+ </tr>
387	+
388	+ </tbody>
389	+
390	+ </table>
391	+
392	+ <p class="submit"><input type="submit" name="wpvl_fancyBox_update_settings" id="wpvl_fancyBox_update_settings" class="button button-primary" value="<?php _e('Save Changes', 'wp-video-lightbox')?>"></p></form>
393	+
394	+ <?php
395	+ }
396
397	function current_tab() {
398	$tab = isset( $_GET['tab'] ) ? $_GET['tab'] : $this->plugin_settings_page_key;