Version Description
- incremental database backup
- incremental file system scan
- backup size limit and option to split it into additional archives, default 2GB
- exclude files larger than a certain size option
- incremental files restore
- JQuery Start interface
Download this release
Release Info
| Developer | xcloner |
| Plugin |  XCloner – Backup and Restore |
| Version | 3.0 |
| Comparing to | |
| See all releases | |
Code changes from version 2.2.1 to 3.0
- admin.cloner.html.php +1526 -1072
- admin.cloner.php +213 -197
- admin.xcloner-backupandrestore.php +5 -0
- browser/files_inpage.php +10 -3
- browser/files_xml.php +20 -13
- browser/xmlhttp.js +5 -5
- classes/S3.php +4 -1
- administrator/backups/.excl → classes/error.class.php +0 -0
- classes/fileRecursion.php +57 -8
- classes/index.html +0 -0
- classes/main.class.php +116 -0
- classes/mysqlBackup.class.php +488 -0
- cloner.config.php +3 -0
- cloner.cron.php +93 -76
- cloner.functions.php +285 -126
- common.php +40 -15
- configs/test.php +53 -0
- css/main.css +90 -6
- css/start/images/ui-bg_flat_55_999999_40x100.png +0 -0
- css/start/images/ui-bg_flat_75_aaaaaa_40x100.png +0 -0
- css/start/images/ui-bg_glass_45_0078ae_1x400.png +0 -0
- css/start/images/ui-bg_glass_55_f8da4e_1x400.png +0 -0
- css/start/images/ui-bg_glass_75_79c9ec_1x400.png +0 -0
- css/start/images/ui-bg_gloss-wave_45_e14f1c_500x100.png +0 -0
- css/start/images/ui-bg_gloss-wave_50_6eac2c_500x100.png +0 -0
- css/start/images/ui-bg_gloss-wave_75_2191c0_500x100.png +0 -0
- css/start/images/ui-bg_inset-hard_100_fcfdfd_1x100.png +0 -0
- css/start/images/ui-icons_0078ae_256x240.png +0 -0
- css/start/images/ui-icons_056b93_256x240.png +0 -0
- css/start/images/ui-icons_d8e7f3_256x240.png +0 -0
- css/start/images/ui-icons_e0fdff_256x240.png +0 -0
- css/start/images/ui-icons_f5e175_256x240.png +0 -0
- css/start/images/ui-icons_f7a50d_256x240.png +0 -0
- css/start/images/ui-icons_fcd113_256x240.png +0 -0
- css/{jquery-ui.css → start/jquery-ui-1.8.9.custom.css} +319 -316
- css/tabber.css +0 -109
- images/logo.gif +0 -0
- images/logo.png +0 -0
- images/progressBarLong.gif +0 -0
- install.xcloner.php +4 -12
- javascript/backup.js +172 -0
- javascript/jquery-ui-1.8.9.custom.min.js +781 -0
- javascript/jquery-ui.min.js +0 -404
- javascript/main.js +37 -0
- javascript/tabber.js +0 -512
- language/deutsch.php +0 -0
- language/dutch.php +0 -0
- language/english.php +46 -33
- language/index.html +0 -0
- language/spanish.php +0 -0
- license.txt +340 -2
- readme.txt +30 -31
- recursive.php +0 -118
- restore/TAR.php +274 -11
- restore/XCloner.php +1362 -2222
- screenshot-1.png +0 -0
- screenshot-2.png +0 -0
- screenshot-3.png +0 -0
- screenshot-4.png +0 -0
- screenshot-5.png +0 -0
- screenshot-6.png +0 -0
- screenshot-7.png +0 -0
- screenshot-8.png +0 -0
- toolbar.cloner.html.php +33 -11
- toolbar.cloner.php +8 -7
- xcloner.php +1 -1
- xcloner_j1.5.xml +115 -92
admin.cloner.html.php
CHANGED
|
@@ -31,20 +31,20 @@ class mosTabs{
|
|
| 31 |
|
| 32 |
function mosTabs($int){
|
| 33 |
|
| 34 |
-
echo "<div
|
| 35 |
|
| 36 |
}
|
| 37 |
|
| 38 |
function startTab($name, $class){
|
| 39 |
|
| 40 |
-
echo "<div
|
| 41 |
|
| 42 |
|
| 43 |
}
|
| 44 |
|
| 45 |
function endTab(){
|
| 46 |
|
| 47 |
-
echo "</div>";
|
| 48 |
|
| 49 |
}
|
| 50 |
|
|
@@ -63,8 +63,16 @@ class HTML_cloner {
|
|
| 63 |
|
| 64 |
function header(){
|
| 65 |
|
| 66 |
-
|
|
|
|
| 67 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 68 |
?>
|
| 69 |
<html lang="en">
|
| 70 |
<head>
|
|
@@ -72,16 +80,14 @@ function header(){
|
|
| 72 |
<title>XCloner Backup and Restore</title>
|
| 73 |
<META NAME="ROBOTS" CONTENT="NOINDEX, NOFOLLOW">
|
| 74 |
|
| 75 |
-
<link rel="stylesheet" href="css/tabber.css" TYPE="text/css" MEDIA="screen">
|
| 76 |
<link rel="styleSheet" href="css/dtree.css" type="text/css" />
|
| 77 |
<link rel="styleSheet" href="css/main.css" type="text/css" />
|
| 78 |
-
<link rel="styleSheet" href="css/jquery-ui.css" type="text/css" />
|
| 79 |
|
| 80 |
-
<script type="text/javascript" src="javascript/tabber.js"></script>
|
| 81 |
<script type="text/javascript" src="javascript/dtree.js"></script>
|
| 82 |
<script type="text/javascript" src="javascript/main.js"></script>
|
| 83 |
<script type="text/javascript" src="javascript/jquery-1.4.4.min.js"></script>
|
| 84 |
-
<script type="text/javascript" src="javascript/jquery-ui.min.js"></script>
|
| 85 |
<script type="text/javascript">
|
| 86 |
|
| 87 |
/* Optional: Temporarily hide the "tabber" class so it does not "flash"
|
|
@@ -101,23 +107,31 @@ document.write('<style type="text/css">.tabber{display:none;}<\/style>');
|
|
| 101 |
|
| 102 |
<tr><td align='center'>
|
| 103 |
|
| 104 |
-
<
|
|
|
|
| 105 |
<tr>
|
| 106 |
-
<td width='
|
| 107 |
-
<table><tr><td>
|
| 108 |
-
<img src="images/backup.png" align="middle">
|
| 109 |
-
</td><td>
|
| 110 |
-
<h2><?php echo LM_COM_TITLE.$_SERVER['HTTP_HOST']; ?></h2>
|
| 111 |
-
<h1>Backup and Restore</h1>
|
| 112 |
-
</
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 119 |
</tr>
|
| 120 |
</table>
|
|
|
|
|
|
|
| 121 |
<br />
|
| 122 |
<table width="100%" cellspacing='3' cellpadding="4" >
|
| 123 |
<tr><td valign='top' width="160" >
|
|
@@ -192,7 +206,7 @@ document.write(d);
|
|
| 192 |
<?php
|
| 193 |
if($_REQUEST['mosmsg']!="")
|
| 194 |
|
| 195 |
-
echo "<center><h2>"
|
| 196 |
|
| 197 |
}
|
| 198 |
|
|
@@ -202,9 +216,11 @@ function footer(){
|
|
| 202 |
</td></tr></table>
|
| 203 |
<hr><br /><br />
|
| 204 |
<center>
|
| 205 |
-
<p>Powered by <a href='http://www.xcloner.com' target='_blank'>XCloner</a>.
|
| 206 |
|
| 207 |
</td></tr></table>
|
|
|
|
|
|
|
| 208 |
|
| 209 |
<?php
|
| 210 |
|
|
@@ -218,8 +234,9 @@ function goRefreshHtml($filename, $perm_lines, $excl_manual){
|
|
| 218 |
$backupFile = $f['basename'];
|
| 219 |
|
| 220 |
if (file_exists($filename)) {
|
| 221 |
-
echo "
|
| 222 |
-
|
|
|
|
| 223 |
$urlReturn = "index2.php?option=com_cloner&lines=" . $perm_lines . "&task=refresh&backup=$backupFile&excl_manual=$excl_manual";
|
| 224 |
|
| 225 |
if(!$_CONFIG['refresh_mode']){
|
|
@@ -230,6 +247,8 @@ function goRefreshHtml($filename, $perm_lines, $excl_manual){
|
|
| 230 |
|
| 231 |
}else{
|
| 232 |
|
|
|
|
|
|
|
| 233 |
?>
|
| 234 |
<!--Start ProgressBar-->
|
| 235 |
<script type="text/javascript">
|
|
@@ -238,6 +257,13 @@ function goRefreshHtml($filename, $perm_lines, $excl_manual){
|
|
| 238 |
|
| 239 |
var globalUrl;
|
| 240 |
var step = "r1";
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 241 |
|
| 242 |
$("#progressbar").progressbar({ value: 0 });
|
| 243 |
|
|
@@ -246,12 +272,22 @@ function goRefreshHtml($filename, $perm_lines, $excl_manual){
|
|
| 246 |
//reset state here;
|
| 247 |
$("#error").show();
|
| 248 |
$("#errorText").append(status+" -- "+error);
|
|
|
|
| 249 |
}});
|
| 250 |
|
| 251 |
-
function
|
| 252 |
|
| 253 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 254 |
|
|
|
|
|
|
|
| 255 |
globalUrl = url;
|
| 256 |
step = "r1";
|
| 257 |
|
|
@@ -262,6 +298,56 @@ function goRefreshHtml($filename, $perm_lines, $excl_manual){
|
|
| 262 |
$("#errorText").text(url);
|
| 263 |
}
|
| 264 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 265 |
if(!parseInt(json.finished)){
|
| 266 |
|
| 267 |
$("#recurseStatus").text(json.tfiles);
|
|
@@ -272,8 +358,18 @@ function goRefreshHtml($filename, $perm_lines, $excl_manual){
|
|
| 272 |
}
|
| 273 |
else{
|
| 274 |
var size = parseFloat(json.size)/(1024*1024);
|
| 275 |
-
$("#recurseStatus").text(" done! (Estimated size:"+size.toFixed(2)+"MB)");
|
| 276 |
$("#result").show();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 277 |
//xclonerGetJSON("<?php echo $urlReturn;?>");
|
| 278 |
returnUrl = "index2.php?option=com_cloner&lines="+json.tfiles+"&task=refresh&backup=<?php echo $backupFile; ?>&excl_manual=";
|
| 279 |
xclonerGetJSON(returnUrl);
|
|
@@ -285,9 +381,9 @@ function goRefreshHtml($filename, $perm_lines, $excl_manual){
|
|
| 285 |
}
|
| 286 |
|
| 287 |
function xclonerGetJSON(url){
|
| 288 |
-
|
| 289 |
globalUrl = url;
|
| 290 |
-
step = "
|
| 291 |
|
| 292 |
$.getJSON(url, function(json) {
|
| 293 |
|
|
@@ -298,62 +394,145 @@ function goRefreshHtml($filename, $perm_lines, $excl_manual){
|
|
| 298 |
|
| 299 |
var percent = parseInt(json.percent);
|
| 300 |
$("#progressbar").progressbar({ value: percent });
|
| 301 |
-
$("#backupSize").text(json.backupSize);
|
| 302 |
$("#nFiles").text(json.startf);
|
| 303 |
$("#percent").text(json.percent);
|
|
|
|
| 304 |
if(!json.finished){
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 305 |
var url = "index2.php?option="+json.option+"&task="+json.task+"&json="+json.json+"&startf="+json.startf+"&lines="+json.lines+"&backup="+json.backup+"&excl_manual="+json.excl_manual;
|
| 306 |
xclonerGetJSON(url);
|
| 307 |
}else{
|
| 308 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 309 |
$("#complete").show();
|
| 310 |
$("#nFiles").text(json.lines);
|
| 311 |
-
|
|
|
|
|
|
|
| 312 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 313 |
|
| 314 |
});
|
| 315 |
|
| 316 |
}
|
| 317 |
|
|
|
|
|
|
|
| 318 |
$("#retry").click(function(){
|
| 319 |
$("#error").hide();
|
| 320 |
$("#errorText").empty();
|
| 321 |
if(step == "r1"){
|
|
|
|
|
|
|
|
|
|
|
|
|
| 322 |
xclonerRecurseJSON(globalUrl);
|
| 323 |
}
|
| 324 |
-
else if(step == "
|
| 325 |
xclonerGetJSON(globalUrl);
|
| 326 |
}
|
| 327 |
});
|
| 328 |
|
| 329 |
-
|
| 330 |
-
|
| 331 |
-
//xclonerGetJSON("<?php echo $urlReturn;?>");
|
| 332 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 333 |
|
| 334 |
});
|
| 335 |
</script>
|
| 336 |
|
| 337 |
-
|
| 338 |
-
<br /><strong>Scanning files system...</strong> <span id="recurseStatus"></span>
|
| 339 |
-
</div>
|
| 340 |
-
|
| 341 |
-
<div id="result">
|
| 342 |
-
<br /> <strong>Processing Files:</strong> <span id="percent">0</span>% (<span id="nFiles"></span> files)
|
| 343 |
-
<br /><br /> <strong>Backup Size: </strong><span id="backupSize"></span>
|
| 344 |
-
<br /><br /> <div id="progressbar"></div>
|
| 345 |
-
</div>
|
| 346 |
|
| 347 |
-
|
| 348 |
-
|
|
|
|
| 349 |
|
| 350 |
-
|
| 351 |
-
<
|
| 352 |
-
<
|
| 353 |
-
|
| 354 |
-
<input type="hidden" name="task" value=""/>
|
| 355 |
-
</form>
|
| 356 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 357 |
</div>
|
| 358 |
|
| 359 |
<div id="error" style="display:none;">
|
|
@@ -489,6 +668,7 @@ $error = 0;
|
|
| 489 |
echo " ($_CONFIG[backup_start_path])";
|
| 490 |
?>
|
| 491 |
</span></div>
|
|
|
|
| 492 |
<div class="status">
|
| 493 |
<span class="mtext">Backup Store Path Check: </span>
|
| 494 |
<?php
|
|
@@ -503,7 +683,9 @@ $error = 0;
|
|
| 503 |
}
|
| 504 |
echo " ($_CONFIG[backup_store_path])";
|
| 505 |
?>
|
| 506 |
-
</span
|
|
|
|
|
|
|
| 507 |
<div class="status">
|
| 508 |
<span class="mtext">Temporary Path Check: </span>
|
| 509 |
<?php
|
|
@@ -520,6 +702,20 @@ $error = 0;
|
|
| 520 |
?>
|
| 521 |
</span></div>
|
| 522 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 523 |
<div class="status">
|
| 524 |
<span class="mtext">Backup Ready: </span>
|
| 525 |
<?php
|
|
@@ -544,30 +740,57 @@ $error = 0;
|
|
| 544 |
<?php
|
| 545 |
}
|
| 546 |
|
| 547 |
-
/*The basic
|
| 548 |
function Login(){
|
| 549 |
|
| 550 |
?>
|
| 551 |
<center><br />
|
| 552 |
-
<form action="index2.php" method="post" name="adminForm">
|
| 553 |
-
<table border='1' ><tr><td align='center'>
|
| 554 |
-
<table align='center' cellpadding='10' cellspacing='20'>
|
| 555 |
-
<tr ><td colspan='2' align='center'><b>Authentification Area:</b></td></tr>
|
| 556 |
-
<tr><td>Username:</td><td><input type='text' size='30' name='username'></td></tr>
|
| 557 |
-
<tr><td>Password:</td><td><input type='password' size='30' name='password'></td></tr>
|
| 558 |
-
<tr><td></td><td><input type="submit" value='Login' name="login"> <input type="reset" value='Cancel'></td></tr>
|
| 559 |
|
| 560 |
-
<
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 561 |
|
| 562 |
-
|
| 563 |
-
|
|
|
|
| 564 |
|
| 565 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 566 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 567 |
</table>
|
| 568 |
|
| 569 |
<input type="hidden" name="option" value="com_cloner" />
|
| 570 |
-
|
| 571 |
<input type="hidden" name="boxchecked" value="0" />
|
| 572 |
<input type="hidden" name="hidemainmenu" value="0" />
|
| 573 |
|
|
@@ -580,36 +803,45 @@ function Login(){
|
|
| 580 |
function Cron(){
|
| 581 |
global $_CONFIG;
|
| 582 |
?>
|
| 583 |
-
<table class='adminform'>
|
| 584 |
-
<tr><th>
|
| 585 |
-
<?php echo LM_CRON_TOP?>
|
| 586 |
-
</th></tr>
|
| 587 |
-
<tr><td>
|
| 588 |
-
<pre>
|
| 589 |
-
<?php echo LM_CRON_SUB?>
|
| 590 |
-
<br /><b>For Joomla:</b>
|
| 591 |
-
<span style='background: #eeeeee'>
|
| 592 |
-
/usr/bin/php <?php echo dirname(__FILE__);?>/cloner.cron.php
|
| 593 |
-
<br />
|
| 594 |
-
or
|
| 595 |
-
<br />
|
| 596 |
-
links http://link_to_xcloner_dir/cloner.cron.php
|
| 597 |
-
<br />
|
| 598 |
-
or
|
| 599 |
-
<br />
|
| 600 |
-
lynx -source http://link_to_xcloner_dir/cloner.cron.php
|
| 601 |
-
</span>
|
| 602 |
|
| 603 |
-
|
| 604 |
-
|
|
|
|
|
|
|
|
|
|
| 605 |
|
| 606 |
-
|
| 607 |
-
|
|
|
|
|
|
|
| 608 |
|
| 609 |
-
|
| 610 |
-
|
| 611 |
-
|
| 612 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 613 |
|
| 614 |
<?php
|
| 615 |
}
|
|
@@ -743,29 +975,37 @@ function Translator($option, $lang_arr){
|
|
| 743 |
global $_CONFIG;
|
| 744 |
|
| 745 |
?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 746 |
|
| 747 |
-
|
|
|
|
| 748 |
<table class="adminlist">
|
| 749 |
<tr>
|
| 750 |
-
<th
|
| 751 |
-
<
|
| 752 |
-
<input type="checkbox" name="toggle" value="" onClick="checkAll(<?php echo count( $lang_arr ); ?>);" />
|
| 753 |
</th>
|
| 754 |
<th align="left">
|
| 755 |
<?php echo LM_LANG_NAME ?>
|
| 756 |
</th>
|
| 757 |
</tr>
|
| 758 |
-
<?php
|
| 759 |
|
|
|
|
| 760 |
for($i=0; $i<sizeof($lang_arr); $i++){
|
| 761 |
|
| 762 |
?>
|
| 763 |
|
| 764 |
<tr>
|
| 765 |
-
|
| 766 |
-
<td
|
| 767 |
-
<
|
| 768 |
-
|
|
|
|
| 769 |
</td>
|
| 770 |
<td align="left" >
|
| 771 |
<a href="index2.php?option=<?php echo $option;?>&task=edit_lang&langx=<?php echo $lang_arr[$i];?>"><?php echo ucfirst($lang_arr[$i])?>
|
|
@@ -775,7 +1015,7 @@ function Translator($option, $lang_arr){
|
|
| 775 |
|
| 776 |
}
|
| 777 |
?>
|
| 778 |
-
|
| 779 |
<input type="hidden" name="option" value="com_cloner" />
|
| 780 |
<input type="hidden" name="task" value="lang" />
|
| 781 |
<input type="hidden" name="boxchecked" value="0" />
|
|
@@ -791,23 +1031,31 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 791 |
global $baDownloadPath, $_CONFIG;
|
| 792 |
|
| 793 |
?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 794 |
<form action="index2.php" method="post" name="adminForm">
|
| 795 |
<table class="adminlist">
|
| 796 |
<tr>
|
| 797 |
-
<th width="
|
| 798 |
-
<
|
| 799 |
-
<input type="checkbox" name="toggle" value="" onClick="checkAll(<?php echo count( $files ); ?>);" />
|
| 800 |
-
</th>
|
| 801 |
-
<th width="33%" class="title">
|
| 802 |
-
<?php echo LM_COL_FILENAME ?>
|
| 803 |
</th>
|
| 804 |
-
<th align="left" width="
|
| 805 |
<?php echo LM_COL_DOWNLOAD ?>
|
| 806 |
</th>
|
|
|
|
|
|
|
|
|
|
| 807 |
<th align="left" width="10%">
|
| 808 |
<?php echo LM_COL_SIZE ?>
|
| 809 |
</th>
|
| 810 |
-
<th align="left" width="
|
| 811 |
<?php echo LM_COL_DATE ?>
|
| 812 |
</th>
|
| 813 |
</tr>
|
|
@@ -815,38 +1063,28 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 815 |
$k = 0;
|
| 816 |
for ($i=0; $i <= (count( $files )-1); $i++) {
|
| 817 |
$date = date ("D jS M Y H:i:s (\G\M\T O)", filemtime($path.'/'.$files[$i]));
|
|
|
|
| 818 |
?>
|
| 819 |
<tr class="<?php echo "row$k"; ?>">
|
| 820 |
-
|
| 821 |
-
<?php echo $i+1; ?>
|
| 822 |
-
</td>
|
| 823 |
<td align="center">
|
| 824 |
-
|
| 825 |
-
|
| 826 |
-
|
| 827 |
-
<td >
|
| 828 |
-
<a target='_blank' href="<?php echo "index2.php?option=com_cloner&task=download&file=".'/'.urlencode($files[$i]); ?>"><?php echo $files[$i]; ?></a><input type="hidden" id="f<?php echo $i ?>" name="f<?php echo $i ?>" value="<?php echo $files[$i]; ?>" >
|
| 829 |
</td>
|
| 830 |
<td align="left">
|
| 831 |
-
|
| 832 |
-
|
| 833 |
-
|
| 834 |
-
|
| 835 |
-
|
| 836 |
-
|
| 837 |
-
|
| 838 |
-
echo "<a href=\"index2.php?option=com_cloner&task=action&action=delete&file=$files[$i]\">
|
| 839 |
-
<img border='0' src='images/tick.png'></a>";
|
| 840 |
-
else
|
| 841 |
-
echo "<a href=\"index2.php?option=com_cloner&task=action&action=copy&file=$files[$i]\">
|
| 842 |
-
<img border='0' src='images/publish_x.png'></a>";
|
| 843 |
-
?>
|
| 844 |
-
</td>-->
|
| 845 |
<td align="left">
|
| 846 |
-
|
| 847 |
</td >
|
| 848 |
<td align="left">
|
| 849 |
-
|
| 850 |
</td>
|
| 851 |
</tr>
|
| 852 |
<?php
|
|
@@ -854,7 +1092,7 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 854 |
}
|
| 855 |
?>
|
| 856 |
</table>
|
| 857 |
-
|
| 858 |
<input type="hidden" name="option" value="com_cloner" />
|
| 859 |
<input type="hidden" name="task" value="" />
|
| 860 |
<input type="hidden" name="boxchecked" value="0" />
|
|
@@ -868,926 +1106,1083 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 868 |
global $config_file,$_CONFIG, $lang_array, $database, $mosConfig_db;
|
| 869 |
?>
|
| 870 |
<form name='adminForm' action='index2.php' method='POST'>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 871 |
<table class='adminform'>
|
| 872 |
<tr><th colspan='2'>
|
| 873 |
<?php echo LM_CONFIG_EDIT?> <?php echo $config_file?>
|
| 874 |
</th></tr>
|
| 875 |
</table>
|
| 876 |
<?php
|
| 877 |
-
$tabs
|
| 878 |
-
$tabs->startTab(LM_TAB_GENERAL,"config-general-tab");
|
| 879 |
?>
|
| 880 |
-
<table class='adminform'>
|
| 881 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 882 |
|
| 883 |
-
|
| 884 |
-
|
| 885 |
-
|
| 886 |
-
|
| 887 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 888 |
|
| 889 |
-
<
|
| 890 |
-
|
| 891 |
-
|
| 892 |
-
|
| 893 |
-
|
| 894 |
-
|
| 895 |
-
|
| 896 |
-
|
| 897 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 898 |
|
| 899 |
-
|
| 900 |
-
|
| 901 |
-
|
| 902 |
-
|
| 903 |
-
|
| 904 |
-
|
| 905 |
-
|
| 906 |
-
|
| 907 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 908 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 909 |
|
| 910 |
-
|
| 911 |
-
|
| 912 |
-
|
| 913 |
-
|
| 914 |
-
|
|
|
|
|
|
|
|
|
|
| 915 |
|
| 916 |
-
|
| 917 |
-
|
| 918 |
-
|
| 919 |
-
|
| 920 |
-
|
| 921 |
-
|
| 922 |
-
|
| 923 |
-
|
| 924 |
-
</td>
|
| 925 |
-
</tr>
|
| 926 |
|
| 927 |
-
|
| 928 |
-
|
| 929 |
-
|
| 930 |
-
|
| 931 |
-
|
| 932 |
-
|
| 933 |
-
|
| 934 |
-
|
| 935 |
-
|
| 936 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 937 |
|
| 938 |
-
|
| 939 |
-
|
| 940 |
-
|
| 941 |
-
|
| 942 |
-
|
| 943 |
-
|
| 944 |
-
|
| 945 |
-
|
| 946 |
-
|
| 947 |
-
|
| 948 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 949 |
|
| 950 |
-
|
| 951 |
-
|
| 952 |
-
|
| 953 |
-
|
| 954 |
-
|
| 955 |
-
|
| 956 |
-
|
| 957 |
-
|
| 958 |
-
|
| 959 |
-
|
| 960 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 961 |
|
| 962 |
-
|
| 963 |
-
|
| 964 |
-
|
| 965 |
-
|
| 966 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 967 |
|
|
|
|
|
|
|
| 968 |
|
| 969 |
-
|
| 970 |
-
<td>
|
| 971 |
-
<?php echo LM_CONFIG_MEM?>
|
| 972 |
-
</td>
|
| 973 |
-
<td align='left'>
|
| 974 |
-
<table width='85%' cellpadding='0' cellspacing='2' border='1'>
|
| 975 |
-
<tr bgcolor='#efefef'><td valign='middle'>
|
| 976 |
-
<?php echo LM_ACTIVE;?> <input type=checkbox value=1 name='mem' <?php if($_CONFIG[mem]==1) echo 'checked';?>>
|
| 977 |
-
</td><td align='left'>
|
| 978 |
|
| 979 |
-
|
| 980 |
-
|
| 981 |
-
|
| 982 |
-
|
| 983 |
-
|
|
|
|
|
|
|
|
|
|
| 984 |
|
| 985 |
-
|
|
|
|
| 986 |
|
| 987 |
-
|
| 988 |
|
| 989 |
-
|
| 990 |
-
|
| 991 |
-
|
| 992 |
-
|
| 993 |
|
| 994 |
-
|
| 995 |
-
</table>
|
| 996 |
|
| 997 |
-
|
|
|
|
| 998 |
|
| 999 |
-
|
| 1000 |
-
|
|
|
|
| 1001 |
|
| 1002 |
-
<tr>
|
| 1003 |
-
<th colspan='2'>
|
| 1004 |
-
<?php echo "License Management"?>
|
| 1005 |
-
</th>
|
| 1006 |
-
</tr>
|
| 1007 |
-
<tr>
|
| 1008 |
-
<td>
|
| 1009 |
-
<?php echo "License Code - optional*
|
| 1010 |
-
<br />*only for support purposes"?>
|
| 1011 |
-
</td>
|
| 1012 |
-
<td>
|
| 1013 |
-
<textarea cols=40 rows='7' name='license_code' ><?php echo $_CONFIG[license_code]?></textarea>
|
| 1014 |
-
<br />Copy/Paste the license code from <a target='_blank' href='http://www.xcloner.com/'>XCloner.com Members area</a>
|
| 1015 |
-
</td>
|
| 1016 |
-
</tr>
|
| 1017 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1018 |
|
| 1019 |
-
|
| 1020 |
-
<?php
|
| 1021 |
-
$tabs->endTab();
|
| 1022 |
-
$tabs->startTab(LM_TAB_MYSQL,"config-mysql-tab");
|
| 1023 |
-
?>
|
| 1024 |
-
<table class='adminform'>
|
| 1025 |
|
| 1026 |
-
|
| 1027 |
-
<tr>
|
| 1028 |
-
<th colspan='2'>
|
| 1029 |
-
<?php echo LM_CONFIG_MYSQL?>
|
| 1030 |
-
</th>
|
| 1031 |
-
</tr>
|
| 1032 |
-
|
| 1033 |
-
<tr>
|
| 1034 |
-
<td>
|
| 1035 |
-
<?php echo LM_CONFIG_MYSQLH?>
|
| 1036 |
-
</td>
|
| 1037 |
-
<td>
|
| 1038 |
-
<input type=text size=50 name='mysql_host' value='<?php echo $_CONFIG[mysql_host]?>'>
|
| 1039 |
-
<br /><?php echo LM_CONFIG_MYSQLH_SUB?>
|
| 1040 |
-
</td>
|
| 1041 |
-
</tr>
|
| 1042 |
-
|
| 1043 |
-
<tr>
|
| 1044 |
-
<td>
|
| 1045 |
-
<?php echo LM_CONFIG_MYSQLU?>
|
| 1046 |
-
</td>
|
| 1047 |
-
<td>
|
| 1048 |
-
<input type=text size=50 name='mysql_user' value='<?php echo $_CONFIG[mysql_user]?>'>
|
| 1049 |
-
<br /><?php echo LM_CONFIG_MYSQLU_SUB?>
|
| 1050 |
-
</td>
|
| 1051 |
-
</tr>
|
| 1052 |
-
|
| 1053 |
-
<tr>
|
| 1054 |
-
<td>
|
| 1055 |
-
<?php echo LM_CONFIG_MYSQLP?>
|
| 1056 |
-
</td>
|
| 1057 |
-
<td>
|
| 1058 |
-
<input type=text size=50 name='mysql_pass' value='<?php echo $_CONFIG[mysql_pass]?>'>
|
| 1059 |
-
<br /><?php echo LM_CONFIG_MYSQLP_SUB?>
|
| 1060 |
-
</td>
|
| 1061 |
-
</tr>
|
| 1062 |
-
|
| 1063 |
-
<tr>
|
| 1064 |
-
<td>
|
| 1065 |
-
<?php echo LM_CONFIG_MYSQLD?>
|
| 1066 |
-
</td>
|
| 1067 |
-
<td>
|
| 1068 |
-
<input type=text size=50 name='mysql_database' value='<?php echo $_CONFIG[mysql_database]?>'>
|
| 1069 |
-
<br /><?php echo LM_CONFIG_MYSQLD_SUB?>
|
| 1070 |
-
</td>
|
| 1071 |
-
</tr>
|
| 1072 |
-
|
| 1073 |
-
<tr>
|
| 1074 |
-
<td width='200'>
|
| 1075 |
-
<?php echo LM_CONFIG_SYSTEM_MDATABASES?>
|
| 1076 |
-
</td>
|
| 1077 |
-
<td>
|
| 1078 |
-
<?php echo LM_YES?> <input type=radio name='system_mdatabases' value='0' <?php if(abs($_CONFIG[system_mdatabases])==0) echo "checked";?>>
|
| 1079 |
-
<?php echo LM_NO?> <input type=radio name='system_mdatabases' value='1' <?php if(abs($_CONFIG[system_mdatabases])==1) echo "checked";?>>
|
| 1080 |
-
<br>
|
| 1081 |
-
|
| 1082 |
-
<br /><?php echo LM_CONFIG_SYSTEM_MDATABASES_SUB?>
|
| 1083 |
-
</td>
|
| 1084 |
-
</tr>
|
| 1085 |
-
|
| 1086 |
-
</table>
|
| 1087 |
-
<?php
|
| 1088 |
-
$tabs->endTab();
|
| 1089 |
-
$tabs->startTab(LM_TAB_AUTH,"config-mysql-tab");
|
| 1090 |
-
?>
|
| 1091 |
-
<table class='adminform'>
|
| 1092 |
-
|
| 1093 |
-
|
| 1094 |
-
<tr>
|
| 1095 |
-
<th colspan='2'>
|
| 1096 |
-
<?php echo LM_CONFIG_AUTH?>
|
| 1097 |
-
</th>
|
| 1098 |
-
</tr>
|
| 1099 |
-
|
| 1100 |
-
<tr>
|
| 1101 |
-
<td>
|
| 1102 |
-
<?php echo LM_CONFIG_AUTH_USER?>
|
| 1103 |
-
</td>
|
| 1104 |
-
<td>
|
| 1105 |
-
<input type=text size=30 name='jcuser' value='<?php echo $_CONFIG[jcuser]?>'>
|
| 1106 |
-
<br /><?php echo LM_CONFIG_AUTH_USER_SUB?>
|
| 1107 |
-
</td>
|
| 1108 |
-
</tr>
|
| 1109 |
-
|
| 1110 |
-
<tr>
|
| 1111 |
-
<td>
|
| 1112 |
-
<?php echo LM_CONFIG_AUTH_PASS?>
|
| 1113 |
-
</td>
|
| 1114 |
-
<td>
|
| 1115 |
-
<input type=text size=30 name='jcpass' value=''> <?php if($_CONFIG['jcpass'] == md5('admin')) echo "<font color=red>please change the default password 'admin'</font>"?>
|
| 1116 |
-
<br /><?php echo LM_CONFIG_AUTH_PASS_SUB?>
|
| 1117 |
-
</td>
|
| 1118 |
-
</tr>
|
| 1119 |
-
|
| 1120 |
-
|
| 1121 |
-
</table>
|
| 1122 |
-
<?php
|
| 1123 |
-
$tabs->endTab();
|
| 1124 |
-
$tabs->startTab(LM_TAB_SYSTEM,"config-system-tab");
|
| 1125 |
-
?>
|
| 1126 |
-
<table class='adminform'>
|
| 1127 |
-
<tr>
|
| 1128 |
-
<th colspan='2'>
|
| 1129 |
-
<?php echo LM_CONFIG_DISPLAY?>
|
| 1130 |
-
</th>
|
| 1131 |
-
</tr>
|
| 1132 |
-
|
| 1133 |
-
<tr>
|
| 1134 |
-
<td width='200'>
|
| 1135 |
-
<?php echo LM_CONFIG_SYSTEM_LANG?>
|
| 1136 |
-
</td>
|
| 1137 |
-
<td>
|
| 1138 |
-
<select name='select_lang'>
|
| 1139 |
-
<option value=''><?php echo LM_CONFIG_SYSTEM_LANG_DEFAULT;?></option>
|
| 1140 |
-
<?php
|
| 1141 |
-
foreach($lang_array as $value)
|
| 1142 |
-
if($_CONFIG['select_lang'] == $value)
|
| 1143 |
-
echo "<option value='$value' selected>$value</option>\n";
|
| 1144 |
-
else
|
| 1145 |
-
echo "<option value='$value'>$value</option>\n";
|
| 1146 |
-
?>
|
| 1147 |
-
</select>
|
| 1148 |
-
<br>
|
| 1149 |
-
<br /><?php echo LM_CONFIG_SYSTEM_LANG_SUB?>
|
| 1150 |
-
</td>
|
| 1151 |
-
</tr>
|
| 1152 |
-
|
| 1153 |
-
|
| 1154 |
-
<!--<tr>
|
| 1155 |
-
<td width='200'>
|
| 1156 |
-
<?php echo LM_CONFIG_SYSTEM_DOWNLOAD?>
|
| 1157 |
-
</td>
|
| 1158 |
-
<td>
|
| 1159 |
-
<?php echo LM_YES?> <input type=radio name='system_dlink' value='1' <?php if(abs($_CONFIG[system_dlink])==1) echo "checked";?>>
|
| 1160 |
-
<?php echo LM_NO?> <input type=radio name='system_dlink' value='0' <?php if(abs($_CONFIG[system_dlink])==0) echo "checked";?>>
|
| 1161 |
-
<br>
|
| 1162 |
-
|
| 1163 |
-
<br /><?php echo LM_CONFIG_SYSTEM_DOWNLOAD_SUB?>
|
| 1164 |
-
</td>
|
| 1165 |
-
</tr>-->
|
| 1166 |
-
|
| 1167 |
-
|
| 1168 |
-
<tr>
|
| 1169 |
-
<th colspan='2'>
|
| 1170 |
-
<?php echo LM_CONFIG_SYSTEM?>
|
| 1171 |
-
</th>
|
| 1172 |
-
</tr>
|
| 1173 |
-
|
| 1174 |
-
<tr>
|
| 1175 |
-
<td width='200'>
|
| 1176 |
-
<?php echo LM_CONFIG_SYSTEM_FTP?>
|
| 1177 |
-
</td>
|
| 1178 |
-
<td>
|
| 1179 |
-
Direct <input type=radio name='system_ftptransfer' value='0' <?php if(abs($_CONFIG[system_ftptransfer])==0) echo "checked";?>>
|
| 1180 |
-
Passive <input type=radio name='system_ftptransfer' value='1' <?php if(abs($_CONFIG[system_ftptransfer])==1) echo "checked";?>> <br>
|
| 1181 |
-
|
| 1182 |
-
<br /><?php echo LM_CONFIG_SYSTEM_FTP_SUB?>
|
| 1183 |
-
</td>
|
| 1184 |
-
</tr>
|
| 1185 |
-
<tr>
|
| 1186 |
-
<td>
|
| 1187 |
-
<?php echo LM_FTP_TRANSFER_MORE?>
|
| 1188 |
-
</td>
|
| 1189 |
-
<td>
|
| 1190 |
-
Normal <input type=radio size=50 value=0 name='secure_ftp' <?php if($_CONFIG[secure_ftp]==0) echo 'checked';?>>
|
| 1191 |
-
Secure <input type=radio size=50 value=1 name='secure_ftp' <?php if($_CONFIG[secure_ftp]==1) echo 'checked';?>>
|
| 1192 |
-
</td>
|
| 1193 |
-
</tr>
|
| 1194 |
-
|
| 1195 |
-
<th colspan='2'>
|
| 1196 |
-
<?php echo LM_CONFIG_MANUAL?>
|
| 1197 |
-
</th>
|
| 1198 |
-
</tr>
|
| 1199 |
-
|
| 1200 |
-
<tr>
|
| 1201 |
-
<td>
|
| 1202 |
-
<?php echo LM_CONFIG_MANUAL_FILES;?>
|
| 1203 |
-
</td>
|
| 1204 |
-
<td>
|
| 1205 |
-
<input type=text size=20 name='backup_refresh_number' value=<?php echo $_CONFIG[backup_refresh_number];?>>
|
| 1206 |
-
|
| 1207 |
-
</td>
|
| 1208 |
-
</tr>
|
| 1209 |
-
|
| 1210 |
-
<tr>
|
| 1211 |
-
<td>
|
| 1212 |
-
<?php echo LM_CONFIG_MANUAL_REFRESH;?>
|
| 1213 |
-
</td>
|
| 1214 |
-
<td>
|
| 1215 |
-
<input type=text size=20 name='refresh_time' value=<?php echo $_CONFIG[refresh_time];?>> seconds
|
| 1216 |
-
|
| 1217 |
-
</td>
|
| 1218 |
-
</tr>
|
| 1219 |
-
|
| 1220 |
-
<tr>
|
| 1221 |
-
<td>
|
| 1222 |
-
<?php echo LM_REFRESH_MODE?>
|
| 1223 |
-
</td>
|
| 1224 |
-
<td>
|
| 1225 |
-
Normal <input type=radio size=50 value=0 name='refresh_mode' <?php if($_CONFIG[refresh_mode]==0) echo 'checked';?>>
|
| 1226 |
-
AJAX <input type=radio size=50 value=1 name='refresh_mode' <?php if($_CONFIG[refresh_mode]==1) echo 'checked';?>>
|
| 1227 |
-
</td>
|
| 1228 |
-
</tr>
|
| 1229 |
-
|
| 1230 |
-
<tr>
|
| 1231 |
-
<td>
|
| 1232 |
-
<?php echo LM_DEBUG_MODE?>
|
| 1233 |
-
</td>
|
| 1234 |
-
<td>
|
| 1235 |
-
No <input type=radio size=50 value=0 name='debug' <?php if($_CONFIG[debug]==0) echo 'checked';?>>
|
| 1236 |
-
Yes <input type=radio size=50 value=1 name='debug' <?php if($_CONFIG[debug]==1) echo 'checked';?>>
|
| 1237 |
-
</td>
|
| 1238 |
-
</tr>
|
| 1239 |
-
|
| 1240 |
-
</table>
|
| 1241 |
-
<?php
|
| 1242 |
-
$tabs->endTab();
|
| 1243 |
-
$tabs->startTab(LM_TAB_CRON,"config-cron-tab");
|
| 1244 |
-
?>
|
| 1245 |
-
<table class='adminform'>
|
| 1246 |
-
<tr>
|
| 1247 |
-
<th colspan='2'>
|
| 1248 |
-
<?php echo LM_CRON_SETTINGS_M?> - all configs are saved in configs/
|
| 1249 |
-
</th>
|
| 1250 |
-
</tr>
|
| 1251 |
-
|
| 1252 |
-
<tr>
|
| 1253 |
-
<td>
|
| 1254 |
-
<?php echo LM_CRON_MCRON?>
|
| 1255 |
-
</td>
|
| 1256 |
-
<td>
|
| 1257 |
-
<input type=text size=30 value="<?php echo $_CONFIG[cron_save_as]?>" name='cron_save_as' >.php <br />
|
| 1258 |
-
<?php echo LM_CRON_MCRON_SUB?>
|
| 1259 |
-
</td>
|
| 1260 |
-
</tr>
|
| 1261 |
-
|
| 1262 |
-
<tr>
|
| 1263 |
-
<td>
|
| 1264 |
-
<?php echo LM_CRON_MCRON_AVAIL?>
|
| 1265 |
-
</td>
|
| 1266 |
-
<td>
|
| 1267 |
-
<?php
|
| 1268 |
-
|
| 1269 |
-
if ($handle = @opendir($_CONFIG['multiple_config_dir'])) {
|
| 1270 |
-
|
| 1271 |
-
while (false !== ($file = readdir($handle))) {
|
| 1272 |
-
if( ($file!=".") && ($file!="..") &&($file!="") && (strstr($file, '.php'))){
|
| 1273 |
-
$fcron = "cloner.cron.php?config=$file";
|
| 1274 |
-
|
| 1275 |
-
echo "<b>$fcron</b>";
|
| 1276 |
-
|
| 1277 |
-
echo " - <a href='$fcron' target='_blank'>execute cron</a>";
|
| 1278 |
-
|
| 1279 |
-
echo " | <a href='index2.php?option=com_cloner&task=cron_delete&fconfig=$file'>delete config</a>";
|
| 1280 |
-
|
| 1281 |
-
echo "\n<br />";
|
| 1282 |
-
}
|
| 1283 |
-
}
|
| 1284 |
-
|
| 1285 |
-
closedir($handle);
|
| 1286 |
-
}
|
| 1287 |
-
?>
|
| 1288 |
-
</td>
|
| 1289 |
-
</tr>
|
| 1290 |
-
|
| 1291 |
-
<tr>
|
| 1292 |
-
<th colspan='2'>
|
| 1293 |
-
<?php echo LM_CRON_SETTINGS?>
|
| 1294 |
-
</th>
|
| 1295 |
-
</tr>
|
| 1296 |
-
|
| 1297 |
-
<tr>
|
| 1298 |
-
<td>
|
| 1299 |
-
<?php echo LM_CRON_SEMAIL?>
|
| 1300 |
-
</td>
|
| 1301 |
-
<td>
|
| 1302 |
-
<input type=text size=30 value="<?php echo $_CONFIG[cron_logemail]?>" name='cron_logemail' > <br />
|
| 1303 |
-
<?php echo LM_CRON_SEMAIL_SUB?>
|
| 1304 |
-
</td>
|
| 1305 |
-
</tr>
|
| 1306 |
-
|
| 1307 |
-
<tr>
|
| 1308 |
-
<td width='200'>
|
| 1309 |
-
<?php echo LM_CRON_MODE?>
|
| 1310 |
-
</td>
|
| 1311 |
-
<td>
|
| 1312 |
-
<input type=radio size=50 value=0 name='cron_send' <?php if($_CONFIG[cron_send]==0) echo 'checked';?>>
|
| 1313 |
-
<?php echo LM_CONFIG_CRON_LOCAL?><br />
|
| 1314 |
-
<input type=radio size=50 value=1 name='cron_send' <?php if($_CONFIG[cron_send]==1) echo 'checked';?>>
|
| 1315 |
-
<?php echo LM_CONFIG_CRON_REMOTE?><br />
|
| 1316 |
-
<input type=radio size=50 value=2 name='cron_send' <?php if($_CONFIG[cron_send]==2) echo 'checked';?>>
|
| 1317 |
-
<?php echo LM_CONFIG_CRON_EMAIL?> <br />
|
| 1318 |
-
<?php echo LM_CRON_MODE_INFO?>
|
| 1319 |
-
</td>
|
| 1320 |
-
</tr>
|
| 1321 |
-
|
| 1322 |
-
|
| 1323 |
-
<tr>
|
| 1324 |
-
<td>
|
| 1325 |
-
<?php echo LM_CRON_TYPE?>
|
| 1326 |
-
</td>
|
| 1327 |
-
<td>
|
| 1328 |
-
<input type=radio size=50 value=0 name='cron_btype' <?php if($_CONFIG[cron_btype]==0) echo 'checked';?>>
|
| 1329 |
-
<?php echo LM_CONFIG_CRON_FULL?> <br />
|
| 1330 |
-
<input type=radio size=50 value=1 name='cron_btype' <?php if($_CONFIG[cron_btype]==1) echo 'checked';?>>
|
| 1331 |
-
<?php echo LM_CONFIG_CRON_FILES?><br />
|
| 1332 |
-
<input type=radio size=50 value=2 name='cron_btype' <?php if($_CONFIG[cron_btype]==2) echo 'checked';?>>
|
| 1333 |
-
<?php echo LM_CONFIG_CRON_DATABASE?> <br />
|
| 1334 |
-
<?php echo LM_CRON_TYPE_INFO?>
|
| 1335 |
-
</td>
|
| 1336 |
-
</tr>
|
| 1337 |
-
|
| 1338 |
-
<tr>
|
| 1339 |
-
<td>
|
| 1340 |
-
<?php echo LM_CRON_BNAME?>
|
| 1341 |
-
</td>
|
| 1342 |
-
<td>
|
| 1343 |
-
<input type=text size=50 value="<?php echo $_CONFIG[cron_bname]?>" name='cron_bname' > <br />
|
| 1344 |
-
<?php echo LM_CRON_BNAME_SUB?>
|
| 1345 |
-
</td>
|
| 1346 |
-
</tr>
|
| 1347 |
-
|
| 1348 |
-
|
| 1349 |
-
<tr>
|
| 1350 |
-
<td>
|
| 1351 |
-
<?php echo LM_CRON_IP?>
|
| 1352 |
-
</td>
|
| 1353 |
-
<td>
|
| 1354 |
-
<textarea type=text size=50 name='cron_ip' cols='30' rows='5'><?php echo $_CONFIG[cron_ip]?></textarea> <br />
|
| 1355 |
-
<?php echo LM_CRON_IP_SUB?>
|
| 1356 |
-
</td>
|
| 1357 |
-
</tr>
|
| 1358 |
-
|
| 1359 |
-
</table>
|
| 1360 |
-
<table class='adminform'>
|
| 1361 |
-
<tr>
|
| 1362 |
-
<th colspan='2'>
|
| 1363 |
-
<?php echo LM_CRON_FTP_DETAILS?>
|
| 1364 |
-
</th>
|
| 1365 |
-
</tr>
|
| 1366 |
-
</tr>
|
| 1367 |
-
<tr>
|
| 1368 |
-
<td width='200'>
|
| 1369 |
-
<?php echo LM_CRON_FTP_SERVER?>
|
| 1370 |
-
</td>
|
| 1371 |
-
<td>
|
| 1372 |
-
<input type=text size=50 name='cron_ftp_server' value='<?php echo $_CONFIG[cron_ftp_server]?>'>
|
| 1373 |
-
</td>
|
| 1374 |
-
</tr>
|
| 1375 |
-
<tr>
|
| 1376 |
-
<td>
|
| 1377 |
-
<?php echo LM_CRON_FTP_USER?>
|
| 1378 |
-
</td>
|
| 1379 |
-
<td>
|
| 1380 |
-
<input type=text size=50 name='cron_ftp_user' value='<?php echo $_CONFIG[cron_ftp_user]?>'>
|
| 1381 |
-
</td>
|
| 1382 |
-
</tr>
|
| 1383 |
-
<tr>
|
| 1384 |
-
<td>
|
| 1385 |
-
<?php echo LM_CRON_FTP_PASS?>
|
| 1386 |
-
</td>
|
| 1387 |
-
<td>
|
| 1388 |
-
<input type=text size=50 name='cron_ftp_pass' value='<?php echo $_CONFIG[cron_ftp_pass]?>'>
|
| 1389 |
-
</td>
|
| 1390 |
-
</tr>
|
| 1391 |
-
<tr>
|
| 1392 |
-
<td>
|
| 1393 |
-
<?php echo LM_CRON_FTP_PATH?>
|
| 1394 |
-
</td>
|
| 1395 |
-
<td>
|
| 1396 |
-
<input type=text size=50 name='cron_ftp_path' value='<?php echo $_CONFIG[cron_ftp_path]?>'>
|
| 1397 |
-
</td>
|
| 1398 |
-
</tr>
|
| 1399 |
-
<tr>
|
| 1400 |
-
<td>
|
| 1401 |
-
<?php echo LM_CRON_FTP_DELB?>
|
| 1402 |
-
</td>
|
| 1403 |
-
<td>
|
| 1404 |
-
<input type=checkbox name='cron_ftp_delb' <?php if($_CONFIG[cron_ftp_delb]==1) echo "checked";?> value='1'>
|
| 1405 |
-
</td>
|
| 1406 |
-
</tr>
|
| 1407 |
-
</table>
|
| 1408 |
-
|
| 1409 |
-
<table class='adminform'>
|
| 1410 |
-
|
| 1411 |
-
<tr><th colspan=2>
|
| 1412 |
-
<?php echo LM_AMAZON_S3?>
|
| 1413 |
-
</th></tr>
|
| 1414 |
-
<tr>
|
| 1415 |
-
<td width='200'>
|
| 1416 |
-
<?php echo LM_AMAZON_S3_ACTIVATE?>
|
| 1417 |
-
</td>
|
| 1418 |
-
<td>
|
| 1419 |
-
<input type=checkbox name='cron_amazon_active' <?php if($_CONFIG[cron_amazon_active]==1) echo "checked";?> value='1'>
|
| 1420 |
-
</td>
|
| 1421 |
-
</tr>
|
| 1422 |
-
|
| 1423 |
-
<tr>
|
| 1424 |
-
<td width='200'>
|
| 1425 |
-
<?php echo LM_AMAZON_S3_AWSACCESSKEY;?>
|
| 1426 |
-
</td>
|
| 1427 |
-
<td>
|
| 1428 |
-
<input type=text size=50 name='cron_amazon_awsAccessKey' value="<?php echo $_CONFIG['cron_amazon_awsAccessKey'];?>">
|
| 1429 |
-
</td>
|
| 1430 |
-
</tr>
|
| 1431 |
-
|
| 1432 |
-
<tr>
|
| 1433 |
-
<td width='200'>
|
| 1434 |
-
<?php echo LM_AMAZON_S3_AWSSECRETKEY;?>
|
| 1435 |
-
</td>
|
| 1436 |
-
<td>
|
| 1437 |
-
<input type=text size=50 name='cron_amazon_awsSecretKey' value="<?php echo $_CONFIG['cron_amazon_awsSecretKey'];?>">
|
| 1438 |
-
</td>
|
| 1439 |
-
</tr>
|
| 1440 |
-
|
| 1441 |
-
<tr>
|
| 1442 |
-
<td width='200'>
|
| 1443 |
-
<?php echo LM_AMAZON_S3_BUCKET;?>
|
| 1444 |
-
</td>
|
| 1445 |
-
<td>
|
| 1446 |
-
<input type=text size=50 name='cron_amazon_bucket' value="<?php echo $_CONFIG['cron_amazon_bucket'];?>">
|
| 1447 |
-
</td>
|
| 1448 |
-
</tr>
|
| 1449 |
-
|
| 1450 |
-
<tr>
|
| 1451 |
-
<td width='200'>
|
| 1452 |
-
<?php echo LM_AMAZON_S3_DIRNAME;?>
|
| 1453 |
-
</td>
|
| 1454 |
-
<td>
|
| 1455 |
-
<input type=text size=50 name='cron_amazon_dirname' value="<?php echo $_CONFIG['cron_amazon_dirname'];?>">
|
| 1456 |
-
</td>
|
| 1457 |
-
</tr>
|
| 1458 |
-
|
| 1459 |
-
<td>
|
| 1460 |
-
|
| 1461 |
-
</td>
|
| 1462 |
-
</tr>
|
| 1463 |
-
|
| 1464 |
-
</table>
|
| 1465 |
-
|
| 1466 |
-
|
| 1467 |
-
<table class='adminform'>
|
| 1468 |
-
<tr>
|
| 1469 |
-
<th colspan='2'>
|
| 1470 |
-
<?php echo LM_CRON_EMAIL_DETAILS?>
|
| 1471 |
-
</th>
|
| 1472 |
-
</tr>
|
| 1473 |
-
</tr>
|
| 1474 |
-
<tr>
|
| 1475 |
-
<td width='200'>
|
| 1476 |
-
<?php echo LM_CRON_EMAIL_ACCOUNT?>
|
| 1477 |
-
</td>
|
| 1478 |
-
<td>
|
| 1479 |
-
<input type=text size=50 name='cron_email_address' value='<?php echo $_CONFIG[cron_email_address]?>'>
|
| 1480 |
-
</td>
|
| 1481 |
-
</tr>
|
| 1482 |
-
|
| 1483 |
-
|
| 1484 |
-
</table>
|
| 1485 |
-
|
| 1486 |
-
<table class='adminform'>
|
| 1487 |
-
<tr>
|
| 1488 |
-
<th colspan='2'>
|
| 1489 |
-
<?php echo LM_CRON_MYSQL_DETAILS?>
|
| 1490 |
-
</th>
|
| 1491 |
-
</tr>
|
| 1492 |
-
</tr>
|
| 1493 |
-
<tr bgcolor='#ffffff'>
|
| 1494 |
-
<td width='200'>
|
| 1495 |
-
<?php echo LM_CRON_MYSQL_DROP?>
|
| 1496 |
-
</td>
|
| 1497 |
-
<td>
|
| 1498 |
-
<input type=checkbox name='cron_sql_drop' value='1' <?php if($_CONFIG[cron_sql_drop]) echo "checked";?> >
|
| 1499 |
-
</td>
|
| 1500 |
-
</tr>
|
| 1501 |
-
|
| 1502 |
-
<?php
|
| 1503 |
-
if((abs($_CONFIG[system_mdatabases])==0) && ($_CONFIG[enable_db_backup]==1)){
|
| 1504 |
-
?>
|
| 1505 |
-
<tr><td valign='top'>
|
| 1506 |
-
<?php echo LM_DATABASE_INCLUDE_DATABASES?>
|
| 1507 |
-
</td><td>
|
| 1508 |
-
<select name='databases_incl[]' MULTIPLE SIZE=5>
|
| 1509 |
-
<?php
|
| 1510 |
-
|
| 1511 |
-
$curent_dbs = explode(",", $_CONFIG['databases_incl_list']);
|
| 1512 |
-
|
| 1513 |
-
$query = @mysql_query("SHOW databases");
|
| 1514 |
-
while($row = @mysql_fetch_array($query)){
|
| 1515 |
-
|
| 1516 |
-
$table = $row[0];
|
| 1517 |
-
|
| 1518 |
-
if($table != $_CONFIG['mysql_database'])
|
| 1519 |
-
|
| 1520 |
-
if(in_array($table, $curent_dbs)){
|
| 1521 |
-
|
| 1522 |
-
echo "<option value='".$table."' selected>$table</option>";
|
| 1523 |
-
|
| 1524 |
-
}else{
|
| 1525 |
-
|
| 1526 |
-
echo "<option value='".$table."'>$table</option>";
|
| 1527 |
-
|
| 1528 |
-
}
|
| 1529 |
-
}
|
| 1530 |
-
?>
|
| 1531 |
-
</select><br />
|
| 1532 |
-
<?php echo LM_DATABASE_INCLUDE_DATABASES_SUB?>
|
| 1533 |
-
</td></tr>
|
| 1534 |
-
<?php
|
| 1535 |
-
}
|
| 1536 |
-
?>
|
| 1537 |
-
|
| 1538 |
-
<tr><th colspan=2>
|
| 1539 |
-
<?php echo LM_CRON_DELETE_FILES?>
|
| 1540 |
-
</th></tr>
|
| 1541 |
-
<tr>
|
| 1542 |
-
<td width='200'>
|
| 1543 |
-
<?php echo LM_CRON_DELETE_FILES_SUB_ACTIVE?>
|
| 1544 |
-
</td>
|
| 1545 |
-
<td>
|
| 1546 |
-
<input type=checkbox name='cron_file_delete_act' <?php if ($_CONFIG['cron_file_delete_act'] == 1) echo 'checked';?> value='1'>
|
| 1547 |
-
</td>
|
| 1548 |
-
</tr>
|
| 1549 |
-
<tr>
|
| 1550 |
-
<td width='200'>
|
| 1551 |
-
<?php echo LM_CRON_DELETE_FILES_SUB?>
|
| 1552 |
-
</td>
|
| 1553 |
-
<td>
|
| 1554 |
-
<input size=5 name='cron_file_delete' value='<?php echo $_CONFIG[cron_file_delete]?>'> days:
|
| 1555 |
-
</td>
|
| 1556 |
-
</tr>
|
| 1557 |
-
</table>
|
| 1558 |
-
|
| 1559 |
-
<table class='adminform'>
|
| 1560 |
-
<tr>
|
| 1561 |
-
<th colspan='2'>
|
| 1562 |
-
<?php echo LM_CRON_EXCLUDE?>
|
| 1563 |
-
</th>
|
| 1564 |
-
</tr>
|
| 1565 |
-
</tr>
|
| 1566 |
-
<tr>
|
| 1567 |
-
<td width='200'>
|
| 1568 |
-
<?php echo LM_CRON_EXCLUDE_DIR?>
|
| 1569 |
-
</td>
|
| 1570 |
-
<td>
|
| 1571 |
-
<textarea cols=50 rows=5 name='cron_exclude'><?php echo $_CONFIG[cron_exclude]?></textarea>
|
| 1572 |
-
</td>
|
| 1573 |
-
</tr>
|
| 1574 |
-
|
| 1575 |
-
</table>
|
| 1576 |
-
<?php
|
| 1577 |
-
$tabs->endTab();
|
| 1578 |
-
$tabs->startTab(LM_TAB_INFO,"config-info-tab");
|
| 1579 |
-
?>
|
| 1580 |
-
<table class='adminform'>
|
| 1581 |
-
<tr>
|
| 1582 |
-
<th colspan='2'>
|
| 1583 |
-
<?php echo LM_CONFIG_INFO_PHP?>
|
| 1584 |
-
</th>
|
| 1585 |
-
</tr>
|
| 1586 |
-
|
| 1587 |
-
<tr>
|
| 1588 |
-
<td width='200'>
|
| 1589 |
-
<?php echo LM_CONFIG_INFO_T_VERSION?>
|
| 1590 |
-
</td>
|
| 1591 |
-
<td>
|
| 1592 |
-
<b><?php
|
| 1593 |
-
$version = phpversion();
|
| 1594 |
-
$ver = str_replace(".", "", $version);
|
| 1595 |
-
$val = ($ver < 520)? $version: "Off";
|
| 1596 |
-
echo HTML_cloner::get_color($version, $val);
|
| 1597 |
-
?></b>
|
| 1598 |
-
<br />
|
| 1599 |
-
<?php echo LM_CONFIG_INFO_VERSION?>
|
| 1600 |
-
</td>
|
| 1601 |
-
</tr>
|
| 1602 |
-
|
| 1603 |
-
<tr>
|
| 1604 |
-
<td width='200'>
|
| 1605 |
-
<?php echo LM_CONFIG_INFO_T_SAFEMODE?>
|
| 1606 |
-
</td>
|
| 1607 |
-
<td>
|
| 1608 |
-
<b><?php $val = (ini_get('safe_mode') != "")? ini_get('safe_mode'):"Off";
|
| 1609 |
-
echo HTML_cloner::get_color($val, 'On');
|
| 1610 |
-
?></b>
|
| 1611 |
-
<br />
|
| 1612 |
-
<?php echo LM_CONFIG_INFO_SAFEMODE?>
|
| 1613 |
-
</td>
|
| 1614 |
-
</tr>
|
| 1615 |
-
|
| 1616 |
-
<tr>
|
| 1617 |
-
<td width='200'>
|
| 1618 |
-
<?php echo LM_CONFIG_INFO_T_MTIME?>
|
| 1619 |
-
</td>
|
| 1620 |
-
<td>
|
| 1621 |
-
<b><?php echo (ini_get('max_execution_time') != "")? ini_get('max_execution_time'):"no value";
|
| 1622 |
-
|
| 1623 |
-
?></b>
|
| 1624 |
-
<br />
|
| 1625 |
-
<?php echo LM_CONFIG_INFO_TIME?>
|
| 1626 |
-
</td>
|
| 1627 |
-
</tr>
|
| 1628 |
-
|
| 1629 |
-
<tr>
|
| 1630 |
-
<td width='200'>
|
| 1631 |
-
<?php echo LM_CONFIG_INFO_T_MEML?>
|
| 1632 |
-
</td>
|
| 1633 |
-
<td>
|
| 1634 |
-
<b><?php echo (ini_get('memory_limit') != "")? ini_get('memory_limit'):"no value";?> </b>
|
| 1635 |
-
<br />
|
| 1636 |
-
<?php echo LM_CONFIG_INFO_MEMORY?>
|
| 1637 |
-
</td>
|
| 1638 |
-
</tr>
|
| 1639 |
-
|
| 1640 |
-
<tr>
|
| 1641 |
-
<td width='200'>
|
| 1642 |
-
<?php echo LM_CONFIG_INFO_T_BDIR?>
|
| 1643 |
-
</td>
|
| 1644 |
-
<td>
|
| 1645 |
-
<b><?php $val = (ini_get('open_basedir') != "")? ini_get('open_basedir'):"no value";
|
| 1646 |
-
echo HTML_cloner::get_color($val, '/');
|
| 1647 |
-
?> </b>
|
| 1648 |
-
<br />
|
| 1649 |
-
<?php echo LM_CONFIG_INFO_BASEDIR?>
|
| 1650 |
-
</td>
|
| 1651 |
-
</tr>
|
| 1652 |
-
|
| 1653 |
-
<tr>
|
| 1654 |
-
<td width='200'>
|
| 1655 |
-
<?php echo LM_CONFIG_INFO_T_EXEC?>
|
| 1656 |
-
</td>
|
| 1657 |
-
<td>
|
| 1658 |
-
<b><?php
|
| 1659 |
-
|
| 1660 |
-
$out = "";
|
| 1661 |
-
if(function_exists("exec")){
|
| 1662 |
-
|
| 1663 |
-
$out = @exec("ls -al");
|
| 1664 |
-
}
|
| 1665 |
-
|
| 1666 |
-
$val = ($out != "")? "ENABLED":"<font color='red'>DISABLED</font>";
|
| 1667 |
-
echo HTML_cloner::get_color($val, 'DISABLED');
|
| 1668 |
-
?> </b>
|
| 1669 |
-
<br />
|
| 1670 |
-
<?php echo LM_CONFIG_INFO_EXEC?>
|
| 1671 |
-
</td>
|
| 1672 |
-
</tr>
|
| 1673 |
-
|
| 1674 |
-
<tr>
|
| 1675 |
-
<th colspan='2'>
|
| 1676 |
-
<?php echo LM_CONFIG_INFO_PATHS?>
|
| 1677 |
-
</td>
|
| 1678 |
-
<td>
|
| 1679 |
-
</tr>
|
| 1680 |
-
|
| 1681 |
-
<tr>
|
| 1682 |
-
<td width='200'>
|
| 1683 |
-
<?php echo LM_CONFIG_INFO_ROOT_BPATH_TMP?>
|
| 1684 |
-
</td>
|
| 1685 |
-
<td>
|
| 1686 |
-
<b><?php $tmp_dir = realpath($_CONFIG['backup_path']."/administrator/backups");
|
| 1687 |
-
echo (@is_writeable( $tmp_dir ))? $tmp_dir . " is <font color=green>writeable</font>":$tmp_dir. " <font color=red>incorrect or unreadable</font>";?></b>
|
| 1688 |
-
<br />
|
| 1689 |
-
<?php echo LM_CONFIG_INFO_ROOT_PATH_TMP_SUB?>
|
| 1690 |
-
</td>
|
| 1691 |
-
</tr>
|
| 1692 |
-
|
| 1693 |
-
<tr>
|
| 1694 |
-
<td width='200'>
|
| 1695 |
-
<?php echo LM_CONFIG_INFO_ROOT_BPATH?>
|
| 1696 |
-
</td>
|
| 1697 |
-
<td>
|
| 1698 |
-
<b><?php echo (@is_readable($_CONFIG['backup_path']) )? $_CONFIG['backup_path'] . " is <font color=green>readable</font>":$_CONFIG['backup_path']. " <font color=red>incorrect or unreadable</font>";?></b>
|
| 1699 |
-
<br />
|
| 1700 |
-
<?php echo LM_CONFIG_INFO_ROOT_PATH_SUB?>
|
| 1701 |
-
</td>
|
| 1702 |
-
</tr>
|
| 1703 |
-
|
| 1704 |
-
|
| 1705 |
-
<tr>
|
| 1706 |
-
<td width='200'>
|
| 1707 |
-
<?php echo LM_CONFIG_INFO_T_BPATH?>
|
| 1708 |
-
</td>
|
| 1709 |
-
<td>
|
| 1710 |
-
<b><?php echo (@is_writeable($_CONFIG['clonerPath']) )? $_CONFIG['clonerPath'] . " is <font color=green>writeable</font>":$_CONFIG['clonerPath']. " <font color=red>unwriteable</font>";?></b>
|
| 1711 |
-
<br />
|
| 1712 |
-
<?php echo LM_CONFIG_INFO_BPATH?>
|
| 1713 |
-
</td>
|
| 1714 |
-
</tr>
|
| 1715 |
-
|
| 1716 |
-
|
| 1717 |
-
<tr>
|
| 1718 |
-
<td width='200'>
|
| 1719 |
-
<?php echo LM_CONFIG_INFO_T_TAR?>
|
| 1720 |
-
</td>
|
| 1721 |
-
<td>
|
| 1722 |
-
<b><?php
|
| 1723 |
-
if(function_exists('exec')){
|
| 1724 |
-
$info_tar_path = explode(" ", @exec("whereis tar"));
|
| 1725 |
-
}
|
| 1726 |
-
echo ($info_tar_path['1'] != "")? $info_tar_path['1']:"unable to determine";
|
| 1727 |
-
?> </b>
|
| 1728 |
-
<br />
|
| 1729 |
-
<?php echo LM_CONFIG_INFO_TAR?>
|
| 1730 |
-
</td>
|
| 1731 |
-
</tr>
|
| 1732 |
-
|
| 1733 |
-
|
| 1734 |
-
<tr>
|
| 1735 |
-
<td width='200'>
|
| 1736 |
-
<?php echo LM_CONFIG_INFO_T_MSQL?>
|
| 1737 |
-
</td>
|
| 1738 |
-
<td>
|
| 1739 |
-
<b><?php
|
| 1740 |
-
if(function_exists('exec')){
|
| 1741 |
-
$info_msql_path = explode(" ", @exec("whereis mysqldump"));
|
| 1742 |
-
}
|
| 1743 |
-
echo ($info_msql_path['1'] != "")? $info_msql_path['1']:"unable to determine";
|
| 1744 |
-
?> </b>
|
| 1745 |
-
<br />
|
| 1746 |
-
<?php echo LM_CONFIG_INFO_MSQL?>
|
| 1747 |
-
</td>
|
| 1748 |
-
</tr>
|
| 1749 |
-
|
| 1750 |
-
|
| 1751 |
-
</table>
|
| 1752 |
-
<?php
|
| 1753 |
-
$tabs->endTab();
|
| 1754 |
-
$tabs->endPane();
|
| 1755 |
-
?>
|
| 1756 |
-
<input type="hidden" name="option" value="com_cloner" />
|
| 1757 |
-
<input type="hidden" name="task" value="config" />
|
| 1758 |
-
<input type="hidden" name='action' value='save'>
|
| 1759 |
-
</form>
|
| 1760 |
-
|
| 1761 |
-
<?php
|
| 1762 |
-
}
|
| 1763 |
-
|
| 1764 |
-
function get_color($val, $comp){
|
| 1765 |
-
|
| 1766 |
-
if(!stristr($val, $comp))
|
| 1767 |
-
echo "<span style='color:green'>$val</span>";
|
| 1768 |
-
else
|
| 1769 |
-
echo "<span style='color:red'>$val</span>";
|
| 1770 |
-
|
| 1771 |
-
}
|
| 1772 |
-
|
| 1773 |
-
function TransferForm($option, $files){
|
| 1774 |
-
global $baDownloadPath, $mosConfig_absolute_path, $clonerPath, $task;
|
| 1775 |
-
|
| 1776 |
-
?>
|
| 1777 |
-
<form action="index2.php" method="GET" name="adminForm">
|
| 1778 |
-
<script language="javascript" type="text/javascript">
|
| 1779 |
-
|
| 1780 |
-
|
| 1781 |
-
function submitbutton(pressbutton) {
|
| 1782 |
-
var form = document.adminForm;
|
| 1783 |
-
if (pressbutton == 'cancel') {
|
| 1784 |
-
submitform( pressbutton );
|
| 1785 |
-
return;
|
| 1786 |
-
}
|
| 1787 |
-
|
| 1788 |
-
submitform( pressbutton );
|
| 1789 |
-
|
| 1790 |
-
}
|
| 1791 |
|
| 1792 |
function gotocontact( id ) {
|
| 1793 |
var form = document.adminForm;
|
|
@@ -1877,23 +2272,48 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 1877 |
<form action="index2.php" method="post" name="adminForm">
|
| 1878 |
<?php
|
| 1879 |
$tabs = new mosTabs(1);
|
| 1880 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1881 |
if($_CONFIG['enable_db_backup']){
|
| 1882 |
$tabs->startTab(LM_TAB_G_DATABASE,"users-databse-options-tab");
|
| 1883 |
?>
|
| 1884 |
|
| 1885 |
-
|
| 1886 |
<table class="adminform">
|
| 1887 |
-
|
| 1888 |
<th colspan=2>
|
| 1889 |
-
<b><?php echo LM_DATABASE_ARCHIVE; ?></b>
|
| 1890 |
</th>
|
| 1891 |
-
</tr
|
| 1892 |
-
<tr>
|
| 1893 |
-
<td><input type="checkbox" id="dbbackup" name="dbbackup" checked value="1" /> <?php echo LM_CONFIRM_DATABASE; ?></td>
|
| 1894 |
-
</tr>
|
| 1895 |
<tr>
|
| 1896 |
-
<td
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1897 |
</tr>
|
| 1898 |
<tr>
|
| 1899 |
<td><?php echo "Mysql Compatibility"; ?>
|
|
@@ -1908,7 +2328,7 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 1908 |
<?php echo LM_DATABASE_EXCLUDE_TABLES?>
|
| 1909 |
</th></tr>
|
| 1910 |
<tr><td>
|
| 1911 |
-
<?php echo LM_DATABASE_CURRENT?> <b><?php echo $
|
| 1912 |
<select name='excltables[]' MULTIPLE SIZE=15>
|
| 1913 |
<?php
|
| 1914 |
|
|
@@ -1937,7 +2357,8 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 1937 |
|
| 1938 |
while($row = mysql_fetch_array($query)){
|
| 1939 |
|
| 1940 |
-
|
|
|
|
| 1941 |
|
| 1942 |
}
|
| 1943 |
|
|
@@ -1951,6 +2372,7 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 1951 |
?>
|
| 1952 |
|
| 1953 |
</table>
|
|
|
|
| 1954 |
<?php
|
| 1955 |
$tabs->endTab();
|
| 1956 |
}
|
|
@@ -1964,7 +2386,7 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 1964 |
</tr>
|
| 1965 |
<tr>
|
| 1966 |
<td>
|
| 1967 |
-
<input type=text name='bname' value='' size=
|
| 1968 |
<?php echo LM_BACKUP_NAME_SUB?>
|
| 1969 |
</td>
|
| 1970 |
</tr>
|
|
@@ -1998,6 +2420,15 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 1998 |
?>
|
| 1999 |
|
| 2000 |
</table>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2001 |
<?php
|
| 2002 |
$tabs->endTab();
|
| 2003 |
$tabs->endPane();
|
|
@@ -2078,17 +2509,23 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 2078 |
|
| 2079 |
function showHelp( $option ) {
|
| 2080 |
?>
|
| 2081 |
-
|
| 2082 |
-
|
| 2083 |
-
|
| 2084 |
-
|
| 2085 |
-
|
| 2086 |
-
|
| 2087 |
-
|
| 2088 |
-
|
| 2089 |
-
|
| 2090 |
-
|
| 2091 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2092 |
<form action="index2.php" name="adminForm" method="post">
|
| 2093 |
<input type="hidden" name="option" value="<?php echo $option; ?>"/>
|
| 2094 |
<input type="hidden" name="task" value=""/>
|
|
@@ -2103,17 +2540,26 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 2103 |
|
| 2104 |
?>
|
| 2105 |
|
| 2106 |
-
|
| 2107 |
-
|
| 2108 |
-
|
| 2109 |
-
|
| 2110 |
-
|
| 2111 |
-
|
| 2112 |
-
|
| 2113 |
-
|
| 2114 |
-
|
| 2115 |
-
|
| 2116 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2117 |
<form action="index2.php" name="adminForm" method="post">
|
| 2118 |
<input type="hidden" name="option" value="<?php echo $option; ?>"/>
|
| 2119 |
<input type="hidden" name="task" value=""/>
|
|
@@ -2126,18 +2572,26 @@ function showBackups( &$files, &$sizes, $path, $option ) {
|
|
| 2126 |
// ----------------------------------------------------------
|
| 2127 |
|
| 2128 |
?>
|
| 2129 |
-
|
| 2130 |
-
|
| 2131 |
-
|
| 2132 |
-
|
| 2133 |
-
|
| 2134 |
-
|
| 2135 |
-
|
| 2136 |
-
|
| 2137 |
-
|
| 2138 |
-
|
| 2139 |
-
|
| 2140 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2141 |
<form action="index2.php" name="adminForm" method="post">
|
| 2142 |
<input type="hidden" name="option" value="<?php echo $option; ?>"/>
|
| 2143 |
<input type="hidden" name="task" value=""/>
|
| 31 |
|
| 32 |
function mosTabs($int){
|
| 33 |
|
| 34 |
+
echo "<div id=\"tabs\">";
|
| 35 |
|
| 36 |
}
|
| 37 |
|
| 38 |
function startTab($name, $class){
|
| 39 |
|
| 40 |
+
echo "<div id=\"tabs-$class\"><p>";
|
| 41 |
|
| 42 |
|
| 43 |
}
|
| 44 |
|
| 45 |
function endTab(){
|
| 46 |
|
| 47 |
+
echo "</pp></div>";
|
| 48 |
|
| 49 |
}
|
| 50 |
|
| 63 |
|
| 64 |
function header(){
|
| 65 |
|
| 66 |
+
global $mosConfig_live_site, $task;
|
| 67 |
+
$excl_tasks = array("view", "config","");
|
| 68 |
|
| 69 |
+
/*if(!in_array($_REQUEST['task'], $excl_tasks)){
|
| 70 |
+
$seconds_to_cache = 3600;
|
| 71 |
+
$ts = gmdate("D, d M Y H:i:s", time() + $seconds_to_cache) . " GMT";
|
| 72 |
+
@header("Expires: $ts");
|
| 73 |
+
@header("Pragma: cache");
|
| 74 |
+
@header("Cache-Control: maxage=$seconds_to_cache");
|
| 75 |
+
}*/
|
| 76 |
?>
|
| 77 |
<html lang="en">
|
| 78 |
<head>
|
| 80 |
<title>XCloner Backup and Restore</title>
|
| 81 |
<META NAME="ROBOTS" CONTENT="NOINDEX, NOFOLLOW">
|
| 82 |
|
|
|
|
| 83 |
<link rel="styleSheet" href="css/dtree.css" type="text/css" />
|
| 84 |
<link rel="styleSheet" href="css/main.css" type="text/css" />
|
| 85 |
+
<link rel="styleSheet" href="css/start/jquery-ui-1.8.9.custom.css" type="text/css" />
|
| 86 |
|
|
|
|
| 87 |
<script type="text/javascript" src="javascript/dtree.js"></script>
|
| 88 |
<script type="text/javascript" src="javascript/main.js"></script>
|
| 89 |
<script type="text/javascript" src="javascript/jquery-1.4.4.min.js"></script>
|
| 90 |
+
<script type="text/javascript" src="javascript/jquery-ui-1.8.9.custom.min.js"></script>
|
| 91 |
<script type="text/javascript">
|
| 92 |
|
| 93 |
/* Optional: Temporarily hide the "tabber" class so it does not "flash"
|
| 107 |
|
| 108 |
<tr><td align='center'>
|
| 109 |
|
| 110 |
+
<div class="status" >
|
| 111 |
+
<table width='100%' bgcolor='white' class="header">
|
| 112 |
<tr>
|
| 113 |
+
<td width='auto'>
|
| 114 |
+
<table><tr><td>
|
| 115 |
+
<img src="images/backup.png" align="middle">
|
| 116 |
+
</td><td>
|
| 117 |
+
<a href="index.php"><h2><?php echo LM_COM_TITLE.$_SERVER['HTTP_HOST']; ?></h2>
|
| 118 |
+
<h1>Backup and Restore</h1>
|
| 119 |
+
</a>
|
| 120 |
+
</td></tr>
|
| 121 |
+
</table>
|
| 122 |
+
</td>
|
| 123 |
+
<td align="right">
|
| 124 |
+
<div id="toolbar" style="display:none">
|
| 125 |
+
<?php
|
| 126 |
+
# Generating the buttons...
|
| 127 |
+
require_once( "toolbar.cloner.php" );
|
| 128 |
+
?>
|
| 129 |
+
</div>
|
| 130 |
+
</td>
|
| 131 |
</tr>
|
| 132 |
</table>
|
| 133 |
+
</div>
|
| 134 |
+
|
| 135 |
<br />
|
| 136 |
<table width="100%" cellspacing='3' cellpadding="4" >
|
| 137 |
<tr><td valign='top' width="160" >
|
| 206 |
<?php
|
| 207 |
if($_REQUEST['mosmsg']!="")
|
| 208 |
|
| 209 |
+
echo "<center><h2>".strip_tags($_REQUEST['mosmsg'])."</h2></center>";
|
| 210 |
|
| 211 |
}
|
| 212 |
|
| 216 |
</td></tr></table>
|
| 217 |
<hr><br /><br />
|
| 218 |
<center>
|
| 219 |
+
<p>Powered by <a href='http://www.xcloner.com' target='_blank'>XCloner</a>. Backup and Restore Made Easy!</p></center>
|
| 220 |
|
| 221 |
</td></tr></table>
|
| 222 |
+
<script> $( "#toolbar" ).show(); </script>
|
| 223 |
+
</body></html>
|
| 224 |
|
| 225 |
<?php
|
| 226 |
|
| 234 |
$backupFile = $f['basename'];
|
| 235 |
|
| 236 |
if (file_exists($filename)) {
|
| 237 |
+
echo "<h2>Initializing backup...</h2>";
|
| 238 |
+
echo "<h3 >Backup <b>$filename</b> created, we may continue!</h3><br />";
|
| 239 |
+
|
| 240 |
$urlReturn = "index2.php?option=com_cloner&lines=" . $perm_lines . "&task=refresh&backup=$backupFile&excl_manual=$excl_manual";
|
| 241 |
|
| 242 |
if(!$_CONFIG['refresh_mode']){
|
| 247 |
|
| 248 |
}else{
|
| 249 |
|
| 250 |
+
echo "<script>var dbbackup = ".intval($_REQUEST['dbbackup']).";</script>";
|
| 251 |
+
|
| 252 |
?>
|
| 253 |
<!--Start ProgressBar-->
|
| 254 |
<script type="text/javascript">
|
| 257 |
|
| 258 |
var globalUrl;
|
| 259 |
var step = "r1";
|
| 260 |
+
var count = 0;
|
| 261 |
+
var counter = 0;
|
| 262 |
+
var counter_old = 0;
|
| 263 |
+
var completeSize = 0;
|
| 264 |
+
var oldBackupName = "";
|
| 265 |
+
var parts = 0;
|
| 266 |
+
var oldSize = 0;
|
| 267 |
|
| 268 |
$("#progressbar").progressbar({ value: 0 });
|
| 269 |
|
| 272 |
//reset state here;
|
| 273 |
$("#error").show();
|
| 274 |
$("#errorText").append(status+" -- "+error);
|
| 275 |
+
$("#errorText").append("<br /><br />JSON url: "+globalUrl);
|
| 276 |
}});
|
| 277 |
|
| 278 |
+
function getSize(bytes, conv){
|
| 279 |
|
| 280 |
+
return (parseInt(bytes)/parseInt(conv)).toFixed(2);
|
| 281 |
+
|
| 282 |
+
}
|
| 283 |
+
function appendIcon(icon){
|
| 284 |
+
|
| 285 |
+
return '<span class="ui-icon ui-icon-'+icon+'" style="float:left;"></span>';
|
| 286 |
+
|
| 287 |
+
}
|
| 288 |
|
| 289 |
+
function xclonerRecurseMYSQL(url){
|
| 290 |
+
// create database backup
|
| 291 |
globalUrl = url;
|
| 292 |
step = "r1";
|
| 293 |
|
| 298 |
$("#errorText").text(url);
|
| 299 |
}
|
| 300 |
|
| 301 |
+
if(json.dumpsize && !json.endDump){
|
| 302 |
+
$("#mysqlProcess").append(" ("+getSize(json.dumpsize, 1024*1024)+" MB) <br />");
|
| 303 |
+
}
|
| 304 |
+
|
| 305 |
+
if(json.newDump){
|
| 306 |
+
count++;
|
| 307 |
+
//$("#mysqlProcess").append(appendIcon("arrowthick-1-e"));
|
| 308 |
+
if(json.databaseName!="")
|
| 309 |
+
$("#mysqlProcess").append("<b>["+json.databaseName+"]</b> <span id='db"+count+"'></span> tables ");
|
| 310 |
+
counter = parseInt(json.startAtLine);
|
| 311 |
+
|
| 312 |
+
}else{
|
| 313 |
+
$("#db"+count).text(json.startAtLine - counter);
|
| 314 |
+
}
|
| 315 |
+
|
| 316 |
+
if(!parseInt(json.finished)){
|
| 317 |
+
//get next records
|
| 318 |
+
|
| 319 |
+
$("#db"+count).text(json.startAtLine - counter);
|
| 320 |
+
|
| 321 |
+
recurseUrl = "index2.php?task=recurse_database&nohtml=1&dbbackup_comp="+json.dbbackup_comp+"&dbbackup_drop="+json.dbbackup_drop+"&startAtLine="+json.startAtLine+"&startAtRecord="+json.startAtRecord+"&dumpfile="+json.dumpfile;
|
| 322 |
+
xclonerRecurseMYSQL(recurseUrl);
|
| 323 |
+
|
| 324 |
+
}
|
| 325 |
+
else{
|
| 326 |
+
|
| 327 |
+
$("#fileSystem").show();
|
| 328 |
+
var recurseUrl="index2.php?task=recurse_files&mode=start&nohtml=1";
|
| 329 |
+
xclonerRecurseJSON(recurseUrl);
|
| 330 |
+
|
| 331 |
+
}
|
| 332 |
+
|
| 333 |
+
|
| 334 |
+
});
|
| 335 |
+
}
|
| 336 |
+
|
| 337 |
+
function xclonerRecurseJSON(url){
|
| 338 |
+
//scan file system
|
| 339 |
+
$("#result").hide();
|
| 340 |
+
|
| 341 |
+
globalUrl = url;
|
| 342 |
+
step = "r2";
|
| 343 |
+
|
| 344 |
+
$.getJSON(url, function(json) {
|
| 345 |
+
|
| 346 |
+
if(!json){
|
| 347 |
+
$("#error").show();
|
| 348 |
+
$("#errorText").text(url);
|
| 349 |
+
}
|
| 350 |
+
|
| 351 |
if(!parseInt(json.finished)){
|
| 352 |
|
| 353 |
$("#recurseStatus").text(json.tfiles);
|
| 358 |
}
|
| 359 |
else{
|
| 360 |
var size = parseFloat(json.size)/(1024*1024);
|
| 361 |
+
$("#recurseStatus").text(" done! (Estimated size:"+size.toFixed(2)+"MB) in "+json.tfiles+" files");
|
| 362 |
$("#result").show();
|
| 363 |
+
|
| 364 |
+
if(json.overlimit.length > 0){
|
| 365 |
+
$("#overlimit").show();
|
| 366 |
+
for(var i=0; i < json.overlimit.length; i++){
|
| 367 |
+
|
| 368 |
+
$("#overlimit").append("<span class='oversizedFile'></span>"+json.overlimit[i]+"<br />");
|
| 369 |
+
|
| 370 |
+
}
|
| 371 |
+
}
|
| 372 |
+
|
| 373 |
//xclonerGetJSON("<?php echo $urlReturn;?>");
|
| 374 |
returnUrl = "index2.php?option=com_cloner&lines="+json.tfiles+"&task=refresh&backup=<?php echo $backupFile; ?>&excl_manual=";
|
| 375 |
xclonerGetJSON(returnUrl);
|
| 381 |
}
|
| 382 |
|
| 383 |
function xclonerGetJSON(url){
|
| 384 |
+
//create backup archive
|
| 385 |
globalUrl = url;
|
| 386 |
+
step = "r3";
|
| 387 |
|
| 388 |
$.getJSON(url, function(json) {
|
| 389 |
|
| 394 |
|
| 395 |
var percent = parseInt(json.percent);
|
| 396 |
$("#progressbar").progressbar({ value: percent });
|
| 397 |
+
$("#backupSize").text(getSize(json.backupSize, 1024*1024));
|
| 398 |
$("#nFiles").text(json.startf);
|
| 399 |
$("#percent").text(json.percent);
|
| 400 |
+
$("#backupName").text(json.backup);
|
| 401 |
if(!json.finished){
|
| 402 |
+
|
| 403 |
+
if(oldBackupName != json.backup){
|
| 404 |
+
oldBackupName = json.backup;
|
| 405 |
+
completeSize = completeSize + oldSize;
|
| 406 |
+
parts++;
|
| 407 |
+
}else{
|
| 408 |
+
oldSize = parseInt(json.backupSize);
|
| 409 |
+
}
|
| 410 |
+
|
| 411 |
var url = "index2.php?option="+json.option+"&task="+json.task+"&json="+json.json+"&startf="+json.startf+"&lines="+json.lines+"&backup="+json.backup+"&excl_manual="+json.excl_manual;
|
| 412 |
xclonerGetJSON(url);
|
| 413 |
}else{
|
| 414 |
|
| 415 |
+
//all done
|
| 416 |
+
url = "index2.php?task=cleanup&nohtml=1";
|
| 417 |
+
$.getJSON(url, function(json) {
|
| 418 |
+
});
|
| 419 |
+
|
| 420 |
$("#complete").show();
|
| 421 |
$("#nFiles").text(json.lines);
|
| 422 |
+
if(parts > 0){
|
| 423 |
+
$("#backupParts").show();
|
| 424 |
+
$("#backupPartsNr").text(parts);
|
| 425 |
}
|
| 426 |
+
$("#backupFiles").text(json.lines);
|
| 427 |
+
$("#backupSizeComplete").append(getSize(completeSize+parseInt(json.backupSize), 1024*1024));
|
| 428 |
+
$("#backupNameC").text(json.backup);
|
| 429 |
+
$( "#dialog:ui-dialog" ).dialog( "destroy" );
|
| 430 |
+
$( "#dialog-message" ).dialog({
|
| 431 |
+
modal: true,
|
| 432 |
+
width: 600,
|
| 433 |
+
buttons: {
|
| 434 |
+
Close: function() {
|
| 435 |
+
$( this ).dialog( "close" );
|
| 436 |
+
}
|
| 437 |
+
}
|
| 438 |
+
});
|
| 439 |
+
|
| 440 |
+
}
|
| 441 |
|
| 442 |
});
|
| 443 |
|
| 444 |
}
|
| 445 |
|
| 446 |
+
//Main program here
|
| 447 |
+
|
| 448 |
$("#retry").click(function(){
|
| 449 |
$("#error").hide();
|
| 450 |
$("#errorText").empty();
|
| 451 |
if(step == "r1"){
|
| 452 |
+
xclonerRecurseMYSQL(globalUrl);
|
| 453 |
+
}
|
| 454 |
+
else
|
| 455 |
+
if(step == "r2"){
|
| 456 |
xclonerRecurseJSON(globalUrl);
|
| 457 |
}
|
| 458 |
+
else if(step == "r3"){
|
| 459 |
xclonerGetJSON(globalUrl);
|
| 460 |
}
|
| 461 |
});
|
| 462 |
|
| 463 |
+
$("#result").hide();
|
| 464 |
+
$("#fileSystem").hide();
|
|
|
|
| 465 |
|
| 466 |
+
if(dbbackup){
|
| 467 |
+
recurseUrl = "index2.php?task=recurse_database&nohtml=1&dbbackup_comp=<?php echo $_REQUEST['dbbackup_comp']?>&dbbackup_drop=<?php echo $_REQUEST['dbbackup_drop']?>";
|
| 468 |
+
xclonerRecurseMYSQL(recurseUrl);
|
| 469 |
+
}else{
|
| 470 |
+
$("#fileSystem").show();
|
| 471 |
+
var recurseUrl="index2.php?task=recurse_files&mode=start&nohtml=1";
|
| 472 |
+
xclonerRecurseJSON(recurseUrl);
|
| 473 |
+
|
| 474 |
+
}
|
| 475 |
|
| 476 |
});
|
| 477 |
</script>
|
| 478 |
|
| 479 |
+
<?php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 480 |
|
| 481 |
+
if($_REQUEST['dbbackup']){
|
| 482 |
+
//lets start the incremental procedure
|
| 483 |
+
?>
|
| 484 |
|
| 485 |
+
<div id="mysqlBackup">
|
| 486 |
+
<h2>Database backup...</h2><br />
|
| 487 |
+
<div id="mysqlProcess"></div><div id="counter"></div>
|
| 488 |
+
</div>
|
|
|
|
|
|
|
| 489 |
|
| 490 |
+
<?php
|
| 491 |
+
}
|
| 492 |
+
?>
|
| 493 |
+
|
| 494 |
+
<div id="fileSystem">
|
| 495 |
+
<h2>Filesystem backup...</h2>
|
| 496 |
+
|
| 497 |
+
<div id="recurseFiles">
|
| 498 |
+
<br /><strong>Scanning files system...</strong> <span id="recurseStatus"></span>
|
| 499 |
+
<br /><div id="overlimit" style="display:none"><b>Excluded oversized files:</b><br /> </div>
|
| 500 |
+
</div>
|
| 501 |
+
|
| 502 |
+
<div id="result">
|
| 503 |
+
<br /> <strong>Processing Files:</strong> <span id="percent">0</span>% (<span id="nFiles"></span> files)
|
| 504 |
+
<br /><br /> <strong>Backup Name: </strong><span id="backupName"></span>
|
| 505 |
+
<br /><br /> <strong>Backup Size: </strong><span id="backupSize"></span>MB
|
| 506 |
+
<br /><br /> <div id="progressbar"></div>
|
| 507 |
+
</div>
|
| 508 |
+
|
| 509 |
+
<div id="complete">
|
| 510 |
+
<br /><h2>Backup completed!</h2>
|
| 511 |
+
|
| 512 |
+
<form action="index2.php" name="adminForm" method="post">
|
| 513 |
+
<input type=hidden name=files[1] value='<?php echo $backupFile?>'>
|
| 514 |
+
<input type=hidden name=cid[1] value='<?php echo $backupFile?>'>
|
| 515 |
+
<input type="hidden" name="option" value="<?php echo $option; ?>"/>
|
| 516 |
+
<input type="hidden" name="task" value=""/>
|
| 517 |
+
</form>
|
| 518 |
+
|
| 519 |
+
<div id="dialog-message" title="Backup completed">
|
| 520 |
+
<p>
|
| 521 |
+
<span class="ui-icon ui-icon-arrowthick-1-e" style="float:left;"></span>
|
| 522 |
+
<strong>Backup name:</strong> <span id="backupNameC"></span>
|
| 523 |
+
</p>
|
| 524 |
+
<p>
|
| 525 |
+
<span class="ui-icon ui-icon-arrowthick-1-e" style="float:left;"></span><strong>Backup size:</strong> <span id="backupSizeComplete"></span>MB
|
| 526 |
+
</p>
|
| 527 |
+
<p>
|
| 528 |
+
<span class="ui-icon ui-icon-arrowthick-1-e" style="float:left;"></span><strong>Number of files:</strong> <span id="backupFiles"></span>
|
| 529 |
+
</p>
|
| 530 |
+
<p class="backupParts">
|
| 531 |
+
<span class="ui-icon ui-icon-arrowthick-1-e" style="float:left;"></span><strong>Backup Parts:</strong> <span id="backupPartsNr"></span>
|
| 532 |
+
</p>
|
| 533 |
+
</div>
|
| 534 |
+
|
| 535 |
+
</div>
|
| 536 |
</div>
|
| 537 |
|
| 538 |
<div id="error" style="display:none;">
|
| 668 |
echo " ($_CONFIG[backup_start_path])";
|
| 669 |
?>
|
| 670 |
</span></div>
|
| 671 |
+
|
| 672 |
<div class="status">
|
| 673 |
<span class="mtext">Backup Store Path Check: </span>
|
| 674 |
<?php
|
| 683 |
}
|
| 684 |
echo " ($_CONFIG[backup_store_path])";
|
| 685 |
?>
|
| 686 |
+
</span>
|
| 687 |
+
</div>
|
| 688 |
+
|
| 689 |
<div class="status">
|
| 690 |
<span class="mtext">Temporary Path Check: </span>
|
| 691 |
<?php
|
| 702 |
?>
|
| 703 |
</span></div>
|
| 704 |
|
| 705 |
+
<div class="status">
|
| 706 |
+
<span class="mtext">Authentication: </span>
|
| 707 |
+
<?php
|
| 708 |
+
|
| 709 |
+
if($_CONFIG['jcpass'] == md5('admin')){
|
| 710 |
+
echo "<span class='error'>Change default password 'admin'"; $error = 1;
|
| 711 |
+
}
|
| 712 |
+
else{
|
| 713 |
+
echo "<span class='success'>OK";
|
| 714 |
+
}
|
| 715 |
+
|
| 716 |
+
?>
|
| 717 |
+
</span></div>
|
| 718 |
+
|
| 719 |
<div class="status">
|
| 720 |
<span class="mtext">Backup Ready: </span>
|
| 721 |
<?php
|
| 740 |
<?php
|
| 741 |
}
|
| 742 |
|
| 743 |
+
/*The basic Authentication form*/
|
| 744 |
function Login(){
|
| 745 |
|
| 746 |
?>
|
| 747 |
<center><br />
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 748 |
|
| 749 |
+
<script>
|
| 750 |
+
$(function() {
|
| 751 |
+
$( "button, submit:input", ".loginform" ).button({
|
| 752 |
+
icons: {
|
| 753 |
+
primary: "ui-icon-locked"
|
| 754 |
+
}
|
| 755 |
+
}).next()
|
| 756 |
+
.button({
|
| 757 |
+
icons: {
|
| 758 |
+
primary: "ui-icon-trash"
|
| 759 |
+
}
|
| 760 |
+
})
|
| 761 |
+
.click(function() {
|
| 762 |
+
$("#adminForm")[0].reset();
|
| 763 |
+
return false;
|
| 764 |
+
});
|
| 765 |
|
| 766 |
+
|
| 767 |
+
});
|
| 768 |
+
</script>
|
| 769 |
|
| 770 |
|
| 771 |
+
<div class="loginform">
|
| 772 |
+
<form action="index2.php" method="post" name="adminForm" id="adminForm">
|
| 773 |
+
<table class="loginForm">
|
| 774 |
+
<tr><td align='center'>
|
| 775 |
+
<table align='center' cellpadding='10' cellspacing='20'>
|
| 776 |
+
<tr ><td colspan='2' align='center'><b>Authentication Area:</b></td></tr>
|
| 777 |
+
<tr><td>Username:</td><td><input type='text' size='30' name='username'></td></tr>
|
| 778 |
+
<tr><td>Password:</td><td><input type='password' size='30' name='password'></td></tr>
|
| 779 |
+
<tr><td> </td><td>
|
| 780 |
+
<div class="loginform">
|
| 781 |
+
<button>Login</button>
|
| 782 |
+
<button>Reset</button>
|
| 783 |
|
| 784 |
+
|
| 785 |
+
</div>
|
| 786 |
+
</td></tr>
|
| 787 |
+
<tr><td colspan='2'><?php echo LM_LOGIN_TEXT;?></td></tr>
|
| 788 |
+
</table>
|
| 789 |
+
</td></tr>
|
| 790 |
</table>
|
| 791 |
|
| 792 |
<input type="hidden" name="option" value="com_cloner" />
|
| 793 |
+
<input type="hidden" name="task" value="dologin" />
|
| 794 |
<input type="hidden" name="boxchecked" value="0" />
|
| 795 |
<input type="hidden" name="hidemainmenu" value="0" />
|
| 796 |
|
| 803 |
function Cron(){
|
| 804 |
global $_CONFIG;
|
| 805 |
?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 806 |
|
| 807 |
+
<script>
|
| 808 |
+
$(function() {
|
| 809 |
+
$( "#tabs" ).tabs();
|
| 810 |
+
});
|
| 811 |
+
</script>
|
| 812 |
|
| 813 |
+
<div id="tabs">
|
| 814 |
+
<ul>
|
| 815 |
+
<li><a href="#tabs-1"><?php echo LM_CRON_TOP?></a></li>
|
| 816 |
+
</ul>
|
| 817 |
|
| 818 |
+
<div id="tabs-1"><p>
|
| 819 |
+
|
| 820 |
+
<div class="mainText">
|
| 821 |
+
<?php echo LM_CRON_SUB?>
|
| 822 |
+
<br /><br />
|
| 823 |
+
|
| 824 |
+
<ul>
|
| 825 |
+
<li><input type="text" value="/usr/bin/php <?php echo dirname(__FILE__);?>/cloner.cron.php" size="150" /></li>
|
| 826 |
+
<li><strong>curl http://website/path_to_xcloner_folder/cloner.cron.php</strong></li>
|
| 827 |
+
<li><strong>wget -q http://website/path_to_xcloner_folder/cloner.cron.php</strong></li>
|
| 828 |
+
<li><strong>lynx -sourcehttp://website/path_to_xcloner_folder/cloner.cron.php</strong></li>
|
| 829 |
+
</ul>
|
| 830 |
+
<br /><br />
|
| 831 |
+
|
| 832 |
+
For <b>Running Multiple Crons</b>, you need to first create a custom configuration file in the XCloner Configuration -> Cron tab
|
| 833 |
+
and then replace "cloner.cron.php" with "cloner.cron.php?config=myconfig.php", only use 'links' or 'lynx' options to run the cronjob
|
| 834 |
+
<br /><br />
|
| 835 |
+
|
| 836 |
+
If you would like to use the <b>php SSH command</b> for running Multiple Crons, you will need to replace
|
| 837 |
+
the "cloner.cron.php" with <b>"cloner.cron.php myconfig.php"</b> in the command line.
|
| 838 |
+
<br /><br />
|
| 839 |
+
|
| 840 |
+
<?php echo LM_CRON_HELP?>
|
| 841 |
+
</div>
|
| 842 |
+
|
| 843 |
+
</p></div>
|
| 844 |
+
</div>
|
| 845 |
|
| 846 |
<?php
|
| 847 |
}
|
| 975 |
global $_CONFIG;
|
| 976 |
|
| 977 |
?>
|
| 978 |
+
<script>
|
| 979 |
+
$(function() {
|
| 980 |
+
$( "#toggle" ).button();
|
| 981 |
+
$( "#toggle" ).click(function() { checkJAll(<?php echo count( $lang_arr ); ?>, "toggle", "cb"); });
|
| 982 |
+
$( "#checklist" ).buttonset();
|
| 983 |
+
});
|
| 984 |
+
</script>
|
| 985 |
|
| 986 |
+
<form action="index2.php" method="post" name="adminForm">
|
| 987 |
+
<div id="checklist">
|
| 988 |
<table class="adminlist">
|
| 989 |
<tr>
|
| 990 |
+
<th align="center">
|
| 991 |
+
<input id="toggle" type="checkbox" name="toggle" value="" /><label for="toggle">Check All</label>
|
|
|
|
| 992 |
</th>
|
| 993 |
<th align="left">
|
| 994 |
<?php echo LM_LANG_NAME ?>
|
| 995 |
</th>
|
| 996 |
</tr>
|
|
|
|
| 997 |
|
| 998 |
+
<?php
|
| 999 |
for($i=0; $i<sizeof($lang_arr); $i++){
|
| 1000 |
|
| 1001 |
?>
|
| 1002 |
|
| 1003 |
<tr>
|
| 1004 |
+
<!--<td width="5" align="left"><?php echo ($i+1);?></td>-->
|
| 1005 |
+
<td align="center" width="100">
|
| 1006 |
+
<label for="cb<?php echo $i ?>"><?php echo $i ?></label>
|
| 1007 |
+
<input type="checkbox" id="cb<?php echo $i ?>" name="cid[<?php echo $i?>]" value="<?php echo $i ?>" />
|
| 1008 |
+
<input type="hidden" name="files[<?php echo $i?>]" value="<?php echo $lang_arr[$i] ?>" />
|
| 1009 |
</td>
|
| 1010 |
<td align="left" >
|
| 1011 |
<a href="index2.php?option=<?php echo $option;?>&task=edit_lang&langx=<?php echo $lang_arr[$i];?>"><?php echo ucfirst($lang_arr[$i])?>
|
| 1015 |
|
| 1016 |
}
|
| 1017 |
?>
|
| 1018 |
+
</table></div>
|
| 1019 |
<input type="hidden" name="option" value="com_cloner" />
|
| 1020 |
<input type="hidden" name="task" value="lang" />
|
| 1021 |
<input type="hidden" name="boxchecked" value="0" />
|
| 1031 |
global $baDownloadPath, $_CONFIG;
|
| 1032 |
|
| 1033 |
?>
|
| 1034 |
+
|
| 1035 |
+
<script>
|
| 1036 |
+
$(function() {
|
| 1037 |
+
$( "#toggle" ).button();
|
| 1038 |
+
$( "#toggle" ).click(function() { checkJAll(<?php echo (count( $files )); ?>, "toggle", "cb"); });
|
| 1039 |
+
$( "#checklist" ).buttonset();
|
| 1040 |
+
});
|
| 1041 |
+
</script>
|
| 1042 |
+
<div id="checklist">
|
| 1043 |
<form action="index2.php" method="post" name="adminForm">
|
| 1044 |
<table class="adminlist">
|
| 1045 |
<tr>
|
| 1046 |
+
<th width="100">
|
| 1047 |
+
<input type="checkbox" id="toggle" name="toggle" value="" /><label for="toggle">Check All</label>
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1048 |
</th>
|
| 1049 |
+
<th align="left" width="100px;">
|
| 1050 |
<?php echo LM_COL_DOWNLOAD ?>
|
| 1051 |
</th>
|
| 1052 |
+
<th width="50%" class="title">
|
| 1053 |
+
<?php echo LM_COL_FILENAME ?>
|
| 1054 |
+
</th>
|
| 1055 |
<th align="left" width="10%">
|
| 1056 |
<?php echo LM_COL_SIZE ?>
|
| 1057 |
</th>
|
| 1058 |
+
<th align="left" width="">
|
| 1059 |
<?php echo LM_COL_DATE ?>
|
| 1060 |
</th>
|
| 1061 |
</tr>
|
| 1063 |
$k = 0;
|
| 1064 |
for ($i=0; $i <= (count( $files )-1); $i++) {
|
| 1065 |
$date = date ("D jS M Y H:i:s (\G\M\T O)", filemtime($path.'/'.$files[$i]));
|
| 1066 |
+
$url = "index2.php?option=com_cloner&task=download&file=".'/'.urlencode($files[$i]);
|
| 1067 |
?>
|
| 1068 |
<tr class="<?php echo "row$k"; ?>">
|
| 1069 |
+
|
|
|
|
|
|
|
| 1070 |
<td align="center">
|
| 1071 |
+
<label for="cb<?php echo $i ?>"><?php echo $i ?></label>
|
| 1072 |
+
<input type="checkbox" id="cb<?php echo $i ?>" name="cid[<?php echo $i?>]" value="<?php echo $i ?>" />
|
| 1073 |
+
<input type="hidden" name="files[<?php echo $i?>]" value="<?php echo $files[$i] ?>" />
|
|
|
|
|
|
|
| 1074 |
</td>
|
| 1075 |
<td align="left">
|
| 1076 |
+
<a target='_blank' href="<?php echo $url ?>"><img src="images/filesave.png" border="0" title="<?php echo LM_DOWNLOAD_TITLE." - ".$files[$i] ?>" /></a>
|
| 1077 |
+
</td>
|
| 1078 |
+
<td>
|
| 1079 |
+
<span class="backup_name"><?php echo $files[$i]; ?></span>
|
| 1080 |
+
<input type="hidden" id="f<?php echo $i ?>" name="f<?php echo $i ?>" value="<?php echo $files[$i]; ?>" >
|
| 1081 |
+
</td>
|
| 1082 |
+
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1083 |
<td align="left">
|
| 1084 |
+
<?php echo $sizes[$i]; ?>
|
| 1085 |
</td >
|
| 1086 |
<td align="left">
|
| 1087 |
+
<?php echo $date; ?>
|
| 1088 |
</td>
|
| 1089 |
</tr>
|
| 1090 |
<?php
|
| 1092 |
}
|
| 1093 |
?>
|
| 1094 |
</table>
|
| 1095 |
+
</div>
|
| 1096 |
<input type="hidden" name="option" value="com_cloner" />
|
| 1097 |
<input type="hidden" name="task" value="" />
|
| 1098 |
<input type="hidden" name="boxchecked" value="0" />
|
| 1106 |
global $config_file,$_CONFIG, $lang_array, $database, $mosConfig_db;
|
| 1107 |
?>
|
| 1108 |
<form name='adminForm' action='index2.php' method='POST'>
|
| 1109 |
+
|
| 1110 |
+
<script>
|
| 1111 |
+
$(function() {
|
| 1112 |
+
$( "#tabs" ).tabs();
|
| 1113 |
+
});
|
| 1114 |
+
|
| 1115 |
+
$(function() {
|
| 1116 |
+
$( "#radiog1" ).buttonset();
|
| 1117 |
+
$( "#radiog2" ).buttonset();
|
| 1118 |
+
$( "#radiog3" ).buttonset();
|
| 1119 |
+
$( "#radiog4" ).buttonset();
|
| 1120 |
+
$( "#radio" ).buttonset();
|
| 1121 |
+
$( "#radiom" ).buttonset();
|
| 1122 |
+
$( "#radiob" ).buttonset();
|
| 1123 |
+
$( "#radioftp" ).buttonset();
|
| 1124 |
+
$( "#radioftps" ).buttonset();
|
| 1125 |
+
$( "#radiodebug" ).buttonset();
|
| 1126 |
+
$( "#radiorefresh" ).buttonset();
|
| 1127 |
+
$( "#checktar" ).button();
|
| 1128 |
+
$( "#cron_file_delete_act" ).button();
|
| 1129 |
+
$( "#cron_sql_drop" ).button();
|
| 1130 |
+
$( "#cron_amazon_active" ).button();
|
| 1131 |
+
$( "#cron_ftp_delb" ).button();
|
| 1132 |
+
$( "#checkmysqldump" ).button();
|
| 1133 |
+
});
|
| 1134 |
+
</script>
|
| 1135 |
+
|
| 1136 |
+
<?php $tabs = new mosTabs(1);?>
|
| 1137 |
+
<ul>
|
| 1138 |
+
|
| 1139 |
+
<li><a href="#tabs-1"><?php echo LM_TAB_GENERAL;?></a></li>
|
| 1140 |
+
<li><a href="#tabs-2"><?php echo LM_TAB_MYSQL;?></a></li>
|
| 1141 |
+
<li><a href="#tabs-3"><?php echo LM_TAB_AUTH;?></a></li>
|
| 1142 |
+
<li><a href="#tabs-4"><?php echo LM_TAB_SYSTEM;?></a></li>
|
| 1143 |
+
<li><a href="#tabs-5"><?php echo LM_TAB_CRON;?></a></li>
|
| 1144 |
+
<li><a href="#tabs-6"><?php echo LM_TAB_INFO;?></a></li>
|
| 1145 |
+
</ul>
|
| 1146 |
+
|
| 1147 |
<table class='adminform'>
|
| 1148 |
<tr><th colspan='2'>
|
| 1149 |
<?php echo LM_CONFIG_EDIT?> <?php echo $config_file?>
|
| 1150 |
</th></tr>
|
| 1151 |
</table>
|
| 1152 |
<?php
|
| 1153 |
+
$tabs->startTab(LM_TAB_GENERAL,"1");
|
|
|
|
| 1154 |
?>
|
|
|
|
| 1155 |
|
| 1156 |
+
<div id="configtabinside">
|
| 1157 |
+
|
| 1158 |
+
<div>
|
| 1159 |
+
<h3><a href="#"> <?php echo LM_CONFIG_BSETTINGS?></a></h3>
|
| 1160 |
+
<div><p>
|
| 1161 |
+
<table class='adminform'>
|
| 1162 |
+
|
| 1163 |
+
<tr>
|
| 1164 |
+
<td>
|
| 1165 |
+
<?php echo LM_CONFIG_UBPATH?>
|
| 1166 |
+
</td>
|
| 1167 |
+
<td>
|
| 1168 |
+
<input type=text size=100 name='backup_path' value='<?php echo $_CONFIG[backup_path]?>'>
|
| 1169 |
+
<br /><?php echo LM_CONFIG_UBPATH_SUB?>
|
| 1170 |
+
</td>
|
| 1171 |
+
</tr>
|
| 1172 |
+
|
| 1173 |
+
<tr>
|
| 1174 |
+
<td width='250'>
|
| 1175 |
+
<?php echo LM_CONFIG_BPATH?>
|
| 1176 |
+
</td>
|
| 1177 |
+
<td>
|
| 1178 |
+
<input type=text size=100 name='clonerPath' value='<?php echo $_CONFIG[clonerPath]?>'>
|
| 1179 |
+
<br /><?php echo LM_CONFIG_BPATH_SUB?>
|
| 1180 |
+
</td>
|
| 1181 |
+
</tr>
|
| 1182 |
+
|
| 1183 |
+
</table>
|
| 1184 |
+
</p></div>
|
| 1185 |
+
</div>
|
| 1186 |
+
|
| 1187 |
+
<div>
|
| 1188 |
+
<h3><a href="#"> <?php echo LM_CONFIG_BSETTINGS_OPTIONS?></a></h3>
|
| 1189 |
+
<div><p>
|
| 1190 |
+
<table class='adminform'>
|
| 1191 |
+
|
| 1192 |
+
<tr>
|
| 1193 |
+
<td width='250'>
|
| 1194 |
+
<?php echo LM_CONFIG_MANUAL_BACKUP;?>
|
| 1195 |
+
</td>
|
| 1196 |
+
<td>
|
| 1197 |
+
<div id="radiog1">
|
| 1198 |
+
<label for="radiog11"><?php echo LM_YES?></label> <input id="radiog11" type=radio size=50 value=1 name='backup_refresh' <?php if($_CONFIG[backup_refresh]==1) echo 'checked';?>>
|
| 1199 |
+
<label for="radiog12"><?php echo LM_NO?></label> <input id="radiog12" type=radio size=50 value=0 name='backup_refresh' <?php if($_CONFIG[backup_refresh]==0) echo 'checked';?>>
|
| 1200 |
+
<br><small><?php echo LM_CONFIG_MANUAL_BACKUP_SUB?></small>
|
| 1201 |
+
</div>
|
| 1202 |
+
</td>
|
| 1203 |
+
</tr>
|
| 1204 |
+
|
| 1205 |
+
<tr>
|
| 1206 |
+
<td>
|
| 1207 |
+
<?php echo LM_CRON_COMPRESS?>
|
| 1208 |
+
</td>
|
| 1209 |
+
<td>
|
| 1210 |
+
<div id="radiog2">
|
| 1211 |
+
<label for="radiog21"><?php echo LM_YES?></label> <input id="radiog21" type=radio size=50 value=1 name='backup_compress' <?php if($_CONFIG[backup_compress]==1) echo 'checked';?>>
|
| 1212 |
+
<label for="radiog22"><?php echo LM_NO?></label> <input id="radiog22" type=radio size=50 value=0 name='backup_compress' <?php if($_CONFIG[backup_compress]==0) echo 'checked';?>>
|
| 1213 |
+
<br /> <small>set it to Yes in order to compress the files into smaller backups</small>
|
| 1214 |
+
</div>
|
| 1215 |
+
</td>
|
| 1216 |
+
</tr>
|
| 1217 |
+
|
| 1218 |
+
<tr>
|
| 1219 |
+
<td>
|
| 1220 |
+
<?php echo LM_CRON_DB_BACKUP?>
|
| 1221 |
+
</td>
|
| 1222 |
+
<td>
|
| 1223 |
+
<div id="radiog3">
|
| 1224 |
+
<label for="radiog31">Yes</label> <input id="radiog31" type=radio size=50 value=1 name='enable_db_backup' <?php if($_CONFIG[enable_db_backup]==1) echo 'checked';?>>
|
| 1225 |
+
<label for="radiog32">No</label> <input id="radiog32" type=radio size=50 value=0 name='enable_db_backup' <?php if($_CONFIG[enable_db_backup]==0) echo 'checked';?>>
|
| 1226 |
+
<br /><?php echo LM_CRON_DB_BACKUP_SUB?>
|
| 1227 |
+
</div>
|
| 1228 |
+
|
| 1229 |
+
</td>
|
| 1230 |
+
</tr>
|
| 1231 |
+
|
| 1232 |
+
<tr>
|
| 1233 |
+
<td>
|
| 1234 |
+
<?php echo LM_CONFIG_SYSTEM_MBACKUP?>
|
| 1235 |
+
</td>
|
| 1236 |
+
<td>
|
| 1237 |
+
<div id="radiog4">
|
| 1238 |
+
<label for="radiog41">Yes</label> <input id="radiog41" type=radio size=50 value=1 name='add_backups_dir' <?php if($_CONFIG[add_backups_dir]==1) echo 'checked';?>>
|
| 1239 |
+
<label for="radiog42">No</label> <input id="radiog42" type=radio size=50 value=0 name='add_backups_dir' <?php if($_CONFIG[add_backups_dir]==0) echo 'checked';?>>
|
| 1240 |
+
<br /><?php echo LM_CONFIG_SYSTEM_MBACKUP_SUB?>
|
| 1241 |
+
</td>
|
| 1242 |
+
</div>
|
| 1243 |
+
</tr>
|
| 1244 |
+
|
| 1245 |
+
</table>
|
| 1246 |
+
</p></div>
|
| 1247 |
+
</div>
|
| 1248 |
+
|
| 1249 |
+
<div>
|
| 1250 |
+
<h3><a href="#"> <?php echo LM_CONFIG_BSETTINGS_SERVER?></a></h3>
|
| 1251 |
+
<div><p>
|
| 1252 |
+
<table class='adminform'>
|
| 1253 |
+
|
| 1254 |
+
<tr><td width='250'>
|
| 1255 |
+
<?php echo LM_CONFIG_MEM?>
|
| 1256 |
+
</td>
|
| 1257 |
+
<td align='left'>
|
| 1258 |
+
<table style="width:auto; margin-bottom: 10px;" cellpadding='0' cellspacing='2' border='1'>
|
| 1259 |
+
<tr bgcolor='#efefef'><td style="width:70px;">
|
| 1260 |
+
<label for="checktar"><?php echo LM_ACTIVE;?></label> <input type=checkbox id="checktar" value=1 name='mem' <?php if($_CONFIG[mem]==1) echo 'checked';?>>
|
| 1261 |
+
</td><td align='left'>
|
| 1262 |
+
|
| 1263 |
+
<table width='100%' cellpadding='0' cellspacing='0'>
|
| 1264 |
+
<tr><td>
|
| 1265 |
+
<?php echo LM_TAR_PATH;?> <br /><input size='50' type=text name=tarpath value='<?php echo $_CONFIG[tarpath]?>'><br />
|
| 1266 |
+
<?php echo LM_TAR_PATH_SUB;?>
|
| 1267 |
+
</td></tr>
|
| 1268 |
+
|
| 1269 |
+
</table>
|
| 1270 |
+
|
| 1271 |
+
|
| 1272 |
+
</td></tr>
|
| 1273 |
+
|
| 1274 |
+
<tr bgcolor='#dedede'><td>
|
| 1275 |
+
<label for="checkmysqldump"><?php echo LM_ACTIVE?></label> <input id="checkmysqldump" type=checkbox value=1 name='sql_mem' <?php if($_CONFIG[sql_mem]==1) echo 'checked';?>>
|
| 1276 |
+
</td><td align='left'>
|
| 1277 |
+
<?php echo LM_MYSQLDUMP_PATH;?> <br /><input type=text size='50' name='sqldump' value='<?php echo $_CONFIG[sqldump]?>'>
|
| 1278 |
+
|
| 1279 |
+
</td></tr>
|
| 1280 |
+
</table>
|
| 1281 |
+
|
| 1282 |
+
<?php echo LM_CONFIG_MEM_SUB?>
|
| 1283 |
+
|
| 1284 |
+
</td>
|
| 1285 |
+
</tr>
|
| 1286 |
+
</table>
|
| 1287 |
+
</p></div>
|
| 1288 |
+
</div>
|
| 1289 |
+
|
| 1290 |
+
<div>
|
| 1291 |
+
<h3><a href="#">Public Key Management</a></h3>
|
| 1292 |
+
<div><p>
|
| 1293 |
+
<table class='adminForm'>
|
| 1294 |
+
|
| 1295 |
+
<tr><td width="250">
|
| 1296 |
+
Public Key
|
| 1297 |
+
</td>
|
| 1298 |
+
<td>
|
| 1299 |
+
<input type-text size=50 name='license_code' value="<?php echo $_CONFIG[license_code]?>"/>
|
| 1300 |
+
<br />Use this code in the MultiSite XCloner Manager <a target='_blank' href='http://www.xcloner.com/'>XCloner.com Members area</a>
|
| 1301 |
+
<br />Leave it empty to disable it
|
| 1302 |
+
|
| 1303 |
+
</td>
|
| 1304 |
+
</tr>
|
| 1305 |
+
|
| 1306 |
+
</table>
|
| 1307 |
+
</p></div>
|
| 1308 |
+
</div>
|
| 1309 |
+
|
| 1310 |
+
</div>
|
| 1311 |
|
| 1312 |
+
<?php
|
| 1313 |
+
$tabs->endTab();
|
| 1314 |
+
$tabs->startTab(LM_TAB_MYSQL,"2");
|
| 1315 |
+
?>
|
| 1316 |
+
<div id="configtabinside">
|
| 1317 |
+
<div>
|
| 1318 |
+
<h3><a href="#"><?php echo LM_CONFIG_MYSQL?></a></h3>
|
| 1319 |
+
<div><p>
|
| 1320 |
+
|
| 1321 |
+
<table class='adminform'>
|
| 1322 |
+
|
| 1323 |
+
<tr>
|
| 1324 |
+
<td width='250'>
|
| 1325 |
+
<?php echo LM_CONFIG_MYSQLH?>
|
| 1326 |
+
</td>
|
| 1327 |
+
<td>
|
| 1328 |
+
<input type=text size=50 name='mysql_host' value='<?php echo $_CONFIG[mysql_host]?>'>
|
| 1329 |
+
<br /><?php echo LM_CONFIG_MYSQLH_SUB?>
|
| 1330 |
+
</td>
|
| 1331 |
+
</tr>
|
| 1332 |
+
|
| 1333 |
+
<tr>
|
| 1334 |
+
<td>
|
| 1335 |
+
<?php echo LM_CONFIG_MYSQLU?>
|
| 1336 |
+
</td>
|
| 1337 |
+
<td>
|
| 1338 |
+
<input type=text size=50 name='mysql_user' value='<?php echo $_CONFIG[mysql_user]?>'>
|
| 1339 |
+
<br /><?php echo LM_CONFIG_MYSQLU_SUB?>
|
| 1340 |
+
</td>
|
| 1341 |
+
</tr>
|
| 1342 |
+
|
| 1343 |
+
<tr>
|
| 1344 |
+
<td>
|
| 1345 |
+
<?php echo LM_CONFIG_MYSQLP?>
|
| 1346 |
+
</td>
|
| 1347 |
+
<td>
|
| 1348 |
+
<input type=text size=50 name='mysql_pass' value='<?php echo $_CONFIG[mysql_pass]?>'>
|
| 1349 |
+
<br /><?php echo LM_CONFIG_MYSQLP_SUB?>
|
| 1350 |
+
</td>
|
| 1351 |
+
</tr>
|
| 1352 |
+
|
| 1353 |
+
<tr>
|
| 1354 |
+
<td>
|
| 1355 |
+
<?php echo LM_CONFIG_MYSQLD?>
|
| 1356 |
+
</td>
|
| 1357 |
+
<td>
|
| 1358 |
+
<input type=text size=50 name='mysql_database' value='<?php echo $_CONFIG[mysql_database]?>'>
|
| 1359 |
+
<br /><?php echo LM_CONFIG_MYSQLD_SUB?>
|
| 1360 |
+
</td>
|
| 1361 |
+
</tr>
|
| 1362 |
+
|
| 1363 |
+
<tr>
|
| 1364 |
+
<td width='200'>
|
| 1365 |
+
<?php echo LM_CONFIG_SYSTEM_MDATABASES?>
|
| 1366 |
+
</td>
|
| 1367 |
+
<td>
|
| 1368 |
+
<div id="radiom">
|
| 1369 |
+
<label for="radiom1"><?php echo LM_YES?></label> <input id="radiom1" type=radio name='system_mdatabases' value='0' <?php if(abs($_CONFIG[system_mdatabases])==0) echo "checked";?>>
|
| 1370 |
+
<label for="radiom2"><?php echo LM_NO?></label> <input id="radiom2" type=radio name='system_mdatabases' value='1' <?php if(abs($_CONFIG[system_mdatabases])==1) echo "checked";?>>
|
| 1371 |
+
<br /> <?php echo LM_CONFIG_SYSTEM_MDATABASES_SUB?>
|
| 1372 |
+
</div>
|
| 1373 |
+
</td>
|
| 1374 |
+
</tr>
|
| 1375 |
+
|
| 1376 |
+
</table>
|
| 1377 |
+
</p></div>
|
| 1378 |
+
</div>
|
| 1379 |
+
</div>
|
| 1380 |
+
<?php
|
| 1381 |
+
$tabs->endTab();
|
| 1382 |
+
$tabs->startTab(LM_TAB_AUTH,"3");
|
| 1383 |
+
?>
|
| 1384 |
+
<div id="configtabinside">
|
| 1385 |
+
<div>
|
| 1386 |
+
<h3><a href="#"><?php echo LM_CONFIG_AUTH?></a></h3>
|
| 1387 |
+
<div><p>
|
| 1388 |
+
<table class='adminform'>
|
| 1389 |
+
<tr>
|
| 1390 |
+
<td width='250'>
|
| 1391 |
+
<?php echo LM_CONFIG_AUTH_USER?>
|
| 1392 |
+
</td>
|
| 1393 |
+
<td>
|
| 1394 |
+
<input type=text size=30 name='jcuser' value='<?php echo $_CONFIG[jcuser]?>'>
|
| 1395 |
+
<br /><?php echo LM_CONFIG_AUTH_USER_SUB?>
|
| 1396 |
+
</td>
|
| 1397 |
+
</tr>
|
| 1398 |
+
|
| 1399 |
+
<tr>
|
| 1400 |
+
<td>
|
| 1401 |
+
<?php echo LM_CONFIG_AUTH_PASS?>
|
| 1402 |
+
</td>
|
| 1403 |
+
<td>
|
| 1404 |
+
<input type=text size=30 name='jcpass' value=''> <?php if($_CONFIG['jcpass'] == md5('admin')) echo "<font color=red>please change the default password 'admin'</font>"?>
|
| 1405 |
+
<br /><?php echo LM_CONFIG_AUTH_PASS_SUB?>
|
| 1406 |
+
</td>
|
| 1407 |
+
</tr>
|
| 1408 |
+
</table>
|
| 1409 |
+
</p></div>
|
| 1410 |
+
</div>
|
| 1411 |
+
</div>
|
| 1412 |
+
<?php
|
| 1413 |
+
$tabs->endTab();
|
| 1414 |
+
$tabs->startTab(LM_TAB_SYSTEM,"4");
|
| 1415 |
+
?>
|
| 1416 |
|
| 1417 |
+
<div id="configtabinside">
|
| 1418 |
+
<div>
|
| 1419 |
+
<h3><a href="#"><?php echo LM_CONFIG_DISPLAY?></a></h3>
|
| 1420 |
+
<div><p>
|
| 1421 |
+
<table class='adminform'>
|
| 1422 |
+
<tr>
|
| 1423 |
+
<td width='250'>
|
| 1424 |
+
<?php echo LM_CONFIG_SYSTEM_LANG?>
|
| 1425 |
+
</td><td>
|
| 1426 |
+
<select name='select_lang'>
|
| 1427 |
+
<option value=''><?php echo LM_CONFIG_SYSTEM_LANG_DEFAULT;?></option>
|
| 1428 |
+
<?php
|
| 1429 |
+
foreach($lang_array as $value)
|
| 1430 |
+
if($_CONFIG['select_lang'] == $value)
|
| 1431 |
+
echo "<option value='$value' selected>$value</option>\n";
|
| 1432 |
+
else
|
| 1433 |
+
echo "<option value='$value'>$value</option>\n";
|
| 1434 |
+
?>
|
| 1435 |
+
</select>
|
| 1436 |
+
<br>
|
| 1437 |
+
<br /><?php echo LM_CONFIG_SYSTEM_LANG_SUB?>
|
| 1438 |
+
</td></tr>
|
| 1439 |
+
</table>
|
| 1440 |
+
</p></div>
|
| 1441 |
+
</div>
|
| 1442 |
+
<div>
|
| 1443 |
+
<h3><a href="#"> <?php echo LM_CONFIG_SYSTEM?></a></h3>
|
| 1444 |
+
<div><p>
|
| 1445 |
+
|
| 1446 |
+
<table class='adminform'>
|
| 1447 |
+
|
| 1448 |
+
<tr>
|
| 1449 |
+
<td width='250'>
|
| 1450 |
+
<?php echo LM_CONFIG_SYSTEM_FTP?>
|
| 1451 |
+
</td>
|
| 1452 |
+
<td>
|
| 1453 |
+
<div id="radioftp">
|
| 1454 |
+
<label for="radioftp1">Direct</label><input id="radioftp1" type=radio name='system_ftptransfer' value='0' <?php if(abs($_CONFIG[system_ftptransfer])==0) echo "checked";?>>
|
| 1455 |
+
<label for="radioftp2">Passive</label><input id="radioftp2" type=radio name='system_ftptransfer' value='1' <?php if(abs($_CONFIG[system_ftptransfer])==1) echo "checked";?>> <br>
|
| 1456 |
+
<br /><?php echo LM_CONFIG_SYSTEM_FTP_SUB?>
|
| 1457 |
+
</div>
|
| 1458 |
+
|
| 1459 |
+
</td></tr>
|
| 1460 |
+
<tr><td>
|
| 1461 |
+
<?php echo LM_FTP_TRANSFER_MORE?>
|
| 1462 |
+
</td><td>
|
| 1463 |
+
<div id="radioftps">
|
| 1464 |
+
<label for="radioftps1">Normal</label><input id="radioftps1" type=radio size=50 value=0 name='secure_ftp' <?php if($_CONFIG[secure_ftp]==0) echo 'checked';?>>
|
| 1465 |
+
<label for="radioftps2">Secure</label><input id="radioftps2" type=radio size=50 value=1 name='secure_ftp' <?php if($_CONFIG[secure_ftp]==1) echo 'checked';?>>
|
| 1466 |
+
</td>
|
| 1467 |
+
</tr>
|
| 1468 |
+
|
| 1469 |
+
</table>
|
| 1470 |
+
</p></div>
|
| 1471 |
+
</div>
|
| 1472 |
+
<div>
|
| 1473 |
+
<h3><a href="#"> <?php echo LM_CONFIG_MANUAL?></a></h3>
|
| 1474 |
+
<div><p>
|
| 1475 |
+
|
| 1476 |
+
<script>
|
| 1477 |
+
$(function() {
|
| 1478 |
+
$( "#slider" ).slider({
|
| 1479 |
+
value:parseInt(<?php echo $_CONFIG[backup_refresh_number];?>),
|
| 1480 |
+
min: 10,
|
| 1481 |
+
max: 1000,
|
| 1482 |
+
step: 10,
|
| 1483 |
+
slide: function( event, ui ) {
|
| 1484 |
+
$( "#backup_refresh_number" ).val( ui.value );
|
| 1485 |
+
}
|
| 1486 |
+
});
|
| 1487 |
+
$( "#backup_refresh_number" ).val( $( "#slider" ).slider( "value" ) );
|
| 1488 |
+
});
|
| 1489 |
+
$(function() {
|
| 1490 |
+
$( "#sliderRPS" ).slider({
|
| 1491 |
+
value:parseInt(<?php echo $_CONFIG[recordsPerSession];?>),
|
| 1492 |
+
min: 100,
|
| 1493 |
+
max: 100000,
|
| 1494 |
+
step: 100,
|
| 1495 |
+
slide: function( event, ui ) {
|
| 1496 |
+
$( "#recordsPerSession" ).val( ui.value );
|
| 1497 |
+
}
|
| 1498 |
+
});
|
| 1499 |
+
$( "#recordsPerSession" ).val( $( "#sliderRPS" ).slider( "value" ) );
|
| 1500 |
+
});
|
| 1501 |
+
$(function() {
|
| 1502 |
+
$( "#sliderEFZ" ).slider({
|
| 1503 |
+
value:parseInt(<?php echo $_CONFIG[excludeFilesSize];?>),
|
| 1504 |
+
min: -1,
|
| 1505 |
+
max: 10240,
|
| 1506 |
+
step: 1,
|
| 1507 |
+
slide: function( event, ui ) {
|
| 1508 |
+
$( "#excludeFilesSize" ).val( ui.value );
|
| 1509 |
+
}
|
| 1510 |
+
});
|
| 1511 |
+
$( "#excludeFilesSize" ).val( $( "#sliderEFZ" ).slider( "value" ) );
|
| 1512 |
+
});
|
| 1513 |
+
|
| 1514 |
+
$(function() {
|
| 1515 |
+
$( "#sliderSBS" ).slider({
|
| 1516 |
+
value:parseInt(<?php echo $_CONFIG[splitBackupSize];?>),
|
| 1517 |
+
min: -1,
|
| 1518 |
+
max: 10000,
|
| 1519 |
+
step: 1,
|
| 1520 |
+
slide: function( event, ui ) {
|
| 1521 |
+
$( "#splitBackupSize" ).val( ui.value );
|
| 1522 |
+
}
|
| 1523 |
+
});
|
| 1524 |
+
$( "#splitBackupSize" ).val( $( "#sliderSBS" ).slider( "value" ) );
|
| 1525 |
+
});
|
| 1526 |
+
</script>
|
| 1527 |
+
|
| 1528 |
+
<table class='adminform'>
|
| 1529 |
+
|
| 1530 |
+
<tr><td width="250">
|
| 1531 |
+
<?php echo LM_CONFIG_MANUAL_FILES;?>
|
| 1532 |
+
</td><td>
|
| 1533 |
+
<div class="sliderContainer">
|
| 1534 |
+
<div id="slider" style="width:500px;padding:5px 0 0 0;float:left"></div>
|
| 1535 |
+
<label for="backup_refresh_number"></label>
|
| 1536 |
+
<input id="backup_refresh_number" type=text size=10 name='backup_refresh_number' value=<?php echo $_CONFIG[backup_refresh_number];?>>
|
| 1537 |
+
</div>
|
| 1538 |
+
</td></tr>
|
| 1539 |
+
|
| 1540 |
+
<tr><td width="250">
|
| 1541 |
+
<?php echo LM_CONFIG_DB_RECORDS;?>
|
| 1542 |
+
</td><td>
|
| 1543 |
+
<div class="sliderContainer">
|
| 1544 |
+
<div id="sliderRPS" style="width:500px;padding:5px 0 0 0;float:left;"></div>
|
| 1545 |
+
<label for="recordsPerSession"></label>
|
| 1546 |
+
<input id="recordsPerSession" type=text size=10 name='recordsPerSession' value=<?php echo $_CONFIG[recordsPerSession];?>>
|
| 1547 |
+
</div>
|
| 1548 |
+
</td></tr>
|
| 1549 |
+
|
| 1550 |
+
<tr><td width="250">
|
| 1551 |
+
<?php echo LM_CONFIG_EXCLUDE_FILES_SIZE;?>
|
| 1552 |
+
</td><td>
|
| 1553 |
+
<div class="sliderContainer">
|
| 1554 |
+
<div id="sliderEFZ" style="width:500px;padding:5px 0 0 0;float:left"></div>
|
| 1555 |
+
<label for="excludeFilesSize"></label>
|
| 1556 |
+
<input id="excludeFilesSize" type=text size=10 name='excludeFilesSize' value=<?php echo $_CONFIG[excludeFilesSize];?>> MB
|
| 1557 |
+
</div>
|
| 1558 |
+
</td></tr>
|
| 1559 |
+
|
| 1560 |
+
<tr><td width="250">
|
| 1561 |
+
<?php echo LM_CONFIG_SPLIT_BACKUP_SIZE;?>
|
| 1562 |
+
</td><td>
|
| 1563 |
+
<div class="sliderContainer">
|
| 1564 |
+
<div id="sliderSBS" style="width:500px;padding:5px 0 0 0;float:left;"></div>
|
| 1565 |
+
<label for="splitBackupSize"></label>
|
| 1566 |
+
<input id="splitBackupSize" type=text size=10 name='splitBackupSize' value=<?php echo $_CONFIG[splitBackupSize];?>> MB
|
| 1567 |
+
</div>
|
| 1568 |
+
|
| 1569 |
+
</td></tr>
|
| 1570 |
+
|
| 1571 |
+
<tr><td>
|
| 1572 |
+
<?php echo LM_CONFIG_MANUAL_REFRESH;?>
|
| 1573 |
+
</td><td>
|
| 1574 |
+
<input type=text size=20 name='refresh_time' value=<?php echo $_CONFIG[refresh_time];?>> miliseconds
|
| 1575 |
+
|
| 1576 |
+
</td></tr>
|
| 1577 |
+
|
| 1578 |
+
<tr><td>
|
| 1579 |
+
<?php echo LM_REFRESH_MODE?>
|
| 1580 |
+
</td><td>
|
| 1581 |
+
<div id="radiorefresh">
|
| 1582 |
+
<label for="radiorefresh1">Normal</label> <input id="radiorefresh1" type=radio size=50 value=0 name='refresh_mode' <?php if($_CONFIG[refresh_mode]==0) echo 'checked';?>>
|
| 1583 |
+
<label for="radiorefresh2">AJAX</label> <input id="radiorefresh2" type=radio size=50 value=1 name='refresh_mode' <?php if($_CONFIG[refresh_mode]==1) echo 'checked';?>>
|
| 1584 |
+
</div>
|
| 1585 |
+
</td></tr>
|
| 1586 |
+
|
| 1587 |
+
<tr><td>
|
| 1588 |
+
<?php echo LM_DEBUG_MODE?>
|
| 1589 |
+
</td><td>
|
| 1590 |
+
<div id="radiodebug">
|
| 1591 |
+
<label for="radiodebug1">No</label> <input id="radiodebug1" type=radio size=50 value=0 name='debug' <?php if($_CONFIG[debug]==0) echo 'checked';?>>
|
| 1592 |
+
<label for="radiodebug2">Yes</label> <input id="radiodebug2" type=radio size=50 value=1 name='debug' <?php if($_CONFIG[debug]==1) echo 'checked';?>>
|
| 1593 |
+
</td></tr>
|
| 1594 |
+
</table>
|
| 1595 |
+
|
| 1596 |
+
</p></div>
|
| 1597 |
+
</div>
|
| 1598 |
|
| 1599 |
+
</div>
|
| 1600 |
+
<?php
|
| 1601 |
+
$tabs->endTab();
|
| 1602 |
+
$tabs->startTab(LM_TAB_CRON,"5");
|
| 1603 |
+
?>
|
| 1604 |
+
<div id="configtabinside">
|
| 1605 |
+
|
| 1606 |
+
<div>
|
| 1607 |
+
<h3><a href="#"> <?php echo LM_CRON_SETTINGS_M?> - all configs are saved in directory configs/ </a></h3>
|
| 1608 |
+
<div><p>
|
| 1609 |
+
<table class='adminform'>
|
| 1610 |
+
|
| 1611 |
+
<tr>
|
| 1612 |
+
<td width='250'>
|
| 1613 |
+
<?php echo LM_CRON_MCRON?>
|
| 1614 |
+
</td>
|
| 1615 |
+
<td>
|
| 1616 |
+
<input type=text size=30 value="<?php echo $_CONFIG[cron_save_as]?>" name='cron_save_as' >.php <br />
|
| 1617 |
+
<?php echo LM_CRON_MCRON_SUB?>
|
| 1618 |
+
</td>
|
| 1619 |
+
</tr>
|
| 1620 |
+
|
| 1621 |
+
<tr>
|
| 1622 |
+
<td>
|
| 1623 |
+
<?php echo LM_CRON_MCRON_AVAIL?>
|
| 1624 |
+
</td>
|
| 1625 |
+
<td>
|
| 1626 |
+
<?php
|
| 1627 |
+
|
| 1628 |
+
if ($handle = @opendir($_CONFIG['multiple_config_dir'])) {
|
| 1629 |
+
|
| 1630 |
+
while (false !== ($file = readdir($handle))) {
|
| 1631 |
+
if( ($file!=".") && ($file!="..") &&($file!="") && (strstr($file, '.php'))){
|
| 1632 |
+
$fcron = "cloner.cron.php?config=$file";
|
| 1633 |
+
|
| 1634 |
+
echo "<b>$fcron</b>";
|
| 1635 |
+
|
| 1636 |
+
echo " - <a href='$fcron' target='_blank'>execute cron</a>";
|
| 1637 |
+
|
| 1638 |
+
echo " | <a href='index2.php?option=com_cloner&task=cron_delete&fconfig=$file'>delete config</a>";
|
| 1639 |
+
|
| 1640 |
+
echo "\n<br />";
|
| 1641 |
+
}
|
| 1642 |
+
}
|
| 1643 |
+
|
| 1644 |
+
closedir($handle);
|
| 1645 |
+
}
|
| 1646 |
+
?>
|
| 1647 |
+
</td>
|
| 1648 |
+
</tr>
|
| 1649 |
+
</table>
|
| 1650 |
+
</p></div>
|
| 1651 |
+
</div>
|
| 1652 |
+
|
| 1653 |
+
<div>
|
| 1654 |
+
<h3><a href="#"> <?php echo LM_CRON_SETTINGS?></a></h3>
|
| 1655 |
+
<div><p>
|
| 1656 |
+
<table class='adminform'>
|
| 1657 |
+
|
| 1658 |
+
<tr>
|
| 1659 |
+
<td width='250'>
|
| 1660 |
+
<?php echo LM_CRON_SEMAIL?>
|
| 1661 |
+
</td>
|
| 1662 |
+
<td>
|
| 1663 |
+
<input type=text size=30 value="<?php echo $_CONFIG[cron_logemail]?>" name='cron_logemail' > <br />
|
| 1664 |
+
<?php echo LM_CRON_SEMAIL_SUB?>
|
| 1665 |
+
</td>
|
| 1666 |
+
</tr>
|
| 1667 |
+
|
| 1668 |
+
<tr>
|
| 1669 |
+
<td>
|
| 1670 |
+
<?php echo LM_CRON_MODE?>
|
| 1671 |
+
</td>
|
| 1672 |
+
<td>
|
| 1673 |
+
|
| 1674 |
+
<div id="radio">
|
| 1675 |
+
<input id="radio1" type=radio size=50 value=0 name='cron_send' <?php if($_CONFIG[cron_send]==0) echo 'checked';?>>
|
| 1676 |
+
<label for="radio1"><?php echo LM_CONFIG_CRON_LOCAL?></label>
|
| 1677 |
+
<input id="radio2" type=radio size=50 value=1 name='cron_send' <?php if($_CONFIG[cron_send]==1) echo 'checked';?>>
|
| 1678 |
+
<label for="radio2"><?php echo LM_CONFIG_CRON_REMOTE?></label>
|
| 1679 |
+
<input id="radio3" type=radio size=50 value=2 name='cron_send' <?php if($_CONFIG[cron_send]==2) echo 'checked';?>>
|
| 1680 |
+
<label for="radio3"><?php echo LM_CONFIG_CRON_EMAIL?></label>
|
| 1681 |
+
</div>
|
| 1682 |
+
<?php echo LM_CRON_MODE_INFO?>
|
| 1683 |
+
</td>
|
| 1684 |
+
</tr>
|
| 1685 |
+
|
| 1686 |
+
|
| 1687 |
+
<tr>
|
| 1688 |
+
<td>
|
| 1689 |
+
<?php echo LM_CRON_TYPE?>
|
| 1690 |
+
</td>
|
| 1691 |
+
<td>
|
| 1692 |
+
<div id="radiob">
|
| 1693 |
+
<input id="radiob1" type=radio size=50 value=0 name='cron_btype' <?php if($_CONFIG[cron_btype]==0) echo 'checked';?>>
|
| 1694 |
+
<label for="radiob1"><?php echo LM_CONFIG_CRON_FULL?></label>
|
| 1695 |
+
<input id="radiob2" type=radio size=50 value=1 name='cron_btype' <?php if($_CONFIG[cron_btype]==1) echo 'checked';?>>
|
| 1696 |
+
<label for="radiob2"><?php echo LM_CONFIG_CRON_FILES?></label>
|
| 1697 |
+
<input id="radiob3" type=radio size=50 value=2 name='cron_btype' <?php if($_CONFIG[cron_btype]==2) echo 'checked';?>>
|
| 1698 |
+
<label for="radiob3"><?php echo LM_CONFIG_CRON_DATABASE?></label>
|
| 1699 |
+
<?php echo LM_CRON_TYPE_INFO?>
|
| 1700 |
+
</div>
|
| 1701 |
+
</td>
|
| 1702 |
+
</tr>
|
| 1703 |
+
|
| 1704 |
+
<tr>
|
| 1705 |
+
<td>
|
| 1706 |
+
<?php echo LM_CRON_BNAME?>
|
| 1707 |
+
</td>
|
| 1708 |
+
<td>
|
| 1709 |
+
<input type=text size=50 value="<?php echo $_CONFIG[cron_bname]?>" name='cron_bname' > <br />
|
| 1710 |
+
<?php echo LM_CRON_BNAME_SUB?>
|
| 1711 |
+
</td>
|
| 1712 |
+
</tr>
|
| 1713 |
+
|
| 1714 |
+
|
| 1715 |
+
<tr>
|
| 1716 |
+
<td>
|
| 1717 |
+
<?php echo LM_CRON_IP?>
|
| 1718 |
+
</td>
|
| 1719 |
+
<td>
|
| 1720 |
+
<textarea type=text size=50 name='cron_ip' cols='30' rows='5'><?php echo $_CONFIG[cron_ip]?></textarea> <br />
|
| 1721 |
+
<?php echo LM_CRON_IP_SUB?>
|
| 1722 |
+
</td>
|
| 1723 |
+
</tr>
|
| 1724 |
+
</table>
|
| 1725 |
+
</p></div>
|
| 1726 |
+
</div>
|
| 1727 |
+
|
| 1728 |
+
<div>
|
| 1729 |
+
<h3><a href="#"> <?php echo LM_CRON_FTP_DETAILS?></a></h3>
|
| 1730 |
+
<div><p>
|
| 1731 |
+
<table class='adminform'>
|
| 1732 |
+
|
| 1733 |
+
<tr>
|
| 1734 |
+
<td width='250'>
|
| 1735 |
+
<?php echo LM_CRON_FTP_SERVER?>
|
| 1736 |
+
</td>
|
| 1737 |
+
<td>
|
| 1738 |
+
<input type=text size=50 name='cron_ftp_server' value='<?php echo $_CONFIG[cron_ftp_server]?>'>
|
| 1739 |
+
</td>
|
| 1740 |
+
</tr>
|
| 1741 |
+
<tr>
|
| 1742 |
+
<td>
|
| 1743 |
+
<?php echo LM_CRON_FTP_USER?>
|
| 1744 |
+
</td>
|
| 1745 |
+
<td>
|
| 1746 |
+
<input type=text size=50 name='cron_ftp_user' value='<?php echo $_CONFIG[cron_ftp_user]?>'>
|
| 1747 |
+
</td>
|
| 1748 |
+
</tr>
|
| 1749 |
+
<tr>
|
| 1750 |
+
<td>
|
| 1751 |
+
<?php echo LM_CRON_FTP_PASS?>
|
| 1752 |
+
</td>
|
| 1753 |
+
<td>
|
| 1754 |
+
<input type=text size=50 name='cron_ftp_pass' value='<?php echo $_CONFIG[cron_ftp_pass]?>'>
|
| 1755 |
+
</td>
|
| 1756 |
+
</tr>
|
| 1757 |
+
<tr>
|
| 1758 |
+
<td>
|
| 1759 |
+
<?php echo LM_CRON_FTP_PATH?>
|
| 1760 |
+
</td>
|
| 1761 |
+
<td>
|
| 1762 |
+
<input type=text size=50 name='cron_ftp_path' value='<?php echo $_CONFIG[cron_ftp_path]?>'>
|
| 1763 |
+
</td>
|
| 1764 |
+
</tr>
|
| 1765 |
+
<tr>
|
| 1766 |
+
<td>
|
| 1767 |
+
<!--<?php echo LM_CRON_FTP_DELB?>-->
|
| 1768 |
+
</td>
|
| 1769 |
+
<td>
|
| 1770 |
+
<input id="cron_ftp_delb" type=checkbox name='cron_ftp_delb' <?php if($_CONFIG[cron_ftp_delb]==1) echo "checked";?> value='1'>
|
| 1771 |
+
<label for="cron_ftp_delb"><?php echo LM_CRON_FTP_DELB?></label>
|
| 1772 |
+
</td>
|
| 1773 |
+
</tr>
|
| 1774 |
+
</table>
|
| 1775 |
+
</p></div>
|
| 1776 |
+
</div>
|
| 1777 |
+
|
| 1778 |
+
<div>
|
| 1779 |
+
<h3><a href="#"> <?php echo LM_AMAZON_S3?></a></h3>
|
| 1780 |
+
<div><p>
|
| 1781 |
+
<table class='adminform'>
|
| 1782 |
+
|
| 1783 |
+
<tr>
|
| 1784 |
+
<td width='250'>
|
| 1785 |
+
<?php #echo LM_AMAZON_S3_ACTIVATE?>
|
| 1786 |
+
</td>
|
| 1787 |
+
<td>
|
| 1788 |
+
<label for="cron_amazon_active"><?php echo LM_AMAZON_S3_ACTIVATE?></label>
|
| 1789 |
+
<input id="cron_amazon_active" type=checkbox name='cron_amazon_active' <?php if($_CONFIG[cron_amazon_active]==1) echo "checked";?> value='1'>
|
| 1790 |
+
</td>
|
| 1791 |
+
</tr>
|
| 1792 |
|
| 1793 |
+
<tr>
|
| 1794 |
+
<td>
|
| 1795 |
+
<?php echo LM_AMAZON_S3_AWSACCESSKEY;?>
|
| 1796 |
+
</td>
|
| 1797 |
+
<td>
|
| 1798 |
+
<input type=text size=50 name='cron_amazon_awsAccessKey' value="<?php echo $_CONFIG['cron_amazon_awsAccessKey'];?>">
|
| 1799 |
+
</td>
|
| 1800 |
+
</tr>
|
| 1801 |
|
| 1802 |
+
<tr>
|
| 1803 |
+
<td>
|
| 1804 |
+
<?php echo LM_AMAZON_S3_AWSSECRETKEY;?>
|
| 1805 |
+
</td>
|
| 1806 |
+
<td>
|
| 1807 |
+
<input type=text size=50 name='cron_amazon_awsSecretKey' value="<?php echo $_CONFIG['cron_amazon_awsSecretKey'];?>">
|
| 1808 |
+
</td>
|
| 1809 |
+
</tr>
|
| 1810 |
|
| 1811 |
+
<tr>
|
| 1812 |
+
<td width='200'>
|
| 1813 |
+
<?php echo LM_AMAZON_S3_BUCKET;?>
|
| 1814 |
+
</td>
|
| 1815 |
+
<td>
|
| 1816 |
+
<input type=text size=50 name='cron_amazon_bucket' value="<?php echo $_CONFIG['cron_amazon_bucket'];?>">
|
| 1817 |
+
</td>
|
| 1818 |
+
</tr>
|
|
|
|
|
|
|
| 1819 |
|
| 1820 |
+
<tr>
|
| 1821 |
+
<td>
|
| 1822 |
+
<?php echo LM_AMAZON_S3_DIRNAME;?>
|
| 1823 |
+
</td>
|
| 1824 |
+
<td>
|
| 1825 |
+
<input type=text size=50 name='cron_amazon_dirname' value="<?php echo $_CONFIG['cron_amazon_dirname'];?>">
|
| 1826 |
+
</td>
|
| 1827 |
+
</tr>
|
| 1828 |
+
</tr>
|
| 1829 |
+
</table>
|
| 1830 |
+
</p></div>
|
| 1831 |
+
</div>
|
| 1832 |
+
|
| 1833 |
+
<div>
|
| 1834 |
+
<h3><a href="#"> <?php echo LM_CRON_EMAIL_DETAILS?></a></h3>
|
| 1835 |
+
<div><p>
|
| 1836 |
+
<table class='adminform'>
|
| 1837 |
+
|
| 1838 |
+
<tr>
|
| 1839 |
+
<td width="250">
|
| 1840 |
+
<?php echo LM_CRON_EMAIL_ACCOUNT?>
|
| 1841 |
+
</td>
|
| 1842 |
+
<td>
|
| 1843 |
+
<input type=text size=50 name='cron_email_address' value='<?php echo $_CONFIG[cron_email_address]?>'>
|
| 1844 |
+
</td>
|
| 1845 |
+
</tr>
|
| 1846 |
+
</table>
|
| 1847 |
+
</p></div>
|
| 1848 |
+
</div>
|
| 1849 |
+
|
| 1850 |
+
<div>
|
| 1851 |
+
<h3><a href="#"> <?php echo LM_CRON_MYSQL_DETAILS?></a></h3>
|
| 1852 |
+
<div><p>
|
| 1853 |
+
<table class='adminform'>
|
| 1854 |
+
|
| 1855 |
+
<tr bgcolor='#ffffff'>
|
| 1856 |
+
<td width='250'>
|
| 1857 |
+
<?php #echo LM_CRON_MYSQL_DROP?>
|
| 1858 |
+
</td>
|
| 1859 |
+
<td>
|
| 1860 |
+
<label for="cron_sql_drop"><?php echo LM_CRON_MYSQL_DROP?></label>
|
| 1861 |
+
<input id="cron_sql_drop" type=checkbox name='cron_sql_drop' value='1' <?php if($_CONFIG[cron_sql_drop]) echo "checked";?> >
|
| 1862 |
+
</td>
|
| 1863 |
+
</tr>
|
| 1864 |
+
|
| 1865 |
+
<?php
|
| 1866 |
+
if((abs($_CONFIG[system_mdatabases])==0) && ($_CONFIG[enable_db_backup]==1)){
|
| 1867 |
+
?>
|
| 1868 |
+
<tr><td valign='top'>
|
| 1869 |
+
<?php echo LM_DATABASE_INCLUDE_DATABASES?>
|
| 1870 |
+
</td><td>
|
| 1871 |
+
<select name='databases_incl[]' MULTIPLE SIZE=5>
|
| 1872 |
+
<?php
|
| 1873 |
+
|
| 1874 |
+
$curent_dbs = explode(",", $_CONFIG['databases_incl_list']);
|
| 1875 |
+
|
| 1876 |
+
$query = @mysql_query("SHOW databases");
|
| 1877 |
+
while($row = @mysql_fetch_array($query)){
|
| 1878 |
+
|
| 1879 |
+
$table = $row[0];
|
| 1880 |
+
|
| 1881 |
+
if($table != $_CONFIG['mysql_database'])
|
| 1882 |
+
|
| 1883 |
+
if(in_array($table, $curent_dbs)){
|
| 1884 |
+
|
| 1885 |
+
echo "<option value='".$table."' selected>$table</option>";
|
| 1886 |
+
|
| 1887 |
+
}else{
|
| 1888 |
+
|
| 1889 |
+
echo "<option value='".$table."'>$table</option>";
|
| 1890 |
|
| 1891 |
+
}
|
| 1892 |
+
}
|
| 1893 |
+
?>
|
| 1894 |
+
</select><br />
|
| 1895 |
+
<?php echo LM_DATABASE_INCLUDE_DATABASES_SUB?>
|
| 1896 |
+
</td></tr>
|
| 1897 |
+
<?php
|
| 1898 |
+
}
|
| 1899 |
+
?>
|
| 1900 |
+
</table>
|
| 1901 |
+
</p></div>
|
| 1902 |
+
</div>
|
| 1903 |
+
|
| 1904 |
+
<div>
|
| 1905 |
+
<h3><a href="#"> <?php echo LM_CRON_DELETE_FILES?></a></h3>
|
| 1906 |
+
<div><p>
|
| 1907 |
+
|
| 1908 |
+
<script>
|
| 1909 |
+
$(function() {
|
| 1910 |
+
$( "#slider2" ).slider({
|
| 1911 |
+
value:parseInt(<?php echo (int)$_CONFIG[cron_file_delete];?>),
|
| 1912 |
+
min: 0,
|
| 1913 |
+
max: 100,
|
| 1914 |
+
step: 1,
|
| 1915 |
+
slide: function( event, ui ) {
|
| 1916 |
+
$( "#cron_file_delete" ).val( ui.value );
|
| 1917 |
+
}
|
| 1918 |
+
});
|
| 1919 |
+
$( "#cron_file_delete" ).val( $( "#slider2" ).slider( "value" ) );
|
| 1920 |
+
});
|
| 1921 |
+
</script>
|
| 1922 |
+
|
| 1923 |
+
<table class='adminform'>
|
| 1924 |
+
|
| 1925 |
+
<tr>
|
| 1926 |
+
<td width='250'>
|
| 1927 |
+
<?php #echo LM_CRON_DELETE_FILES_SUB_ACTIVE?>
|
| 1928 |
+
</td>
|
| 1929 |
+
<td>
|
| 1930 |
+
<label for="cron_file_delete_act"><?php echo LM_CRON_DELETE_FILES_SUB_ACTIVE?></label>
|
| 1931 |
+
<input id="cron_file_delete_act" type=checkbox name='cron_file_delete_act' <?php if ($_CONFIG['cron_file_delete_act'] == 1) echo 'checked';?> value='1'>
|
| 1932 |
+
</td>
|
| 1933 |
+
</tr>
|
| 1934 |
+
<tr>
|
| 1935 |
+
<td>
|
| 1936 |
+
<?php echo LM_CRON_DELETE_FILES_SUB?>
|
| 1937 |
+
</td>
|
| 1938 |
+
<td>
|
| 1939 |
+
<div id="slider2" style="width:300px;padding-top:5px;"></div>
|
| 1940 |
+
<br /><label for="cron_file_delete"></label>
|
| 1941 |
+
<input id="cron_file_delete" size=5 name='cron_file_delete' value='<?php echo $_CONFIG[cron_file_delete]?>'> days:
|
| 1942 |
+
</td>
|
| 1943 |
+
</tr>
|
| 1944 |
+
</table>
|
| 1945 |
+
|
| 1946 |
+
<table class='adminform'>
|
| 1947 |
+
<tr>
|
| 1948 |
+
<th colspan='2'>
|
| 1949 |
+
<?php echo LM_CRON_EXCLUDE?>
|
| 1950 |
+
</th>
|
| 1951 |
+
</tr>
|
| 1952 |
+
</tr>
|
| 1953 |
+
<tr>
|
| 1954 |
+
<td width='250'>
|
| 1955 |
+
<?php echo LM_CRON_EXCLUDE_DIR?>
|
| 1956 |
+
</td>
|
| 1957 |
+
<td>
|
| 1958 |
+
<textarea cols=50 rows=5 name='cron_exclude'><?php echo $_CONFIG[cron_exclude]?></textarea>
|
| 1959 |
+
</td>
|
| 1960 |
+
</tr>
|
| 1961 |
+
|
| 1962 |
+
</table>
|
| 1963 |
+
</p></div>
|
| 1964 |
+
</div>
|
| 1965 |
+
|
| 1966 |
+
</div>
|
| 1967 |
+
<?php
|
| 1968 |
+
$tabs->endTab();
|
| 1969 |
+
$tabs->startTab(LM_TAB_INFO,"6");
|
| 1970 |
+
?>
|
| 1971 |
|
| 1972 |
+
<div id="configtabinside">
|
| 1973 |
+
<div>
|
| 1974 |
+
<h3><a href="#"><?php echo LM_CONFIG_INFO_PHP?></a></h3>
|
| 1975 |
+
<div><p>
|
| 1976 |
+
|
| 1977 |
+
<table class='adminform'>
|
| 1978 |
+
|
| 1979 |
+
<tr>
|
| 1980 |
+
<td width='250'>
|
| 1981 |
+
<?php echo LM_CONFIG_INFO_T_VERSION?>
|
| 1982 |
+
</td>
|
| 1983 |
+
<td>
|
| 1984 |
+
<b><?php
|
| 1985 |
+
$version = phpversion();
|
| 1986 |
+
$ver = str_replace(".", "", $version);
|
| 1987 |
+
$val = (version_compare(PHP_VERSION, '5.2.3') < 0)? $version: "Off";
|
| 1988 |
+
echo HTML_cloner::get_color($version, $val);
|
| 1989 |
+
?></b>
|
| 1990 |
+
<br />
|
| 1991 |
+
<?php echo LM_CONFIG_INFO_VERSION?>
|
| 1992 |
+
</td>
|
| 1993 |
+
</tr>
|
| 1994 |
+
|
| 1995 |
+
<tr>
|
| 1996 |
+
<td>
|
| 1997 |
+
<?php echo LM_CONFIG_INFO_T_SAFEMODE?>
|
| 1998 |
+
</td>
|
| 1999 |
+
<td>
|
| 2000 |
+
<b><?php $val = (ini_get('safe_mode') != "")? ini_get('safe_mode'):"Off";
|
| 2001 |
+
echo HTML_cloner::get_color($val, 'On');
|
| 2002 |
+
?></b>
|
| 2003 |
+
<br />
|
| 2004 |
+
<?php echo LM_CONFIG_INFO_SAFEMODE?>
|
| 2005 |
+
</td>
|
| 2006 |
+
</tr>
|
| 2007 |
+
|
| 2008 |
+
<tr>
|
| 2009 |
+
<td>
|
| 2010 |
+
<?php echo LM_CONFIG_INFO_T_MTIME?>
|
| 2011 |
+
</td>
|
| 2012 |
+
<td>
|
| 2013 |
+
<b><?php echo (ini_get('max_execution_time') != "")? ini_get('max_execution_time'):"no value";
|
| 2014 |
+
|
| 2015 |
+
?></b>
|
| 2016 |
+
<br />
|
| 2017 |
+
<?php echo LM_CONFIG_INFO_TIME?>
|
| 2018 |
+
</td>
|
| 2019 |
+
</tr>
|
| 2020 |
+
|
| 2021 |
+
<tr>
|
| 2022 |
+
<td>
|
| 2023 |
+
<?php echo LM_CONFIG_INFO_T_MEML?>
|
| 2024 |
+
</td>
|
| 2025 |
+
<td>
|
| 2026 |
+
<b><?php echo (ini_get('memory_limit') != "")? ini_get('memory_limit'):"no value";?> </b>
|
| 2027 |
+
<br />
|
| 2028 |
+
<?php echo LM_CONFIG_INFO_MEMORY?>
|
| 2029 |
+
</td>
|
| 2030 |
+
</tr>
|
| 2031 |
+
|
| 2032 |
+
<tr>
|
| 2033 |
+
<td>
|
| 2034 |
+
<?php echo LM_CONFIG_INFO_T_BDIR?>
|
| 2035 |
+
</td>
|
| 2036 |
+
<td>
|
| 2037 |
+
<b><?php $val = (ini_get('open_basedir') != "")? ini_get('open_basedir'):"no value";
|
| 2038 |
+
echo HTML_cloner::get_color($val, '/');
|
| 2039 |
+
?> </b>
|
| 2040 |
+
<br />
|
| 2041 |
+
<?php echo LM_CONFIG_INFO_BASEDIR?>
|
| 2042 |
+
</td>
|
| 2043 |
+
</tr>
|
| 2044 |
+
|
| 2045 |
+
<tr>
|
| 2046 |
+
<td>
|
| 2047 |
+
<?php echo LM_CONFIG_INFO_T_EXEC?>
|
| 2048 |
+
</td>
|
| 2049 |
+
<td>
|
| 2050 |
+
<b><?php
|
| 2051 |
+
|
| 2052 |
+
$out = "";
|
| 2053 |
+
if(function_exists("exec")){
|
| 2054 |
+
|
| 2055 |
+
$out = @exec("ls -al");
|
| 2056 |
+
}
|
| 2057 |
|
| 2058 |
+
$val = ($out != "")? "ENABLED":"<font color='red'>DISABLED</font>";
|
| 2059 |
+
echo HTML_cloner::get_color($val, 'DISABLED');
|
| 2060 |
+
?> </b>
|
| 2061 |
+
<br />
|
| 2062 |
+
<?php echo LM_CONFIG_INFO_EXEC?>
|
| 2063 |
+
</td>
|
| 2064 |
+
</tr>
|
| 2065 |
+
</table>
|
| 2066 |
+
</p></div>
|
| 2067 |
+
</div>
|
| 2068 |
+
<div>
|
| 2069 |
+
<h3><a href="#"><?php echo LM_CONFIG_INFO_PATHS?></a></h3>
|
| 2070 |
+
<div><p>
|
| 2071 |
+
<table class='adminform'>
|
| 2072 |
+
|
| 2073 |
+
<tr>
|
| 2074 |
+
<td width='250'>
|
| 2075 |
+
<?php echo LM_CONFIG_INFO_ROOT_BPATH_TMP?>
|
| 2076 |
+
</td>
|
| 2077 |
+
<td>
|
| 2078 |
+
<b><?php $tmp_dir = realpath($_CONFIG['backup_path']."/administrator/backups");
|
| 2079 |
+
echo (@is_writeable( $tmp_dir ))? $tmp_dir . " is <font color=green>writeable</font>":$tmp_dir. " <font color=red>incorrect or unreadable</font>";?></b>
|
| 2080 |
+
<br />
|
| 2081 |
+
<?php echo LM_CONFIG_INFO_ROOT_PATH_TMP_SUB?>
|
| 2082 |
+
</td>
|
| 2083 |
+
</tr>
|
| 2084 |
+
|
| 2085 |
+
<tr>
|
| 2086 |
+
<td>
|
| 2087 |
+
<?php echo LM_CONFIG_INFO_ROOT_BPATH?>
|
| 2088 |
+
</td>
|
| 2089 |
+
<td>
|
| 2090 |
+
<b><?php echo (@is_readable($_CONFIG['backup_path']) )? $_CONFIG['backup_path'] . " is <font color=green>readable</font>":$_CONFIG['backup_path']. " <font color=red>incorrect or unreadable</font>";?></b>
|
| 2091 |
+
<br />
|
| 2092 |
+
<?php echo LM_CONFIG_INFO_ROOT_PATH_SUB?>
|
| 2093 |
+
</td>
|
| 2094 |
+
</tr>
|
| 2095 |
+
|
| 2096 |
+
|
| 2097 |
+
<tr>
|
| 2098 |
+
<td>
|
| 2099 |
+
<?php echo LM_CONFIG_INFO_T_BPATH?>
|
| 2100 |
+
</td>
|
| 2101 |
+
<td>
|
| 2102 |
+
<b><?php echo (@is_writeable($_CONFIG['clonerPath']) )? $_CONFIG['clonerPath'] . " is <font color=green>writeable</font>":$_CONFIG['clonerPath']. " <font color=red>unwriteable</font>";?></b>
|
| 2103 |
+
<br />
|
| 2104 |
+
<?php echo LM_CONFIG_INFO_BPATH?>
|
| 2105 |
+
</td>
|
| 2106 |
+
</tr>
|
| 2107 |
+
|
| 2108 |
+
|
| 2109 |
+
<tr>
|
| 2110 |
+
<td>
|
| 2111 |
+
<?php echo LM_CONFIG_INFO_T_TAR?>
|
| 2112 |
+
</td>
|
| 2113 |
+
<td>
|
| 2114 |
+
<b><?php
|
| 2115 |
+
if(function_exists('exec')){
|
| 2116 |
+
$info_tar_path = explode(" ", @exec("whereis tar"));
|
| 2117 |
+
}
|
| 2118 |
+
echo ($info_tar_path['1'] != "")? $info_tar_path['1']:"unable to determine";
|
| 2119 |
+
?> </b>
|
| 2120 |
+
<br />
|
| 2121 |
+
<?php echo LM_CONFIG_INFO_TAR?>
|
| 2122 |
+
</td>
|
| 2123 |
+
</tr>
|
| 2124 |
+
|
| 2125 |
+
|
| 2126 |
+
<tr>
|
| 2127 |
+
<td>
|
| 2128 |
+
<?php echo LM_CONFIG_INFO_T_MSQL?>
|
| 2129 |
+
</td>
|
| 2130 |
+
<td>
|
| 2131 |
+
<b><?php
|
| 2132 |
+
if(function_exists('exec')){
|
| 2133 |
+
$info_msql_path = explode(" ", @exec("whereis mysqldump"));
|
| 2134 |
+
}
|
| 2135 |
+
echo ($info_msql_path['1'] != "")? $info_msql_path['1']:"unable to determine";
|
| 2136 |
+
?> </b>
|
| 2137 |
+
<br />
|
| 2138 |
+
<?php echo LM_CONFIG_INFO_MSQL?>
|
| 2139 |
+
</td>
|
| 2140 |
+
</tr>
|
| 2141 |
|
| 2142 |
+
</table>
|
| 2143 |
+
</p></div>
|
| 2144 |
|
| 2145 |
+
</div></div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2146 |
|
| 2147 |
+
<?php
|
| 2148 |
+
$tabs->endTab();
|
| 2149 |
+
$tabs->endPane();
|
| 2150 |
+
?>
|
| 2151 |
+
<input type="hidden" name="option" value="com_cloner" />
|
| 2152 |
+
<input type="hidden" name="task" value="config" />
|
| 2153 |
+
<input type="hidden" name='action' value='save'>
|
| 2154 |
+
</form>
|
| 2155 |
|
| 2156 |
+
<?php
|
| 2157 |
+
}
|
| 2158 |
|
| 2159 |
+
function get_color($val, $comp){
|
| 2160 |
|
| 2161 |
+
if(!stristr($val, $comp))
|
| 2162 |
+
echo "<span style='color:green'>$val</span>";
|
| 2163 |
+
else
|
| 2164 |
+
echo "<span style='color:red'>$val</span>";
|
| 2165 |
|
| 2166 |
+
}
|
|
|
|
| 2167 |
|
| 2168 |
+
function TransferForm($option, $files){
|
| 2169 |
+
global $baDownloadPath, $mosConfig_absolute_path, $clonerPath, $task;
|
| 2170 |
|
| 2171 |
+
?>
|
| 2172 |
+
<form action="index2.php" method="GET" name="adminForm">
|
| 2173 |
+
<script language="javascript" type="text/javascript">
|
| 2174 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2175 |
|
| 2176 |
+
function submitbutton(pressbutton) {
|
| 2177 |
+
var form = document.adminForm;
|
| 2178 |
+
if (pressbutton == 'cancel') {
|
| 2179 |
+
submitform( pressbutton );
|
| 2180 |
+
return;
|
| 2181 |
+
}
|
| 2182 |
|
| 2183 |
+
submitform( pressbutton );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2184 |
|
| 2185 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2186 |
|
| 2187 |
function gotocontact( id ) {
|
| 2188 |
var form = document.adminForm;
|
| 2272 |
<form action="index2.php" method="post" name="adminForm">
|
| 2273 |
<?php
|
| 2274 |
$tabs = new mosTabs(1);
|
| 2275 |
+
?>
|
| 2276 |
+
|
| 2277 |
+
<script>
|
| 2278 |
+
$(function() {
|
| 2279 |
+
$( "#tabs" ).tabs().find( ".ui-tabs-nav" ).sortable({ axis: "x" });
|
| 2280 |
+
$( "#radio_dbbackup" ).buttonset();
|
| 2281 |
+
$( "#radio_dbbackup1" ).button( { icons: {primary:'ui-icon-bullet'} } );
|
| 2282 |
+
$( "#radio_dbbackup2" ).button( { icons: {primary:'ui-icon-bullet'} } );
|
| 2283 |
+
});
|
| 2284 |
+
</script>
|
| 2285 |
+
|
| 2286 |
+
|
| 2287 |
+
<ul>
|
| 2288 |
+
<?php
|
| 2289 |
+
if($_CONFIG['enable_db_backup']){
|
| 2290 |
+
?>
|
| 2291 |
+
<li><a href="#tabs-users-databse-options-tab"><?php echo LM_TAB_G_DATABASE;?></a></li>
|
| 2292 |
+
<?php }?>
|
| 2293 |
+
<li><a href="#tabs-users-files-options-tab"><?php echo LM_TAB_G_FILES;?></a></li>
|
| 2294 |
+
<li><a href="#tabs-users-comments-options-tab"><?php echo LM_TAB_G_COMMENTS;?></a></li>
|
| 2295 |
+
</ul>
|
| 2296 |
+
|
| 2297 |
+
<?php
|
| 2298 |
+
#$tabs->startPane("BGeneratePane");
|
| 2299 |
if($_CONFIG['enable_db_backup']){
|
| 2300 |
$tabs->startTab(LM_TAB_G_DATABASE,"users-databse-options-tab");
|
| 2301 |
?>
|
| 2302 |
|
| 2303 |
+
<div id="radio_dbbackup">
|
| 2304 |
<table class="adminform">
|
| 2305 |
+
<!--<tr>
|
| 2306 |
<th colspan=2>
|
| 2307 |
+
<b><?php #echo LM_DATABASE_ARCHIVE; ?></b>
|
| 2308 |
</th>
|
| 2309 |
+
</tr>-->
|
|
|
|
|
|
|
|
|
|
| 2310 |
<tr>
|
| 2311 |
+
<td>
|
| 2312 |
+
<label for="radio_dbbackup1"><?php echo LM_CONFIRM_DATABASE; ?></label>
|
| 2313 |
+
<input id="radio_dbbackup1" type="checkbox" id="dbbackup" name="dbbackup" checked value="1" />
|
| 2314 |
+
<label for="radio_dbbackup2">Add DROP SYNTAX</label>
|
| 2315 |
+
<input id="radio_dbbackup2" type="checkbox" id="dbbackup_drop" name="dbbackup_drop" value="1" />
|
| 2316 |
+
</td>
|
| 2317 |
</tr>
|
| 2318 |
<tr>
|
| 2319 |
<td><?php echo "Mysql Compatibility"; ?>
|
| 2328 |
<?php echo LM_DATABASE_EXCLUDE_TABLES?>
|
| 2329 |
</th></tr>
|
| 2330 |
<tr><td>
|
| 2331 |
+
<?php echo LM_DATABASE_CURRENT?> <b><?php echo $_CONFIG['mysql_database'];?></b><br />
|
| 2332 |
<select name='excltables[]' MULTIPLE SIZE=15>
|
| 2333 |
<?php
|
| 2334 |
|
| 2357 |
|
| 2358 |
while($row = mysql_fetch_array($query)){
|
| 2359 |
|
| 2360 |
+
if($_CONFIG['mysql_database'] != $row[0])
|
| 2361 |
+
echo "<option value='".$row[0]."'>$row[0]</option>";
|
| 2362 |
|
| 2363 |
}
|
| 2364 |
|
| 2372 |
?>
|
| 2373 |
|
| 2374 |
</table>
|
| 2375 |
+
</div>
|
| 2376 |
<?php
|
| 2377 |
$tabs->endTab();
|
| 2378 |
}
|
| 2386 |
</tr>
|
| 2387 |
<tr>
|
| 2388 |
<td>
|
| 2389 |
+
<input type=text name='bname' value='' size=100><br/>
|
| 2390 |
<?php echo LM_BACKUP_NAME_SUB?>
|
| 2391 |
</td>
|
| 2392 |
</tr>
|
| 2420 |
?>
|
| 2421 |
|
| 2422 |
</table>
|
| 2423 |
+
<?php
|
| 2424 |
+
$tabs->endTab();
|
| 2425 |
+
$tabs->startTab(LM_TAB_G_COMMENTS,"users-comments-options-tab");
|
| 2426 |
+
?>
|
| 2427 |
+
<div class="mainText">
|
| 2428 |
+
<h2><?php echo LM_TAB_G_COMMENTS_H2?></h2>
|
| 2429 |
+
<textarea name="backupComments" rows=20 cols=80></textarea>
|
| 2430 |
+
<br /><small> <?php echo LM_TAB_G_COMMENTS_NOTE?></small>
|
| 2431 |
+
</div>
|
| 2432 |
<?php
|
| 2433 |
$tabs->endTab();
|
| 2434 |
$tabs->endPane();
|
| 2509 |
|
| 2510 |
function showHelp( $option ) {
|
| 2511 |
?>
|
| 2512 |
+
<script>
|
| 2513 |
+
$(function() {
|
| 2514 |
+
$( "#tabs" ).tabs();
|
| 2515 |
+
});
|
| 2516 |
+
</script>
|
| 2517 |
+
|
| 2518 |
+
<div id="tabs" >
|
| 2519 |
+
<ul>
|
| 2520 |
+
<li><a href="#tabs-1"><?php echo LM_CREDIT_TOP?></a></li>
|
| 2521 |
+
</ul>
|
| 2522 |
+
<div id="tabs-1" >
|
| 2523 |
+
<div class="mainText">
|
| 2524 |
+
|
| 2525 |
+
<?php echo LM_CLONER_ABOUT?>
|
| 2526 |
+
</div>
|
| 2527 |
+
</div>
|
| 2528 |
+
</div>
|
| 2529 |
<form action="index2.php" name="adminForm" method="post">
|
| 2530 |
<input type="hidden" name="option" value="<?php echo $option; ?>"/>
|
| 2531 |
<input type="hidden" name="task" value=""/>
|
| 2540 |
|
| 2541 |
?>
|
| 2542 |
|
| 2543 |
+
<script>
|
| 2544 |
+
$(function() {
|
| 2545 |
+
$( "#tabs" ).tabs();
|
| 2546 |
+
});
|
| 2547 |
+
</script>
|
| 2548 |
+
|
| 2549 |
+
<div id="tabs">
|
| 2550 |
+
<ul>
|
| 2551 |
+
<li><a href="#tabs-1"><?php echo LM_RESTORE_TOP?></a></li>
|
| 2552 |
+
</ul>
|
| 2553 |
+
<div id="tabs-1"><p class="mainText">
|
| 2554 |
+
<table border="0" align="center" cellspacing="0" cellpadding="2" width="100%" class="adminform">
|
| 2555 |
+
<tr>
|
| 2556 |
+
<td>
|
| 2557 |
+
<?php echo LM_CLONER_RESTORE?>
|
| 2558 |
+
</td>
|
| 2559 |
+
</tr>
|
| 2560 |
+
</table>
|
| 2561 |
+
</p></div>
|
| 2562 |
+
</div>
|
| 2563 |
<form action="index2.php" name="adminForm" method="post">
|
| 2564 |
<input type="hidden" name="option" value="<?php echo $option; ?>"/>
|
| 2565 |
<input type="hidden" name="task" value=""/>
|
| 2572 |
// ----------------------------------------------------------
|
| 2573 |
|
| 2574 |
?>
|
| 2575 |
+
<script>
|
| 2576 |
+
$(function() {
|
| 2577 |
+
$( "#tabs" ).tabs();
|
| 2578 |
+
});
|
| 2579 |
+
</script>
|
| 2580 |
+
|
| 2581 |
+
<div id="tabs">
|
| 2582 |
+
<ul>
|
| 2583 |
+
<li><a href="#tabs-1"><?php echo LM_CREDIT_TOP?></a></li>
|
| 2584 |
+
</ul>
|
| 2585 |
+
<div id="tabs-1"><p class="mainText">
|
| 2586 |
+
<table border="0" align="center" cellspacing="0" cellpadding="2" width="100%" class="adminform">
|
| 2587 |
+
<tr>
|
| 2588 |
+
<td>
|
| 2589 |
+
<?echo LM_CLONER_CREDITS?>
|
| 2590 |
+
</td>
|
| 2591 |
+
</tr>
|
| 2592 |
+
</table>
|
| 2593 |
+
</p></div>
|
| 2594 |
+
</div>
|
| 2595 |
<form action="index2.php" name="adminForm" method="post">
|
| 2596 |
<input type="hidden" name="option" value="<?php echo $option; ?>"/>
|
| 2597 |
<input type="hidden" name="task" value=""/>
|
admin.cloner.php
CHANGED
|
@@ -1,202 +1,218 @@
|
|
| 1 |
<?php
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
if (!is_array($cid)) {
|
| 76 |
-
$cid = array(0);
|
| 77 |
-
}
|
| 78 |
|
| 79 |
if(!$_REQUEST['nohtml'])
|
| 80 |
if (($task != 'download') and (($_REQUEST['task']!="refresh") or (!$_CONFIG['refresh_mode'])))
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
|
| 124 |
-
|
| 125 |
-
|
| 126 |
-
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
|
| 130 |
-
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
|
| 134 |
-
|
| 135 |
-
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
|
| 139 |
-
|
| 140 |
-
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
|
| 155 |
-
|
| 156 |
-
|
| 157 |
-
|
| 158 |
-
|
| 159 |
-
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
|
| 163 |
-
|
| 164 |
-
|
| 165 |
-
|
| 166 |
-
|
| 167 |
-
|
| 168 |
-
|
| 169 |
-
|
| 170 |
-
|
| 171 |
-
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
|
| 179 |
-
|
| 180 |
-
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
|
| 184 |
-
|
| 185 |
-
|
| 186 |
-
|
| 187 |
-
|
| 188 |
-
|
| 189 |
-
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
|
| 200 |
-
|
| 201 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 202 |
?>
|
| 1 |
<?php
|
| 2 |
+
/*
|
| 3 |
+
* admin.cloner.php
|
| 4 |
+
*
|
| 5 |
+
* Copyright 2011 Ovidiu Liuta <info@thinkovi.com>
|
| 6 |
+
*
|
| 7 |
+
* This program is free software; you can redistribute it and/or modify
|
| 8 |
+
* it under the terms of the GNU General Public License as published by
|
| 9 |
+
* the Free Software Foundation; either version 2 of the License, or
|
| 10 |
+
* (at your option) any later version.
|
| 11 |
+
*
|
| 12 |
+
* This program is distributed in the hope that it will be useful,
|
| 13 |
+
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 14 |
+
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 15 |
+
* GNU General Public License for more details.
|
| 16 |
+
*
|
| 17 |
+
* You should have received a copy of the GNU General Public License
|
| 18 |
+
* along with this program; if not, write to the Free Software
|
| 19 |
+
* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston,
|
| 20 |
+
* MA 02110-1301, USA.
|
| 21 |
+
*/
|
| 22 |
+
|
| 23 |
+
|
| 24 |
+
session_start();
|
| 25 |
+
@set_time_limit("3600");
|
| 26 |
+
@error_reporting(E_ALL ^ E_NOTICE);
|
| 27 |
+
|
| 28 |
+
define("_VALID_MOS", 1);
|
| 29 |
+
|
| 30 |
+
//load configuration
|
| 31 |
+
$config_file = "cloner.config.php";
|
| 32 |
+
require_once($config_file);
|
| 33 |
+
require_once("restore/TAR.php");
|
| 34 |
+
require_once("cloner.functions.php");
|
| 35 |
+
require_once("admin.cloner.html.php");
|
| 36 |
+
require_once("common.php");
|
| 37 |
+
|
| 38 |
+
//Doing some basic authentification
|
| 39 |
+
if ((!isset($_SESSION['clone'])) && ($task != 'dologin')) {
|
| 40 |
+
$task = 'login';
|
| 41 |
+
|
| 42 |
+
HTML_cloner::header();
|
| 43 |
+
|
| 44 |
+
HTML_cloner::Login();
|
| 45 |
+
|
| 46 |
+
HTML_cloner::footer();
|
| 47 |
+
|
| 48 |
+
exit;
|
| 49 |
+
} elseif ($task == 'dologin') {
|
| 50 |
+
if (($_REQUEST['username'] == $_CONFIG['jcuser']) && (md5($_REQUEST['password']) == $_CONFIG['jcpass'])) {
|
| 51 |
+
if (function_exists('session_register')) {
|
| 52 |
+
@session_register('clone');
|
| 53 |
+
}
|
| 54 |
+
$_SESSION['clone'] = 1;
|
| 55 |
+
|
| 56 |
+
mosRedirect('index2.php?option=' . $option, "Welcome to XCloner backend");
|
| 57 |
+
} else {
|
| 58 |
+
|
| 59 |
+
|
| 60 |
+
mosRedirect('index2.php?option=' . $option, "Incorrect username and/or password");
|
| 61 |
+
}
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
//###########GLOBALS in effect
|
| 65 |
+
$GLOBALS['lang_dir'] = $lang_dir;
|
| 66 |
+
//###########
|
| 67 |
+
$lang_array = get_avalaible_langs();
|
| 68 |
+
|
| 69 |
+
|
| 70 |
+
// retrieve row selection from forms
|
| 71 |
+
$cid = $_REQUEST['cid'];
|
| 72 |
+
if (!is_array($cid)) {
|
| 73 |
+
$cid = array(0);
|
| 74 |
+
}
|
|
|
|
|
|
|
|
|
|
| 75 |
|
| 76 |
if(!$_REQUEST['nohtml'])
|
| 77 |
if (($task != 'download') and (($_REQUEST['task']!="refresh") or (!$_CONFIG['refresh_mode'])))
|
| 78 |
+
HTML_cloner::header();
|
| 79 |
+
|
| 80 |
+
//########## SETTING THE GLOBALS VARIABLES #########################
|
| 81 |
+
|
| 82 |
+
$GLOBALS['joomla_compatible'] = $joomla_compatible;
|
| 83 |
+
|
| 84 |
+
$GLOBALS['_CONFIG'] = $_CONFIG;
|
| 85 |
+
|
| 86 |
+
$GLOBALS['clonerPath'] = $clonerPath;
|
| 87 |
+
|
| 88 |
+
$GLOBALS['baDownloadPath'] = $baDownloadPath;
|
| 89 |
+
|
| 90 |
+
$GLOBALS['config_file'] = $config_file;
|
| 91 |
+
|
| 92 |
+
$GLOBALS['lang_array'] = $lang_array;
|
| 93 |
+
|
| 94 |
+
openXLog();
|
| 95 |
+
|
| 96 |
+
// process the workflow selection
|
| 97 |
+
switch ($task) {
|
| 98 |
+
case 'rename_save':
|
| 99 |
+
case 'rename':
|
| 100 |
+
clone_rename($option);
|
| 101 |
+
break;
|
| 102 |
+
case 'action':
|
| 103 |
+
action($option);
|
| 104 |
+
break;
|
| 105 |
+
|
| 106 |
+
|
| 107 |
+
case 'cancel_lang':
|
| 108 |
+
mosRedirect('index2.php?option=' . $option . "&task=lang");
|
| 109 |
+
break;
|
| 110 |
+
case 'add_lang':
|
| 111 |
+
case 'add_lang_new':
|
| 112 |
+
translator_add($option, $task);
|
| 113 |
+
break;
|
| 114 |
+
case 'save_lang_apply':
|
| 115 |
+
case 'save_lang':
|
| 116 |
+
case 'edit_lang':
|
| 117 |
+
translator_edit($option, $task);
|
| 118 |
+
break;
|
| 119 |
+
|
| 120 |
+
|
| 121 |
+
case 'del_lang':
|
| 122 |
+
case 'lang':
|
| 123 |
+
translator($option);
|
| 124 |
+
break;
|
| 125 |
+
|
| 126 |
+
case 'recurse_database';
|
| 127 |
+
goRecurseDatabases();
|
| 128 |
+
break;
|
| 129 |
+
|
| 130 |
+
case 'recurse_files':
|
| 131 |
+
goRecurseFiles();
|
| 132 |
+
break;
|
| 133 |
+
|
| 134 |
+
case 'cleanup':
|
| 135 |
+
include_once("classes/main.class.php");
|
| 136 |
+
$main = new Main();
|
| 137 |
+
$main->init($_CONFIG);
|
| 138 |
+
$main->cleanUp();
|
| 139 |
+
break;
|
| 140 |
+
|
| 141 |
+
case 'refresh':
|
| 142 |
+
generateBackuprefresh($cid, $option, $_REQUEST['backup'], $_CONFIG['refresh_mode']);
|
| 143 |
+
break;
|
| 144 |
+
|
| 145 |
+
case 'generate':
|
| 146 |
+
if($_CONFIG['refresh_mode']){
|
| 147 |
+
$_REQUEST['mode'] = "start";
|
| 148 |
+
if($_CONFIG['enable_db_backup'])
|
| 149 |
+
goRecurseDatabases();
|
| 150 |
+
//initBackup($_REQUEST['bname']);
|
| 151 |
+
//break;
|
| 152 |
+
}
|
| 153 |
+
generateBackup($cid, $option);
|
| 154 |
+
break;
|
| 155 |
+
|
| 156 |
+
case 'confirm':
|
| 157 |
+
deleteXLog();
|
| 158 |
+
confirmBackup($option);
|
| 159 |
+
break;
|
| 160 |
+
case 'download':
|
| 161 |
+
downloadBackup($_REQUEST[file]);
|
| 162 |
+
break;
|
| 163 |
+
case 'cron':
|
| 164 |
+
HTML_cloner::Cron();
|
| 165 |
+
break;
|
| 166 |
+
case 'about':
|
| 167 |
+
case 'credits':
|
| 168 |
+
showHelp($option);
|
| 169 |
+
break;
|
| 170 |
+
case 'restore':
|
| 171 |
+
HTML_cloner::Restore($option);
|
| 172 |
+
break;
|
| 173 |
+
|
| 174 |
+
case 'cron_delete':
|
| 175 |
+
if (unlink($_CONFIG['multiple_config_dir'] . "/" . $_REQUEST['fconfig']))
|
| 176 |
+
$msg = " was deleted";
|
| 177 |
+
else
|
| 178 |
+
$msg = " was not deleted, please delete it manually!";
|
| 179 |
+
|
| 180 |
+
mosRedirect('index2.php?option=' . $option . "&task=config", $_REQUEST['fconfig'] . $msg);
|
| 181 |
+
break;
|
| 182 |
+
|
| 183 |
+
case 'remove':
|
| 184 |
+
deleteBackups($cid, $option);
|
| 185 |
+
break;
|
| 186 |
+
case 'continue':
|
| 187 |
+
case 'move':
|
| 188 |
+
case 'clone':
|
| 189 |
+
moveBackup($option);
|
| 190 |
+
break;
|
| 191 |
+
|
| 192 |
+
case 'cancel':
|
| 193 |
+
mosRedirect('index2.php?option=' . $option);
|
| 194 |
+
break;
|
| 195 |
+
case 'config':
|
| 196 |
+
config($option);
|
| 197 |
+
break;
|
| 198 |
+
case 'rename_cancel':
|
| 199 |
+
mosRedirect('index2.php?option=' . $option . "&task=view");
|
| 200 |
+
break;
|
| 201 |
+
case 'show':
|
| 202 |
+
case 'view':
|
| 203 |
+
showBackups($option);
|
| 204 |
+
break;
|
| 205 |
+
case 'logout':
|
| 206 |
+
doLogout();
|
| 207 |
+
break;
|
| 208 |
+
default:
|
| 209 |
+
fdefault();
|
| 210 |
+
break;
|
| 211 |
+
}
|
| 212 |
+
|
| 213 |
+
closeXLog();
|
| 214 |
+
if(!$_REQUEST['nohtml'])
|
| 215 |
+
HTML_cloner::footer();
|
| 216 |
+
|
| 217 |
+
@mysql_close($link);
|
| 218 |
?>
|
admin.xcloner-backupandrestore.php
ADDED
|
@@ -0,0 +1,5 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
print "<iframe src='components/com_xcloner-backupandrestore/index.php' width='100%' height='900' frameborder=0 marginWidth=0 frameSpacing=0 marginHeight=110 ></iframe>";
|
| 4 |
+
|
| 5 |
+
?>
|
browser/files_inpage.php
CHANGED
|
@@ -1,18 +1,25 @@
|
|
| 1 |
<?php
|
| 2 |
@ini_set("error_reporting", "2");
|
| 3 |
|
|
|
|
|
|
|
| 4 |
$thisApp=$_SERVER['PHP_SELF'] . "?browse=true";
|
| 5 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 6 |
if(isset($_GET['browse'])){
|
| 7 |
$dir = isset($_GET['dir']) ? $_GET['dir'] : '/files';
|
| 8 |
if(strpos($dir, "../")===true){
|
| 9 |
exit;
|
| 10 |
-
|
| 11 |
-
|
| 12 |
}else{
|
| 13 |
|
| 14 |
echo "Please wait... we are loading the folder structure";
|
| 15 |
|
| 16 |
}
|
| 17 |
|
| 18 |
-
?>
|
| 1 |
<?php
|
| 2 |
@ini_set("error_reporting", "2");
|
| 3 |
|
| 4 |
+
define("_VALID_MOS", 1);
|
| 5 |
+
|
| 6 |
$thisApp=$_SERVER['PHP_SELF'] . "?browse=true";
|
| 7 |
|
| 8 |
+
$fp = @fopen($_CONFIG['exfile'], "w");
|
| 9 |
+
if($fp){
|
| 10 |
+
@fwrite($fp, $_CONFIG['cron_exclude']);
|
| 11 |
+
@fclose($fp);
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
if(isset($_GET['browse'])){
|
| 15 |
$dir = isset($_GET['dir']) ? $_GET['dir'] : '/files';
|
| 16 |
if(strpos($dir, "../")===true){
|
| 17 |
exit;
|
| 18 |
+
}
|
|
|
|
| 19 |
}else{
|
| 20 |
|
| 21 |
echo "Please wait... we are loading the folder structure";
|
| 22 |
|
| 23 |
}
|
| 24 |
|
| 25 |
+
?>
|
browser/files_xml.php
CHANGED
|
@@ -10,6 +10,14 @@
|
|
| 10 |
* Date: November 2010
|
| 11 |
**/
|
| 12 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 13 |
header("Cache-Control: no-cache");
|
| 14 |
header("Pragma: nocache");
|
| 15 |
header("Content-Type: text/xml");
|
|
@@ -22,7 +30,7 @@ if($_COOKIE["auth_clone"] != 1){
|
|
| 22 |
exit;
|
| 23 |
}
|
| 24 |
|
| 25 |
-
|
| 26 |
include("../cloner.config.php");
|
| 27 |
include("../common.php");
|
| 28 |
|
|
@@ -45,15 +53,15 @@ $path = $_REQUEST['path'];
|
|
| 45 |
$loc = $_REQUEST['dir'];
|
| 46 |
|
| 47 |
if(!is_dir($_CONFIG['backup_path'])){
|
| 48 |
-
|
| 49 |
echo "<directory location=\"Error: Directory $_CONFIG[backup_path] does not exist!\"></directory>";
|
| 50 |
exit;
|
| 51 |
-
|
| 52 |
}elseif(!is_readable($_CONFIG['backup_path'])){
|
| 53 |
-
|
| 54 |
echo "<directory location=\"Error: Directory $_CONFIG[backup_path] is not readable!\"></directory>";
|
| 55 |
exit;
|
| 56 |
-
|
| 57 |
}
|
| 58 |
|
| 59 |
|
|
@@ -70,8 +78,8 @@ elseif($_REQUEST['act'] == "uncheckall"){
|
|
| 70 |
|
| 71 |
if($loc == "")
|
| 72 |
$loc = "/";
|
| 73 |
-
|
| 74 |
-
|
| 75 |
$data = "";
|
| 76 |
|
| 77 |
if($fp = @fopen($exfile,"r")){
|
|
@@ -84,7 +92,6 @@ fclose($fp);
|
|
| 84 |
$_COOKIES = explode("\r\n", $data);
|
| 85 |
|
| 86 |
|
| 87 |
-
|
| 88 |
$exc = 0;
|
| 89 |
|
| 90 |
if($fp = @fopen($exfile,"w")){
|
|
@@ -127,10 +134,10 @@ fclose($fp);
|
|
| 127 |
|
| 128 |
}
|
| 129 |
else{
|
| 130 |
-
|
| 131 |
echo "<directory location=\"Error: Unable to write to file $exfile\"></directory>";
|
| 132 |
exit;
|
| 133 |
-
|
| 134 |
}
|
| 135 |
|
| 136 |
$_COOKIES = explode("\r\n", $data);
|
|
@@ -187,7 +194,7 @@ sort($exclude);
|
|
| 187 |
$check = 'checked';
|
| 188 |
else
|
| 189 |
$check = '';
|
| 190 |
-
|
| 191 |
echo "<file check='$check' link=\"#\">".htmlspecialchars($file)."</file>";
|
| 192 |
|
| 193 |
}
|
|
@@ -202,7 +209,7 @@ sort($exclude);
|
|
| 202 |
|
| 203 |
function check($loc, $exfile, $act ){
|
| 204 |
global $_CONFIG;
|
| 205 |
-
|
| 206 |
$fulldir = $loc;
|
| 207 |
$flist = array();
|
| 208 |
$_COOKIES = array();
|
|
@@ -235,7 +242,7 @@ function check($loc, $exfile, $act ){
|
|
| 235 |
if($act == 1){
|
| 236 |
|
| 237 |
$flist = @array_merge($_COOKIES, $flist);
|
| 238 |
-
|
| 239 |
}
|
| 240 |
else{
|
| 241 |
|
| 10 |
* Date: November 2010
|
| 11 |
**/
|
| 12 |
|
| 13 |
+
define("_VALID_MOS", 1);
|
| 14 |
+
|
| 15 |
+
session_start();
|
| 16 |
+
if(!isset($_SESSION['clone'])){
|
| 17 |
+
echo "Not Authorized";
|
| 18 |
+
exit;
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
header("Cache-Control: no-cache");
|
| 22 |
header("Pragma: nocache");
|
| 23 |
header("Content-Type: text/xml");
|
| 30 |
exit;
|
| 31 |
}
|
| 32 |
|
| 33 |
+
|
| 34 |
include("../cloner.config.php");
|
| 35 |
include("../common.php");
|
| 36 |
|
| 53 |
$loc = $_REQUEST['dir'];
|
| 54 |
|
| 55 |
if(!is_dir($_CONFIG['backup_path'])){
|
| 56 |
+
|
| 57 |
echo "<directory location=\"Error: Directory $_CONFIG[backup_path] does not exist!\"></directory>";
|
| 58 |
exit;
|
| 59 |
+
|
| 60 |
}elseif(!is_readable($_CONFIG['backup_path'])){
|
| 61 |
+
|
| 62 |
echo "<directory location=\"Error: Directory $_CONFIG[backup_path] is not readable!\"></directory>";
|
| 63 |
exit;
|
| 64 |
+
|
| 65 |
}
|
| 66 |
|
| 67 |
|
| 78 |
|
| 79 |
if($loc == "")
|
| 80 |
$loc = "/";
|
| 81 |
+
|
| 82 |
+
|
| 83 |
$data = "";
|
| 84 |
|
| 85 |
if($fp = @fopen($exfile,"r")){
|
| 92 |
$_COOKIES = explode("\r\n", $data);
|
| 93 |
|
| 94 |
|
|
|
|
| 95 |
$exc = 0;
|
| 96 |
|
| 97 |
if($fp = @fopen($exfile,"w")){
|
| 134 |
|
| 135 |
}
|
| 136 |
else{
|
| 137 |
+
|
| 138 |
echo "<directory location=\"Error: Unable to write to file $exfile\"></directory>";
|
| 139 |
exit;
|
| 140 |
+
|
| 141 |
}
|
| 142 |
|
| 143 |
$_COOKIES = explode("\r\n", $data);
|
| 194 |
$check = 'checked';
|
| 195 |
else
|
| 196 |
$check = '';
|
| 197 |
+
|
| 198 |
echo "<file check='$check' link=\"#\">".htmlspecialchars($file)."</file>";
|
| 199 |
|
| 200 |
}
|
| 209 |
|
| 210 |
function check($loc, $exfile, $act ){
|
| 211 |
global $_CONFIG;
|
| 212 |
+
|
| 213 |
$fulldir = $loc;
|
| 214 |
$flist = array();
|
| 215 |
$_COOKIES = array();
|
| 242 |
if($act == 1){
|
| 243 |
|
| 244 |
$flist = @array_merge($_COOKIES, $flist);
|
| 245 |
+
|
| 246 |
}
|
| 247 |
else{
|
| 248 |
|
browser/xmlhttp.js
CHANGED
|
@@ -35,7 +35,7 @@ function processXMLRequest() {
|
|
| 35 |
|
| 36 |
function do_browser(){
|
| 37 |
targetDiv=document.getElementById("browser");
|
| 38 |
-
|
| 39 |
if(loadXMLDoc("browser/files_xml.php")){
|
| 40 |
targetDiv.className="searching";
|
| 41 |
targetDiv.innerHTML="";
|
|
@@ -102,7 +102,7 @@ function checkc(value){
|
|
| 102 |
function useXML(xmlInfo){
|
| 103 |
targetDiv.className="";
|
| 104 |
message = "";
|
| 105 |
-
|
| 106 |
var infoTags=xmlInfo.getElementsByTagName("directory");
|
| 107 |
var loc=infoTags[0].getAttribute("location");
|
| 108 |
if(loc == "")
|
|
@@ -124,11 +124,11 @@ function useXML(xmlInfo){
|
|
| 124 |
|
| 125 |
var newloc="browser/files_xml.php?dir=" + loc ;
|
| 126 |
path = loc+"/"+node.firstChild.nodeValue;
|
| 127 |
-
|
| 128 |
if(node.nodeName=="file"){
|
| 129 |
|
| 130 |
stringHTML=stringHTML+"<li class=\"file\"><img src='browser/file.gif' border='0'><input type=checkbox "+node.getAttribute('check')+" onclick=\"loadXMLDoc('" + newloc +"&path="+path+"')\" name=cid[] value='"+path+"'><a href=\"" +node.getAttribute('link')+ "\">"+node.firstChild.nodeValue+"</a></li>";
|
| 131 |
-
|
| 132 |
}
|
| 133 |
if(node.nodeName=="message"){
|
| 134 |
|
|
@@ -150,5 +150,5 @@ function useXML(xmlInfo){
|
|
| 150 |
}
|
| 151 |
|
| 152 |
//stringHTML = stringHTML+ "</form>";
|
| 153 |
-
targetDiv.innerHTML= "<table align='right' width='
|
| 154 |
}
|
| 35 |
|
| 36 |
function do_browser(){
|
| 37 |
targetDiv=document.getElementById("browser");
|
| 38 |
+
|
| 39 |
if(loadXMLDoc("browser/files_xml.php")){
|
| 40 |
targetDiv.className="searching";
|
| 41 |
targetDiv.innerHTML="";
|
| 102 |
function useXML(xmlInfo){
|
| 103 |
targetDiv.className="";
|
| 104 |
message = "";
|
| 105 |
+
|
| 106 |
var infoTags=xmlInfo.getElementsByTagName("directory");
|
| 107 |
var loc=infoTags[0].getAttribute("location");
|
| 108 |
if(loc == "")
|
| 124 |
|
| 125 |
var newloc="browser/files_xml.php?dir=" + loc ;
|
| 126 |
path = loc+"/"+node.firstChild.nodeValue;
|
| 127 |
+
|
| 128 |
if(node.nodeName=="file"){
|
| 129 |
|
| 130 |
stringHTML=stringHTML+"<li class=\"file\"><img src='browser/file.gif' border='0'><input type=checkbox "+node.getAttribute('check')+" onclick=\"loadXMLDoc('" + newloc +"&path="+path+"')\" name=cid[] value='"+path+"'><a href=\"" +node.getAttribute('link')+ "\">"+node.firstChild.nodeValue+"</a></li>";
|
| 131 |
+
|
| 132 |
}
|
| 133 |
if(node.nodeName=="message"){
|
| 134 |
|
| 150 |
}
|
| 151 |
|
| 152 |
//stringHTML = stringHTML+ "</form>";
|
| 153 |
+
targetDiv.innerHTML= "<table align='right' width='450'><tr><td align='right'><b>" + "Excluded items list:" + "</b><br />"+ message+"</td></tr></table>" + stringHTML ;
|
| 154 |
}
|
classes/S3.php
CHANGED
|
@@ -28,6 +28,9 @@
|
|
| 28 |
* Amazon S3 is a trademark of Amazon.com, Inc. or its affiliates.
|
| 29 |
*/
|
| 30 |
|
|
|
|
|
|
|
|
|
|
| 31 |
/**
|
| 32 |
* Amazon S3 PHP class
|
| 33 |
*
|
|
@@ -794,7 +797,7 @@ class S3 {
|
|
| 794 |
}
|
| 795 |
array_push($policy->conditions, array('content-length-range', 0, $maxFileSize));
|
| 796 |
$policy = base64_encode(str_replace('\/', '/', json_encode($policy)));
|
| 797 |
-
|
| 798 |
// Create parameters
|
| 799 |
$params = new stdClass;
|
| 800 |
$params->AWSAccessKeyId = self::$__accessKey;
|
| 28 |
* Amazon S3 is a trademark of Amazon.com, Inc. or its affiliates.
|
| 29 |
*/
|
| 30 |
|
| 31 |
+
/** ensure this file is being included by a parent file */
|
| 32 |
+
defined( '_VALID_MOS' ) or die( 'Direct Access to this location is not allowed.' );
|
| 33 |
+
|
| 34 |
/**
|
| 35 |
* Amazon S3 PHP class
|
| 36 |
*
|
| 797 |
}
|
| 798 |
array_push($policy->conditions, array('content-length-range', 0, $maxFileSize));
|
| 799 |
$policy = base64_encode(str_replace('\/', '/', json_encode($policy)));
|
| 800 |
+
|
| 801 |
// Create parameters
|
| 802 |
$params = new stdClass;
|
| 803 |
$params->AWSAccessKeyId = self::$__accessKey;
|
administrator/backups/.excl → classes/error.class.php
RENAMED
|
File without changes
|
classes/fileRecursion.php
CHANGED
|
@@ -27,6 +27,7 @@ class fileRecursion{
|
|
| 27 |
|
| 28 |
private static $fp;
|
| 29 |
private static $fpd;
|
|
|
|
| 30 |
private static $d_arr;
|
| 31 |
private static $f_arr;
|
| 32 |
private static $BACKUP_EXTENSIONS = array("tar", "zip", "tgz", "tar.gz");
|
|
@@ -39,17 +40,22 @@ class fileRecursion{
|
|
| 39 |
public static $TEMP_EXCL = "tmp/.excl";
|
| 40 |
public static $TEMP_DIR = "/opt/lampp/htdocs/joomla/administrator/backups"; //exclude other backups
|
| 41 |
public static $START_DIR = "/"; # Backups Start Dir
|
|
|
|
|
|
|
| 42 |
|
| 43 |
|
| 44 |
|
| 45 |
-
public static function setData($
|
| 46 |
|
| 47 |
-
self::$TEMP_PERM
|
| 48 |
-
self::$TEMP_EXCL
|
| 49 |
-
self::$TEMP_D_ARR
|
| 50 |
-
self::$TEMP_DIR
|
| 51 |
-
self::$START_DIR
|
|
|
|
|
|
|
| 52 |
}
|
|
|
|
| 53 |
/*
|
| 54 |
* Init the recursion system
|
| 55 |
* name: init
|
|
@@ -74,6 +80,7 @@ class fileRecursion{
|
|
| 74 |
|
| 75 |
self::$fp = fopen(self::$TEMP_PERM, "a");
|
| 76 |
self::$fpd = fopen(self::$TEMP_D_ARR, "w");
|
|
|
|
| 77 |
|
| 78 |
self::initEXCL();
|
| 79 |
|
|
@@ -84,6 +91,20 @@ class fileRecursion{
|
|
| 84 |
|
| 85 |
}
|
| 86 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 87 |
/*
|
| 88 |
* Count the number of files saved in TEMP_PERM
|
| 89 |
* name: countPermFiles
|
|
@@ -327,6 +348,23 @@ class fileRecursion{
|
|
| 327 |
|
| 328 |
}
|
| 329 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 330 |
/*
|
| 331 |
* Writing file details(path, permissions, size) to file
|
| 332 |
*
|
|
@@ -338,12 +376,23 @@ class fileRecursion{
|
|
| 338 |
public static function writePermFile($file, $append = "", $force = 0){
|
| 339 |
|
| 340 |
$file = realpath($file);
|
|
|
|
| 341 |
if((self::isNotExcluded($file)) or ($force)){
|
|
|
|
| 342 |
$fperm = substr(sprintf('%o', @fileperms($file)), -4);
|
| 343 |
$fsize = self::getFileSize($file);
|
| 344 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 345 |
$file = str_replace(self::$START_DIR, "", str_replace("\\","/", $file));
|
| 346 |
-
|
| 347 |
fwrite(self::$fp, $file."|".$fperm."|".$fsize."|".$append."\n");
|
| 348 |
self::debug($file ." added to list");
|
| 349 |
}
|
| 27 |
|
| 28 |
private static $fp;
|
| 29 |
private static $fpd;
|
| 30 |
+
private static $fpe;
|
| 31 |
private static $d_arr;
|
| 32 |
private static $f_arr;
|
| 33 |
private static $BACKUP_EXTENSIONS = array("tar", "zip", "tgz", "tar.gz");
|
| 40 |
public static $TEMP_EXCL = "tmp/.excl";
|
| 41 |
public static $TEMP_DIR = "/opt/lampp/htdocs/joomla/administrator/backups"; //exclude other backups
|
| 42 |
public static $START_DIR = "/"; # Backups Start Dir
|
| 43 |
+
public static $EXCLUDE_FILES_SIZE = -1; //disabled
|
| 44 |
+
public static $TEMP_OVERSIZED_FILE = "tmp/.oversized_files";
|
| 45 |
|
| 46 |
|
| 47 |
|
| 48 |
+
public static function setData($data) {
|
| 49 |
|
| 50 |
+
self::$TEMP_PERM = $data['TEMP_PERM'];
|
| 51 |
+
self::$TEMP_EXCL = $data['TEMP_EXCL'];
|
| 52 |
+
self::$TEMP_D_ARR = $data['TEMP_D_ARR'];
|
| 53 |
+
self::$TEMP_DIR = $data['TEMP_DIR'];
|
| 54 |
+
self::$START_DIR = $data['START_DIR'];
|
| 55 |
+
self::$EXCLUDE_FILES_SIZE = $data['EXCLUDE_FILES_SIZE'];
|
| 56 |
+
self::$TEMP_OVERSIZED_FILE = $data['TEMP_OVERSIZED_FILE'];
|
| 57 |
}
|
| 58 |
+
|
| 59 |
/*
|
| 60 |
* Init the recursion system
|
| 61 |
* name: init
|
| 80 |
|
| 81 |
self::$fp = fopen(self::$TEMP_PERM, "a");
|
| 82 |
self::$fpd = fopen(self::$TEMP_D_ARR, "w");
|
| 83 |
+
self::$fpe = fopen(self::$TEMP_OVERSIZED_FILE, "a");
|
| 84 |
|
| 85 |
self::initEXCL();
|
| 86 |
|
| 91 |
|
| 92 |
}
|
| 93 |
|
| 94 |
+
/*
|
| 95 |
+
* We close the stuff left opened
|
| 96 |
+
* name: close
|
| 97 |
+
* @param
|
| 98 |
+
* @return
|
| 99 |
+
*/
|
| 100 |
+
public static function close(){
|
| 101 |
+
|
| 102 |
+
@fclose(self::$fp );
|
| 103 |
+
@fclose(self::$fpd );
|
| 104 |
+
@fclose(self::$fpe );
|
| 105 |
+
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
/*
|
| 109 |
* Count the number of files saved in TEMP_PERM
|
| 110 |
* name: countPermFiles
|
| 348 |
|
| 349 |
}
|
| 350 |
|
| 351 |
+
public static function getOverLimitFiles(){
|
| 352 |
+
@fclose(self::$fpe);
|
| 353 |
+
$files = explode("\n", file_get_contents(self::$TEMP_OVERSIZED_FILE));
|
| 354 |
+
|
| 355 |
+
return array_diff($files, array(""));
|
| 356 |
+
}
|
| 357 |
+
|
| 358 |
+
public static function writeExcludedFile($file, $fsize = 0){
|
| 359 |
+
|
| 360 |
+
self::debug("Excluded $file from list as it is bigger than ". self::$EXCLUDE_FILES_SIZE." MB!!!");
|
| 361 |
+
|
| 362 |
+
if(self::$fpe){
|
| 363 |
+
fwrite(self::$fpe, $file."\t(".$fsize." bytes)\n");
|
| 364 |
+
}
|
| 365 |
+
|
| 366 |
+
}
|
| 367 |
+
|
| 368 |
/*
|
| 369 |
* Writing file details(path, permissions, size) to file
|
| 370 |
*
|
| 376 |
public static function writePermFile($file, $append = "", $force = 0){
|
| 377 |
|
| 378 |
$file = realpath($file);
|
| 379 |
+
|
| 380 |
if((self::isNotExcluded($file)) or ($force)){
|
| 381 |
+
// we check if file is not excluded
|
| 382 |
$fperm = substr(sprintf('%o', @fileperms($file)), -4);
|
| 383 |
$fsize = self::getFileSize($file);
|
| 384 |
+
$sizeLimit = (self::$EXCLUDE_FILES_SIZE)*1024*1024; // we limit by MB
|
| 385 |
+
|
| 386 |
+
if(intval(self::$EXCLUDE_FILES_SIZE) > -1){
|
| 387 |
+
if(($fsize > $sizeLimit) and is_file($file)){
|
| 388 |
+
//we check if file is larger than $EXCLUDE_FILES_SIZE
|
| 389 |
+
self::writeExcludedFile($file, $fsize);
|
| 390 |
+
return;
|
| 391 |
+
}
|
| 392 |
+
}
|
| 393 |
+
|
| 394 |
$file = str_replace(self::$START_DIR, "", str_replace("\\","/", $file));
|
| 395 |
+
|
| 396 |
fwrite(self::$fp, $file."|".$fperm."|".$fsize."|".$append."\n");
|
| 397 |
self::debug($file ." added to list");
|
| 398 |
}
|
classes/index.html
CHANGED
|
File without changes
|
classes/main.class.php
ADDED
|
@@ -0,0 +1,116 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/*
|
| 3 |
+
* main.class.php
|
| 4 |
+
*
|
| 5 |
+
* Copyright 2011 Ovidiu Liuta <info@thinkovi.com>
|
| 6 |
+
*
|
| 7 |
+
* This program is free software; you can redistribute it and/or modify
|
| 8 |
+
* it under the terms of the GNU General Public License as published by
|
| 9 |
+
* the Free Software Foundation; either version 2 of the License, or
|
| 10 |
+
* (at your option) any later version.
|
| 11 |
+
*
|
| 12 |
+
* This program is distributed in the hope that it will be useful,
|
| 13 |
+
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 14 |
+
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 15 |
+
* GNU General Public License for more details.
|
| 16 |
+
*
|
| 17 |
+
* You should have received a copy of the GNU General Public License
|
| 18 |
+
* along with this program; if not, write to the Free Software
|
| 19 |
+
* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston,
|
| 20 |
+
* MA 02110-1301, USA.
|
| 21 |
+
*/
|
| 22 |
+
|
| 23 |
+
class Main{
|
| 24 |
+
|
| 25 |
+
public static $_CONFIG;
|
| 26 |
+
|
| 27 |
+
|
| 28 |
+
/*
|
| 29 |
+
*
|
| 30 |
+
* name: init
|
| 31 |
+
* @param
|
| 32 |
+
* @return
|
| 33 |
+
*/
|
| 34 |
+
public static function init($_CONFIG){
|
| 35 |
+
self::$_CONFIG = $_CONFIG;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
/*
|
| 39 |
+
*
|
| 40 |
+
* name: unknown
|
| 41 |
+
* @param
|
| 42 |
+
* @return
|
| 43 |
+
*/
|
| 44 |
+
public static function initBackup($backupName){
|
| 45 |
+
|
| 46 |
+
self::generateBackupName($backupName);
|
| 47 |
+
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
/*
|
| 51 |
+
* Will cleanup the temporary directory
|
| 52 |
+
*
|
| 53 |
+
* name: cleanUp
|
| 54 |
+
* @param
|
| 55 |
+
* @return
|
| 56 |
+
*/
|
| 57 |
+
public static function cleanUp(){
|
| 58 |
+
|
| 59 |
+
$dir = self::$_CONFIG['temp_dir'] ;
|
| 60 |
+
|
| 61 |
+
if (@is_dir($dir)) {
|
| 62 |
+
if ($dh = @opendir($dir)) {
|
| 63 |
+
while (($file = @readdir($dh)) !== false) {
|
| 64 |
+
if(($file!=".") and ($file!="..")){
|
| 65 |
+
if(($file[0] == ".") and ($file[0] != ".htaccess"))
|
| 66 |
+
//cleanup temp files
|
| 67 |
+
@unlink($dir."/".$file);
|
| 68 |
+
elseif(strstr( $file, "-sql.sql") != "")
|
| 69 |
+
//cleanup sql files
|
| 70 |
+
@unlink($dir."/".$file);
|
| 71 |
+
|
| 72 |
+
}
|
| 73 |
+
}
|
| 74 |
+
closedir($dh);
|
| 75 |
+
}
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
public static function generateBackupName($backupName, $backupDatabase = 0, $dbbackup_drop = 0){
|
| 81 |
+
|
| 82 |
+
$domainname = $_SERVER['HTTP_HOST'];
|
| 83 |
+
|
| 84 |
+
if ((self::$_CONFIG['mem']) && ($_CONFIG['backup_refresh'])) {
|
| 85 |
+
$f_ext = '.tar';
|
| 86 |
+
$_CONFIG['tarcompress'] = '';
|
| 87 |
+
} elseif (self::$_CONFIG['backup_compress']) {
|
| 88 |
+
$f_ext = '.tgz';
|
| 89 |
+
$_CONFIG['tarcompress'] = 'z';
|
| 90 |
+
} else {
|
| 91 |
+
$f_ext = '.tar';
|
| 92 |
+
$_CONFIG['tarcompress'] = '';
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
|
| 96 |
+
if ($backupName == "") {
|
| 97 |
+
if ($backupDatabase == 1) {
|
| 98 |
+
if ($_REQUEST['dbbackup_drop']) {
|
| 99 |
+
$filename = 'backup_' . date("Y-m-d_H-i") . '_' . $domainname . '-sql-drop' . $f_ext;
|
| 100 |
+
} else {
|
| 101 |
+
$filename = 'backup_' . date("Y-m-d_H-i") . '_' . $domainname . '-sql-nodrop' . $f_ext;
|
| 102 |
+
}
|
| 103 |
+
} else
|
| 104 |
+
$filename = 'backup_' . date("Y-m-d_H-i") . '_' . $domainname . '-nosql' . $f_ext;
|
| 105 |
+
} else {
|
| 106 |
+
$filename = $_REQUEST['bname'] . $f_ext;
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
return $filename;
|
| 110 |
+
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
|
| 116 |
+
?>
|
classes/mysqlBackup.class.php
ADDED
|
@@ -0,0 +1,488 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/*
|
| 3 |
+
* mysqlBackup.class.php
|
| 4 |
+
*
|
| 5 |
+
* Copyright 2011 Ovidiu Liuta <info@thinkovi.com>
|
| 6 |
+
*
|
| 7 |
+
* This program is free software; you can redistribute it and/or modify
|
| 8 |
+
* it under the terms of the GNU General Public License as published by
|
| 9 |
+
* the Free Software Foundation; either version 2 of the License, or
|
| 10 |
+
* (at your option) any later version.
|
| 11 |
+
*
|
| 12 |
+
* This program is distributed in the hope that it will be useful,
|
| 13 |
+
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 14 |
+
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 15 |
+
* GNU General Public License for more details.
|
| 16 |
+
*
|
| 17 |
+
* You should have received a copy of the GNU General Public License
|
| 18 |
+
* along with this program; if not, write to the Free Software
|
| 19 |
+
* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston,
|
| 20 |
+
* MA 02110-1301, USA.
|
| 21 |
+
*/
|
| 22 |
+
|
| 23 |
+
|
| 24 |
+
class DB{
|
| 25 |
+
|
| 26 |
+
public static $dbHostname = "localhost";
|
| 27 |
+
public static $dbUsername = "root";
|
| 28 |
+
public static $dbPassword = "";
|
| 29 |
+
public static $dbDatabase = "";
|
| 30 |
+
public static $excludedTables = array();
|
| 31 |
+
|
| 32 |
+
public static $debug = 0;
|
| 33 |
+
public static $recordsPerSession = 10000;
|
| 34 |
+
public static $dbCompatibility = "";
|
| 35 |
+
public static $dbDropSyntax = 0;
|
| 36 |
+
public static $countRecords = 0;
|
| 37 |
+
|
| 38 |
+
private static $link;
|
| 39 |
+
private static $db_selected;
|
| 40 |
+
|
| 41 |
+
public static $TEMP_DBPROCESS_FILE = "tmp/.database";
|
| 42 |
+
public static $TEMP_DUMP_FILE = "tmp/database-sql.sql";
|
| 43 |
+
|
| 44 |
+
/*
|
| 45 |
+
*Return any error
|
| 46 |
+
*
|
| 47 |
+
* name: error
|
| 48 |
+
* @param string $message
|
| 49 |
+
* @return
|
| 50 |
+
*/
|
| 51 |
+
public function error($message, $force = ""){
|
| 52 |
+
|
| 53 |
+
$return = "";
|
| 54 |
+
$date = date("M j, Y @ H:i:s");
|
| 55 |
+
|
| 56 |
+
if((self::$debug) && ($force)){
|
| 57 |
+
//we have debug message as force is 1
|
| 58 |
+
printf("Debug(%s) - %s \n", $date, $message);
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
if(!$force){
|
| 62 |
+
//we have an error message
|
| 63 |
+
printf("Error(%s) - %s \n", $date, $message);
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
return;
|
| 67 |
+
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
/*
|
| 71 |
+
* Initialize the database connection
|
| 72 |
+
*
|
| 73 |
+
* name: init
|
| 74 |
+
* @param array $data {'dbHostname', 'dbUsername', 'dbPassword', 'dbDatabase'}
|
| 75 |
+
* @return
|
| 76 |
+
*/
|
| 77 |
+
public function init($data, $start = 0){
|
| 78 |
+
|
| 79 |
+
self::$dbHostname = $data['dbHostname'];
|
| 80 |
+
self::$dbUsername = $data['dbUsername'];
|
| 81 |
+
self::$dbPassword = $data['dbPassword'];
|
| 82 |
+
self::$dbDatabase = $data['dbDatabase'];
|
| 83 |
+
self::$excludedTables = $data['excludedTables'];
|
| 84 |
+
self::$TEMP_DBPROCESS_FILE = $data['TEMP_DBPROCESS_FILE'];
|
| 85 |
+
self::$TEMP_DUMP_FILE = $data['TEMP_DUMP_FILE'];
|
| 86 |
+
self::$recordsPerSession = $data['recordsPerSession'];
|
| 87 |
+
self::$dbCompatibility = $data['dbCompatibility'];
|
| 88 |
+
self::$dbDropSyntax = $data['dbDropSyntax'];
|
| 89 |
+
|
| 90 |
+
self::connect();
|
| 91 |
+
self::headers();
|
| 92 |
+
|
| 93 |
+
if($start){
|
| 94 |
+
@unlink(self::$TEMP_DBPROCESS_FILE);
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
}
|
| 98 |
+
|
| 99 |
+
/*
|
| 100 |
+
* Connect to the database
|
| 101 |
+
*
|
| 102 |
+
* name: connect
|
| 103 |
+
* @param
|
| 104 |
+
* @return
|
| 105 |
+
*/
|
| 106 |
+
public function connect(){
|
| 107 |
+
|
| 108 |
+
self::$link = mysql_connect(self::$dbHostname, self::$dbUsername, self::$dbPassword);
|
| 109 |
+
if (!self::$link) {
|
| 110 |
+
self::error('Could not connect: ' . mysql_error());
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
if(self::$dbDatabase != ""){
|
| 114 |
+
self::$db_selected = mysql_select_db(self::$dbDatabase, self::$link);
|
| 115 |
+
if (!self::$db_selected) {
|
| 116 |
+
self::error ('Can\'t use foo : ' . mysql_error());
|
| 117 |
+
}
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
/*
|
| 123 |
+
* Disconnect from the database
|
| 124 |
+
*
|
| 125 |
+
* name: disconnect
|
| 126 |
+
* @param
|
| 127 |
+
* @return
|
| 128 |
+
*/
|
| 129 |
+
public function disconnect(){
|
| 130 |
+
|
| 131 |
+
mysql_close(self::$link);
|
| 132 |
+
|
| 133 |
+
}
|
| 134 |
+
|
| 135 |
+
/*
|
| 136 |
+
* Send some special headers after the connection is initialized
|
| 137 |
+
*
|
| 138 |
+
* name: headers
|
| 139 |
+
* @param
|
| 140 |
+
* @return
|
| 141 |
+
*/
|
| 142 |
+
private function headers(){
|
| 143 |
+
|
| 144 |
+
self::query("SET SQL_QUOTE_SHOW_CREATE=1;");
|
| 145 |
+
self::query("SET sql_mode = 0;");
|
| 146 |
+
mysql_set_charset('utf8', self::$link);
|
| 147 |
+
if (self::$dbCompatibility)
|
| 148 |
+
self::query("SET sql_mode=" . self::$dbCompatibility . ";");
|
| 149 |
+
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
/*
|
| 153 |
+
* Run a mysql qeury
|
| 154 |
+
*
|
| 155 |
+
* name: query
|
| 156 |
+
* @param string $query Query to run
|
| 157 |
+
* @return $result or false
|
| 158 |
+
*/
|
| 159 |
+
public function query($query){
|
| 160 |
+
|
| 161 |
+
$result = mysql_query($query.";", self::$link);
|
| 162 |
+
self::error($query, 1);
|
| 163 |
+
|
| 164 |
+
if (!$result) {
|
| 165 |
+
self::error('Invalid query: ' . mysql_error());
|
| 166 |
+
return false;
|
| 167 |
+
}
|
| 168 |
+
else{
|
| 169 |
+
return $result;
|
| 170 |
+
}
|
| 171 |
+
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
|
| 175 |
+
/*
|
| 176 |
+
* Returns an array of tables from a database and mark $2excluded ones
|
| 177 |
+
*
|
| 178 |
+
* name: lisTables
|
| 179 |
+
* @param array $excluded array of tables to mark as excluded
|
| 180 |
+
* @return array $tablesList
|
| 181 |
+
*/
|
| 182 |
+
public function listTables($excluded){
|
| 183 |
+
|
| 184 |
+
$tablesList = array("");
|
| 185 |
+
$inc = 0;
|
| 186 |
+
|
| 187 |
+
$result = self::query("SHOW TABLES in `".self::$dbDatabase."`");
|
| 188 |
+
|
| 189 |
+
while ($row = mysql_fetch_array($result)){
|
| 190 |
+
$tablesList[$inc]['table'] = $row[0];
|
| 191 |
+
|
| 192 |
+
if(is_array($excluded))
|
| 193 |
+
if( in_array($row[0], $excluded) )
|
| 194 |
+
$tablesList[$inc]['excluded'] = 1;
|
| 195 |
+
$inc++;
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
return $tablesList;
|
| 199 |
+
|
| 200 |
+
}
|
| 201 |
+
|
| 202 |
+
public function writeTempFile(){
|
| 203 |
+
|
| 204 |
+
$tables = self::listTables(self::$excludedTables);
|
| 205 |
+
|
| 206 |
+
$fp = fopen(self::$TEMP_DBPROCESS_FILE, "a");
|
| 207 |
+
|
| 208 |
+
if($fp){
|
| 209 |
+
|
| 210 |
+
fwrite($fp, sprintf("###newdump###\t%s\t%s\n", self::$dbDatabase, self::$TEMP_DUMP_FILE));
|
| 211 |
+
|
| 212 |
+
// write this to the class and write to $TEMP_DBPROCESS_FILE file as database.table records
|
| 213 |
+
foreach($tables as $key=>$table) if($table!= ""){
|
| 214 |
+
|
| 215 |
+
$tables[$key]['records'] = 0;
|
| 216 |
+
|
| 217 |
+
if(!$tables[$key]['excluded'])
|
| 218 |
+
$tables[$key]['records'] = self::countRecords($tables[$key]['table']);
|
| 219 |
+
|
| 220 |
+
$tmp = sprintf("`%s`.`%s`\t%s\t%s\n", self::$dbDatabase, $tables[$key]['table'], $tables[$key]['records'], $tables[$key]['excluded']);
|
| 221 |
+
fwrite($fp, $tmp);
|
| 222 |
+
}
|
| 223 |
+
|
| 224 |
+
fwrite($fp, "###enddump###\n");
|
| 225 |
+
fclose($fp);
|
| 226 |
+
}
|
| 227 |
+
else{
|
| 228 |
+
self::error("Unable to open for writing file ".self::$TEMP_DBPROCESS_FILE);
|
| 229 |
+
}
|
| 230 |
+
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
/*
|
| 234 |
+
* Returns the number of records from a table
|
| 235 |
+
*
|
| 236 |
+
* name: countRecords
|
| 237 |
+
* @param string $table - the source table
|
| 238 |
+
* @return int $count
|
| 239 |
+
*/
|
| 240 |
+
public function countRecords($table){
|
| 241 |
+
|
| 242 |
+
$table = "`".self::$dbDatabase."`.`$table`";
|
| 243 |
+
|
| 244 |
+
$result = self::query("SELECT count(*) FROM $table;");
|
| 245 |
+
|
| 246 |
+
$count = mysql_fetch_row($result);
|
| 247 |
+
|
| 248 |
+
return intval($count[0]) ;// not max limit on 32 bit systems 2147483647; on 64 bit 9223372036854775807
|
| 249 |
+
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
/*
|
| 253 |
+
* Processing the mysql backup incrementally
|
| 254 |
+
*
|
| 255 |
+
* name: processIncremental
|
| 256 |
+
* @param
|
| 257 |
+
* int $startAtLine - at which line from the perm.txt file to start reading
|
| 258 |
+
* int startAtRecord - at which record to start from the table found at $startAtLine
|
| 259 |
+
* string $dumpfie - where to save the data
|
| 260 |
+
* string $dbCompatibility - MYSQL40, MYSQ32, none=default
|
| 261 |
+
* int $dbDropSyntax - check if the DROP TABLE syntax should be added
|
| 262 |
+
* @return array $return
|
| 263 |
+
*/
|
| 264 |
+
public function processIncremental($startAtLine= 0, $startAtRecord = 0, $dumpfile = "", $dbCompatibility= "", $dbDropSyntax= ""){
|
| 265 |
+
|
| 266 |
+
$count = 0;
|
| 267 |
+
$return = array();
|
| 268 |
+
|
| 269 |
+
self::error("Starting new process at line $startAtLine from record $startAtRecord", 1);
|
| 270 |
+
|
| 271 |
+
$fp = fopen(self::$TEMP_DBPROCESS_FILE, "r");
|
| 272 |
+
if($fp){
|
| 273 |
+
|
| 274 |
+
while (($buffer = fgets($fp, 4096)) !== false){
|
| 275 |
+
|
| 276 |
+
if($count == $startAtLine){
|
| 277 |
+
|
| 278 |
+
$buffer = str_replace("\n", "", $buffer);
|
| 279 |
+
$tableInfo =explode("\t", $buffer);
|
| 280 |
+
//print_r($tableInfo);
|
| 281 |
+
if($tableInfo[0] == "###newdump###"){
|
| 282 |
+
// we create a new mysql dump file
|
| 283 |
+
if($dumpfile != ""){
|
| 284 |
+
// we finished a previous one and write the footers
|
| 285 |
+
$return['dumpsize'] = self::dataFooters($dumpfile);
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
$dump = fopen($tableInfo[2], "w");
|
| 289 |
+
fwrite($dump, self::dataHeaders($tableInfo[1]));
|
| 290 |
+
$startAtLine++;
|
| 291 |
+
fclose($dump);
|
| 292 |
+
$dumpfile = $tableInfo[2];
|
| 293 |
+
|
| 294 |
+
$return['newDump'] = 1;
|
| 295 |
+
//break;
|
| 296 |
+
}
|
| 297 |
+
else{
|
| 298 |
+
//we export the table
|
| 299 |
+
if($tableInfo[0] == "###enddump###")
|
| 300 |
+
$return['endDump'] = 1;
|
| 301 |
+
|
| 302 |
+
$fd = fopen($dumpfile, "a");
|
| 303 |
+
|
| 304 |
+
if($fd){
|
| 305 |
+
|
| 306 |
+
$next = $startAtRecord + self::$recordsPerSession;
|
| 307 |
+
// $tableInfo[1] number of records in the table
|
| 308 |
+
$table = explode("`.`", $tableInfo[0]);
|
| 309 |
+
$tableName = str_replace("`", "", $table[1]);
|
| 310 |
+
$databaseName = str_replace("`", "", $table[0]);
|
| 311 |
+
|
| 312 |
+
//return something to the browser
|
| 313 |
+
$return['tableName'] = $tableName;
|
| 314 |
+
$return['databaseName'] = $databaseName;
|
| 315 |
+
$return['totalRecords'] = $tableInfo[1];
|
| 316 |
+
|
| 317 |
+
//if(intval($return['totalRecords']) != 0)
|
| 318 |
+
if(trim($tableName) != "")
|
| 319 |
+
self::exportTable($databaseName, $tableName, $startAtRecord, self::$recordsPerSession, $fd);
|
| 320 |
+
|
| 321 |
+
fclose($fd);
|
| 322 |
+
|
| 323 |
+
if($next > $tableInfo[1]) //we finished loading the records for next sessions, will go to the new record
|
| 324 |
+
{
|
| 325 |
+
$startAtLine ++;
|
| 326 |
+
$startAtRecord = 0;
|
| 327 |
+
}else{
|
| 328 |
+
$startAtRecord = $startAtRecord + self::$recordsPerSession;
|
| 329 |
+
}
|
| 330 |
+
|
| 331 |
+
//$return['dbCompatibility'] = self::$dbCompatibility;
|
| 332 |
+
//$return['dbDropSyntax'] = self::$dbDropSyntax;
|
| 333 |
+
$return['startAtLine'] = $startAtLine;
|
| 334 |
+
$return['startAtRecord'] = $startAtRecord;
|
| 335 |
+
$return['dumpfile'] = $dumpfile;
|
| 336 |
+
|
| 337 |
+
return $return;
|
| 338 |
+
break;
|
| 339 |
+
|
| 340 |
+
}else{
|
| 341 |
+
self::error("Unable to open for writing file $dumpfile");
|
| 342 |
+
}
|
| 343 |
+
}
|
| 344 |
+
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
$count++;
|
| 348 |
+
|
| 349 |
+
|
| 350 |
+
}
|
| 351 |
+
|
| 352 |
+
//while is finished, lets go home...
|
| 353 |
+
if($dumpfile != ""){
|
| 354 |
+
// we finished a previous one and write the footers
|
| 355 |
+
$return['dumpsize'] = self::dataFooters($dumpfile);
|
| 356 |
+
}
|
| 357 |
+
$return['finished'] = 1;
|
| 358 |
+
$return['startAtLine'] = $startAtLine;
|
| 359 |
+
|
| 360 |
+
return $return;
|
| 361 |
+
|
| 362 |
+
}else{
|
| 363 |
+
self::error("Unable to open for reading file ".self::$TEMP_DBPROCESS_FILE);
|
| 364 |
+
}
|
| 365 |
+
|
| 366 |
+
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
+
|
| 370 |
+
/*
|
| 371 |
+
* Exporting the table records
|
| 372 |
+
*
|
| 373 |
+
* name: exportTable
|
| 374 |
+
* @param
|
| 375 |
+
* string $databaseName - database name of the table
|
| 376 |
+
* string tableName - table name
|
| 377 |
+
* int $start - where to start from
|
| 378 |
+
* int $limit - how many records
|
| 379 |
+
* handler $fd - file handler where to write the records
|
| 380 |
+
* @return
|
| 381 |
+
*/
|
| 382 |
+
public function exportTable($databaseName, $tableName, $start, $limit, $fd){
|
| 383 |
+
|
| 384 |
+
if($start == 0)
|
| 385 |
+
self::dumpStructure($databaseName, $tableName, $fd);
|
| 386 |
+
|
| 387 |
+
$start = intval($start);
|
| 388 |
+
$limit = intval($limit);
|
| 389 |
+
//exporting the table content now
|
| 390 |
+
|
| 391 |
+
$result = self::query("SELECT * from `$databaseName`.`$tableName` Limit $start, $limit ;");
|
| 392 |
+
if($result){
|
| 393 |
+
while($row = mysql_fetch_array($result, MYSQL_ASSOC)){
|
| 394 |
+
|
| 395 |
+
fwrite($fd, "INSERT INTO `$tableName` VALUES (");
|
| 396 |
+
$arr = $row;
|
| 397 |
+
$buffer = "";
|
| 398 |
+
self::$countRecords++;
|
| 399 |
+
|
| 400 |
+
foreach ($arr as $key => $value) {
|
| 401 |
+
$value = mysql_escape_string($value);
|
| 402 |
+
$buffer .= "'".$value."', ";
|
| 403 |
+
}
|
| 404 |
+
$buffer = rtrim($buffer, ', ') . ");\n";
|
| 405 |
+
fwrite($fd, $buffer);
|
| 406 |
+
unset($buffer);
|
| 407 |
+
|
| 408 |
+
}
|
| 409 |
+
}
|
| 410 |
+
|
| 411 |
+
}
|
| 412 |
+
|
| 413 |
+
public function dumpStructure($databaseName, $tableName ,$fd){
|
| 414 |
+
|
| 415 |
+
fwrite($fd, "\n#\n# Table structure for table `$tableName`\n#\n\n");
|
| 416 |
+
|
| 417 |
+
if (self::$dbDropSyntax)
|
| 418 |
+
fwrite($fd, "\nDROP table IF EXISTS `$tableName`;\n");
|
| 419 |
+
|
| 420 |
+
$result = self::query("SHOW CREATE table `$databaseName`.`$tableName`;");
|
| 421 |
+
if($result){
|
| 422 |
+
$row = mysql_fetch_row($result);
|
| 423 |
+
fwrite($fd, $row[1].";\n");
|
| 424 |
+
}
|
| 425 |
+
|
| 426 |
+
fwrite($fd, "\n#\n# End Structure for table `$tableName`\n#\n\n");
|
| 427 |
+
fwrite($fd, "#\n# Dumping data for table `$tableName`\n#\n\n");
|
| 428 |
+
return;
|
| 429 |
+
|
| 430 |
+
}
|
| 431 |
+
|
| 432 |
+
public function dataFooters($dumpfile){
|
| 433 |
+
|
| 434 |
+
// we finished the dump file, not return the size of it
|
| 435 |
+
$ftemp = fopen($dumpfile, "a");
|
| 436 |
+
if($ftemp){
|
| 437 |
+
fwrite($ftemp, "\n#\n# Finished at: ".date("M j, Y \a\\t H:i")."\n#");
|
| 438 |
+
fclose($ftemp);
|
| 439 |
+
}else{
|
| 440 |
+
self::error("Unable to open file $ftemp for writing");
|
| 441 |
+
}
|
| 442 |
+
|
| 443 |
+
return sprintf("%u", filesize($dumpfile));
|
| 444 |
+
|
| 445 |
+
}
|
| 446 |
+
|
| 447 |
+
public function resetcountRecords(){
|
| 448 |
+
self::$countRecords = 0;
|
| 449 |
+
|
| 450 |
+
return self::$countRecords;
|
| 451 |
+
}
|
| 452 |
+
|
| 453 |
+
public function getcountRecords(){
|
| 454 |
+
return self::$countRecords;
|
| 455 |
+
}
|
| 456 |
+
|
| 457 |
+
|
| 458 |
+
public function dataHeaders($database){
|
| 459 |
+
|
| 460 |
+
$return = "";
|
| 461 |
+
|
| 462 |
+
$return .= "#\n";
|
| 463 |
+
$return .= "# Powered by XCloner Site Backup\n";
|
| 464 |
+
$return .= "# http://www.xcloner.com\n";
|
| 465 |
+
$return .= "#\n";
|
| 466 |
+
$return .= "# Host: " . $_SERVER['HTTP_HOST'] . "\n";
|
| 467 |
+
$return .= "# Generation Time: " . date("M j, Y \a\\t H:i") . "\n";
|
| 468 |
+
$return .= "# PHP Version: " . phpversion() . "\n";
|
| 469 |
+
$return .= "# Mysql Compatibility: ". self::$dbCompatibility . "\n";
|
| 470 |
+
|
| 471 |
+
$result = self::query("SHOW VARIABLES LIKE \"%version%\";");
|
| 472 |
+
if($result){
|
| 473 |
+
while($row = mysql_fetch_array($result)){
|
| 474 |
+
|
| 475 |
+
$return .= "# MYSQL ".$row[0].": ".$row[1]."\n";
|
| 476 |
+
|
| 477 |
+
}
|
| 478 |
+
}
|
| 479 |
+
|
| 480 |
+
$return .= "#\n# Database : `" . $database . "`\n# --------------------------------------------------------\n\n";
|
| 481 |
+
return $return;
|
| 482 |
+
|
| 483 |
+
}
|
| 484 |
+
|
| 485 |
+
|
| 486 |
+
}
|
| 487 |
+
|
| 488 |
+
?>
|
cloner.config.php
CHANGED
|
@@ -39,6 +39,9 @@ $_CONFIG['sqldump']="mysqldump --quote-names ";
|
|
| 39 |
$_CONFIG['system_dlink']="";
|
| 40 |
$_CONFIG['system_ftptransfer']="0";
|
| 41 |
$_CONFIG['system_mdatabases']="0";
|
|
|
|
|
|
|
|
|
|
| 42 |
|
| 43 |
### Defaults
|
| 44 |
$script_dir = str_replace("\\","/",dirname(__FILE__));
|
| 39 |
$_CONFIG['system_dlink']="";
|
| 40 |
$_CONFIG['system_ftptransfer']="0";
|
| 41 |
$_CONFIG['system_mdatabases']="0";
|
| 42 |
+
$_CONFIG['recordsPerSession']= "10000";
|
| 43 |
+
$_CONFIG['excludeFilesSize'] = "-1";
|
| 44 |
+
$_CONFIG['splitBackupSize'] = "2048"; //MB
|
| 45 |
|
| 46 |
### Defaults
|
| 47 |
$script_dir = str_replace("\\","/",dirname(__FILE__));
|
cloner.cron.php
CHANGED
|
@@ -18,36 +18,53 @@ define( '_VALID_MOS', 1 );
|
|
| 18 |
include_once("admin.cloner.html.php");
|
| 19 |
include_once("cloner.functions.php");
|
| 20 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 21 |
|
| 22 |
$script_dir = str_replace("\\","/",dirname(__FILE__));
|
| 23 |
if(is_dir($script_dir)){
|
| 24 |
-
|
| 25 |
chdir($script_dir);
|
| 26 |
|
| 27 |
}
|
| 28 |
|
| 29 |
if($_REQUEST['config'] == ""){
|
| 30 |
-
|
| 31 |
if($argv[1] != ""){
|
| 32 |
-
|
| 33 |
-
$_REQUEST['config'] = $argv[1];
|
| 34 |
-
|
| 35 |
}
|
| 36 |
|
| 37 |
|
| 38 |
}
|
| 39 |
|
| 40 |
if($_REQUEST['config'] != ""){
|
| 41 |
-
|
| 42 |
require_once( './configs/'.$_REQUEST['config'] );
|
| 43 |
-
|
| 44 |
$smsg = "Using configs/".$_REQUEST['config']." as configuration file";
|
| 45 |
-
|
| 46 |
}
|
| 47 |
else{
|
| 48 |
|
| 49 |
@require_once( './cloner.config.php' );
|
| 50 |
-
|
| 51 |
$smsg = "Using default configuration file";
|
| 52 |
|
| 53 |
}
|
|
@@ -74,7 +91,7 @@ if($_CONFIG['select_lang']!="")
|
|
| 74 |
if (file_exists( "language/".$mosConfig_lang.".php" )) {
|
| 75 |
include_once( "language/".$mosConfig_lang.".php" );
|
| 76 |
@include_once( "language/english.php" );
|
| 77 |
-
}
|
| 78 |
else{
|
| 79 |
include_once( "language/english.php" );
|
| 80 |
}
|
|
@@ -82,16 +99,16 @@ else{
|
|
| 82 |
|
| 83 |
|
| 84 |
####### VERIFY IP ACCESS
|
| 85 |
-
|
| 86 |
$ip_list[] = $_SERVER['SERVER_ADDR'];
|
| 87 |
$curent_ip = $_SERVER["REMOTE_ADDR"];
|
| 88 |
|
| 89 |
if(!in_array($curent_ip, $ip_list)){
|
| 90 |
-
|
| 91 |
echo "Access Denied for ip $curent_ip!";
|
| 92 |
exit;
|
| 93 |
-
|
| 94 |
-
}
|
| 95 |
#########################
|
| 96 |
|
| 97 |
$access=1;
|
|
@@ -104,14 +121,14 @@ $_REQUEST['databases_incl'] = @explode(",",$_CONFIG[databases_incl_list]);
|
|
| 104 |
|
| 105 |
if($_CONFIG[cron_bname]!="")
|
| 106 |
$_REQUEST['bname'] = $_CONFIG[cron_bname];
|
| 107 |
-
|
| 108 |
-
|
| 109 |
function logxx($string = ""){
|
| 110 |
-
|
| 111 |
-
global $mail_log;
|
| 112 |
|
| 113 |
$return = "<b>$string</b><br />\r\n";
|
| 114 |
-
|
| 115 |
$mail_log .= $return;
|
| 116 |
|
| 117 |
echo $return;
|
|
@@ -131,8 +148,8 @@ logxx("Starting XCloner for site $mosConfig_live_site at ".date("Y-m-d H:i"));
|
|
| 131 |
#recurseFiles($d_arr, $ds_arr, $f_arr, $s_arr, $d, $f, $s, $excludefolders, '');
|
| 132 |
#$excludedFolders = confirmBackup('nohtml');
|
| 133 |
#logxx("Done");
|
| 134 |
-
|
| 135 |
-
|
| 136 |
|
| 137 |
if($_CONFIG['cron_btype']==0){
|
| 138 |
$_REQUEST[dbbackup] = 1;
|
|
@@ -154,7 +171,7 @@ if($_CONFIG['cron_btype']==2){
|
|
| 154 |
$GLOBALS['_CONFIG'] = $_CONFIG;
|
| 155 |
$_REQUEST[cron_dbonly] = 1;
|
| 156 |
#}
|
| 157 |
-
|
| 158 |
logxx("Creating an sql only backup");
|
| 159 |
$msg = "database backup";
|
| 160 |
}
|
|
@@ -183,7 +200,7 @@ $destination_files[] = $_CONFIG[cron_ftp_path]."/".$file;
|
|
| 183 |
list($fhost, $fport) = explode(":",$_CONFIG[cron_ftp_server]);
|
| 184 |
if($fport == "")
|
| 185 |
$fport = '21';
|
| 186 |
-
|
| 187 |
$ftp_timeout = '3600';
|
| 188 |
|
| 189 |
// set up basic connection
|
|
@@ -248,7 +265,7 @@ if($_CONFIG[cron_ftp_delb]==1){
|
|
| 248 |
@unlink($source_file);
|
| 249 |
logxx("Backup succesfully deleted from the original server!");
|
| 250 |
}
|
| 251 |
-
|
| 252 |
##############################################################################
|
| 253 |
}
|
| 254 |
elseif($_CONFIG['cron_send']==2){
|
|
@@ -262,19 +279,19 @@ elseif($_CONFIG['cron_send']==2){
|
|
| 262 |
Attached is the backup generated on $date
|
| 263 |
Source Filename: $source_file
|
| 264 |
Server: $mosConfig_live_site
|
| 265 |
-
|
| 266 |
-
Powered by http://www.xcloner.com -
|
| 267 |
</pre>
|
| 268 |
|
| 269 |
";
|
| 270 |
-
|
| 271 |
$ok = send_mail($mosConfig_mailfrom, "XCloner $msg", $message, $_CONFIG['cron_email_address'], $source_file);
|
| 272 |
-
|
| 273 |
#echo mosMail( $mosConfig_mailfrom, $mosConfig_fromname, $_CONFIG['cron_email_address'], "XCloner $msg", $message, $mode, '', '' );
|
| 274 |
if($ok)
|
| 275 |
logxx("Mail sent to ".$_CONFIG['cron_email_address']);
|
| 276 |
else
|
| 277 |
-
logxx("There was an error in sending the mail cron to ".$_CONFIG['cron_email_address']);
|
| 278 |
|
| 279 |
##############################################################################
|
| 280 |
}
|
|
@@ -332,27 +349,27 @@ delete_older_backups($clonerPath);
|
|
| 332 |
|
| 333 |
$logemail = explode(";", $_CONFIG['cron_logemail']);
|
| 334 |
if(sizeof($logemail)>0){
|
| 335 |
-
|
| 336 |
for($i=0; $i<sizeof($logemail);$i++){
|
| 337 |
-
|
| 338 |
$email = trim($logemail[$i]);
|
| 339 |
if($email != ""){
|
| 340 |
-
|
| 341 |
$email_subject = "cron log ".time();
|
| 342 |
-
|
| 343 |
$headers ="From: \"Cronlog XCloner\" <nobody@noreply.com>\n";
|
| 344 |
|
| 345 |
if(mail($email, $email_subject, strip_tags($mail_log), $headers)){
|
| 346 |
-
|
| 347 |
logxx ("Notification Mail was sent to $email");
|
| 348 |
-
|
| 349 |
}
|
| 350 |
-
|
| 351 |
-
|
| 352 |
}
|
| 353 |
-
|
| 354 |
}
|
| 355 |
-
|
| 356 |
}
|
| 357 |
|
| 358 |
logxx("<br />\n\nALL DONE! I will exit now from cron.");
|
|
@@ -374,78 +391,78 @@ getBackupFiles($d_arr, $f_arr, $s_arr, $d, $f);
|
|
| 374 |
if(is_array($f_arr))
|
| 375 |
foreach($f_arr as $file)
|
| 376 |
if(($file!='.')&&($file != '..')){
|
| 377 |
-
|
| 378 |
#logxx("Processing backup file $file");
|
| 379 |
$cfile = $_CONFIG['clonerPath']."/".$file;
|
| 380 |
-
|
| 381 |
$filemtime = filemtime($cfile) ;
|
| 382 |
-
|
| 383 |
$ftime= $filemtime + $_CONFIG['cron_file_delete']*24*60*60;
|
| 384 |
-
|
| 385 |
$ctime = time();
|
| 386 |
-
|
| 387 |
if($ftime < $ctime){
|
| 388 |
-
|
| 389 |
if(unlink($cfile))
|
| 390 |
logxx("Deleted backup file $file created on ".date("Y-m-d", $filemtime));
|
| 391 |
else
|
| 392 |
logxx("Could not delete backup file $file, please delete it manually");
|
| 393 |
-
|
| 394 |
}
|
| 395 |
-
|
| 396 |
}
|
| 397 |
|
| 398 |
}
|
| 399 |
|
| 400 |
function send_mail($email_from, $email_subject, $email_txt, $email_to, $fileatt){
|
| 401 |
-
$fileatt_type = "application/octet-stream"; // File Type
|
| 402 |
-
$fileatt_name = basename($fileatt); // Filename that will be used for the file as the attachment
|
| 403 |
$data = "";
|
| 404 |
|
| 405 |
-
$headers = "From: \"Cronbackup XCloner\" <".$email_from.">";
|
| 406 |
|
| 407 |
if($fileatt != ""){
|
| 408 |
-
|
| 409 |
if($file = @fopen($fileatt,'rb')){
|
| 410 |
-
|
| 411 |
$data = fread($file,filesize($fileatt));
|
| 412 |
-
|
| 413 |
fclose($file);
|
| 414 |
|
| 415 |
-
}
|
| 416 |
else{
|
| 417 |
logxx("Unable to open file $fileatt");
|
| 418 |
}
|
| 419 |
|
| 420 |
}
|
| 421 |
|
| 422 |
-
$semi_rand = md5(time());
|
| 423 |
-
$mime_boundary = "==Multipart_Boundary_x{$semi_rand}x";
|
| 424 |
-
|
| 425 |
-
$headers .= "\nMIME-Version: 1.0\n" .
|
| 426 |
-
"Content-Type: multipart/mixed;\n" .
|
| 427 |
-
" boundary=\"{$mime_boundary}\"";
|
| 428 |
|
| 429 |
-
$
|
| 430 |
-
|
| 431 |
-
|
| 432 |
-
"Content-Transfer-Encoding: 7bit\n\n" .
|
| 433 |
-
$email_txt . "\n\n";
|
| 434 |
|
| 435 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
| 436 |
|
| 437 |
-
$
|
| 438 |
-
"Content-Type: {$fileatt_type};\n" .
|
| 439 |
-
" name=\"{$fileatt_name}\"\n" .
|
| 440 |
-
//"Content-Disposition: attachment;\n" .
|
| 441 |
-
//" filename=\"{$fileatt_name}\"\n" .
|
| 442 |
-
"Content-Transfer-Encoding: base64\n\n" .
|
| 443 |
-
$data . "\n\n" .
|
| 444 |
-
"--{$mime_boundary}--\n";
|
| 445 |
|
| 446 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 447 |
|
| 448 |
return $ok;
|
| 449 |
|
| 450 |
}
|
| 451 |
-
?>
|
| 18 |
include_once("admin.cloner.html.php");
|
| 19 |
include_once("cloner.functions.php");
|
| 20 |
|
| 21 |
+
require_once( 'cloner.config.php' );
|
| 22 |
+
|
| 23 |
+
####### VERIFY IP ACCESS
|
| 24 |
+
$ip_list = @explode("\r\n", $_CONFIG['cron_ip']);
|
| 25 |
+
$ip_list[] = $_SERVER['SERVER_ADDR'];
|
| 26 |
+
$curent_ip = $_SERVER["REMOTE_ADDR"];
|
| 27 |
+
|
| 28 |
+
if(!in_array($curent_ip, $ip_list)){
|
| 29 |
+
|
| 30 |
+
echo "Access Denied for ip $curent_ip!";
|
| 31 |
+
exit;
|
| 32 |
+
|
| 33 |
+
}
|
| 34 |
+
#########################
|
| 35 |
+
|
| 36 |
+
|
| 37 |
+
|
| 38 |
|
| 39 |
$script_dir = str_replace("\\","/",dirname(__FILE__));
|
| 40 |
if(is_dir($script_dir)){
|
| 41 |
+
|
| 42 |
chdir($script_dir);
|
| 43 |
|
| 44 |
}
|
| 45 |
|
| 46 |
if($_REQUEST['config'] == ""){
|
| 47 |
+
|
| 48 |
if($argv[1] != ""){
|
| 49 |
+
|
| 50 |
+
$_REQUEST['config'] = $argv[1];
|
| 51 |
+
|
| 52 |
}
|
| 53 |
|
| 54 |
|
| 55 |
}
|
| 56 |
|
| 57 |
if($_REQUEST['config'] != ""){
|
| 58 |
+
|
| 59 |
require_once( './configs/'.$_REQUEST['config'] );
|
| 60 |
+
|
| 61 |
$smsg = "Using configs/".$_REQUEST['config']." as configuration file";
|
| 62 |
+
|
| 63 |
}
|
| 64 |
else{
|
| 65 |
|
| 66 |
@require_once( './cloner.config.php' );
|
| 67 |
+
|
| 68 |
$smsg = "Using default configuration file";
|
| 69 |
|
| 70 |
}
|
| 91 |
if (file_exists( "language/".$mosConfig_lang.".php" )) {
|
| 92 |
include_once( "language/".$mosConfig_lang.".php" );
|
| 93 |
@include_once( "language/english.php" );
|
| 94 |
+
}
|
| 95 |
else{
|
| 96 |
include_once( "language/english.php" );
|
| 97 |
}
|
| 99 |
|
| 100 |
|
| 101 |
####### VERIFY IP ACCESS
|
| 102 |
+
/*$ip_list = @explode("\r\n", $_CONFIG['cron_ip']);
|
| 103 |
$ip_list[] = $_SERVER['SERVER_ADDR'];
|
| 104 |
$curent_ip = $_SERVER["REMOTE_ADDR"];
|
| 105 |
|
| 106 |
if(!in_array($curent_ip, $ip_list)){
|
| 107 |
+
|
| 108 |
echo "Access Denied for ip $curent_ip!";
|
| 109 |
exit;
|
| 110 |
+
|
| 111 |
+
}*/
|
| 112 |
#########################
|
| 113 |
|
| 114 |
$access=1;
|
| 121 |
|
| 122 |
if($_CONFIG[cron_bname]!="")
|
| 123 |
$_REQUEST['bname'] = $_CONFIG[cron_bname];
|
| 124 |
+
|
| 125 |
+
|
| 126 |
function logxx($string = ""){
|
| 127 |
+
|
| 128 |
+
global $mail_log;
|
| 129 |
|
| 130 |
$return = "<b>$string</b><br />\r\n";
|
| 131 |
+
|
| 132 |
$mail_log .= $return;
|
| 133 |
|
| 134 |
echo $return;
|
| 148 |
#recurseFiles($d_arr, $ds_arr, $f_arr, $s_arr, $d, $f, $s, $excludefolders, '');
|
| 149 |
#$excludedFolders = confirmBackup('nohtml');
|
| 150 |
#logxx("Done");
|
| 151 |
+
|
| 152 |
+
|
| 153 |
|
| 154 |
if($_CONFIG['cron_btype']==0){
|
| 155 |
$_REQUEST[dbbackup] = 1;
|
| 171 |
$GLOBALS['_CONFIG'] = $_CONFIG;
|
| 172 |
$_REQUEST[cron_dbonly] = 1;
|
| 173 |
#}
|
| 174 |
+
|
| 175 |
logxx("Creating an sql only backup");
|
| 176 |
$msg = "database backup";
|
| 177 |
}
|
| 200 |
list($fhost, $fport) = explode(":",$_CONFIG[cron_ftp_server]);
|
| 201 |
if($fport == "")
|
| 202 |
$fport = '21';
|
| 203 |
+
|
| 204 |
$ftp_timeout = '3600';
|
| 205 |
|
| 206 |
// set up basic connection
|
| 265 |
@unlink($source_file);
|
| 266 |
logxx("Backup succesfully deleted from the original server!");
|
| 267 |
}
|
| 268 |
+
|
| 269 |
##############################################################################
|
| 270 |
}
|
| 271 |
elseif($_CONFIG['cron_send']==2){
|
| 279 |
Attached is the backup generated on $date
|
| 280 |
Source Filename: $source_file
|
| 281 |
Server: $mosConfig_live_site
|
| 282 |
+
|
| 283 |
+
Powered by http://www.xcloner.com - XCloner - Backup and Restore made easy!
|
| 284 |
</pre>
|
| 285 |
|
| 286 |
";
|
| 287 |
+
|
| 288 |
$ok = send_mail($mosConfig_mailfrom, "XCloner $msg", $message, $_CONFIG['cron_email_address'], $source_file);
|
| 289 |
+
|
| 290 |
#echo mosMail( $mosConfig_mailfrom, $mosConfig_fromname, $_CONFIG['cron_email_address'], "XCloner $msg", $message, $mode, '', '' );
|
| 291 |
if($ok)
|
| 292 |
logxx("Mail sent to ".$_CONFIG['cron_email_address']);
|
| 293 |
else
|
| 294 |
+
logxx("There was an error in sending the mail cron to ".$_CONFIG['cron_email_address']);
|
| 295 |
|
| 296 |
##############################################################################
|
| 297 |
}
|
| 349 |
|
| 350 |
$logemail = explode(";", $_CONFIG['cron_logemail']);
|
| 351 |
if(sizeof($logemail)>0){
|
| 352 |
+
|
| 353 |
for($i=0; $i<sizeof($logemail);$i++){
|
| 354 |
+
|
| 355 |
$email = trim($logemail[$i]);
|
| 356 |
if($email != ""){
|
| 357 |
+
|
| 358 |
$email_subject = "cron log ".time();
|
| 359 |
+
|
| 360 |
$headers ="From: \"Cronlog XCloner\" <nobody@noreply.com>\n";
|
| 361 |
|
| 362 |
if(mail($email, $email_subject, strip_tags($mail_log), $headers)){
|
| 363 |
+
|
| 364 |
logxx ("Notification Mail was sent to $email");
|
| 365 |
+
|
| 366 |
}
|
| 367 |
+
|
| 368 |
+
|
| 369 |
}
|
| 370 |
+
|
| 371 |
}
|
| 372 |
+
|
| 373 |
}
|
| 374 |
|
| 375 |
logxx("<br />\n\nALL DONE! I will exit now from cron.");
|
| 391 |
if(is_array($f_arr))
|
| 392 |
foreach($f_arr as $file)
|
| 393 |
if(($file!='.')&&($file != '..')){
|
| 394 |
+
|
| 395 |
#logxx("Processing backup file $file");
|
| 396 |
$cfile = $_CONFIG['clonerPath']."/".$file;
|
| 397 |
+
|
| 398 |
$filemtime = filemtime($cfile) ;
|
| 399 |
+
|
| 400 |
$ftime= $filemtime + $_CONFIG['cron_file_delete']*24*60*60;
|
| 401 |
+
|
| 402 |
$ctime = time();
|
| 403 |
+
|
| 404 |
if($ftime < $ctime){
|
| 405 |
+
|
| 406 |
if(unlink($cfile))
|
| 407 |
logxx("Deleted backup file $file created on ".date("Y-m-d", $filemtime));
|
| 408 |
else
|
| 409 |
logxx("Could not delete backup file $file, please delete it manually");
|
| 410 |
+
|
| 411 |
}
|
| 412 |
+
|
| 413 |
}
|
| 414 |
|
| 415 |
}
|
| 416 |
|
| 417 |
function send_mail($email_from, $email_subject, $email_txt, $email_to, $fileatt){
|
| 418 |
+
$fileatt_type = "application/octet-stream"; // File Type
|
| 419 |
+
$fileatt_name = basename($fileatt); // Filename that will be used for the file as the attachment
|
| 420 |
$data = "";
|
| 421 |
|
| 422 |
+
$headers = "From: \"Cronbackup XCloner\" <".$email_from.">";
|
| 423 |
|
| 424 |
if($fileatt != ""){
|
| 425 |
+
|
| 426 |
if($file = @fopen($fileatt,'rb')){
|
| 427 |
+
|
| 428 |
$data = fread($file,filesize($fileatt));
|
| 429 |
+
|
| 430 |
fclose($file);
|
| 431 |
|
| 432 |
+
}
|
| 433 |
else{
|
| 434 |
logxx("Unable to open file $fileatt");
|
| 435 |
}
|
| 436 |
|
| 437 |
}
|
| 438 |
|
| 439 |
+
$semi_rand = md5(time());
|
| 440 |
+
$mime_boundary = "==Multipart_Boundary_x{$semi_rand}x";
|
|
|
|
|
|
|
|
|
|
|
|
|
| 441 |
|
| 442 |
+
$headers .= "\nMIME-Version: 1.0\n" .
|
| 443 |
+
"Content-Type: multipart/mixed;\n" .
|
| 444 |
+
" boundary=\"{$mime_boundary}\"";
|
|
|
|
|
|
|
| 445 |
|
| 446 |
+
$email_message .= "This is a multi-part message in MIME format.\n\n" .
|
| 447 |
+
"--{$mime_boundary}\n" .
|
| 448 |
+
"Content-Type:text/html; charset=\"iso-8859-1\"\n" .
|
| 449 |
+
"Content-Transfer-Encoding: 7bit\n\n" .
|
| 450 |
+
$email_txt . "\n\n";
|
| 451 |
|
| 452 |
+
$data = chunk_split(base64_encode($data));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 453 |
|
| 454 |
+
$email_message .= "--{$mime_boundary}\n" .
|
| 455 |
+
"Content-Type: {$fileatt_type};\n" .
|
| 456 |
+
" name=\"{$fileatt_name}\"\n" .
|
| 457 |
+
//"Content-Disposition: attachment;\n" .
|
| 458 |
+
//" filename=\"{$fileatt_name}\"\n" .
|
| 459 |
+
"Content-Transfer-Encoding: base64\n\n" .
|
| 460 |
+
$data . "\n\n" .
|
| 461 |
+
"--{$mime_boundary}--\n";
|
| 462 |
+
|
| 463 |
+
$ok = mail($email_to, $email_subject, $email_message, $headers);
|
| 464 |
|
| 465 |
return $ok;
|
| 466 |
|
| 467 |
}
|
| 468 |
+
?>
|
cloner.functions.php
CHANGED
|
@@ -20,14 +20,16 @@
|
|
| 20 |
* MA 02110-1301, USA.
|
| 21 |
*/
|
| 22 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 23 |
/*
|
| 24 |
* Process the logout request
|
| 25 |
* name: doLogout()
|
| 26 |
* @param
|
| 27 |
* @return
|
| 28 |
*/
|
| 29 |
-
|
| 30 |
-
/*processing the Logout task*/
|
| 31 |
function doLogout()
|
| 32 |
{
|
| 33 |
if (function_exists('session_unregister')) {
|
|
@@ -139,13 +141,13 @@
|
|
| 139 |
if ($fp = @fopen($config_file, 'w')) {
|
| 140 |
$cfg = '<?' . 'php' . "\n";
|
| 141 |
|
| 142 |
-
$cfg .= '$_CONFIG[\'license_code\']
|
| 143 |
|
| 144 |
$cfg .= '$_CONFIG[\'backup_path\']="' . $_REQUEST[backup_path] . '";' . "\n";
|
| 145 |
|
| 146 |
$cfg .= '$_CONFIG[\'clonerPath\']="' . $_REQUEST[clonerPath] . '";' . "\n";
|
| 147 |
|
| 148 |
-
$cfg .= '$_CONFIG[\'jcuser\']
|
| 149 |
|
| 150 |
if ($_REQUEST['jcpass'] == '') {
|
| 151 |
$jcpass = $_CONFIG['jcpass'];
|
|
@@ -159,7 +161,7 @@
|
|
| 159 |
|
| 160 |
$cfg .= '$_CONFIG[\'mysql_host\']="' . $_REQUEST[mysql_host] . '";' . "\n";
|
| 161 |
|
| 162 |
-
$cfg .= '$_CONFIG[\'mysql_user\']
|
| 163 |
|
| 164 |
$cfg .= '$_CONFIG[\'mysql_pass\']=\'' . $_REQUEST[mysql_pass] . '\';' . "\n";
|
| 165 |
|
|
@@ -187,7 +189,7 @@
|
|
| 187 |
|
| 188 |
$cfg .= '$_CONFIG[\'cron_ftp_server\']="' . $_REQUEST[cron_ftp_server] . '";' . "\n";
|
| 189 |
|
| 190 |
-
$cfg .= '$_CONFIG[\'cron_ftp_user\']
|
| 191 |
|
| 192 |
$cfg .= '$_CONFIG[\'cron_ftp_pass\']=\'' . $_REQUEST[cron_ftp_pass] . '\';' . "\n";
|
| 193 |
|
|
@@ -213,6 +215,12 @@
|
|
| 213 |
|
| 214 |
$cfg .= '$_CONFIG[\'refresh_mode\']="' . $_REQUEST[refresh_mode] . '";' . "\n";
|
| 215 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 216 |
$cfg .= '$_CONFIG[\'backup_refresh_number\']="' . $_REQUEST[backup_refresh_number] . '";' . "\n";
|
| 217 |
|
| 218 |
$cfg .= '$_CONFIG[\'sql_mem\']="' . $_REQUEST[sql_mem] . '";' . "\n";
|
|
@@ -237,13 +245,13 @@
|
|
| 237 |
|
| 238 |
$cfg .= '$_CONFIG[\'cron_amazon_active\']="' . $_REQUEST[cron_amazon_active] . '";' . "\n";
|
| 239 |
|
| 240 |
-
$cfg .= '$_CONFIG[\'cron_amazon_awsAccessKey\']
|
| 241 |
|
| 242 |
-
$cfg .= '$_CONFIG[\'cron_amazon_awsSecretKey\']
|
| 243 |
|
| 244 |
-
$cfg .= '$_CONFIG[\'cron_amazon_bucket\']
|
| 245 |
|
| 246 |
-
$cfg .= '$_CONFIG[\'cron_amazon_dirname\']
|
| 247 |
|
| 248 |
$cfg .= '$_CONFIG[\'debug\']="' . $_REQUEST[debug] . '";' . "\n";
|
| 249 |
|
|
@@ -266,7 +274,7 @@
|
|
| 266 |
} else {
|
| 267 |
|
| 268 |
|
| 269 |
-
$msg = "Unable to save
|
| 270 |
}
|
| 271 |
}
|
| 272 |
|
|
@@ -469,11 +477,103 @@
|
|
| 469 |
return $lang_arr;
|
| 470 |
}
|
| 471 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 472 |
|
| 473 |
function goRecurseFiles(){
|
| 474 |
|
| 475 |
global $_CONFIG;
|
| 476 |
-
|
| 477 |
include_once("classes/fileRecursion.php");
|
| 478 |
|
| 479 |
$status['finished'] = "1";
|
|
@@ -481,16 +581,18 @@
|
|
| 481 |
|
| 482 |
$handle = new fileRecursion();
|
| 483 |
|
| 484 |
-
$TEMP_PERM
|
| 485 |
-
$TEMP_EXCL
|
| 486 |
-
$TEMP_D_ARR
|
| 487 |
-
$TEMP_DIR
|
| 488 |
-
$START_DIR
|
|
|
|
|
|
|
| 489 |
|
| 490 |
-
$handle->setData($
|
| 491 |
|
| 492 |
if($_REQUEST['mode'] == 'start')
|
| 493 |
-
$handle->init($_CONFIG['
|
| 494 |
else
|
| 495 |
$handle->init();
|
| 496 |
|
|
@@ -505,10 +607,15 @@
|
|
| 505 |
|
| 506 |
if(!$handle->isQueueFinished())
|
| 507 |
$status['finished'] = "0";
|
| 508 |
-
|
| 509 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 510 |
|
| 511 |
echo json_encode($status);
|
|
|
|
| 512 |
exit;
|
| 513 |
|
| 514 |
}
|
|
@@ -793,7 +900,7 @@
|
|
| 793 |
{
|
| 794 |
global $_CONFIG;
|
| 795 |
|
| 796 |
-
$file = $_CONFIG['clonerPath'] . "/$file";
|
| 797 |
|
| 798 |
//First, see if the file exists
|
| 799 |
if (!is_file($file)) {
|
|
@@ -807,75 +914,66 @@
|
|
| 807 |
|
| 808 |
//Setam Content-Type-urile pentru fisierul in cauza
|
| 809 |
switch ($file_extension) {
|
| 810 |
-
case "pdf":
|
| 811 |
-
$ctype = "application/pdf";
|
| 812 |
-
break;
|
| 813 |
-
case "exe":
|
| 814 |
-
$ctype = "application/octet-stream";
|
| 815 |
-
break;
|
| 816 |
-
case "zip":
|
| 817 |
-
$ctype = "application/zip";
|
| 818 |
-
break;
|
| 819 |
-
case "doc":
|
| 820 |
-
$ctype = "application/msword";
|
| 821 |
-
break;
|
| 822 |
-
case "xls":
|
| 823 |
-
$ctype = "application/vnd.ms-excel";
|
| 824 |
-
break;
|
| 825 |
-
case "ppt":
|
| 826 |
-
$ctype = "application/vnd.ms-powerpoint";
|
| 827 |
-
break;
|
| 828 |
-
case "gif":
|
| 829 |
-
$ctype = "image/gif";
|
| 830 |
-
break;
|
| 831 |
-
case "png":
|
| 832 |
-
$ctype = "image/png";
|
| 833 |
-
break;
|
| 834 |
-
case "jpeg":
|
| 835 |
-
case "jpg":
|
| 836 |
-
$ctype = "image/jpg";
|
| 837 |
-
break;
|
| 838 |
-
case "mp3":
|
| 839 |
-
$ctype = "audio/mpeg";
|
| 840 |
-
break;
|
| 841 |
-
case "wav":
|
| 842 |
-
$ctype = "audio/x-wav";
|
| 843 |
-
break;
|
| 844 |
-
case "mpeg":
|
| 845 |
-
case "mpg":
|
| 846 |
-
case "mpe":
|
| 847 |
-
$ctype = "video/mpeg";
|
| 848 |
-
break;
|
| 849 |
-
case "mov":
|
| 850 |
-
$ctype = "video/quicktime";
|
| 851 |
-
break;
|
| 852 |
-
case "avi":
|
| 853 |
-
$ctype = "video/x-msvideo";
|
| 854 |
-
break;
|
| 855 |
-
|
| 856 |
default:
|
| 857 |
$ctype = "application/force-download";
|
| 858 |
}
|
| 859 |
|
| 860 |
-
|
| 861 |
-
header("Pragma: public");
|
| 862 |
-
header("Expires: 0");
|
| 863 |
-
header("Cache-Control: must-revalidate, post-check=0, pre-check=0");
|
| 864 |
-
header("Cache-Control: public");
|
| 865 |
-
header("Content-Description: File Transfer");
|
| 866 |
|
| 867 |
-
//Content-Type-ul
|
| 868 |
-
header("Content-Type: $ctype");
|
| 869 |
-
|
| 870 |
-
//Force Download
|
| 871 |
-
$header = "Content-Disposition: attachment; filename=" . $filename . ";";
|
| 872 |
-
header($header);
|
| 873 |
-
header("Content-Transfer-Encoding: binary");
|
| 874 |
-
header("Content-Length: " . $len);
|
| 875 |
-
@readfile($file);
|
| 876 |
exit;
|
| 877 |
}
|
| 878 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 879 |
|
| 880 |
function confirmBackup($option)
|
| 881 |
{
|
|
@@ -965,9 +1063,9 @@
|
|
| 965 |
|
| 966 |
$log = "";
|
| 967 |
|
| 968 |
-
$backup_file = $_CONFIG['
|
| 969 |
|
| 970 |
-
$perm_file = $_CONFIG['
|
| 971 |
|
| 972 |
|
| 973 |
$lines = $_REQUEST['lines'];
|
|
@@ -991,7 +1089,6 @@
|
|
| 991 |
|
| 992 |
$url = "index2.php?option=com_cloner&task=refresh&json=$json&startf=$endf&lines=$lines&backup=$backup_filename&excl_manual=" . $_REQUEST['excl_manual'];
|
| 993 |
|
| 994 |
-
|
| 995 |
if ($endf >= $lines)
|
| 996 |
$endf = $lines;
|
| 997 |
else
|
|
@@ -1000,7 +1097,6 @@
|
|
| 1000 |
if ((int)$lines != 0)
|
| 1001 |
$percent = sprintf("%d", ($endf * 100) / (int)$lines);
|
| 1002 |
|
| 1003 |
-
|
| 1004 |
$log .= "Total process: $percent% out of $lines files<br />\n";
|
| 1005 |
$log .= "Processing files $startf to $endf for backup file $backup_file!<br />\n";
|
| 1006 |
$log .= "Current backup size: " . getFileSizeText(get_filesize($backup_file)) . "<br /><br />\n";
|
|
@@ -1022,6 +1118,23 @@
|
|
| 1022 |
//## appending files
|
| 1023 |
$log .= "file - $file";
|
| 1024 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1025 |
|
| 1026 |
if (!$_CONFIG['mem']) {
|
| 1027 |
//### CREATE BACKUP USING TAR LIBRARIES
|
|
@@ -1055,7 +1168,7 @@
|
|
| 1055 |
}
|
| 1056 |
|
| 1057 |
//exit;
|
| 1058 |
-
$newFileSize =
|
| 1059 |
$log .= "\n<br />New backup size: " . $newFileSize . "<br />\n";
|
| 1060 |
|
| 1061 |
addXLog($log);
|
|
@@ -1070,21 +1183,21 @@
|
|
| 1070 |
//# REDIRECTING
|
| 1071 |
@fclose($fperm);
|
| 1072 |
|
| 1073 |
-
$log .= "<br>All done, redirecting
|
| 1074 |
|
| 1075 |
$log .= "
|
| 1076 |
-
|
| 1077 |
-
|
| 1078 |
-
|
| 1079 |
-
|
| 1080 |
|
| 1081 |
-
|
|
|
|
| 1082 |
|
| 1083 |
-
|
| 1084 |
}
|
| 1085 |
-
} else {
|
| 1086 |
-
|
| 1087 |
|
|
|
|
| 1088 |
$log .= "Unable to continue, could not open file $perm_file for reading!";
|
| 1089 |
}
|
| 1090 |
|
|
@@ -1098,10 +1211,10 @@
|
|
| 1098 |
$status['finished'] = 1;
|
| 1099 |
}
|
| 1100 |
|
| 1101 |
-
|
| 1102 |
-
|
| 1103 |
}
|
| 1104 |
-
|
| 1105 |
$status['backupSize'] = $newFileSize;
|
| 1106 |
$status['percent'] = $percent;
|
| 1107 |
$status['option'] = 'com_cloner';
|
|
@@ -1115,7 +1228,7 @@
|
|
| 1115 |
echo json_encode($status);
|
| 1116 |
exit;
|
| 1117 |
|
| 1118 |
-
|
| 1119 |
|
| 1120 |
return;
|
| 1121 |
}
|
|
@@ -1134,9 +1247,7 @@
|
|
| 1134 |
if (!$_CONFIG['enable_db_backup']) {
|
| 1135 |
$backupDatabase = 0;
|
| 1136 |
} else {
|
| 1137 |
-
|
| 1138 |
-
|
| 1139 |
-
$backupDatabase = $_REQUEST['dbbackup'];
|
| 1140 |
}
|
| 1141 |
|
| 1142 |
if ($_REQUEST[cron_access]) {
|
|
@@ -1173,8 +1284,6 @@
|
|
| 1173 |
$f_ext = '.tgz';
|
| 1174 |
$_CONFIG['tarcompress'] = 'z';
|
| 1175 |
} else {
|
| 1176 |
-
|
| 1177 |
-
|
| 1178 |
$f_ext = '.tar';
|
| 1179 |
$_CONFIG['tarcompress'] = '';
|
| 1180 |
}
|
|
@@ -1204,6 +1313,15 @@
|
|
| 1204 |
$filename1 = $_REQUEST['bname'] . $f_ext;
|
| 1205 |
}
|
| 1206 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1207 |
$sql_file = array();
|
| 1208 |
|
| 1209 |
if ($backupDatabase == 1) {
|
|
@@ -1231,7 +1349,7 @@
|
|
| 1231 |
mysql_query("USE " . $_CONFIG['mysql_database']);
|
| 1232 |
}
|
| 1233 |
} else {
|
| 1234 |
-
|
| 1235 |
}
|
| 1236 |
|
| 1237 |
|
|
@@ -1324,22 +1442,24 @@
|
|
| 1324 |
|
| 1325 |
if(($_REQUEST['cron_access']) or (!$_CONFIG['refresh_mode'])){
|
| 1326 |
|
| 1327 |
-
|
| 1328 |
-
|
| 1329 |
-
|
| 1330 |
|
| 1331 |
-
|
| 1332 |
-
|
| 1333 |
-
|
| 1334 |
|
| 1335 |
-
|
| 1336 |
-
|
| 1337 |
|
| 1338 |
-
|
| 1339 |
-
@fclose($fperm);
|
| 1340 |
-
@chmod($perm_file, 0777);
|
| 1341 |
|
| 1342 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1343 |
|
| 1344 |
|
| 1345 |
// format total archive size
|
|
@@ -1395,6 +1515,9 @@
|
|
| 1395 |
|
| 1396 |
if ($_CONFIG['backup_refresh']) {
|
| 1397 |
$f_arr = array($_CONFIG['backups_dir'] . "/index.html");
|
|
|
|
|
|
|
|
|
|
| 1398 |
}
|
| 1399 |
|
| 1400 |
|
|
@@ -1417,7 +1540,8 @@
|
|
| 1417 |
|
| 1418 |
if ($_CONFIG['backup_refresh']) {
|
| 1419 |
// echo "Starting the manual backup process!<br />";
|
| 1420 |
-
|
|
|
|
| 1421 |
|
| 1422 |
HTML_cloner::goRefreshHtml($filename, $perm_lines, $excl_manual);
|
| 1423 |
return;
|
|
@@ -1956,11 +2080,46 @@
|
|
| 1956 |
}
|
| 1957 |
}
|
| 1958 |
|
|
|
|
| 1959 |
|
| 1960 |
-
|
| 1961 |
-
|
| 1962 |
-
|
| 1963 |
-
|
| 1964 |
-
|
| 1965 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1966 |
?>
|
| 20 |
* MA 02110-1301, USA.
|
| 21 |
*/
|
| 22 |
|
| 23 |
+
/** ensure this file is being included by a parent file */
|
| 24 |
+
defined( '_VALID_MOS' ) or die( 'Direct Access to this location is not allowed.' );
|
| 25 |
+
|
| 26 |
+
|
| 27 |
/*
|
| 28 |
* Process the logout request
|
| 29 |
* name: doLogout()
|
| 30 |
* @param
|
| 31 |
* @return
|
| 32 |
*/
|
|
|
|
|
|
|
| 33 |
function doLogout()
|
| 34 |
{
|
| 35 |
if (function_exists('session_unregister')) {
|
| 141 |
if ($fp = @fopen($config_file, 'w')) {
|
| 142 |
$cfg = '<?' . 'php' . "\n";
|
| 143 |
|
| 144 |
+
$cfg .= '$_CONFIG[\'license_code\']=\'' . $_REQUEST[license_code] . '\';' . "\n";
|
| 145 |
|
| 146 |
$cfg .= '$_CONFIG[\'backup_path\']="' . $_REQUEST[backup_path] . '";' . "\n";
|
| 147 |
|
| 148 |
$cfg .= '$_CONFIG[\'clonerPath\']="' . $_REQUEST[clonerPath] . '";' . "\n";
|
| 149 |
|
| 150 |
+
$cfg .= '$_CONFIG[\'jcuser\']=\'' . $_REQUEST[jcuser] . '\';' . "\n";
|
| 151 |
|
| 152 |
if ($_REQUEST['jcpass'] == '') {
|
| 153 |
$jcpass = $_CONFIG['jcpass'];
|
| 161 |
|
| 162 |
$cfg .= '$_CONFIG[\'mysql_host\']="' . $_REQUEST[mysql_host] . '";' . "\n";
|
| 163 |
|
| 164 |
+
$cfg .= '$_CONFIG[\'mysql_user\']=\'' . $_REQUEST[mysql_user] . '\';' . "\n";
|
| 165 |
|
| 166 |
$cfg .= '$_CONFIG[\'mysql_pass\']=\'' . $_REQUEST[mysql_pass] . '\';' . "\n";
|
| 167 |
|
| 189 |
|
| 190 |
$cfg .= '$_CONFIG[\'cron_ftp_server\']="' . $_REQUEST[cron_ftp_server] . '";' . "\n";
|
| 191 |
|
| 192 |
+
$cfg .= '$_CONFIG[\'cron_ftp_user\']=\'' . $_REQUEST[cron_ftp_user] . '\';' . "\n";
|
| 193 |
|
| 194 |
$cfg .= '$_CONFIG[\'cron_ftp_pass\']=\'' . $_REQUEST[cron_ftp_pass] . '\';' . "\n";
|
| 195 |
|
| 215 |
|
| 216 |
$cfg .= '$_CONFIG[\'refresh_mode\']="' . $_REQUEST[refresh_mode] . '";' . "\n";
|
| 217 |
|
| 218 |
+
$cfg .= '$_CONFIG[\'recordsPerSession\']="' . $_REQUEST[recordsPerSession] . '";' . "\n";
|
| 219 |
+
|
| 220 |
+
$cfg .= '$_CONFIG[\'excludeFilesSize\']="' . $_REQUEST[excludeFilesSize] . '";' . "\n";
|
| 221 |
+
|
| 222 |
+
$cfg .= '$_CONFIG[\'splitBackupSize\']="' . $_REQUEST[splitBackupSize] . '";' . "\n";
|
| 223 |
+
|
| 224 |
$cfg .= '$_CONFIG[\'backup_refresh_number\']="' . $_REQUEST[backup_refresh_number] . '";' . "\n";
|
| 225 |
|
| 226 |
$cfg .= '$_CONFIG[\'sql_mem\']="' . $_REQUEST[sql_mem] . '";' . "\n";
|
| 245 |
|
| 246 |
$cfg .= '$_CONFIG[\'cron_amazon_active\']="' . $_REQUEST[cron_amazon_active] . '";' . "\n";
|
| 247 |
|
| 248 |
+
$cfg .= '$_CONFIG[\'cron_amazon_awsAccessKey\']=\'' . $_REQUEST[cron_amazon_awsAccessKey] . '\';' . "\n";
|
| 249 |
|
| 250 |
+
$cfg .= '$_CONFIG[\'cron_amazon_awsSecretKey\']=\'' . $_REQUEST[cron_amazon_awsSecretKey] . '\';' . "\n";
|
| 251 |
|
| 252 |
+
$cfg .= '$_CONFIG[\'cron_amazon_bucket\']=\'' . $_REQUEST[cron_amazon_bucket] . '\';' . "\n";
|
| 253 |
|
| 254 |
+
$cfg .= '$_CONFIG[\'cron_amazon_dirname\']=\'' . $_REQUEST[cron_amazon_dirname] . '\';' . "\n";
|
| 255 |
|
| 256 |
$cfg .= '$_CONFIG[\'debug\']="' . $_REQUEST[debug] . '";' . "\n";
|
| 257 |
|
| 274 |
} else {
|
| 275 |
|
| 276 |
|
| 277 |
+
$msg = "Unable to save ".$fcron." file, please make sure the folder is writeable!";
|
| 278 |
}
|
| 279 |
}
|
| 280 |
|
| 477 |
return $lang_arr;
|
| 478 |
}
|
| 479 |
|
| 480 |
+
function goRecurseDatabases(){
|
| 481 |
+
global $_CONFIG;
|
| 482 |
+
|
| 483 |
+
include_once("classes/mysqlBackup.class.php");
|
| 484 |
+
|
| 485 |
+
$return = array();
|
| 486 |
+
|
| 487 |
+
$data['dbHostname'] = $_CONFIG['mysql_host'];
|
| 488 |
+
$data['dbUsername'] = $_CONFIG['mysql_user'];
|
| 489 |
+
$data['dbPassword'] = $_CONFIG['mysql_pass'];
|
| 490 |
+
$data['dbDatabase'] = $_CONFIG['mysql_database'];
|
| 491 |
+
$data['excludedTables'] = "";
|
| 492 |
+
$data['recordsPerSession'] = $_CONFIG['recordsPerSession'];
|
| 493 |
+
$data['dbCompatibility'] = $_REQUEST['dbbackup_comp']; //version compatibility
|
| 494 |
+
$data['dbDropSyntax'] = $_REQUEST['dbbackup_drop']; //Add DROP Syntax
|
| 495 |
+
|
| 496 |
+
$data['TEMP_DUMP_FILE'] = $_CONFIG['temp_dir']."/database-sql.sql";
|
| 497 |
+
$data['TEMP_DBPROCESS_FILE'] = $_CONFIG['temp_dir']."/.database";
|
| 498 |
+
|
| 499 |
+
if($_REQUEST['mode'] == "start"){
|
| 500 |
+
//do the initial table readings
|
| 501 |
+
|
| 502 |
+
//foreach($_REQUEST['excltables'] as $value) //check if any tables are excluded, we will only export their structure
|
| 503 |
+
$data['excludedTables'] = $_REQUEST['excltables'];
|
| 504 |
+
|
| 505 |
+
//foreach($_REQUEST['excltables'] as $value) //check if any other databases are included
|
| 506 |
+
$extradb = $_REQUEST['databases_incl'];
|
| 507 |
+
|
| 508 |
+
$db = new DB();
|
| 509 |
+
$db->init($data, 1);
|
| 510 |
+
$db->writeTempFile();
|
| 511 |
+
$db->disconnect();
|
| 512 |
+
|
| 513 |
+
//building the .database temp file
|
| 514 |
+
if(is_array($extradb))
|
| 515 |
+
foreach($extradb as $database){
|
| 516 |
+
$data['dbDatabase'] = $database;
|
| 517 |
+
$data['TEMP_DUMP_FILE'] = $_CONFIG['temp_dir']."/".$data['dbDatabase']."-sql.sql";
|
| 518 |
+
$db = new DB();
|
| 519 |
+
$db->init($data);
|
| 520 |
+
$db->writeTempFile();
|
| 521 |
+
$db->disconnect();
|
| 522 |
+
|
| 523 |
+
}
|
| 524 |
+
|
| 525 |
+
return;
|
| 526 |
+
}
|
| 527 |
+
|
| 528 |
+
//we start the backup process for the actual database
|
| 529 |
+
|
| 530 |
+
$data['dbDatabase'] = "";
|
| 531 |
+
$dumpfile = "";
|
| 532 |
+
$data['dbCompatibility'] = $_REQUEST['dbbackup_comp']; //version compatibility
|
| 533 |
+
$data['dbDropSyntax'] = $_REQUEST['dbbackup_drop']; //Add DROP Syntax
|
| 534 |
+
$startAtLine = intval($_REQUEST['startAtLine']);
|
| 535 |
+
$startAtRecord = intval($_REQUEST['startAtRecord']);
|
| 536 |
+
$dumpfile = $_REQUEST['dumpfile'];
|
| 537 |
+
|
| 538 |
+
$db = new DB();
|
| 539 |
+
$db->init($data);
|
| 540 |
+
|
| 541 |
+
$records = $db->resetcountRecords();
|
| 542 |
+
|
| 543 |
+
while(($records < $_CONFIG['recordsPerSession']) and (!$return['finished']) and(!$return['newDump']) and(!$return['endDump'])){
|
| 544 |
+
|
| 545 |
+
$return = $db->processIncremental($startAtLine, $startAtRecord, $dumpfile);
|
| 546 |
+
|
| 547 |
+
$records = $db->getcountRecords();
|
| 548 |
+
$startAtLine = $return['startAtLine'];
|
| 549 |
+
$startAtRecord = $return['startAtRecord'];
|
| 550 |
+
$dumpfile = $return['dumpfile'];
|
| 551 |
+
|
| 552 |
+
}
|
| 553 |
+
|
| 554 |
+
/*if($return['newDump'])
|
| 555 |
+
print_r($return);*/
|
| 556 |
+
/*$startAtLine = $return['startAtLine'];
|
| 557 |
+
$startAtRecord = $return['startAtRecord'];
|
| 558 |
+
$dumpfile = $return['dumpfile'];*/
|
| 559 |
+
|
| 560 |
+
$return['dbbackup_comp'] = $_REQUEST['dbbackup_comp'];
|
| 561 |
+
$return['dbbackup_drop'] = $_REQUEST['dbbackup_drop'];
|
| 562 |
+
|
| 563 |
+
if($return['databaseName'] == "###enddump###")
|
| 564 |
+
$return['databaseName'] = "";
|
| 565 |
+
|
| 566 |
+
$db->disconnect();
|
| 567 |
+
|
| 568 |
+
echo json_encode($return);
|
| 569 |
+
exit;
|
| 570 |
+
|
| 571 |
+
}
|
| 572 |
|
| 573 |
function goRecurseFiles(){
|
| 574 |
|
| 575 |
global $_CONFIG;
|
| 576 |
+
|
| 577 |
include_once("classes/fileRecursion.php");
|
| 578 |
|
| 579 |
$status['finished'] = "1";
|
| 581 |
|
| 582 |
$handle = new fileRecursion();
|
| 583 |
|
| 584 |
+
$dataInit['TEMP_PERM'] = $_CONFIG['temp_dir']."/perm.txt";
|
| 585 |
+
$dataInit['TEMP_EXCL'] = $_CONFIG['exfile'];
|
| 586 |
+
$dataInit['TEMP_D_ARR'] = $_CONFIG['temp_dir']."/.dir";
|
| 587 |
+
$dataInit['TEMP_DIR'] = $_CONFIG['clonerPath'];
|
| 588 |
+
$dataInit['START_DIR'] = $_CONFIG['backup_path'];
|
| 589 |
+
$dataInit['EXCLUDE_FILES_SIZE'] = $_CONFIG['excludeFilesSize'];
|
| 590 |
+
$dataInit['TEMP_OVERSIZED_FILE'] = $_CONFIG['temp_dir']."/.oversized_files";
|
| 591 |
|
| 592 |
+
$handle->setData($dataInit);
|
| 593 |
|
| 594 |
if($_REQUEST['mode'] == 'start')
|
| 595 |
+
$handle->init($_CONFIG['backup_start_path']);
|
| 596 |
else
|
| 597 |
$handle->init();
|
| 598 |
|
| 607 |
|
| 608 |
if(!$handle->isQueueFinished())
|
| 609 |
$status['finished'] = "0";
|
| 610 |
+
else{
|
| 611 |
+
//recurse finished, lets return the excluded files by size
|
| 612 |
+
if(intval($_CONFIG['EXCLUDE_FILES_SIZE']) > -1){
|
| 613 |
+
$status['overlimit'] = $handle->getOverLimitFiles();
|
| 614 |
+
}
|
| 615 |
+
}
|
| 616 |
|
| 617 |
echo json_encode($status);
|
| 618 |
+
$handle->close();
|
| 619 |
exit;
|
| 620 |
|
| 621 |
}
|
| 900 |
{
|
| 901 |
global $_CONFIG;
|
| 902 |
|
| 903 |
+
$file = realpath($_CONFIG['clonerPath'] . "/$file");
|
| 904 |
|
| 905 |
//First, see if the file exists
|
| 906 |
if (!is_file($file)) {
|
| 914 |
|
| 915 |
//Setam Content-Type-urile pentru fisierul in cauza
|
| 916 |
switch ($file_extension) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 917 |
default:
|
| 918 |
$ctype = "application/force-download";
|
| 919 |
}
|
| 920 |
|
| 921 |
+
smartReadFile($file, $filename);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 922 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 923 |
exit;
|
| 924 |
}
|
| 925 |
|
| 926 |
+
function smartReadFile($location, $filename, $mimeType='application/octet-stream')
|
| 927 |
+
{ if(!file_exists($location))
|
| 928 |
+
{ header ("HTTP/1.0 404 Not Found");
|
| 929 |
+
return;
|
| 930 |
+
}
|
| 931 |
+
|
| 932 |
+
$size=filesize($location);
|
| 933 |
+
$time=date('r',filemtime($location));
|
| 934 |
+
|
| 935 |
+
$fm=@fopen($location,'r');
|
| 936 |
+
if(!$fm)
|
| 937 |
+
{ header ("HTTP/1.0 505 Internal server error");
|
| 938 |
+
return;
|
| 939 |
+
}
|
| 940 |
+
|
| 941 |
+
$begin=0;
|
| 942 |
+
$end=$size;
|
| 943 |
+
|
| 944 |
+
if(isset($_SERVER['HTTP_RANGE']))
|
| 945 |
+
{ if(preg_match('/bytes=\h*(\d+)-(\d*)[\D.*]?/i', $_SERVER['HTTP_RANGE'], $matches))
|
| 946 |
+
{ $begin=intval($matches[0]);
|
| 947 |
+
if(!empty($matches[1]))
|
| 948 |
+
$end=intval($matches[1]);
|
| 949 |
+
}
|
| 950 |
+
}
|
| 951 |
+
|
| 952 |
+
if($begin>0||$end<$size)
|
| 953 |
+
header('HTTP/1.0 206 Partial Content');
|
| 954 |
+
else
|
| 955 |
+
header('HTTP/1.0 200 OK');
|
| 956 |
+
|
| 957 |
+
header("Content-Type: $mimeType");
|
| 958 |
+
header('Cache-Control: public, must-revalidate, max-age=0');
|
| 959 |
+
header('Pragma: no-cache');
|
| 960 |
+
header('Accept-Ranges: bytes');
|
| 961 |
+
header('Content-Length:'.($end-$begin));
|
| 962 |
+
header("Content-Range: bytes $begin-$end/$size");
|
| 963 |
+
header("Content-Disposition: inline; filename=$filename");
|
| 964 |
+
header("Content-Transfer-Encoding: binary\n");
|
| 965 |
+
header("Last-Modified: $time");
|
| 966 |
+
header('Connection: close');
|
| 967 |
+
|
| 968 |
+
$cur=$begin;
|
| 969 |
+
fseek($fm,$begin,0);
|
| 970 |
+
|
| 971 |
+
while(!feof($fm)&&$cur<$end&&(connection_status()==0))
|
| 972 |
+
{ print fread($fm,min(1024*16,$end-$cur));
|
| 973 |
+
$cur+=1024*16;
|
| 974 |
+
}
|
| 975 |
+
}
|
| 976 |
+
|
| 977 |
|
| 978 |
function confirmBackup($option)
|
| 979 |
{
|
| 1063 |
|
| 1064 |
$log = "";
|
| 1065 |
|
| 1066 |
+
$backup_file = $_CONFIG['backup_store_path']."/".$backup_filename;
|
| 1067 |
|
| 1068 |
+
$perm_file = $_CONFIG['temp_dir'] . "/perm.txt";
|
| 1069 |
|
| 1070 |
|
| 1071 |
$lines = $_REQUEST['lines'];
|
| 1089 |
|
| 1090 |
$url = "index2.php?option=com_cloner&task=refresh&json=$json&startf=$endf&lines=$lines&backup=$backup_filename&excl_manual=" . $_REQUEST['excl_manual'];
|
| 1091 |
|
|
|
|
| 1092 |
if ($endf >= $lines)
|
| 1093 |
$endf = $lines;
|
| 1094 |
else
|
| 1097 |
if ((int)$lines != 0)
|
| 1098 |
$percent = sprintf("%d", ($endf * 100) / (int)$lines);
|
| 1099 |
|
|
|
|
| 1100 |
$log .= "Total process: $percent% out of $lines files<br />\n";
|
| 1101 |
$log .= "Processing files $startf to $endf for backup file $backup_file!<br />\n";
|
| 1102 |
$log .= "Current backup size: " . getFileSizeText(get_filesize($backup_file)) . "<br /><br />\n";
|
| 1118 |
//## appending files
|
| 1119 |
$log .= "file - $file";
|
| 1120 |
|
| 1121 |
+
if(intval($_CONFIG['splitBackupSize']) > 0){
|
| 1122 |
+
|
| 1123 |
+
$fileSize = intval($buffer[2]);
|
| 1124 |
+
$backupSize = get_filesize($backup_file);
|
| 1125 |
+
$limit = $_CONFIG['splitBackupSize']*1024*1024; //MB limit
|
| 1126 |
+
|
| 1127 |
+
//check if the size is bigger than $_CONFIF['splitBackupSize'] and split backup
|
| 1128 |
+
if(($fileSize+$backupSize) > $limit){
|
| 1129 |
+
|
| 1130 |
+
$backup_filename = getNewBackupName($backup_filename);
|
| 1131 |
+
//exit;
|
| 1132 |
+
$backup_file = $_CONFIG['backup_store_path']."/".$backup_filename;
|
| 1133 |
+
|
| 1134 |
+
}
|
| 1135 |
+
|
| 1136 |
+
}
|
| 1137 |
+
|
| 1138 |
|
| 1139 |
if (!$_CONFIG['mem']) {
|
| 1140 |
//### CREATE BACKUP USING TAR LIBRARIES
|
| 1168 |
}
|
| 1169 |
|
| 1170 |
//exit;
|
| 1171 |
+
$newFileSize = get_filesize($backup_file);
|
| 1172 |
$log .= "\n<br />New backup size: " . $newFileSize . "<br />\n";
|
| 1173 |
|
| 1174 |
addXLog($log);
|
| 1183 |
//# REDIRECTING
|
| 1184 |
@fclose($fperm);
|
| 1185 |
|
| 1186 |
+
$log .= "<br>All done, redirecting... or <a href='$url'>click here </a>";
|
| 1187 |
|
| 1188 |
$log .= "
|
| 1189 |
+
<script language='javascript'>
|
| 1190 |
+
function redirect(){
|
| 1191 |
+
window.location = '" . $url . "';
|
| 1192 |
+
}
|
| 1193 |
|
| 1194 |
+
setTimeout(\"redirect()\",parseInt(" . $_CONFIG['refresh_time'] . "));
|
| 1195 |
+
//redirect();
|
| 1196 |
|
| 1197 |
+
</script>";
|
| 1198 |
}
|
|
|
|
|
|
|
| 1199 |
|
| 1200 |
+
} else {
|
| 1201 |
$log .= "Unable to continue, could not open file $perm_file for reading!";
|
| 1202 |
}
|
| 1203 |
|
| 1211 |
$status['finished'] = 1;
|
| 1212 |
}
|
| 1213 |
|
| 1214 |
+
if(!$json){
|
| 1215 |
+
echo $log;
|
| 1216 |
}
|
| 1217 |
+
else{
|
| 1218 |
$status['backupSize'] = $newFileSize;
|
| 1219 |
$status['percent'] = $percent;
|
| 1220 |
$status['option'] = 'com_cloner';
|
| 1228 |
echo json_encode($status);
|
| 1229 |
exit;
|
| 1230 |
|
| 1231 |
+
}
|
| 1232 |
|
| 1233 |
return;
|
| 1234 |
}
|
| 1247 |
if (!$_CONFIG['enable_db_backup']) {
|
| 1248 |
$backupDatabase = 0;
|
| 1249 |
} else {
|
| 1250 |
+
$backupDatabase = $_REQUEST['dbbackup'];
|
|
|
|
|
|
|
| 1251 |
}
|
| 1252 |
|
| 1253 |
if ($_REQUEST[cron_access]) {
|
| 1284 |
$f_ext = '.tgz';
|
| 1285 |
$_CONFIG['tarcompress'] = 'z';
|
| 1286 |
} else {
|
|
|
|
|
|
|
| 1287 |
$f_ext = '.tar';
|
| 1288 |
$_CONFIG['tarcompress'] = '';
|
| 1289 |
}
|
| 1313 |
$filename1 = $_REQUEST['bname'] . $f_ext;
|
| 1314 |
}
|
| 1315 |
|
| 1316 |
+
//check if comments are set
|
| 1317 |
+
if($_REQUEST['backupComments'] != "")
|
| 1318 |
+
writeComments($_REQUEST['backupComments']);
|
| 1319 |
+
|
| 1320 |
+
//we created the backup name, but skip sql at this step, we will do it incrementally
|
| 1321 |
+
if(($_CONFIG['refresh_mode']) and (!$_REQUEST[cron_access]))
|
| 1322 |
+
//we skip the backup at this process,we will do it incrementally
|
| 1323 |
+
$backupDatabase = 0;
|
| 1324 |
+
|
| 1325 |
$sql_file = array();
|
| 1326 |
|
| 1327 |
if ($backupDatabase == 1) {
|
| 1349 |
mysql_query("USE " . $_CONFIG['mysql_database']);
|
| 1350 |
}
|
| 1351 |
} else {
|
| 1352 |
+
#$databaseResult = LM_DATABASE_EXCLUDED;
|
| 1353 |
}
|
| 1354 |
|
| 1355 |
|
| 1442 |
|
| 1443 |
if(($_REQUEST['cron_access']) or (!$_CONFIG['refresh_mode'])){
|
| 1444 |
|
| 1445 |
+
$perm_file = $_CONFIG['backups_dir'] . "/perm.txt";
|
| 1446 |
+
@unlink($perm_file);
|
| 1447 |
+
$fperm = fopen($perm_file, "w");
|
| 1448 |
|
| 1449 |
+
for ($i = 0; $i < sizeof($excluded); $i++) {
|
| 1450 |
+
$excluded[$i] = str_replace("//", "/", $excluded[$i]);
|
| 1451 |
+
}
|
| 1452 |
|
| 1453 |
+
// obtain the list of files by recursing the mambo file store
|
| 1454 |
+
addXLog("Starting the file scanning process");
|
| 1455 |
|
| 1456 |
+
recurseFiles($d_arr, $ds_arr, $f_arr, $s_arr, $d, $f, $s, $includeFolder, '', $excluded, $fperm);
|
|
|
|
|
|
|
| 1457 |
|
| 1458 |
+
@fclose($fperm);
|
| 1459 |
+
|
| 1460 |
+
@chmod($perm_file, 0777);
|
| 1461 |
+
|
| 1462 |
+
}
|
| 1463 |
|
| 1464 |
|
| 1465 |
// format total archive size
|
| 1515 |
|
| 1516 |
if ($_CONFIG['backup_refresh']) {
|
| 1517 |
$f_arr = array($_CONFIG['backups_dir'] . "/index.html");
|
| 1518 |
+
$fp=@fopen($_CONFIG['backups_dir'] . "/index.html" , "w");
|
| 1519 |
+
if($fp)
|
| 1520 |
+
fclose($fp);
|
| 1521 |
}
|
| 1522 |
|
| 1523 |
|
| 1540 |
|
| 1541 |
if ($_CONFIG['backup_refresh']) {
|
| 1542 |
// echo "Starting the manual backup process!<br />";
|
| 1543 |
+
if((!$_CONFIG['refresh_mode']) and ($_CONFIG['enable_db_backup']))
|
| 1544 |
+
echo "<h2>Database backup: </h2>" . $databaseResult . "<br /><br />";
|
| 1545 |
|
| 1546 |
HTML_cloner::goRefreshHtml($filename, $perm_lines, $excl_manual);
|
| 1547 |
return;
|
| 2080 |
}
|
| 2081 |
}
|
| 2082 |
|
| 2083 |
+
function getNewBackupName($backupFilename){
|
| 2084 |
|
| 2085 |
+
$newFilename = $backupFilename;
|
| 2086 |
+
|
| 2087 |
+
$tmp = explode(".",$backupFilename);
|
| 2088 |
+
$extension = $tmp[sizeof($tmp)-1];
|
| 2089 |
+
$inc = $tmp[sizeof($tmp)-2];
|
| 2090 |
+
|
| 2091 |
+
if(strlen($inc)<3){
|
| 2092 |
+
$newinc = $inc+1;
|
| 2093 |
+
$newFilename = str_replace(".$inc.$extension", "", $backupFilename); //ex, replace .1.tar
|
| 2094 |
+
$newFilename = $newFilename .".$newinc.$extension";
|
| 2095 |
+
}else{
|
| 2096 |
+
//it is a first backup, no .0.tar
|
| 2097 |
+
$newFilename = str_replace(".".$extension, "", $backupFilename); //ex, replace .1.tar
|
| 2098 |
+
$newFilename = $newFilename .".1.". $extension;
|
| 2099 |
+
}
|
| 2100 |
+
|
| 2101 |
+
return $newFilename;
|
| 2102 |
+
}
|
| 2103 |
+
|
| 2104 |
+
function writeComments($comments){
|
| 2105 |
+
global $_CONFIG;
|
| 2106 |
+
|
| 2107 |
+
$fp = @fopen($_CONFIG['commentsfile'], "w");
|
| 2108 |
+
if($fp){
|
| 2109 |
+
fwrite($fp, stripcslashes($comments));
|
| 2110 |
+
fclose($fp);
|
| 2111 |
+
}
|
| 2112 |
+
else{
|
| 2113 |
+
addXLog("Unable to write comments to file ".$_CONFIG['commentsfile']);
|
| 2114 |
+
}
|
| 2115 |
+
|
| 2116 |
+
|
| 2117 |
+
}
|
| 2118 |
+
|
| 2119 |
+
function getVersion()
|
| 2120 |
+
{
|
| 2121 |
+
$query = mysql_query("SELECT version()");
|
| 2122 |
+
$row = mysql_fetch_array($query);
|
| 2123 |
+
return $row[0];
|
| 2124 |
+
}
|
| 2125 |
?>
|
common.php
CHANGED
|
@@ -1,22 +1,39 @@
|
|
| 1 |
<?php
|
| 2 |
-
|
| 3 |
-
*
|
| 4 |
-
*
|
| 5 |
-
*
|
| 6 |
-
*
|
| 7 |
-
*
|
| 8 |
-
*
|
| 9 |
-
*
|
| 10 |
-
*
|
| 11 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 12 |
if ((!extension_loaded('zlib')) &&(function_exists('ob_start'))) {
|
| 13 |
ob_end_clean();
|
| 14 |
ob_start('ob_gzhandler');
|
| 15 |
-
}
|
| 16 |
|
| 17 |
####################################
|
| 18 |
|
| 19 |
$_CONFIG['multiple_config_dir'] = "configs";
|
|
|
|
|
|
|
|
|
|
| 20 |
|
| 21 |
$_CONFIG['backup_path'] = realpath($_CONFIG['backup_path'])."/";
|
| 22 |
$_CONFIG['backups_dir'] = realpath($_CONFIG['backup_path'])."/administrator/backups";
|
|
@@ -24,8 +41,13 @@ $_CONFIG['backups_dir'] = realpath($_CONFIG['backup_path'])."/administrator/back
|
|
| 24 |
$_CONFIG['backup_path'] = str_replace("\\","/", $_CONFIG['backup_path']);
|
| 25 |
$_CONFIG['backups_dir'] = str_replace("\\","/", $_CONFIG['backups_dir']);
|
| 26 |
|
|
|
|
| 27 |
$_CONFIG['exfile'] = $_CONFIG['backups_dir']."/.excl";
|
| 28 |
$_CONFIG['exfile_tar'] = $_CONFIG['backups_dir']."/.excl_tar";
|
|
|
|
|
|
|
|
|
|
|
|
|
| 29 |
$_CONFIG['script_path'] = str_replace("\\","/",dirname(__FILE__));
|
| 30 |
|
| 31 |
$lang_dir = "language";
|
|
@@ -37,7 +59,7 @@ $task = $_REQUEST['task'];
|
|
| 37 |
if($_CONFIG['enable_db_backup']){
|
| 38 |
|
| 39 |
### Connecting to the mysql server
|
| 40 |
-
@mysql_connect($_CONFIG['mysql_host'], $_CONFIG['mysql_user'], $_CONFIG['mysql_pass']) or
|
| 41 |
E_print("Could not connect: " . mysql_error());
|
| 42 |
@mysql_select_db($_CONFIG['mysql_database']) or E_print("Unable to select database ".$_CONFIG['mysql_database']);
|
| 43 |
@mysql_query("SET NAMES 'utf8'");
|
|
@@ -55,17 +77,20 @@ if (file_exists( "language/".$mosConfig_lang.".php" )) {
|
|
| 55 |
|
| 56 |
@include_once( "language/english.php" );
|
| 57 |
|
| 58 |
-
}
|
| 59 |
|
| 60 |
else{
|
|
|
|
| 61 |
include_once( "language/english.php" );
|
|
|
|
| 62 |
}
|
| 63 |
|
| 64 |
$version = str_replace(".", "", phpversion());
|
| 65 |
-
if(
|
| 66 |
$_CONFIG['refresh_mode']="0";
|
| 67 |
}
|
| 68 |
-
|
|
|
|
| 69 |
$_CONFIG['refresh_mode']="0";
|
| 70 |
}
|
| 71 |
|
| 1 |
<?php
|
| 2 |
+
/*
|
| 3 |
+
* common.php
|
| 4 |
+
*
|
| 5 |
+
* Copyright 2011 Ovidiu Liuta <info@thinkovi.com>
|
| 6 |
+
*
|
| 7 |
+
* This program is free software; you can redistribute it and/or modify
|
| 8 |
+
* it under the terms of the GNU General Public License as published by
|
| 9 |
+
* the Free Software Foundation; either version 2 of the License, or
|
| 10 |
+
* (at your option) any later version.
|
| 11 |
+
*
|
| 12 |
+
* This program is distributed in the hope that it will be useful,
|
| 13 |
+
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 14 |
+
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 15 |
+
* GNU General Public License for more details.
|
| 16 |
+
*
|
| 17 |
+
* You should have received a copy of the GNU General Public License
|
| 18 |
+
* along with this program; if not, write to the Free Software
|
| 19 |
+
* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston,
|
| 20 |
+
* MA 02110-1301, USA.
|
| 21 |
+
*/
|
| 22 |
+
|
| 23 |
+
/** ensure this file is being included by a parent file */
|
| 24 |
+
defined( '_VALID_MOS' ) or die( 'Direct Access to this location is not allowed.' );
|
| 25 |
+
|
| 26 |
if ((!extension_loaded('zlib')) &&(function_exists('ob_start'))) {
|
| 27 |
ob_end_clean();
|
| 28 |
ob_start('ob_gzhandler');
|
| 29 |
+
}
|
| 30 |
|
| 31 |
####################################
|
| 32 |
|
| 33 |
$_CONFIG['multiple_config_dir'] = "configs";
|
| 34 |
+
//$strlen = strlen($_CONFIG['backup_path']);
|
| 35 |
+
//if((substr($_CONFIG['backup_path'], $strlen-1, $strlen) != '/') && (substr($_CONFIG['backup_path'], $strlen-1, $strlen) != '\\'))
|
| 36 |
+
// $_CONFIG['backup_path'] .= "/";
|
| 37 |
|
| 38 |
$_CONFIG['backup_path'] = realpath($_CONFIG['backup_path'])."/";
|
| 39 |
$_CONFIG['backups_dir'] = realpath($_CONFIG['backup_path'])."/administrator/backups";
|
| 41 |
$_CONFIG['backup_path'] = str_replace("\\","/", $_CONFIG['backup_path']);
|
| 42 |
$_CONFIG['backups_dir'] = str_replace("\\","/", $_CONFIG['backups_dir']);
|
| 43 |
|
| 44 |
+
|
| 45 |
$_CONFIG['exfile'] = $_CONFIG['backups_dir']."/.excl";
|
| 46 |
$_CONFIG['exfile_tar'] = $_CONFIG['backups_dir']."/.excl_tar";
|
| 47 |
+
|
| 48 |
+
$_CONFIG['logfile'] = $_CONFIG['backups_dir']."/xcloner.log";
|
| 49 |
+
$_CONFIG['commentsfile'] = $_CONFIG['backups_dir']."/.comments"; #$_REQUEST['backupComments']
|
| 50 |
+
|
| 51 |
$_CONFIG['script_path'] = str_replace("\\","/",dirname(__FILE__));
|
| 52 |
|
| 53 |
$lang_dir = "language";
|
| 59 |
if($_CONFIG['enable_db_backup']){
|
| 60 |
|
| 61 |
### Connecting to the mysql server
|
| 62 |
+
$link = @mysql_connect($_CONFIG['mysql_host'], $_CONFIG['mysql_user'], $_CONFIG['mysql_pass']) or
|
| 63 |
E_print("Could not connect: " . mysql_error());
|
| 64 |
@mysql_select_db($_CONFIG['mysql_database']) or E_print("Unable to select database ".$_CONFIG['mysql_database']);
|
| 65 |
@mysql_query("SET NAMES 'utf8'");
|
| 77 |
|
| 78 |
@include_once( "language/english.php" );
|
| 79 |
|
| 80 |
+
}
|
| 81 |
|
| 82 |
else{
|
| 83 |
+
|
| 84 |
include_once( "language/english.php" );
|
| 85 |
+
|
| 86 |
}
|
| 87 |
|
| 88 |
$version = str_replace(".", "", phpversion());
|
| 89 |
+
if (version_compare(PHP_VERSION, '5.2.3') < 0) {
|
| 90 |
$_CONFIG['refresh_mode']="0";
|
| 91 |
}
|
| 92 |
+
|
| 93 |
+
if (!$_CONFIG['backup_refresh']) {
|
| 94 |
$_CONFIG['refresh_mode']="0";
|
| 95 |
}
|
| 96 |
|
configs/test.php
ADDED
|
@@ -0,0 +1,53 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
$_CONFIG['license_code']="";
|
| 3 |
+
$_CONFIG['backup_path']="/opt/lampp/htdocs/Joomla_1.6.0/";
|
| 4 |
+
$_CONFIG['clonerPath']="/opt/lampp/htdocs/Joomla_1.6.0/administrator/backups";
|
| 5 |
+
$_CONFIG['jcuser']="admin";
|
| 6 |
+
$_CONFIG['jcpass']='21232f297a57a5a743894a0e4a801fc3';
|
| 7 |
+
$_CONFIG['mysql_host']="localhost";
|
| 8 |
+
$_CONFIG['mysql_user']="root";
|
| 9 |
+
$_CONFIG['mysql_pass']='';
|
| 10 |
+
$_CONFIG['mysql_database']="joomla16";
|
| 11 |
+
$_CONFIG['select_folders']="";
|
| 12 |
+
$_CONFIG['select_lang']="english";
|
| 13 |
+
$_CONFIG['secure_ftp']="0";
|
| 14 |
+
$_CONFIG['backup_compress']="0";
|
| 15 |
+
$_CONFIG['cron_logemail']="";
|
| 16 |
+
$_CONFIG['cron_exclude']="";
|
| 17 |
+
$_CONFIG['cron_send']="0";
|
| 18 |
+
$_CONFIG['cron_btype']="0";
|
| 19 |
+
$_CONFIG['cron_bname']="";
|
| 20 |
+
$_CONFIG['cron_ip']="";
|
| 21 |
+
$_CONFIG['cron_ftp_server']="";
|
| 22 |
+
$_CONFIG['cron_ftp_user']="";
|
| 23 |
+
$_CONFIG['cron_ftp_pass']='';
|
| 24 |
+
$_CONFIG['cron_ftp_path']="";
|
| 25 |
+
$_CONFIG['cron_ftp_delb']="";
|
| 26 |
+
$_CONFIG['databases_incl_list']="";
|
| 27 |
+
$_CONFIG['cron_sql_drop']="";
|
| 28 |
+
$_CONFIG['cron_email_address']="";
|
| 29 |
+
$_CONFIG['cron_file_delete']="0";
|
| 30 |
+
$_CONFIG['cron_file_delete_act']="";
|
| 31 |
+
$_CONFIG['mem']="";
|
| 32 |
+
$_CONFIG['backup_refresh']="1";
|
| 33 |
+
$_CONFIG['refresh_time']="1";
|
| 34 |
+
$_CONFIG['refresh_mode']="1";
|
| 35 |
+
$_CONFIG['recordsPerSession']="10000";
|
| 36 |
+
$_CONFIG['backup_refresh_number']="100";
|
| 37 |
+
$_CONFIG['sql_mem']="";
|
| 38 |
+
$_CONFIG['enable_db_backup']="1";
|
| 39 |
+
$_CONFIG['zippath']="";
|
| 40 |
+
$_CONFIG['tarpath']="tar";
|
| 41 |
+
$_CONFIG['sqldump']="mysqldump --quote-names ";
|
| 42 |
+
$_CONFIG['system_dlink']="";
|
| 43 |
+
$_CONFIG['mosConfig_live_site']="localhost";
|
| 44 |
+
$_CONFIG['system_ftptransfer']="0";
|
| 45 |
+
$_CONFIG['system_mdatabases']="0";
|
| 46 |
+
$_CONFIG['add_backups_dir']="0";
|
| 47 |
+
$_CONFIG['cron_amazon_active']="";
|
| 48 |
+
$_CONFIG['cron_amazon_awsAccessKey']="";
|
| 49 |
+
$_CONFIG['cron_amazon_awsSecretKey']="";
|
| 50 |
+
$_CONFIG['cron_amazon_bucket']="";
|
| 51 |
+
$_CONFIG['cron_amazon_dirname']="";
|
| 52 |
+
$_CONFIG['debug']="0";
|
| 53 |
+
?>
|
css/main.css
CHANGED
|
@@ -155,16 +155,16 @@ a.pagenav:active {
|
|
| 155 |
}
|
| 156 |
.inputbox {
|
| 157 |
z-index: -3;
|
| 158 |
-
font-size:
|
| 159 |
}
|
| 160 |
.text_area {
|
| 161 |
border : 1px solid #ccc;
|
| 162 |
z-index: -3;
|
| 163 |
-
font-size:
|
| 164 |
}
|
| 165 |
input, textarea, select {
|
| 166 |
z-index : -3;
|
| 167 |
-
font-size:
|
| 168 |
}
|
| 169 |
.small {
|
| 170 |
color : #FF9900;
|
|
@@ -190,7 +190,7 @@ table.menubar {
|
|
| 190 |
|
| 191 |
}
|
| 192 |
td {
|
| 193 |
-
font-size:
|
| 194 |
}
|
| 195 |
/* header block */
|
| 196 |
table.adminheading {
|
|
@@ -309,7 +309,8 @@ table.adminlist th {
|
|
| 309 |
padding: 6px 4px 2px 4px;
|
| 310 |
height: 25px;
|
| 311 |
background-repeat: repeat;
|
| 312 |
-
font-size:
|
|
|
|
| 313 |
color: #000;
|
| 314 |
}
|
| 315 |
table.adminlist th.title {
|
|
@@ -378,7 +379,6 @@ table.adminform th {
|
|
| 378 |
table.adminform td {
|
| 379 |
padding: 3px;
|
| 380 |
border: solid 1px #d5d5d5;
|
| 381 |
-
|
| 382 |
text-align: left;
|
| 383 |
}
|
| 384 |
table.adminform td.editor {
|
|
@@ -720,4 +720,88 @@ display:block;
|
|
| 720 |
.mtext {
|
| 721 |
font-weight: bold;
|
| 722 |
font-size: 16px;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 723 |
}
|
| 155 |
}
|
| 156 |
.inputbox {
|
| 157 |
z-index: -3;
|
| 158 |
+
font-size: 12px;
|
| 159 |
}
|
| 160 |
.text_area {
|
| 161 |
border : 1px solid #ccc;
|
| 162 |
z-index: -3;
|
| 163 |
+
font-size: 12px;
|
| 164 |
}
|
| 165 |
input, textarea, select {
|
| 166 |
z-index : -3;
|
| 167 |
+
font-size: 14px;
|
| 168 |
}
|
| 169 |
.small {
|
| 170 |
color : #FF9900;
|
| 190 |
|
| 191 |
}
|
| 192 |
td {
|
| 193 |
+
font-size: 12px;
|
| 194 |
}
|
| 195 |
/* header block */
|
| 196 |
table.adminheading {
|
| 309 |
padding: 6px 4px 2px 4px;
|
| 310 |
height: 25px;
|
| 311 |
background-repeat: repeat;
|
| 312 |
+
font-size: 13px;
|
| 313 |
+
text-align: left;
|
| 314 |
color: #000;
|
| 315 |
}
|
| 316 |
table.adminlist th.title {
|
| 379 |
table.adminform td {
|
| 380 |
padding: 3px;
|
| 381 |
border: solid 1px #d5d5d5;
|
|
|
|
| 382 |
text-align: left;
|
| 383 |
}
|
| 384 |
table.adminform td.editor {
|
| 720 |
.mtext {
|
| 721 |
font-weight: bold;
|
| 722 |
font-size: 16px;
|
| 723 |
+
display:inline;
|
| 724 |
+
}
|
| 725 |
+
|
| 726 |
+
#configtabinside div h3{
|
| 727 |
+
padding: 15px 0 5px 0;
|
| 728 |
+
font-weight: bold;
|
| 729 |
+
}
|
| 730 |
+
|
| 731 |
+
.backup_name {
|
| 732 |
+
font-size:16px;
|
| 733 |
+
}
|
| 734 |
+
|
| 735 |
+
#mysqlProcess{
|
| 736 |
+
|
| 737 |
+
padding-left: 50px;
|
| 738 |
+
}
|
| 739 |
+
|
| 740 |
+
#mysqlBackup{
|
| 741 |
+
padding-bottom: 10px;
|
| 742 |
+
}
|
| 743 |
+
|
| 744 |
+
#recurseFiles{
|
| 745 |
+
|
| 746 |
+
padding-left: 50px;
|
| 747 |
+
}
|
| 748 |
+
|
| 749 |
+
.mainText a{
|
| 750 |
+
font-weight: bold;
|
| 751 |
+
}
|
| 752 |
+
|
| 753 |
+
.mainText li{
|
| 754 |
+
font-weight: bold;
|
| 755 |
+
padding: 5px 0 5px 0;
|
| 756 |
+
list-style: disc inside;
|
| 757 |
+
}
|
| 758 |
+
|
| 759 |
+
.mainText{
|
| 760 |
+
padding: 5px 10px 10px 10px;
|
| 761 |
+
width: auto;
|
| 762 |
+
border: 1px solid #2e90bd;
|
| 763 |
+
}
|
| 764 |
+
|
| 765 |
+
.mainText h2{
|
| 766 |
+
padding-bottom: 5px;
|
| 767 |
+
}
|
| 768 |
+
|
| 769 |
+
.header a{
|
| 770 |
+
color: #000;
|
| 771 |
+
}
|
| 772 |
+
|
| 773 |
+
.adminForm textarea, .adminForm input, .adminForm select, .mainText input{
|
| 774 |
+
color: #000;
|
| 775 |
+
background: #fefefe;
|
| 776 |
+
border: 1px outset #2e90bd;
|
| 777 |
+
margin-left: 1px;
|
| 778 |
+
font-family: Tahoma, Arial;
|
| 779 |
+
}
|
| 780 |
+
|
| 781 |
+
.adminForm a, .adminform a {
|
| 782 |
+
font-family: Tahoma, Arial;
|
| 783 |
+
font-weight: bold;
|
| 784 |
+
}
|
| 785 |
+
|
| 786 |
+
.loginForm table {
|
| 787 |
+
border: 1px dashed #2e90bd;
|
| 788 |
+
font-size:12px;
|
| 789 |
+
}
|
| 790 |
+
.loginForm input{
|
| 791 |
+
color: #000;
|
| 792 |
+
background: #fefefe;
|
| 793 |
+
border: 1px outset #2e90bd;
|
| 794 |
+
margin-left: 1px;
|
| 795 |
+
font-family: Tahoma, Arial;
|
| 796 |
+
|
| 797 |
+
}
|
| 798 |
+
.oversizedFile{
|
| 799 |
+
padding-left: 25px;
|
| 800 |
+
}
|
| 801 |
+
|
| 802 |
+
.sliderContainer{
|
| 803 |
+
|
| 804 |
+
display: inline;
|
| 805 |
+
margin-bottom: 15px;
|
| 806 |
+
|
| 807 |
}
|
css/start/images/ui-bg_flat_55_999999_40x100.png
ADDED
|
Binary file
|
css/start/images/ui-bg_flat_75_aaaaaa_40x100.png
ADDED
|
Binary file
|
css/start/images/ui-bg_glass_45_0078ae_1x400.png
ADDED
|
Binary file
|
css/start/images/ui-bg_glass_55_f8da4e_1x400.png
ADDED
|
Binary file
|
css/start/images/ui-bg_glass_75_79c9ec_1x400.png
ADDED
|
Binary file
|
css/start/images/ui-bg_gloss-wave_45_e14f1c_500x100.png
ADDED
|
Binary file
|
css/start/images/ui-bg_gloss-wave_50_6eac2c_500x100.png
ADDED
|
Binary file
|
css/start/images/ui-bg_gloss-wave_75_2191c0_500x100.png
ADDED
|
Binary file
|
css/start/images/ui-bg_inset-hard_100_fcfdfd_1x100.png
ADDED
|
Binary file
|
css/start/images/ui-icons_0078ae_256x240.png
ADDED
|
Binary file
|
css/start/images/ui-icons_056b93_256x240.png
ADDED
|
Binary file
|
css/start/images/ui-icons_d8e7f3_256x240.png
ADDED
|
Binary file
|
css/start/images/ui-icons_e0fdff_256x240.png
ADDED
|
Binary file
|
css/start/images/ui-icons_f5e175_256x240.png
ADDED
|
Binary file
|
css/start/images/ui-icons_f7a50d_256x240.png
ADDED
|
Binary file
|
css/start/images/ui-icons_fcd113_256x240.png
ADDED
|
Binary file
|
css/{jquery-ui.css → start/jquery-ui-1.8.9.custom.css}
RENAMED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
/*
|
| 2 |
-
* jQuery UI CSS Framework 1.8.
|
| 3 |
*
|
| 4 |
-
* Copyright
|
| 5 |
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 6 |
* http://jquery.org/license
|
| 7 |
*
|
|
@@ -39,323 +39,48 @@
|
|
| 39 |
|
| 40 |
/* Overlays */
|
| 41 |
.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
|
| 42 |
-
/*
|
| 43 |
-
* jQuery UI Accordion 1.8.8
|
| 44 |
-
*
|
| 45 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 46 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 47 |
-
* http://jquery.org/license
|
| 48 |
-
*
|
| 49 |
-
* http://docs.jquery.com/UI/Accordion#theming
|
| 50 |
-
*/
|
| 51 |
-
/* IE/Win - Fix animation bug - #4615 */
|
| 52 |
-
.ui-accordion { width: 100%; }
|
| 53 |
-
.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
|
| 54 |
-
.ui-accordion .ui-accordion-li-fix { display: inline; }
|
| 55 |
-
.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
|
| 56 |
-
.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
|
| 57 |
-
.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
|
| 58 |
-
.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
|
| 59 |
-
.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
|
| 60 |
-
.ui-accordion .ui-accordion-content-active { display: block; }/*
|
| 61 |
-
* jQuery UI Autocomplete 1.8.8
|
| 62 |
-
*
|
| 63 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 64 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 65 |
-
* http://jquery.org/license
|
| 66 |
-
*
|
| 67 |
-
* http://docs.jquery.com/UI/Autocomplete#theming
|
| 68 |
-
*/
|
| 69 |
-
.ui-autocomplete { position: absolute; cursor: default; }
|
| 70 |
-
|
| 71 |
-
/* workarounds */
|
| 72 |
-
* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
|
| 73 |
-
|
| 74 |
-
/*
|
| 75 |
-
* jQuery UI Menu 1.8.8
|
| 76 |
-
*
|
| 77 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 78 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 79 |
-
* http://jquery.org/license
|
| 80 |
-
*
|
| 81 |
-
* http://docs.jquery.com/UI/Menu#theming
|
| 82 |
-
*/
|
| 83 |
-
.ui-menu {
|
| 84 |
-
list-style:none;
|
| 85 |
-
padding: 2px;
|
| 86 |
-
margin: 0;
|
| 87 |
-
display:block;
|
| 88 |
-
float: left;
|
| 89 |
-
}
|
| 90 |
-
.ui-menu .ui-menu {
|
| 91 |
-
margin-top: -3px;
|
| 92 |
-
}
|
| 93 |
-
.ui-menu .ui-menu-item {
|
| 94 |
-
margin:0;
|
| 95 |
-
padding: 0;
|
| 96 |
-
zoom: 1;
|
| 97 |
-
float: left;
|
| 98 |
-
clear: left;
|
| 99 |
-
width: 100%;
|
| 100 |
-
}
|
| 101 |
-
.ui-menu .ui-menu-item a {
|
| 102 |
-
text-decoration:none;
|
| 103 |
-
display:block;
|
| 104 |
-
padding:.2em .4em;
|
| 105 |
-
line-height:1.5;
|
| 106 |
-
zoom:1;
|
| 107 |
-
}
|
| 108 |
-
.ui-menu .ui-menu-item a.ui-state-hover,
|
| 109 |
-
.ui-menu .ui-menu-item a.ui-state-active {
|
| 110 |
-
font-weight: normal;
|
| 111 |
-
margin: -1px;
|
| 112 |
-
}
|
| 113 |
-
/*
|
| 114 |
-
* jQuery UI Button 1.8.8
|
| 115 |
-
*
|
| 116 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 117 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 118 |
-
* http://jquery.org/license
|
| 119 |
-
*
|
| 120 |
-
* http://docs.jquery.com/UI/Button#theming
|
| 121 |
-
*/
|
| 122 |
-
.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
|
| 123 |
-
.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
|
| 124 |
-
button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
|
| 125 |
-
.ui-button-icons-only { width: 3.4em; }
|
| 126 |
-
button.ui-button-icons-only { width: 3.7em; }
|
| 127 |
-
|
| 128 |
-
/*button text element */
|
| 129 |
-
.ui-button .ui-button-text { display: block; line-height: 1.4; }
|
| 130 |
-
.ui-button-text-only .ui-button-text { padding: .4em 1em; }
|
| 131 |
-
.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
|
| 132 |
-
.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
|
| 133 |
-
.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
|
| 134 |
-
.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
|
| 135 |
-
/* no icon support for input elements, provide padding by default */
|
| 136 |
-
input.ui-button { padding: .4em 1em; }
|
| 137 |
|
| 138 |
-
/*button icon element(s) */
|
| 139 |
-
.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
|
| 140 |
-
.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
|
| 141 |
-
.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
|
| 142 |
-
.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
|
| 143 |
-
.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
|
| 144 |
-
|
| 145 |
-
/*button sets*/
|
| 146 |
-
.ui-buttonset { margin-right: 7px; }
|
| 147 |
-
.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
|
| 148 |
|
| 149 |
-
/* workarounds */
|
| 150 |
-
button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
|
| 151 |
/*
|
| 152 |
-
* jQuery UI
|
| 153 |
*
|
| 154 |
-
* Copyright
|
| 155 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 156 |
-
* http://jquery.org/license
|
| 157 |
-
*
|
| 158 |
-
* http://docs.jquery.com/UI/Datepicker#theming
|
| 159 |
-
*/
|
| 160 |
-
.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
|
| 161 |
-
.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
|
| 162 |
-
.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
|
| 163 |
-
.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
|
| 164 |
-
.ui-datepicker .ui-datepicker-prev { left:2px; }
|
| 165 |
-
.ui-datepicker .ui-datepicker-next { right:2px; }
|
| 166 |
-
.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
|
| 167 |
-
.ui-datepicker .ui-datepicker-next-hover { right:1px; }
|
| 168 |
-
.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
|
| 169 |
-
.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
|
| 170 |
-
.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
|
| 171 |
-
.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
|
| 172 |
-
.ui-datepicker select.ui-datepicker-month,
|
| 173 |
-
.ui-datepicker select.ui-datepicker-year { width: 49%;}
|
| 174 |
-
.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
|
| 175 |
-
.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
|
| 176 |
-
.ui-datepicker td { border: 0; padding: 1px; }
|
| 177 |
-
.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
|
| 178 |
-
.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
|
| 179 |
-
.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
|
| 180 |
-
.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
|
| 181 |
-
|
| 182 |
-
/* with multiple calendars */
|
| 183 |
-
.ui-datepicker.ui-datepicker-multi { width:auto; }
|
| 184 |
-
.ui-datepicker-multi .ui-datepicker-group { float:left; }
|
| 185 |
-
.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
|
| 186 |
-
.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
|
| 187 |
-
.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
|
| 188 |
-
.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
|
| 189 |
-
.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
|
| 190 |
-
.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
|
| 191 |
-
.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
|
| 192 |
-
.ui-datepicker-row-break { clear:both; width:100%; }
|
| 193 |
-
|
| 194 |
-
/* RTL support */
|
| 195 |
-
.ui-datepicker-rtl { direction: rtl; }
|
| 196 |
-
.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
|
| 197 |
-
.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
|
| 198 |
-
.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
|
| 199 |
-
.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
|
| 200 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
|
| 201 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
|
| 202 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
|
| 203 |
-
.ui-datepicker-rtl .ui-datepicker-group { float:right; }
|
| 204 |
-
.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
|
| 205 |
-
.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
|
| 206 |
-
|
| 207 |
-
/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
|
| 208 |
-
.ui-datepicker-cover {
|
| 209 |
-
display: none; /*sorry for IE5*/
|
| 210 |
-
display/**/: block; /*sorry for IE5*/
|
| 211 |
-
position: absolute; /*must have*/
|
| 212 |
-
z-index: -1; /*must have*/
|
| 213 |
-
filter: mask(); /*must have*/
|
| 214 |
-
top: -4px; /*must have*/
|
| 215 |
-
left: -4px; /*must have*/
|
| 216 |
-
width: 200px; /*must have*/
|
| 217 |
-
height: 200px; /*must have*/
|
| 218 |
-
}/*
|
| 219 |
-
* jQuery UI Dialog 1.8.8
|
| 220 |
-
*
|
| 221 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 222 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 223 |
-
* http://jquery.org/license
|
| 224 |
-
*
|
| 225 |
-
* http://docs.jquery.com/UI/Dialog#theming
|
| 226 |
-
*/
|
| 227 |
-
.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
|
| 228 |
-
.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
|
| 229 |
-
.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
|
| 230 |
-
.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
|
| 231 |
-
.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
|
| 232 |
-
.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
|
| 233 |
-
.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
|
| 234 |
-
.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
|
| 235 |
-
.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
|
| 236 |
-
.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
|
| 237 |
-
.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
|
| 238 |
-
.ui-draggable .ui-dialog-titlebar { cursor: move; }
|
| 239 |
-
/*
|
| 240 |
-
* jQuery UI Progressbar 1.8.8
|
| 241 |
-
*
|
| 242 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 243 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 244 |
-
* http://jquery.org/license
|
| 245 |
-
*
|
| 246 |
-
* http://docs.jquery.com/UI/Progressbar#theming
|
| 247 |
-
*/
|
| 248 |
-
.ui-progressbar { height:2em; text-align: left; }
|
| 249 |
-
.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/*
|
| 250 |
-
* jQuery UI Resizable 1.8.8
|
| 251 |
-
*
|
| 252 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 253 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 254 |
-
* http://jquery.org/license
|
| 255 |
-
*
|
| 256 |
-
* http://docs.jquery.com/UI/Resizable#theming
|
| 257 |
-
*/
|
| 258 |
-
.ui-resizable { position: relative;}
|
| 259 |
-
.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
|
| 260 |
-
.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
|
| 261 |
-
.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
|
| 262 |
-
.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
|
| 263 |
-
.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
|
| 264 |
-
.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
|
| 265 |
-
.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
|
| 266 |
-
.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
|
| 267 |
-
.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
|
| 268 |
-
.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
|
| 269 |
-
* jQuery UI Selectable 1.8.8
|
| 270 |
-
*
|
| 271 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 272 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 273 |
-
* http://jquery.org/license
|
| 274 |
-
*
|
| 275 |
-
* http://docs.jquery.com/UI/Selectable#theming
|
| 276 |
-
*/
|
| 277 |
-
.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
|
| 278 |
-
/*
|
| 279 |
-
* jQuery UI Slider 1.8.8
|
| 280 |
-
*
|
| 281 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 282 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 283 |
-
* http://jquery.org/license
|
| 284 |
-
*
|
| 285 |
-
* http://docs.jquery.com/UI/Slider#theming
|
| 286 |
-
*/
|
| 287 |
-
.ui-slider { position: relative; text-align: left; }
|
| 288 |
-
.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
|
| 289 |
-
.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
|
| 290 |
-
|
| 291 |
-
.ui-slider-horizontal { height: .8em; }
|
| 292 |
-
.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
|
| 293 |
-
.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
|
| 294 |
-
.ui-slider-horizontal .ui-slider-range-min { left: 0; }
|
| 295 |
-
.ui-slider-horizontal .ui-slider-range-max { right: 0; }
|
| 296 |
-
|
| 297 |
-
.ui-slider-vertical { width: .8em; height: 100px; }
|
| 298 |
-
.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
|
| 299 |
-
.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
|
| 300 |
-
.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
|
| 301 |
-
.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
|
| 302 |
-
* jQuery UI Tabs 1.8.8
|
| 303 |
-
*
|
| 304 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 305 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 306 |
-
* http://jquery.org/license
|
| 307 |
-
*
|
| 308 |
-
* http://docs.jquery.com/UI/Tabs#theming
|
| 309 |
-
*/
|
| 310 |
-
.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
|
| 311 |
-
.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
|
| 312 |
-
.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
|
| 313 |
-
.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
|
| 314 |
-
.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
|
| 315 |
-
.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
|
| 316 |
-
.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
|
| 317 |
-
.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
|
| 318 |
-
.ui-tabs .ui-tabs-hide { display: none !important; }
|
| 319 |
-
/*
|
| 320 |
-
* jQuery UI CSS Framework 1.8.8
|
| 321 |
-
*
|
| 322 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 323 |
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 324 |
* http://jquery.org/license
|
| 325 |
*
|
| 326 |
* http://docs.jquery.com/UI/Theming/API
|
| 327 |
*
|
| 328 |
-
* To view and modify this theme, visit http://jqueryui.com/themeroller
|
| 329 |
*/
|
| 330 |
|
| 331 |
|
| 332 |
/* Component containers
|
| 333 |
----------------------------------*/
|
| 334 |
-
.ui-widget { font-family: Verdana,Arial,sans-serif
|
| 335 |
.ui-widget .ui-widget { font-size: 1em; }
|
| 336 |
-
.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif
|
| 337 |
-
.ui-widget-content { border: 1px solid #
|
| 338 |
-
.ui-widget-content a { color: #222222
|
| 339 |
-
.ui-widget-header { border: 1px solid #
|
| 340 |
-
.ui-widget-header a { color: #
|
| 341 |
|
| 342 |
/* Interaction states
|
| 343 |
----------------------------------*/
|
| 344 |
-
.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #
|
| 345 |
-
.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #
|
| 346 |
-
.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #
|
| 347 |
-
.ui-state-hover a, .ui-state-hover a:hover { color: #
|
| 348 |
-
.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #
|
| 349 |
-
.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #
|
| 350 |
.ui-widget :active { outline: none; }
|
| 351 |
|
| 352 |
/* Interaction Cues
|
| 353 |
----------------------------------*/
|
| 354 |
-
.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #
|
| 355 |
-
.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #
|
| 356 |
-
.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a
|
| 357 |
-
.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #
|
| 358 |
-
.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #
|
| 359 |
.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
|
| 360 |
.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
|
| 361 |
.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
|
|
@@ -364,14 +89,14 @@ button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra pad
|
|
| 364 |
----------------------------------*/
|
| 365 |
|
| 366 |
/* states and images */
|
| 367 |
-
.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-
|
| 368 |
-
.ui-widget-content .ui-icon {background-image: url(images/ui-
|
| 369 |
-
.ui-widget-header .ui-icon {background-image: url(images/ui-
|
| 370 |
-
.ui-state-default .ui-icon { background-image: url(images/ui-
|
| 371 |
-
.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-
|
| 372 |
-
.ui-state-active .ui-icon {background-image: url(images/ui-
|
| 373 |
-
.ui-state-highlight .ui-icon {background-image: url(images/ui-
|
| 374 |
-
.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-
|
| 375 |
|
| 376 |
/* positioning */
|
| 377 |
.ui-icon-carat-1-n { background-position: 0 0; }
|
|
@@ -555,16 +280,294 @@ button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra pad
|
|
| 555 |
----------------------------------*/
|
| 556 |
|
| 557 |
/* Corner radius */
|
| 558 |
-
.ui-corner-tl { -moz-border-radius-topleft:
|
| 559 |
-
.ui-corner-tr { -moz-border-radius-topright:
|
| 560 |
-
.ui-corner-bl { -moz-border-radius-bottomleft:
|
| 561 |
-
.ui-corner-br { -moz-border-radius-bottomright:
|
| 562 |
-
.ui-corner-top { -moz-border-radius-topleft:
|
| 563 |
-
.ui-corner-bottom { -moz-border-radius-bottomleft:
|
| 564 |
-
.ui-corner-right { -moz-border-radius-topright:
|
| 565 |
-
.ui-corner-left { -moz-border-radius-topleft:
|
| 566 |
-
.ui-corner-all { -moz-border-radius:
|
| 567 |
|
| 568 |
/* Overlays */
|
| 569 |
-
.ui-widget-overlay { background: #aaaaaa
|
| 570 |
-
.ui-widget-shadow { margin:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
/*
|
| 2 |
+
* jQuery UI CSS Framework 1.8.9
|
| 3 |
*
|
| 4 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 5 |
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 6 |
* http://jquery.org/license
|
| 7 |
*
|
| 39 |
|
| 40 |
/* Overlays */
|
| 41 |
.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 42 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 43 |
|
|
|
|
|
|
|
| 44 |
/*
|
| 45 |
+
* jQuery UI CSS Framework 1.8.9
|
| 46 |
*
|
| 47 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 48 |
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 49 |
* http://jquery.org/license
|
| 50 |
*
|
| 51 |
* http://docs.jquery.com/UI/Theming/API
|
| 52 |
*
|
| 53 |
+
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=5px&bgColorHeader=2191c0&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=75&borderColorHeader=4297d7&fcHeader=eaf5f7&iconColorHeader=d8e7f3&bgColorContent=fcfdfd&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=a6c9e2&fcContent=222222&iconColorContent=0078ae&bgColorDefault=0078ae&bgTextureDefault=02_glass.png&bgImgOpacityDefault=45&borderColorDefault=77d5f7&fcDefault=ffffff&iconColorDefault=e0fdff&bgColorHover=79c9ec&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=448dae&fcHover=026890&iconColorHover=056b93&bgColorActive=6eac2c&bgTextureActive=12_gloss_wave.png&bgImgOpacityActive=50&borderColorActive=acdd4a&fcActive=ffffff&iconColorActive=f5e175&bgColorHighlight=f8da4e&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcd113&fcHighlight=915608&iconColorHighlight=f7a50d&bgColorError=e14f1c&bgTextureError=12_gloss_wave.png&bgImgOpacityError=45&borderColorError=cd0a0a&fcError=ffffff&iconColorError=fcd113&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=75&opacityOverlay=30&bgColorShadow=999999&bgTextureShadow=01_flat.png&bgImgOpacityShadow=55&opacityShadow=45&thicknessShadow=0px&offsetTopShadow=5px&offsetLeftShadow=5px&cornerRadiusShadow=5px
|
| 54 |
*/
|
| 55 |
|
| 56 |
|
| 57 |
/* Component containers
|
| 58 |
----------------------------------*/
|
| 59 |
+
.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
|
| 60 |
.ui-widget .ui-widget { font-size: 1em; }
|
| 61 |
+
.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
|
| 62 |
+
.ui-widget-content { border: 1px solid #a6c9e2; background: #fcfdfd url(images/ui-bg_inset-hard_100_fcfdfd_1x100.png) 50% bottom repeat-x; color: #222222; }
|
| 63 |
+
.ui-widget-content a { color: #222222; }
|
| 64 |
+
.ui-widget-header { border: 1px solid #4297d7; background: #2191c0 url(images/ui-bg_gloss-wave_75_2191c0_500x100.png) 50% 50% repeat-x; color: #eaf5f7; font-weight: bold; }
|
| 65 |
+
.ui-widget-header a { color: #eaf5f7; }
|
| 66 |
|
| 67 |
/* Interaction states
|
| 68 |
----------------------------------*/
|
| 69 |
+
.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #77d5f7; background: #0078ae url(images/ui-bg_glass_45_0078ae_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; }
|
| 70 |
+
.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #ffffff; text-decoration: none; }
|
| 71 |
+
.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #448dae; background: #79c9ec url(images/ui-bg_glass_75_79c9ec_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #026890; }
|
| 72 |
+
.ui-state-hover a, .ui-state-hover a:hover { color: #026890; text-decoration: none; }
|
| 73 |
+
.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #acdd4a; background: #6eac2c url(images/ui-bg_gloss-wave_50_6eac2c_500x100.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; }
|
| 74 |
+
.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #ffffff; text-decoration: none; }
|
| 75 |
.ui-widget :active { outline: none; }
|
| 76 |
|
| 77 |
/* Interaction Cues
|
| 78 |
----------------------------------*/
|
| 79 |
+
.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcd113; background: #f8da4e url(images/ui-bg_glass_55_f8da4e_1x400.png) 50% 50% repeat-x; color: #915608; }
|
| 80 |
+
.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #915608; }
|
| 81 |
+
.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #e14f1c url(images/ui-bg_gloss-wave_45_e14f1c_500x100.png) 50% top repeat-x; color: #ffffff; }
|
| 82 |
+
.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
|
| 83 |
+
.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
|
| 84 |
.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
|
| 85 |
.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
|
| 86 |
.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
|
| 89 |
----------------------------------*/
|
| 90 |
|
| 91 |
/* states and images */
|
| 92 |
+
.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_0078ae_256x240.png); }
|
| 93 |
+
.ui-widget-content .ui-icon {background-image: url(images/ui-icons_0078ae_256x240.png); }
|
| 94 |
+
.ui-widget-header .ui-icon {background-image: url(images/ui-icons_d8e7f3_256x240.png); }
|
| 95 |
+
.ui-state-default .ui-icon { background-image: url(images/ui-icons_e0fdff_256x240.png); }
|
| 96 |
+
.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_056b93_256x240.png); }
|
| 97 |
+
.ui-state-active .ui-icon {background-image: url(images/ui-icons_f5e175_256x240.png); }
|
| 98 |
+
.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_f7a50d_256x240.png); }
|
| 99 |
+
.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_fcd113_256x240.png); }
|
| 100 |
|
| 101 |
/* positioning */
|
| 102 |
.ui-icon-carat-1-n { background-position: 0 0; }
|
| 280 |
----------------------------------*/
|
| 281 |
|
| 282 |
/* Corner radius */
|
| 283 |
+
.ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; border-top-left-radius: 5px; }
|
| 284 |
+
.ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; border-top-right-radius: 5px; }
|
| 285 |
+
.ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; }
|
| 286 |
+
.ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; }
|
| 287 |
+
.ui-corner-top { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; border-top-left-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; border-top-right-radius: 5px; }
|
| 288 |
+
.ui-corner-bottom { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; }
|
| 289 |
+
.ui-corner-right { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; border-top-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; }
|
| 290 |
+
.ui-corner-left { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; border-top-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; }
|
| 291 |
+
.ui-corner-all { -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }
|
| 292 |
|
| 293 |
/* Overlays */
|
| 294 |
+
.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_75_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
|
| 295 |
+
.ui-widget-shadow { margin: 5px 0 0 5px; padding: 0px; background: #999999 url(images/ui-bg_flat_55_999999_40x100.png) 50% 50% repeat-x; opacity: .45;filter:Alpha(Opacity=45); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/*
|
| 296 |
+
* jQuery UI Resizable 1.8.9
|
| 297 |
+
*
|
| 298 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 299 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 300 |
+
* http://jquery.org/license
|
| 301 |
+
*
|
| 302 |
+
* http://docs.jquery.com/UI/Resizable#theming
|
| 303 |
+
*/
|
| 304 |
+
.ui-resizable { position: relative;}
|
| 305 |
+
.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
|
| 306 |
+
.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
|
| 307 |
+
.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
|
| 308 |
+
.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
|
| 309 |
+
.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
|
| 310 |
+
.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
|
| 311 |
+
.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
|
| 312 |
+
.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
|
| 313 |
+
.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
|
| 314 |
+
.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
|
| 315 |
+
* jQuery UI Selectable 1.8.9
|
| 316 |
+
*
|
| 317 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 318 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 319 |
+
* http://jquery.org/license
|
| 320 |
+
*
|
| 321 |
+
* http://docs.jquery.com/UI/Selectable#theming
|
| 322 |
+
*/
|
| 323 |
+
.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
|
| 324 |
+
/*
|
| 325 |
+
* jQuery UI Accordion 1.8.9
|
| 326 |
+
*
|
| 327 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 328 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 329 |
+
* http://jquery.org/license
|
| 330 |
+
*
|
| 331 |
+
* http://docs.jquery.com/UI/Accordion#theming
|
| 332 |
+
*/
|
| 333 |
+
/* IE/Win - Fix animation bug - #4615 */
|
| 334 |
+
.ui-accordion { width: 100%; }
|
| 335 |
+
.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
|
| 336 |
+
.ui-accordion .ui-accordion-li-fix { display: inline; }
|
| 337 |
+
.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
|
| 338 |
+
.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
|
| 339 |
+
.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
|
| 340 |
+
.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
|
| 341 |
+
.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
|
| 342 |
+
.ui-accordion .ui-accordion-content-active { display: block; }
|
| 343 |
+
/*
|
| 344 |
+
* jQuery UI Autocomplete 1.8.9
|
| 345 |
+
*
|
| 346 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 347 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 348 |
+
* http://jquery.org/license
|
| 349 |
+
*
|
| 350 |
+
* http://docs.jquery.com/UI/Autocomplete#theming
|
| 351 |
+
*/
|
| 352 |
+
.ui-autocomplete { position: absolute; cursor: default; }
|
| 353 |
+
|
| 354 |
+
/* workarounds */
|
| 355 |
+
* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
|
| 356 |
+
|
| 357 |
+
/*
|
| 358 |
+
* jQuery UI Menu 1.8.9
|
| 359 |
+
*
|
| 360 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 361 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 362 |
+
* http://jquery.org/license
|
| 363 |
+
*
|
| 364 |
+
* http://docs.jquery.com/UI/Menu#theming
|
| 365 |
+
*/
|
| 366 |
+
.ui-menu {
|
| 367 |
+
list-style:none;
|
| 368 |
+
padding: 2px;
|
| 369 |
+
margin: 0;
|
| 370 |
+
display:block;
|
| 371 |
+
float: left;
|
| 372 |
+
}
|
| 373 |
+
.ui-menu .ui-menu {
|
| 374 |
+
margin-top: -3px;
|
| 375 |
+
}
|
| 376 |
+
.ui-menu .ui-menu-item {
|
| 377 |
+
margin:0;
|
| 378 |
+
padding: 0;
|
| 379 |
+
zoom: 1;
|
| 380 |
+
float: left;
|
| 381 |
+
clear: left;
|
| 382 |
+
width: 100%;
|
| 383 |
+
}
|
| 384 |
+
.ui-menu .ui-menu-item a {
|
| 385 |
+
text-decoration:none;
|
| 386 |
+
display:block;
|
| 387 |
+
padding:.2em .4em;
|
| 388 |
+
line-height:1.5;
|
| 389 |
+
zoom:1;
|
| 390 |
+
}
|
| 391 |
+
.ui-menu .ui-menu-item a.ui-state-hover,
|
| 392 |
+
.ui-menu .ui-menu-item a.ui-state-active {
|
| 393 |
+
font-weight: normal;
|
| 394 |
+
margin: -1px;
|
| 395 |
+
}
|
| 396 |
+
/*
|
| 397 |
+
* jQuery UI Button 1.8.9
|
| 398 |
+
*
|
| 399 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 400 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 401 |
+
* http://jquery.org/license
|
| 402 |
+
*
|
| 403 |
+
* http://docs.jquery.com/UI/Button#theming
|
| 404 |
+
*/
|
| 405 |
+
.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
|
| 406 |
+
.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
|
| 407 |
+
button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
|
| 408 |
+
.ui-button-icons-only { width: 3.4em; }
|
| 409 |
+
button.ui-button-icons-only { width: 3.7em; }
|
| 410 |
+
|
| 411 |
+
/*button text element */
|
| 412 |
+
.ui-button .ui-button-text { display: block; line-height: 1.4; }
|
| 413 |
+
.ui-button-text-only .ui-button-text { padding: .4em 1em; }
|
| 414 |
+
.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
|
| 415 |
+
.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
|
| 416 |
+
.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
|
| 417 |
+
.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
|
| 418 |
+
/* no icon support for input elements, provide padding by default */
|
| 419 |
+
input.ui-button { padding: .4em 1em; }
|
| 420 |
+
|
| 421 |
+
/*button icon element(s) */
|
| 422 |
+
.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
|
| 423 |
+
.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
|
| 424 |
+
.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
|
| 425 |
+
.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
|
| 426 |
+
.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
|
| 427 |
+
|
| 428 |
+
/*button sets*/
|
| 429 |
+
.ui-buttonset { margin-right: 7px; }
|
| 430 |
+
.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
|
| 431 |
+
|
| 432 |
+
/* workarounds */
|
| 433 |
+
button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
|
| 434 |
+
/*
|
| 435 |
+
* jQuery UI Dialog 1.8.9
|
| 436 |
+
*
|
| 437 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 438 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 439 |
+
* http://jquery.org/license
|
| 440 |
+
*
|
| 441 |
+
* http://docs.jquery.com/UI/Dialog#theming
|
| 442 |
+
*/
|
| 443 |
+
.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
|
| 444 |
+
.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
|
| 445 |
+
.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
|
| 446 |
+
.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
|
| 447 |
+
.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
|
| 448 |
+
.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
|
| 449 |
+
.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
|
| 450 |
+
.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
|
| 451 |
+
.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
|
| 452 |
+
.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
|
| 453 |
+
.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
|
| 454 |
+
.ui-draggable .ui-dialog-titlebar { cursor: move; }
|
| 455 |
+
/*
|
| 456 |
+
* jQuery UI Slider 1.8.9
|
| 457 |
+
*
|
| 458 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 459 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 460 |
+
* http://jquery.org/license
|
| 461 |
+
*
|
| 462 |
+
* http://docs.jquery.com/UI/Slider#theming
|
| 463 |
+
*/
|
| 464 |
+
.ui-slider { position: relative; text-align: left; }
|
| 465 |
+
.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
|
| 466 |
+
.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
|
| 467 |
+
|
| 468 |
+
.ui-slider-horizontal { height: .8em; }
|
| 469 |
+
.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
|
| 470 |
+
.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
|
| 471 |
+
.ui-slider-horizontal .ui-slider-range-min { left: 0; }
|
| 472 |
+
.ui-slider-horizontal .ui-slider-range-max { right: 0; }
|
| 473 |
+
|
| 474 |
+
.ui-slider-vertical { width: .8em; height: 100px; }
|
| 475 |
+
.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
|
| 476 |
+
.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
|
| 477 |
+
.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
|
| 478 |
+
.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
|
| 479 |
+
* jQuery UI Tabs 1.8.9
|
| 480 |
+
*
|
| 481 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 482 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 483 |
+
* http://jquery.org/license
|
| 484 |
+
*
|
| 485 |
+
* http://docs.jquery.com/UI/Tabs#theming
|
| 486 |
+
*/
|
| 487 |
+
.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
|
| 488 |
+
.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
|
| 489 |
+
.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
|
| 490 |
+
.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
|
| 491 |
+
.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
|
| 492 |
+
.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
|
| 493 |
+
.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
|
| 494 |
+
.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
|
| 495 |
+
.ui-tabs .ui-tabs-hide { display: none !important; }
|
| 496 |
+
/*
|
| 497 |
+
* jQuery UI Datepicker 1.8.9
|
| 498 |
+
*
|
| 499 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 500 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 501 |
+
* http://jquery.org/license
|
| 502 |
+
*
|
| 503 |
+
* http://docs.jquery.com/UI/Datepicker#theming
|
| 504 |
+
*/
|
| 505 |
+
.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
|
| 506 |
+
.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
|
| 507 |
+
.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
|
| 508 |
+
.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
|
| 509 |
+
.ui-datepicker .ui-datepicker-prev { left:2px; }
|
| 510 |
+
.ui-datepicker .ui-datepicker-next { right:2px; }
|
| 511 |
+
.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
|
| 512 |
+
.ui-datepicker .ui-datepicker-next-hover { right:1px; }
|
| 513 |
+
.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
|
| 514 |
+
.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
|
| 515 |
+
.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
|
| 516 |
+
.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
|
| 517 |
+
.ui-datepicker select.ui-datepicker-month,
|
| 518 |
+
.ui-datepicker select.ui-datepicker-year { width: 49%;}
|
| 519 |
+
.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
|
| 520 |
+
.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
|
| 521 |
+
.ui-datepicker td { border: 0; padding: 1px; }
|
| 522 |
+
.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
|
| 523 |
+
.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
|
| 524 |
+
.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
|
| 525 |
+
.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
|
| 526 |
+
|
| 527 |
+
/* with multiple calendars */
|
| 528 |
+
.ui-datepicker.ui-datepicker-multi { width:auto; }
|
| 529 |
+
.ui-datepicker-multi .ui-datepicker-group { float:left; }
|
| 530 |
+
.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
|
| 531 |
+
.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
|
| 532 |
+
.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
|
| 533 |
+
.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
|
| 534 |
+
.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
|
| 535 |
+
.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
|
| 536 |
+
.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
|
| 537 |
+
.ui-datepicker-row-break { clear:both; width:100%; }
|
| 538 |
+
|
| 539 |
+
/* RTL support */
|
| 540 |
+
.ui-datepicker-rtl { direction: rtl; }
|
| 541 |
+
.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
|
| 542 |
+
.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
|
| 543 |
+
.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
|
| 544 |
+
.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
|
| 545 |
+
.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
|
| 546 |
+
.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
|
| 547 |
+
.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
|
| 548 |
+
.ui-datepicker-rtl .ui-datepicker-group { float:right; }
|
| 549 |
+
.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
|
| 550 |
+
.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
|
| 551 |
+
|
| 552 |
+
/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
|
| 553 |
+
.ui-datepicker-cover {
|
| 554 |
+
display: none; /*sorry for IE5*/
|
| 555 |
+
display/**/: block; /*sorry for IE5*/
|
| 556 |
+
position: absolute; /*must have*/
|
| 557 |
+
z-index: -1; /*must have*/
|
| 558 |
+
filter: mask(); /*must have*/
|
| 559 |
+
top: -4px; /*must have*/
|
| 560 |
+
left: -4px; /*must have*/
|
| 561 |
+
width: 200px; /*must have*/
|
| 562 |
+
height: 200px; /*must have*/
|
| 563 |
+
}/*
|
| 564 |
+
* jQuery UI Progressbar 1.8.9
|
| 565 |
+
*
|
| 566 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 567 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 568 |
+
* http://jquery.org/license
|
| 569 |
+
*
|
| 570 |
+
* http://docs.jquery.com/UI/Progressbar#theming
|
| 571 |
+
*/
|
| 572 |
+
.ui-progressbar { height:2em; text-align: left; }
|
| 573 |
+
.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
|
css/tabber.css
DELETED
|
@@ -1,109 +0,0 @@
|
|
| 1 |
-
/* $Id: example.css,v 1.5 2006/03/27 02:44:36 pat Exp $ */
|
| 2 |
-
|
| 3 |
-
/*--------------------------------------------------
|
| 4 |
-
REQUIRED to hide the non-active tab content.
|
| 5 |
-
But do not hide them in the print stylesheet!
|
| 6 |
-
--------------------------------------------------*/
|
| 7 |
-
.tabberlive .tabbertabhide {
|
| 8 |
-
display:none;
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
/*--------------------------------------------------
|
| 12 |
-
.tabber = before the tabber interface is set up
|
| 13 |
-
.tabberlive = after the tabber interface is set up
|
| 14 |
-
--------------------------------------------------*/
|
| 15 |
-
.tabber {
|
| 16 |
-
}
|
| 17 |
-
.tabberlive {
|
| 18 |
-
margin-top:1em;
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
/*--------------------------------------------------
|
| 22 |
-
ul.tabbernav = the tab navigation list
|
| 23 |
-
li.tabberactive = the active tab
|
| 24 |
-
--------------------------------------------------*/
|
| 25 |
-
ul.tabbernav
|
| 26 |
-
{
|
| 27 |
-
margin:0;
|
| 28 |
-
padding: 3px 0;
|
| 29 |
-
border-bottom: 1px solid #778;
|
| 30 |
-
font: bold 12px Verdana, sans-serif;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
ul.tabbernav li
|
| 34 |
-
{
|
| 35 |
-
list-style: none;
|
| 36 |
-
margin: 0;
|
| 37 |
-
display: inline;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
ul.tabbernav li a
|
| 41 |
-
{
|
| 42 |
-
padding: 3px 0.5em;
|
| 43 |
-
margin-left: 3px;
|
| 44 |
-
border: 1px solid #778;
|
| 45 |
-
border-bottom: none;
|
| 46 |
-
background: #DDE;
|
| 47 |
-
text-decoration: none;
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
ul.tabbernav li a:link { color: #448; }
|
| 51 |
-
ul.tabbernav li a:visited { color: #667; }
|
| 52 |
-
|
| 53 |
-
ul.tabbernav li a:hover
|
| 54 |
-
{
|
| 55 |
-
color: #000;
|
| 56 |
-
background: #AAE;
|
| 57 |
-
border-color: #227;
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
ul.tabbernav li.tabberactive a
|
| 61 |
-
{
|
| 62 |
-
background-color: #fff;
|
| 63 |
-
border-bottom: 1px solid #fff;
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
ul.tabbernav li.tabberactive a:hover
|
| 67 |
-
{
|
| 68 |
-
color: #000;
|
| 69 |
-
background: white;
|
| 70 |
-
border-bottom: 1px solid white;
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
/*--------------------------------------------------
|
| 74 |
-
.tabbertab = the tab content
|
| 75 |
-
Add style only after the tabber interface is set up (.tabberlive)
|
| 76 |
-
--------------------------------------------------*/
|
| 77 |
-
.tabberlive .tabbertab {
|
| 78 |
-
padding:5px;
|
| 79 |
-
border:1px solid #aaa;
|
| 80 |
-
border-top:0;
|
| 81 |
-
|
| 82 |
-
/* If you don't want the tab size changing whenever a tab is changed
|
| 83 |
-
you can set a fixed height */
|
| 84 |
-
|
| 85 |
-
/* height:200px; */
|
| 86 |
-
|
| 87 |
-
/* If you set a fix height set overflow to auto and you will get a
|
| 88 |
-
scrollbar when necessary */
|
| 89 |
-
|
| 90 |
-
/* overflow:auto; */
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
/* If desired, hide the heading since a heading is provided by the tab */
|
| 94 |
-
.tabberlive .tabbertab h2 {
|
| 95 |
-
display:none;
|
| 96 |
-
}
|
| 97 |
-
.tabberlive .tabbertab h3 {
|
| 98 |
-
display:none;
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
/* Example of using an ID to set different styles for the tabs on the page */
|
| 102 |
-
.tabberlive#tab1 {
|
| 103 |
-
}
|
| 104 |
-
.tabberlive#tab2 {
|
| 105 |
-
}
|
| 106 |
-
.tabberlive#tab2 .tabbertab {
|
| 107 |
-
height:200px;
|
| 108 |
-
overflow:auto;
|
| 109 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
images/logo.gif
CHANGED
|
Binary file
|
images/logo.png
CHANGED
|
Binary file
|
images/progressBarLong.gif
ADDED
|
Binary file
|
install.xcloner.php
CHANGED
|
@@ -11,23 +11,15 @@ function com_install(){
|
|
| 11 |
|
| 12 |
if( is_callable( array( 'JFactory', 'getDBO' ))) {
|
| 13 |
$database = JFactory::getDBO();
|
|
|
|
|
|
|
| 14 |
}
|
| 15 |
$mypath = dirname(__FILE__);
|
| 16 |
|
| 17 |
-
@chmod("components/com_xcloner/cloner.config.php", 0777);
|
| 18 |
-
@mkdir("backups", 0777);
|
| 19 |
-
@chmod("backups", 0777);
|
| 20 |
-
@chmod("components/com_xcloner/configs", 0777);
|
| 21 |
-
@chmod("components/com_xcloner/browser", 0755);
|
| 22 |
-
@chmod("components/com_xcloner/", 0755);
|
| 23 |
-
@chmod("components/com_xcloner/index.php", 0755);
|
| 24 |
-
@chmod("components/com_xcloner/index2.php", 0755);
|
| 25 |
-
@chmod("components/com_xcloner/cloner.cron.php", 0755);
|
| 26 |
-
|
| 27 |
error_reporting( E_ALL ^ E_NOTICE );
|
| 28 |
|
| 29 |
//add new admin menu images
|
| 30 |
-
|
| 31 |
-
|
| 32 |
}
|
| 33 |
?>
|
| 11 |
|
| 12 |
if( is_callable( array( 'JFactory', 'getDBO' ))) {
|
| 13 |
$database = JFactory::getDBO();
|
| 14 |
+
$database->setQuery("UPDATE #__menu SET alias = 'XCloner Backup and Restore' WHERE path = 'xcloner-backup-and-restore'");
|
| 15 |
+
$database->query();
|
| 16 |
}
|
| 17 |
$mypath = dirname(__FILE__);
|
| 18 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 19 |
error_reporting( E_ALL ^ E_NOTICE );
|
| 20 |
|
| 21 |
//add new admin menu images
|
| 22 |
+
|
| 23 |
+
|
| 24 |
}
|
| 25 |
?>
|
javascript/backup.js
ADDED
|
@@ -0,0 +1,172 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
$(document).ready(function() {
|
| 2 |
+
|
| 3 |
+
var globalUrl;
|
| 4 |
+
var step = "r1";
|
| 5 |
+
var count = 0;
|
| 6 |
+
var counter = 0;
|
| 7 |
+
var counter_old = 0;
|
| 8 |
+
|
| 9 |
+
$("#progressbar").progressbar({ value: 0 });
|
| 10 |
+
|
| 11 |
+
$.ajaxSetup({
|
| 12 |
+
"error":function(request, status, error) {
|
| 13 |
+
//reset state here;
|
| 14 |
+
$("#error").show();
|
| 15 |
+
$("#errorText").append(status+" -- "+error);
|
| 16 |
+
$("#errorText").append("<br /><br />JSON url: "+globalUrl);
|
| 17 |
+
}});
|
| 18 |
+
|
| 19 |
+
function getSize(bytes, conv){
|
| 20 |
+
|
| 21 |
+
return (bytes/conv).toFixed(2);
|
| 22 |
+
|
| 23 |
+
}
|
| 24 |
+
function appendIcon(icon){
|
| 25 |
+
|
| 26 |
+
return '<span class="ui-icon ui-icon-'+icon+'" style="float:left;"></span>';
|
| 27 |
+
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
function xclonerRecurseMYSQL(url){
|
| 31 |
+
|
| 32 |
+
globalUrl = url;
|
| 33 |
+
step = "r1";
|
| 34 |
+
|
| 35 |
+
$.getJSON(url, function(json) {
|
| 36 |
+
|
| 37 |
+
if(!json){
|
| 38 |
+
$("#error").show();
|
| 39 |
+
$("#errorText").text(url);
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
if(json.dumpsize && !json.endDump){
|
| 43 |
+
$("#mysqlProcess").append(" ("+getSize(json.dumpsize, 1024*1024)+" MB) <br />");
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
if(json.newDump){
|
| 47 |
+
count++;
|
| 48 |
+
//$("#mysqlProcess").append(appendIcon("arrowthick-1-e"));
|
| 49 |
+
if(json.databaseName!="")
|
| 50 |
+
$("#mysqlProcess").append("<b>["+json.databaseName+"]</b> <span id='db"+count+"'></span> tables ");
|
| 51 |
+
counter = parseInt(json.startAtLine);
|
| 52 |
+
|
| 53 |
+
}else{
|
| 54 |
+
$("#db"+count).text(json.startAtLine - counter);
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
+
if(!parseInt(json.finished)){
|
| 58 |
+
//get next records
|
| 59 |
+
|
| 60 |
+
$("#db"+count).text(json.startAtLine - counter);
|
| 61 |
+
|
| 62 |
+
recurseUrl = "index2.php?task=recurse_database&nohtml=1&dbbackup_comp="+json.dbbackup_comp+"&dbbackup_drop="+json.dbbackup_drop+"&startAtLine="+json.startAtLine+"&startAtRecord="+json.startAtRecord+"&dumpfile="+json.dumpfile;
|
| 63 |
+
xclonerRecurseMYSQL(recurseUrl);
|
| 64 |
+
|
| 65 |
+
}
|
| 66 |
+
else{
|
| 67 |
+
|
| 68 |
+
$("#fileSystem").show();
|
| 69 |
+
var recurseUrl="index2.php?task=recurse_files&mode=start&nohtml=1";
|
| 70 |
+
xclonerRecurseJSON(recurseUrl);
|
| 71 |
+
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
|
| 75 |
+
});
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
function xclonerRecurseJSON(url){
|
| 79 |
+
|
| 80 |
+
$("#result").hide();
|
| 81 |
+
|
| 82 |
+
globalUrl = url;
|
| 83 |
+
step = "r2";
|
| 84 |
+
|
| 85 |
+
$.getJSON(url, function(json) {
|
| 86 |
+
|
| 87 |
+
if(!json){
|
| 88 |
+
$("#error").show();
|
| 89 |
+
$("#errorText").text(url);
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
if(!parseInt(json.finished)){
|
| 93 |
+
|
| 94 |
+
$("#recurseStatus").text(json.tfiles);
|
| 95 |
+
|
| 96 |
+
var recurseUrl = "index2.php?task=recurse_files&mode="+json.mode+"&nohtml=1";
|
| 97 |
+
xclonerRecurseJSON(recurseUrl);
|
| 98 |
+
|
| 99 |
+
}
|
| 100 |
+
else{
|
| 101 |
+
var size = parseFloat(json.size)/(1024*1024);
|
| 102 |
+
$("#recurseStatus").text(" done! (Estimated size:"+size.toFixed(2)+"MB) in "+json.tfiles+" files");
|
| 103 |
+
$("#result").show();
|
| 104 |
+
returnUrl = "index2.php?option=com_cloner&lines="+json.tfiles+"&task=refresh&backup="+backupFile+"&excl_manual=";
|
| 105 |
+
xclonerGetJSON(returnUrl);
|
| 106 |
+
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
|
| 110 |
+
});
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
function xclonerGetJSON(url){
|
| 114 |
+
|
| 115 |
+
globalUrl = url;
|
| 116 |
+
step = "r3";
|
| 117 |
+
|
| 118 |
+
$.getJSON(url, function(json) {
|
| 119 |
+
|
| 120 |
+
if(!json){
|
| 121 |
+
$("#error").show();
|
| 122 |
+
$("#errorText").append(url);
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
var percent = parseInt(json.percent);
|
| 126 |
+
$("#progressbar").progressbar({ value: percent });
|
| 127 |
+
$("#backupSize").text(json.backupSize);
|
| 128 |
+
$("#nFiles").text(json.startf);
|
| 129 |
+
$("#percent").text(json.percent);
|
| 130 |
+
if(!json.finished){
|
| 131 |
+
var url = "index2.php?option="+json.option+"&task="+json.task+"&json="+json.json+"&startf="+json.startf+"&lines="+json.lines+"&backup="+json.backup+"&excl_manual="+json.excl_manual;
|
| 132 |
+
xclonerGetJSON(url);
|
| 133 |
+
}else{
|
| 134 |
+
|
| 135 |
+
$("#complete").show();
|
| 136 |
+
$("#nFiles").text(json.lines);
|
| 137 |
+
$("#backupFiles").text(json.lines);
|
| 138 |
+
$("#backupSizeComplete").text(json.backupSize);
|
| 139 |
+
$("#backupName").text(json.backup);
|
| 140 |
+
$( "#dialog:ui-dialog" ).dialog( "destroy" );
|
| 141 |
+
$( "#dialog-message" ).dialog({
|
| 142 |
+
modal: true,
|
| 143 |
+
width: 600,
|
| 144 |
+
buttons: {
|
| 145 |
+
Close: function() {
|
| 146 |
+
$( this ).dialog( "close" );
|
| 147 |
+
}
|
| 148 |
+
}
|
| 149 |
+
});
|
| 150 |
+
|
| 151 |
+
}
|
| 152 |
+
|
| 153 |
+
});
|
| 154 |
+
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
$("#retry").click(function(){
|
| 158 |
+
$("#error").hide();
|
| 159 |
+
$("#errorText").empty();
|
| 160 |
+
if(step == "r1"){
|
| 161 |
+
xclonerRecurseMYSQL(globalUrl);
|
| 162 |
+
}
|
| 163 |
+
else
|
| 164 |
+
if(step == "r2"){
|
| 165 |
+
xclonerRecurseJSON(globalUrl);
|
| 166 |
+
}
|
| 167 |
+
else if(step == "r3"){
|
| 168 |
+
xclonerGetJSON(globalUrl);
|
| 169 |
+
}
|
| 170 |
+
});
|
| 171 |
+
|
| 172 |
+
});
|
javascript/jquery-ui-1.8.9.custom.min.js
ADDED
|
@@ -0,0 +1,781 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*!
|
| 2 |
+
* jQuery UI 1.8.9
|
| 3 |
+
*
|
| 4 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 5 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 6 |
+
* http://jquery.org/license
|
| 7 |
+
*
|
| 8 |
+
* http://docs.jquery.com/UI
|
| 9 |
+
*/
|
| 10 |
+
(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.9",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
|
| 11 |
+
NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
|
| 12 |
+
"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
|
| 13 |
+
if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
|
| 14 |
+
"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
|
| 15 |
+
d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
|
| 16 |
+
c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
|
| 17 |
+
b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
|
| 18 |
+
;/*!
|
| 19 |
+
* jQuery UI Widget 1.8.9
|
| 20 |
+
*
|
| 21 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 22 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 23 |
+
* http://jquery.org/license
|
| 24 |
+
*
|
| 25 |
+
* http://docs.jquery.com/UI/Widget
|
| 26 |
+
*/
|
| 27 |
+
(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
|
| 28 |
+
a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
|
| 29 |
+
e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
|
| 30 |
+
this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
|
| 31 |
+
widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
|
| 32 |
+
enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
|
| 33 |
+
;/*!
|
| 34 |
+
* jQuery UI Mouse 1.8.9
|
| 35 |
+
*
|
| 36 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 37 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 38 |
+
* http://jquery.org/license
|
| 39 |
+
*
|
| 40 |
+
* http://docs.jquery.com/UI/Mouse
|
| 41 |
+
*
|
| 42 |
+
* Depends:
|
| 43 |
+
* jquery.ui.widget.js
|
| 44 |
+
*/
|
| 45 |
+
(function(c){c.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(b){return a._mouseDown(b)}).bind("click."+this.widgetName,function(b){if(true===c.data(b.target,a.widgetName+".preventClickEvent")){c.removeData(b.target,a.widgetName+".preventClickEvent");b.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=
|
| 46 |
+
a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var b=this,e=a.which==1,f=typeof this.options.cancel=="string"?c(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){b.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
|
| 47 |
+
this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}this._mouseMoveDelegate=function(d){return b._mouseMove(d)};this._mouseUpDelegate=function(d){return b._mouseUp(d)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled=true}},_mouseMove:function(a){if(c.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);
|
| 48 |
+
return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&c.data(a.target,this.widgetName+".preventClickEvent",
|
| 49 |
+
true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
|
| 50 |
+
;/*
|
| 51 |
+
* jQuery UI Position 1.8.9
|
| 52 |
+
*
|
| 53 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 54 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 55 |
+
* http://jquery.org/license
|
| 56 |
+
*
|
| 57 |
+
* http://docs.jquery.com/UI/Position
|
| 58 |
+
*/
|
| 59 |
+
(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
|
| 60 |
+
left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
|
| 61 |
+
k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
|
| 62 |
+
m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
|
| 63 |
+
d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
|
| 64 |
+
a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
|
| 65 |
+
g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
|
| 66 |
+
;/*
|
| 67 |
+
* jQuery UI Draggable 1.8.9
|
| 68 |
+
*
|
| 69 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 70 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 71 |
+
* http://jquery.org/license
|
| 72 |
+
*
|
| 73 |
+
* http://docs.jquery.com/UI/Draggables
|
| 74 |
+
*
|
| 75 |
+
* Depends:
|
| 76 |
+
* jquery.ui.core.js
|
| 77 |
+
* jquery.ui.mouse.js
|
| 78 |
+
* jquery.ui.widget.js
|
| 79 |
+
*/
|
| 80 |
+
(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
|
| 81 |
+
"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
|
| 82 |
+
this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
|
| 83 |
+
this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
|
| 84 |
+
d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
|
| 85 |
+
this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&
|
| 86 |
+
this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
|
| 87 |
+
a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
|
| 88 |
+
0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
|
| 89 |
+
this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
|
| 90 |
+
(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment==
|
| 91 |
+
"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?
|
| 92 |
+
0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),
|
| 93 |
+
10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor==
|
| 94 |
+
Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():
|
| 95 |
+
f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;
|
| 96 |
+
if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/
|
| 97 |
+
b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-
|
| 98 |
+
this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=
|
| 99 |
+
this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.9"});
|
| 100 |
+
d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=
|
| 101 |
+
0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=
|
| 102 |
+
c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,
|
| 103 |
+
true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=
|
| 104 |
+
0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=
|
| 105 |
+
a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},
|
| 106 |
+
stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=
|
| 107 |
+
document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-
|
| 108 |
+
c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-
|
| 109 |
+
(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable",
|
| 110 |
+
"snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=
|
| 111 |
+
c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",
|
| 112 |
+
{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,
|
| 113 |
+
left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,
|
| 114 |
+
a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,
|
| 115 |
+
b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
|
| 116 |
+
;/*
|
| 117 |
+
* jQuery UI Droppable 1.8.9
|
| 118 |
+
*
|
| 119 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 120 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 121 |
+
* http://jquery.org/license
|
| 122 |
+
*
|
| 123 |
+
* http://docs.jquery.com/UI/Droppables
|
| 124 |
+
*
|
| 125 |
+
* Depends:
|
| 126 |
+
* jquery.ui.core.js
|
| 127 |
+
* jquery.ui.widget.js
|
| 128 |
+
* jquery.ui.mouse.js
|
| 129 |
+
* jquery.ui.draggable.js
|
| 130 |
+
*/
|
| 131 |
+
(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
|
| 132 |
+
a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
|
| 133 |
+
this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
|
| 134 |
+
this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
|
| 135 |
+
d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
|
| 136 |
+
a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.9"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
|
| 137 |
+
switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
|
| 138 |
+
i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
|
| 139 |
+
"none";if(c[f].visible){c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight};e=="mousedown"&&c[f]._activate.call(c[f],b)}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
|
| 140 |
+
a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
|
| 141 |
+
d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
|
| 142 |
+
;/*
|
| 143 |
+
* jQuery UI Resizable 1.8.9
|
| 144 |
+
*
|
| 145 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 146 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 147 |
+
* http://jquery.org/license
|
| 148 |
+
*
|
| 149 |
+
* http://docs.jquery.com/UI/Resizables
|
| 150 |
+
*
|
| 151 |
+
* Depends:
|
| 152 |
+
* jquery.ui.core.js
|
| 153 |
+
* jquery.ui.mouse.js
|
| 154 |
+
* jquery.ui.widget.js
|
| 155 |
+
*/
|
| 156 |
+
(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
|
| 157 |
+
_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
|
| 158 |
+
top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
|
| 159 |
+
this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
|
| 160 |
+
nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
|
| 161 |
+
String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
|
| 162 |
+
this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
|
| 163 |
+
if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
|
| 164 |
+
d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
|
| 165 |
+
this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
|
| 166 |
+
this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
|
| 167 |
+
b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
|
| 168 |
+
f={width:c.size.width-(f?0:c.sizeDiff.width),height:c.size.height-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",
|
| 169 |
+
b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=
|
| 170 |
+
a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,
|
| 171 |
+
k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),
|
| 172 |
+
c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=
|
| 173 |
+
this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+
|
| 174 |
+
a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,
|
| 175 |
+
arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,
|
| 176 |
+
{version:"1.8.9"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,
|
| 177 |
+
function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=
|
| 178 |
+
(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=
|
| 179 |
+
false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-
|
| 180 |
+
a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",
|
| 181 |
+
b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top",
|
| 182 |
+
"Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,
|
| 183 |
+
f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=
|
| 184 |
+
a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+
|
| 185 |
+
a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&
|
| 186 |
+
e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",
|
| 187 |
+
height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=
|
| 188 |
+
d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
|
| 189 |
+
;/*
|
| 190 |
+
* jQuery UI Selectable 1.8.9
|
| 191 |
+
*
|
| 192 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 193 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 194 |
+
* http://jquery.org/license
|
| 195 |
+
*
|
| 196 |
+
* http://docs.jquery.com/UI/Selectables
|
| 197 |
+
*
|
| 198 |
+
* Depends:
|
| 199 |
+
* jquery.ui.core.js
|
| 200 |
+
* jquery.ui.mouse.js
|
| 201 |
+
* jquery.ui.widget.js
|
| 202 |
+
*/
|
| 203 |
+
(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
|
| 204 |
+
selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
|
| 205 |
+
c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
|
| 206 |
+
c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
|
| 207 |
+
this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
|
| 208 |
+
a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
|
| 209 |
+
!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
|
| 210 |
+
e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.9"})})(jQuery);
|
| 211 |
+
;/*
|
| 212 |
+
* jQuery UI Sortable 1.8.9
|
| 213 |
+
*
|
| 214 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 215 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 216 |
+
* http://jquery.org/license
|
| 217 |
+
*
|
| 218 |
+
* http://docs.jquery.com/UI/Sortables
|
| 219 |
+
*
|
| 220 |
+
* Depends:
|
| 221 |
+
* jquery.ui.core.js
|
| 222 |
+
* jquery.ui.mouse.js
|
| 223 |
+
* jquery.ui.widget.js
|
| 224 |
+
*/
|
| 225 |
+
(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
|
| 226 |
+
this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,
|
| 227 |
+
arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=
|
| 228 |
+
c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,
|
| 229 |
+
{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();
|
| 230 |
+
if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",
|
| 231 |
+
a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");
|
| 232 |
+
if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+
|
| 233 |
+
this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+
|
| 234 |
+
b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+
|
| 235 |
+
"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,
|
| 236 |
+
c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==
|
| 237 |
+
document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length-
|
| 238 |
+
1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});
|
| 239 |
+
this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&&
|
| 240 |
+
a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?
|
| 241 |
+
"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?
|
| 242 |
+
c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;
|
| 243 |
+
return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=
|
| 244 |
+
d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});
|
| 245 |
+
return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=
|
| 246 |
+
d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&this.helper)this.offset.parent=
|
| 247 |
+
this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=
|
| 248 |
+
e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];
|
| 249 |
+
if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);
|
| 250 |
+
c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===
|
| 251 |
+
1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=
|
| 252 |
+
this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):
|
| 253 |
+
b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==
|
| 254 |
+
""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
|
| 255 |
+
this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
|
| 256 |
+
10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions=
|
| 257 |
+
{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||
|
| 258 |
+
document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,
|
| 259 |
+
b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=
|
| 260 |
+
document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
|
| 261 |
+
e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-
|
| 262 |
+
this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<
|
| 263 |
+
this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&
|
| 264 |
+
this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=
|
| 265 |
+
this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();
|
| 266 |
+
this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],
|
| 267 |
+
this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",
|
| 268 |
+
g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||
|
| 269 |
+
this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,
|
| 270 |
+
originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.9"})})(jQuery);
|
| 271 |
+
;/*
|
| 272 |
+
* jQuery UI Accordion 1.8.9
|
| 273 |
+
*
|
| 274 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 275 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 276 |
+
* http://jquery.org/license
|
| 277 |
+
*
|
| 278 |
+
* http://docs.jquery.com/UI/Accordion
|
| 279 |
+
*
|
| 280 |
+
* Depends:
|
| 281 |
+
* jquery.ui.core.js
|
| 282 |
+
* jquery.ui.widget.js
|
| 283 |
+
*/
|
| 284 |
+
(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
|
| 285 |
+
a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
|
| 286 |
+
if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
|
| 287 |
+
function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+
|
| 288 |
+
a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");
|
| 289 |
+
this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
|
| 290 |
+
b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
|
| 291 |
+
a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
|
| 292 |
+
c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
|
| 293 |
+
if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
|
| 294 |
+
if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
|
| 295 |
+
e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
|
| 296 |
+
e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
|
| 297 |
+
tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.9",animations:{slide:function(a,b){a=
|
| 298 |
+
c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);f[i]={value:j[1],
|
| 299 |
+
unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",paddingTop:"hide",
|
| 300 |
+
paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
|
| 301 |
+
;/*
|
| 302 |
+
* jQuery UI Autocomplete 1.8.9
|
| 303 |
+
*
|
| 304 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 305 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 306 |
+
* http://jquery.org/license
|
| 307 |
+
*
|
| 308 |
+
* http://docs.jquery.com/UI/Autocomplete
|
| 309 |
+
*
|
| 310 |
+
* Depends:
|
| 311 |
+
* jquery.ui.core.js
|
| 312 |
+
* jquery.ui.widget.js
|
| 313 |
+
* jquery.ui.position.js
|
| 314 |
+
*/
|
| 315 |
+
(function(d){d.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,f;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){f=false;var e=d.ui.keyCode;
|
| 316 |
+
switch(c.keyCode){case e.PAGE_UP:a._move("previousPage",c);break;case e.PAGE_DOWN:a._move("nextPage",c);break;case e.UP:a._move("previous",c);c.preventDefault();break;case e.DOWN:a._move("next",c);c.preventDefault();break;case e.ENTER:case e.NUMPAD_ENTER:if(a.menu.active){f=true;c.preventDefault()}case e.TAB:if(!a.menu.active)return;a.menu.select(c);break;case e.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=a.element.val()){a.selectedItem=
|
| 317 |
+
null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(f){f=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||
|
| 318 |
+
"body",b)[0]).mousedown(function(c){var e=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(g){g.target!==a.element[0]&&g.target!==e&&!d.ui.contains(e,g.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,e){e=e.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:e})&&/^key/.test(c.originalEvent.type)&&a.element.val(e.value)},selected:function(c,e){var g=e.item.data("item.autocomplete"),
|
| 319 |
+
h=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=h;setTimeout(function(){a.previous=h;a.selectedItem=g},1)}false!==a._trigger("select",c,{item:g})&&a.element.val(g.value);a.term=a.element.val();a.close(c);a.selectedItem=g},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
|
| 320 |
+
this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,f;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,e){e(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source===
|
| 321 |
+
"string"){f=this.options.source;this.source=function(c,e){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:f,data:c,dataType:"json",success:function(g,h,i){i===a.xhr&&e(g);a.xhr=null},error:function(g){g===a.xhr&&e([]);a.xhr=null}})}}else this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;
|
| 322 |
+
this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==
|
| 323 |
+
this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position))},
|
| 324 |
+
_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var f=this;d.each(b,function(c,e){f._renderItem(a,e)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);
|
| 325 |
+
else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(a,b){var f=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return f.test(c.label||c.value||c)})}})})(jQuery);
|
| 326 |
+
(function(d){d.widget("ui.menu",{_create:function(){var a=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(b){if(d(b.target).closest(".ui-menu-item a").length){b.preventDefault();a.select(b)}});this.refresh()},refresh:function(){var a=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
|
| 327 |
+
-1).mouseenter(function(b){a.activate(b,d(this).parent())}).mouseleave(function(){a.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var f=b.offset().top-this.element.offset().top,c=this.element.attr("scrollTop"),e=this.element.height();if(f<0)this.element.attr("scrollTop",c+f);else f>=e&&this.element.attr("scrollTop",c+f-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",a,{item:b})},
|
| 328 |
+
deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,f){if(this.active){a=this.active[a+"All"](".ui-menu-item").eq(0);
|
| 329 |
+
a.length?this.activate(f,a):this.activate(f,this.element.children(b))}else this.activate(f,this.element.children(b))},nextPage:function(a){if(this.hasScroll())if(!this.active||this.last())this.activate(a,this.element.children(".ui-menu-item:first"));else{var b=this.active.offset().top,f=this.element.height(),c=this.element.children(".ui-menu-item").filter(function(){var e=d(this).offset().top-b-f+d(this).height();return e<10&&e>-10});c.length||(c=this.element.children(".ui-menu-item:last"));this.activate(a,
|
| 330 |
+
c)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(a){if(this.hasScroll())if(!this.active||this.first())this.activate(a,this.element.children(".ui-menu-item:last"));else{var b=this.active.offset().top,f=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-b+f-d(this).height();return c<10&&c>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
|
| 331 |
+
this.activate(a,result)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})})(jQuery);
|
| 332 |
+
;/*
|
| 333 |
+
* jQuery UI Button 1.8.9
|
| 334 |
+
*
|
| 335 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 336 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 337 |
+
* http://jquery.org/license
|
| 338 |
+
*
|
| 339 |
+
* http://docs.jquery.com/UI/Button
|
| 340 |
+
*
|
| 341 |
+
* Depends:
|
| 342 |
+
* jquery.ui.core.js
|
| 343 |
+
* jquery.ui.widget.js
|
| 344 |
+
*/
|
| 345 |
+
(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,e=a([]);if(c)e=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return e};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
|
| 346 |
+
i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",e="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
|
| 347 |
+
function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||a(this).removeClass(e)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");
|
| 348 |
+
b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var f=b.element[0];h(f).not(f).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");
|
| 349 |
+
g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(f){if(c.disabled)return false;if(f.keyCode==a.ui.keyCode.SPACE||f.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(f){f.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",
|
| 350 |
+
c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var b=this.element.is(":checked");b&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=
|
| 351 |
+
this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||
|
| 352 |
+
this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
|
| 353 |
+
true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
|
| 354 |
+
c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary;if(d.primary||d.secondary){b.addClass("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){b.addClass(e?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary");
|
| 355 |
+
this.hasTitle||b.attr("title",c)}}else b.addClass("ui-button-text-only")}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
|
| 356 |
+
destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
|
| 357 |
+
;/*
|
| 358 |
+
* jQuery UI Dialog 1.8.9
|
| 359 |
+
*
|
| 360 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 361 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 362 |
+
* http://jquery.org/license
|
| 363 |
+
*
|
| 364 |
+
* http://docs.jquery.com/UI/Dialog
|
| 365 |
+
*
|
| 366 |
+
* Depends:
|
| 367 |
+
* jquery.ui.core.js
|
| 368 |
+
* jquery.ui.widget.js
|
| 369 |
+
* jquery.ui.button.js
|
| 370 |
+
* jquery.ui.draggable.js
|
| 371 |
+
* jquery.ui.mouse.js
|
| 372 |
+
* jquery.ui.position.js
|
| 373 |
+
* jquery.ui.resizable.js
|
| 374 |
+
*/
|
| 375 |
+
(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&
|
| 376 |
+
c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",
|
| 377 |
+
-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role",
|
| 378 |
+
"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=
|
| 379 |
+
b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&&
|
| 380 |
+
a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index");
|
| 381 |
+
isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);
|
| 382 |
+
d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}});
|
| 383 |
+
c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f,
|
| 384 |
+
h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('<button type="button"></button>').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=
|
| 385 |
+
d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize,
|
| 386 |
+
position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f,
|
| 387 |
+
h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===
|
| 388 |
+
1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in
|
| 389 |
+
l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled");
|
| 390 |
+
break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e=
|
| 391 |
+
this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&&
|
| 392 |
+
this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.9",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===
|
| 393 |
+
0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
|
| 394 |
+
height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
|
| 395 |
+
b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,
|
| 396 |
+
function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
|
| 397 |
+
;/*
|
| 398 |
+
* jQuery UI Slider 1.8.9
|
| 399 |
+
*
|
| 400 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 401 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 402 |
+
* http://jquery.org/license
|
| 403 |
+
*
|
| 404 |
+
* http://docs.jquery.com/UI/Slider
|
| 405 |
+
*
|
| 406 |
+
* Depends:
|
| 407 |
+
* jquery.ui.core.js
|
| 408 |
+
* jquery.ui.mouse.js
|
| 409 |
+
* jquery.ui.widget.js
|
| 410 |
+
*/
|
| 411 |
+
(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");a.disabled&&this.element.addClass("ui-slider-disabled ui-disabled");
|
| 412 |
+
this.range=d([]);if(a.range){if(a.range===true){this.range=d("<div></div>");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");
|
| 413 |
+
if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length<a.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();
|
| 414 |
+
else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e=
|
| 415 |
+
false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h===
|
| 416 |
+
b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
|
| 417 |
+
this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b,
|
| 418 |
+
g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},
|
| 419 |
+
_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;
|
| 420 |
+
if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=
|
| 421 |
+
this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c<e))c=e;if(c!==this.values(a)){e=this.values();e[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:e});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],
|
| 422 |
+
value:c});b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value=
|
| 423 |
+
this._trimAlignValue(b);this._refreshValue();this._change(null,0)}return this._value()},values:function(b,a){var c,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):this.value();
|
| 424 |
+
else return this._values()},_setOption:function(b,a){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
|
| 425 |
+
this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b];
|
| 426 |
+
return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
|
| 427 |
+
_refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate);
|
| 428 |
+
if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,
|
| 429 |
+
1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.9"})})(jQuery);
|
| 430 |
+
;/*
|
| 431 |
+
* jQuery UI Tabs 1.8.9
|
| 432 |
+
*
|
| 433 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 434 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 435 |
+
* http://jquery.org/license
|
| 436 |
+
*
|
| 437 |
+
* http://docs.jquery.com/UI/Tabs
|
| 438 |
+
*
|
| 439 |
+
* Depends:
|
| 440 |
+
* jquery.ui.core.js
|
| 441 |
+
* jquery.ui.widget.js
|
| 442 |
+
*/
|
| 443 |
+
(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
|
| 444 |
+
e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
|
| 445 |
+
d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
|
| 446 |
+
(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
|
| 447 |
+
this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
|
| 448 |
+
this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
|
| 449 |
+
if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
|
| 450 |
+
this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
|
| 451 |
+
g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
|
| 452 |
+
function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
|
| 453 |
+
this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=
|
| 454 |
+
-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
|
| 455 |
+
d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
|
| 456 |
+
d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
|
| 457 |
+
e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
|
| 458 |
+
j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
|
| 459 |
+
if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
|
| 460 |
+
this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
|
| 461 |
+
load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
|
| 462 |
+
"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
|
| 463 |
+
url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.9"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&&
|
| 464 |
+
a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
|
| 465 |
+
;/*
|
| 466 |
+
* jQuery UI Datepicker 1.8.9
|
| 467 |
+
*
|
| 468 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 469 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 470 |
+
* http://jquery.org/license
|
| 471 |
+
*
|
| 472 |
+
* http://docs.jquery.com/UI/Datepicker
|
| 473 |
+
*
|
| 474 |
+
* Depends:
|
| 475 |
+
* jquery.ui.core.js
|
| 476 |
+
*/
|
| 477 |
+
(function(d,G){function K(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
|
| 478 |
+
"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
|
| 479 |
+
"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
|
| 480 |
+
minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function E(a,b){d.extend(a,b);for(var c in b)if(b[c]==
|
| 481 |
+
null||b[c]==G)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.9"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();
|
| 482 |
+
f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
|
| 483 |
+
_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
|
| 484 |
+
b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==
|
| 485 |
+
""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
|
| 486 |
+
c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
|
| 487 |
+
true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{});
|
| 488 |
+
b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);
|
| 489 |
+
this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",
|
| 490 |
+
this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,
|
| 491 |
+
function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:
|
| 492 |
+
f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},
|
| 493 |
+
e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true);E(e.settings,f);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);
|
| 494 |
+
this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]?
|
| 495 |
+
d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||
|
| 496 |
+
a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,
|
| 497 |
+
e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,
|
| 498 |
+
"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==G?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},
|
| 499 |
+
_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=
|
| 500 |
+
d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,
|
| 501 |
+
c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&
|
| 502 |
+
d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",
|
| 503 |
+
function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=
|
| 504 |
+
-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,
|
| 505 |
+
"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},
|
| 506 |
+
_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-
|
| 507 |
+
g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?
|
| 508 |
+
b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},
|
| 509 |
+
_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):
|
| 510 |
+
0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=
|
| 511 |
+
false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=
|
| 512 |
+
d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);
|
| 513 |
+
else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=
|
| 514 |
+
a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,
|
| 515 |
+
g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){var v=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&v?4:p=="o"?3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,v,H){p=o(p)?H:v;for(v=0;v<p.length;v++)if(b.substr(s,p[v].length).toLowerCase()==p[v].toLowerCase()){s+=p[v].length;return v+1}throw"Unknown name at position "+
|
| 516 |
+
s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(k)if(a.charAt(z)=="'"&&!o("'"))k=false;else r();else switch(a.charAt(z)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var w=new Date(m("@"));c=w.getFullYear();j=w.getMonth()+1;l=w.getDate();break;case "!":w=new Date((m("!")-this._ticksTo1970)/1E4);c=w.getFullYear();j=w.getMonth()+
|
| 517 |
+
1;l=w.getDate();break;case "'":if(o("'"))r();else k=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",
|
| 518 |
+
RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&
|
| 519 |
+
a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",
|
| 520 |
+
b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+=
|
| 521 |
+
"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==G?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=
|
| 522 |
+
f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=
|
| 523 |
+
(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,
|
| 524 |
+
l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=
|
| 525 |
+
a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),
|
| 526 |
+
b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=
|
| 527 |
+
this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+
|
| 528 |
+
(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+
|
| 529 |
+
(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a,
|
| 530 |
+
"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=
|
| 531 |
+
this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",C=0;C<i[0];C++){for(var M="",D=0;D<i[1];D++){var N=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-
|
| 532 |
+
1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&C==0?c?f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,C>0||D>0,z,w)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var A=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q=
|
| 533 |
+
(t+h)%7;A+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=A+"</tr></thead><tbody>";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O<A;O++){x+="<tr>";var P=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var F=
|
| 534 |
+
p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,J=B&&!H||!F[0]||k&&q<k||o&&q>o;P+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(B?" ui-datepicker-other-month":"")+(q.getTime()==N.getTime()&&g==a.selectedMonth&&a._keyEvent||L.getTime()==q.getTime()&&L.getTime()==N.getTime()?" "+this._dayOverClass:"")+(J?" "+this._unselectableClass+" ui-state-disabled":"")+(B&&!v?"":" "+F[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today":
|
| 535 |
+
""))+'"'+((!B||v)&&F[2]?' title="'+F[2]+'"':"")+(J?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(B&&!v?" ":J?'<span class="ui-state-default">'+q.getDate()+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==u.getTime()?" ui-state-active":"")+(B?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=
|
| 536 |
+
P+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&D==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',
|
| 537 |
+
o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&
|
| 538 |
+
l)?" ":""));a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+
|
| 539 |
+
a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";if(d.browser.mozilla)k+='<select class="ui-datepicker-year"><option value="'+c+'" selected="selected">'+c+"</option></select>";else{k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=
|
| 540 |
+
a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,
|
| 541 |
+
"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
|
| 542 |
+
c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
|
| 543 |
+
"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
|
| 544 |
+
function(a){if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));
|
| 545 |
+
return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.9";window["DP_jQuery_"+y]=d})(jQuery);
|
| 546 |
+
;/*
|
| 547 |
+
* jQuery UI Progressbar 1.8.9
|
| 548 |
+
*
|
| 549 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 550 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 551 |
+
* http://jquery.org/license
|
| 552 |
+
*
|
| 553 |
+
* http://docs.jquery.com/UI/Progressbar
|
| 554 |
+
*
|
| 555 |
+
* Depends:
|
| 556 |
+
* jquery.ui.core.js
|
| 557 |
+
* jquery.ui.widget.js
|
| 558 |
+
*/
|
| 559 |
+
(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
|
| 560 |
+
this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*
|
| 561 |
+
this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.9"})})(jQuery);
|
| 562 |
+
;/*
|
| 563 |
+
* jQuery UI Effects 1.8.9
|
| 564 |
+
*
|
| 565 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 566 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 567 |
+
* http://jquery.org/license
|
| 568 |
+
*
|
| 569 |
+
* http://docs.jquery.com/UI/Effects/
|
| 570 |
+
*/
|
| 571 |
+
jQuery.effects||function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
|
| 572 |
+
16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
|
| 573 |
+
a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
|
| 574 |
+
a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function m(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
|
| 575 |
+
"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
|
| 576 |
+
0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
|
| 577 |
+
211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,
|
| 578 |
+
d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")||" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0];
|
| 579 |
+
h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,
|
| 580 |
+
a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.9",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,
|
| 581 |
+
a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",
|
| 582 |
+
border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);
|
| 583 |
+
return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments);
|
| 584 |
+
else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),
|
| 585 |
+
b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,
|
| 586 |
+
a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,
|
| 587 |
+
a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==
|
| 588 |
+
e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=
|
| 589 |
+
g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/
|
| 590 |
+
h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,
|
| 591 |
+
a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
|
| 592 |
+
;/*
|
| 593 |
+
* jQuery UI Effects Blind 1.8.9
|
| 594 |
+
*
|
| 595 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 596 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 597 |
+
* http://jquery.org/license
|
| 598 |
+
*
|
| 599 |
+
* http://docs.jquery.com/UI/Effects/Blind
|
| 600 |
+
*
|
| 601 |
+
* Depends:
|
| 602 |
+
* jquery.effects.core.js
|
| 603 |
+
*/
|
| 604 |
+
(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,
|
| 605 |
+
g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
|
| 606 |
+
;/*
|
| 607 |
+
* jQuery UI Effects Bounce 1.8.9
|
| 608 |
+
*
|
| 609 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 610 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 611 |
+
* http://jquery.org/license
|
| 612 |
+
*
|
| 613 |
+
* http://docs.jquery.com/UI/Effects/Bounce
|
| 614 |
+
*
|
| 615 |
+
* Depends:
|
| 616 |
+
* jquery.effects.core.js
|
| 617 |
+
*/
|
| 618 |
+
(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
|
| 619 |
+
3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
|
| 620 |
+
b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
|
| 621 |
+
;/*
|
| 622 |
+
* jQuery UI Effects Clip 1.8.9
|
| 623 |
+
*
|
| 624 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 625 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 626 |
+
* http://jquery.org/license
|
| 627 |
+
*
|
| 628 |
+
* http://docs.jquery.com/UI/Effects/Clip
|
| 629 |
+
*
|
| 630 |
+
* Depends:
|
| 631 |
+
* jquery.effects.core.js
|
| 632 |
+
*/
|
| 633 |
+
(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,
|
| 634 |
+
c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
|
| 635 |
+
;/*
|
| 636 |
+
* jQuery UI Effects Drop 1.8.9
|
| 637 |
+
*
|
| 638 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 639 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 640 |
+
* http://jquery.org/license
|
| 641 |
+
*
|
| 642 |
+
* http://docs.jquery.com/UI/Effects/Drop
|
| 643 |
+
*
|
| 644 |
+
* Depends:
|
| 645 |
+
* jquery.effects.core.js
|
| 646 |
+
*/
|
| 647 |
+
(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e==
|
| 648 |
+
"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
|
| 649 |
+
;/*
|
| 650 |
+
* jQuery UI Effects Explode 1.8.9
|
| 651 |
+
*
|
| 652 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 653 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 654 |
+
* http://jquery.org/license
|
| 655 |
+
*
|
| 656 |
+
* http://docs.jquery.com/UI/Effects/Explode
|
| 657 |
+
*
|
| 658 |
+
* Depends:
|
| 659 |
+
* jquery.effects.core.js
|
| 660 |
+
*/
|
| 661 |
+
(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
|
| 662 |
+
0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
|
| 663 |
+
e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
|
| 664 |
+
;/*
|
| 665 |
+
* jQuery UI Effects Fade 1.8.9
|
| 666 |
+
*
|
| 667 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 668 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 669 |
+
* http://jquery.org/license
|
| 670 |
+
*
|
| 671 |
+
* http://docs.jquery.com/UI/Effects/Fade
|
| 672 |
+
*
|
| 673 |
+
* Depends:
|
| 674 |
+
* jquery.effects.core.js
|
| 675 |
+
*/
|
| 676 |
+
(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
|
| 677 |
+
;/*
|
| 678 |
+
* jQuery UI Effects Fold 1.8.9
|
| 679 |
+
*
|
| 680 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 681 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 682 |
+
* http://jquery.org/license
|
| 683 |
+
*
|
| 684 |
+
* http://docs.jquery.com/UI/Effects/Fold
|
| 685 |
+
*
|
| 686 |
+
* Depends:
|
| 687 |
+
* jquery.effects.core.js
|
| 688 |
+
*/
|
| 689 |
+
(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],
|
| 690 |
+
10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
|
| 691 |
+
;/*
|
| 692 |
+
* jQuery UI Effects Highlight 1.8.9
|
| 693 |
+
*
|
| 694 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 695 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 696 |
+
* http://jquery.org/license
|
| 697 |
+
*
|
| 698 |
+
* http://docs.jquery.com/UI/Effects/Highlight
|
| 699 |
+
*
|
| 700 |
+
* Depends:
|
| 701 |
+
* jquery.effects.core.js
|
| 702 |
+
*/
|
| 703 |
+
(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
|
| 704 |
+
this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
|
| 705 |
+
;/*
|
| 706 |
+
* jQuery UI Effects Pulsate 1.8.9
|
| 707 |
+
*
|
| 708 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 709 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 710 |
+
* http://jquery.org/license
|
| 711 |
+
*
|
| 712 |
+
* http://docs.jquery.com/UI/Effects/Pulsate
|
| 713 |
+
*
|
| 714 |
+
* Depends:
|
| 715 |
+
* jquery.effects.core.js
|
| 716 |
+
*/
|
| 717 |
+
(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
|
| 718 |
+
a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
|
| 719 |
+
;/*
|
| 720 |
+
* jQuery UI Effects Scale 1.8.9
|
| 721 |
+
*
|
| 722 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 723 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 724 |
+
* http://jquery.org/license
|
| 725 |
+
*
|
| 726 |
+
* http://docs.jquery.com/UI/Effects/Scale
|
| 727 |
+
*
|
| 728 |
+
* Depends:
|
| 729 |
+
* jquery.effects.core.js
|
| 730 |
+
*/
|
| 731 |
+
(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
|
| 732 |
+
b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
|
| 733 |
+
1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
|
| 734 |
+
p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};
|
| 735 |
+
if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);
|
| 736 |
+
a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);
|
| 737 |
+
child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,
|
| 738 |
+
n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
|
| 739 |
+
;/*
|
| 740 |
+
* jQuery UI Effects Shake 1.8.9
|
| 741 |
+
*
|
| 742 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 743 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 744 |
+
* http://jquery.org/license
|
| 745 |
+
*
|
| 746 |
+
* http://docs.jquery.com/UI/Effects/Shake
|
| 747 |
+
*
|
| 748 |
+
* Depends:
|
| 749 |
+
* jquery.effects.core.js
|
| 750 |
+
*/
|
| 751 |
+
(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=
|
| 752 |
+
(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
|
| 753 |
+
;/*
|
| 754 |
+
* jQuery UI Effects Slide 1.8.9
|
| 755 |
+
*
|
| 756 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 757 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 758 |
+
* http://jquery.org/license
|
| 759 |
+
*
|
| 760 |
+
* http://docs.jquery.com/UI/Effects/Slide
|
| 761 |
+
*
|
| 762 |
+
* Depends:
|
| 763 |
+
* jquery.effects.core.js
|
| 764 |
+
*/
|
| 765 |
+
(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e);
|
| 766 |
+
var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
|
| 767 |
+
;/*
|
| 768 |
+
* jQuery UI Effects Transfer 1.8.9
|
| 769 |
+
*
|
| 770 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 771 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 772 |
+
* http://jquery.org/license
|
| 773 |
+
*
|
| 774 |
+
* http://docs.jquery.com/UI/Effects/Transfer
|
| 775 |
+
*
|
| 776 |
+
* Depends:
|
| 777 |
+
* jquery.effects.core.js
|
| 778 |
+
*/
|
| 779 |
+
(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
|
| 780 |
+
b.dequeue()})})}})(jQuery);
|
| 781 |
+
;
|
javascript/jquery-ui.min.js
DELETED
|
@@ -1,404 +0,0 @@
|
|
| 1 |
-
/*!
|
| 2 |
-
* jQuery UI 1.8.8
|
| 3 |
-
*
|
| 4 |
-
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
| 5 |
-
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 6 |
-
* http://jquery.org/license
|
| 7 |
-
*
|
| 8 |
-
* http://docs.jquery.com/UI
|
| 9 |
-
*/
|
| 10 |
-
(function(b,c){function f(g){return!b(g).parents().andSelf().filter(function(){return b.curCSS(this,"visibility")==="hidden"||b.expr.filters.hidden(this)}).length}b.ui=b.ui||{};if(!b.ui.version){b.extend(b.ui,{version:"1.8.8",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
|
| 11 |
-
NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});b.fn.extend({_focus:b.fn.focus,focus:function(g,e){return typeof g==="number"?this.each(function(){var a=this;setTimeout(function(){b(a).focus();e&&e.call(a)},g)}):this._focus.apply(this,arguments)},scrollParent:function(){var g;g=b.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(b.curCSS(this,
|
| 12 |
-
"position",1))&&/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!g.length?b(document):g},zIndex:function(g){if(g!==c)return this.css("zIndex",g);if(this.length){g=b(this[0]);for(var e;g.length&&g[0]!==document;){e=g.css("position");
|
| 13 |
-
if(e==="absolute"||e==="relative"||e==="fixed"){e=parseInt(g.css("zIndex"),10);if(!isNaN(e)&&e!==0)return e}g=g.parent()}}return 0},disableSelection:function(){return this.bind((b.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(g){g.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});b.each(["Width","Height"],function(g,e){function a(j,n,q,l){b.each(d,function(){n-=parseFloat(b.curCSS(j,"padding"+this,true))||0;if(q)n-=parseFloat(b.curCSS(j,
|
| 14 |
-
"border"+this+"Width",true))||0;if(l)n-=parseFloat(b.curCSS(j,"margin"+this,true))||0});return n}var d=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),i={innerWidth:b.fn.innerWidth,innerHeight:b.fn.innerHeight,outerWidth:b.fn.outerWidth,outerHeight:b.fn.outerHeight};b.fn["inner"+e]=function(j){if(j===c)return i["inner"+e].call(this);return this.each(function(){b(this).css(h,a(this,j)+"px")})};b.fn["outer"+e]=function(j,n){if(typeof j!=="number")return i["outer"+e].call(this,j);return this.each(function(){b(this).css(h,
|
| 15 |
-
a(this,j,true,n)+"px")})}});b.extend(b.expr[":"],{data:function(g,e,a){return!!b.data(g,a[3])},focusable:function(g){var e=g.nodeName.toLowerCase(),a=b.attr(g,"tabindex");if("area"===e){e=g.parentNode;a=e.name;if(!g.href||!a||e.nodeName.toLowerCase()!=="map")return false;g=b("img[usemap=#"+a+"]")[0];return!!g&&f(g)}return(/input|select|textarea|button|object/.test(e)?!g.disabled:"a"==e?g.href||!isNaN(a):!isNaN(a))&&f(g)},tabbable:function(g){var e=b.attr(g,"tabindex");return(isNaN(e)||e>=0)&&b(g).is(":focusable")}});
|
| 16 |
-
b(function(){var g=document.body,e=g.appendChild(e=document.createElement("div"));b.extend(e.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});b.support.minHeight=e.offsetHeight===100;b.support.selectstart="onselectstart"in e;g.removeChild(e).style.display="none"});b.extend(b.ui,{plugin:{add:function(g,e,a){g=b.ui[g].prototype;for(var d in a){g.plugins[d]=g.plugins[d]||[];g.plugins[d].push([e,a[d]])}},call:function(g,e,a){if((e=g.plugins[e])&&g.element[0].parentNode)for(var d=0;d<e.length;d++)g.options[e[d][0]]&&
|
| 17 |
-
e[d][1].apply(g.element,a)}},contains:function(g,e){return document.compareDocumentPosition?g.compareDocumentPosition(e)&16:g!==e&&g.contains(e)},hasScroll:function(g,e){if(b(g).css("overflow")==="hidden")return false;e=e&&e==="left"?"scrollLeft":"scrollTop";var a=false;if(g[e]>0)return true;g[e]=1;a=g[e]>0;g[e]=0;return a},isOverAxis:function(g,e,a){return g>e&&g<e+a},isOver:function(g,e,a,d,h,i){return b.ui.isOverAxis(g,a,h)&&b.ui.isOverAxis(e,d,i)}})}})(jQuery);
|
| 18 |
-
(function(b,c){if(b.cleanData){var f=b.cleanData;b.cleanData=function(e){for(var a=0,d;(d=e[a])!=null;a++)b(d).triggerHandler("remove");f(e)}}else{var g=b.fn.remove;b.fn.remove=function(e,a){return this.each(function(){if(!a)if(!e||b.filter(e,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return g.call(b(this),e,a)})}}b.widget=function(e,a,d){var h=e.split(".")[0],i;e=e.split(".")[1];i=h+"-"+e;if(!d){d=a;a=b.Widget}b.expr[":"][i]=function(j){return!!b.data(j,
|
| 19 |
-
e)};b[h]=b[h]||{};b[h][e]=function(j,n){arguments.length&&this._createWidget(j,n)};a=new a;a.options=b.extend(true,{},a.options);b[h][e].prototype=b.extend(true,a,{namespace:h,widgetName:e,widgetEventPrefix:b[h][e].prototype.widgetEventPrefix||e,widgetBaseClass:i},d);b.widget.bridge(e,b[h][e])};b.widget.bridge=function(e,a){b.fn[e]=function(d){var h=typeof d==="string",i=Array.prototype.slice.call(arguments,1),j=this;d=!h&&i.length?b.extend.apply(null,[true,d].concat(i)):d;if(h&&d.charAt(0)==="_")return j;
|
| 20 |
-
h?this.each(function(){var n=b.data(this,e),q=n&&b.isFunction(n[d])?n[d].apply(n,i):n;if(q!==n&&q!==c){j=q;return false}}):this.each(function(){var n=b.data(this,e);n?n.option(d||{})._init():b.data(this,e,new a(d,this))});return j}};b.Widget=function(e,a){arguments.length&&this._createWidget(e,a)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(e,a){b.data(a,this.widgetName,this);this.element=b(a);this.options=b.extend(true,{},this.options,
|
| 21 |
-
this._getCreateOptions(),e);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
|
| 22 |
-
widget:function(){return this.element},option:function(e,a){var d=e;if(arguments.length===0)return b.extend({},this.options);if(typeof e==="string"){if(a===c)return this.options[e];d={};d[e]=a}this._setOptions(d);return this},_setOptions:function(e){var a=this;b.each(e,function(d,h){a._setOption(d,h)});return this},_setOption:function(e,a){this.options[e]=a;if(e==="disabled")this.widget()[a?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",a);return this},
|
| 23 |
-
enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,a,d){var h=this.options[e];a=b.Event(a);a.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();d=d||{};if(a.originalEvent){e=b.event.props.length;for(var i;e;){i=b.event.props[--e];a[i]=a.originalEvent[i]}}this.element.trigger(a,d);return!(b.isFunction(h)&&h.call(this.element[0],a,d)===false||a.isDefaultPrevented())}}})(jQuery);
|
| 24 |
-
(function(b){b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var c=this;this.element.bind("mousedown."+this.widgetName,function(f){return c._mouseDown(f)}).bind("click."+this.widgetName,function(f){if(true===b.data(f.target,c.widgetName+".preventClickEvent")){b.removeData(f.target,c.widgetName+".preventClickEvent");f.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(c){c.originalEvent=
|
| 25 |
-
c.originalEvent||{};if(!c.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(c);this._mouseDownEvent=c;var f=this,g=c.which==1,e=typeof this.options.cancel=="string"?b(c.target).parents().add(c.target).filter(this.options.cancel).length:false;if(!g||e||!this._mouseCapture(c))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){f.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c)){this._mouseStarted=
|
| 26 |
-
this._mouseStart(c)!==false;if(!this._mouseStarted){c.preventDefault();return true}}this._mouseMoveDelegate=function(a){return f._mouseMove(a)};this._mouseUpDelegate=function(a){return f._mouseUp(a)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.preventDefault();return c.originalEvent.mouseHandled=true}},_mouseMove:function(c){if(b.browser.msie&&!(document.documentMode>=9)&&!c.button)return this._mouseUp(c);if(this._mouseStarted){this._mouseDrag(c);
|
| 27 |
-
return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,c)!==false)?this._mouseDrag(c):this._mouseUp(c);return!this._mouseStarted},_mouseUp:function(c){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;c.target==this._mouseDownEvent.target&&b.data(c.target,this.widgetName+".preventClickEvent",
|
| 28 |
-
true);this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
|
| 29 |
-
(function(b){b.widget("ui.draggable",b.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
|
| 30 |
-
"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(c){var f=
|
| 31 |
-
this.options;if(this.helper||f.disabled||b(c.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(c);if(!this.handle)return false;return true},_mouseStart:function(c){var f=this.options;this.helper=this._createHelper(c);this._cacheHelperProportions();if(b.ui.ddmanager)b.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
|
| 32 |
-
this.margins.top,left:this.offset.left-this.margins.left};b.extend(this.offset,{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;f.cursorAt&&this._adjustOffsetFromHelper(f.cursorAt);f.containment&&this._setContainment();if(this._trigger("start",c)===false){this._clear();return false}this._cacheHelperProportions();
|
| 33 |
-
b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(c,true);return true},_mouseDrag:function(c,f){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute");if(!f){f=this._uiHash();if(this._trigger("drag",c,f)===false){this._mouseUp({});return false}this.position=f.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
|
| 34 |
-
this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";b.ui.ddmanager&&b.ui.ddmanager.drag(this,c);return false},_mouseStop:function(c){var f=false;if(b.ui.ddmanager&&!this.options.dropBehaviour)f=b.ui.ddmanager.drop(this,c);if(this.dropped){f=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!f||this.options.revert=="valid"&&f||this.options.revert===true||b.isFunction(this.options.revert)&&this.options.revert.call(this.element,
|
| 35 |
-
f)){var g=this;b(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){g._trigger("stop",c)!==false&&g._clear()})}else this._trigger("stop",c)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(c){var f=!this.options.handle||!b(this.options.handle,this.element).length?true:false;b(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
|
| 36 |
-
c.target)f=true});return f},_createHelper:function(c){var f=this.options;c=b.isFunction(f.helper)?b(f.helper.apply(this.element[0],[c])):f.helper=="clone"?this.element.clone():this.element;c.parents("body").length||c.appendTo(f.appendTo=="parent"?this.element[0].parentNode:f.appendTo);c[0]!=this.element[0]&&!/(fixed|absolute)/.test(c.css("position"))&&c.css("position","absolute");return c},_adjustOffsetFromHelper:function(c){if(typeof c=="string")c=c.split(" ");if(b.isArray(c))c={left:+c[0],top:+c[1]||
|
| 37 |
-
0};if("left"in c)this.offset.click.left=c.left+this.margins.left;if("right"in c)this.offset.click.left=this.helperProportions.width-c.right+this.margins.left;if("top"in c)this.offset.click.top=c.top+this.margins.top;if("bottom"in c)this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],
|
| 38 |
-
this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)c={top:0,left:0};return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var c=this.element.position();return{top:c.top-
|
| 39 |
-
(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var c=this.options;if(c.containment==
|
| 40 |
-
"parent")c.containment=this.helper[0].parentNode;if(c.containment=="document"||c.containment=="window")this.containment=[(c.containment=="document"?0:b(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(c.containment=="document"?0:b(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(c.containment=="document"?0:b(window).scrollLeft())+b(c.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(c.containment=="document"?
|
| 41 |
-
0:b(window).scrollTop())+(b(c.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(c.containment)&&c.containment.constructor!=Array){var f=b(c.containment)[0];if(f){c=b(c.containment).offset();var g=b(f).css("overflow")!="hidden";this.containment=[c.left+(parseInt(b(f).css("borderLeftWidth"),10)||0)+(parseInt(b(f).css("paddingLeft"),10)||0)-this.margins.left,c.top+(parseInt(b(f).css("borderTopWidth"),
|
| 42 |
-
10)||0)+(parseInt(b(f).css("paddingTop"),10)||0)-this.margins.top,c.left+(g?Math.max(f.scrollWidth,f.offsetWidth):f.offsetWidth)-(parseInt(b(f).css("borderLeftWidth"),10)||0)-(parseInt(b(f).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,c.top+(g?Math.max(f.scrollHeight,f.offsetHeight):f.offsetHeight)-(parseInt(b(f).css("borderTopWidth"),10)||0)-(parseInt(b(f).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(c.containment.constructor==
|
| 43 |
-
Array)this.containment=c.containment},_convertPositionTo:function(c,f){if(!f)f=this.position;c=c=="absolute"?1:-1;var g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);return{top:f.top+this.offset.relative.top*c+this.offset.parent.top*c-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():
|
| 44 |
-
e?0:g.scrollTop())*c),left:f.left+this.offset.relative.left*c+this.offset.parent.left*c-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())*c)}},_generatePosition:function(c){var f=this.options,g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName),a=c.pageX,d=c.pageY;
|
| 45 |
-
if(this.originalPosition){if(this.containment){if(c.pageX-this.offset.click.left<this.containment[0])a=this.containment[0]+this.offset.click.left;if(c.pageY-this.offset.click.top<this.containment[1])d=this.containment[1]+this.offset.click.top;if(c.pageX-this.offset.click.left>this.containment[2])a=this.containment[2]+this.offset.click.left;if(c.pageY-this.offset.click.top>this.containment[3])d=this.containment[3]+this.offset.click.top}if(f.grid){d=this.originalPageY+Math.round((d-this.originalPageY)/
|
| 46 |
-
f.grid[1])*f.grid[1];d=this.containment?!(d-this.offset.click.top<this.containment[1]||d-this.offset.click.top>this.containment[3])?d:!(d-this.offset.click.top<this.containment[1])?d-f.grid[1]:d+f.grid[1]:d;a=this.originalPageX+Math.round((a-this.originalPageX)/f.grid[0])*f.grid[0];a=this.containment?!(a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2])?a:!(a-this.offset.click.left<this.containment[0])?a-f.grid[0]:a+f.grid[0]:a}}return{top:d-this.offset.click.top-
|
| 47 |
-
this.offset.relative.top-this.offset.parent.top+(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:g.scrollTop()),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=
|
| 48 |
-
this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(c,f,g){g=g||this._uiHash();b.ui.plugin.call(this,c,[f,g]);if(c=="drag")this.positionAbs=this._convertPositionTo("absolute");return b.Widget.prototype._trigger.call(this,c,f,g)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});b.extend(b.ui.draggable,{version:"1.8.8"});
|
| 49 |
-
b.ui.plugin.add("draggable","connectToSortable",{start:function(c,f){var g=b(this).data("draggable"),e=g.options,a=b.extend({},f,{item:g.element});g.sortables=[];b(e.connectToSortable).each(function(){var d=b.data(this,"sortable");if(d&&!d.options.disabled){g.sortables.push({instance:d,shouldRevert:d.options.revert});d._refreshItems();d._trigger("activate",c,a)}})},stop:function(c,f){var g=b(this).data("draggable"),e=b.extend({},f,{item:g.element});b.each(g.sortables,function(){if(this.instance.isOver){this.instance.isOver=
|
| 50 |
-
0;g.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(c);this.instance.options.helper=this.instance.options._helper;g.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",c,e)}})},drag:function(c,f){var g=b(this).data("draggable"),e=this;b.each(g.sortables,function(){this.instance.positionAbs=
|
| 51 |
-
g.positionAbs;this.instance.helperProportions=g.helperProportions;this.instance.offset.click=g.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=b(e).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return f.helper[0]};c.target=this.instance.currentItem[0];this.instance._mouseCapture(c,
|
| 52 |
-
true);this.instance._mouseStart(c,true,true);this.instance.offset.click.top=g.offset.click.top;this.instance.offset.click.left=g.offset.click.left;this.instance.offset.parent.left-=g.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=g.offset.parent.top-this.instance.offset.parent.top;g._trigger("toSortable",c);g.dropped=this.instance.element;g.currentItem=g.element;this.instance.fromOutside=g}this.instance.currentItem&&this.instance._mouseDrag(c)}else if(this.instance.isOver){this.instance.isOver=
|
| 53 |
-
0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",c,this.instance._uiHash(this.instance));this.instance._mouseStop(c,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();g._trigger("fromSortable",c);g.dropped=false}})}});b.ui.plugin.add("draggable","cursor",{start:function(){var c=b("body"),f=b(this).data("draggable").options;if(c.css("cursor"))f._cursor=
|
| 54 |
-
c.css("cursor");c.css("cursor",f.cursor)},stop:function(){var c=b(this).data("draggable").options;c._cursor&&b("body").css("cursor",c._cursor)}});b.ui.plugin.add("draggable","iframeFix",{start:function(){var c=b(this).data("draggable").options;b(c.iframeFix===true?"iframe":c.iframeFix).each(function(){b('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(b(this).offset()).appendTo("body")})},
|
| 55 |
-
stop:function(){b("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});b.ui.plugin.add("draggable","opacity",{start:function(c,f){c=b(f.helper);f=b(this).data("draggable").options;if(c.css("opacity"))f._opacity=c.css("opacity");c.css("opacity",f.opacity)},stop:function(c,f){c=b(this).data("draggable").options;c._opacity&&b(f.helper).css("opacity",c._opacity)}});b.ui.plugin.add("draggable","scroll",{start:function(){var c=b(this).data("draggable");if(c.scrollParent[0]!=
|
| 56 |
-
document&&c.scrollParent[0].tagName!="HTML")c.overflowOffset=c.scrollParent.offset()},drag:function(c){var f=b(this).data("draggable"),g=f.options,e=false;if(f.scrollParent[0]!=document&&f.scrollParent[0].tagName!="HTML"){if(!g.axis||g.axis!="x")if(f.overflowOffset.top+f.scrollParent[0].offsetHeight-c.pageY<g.scrollSensitivity)f.scrollParent[0].scrollTop=e=f.scrollParent[0].scrollTop+g.scrollSpeed;else if(c.pageY-f.overflowOffset.top<g.scrollSensitivity)f.scrollParent[0].scrollTop=e=f.scrollParent[0].scrollTop-
|
| 57 |
-
g.scrollSpeed;if(!g.axis||g.axis!="y")if(f.overflowOffset.left+f.scrollParent[0].offsetWidth-c.pageX<g.scrollSensitivity)f.scrollParent[0].scrollLeft=e=f.scrollParent[0].scrollLeft+g.scrollSpeed;else if(c.pageX-f.overflowOffset.left<g.scrollSensitivity)f.scrollParent[0].scrollLeft=e=f.scrollParent[0].scrollLeft-g.scrollSpeed}else{if(!g.axis||g.axis!="x")if(c.pageY-b(document).scrollTop()<g.scrollSensitivity)e=b(document).scrollTop(b(document).scrollTop()-g.scrollSpeed);else if(b(window).height()-
|
| 58 |
-
(c.pageY-b(document).scrollTop())<g.scrollSensitivity)e=b(document).scrollTop(b(document).scrollTop()+g.scrollSpeed);if(!g.axis||g.axis!="y")if(c.pageX-b(document).scrollLeft()<g.scrollSensitivity)e=b(document).scrollLeft(b(document).scrollLeft()-g.scrollSpeed);else if(b(window).width()-(c.pageX-b(document).scrollLeft())<g.scrollSensitivity)e=b(document).scrollLeft(b(document).scrollLeft()+g.scrollSpeed)}e!==false&&b.ui.ddmanager&&!g.dropBehaviour&&b.ui.ddmanager.prepareOffsets(f,c)}});b.ui.plugin.add("draggable",
|
| 59 |
-
"snap",{start:function(){var c=b(this).data("draggable"),f=c.options;c.snapElements=[];b(f.snap.constructor!=String?f.snap.items||":data(draggable)":f.snap).each(function(){var g=b(this),e=g.offset();this!=c.element[0]&&c.snapElements.push({item:this,width:g.outerWidth(),height:g.outerHeight(),top:e.top,left:e.left})})},drag:function(c,f){for(var g=b(this).data("draggable"),e=g.options,a=e.snapTolerance,d=f.offset.left,h=d+g.helperProportions.width,i=f.offset.top,j=i+g.helperProportions.height,n=
|
| 60 |
-
g.snapElements.length-1;n>=0;n--){var q=g.snapElements[n].left,l=q+g.snapElements[n].width,k=g.snapElements[n].top,m=k+g.snapElements[n].height;if(q-a<d&&d<l+a&&k-a<i&&i<m+a||q-a<d&&d<l+a&&k-a<j&&j<m+a||q-a<h&&h<l+a&&k-a<i&&i<m+a||q-a<h&&h<l+a&&k-a<j&&j<m+a){if(e.snapMode!="inner"){var o=Math.abs(k-j)<=a,p=Math.abs(m-i)<=a,s=Math.abs(q-h)<=a,r=Math.abs(l-d)<=a;if(o)f.position.top=g._convertPositionTo("relative",{top:k-g.helperProportions.height,left:0}).top-g.margins.top;if(p)f.position.top=g._convertPositionTo("relative",
|
| 61 |
-
{top:m,left:0}).top-g.margins.top;if(s)f.position.left=g._convertPositionTo("relative",{top:0,left:q-g.helperProportions.width}).left-g.margins.left;if(r)f.position.left=g._convertPositionTo("relative",{top:0,left:l}).left-g.margins.left}var u=o||p||s||r;if(e.snapMode!="outer"){o=Math.abs(k-i)<=a;p=Math.abs(m-j)<=a;s=Math.abs(q-d)<=a;r=Math.abs(l-h)<=a;if(o)f.position.top=g._convertPositionTo("relative",{top:k,left:0}).top-g.margins.top;if(p)f.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height,
|
| 62 |
-
left:0}).top-g.margins.top;if(s)f.position.left=g._convertPositionTo("relative",{top:0,left:q}).left-g.margins.left;if(r)f.position.left=g._convertPositionTo("relative",{top:0,left:l-g.helperProportions.width}).left-g.margins.left}if(!g.snapElements[n].snapping&&(o||p||s||r||u))g.options.snap.snap&&g.options.snap.snap.call(g.element,c,b.extend(g._uiHash(),{snapItem:g.snapElements[n].item}));g.snapElements[n].snapping=o||p||s||r||u}else{g.snapElements[n].snapping&&g.options.snap.release&&g.options.snap.release.call(g.element,
|
| 63 |
-
c,b.extend(g._uiHash(),{snapItem:g.snapElements[n].item}));g.snapElements[n].snapping=false}}}});b.ui.plugin.add("draggable","stack",{start:function(){var c=b(this).data("draggable").options;c=b.makeArray(b(c.stack)).sort(function(g,e){return(parseInt(b(g).css("zIndex"),10)||0)-(parseInt(b(e).css("zIndex"),10)||0)});if(c.length){var f=parseInt(c[0].style.zIndex)||0;b(c).each(function(g){this.style.zIndex=f+g});this[0].style.zIndex=f+c.length}}});b.ui.plugin.add("draggable","zIndex",{start:function(c,
|
| 64 |
-
f){c=b(f.helper);f=b(this).data("draggable").options;if(c.css("zIndex"))f._zIndex=c.css("zIndex");c.css("zIndex",f.zIndex)},stop:function(c,f){c=b(this).data("draggable").options;c._zIndex&&b(f.helper).css("zIndex",c._zIndex)}})})(jQuery);
|
| 65 |
-
(function(b){b.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var c=this.options,f=c.accept;this.isover=0;this.isout=1;this.accept=b.isFunction(f)?f:function(g){return g.is(f)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};b.ui.ddmanager.droppables[c.scope]=b.ui.ddmanager.droppables[c.scope]||[];b.ui.ddmanager.droppables[c.scope].push(this);
|
| 66 |
-
c.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var c=b.ui.ddmanager.droppables[this.options.scope],f=0;f<c.length;f++)c[f]==this&&c.splice(f,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(c,f){if(c=="accept")this.accept=b.isFunction(f)?f:function(g){return g.is(f)};b.Widget.prototype._setOption.apply(this,arguments)},_activate:function(c){var f=b.ui.ddmanager.current;this.options.activeClass&&
|
| 67 |
-
this.element.addClass(this.options.activeClass);f&&this._trigger("activate",c,this.ui(f))},_deactivate:function(c){var f=b.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);f&&this._trigger("deactivate",c,this.ui(f))},_over:function(c){var f=b.ui.ddmanager.current;if(!(!f||(f.currentItem||f.element)[0]==this.element[0]))if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
|
| 68 |
-
this._trigger("over",c,this.ui(f))}},_out:function(c){var f=b.ui.ddmanager.current;if(!(!f||(f.currentItem||f.element)[0]==this.element[0]))if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",c,this.ui(f))}},_drop:function(c,f){var g=f||b.ui.ddmanager.current;if(!g||(g.currentItem||g.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var a=
|
| 69 |
-
b.data(this,"droppable");if(a.options.greedy&&!a.options.disabled&&a.options.scope==g.options.scope&&a.accept.call(a.element[0],g.currentItem||g.element)&&b.ui.intersect(g,b.extend(a,{offset:a.element.offset()}),a.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],g.currentItem||g.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
|
| 70 |
-
c,this.ui(g));return this.element}return false},ui:function(c){return{draggable:c.currentItem||c.element,helper:c.helper,position:c.position,offset:c.positionAbs}}});b.extend(b.ui.droppable,{version:"1.8.8"});b.ui.intersect=function(c,f,g){if(!f.offset)return false;var e=(c.positionAbs||c.position.absolute).left,a=e+c.helperProportions.width,d=(c.positionAbs||c.position.absolute).top,h=d+c.helperProportions.height,i=f.offset.left,j=i+f.proportions.width,n=f.offset.top,q=n+f.proportions.height;
|
| 71 |
-
switch(g){case "fit":return i<=e&&a<=j&&n<=d&&h<=q;case "intersect":return i<e+c.helperProportions.width/2&&a-c.helperProportions.width/2<j&&n<d+c.helperProportions.height/2&&h-c.helperProportions.height/2<q;case "pointer":return b.ui.isOver((c.positionAbs||c.position.absolute).top+(c.clickOffset||c.offset.click).top,(c.positionAbs||c.position.absolute).left+(c.clickOffset||c.offset.click).left,n,i,f.proportions.height,f.proportions.width);case "touch":return(d>=n&&d<=q||h>=n&&h<=q||d<n&&h>q)&&(e>=
|
| 72 |
-
i&&e<=j||a>=i&&a<=j||e<i&&a>j);default:return false}};b.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(c,f){var g=b.ui.ddmanager.droppables[c.options.scope]||[],e=f?f.type:null,a=(c.currentItem||c.element).find(":data(droppable)").andSelf(),d=0;a:for(;d<g.length;d++)if(!(g[d].options.disabled||c&&!g[d].accept.call(g[d].element[0],c.currentItem||c.element))){for(var h=0;h<a.length;h++)if(a[h]==g[d].element[0]){g[d].proportions.height=0;continue a}g[d].visible=g[d].element.css("display")!=
|
| 73 |
-
"none";if(g[d].visible){g[d].offset=g[d].element.offset();g[d].proportions={width:g[d].element[0].offsetWidth,height:g[d].element[0].offsetHeight};e=="mousedown"&&g[d]._activate.call(g[d],f)}}},drop:function(c,f){var g=false;b.each(b.ui.ddmanager.droppables[c.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&b.ui.intersect(c,this,this.options.tolerance))g=g||this._drop.call(this,f);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],c.currentItem||
|
| 74 |
-
c.element)){this.isout=1;this.isover=0;this._deactivate.call(this,f)}}});return g},drag:function(c,f){c.options.refreshPositions&&b.ui.ddmanager.prepareOffsets(c,f);b.each(b.ui.ddmanager.droppables[c.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var g=b.ui.intersect(c,this,this.options.tolerance);if(g=!g&&this.isover==1?"isout":g&&this.isover==0?"isover":null){var e;if(this.options.greedy){var a=this.element.parents(":data(droppable):eq(0)");if(a.length){e=
|
| 75 |
-
b.data(a[0],"droppable");e.greedyChild=g=="isover"?1:0}}if(e&&g=="isover"){e.isover=0;e.isout=1;e._out.call(e,f)}this[g]=1;this[g=="isout"?"isover":"isout"]=0;this[g=="isover"?"_over":"_out"].call(this,f);if(e&&g=="isout"){e.isout=0;e.isover=1;e._over.call(e,f)}}}})}}})(jQuery);
|
| 76 |
-
(function(b){b.widget("ui.resizable",b.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var g=this,e=this.options;this.element.addClass("ui-resizable");b.extend(this,{_aspectRatio:!!e.aspectRatio,aspectRatio:e.aspectRatio,originalElement:this.element,
|
| 77 |
-
_proportionallyResizeElements:[],_helper:e.helper||e.ghost||e.animate?e.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&b.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(b('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
|
| 78 |
-
top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
|
| 79 |
-
this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=e.handles||(!b(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
|
| 80 |
-
nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var a=this.handles.split(",");this.handles={};for(var d=0;d<a.length;d++){var h=b.trim(a[d]),i=b('<div class="ui-resizable-handle '+("ui-resizable-"+h)+'"></div>');/sw|se|ne|nw/.test(h)&&i.css({zIndex:++e.zIndex});"se"==h&&i.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[h]=".ui-resizable-"+h;this.element.append(i)}}this._renderAxis=function(j){j=j||this.element;for(var n in this.handles){if(this.handles[n].constructor==
|
| 81 |
-
String)this.handles[n]=b(this.handles[n],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var q=b(this.handles[n],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(n)?q.outerHeight():q.outerWidth();q=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");j.css(q,l);this._proportionallyResize()}b(this.handles[n])}};this._renderAxis(this.element);this._handles=b(".ui-resizable-handle",this.element).disableSelection();
|
| 82 |
-
this._handles.mouseover(function(){if(!g.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);g.axis=j&&j[1]?j[1]:"se"}});if(e.autoHide){this._handles.hide();b(this.element).addClass("ui-resizable-autohide").hover(function(){b(this).removeClass("ui-resizable-autohide");g._handles.show()},function(){if(!g.resizing){b(this).addClass("ui-resizable-autohide");g._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var g=function(a){b(a).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
|
| 83 |
-
if(this.elementIsWrapper){g(this.element);var e=this.element;e.after(this.originalElement.css({position:e.css("position"),width:e.outerWidth(),height:e.outerHeight(),top:e.css("top"),left:e.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);g(this.originalElement);return this},_mouseCapture:function(g){var e=false;for(var a in this.handles)if(b(this.handles[a])[0]==g.target)e=true;return!this.options.disabled&&e},_mouseStart:function(g){var e=this.options,a=this.element.position(),
|
| 84 |
-
d=this.element;this.resizing=true;this.documentScroll={top:b(document).scrollTop(),left:b(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:a.top,left:a.left});b.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();a=c(this.helper.css("left"));var h=c(this.helper.css("top"));if(e.containment){a+=b(e.containment).scrollLeft()||0;h+=b(e.containment).scrollTop()||0}this.offset=
|
| 85 |
-
this.helper.offset();this.position={left:a,top:h};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:a,top:h};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=typeof e.aspectRatio=="number"?e.aspectRatio:
|
| 86 |
-
this.originalSize.width/this.originalSize.height||1;e=b(".ui-resizable-"+this.axis).css("cursor");b("body").css("cursor",e=="auto"?this.axis+"-resize":e);d.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(g){var e=this.helper,a=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;a=d.apply(this,[g,g.pageX-a.left||0,g.pageY-a.top||0]);if(this._aspectRatio||g.shiftKey)a=this._updateRatio(a,g);a=this._respectSize(a,g);this._propagate("resize",
|
| 87 |
-
g);e.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(a);this._trigger("resize",g,this.ui());return false},_mouseStop:function(g){this.resizing=false;var e=this.options,a=this;if(this._helper){var d=this._proportionallyResizeElements,h=d.length&&/textarea/i.test(d[0].nodeName);d=h&&b.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;
|
| 88 |
-
h={width:a.size.width-(h?0:a.sizeDiff.width),height:a.size.height-d};d=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var i=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;e.animate||this.element.css(b.extend(h,{top:i,left:d}));a.helper.height(a.size.height);a.helper.width(a.size.width);this._helper&&!e.animate&&this._proportionallyResize()}b("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",
|
| 89 |
-
g);this._helper&&this.helper.remove();return false},_updateCache:function(g){this.offset=this.helper.offset();if(f(g.left))this.position.left=g.left;if(f(g.top))this.position.top=g.top;if(f(g.height))this.size.height=g.height;if(f(g.width))this.size.width=g.width},_updateRatio:function(g){var e=this.position,a=this.size,d=this.axis;if(g.height)g.width=a.height*this.aspectRatio;else if(g.width)g.height=a.width/this.aspectRatio;if(d=="sw"){g.left=e.left+(a.width-g.width);g.top=null}if(d=="nw"){g.top=
|
| 90 |
-
e.top+(a.height-g.height);g.left=e.left+(a.width-g.width)}return g},_respectSize:function(g){var e=this.options,a=this.axis,d=f(g.width)&&e.maxWidth&&e.maxWidth<g.width,h=f(g.height)&&e.maxHeight&&e.maxHeight<g.height,i=f(g.width)&&e.minWidth&&e.minWidth>g.width,j=f(g.height)&&e.minHeight&&e.minHeight>g.height;if(i)g.width=e.minWidth;if(j)g.height=e.minHeight;if(d)g.width=e.maxWidth;if(h)g.height=e.maxHeight;var n=this.originalPosition.left+this.originalSize.width,q=this.position.top+this.size.height,
|
| 91 |
-
l=/sw|nw|w/.test(a);a=/nw|ne|n/.test(a);if(i&&l)g.left=n-e.minWidth;if(d&&l)g.left=n-e.maxWidth;if(j&&a)g.top=q-e.minHeight;if(h&&a)g.top=q-e.maxHeight;if((e=!g.width&&!g.height)&&!g.left&&g.top)g.top=null;else if(e&&!g.top&&g.left)g.left=null;return g},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var g=this.helper||this.element,e=0;e<this._proportionallyResizeElements.length;e++){var a=this._proportionallyResizeElements[e];if(!this.borderDif){var d=[a.css("borderTopWidth"),
|
| 92 |
-
a.css("borderRightWidth"),a.css("borderBottomWidth"),a.css("borderLeftWidth")],h=[a.css("paddingTop"),a.css("paddingRight"),a.css("paddingBottom"),a.css("paddingLeft")];this.borderDif=b.map(d,function(i,j){i=parseInt(i,10)||0;j=parseInt(h[j],10)||0;return i+j})}b.browser.msie&&(b(g).is(":hidden")||b(g).parents(":hidden").length)||a.css({height:g.height()-this.borderDif[0]-this.borderDif[2]||0,width:g.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var g=this.options;this.elementOffset=
|
| 93 |
-
this.element.offset();if(this._helper){this.helper=this.helper||b('<div style="overflow:hidden;"></div>');var e=b.browser.msie&&b.browser.version<7,a=e?1:0;e=e?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+e,height:this.element.outerHeight()+e,position:"absolute",left:this.elementOffset.left-a+"px",top:this.elementOffset.top-a+"px",zIndex:++g.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(g,e){return{width:this.originalSize.width+
|
| 94 |
-
e}},w:function(g,e){return{left:this.originalPosition.left+e,width:this.originalSize.width-e}},n:function(g,e,a){return{top:this.originalPosition.top+a,height:this.originalSize.height-a}},s:function(g,e,a){return{height:this.originalSize.height+a}},se:function(g,e,a){return b.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,e,a]))},sw:function(g,e,a){return b.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,e,a]))},ne:function(g,e,a){return b.extend(this._change.n.apply(this,
|
| 95 |
-
arguments),this._change.e.apply(this,[g,e,a]))},nw:function(g,e,a){return b.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,e,a]))}},_propagate:function(g,e){b.ui.plugin.call(this,g,[e,this.ui()]);g!="resize"&&this._trigger(g,e,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});b.extend(b.ui.resizable,
|
| 96 |
-
{version:"1.8.8"});b.ui.plugin.add("resizable","alsoResize",{start:function(){var g=b(this).data("resizable").options,e=function(a){b(a).each(function(){var d=b(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof g.alsoResize=="object"&&!g.alsoResize.parentNode)if(g.alsoResize.length){g.alsoResize=g.alsoResize[0];e(g.alsoResize)}else b.each(g.alsoResize,
|
| 97 |
-
function(a){e(a)});else e(g.alsoResize)},resize:function(g,e){var a=b(this).data("resizable");g=a.options;var d=a.originalSize,h=a.originalPosition,i={height:a.size.height-d.height||0,width:a.size.width-d.width||0,top:a.position.top-h.top||0,left:a.position.left-h.left||0},j=function(n,q){b(n).each(function(){var l=b(this),k=b(this).data("resizable-alsoresize"),m={},o=q&&q.length?q:l.parents(e.originalElement[0]).length?["width","height"]:["width","height","top","left"];b.each(o,function(p,s){if((p=
|
| 98 |
-
(k[s]||0)+(i[s]||0))&&p>=0)m[s]=p||null});if(b.browser.opera&&/relative/.test(l.css("position"))){a._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(m)})};typeof g.alsoResize=="object"&&!g.alsoResize.nodeType?b.each(g.alsoResize,function(n,q){j(n,q)}):j(g.alsoResize)},stop:function(){var g=b(this).data("resizable"),e=g.options,a=function(d){b(d).each(function(){var h=b(this);h.css({position:h.data("resizable-alsoresize").position})})};if(g._revertToRelativePosition){g._revertToRelativePosition=
|
| 99 |
-
false;typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?b.each(e.alsoResize,function(d){a(d)}):a(e.alsoResize)}b(this).removeData("resizable-alsoresize")}});b.ui.plugin.add("resizable","animate",{stop:function(g){var e=b(this).data("resizable"),a=e.options,d=e._proportionallyResizeElements,h=d.length&&/textarea/i.test(d[0].nodeName),i=h&&b.ui.hasScroll(d[0],"left")?0:e.sizeDiff.height;h={width:e.size.width-(h?0:e.sizeDiff.width),height:e.size.height-i};i=parseInt(e.element.css("left"),10)+(e.position.left-
|
| 100 |
-
e.originalPosition.left)||null;var j=parseInt(e.element.css("top"),10)+(e.position.top-e.originalPosition.top)||null;e.element.animate(b.extend(h,j&&i?{top:j,left:i}:{}),{duration:a.animateDuration,easing:a.animateEasing,step:function(){var n={width:parseInt(e.element.css("width"),10),height:parseInt(e.element.css("height"),10),top:parseInt(e.element.css("top"),10),left:parseInt(e.element.css("left"),10)};d&&d.length&&b(d[0]).css({width:n.width,height:n.height});e._updateCache(n);e._propagate("resize",
|
| 101 |
-
g)}})}});b.ui.plugin.add("resizable","containment",{start:function(){var g=b(this).data("resizable"),e=g.element,a=g.options.containment;if(e=a instanceof b?a.get(0):/parent/.test(a)?e.parent().get(0):a){g.containerElement=b(e);if(/document/.test(a)||a==document){g.containerOffset={left:0,top:0};g.containerPosition={left:0,top:0};g.parentData={element:b(document),left:0,top:0,width:b(document).width(),height:b(document).height()||document.body.parentNode.scrollHeight}}else{var d=b(e),h=[];b(["Top",
|
| 102 |
-
"Right","Left","Bottom"]).each(function(n,q){h[n]=c(d.css("padding"+q))});g.containerOffset=d.offset();g.containerPosition=d.position();g.containerSize={height:d.innerHeight()-h[3],width:d.innerWidth()-h[1]};a=g.containerOffset;var i=g.containerSize.height,j=g.containerSize.width;j=b.ui.hasScroll(e,"left")?e.scrollWidth:j;i=b.ui.hasScroll(e)?e.scrollHeight:i;g.parentData={element:e,left:a.left,top:a.top,width:j,height:i}}}},resize:function(g){var e=b(this).data("resizable"),a=e.options,d=e.containerOffset,
|
| 103 |
-
h=e.position;g=e._aspectRatio||g.shiftKey;var i={top:0,left:0},j=e.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))i=d;if(h.left<(e._helper?d.left:0)){e.size.width+=e._helper?e.position.left-d.left:e.position.left-i.left;if(g)e.size.height=e.size.width/a.aspectRatio;e.position.left=a.helper?d.left:0}if(h.top<(e._helper?d.top:0)){e.size.height+=e._helper?e.position.top-d.top:e.position.top;if(g)e.size.width=e.size.height*a.aspectRatio;e.position.top=e._helper?d.top:0}e.offset.left=
|
| 104 |
-
e.parentData.left+e.position.left;e.offset.top=e.parentData.top+e.position.top;a=Math.abs((e._helper?e.offset.left-i.left:e.offset.left-i.left)+e.sizeDiff.width);d=Math.abs((e._helper?e.offset.top-i.top:e.offset.top-d.top)+e.sizeDiff.height);h=e.containerElement.get(0)==e.element.parent().get(0);i=/relative|absolute/.test(e.containerElement.css("position"));if(h&&i)a-=e.parentData.left;if(a+e.size.width>=e.parentData.width){e.size.width=e.parentData.width-a;if(g)e.size.height=e.size.width/e.aspectRatio}if(d+
|
| 105 |
-
e.size.height>=e.parentData.height){e.size.height=e.parentData.height-d;if(g)e.size.width=e.size.height*e.aspectRatio}},stop:function(){var g=b(this).data("resizable"),e=g.options,a=g.containerOffset,d=g.containerPosition,h=g.containerElement,i=b(g.helper),j=i.offset(),n=i.outerWidth()-g.sizeDiff.width;i=i.outerHeight()-g.sizeDiff.height;g._helper&&!e.animate&&/relative/.test(h.css("position"))&&b(this).css({left:j.left-d.left-a.left,width:n,height:i});g._helper&&!e.animate&&/static/.test(h.css("position"))&&
|
| 106 |
-
b(this).css({left:j.left-d.left-a.left,width:n,height:i})}});b.ui.plugin.add("resizable","ghost",{start:function(){var g=b(this).data("resizable"),e=g.options,a=g.size;g.ghost=g.originalElement.clone();g.ghost.css({opacity:0.25,display:"block",position:"relative",height:a.height,width:a.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:"");g.ghost.appendTo(g.helper)},resize:function(){var g=b(this).data("resizable");g.ghost&&g.ghost.css({position:"relative",
|
| 107 |
-
height:g.size.height,width:g.size.width})},stop:function(){var g=b(this).data("resizable");g.ghost&&g.helper&&g.helper.get(0).removeChild(g.ghost.get(0))}});b.ui.plugin.add("resizable","grid",{resize:function(){var g=b(this).data("resizable"),e=g.options,a=g.size,d=g.originalSize,h=g.originalPosition,i=g.axis;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var j=Math.round((a.width-d.width)/(e.grid[0]||1))*(e.grid[0]||1);e=Math.round((a.height-d.height)/(e.grid[1]||1))*(e.grid[1]||1);if(/^(se|s|e)$/.test(i)){g.size.width=
|
| 108 |
-
d.width+j;g.size.height=d.height+e}else if(/^(ne)$/.test(i)){g.size.width=d.width+j;g.size.height=d.height+e;g.position.top=h.top-e}else{if(/^(sw)$/.test(i)){g.size.width=d.width+j;g.size.height=d.height+e}else{g.size.width=d.width+j;g.size.height=d.height+e;g.position.top=h.top-e}g.position.left=h.left-j}}});var c=function(g){return parseInt(g,10)||0},f=function(g){return!isNaN(parseInt(g,10))}})(jQuery);
|
| 109 |
-
(function(b){b.widget("ui.selectable",b.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=b(c.options.filter,c.element[0]);f.each(function(){var g=b(this),e=g.offset();b.data(this,"selectable-item",{element:this,$element:g,left:e.left,top:e.top,right:e.left+g.outerWidth(),bottom:e.top+g.outerHeight(),startselected:false,selected:g.hasClass("ui-selected"),
|
| 110 |
-
selecting:g.hasClass("ui-selecting"),unselecting:g.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=b("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
|
| 111 |
-
c.pageY];if(!this.options.disabled){var g=this.options;this.selectees=b(g.filter,this.element[0]);this._trigger("start",c);b(g.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});g.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var e=b.data(this,"selectable-item");e.startselected=true;if(!c.metaKey){e.$element.removeClass("ui-selected");e.selected=false;e.$element.addClass("ui-unselecting");e.unselecting=true;f._trigger("unselecting",
|
| 112 |
-
c,{unselecting:e.element})}});b(c.target).parents().andSelf().each(function(){var e=b.data(this,"selectable-item");if(e){var a=!c.metaKey||!e.$element.hasClass("ui-selected");e.$element.removeClass(a?"ui-unselecting":"ui-selected").addClass(a?"ui-selecting":"ui-unselecting");e.unselecting=!a;e.selecting=a;(e.selected=a)?f._trigger("selecting",c,{selecting:e.element}):f._trigger("unselecting",c,{unselecting:e.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var g=
|
| 113 |
-
this.options,e=this.opos[0],a=this.opos[1],d=c.pageX,h=c.pageY;if(e>d){var i=d;d=e;e=i}if(a>h){i=h;h=a;a=i}this.helper.css({left:e,top:a,width:d-e,height:h-a});this.selectees.each(function(){var j=b.data(this,"selectable-item");if(!(!j||j.element==f.element[0])){var n=false;if(g.tolerance=="touch")n=!(j.left>d||j.right<e||j.top>h||j.bottom<a);else if(g.tolerance=="fit")n=j.left>e&&j.right<d&&j.top>a&&j.bottom<h;if(n){if(j.selected){j.$element.removeClass("ui-selected");j.selected=false}if(j.unselecting){j.$element.removeClass("ui-unselecting");
|
| 114 |
-
j.unselecting=false}if(!j.selecting){j.$element.addClass("ui-selecting");j.selecting=true;f._trigger("selecting",c,{selecting:j.element})}}else{if(j.selecting)if(c.metaKey&&j.startselected){j.$element.removeClass("ui-selecting");j.selecting=false;j.$element.addClass("ui-selected");j.selected=true}else{j.$element.removeClass("ui-selecting");j.selecting=false;if(j.startselected){j.$element.addClass("ui-unselecting");j.unselecting=true}f._trigger("unselecting",c,{unselecting:j.element})}if(j.selected)if(!c.metaKey&&
|
| 115 |
-
!j.startselected){j.$element.removeClass("ui-selected");j.selected=false;j.$element.addClass("ui-unselecting");j.unselecting=true;f._trigger("unselecting",c,{unselecting:j.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;b(".ui-unselecting",this.element[0]).each(function(){var g=b.data(this,"selectable-item");g.$element.removeClass("ui-unselecting");g.unselecting=false;g.startselected=false;f._trigger("unselected",c,{unselected:g.element})});b(".ui-selecting",this.element[0]).each(function(){var g=
|
| 116 |
-
b.data(this,"selectable-item");g.$element.removeClass("ui-selecting").addClass("ui-selected");g.selecting=false;g.selected=true;g.startselected=true;f._trigger("selected",c,{selected:g.element})});this._trigger("stop",c);this.helper.remove();return false}});b.extend(b.ui.selectable,{version:"1.8.8"})})(jQuery);
|
| 117 |
-
(function(b){b.widget("ui.sortable",b.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
|
| 118 |
-
this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var c=this.items.length-1;c>=0;c--)this.items[c].item.removeData("sortable-item");return this},_setOption:function(c,f){if(c==="disabled"){this.options[c]=f;this.widget()[f?"addClass":"removeClass"]("ui-sortable-disabled")}else b.Widget.prototype._setOption.apply(this,
|
| 119 |
-
arguments)},_mouseCapture:function(c,f){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(c);var g=null,e=this;b(c.target).parents().each(function(){if(b.data(this,"sortable-item")==e){g=b(this);return false}});if(b.data(c.target,"sortable-item")==e)g=b(c.target);if(!g)return false;if(this.options.handle&&!f){var a=false;b(this.options.handle,g).find("*").andSelf().each(function(){if(this==c.target)a=true});if(!a)return false}this.currentItem=
|
| 120 |
-
g;this._removeCurrentsFromItems();return true},_mouseStart:function(c,f,g){f=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(c);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");b.extend(this.offset,
|
| 121 |
-
{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;f.cursorAt&&this._adjustOffsetFromHelper(f.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();f.containment&&this._setContainment();
|
| 122 |
-
if(f.cursor){if(b("body").css("cursor"))this._storedCursor=b("body").css("cursor");b("body").css("cursor",f.cursor)}if(f.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",f.opacity)}if(f.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",f.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",
|
| 123 |
-
c,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!g)for(g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",c,e._uiHash(this));if(b.ui.ddmanager)b.ui.ddmanager.current=this;b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(c);return true},_mouseDrag:function(c){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute");
|
| 124 |
-
if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var f=this.options,g=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-c.pageY<f.scrollSensitivity)this.scrollParent[0].scrollTop=g=this.scrollParent[0].scrollTop+f.scrollSpeed;else if(c.pageY-this.overflowOffset.top<f.scrollSensitivity)this.scrollParent[0].scrollTop=g=this.scrollParent[0].scrollTop-f.scrollSpeed;if(this.overflowOffset.left+
|
| 125 |
-
this.scrollParent[0].offsetWidth-c.pageX<f.scrollSensitivity)this.scrollParent[0].scrollLeft=g=this.scrollParent[0].scrollLeft+f.scrollSpeed;else if(c.pageX-this.overflowOffset.left<f.scrollSensitivity)this.scrollParent[0].scrollLeft=g=this.scrollParent[0].scrollLeft-f.scrollSpeed}else{if(c.pageY-b(document).scrollTop()<f.scrollSensitivity)g=b(document).scrollTop(b(document).scrollTop()-f.scrollSpeed);else if(b(window).height()-(c.pageY-b(document).scrollTop())<f.scrollSensitivity)g=b(document).scrollTop(b(document).scrollTop()+
|
| 126 |
-
f.scrollSpeed);if(c.pageX-b(document).scrollLeft()<f.scrollSensitivity)g=b(document).scrollLeft(b(document).scrollLeft()-f.scrollSpeed);else if(b(window).width()-(c.pageX-b(document).scrollLeft())<f.scrollSensitivity)g=b(document).scrollLeft(b(document).scrollLeft()+f.scrollSpeed)}g!==false&&b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+
|
| 127 |
-
"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(f=this.items.length-1;f>=0;f--){g=this.items[f];var e=g.item[0],a=this._intersectsWithPointer(g);if(a)if(e!=this.currentItem[0]&&this.placeholder[a==1?"next":"prev"]()[0]!=e&&!b.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!b.ui.contains(this.element[0],e):true)){this.direction=a==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(g))this._rearrange(c,
|
| 128 |
-
g);else break;this._trigger("change",c,this._uiHash());break}}this._contactContainers(c);b.ui.ddmanager&&b.ui.ddmanager.drag(this,c);this._trigger("sort",c,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,f){if(c){b.ui.ddmanager&&!this.options.dropBehaviour&&b.ui.ddmanager.drop(this,c);if(this.options.revert){var g=this;f=g.placeholder.offset();g.reverting=true;b(this.helper).animate({left:f.left-this.offset.parent.left-g.margins.left+(this.offsetParent[0]==
|
| 129 |
-
document.body?0:this.offsetParent[0].scrollLeft),top:f.top-this.offset.parent.top-g.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){g._clear(c)})}else this._clear(c,f);return false}},cancel:function(){var c=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var f=this.containers.length-1;f>=0;f--){this.containers[f]._trigger("deactivate",
|
| 130 |
-
null,c._uiHash(this));if(this.containers[f].containerCache.over){this.containers[f]._trigger("out",null,c._uiHash(this));this.containers[f].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();b.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?b(this.domPosition.prev).after(this.currentItem):
|
| 131 |
-
b(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(c){var f=this._getItemsAsjQuery(c&&c.connected),g=[];c=c||{};b(f).each(function(){var e=(b(c.item||this).attr(c.attribute||"id")||"").match(c.expression||/(.+)[-=_](.+)/);if(e)g.push((c.key||e[1]+"[]")+"="+(c.key&&c.expression?e[1]:e[2]))});!g.length&&c.key&&g.push(c.key+"=");return g.join("&")},toArray:function(c){var f=this._getItemsAsjQuery(c&&c.connected),g=[];c=c||{};f.each(function(){g.push(b(c.item||this).attr(c.attribute||
|
| 132 |
-
"id")||"")});return g},_intersectsWith:function(c){var f=this.positionAbs.left,g=f+this.helperProportions.width,e=this.positionAbs.top,a=e+this.helperProportions.height,d=c.left,h=d+c.width,i=c.top,j=i+c.height,n=this.offset.click.top,q=this.offset.click.left;n=e+n>i&&e+n<j&&f+q>d&&f+q<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>c[this.floating?"width":"height"]?n:d<f+
|
| 133 |
-
this.helperProportions.width/2&&g-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&a-this.helperProportions.height/2<j},_intersectsWithPointer:function(c){var f=b.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,c.top,c.height);c=b.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,c.left,c.width);f=f&&c;c=this._getDragVerticalDirection();var g=this._getDragHorizontalDirection();if(!f)return false;return this.floating?g&&g=="right"||c=="down"?2:1:c&&(c=="down"?
|
| 134 |
-
2:1)},_intersectsWithSides:function(c){var f=b.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,c.top+c.height/2,c.height);c=b.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,c.left+c.width/2,c.width);var g=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&c||e=="left"&&!c:g&&(g=="down"&&f||g=="up"&&!f)},_getDragVerticalDirection:function(){var c=this.positionAbs.top-this.lastPositionAbs.top;return c!=0&&(c>0?"down":"up")},
|
| 135 |
-
_getDragHorizontalDirection:function(){var c=this.positionAbs.left-this.lastPositionAbs.left;return c!=0&&(c>0?"right":"left")},refresh:function(c){this._refreshItems(c);this.refreshPositions();return this},_connectWith:function(){var c=this.options;return c.connectWith.constructor==String?[c.connectWith]:c.connectWith},_getItemsAsjQuery:function(c){var f=[],g=[],e=this._connectWith();if(e&&c)for(c=e.length-1;c>=0;c--)for(var a=b(e[c]),d=a.length-1;d>=0;d--){var h=b.data(a[d],"sortable");if(h&&h!=
|
| 136 |
-
this&&!h.options.disabled)g.push([b.isFunction(h.options.items)?h.options.items.call(h.element):b(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}g.push([b.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):b(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(c=g.length-1;c>=0;c--)g[c][0].each(function(){f.push(this)});return b(f)},_removeCurrentsFromItems:function(){for(var c=
|
| 137 |
-
this.currentItem.find(":data(sortable-item)"),f=0;f<this.items.length;f++)for(var g=0;g<c.length;g++)c[g]==this.items[f].item[0]&&this.items.splice(f,1)},_refreshItems:function(c){this.items=[];this.containers=[this];var f=this.items,g=[[b.isFunction(this.options.items)?this.options.items.call(this.element[0],c,{item:this.currentItem}):b(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var a=e.length-1;a>=0;a--)for(var d=b(e[a]),h=d.length-1;h>=0;h--){var i=b.data(d[h],"sortable");
|
| 138 |
-
if(i&&i!=this&&!i.options.disabled){g.push([b.isFunction(i.options.items)?i.options.items.call(i.element[0],c,{item:this.currentItem}):b(i.options.items,i.element),i]);this.containers.push(i)}}for(a=g.length-1;a>=0;a--){c=g[a][1];e=g[a][0];h=0;for(d=e.length;h<d;h++){i=b(e[h]);i.data("sortable-item",c);f.push({item:i,instance:c,width:0,height:0,left:0,top:0})}}},refreshPositions:function(c){if(this.offsetParent&&this.helper)this.offset.parent=this._getParentOffset();for(var f=this.items.length-1;f>=
|
| 139 |
-
0;f--){var g=this.items[f],e=this.options.toleranceElement?b(this.options.toleranceElement,g.item):g.item;if(!c){g.width=e.outerWidth();g.height=e.outerHeight()}e=e.offset();g.left=e.left;g.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(f=this.containers.length-1;f>=0;f--){e=this.containers[f].element.offset();this.containers[f].containerCache.left=e.left;this.containers[f].containerCache.top=e.top;this.containers[f].containerCache.width=
|
| 140 |
-
this.containers[f].element.outerWidth();this.containers[f].containerCache.height=this.containers[f].element.outerHeight()}return this},_createPlaceholder:function(c){var f=c||this,g=f.options;if(!g.placeholder||g.placeholder.constructor==String){var e=g.placeholder;g.placeholder={element:function(){var a=b(document.createElement(f.currentItem[0].nodeName)).addClass(e||f.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)a.style.visibility="hidden";return a},
|
| 141 |
-
update:function(a,d){if(!(e&&!g.forcePlaceholderSize)){d.height()||d.height(f.currentItem.innerHeight()-parseInt(f.currentItem.css("paddingTop")||0,10)-parseInt(f.currentItem.css("paddingBottom")||0,10));d.width()||d.width(f.currentItem.innerWidth()-parseInt(f.currentItem.css("paddingLeft")||0,10)-parseInt(f.currentItem.css("paddingRight")||0,10))}}}}f.placeholder=b(g.placeholder.element.call(f.element,f.currentItem));f.currentItem.after(f.placeholder);g.placeholder.update(f,f.placeholder)},_contactContainers:function(c){for(var f=
|
| 142 |
-
null,g=null,e=this.containers.length-1;e>=0;e--)if(!b.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(f&&b.ui.contains(this.containers[e].element[0],f.element[0]))){f=this.containers[e];g=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",c,this._uiHash(this));this.containers[e].containerCache.over=0}if(f)if(this.containers.length===1){this.containers[g]._trigger("over",c,this._uiHash(this));
|
| 143 |
-
this.containers[g].containerCache.over=1}else if(this.currentContainer!=this.containers[g]){f=1E4;e=null;for(var a=this.positionAbs[this.containers[g].floating?"left":"top"],d=this.items.length-1;d>=0;d--)if(b.ui.contains(this.containers[g].element[0],this.items[d].item[0])){var h=this.items[d][this.containers[g].floating?"left":"top"];if(Math.abs(h-a)<f){f=Math.abs(h-a);e=this.items[d]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[g];e?this._rearrange(c,e,null,true):this._rearrange(c,
|
| 144 |
-
null,this.containers[g].element,true);this._trigger("change",c,this._uiHash());this.containers[g]._trigger("change",c,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[g]._trigger("over",c,this._uiHash(this));this.containers[g].containerCache.over=1}}},_createHelper:function(c){var f=this.options;c=b.isFunction(f.helper)?b(f.helper.apply(this.element[0],[c,this.currentItem])):f.helper=="clone"?this.currentItem.clone():this.currentItem;c.parents("body").length||
|
| 145 |
-
b(f.appendTo!="parent"?f.appendTo:this.currentItem[0].parentNode)[0].appendChild(c[0]);if(c[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(c[0].style.width==""||f.forceHelperSize)c.width(this.currentItem.width());if(c[0].style.height==""||f.forceHelperSize)c.height(this.currentItem.height());return c},_adjustOffsetFromHelper:function(c){if(typeof c==
|
| 146 |
-
"string")c=c.split(" ");if(b.isArray(c))c={left:+c[0],top:+c[1]||0};if("left"in c)this.offset.click.left=c.left+this.margins.left;if("right"in c)this.offset.click.left=this.helperProportions.width-c.right+this.margins.left;if("top"in c)this.offset.click.top=c.top+this.margins.top;if("bottom"in c)this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition==
|
| 147 |
-
"absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)c={top:0,left:0};return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition==
|
| 148 |
-
"relative"){var c=this.currentItem.position();return{top:c.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},
|
| 149 |
-
_setContainment:function(){var c=this.options;if(c.containment=="parent")c.containment=this.helper[0].parentNode;if(c.containment=="document"||c.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,b(c.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b(c.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-
|
| 150 |
-
this.margins.top];if(!/^(document|window|parent)$/.test(c.containment)){var f=b(c.containment)[0];c=b(c.containment).offset();var g=b(f).css("overflow")!="hidden";this.containment=[c.left+(parseInt(b(f).css("borderLeftWidth"),10)||0)+(parseInt(b(f).css("paddingLeft"),10)||0)-this.margins.left,c.top+(parseInt(b(f).css("borderTopWidth"),10)||0)+(parseInt(b(f).css("paddingTop"),10)||0)-this.margins.top,c.left+(g?Math.max(f.scrollWidth,f.offsetWidth):f.offsetWidth)-(parseInt(b(f).css("borderLeftWidth"),
|
| 151 |
-
10)||0)-(parseInt(b(f).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,c.top+(g?Math.max(f.scrollHeight,f.offsetHeight):f.offsetHeight)-(parseInt(b(f).css("borderTopWidth"),10)||0)-(parseInt(b(f).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(c,f){if(!f)f=this.position;c=c=="absolute"?1:-1;var g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?
|
| 152 |
-
this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);return{top:f.top+this.offset.relative.top*c+this.offset.parent.top*c-(b.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:g.scrollTop())*c),left:f.left+this.offset.relative.left*c+this.offset.parent.left*c-(b.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())*c)}},_generatePosition:function(c){var f=
|
| 153 |
-
this.options,g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var a=c.pageX,d=c.pageY;if(this.originalPosition){if(this.containment){if(c.pageX-this.offset.click.left<this.containment[0])a=this.containment[0]+
|
| 154 |
-
this.offset.click.left;if(c.pageY-this.offset.click.top<this.containment[1])d=this.containment[1]+this.offset.click.top;if(c.pageX-this.offset.click.left>this.containment[2])a=this.containment[2]+this.offset.click.left;if(c.pageY-this.offset.click.top>this.containment[3])d=this.containment[3]+this.offset.click.top}if(f.grid){d=this.originalPageY+Math.round((d-this.originalPageY)/f.grid[1])*f.grid[1];d=this.containment?!(d-this.offset.click.top<this.containment[1]||d-this.offset.click.top>this.containment[3])?
|
| 155 |
-
d:!(d-this.offset.click.top<this.containment[1])?d-f.grid[1]:d+f.grid[1]:d;a=this.originalPageX+Math.round((a-this.originalPageX)/f.grid[0])*f.grid[0];a=this.containment?!(a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2])?a:!(a-this.offset.click.left<this.containment[0])?a-f.grid[0]:a+f.grid[0]:a}}return{top:d-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(b.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():
|
| 156 |
-
e?0:g.scrollTop()),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(b.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())}},_rearrange:function(c,f,g,e){g?g[0].appendChild(this.placeholder[0]):f.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?f.item[0]:f.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var a=this,d=this.counter;window.setTimeout(function(){d==
|
| 157 |
-
a.counter&&a.refreshPositions(!e)},0)},_clear:function(c,f){this.reverting=false;var g=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!f&&g.push(function(a){this._trigger("receive",
|
| 158 |
-
a,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!f)g.push(function(a){this._trigger("update",a,this._uiHash())});if(!b.ui.contains(this.element[0],this.currentItem[0])){f||g.push(function(a){this._trigger("remove",a,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(b.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!f){g.push(function(a){return function(d){a._trigger("receive",
|
| 159 |
-
d,this._uiHash(this))}}.call(this,this.containers[e]));g.push(function(a){return function(d){a._trigger("update",d,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){f||g.push(function(a){return function(d){a._trigger("deactivate",d,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){g.push(function(a){return function(d){a._trigger("out",d,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=
|
| 160 |
-
0}}this._storedCursor&&b("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!f){this._trigger("beforeStop",c,this._uiHash());for(e=0;e<g.length;e++)g[e].call(this,c);this._trigger("stop",c,this._uiHash())}return false}f||this._trigger("beforeStop",c,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
|
| 161 |
-
this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!f){for(e=0;e<g.length;e++)g[e].call(this,c);this._trigger("stop",c,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){b.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(c){var f=c||this;return{helper:f.helper,placeholder:f.placeholder||b([]),position:f.position,originalPosition:f.originalPosition,offset:f.positionAbs,item:f.currentItem,sender:c?c.element:null}}});
|
| 162 |
-
b.extend(b.ui.sortable,{version:"1.8.8"})})(jQuery);
|
| 163 |
-
jQuery.effects||function(b,c){function f(l){var k;if(l&&l.constructor==Array&&l.length==3)return l;if(k=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(l))return[parseInt(k[1],10),parseInt(k[2],10),parseInt(k[3],10)];if(k=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(l))return[parseFloat(k[1])*2.55,parseFloat(k[2])*2.55,parseFloat(k[3])*2.55];if(k=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(l))return[parseInt(k[1],16),
|
| 164 |
-
parseInt(k[2],16),parseInt(k[3],16)];if(k=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(l))return[parseInt(k[1]+k[1],16),parseInt(k[2]+k[2],16),parseInt(k[3]+k[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(l))return j.transparent;return j[b.trim(l).toLowerCase()]}function g(l,k){var m;do{m=b.curCSS(l,k);if(m!=""&&m!="transparent"||b.nodeName(l,"body"))break;k="backgroundColor"}while(l=l.parentNode);return f(m)}function e(){var l=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
|
| 165 |
-
k={},m,o;if(l&&l.length&&l[0]&&l[l[0]])for(var p=l.length;p--;){m=l[p];if(typeof l[m]=="string"){o=m.replace(/\-(\w)/g,function(s,r){return r.toUpperCase()});k[o]=l[m]}}else for(m in l)if(typeof l[m]==="string")k[m]=l[m];return k}function a(l){var k,m;for(k in l){m=l[k];if(m==null||b.isFunction(m)||k in q||/scrollbar/.test(k)||!/color/i.test(k)&&isNaN(parseFloat(m)))delete l[k]}return l}function d(l,k){var m={_:0},o;for(o in k)if(l[o]!=k[o])m[o]=k[o];return m}function h(l,k,m,o){if(typeof l=="object"){o=
|
| 166 |
-
k;m=null;k=l;l=k.effect}if(b.isFunction(k)){o=k;m=null;k={}}if(typeof k=="number"||b.fx.speeds[k]){o=m;m=k;k={}}if(b.isFunction(m)){o=m;m=null}k=k||{};m=m||k.duration;m=b.fx.off?0:typeof m=="number"?m:m in b.fx.speeds?b.fx.speeds[m]:b.fx.speeds._default;o=o||k.complete;return[l,k,m,o]}function i(l){if(!l||typeof l==="number"||b.fx.speeds[l])return true;if(typeof l==="string"&&!b.effects[l])return true;return false}b.effects={};b.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
|
| 167 |
-
"borderTopColor","borderColor","color","outlineColor"],function(l,k){b.fx.step[k]=function(m){if(!m.colorInit){m.start=g(m.elem,k);m.end=f(m.end);m.colorInit=true}m.elem.style[k]="rgb("+Math.max(Math.min(parseInt(m.pos*(m.end[0]-m.start[0])+m.start[0],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[1]-m.start[1])+m.start[1],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[2]-m.start[2])+m.start[2],10),255),0)+")"}});var j={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
|
| 168 |
-
0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
|
| 169 |
-
211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},n=["add","remove","toggle"],q={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};b.effects.animateClass=function(l,k,m,
|
| 170 |
-
o){if(b.isFunction(m)){o=m;m=null}return this.queue("fx",function(){var p=b(this),s=p.attr("style")||" ",r=a(e.call(this)),u,v=p.attr("className");b.each(n,function(w,y){l[y]&&p[y+"Class"](l[y])});u=a(e.call(this));p.attr("className",v);p.animate(d(r,u),k,m,function(){b.each(n,function(w,y){l[y]&&p[y+"Class"](l[y])});if(typeof p.attr("style")=="object"){p.attr("style").cssText="";p.attr("style").cssText=s}else p.attr("style",s);o&&o.apply(this,arguments)});r=b.queue(this);u=r.splice(r.length-1,1)[0];
|
| 171 |
-
r.splice(1,0,u);b.dequeue(this)})};b.fn.extend({_addClass:b.fn.addClass,addClass:function(l,k,m,o){return k?b.effects.animateClass.apply(this,[{add:l},k,m,o]):this._addClass(l)},_removeClass:b.fn.removeClass,removeClass:function(l,k,m,o){return k?b.effects.animateClass.apply(this,[{remove:l},k,m,o]):this._removeClass(l)},_toggleClass:b.fn.toggleClass,toggleClass:function(l,k,m,o,p){return typeof k=="boolean"||k===c?m?b.effects.animateClass.apply(this,[k?{add:l}:{remove:l},m,o,p]):this._toggleClass(l,
|
| 172 |
-
k):b.effects.animateClass.apply(this,[{toggle:l},k,m,o])},switchClass:function(l,k,m,o,p){return b.effects.animateClass.apply(this,[{add:k,remove:l},m,o,p])}});b.extend(b.effects,{version:"1.8.8",save:function(l,k){for(var m=0;m<k.length;m++)k[m]!==null&&l.data("ec.storage."+k[m],l[0].style[k[m]])},restore:function(l,k){for(var m=0;m<k.length;m++)k[m]!==null&&l.css(k[m],l.data("ec.storage."+k[m]))},setMode:function(l,k){if(k=="toggle")k=l.is(":hidden")?"show":"hide";return k},getBaseline:function(l,
|
| 173 |
-
k){var m;switch(l[0]){case "top":m=0;break;case "middle":m=0.5;break;case "bottom":m=1;break;default:m=l[0]/k.height}switch(l[1]){case "left":l=0;break;case "center":l=0.5;break;case "right":l=1;break;default:l=l[1]/k.width}return{x:l,y:m}},createWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent();var k={width:l.outerWidth(true),height:l.outerHeight(true),"float":l.css("float")},m=b("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",
|
| 174 |
-
border:"none",margin:0,padding:0});l.wrap(m);m=l.parent();if(l.css("position")=="static"){m.css({position:"relative"});l.css({position:"relative"})}else{b.extend(k,{position:l.css("position"),zIndex:l.css("z-index")});b.each(["top","left","bottom","right"],function(o,p){k[p]=l.css(p);if(isNaN(parseInt(k[p],10)))k[p]="auto"});l.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return m.css(k).show()},removeWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent().replaceWith(l);
|
| 175 |
-
return l},setTransition:function(l,k,m,o){o=o||{};b.each(k,function(p,s){unit=l.cssUnit(s);if(unit[0]>0)o[s]=unit[0]*m+unit[1]});return o}});b.fn.extend({effect:function(l){var k=h.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var o=b.effects[l];if(b.fx.off||!o)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)});return o.call(this,m)},_show:b.fn.show,show:function(l){if(i(l))return this._show.apply(this,arguments);
|
| 176 |
-
else{var k=h.apply(this,arguments);k[1].mode="show";return this.effect.apply(this,k)}},_hide:b.fn.hide,hide:function(l){if(i(l))return this._hide.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:b.fn.toggle,toggle:function(l){if(i(l)||typeof l==="boolean"||b.isFunction(l))return this.__toggle.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(l){var k=this.css(l),
|
| 177 |
-
m=[];b.each(["em","px","%","pt"],function(o,p){if(k.indexOf(p)>0)m=[parseFloat(k),p]});return m}});b.easing.jswing=b.easing.swing;b.extend(b.easing,{def:"easeOutQuad",swing:function(l,k,m,o,p){return b.easing[b.easing.def](l,k,m,o,p)},easeInQuad:function(l,k,m,o,p){return o*(k/=p)*k+m},easeOutQuad:function(l,k,m,o,p){return-o*(k/=p)*(k-2)+m},easeInOutQuad:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k+m;return-o/2*(--k*(k-2)-1)+m},easeInCubic:function(l,k,m,o,p){return o*(k/=p)*k*k+m},easeOutCubic:function(l,
|
| 178 |
-
k,m,o,p){return o*((k=k/p-1)*k*k+1)+m},easeInOutCubic:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k+m;return o/2*((k-=2)*k*k+2)+m},easeInQuart:function(l,k,m,o,p){return o*(k/=p)*k*k*k+m},easeOutQuart:function(l,k,m,o,p){return-o*((k=k/p-1)*k*k*k-1)+m},easeInOutQuart:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k*k+m;return-o/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(l,k,m,o,p){return o*(k/=p)*k*k*k*k+m},easeOutQuint:function(l,k,m,o,p){return o*((k=k/p-1)*k*k*k*k+1)+m},easeInOutQuint:function(l,
|
| 179 |
-
k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k*k*k+m;return o/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(l,k,m,o,p){return-o*Math.cos(k/p*(Math.PI/2))+o+m},easeOutSine:function(l,k,m,o,p){return o*Math.sin(k/p*(Math.PI/2))+m},easeInOutSine:function(l,k,m,o,p){return-o/2*(Math.cos(Math.PI*k/p)-1)+m},easeInExpo:function(l,k,m,o,p){return k==0?m:o*Math.pow(2,10*(k/p-1))+m},easeOutExpo:function(l,k,m,o,p){return k==p?m+o:o*(-Math.pow(2,-10*k/p)+1)+m},easeInOutExpo:function(l,k,m,o,p){if(k==0)return m;if(k==
|
| 180 |
-
p)return m+o;if((k/=p/2)<1)return o/2*Math.pow(2,10*(k-1))+m;return o/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(l,k,m,o,p){return-o*(Math.sqrt(1-(k/=p)*k)-1)+m},easeOutCirc:function(l,k,m,o,p){return o*Math.sqrt(1-(k=k/p-1)*k)+m},easeInOutCirc:function(l,k,m,o,p){if((k/=p/2)<1)return-o/2*(Math.sqrt(1-k*k)-1)+m;return o/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p)==1)return m+o;s||(s=p*0.3);if(r<Math.abs(o)){r=o;l=s/4}else l=
|
| 181 |
-
s/(2*Math.PI)*Math.asin(o/r);return-(r*Math.pow(2,10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s))+m},easeOutElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p)==1)return m+o;s||(s=p*0.3);if(r<Math.abs(o)){r=o;l=s/4}else l=s/(2*Math.PI)*Math.asin(o/r);return r*Math.pow(2,-10*k)*Math.sin((k*p-l)*2*Math.PI/s)+o+m},easeInOutElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p/2)==2)return m+o;s||(s=p*0.3*1.5);if(r<Math.abs(o)){r=o;l=s/4}else l=s/(2*Math.PI)*Math.asin(o/
|
| 182 |
-
r);if(k<1)return-0.5*r*Math.pow(2,10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s)+m;return r*Math.pow(2,-10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s)*0.5+o+m},easeInBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;return o*(k/=p)*k*((s+1)*k-s)+m},easeOutBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;return o*((k=k/p-1)*k*((s+1)*k+s)+1)+m},easeInOutBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;if((k/=p/2)<1)return o/2*k*k*(((s*=1.525)+1)*k-s)+m;return o/2*((k-=2)*k*(((s*=1.525)+1)*k+s)+2)+m},easeInBounce:function(l,
|
| 183 |
-
k,m,o,p){return o-b.easing.easeOutBounce(l,p-k,0,o,p)+m},easeOutBounce:function(l,k,m,o,p){return(k/=p)<1/2.75?o*7.5625*k*k+m:k<2/2.75?o*(7.5625*(k-=1.5/2.75)*k+0.75)+m:k<2.5/2.75?o*(7.5625*(k-=2.25/2.75)*k+0.9375)+m:o*(7.5625*(k-=2.625/2.75)*k+0.984375)+m},easeInOutBounce:function(l,k,m,o,p){if(k<p/2)return b.easing.easeInBounce(l,k*2,0,o,p)*0.5+m;return b.easing.easeOutBounce(l,k*2-p,0,o,p)*0.5+o*0.5+m}})}(jQuery);
|
| 184 |
-
(function(b){b.effects.blind=function(c){return this.queue(function(){var f=b(this),g=["position","top","bottom","left","right"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"vertical";b.effects.save(f,g);f.show();var d=b.effects.createWrapper(f).css({overflow:"hidden"}),h=a=="vertical"?"height":"width";a=a=="vertical"?d.height():d.width();e=="show"&&d.css(h,0);var i={};i[h]=e=="show"?a:0;d.animate(i,c.duration,c.options.easing,function(){e=="hide"&&f.hide();b.effects.restore(f,
|
| 185 |
-
g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()})})}})(jQuery);
|
| 186 |
-
(function(b){b.effects.bounce=function(c){return this.queue(function(){var f=b(this),g=["position","top","bottom","left","right"],e=b.effects.setMode(f,c.options.mode||"effect"),a=c.options.direction||"up",d=c.options.distance||20,h=c.options.times||5,i=c.duration||250;/show|hide/.test(e)&&g.push("opacity");b.effects.save(f,g);f.show();b.effects.createWrapper(f);var j=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";d=c.options.distance||(j=="top"?f.outerHeight({margin:true})/3:f.outerWidth({margin:true})/
|
| 187 |
-
3);if(e=="show")f.css("opacity",0).css(j,a=="pos"?-d:d);if(e=="hide")d/=h*2;e!="hide"&&h--;if(e=="show"){var n={opacity:1};n[j]=(a=="pos"?"+=":"-=")+d;f.animate(n,i/2,c.options.easing);d/=2;h--}for(n=0;n<h;n++){var q={},l={};q[j]=(a=="pos"?"-=":"+=")+d;l[j]=(a=="pos"?"+=":"-=")+d;f.animate(q,i/2,c.options.easing).animate(l,i/2,c.options.easing);d=e=="hide"?d*2:d/2}if(e=="hide"){n={opacity:0};n[j]=(a=="pos"?"-=":"+=")+d;f.animate(n,i/2,c.options.easing,function(){f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);
|
| 188 |
-
c.callback&&c.callback.apply(this,arguments)})}else{q={};l={};q[j]=(a=="pos"?"-=":"+=")+d;l[j]=(a=="pos"?"+=":"-=")+d;f.animate(q,i/2,c.options.easing).animate(l,i/2,c.options.easing,function(){b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments)})}f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery);
|
| 189 |
-
(function(b){b.effects.clip=function(c){return this.queue(function(){var f=b(this),g=["position","top","bottom","left","right","height","width"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"vertical";b.effects.save(f,g);f.show();var d=b.effects.createWrapper(f).css({overflow:"hidden"});d=f[0].tagName=="IMG"?d:f;var h={size:a=="vertical"?"height":"width",position:a=="vertical"?"top":"left"};a=a=="vertical"?d.height():d.width();if(e=="show"){d.css(h.size,0);d.css(h.position,
|
| 190 |
-
a/2)}var i={};i[h.size]=e=="show"?a:0;i[h.position]=e=="show"?0:a/2;d.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()}})})}})(jQuery);
|
| 191 |
-
(function(b){b.effects.drop=function(c){return this.queue(function(){var f=b(this),g=["position","top","bottom","left","right","opacity"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"left";b.effects.save(f,g);f.show();b.effects.createWrapper(f);var d=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";var h=c.options.distance||(d=="top"?f.outerHeight({margin:true})/2:f.outerWidth({margin:true})/2);if(e=="show")f.css("opacity",0).css(d,a=="pos"?-h:h);var i={opacity:e==
|
| 192 |
-
"show"?1:0};i[d]=(e=="show"?a=="pos"?"+=":"-=":a=="pos"?"-=":"+=")+h;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery);
|
| 193 |
-
(function(b){b.effects.explode=function(c){return this.queue(function(){var f=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3,g=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3;c.options.mode=c.options.mode=="toggle"?b(this).is(":visible")?"hide":"show":c.options.mode;var e=b(this).show().css("visibility","hidden"),a=e.offset();a.top-=parseInt(e.css("marginTop"),10)||0;a.left-=parseInt(e.css("marginLeft"),10)||0;for(var d=e.outerWidth(true),h=e.outerHeight(true),i=0;i<f;i++)for(var j=
|
| 194 |
-
0;j<g;j++)e.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-j*(d/g),top:-i*(h/f)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:d/g,height:h/f,left:a.left+j*(d/g)+(c.options.mode=="show"?(j-Math.floor(g/2))*(d/g):0),top:a.top+i*(h/f)+(c.options.mode=="show"?(i-Math.floor(f/2))*(h/f):0),opacity:c.options.mode=="show"?0:1}).animate({left:a.left+j*(d/g)+(c.options.mode=="show"?0:(j-Math.floor(g/2))*(d/g)),top:a.top+
|
| 195 |
-
i*(h/f)+(c.options.mode=="show"?0:(i-Math.floor(f/2))*(h/f)),opacity:c.options.mode=="show"?1:0},c.duration||500);setTimeout(function(){c.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide();c.callback&&c.callback.apply(e[0]);e.dequeue();b("div.ui-effects-explode").remove()},c.duration||500)})}})(jQuery);
|
| 196 |
-
(function(b){b.effects.fade=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"hide");f.animate({opacity:g},{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery);
|
| 197 |
-
(function(b){b.effects.fold=function(c){return this.queue(function(){var f=b(this),g=["position","top","bottom","left","right"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.size||15,d=!!c.options.horizFirst,h=c.duration?c.duration/2:b.fx.speeds._default/2;b.effects.save(f,g);f.show();var i=b.effects.createWrapper(f).css({overflow:"hidden"}),j=e=="show"!=d,n=j?["width","height"]:["height","width"];j=j?[i.width(),i.height()]:[i.height(),i.width()];var q=/([0-9]+)%/.exec(a);if(q)a=parseInt(q[1],
|
| 198 |
-
10)/100*j[e=="hide"?0:1];if(e=="show")i.css(d?{height:0,width:a}:{height:a,width:0});d={};q={};d[n[0]]=e=="show"?j[0]:a;q[n[1]]=e=="show"?j[1]:0;i.animate(d,h,c.options.easing).animate(q,h,c.options.easing,function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()})})}})(jQuery);
|
| 199 |
-
(function(b){b.effects.highlight=function(c){return this.queue(function(){var f=b(this),g=["backgroundImage","backgroundColor","opacity"],e=b.effects.setMode(f,c.options.mode||"show"),a={backgroundColor:f.css("backgroundColor")};if(e=="hide")a.opacity=0;b.effects.save(f,g);f.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(a,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);e=="show"&&!b.support.opacity&&
|
| 200 |
-
this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery);
|
| 201 |
-
(function(b){b.effects.pulsate=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"show");times=(c.options.times||5)*2-1;duration=c.duration?c.duration/2:b.fx.speeds._default/2;isVisible=f.is(":visible");animateTo=0;if(!isVisible){f.css("opacity",0).show();animateTo=1}if(g=="hide"&&isVisible||g=="show"&&!isVisible)times--;for(g=0;g<times;g++){f.animate({opacity:animateTo},duration,c.options.easing);animateTo=(animateTo+1)%2}f.animate({opacity:animateTo},duration,
|
| 202 |
-
c.options.easing,function(){animateTo==0&&f.hide();c.callback&&c.callback.apply(this,arguments)});f.queue("fx",function(){f.dequeue()}).dequeue()})}})(jQuery);
|
| 203 |
-
(function(b){b.effects.puff=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"hide"),e=parseInt(c.options.percent,10)||150,a=e/100,d={height:f.height(),width:f.width()};b.extend(c.options,{fade:true,mode:g,percent:g=="hide"?e:100,from:g=="hide"?d:{height:d.height*a,width:d.width*a}});f.effect("scale",c.options,c.duration,c.callback);f.dequeue()})};b.effects.scale=function(c){return this.queue(function(){var f=b(this),g=b.extend(true,{},c.options),e=b.effects.setMode(f,
|
| 204 |
-
c.options.mode||"effect"),a=parseInt(c.options.percent,10)||(parseInt(c.options.percent,10)==0?0:e=="hide"?0:100),d=c.options.direction||"both",h=c.options.origin;if(e!="effect"){g.origin=h||["middle","center"];g.restore=true}h={height:f.height(),width:f.width()};f.from=c.options.from||(e=="show"?{height:0,width:0}:h);a={y:d!="horizontal"?a/100:1,x:d!="vertical"?a/100:1};f.to={height:h.height*a.y,width:h.width*a.x};if(c.options.fade){if(e=="show"){f.from.opacity=0;f.to.opacity=1}if(e=="hide"){f.from.opacity=
|
| 205 |
-
1;f.to.opacity=0}}g.from=f.from;g.to=f.to;g.mode=e;f.effect("size",g,c.duration,c.callback);f.dequeue()})};b.effects.size=function(c){return this.queue(function(){var f=b(this),g=["position","top","bottom","left","right","width","height","overflow","opacity"],e=["position","top","bottom","left","right","overflow","opacity"],a=["width","height","overflow"],d=["fontSize"],h=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],i=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
|
| 206 |
-
j=b.effects.setMode(f,c.options.mode||"effect"),n=c.options.restore||false,q=c.options.scale||"both",l=c.options.origin,k={height:f.height(),width:f.width()};f.from=c.options.from||k;f.to=c.options.to||k;if(l){l=b.effects.getBaseline(l,k);f.from.top=(k.height-f.from.height)*l.y;f.from.left=(k.width-f.from.width)*l.x;f.to.top=(k.height-f.to.height)*l.y;f.to.left=(k.width-f.to.width)*l.x}var m={from:{y:f.from.height/k.height,x:f.from.width/k.width},to:{y:f.to.height/k.height,x:f.to.width/k.width}};
|
| 207 |
-
if(q=="box"||q=="both"){if(m.from.y!=m.to.y){g=g.concat(h);f.from=b.effects.setTransition(f,h,m.from.y,f.from);f.to=b.effects.setTransition(f,h,m.to.y,f.to)}if(m.from.x!=m.to.x){g=g.concat(i);f.from=b.effects.setTransition(f,i,m.from.x,f.from);f.to=b.effects.setTransition(f,i,m.to.x,f.to)}}if(q=="content"||q=="both")if(m.from.y!=m.to.y){g=g.concat(d);f.from=b.effects.setTransition(f,d,m.from.y,f.from);f.to=b.effects.setTransition(f,d,m.to.y,f.to)}b.effects.save(f,n?g:e);f.show();b.effects.createWrapper(f);
|
| 208 |
-
f.css("overflow","hidden").css(f.from);if(q=="content"||q=="both"){h=h.concat(["marginTop","marginBottom"]).concat(d);i=i.concat(["marginLeft","marginRight"]);a=g.concat(h).concat(i);f.find("*[width]").each(function(){child=b(this);n&&b.effects.save(child,a);var o={height:child.height(),width:child.width()};child.from={height:o.height*m.from.y,width:o.width*m.from.x};child.to={height:o.height*m.to.y,width:o.width*m.to.x};if(m.from.y!=m.to.y){child.from=b.effects.setTransition(child,h,m.from.y,child.from);
|
| 209 |
-
child.to=b.effects.setTransition(child,h,m.to.y,child.to)}if(m.from.x!=m.to.x){child.from=b.effects.setTransition(child,i,m.from.x,child.from);child.to=b.effects.setTransition(child,i,m.to.x,child.to)}child.css(child.from);child.animate(child.to,c.duration,c.options.easing,function(){n&&b.effects.restore(child,a)})})}f.animate(f.to,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){f.to.opacity===0&&f.css("opacity",f.from.opacity);j=="hide"&&f.hide();b.effects.restore(f,
|
| 210 |
-
n?g:e);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery);
|
| 211 |
-
(function(b){b.effects.shake=function(c){return this.queue(function(){var f=b(this),g=["position","top","bottom","left","right"];b.effects.setMode(f,c.options.mode||"effect");var e=c.options.direction||"left",a=c.options.distance||20,d=c.options.times||3,h=c.duration||c.options.duration||140;b.effects.save(f,g);f.show();b.effects.createWrapper(f);var i=e=="up"||e=="down"?"top":"left",j=e=="up"||e=="left"?"pos":"neg";e={};var n={},q={};e[i]=(j=="pos"?"-=":"+=")+a;n[i]=(j=="pos"?"+=":"-=")+a*2;q[i]=
|
| 212 |
-
(j=="pos"?"-=":"+=")+a*2;f.animate(e,h,c.options.easing);for(a=1;a<d;a++)f.animate(n,h,c.options.easing).animate(q,h,c.options.easing);f.animate(n,h,c.options.easing).animate(e,h/2,c.options.easing,function(){b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments)});f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery);
|
| 213 |
-
(function(b){b.effects.slide=function(c){return this.queue(function(){var f=b(this),g=["position","top","bottom","left","right"],e=b.effects.setMode(f,c.options.mode||"show"),a=c.options.direction||"left";b.effects.save(f,g);f.show();b.effects.createWrapper(f).css({overflow:"hidden"});var d=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";var h=c.options.distance||(d=="top"?f.outerHeight({margin:true}):f.outerWidth({margin:true}));if(e=="show")f.css(d,a=="pos"?isNaN(h)?"-"+h:-h:h);
|
| 214 |
-
var i={};i[d]=(e=="show"?a=="pos"?"+=":"-=":a=="pos"?"-=":"+=")+h;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery);
|
| 215 |
-
(function(b){b.effects.transfer=function(c){return this.queue(function(){var f=b(this),g=b(c.options.to),e=g.offset();g={top:e.top,left:e.left,height:g.innerHeight(),width:g.innerWidth()};e=f.offset();var a=b('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(c.options.className).css({top:e.top,left:e.left,height:f.innerHeight(),width:f.innerWidth(),position:"absolute"}).animate(g,c.duration,c.options.easing,function(){a.remove();c.callback&&c.callback.apply(f[0],arguments);
|
| 216 |
-
f.dequeue()})})}})(jQuery);
|
| 217 |
-
(function(b){b.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var c=this,f=c.options;c.running=0;c.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");c.headers=
|
| 218 |
-
c.element.find(f.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){f.disabled||b(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){f.disabled||b(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){f.disabled||b(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){f.disabled||b(this).removeClass("ui-state-focus")});c.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
|
| 219 |
-
if(f.navigation){var g=c.element.find("a").filter(f.navigationFilter).eq(0);if(g.length){var e=g.closest(".ui-accordion-header");c.active=e.length?e:g.closest(".ui-accordion-content").prev()}}c.active=c._findActive(c.active||f.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");c.active.next().addClass("ui-accordion-content-active");c._createIcons();c.resize();c.element.attr("role","tablist");c.headers.attr("role","tab").bind("keydown.accordion",
|
| 220 |
-
function(a){return c._keydown(a)}).next().attr("role","tabpanel");c.headers.not(c.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();c.active.length?c.active.attr({"aria-expanded":"true",tabIndex:0}):c.headers.eq(0).attr("tabIndex",0);b.browser.safari||c.headers.find("a").attr("tabIndex",-1);f.event&&c.headers.bind(f.event.split(" ").join(".accordion ")+".accordion",function(a){c._clickHandler.call(c,a,this);a.preventDefault()})},_createIcons:function(){var c=this.options;if(c.icons){b("<span></span>").addClass("ui-icon "+
|
| 221 |
-
c.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(c.icons.header).toggleClass(c.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");
|
| 222 |
-
this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var f=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(c.autoHeight||c.fillHeight)f.css("height","");return b.Widget.prototype.destroy.call(this)},_setOption:function(c,f){b.Widget.prototype._setOption.apply(this,arguments);c=="active"&&this.activate(f);if(c=="icons"){this._destroyIcons();
|
| 223 |
-
f&&this._createIcons()}if(c=="disabled")this.headers.add(this.headers.next())[f?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(c){if(!(this.options.disabled||c.altKey||c.ctrlKey)){var f=b.ui.keyCode,g=this.headers.length,e=this.headers.index(c.target),a=false;switch(c.keyCode){case f.RIGHT:case f.DOWN:a=this.headers[(e+1)%g];break;case f.LEFT:case f.UP:a=this.headers[(e-1+g)%g];break;case f.SPACE:case f.ENTER:this._clickHandler({target:c.target},c.target);
|
| 224 |
-
c.preventDefault()}if(a){b(c.target).attr("tabIndex",-1);b(a).attr("tabIndex",0);a.focus();return false}return true}},resize:function(){var c=this.options,f;if(c.fillSpace){if(b.browser.msie){var g=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}f=this.element.parent().height();b.browser.msie&&this.element.parent().css("overflow",g);this.headers.each(function(){f-=b(this).outerHeight(true)});this.headers.next().each(function(){b(this).height(Math.max(0,f-b(this).innerHeight()+
|
| 225 |
-
b(this).height()))}).css("overflow","auto")}else if(c.autoHeight){f=0;this.headers.next().each(function(){f=Math.max(f,b(this).height("").height())}).height(f)}return this},activate:function(c){this.options.active=c;c=this._findActive(c)[0];this._clickHandler({target:c},c);return this},_findActive:function(c){return c?typeof c==="number"?this.headers.filter(":eq("+c+")"):this.headers.not(this.headers.not(c)):c===false?b([]):this.headers.filter(":eq(0)")},_clickHandler:function(c,f){var g=this.options;
|
| 226 |
-
if(!g.disabled)if(c.target){c=b(c.currentTarget||f);f=c[0]===this.active[0];g.active=g.collapsible&&f?false:this.headers.index(c);if(!(this.running||!g.collapsible&&f)){var e=this.active;i=c.next();d=this.active.next();h={options:g,newHeader:f&&g.collapsible?b([]):c,oldHeader:this.active,newContent:f&&g.collapsible?b([]):i,oldContent:d};var a=this.headers.index(this.active[0])>this.headers.index(c[0]);this.active=f?b([]):c;this._toggle(i,d,h,f,a);e.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(g.icons.headerSelected).addClass(g.icons.header);
|
| 227 |
-
if(!f){c.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(g.icons.header).addClass(g.icons.headerSelected);c.next().addClass("ui-accordion-content-active")}}}else if(g.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(g.icons.headerSelected).addClass(g.icons.header);this.active.next().addClass("ui-accordion-content-active");var d=this.active.next(),
|
| 228 |
-
h={options:g,newHeader:b([]),oldHeader:g.active,newContent:b([]),oldContent:d},i=this.active=b([]);this._toggle(i,d,h)}},_toggle:function(c,f,g,e,a){var d=this,h=d.options;d.toShow=c;d.toHide=f;d.data=g;var i=function(){if(d)return d._completed.apply(d,arguments)};d._trigger("changestart",null,d.data);d.running=f.size()===0?c.size():f.size();if(h.animated){g={};g=h.collapsible&&e?{toShow:b([]),toHide:f,complete:i,down:a,autoHeight:h.autoHeight||h.fillSpace}:{toShow:c,toHide:f,complete:i,down:a,autoHeight:h.autoHeight||
|
| 229 |
-
h.fillSpace};if(!h.proxied)h.proxied=h.animated;if(!h.proxiedDuration)h.proxiedDuration=h.duration;h.animated=b.isFunction(h.proxied)?h.proxied(g):h.proxied;h.duration=b.isFunction(h.proxiedDuration)?h.proxiedDuration(g):h.proxiedDuration;e=b.ui.accordion.animations;var j=h.duration,n=h.animated;if(n&&!e[n]&&!b.easing[n])n="slide";e[n]||(e[n]=function(q){this.slide(q,{easing:n,duration:j||700})});e[n](g)}else{if(h.collapsible&&e)c.toggle();else{f.hide();c.show()}i(true)}f.prev().attr({"aria-expanded":"false",
|
| 230 |
-
tabIndex:-1}).blur();c.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(c){this.running=c?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});b.extend(b.ui.accordion,{version:"1.8.8",animations:{slide:function(c,f){c=b.extend({easing:"swing",
|
| 231 |
-
duration:300},c,f);if(c.toHide.size())if(c.toShow.size()){var g=c.toShow.css("overflow"),e=0,a={},d={},h;f=c.toShow;h=f[0].style.width;f.width(parseInt(f.parent().width(),10)-parseInt(f.css("paddingLeft"),10)-parseInt(f.css("paddingRight"),10)-(parseInt(f.css("borderLeftWidth"),10)||0)-(parseInt(f.css("borderRightWidth"),10)||0));b.each(["height","paddingTop","paddingBottom"],function(i,j){d[j]="hide";i=(""+b.css(c.toShow[0],j)).match(/^([\d+-.]+)(.*)$/);a[j]={value:i[1],unit:i[2]||"px"}});c.toShow.css({height:0,
|
| 232 |
-
overflow:"hidden"}).show();c.toHide.filter(":hidden").each(c.complete).end().filter(":visible").animate(d,{step:function(i,j){if(j.prop=="height")e=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);c.toShow[0].style[j.prop]=e*a[j.prop].value+a[j.prop].unit},duration:c.duration,easing:c.easing,complete:function(){c.autoHeight||c.toShow.css("height","");c.toShow.css({width:h,overflow:g});c.complete()}})}else c.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},c);else c.toShow.animate({height:"show",
|
| 233 |
-
paddingTop:"show",paddingBottom:"show"},c)},bounceslide:function(c){this.slide(c,{easing:c.down?"easeOutBounce":"swing",duration:c.down?1E3:200})}}})})(jQuery);
|
| 234 |
-
(function(b){b.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var c=this,f=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(e){if(!(c.options.disabled||c.element.attr("readonly"))){g=false;var a=b.ui.keyCode;
|
| 235 |
-
switch(e.keyCode){case a.PAGE_UP:c._move("previousPage",e);break;case a.PAGE_DOWN:c._move("nextPage",e);break;case a.UP:c._move("previous",e);e.preventDefault();break;case a.DOWN:c._move("next",e);e.preventDefault();break;case a.ENTER:case a.NUMPAD_ENTER:if(c.menu.active){g=true;e.preventDefault()}case a.TAB:if(!c.menu.active)return;c.menu.select(e);break;case a.ESCAPE:c.element.val(c.term);c.close(e);break;default:clearTimeout(c.searching);c.searching=setTimeout(function(){if(c.term!=c.element.val()){c.selectedItem=
|
| 236 |
-
null;c.search(null,e)}},c.options.delay);break}}}).bind("keypress.autocomplete",function(e){if(g){g=false;e.preventDefault()}}).bind("focus.autocomplete",function(){if(!c.options.disabled){c.selectedItem=null;c.previous=c.element.val()}}).bind("blur.autocomplete",function(e){if(!c.options.disabled){clearTimeout(c.searching);c.closing=setTimeout(function(){c.close(e);c._change(e)},150)}});this._initSource();this.response=function(){return c._response.apply(c,arguments)};this.menu=b("<ul></ul>").addClass("ui-autocomplete").appendTo(b(this.options.appendTo||
|
| 237 |
-
"body",f)[0]).mousedown(function(e){var a=c.menu.element[0];b(e.target).closest(".ui-menu-item").length||setTimeout(function(){b(document).one("mousedown",function(d){d.target!==c.element[0]&&d.target!==a&&!b.ui.contains(a,d.target)&&c.close()})},1);setTimeout(function(){clearTimeout(c.closing)},13)}).menu({focus:function(e,a){a=a.item.data("item.autocomplete");false!==c._trigger("focus",e,{item:a})&&/^key/.test(e.originalEvent.type)&&c.element.val(a.value)},selected:function(e,a){var d=a.item.data("item.autocomplete"),
|
| 238 |
-
h=c.previous;if(c.element[0]!==f.activeElement){c.element.focus();c.previous=h;setTimeout(function(){c.previous=h;c.selectedItem=d},1)}false!==c._trigger("select",e,{item:d})&&c.element.val(d.value);c.term=c.element.val();c.close(e);c.selectedItem=d},blur:function(){c.menu.element.is(":visible")&&c.element.val()!==c.term&&c.element.val(c.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");b.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
|
| 239 |
-
this.menu.element.remove();b.Widget.prototype.destroy.call(this)},_setOption:function(c,f){b.Widget.prototype._setOption.apply(this,arguments);c==="source"&&this._initSource();if(c==="appendTo")this.menu.element.appendTo(b(f||"body",this.element[0].ownerDocument)[0]);c==="disabled"&&f&&this.xhr&&this.xhr.abort()},_initSource:function(){var c=this,f,g;if(b.isArray(this.options.source)){f=this.options.source;this.source=function(e,a){a(b.ui.autocomplete.filter(f,e.term))}}else if(typeof this.options.source===
|
| 240 |
-
"string"){g=this.options.source;this.source=function(e,a){c.xhr&&c.xhr.abort();c.xhr=b.ajax({url:g,data:e,dataType:"json",success:function(d,h,i){i===c.xhr&&a(d);c.xhr=null},error:function(d){d===c.xhr&&a([]);c.xhr=null}})}}else this.source=this.options.source},search:function(c,f){c=c!=null?c:this.element.val();this.term=this.element.val();if(c.length<this.options.minLength)return this.close(f);clearTimeout(this.closing);if(this._trigger("search",f)!==false)return this._search(c)},_search:function(c){this.pending++;
|
| 241 |
-
this.element.addClass("ui-autocomplete-loading");this.source({term:c},this.response)},_response:function(c){if(!this.options.disabled&&c&&c.length){c=this._normalize(c);this._suggest(c);this._trigger("open")}else this.close();this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(c){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",c)}},_change:function(c){this.previous!==
|
| 242 |
-
this.element.val()&&this._trigger("change",c,{item:this.selectedItem})},_normalize:function(c){if(c.length&&c[0].label&&c[0].value)return c;return b.map(c,function(f){if(typeof f==="string")return{label:f,value:f};return b.extend({label:f.label||f.value,value:f.value||f.label},f)})},_suggest:function(c){var f=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(f,c);this.menu.deactivate();this.menu.refresh();f.show();this._resizeMenu();f.position(b.extend({of:this.element},this.options.position))},
|
| 243 |
-
_resizeMenu:function(){var c=this.menu.element;c.outerWidth(Math.max(c.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(c,f){var g=this;b.each(f,function(e,a){g._renderItem(c,a)})},_renderItem:function(c,f){return b("<li></li>").data("item.autocomplete",f).append(b("<a></a>").text(f.label)).appendTo(c)},_move:function(c,f){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(c)||this.menu.last()&&/^next/.test(c)){this.element.val(this.term);this.menu.deactivate()}else this.menu[c](f);
|
| 244 |
-
else this.search(null,f)},widget:function(){return this.menu.element}});b.extend(b.ui.autocomplete,{escapeRegex:function(c){return c.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(c,f){var g=new RegExp(b.ui.autocomplete.escapeRegex(f),"i");return b.grep(c,function(e){return g.test(e.label||e.value||e)})}})})(jQuery);
|
| 245 |
-
(function(b){b.widget("ui.menu",{_create:function(){var c=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(f){if(b(f.target).closest(".ui-menu-item a").length){f.preventDefault();c.select(f)}});this.refresh()},refresh:function(){var c=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
|
| 246 |
-
-1).mouseenter(function(f){c.activate(f,b(this).parent())}).mouseleave(function(){c.deactivate()})},activate:function(c,f){this.deactivate();if(this.hasScroll()){var g=f.offset().top-this.element.offset().top,e=this.element.attr("scrollTop"),a=this.element.height();if(g<0)this.element.attr("scrollTop",e+g);else g>=a&&this.element.attr("scrollTop",e+g-a+f.height())}this.active=f.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",c,{item:f})},
|
| 247 |
-
deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(c){this.move("next",".ui-menu-item:first",c)},previous:function(c){this.move("prev",".ui-menu-item:last",c)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(c,f,g){if(this.active){c=this.active[c+"All"](".ui-menu-item").eq(0);
|
| 248 |
-
c.length?this.activate(g,c):this.activate(g,this.element.children(f))}else this.activate(g,this.element.children(f))},nextPage:function(c){if(this.hasScroll())if(!this.active||this.last())this.activate(c,this.element.children(".ui-menu-item:first"));else{var f=this.active.offset().top,g=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var a=b(this).offset().top-f-g+b(this).height();return a<10&&a>-10});e.length||(e=this.element.children(".ui-menu-item:last"));this.activate(c,
|
| 249 |
-
e)}else this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(c){if(this.hasScroll())if(!this.active||this.first())this.activate(c,this.element.children(".ui-menu-item:last"));else{var f=this.active.offset().top,g=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var e=b(this).offset().top-f+g-b(this).height();return e<10&&e>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
|
| 250 |
-
this.activate(c,result)}else this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(c){this._trigger("selected",c,{item:this.active})}})})(jQuery);
|
| 251 |
-
(function(b){var c,f=function(e){b(":ui-button",e.target.form).each(function(){var a=b(this).data("button");setTimeout(function(){a.refresh()},1)})},g=function(e){var a=e.name,d=e.form,h=b([]);if(a)h=d?b(d).find("[name='"+a+"']"):b("[name='"+a+"']",e.ownerDocument).filter(function(){return!this.form});return h};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
|
| 252 |
-
f);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var e=this,a=this.options,d=this.type==="checkbox"||this.type==="radio",h="ui-state-hover"+(!d?" ui-state-active":"");if(a.label===null)a.label=this.buttonElement.html();if(this.element.is(":disabled"))a.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
|
| 253 |
-
function(){if(!a.disabled){b(this).addClass("ui-state-hover");this===c&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){a.disabled||b(this).removeClass(h)}).bind("focus.button",function(){b(this).addClass("ui-state-focus")}).bind("blur.button",function(){b(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){e.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(a.disabled)return false;b(this).toggleClass("ui-state-active");
|
| 254 |
-
e.buttonElement.attr("aria-pressed",e.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(a.disabled)return false;b(this).addClass("ui-state-active");e.buttonElement.attr("aria-pressed",true);var i=e.element[0];g(i).not(i).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(a.disabled)return false;b(this).addClass("ui-state-active");
|
| 255 |
-
c=this;b(document).one("mouseup",function(){c=null})}).bind("mouseup.button",function(){if(a.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(i){if(a.disabled)return false;if(i.keyCode==b.ui.keyCode.SPACE||i.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(i){i.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",
|
| 256 |
-
a.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var e=this.element.is(":checked");e&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",e)}else this.buttonElement=
|
| 257 |
-
this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||
|
| 258 |
-
this.buttonElement.removeAttr("title");b.Widget.prototype.destroy.call(this)},_setOption:function(e,a){b.Widget.prototype._setOption.apply(this,arguments);if(e==="disabled")a?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var e=this.element.is(":disabled");e!==this.options.disabled&&this._setOption("disabled",e);if(this.type==="radio")g(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
|
| 259 |
-
true):b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var e=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
|
| 260 |
-
a=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(e.empty()).text(),d=this.options.icons,h=d.primary&&d.secondary;if(d.primary||d.secondary){e.addClass("ui-button-text-icon"+(h?"s":d.primary?"-primary":"-secondary"));d.primary&&e.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&e.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.addClass(h?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary");
|
| 261 |
-
this.hasTitle||e.attr("title",a)}}else e.addClass("ui-button-text-only")}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(e,a){e==="disabled"&&this.buttons.button("option",e,a);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
|
| 262 |
-
destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");b.Widget.prototype.destroy.call(this)}})})(jQuery);
|
| 263 |
-
(function(b,c){function f(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
|
| 264 |
-
"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
|
| 265 |
-
"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
|
| 266 |
-
minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};b.extend(this._defaults,this.regional[""]);this.dpDiv=b('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function g(a,d){b.extend(a,d);for(var h in d)if(d[h]==
|
| 267 |
-
null||d[h]==c)a[h]=d[h];return a}b.extend(b.ui,{datepicker:{version:"1.8.8"}});var e=(new Date).getTime();b.extend(f.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){g(this._defaults,a||{});return this},_attachDatepicker:function(a,d){var h=null;for(var i in this._defaults){var j=a.getAttribute("date:"+i);if(j){h=h||{};try{h[i]=eval(j)}catch(n){h[i]=j}}}i=a.nodeName.toLowerCase();
|
| 268 |
-
j=i=="div"||i=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var q=this._newInst(b(a),j);q.settings=b.extend({},d||{},h||{});if(i=="input")this._connectDatepicker(a,q);else j&&this._inlineDatepicker(a,q)},_newInst:function(a,d){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:d,dpDiv:!d?this.dpDiv:b('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
|
| 269 |
-
_connectDatepicker:function(a,d){var h=b(a);d.append=b([]);d.trigger=b([]);if(!h.hasClass(this.markerClassName)){this._attachments(h,d);h.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(i,j,n){d.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(d,j)});this._autoSize(d);b.data(a,"datepicker",d)}},_attachments:function(a,d){var h=this._get(d,"appendText"),i=this._get(d,"isRTL");d.append&&
|
| 270 |
-
d.append.remove();if(h){d.append=b('<span class="'+this._appendClass+'">'+h+"</span>");a[i?"before":"after"](d.append)}a.unbind("focus",this._showDatepicker);d.trigger&&d.trigger.remove();h=this._get(d,"showOn");if(h=="focus"||h=="both")a.focus(this._showDatepicker);if(h=="button"||h=="both"){h=this._get(d,"buttonText");var j=this._get(d,"buttonImage");d.trigger=b(this._get(d,"buttonImageOnly")?b("<img/>").addClass(this._triggerClass).attr({src:j,alt:h,title:h}):b('<button type="button"></button>').addClass(this._triggerClass).html(j==
|
| 271 |
-
""?h:b("<img/>").attr({src:j,alt:h,title:h})));a[i?"before":"after"](d.trigger);d.trigger.click(function(){b.datepicker._datepickerShowing&&b.datepicker._lastInput==a[0]?b.datepicker._hideDatepicker():b.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var d=new Date(2009,11,20),h=this._get(a,"dateFormat");if(h.match(/[DM]/)){var i=function(j){for(var n=0,q=0,l=0;l<j.length;l++)if(j[l].length>n){n=j[l].length;q=l}return q};d.setMonth(i(this._get(a,
|
| 272 |
-
h.match(/MM/)?"monthNames":"monthNamesShort")));d.setDate(i(this._get(a,h.match(/DD/)?"dayNames":"dayNamesShort"))+20-d.getDay())}a.input.attr("size",this._formatDate(a,d).length)}},_inlineDatepicker:function(a,d){var h=b(a);if(!h.hasClass(this.markerClassName)){h.addClass(this.markerClassName).append(d.dpDiv).bind("setData.datepicker",function(i,j,n){d.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(d,j)});b.data(a,"datepicker",d);this._setDate(d,this._getDefaultDate(d),
|
| 273 |
-
true);this._updateDatepicker(d);this._updateAlternate(d);d.dpDiv.show()}},_dialogDatepicker:function(a,d,h,i,j){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=b('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);b("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};b.data(this._dialogInput[0],"datepicker",a)}g(a.settings,i||{});
|
| 274 |
-
d=d&&d.constructor==Date?this._formatDate(a,d):d;this._dialogInput.val(d);this._pos=j?j.length?j:[j.pageX,j.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=h;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);
|
| 275 |
-
this._showDatepicker(this._dialogInput[0]);b.blockUI&&b.blockUI(this.dpDiv);b.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();b.removeData(a,"datepicker");if(i=="input"){h.append.remove();h.trigger.remove();d.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",
|
| 276 |
-
this._doKeyUp)}else if(i=="div"||i=="span")d.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=false;h.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(i=="div"||i=="span")d.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs,
|
| 277 |
-
function(j){return j==a?null:j})}},_disableDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=true;h.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(i=="div"||i=="span")d.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs,function(j){return j==a?null:
|
| 278 |
-
j});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var d=0;d<this._disabledInputs.length;d++)if(this._disabledInputs[d]==a)return true;return false},_getInst:function(a){try{return b.data(a,"datepicker")}catch(d){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,d,h){var i=this._getInst(a);if(arguments.length==2&&typeof d=="string")return d=="defaults"?b.extend({},b.datepicker._defaults):i?d=="all"?b.extend({},
|
| 279 |
-
i.settings):this._get(i,d):null;var j=d||{};if(typeof d=="string"){j={};j[d]=h}if(i){this._curInst==i&&this._hideDatepicker();var n=this._getDateDatepicker(a,true);g(i.settings,j);this._attachments(b(a),i);this._autoSize(i);this._setDateDatepicker(a,n);this._updateDatepicker(i)}},_changeDatepicker:function(a,d,h){this._optionDatepicker(a,d,h)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,d){if(a=this._getInst(a)){this._setDate(a,d);
|
| 280 |
-
this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,d){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,d);return a?this._getDate(a):null},_doKeyDown:function(a){var d=b.datepicker._getInst(a.target),h=true,i=d.dpDiv.is(".ui-datepicker-rtl");d._keyEvent=true;if(b.datepicker._datepickerShowing)switch(a.keyCode){case 9:b.datepicker._hideDatepicker();h=false;break;case 13:h=b("td."+b.datepicker._dayOverClass+":not(."+b.datepicker._currentClass+")",d.dpDiv);h[0]?
|
| 281 |
-
b.datepicker._selectDay(a.target,d.selectedMonth,d.selectedYear,h[0]):b.datepicker._hideDatepicker();return false;case 27:b.datepicker._hideDatepicker();break;case 33:b.datepicker._adjustDate(a.target,a.ctrlKey?-b.datepicker._get(d,"stepBigMonths"):-b.datepicker._get(d,"stepMonths"),"M");break;case 34:b.datepicker._adjustDate(a.target,a.ctrlKey?+b.datepicker._get(d,"stepBigMonths"):+b.datepicker._get(d,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)b.datepicker._clearDate(a.target);h=a.ctrlKey||
|
| 282 |
-
a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)b.datepicker._gotoToday(a.target);h=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,i?+1:-1,"D");h=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)b.datepicker._adjustDate(a.target,a.ctrlKey?-b.datepicker._get(d,"stepBigMonths"):-b.datepicker._get(d,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,-7,"D");h=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,
|
| 283 |
-
i?-1:+1,"D");h=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)b.datepicker._adjustDate(a.target,a.ctrlKey?+b.datepicker._get(d,"stepBigMonths"):+b.datepicker._get(d,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,+7,"D");h=a.ctrlKey||a.metaKey;break;default:h=false}else if(a.keyCode==36&&a.ctrlKey)b.datepicker._showDatepicker(this);else h=false;if(h){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var d=b.datepicker._getInst(a.target);if(b.datepicker._get(d,
|
| 284 |
-
"constrainInput")){d=b.datepicker._possibleChars(b.datepicker._get(d,"dateFormat"));var h=String.fromCharCode(a.charCode==c?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||h<" "||!d||d.indexOf(h)>-1}},_doKeyUp:function(a){a=b.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,b.datepicker._getFormatConfig(a))){b.datepicker._setDateFromField(a);b.datepicker._updateAlternate(a);b.datepicker._updateDatepicker(a)}}catch(d){b.datepicker.log(d)}return true},
|
| 285 |
-
_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=b("input",a.parentNode)[0];if(!(b.datepicker._isDisabledDatepicker(a)||b.datepicker._lastInput==a)){var d=b.datepicker._getInst(a);b.datepicker._curInst&&b.datepicker._curInst!=d&&b.datepicker._curInst.dpDiv.stop(true,true);var h=b.datepicker._get(d,"beforeShow");g(d.settings,h?h.apply(a,[a,d]):{});d.lastVal=null;b.datepicker._lastInput=a;b.datepicker._setDateFromField(d);if(b.datepicker._inDialog)a.value="";if(!b.datepicker._pos){b.datepicker._pos=
|
| 286 |
-
b.datepicker._findPos(a);b.datepicker._pos[1]+=a.offsetHeight}var i=false;b(a).parents().each(function(){i|=b(this).css("position")=="fixed";return!i});if(i&&b.browser.opera){b.datepicker._pos[0]-=document.documentElement.scrollLeft;b.datepicker._pos[1]-=document.documentElement.scrollTop}h={left:b.datepicker._pos[0],top:b.datepicker._pos[1]};b.datepicker._pos=null;d.dpDiv.empty();d.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});b.datepicker._updateDatepicker(d);h=b.datepicker._checkOffset(d,
|
| 287 |
-
h,i);d.dpDiv.css({position:b.datepicker._inDialog&&b.blockUI?"static":i?"fixed":"absolute",display:"none",left:h.left+"px",top:h.top+"px"});if(!d.inline){h=b.datepicker._get(d,"showAnim");var j=b.datepicker._get(d,"duration"),n=function(){b.datepicker._datepickerShowing=true;var q=d.dpDiv.find("iframe.ui-datepicker-cover");if(q.length){var l=b.datepicker._getBorders(d.dpDiv);q.css({left:-l[0],top:-l[1],width:d.dpDiv.outerWidth(),height:d.dpDiv.outerHeight()})}};d.dpDiv.zIndex(b(a).zIndex()+1);b.effects&&
|
| 288 |
-
b.effects[h]?d.dpDiv.show(h,b.datepicker._get(d,"showOptions"),j,n):d.dpDiv[h||"show"](h?j:null,n);if(!h||!j)n();d.input.is(":visible")&&!d.input.is(":disabled")&&d.input.focus();b.datepicker._curInst=d}}},_updateDatepicker:function(a){var d=this,h=b.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var i=a.dpDiv.find("iframe.ui-datepicker-cover");i.length&&i.css({left:-h[0],top:-h[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",
|
| 289 |
-
function(){b(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&b(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!d._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){b(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=
|
| 290 |
-
-1&&b(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();h=this._getNumberOfMonths(a);i=h[1];i>1?a.dpDiv.addClass("ui-datepicker-multi-"+i).css("width",17*i+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(h[0]!=1||h[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,
|
| 291 |
-
"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==b.datepicker._curInst&&b.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus();if(a.yearshtml){var j=a.yearshtml;setTimeout(function(){j===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);j=a.yearshtml=null},0)}},_getBorders:function(a){var d=function(h){return{thin:1,medium:2,thick:3}[h]||h};return[parseFloat(d(a.css("border-left-width"))),parseFloat(d(a.css("border-top-width")))]},
|
| 292 |
-
_checkOffset:function(a,d,h){var i=a.dpDiv.outerWidth(),j=a.dpDiv.outerHeight(),n=a.input?a.input.outerWidth():0,q=a.input?a.input.outerHeight():0,l=document.documentElement.clientWidth+b(document).scrollLeft(),k=document.documentElement.clientHeight+b(document).scrollTop();d.left-=this._get(a,"isRTL")?i-n:0;d.left-=h&&d.left==a.input.offset().left?b(document).scrollLeft():0;d.top-=h&&d.top==a.input.offset().top+q?b(document).scrollTop():0;d.left-=Math.min(d.left,d.left+i>l&&l>i?Math.abs(d.left+i-
|
| 293 |
-
l):0);d.top-=Math.min(d.top,d.top+j>k&&k>j?Math.abs(j+q):0);return d},_findPos:function(a){for(var d=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[d?"previousSibling":"nextSibling"];a=b(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var d=this._curInst;if(!(!d||a&&d!=b.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(d,"showAnim");var h=this._get(d,"duration"),i=function(){b.datepicker._tidyDialog(d);this._curInst=null};b.effects&&b.effects[a]?
|
| 294 |
-
d.dpDiv.hide(a,b.datepicker._get(d,"showOptions"),h,i):d.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?h:null,i);a||i();if(a=this._get(d,"onClose"))a.apply(d.input?d.input[0]:null,[d.input?d.input.val():"",d]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(b.blockUI){b.unblockUI();b("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},
|
| 295 |
-
_checkExternalClick:function(a){if(b.datepicker._curInst){a=b(a.target);a[0].id!=b.datepicker._mainDivId&&a.parents("#"+b.datepicker._mainDivId).length==0&&!a.hasClass(b.datepicker.markerClassName)&&!a.hasClass(b.datepicker._triggerClass)&&b.datepicker._datepickerShowing&&!(b.datepicker._inDialog&&b.blockUI)&&b.datepicker._hideDatepicker()}},_adjustDate:function(a,d,h){a=b(a);var i=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(i,d+(h=="M"?this._get(i,"showCurrentAtPos"):
|
| 296 |
-
0),h);this._updateDatepicker(i)}},_gotoToday:function(a){a=b(a);var d=this._getInst(a[0]);if(this._get(d,"gotoCurrent")&&d.currentDay){d.selectedDay=d.currentDay;d.drawMonth=d.selectedMonth=d.currentMonth;d.drawYear=d.selectedYear=d.currentYear}else{var h=new Date;d.selectedDay=h.getDate();d.drawMonth=d.selectedMonth=h.getMonth();d.drawYear=d.selectedYear=h.getFullYear()}this._notifyChange(d);this._adjustDate(a)},_selectMonthYear:function(a,d,h){a=b(a);var i=this._getInst(a[0]);i._selectingMonthYear=
|
| 297 |
-
false;i["selected"+(h=="M"?"Month":"Year")]=i["draw"+(h=="M"?"Month":"Year")]=parseInt(d.options[d.selectedIndex].value,10);this._notifyChange(i);this._adjustDate(a)},_clickMonthYear:function(a){var d=this._getInst(b(a)[0]);d.input&&d._selectingMonthYear&&setTimeout(function(){d.input.focus()},0);d._selectingMonthYear=!d._selectingMonthYear},_selectDay:function(a,d,h,i){var j=b(a);if(!(b(i).hasClass(this._unselectableClass)||this._isDisabledDatepicker(j[0]))){j=this._getInst(j[0]);j.selectedDay=j.currentDay=
|
| 298 |
-
b("a",i).html();j.selectedMonth=j.currentMonth=d;j.selectedYear=j.currentYear=h;this._selectDate(a,this._formatDate(j,j.currentDay,j.currentMonth,j.currentYear))}},_clearDate:function(a){a=b(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,d){a=this._getInst(b(a)[0]);d=d!=null?d:this._formatDate(a);a.input&&a.input.val(d);this._updateAlternate(a);var h=this._get(a,"onSelect");if(h)h.apply(a.input?a.input[0]:null,[d,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);
|
| 299 |
-
else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var d=this._get(a,"altField");if(d){var h=this._get(a,"altFormat")||this._get(a,"dateFormat"),i=this._getDate(a),j=this.formatDate(h,i,this._getFormatConfig(a));b(d).each(function(){b(this).val(j)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var d=
|
| 300 |
-
a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((d-a)/864E5)/7)+1},parseDate:function(a,d,h){if(a==null||d==null)throw"Invalid arguments";d=typeof d=="object"?d.toString():d+"";if(d=="")return null;for(var i=(h?h.shortYearCutoff:null)||this._defaults.shortYearCutoff,j=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,n=(h?h.dayNames:null)||this._defaults.dayNames,q=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort,l=(h?h.monthNames:null)||this._defaults.monthNames,
|
| 301 |
-
k=h=-1,m=-1,o=-1,p=false,s=function(x){(x=y+1<a.length&&a.charAt(y+1)==x)&&y++;return x},r=function(x){var C=s(x);x=new RegExp("^\\d{1,"+(x=="@"?14:x=="!"?20:x=="y"&&C?4:x=="o"?3:2)+"}");x=d.substring(w).match(x);if(!x)throw"Missing number at position "+w;w+=x[0].length;return parseInt(x[0],10)},u=function(x,C,J){x=s(x)?J:C;for(C=0;C<x.length;C++)if(d.substr(w,x[C].length).toLowerCase()==x[C].toLowerCase()){w+=x[C].length;return C+1}throw"Unknown name at position "+w;},v=function(){if(d.charAt(w)!=
|
| 302 |
-
a.charAt(y))throw"Unexpected literal at position "+w;w++},w=0,y=0;y<a.length;y++)if(p)if(a.charAt(y)=="'"&&!s("'"))p=false;else v();else switch(a.charAt(y)){case "d":m=r("d");break;case "D":u("D",j,n);break;case "o":o=r("o");break;case "m":k=r("m");break;case "M":k=u("M",q,l);break;case "y":h=r("y");break;case "@":var B=new Date(r("@"));h=B.getFullYear();k=B.getMonth()+1;m=B.getDate();break;case "!":B=new Date((r("!")-this._ticksTo1970)/1E4);h=B.getFullYear();k=B.getMonth()+1;m=B.getDate();break;
|
| 303 |
-
case "'":if(s("'"))v();else p=true;break;default:v()}if(h==-1)h=(new Date).getFullYear();else if(h<100)h+=(new Date).getFullYear()-(new Date).getFullYear()%100+(h<=i?0:-100);if(o>-1){k=1;m=o;do{i=this._getDaysInMonth(h,k-1);if(m<=i)break;k++;m-=i}while(1)}B=this._daylightSavingAdjust(new Date(h,k-1,m));if(B.getFullYear()!=h||B.getMonth()+1!=k||B.getDate()!=m)throw"Invalid date";return B},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",
|
| 304 |
-
RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,d,h){if(!d)return"";var i=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,j=(h?h.dayNames:null)||this._defaults.dayNames,n=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort;h=(h?h.monthNames:null)||this._defaults.monthNames;var q=function(s){(s=p+1<a.length&&a.charAt(p+1)==s)&&p++;
|
| 305 |
-
return s},l=function(s,r,u){r=""+r;if(q(s))for(;r.length<u;)r="0"+r;return r},k=function(s,r,u,v){return q(s)?v[r]:u[r]},m="",o=false;if(d)for(var p=0;p<a.length;p++)if(o)if(a.charAt(p)=="'"&&!q("'"))o=false;else m+=a.charAt(p);else switch(a.charAt(p)){case "d":m+=l("d",d.getDate(),2);break;case "D":m+=k("D",d.getDay(),i,j);break;case "o":m+=l("o",(d.getTime()-(new Date(d.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":m+=l("m",d.getMonth()+1,2);break;case "M":m+=k("M",d.getMonth(),n,h);break;
|
| 306 |
-
case "y":m+=q("y")?d.getFullYear():(d.getYear()%100<10?"0":"")+d.getYear()%100;break;case "@":m+=d.getTime();break;case "!":m+=d.getTime()*1E4+this._ticksTo1970;break;case "'":if(q("'"))m+="'";else o=true;break;default:m+=a.charAt(p)}return m},_possibleChars:function(a){for(var d="",h=false,i=function(n){(n=j+1<a.length&&a.charAt(j+1)==n)&&j++;return n},j=0;j<a.length;j++)if(h)if(a.charAt(j)=="'"&&!i("'"))h=false;else d+=a.charAt(j);else switch(a.charAt(j)){case "d":case "m":case "y":case "@":d+=
|
| 307 |
-
"0123456789";break;case "D":case "M":return null;case "'":if(i("'"))d+="'";else h=true;break;default:d+=a.charAt(j)}return d},_get:function(a,d){return a.settings[d]!==c?a.settings[d]:this._defaults[d]},_setDateFromField:function(a,d){if(a.input.val()!=a.lastVal){var h=this._get(a,"dateFormat"),i=a.lastVal=a.input?a.input.val():null,j,n;j=n=this._getDefaultDate(a);var q=this._getFormatConfig(a);try{j=this.parseDate(h,i,q)||n}catch(l){this.log(l);i=d?"":i}a.selectedDay=j.getDate();a.drawMonth=a.selectedMonth=
|
| 308 |
-
j.getMonth();a.drawYear=a.selectedYear=j.getFullYear();a.currentDay=i?j.getDate():0;a.currentMonth=i?j.getMonth():0;a.currentYear=i?j.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,d,h){var i=function(n){var q=new Date;q.setDate(q.getDate()+n);return q},j=function(n){try{return b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),n,b.datepicker._getFormatConfig(a))}catch(q){}var l=
|
| 309 |
-
(n.toLowerCase().match(/^c/)?b.datepicker._getDate(a):null)||new Date,k=l.getFullYear(),m=l.getMonth();l=l.getDate();for(var o=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,p=o.exec(n);p;){switch(p[2]||"d"){case "d":case "D":l+=parseInt(p[1],10);break;case "w":case "W":l+=parseInt(p[1],10)*7;break;case "m":case "M":m+=parseInt(p[1],10);l=Math.min(l,b.datepicker._getDaysInMonth(k,m));break;case "y":case "Y":k+=parseInt(p[1],10);l=Math.min(l,b.datepicker._getDaysInMonth(k,m));break}p=o.exec(n)}return new Date(k,
|
| 310 |
-
m,l)};if(d=(d=d==null||d===""?h:typeof d=="string"?j(d):typeof d=="number"?isNaN(d)?h:i(d):new Date(d.getTime()))&&d.toString()=="Invalid Date"?h:d){d.setHours(0);d.setMinutes(0);d.setSeconds(0);d.setMilliseconds(0)}return this._daylightSavingAdjust(d)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,d,h){var i=!d,j=a.selectedMonth,n=a.selectedYear;d=this._restrictMinMax(a,this._determineDate(a,d,new Date));a.selectedDay=
|
| 311 |
-
a.currentDay=d.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=d.getMonth();a.drawYear=a.selectedYear=a.currentYear=d.getFullYear();if((j!=a.selectedMonth||n!=a.selectedYear)&&!h)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(i?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var d=new Date;d=this._daylightSavingAdjust(new Date(d.getFullYear(),
|
| 312 |
-
d.getMonth(),d.getDate()));var h=this._get(a,"isRTL"),i=this._get(a,"showButtonPanel"),j=this._get(a,"hideIfNoPrevNext"),n=this._get(a,"navigationAsDateFormat"),q=this._getNumberOfMonths(a),l=this._get(a,"showCurrentAtPos"),k=this._get(a,"stepMonths"),m=q[0]!=1||q[1]!=1,o=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),p=this._getMinMaxDate(a,"min"),s=this._getMinMaxDate(a,"max");l=a.drawMonth-l;var r=a.drawYear;if(l<0){l+=12;r--}if(s){var u=
|
| 313 |
-
this._daylightSavingAdjust(new Date(s.getFullYear(),s.getMonth()-q[0]*q[1]+1,s.getDate()));for(u=p&&u<p?p:u;this._daylightSavingAdjust(new Date(r,l,1))>u;){l--;if(l<0){l=11;r--}}}a.drawMonth=l;a.drawYear=r;u=this._get(a,"prevText");u=!n?u:this.formatDate(u,this._daylightSavingAdjust(new Date(r,l-k,1)),this._getFormatConfig(a));u=this._canAdjustMonth(a,-1,r,l)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+a.id+"', -"+k+", 'M');\" title=\""+u+'"><span class="ui-icon ui-icon-circle-triangle-'+
|
| 314 |
-
(h?"e":"w")+'">'+u+"</span></a>":j?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+u+'"><span class="ui-icon ui-icon-circle-triangle-'+(h?"e":"w")+'">'+u+"</span></a>";var v=this._get(a,"nextText");v=!n?v:this.formatDate(v,this._daylightSavingAdjust(new Date(r,l+k,1)),this._getFormatConfig(a));j=this._canAdjustMonth(a,+1,r,l)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+a.id+"', +"+k+", 'M');\" title=\""+v+'"><span class="ui-icon ui-icon-circle-triangle-'+
|
| 315 |
-
(h?"w":"e")+'">'+v+"</span></a>":j?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+v+'"><span class="ui-icon ui-icon-circle-triangle-'+(h?"w":"e")+'">'+v+"</span></a>";k=this._get(a,"currentText");v=this._get(a,"gotoCurrent")&&a.currentDay?o:d;k=!n?k:this.formatDate(k,v,this._getFormatConfig(a));n=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+e+'.datepicker._hideDatepicker();">'+this._get(a,
|
| 316 |
-
"closeText")+"</button>":"";i=i?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(h?n:"")+(this._isInRange(a,v)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._gotoToday('#"+a.id+"');\">"+k+"</button>":"")+(h?"":n)+"</div>":"";n=parseInt(this._get(a,"firstDay"),10);n=isNaN(n)?0:n;k=this._get(a,"showWeek");v=this._get(a,"dayNames");this._get(a,"dayNamesShort");var w=this._get(a,"dayNamesMin"),y=
|
| 317 |
-
this._get(a,"monthNames"),B=this._get(a,"monthNamesShort"),x=this._get(a,"beforeShowDay"),C=this._get(a,"showOtherMonths"),J=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var M=this._getDefaultDate(a),K="",G=0;G<q[0];G++){for(var N="",H=0;H<q[1];H++){var O=this._daylightSavingAdjust(new Date(r,l,a.selectedDay)),A=" ui-corner-all",D="";if(m){D+='<div class="ui-datepicker-group';if(q[1]>1)switch(H){case 0:D+=" ui-datepicker-group-first";A=" ui-corner-"+(h?"right":"left");break;case q[1]-
|
| 318 |
-
1:D+=" ui-datepicker-group-last";A=" ui-corner-"+(h?"left":"right");break;default:D+=" ui-datepicker-group-middle";A="";break}D+='">'}D+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+A+'">'+(/all|left/.test(A)&&G==0?h?j:u:"")+(/all|right/.test(A)&&G==0?h?u:j:"")+this._generateMonthYearHeader(a,l,r,p,s,G>0||H>0,y,B)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var E=k?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(A=0;A<7;A++){var z=
|
| 319 |
-
(A+n)%7;E+="<th"+((A+n+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+v[z]+'">'+w[z]+"</span></th>"}D+=E+"</tr></thead><tbody>";E=this._getDaysInMonth(r,l);if(r==a.selectedYear&&l==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,E);A=(this._getFirstDayOfMonth(r,l)-n+7)%7;E=m?6:Math.ceil((A+E)/7);z=this._daylightSavingAdjust(new Date(r,l,1-A));for(var P=0;P<E;P++){D+="<tr>";var Q=!k?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(z)+"</td>";for(A=0;A<7;A++){var I=
|
| 320 |
-
x?x.apply(a.input?a.input[0]:null,[z]):[true,""],F=z.getMonth()!=l,L=F&&!J||!I[0]||p&&z<p||s&&z>s;Q+='<td class="'+((A+n+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(z.getTime()==O.getTime()&&l==a.selectedMonth&&a._keyEvent||M.getTime()==z.getTime()&&M.getTime()==O.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!C?"":" "+I[1]+(z.getTime()==o.getTime()?" "+this._currentClass:"")+(z.getTime()==d.getTime()?" ui-datepicker-today":
|
| 321 |
-
""))+'"'+((!F||C)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+e+".datepicker._selectDay('#"+a.id+"',"+z.getMonth()+","+z.getFullYear()+', this);return false;"')+">"+(F&&!C?" ":L?'<span class="ui-state-default">'+z.getDate()+"</span>":'<a class="ui-state-default'+(z.getTime()==d.getTime()?" ui-state-highlight":"")+(z.getTime()==o.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+z.getDate()+"</a>")+"</td>";z.setDate(z.getDate()+1);z=this._daylightSavingAdjust(z)}D+=
|
| 322 |
-
Q+"</tr>"}l++;if(l>11){l=0;r++}D+="</tbody></table>"+(m?"</div>"+(q[0]>0&&H==q[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");N+=D}K+=N}K+=i+(b.browser.msie&&parseInt(b.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return K},_generateMonthYearHeader:function(a,d,h,i,j,n,q,l){var k=this._get(a,"changeMonth"),m=this._get(a,"changeYear"),o=this._get(a,"showMonthAfterYear"),p='<div class="ui-datepicker-title">',
|
| 323 |
-
s="";if(n||!k)s+='<span class="ui-datepicker-month">'+q[d]+"</span>";else{q=i&&i.getFullYear()==h;var r=j&&j.getFullYear()==h;s+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var u=0;u<12;u++)if((!q||u>=i.getMonth())&&(!r||u<=j.getMonth()))s+='<option value="'+u+'"'+(u==d?' selected="selected"':"")+">"+l[u]+"</option>";s+="</select>"}o||(p+=s+(n||!(k&&
|
| 324 |
-
m)?" ":""));a.yearshtml="";if(n||!m)p+='<span class="ui-datepicker-year">'+h+"</span>";else{l=this._get(a,"yearRange").split(":");var v=(new Date).getFullYear();q=function(w){w=w.match(/c[+-].*/)?h+parseInt(w.substring(1),10):w.match(/[+-].*/)?v+parseInt(w,10):parseInt(w,10);return isNaN(w)?v:w};d=q(l[0]);l=Math.max(d,q(l[1]||""));d=i?Math.max(d,i.getFullYear()):d;l=j?Math.min(l,j.getFullYear()):l;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+
|
| 325 |
-
a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+a.id+"');\">";d<=l;d++)a.yearshtml+='<option value="'+d+'"'+(d==h?' selected="selected"':"")+">"+d+"</option>";a.yearshtml+="</select>";if(b.browser.mozilla)p+='<select class="ui-datepicker-year"><option value="'+h+'" selected="selected">'+h+"</option></select>";else{p+=a.yearshtml;a.yearshtml=null}}p+=this._get(a,"yearSuffix");if(o)p+=(n||!(k&&m)?" ":"")+s;p+="</div>";return p},_adjustInstDate:function(a,d,h){var i=
|
| 326 |
-
a.drawYear+(h=="Y"?d:0),j=a.drawMonth+(h=="M"?d:0);d=Math.min(a.selectedDay,this._getDaysInMonth(i,j))+(h=="D"?d:0);i=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(i,j,d)));a.selectedDay=i.getDate();a.drawMonth=a.selectedMonth=i.getMonth();a.drawYear=a.selectedYear=i.getFullYear();if(h=="M"||h=="Y")this._notifyChange(a)},_restrictMinMax:function(a,d){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");d=h&&d<h?h:d;return d=a&&d>a?a:d},_notifyChange:function(a){var d=this._get(a,
|
| 327 |
-
"onChangeMonthYear");if(d)d.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,d){return this._determineDate(a,this._get(a,d+"Date"),null)},_getDaysInMonth:function(a,d){return 32-(new Date(a,d,32)).getDate()},_getFirstDayOfMonth:function(a,d){return(new Date(a,d,1)).getDay()},_canAdjustMonth:function(a,d,h,i){var j=this._getNumberOfMonths(a);
|
| 328 |
-
h=this._daylightSavingAdjust(new Date(h,i+(d<0?d:j[0]*j[1]),1));d<0&&h.setDate(this._getDaysInMonth(h.getFullYear(),h.getMonth()));return this._isInRange(a,h)},_isInRange:function(a,d){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!h||d.getTime()>=h.getTime())&&(!a||d.getTime()<=a.getTime())},_getFormatConfig:function(a){var d=this._get(a,"shortYearCutoff");d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);return{shortYearCutoff:d,dayNamesShort:this._get(a,
|
| 329 |
-
"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,d,h,i){if(!d){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}d=d?typeof d=="object"?d:this._daylightSavingAdjust(new Date(i,h,d)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),d,this._getFormatConfig(a))}});b.fn.datepicker=
|
| 330 |
-
function(a){if(!b.datepicker.initialized){b(document).mousedown(b.datepicker._checkExternalClick).find("body").append(b.datepicker.dpDiv);b.datepicker.initialized=true}var d=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(d));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(d));
|
| 331 |
-
return this.each(function(){typeof a=="string"?b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this].concat(d)):b.datepicker._attachDatepicker(this,a)})};b.datepicker=new f;b.datepicker.initialized=false;b.datepicker.uuid=(new Date).getTime();b.datepicker.version="1.8.8";window["DP_jQuery_"+e]=b})(jQuery);
|
| 332 |
-
(function(b,c){var f={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},g={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};b.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(e){var a=b(this).css(e).offset().top;a<0&&
|
| 333 |
-
b(this).css("top",e.top-a)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var e=this,a=e.options,d=a.title||" ",h=b.ui.dialog.getTitleId(e.element),i=(e.uiDialog=b("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+a.dialogClass).css({zIndex:a.zIndex}).attr("tabIndex",
|
| 334 |
-
-1).css("outline",0).keydown(function(q){if(a.closeOnEscape&&q.keyCode&&q.keyCode===b.ui.keyCode.ESCAPE){e.close(q);q.preventDefault()}}).attr({role:"dialog","aria-labelledby":h}).mousedown(function(q){e.moveToTop(false,q)});e.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(i);var j=(e.uiDialogTitlebar=b("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(i),n=b('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role",
|
| 335 |
-
"button").hover(function(){n.addClass("ui-state-hover")},function(){n.removeClass("ui-state-hover")}).focus(function(){n.addClass("ui-state-focus")}).blur(function(){n.removeClass("ui-state-focus")}).click(function(q){e.close(q);return false}).appendTo(j);(e.uiDialogTitlebarCloseText=b("<span></span>")).addClass("ui-icon ui-icon-closethick").text(a.closeText).appendTo(n);b("<span></span>").addClass("ui-dialog-title").attr("id",h).html(d).prependTo(j);if(b.isFunction(a.beforeclose)&&!b.isFunction(a.beforeClose))a.beforeClose=
|
| 336 |
-
a.beforeclose;j.find("*").add(j).disableSelection();a.draggable&&b.fn.draggable&&e._makeDraggable();a.resizable&&b.fn.resizable&&e._makeResizable();e._createButtons(a.buttons);e._isOpen=false;b.fn.bgiframe&&i.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var e=this;e.overlay&&e.overlay.destroy();e.uiDialog.hide();e.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");e.uiDialog.remove();e.originalTitle&&
|
| 337 |
-
e.element.attr("title",e.originalTitle);return e},widget:function(){return this.uiDialog},close:function(e){var a=this,d,h;if(false!==a._trigger("beforeClose",e)){a.overlay&&a.overlay.destroy();a.uiDialog.unbind("keypress.ui-dialog");a._isOpen=false;if(a.options.hide)a.uiDialog.hide(a.options.hide,function(){a._trigger("close",e)});else{a.uiDialog.hide();a._trigger("close",e)}b.ui.dialog.overlay.resize();if(a.options.modal){d=0;b(".ui-dialog").each(function(){if(this!==a.uiDialog[0]){h=b(this).css("z-index");
|
| 338 |
-
isNaN(h)||(d=Math.max(d,h))}});b.ui.dialog.maxZ=d}return a}},isOpen:function(){return this._isOpen},moveToTop:function(e,a){var d=this,h=d.options;if(h.modal&&!e||!h.stack&&!h.modal)return d._trigger("focus",a);if(h.zIndex>b.ui.dialog.maxZ)b.ui.dialog.maxZ=h.zIndex;if(d.overlay){b.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",b.ui.dialog.overlay.maxZ=b.ui.dialog.maxZ)}e={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};b.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",b.ui.dialog.maxZ);
|
| 339 |
-
d.element.attr(e);d._trigger("focus",a);return d},open:function(){if(!this._isOpen){var e=this,a=e.options,d=e.uiDialog;e.overlay=a.modal?new b.ui.dialog.overlay(e):null;e._size();e._position(a.position);d.show(a.show);e.moveToTop(true);a.modal&&d.bind("keypress.ui-dialog",function(h){if(h.keyCode===b.ui.keyCode.TAB){var i=b(":tabbable",this),j=i.filter(":first");i=i.filter(":last");if(h.target===i[0]&&!h.shiftKey){j.focus(1);return false}else if(h.target===j[0]&&h.shiftKey){i.focus(1);return false}}});
|
| 340 |
-
b(e.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();e._isOpen=true;e._trigger("open");return e}},_createButtons:function(e){var a=this,d=false,h=b("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),i=b("<div></div>").addClass("ui-dialog-buttonset").appendTo(h);a.uiDialog.find(".ui-dialog-buttonpane").remove();typeof e==="object"&&e!==null&&b.each(e,function(){return!(d=true)});if(d){b.each(e,function(j,
|
| 341 |
-
n){n=b.isFunction(n)?{click:n,text:j}:n;j=b('<button type="button"></button>').attr(n,true).unbind("click").click(function(){n.click.apply(a.element[0],arguments)}).appendTo(i);b.fn.button&&j.button()});h.appendTo(a.uiDialog)}},_makeDraggable:function(){function e(j){return{position:j.position,offset:j.offset}}var a=this,d=a.options,h=b(document),i;a.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(j,n){i=
|
| 342 |
-
d.height==="auto"?"auto":b(this).height();b(this).height(b(this).height()).addClass("ui-dialog-dragging");a._trigger("dragStart",j,e(n))},drag:function(j,n){a._trigger("drag",j,e(n))},stop:function(j,n){d.position=[n.position.left-h.scrollLeft(),n.position.top-h.scrollTop()];b(this).removeClass("ui-dialog-dragging").height(i);a._trigger("dragStop",j,e(n));b.ui.dialog.overlay.resize()}})},_makeResizable:function(e){function a(j){return{originalPosition:j.originalPosition,originalSize:j.originalSize,
|
| 343 |
-
position:j.position,size:j.size}}e=e===c?this.options.resizable:e;var d=this,h=d.options,i=d.uiDialog.css("position");e=typeof e==="string"?e:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:h.maxWidth,maxHeight:h.maxHeight,minWidth:h.minWidth,minHeight:d._minHeight(),handles:e,start:function(j,n){b(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",j,a(n))},resize:function(j,n){d._trigger("resize",j,a(n))},stop:function(j,
|
| 344 |
-
n){b(this).removeClass("ui-dialog-resizing");h.height=b(this).height();h.width=b(this).width();d._trigger("resizeStop",j,a(n));b.ui.dialog.overlay.resize()}}).css("position",i).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var e=this.options;return e.height==="auto"?e.minHeight:Math.min(e.minHeight,e.height)},_position:function(e){var a=[],d=[0,0],h;if(e){if(typeof e==="string"||typeof e==="object"&&"0"in e){a=e.split?e.split(" "):[e[0],e[1]];if(a.length===
|
| 345 |
-
1)a[1]=a[0];b.each(["left","top"],function(i,j){if(+a[i]===a[i]){d[i]=a[i];a[i]=j}});e={my:a.join(" "),at:a.join(" "),offset:d.join(" ")}}e=b.extend({},b.ui.dialog.prototype.options.position,e)}else e=b.ui.dialog.prototype.options.position;(h=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(b.extend({of:window},e));h||this.uiDialog.hide()},_setOptions:function(e){var a=this,d={},h=false;b.each(e,function(i,j){a._setOption(i,j);if(i in f)h=true;if(i in
|
| 346 |
-
g)d[i]=j});h&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(e,a){var d=this,h=d.uiDialog;switch(e){case "beforeclose":e="beforeClose";break;case "buttons":d._createButtons(a);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+a);break;case "dialogClass":h.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+a);break;case "disabled":a?h.addClass("ui-dialog-disabled"):h.removeClass("ui-dialog-disabled");
|
| 347 |
-
break;case "draggable":var i=h.is(":data(draggable)");i&&!a&&h.draggable("destroy");!i&&a&&d._makeDraggable();break;case "position":d._position(a);break;case "resizable":(i=h.is(":data(resizable)"))&&!a&&h.resizable("destroy");i&&typeof a==="string"&&h.resizable("option","handles",a);!i&&a!==false&&d._makeResizable(a);break;case "title":b(".ui-dialog-title",d.uiDialogTitlebar).html(""+(a||" "));break}b.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var e=this.options,a,d,h=
|
| 348 |
-
this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(e.minWidth>e.width)e.width=e.minWidth;a=this.uiDialog.css({height:"auto",width:e.width}).height();d=Math.max(0,e.minHeight-a);if(e.height==="auto")if(b.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();e=this.element.css("height","auto").height();h||this.uiDialog.hide();this.element.height(Math.max(e,d))}else this.element.height(Math.max(e.height-a,0));this.uiDialog.is(":data(resizable)")&&
|
| 349 |
-
this.uiDialog.resizable("option","minHeight",this._minHeight())}});b.extend(b.ui.dialog,{version:"1.8.8",uuid:0,maxZ:0,getTitleId:function(e){e=e.attr("id");if(!e){this.uuid+=1;e=this.uuid}return"ui-dialog-title-"+e},overlay:function(e){this.$el=b.ui.dialog.overlay.create(e)}});b.extend(b.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:b.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(e){return e+".dialog-overlay"}).join(" "),create:function(e){if(this.instances.length===
|
| 350 |
-
0){setTimeout(function(){b.ui.dialog.overlay.instances.length&&b(document).bind(b.ui.dialog.overlay.events,function(d){if(b(d.target).zIndex()<b.ui.dialog.overlay.maxZ)return false})},1);b(document).bind("keydown.dialog-overlay",function(d){if(e.options.closeOnEscape&&d.keyCode&&d.keyCode===b.ui.keyCode.ESCAPE){e.close(d);d.preventDefault()}});b(window).bind("resize.dialog-overlay",b.ui.dialog.overlay.resize)}var a=(this.oldInstances.pop()||b("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
|
| 351 |
-
height:this.height()});b.fn.bgiframe&&a.bgiframe();this.instances.push(a);return a},destroy:function(e){var a=b.inArray(e,this.instances);a!=-1&&this.oldInstances.push(this.instances.splice(a,1)[0]);this.instances.length===0&&b([document,window]).unbind(".dialog-overlay");e.remove();var d=0;b.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var e,a;if(b.browser.msie&&b.browser.version<7){e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
|
| 352 |
-
a=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return e<a?b(window).height()+"px":e+"px"}else return b(document).height()+"px"},width:function(){var e,a;if(b.browser.msie&&b.browser.version<7){e=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);a=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return e<a?b(window).width()+"px":e+"px"}else return b(document).width()+"px"},resize:function(){var e=b([]);b.each(b.ui.dialog.overlay.instances,
|
| 353 |
-
function(){e=e.add(this)});e.css({width:0,height:0}).css({width:b.ui.dialog.overlay.width(),height:b.ui.dialog.overlay.height()})}});b.extend(b.ui.dialog.overlay.prototype,{destroy:function(){b.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
|
| 354 |
-
(function(b){b.ui=b.ui||{};var c=/left|center|right/,f=/top|center|bottom/,g=b.fn.position,e=b.fn.offset;b.fn.position=function(a){if(!a||!a.of)return g.apply(this,arguments);a=b.extend({},a);var d=b(a.of),h=d[0],i=(a.collision||"flip").split(" "),j=a.offset?a.offset.split(" "):[0,0],n,q,l;if(h.nodeType===9){n=d.width();q=d.height();l={top:0,left:0}}else if(h.setTimeout){n=d.width();q=d.height();l={top:d.scrollTop(),left:d.scrollLeft()}}else if(h.preventDefault){a.at="left top";n=q=0;l={top:a.of.pageY,
|
| 355 |
-
left:a.of.pageX}}else{n=d.outerWidth();q=d.outerHeight();l=d.offset()}b.each(["my","at"],function(){var k=(a[this]||"").split(" ");if(k.length===1)k=c.test(k[0])?k.concat(["center"]):f.test(k[0])?["center"].concat(k):["center","center"];k[0]=c.test(k[0])?k[0]:"center";k[1]=f.test(k[1])?k[1]:"center";a[this]=k});if(i.length===1)i[1]=i[0];j[0]=parseInt(j[0],10)||0;if(j.length===1)j[1]=j[0];j[1]=parseInt(j[1],10)||0;if(a.at[0]==="right")l.left+=n;else if(a.at[0]==="center")l.left+=n/2;if(a.at[1]==="bottom")l.top+=
|
| 356 |
-
q;else if(a.at[1]==="center")l.top+=q/2;l.left+=j[0];l.top+=j[1];return this.each(function(){var k=b(this),m=k.outerWidth(),o=k.outerHeight(),p=parseInt(b.curCSS(this,"marginLeft",true))||0,s=parseInt(b.curCSS(this,"marginTop",true))||0,r=m+p+(parseInt(b.curCSS(this,"marginRight",true))||0),u=o+s+(parseInt(b.curCSS(this,"marginBottom",true))||0),v=b.extend({},l),w;if(a.my[0]==="right")v.left-=m;else if(a.my[0]==="center")v.left-=m/2;if(a.my[1]==="bottom")v.top-=o;else if(a.my[1]==="center")v.top-=
|
| 357 |
-
o/2;v.left=Math.round(v.left);v.top=Math.round(v.top);w={left:v.left-p,top:v.top-s};b.each(["left","top"],function(y,B){b.ui.position[i[y]]&&b.ui.position[i[y]][B](v,{targetWidth:n,targetHeight:q,elemWidth:m,elemHeight:o,collisionPosition:w,collisionWidth:r,collisionHeight:u,offset:j,my:a.my,at:a.at})});b.fn.bgiframe&&k.bgiframe();k.offset(b.extend(v,{using:a.using}))})};b.ui.position={fit:{left:function(a,d){var h=b(window);h=d.collisionPosition.left+d.collisionWidth-h.width()-h.scrollLeft();a.left=
|
| 358 |
-
h>0?a.left-h:Math.max(a.left-d.collisionPosition.left,a.left)},top:function(a,d){var h=b(window);h=d.collisionPosition.top+d.collisionHeight-h.height()-h.scrollTop();a.top=h>0?a.top-h:Math.max(a.top-d.collisionPosition.top,a.top)}},flip:{left:function(a,d){if(d.at[0]!=="center"){var h=b(window);h=d.collisionPosition.left+d.collisionWidth-h.width()-h.scrollLeft();var i=d.my[0]==="left"?-d.elemWidth:d.my[0]==="right"?d.elemWidth:0,j=d.at[0]==="left"?d.targetWidth:-d.targetWidth,n=-2*d.offset[0];a.left+=
|
| 359 |
-
d.collisionPosition.left<0?i+j+n:h>0?i+j+n:0}},top:function(a,d){if(d.at[1]!=="center"){var h=b(window);h=d.collisionPosition.top+d.collisionHeight-h.height()-h.scrollTop();var i=d.my[1]==="top"?-d.elemHeight:d.my[1]==="bottom"?d.elemHeight:0,j=d.at[1]==="top"?d.targetHeight:-d.targetHeight,n=-2*d.offset[1];a.top+=d.collisionPosition.top<0?i+j+n:h>0?i+j+n:0}}}};if(!b.offset.setOffset){b.offset.setOffset=function(a,d){if(/static/.test(b.curCSS(a,"position")))a.style.position="relative";var h=b(a),
|
| 360 |
-
i=h.offset(),j=parseInt(b.curCSS(a,"top",true),10)||0,n=parseInt(b.curCSS(a,"left",true),10)||0;i={top:d.top-i.top+j,left:d.left-i.left+n};"using"in d?d.using.call(a,i):h.css(i)};b.fn.offset=function(a){var d=this[0];if(!d||!d.ownerDocument)return null;if(a)return this.each(function(){b.offset.setOffset(this,a)});return e.call(this)}}})(jQuery);
|
| 361 |
-
(function(b,c){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
|
| 362 |
-
this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(f){if(f===c)return this._value();this._setOption("value",f);return this},_setOption:function(f,g){if(f==="value"){this.options.value=g;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var f=this.options.value;if(typeof f!=="number")f=0;return Math.min(this.options.max,Math.max(this.min,f))},_percentage:function(){return 100*
|
| 363 |
-
this._value()/this.options.max},_refreshValue:function(){var f=this.value(),g=this._percentage();if(this.oldValue!==f){this.oldValue=f;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",f===this.options.max).width(g.toFixed(0)+"%");this.element.attr("aria-valuenow",f)}});b.extend(b.ui.progressbar,{version:"1.8.8"})})(jQuery);
|
| 364 |
-
(function(b){b.widget("ui.slider",b.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var c=this,f=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");f.disabled&&this.element.addClass("ui-slider-disabled ui-disabled");
|
| 365 |
-
this.range=b([]);if(f.range){if(f.range===true){this.range=b("<div></div>");if(!f.values)f.values=[this._valueMin(),this._valueMin()];if(f.values.length&&f.values.length!==2)f.values=[f.values[0],f.values[0]]}else this.range=b("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(f.range==="min"||f.range==="max")this.range.addClass("ui-slider-range-"+f.range);this.range.addClass("ui-widget-header")}b(".ui-slider-handle",this.element).length===0&&b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");
|
| 366 |
-
if(f.values&&f.values.length)for(;b(".ui-slider-handle",this.element).length<f.values.length;)b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=b(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){f.disabled||b(this).addClass("ui-state-hover")},function(){b(this).removeClass("ui-state-hover")}).focus(function(){if(f.disabled)b(this).blur();
|
| 367 |
-
else{b(".ui-slider .ui-state-focus").removeClass("ui-state-focus");b(this).addClass("ui-state-focus")}}).blur(function(){b(this).removeClass("ui-state-focus")});this.handles.each(function(g){b(this).data("index.ui-slider-handle",g)});this.handles.keydown(function(g){var e=true,a=b(this).data("index.ui-slider-handle"),d,h,i;if(!c.options.disabled){switch(g.keyCode){case b.ui.keyCode.HOME:case b.ui.keyCode.END:case b.ui.keyCode.PAGE_UP:case b.ui.keyCode.PAGE_DOWN:case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:e=
|
| 368 |
-
false;if(!c._keySliding){c._keySliding=true;b(this).addClass("ui-state-active");d=c._start(g,a);if(d===false)return}break}i=c.options.step;d=c.options.values&&c.options.values.length?(h=c.values(a)):(h=c.value());switch(g.keyCode){case b.ui.keyCode.HOME:h=c._valueMin();break;case b.ui.keyCode.END:h=c._valueMax();break;case b.ui.keyCode.PAGE_UP:h=c._trimAlignValue(d+(c._valueMax()-c._valueMin())/5);break;case b.ui.keyCode.PAGE_DOWN:h=c._trimAlignValue(d-(c._valueMax()-c._valueMin())/5);break;case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:if(d===
|
| 369 |
-
c._valueMax())return;h=c._trimAlignValue(d+i);break;case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:if(d===c._valueMin())return;h=c._trimAlignValue(d-i);break}c._slide(g,a,h);return e}}).keyup(function(g){var e=b(this).data("index.ui-slider-handle");if(c._keySliding){c._keySliding=false;c._stop(g,e);c._change(g,e);b(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
|
| 370 |
-
this._mouseDestroy();return this},_mouseCapture:function(c){var f=this.options,g,e,a,d,h;if(f.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();g=this._normValueFromMouse({x:c.pageX,y:c.pageY});e=this._valueMax()-this._valueMin()+1;d=this;this.handles.each(function(i){var j=Math.abs(g-d.values(i));if(e>j){e=j;a=b(this);h=i}});if(f.range===true&&this.values(1)===f.min){h+=1;a=b(this.handles[h])}if(this._start(c,
|
| 371 |
-
h)===false)return false;this._mouseSliding=true;d._handleIndex=h;a.addClass("ui-state-active").focus();f=a.offset();this._clickOffset=!b(c.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:c.pageX-f.left-a.width()/2,top:c.pageY-f.top-a.height()/2-(parseInt(a.css("borderTopWidth"),10)||0)-(parseInt(a.css("borderBottomWidth"),10)||0)+(parseInt(a.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(c,h,g);return this._animateOff=true},_mouseStart:function(){return true},
|
| 372 |
-
_mouseDrag:function(c){var f=this._normValueFromMouse({x:c.pageX,y:c.pageY});this._slide(c,this._handleIndex,f);return false},_mouseStop:function(c){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(c,this._handleIndex);this._change(c,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(c){var f;
|
| 373 |
-
if(this.orientation==="horizontal"){f=this.elementSize.width;c=c.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{f=this.elementSize.height;c=c.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}f=c/f;if(f>1)f=1;if(f<0)f=0;if(this.orientation==="vertical")f=1-f;c=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+f*c)},_start:function(c,f){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=
|
| 374 |
-
this.values(f);g.values=this.values()}return this._trigger("start",c,g)},_slide:function(c,f,g){var e;if(this.options.values&&this.options.values.length){e=this.values(f?0:1);if(this.options.values.length===2&&this.options.range===true&&(f===0&&g>e||f===1&&g<e))g=e;if(g!==this.values(f)){e=this.values();e[f]=g;c=this._trigger("slide",c,{handle:this.handles[f],value:g,values:e});this.values(f?0:1);c!==false&&this.values(f,g,true)}}else if(g!==this.value()){c=this._trigger("slide",c,{handle:this.handles[f],
|
| 375 |
-
value:g});c!==false&&this.value(g)}},_stop:function(c,f){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=this.values(f);g.values=this.values()}this._trigger("stop",c,g)},_change:function(c,f){if(!this._keySliding&&!this._mouseSliding){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=this.values(f);g.values=this.values()}this._trigger("change",c,g)}},value:function(c){if(arguments.length){this.options.value=
|
| 376 |
-
this._trimAlignValue(c);this._refreshValue();this._change(null,0)}return this._value()},values:function(c,f){var g,e,a;if(arguments.length>1){this.options.values[c]=this._trimAlignValue(f);this._refreshValue();this._change(null,c)}if(arguments.length)if(b.isArray(arguments[0])){g=this.options.values;e=arguments[0];for(a=0;a<g.length;a+=1){g[a]=this._trimAlignValue(e[a]);this._change(null,a)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(c):this.value();
|
| 377 |
-
else return this._values()},_setOption:function(c,f){var g,e=0;if(b.isArray(this.options.values))e=this.options.values.length;b.Widget.prototype._setOption.apply(this,arguments);switch(c){case "disabled":if(f){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
|
| 378 |
-
this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(g=0;g<e;g+=1)this._change(null,g);this._animateOff=false;break}},_value:function(){var c=this.options.value;return c=this._trimAlignValue(c)},_values:function(c){var f,g;if(arguments.length){f=this.options.values[c];
|
| 379 |
-
return f=this._trimAlignValue(f)}else{f=this.options.values.slice();for(g=0;g<f.length;g+=1)f[g]=this._trimAlignValue(f[g]);return f}},_trimAlignValue:function(c){if(c<=this._valueMin())return this._valueMin();if(c>=this._valueMax())return this._valueMax();var f=this.options.step>0?this.options.step:1,g=(c-this._valueMin())%f;alignValue=c-g;if(Math.abs(g)*2>=f)alignValue+=g>0?f:-f;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
|
| 380 |
-
_refreshValue:function(){var c=this.options.range,f=this.options,g=this,e=!this._animateOff?f.animate:false,a,d={},h,i,j,n;if(this.options.values&&this.options.values.length)this.handles.each(function(q){a=(g.values(q)-g._valueMin())/(g._valueMax()-g._valueMin())*100;d[g.orientation==="horizontal"?"left":"bottom"]=a+"%";b(this).stop(1,1)[e?"animate":"css"](d,f.animate);if(g.options.range===true)if(g.orientation==="horizontal"){if(q===0)g.range.stop(1,1)[e?"animate":"css"]({left:a+"%"},f.animate);
|
| 381 |
-
if(q===1)g.range[e?"animate":"css"]({width:a-h+"%"},{queue:false,duration:f.animate})}else{if(q===0)g.range.stop(1,1)[e?"animate":"css"]({bottom:a+"%"},f.animate);if(q===1)g.range[e?"animate":"css"]({height:a-h+"%"},{queue:false,duration:f.animate})}h=a});else{i=this.value();j=this._valueMin();n=this._valueMax();a=n!==j?(i-j)/(n-j)*100:0;d[g.orientation==="horizontal"?"left":"bottom"]=a+"%";this.handle.stop(1,1)[e?"animate":"css"](d,f.animate);if(c==="min"&&this.orientation==="horizontal")this.range.stop(1,
|
| 382 |
-
1)[e?"animate":"css"]({width:a+"%"},f.animate);if(c==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-a+"%"},{queue:false,duration:f.animate});if(c==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:a+"%"},f.animate);if(c==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-a+"%"},{queue:false,duration:f.animate})}}});b.extend(b.ui.slider,{version:"1.8.8"})})(jQuery);
|
| 383 |
-
(function(b,c){function f(){return++e}function g(){return++a}var e=0,a=0;b.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(d,h){if(d=="selected")this.options.collapsible&&
|
| 384 |
-
h==this.options.selected||this.select(h);else{this.options[d]=h;this._tabify()}},_tabId:function(d){return d.title&&d.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+f()},_sanitizeSelector:function(d){return d.replace(/:/g,"\\:")},_cookie:function(){var d=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+g());return b.cookie.apply(null,[d].concat(b.makeArray(arguments)))},_ui:function(d,h){return{tab:d,panel:h,index:this.anchors.index(d)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var d=
|
| 385 |
-
b(this);d.html(d.data("label.tabs")).removeData("label.tabs")})},_tabify:function(d){function h(r,u){r.css("display","");!b.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var i=this,j=this.options,n=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=b(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return b("a",this)[0]});this.panels=b([]);this.anchors.each(function(r,u){var v=b(u).attr("href"),w=v.split("#")[0],y;if(w&&(w===location.toString().split("#")[0]||
|
| 386 |
-
(y=b("base")[0])&&w===y.href)){v=u.hash;u.href=v}if(n.test(v))i.panels=i.panels.add(i.element.find(i._sanitizeSelector(v)));else if(v&&v!=="#"){b.data(u,"href.tabs",v);b.data(u,"load.tabs",v.replace(/#.*$/,""));v=i._tabId(u);u.href="#"+v;u=i.element.find("#"+v);if(!u.length){u=b(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(i.panels[r-1]||i.list);u.data("destroy.tabs",true)}i.panels=i.panels.add(u)}else j.disabled.push(r)});if(d){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
|
| 387 |
-
this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===c){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(i._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected=
|
| 388 |
-
this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=b.unique(j.disabled.concat(b.map(this.lis.filter(".ui-state-disabled"),function(r){return i.lis.index(r)}))).sort();b.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(b.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
|
| 389 |
-
if(j.selected>=0&&this.anchors.length){i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");i.element.queue("tabs",function(){i._trigger("show",null,i._ui(i.anchors[j.selected],i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash))))});this.load(j.selected)}b(window).bind("unload",function(){i.lis.add(i.anchors).unbind(".tabs");i.lis=i.anchors=i.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
|
| 390 |
-
this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);d=0;for(var q;q=this.lis[d];d++)b(q)[b.inArray(d,j.disabled)!=-1&&!b(q).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var l=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+
|
| 391 |
-
r)};this.lis.bind("mouseover.tabs",function(){l("hover",b(this))});this.lis.bind("mouseout.tabs",function(){k("hover",b(this))});this.anchors.bind("focus.tabs",function(){l("focus",b(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",b(this).closest("li"))})}var m,o;if(j.fx)if(b.isArray(j.fx)){m=j.fx[0];o=j.fx[1]}else m=o=j.fx;var p=o?function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
|
| 392 |
-
function(){h(u,o);i._trigger("show",null,i._ui(r,u[0]))})}:function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");i._trigger("show",null,i._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");h(u,m);i.element.dequeue("tabs")})}:function(r,u){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");i.element.dequeue("tabs")};
|
| 393 |
-
this.anchors.bind(j.event+".tabs",function(){var r=this,u=b(r).closest("li"),v=i.panels.filter(":not(.ui-tabs-hide)"),w=i.element.find(i._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||i.panels.filter(":animated").length||i._trigger("select",null,i._ui(this,w[0]))===false){this.blur();return false}j.selected=i.anchors.index(this);i.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected=
|
| 394 |
-
-1;j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){p(r,w)});i.load(i.anchors.index(this));this.blur();return false}j.cookie&&i._cookie(j.selected,j.cookie);if(w.length){v.length&&i.element.queue("tabs",function(){s(r,v)});i.element.queue("tabs",function(){p(r,w)});i.load(i.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
|
| 395 |
-
b.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(d){if(typeof d=="string")d=this.anchors.index(this.anchors.filter("[href$="+d+"]"));return d},destroy:function(){var d=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var h=
|
| 396 |
-
b.data(this,"href.tabs");if(h)this.href=h;var i=b(this).unbind(".tabs");b.each(["href","load","cache"],function(j,n){i.removeData(n+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){b.data(this,"destroy.tabs")?b(this).remove():b(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});d.cookie&&this._cookie(null,d.cookie);return this},add:function(d,
|
| 397 |
-
h,i){if(i===c)i=this.anchors.length;var j=this,n=this.options;h=b(n.tabTemplate.replace(/#\{href\}/g,d).replace(/#\{label\}/g,h));d=!d.indexOf("#")?d.replace("#",""):this._tabId(b("a",h)[0]);h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var q=j.element.find("#"+d);q.length||(q=b(n.panelTemplate).attr("id",d).data("destroy.tabs",true));q.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(i>=this.lis.length){h.appendTo(this.list);q.appendTo(this.list[0].parentNode)}else{h.insertBefore(this.lis[i]);
|
| 398 |
-
q.insertBefore(this.panels[i])}n.disabled=b.map(n.disabled,function(l){return l>=i?++l:l});this._tabify();if(this.anchors.length==1){n.selected=0;h.addClass("ui-tabs-selected ui-state-active");q.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[i],this.panels[i]));return this},remove:function(d){d=this._getIndex(d);var h=this.options,i=this.lis.eq(d).remove(),j=this.panels.eq(d).remove();
|
| 399 |
-
if(i.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(d+(d+1<this.anchors.length?1:-1));h.disabled=b.map(b.grep(h.disabled,function(n){return n!=d}),function(n){return n>=d?--n:n});this._tabify();this._trigger("remove",null,this._ui(i.find("a")[0],j[0]));return this},enable:function(d){d=this._getIndex(d);var h=this.options;if(b.inArray(d,h.disabled)!=-1){this.lis.eq(d).removeClass("ui-state-disabled");h.disabled=b.grep(h.disabled,function(i){return i!=d});this._trigger("enable",null,
|
| 400 |
-
this._ui(this.anchors[d],this.panels[d]));return this}},disable:function(d){d=this._getIndex(d);var h=this.options;if(d!=h.selected){this.lis.eq(d).addClass("ui-state-disabled");h.disabled.push(d);h.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[d],this.panels[d]))}return this},select:function(d){d=this._getIndex(d);if(d==-1)if(this.options.collapsible&&this.options.selected!=-1)d=this.options.selected;else return this;this.anchors.eq(d).trigger(this.options.event+".tabs");return this},
|
| 401 |
-
load:function(d){d=this._getIndex(d);var h=this,i=this.options,j=this.anchors.eq(d)[0],n=b.data(j,"load.tabs");this.abort();if(!n||this.element.queue("tabs").length!==0&&b.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(d).addClass("ui-state-processing");if(i.spinner){var q=b("span",j);q.data("label.tabs",q.html()).html(i.spinner)}this.xhr=b.ajax(b.extend({},i.ajaxOptions,{url:n,success:function(l,k){h.element.find(h._sanitizeSelector(j.hash)).html(l);h._cleanup();i.cache&&b.data(j,
|
| 402 |
-
"cache.tabs",true);h._trigger("load",null,h._ui(h.anchors[d],h.panels[d]));try{i.ajaxOptions.success(l,k)}catch(m){}},error:function(l,k){h._cleanup();h._trigger("load",null,h._ui(h.anchors[d],h.panels[d]));try{i.ajaxOptions.error(l,k,d,j)}catch(m){}}}));h.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
|
| 403 |
-
url:function(d,h){this.anchors.eq(d).removeData("cache.tabs").data("load.tabs",h);return this},length:function(){return this.anchors.length}});b.extend(b.ui.tabs,{version:"1.8.8"});b.extend(b.ui.tabs.prototype,{rotation:null,rotate:function(d,h){var i=this,j=this.options,n=i._rotate||(i._rotate=function(q){clearTimeout(i.rotation);i.rotation=setTimeout(function(){var l=j.selected;i.select(++l<i.anchors.length?l:0)},d);q&&q.stopPropagation()});h=i._unrotate||(i._unrotate=!h?function(q){q.clientX&&
|
| 404 |
-
i.rotate(null)}:function(){t=j.selected;n()});if(d){this.element.bind("tabsshow",n);this.anchors.bind(j.event+".tabs",h);n()}else{clearTimeout(i.rotation);this.element.unbind("tabsshow",n);this.anchors.unbind(j.event+".tabs",h);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
javascript/main.js
CHANGED
|
@@ -21,3 +21,40 @@ function cLink_load(){
|
|
| 21 |
setTimeout('autoClick();', time);
|
| 22 |
setInterval('countdown()', 1000);
|
| 23 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 21 |
setTimeout('autoClick();', time);
|
| 22 |
setInterval('countdown()', 1000);
|
| 23 |
}
|
| 24 |
+
|
| 25 |
+
function checkAll( n, fldName ) {
|
| 26 |
+
if (!fldName) {
|
| 27 |
+
fldName = 'cb';
|
| 28 |
+
}
|
| 29 |
+
var f = document.adminForm;
|
| 30 |
+
var c = f.toggle.checked;
|
| 31 |
+
var n2 = 0;
|
| 32 |
+
for (i=0; i < n; i++) {
|
| 33 |
+
cb = eval( 'f.' + fldName + '' + i );
|
| 34 |
+
if (cb) {
|
| 35 |
+
cb.checked = c;
|
| 36 |
+
n2++;
|
| 37 |
+
}
|
| 38 |
+
}
|
| 39 |
+
if (c) {
|
| 40 |
+
document.adminForm.boxchecked.value = n2;
|
| 41 |
+
} else {
|
| 42 |
+
document.adminForm.boxchecked.value = 0;
|
| 43 |
+
}
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
function checkJAll(n, toggle, cb){
|
| 47 |
+
|
| 48 |
+
if( $( "#"+toggle).is(":checked") )
|
| 49 |
+
var checkall = true;
|
| 50 |
+
else
|
| 51 |
+
var checkal = false;
|
| 52 |
+
|
| 53 |
+
for (var i=0; i < n; i++) {
|
| 54 |
+
if(!checkall)
|
| 55 |
+
$( "#"+cb+i ).removeAttr("checked").button("refresh");
|
| 56 |
+
else
|
| 57 |
+
$( "#"+cb+i ).attr("checked", true).button("refresh");
|
| 58 |
+
|
| 59 |
+
}
|
| 60 |
+
}
|
javascript/tabber.js
DELETED
|
@@ -1,512 +0,0 @@
|
|
| 1 |
-
function checkAll( n, fldName ) {
|
| 2 |
-
if (!fldName) {
|
| 3 |
-
fldName = 'cb';
|
| 4 |
-
}
|
| 5 |
-
var f = document.adminForm;
|
| 6 |
-
var c = f.toggle.checked;
|
| 7 |
-
var n2 = 0;
|
| 8 |
-
for (i=0; i < n; i++) {
|
| 9 |
-
cb = eval( 'f.' + fldName + '' + i );
|
| 10 |
-
if (cb) {
|
| 11 |
-
cb.checked = c;
|
| 12 |
-
n2++;
|
| 13 |
-
}
|
| 14 |
-
}
|
| 15 |
-
if (c) {
|
| 16 |
-
document.adminForm.boxchecked.value = n2;
|
| 17 |
-
} else {
|
| 18 |
-
document.adminForm.boxchecked.value = 0;
|
| 19 |
-
}
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
function tabberObj(argsObj)
|
| 23 |
-
{
|
| 24 |
-
var arg; /* name of an argument to override */
|
| 25 |
-
|
| 26 |
-
/* Element for the main tabber div. If you supply this in argsObj,
|
| 27 |
-
then the init() method will be called.
|
| 28 |
-
*/
|
| 29 |
-
this.div = null;
|
| 30 |
-
|
| 31 |
-
/* Class of the main tabber div */
|
| 32 |
-
this.classMain = "tabber";
|
| 33 |
-
|
| 34 |
-
/* Rename classMain to classMainLive after tabifying
|
| 35 |
-
(so a different style can be applied)
|
| 36 |
-
*/
|
| 37 |
-
this.classMainLive = "tabberlive";
|
| 38 |
-
|
| 39 |
-
/* Class of each DIV that contains a tab */
|
| 40 |
-
this.classTab = "tabbertab";
|
| 41 |
-
|
| 42 |
-
/* Class to indicate which tab should be active on startup */
|
| 43 |
-
this.classTabDefault = "tabbertabdefault";
|
| 44 |
-
|
| 45 |
-
/* Class for the navigation UL */
|
| 46 |
-
this.classNav = "tabbernav";
|
| 47 |
-
|
| 48 |
-
/* When a tab is to be hidden, instead of setting display='none', we
|
| 49 |
-
set the class of the div to classTabHide. In your screen
|
| 50 |
-
stylesheet you should set classTabHide to display:none. In your
|
| 51 |
-
print stylesheet you should set display:block to ensure that all
|
| 52 |
-
the information is printed.
|
| 53 |
-
*/
|
| 54 |
-
this.classTabHide = "tabbertabhide";
|
| 55 |
-
|
| 56 |
-
/* Class to set the navigation LI when the tab is active, so you can
|
| 57 |
-
use a different style on the active tab.
|
| 58 |
-
*/
|
| 59 |
-
this.classNavActive = "tabberactive";
|
| 60 |
-
|
| 61 |
-
/* Elements that might contain the title for the tab, only used if a
|
| 62 |
-
title is not specified in the TITLE attribute of DIV classTab.
|
| 63 |
-
*/
|
| 64 |
-
this.titleElements = ['h2','h3','h4','h5','h6'];
|
| 65 |
-
|
| 66 |
-
/* Should we strip out the HTML from the innerHTML of the title elements?
|
| 67 |
-
This should usually be true.
|
| 68 |
-
*/
|
| 69 |
-
this.titleElementsStripHTML = true;
|
| 70 |
-
|
| 71 |
-
/* If the user specified the tab names using a TITLE attribute on
|
| 72 |
-
the DIV, then the browser will display a tooltip whenever the
|
| 73 |
-
mouse is over the DIV. To prevent this tooltip, we can remove the
|
| 74 |
-
TITLE attribute after getting the tab name.
|
| 75 |
-
*/
|
| 76 |
-
this.removeTitle = true;
|
| 77 |
-
|
| 78 |
-
/* If you want to add an id to each link set this to true */
|
| 79 |
-
this.addLinkId = false;
|
| 80 |
-
|
| 81 |
-
/* If addIds==true, then you can set a format for the ids.
|
| 82 |
-
<tabberid> will be replaced with the id of the main tabber div.
|
| 83 |
-
<tabnumberzero> will be replaced with the tab number
|
| 84 |
-
(tab numbers starting at zero)
|
| 85 |
-
<tabnumberone> will be replaced with the tab number
|
| 86 |
-
(tab numbers starting at one)
|
| 87 |
-
<tabtitle> will be replaced by the tab title
|
| 88 |
-
(with all non-alphanumeric characters removed)
|
| 89 |
-
*/
|
| 90 |
-
this.linkIdFormat = '<tabberid>nav<tabnumberone>';
|
| 91 |
-
|
| 92 |
-
/* You can override the defaults listed above by passing in an object:
|
| 93 |
-
var mytab = new tabber({property:value,property:value});
|
| 94 |
-
*/
|
| 95 |
-
for (arg in argsObj) { this[arg] = argsObj[arg]; }
|
| 96 |
-
|
| 97 |
-
/* Create regular expressions for the class names; Note: if you
|
| 98 |
-
change the class names after a new object is created you must
|
| 99 |
-
also change these regular expressions.
|
| 100 |
-
*/
|
| 101 |
-
this.REclassMain = new RegExp('\\b' + this.classMain + '\\b', 'gi');
|
| 102 |
-
this.REclassMainLive = new RegExp('\\b' + this.classMainLive + '\\b', 'gi');
|
| 103 |
-
this.REclassTab = new RegExp('\\b' + this.classTab + '\\b', 'gi');
|
| 104 |
-
this.REclassTabDefault = new RegExp('\\b' + this.classTabDefault + '\\b', 'gi');
|
| 105 |
-
this.REclassTabHide = new RegExp('\\b' + this.classTabHide + '\\b', 'gi');
|
| 106 |
-
|
| 107 |
-
/* Array of objects holding info about each tab */
|
| 108 |
-
this.tabs = new Array();
|
| 109 |
-
|
| 110 |
-
/* If the main tabber div was specified, call init() now */
|
| 111 |
-
if (this.div) {
|
| 112 |
-
|
| 113 |
-
this.init(this.div);
|
| 114 |
-
|
| 115 |
-
/* We don't need the main div anymore, and to prevent a memory leak
|
| 116 |
-
in IE, we must remove the circular reference between the div
|
| 117 |
-
and the tabber object. */
|
| 118 |
-
this.div = null;
|
| 119 |
-
}
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
/*--------------------------------------------------
|
| 124 |
-
Methods for tabberObj
|
| 125 |
-
--------------------------------------------------*/
|
| 126 |
-
|
| 127 |
-
|
| 128 |
-
tabberObj.prototype.init = function(e)
|
| 129 |
-
{
|
| 130 |
-
/* Set up the tabber interface.
|
| 131 |
-
|
| 132 |
-
e = element (the main containing div)
|
| 133 |
-
|
| 134 |
-
Example:
|
| 135 |
-
init(document.getElementById('mytabberdiv'))
|
| 136 |
-
*/
|
| 137 |
-
|
| 138 |
-
var
|
| 139 |
-
childNodes, /* child nodes of the tabber div */
|
| 140 |
-
i, i2, /* loop indices */
|
| 141 |
-
t, /* object to store info about a single tab */
|
| 142 |
-
defaultTab=0, /* which tab to select by default */
|
| 143 |
-
DOM_ul, /* tabbernav list */
|
| 144 |
-
DOM_li, /* tabbernav list item */
|
| 145 |
-
DOM_a, /* tabbernav link */
|
| 146 |
-
aId, /* A unique id for DOM_a */
|
| 147 |
-
headingElement; /* searching for text to use in the tab */
|
| 148 |
-
|
| 149 |
-
/* Verify that the browser supports DOM scripting */
|
| 150 |
-
if (!document.getElementsByTagName) { return false; }
|
| 151 |
-
|
| 152 |
-
/* If the main DIV has an ID then save it. */
|
| 153 |
-
if (e.id) {
|
| 154 |
-
this.id = e.id;
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
/* Clear the tabs array (but it should normally be empty) */
|
| 158 |
-
this.tabs.length = 0;
|
| 159 |
-
|
| 160 |
-
/* Loop through an array of all the child nodes within our tabber element. */
|
| 161 |
-
childNodes = e.childNodes;
|
| 162 |
-
for(i=0; i < childNodes.length; i++) {
|
| 163 |
-
|
| 164 |
-
/* Find the nodes where class="tabbertab" */
|
| 165 |
-
if(childNodes[i].className &&
|
| 166 |
-
childNodes[i].className.match(this.REclassTab)) {
|
| 167 |
-
|
| 168 |
-
/* Create a new object to save info about this tab */
|
| 169 |
-
t = new Object();
|
| 170 |
-
|
| 171 |
-
/* Save a pointer to the div for this tab */
|
| 172 |
-
t.div = childNodes[i];
|
| 173 |
-
|
| 174 |
-
/* Add the new object to the array of tabs */
|
| 175 |
-
this.tabs[this.tabs.length] = t;
|
| 176 |
-
|
| 177 |
-
/* If the class name contains classTabDefault,
|
| 178 |
-
then select this tab by default.
|
| 179 |
-
*/
|
| 180 |
-
if (childNodes[i].className.match(this.REclassTabDefault)) {
|
| 181 |
-
defaultTab = this.tabs.length-1;
|
| 182 |
-
}
|
| 183 |
-
}
|
| 184 |
-
}
|
| 185 |
-
|
| 186 |
-
/* Create a new UL list to hold the tab headings */
|
| 187 |
-
DOM_ul = document.createElement("ul");
|
| 188 |
-
DOM_ul.className = this.classNav;
|
| 189 |
-
|
| 190 |
-
/* Loop through each tab we found */
|
| 191 |
-
for (i=0; i < this.tabs.length; i++) {
|
| 192 |
-
|
| 193 |
-
t = this.tabs[i];
|
| 194 |
-
|
| 195 |
-
/* Get the label to use for this tab:
|
| 196 |
-
From the title attribute on the DIV,
|
| 197 |
-
Or from one of the this.titleElements[] elements,
|
| 198 |
-
Or use an automatically generated number.
|
| 199 |
-
*/
|
| 200 |
-
t.headingText = t.div.title;
|
| 201 |
-
|
| 202 |
-
/* Remove the title attribute to prevent a tooltip from appearing */
|
| 203 |
-
if (this.removeTitle) { t.div.title = ''; }
|
| 204 |
-
|
| 205 |
-
if (!t.headingText) {
|
| 206 |
-
|
| 207 |
-
/* Title was not defined in the title of the DIV,
|
| 208 |
-
So try to get the title from an element within the DIV.
|
| 209 |
-
Go through the list of elements in this.titleElements
|
| 210 |
-
(typically heading elements ['h2','h3','h4'])
|
| 211 |
-
*/
|
| 212 |
-
for (i2=0; i2<this.titleElements.length; i2++) {
|
| 213 |
-
headingElement = t.div.getElementsByTagName(this.titleElements[i2])[0];
|
| 214 |
-
if (headingElement) {
|
| 215 |
-
t.headingText = headingElement.innerHTML;
|
| 216 |
-
if (this.titleElementsStripHTML) {
|
| 217 |
-
t.headingText.replace(/<br>/gi," ");
|
| 218 |
-
t.headingText = t.headingText.replace(/<[^>]+>/g,"");
|
| 219 |
-
}
|
| 220 |
-
break;
|
| 221 |
-
}
|
| 222 |
-
}
|
| 223 |
-
}
|
| 224 |
-
|
| 225 |
-
if (!t.headingText) {
|
| 226 |
-
/* Title was not found (or is blank) so automatically generate a
|
| 227 |
-
number for the tab.
|
| 228 |
-
*/
|
| 229 |
-
t.headingText = i + 1;
|
| 230 |
-
}
|
| 231 |
-
|
| 232 |
-
/* Create a list element for the tab */
|
| 233 |
-
DOM_li = document.createElement("li");
|
| 234 |
-
|
| 235 |
-
/* Save a reference to this list item so we can later change it to
|
| 236 |
-
the "active" class */
|
| 237 |
-
t.li = DOM_li;
|
| 238 |
-
|
| 239 |
-
/* Create a link to activate the tab */
|
| 240 |
-
DOM_a = document.createElement("a");
|
| 241 |
-
DOM_a.appendChild(document.createTextNode(t.headingText));
|
| 242 |
-
DOM_a.href = "javascript:void(null);";
|
| 243 |
-
DOM_a.title = t.headingText;
|
| 244 |
-
DOM_a.onclick = this.navClick;
|
| 245 |
-
|
| 246 |
-
/* Add some properties to the link so we can identify which tab
|
| 247 |
-
was clicked. Later the navClick method will need this.
|
| 248 |
-
*/
|
| 249 |
-
DOM_a.tabber = this;
|
| 250 |
-
DOM_a.tabberIndex = i;
|
| 251 |
-
|
| 252 |
-
/* Do we need to add an id to DOM_a? */
|
| 253 |
-
if (this.addLinkId && this.linkIdFormat) {
|
| 254 |
-
|
| 255 |
-
/* Determine the id name */
|
| 256 |
-
aId = this.linkIdFormat;
|
| 257 |
-
aId = aId.replace(/<tabberid>/gi, this.id);
|
| 258 |
-
aId = aId.replace(/<tabnumberzero>/gi, i);
|
| 259 |
-
aId = aId.replace(/<tabnumberone>/gi, i+1);
|
| 260 |
-
aId = aId.replace(/<tabtitle>/gi, t.headingText.replace(/[^a-zA-Z0-9\-]/gi, ''));
|
| 261 |
-
|
| 262 |
-
DOM_a.id = aId;
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
/* Add the link to the list element */
|
| 266 |
-
DOM_li.appendChild(DOM_a);
|
| 267 |
-
|
| 268 |
-
/* Add the list element to the list */
|
| 269 |
-
DOM_ul.appendChild(DOM_li);
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
/* Add the UL list to the beginning of the tabber div */
|
| 273 |
-
e.insertBefore(DOM_ul, e.firstChild);
|
| 274 |
-
|
| 275 |
-
/* Make the tabber div "live" so different CSS can be applied */
|
| 276 |
-
e.className = e.className.replace(this.REclassMain, this.classMainLive);
|
| 277 |
-
|
| 278 |
-
/* Activate the default tab, and do not call the onclick handler */
|
| 279 |
-
this.tabShow(defaultTab);
|
| 280 |
-
|
| 281 |
-
/* If the user specified an onLoad function, call it now. */
|
| 282 |
-
if (typeof this.onLoad == 'function') {
|
| 283 |
-
this.onLoad({tabber:this});
|
| 284 |
-
}
|
| 285 |
-
|
| 286 |
-
return this;
|
| 287 |
-
};
|
| 288 |
-
|
| 289 |
-
|
| 290 |
-
tabberObj.prototype.navClick = function(event)
|
| 291 |
-
{
|
| 292 |
-
/* This method should only be called by the onClick event of an <A>
|
| 293 |
-
element, in which case we will determine which tab was clicked by
|
| 294 |
-
examining a property that we previously attached to the <A>
|
| 295 |
-
element.
|
| 296 |
-
|
| 297 |
-
Since this was triggered from an onClick event, the variable
|
| 298 |
-
"this" refers to the <A> element that triggered the onClick
|
| 299 |
-
event (and not to the tabberObj).
|
| 300 |
-
|
| 301 |
-
When tabberObj was initialized, we added some extra properties
|
| 302 |
-
to the <A> element, for the purpose of retrieving them now. Get
|
| 303 |
-
the tabberObj object, plus the tab number that was clicked.
|
| 304 |
-
*/
|
| 305 |
-
|
| 306 |
-
var
|
| 307 |
-
rVal, /* Return value from the user onclick function */
|
| 308 |
-
a, /* element that triggered the onclick event */
|
| 309 |
-
self, /* the tabber object */
|
| 310 |
-
tabberIndex, /* index of the tab that triggered the event */
|
| 311 |
-
onClickArgs; /* args to send the onclick function */
|
| 312 |
-
|
| 313 |
-
a = this;
|
| 314 |
-
if (!a.tabber) { return false; }
|
| 315 |
-
|
| 316 |
-
self = a.tabber;
|
| 317 |
-
tabberIndex = a.tabberIndex;
|
| 318 |
-
|
| 319 |
-
/* Remove focus from the link because it looks ugly.
|
| 320 |
-
I don't know if this is a good idea...
|
| 321 |
-
*/
|
| 322 |
-
a.blur();
|
| 323 |
-
|
| 324 |
-
/* If the user specified an onClick function, call it now.
|
| 325 |
-
If the function returns false then do not continue.
|
| 326 |
-
*/
|
| 327 |
-
if (typeof self.onClick == 'function') {
|
| 328 |
-
|
| 329 |
-
onClickArgs = {'tabber':self, 'index':tabberIndex, 'event':event};
|
| 330 |
-
|
| 331 |
-
/* IE uses a different way to access the event object */
|
| 332 |
-
if (!event) { onClickArgs.event = window.event; }
|
| 333 |
-
|
| 334 |
-
rVal = self.onClick(onClickArgs);
|
| 335 |
-
if (rVal === false) { return false; }
|
| 336 |
-
}
|
| 337 |
-
|
| 338 |
-
self.tabShow(tabberIndex);
|
| 339 |
-
|
| 340 |
-
return false;
|
| 341 |
-
};
|
| 342 |
-
|
| 343 |
-
|
| 344 |
-
tabberObj.prototype.tabHideAll = function()
|
| 345 |
-
{
|
| 346 |
-
var i; /* counter */
|
| 347 |
-
|
| 348 |
-
/* Hide all tabs and make all navigation links inactive */
|
| 349 |
-
for (i = 0; i < this.tabs.length; i++) {
|
| 350 |
-
this.tabHide(i);
|
| 351 |
-
}
|
| 352 |
-
};
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
tabberObj.prototype.tabHide = function(tabberIndex)
|
| 356 |
-
{
|
| 357 |
-
var div;
|
| 358 |
-
|
| 359 |
-
if (!this.tabs[tabberIndex]) { return false; }
|
| 360 |
-
|
| 361 |
-
/* Hide a single tab and make its navigation link inactive */
|
| 362 |
-
div = this.tabs[tabberIndex].div;
|
| 363 |
-
|
| 364 |
-
/* Hide the tab contents by adding classTabHide to the div */
|
| 365 |
-
if (!div.className.match(this.REclassTabHide)) {
|
| 366 |
-
div.className += ' ' + this.classTabHide;
|
| 367 |
-
}
|
| 368 |
-
this.navClearActive(tabberIndex);
|
| 369 |
-
|
| 370 |
-
return this;
|
| 371 |
-
};
|
| 372 |
-
|
| 373 |
-
|
| 374 |
-
tabberObj.prototype.tabShow = function(tabberIndex)
|
| 375 |
-
{
|
| 376 |
-
/* Show the tabberIndex tab and hide all the other tabs */
|
| 377 |
-
|
| 378 |
-
var div;
|
| 379 |
-
|
| 380 |
-
if (!this.tabs[tabberIndex]) { return false; }
|
| 381 |
-
|
| 382 |
-
/* Hide all the tabs first */
|
| 383 |
-
this.tabHideAll();
|
| 384 |
-
|
| 385 |
-
/* Get the div that holds this tab */
|
| 386 |
-
div = this.tabs[tabberIndex].div;
|
| 387 |
-
|
| 388 |
-
/* Remove classTabHide from the div */
|
| 389 |
-
div.className = div.className.replace(this.REclassTabHide, '');
|
| 390 |
-
|
| 391 |
-
/* Mark this tab navigation link as "active" */
|
| 392 |
-
this.navSetActive(tabberIndex);
|
| 393 |
-
|
| 394 |
-
/* If the user specified an onTabDisplay function, call it now. */
|
| 395 |
-
if (typeof this.onTabDisplay == 'function') {
|
| 396 |
-
this.onTabDisplay({'tabber':this, 'index':tabberIndex});
|
| 397 |
-
}
|
| 398 |
-
|
| 399 |
-
return this;
|
| 400 |
-
};
|
| 401 |
-
|
| 402 |
-
tabberObj.prototype.navSetActive = function(tabberIndex)
|
| 403 |
-
{
|
| 404 |
-
/* Note: this method does *not* enforce the rule
|
| 405 |
-
that only one nav item can be active at a time.
|
| 406 |
-
*/
|
| 407 |
-
|
| 408 |
-
/* Set classNavActive for the navigation list item */
|
| 409 |
-
this.tabs[tabberIndex].li.className = this.classNavActive;
|
| 410 |
-
|
| 411 |
-
return this;
|
| 412 |
-
};
|
| 413 |
-
|
| 414 |
-
|
| 415 |
-
tabberObj.prototype.navClearActive = function(tabberIndex)
|
| 416 |
-
{
|
| 417 |
-
/* Note: this method does *not* enforce the rule
|
| 418 |
-
that one nav should always be active.
|
| 419 |
-
*/
|
| 420 |
-
|
| 421 |
-
/* Remove classNavActive from the navigation list item */
|
| 422 |
-
this.tabs[tabberIndex].li.className = '';
|
| 423 |
-
|
| 424 |
-
return this;
|
| 425 |
-
};
|
| 426 |
-
|
| 427 |
-
|
| 428 |
-
/*==================================================*/
|
| 429 |
-
|
| 430 |
-
|
| 431 |
-
function tabberAutomatic(tabberArgs)
|
| 432 |
-
{
|
| 433 |
-
/* This function finds all DIV elements in the document where
|
| 434 |
-
class=tabber.classMain, then converts them to use the tabber
|
| 435 |
-
interface.
|
| 436 |
-
|
| 437 |
-
tabberArgs = an object to send to "new tabber()"
|
| 438 |
-
*/
|
| 439 |
-
var
|
| 440 |
-
tempObj, /* Temporary tabber object */
|
| 441 |
-
divs, /* Array of all divs on the page */
|
| 442 |
-
i; /* Loop index */
|
| 443 |
-
|
| 444 |
-
if (!tabberArgs) { tabberArgs = {}; }
|
| 445 |
-
|
| 446 |
-
/* Create a tabber object so we can get the value of classMain */
|
| 447 |
-
tempObj = new tabberObj(tabberArgs);
|
| 448 |
-
|
| 449 |
-
/* Find all DIV elements in the document that have class=tabber */
|
| 450 |
-
|
| 451 |
-
/* First get an array of all DIV elements and loop through them */
|
| 452 |
-
divs = document.getElementsByTagName("div");
|
| 453 |
-
for (i=0; i < divs.length; i++) {
|
| 454 |
-
|
| 455 |
-
/* Is this DIV the correct class? */
|
| 456 |
-
if (divs[i].className &&
|
| 457 |
-
divs[i].className.match(tempObj.REclassMain)) {
|
| 458 |
-
|
| 459 |
-
/* Now tabify the DIV */
|
| 460 |
-
tabberArgs.div = divs[i];
|
| 461 |
-
divs[i].tabber = new tabberObj(tabberArgs);
|
| 462 |
-
}
|
| 463 |
-
}
|
| 464 |
-
|
| 465 |
-
return this;
|
| 466 |
-
}
|
| 467 |
-
|
| 468 |
-
|
| 469 |
-
/*==================================================*/
|
| 470 |
-
|
| 471 |
-
|
| 472 |
-
function tabberAutomaticOnLoad(tabberArgs)
|
| 473 |
-
{
|
| 474 |
-
/* This function adds tabberAutomatic to the window.onload event,
|
| 475 |
-
so it will run after the document has finished loading.
|
| 476 |
-
*/
|
| 477 |
-
var oldOnLoad;
|
| 478 |
-
|
| 479 |
-
if (!tabberArgs) { tabberArgs = {}; }
|
| 480 |
-
|
| 481 |
-
/* Taken from: http://simon.incutio.com/archive/2004/05/26/addLoadEvent */
|
| 482 |
-
|
| 483 |
-
oldOnLoad = window.onload;
|
| 484 |
-
if (typeof window.onload != 'function') {
|
| 485 |
-
window.onload = function() {
|
| 486 |
-
tabberAutomatic(tabberArgs);
|
| 487 |
-
};
|
| 488 |
-
} else {
|
| 489 |
-
window.onload = function() {
|
| 490 |
-
oldOnLoad();
|
| 491 |
-
tabberAutomatic(tabberArgs);
|
| 492 |
-
};
|
| 493 |
-
}
|
| 494 |
-
}
|
| 495 |
-
|
| 496 |
-
|
| 497 |
-
/*==================================================*/
|
| 498 |
-
|
| 499 |
-
|
| 500 |
-
/* Run tabberAutomaticOnload() unless the "manualStartup" option was specified */
|
| 501 |
-
|
| 502 |
-
if (typeof tabberOptions == 'undefined') {
|
| 503 |
-
|
| 504 |
-
tabberAutomaticOnLoad();
|
| 505 |
-
|
| 506 |
-
} else {
|
| 507 |
-
|
| 508 |
-
if (!tabberOptions['manualStartup']) {
|
| 509 |
-
tabberAutomaticOnLoad(tabberOptions);
|
| 510 |
-
}
|
| 511 |
-
|
| 512 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
language/deutsch.php
CHANGED
|
File without changes
|
language/dutch.php
CHANGED
|
File without changes
|
language/english.php
CHANGED
|
@@ -14,7 +14,7 @@ define("LM_FRONT_FTP_USER_SUB","<small>example john</small>");
|
|
| 14 |
define("LM_FRONT_FTP_PASS","<b>Ftp password:</b>");
|
| 15 |
define("LM_FRONT_FTP_PASS_SUB","<small>example johnpass</small>");
|
| 16 |
define("LM_FRONT_FTP_DIR","<b>Ftp directory:</b>");
|
| 17 |
-
define("LM_FRONT_FTP_DIR_SUB","<small>Please provide the ftp directory of where you would like to install Joomla, example public_html/Joomla/ or htdocs/Joomla/ and make sure it has write permissions for everybody
|
| 18 |
define("LM_TRANSFER_FTP_INCT","Incremental transfer: ");
|
| 19 |
define("LM_TRANSFER_FTP_INCT_SUB","will attempt to transfer the files over ftp in an incremental mode to avoid any blank pages or timeouts ");
|
| 20 |
define("LM_FRONT_BOTTOM","Didn't worked for you? Please tell us what happened -> <a href='http://www.xcloner.com/contact/'>Contact page</a><br />
|
|
@@ -26,7 +26,7 @@ define("LM_NOPAKCAGE_ERROR","There is no package selected, aborting...!");
|
|
| 26 |
|
| 27 |
//Amazon S3
|
| 28 |
define("LM_AMAZON_S3", "Amazon S3 Storage");
|
| 29 |
-
define("LM_AMAZON_S3_ACTIVATE", "
|
| 30 |
define("LM_AMAZON_S3_AWSACCESSKEY", "AWS Access Key:");
|
| 31 |
define("LM_AMAZON_S3_AWSSECRETKEY", "AWS Secret Key:");
|
| 32 |
define("LM_AMAZON_S3_BUCKET", "Bucket name:");
|
|
@@ -63,8 +63,8 @@ define("LM_CONFIG_MYSQLU_SUB","");
|
|
| 63 |
define("LM_CONFIG_MYSQLP_SUB","");
|
| 64 |
define("LM_CONFIG_MYSQLD_SUB","");
|
| 65 |
|
| 66 |
-
define("LM_TAB_AUTH","
|
| 67 |
-
define("LM_CONFIG_AUTH","User
|
| 68 |
define("LM_CONFIG_AUTH_USER","Login Username:");
|
| 69 |
define("LM_CONFIG_AUTH_PASS","Login Password:");
|
| 70 |
define("LM_CONFIG_AUTH_USER_SUB","this will be your default login user to XCloner");
|
|
@@ -72,7 +72,7 @@ define("LM_CONFIG_AUTH_PASS_SUB", "your default login password, leave blank if y
|
|
| 72 |
|
| 73 |
define("LM_YES","Yes");
|
| 74 |
define("LM_NO", "No");
|
| 75 |
-
define("LM_ACTIVE","Active
|
| 76 |
define("LM_TAR_PATH","Tar path or command:");
|
| 77 |
define("LM_TAR_PATH_SUB","(required if archive type is Tar and Active box checked)");
|
| 78 |
define("LM_ZIP_PATH","Zip path or command:");
|
|
@@ -84,10 +84,12 @@ define("LM_MYSQLDUMP_PATH","Mysqldump path or command: (required if Active box
|
|
| 84 |
define("LM_CONFIG_MANUAL","Backup Manual Process");
|
| 85 |
define("LM_CONFIG_MANUAL_BACKUP","Manual backup:");
|
| 86 |
define("LM_CONFIG_MANUAL_BACKUP_SUB","This option is indicated if you have php time execution limitations on your server, this will require javascript activated on your browser");
|
| 87 |
-
define("LM_CONFIG_MANUAL_FILES","Files to process per
|
| 88 |
-
define("
|
|
|
|
| 89 |
define("LM_CONFIG_SYSTEM_MDATABASES","Backup Multiple Databases:");
|
| 90 |
define("LM_CONFIG_SYSTEM_MDATABASES_SUB","this option controls wheteher XCloner may backup multiple databases");
|
|
|
|
| 91 |
|
| 92 |
define("LM_CONFIG_CRON_LOCAL","Local server*");
|
| 93 |
define("LM_CONFIG_CRON_REMOTE","Remote ftp account");
|
|
@@ -112,7 +114,7 @@ define("LM_CRON_IP","Cron Allowed IP's:");
|
|
| 112 |
define("LM_CRON_IP_SUB","<small>by default, only the local server will have access to the cron job, but you may enter also other IP's one per line</small>");
|
| 113 |
define("LM_CRON_DELETE_FILES","Delete Older Backups");
|
| 114 |
define("LM_CRON_DELETE_FILES_SUB","Delete backups older than: ");
|
| 115 |
-
define("LM_CRON_DELETE_FILES_SUB_ACTIVE","
|
| 116 |
define("LM_CRON_SEMAIL","Email cron log to: ");
|
| 117 |
define("LM_CRON_SEMAIL_SUB","If an email address is set, after running a cron job, the cron log will be emailed to this address; multiple addresses can be added separated by ;");
|
| 118 |
define("LM_CRON_MCRON","Configuration Name:");
|
|
@@ -120,6 +122,8 @@ define("LM_CRON_MCRON_AVAIL","Available Configurations:");
|
|
| 120 |
define("LM_CRON_MCRON_R","please provide a simple name for your new cron configuration");
|
| 121 |
define("LM_CRON_MCRON_SUB","with this option you will be able to save the current configuration in a separate file and use it for running multiple cronjobs");
|
| 122 |
define("LM_CRON_SETTINGS_M","Multiple CronJobs Configuration");
|
|
|
|
|
|
|
| 123 |
// --- MENU ---//
|
| 124 |
define("LM_MENU_OPEN_ALL", "open all");
|
| 125 |
define("LM_MENU_CLOSE_ALL", "close all");
|
|
@@ -166,9 +170,11 @@ define("LM_TAB_CRON","Cron");
|
|
| 166 |
define("LM_TAB_INFO","Info");
|
| 167 |
define("LM_TAB_G_DATABASE","Database Options");
|
| 168 |
define("LM_TAB_G_FILES","Files Options");
|
|
|
|
| 169 |
define("LM_G_EXCLUDE_COMMENT","<br>Please enter here the excluded folders, each one per line!
|
| 170 |
<br><b>you may want to disable the cache feature when doing a backup, or if not exlude the cache folder from the backup</b>");
|
| 171 |
-
|
|
|
|
| 172 |
|
| 173 |
// --- MESSAGES --//
|
| 174 |
// front end
|
|
@@ -197,9 +203,9 @@ define("LM_MSG_BACK_14","<font color='red'>There was a problem in generating the
|
|
| 197 |
|
| 198 |
|
| 199 |
|
| 200 |
-
define("LM_CRON_TOP","
|
| 201 |
-
define("LM_CRON_SUB","<b>Using the cron function you can setup an automated backup generator for your
|
| 202 |
-
To set it up you need to add in your control panel crontab the following
|
| 203 |
define("LM_CRON_HELP","Notes:
|
| 204 |
- if you php location is diferent than /usr/bin/php please use that one, format /$"."php_path/php
|
| 205 |
|
|
@@ -210,8 +216,7 @@ For more info on how to setup a cron for
|
|
| 210 |
- Interworx <a href='http://www.sagonet.com/interworx/tutorials/siteworx/cron.php' target='_blank'>click here</a>
|
| 211 |
- General Linux crontab info <a href='http://www.computerhope.com/unix/ucrontab.htm#01' target='_blank'>click here</a>
|
| 212 |
|
| 213 |
-
If you need help setting
|
| 214 |
-
or email us at <a href='mailto:info@xcloner.com'>info@xcloner.com</a>");
|
| 215 |
define("LM_CRON_SETTINGS","Cron settings");
|
| 216 |
define("LM_CRON_MODE","Backup store mode:");
|
| 217 |
define("LM_CRON_MODE_INFO"," <br />
|
|
@@ -221,19 +226,19 @@ define("LM_CRON_MODE_INFO"," <br />
|
|
| 221 |
");
|
| 222 |
define("LM_CRON_TYPE_INFO","<small><br /> please choose your backup type you would like to create</small>");
|
| 223 |
define("LM_CRON_MYSQL_DETAILS","Mysql Options");
|
| 224 |
-
define("LM_CRON_MYSQL_DROP","Add Mysql Drop
|
| 225 |
define("LM_CRON_TYPE","Backup type:");
|
| 226 |
define("LM_CRON_FTP_DETAILS","Ftp store mode details:");
|
| 227 |
define("LM_CRON_FTP_SERVER","Ftp server:");
|
| 228 |
define("LM_CRON_FTP_USER","Ftp username:");
|
| 229 |
define("LM_CRON_FTP_PASS","Ftp password:");
|
| 230 |
define("LM_CRON_FTP_PATH","Ftp path:");
|
| 231 |
-
define("LM_CRON_FTP_DELB","Delete backup after transfer
|
| 232 |
define("LM_CRON_EMAIL_DETAILS","Email mode details:");
|
| 233 |
define("LM_CRON_EMAIL_ACCOUNT","Email account:");
|
| 234 |
define("LM_CRON_COMPRESS","Compress backup files:");
|
| 235 |
-
define("LM_RESTORE_TOP","Restoring your backups info
|
| 236 |
-
define("LM_CREDIT_TOP","About XCloner
|
| 237 |
define("LM_CLONE_FORM_TOP","<h2>Provide your ftp details below:</h2>");
|
| 238 |
|
| 239 |
// --- Info Tab ---//
|
|
@@ -261,7 +266,7 @@ define("LM_CONFIG_INFO_TIME","<small>This controls the maximum time your script
|
|
| 261 |
define("LM_CONFIG_INFO_MEMORY","<small>This controls the maximum memory the script may allocate for it's processes</small>");
|
| 262 |
define("LM_CONFIG_INFO_BASEDIR","<small>This controls the paths your script is allowed to access, no value means it can access any path </small>");
|
| 263 |
define("LM_CONFIG_INFO_SAFEMODE","<small>safe mode will need to be set to Off in order for XCloner to work properly </small>");
|
| 264 |
-
define("LM_CONFIG_INFO_VERSION","<small>PHP >=5.2.
|
| 265 |
define("LM_CONFIG_INFO_TAR","<small>If the script is unable to determine the tar path automatically, you might need to uncheck the 'Active' checkbox near TAR line in General Tab</small>");
|
| 266 |
define("LM_CONFIG_INFO_ZIP","<small>If the script is unable to determine the zip path automatically, you might need to uncheck the 'Active' checkbox near ZIP line in General Tab</small>");
|
| 267 |
define("LM_CONFIG_INFO_MSQL","<small>If the script is unable to determine the mysqldump path automatically, you might need to uncheck the 'Active' checkbox near MYSQLDUMP line in General Tabn</small>");
|
|
@@ -280,7 +285,7 @@ define("LM_TRANSFER_FTP_USER_SUB","example 'john'");
|
|
| 280 |
define("LM_TRANSFER_FTP_PASS","Ftp password:");
|
| 281 |
define("LM_TRANSFER_FTP_PASS_SUB","example 'johnpass'");
|
| 282 |
define("LM_TRANSFER_FTP_DIR","Ftp directory:");
|
| 283 |
-
define("LM_TRANSFER_FTP_DIR_SUB","Please provide the ftp directory of where you would like to move the backup , example public_html/ or htdocs/ and make sure it has write permissions for everybody
|
| 284 |
|
| 285 |
|
| 286 |
// --- GENERATE BACKUP---//
|
|
@@ -301,7 +306,7 @@ define("LM_COL_DATE" , "Date of Backup");
|
|
| 301 |
define("LM_COL_FOLDER" , "<b>Excluded Folders and/or files</b>");
|
| 302 |
|
| 303 |
define("LM_DELETE_FILE_SUCCESS", "Files Deleted");
|
| 304 |
-
define("LM_DOWNLOAD_TITLE", "Download
|
| 305 |
|
| 306 |
|
| 307 |
define("LM_ARCHIVE_NAME" , "Archive Name");
|
|
@@ -313,7 +318,7 @@ define("LM_DATABASE_ARCHIVE" , "Database Backup");
|
|
| 313 |
|
| 314 |
define("LM_CONFIRM_INSTRUCTIONS" , "<b>Please select the folders you wish to exclude from archive</b> <br />
|
| 315 |
- by default all folders are included, if you wish to exlude a folder and it's subfolders just check the box next to it");
|
| 316 |
-
define("LM_CONFIRM_DATABASE" , "Backup
|
| 317 |
|
| 318 |
|
| 319 |
define("LM_DATABASE_EXCLUDED", "Excluded");
|
|
@@ -330,11 +335,11 @@ define("LM_RENAME","Rename clone ");
|
|
| 330 |
define("LM_RENAME_TO"," to ");
|
| 331 |
// --- CLONER RESTORE--- //
|
| 332 |
|
| 333 |
-
define("LM_CLONER_RESTORE","<h2>How to restore a backup on different locations INFO!</h2
|
| 334 |
<pre>
|
| 335 |
Restoring your backups has never been more easier!
|
| 336 |
With the help of our cloning function from the <a href='index2.php?option=com_cloner&task=view'>View Backups</a> screen
|
| 337 |
-
you will be able to move your
|
| 338 |
|
| 339 |
Here is what you have to do:
|
| 340 |
|
|
@@ -356,7 +361,7 @@ define("LM_CLONER_RESTORE","<h2>How to restore a backup on different locations I
|
|
| 356 |
<b>Step 2 - the XCloner.php restore screen:</b>
|
| 357 |
|
| 358 |
<b>XCloner.php - the restore script</b>
|
| 359 |
-
-
|
| 360 |
- enter you new mysql details, this includes your new mysql hostname, user and pass, and a new database
|
| 361 |
different from the original one
|
| 362 |
- enter you new location Url and pass
|
|
@@ -381,19 +386,27 @@ define("LM_CLONER_RESTORE","<h2>How to restore a backup on different locations I
|
|
| 381 |
// --- ABOUT CLONER---//
|
| 382 |
|
| 383 |
define("LM_CLONER_ABOUT","<h2>XCloner Backup</h2>
|
| 384 |
-
|
| 385 |
-
|
| 386 |
Features:
|
| 387 |
-
|
| 388 |
-
|
| 389 |
-
|
| 390 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 391 |
|
| 392 |
For reports and suggestions please contact us at info@xcloner.com or visit us on <a href='http://www.xcloner.com'>http://www.xcloner.com</a>
|
| 393 |
-
|
| 394 |
<br/><br/>
|
| 395 |
|
| 396 |
-
XCloner.com © 2004-
|
| 397 |
<br/><p/><br/>
|
| 398 |
");
|
| 399 |
|
| 14 |
define("LM_FRONT_FTP_PASS","<b>Ftp password:</b>");
|
| 15 |
define("LM_FRONT_FTP_PASS_SUB","<small>example johnpass</small>");
|
| 16 |
define("LM_FRONT_FTP_DIR","<b>Ftp directory:</b>");
|
| 17 |
+
define("LM_FRONT_FTP_DIR_SUB","<small>Please provide the ftp directory of where you would like to install Joomla, example public_html/Joomla/ or htdocs/Joomla/ and make sure it has write permissions for everybody</small>");
|
| 18 |
define("LM_TRANSFER_FTP_INCT","Incremental transfer: ");
|
| 19 |
define("LM_TRANSFER_FTP_INCT_SUB","will attempt to transfer the files over ftp in an incremental mode to avoid any blank pages or timeouts ");
|
| 20 |
define("LM_FRONT_BOTTOM","Didn't worked for you? Please tell us what happened -> <a href='http://www.xcloner.com/contact/'>Contact page</a><br />
|
| 26 |
|
| 27 |
//Amazon S3
|
| 28 |
define("LM_AMAZON_S3", "Amazon S3 Storage");
|
| 29 |
+
define("LM_AMAZON_S3_ACTIVATE", "Activate");
|
| 30 |
define("LM_AMAZON_S3_AWSACCESSKEY", "AWS Access Key:");
|
| 31 |
define("LM_AMAZON_S3_AWSSECRETKEY", "AWS Secret Key:");
|
| 32 |
define("LM_AMAZON_S3_BUCKET", "Bucket name:");
|
| 63 |
define("LM_CONFIG_MYSQLP_SUB","");
|
| 64 |
define("LM_CONFIG_MYSQLD_SUB","");
|
| 65 |
|
| 66 |
+
define("LM_TAB_AUTH","Authentication");
|
| 67 |
+
define("LM_CONFIG_AUTH","User Authentication Area");
|
| 68 |
define("LM_CONFIG_AUTH_USER","Login Username:");
|
| 69 |
define("LM_CONFIG_AUTH_PASS","Login Password:");
|
| 70 |
define("LM_CONFIG_AUTH_USER_SUB","this will be your default login user to XCloner");
|
| 72 |
|
| 73 |
define("LM_YES","Yes");
|
| 74 |
define("LM_NO", "No");
|
| 75 |
+
define("LM_ACTIVE","Active");
|
| 76 |
define("LM_TAR_PATH","Tar path or command:");
|
| 77 |
define("LM_TAR_PATH_SUB","(required if archive type is Tar and Active box checked)");
|
| 78 |
define("LM_ZIP_PATH","Zip path or command:");
|
| 84 |
define("LM_CONFIG_MANUAL","Backup Manual Process");
|
| 85 |
define("LM_CONFIG_MANUAL_BACKUP","Manual backup:");
|
| 86 |
define("LM_CONFIG_MANUAL_BACKUP_SUB","This option is indicated if you have php time execution limitations on your server, this will require javascript activated on your browser");
|
| 87 |
+
define("LM_CONFIG_MANUAL_FILES","Files to process per request:");
|
| 88 |
+
define("LM_CONFIG_DB_RECORDS", "Database records per request");
|
| 89 |
+
define("LM_CONFIG_MANUAL_REFRESH","Time between requests:");
|
| 90 |
define("LM_CONFIG_SYSTEM_MDATABASES","Backup Multiple Databases:");
|
| 91 |
define("LM_CONFIG_SYSTEM_MDATABASES_SUB","this option controls wheteher XCloner may backup multiple databases");
|
| 92 |
+
define("LM_CONFIG_EXCLUDE_FILES_SIZE","Exclude files larger than:");
|
| 93 |
|
| 94 |
define("LM_CONFIG_CRON_LOCAL","Local server*");
|
| 95 |
define("LM_CONFIG_CRON_REMOTE","Remote ftp account");
|
| 114 |
define("LM_CRON_IP_SUB","<small>by default, only the local server will have access to the cron job, but you may enter also other IP's one per line</small>");
|
| 115 |
define("LM_CRON_DELETE_FILES","Delete Older Backups");
|
| 116 |
define("LM_CRON_DELETE_FILES_SUB","Delete backups older than: ");
|
| 117 |
+
define("LM_CRON_DELETE_FILES_SUB_ACTIVE"," Activate");
|
| 118 |
define("LM_CRON_SEMAIL","Email cron log to: ");
|
| 119 |
define("LM_CRON_SEMAIL_SUB","If an email address is set, after running a cron job, the cron log will be emailed to this address; multiple addresses can be added separated by ;");
|
| 120 |
define("LM_CRON_MCRON","Configuration Name:");
|
| 122 |
define("LM_CRON_MCRON_R","please provide a simple name for your new cron configuration");
|
| 123 |
define("LM_CRON_MCRON_SUB","with this option you will be able to save the current configuration in a separate file and use it for running multiple cronjobs");
|
| 124 |
define("LM_CRON_SETTINGS_M","Multiple CronJobs Configuration");
|
| 125 |
+
define("LM_CONFIG_SPLIT_BACKUP_SIZE", "Split Backup Archive if size larger than:");
|
| 126 |
+
|
| 127 |
// --- MENU ---//
|
| 128 |
define("LM_MENU_OPEN_ALL", "open all");
|
| 129 |
define("LM_MENU_CLOSE_ALL", "close all");
|
| 170 |
define("LM_TAB_INFO","Info");
|
| 171 |
define("LM_TAB_G_DATABASE","Database Options");
|
| 172 |
define("LM_TAB_G_FILES","Files Options");
|
| 173 |
+
define("LM_TAB_G_COMMENTS","Backup Comments");
|
| 174 |
define("LM_G_EXCLUDE_COMMENT","<br>Please enter here the excluded folders, each one per line!
|
| 175 |
<br><b>you may want to disable the cache feature when doing a backup, or if not exlude the cache folder from the backup</b>");
|
| 176 |
+
define("LM_TAB_G_COMMENTS_H2", "Enter below any additional comments to archive:");
|
| 177 |
+
define("LM_TAB_G_COMMENTS_NOTE","Please note, the comments are store inside the archive, file <b>administrator/backups/.comments</b>");
|
| 178 |
|
| 179 |
// --- MESSAGES --//
|
| 180 |
// front end
|
| 203 |
|
| 204 |
|
| 205 |
|
| 206 |
+
define("LM_CRON_TOP","Cron Command Setup");
|
| 207 |
+
define("LM_CRON_SUB","<b>Using the cron function you can setup an automated backup generator for your website!</b>
|
| 208 |
+
<br />To set it up, you need to add in your control panel crontab one of the following commands:");
|
| 209 |
define("LM_CRON_HELP","Notes:
|
| 210 |
- if you php location is diferent than /usr/bin/php please use that one, format /$"."php_path/php
|
| 211 |
|
| 216 |
- Interworx <a href='http://www.sagonet.com/interworx/tutorials/siteworx/cron.php' target='_blank'>click here</a>
|
| 217 |
- General Linux crontab info <a href='http://www.computerhope.com/unix/ucrontab.htm#01' target='_blank'>click here</a>
|
| 218 |
|
| 219 |
+
If you need help setting up your cron job, please visit our forums <a href='http://www.xcloner.com/support/forums/'>http://www.xcloner.com/support/forums/</a>");
|
|
|
|
| 220 |
define("LM_CRON_SETTINGS","Cron settings");
|
| 221 |
define("LM_CRON_MODE","Backup store mode:");
|
| 222 |
define("LM_CRON_MODE_INFO"," <br />
|
| 226 |
");
|
| 227 |
define("LM_CRON_TYPE_INFO","<small><br /> please choose your backup type you would like to create</small>");
|
| 228 |
define("LM_CRON_MYSQL_DETAILS","Mysql Options");
|
| 229 |
+
define("LM_CRON_MYSQL_DROP","Add Mysql Drop");
|
| 230 |
define("LM_CRON_TYPE","Backup type:");
|
| 231 |
define("LM_CRON_FTP_DETAILS","Ftp store mode details:");
|
| 232 |
define("LM_CRON_FTP_SERVER","Ftp server:");
|
| 233 |
define("LM_CRON_FTP_USER","Ftp username:");
|
| 234 |
define("LM_CRON_FTP_PASS","Ftp password:");
|
| 235 |
define("LM_CRON_FTP_PATH","Ftp path:");
|
| 236 |
+
define("LM_CRON_FTP_DELB","Delete backup after transfer");
|
| 237 |
define("LM_CRON_EMAIL_DETAILS","Email mode details:");
|
| 238 |
define("LM_CRON_EMAIL_ACCOUNT","Email account:");
|
| 239 |
define("LM_CRON_COMPRESS","Compress backup files:");
|
| 240 |
+
define("LM_RESTORE_TOP","Restoring your backups info");
|
| 241 |
+
define("LM_CREDIT_TOP","About XCloner");
|
| 242 |
define("LM_CLONE_FORM_TOP","<h2>Provide your ftp details below:</h2>");
|
| 243 |
|
| 244 |
// --- Info Tab ---//
|
| 266 |
define("LM_CONFIG_INFO_MEMORY","<small>This controls the maximum memory the script may allocate for it's processes</small>");
|
| 267 |
define("LM_CONFIG_INFO_BASEDIR","<small>This controls the paths your script is allowed to access, no value means it can access any path </small>");
|
| 268 |
define("LM_CONFIG_INFO_SAFEMODE","<small>safe mode will need to be set to Off in order for XCloner to work properly </small>");
|
| 269 |
+
define("LM_CONFIG_INFO_VERSION","<small>PHP >=5.2.3 is required to enjoy all features</small>");
|
| 270 |
define("LM_CONFIG_INFO_TAR","<small>If the script is unable to determine the tar path automatically, you might need to uncheck the 'Active' checkbox near TAR line in General Tab</small>");
|
| 271 |
define("LM_CONFIG_INFO_ZIP","<small>If the script is unable to determine the zip path automatically, you might need to uncheck the 'Active' checkbox near ZIP line in General Tab</small>");
|
| 272 |
define("LM_CONFIG_INFO_MSQL","<small>If the script is unable to determine the mysqldump path automatically, you might need to uncheck the 'Active' checkbox near MYSQLDUMP line in General Tabn</small>");
|
| 285 |
define("LM_TRANSFER_FTP_PASS","Ftp password:");
|
| 286 |
define("LM_TRANSFER_FTP_PASS_SUB","example 'johnpass'");
|
| 287 |
define("LM_TRANSFER_FTP_DIR","Ftp directory:");
|
| 288 |
+
define("LM_TRANSFER_FTP_DIR_SUB","Please provide the ftp directory of where you would like to move the backup , example public_html/ or htdocs/ and make sure it has write permissions for everybody");
|
| 289 |
|
| 290 |
|
| 291 |
// --- GENERATE BACKUP---//
|
| 306 |
define("LM_COL_FOLDER" , "<b>Excluded Folders and/or files</b>");
|
| 307 |
|
| 308 |
define("LM_DELETE_FILE_SUCCESS", "Files Deleted");
|
| 309 |
+
define("LM_DOWNLOAD_TITLE", "Download");
|
| 310 |
|
| 311 |
|
| 312 |
define("LM_ARCHIVE_NAME" , "Archive Name");
|
| 318 |
|
| 319 |
define("LM_CONFIRM_INSTRUCTIONS" , "<b>Please select the folders you wish to exclude from archive</b> <br />
|
| 320 |
- by default all folders are included, if you wish to exlude a folder and it's subfolders just check the box next to it");
|
| 321 |
+
define("LM_CONFIRM_DATABASE" , "Backup Database");
|
| 322 |
|
| 323 |
|
| 324 |
define("LM_DATABASE_EXCLUDED", "Excluded");
|
| 335 |
define("LM_RENAME_TO"," to ");
|
| 336 |
// --- CLONER RESTORE--- //
|
| 337 |
|
| 338 |
+
define("LM_CLONER_RESTORE","<h2>How to restore a backup on different locations INFO!</h2><br />
|
| 339 |
<pre>
|
| 340 |
Restoring your backups has never been more easier!
|
| 341 |
With the help of our cloning function from the <a href='index2.php?option=com_cloner&task=view'>View Backups</a> screen
|
| 342 |
+
you will be able to move your website backup anywhere on the Internet.
|
| 343 |
|
| 344 |
Here is what you have to do:
|
| 345 |
|
| 361 |
<b>Step 2 - the XCloner.php restore screen:</b>
|
| 362 |
|
| 363 |
<b>XCloner.php - the restore script</b>
|
| 364 |
+
- at this step you have in place the backup you created and the Restore script
|
| 365 |
- enter you new mysql details, this includes your new mysql hostname, user and pass, and a new database
|
| 366 |
different from the original one
|
| 367 |
- enter you new location Url and pass
|
| 386 |
// --- ABOUT CLONER---//
|
| 387 |
|
| 388 |
define("LM_CLONER_ABOUT","<h2>XCloner Backup</h2>
|
| 389 |
+
XCloner is a tool that wil help you manage your website backups, Generate/Restore/Move so your website will be always secured!
|
| 390 |
+
<br /><br />
|
| 391 |
Features:
|
| 392 |
+
<ul>
|
| 393 |
+
<li>cron script to generate automatic backups</li>
|
| 394 |
+
<li>multiple backup options</li>
|
| 395 |
+
<li>restore tool to move the website rapidly to other locations</li>
|
| 396 |
+
<li>store the backup locally, on remotely</li>
|
| 397 |
+
<li>AJAX/JSON backup interface</li>
|
| 398 |
+
<li>standalone code, can backup any PHP/Mysql website</li>
|
| 399 |
+
<li>incremental database and files backup</li>
|
| 400 |
+
<li>incremental file system scanning</li>
|
| 401 |
+
<li>amazon S3 support</li>
|
| 402 |
+
</ul>
|
| 403 |
+
<br />
|
| 404 |
|
| 405 |
For reports and suggestions please contact us at info@xcloner.com or visit us on <a href='http://www.xcloner.com'>http://www.xcloner.com</a>
|
| 406 |
+
|
| 407 |
<br/><br/>
|
| 408 |
|
| 409 |
+
XCloner.com © 2004-2011 | <a href=\"http://www.xcloner.com\">www.xcloner.com</a>
|
| 410 |
<br/><p/><br/>
|
| 411 |
");
|
| 412 |
|
language/index.html
CHANGED
|
File without changes
|
language/spanish.php
CHANGED
|
File without changes
|
license.txt
CHANGED
|
@@ -1,2 +1,340 @@
|
|
| 1 |
-
|
| 2 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
GNU GENERAL PUBLIC LICENSE
|
| 2 |
+
Version 2, June 1991
|
| 3 |
+
|
| 4 |
+
Copyright (C) 1989, 1991 Free Software Foundation, Inc.,
|
| 5 |
+
51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
|
| 6 |
+
Everyone is permitted to copy and distribute verbatim copies
|
| 7 |
+
of this license document, but changing it is not allowed.
|
| 8 |
+
|
| 9 |
+
Preamble
|
| 10 |
+
|
| 11 |
+
The licenses for most software are designed to take away your
|
| 12 |
+
freedom to share and change it. By contrast, the GNU General Public
|
| 13 |
+
License is intended to guarantee your freedom to share and change free
|
| 14 |
+
software--to make sure the software is free for all its users. This
|
| 15 |
+
General Public License applies to most of the Free Software
|
| 16 |
+
Foundation's software and to any other program whose authors commit to
|
| 17 |
+
using it. (Some other Free Software Foundation software is covered by
|
| 18 |
+
the GNU Lesser General Public License instead.) You can apply it to
|
| 19 |
+
your programs, too.
|
| 20 |
+
|
| 21 |
+
When we speak of free software, we are referring to freedom, not
|
| 22 |
+
price. Our General Public Licenses are designed to make sure that you
|
| 23 |
+
have the freedom to distribute copies of free software (and charge for
|
| 24 |
+
this service if you wish), that you receive source code or can get it
|
| 25 |
+
if you want it, that you can change the software or use pieces of it
|
| 26 |
+
in new free programs; and that you know you can do these things.
|
| 27 |
+
|
| 28 |
+
To protect your rights, we need to make restrictions that forbid
|
| 29 |
+
anyone to deny you these rights or to ask you to surrender the rights.
|
| 30 |
+
These restrictions translate to certain responsibilities for you if you
|
| 31 |
+
distribute copies of the software, or if you modify it.
|
| 32 |
+
|
| 33 |
+
For example, if you distribute copies of such a program, whether
|
| 34 |
+
gratis or for a fee, you must give the recipients all the rights that
|
| 35 |
+
you have. You must make sure that they, too, receive or can get the
|
| 36 |
+
source code. And you must show them these terms so they know their
|
| 37 |
+
rights.
|
| 38 |
+
|
| 39 |
+
We protect your rights with two steps: (1) copyright the software, and
|
| 40 |
+
(2) offer you this license which gives you legal permission to copy,
|
| 41 |
+
distribute and/or modify the software.
|
| 42 |
+
|
| 43 |
+
Also, for each author's protection and ours, we want to make certain
|
| 44 |
+
that everyone understands that there is no warranty for this free
|
| 45 |
+
software. If the software is modified by someone else and passed on, we
|
| 46 |
+
want its recipients to know that what they have is not the original, so
|
| 47 |
+
that any problems introduced by others will not reflect on the original
|
| 48 |
+
authors' reputations.
|
| 49 |
+
|
| 50 |
+
Finally, any free program is threatened constantly by software
|
| 51 |
+
patents. We wish to avoid the danger that redistributors of a free
|
| 52 |
+
program will individually obtain patent licenses, in effect making the
|
| 53 |
+
program proprietary. To prevent this, we have made it clear that any
|
| 54 |
+
patent must be licensed for everyone's free use or not licensed at all.
|
| 55 |
+
|
| 56 |
+
The precise terms and conditions for copying, distribution and
|
| 57 |
+
modification follow.
|
| 58 |
+
|
| 59 |
+
GNU GENERAL PUBLIC LICENSE
|
| 60 |
+
TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
|
| 61 |
+
|
| 62 |
+
0. This License applies to any program or other work which contains
|
| 63 |
+
a notice placed by the copyright holder saying it may be distributed
|
| 64 |
+
under the terms of this General Public License. The "Program", below,
|
| 65 |
+
refers to any such program or work, and a "work based on the Program"
|
| 66 |
+
means either the Program or any derivative work under copyright law:
|
| 67 |
+
that is to say, a work containing the Program or a portion of it,
|
| 68 |
+
either verbatim or with modifications and/or translated into another
|
| 69 |
+
language. (Hereinafter, translation is included without limitation in
|
| 70 |
+
the term "modification".) Each licensee is addressed as "you".
|
| 71 |
+
|
| 72 |
+
Activities other than copying, distribution and modification are not
|
| 73 |
+
covered by this License; they are outside its scope. The act of
|
| 74 |
+
running the Program is not restricted, and the output from the Program
|
| 75 |
+
is covered only if its contents constitute a work based on the
|
| 76 |
+
Program (independent of having been made by running the Program).
|
| 77 |
+
Whether that is true depends on what the Program does.
|
| 78 |
+
|
| 79 |
+
1. You may copy and distribute verbatim copies of the Program's
|
| 80 |
+
source code as you receive it, in any medium, provided that you
|
| 81 |
+
conspicuously and appropriately publish on each copy an appropriate
|
| 82 |
+
copyright notice and disclaimer of warranty; keep intact all the
|
| 83 |
+
notices that refer to this License and to the absence of any warranty;
|
| 84 |
+
and give any other recipients of the Program a copy of this License
|
| 85 |
+
along with the Program.
|
| 86 |
+
|
| 87 |
+
You may charge a fee for the physical act of transferring a copy, and
|
| 88 |
+
you may at your option offer warranty protection in exchange for a fee.
|
| 89 |
+
|
| 90 |
+
2. You may modify your copy or copies of the Program or any portion
|
| 91 |
+
of it, thus forming a work based on the Program, and copy and
|
| 92 |
+
distribute such modifications or work under the terms of Section 1
|
| 93 |
+
above, provided that you also meet all of these conditions:
|
| 94 |
+
|
| 95 |
+
a) You must cause the modified files to carry prominent notices
|
| 96 |
+
stating that you changed the files and the date of any change.
|
| 97 |
+
|
| 98 |
+
b) You must cause any work that you distribute or publish, that in
|
| 99 |
+
whole or in part contains or is derived from the Program or any
|
| 100 |
+
part thereof, to be licensed as a whole at no charge to all third
|
| 101 |
+
parties under the terms of this License.
|
| 102 |
+
|
| 103 |
+
c) If the modified program normally reads commands interactively
|
| 104 |
+
when run, you must cause it, when started running for such
|
| 105 |
+
interactive use in the most ordinary way, to print or display an
|
| 106 |
+
announcement including an appropriate copyright notice and a
|
| 107 |
+
notice that there is no warranty (or else, saying that you provide
|
| 108 |
+
a warranty) and that users may redistribute the program under
|
| 109 |
+
these conditions, and telling the user how to view a copy of this
|
| 110 |
+
License. (Exception: if the Program itself is interactive but
|
| 111 |
+
does not normally print such an announcement, your work based on
|
| 112 |
+
the Program is not required to print an announcement.)
|
| 113 |
+
|
| 114 |
+
These requirements apply to the modified work as a whole. If
|
| 115 |
+
identifiable sections of that work are not derived from the Program,
|
| 116 |
+
and can be reasonably considered independent and separate works in
|
| 117 |
+
themselves, then this License, and its terms, do not apply to those
|
| 118 |
+
sections when you distribute them as separate works. But when you
|
| 119 |
+
distribute the same sections as part of a whole which is a work based
|
| 120 |
+
on the Program, the distribution of the whole must be on the terms of
|
| 121 |
+
this License, whose permissions for other licensees extend to the
|
| 122 |
+
entire whole, and thus to each and every part regardless of who wrote it.
|
| 123 |
+
|
| 124 |
+
Thus, it is not the intent of this section to claim rights or contest
|
| 125 |
+
your rights to work written entirely by you; rather, the intent is to
|
| 126 |
+
exercise the right to control the distribution of derivative or
|
| 127 |
+
collective works based on the Program.
|
| 128 |
+
|
| 129 |
+
In addition, mere aggregation of another work not based on the Program
|
| 130 |
+
with the Program (or with a work based on the Program) on a volume of
|
| 131 |
+
a storage or distribution medium does not bring the other work under
|
| 132 |
+
the scope of this License.
|
| 133 |
+
|
| 134 |
+
3. You may copy and distribute the Program (or a work based on it,
|
| 135 |
+
under Section 2) in object code or executable form under the terms of
|
| 136 |
+
Sections 1 and 2 above provided that you also do one of the following:
|
| 137 |
+
|
| 138 |
+
a) Accompany it with the complete corresponding machine-readable
|
| 139 |
+
source code, which must be distributed under the terms of Sections
|
| 140 |
+
1 and 2 above on a medium customarily used for software interchange; or,
|
| 141 |
+
|
| 142 |
+
b) Accompany it with a written offer, valid for at least three
|
| 143 |
+
years, to give any third party, for a charge no more than your
|
| 144 |
+
cost of physically performing source distribution, a complete
|
| 145 |
+
machine-readable copy of the corresponding source code, to be
|
| 146 |
+
distributed under the terms of Sections 1 and 2 above on a medium
|
| 147 |
+
customarily used for software interchange; or,
|
| 148 |
+
|
| 149 |
+
c) Accompany it with the information you received as to the offer
|
| 150 |
+
to distribute corresponding source code. (This alternative is
|
| 151 |
+
allowed only for noncommercial distribution and only if you
|
| 152 |
+
received the program in object code or executable form with such
|
| 153 |
+
an offer, in accord with Subsection b above.)
|
| 154 |
+
|
| 155 |
+
The source code for a work means the preferred form of the work for
|
| 156 |
+
making modifications to it. For an executable work, complete source
|
| 157 |
+
code means all the source code for all modules it contains, plus any
|
| 158 |
+
associated interface definition files, plus the scripts used to
|
| 159 |
+
control compilation and installation of the executable. However, as a
|
| 160 |
+
special exception, the source code distributed need not include
|
| 161 |
+
anything that is normally distributed (in either source or binary
|
| 162 |
+
form) with the major components (compiler, kernel, and so on) of the
|
| 163 |
+
operating system on which the executable runs, unless that component
|
| 164 |
+
itself accompanies the executable.
|
| 165 |
+
|
| 166 |
+
If distribution of executable or object code is made by offering
|
| 167 |
+
access to copy from a designated place, then offering equivalent
|
| 168 |
+
access to copy the source code from the same place counts as
|
| 169 |
+
distribution of the source code, even though third parties are not
|
| 170 |
+
compelled to copy the source along with the object code.
|
| 171 |
+
|
| 172 |
+
4. You may not copy, modify, sublicense, or distribute the Program
|
| 173 |
+
except as expressly provided under this License. Any attempt
|
| 174 |
+
otherwise to copy, modify, sublicense or distribute the Program is
|
| 175 |
+
void, and will automatically terminate your rights under this License.
|
| 176 |
+
However, parties who have received copies, or rights, from you under
|
| 177 |
+
this License will not have their licenses terminated so long as such
|
| 178 |
+
parties remain in full compliance.
|
| 179 |
+
|
| 180 |
+
5. You are not required to accept this License, since you have not
|
| 181 |
+
signed it. However, nothing else grants you permission to modify or
|
| 182 |
+
distribute the Program or its derivative works. These actions are
|
| 183 |
+
prohibited by law if you do not accept this License. Therefore, by
|
| 184 |
+
modifying or distributing the Program (or any work based on the
|
| 185 |
+
Program), you indicate your acceptance of this License to do so, and
|
| 186 |
+
all its terms and conditions for copying, distributing or modifying
|
| 187 |
+
the Program or works based on it.
|
| 188 |
+
|
| 189 |
+
6. Each time you redistribute the Program (or any work based on the
|
| 190 |
+
Program), the recipient automatically receives a license from the
|
| 191 |
+
original licensor to copy, distribute or modify the Program subject to
|
| 192 |
+
these terms and conditions. You may not impose any further
|
| 193 |
+
restrictions on the recipients' exercise of the rights granted herein.
|
| 194 |
+
You are not responsible for enforcing compliance by third parties to
|
| 195 |
+
this License.
|
| 196 |
+
|
| 197 |
+
7. If, as a consequence of a court judgment or allegation of patent
|
| 198 |
+
infringement or for any other reason (not limited to patent issues),
|
| 199 |
+
conditions are imposed on you (whether by court order, agreement or
|
| 200 |
+
otherwise) that contradict the conditions of this License, they do not
|
| 201 |
+
excuse you from the conditions of this License. If you cannot
|
| 202 |
+
distribute so as to satisfy simultaneously your obligations under this
|
| 203 |
+
License and any other pertinent obligations, then as a consequence you
|
| 204 |
+
may not distribute the Program at all. For example, if a patent
|
| 205 |
+
license would not permit royalty-free redistribution of the Program by
|
| 206 |
+
all those who receive copies directly or indirectly through you, then
|
| 207 |
+
the only way you could satisfy both it and this License would be to
|
| 208 |
+
refrain entirely from distribution of the Program.
|
| 209 |
+
|
| 210 |
+
If any portion of this section is held invalid or unenforceable under
|
| 211 |
+
any particular circumstance, the balance of the section is intended to
|
| 212 |
+
apply and the section as a whole is intended to apply in other
|
| 213 |
+
circumstances.
|
| 214 |
+
|
| 215 |
+
It is not the purpose of this section to induce you to infringe any
|
| 216 |
+
patents or other property right claims or to contest validity of any
|
| 217 |
+
such claims; this section has the sole purpose of protecting the
|
| 218 |
+
integrity of the free software distribution system, which is
|
| 219 |
+
implemented by public license practices. Many people have made
|
| 220 |
+
generous contributions to the wide range of software distributed
|
| 221 |
+
through that system in reliance on consistent application of that
|
| 222 |
+
system; it is up to the author/donor to decide if he or she is willing
|
| 223 |
+
to distribute software through any other system and a licensee cannot
|
| 224 |
+
impose that choice.
|
| 225 |
+
|
| 226 |
+
This section is intended to make thoroughly clear what is believed to
|
| 227 |
+
be a consequence of the rest of this License.
|
| 228 |
+
|
| 229 |
+
8. If the distribution and/or use of the Program is restricted in
|
| 230 |
+
certain countries either by patents or by copyrighted interfaces, the
|
| 231 |
+
original copyright holder who places the Program under this License
|
| 232 |
+
may add an explicit geographical distribution limitation excluding
|
| 233 |
+
those countries, so that distribution is permitted only in or among
|
| 234 |
+
countries not thus excluded. In such case, this License incorporates
|
| 235 |
+
the limitation as if written in the body of this License.
|
| 236 |
+
|
| 237 |
+
9. The Free Software Foundation may publish revised and/or new versions
|
| 238 |
+
of the General Public License from time to time. Such new versions will
|
| 239 |
+
be similar in spirit to the present version, but may differ in detail to
|
| 240 |
+
address new problems or concerns.
|
| 241 |
+
|
| 242 |
+
Each version is given a distinguishing version number. If the Program
|
| 243 |
+
specifies a version number of this License which applies to it and "any
|
| 244 |
+
later version", you have the option of following the terms and conditions
|
| 245 |
+
either of that version or of any later version published by the Free
|
| 246 |
+
Software Foundation. If the Program does not specify a version number of
|
| 247 |
+
this License, you may choose any version ever published by the Free Software
|
| 248 |
+
Foundation.
|
| 249 |
+
|
| 250 |
+
10. If you wish to incorporate parts of the Program into other free
|
| 251 |
+
programs whose distribution conditions are different, write to the author
|
| 252 |
+
to ask for permission. For software which is copyrighted by the Free
|
| 253 |
+
Software Foundation, write to the Free Software Foundation; we sometimes
|
| 254 |
+
make exceptions for this. Our decision will be guided by the two goals
|
| 255 |
+
of preserving the free status of all derivatives of our free software and
|
| 256 |
+
of promoting the sharing and reuse of software generally.
|
| 257 |
+
|
| 258 |
+
NO WARRANTY
|
| 259 |
+
|
| 260 |
+
11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
|
| 261 |
+
FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
|
| 262 |
+
OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
|
| 263 |
+
PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
|
| 264 |
+
OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
| 265 |
+
MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
|
| 266 |
+
TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
|
| 267 |
+
PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
|
| 268 |
+
REPAIR OR CORRECTION.
|
| 269 |
+
|
| 270 |
+
12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
|
| 271 |
+
WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
|
| 272 |
+
REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
|
| 273 |
+
INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
|
| 274 |
+
OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
|
| 275 |
+
TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
|
| 276 |
+
YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
|
| 277 |
+
PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
|
| 278 |
+
POSSIBILITY OF SUCH DAMAGES.
|
| 279 |
+
|
| 280 |
+
END OF TERMS AND CONDITIONS
|
| 281 |
+
|
| 282 |
+
How to Apply These Terms to Your New Programs
|
| 283 |
+
|
| 284 |
+
If you develop a new program, and you want it to be of the greatest
|
| 285 |
+
possible use to the public, the best way to achieve this is to make it
|
| 286 |
+
free software which everyone can redistribute and change under these terms.
|
| 287 |
+
|
| 288 |
+
To do so, attach the following notices to the program. It is safest
|
| 289 |
+
to attach them to the start of each source file to most effectively
|
| 290 |
+
convey the exclusion of warranty; and each file should have at least
|
| 291 |
+
the "copyright" line and a pointer to where the full notice is found.
|
| 292 |
+
|
| 293 |
+
<one line to give the program's name and a brief idea of what it does.>
|
| 294 |
+
Copyright (C) <year> <name of author>
|
| 295 |
+
|
| 296 |
+
This program is free software; you can redistribute it and/or modify
|
| 297 |
+
it under the terms of the GNU General Public License as published by
|
| 298 |
+
the Free Software Foundation; either version 2 of the License, or
|
| 299 |
+
(at your option) any later version.
|
| 300 |
+
|
| 301 |
+
This program is distributed in the hope that it will be useful,
|
| 302 |
+
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 303 |
+
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 304 |
+
GNU General Public License for more details.
|
| 305 |
+
|
| 306 |
+
You should have received a copy of the GNU General Public License along
|
| 307 |
+
with this program; if not, write to the Free Software Foundation, Inc.,
|
| 308 |
+
51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
| 309 |
+
|
| 310 |
+
Also add information on how to contact you by electronic and paper mail.
|
| 311 |
+
|
| 312 |
+
If the program is interactive, make it output a short notice like this
|
| 313 |
+
when it starts in an interactive mode:
|
| 314 |
+
|
| 315 |
+
Gnomovision version 69, Copyright (C) year name of author
|
| 316 |
+
Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
|
| 317 |
+
This is free software, and you are welcome to redistribute it
|
| 318 |
+
under certain conditions; type `show c' for details.
|
| 319 |
+
|
| 320 |
+
The hypothetical commands `show w' and `show c' should show the appropriate
|
| 321 |
+
parts of the General Public License. Of course, the commands you use may
|
| 322 |
+
be called something other than `show w' and `show c'; they could even be
|
| 323 |
+
mouse-clicks or menu items--whatever suits your program.
|
| 324 |
+
|
| 325 |
+
You should also get your employer (if you work as a programmer) or your
|
| 326 |
+
school, if any, to sign a "copyright disclaimer" for the program, if
|
| 327 |
+
necessary. Here is a sample; alter the names:
|
| 328 |
+
|
| 329 |
+
Yoyodyne, Inc., hereby disclaims all copyright interest in the program
|
| 330 |
+
`Gnomovision' (which makes passes at compilers) written by James Hacker.
|
| 331 |
+
|
| 332 |
+
<signature of Ty Coon>, 1 April 1989
|
| 333 |
+
Ty Coon, President of Vice
|
| 334 |
+
|
| 335 |
+
This General Public License does not permit incorporating your program into
|
| 336 |
+
proprietary programs. If your program is a subroutine library, you may
|
| 337 |
+
consider it more useful to permit linking proprietary applications with the
|
| 338 |
+
library. If this is what you want to do, use the GNU Lesser General
|
| 339 |
+
Public License instead of this License.
|
| 340 |
+
|
readme.txt
CHANGED
|
@@ -1,10 +1,10 @@
|
|
| 1 |
=== XCloner - Backup and Restore===
|
| 2 |
Contributors: xcloner
|
| 3 |
Donate link: http://www.xcloner.com/
|
| 4 |
-
Tags: backup, restore, admin, plugin, database, full backup, cloner, xcloner, theme, files, upload, wordpress backup, backup plugin, database backup, database restore, site move, transfer, blog transfer
|
| 5 |
Requires at least: 2.0.2
|
| 6 |
-
Tested up to: 3.
|
| 7 |
-
Stable tag:
|
| 8 |
|
| 9 |
XCloner is a full backup and restore plugin for Wordpress, it will backup and restore both files and database. www.xcloner.com
|
| 10 |
|
|
@@ -26,15 +26,11 @@ XCloner Generate, Move and Restore process:
|
|
| 26 |
|
| 27 |
Features:
|
| 28 |
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
* Restore your backups anywhere
|
| 36 |
-
|
| 37 |
-
* Share your custom backups with your clients
|
| 38 |
|
| 39 |
|
| 40 |
== Installation ==
|
|
@@ -44,14 +40,9 @@ Features:
|
|
| 44 |
3. Create directory administrator/backups and make it writeable under your Wordpress site root
|
| 45 |
4. Access it from the Plugins->XCloner menu
|
| 46 |
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
If
|
| 50 |
-
|
| 51 |
-
1. Upload the package files to your Wordpress ROOT directory
|
| 52 |
-
2. Activate the plugin
|
| 53 |
-
3. Create directory administrator/backups and make it writeable under your Wordpress site root
|
| 54 |
-
4. Access it from the Plugins->XCloner menu
|
| 55 |
|
| 56 |
== Frequently Asked Questions ==
|
| 57 |
|
|
@@ -67,13 +58,24 @@ If the inside Clone option fails for some reason, you need to:
|
|
| 67 |
== Screenshots ==
|
| 68 |
|
| 69 |
1. Login screen
|
| 70 |
-
2.
|
| 71 |
-
3. Config options
|
| 72 |
-
4.
|
| 73 |
-
5.
|
|
|
|
|
|
|
|
|
|
| 74 |
|
| 75 |
== Changelog ==
|
| 76 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 77 |
= 2.2.1 =
|
| 78 |
* Added JSON AJAX interface to the Generate Backup process
|
| 79 |
* Added incremental filesystem scan
|
|
@@ -81,15 +83,12 @@ If the inside Clone option fails for some reason, you need to:
|
|
| 81 |
* php >=5.2.0 version check
|
| 82 |
|
| 83 |
= 2.1.2 =
|
| 84 |
-
Added Amazon S3 cron storage support
|
| 85 |
|
| 86 |
= 2.1 =
|
| 87 |
-
Initial release
|
| 88 |
|
| 89 |
== Upgrade Notice ==
|
| 90 |
|
| 91 |
-
=
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
= 2.1 =
|
| 95 |
-
Initial release
|
| 1 |
=== XCloner - Backup and Restore===
|
| 2 |
Contributors: xcloner
|
| 3 |
Donate link: http://www.xcloner.com/
|
| 4 |
+
Tags: backup, restore, admin, plugin, database, full backup, cloner, xcloner, theme, files, upload, wordpress backup, backup plugin, database backup, database restore, site move, transfer, blog transfer, BuddyPress
|
| 5 |
Requires at least: 2.0.2
|
| 6 |
+
Tested up to: 3.1
|
| 7 |
+
Stable tag: 3.0
|
| 8 |
|
| 9 |
XCloner is a full backup and restore plugin for Wordpress, it will backup and restore both files and database. www.xcloner.com
|
| 10 |
|
| 26 |
|
| 27 |
Features:
|
| 28 |
|
| 29 |
+
* Backup and Restore any PHP/Mysql application
|
| 30 |
+
* Create custom backups
|
| 31 |
+
* Generate automatic backups based on cronjobs
|
| 32 |
+
* Restore your backups anywhere
|
| 33 |
+
* Share your custom backups with your clients
|
|
|
|
|
|
|
|
|
|
|
|
|
| 34 |
|
| 35 |
|
| 36 |
== Installation ==
|
| 40 |
3. Create directory administrator/backups and make it writeable under your Wordpress site root
|
| 41 |
4. Access it from the Plugins->XCloner menu
|
| 42 |
|
| 43 |
+
UPGRADE:
|
| 44 |
+
|
| 45 |
+
If you plan on upgrading your XCloner installation, to keep it's original setting, please keep a copy after your wp-content/plugins/xcloner-backup-and-restore/cloner.config.php file, and re-upload it after the upgrade.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 46 |
|
| 47 |
== Frequently Asked Questions ==
|
| 48 |
|
| 58 |
== Screenshots ==
|
| 59 |
|
| 60 |
1. Login screen
|
| 61 |
+
2. Welcome screen
|
| 62 |
+
3. Config options General tab
|
| 63 |
+
4. COnfig options System tab
|
| 64 |
+
5. View Backups
|
| 65 |
+
6. Generate Backup -> database options
|
| 66 |
+
7. Generate Backup -> files options
|
| 67 |
+
8. Restore screen
|
| 68 |
|
| 69 |
== Changelog ==
|
| 70 |
|
| 71 |
+
= 3.0 =
|
| 72 |
+
* incremental database backup
|
| 73 |
+
* incremental file system scan
|
| 74 |
+
* backup size limit and option to split it into additional archives, default 2GB
|
| 75 |
+
* exclude files larger than a certain size option
|
| 76 |
+
* incremental files restore
|
| 77 |
+
* JQuery Start interface
|
| 78 |
+
|
| 79 |
= 2.2.1 =
|
| 80 |
* Added JSON AJAX interface to the Generate Backup process
|
| 81 |
* Added incremental filesystem scan
|
| 83 |
* php >=5.2.0 version check
|
| 84 |
|
| 85 |
= 2.1.2 =
|
| 86 |
+
* Added Amazon S3 cron storage support
|
| 87 |
|
| 88 |
= 2.1 =
|
| 89 |
+
* Initial release
|
| 90 |
|
| 91 |
== Upgrade Notice ==
|
| 92 |
|
| 93 |
+
= 3.0 =
|
| 94 |
+
Please check the changelog, there are several improvements, including better interface, better incremental backup process, as well as several restore addons and speed improvements
|
|
|
|
|
|
|
|
|
recursive.php
DELETED
|
@@ -1,118 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
$startdir = "D:/server/wamp/www/";
|
| 3 |
-
$dir = $startdir;
|
| 4 |
-
$last_file = "..";
|
| 5 |
-
$recursive_limit = 400;
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
$f_arr = array();
|
| 9 |
-
$d_arr = array() ;
|
| 10 |
-
#$dir = "E:/server/www/Joomla/xcloner/images";
|
| 11 |
-
|
| 12 |
-
while($i++ < 100){
|
| 13 |
-
|
| 14 |
-
$count = 0;
|
| 15 |
-
$k = 0;
|
| 16 |
-
$return = "";
|
| 17 |
-
$last = recursive($dir, $last_file);
|
| 18 |
-
echo "<br /><b>Lastdir:</b> $last<br />" ;
|
| 19 |
-
|
| 20 |
-
if(dirname($last) == dirname($startdir)){
|
| 21 |
-
|
| 22 |
-
$f_arr = array_unique($f_arr);
|
| 23 |
-
$d_arr = array_unique($d_arr);
|
| 24 |
-
sort($f_arr);
|
| 25 |
-
sort($d_arr);
|
| 26 |
-
echo "<b>Recurse finished! Files: ".sizeof($f_arr)." ; Directories: ".sizeof($d_arr)."</b>";
|
| 27 |
-
#print_r($f_arr);
|
| 28 |
-
break;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
#echo $last_return;
|
| 32 |
-
if((!is_dir($last))||($last_return == 1))
|
| 33 |
-
{
|
| 34 |
-
$dir = dirname($last);
|
| 35 |
-
$last_file = basename ($last);
|
| 36 |
-
}
|
| 37 |
-
else{
|
| 38 |
-
$dir = $last;
|
| 39 |
-
$last_file = '..';
|
| 40 |
-
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
function recursive( $dir , $last_file = '..')
|
| 48 |
-
{ global $count, $return, $k, $startdir, $last_return, $recursive_limit, $f_arr, $d_arr;
|
| 49 |
-
|
| 50 |
-
#echo "<br /><b>Opening $dir with last file $last_file</b><br />";
|
| 51 |
-
$last_return = 0;
|
| 52 |
-
|
| 53 |
-
if (is_dir($dir)) {
|
| 54 |
-
if ($dh = opendir($dir)) {
|
| 55 |
-
while (($file = readdir($dh)) !== false ) {
|
| 56 |
-
|
| 57 |
-
#echo $file."--".$last_file."<br />";
|
| 58 |
-
|
| 59 |
-
if (($file != $last_file)&&($k == 0))
|
| 60 |
-
continue;
|
| 61 |
-
elseif(($file == $last_file)&&($file != '..')){
|
| 62 |
-
$k = 1;
|
| 63 |
-
continue;
|
| 64 |
-
}else{
|
| 65 |
-
|
| 66 |
-
$k =1 ;
|
| 67 |
-
}
|
| 68 |
-
#echo "<b>".$file."</b>";
|
| 69 |
-
|
| 70 |
-
if( $file != "." && $file != ".." )
|
| 71 |
-
{
|
| 72 |
-
$cfile = "$dir/$file";
|
| 73 |
-
|
| 74 |
-
if($count == $recursive_limit){
|
| 75 |
-
|
| 76 |
-
if($return == "")
|
| 77 |
-
$return = $cfile;
|
| 78 |
-
|
| 79 |
-
$last_return = 2;
|
| 80 |
-
|
| 81 |
-
if(is_dir($cfile))
|
| 82 |
-
$d_arr[] = $cfile;
|
| 83 |
-
else
|
| 84 |
-
$f_arr[] = $cfile;
|
| 85 |
-
|
| 86 |
-
echo "return here with $cfile";return $return ;
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
++$count;
|
| 90 |
-
|
| 91 |
-
if( is_dir( $dir ."/". $file ) )
|
| 92 |
-
{
|
| 93 |
-
echo "<b>Entering Directory: $cfile</b><br/>";
|
| 94 |
-
$d_arr[] = $cfile;
|
| 95 |
-
recursive( $cfile );
|
| 96 |
-
|
| 97 |
-
}
|
| 98 |
-
else
|
| 99 |
-
{
|
| 100 |
-
|
| 101 |
-
echo "file: $cfile<br/>";
|
| 102 |
-
|
| 103 |
-
$f_arr[] = $cfile;
|
| 104 |
-
|
| 105 |
-
}
|
| 106 |
-
}
|
| 107 |
-
}
|
| 108 |
-
closedir($dh);
|
| 109 |
-
}
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
$last_return = 1;
|
| 113 |
-
return $dir;
|
| 114 |
-
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
restore/TAR.php
CHANGED
|
@@ -383,14 +383,14 @@ class archive_tar
|
|
| 383 |
function addString($p_filename, $p_string)
|
| 384 |
{
|
| 385 |
$v_result = true;
|
| 386 |
-
|
| 387 |
if (!$this->_isArchive()) {
|
| 388 |
if (!$this->_openWrite()) {
|
| 389 |
return false;
|
| 390 |
}
|
| 391 |
$this->_close();
|
| 392 |
}
|
| 393 |
-
|
| 394 |
if (!$this->_openAppend())
|
| 395 |
return false;
|
| 396 |
|
|
@@ -530,12 +530,12 @@ class archive_tar
|
|
| 530 |
function setAttribute()
|
| 531 |
{
|
| 532 |
$v_result = true;
|
| 533 |
-
|
| 534 |
// ----- Get the number of variable list of arguments
|
| 535 |
if (($v_size = func_num_args()) == 0) {
|
| 536 |
return true;
|
| 537 |
}
|
| 538 |
-
|
| 539 |
// ----- Get the arguments
|
| 540 |
$v_att_list = &func_get_args();
|
| 541 |
|
|
@@ -1393,13 +1393,236 @@ class archive_tar
|
|
| 1393 |
// }}}
|
| 1394 |
|
| 1395 |
// {{{ _extractList()
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1396 |
function _extractList($p_path, &$p_list_detail, $p_mode,
|
| 1397 |
-
$p_file_list, $p_remove_path)
|
| 1398 |
{
|
| 1399 |
$v_result=true;
|
| 1400 |
$v_nb = 0;
|
| 1401 |
$v_extract_all = true;
|
| 1402 |
$v_listing = false;
|
|
|
|
| 1403 |
|
| 1404 |
$p_path = $this->_translateWinPath($p_path, false);
|
| 1405 |
if ($p_path == '' || (substr($p_path, 0, 1) != '/'
|
|
@@ -1435,6 +1658,7 @@ class archive_tar
|
|
| 1435 |
|
| 1436 |
while (strlen($v_binary_data = $this->_readBlock()) != 0)
|
| 1437 |
{
|
|
|
|
| 1438 |
$v_extract_file = FALSE;
|
| 1439 |
$v_extraction_stopped = 0;
|
| 1440 |
|
|
@@ -1445,6 +1669,11 @@ class archive_tar
|
|
| 1445 |
continue;
|
| 1446 |
}
|
| 1447 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1448 |
// ----- Look for long filename
|
| 1449 |
if ($v_header['typeflag'] == 'L') {
|
| 1450 |
if (!$this->_readLongHeader($v_header))
|
|
@@ -1612,12 +1841,46 @@ class archive_tar
|
|
| 1612 |
}
|
| 1613 |
// }}}
|
| 1614 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1615 |
// {{{ _openAppend()
|
| 1616 |
function _openAppend()
|
| 1617 |
{
|
| 1618 |
if (filesize($this->_tarname) == 0)
|
| 1619 |
return $this->_openWrite();
|
| 1620 |
-
|
| 1621 |
if ($this->_compress) {
|
| 1622 |
$this->_close();
|
| 1623 |
|
|
@@ -1632,7 +1895,7 @@ class archive_tar
|
|
| 1632 |
$v_temp_tar = @gzopen($this->_tarname.".tmp", "rb");
|
| 1633 |
elseif ($this->_compress_type == 'bz2')
|
| 1634 |
$v_temp_tar = @bzopen($this->_tarname.".tmp", "rb");
|
| 1635 |
-
|
| 1636 |
if ($v_temp_tar == 0) {
|
| 1637 |
$this->_error('Unable to open file \''.$this->_tarname
|
| 1638 |
.'.tmp\' in binary read mode');
|
|
@@ -1686,14 +1949,14 @@ class archive_tar
|
|
| 1686 |
$v_size = filesize($this->_tarname);
|
| 1687 |
|
| 1688 |
// We might have zero, one or two end blocks.
|
| 1689 |
-
// The standard is two, but we should try to handle
|
| 1690 |
// other cases.
|
| 1691 |
fseek($this->_file, $v_size - 1024);
|
| 1692 |
if (fread($this->_file, 512) == ARCHIVE_TAR_END_BLOCK) {
|
| 1693 |
fseek($this->_file, $v_size - 1024);
|
| 1694 |
}
|
| 1695 |
elseif (fread($this->_file, 512) == ARCHIVE_TAR_END_BLOCK) {
|
| 1696 |
-
fseek($this->_file, $v_size - 512);
|
| 1697 |
}
|
| 1698 |
}
|
| 1699 |
|
|
@@ -1706,7 +1969,7 @@ class archive_tar
|
|
| 1706 |
{
|
| 1707 |
if (!$this->_openAppend())
|
| 1708 |
return false;
|
| 1709 |
-
|
| 1710 |
if ($this->_addList($p_filelist, $p_add_dir, $p_remove_dir))
|
| 1711 |
$this->_writeFooter();
|
| 1712 |
|
|
@@ -1752,7 +2015,7 @@ class archive_tar
|
|
| 1752 |
// {{{ _pathReduction()
|
| 1753 |
|
| 1754 |
/**
|
| 1755 |
-
* Compress path by changing for example "/dir/foo/../bar" to "/dir/bar",
|
| 1756 |
* rand emove double slashes.
|
| 1757 |
*
|
| 1758 |
* @param string $p_dir path to reduce
|
| 383 |
function addString($p_filename, $p_string)
|
| 384 |
{
|
| 385 |
$v_result = true;
|
| 386 |
+
|
| 387 |
if (!$this->_isArchive()) {
|
| 388 |
if (!$this->_openWrite()) {
|
| 389 |
return false;
|
| 390 |
}
|
| 391 |
$this->_close();
|
| 392 |
}
|
| 393 |
+
|
| 394 |
if (!$this->_openAppend())
|
| 395 |
return false;
|
| 396 |
|
| 530 |
function setAttribute()
|
| 531 |
{
|
| 532 |
$v_result = true;
|
| 533 |
+
|
| 534 |
// ----- Get the number of variable list of arguments
|
| 535 |
if (($v_size = func_num_args()) == 0) {
|
| 536 |
return true;
|
| 537 |
}
|
| 538 |
+
|
| 539 |
// ----- Get the arguments
|
| 540 |
$v_att_list = &func_get_args();
|
| 541 |
|
| 1393 |
// }}}
|
| 1394 |
|
| 1395 |
// {{{ _extractList()
|
| 1396 |
+
function _extractList_vbdata($p_path, &$p_list_detail, $p_mode,
|
| 1397 |
+
$p_file_list, $p_remove_path, $v_binary_data)
|
| 1398 |
+
{
|
| 1399 |
+
$v_result=true;
|
| 1400 |
+
$v_nb = 0;
|
| 1401 |
+
$v_extract_all = true;
|
| 1402 |
+
$v_listing = false;
|
| 1403 |
+
|
| 1404 |
+
$p_path = $this->_translateWinPath($p_path, false);
|
| 1405 |
+
if ($p_path == '' || (substr($p_path, 0, 1) != '/'
|
| 1406 |
+
&& substr($p_path, 0, 3) != "../" && !strpos($p_path, ':'))) {
|
| 1407 |
+
$p_path = "./".$p_path;
|
| 1408 |
+
}
|
| 1409 |
+
$p_remove_path = $this->_translateWinPath($p_remove_path);
|
| 1410 |
+
|
| 1411 |
+
// ----- Look for path to remove format (should end by /)
|
| 1412 |
+
if (($p_remove_path != '') && (substr($p_remove_path, -1) != '/'))
|
| 1413 |
+
$p_remove_path .= '/';
|
| 1414 |
+
$p_remove_path_size = strlen($p_remove_path);
|
| 1415 |
+
|
| 1416 |
+
switch ($p_mode) {
|
| 1417 |
+
case "complete" :
|
| 1418 |
+
$v_extract_all = TRUE;
|
| 1419 |
+
$v_listing = FALSE;
|
| 1420 |
+
break;
|
| 1421 |
+
case "partial" :
|
| 1422 |
+
$v_extract_all = FALSE;
|
| 1423 |
+
$v_listing = FALSE;
|
| 1424 |
+
break;
|
| 1425 |
+
case "list" :
|
| 1426 |
+
$v_extract_all = FALSE;
|
| 1427 |
+
$v_listing = TRUE;
|
| 1428 |
+
break;
|
| 1429 |
+
default :
|
| 1430 |
+
$this->_error('Invalid extract mode ('.$p_mode.')');
|
| 1431 |
+
return false;
|
| 1432 |
+
}
|
| 1433 |
+
|
| 1434 |
+
clearstatcache();
|
| 1435 |
+
|
| 1436 |
+
//while (strlen($v_binary_data = $this->_readBlock()) != 0)
|
| 1437 |
+
{
|
| 1438 |
+
$v_extract_file = FALSE;
|
| 1439 |
+
$v_extraction_stopped = 0;
|
| 1440 |
+
|
| 1441 |
+
if (!$this->_readHeader($v_binary_data, $v_header))
|
| 1442 |
+
return false;
|
| 1443 |
+
|
| 1444 |
+
if ($v_header['filename'] == '') {
|
| 1445 |
+
continue;
|
| 1446 |
+
}
|
| 1447 |
+
|
| 1448 |
+
// ----- Look for long filename
|
| 1449 |
+
if ($v_header['typeflag'] == 'L') {
|
| 1450 |
+
if (!$this->_readLongHeader($v_header))
|
| 1451 |
+
return false;
|
| 1452 |
+
}
|
| 1453 |
+
|
| 1454 |
+
#if ((!$v_extract_all) && (is_array($p_file_list)))
|
| 1455 |
+
#{
|
| 1456 |
+
// ----- By default no unzip if the file is not found
|
| 1457 |
+
$v_extract_file = true;
|
| 1458 |
+
|
| 1459 |
+
/*for ($i=0; $i<sizeof($p_file_list); $i++) {
|
| 1460 |
+
// ----- Look if it is a directory
|
| 1461 |
+
if (substr($p_file_list[$i], -1) == '/') {
|
| 1462 |
+
// ----- Look if the directory is in the filename path
|
| 1463 |
+
if ((strlen($v_header['filename']) > strlen($p_file_list[$i]))
|
| 1464 |
+
&& (substr($v_header['filename'], 0, strlen($p_file_list[$i]))
|
| 1465 |
+
== $p_file_list[$i])) {
|
| 1466 |
+
$v_extract_file = TRUE;
|
| 1467 |
+
break;
|
| 1468 |
+
}
|
| 1469 |
+
}
|
| 1470 |
+
|
| 1471 |
+
// ----- It is a file, so compare the file names
|
| 1472 |
+
elseif ($p_file_list[$i] == $v_header['filename']) {
|
| 1473 |
+
$v_extract_file = TRUE;
|
| 1474 |
+
break;
|
| 1475 |
+
}
|
| 1476 |
+
}
|
| 1477 |
+
} else {
|
| 1478 |
+
$v_extract_file = TRUE;
|
| 1479 |
+
}*/
|
| 1480 |
+
|
| 1481 |
+
// ----- Look if this file need to be extracted
|
| 1482 |
+
if (($v_extract_file) && (!$v_listing))
|
| 1483 |
+
{
|
| 1484 |
+
if (($p_remove_path != '')
|
| 1485 |
+
&& (substr($v_header['filename'], 0, $p_remove_path_size)
|
| 1486 |
+
== $p_remove_path))
|
| 1487 |
+
$v_header['filename'] = substr($v_header['filename'],
|
| 1488 |
+
$p_remove_path_size);
|
| 1489 |
+
if (($p_path != './') && ($p_path != '/')) {
|
| 1490 |
+
while (substr($p_path, -1) == '/')
|
| 1491 |
+
$p_path = substr($p_path, 0, strlen($p_path)-1);
|
| 1492 |
+
|
| 1493 |
+
if (substr($v_header['filename'], 0, 1) == '/')
|
| 1494 |
+
$v_header['filename'] = $p_path.$v_header['filename'];
|
| 1495 |
+
else
|
| 1496 |
+
$v_header['filename'] = $p_path.'/'.$v_header['filename'];
|
| 1497 |
+
}
|
| 1498 |
+
if (file_exists($v_header['filename'])) {
|
| 1499 |
+
if ( (@is_dir($v_header['filename']))
|
| 1500 |
+
&& ($v_header['typeflag'] == '')) {
|
| 1501 |
+
$this->_error('File '.$v_header['filename']
|
| 1502 |
+
.' already exists as a directory');
|
| 1503 |
+
return false;
|
| 1504 |
+
}
|
| 1505 |
+
if ( ($this->_isArchive($v_header['filename']))
|
| 1506 |
+
&& ($v_header['typeflag'] == "5")) {
|
| 1507 |
+
$this->_error('Directory '.$v_header['filename']
|
| 1508 |
+
.' already exists as a file');
|
| 1509 |
+
return false;
|
| 1510 |
+
}
|
| 1511 |
+
if (!is_writeable($v_header['filename'])) {
|
| 1512 |
+
$this->_error('File '.$v_header['filename']
|
| 1513 |
+
.' already exists and is write protected');
|
| 1514 |
+
return false;
|
| 1515 |
+
}
|
| 1516 |
+
if (filemtime($v_header['filename']) > $v_header['mtime']) {
|
| 1517 |
+
// To be completed : An error or silent no replace ?
|
| 1518 |
+
}
|
| 1519 |
+
}
|
| 1520 |
+
|
| 1521 |
+
// ----- Check the directory availability and create it if necessary
|
| 1522 |
+
elseif (($v_result
|
| 1523 |
+
= $this->_dirCheck(($v_header['typeflag'] == "5"
|
| 1524 |
+
?$v_header['filename']
|
| 1525 |
+
:dirname($v_header['filename'])))) != 1) {
|
| 1526 |
+
$this->_error('Unable to create path for '.$v_header['filename']);
|
| 1527 |
+
return false;
|
| 1528 |
+
}
|
| 1529 |
+
|
| 1530 |
+
if ($v_extract_file) {
|
| 1531 |
+
if ($v_header['typeflag'] == "5") {
|
| 1532 |
+
if (!@file_exists($v_header['filename'])) {
|
| 1533 |
+
if (!@mkdir($v_header['filename'], 0777)) {
|
| 1534 |
+
$this->_error('Unable to create directory {'
|
| 1535 |
+
.$v_header['filename'].'}');
|
| 1536 |
+
return false;
|
| 1537 |
+
}
|
| 1538 |
+
}
|
| 1539 |
+
} elseif ($v_header['typeflag'] == "2") {
|
| 1540 |
+
if (!@symlink($v_header['link'], $v_header['filename'])) {
|
| 1541 |
+
$this->_error('Unable to extract symbolic link {'
|
| 1542 |
+
.$v_header['filename'].'}');
|
| 1543 |
+
return false;
|
| 1544 |
+
}
|
| 1545 |
+
} else {
|
| 1546 |
+
if (($v_dest_file = @fopen($v_header['filename'], "wb")) == 0) {
|
| 1547 |
+
$this->_error('Error while opening {'.$v_header['filename']
|
| 1548 |
+
.'} in write binary mode');
|
| 1549 |
+
return false;
|
| 1550 |
+
} else {
|
| 1551 |
+
$n = floor($v_header['size']/512);
|
| 1552 |
+
for ($i=0; $i<$n; $i++) {
|
| 1553 |
+
$v_content = $this->_readBlock();
|
| 1554 |
+
fwrite($v_dest_file, $v_content, 512);
|
| 1555 |
+
}
|
| 1556 |
+
if (($v_header['size'] % 512) != 0) {
|
| 1557 |
+
$v_content = $this->_readBlock();
|
| 1558 |
+
fwrite($v_dest_file, $v_content, ($v_header['size'] % 512));
|
| 1559 |
+
}
|
| 1560 |
+
|
| 1561 |
+
@fclose($v_dest_file);
|
| 1562 |
+
|
| 1563 |
+
// ----- Change the file mode, mtime
|
| 1564 |
+
@touch($v_header['filename'], $v_header['mtime']);
|
| 1565 |
+
if ($v_header['mode'] & 0111) {
|
| 1566 |
+
// make file executable, obey umask
|
| 1567 |
+
$mode = fileperms($v_header['filename']) | (~umask() & 0111);
|
| 1568 |
+
@chmod($v_header['filename'], $mode);
|
| 1569 |
+
}
|
| 1570 |
+
}
|
| 1571 |
+
|
| 1572 |
+
// ----- Check the file size
|
| 1573 |
+
clearstatcache();
|
| 1574 |
+
if (filesize($v_header['filename']) != $v_header['size']) {
|
| 1575 |
+
$this->_error('Extracted file '.$v_header['filename']
|
| 1576 |
+
.' does not have the correct file size \''
|
| 1577 |
+
.filesize($v_header['filename'])
|
| 1578 |
+
.'\' ('.$v_header['size']
|
| 1579 |
+
.' expected). Archive may be corrupted.');
|
| 1580 |
+
return false;
|
| 1581 |
+
}
|
| 1582 |
+
}
|
| 1583 |
+
} else {
|
| 1584 |
+
$this->_jumpBlock(ceil(($v_header['size']/512)));
|
| 1585 |
+
}
|
| 1586 |
+
} else {
|
| 1587 |
+
$this->_jumpBlock(ceil(($v_header['size']/512)));
|
| 1588 |
+
}
|
| 1589 |
+
|
| 1590 |
+
/* TBC : Seems to be unused ...
|
| 1591 |
+
if ($this->_compress)
|
| 1592 |
+
$v_end_of_file = @gzeof($this->_file);
|
| 1593 |
+
else
|
| 1594 |
+
$v_end_of_file = @feof($this->_file);
|
| 1595 |
+
*/
|
| 1596 |
+
|
| 1597 |
+
if ($v_listing || $v_extract_file || $v_extraction_stopped) {
|
| 1598 |
+
// ----- Log extracted files
|
| 1599 |
+
if (($v_file_dir = dirname($v_header['filename']))
|
| 1600 |
+
== $v_header['filename'])
|
| 1601 |
+
$v_file_dir = '';
|
| 1602 |
+
if ((substr($v_header['filename'], 0, 1) == '/') && ($v_file_dir == ''))
|
| 1603 |
+
$v_file_dir = '/';
|
| 1604 |
+
|
| 1605 |
+
$p_list_detail[$v_nb++] = $v_header;
|
| 1606 |
+
if (is_array($p_file_list) && (count($p_list_detail) == count($p_file_list))) {
|
| 1607 |
+
return true;
|
| 1608 |
+
}
|
| 1609 |
+
}
|
| 1610 |
+
}
|
| 1611 |
+
|
| 1612 |
+
return true;
|
| 1613 |
+
}
|
| 1614 |
+
// }}}
|
| 1615 |
+
|
| 1616 |
+
|
| 1617 |
+
// {{{ _extractList()
|
| 1618 |
function _extractList($p_path, &$p_list_detail, $p_mode,
|
| 1619 |
+
$p_file_list, $p_remove_path, $limit=0)
|
| 1620 |
{
|
| 1621 |
$v_result=true;
|
| 1622 |
$v_nb = 0;
|
| 1623 |
$v_extract_all = true;
|
| 1624 |
$v_listing = false;
|
| 1625 |
+
$inc = 0;
|
| 1626 |
|
| 1627 |
$p_path = $this->_translateWinPath($p_path, false);
|
| 1628 |
if ($p_path == '' || (substr($p_path, 0, 1) != '/'
|
| 1658 |
|
| 1659 |
while (strlen($v_binary_data = $this->_readBlock()) != 0)
|
| 1660 |
{
|
| 1661 |
+
|
| 1662 |
$v_extract_file = FALSE;
|
| 1663 |
$v_extraction_stopped = 0;
|
| 1664 |
|
| 1669 |
continue;
|
| 1670 |
}
|
| 1671 |
|
| 1672 |
+
//Ovi's code
|
| 1673 |
+
if(($inc >= $limit) and ($limit !=0))
|
| 1674 |
+
return ftell($this->_file);
|
| 1675 |
+
$inc++;
|
| 1676 |
+
|
| 1677 |
// ----- Look for long filename
|
| 1678 |
if ($v_header['typeflag'] == 'L') {
|
| 1679 |
if (!$this->_readLongHeader($v_header))
|
| 1841 |
}
|
| 1842 |
// }}}
|
| 1843 |
|
| 1844 |
+
//extract file by sending v_header and setting seek position
|
| 1845 |
+
function extractFile($tar, &$v_header)
|
| 1846 |
+
{
|
| 1847 |
+
$v_result_str = "";
|
| 1848 |
+
$p_filename = $v_header['filename'];
|
| 1849 |
+
|
| 1850 |
+
// ----- Look for long filename
|
| 1851 |
+
if ($v_header['typeflag'] == 'L') {
|
| 1852 |
+
if (!$tar->_readLongHeader($v_header))
|
| 1853 |
+
return NULL;
|
| 1854 |
+
}
|
| 1855 |
+
|
| 1856 |
+
if ($v_header['typeflag'] == "5") {
|
| 1857 |
+
$tar->_error('Unable to extract in string a directory '
|
| 1858 |
+
.'entry {'.$v_header['filename'].'}');
|
| 1859 |
+
return NULL;
|
| 1860 |
+
} else {
|
| 1861 |
+
$n = floor($v_header['size']/512);
|
| 1862 |
+
for ($i=0; $i<$n; $i++) {
|
| 1863 |
+
$v_result_str .= $tar->_readBlock();
|
| 1864 |
+
}
|
| 1865 |
+
if (($v_header['size'] % 512) != 0) {
|
| 1866 |
+
$v_content = $tar->_readBlock();
|
| 1867 |
+
$v_result_str .= substr($v_content, 0,
|
| 1868 |
+
($v_header['size'] % 512));
|
| 1869 |
+
}
|
| 1870 |
+
return $v_result_str;
|
| 1871 |
+
}
|
| 1872 |
+
|
| 1873 |
+
|
| 1874 |
+
return NULL;
|
| 1875 |
+
}
|
| 1876 |
+
|
| 1877 |
+
|
| 1878 |
// {{{ _openAppend()
|
| 1879 |
function _openAppend()
|
| 1880 |
{
|
| 1881 |
if (filesize($this->_tarname) == 0)
|
| 1882 |
return $this->_openWrite();
|
| 1883 |
+
|
| 1884 |
if ($this->_compress) {
|
| 1885 |
$this->_close();
|
| 1886 |
|
| 1895 |
$v_temp_tar = @gzopen($this->_tarname.".tmp", "rb");
|
| 1896 |
elseif ($this->_compress_type == 'bz2')
|
| 1897 |
$v_temp_tar = @bzopen($this->_tarname.".tmp", "rb");
|
| 1898 |
+
|
| 1899 |
if ($v_temp_tar == 0) {
|
| 1900 |
$this->_error('Unable to open file \''.$this->_tarname
|
| 1901 |
.'.tmp\' in binary read mode');
|
| 1949 |
$v_size = filesize($this->_tarname);
|
| 1950 |
|
| 1951 |
// We might have zero, one or two end blocks.
|
| 1952 |
+
// The standard is two, but we should try to handle
|
| 1953 |
// other cases.
|
| 1954 |
fseek($this->_file, $v_size - 1024);
|
| 1955 |
if (fread($this->_file, 512) == ARCHIVE_TAR_END_BLOCK) {
|
| 1956 |
fseek($this->_file, $v_size - 1024);
|
| 1957 |
}
|
| 1958 |
elseif (fread($this->_file, 512) == ARCHIVE_TAR_END_BLOCK) {
|
| 1959 |
+
fseek($this->_file, $v_size - 512);
|
| 1960 |
}
|
| 1961 |
}
|
| 1962 |
|
| 1969 |
{
|
| 1970 |
if (!$this->_openAppend())
|
| 1971 |
return false;
|
| 1972 |
+
|
| 1973 |
if ($this->_addList($p_filelist, $p_add_dir, $p_remove_dir))
|
| 1974 |
$this->_writeFooter();
|
| 1975 |
|
| 2015 |
// {{{ _pathReduction()
|
| 2016 |
|
| 2017 |
/**
|
| 2018 |
+
* Compress path by changing for example "/dir/foo/../bar" to "/dir/bar",
|
| 2019 |
* rand emove double slashes.
|
| 2020 |
*
|
| 2021 |
* @param string $p_dir path to reduce
|
restore/XCloner.php
CHANGED
|
@@ -1,2222 +1,1362 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
*
|
| 5 |
-
*
|
| 6 |
-
*
|
| 7 |
-
*
|
| 8 |
-
* License
|
| 9 |
-
*
|
| 10 |
-
*
|
| 11 |
-
*
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
|
| 124 |
-
|
| 125 |
-
|
| 126 |
-
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
|
| 130 |
-
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
|
| 134 |
-
|
| 135 |
-
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
|
| 139 |
-
|
| 140 |
-
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
|
| 155 |
-
|
| 156 |
-
|
| 157 |
-
|
| 158 |
-
|
| 159 |
-
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
|
| 163 |
-
|
| 164 |
-
|
| 165 |
-
|
| 166 |
-
|
| 167 |
-
|
| 168 |
-
|
| 169 |
-
</
|
| 170 |
-
|
| 171 |
-
</
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
|
| 179 |
-
|
| 180 |
-
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
|
| 184 |
-
|
| 185 |
-
|
| 186 |
-
|
| 187 |
-
|
| 188 |
-
|
| 189 |
-
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
|
| 200 |
-
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
| 218 |
-
|
| 219 |
-
|
| 220 |
-
|
| 221 |
-
|
| 222 |
-
|
| 223 |
-
|
| 224 |
-
|
| 225 |
-
|
| 226 |
-
|
| 227 |
-
|
| 228 |
-
|
| 229 |
-
|
| 230 |
-
|
| 231 |
-
|
| 232 |
-
|
| 233 |
-
|
| 234 |
-
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
</
|
| 242 |
-
|
| 243 |
-
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
|
| 247 |
-
|
| 248 |
-
|
| 249 |
-
|
| 250 |
-
|
| 251 |
-
|
| 252 |
-
|
| 253 |
-
|
| 254 |
-
|
| 255 |
-
|
| 256 |
-
|
| 257 |
-
|
| 258 |
-
|
| 259 |
-
|
| 260 |
-
|
| 261 |
-
|
| 262 |
-
|
| 263 |
-
|
| 264 |
-
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
|
| 268 |
-
|
| 269 |
-
|
| 270 |
-
|
| 271 |
-
|
| 272 |
-
|
| 273 |
-
|
| 274 |
-
|
| 275 |
-
|
| 276 |
-
|
| 277 |
-
|
| 278 |
-
|
| 279 |
-
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
|
| 283 |
-
|
| 284 |
-
|
| 285 |
-
|
| 286 |
-
|
| 287 |
-
|
| 288 |
-
|
| 289 |
-
|
| 290 |
-
|
| 291 |
-
|
| 292 |
-
|
| 293 |
-
|
| 294 |
-
|
| 295 |
-
|
| 296 |
-
|
| 297 |
-
|
| 298 |
-
|
| 299 |
-
|
| 300 |
-
|
| 301 |
-
|
| 302 |
-
|
| 303 |
-
|
| 304 |
-
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
|
| 310 |
-
|
| 311 |
-
|
| 312 |
-
|
| 313 |
-
|
| 314 |
-
|
| 315 |
-
|
| 316 |
-
|
| 317 |
-
|
| 318 |
-
|
| 319 |
-
|
| 320 |
-
|
| 321 |
-
|
| 322 |
-
|
| 323 |
-
|
| 324 |
-
|
| 325 |
-
|
| 326 |
-
|
| 327 |
-
|
| 328 |
-
|
| 329 |
-
|
| 330 |
-
|
| 331 |
-
|
| 332 |
-
|
| 333 |
-
|
| 334 |
-
|
| 335 |
-
|
| 336 |
-
|
| 337 |
-
|
| 338 |
-
|
| 339 |
-
|
| 340 |
-
|
| 341 |
-
|
| 342 |
-
|
| 343 |
-
|
| 344 |
-
|
| 345 |
-
|
| 346 |
-
|
| 347 |
-
|
| 348 |
-
|
| 349 |
-
|
| 350 |
-
|
| 351 |
-
|
| 352 |
-
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
|
| 356 |
-
|
| 357 |
-
|
| 358 |
-
|
| 359 |
-
|
| 360 |
-
|
| 361 |
-
|
| 362 |
-
|
| 363 |
-
|
| 364 |
-
|
| 365 |
-
|
| 366 |
-
|
| 367 |
-
|
| 368 |
-
|
| 369 |
-
|
| 370 |
-
|
| 371 |
-
|
| 372 |
-
|
| 373 |
-
|
| 374 |
-
|
| 375 |
-
|
| 376 |
-
|
| 377 |
-
|
| 378 |
-
|
| 379 |
-
|
| 380 |
-
|
| 381 |
-
|
| 382 |
-
|
| 383 |
-
|
| 384 |
-
|
| 385 |
-
|
| 386 |
-
|
| 387 |
-
|
| 388 |
-
|
| 389 |
-
|
| 390 |
-
|
| 391 |
-
|
| 392 |
-
|
| 393 |
-
|
| 394 |
-
|
| 395 |
-
|
| 396 |
-
|
| 397 |
-
|
| 398 |
-
|
| 399 |
-
|
| 400 |
-
}
|
| 401 |
-
|
| 402 |
-
|
| 403 |
-
|
| 404 |
-
|
| 405 |
-
|
| 406 |
-
|
| 407 |
-
|
| 408 |
-
|
| 409 |
-
|
| 410 |
-
|
| 411 |
-
|
| 412 |
-
|
| 413 |
-
|
| 414 |
-
|
| 415 |
-
|
| 416 |
-
|
| 417 |
-
|
| 418 |
-
|
| 419 |
-
|
| 420 |
-
|
| 421 |
-
|
| 422 |
-
|
| 423 |
-
|
| 424 |
-
|
| 425 |
-
|
| 426 |
-
|
| 427 |
-
|
| 428 |
-
|
| 429 |
-
|
| 430 |
-
|
| 431 |
-
|
| 432 |
-
|
| 433 |
-
|
| 434 |
-
|
| 435 |
-
|
| 436 |
-
|
| 437 |
-
|
| 438 |
-
|
| 439 |
-
|
| 440 |
-
|
| 441 |
-
|
| 442 |
-
|
| 443 |
-
|
| 444 |
-
|
| 445 |
-
|
| 446 |
-
|
| 447 |
-
|
| 448 |
-
|
| 449 |
-
|
| 450 |
-
|
| 451 |
-
|
| 452 |
-
|
| 453 |
-
|
| 454 |
-
|
| 455 |
-
|
| 456 |
-
|
| 457 |
-
|
| 458 |
-
|
| 459 |
-
|
| 460 |
-
|
| 461 |
-
|
| 462 |
-
|
| 463 |
-
|
| 464 |
-
|
| 465 |
-
|
| 466 |
-
|
| 467 |
-
|
| 468 |
-
|
| 469 |
-
|
| 470 |
-
|
| 471 |
-
|
| 472 |
-
|
| 473 |
-
|
| 474 |
-
|
| 475 |
-
|
| 476 |
-
|
| 477 |
-
|
| 478 |
-
|
| 479 |
-
|
| 480 |
-
|
| 481 |
-
|
| 482 |
-
|
| 483 |
-
|
| 484 |
-
|
| 485 |
-
|
| 486 |
-
|
| 487 |
-
|
| 488 |
-
|
| 489 |
-
|
| 490 |
-
|
| 491 |
-
|
| 492 |
-
|
| 493 |
-
|
| 494 |
-
|
| 495 |
-
|
| 496 |
-
|
| 497 |
-
|
| 498 |
-
|
| 499 |
-
|
| 500 |
-
|
| 501 |
-
|
| 502 |
-
|
| 503 |
-
|
| 504 |
-
|
| 505 |
-
|
| 506 |
-
|
| 507 |
-
|
| 508 |
-
|
| 509 |
-
|
| 510 |
-
|
| 511 |
-
|
| 512 |
-
|
| 513 |
-
|
| 514 |
-
|
| 515 |
-
|
| 516 |
-
|
| 517 |
-
|
| 518 |
-
|
| 519 |
-
|
| 520 |
-
|
| 521 |
-
|
| 522 |
-
|
| 523 |
-
|
| 524 |
-
|
| 525 |
-
|
| 526 |
-
|
| 527 |
-
|
| 528 |
-
|
| 529 |
-
|
| 530 |
-
|
| 531 |
-
|
| 532 |
-
|
| 533 |
-
|
| 534 |
-
|
| 535 |
-
|
| 536 |
-
|
| 537 |
-
|
| 538 |
-
|
| 539 |
-
|
| 540 |
-
|
| 541 |
-
|
| 542 |
-
echo "<
|
| 543 |
-
|
| 544 |
-
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
|
| 548 |
-
|
| 549 |
-
|
| 550 |
-
|
| 551 |
-
|
| 552 |
-
|
| 553 |
-
|
| 554 |
-
|
| 555 |
-
|
| 556 |
-
|
| 557 |
-
|
| 558 |
-
|
| 559 |
-
|
| 560 |
-
|
| 561 |
-
|
| 562 |
-
|
| 563 |
-
|
| 564 |
-
|
| 565 |
-
|
| 566 |
-
|
| 567 |
-
|
| 568 |
-
|
| 569 |
-
|
| 570 |
-
|
| 571 |
-
|
| 572 |
-
|
| 573 |
-
|
| 574 |
-
|
| 575 |
-
|
| 576 |
-
|
| 577 |
-
|
| 578 |
-
|
| 579 |
-
|
| 580 |
-
|
| 581 |
-
|
| 582 |
-
|
| 583 |
-
|
| 584 |
-
|
| 585 |
-
|
| 586 |
-
|
| 587 |
-
|
| 588 |
-
|
| 589 |
-
|
| 590 |
-
|
| 591 |
-
|
| 592 |
-
|
| 593 |
-
|
| 594 |
-
|
| 595 |
-
|
| 596 |
-
|
| 597 |
-
|
| 598 |
-
|
| 599 |
-
|
| 600 |
-
|
| 601 |
-
|
| 602 |
-
|
| 603 |
-
|
| 604 |
-
|
| 605 |
-
|
| 606 |
-
|
| 607 |
-
|
| 608 |
-
|
| 609 |
-
|
| 610 |
-
|
| 611 |
-
|
| 612 |
-
|
| 613 |
-
|
| 614 |
-
|
| 615 |
-
|
| 616 |
-
|
| 617 |
-
|
| 618 |
-
|
| 619 |
-
|
| 620 |
-
|
| 621 |
-
|
| 622 |
-
|
| 623 |
-
|
| 624 |
-
|
| 625 |
-
|
| 626 |
-
|
| 627 |
-
|
| 628 |
-
|
| 629 |
-
|
| 630 |
-
|
| 631 |
-
|
| 632 |
-
|
| 633 |
-
|
| 634 |
-
|
| 635 |
-
|
| 636 |
-
|
| 637 |
-
|
| 638 |
-
|
| 639 |
-
|
| 640 |
-
|
| 641 |
-
|
| 642 |
-
|
| 643 |
-
|
| 644 |
-
|
| 645 |
-
|
| 646 |
-
|
| 647 |
-
|
| 648 |
-
|
| 649 |
-
|
| 650 |
-
|
| 651 |
-
|
| 652 |
-
|
| 653 |
-
|
| 654 |
-
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
|
| 658 |
-
|
| 659 |
-
|
| 660 |
-
|
| 661 |
-
|
| 662 |
-
|
| 663 |
-
|
| 664 |
-
|
| 665 |
-
|
| 666 |
-
|
| 667 |
-
|
| 668 |
-
|
| 669 |
-
|
| 670 |
-
|
| 671 |
-
|
| 672 |
-
|
| 673 |
-
|
| 674 |
-
|
| 675 |
-
|
| 676 |
-
|
| 677 |
-
|
| 678 |
-
|
| 679 |
-
|
| 680 |
-
|
| 681 |
-
|
| 682 |
-
|
| 683 |
-
|
| 684 |
-
|
| 685 |
-
|
| 686 |
-
|
| 687 |
-
|
| 688 |
-
|
| 689 |
-
|
| 690 |
-
|
| 691 |
-
|
| 692 |
-
|
| 693 |
-
|
| 694 |
-
|
| 695 |
-
|
| 696 |
-
|
| 697 |
-
|
| 698 |
-
|
| 699 |
-
|
| 700 |
-
|
| 701 |
-
|
| 702 |
-
|
| 703 |
-
|
| 704 |
-
|
| 705 |
-
|
| 706 |
-
|
| 707 |
-
|
| 708 |
-
|
| 709 |
-
|
| 710 |
-
|
| 711 |
-
|
| 712 |
-
|
| 713 |
-
|
| 714 |
-
|
| 715 |
-
|
| 716 |
-
|
| 717 |
-
|
| 718 |
-
|
| 719 |
-
|
| 720 |
-
|
| 721 |
-
|
| 722 |
-
|
| 723 |
-
|
| 724 |
-
|
| 725 |
-
|
| 726 |
-
|
| 727 |
-
|
| 728 |
-
|
| 729 |
-
|
| 730 |
-
|
| 731 |
-
|
| 732 |
-
|
| 733 |
-
|
| 734 |
-
|
| 735 |
-
|
| 736 |
-
|
| 737 |
-
|
| 738 |
-
|
| 739 |
-
|
| 740 |
-
|
| 741 |
-
|
| 742 |
-
|
| 743 |
-
|
| 744 |
-
|
| 745 |
-
|
| 746 |
-
|
| 747 |
-
|
| 748 |
-
|
| 749 |
-
|
| 750 |
-
|
| 751 |
-
|
| 752 |
-
|
| 753 |
-
|
| 754 |
-
|
| 755 |
-
|
| 756 |
-
|
| 757 |
-
|
| 758 |
-
|
| 759 |
-
|
| 760 |
-
|
| 761 |
-
|
| 762 |
-
|
| 763 |
-
|
| 764 |
-
|
| 765 |
-
|
| 766 |
-
|
| 767 |
-
|
| 768 |
-
|
| 769 |
-
|
| 770 |
-
|
| 771 |
-
|
| 772 |
-
|
| 773 |
-
|
| 774 |
-
|
| 775 |
-
|
| 776 |
-
|
| 777 |
-
|
| 778 |
-
|
| 779 |
-
|
| 780 |
-
|
| 781 |
-
|
| 782 |
-
|
| 783 |
-
|
| 784 |
-
|
| 785 |
-
|
| 786 |
-
|
| 787 |
-
|
| 788 |
-
|
| 789 |
-
|
| 790 |
-
|
| 791 |
-
|
| 792 |
-
|
| 793 |
-
|
| 794 |
-
|
| 795 |
-
|
| 796 |
-
|
| 797 |
-
|
| 798 |
-
|
| 799 |
-
|
| 800 |
-
|
| 801 |
-
|
| 802 |
-
|
| 803 |
-
|
| 804 |
-
|
| 805 |
-
|
| 806 |
-
|
| 807 |
-
|
| 808 |
-
|
| 809 |
-
|
| 810 |
-
|
| 811 |
-
|
| 812 |
-
|
| 813 |
-
|
| 814 |
-
|
| 815 |
-
|
| 816 |
-
|
| 817 |
-
|
| 818 |
-
|
| 819 |
-
|
| 820 |
-
|
| 821 |
-
|
| 822 |
-
|
| 823 |
-
|
| 824 |
-
|
| 825 |
-
|
| 826 |
-
|
| 827 |
-
|
| 828 |
-
|
| 829 |
-
|
| 830 |
-
|
| 831 |
-
|
| 832 |
-
|
| 833 |
-
|
| 834 |
-
|
| 835 |
-
|
| 836 |
-
|
| 837 |
-
|
| 838 |
-
|
| 839 |
-
|
| 840 |
-
|
| 841 |
-
|
| 842 |
-
|
| 843 |
-
|
| 844 |
-
|
| 845 |
-
|
| 846 |
-
|
| 847 |
-
|
| 848 |
-
|
| 849 |
-
|
| 850 |
-
|
| 851 |
-
|
| 852 |
-
|
| 853 |
-
|
| 854 |
-
|
| 855 |
-
|
| 856 |
-
|
| 857 |
-
|
| 858 |
-
|
| 859 |
-
|
| 860 |
-
|
| 861 |
-
|
| 862 |
-
|
| 863 |
-
|
| 864 |
-
|
| 865 |
-
|
| 866 |
-
|
| 867 |
-
|
| 868 |
-
|
| 869 |
-
|
| 870 |
-
|
| 871 |
-
|
| 872 |
-
|
| 873 |
-
|
| 874 |
-
|
| 875 |
-
|
| 876 |
-
|
| 877 |
-
|
| 878 |
-
|
| 879 |
-
|
| 880 |
-
|
| 881 |
-
|
| 882 |
-
|
| 883 |
-
|
| 884 |
-
|
| 885 |
-
|
| 886 |
-
|
| 887 |
-
|
| 888 |
-
|
| 889 |
-
|
| 890 |
-
|
| 891 |
-
|
| 892 |
-
|
| 893 |
-
|
| 894 |
-
|
| 895 |
-
|
| 896 |
-
|
| 897 |
-
|
| 898 |
-
|
| 899 |
-
|
| 900 |
-
|
| 901 |
-
|
| 902 |
-
|
| 903 |
-
|
| 904 |
-
|
| 905 |
-
|
| 906 |
-
|
| 907 |
-
|
| 908 |
-
|
| 909 |
-
|
| 910 |
-
|
| 911 |
-
|
| 912 |
-
|
| 913 |
-
|
| 914 |
-
|
| 915 |
-
|
| 916 |
-
|
| 917 |
-
|
| 918 |
-
|
| 919 |
-
|
| 920 |
-
|
| 921 |
-
|
| 922 |
-
|
| 923 |
-
|
| 924 |
-
|
| 925 |
-
|
| 926 |
-
|
| 927 |
-
|
| 928 |
-
|
| 929 |
-
|
| 930 |
-
|
| 931 |
-
|
| 932 |
-
|
| 933 |
-
|
| 934 |
-
|
| 935 |
-
|
| 936 |
-
|
| 937 |
-
|
| 938 |
-
|
| 939 |
-
|
| 940 |
-
|
| 941 |
-
|
| 942 |
-
|
| 943 |
-
|
| 944 |
-
|
| 945 |
-
|
| 946 |
-
|
| 947 |
-
|
| 948 |
-
|
| 949 |
-
|
| 950 |
-
|
| 951 |
-
|
| 952 |
-
|
| 953 |
-
|
| 954 |
-
|
| 955 |
-
|
| 956 |
-
|
| 957 |
-
|
| 958 |
-
|
| 959 |
-
|
| 960 |
-
|
| 961 |
-
|
| 962 |
-
|
| 963 |
-
|
| 964 |
-
|
| 965 |
-
|
| 966 |
-
|
| 967 |
-
|
| 968 |
-
|
| 969 |
-
|
| 970 |
-
|
| 971 |
-
|
| 972 |
-
|
| 973 |
-
|
| 974 |
-
|
| 975 |
-
|
| 976 |
-
|
| 977 |
-
|
| 978 |
-
|
| 979 |
-
|
| 980 |
-
|
| 981 |
-
|
| 982 |
-
|
| 983 |
-
|
| 984 |
-
|
| 985 |
-
|
| 986 |
-
|
| 987 |
-
|
| 988 |
-
|
| 989 |
-
|
| 990 |
-
|
| 991 |
-
|
| 992 |
-
|
| 993 |
-
|
| 994 |
-
|
| 995 |
-
|
| 996 |
-
|
| 997 |
-
|
| 998 |
-
|
| 999 |
-
|
| 1000 |
-
|
| 1001 |
-
|
| 1002 |
-
|
| 1003 |
-
|
| 1004 |
-
|
| 1005 |
-
|
| 1006 |
-
|
| 1007 |
-
|
| 1008 |
-
|
| 1009 |
-
|
| 1010 |
-
|
| 1011 |
-
|
| 1012 |
-
|
| 1013 |
-
|
| 1014 |
-
|
| 1015 |
-
|
| 1016 |
-
|
| 1017 |
-
|
| 1018 |
-
|
| 1019 |
-
|
| 1020 |
-
|
| 1021 |
-
|
| 1022 |
-
|
| 1023 |
-
|
| 1024 |
-
|
| 1025 |
-
|
| 1026 |
-
|
| 1027 |
-
|
| 1028 |
-
|
| 1029 |
-
|
| 1030 |
-
|
| 1031 |
-
|
| 1032 |
-
|
| 1033 |
-
|
| 1034 |
-
|
| 1035 |
-
|
| 1036 |
-
|
| 1037 |
-
|
| 1038 |
-
|
| 1039 |
-
|
| 1040 |
-
|
| 1041 |
-
|
| 1042 |
-
|
| 1043 |
-
|
| 1044 |
-
|
| 1045 |
-
|
| 1046 |
-
|
| 1047 |
-
|
| 1048 |
-
|
| 1049 |
-
|
| 1050 |
-
|
| 1051 |
-
|
| 1052 |
-
|
| 1053 |
-
|
| 1054 |
-
|
| 1055 |
-
|
| 1056 |
-
|
| 1057 |
-
|
| 1058 |
-
|
| 1059 |
-
|
| 1060 |
-
|
| 1061 |
-
|
| 1062 |
-
|
| 1063 |
-
|
| 1064 |
-
|
| 1065 |
-
|
| 1066 |
-
|
| 1067 |
-
|
| 1068 |
-
|
| 1069 |
-
|
| 1070 |
-
|
| 1071 |
-
|
| 1072 |
-
|
| 1073 |
-
|
| 1074 |
-
|
| 1075 |
-
|
| 1076 |
-
|
| 1077 |
-
|
| 1078 |
-
|
| 1079 |
-
|
| 1080 |
-
|
| 1081 |
-
|
| 1082 |
-
|
| 1083 |
-
|
| 1084 |
-
|
| 1085 |
-
|
| 1086 |
-
|
| 1087 |
-
|
| 1088 |
-
|
| 1089 |
-
|
| 1090 |
-
|
| 1091 |
-
|
| 1092 |
-
$
|
| 1093 |
-
|
| 1094 |
-
$
|
| 1095 |
-
|
| 1096 |
-
|
| 1097 |
-
|
| 1098 |
-
|
| 1099 |
-
|
| 1100 |
-
|
| 1101 |
-
|
| 1102 |
-
|
| 1103 |
-
|
| 1104 |
-
|
| 1105 |
-
|
| 1106 |
-
|
| 1107 |
-
|
| 1108 |
-
|
| 1109 |
-
|
| 1110 |
-
|
| 1111 |
-
|
| 1112 |
-
|
| 1113 |
-
|
| 1114 |
-
|
| 1115 |
-
|
| 1116 |
-
|
| 1117 |
-
|
| 1118 |
-
|
| 1119 |
-
|
| 1120 |
-
|
| 1121 |
-
|
| 1122 |
-
|
| 1123 |
-
|
| 1124 |
-
|
| 1125 |
-
|
| 1126 |
-
|
| 1127 |
-
|
| 1128 |
-
|
| 1129 |
-
|
| 1130 |
-
|
| 1131 |
-
|
| 1132 |
-
|
| 1133 |
-
|
| 1134 |
-
|
| 1135 |
-
|
| 1136 |
-
|
| 1137 |
-
|
| 1138 |
-
|
| 1139 |
-
|
| 1140 |
-
|
| 1141 |
-
|
| 1142 |
-
|
| 1143 |
-
|
| 1144 |
-
|
| 1145 |
-
|
| 1146 |
-
|
| 1147 |
-
|
| 1148 |
-
|
| 1149 |
-
|
| 1150 |
-
|
| 1151 |
-
|
| 1152 |
-
|
| 1153 |
-
|
| 1154 |
-
|
| 1155 |
-
|
| 1156 |
-
|
| 1157 |
-
|
| 1158 |
-
|
| 1159 |
-
|
| 1160 |
-
|
| 1161 |
-
|
| 1162 |
-
|
| 1163 |
-
|
| 1164 |
-
|
| 1165 |
-
|
| 1166 |
-
|
| 1167 |
-
|
| 1168 |
-
|
| 1169 |
-
|
| 1170 |
-
|
| 1171 |
-
|
| 1172 |
-
|
| 1173 |
-
|
| 1174 |
-
|
| 1175 |
-
|
| 1176 |
-
|
| 1177 |
-
|
| 1178 |
-
|
| 1179 |
-
|
| 1180 |
-
|
| 1181 |
-
|
| 1182 |
-
|
| 1183 |
-
|
| 1184 |
-
|
| 1185 |
-
|
| 1186 |
-
|
| 1187 |
-
|
| 1188 |
-
|
| 1189 |
-
|
| 1190 |
-
|
| 1191 |
-
|
| 1192 |
-
|
| 1193 |
-
|
| 1194 |
-
|
| 1195 |
-
|
| 1196 |
-
|
| 1197 |
-
|
| 1198 |
-
|
| 1199 |
-
|
| 1200 |
-
|
| 1201 |
-
|
| 1202 |
-
|
| 1203 |
-
|
| 1204 |
-
|
| 1205 |
-
|
| 1206 |
-
|
| 1207 |
-
|
| 1208 |
-
|
| 1209 |
-
|
| 1210 |
-
|
| 1211 |
-
|
| 1212 |
-
|
| 1213 |
-
|
| 1214 |
-
|
| 1215 |
-
|
| 1216 |
-
|
| 1217 |
-
|
| 1218 |
-
|
| 1219 |
-
|
| 1220 |
-
|
| 1221 |
-
|
| 1222 |
-
|
| 1223 |
-
|
| 1224 |
-
|
| 1225 |
-
|
| 1226 |
-
|
| 1227 |
-
|
| 1228 |
-
|
| 1229 |
-
|
| 1230 |
-
|
| 1231 |
-
|
| 1232 |
-
|
| 1233 |
-
|
| 1234 |
-
|
| 1235 |
-
|
| 1236 |
-
|
| 1237 |
-
|
| 1238 |
-
|
| 1239 |
-
|
| 1240 |
-
|
| 1241 |
-
|
| 1242 |
-
|
| 1243 |
-
|
| 1244 |
-
|
| 1245 |
-
|
| 1246 |
-
|
| 1247 |
-
|
| 1248 |
-
|
| 1249 |
-
|
| 1250 |
-
|
| 1251 |
-
|
| 1252 |
-
|
| 1253 |
-
|
| 1254 |
-
|
| 1255 |
-
|
| 1256 |
-
|
| 1257 |
-
|
| 1258 |
-
|
| 1259 |
-
|
| 1260 |
-
|
| 1261 |
-
|
| 1262 |
-
|
| 1263 |
-
|
| 1264 |
-
|
| 1265 |
-
|
| 1266 |
-
|
| 1267 |
-
|
| 1268 |
-
|
| 1269 |
-
|
| 1270 |
-
|
| 1271 |
-
|
| 1272 |
-
|
| 1273 |
-
|
| 1274 |
-
|
| 1275 |
-
|
| 1276 |
-
|
| 1277 |
-
|
| 1278 |
-
|
| 1279 |
-
|
| 1280 |
-
|
| 1281 |
-
|
| 1282 |
-
|
| 1283 |
-
|
| 1284 |
-
|
| 1285 |
-
|
| 1286 |
-
|
| 1287 |
-
|
| 1288 |
-
|
| 1289 |
-
|
| 1290 |
-
|
| 1291 |
-
|
| 1292 |
-
|
| 1293 |
-
|
| 1294 |
-
|
| 1295 |
-
|
| 1296 |
-
|
| 1297 |
-
|
| 1298 |
-
|
| 1299 |
-
|
| 1300 |
-
|
| 1301 |
-
|
| 1302 |
-
|
| 1303 |
-
|
| 1304 |
-
if
|
| 1305 |
-
|
| 1306 |
-
|
| 1307 |
-
|
| 1308 |
-
|
| 1309 |
-
|
| 1310 |
-
|
| 1311 |
-
|
| 1312 |
-
|
| 1313 |
-
|
| 1314 |
-
|
| 1315 |
-
|
| 1316 |
-
|
| 1317 |
-
|
| 1318 |
-
|
| 1319 |
-
|
| 1320 |
-
|
| 1321 |
-
|
| 1322 |
-
|
| 1323 |
-
|
| 1324 |
-
|
| 1325 |
-
|
| 1326 |
-
|
| 1327 |
-
|
| 1328 |
-
|
| 1329 |
-
|
| 1330 |
-
|
| 1331 |
-
|
| 1332 |
-
|
| 1333 |
-
|
| 1334 |
-
|
| 1335 |
-
|
| 1336 |
-
|
| 1337 |
-
|
| 1338 |
-
|
| 1339 |
-
|
| 1340 |
-
|
| 1341 |
-
|
| 1342 |
-
|
| 1343 |
-
|
| 1344 |
-
|
| 1345 |
-
|
| 1346 |
-
|
| 1347 |
-
|
| 1348 |
-
|
| 1349 |
-
|
| 1350 |
-
|
| 1351 |
-
|
| 1352 |
-
|
| 1353 |
-
|
| 1354 |
-
|
| 1355 |
-
|
| 1356 |
-
|
| 1357 |
-
|
| 1358 |
-
|
| 1359 |
-
|
| 1360 |
-
|
| 1361 |
-
|
| 1362 |
-
|
| 1363 |
-
|
| 1364 |
-
|
| 1365 |
-
|
| 1366 |
-
<tr><td colspan=2>
|
| 1367 |
-
|
| 1368 |
-
<table width='100%'>
|
| 1369 |
-
|
| 1370 |
-
<tr>
|
| 1371 |
-
|
| 1372 |
-
<td width='50%' valign='top'>
|
| 1373 |
-
|
| 1374 |
-
|
| 1375 |
-
|
| 1376 |
-
<table width='100%'>
|
| 1377 |
-
|
| 1378 |
-
<tr><td colspan='2'>
|
| 1379 |
-
|
| 1380 |
-
Install files throught ftp: <input type='checkbox' value='1' name='manual_ftp' checked> - incremental transfer
|
| 1381 |
-
|
| 1382 |
-
</td></tr>
|
| 1383 |
-
|
| 1384 |
-
<tr>
|
| 1385 |
-
|
| 1386 |
-
<td colspan='2'><input type=radio name=transfer_mode value=2 checked>
|
| 1387 |
-
|
| 1388 |
-
<br />
|
| 1389 |
-
|
| 1390 |
-
<small>this will attempt to transfer all files through ftp, so the owner keep it's permissions, can be used to send files to other hosts also, <font color=red>*recommended</font></small>
|
| 1391 |
-
|
| 1392 |
-
</td>
|
| 1393 |
-
|
| 1394 |
-
</tr>
|
| 1395 |
-
|
| 1396 |
-
|
| 1397 |
-
|
| 1398 |
-
<tr>
|
| 1399 |
-
|
| 1400 |
-
<td nowrap>Ftp server:</td>
|
| 1401 |
-
|
| 1402 |
-
<td><input type=text size=30 name='ftp_server' value='localhost'><br />
|
| 1403 |
-
|
| 1404 |
-
port: <input type=text size=5 name='ftp_port' value='21'></td>
|
| 1405 |
-
|
| 1406 |
-
</tr>
|
| 1407 |
-
|
| 1408 |
-
<tr>
|
| 1409 |
-
|
| 1410 |
-
<td>Ftp user:</td>
|
| 1411 |
-
|
| 1412 |
-
<td><input type=text size=30 name='ftp_user'></td>
|
| 1413 |
-
|
| 1414 |
-
</tr>
|
| 1415 |
-
|
| 1416 |
-
<tr>
|
| 1417 |
-
|
| 1418 |
-
<td>Ftp pass:</td>
|
| 1419 |
-
|
| 1420 |
-
<td><input type=text size=30 name='ftp_pass'></td>
|
| 1421 |
-
|
| 1422 |
-
</tr>
|
| 1423 |
-
|
| 1424 |
-
<tr>
|
| 1425 |
-
|
| 1426 |
-
<td>Ftp path:</td>
|
| 1427 |
-
|
| 1428 |
-
<td><input type=text size=30 name='ftp_path'>
|
| 1429 |
-
|
| 1430 |
-
<br><small>ftp root path of where Joomla will be installed</small>
|
| 1431 |
-
|
| 1432 |
-
</td>
|
| 1433 |
-
|
| 1434 |
-
</tr>
|
| 1435 |
-
|
| 1436 |
-
</table>
|
| 1437 |
-
|
| 1438 |
-
|
| 1439 |
-
|
| 1440 |
-
</td>
|
| 1441 |
-
|
| 1442 |
-
<td width='50%' valign=top>
|
| 1443 |
-
|
| 1444 |
-
|
| 1445 |
-
|
| 1446 |
-
<table width='100%'>
|
| 1447 |
-
|
| 1448 |
-
<tr><td>
|
| 1449 |
-
|
| 1450 |
-
Install files directly:
|
| 1451 |
-
|
| 1452 |
-
</td></tr>
|
| 1453 |
-
|
| 1454 |
-
<tr>
|
| 1455 |
-
|
| 1456 |
-
<td><input type=radio name=transfer_mode value=1>
|
| 1457 |
-
|
| 1458 |
-
<br />
|
| 1459 |
-
|
| 1460 |
-
<small>transfering the files directly will cause some permissions problem in some cases, but it's faster than the other option </small>
|
| 1461 |
-
|
| 1462 |
-
</td>
|
| 1463 |
-
|
| 1464 |
-
</tr>
|
| 1465 |
-
|
| 1466 |
-
</table>
|
| 1467 |
-
|
| 1468 |
-
|
| 1469 |
-
|
| 1470 |
-
</td>
|
| 1471 |
-
|
| 1472 |
-
</tr>
|
| 1473 |
-
|
| 1474 |
-
|
| 1475 |
-
|
| 1476 |
-
|
| 1477 |
-
|
| 1478 |
-
</table>
|
| 1479 |
-
|
| 1480 |
-
</td></tr>
|
| 1481 |
-
|
| 1482 |
-
<tr><td>
|
| 1483 |
-
|
| 1484 |
-
|
| 1485 |
-
|
| 1486 |
-
</td></tr>
|
| 1487 |
-
|
| 1488 |
-
|
| 1489 |
-
|
| 1490 |
-
<tr><td colspan='2'>
|
| 1491 |
-
|
| 1492 |
-
|
| 1493 |
-
|
| 1494 |
-
<input type=submit name=submit value='Start install' >
|
| 1495 |
-
|
| 1496 |
-
<br /><small>*after hitting submit please wait for the package to get unarchived and transfered through ftp if it is the case!</small>
|
| 1497 |
-
|
| 1498 |
-
|
| 1499 |
-
|
| 1500 |
-
<br /><b>NOTE:*** IMPORTANT - if you plan to apply this script to a live site - upgrade or fresh install over existing files please
|
| 1501 |
-
|
| 1502 |
-
make sure you first make a backup of them! </b>
|
| 1503 |
-
|
| 1504 |
-
</td></tr>
|
| 1505 |
-
|
| 1506 |
-
|
| 1507 |
-
|
| 1508 |
-
</table>
|
| 1509 |
-
|
| 1510 |
-
|
| 1511 |
-
|
| 1512 |
-
<?php
|
| 1513 |
-
|
| 1514 |
-
|
| 1515 |
-
|
| 1516 |
-
}
|
| 1517 |
-
|
| 1518 |
-
|
| 1519 |
-
|
| 1520 |
-
function getPHPINFO(){
|
| 1521 |
-
|
| 1522 |
-
|
| 1523 |
-
|
| 1524 |
-
?>
|
| 1525 |
-
|
| 1526 |
-
<table width='100%'>
|
| 1527 |
-
|
| 1528 |
-
<tr bgcolor='#dddddd'><td>
|
| 1529 |
-
|
| 1530 |
-
<b>Php Configuration: <a target='_blank' href='XCloner.php?task=info'> phpinfo()</a></b>
|
| 1531 |
-
|
| 1532 |
-
</td></tr>
|
| 1533 |
-
|
| 1534 |
-
|
| 1535 |
-
|
| 1536 |
-
<tr><td>
|
| 1537 |
-
|
| 1538 |
-
<table bgcolor='#dddddd' width='65%' style='font-size:10px; text-align:center;' border='1'>
|
| 1539 |
-
|
| 1540 |
-
|
| 1541 |
-
|
| 1542 |
-
<tr>
|
| 1543 |
-
|
| 1544 |
-
<td><b style='color:red'>PHP Setting</b></td>
|
| 1545 |
-
|
| 1546 |
-
<td><b style='color:orange'>Current Value</b></td>
|
| 1547 |
-
|
| 1548 |
-
<td><b style='color:green'>Recomemnded</b></td>
|
| 1549 |
-
|
| 1550 |
-
</tr>
|
| 1551 |
-
|
| 1552 |
-
|
| 1553 |
-
|
| 1554 |
-
<tr>
|
| 1555 |
-
|
| 1556 |
-
<td><b>Open_Basedir:</b> </td>
|
| 1557 |
-
|
| 1558 |
-
<td>
|
| 1559 |
-
|
| 1560 |
-
<?php echo (@ini_get('open_basedir') ? @ini_get('open_basedir') : 'No value')?>
|
| 1561 |
-
|
| 1562 |
-
</td>
|
| 1563 |
-
|
| 1564 |
-
<td><b>No Value</b></td>
|
| 1565 |
-
|
| 1566 |
-
</tr>
|
| 1567 |
-
|
| 1568 |
-
|
| 1569 |
-
|
| 1570 |
-
<tr>
|
| 1571 |
-
|
| 1572 |
-
<td><b>Max Execution Time:</b> </td>
|
| 1573 |
-
|
| 1574 |
-
<td>
|
| 1575 |
-
|
| 1576 |
-
<?php echo (@ini_get('max_execution_time') ? @ini_get('max_execution_time') : 'No value')?>
|
| 1577 |
-
|
| 1578 |
-
</td>
|
| 1579 |
-
|
| 1580 |
-
<td><b>>30</b></td>
|
| 1581 |
-
|
| 1582 |
-
</tr>
|
| 1583 |
-
|
| 1584 |
-
|
| 1585 |
-
|
| 1586 |
-
<tr>
|
| 1587 |
-
|
| 1588 |
-
<td><b>Safe mode:</b> </td>
|
| 1589 |
-
|
| 1590 |
-
<td>
|
| 1591 |
-
|
| 1592 |
-
<?php echo (@ini_get('safe_mode') ? @ini_get('safe_mode') : 'Off')?>
|
| 1593 |
-
|
| 1594 |
-
</td>
|
| 1595 |
-
|
| 1596 |
-
<td><b>Off</b></td>
|
| 1597 |
-
|
| 1598 |
-
</tr>
|
| 1599 |
-
|
| 1600 |
-
|
| 1601 |
-
|
| 1602 |
-
</table>
|
| 1603 |
-
|
| 1604 |
-
</td></tr>
|
| 1605 |
-
|
| 1606 |
-
|
| 1607 |
-
|
| 1608 |
-
</table>
|
| 1609 |
-
|
| 1610 |
-
<?php
|
| 1611 |
-
}
|
| 1612 |
-
|
| 1613 |
-
|
| 1614 |
-
###END
|
| 1615 |
-
|
| 1616 |
-
|
| 1617 |
-
###Starting the manual sql backup
|
| 1618 |
-
|
| 1619 |
-
function populate_db_manual( $db, $sqlfile='administrator/backups/database-sql.sql'){
|
| 1620 |
-
|
| 1621 |
-
global $qstr;
|
| 1622 |
-
|
| 1623 |
-
$extra_que = $qstr[0];
|
| 1624 |
-
|
| 1625 |
-
$file = $sqlfile;
|
| 1626 |
-
|
| 1627 |
-
define ('DATA_CHUNK_LENGTH',16384); // How many chars are read per time
|
| 1628 |
-
|
| 1629 |
-
define ('MAX_QUERY_LINES',300); // How many lines may be considered to be one query (except text lines)
|
| 1630 |
-
|
| 1631 |
-
$lines = "";
|
| 1632 |
-
|
| 1633 |
-
$error = "";
|
| 1634 |
-
|
| 1635 |
-
$error_status = 0;
|
| 1636 |
-
|
| 1637 |
-
if((isset($_REQUEST['chunk']))&&((int)$_REQUEST['chunk'] != 0))
|
| 1638 |
-
|
| 1639 |
-
$chunk = $_REQUEST['chunk'];
|
| 1640 |
-
|
| 1641 |
-
else
|
| 1642 |
-
|
| 1643 |
-
$chunk = DATA_CHUNK_LENGTH;
|
| 1644 |
-
|
| 1645 |
-
if($_REQUEST['correct_query'] != 1){
|
| 1646 |
-
|
| 1647 |
-
$start_pos = (int)$_REQUEST['fpos'];
|
| 1648 |
-
|
| 1649 |
-
$fpos = read_file($file, MAX_QUERY_LINES, $start_pos, $chunk, $lines);
|
| 1650 |
-
|
| 1651 |
-
}else{
|
| 1652 |
-
|
| 1653 |
-
$lines[0] = stripslashes($_REQUEST['error_msg']);
|
| 1654 |
-
|
| 1655 |
-
$fpos = $_REQUEST['start_posf'] ;
|
| 1656 |
-
|
| 1657 |
-
}
|
| 1658 |
-
|
| 1659 |
-
foreach($lines as $line)
|
| 1660 |
-
|
| 1661 |
-
if(trim($line) != ''){
|
| 1662 |
-
|
| 1663 |
-
$query = $line;
|
| 1664 |
-
|
| 1665 |
-
$line = $line .";\n";
|
| 1666 |
-
|
| 1667 |
-
#$tmp = explode("DEFAULT CHARSET",$line);
|
| 1668 |
-
|
| 1669 |
-
$line_tmp = $line;
|
| 1670 |
-
|
| 1671 |
-
$start_pos = $start_pos + strlen($line);
|
| 1672 |
-
|
| 1673 |
-
if(isset($_REQUEST['strrep']))
|
| 1674 |
-
|
| 1675 |
-
{
|
| 1676 |
-
|
| 1677 |
-
$strrep = explode("\r\n", stripslashes($_REQUEST['strrep']));
|
| 1678 |
-
|
| 1679 |
-
foreach($strrep as $value)
|
| 1680 |
-
|
| 1681 |
-
if(trim($value)!= ""){
|
| 1682 |
-
|
| 1683 |
-
|
| 1684 |
-
$tmp = explode("|", $value);
|
| 1685 |
-
|
| 1686 |
-
|
| 1687 |
-
$line_tmp = str_replace(trim($tmp[0]),trim($tmp[1]),$line_tmp);
|
| 1688 |
-
|
| 1689 |
-
$query = str_replace(trim($tmp[0]),trim($tmp[1]),$query);
|
| 1690 |
-
|
| 1691 |
-
}
|
| 1692 |
-
|
| 1693 |
-
}
|
| 1694 |
-
|
| 1695 |
-
if(!mysql_query($line_tmp)){
|
| 1696 |
-
|
| 1697 |
-
if($_REQUEST['correct_query'] != 1)
|
| 1698 |
-
|
| 1699 |
-
$fpos = $start_pos ;
|
| 1700 |
-
|
| 1701 |
-
$form_url = rurl($fpos, $chunk);
|
| 1702 |
-
|
| 1703 |
-
echo "</form><form name='' action='".$form_url."' method='POST'>
|
| 1704 |
-
|
| 1705 |
-
<input type='hidden' name='correct_query' value = '1'>
|
| 1706 |
-
|
| 1707 |
-
<input type='hidden' name='start_pos' value='".$start_pos."'>
|
| 1708 |
-
|
| 1709 |
-
<input type='hidden' name='start_posf' value='".$fpos."'>
|
| 1710 |
-
|
| 1711 |
-
<input type='hidden' name='glen' value='".$qlen."'>
|
| 1712 |
-
|
| 1713 |
-
<center>";
|
| 1714 |
-
|
| 1715 |
-
echo sprintf("<b>###MYSQL error</b>\n<br /><font color='red'>".mysql_error()."</font><br />\n<b>###On Query:</b><br />\n<br /><textarea cols=70 rows=15 name='error_msg'>%s</textarea><br />", $query);
|
| 1716 |
-
|
| 1717 |
-
echo "<b>Search and replace in query:</b><br /><textarea cols=70 rows=5 name='strrep'>".stripslashes($_REQUEST[strrep])."</textarea><br />
|
| 1718 |
-
|
| 1719 |
-
<small>
|
| 1720 |
-
|
| 1721 |
-
enter a string, one per line, which you would like to replace in the query above, example <i>string_to_search|text_to_replace_with</i>
|
| 1722 |
-
|
| 1723 |
-
</small>";
|
| 1724 |
-
|
| 1725 |
-
echo "<br /> <input type=submit name=submit value='Correct Query >>'>";
|
| 1726 |
-
|
| 1727 |
-
echo "</center></form>";
|
| 1728 |
-
|
| 1729 |
-
$error_status = 1;
|
| 1730 |
-
|
| 1731 |
-
break;
|
| 1732 |
-
|
| 1733 |
-
}
|
| 1734 |
-
|
| 1735 |
-
}
|
| 1736 |
-
|
| 1737 |
-
|
| 1738 |
-
$percent = sprintf("%.2f", (100*$fpos)/ filesize($file));
|
| 1739 |
-
|
| 1740 |
-
if($fpos!='-1'){
|
| 1741 |
-
|
| 1742 |
-
echo "<h3>Processed $percent% from sql backup!</h3>";
|
| 1743 |
-
|
| 1744 |
-
$red_url = rurl($fpos, $chunk);
|
| 1745 |
-
|
| 1746 |
-
if($error_status == 1 ){
|
| 1747 |
-
|
| 1748 |
-
echo "<h3><a href='".$red_url."'>To skip this query, click here to Continue</a></h3>";
|
| 1749 |
-
|
| 1750 |
-
exit;
|
| 1751 |
-
|
| 1752 |
-
}else{
|
| 1753 |
-
|
| 1754 |
-
echo "<h3><a href='".$red_url."'>Continue here</a></h3>";
|
| 1755 |
-
|
| 1756 |
-
echo "<script>window.location='".$red_url."'</script>";
|
| 1757 |
-
|
| 1758 |
-
exit;
|
| 1759 |
-
|
| 1760 |
-
}
|
| 1761 |
-
|
| 1762 |
-
} else {
|
| 1763 |
-
|
| 1764 |
-
echo "<h3>The sql import is finished!</h3>";
|
| 1765 |
-
|
| 1766 |
-
}
|
| 1767 |
-
|
| 1768 |
-
return;
|
| 1769 |
-
|
| 1770 |
-
}
|
| 1771 |
-
|
| 1772 |
-
########END
|
| 1773 |
-
|
| 1774 |
-
|
| 1775 |
-
|
| 1776 |
-
### STARTING THE AUTOMATIC BACKUP
|
| 1777 |
-
|
| 1778 |
-
function populate_db( $db, $sqlfile='administrator/backups/database-sql.sql') {
|
| 1779 |
-
|
| 1780 |
-
global $errors, $_CONFIG;
|
| 1781 |
-
|
| 1782 |
-
|
| 1783 |
-
|
| 1784 |
-
if($_REQUEST['use_mysqldump'] == 1){
|
| 1785 |
-
|
| 1786 |
-
|
| 1787 |
-
|
| 1788 |
-
echo shell_exec($_REQUEST['mysqldump_path']." -u ".$_REQUEST[mysql_username]." -p".$_REQUEST[mysql_pass]." -h ".$_REQUEST[mysql_server]." ".$_REQUEST[mysql_db]." < ".$sqlfile);
|
| 1789 |
-
|
| 1790 |
-
return;
|
| 1791 |
-
|
| 1792 |
-
|
| 1793 |
-
|
| 1794 |
-
}
|
| 1795 |
-
|
| 1796 |
-
|
| 1797 |
-
|
| 1798 |
-
$mqr = @get_magic_quotes_runtime();
|
| 1799 |
-
|
| 1800 |
-
@set_magic_quotes_runtime(0);
|
| 1801 |
-
|
| 1802 |
-
@chmod($sqlfile,0777);
|
| 1803 |
-
|
| 1804 |
-
$query = fread( fopen( $sqlfile, 'r' ), filesize( $sqlfile ) );
|
| 1805 |
-
|
| 1806 |
-
@set_magic_quotes_runtime($mqr);
|
| 1807 |
-
|
| 1808 |
-
$pieces = split_sql($query);
|
| 1809 |
-
|
| 1810 |
-
|
| 1811 |
-
|
| 1812 |
-
for ($i=0; $i<count($pieces); $i++) {
|
| 1813 |
-
|
| 1814 |
-
$pieces[$i] = trim($pieces[$i]);
|
| 1815 |
-
|
| 1816 |
-
$tmp = explode("DEFAULT CHARSET",$pieces[$i]);
|
| 1817 |
-
|
| 1818 |
-
$pieces[$i] = $tmp[0].";";
|
| 1819 |
-
|
| 1820 |
-
if(!empty($pieces[$i]) && $pieces[$i] != "#") {
|
| 1821 |
-
|
| 1822 |
-
if (!mysql_query($pieces[$i], $db)) {
|
| 1823 |
-
|
| 1824 |
-
$errors[] = "\n\n##Mysql Query: \n########\n".
|
| 1825 |
-
|
| 1826 |
-
$pieces[$i].
|
| 1827 |
-
|
| 1828 |
-
"\n########\n##Error message: ".
|
| 1829 |
-
|
| 1830 |
-
mysql_error();
|
| 1831 |
-
|
| 1832 |
-
|
| 1833 |
-
|
| 1834 |
-
}
|
| 1835 |
-
|
| 1836 |
-
}
|
| 1837 |
-
|
| 1838 |
-
|
| 1839 |
-
|
| 1840 |
-
}
|
| 1841 |
-
|
| 1842 |
-
return $errors;
|
| 1843 |
-
|
| 1844 |
-
}
|
| 1845 |
-
|
| 1846 |
-
|
| 1847 |
-
|
| 1848 |
-
|
| 1849 |
-
|
| 1850 |
-
function rurl($fpos, $chunk){
|
| 1851 |
-
|
| 1852 |
-
$get_query = "&";
|
| 1853 |
-
|
| 1854 |
-
foreach($_GET as $key=>$value){
|
| 1855 |
-
|
| 1856 |
-
if(($key != 'fpos')&&($key != 'chunk')&&($key != 'strrep_c')&&($key != 'strrep'))
|
| 1857 |
-
|
| 1858 |
-
$get_query .= $key."=".$value."&";
|
| 1859 |
-
|
| 1860 |
-
}
|
| 1861 |
-
|
| 1862 |
-
$url = $_SERVER['PHP_SELF']."?fpos=".$fpos."&chunk=".$chunk.$get_query;
|
| 1863 |
-
|
| 1864 |
-
return $url;
|
| 1865 |
-
|
| 1866 |
-
}
|
| 1867 |
-
|
| 1868 |
-
function read_file($file, $lines, $start_pos, &$chunk, &$text)
|
| 1869 |
-
|
| 1870 |
-
{
|
| 1871 |
-
|
| 1872 |
-
$cline = 0;
|
| 1873 |
-
|
| 1874 |
-
$fp = fopen($file, "r");
|
| 1875 |
-
|
| 1876 |
-
fseek($fp, $start_pos);
|
| 1877 |
-
|
| 1878 |
-
while((!feof($fp)) &&($cline <= $lines)){
|
| 1879 |
-
|
| 1880 |
-
$btemp = fgets($fp, $chunk);
|
| 1881 |
-
|
| 1882 |
-
$buffer .= $btemp;
|
| 1883 |
-
|
| 1884 |
-
if(strstr($btemp, ";\n"))
|
| 1885 |
-
|
| 1886 |
-
$cline++;
|
| 1887 |
-
|
| 1888 |
-
$fpos = ftell($fp);
|
| 1889 |
-
|
| 1890 |
-
}
|
| 1891 |
-
|
| 1892 |
-
$buffer = str_replace(";\r", ";\n", $buffer);
|
| 1893 |
-
|
| 1894 |
-
$text = explode(";\n", $buffer);
|
| 1895 |
-
|
| 1896 |
-
$fpos = $fpos - strlen($text[sizeof($text)-1]);
|
| 1897 |
-
|
| 1898 |
-
if(sizeof($text) == 1)
|
| 1899 |
-
|
| 1900 |
-
$chunk = DATA_CHUNK_LENGTH+$chunk;
|
| 1901 |
-
|
| 1902 |
-
else
|
| 1903 |
-
|
| 1904 |
-
$chunk = DATA_CHUNK_LENGTH;
|
| 1905 |
-
|
| 1906 |
-
if(feof($fp))
|
| 1907 |
-
|
| 1908 |
-
$fpos = '-1';
|
| 1909 |
-
|
| 1910 |
-
fclose ($fp);
|
| 1911 |
-
|
| 1912 |
-
return $fpos; // array_reverse is optional: you can also just return the $text array which consists of the file's lines.
|
| 1913 |
-
|
| 1914 |
-
}
|
| 1915 |
-
|
| 1916 |
-
|
| 1917 |
-
|
| 1918 |
-
/**
|
| 1919 |
-
|
| 1920 |
-
* @param string
|
| 1921 |
-
|
| 1922 |
-
*/
|
| 1923 |
-
|
| 1924 |
-
function split_sql($sql) {
|
| 1925 |
-
|
| 1926 |
-
|
| 1927 |
-
|
| 1928 |
-
$ret = array();
|
| 1929 |
-
|
| 1930 |
-
$sql = str_replace("\n) ", "\n) ;\n#\n#", $sql);
|
| 1931 |
-
|
| 1932 |
-
$sql = str_replace("\n--\n","\n#\n",$sql);
|
| 1933 |
-
|
| 1934 |
-
$sql = str_replace("\n-- ","\n# ",$sql);
|
| 1935 |
-
|
| 1936 |
-
$sql = str_replace("\n/*","\n#/*",$sql);
|
| 1937 |
-
|
| 1938 |
-
$sql = ereg_replace("#\n", "#;\n", $sql);
|
| 1939 |
-
|
| 1940 |
-
|
| 1941 |
-
// Processing the SQL file content
|
| 1942 |
-
|
| 1943 |
-
$file_content = explode("\n",$sql);
|
| 1944 |
-
|
| 1945 |
-
$query = "";
|
| 1946 |
-
|
| 1947 |
-
// Parsing the SQL file content
|
| 1948 |
-
|
| 1949 |
-
foreach($file_content as $key=>$sql_line)
|
| 1950 |
-
|
| 1951 |
-
{
|
| 1952 |
-
|
| 1953 |
-
|
| 1954 |
-
|
| 1955 |
-
if(substr($sql_line, 0, 2) == "--")
|
| 1956 |
-
|
| 1957 |
-
$sql_line = "#".substr($sql_line, 2, strlen($sql_line));
|
| 1958 |
-
|
| 1959 |
-
|
| 1960 |
-
|
| 1961 |
-
if(trim($sql_line) != "" )
|
| 1962 |
-
|
| 1963 |
-
{
|
| 1964 |
-
|
| 1965 |
-
$query .= $sql_line;
|
| 1966 |
-
|
| 1967 |
-
// Checking whether the line is a valid statement
|
| 1968 |
-
|
| 1969 |
-
if(preg_match("/(.*);/", $sql_line))
|
| 1970 |
-
|
| 1971 |
-
{
|
| 1972 |
-
|
| 1973 |
-
$query = substr($query, 0, strlen($query)-1);
|
| 1974 |
-
|
| 1975 |
-
//Executing the parsed string, returns the error code in failure
|
| 1976 |
-
|
| 1977 |
-
$ret[] = $query;
|
| 1978 |
-
|
| 1979 |
-
$query = "";
|
| 1980 |
-
|
| 1981 |
-
}
|
| 1982 |
-
|
| 1983 |
-
}
|
| 1984 |
-
|
| 1985 |
-
} //End of foreach
|
| 1986 |
-
|
| 1987 |
-
return($ret);
|
| 1988 |
-
|
| 1989 |
-
}
|
| 1990 |
-
|
| 1991 |
-
|
| 1992 |
-
|
| 1993 |
-
function recurseFiles(&$d_arr, &$ds_arr, &$f_arr, &$s_arr, &$d, &$f, &$s, &$includedFolders, $path, $mosConfig_absolute_path) {
|
| 1994 |
-
|
| 1995 |
-
|
| 1996 |
-
|
| 1997 |
-
$currentfullpath = $mosConfig_absolute_path.$path;
|
| 1998 |
-
|
| 1999 |
-
# Open possibly available directory
|
| 2000 |
-
|
| 2001 |
-
if( is_dir( $currentfullpath ) ) {
|
| 2002 |
-
|
| 2003 |
-
if( $handle = opendir( $currentfullpath ) ) {
|
| 2004 |
-
|
| 2005 |
-
while( false !== ( $file = readdir( $handle ) ) ) {
|
| 2006 |
-
|
| 2007 |
-
# Make sure we don't push parental directories or dotfiles (unix) into the arrays
|
| 2008 |
-
|
| 2009 |
-
if( $file != "." && $file != ".." ) {
|
| 2010 |
-
|
| 2011 |
-
if( is_dir( $currentfullpath . "/" . $file ) ) {
|
| 2012 |
-
|
| 2013 |
-
# Create array for directories
|
| 2014 |
-
|
| 2015 |
-
$d_arr[++$d] = $currentfullpath . "/" . $file;
|
| 2016 |
-
|
| 2017 |
-
recurseFiles($d_arr, $ds_arr, $f_arr, $s_arr, $d, $f, $s, $includedFolders, $path . "/" . $file, $mosConfig_absolute_path);
|
| 2018 |
-
|
| 2019 |
-
} else {
|
| 2020 |
-
|
| 2021 |
-
if ( in_array($currentfullpath, $includedFolders) ) {
|
| 2022 |
-
|
| 2023 |
-
# Create array for files
|
| 2024 |
-
|
| 2025 |
-
$s_arr[$f] = filesize($currentfullpath.'/'.$file);
|
| 2026 |
-
|
| 2027 |
-
$f_arr[$f++] = str_replace($mosConfig_absolute_path.'/', '', $currentfullpath.'/').$file;
|
| 2028 |
-
|
| 2029 |
-
$s += filesize($currentfullpath.'/'.$file);
|
| 2030 |
-
|
| 2031 |
-
}
|
| 2032 |
-
|
| 2033 |
-
}
|
| 2034 |
-
|
| 2035 |
-
}
|
| 2036 |
-
|
| 2037 |
-
}
|
| 2038 |
-
|
| 2039 |
-
}
|
| 2040 |
-
|
| 2041 |
-
# Wrap things up if we're in a directory
|
| 2042 |
-
|
| 2043 |
-
if( is_dir( $handle ) )
|
| 2044 |
-
|
| 2045 |
-
closedir( $handle );
|
| 2046 |
-
|
| 2047 |
-
}
|
| 2048 |
-
|
| 2049 |
-
}
|
| 2050 |
-
|
| 2051 |
-
|
| 2052 |
-
|
| 2053 |
-
|
| 2054 |
-
|
| 2055 |
-
function version_list($fname) {
|
| 2056 |
-
|
| 2057 |
-
global $_CONFIG;
|
| 2058 |
-
|
| 2059 |
-
|
| 2060 |
-
|
| 2061 |
-
$return = "<select name='$fname'><option value=''>Choose local clone archive</option>";
|
| 2062 |
-
|
| 2063 |
-
|
| 2064 |
-
|
| 2065 |
-
if(is_array($_CONFIG[versions])){
|
| 2066 |
-
|
| 2067 |
-
foreach($_CONFIG[versions] as $key=>$value){
|
| 2068 |
-
|
| 2069 |
-
$size = sprintf("%.2fM", filesize($value)/(1024*1024));
|
| 2070 |
-
|
| 2071 |
-
$return .= "<option selected value='$value'>$value($size)</option>";
|
| 2072 |
-
|
| 2073 |
-
|
| 2074 |
-
|
| 2075 |
-
}
|
| 2076 |
-
|
| 2077 |
-
}
|
| 2078 |
-
|
| 2079 |
-
$return .= "</select>";
|
| 2080 |
-
|
| 2081 |
-
|
| 2082 |
-
|
| 2083 |
-
return $return;
|
| 2084 |
-
|
| 2085 |
-
}
|
| 2086 |
-
|
| 2087 |
-
|
| 2088 |
-
function recursive_remove_directory($directory, $empty=FALSE)
|
| 2089 |
-
|
| 2090 |
-
{
|
| 2091 |
-
|
| 2092 |
-
// if the path has a slash at the end we remove it here
|
| 2093 |
-
|
| 2094 |
-
if(substr($directory,-1) == '/')
|
| 2095 |
-
|
| 2096 |
-
{
|
| 2097 |
-
|
| 2098 |
-
$directory = substr($directory,0,-1);
|
| 2099 |
-
|
| 2100 |
-
}
|
| 2101 |
-
|
| 2102 |
-
|
| 2103 |
-
|
| 2104 |
-
// if the path is not valid or is not a directory ...
|
| 2105 |
-
|
| 2106 |
-
if(!file_exists($directory) || !is_dir($directory))
|
| 2107 |
-
|
| 2108 |
-
{
|
| 2109 |
-
|
| 2110 |
-
// ... we return false and exit the function
|
| 2111 |
-
|
| 2112 |
-
return FALSE;
|
| 2113 |
-
|
| 2114 |
-
|
| 2115 |
-
|
| 2116 |
-
// ... if the path is not readable
|
| 2117 |
-
|
| 2118 |
-
}elseif(!is_readable($directory))
|
| 2119 |
-
|
| 2120 |
-
{
|
| 2121 |
-
|
| 2122 |
-
// ... we return false and exit the function
|
| 2123 |
-
|
| 2124 |
-
return FALSE;
|
| 2125 |
-
|
| 2126 |
-
|
| 2127 |
-
|
| 2128 |
-
// ... else if the path is readable
|
| 2129 |
-
|
| 2130 |
-
}else{
|
| 2131 |
-
|
| 2132 |
-
|
| 2133 |
-
|
| 2134 |
-
// we open the directory
|
| 2135 |
-
|
| 2136 |
-
$handle = opendir($directory);
|
| 2137 |
-
|
| 2138 |
-
|
| 2139 |
-
|
| 2140 |
-
// and scan through the items inside
|
| 2141 |
-
|
| 2142 |
-
while (FALSE !== ($item = readdir($handle)))
|
| 2143 |
-
|
| 2144 |
-
{
|
| 2145 |
-
|
| 2146 |
-
// if the filepointer is not the current directory
|
| 2147 |
-
|
| 2148 |
-
// or the parent directory
|
| 2149 |
-
|
| 2150 |
-
if($item != '.' && $item != '..')
|
| 2151 |
-
|
| 2152 |
-
{
|
| 2153 |
-
|
| 2154 |
-
// we build the new path to delete
|
| 2155 |
-
|
| 2156 |
-
$path = $directory.'/'.$item;
|
| 2157 |
-
|
| 2158 |
-
|
| 2159 |
-
|
| 2160 |
-
// if the new path is a directory
|
| 2161 |
-
|
| 2162 |
-
if(is_dir($path))
|
| 2163 |
-
|
| 2164 |
-
{
|
| 2165 |
-
|
| 2166 |
-
// we call this function with the new path
|
| 2167 |
-
|
| 2168 |
-
recursive_remove_directory($path);
|
| 2169 |
-
|
| 2170 |
-
|
| 2171 |
-
|
| 2172 |
-
// if the new path is a file
|
| 2173 |
-
|
| 2174 |
-
}else{
|
| 2175 |
-
|
| 2176 |
-
// we remove the file
|
| 2177 |
-
|
| 2178 |
-
unlink($path);
|
| 2179 |
-
|
| 2180 |
-
}
|
| 2181 |
-
|
| 2182 |
-
}
|
| 2183 |
-
|
| 2184 |
-
}
|
| 2185 |
-
|
| 2186 |
-
// close the directory
|
| 2187 |
-
|
| 2188 |
-
closedir($handle);
|
| 2189 |
-
|
| 2190 |
-
|
| 2191 |
-
|
| 2192 |
-
// if the option to empty is not set to true
|
| 2193 |
-
|
| 2194 |
-
if($empty == FALSE)
|
| 2195 |
-
|
| 2196 |
-
{
|
| 2197 |
-
|
| 2198 |
-
// try to delete the now empty directory
|
| 2199 |
-
|
| 2200 |
-
if(!@rmdir($directory))
|
| 2201 |
-
|
| 2202 |
-
{
|
| 2203 |
-
|
| 2204 |
-
// return false if not possible
|
| 2205 |
-
|
| 2206 |
-
return FALSE;
|
| 2207 |
-
|
| 2208 |
-
}
|
| 2209 |
-
|
| 2210 |
-
}
|
| 2211 |
-
|
| 2212 |
-
// return success
|
| 2213 |
-
|
| 2214 |
-
return TRUE;
|
| 2215 |
-
|
| 2216 |
-
}
|
| 2217 |
-
|
| 2218 |
-
}
|
| 2219 |
-
|
| 2220 |
-
|
| 2221 |
-
|
| 2222 |
-
?>
|
| 1 |
+
<?php
|
| 2 |
+
/*
|
| 3 |
+
* XCloner.php
|
| 4 |
+
*
|
| 5 |
+
* Copyright 2011 Ovidiu Liuta <info@thinkovi.com>
|
| 6 |
+
*
|
| 7 |
+
* This program is free software; you can redistribute it and/or modify
|
| 8 |
+
* it under the terms of the GNU General Public License as published by
|
| 9 |
+
* the Free Software Foundation; either version 2 of the License, or
|
| 10 |
+
* (at your option) any later version.
|
| 11 |
+
*
|
| 12 |
+
* This program is distributed in the hope that it will be useful,
|
| 13 |
+
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 14 |
+
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 15 |
+
* GNU General Public License for more details.
|
| 16 |
+
*
|
| 17 |
+
* You should have received a copy of the GNU General Public License
|
| 18 |
+
* along with this program; if not, write to the Free Software
|
| 19 |
+
* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston,
|
| 20 |
+
* MA 02110-1301, USA.
|
| 21 |
+
*/
|
| 22 |
+
|
| 23 |
+
if(is_file("../cloner.config.php")){
|
| 24 |
+
|
| 25 |
+
echo "<h3>Access denied, if you are trying to restore a backup, please move the restore script in another directory!</h3>";
|
| 26 |
+
|
| 27 |
+
exit;
|
| 28 |
+
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
|
| 32 |
+
@set_time_limit(3600);
|
| 33 |
+
|
| 34 |
+
@ini_set("error_reporting", E_ALL^E_NOTICE);
|
| 35 |
+
|
| 36 |
+
###################### Do not edit Below #############################
|
| 37 |
+
|
| 38 |
+
$g_pcltar_lib_dir = "./";
|
| 39 |
+
|
| 40 |
+
require "TAR.php";
|
| 41 |
+
|
| 42 |
+
$_CONFIG['my_version'] = "3.0.1";
|
| 43 |
+
$_CONFIG['script_name'] = "XCloner.php";
|
| 44 |
+
$_CONFIG['sql_usefile'] = "";
|
| 45 |
+
$_CONFIG['filesLimit'] = 100;
|
| 46 |
+
$_CONFIG['seek'] = 0;
|
| 47 |
+
|
| 48 |
+
|
| 49 |
+
if(isset($_REQUEST['sql_setfile']))
|
| 50 |
+
$_CONFIG['sql_usefile'] = $_REQUEST['sql_setfile'];
|
| 51 |
+
|
| 52 |
+
if(trim($_CONFIG['sql_usefile']) == "")
|
| 53 |
+
$_CONFIG['sql_usefile'] = "database-sql.sql";
|
| 54 |
+
|
| 55 |
+
if(isset($_REQUEST['strrep'])){
|
| 56 |
+
setcookie ("strrep_c", "", time() - 3600);
|
| 57 |
+
setcookie("strrep_c", str_replace("\r\n","*-*",stripslashes($_REQUEST['strrep'])), time()+3600); /* expire in 1 hour */
|
| 58 |
+
}else{
|
| 59 |
+
$_REQUEST['strrep'] = str_replace("*-*", "\r\n", $_COOKIE['strrep_c']);
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
|
| 63 |
+
if ($handle = opendir('./')) {
|
| 64 |
+
/* This is the correct way to loop over the directory. */
|
| 65 |
+
while (false !== ($file = readdir($handle))){
|
| 66 |
+
$ext = substr($file,strlen($file)-4,strlen($file));
|
| 67 |
+
if(($file!='XCloner.php')&&($file!='..')&&($file!='.')&&(($ext=='.tgz')||($ext=='.tar'))){
|
| 68 |
+
$_CONFIG[versions][] = $file;
|
| 69 |
+
}
|
| 70 |
+
}
|
| 71 |
+
closedir($handle);
|
| 72 |
+
}else{
|
| 73 |
+
echo "Unable to open my directory for reading and listing!";exit;
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
|
| 77 |
+
######################################################################
|
| 78 |
+
|
| 79 |
+
|
| 80 |
+
$_CONFIG['output_path'] = $_REQUEST['output_path'];
|
| 81 |
+
$_CONFIG['output_url'] = $_REQUEST['output_url_pref']."://".$_REQUEST['output_url'];
|
| 82 |
+
$_CONFIG['tmp'] = $_REQUEST['output_path'];
|
| 83 |
+
|
| 84 |
+
if($_REQUEST['files_skip'] == 1)
|
| 85 |
+
$_REQUEST['do_database'] = 1;
|
| 86 |
+
if($_REQUEST['fpos'])
|
| 87 |
+
$_CONFIG['seek'] = $_REQUEST['fpos'];
|
| 88 |
+
|
| 89 |
+
$filepath =$_SERVER["SCRIPT_FILENAME"];
|
| 90 |
+
$pathinfo = pathinfo($filepath);
|
| 91 |
+
$startscript = $pathinfo['dirname'];
|
| 92 |
+
$_CONFIG[group] = $groupinfo[name];
|
| 93 |
+
$_CONFIG[owner] =$ownerinfo[name];
|
| 94 |
+
|
| 95 |
+
###################### FRONT AREA ###################################
|
| 96 |
+
//setCache();
|
| 97 |
+
?>
|
| 98 |
+
|
| 99 |
+
<!DOCTYPE html>
|
| 100 |
+
|
| 101 |
+
<html>
|
| 102 |
+
<head>
|
| 103 |
+
<title>XCloner Restore - <?php echo $_SERVER['HTTP_HOST']?> - Backup and Restore Made Easy</title>
|
| 104 |
+
<META NAME="ROBOTS" CONTENT="NOINDEX, NOFOLLOW">
|
| 105 |
+
<link REL="SHORTCUT ICON" HREF="http://www.xcloner.com/images/favicon.ico">
|
| 106 |
+
<style type="text/css" media="screen">
|
| 107 |
+
@import url( http://www.xcloner.com/downloads/style.css );
|
| 108 |
+
@import url( http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.9/themes/start/jquery-ui.css );
|
| 109 |
+
.error {
|
| 110 |
+
color: red;
|
| 111 |
+
font-size: 15px;
|
| 112 |
+
}
|
| 113 |
+
</style>
|
| 114 |
+
|
| 115 |
+
<script src="https://ajax.googleapis.com/ajax/libs/jquery/1.4.4/jquery.min.js" type="text/javascript"></script>
|
| 116 |
+
<script src="https://ajax.googleapis.com/ajax/libs/jqueryui/1.8.9/jquery-ui.min.js" type="text/javascript"></script>
|
| 117 |
+
</head>
|
| 118 |
+
|
| 119 |
+
<body>
|
| 120 |
+
|
| 121 |
+
<script>
|
| 122 |
+
$(function() {
|
| 123 |
+
$( "#tabs-main" ).tabs();
|
| 124 |
+
});
|
| 125 |
+
</script>
|
| 126 |
+
|
| 127 |
+
|
| 128 |
+
<!-- section 1-->
|
| 129 |
+
|
| 130 |
+
<table align='center' width='700' bgcolor='#eeeeee' style='padding: 0 5px 0 5px;'>
|
| 131 |
+
|
| 132 |
+
<tr><td align='center'><h2><font color=red>XCloner</font> Automatic Restore! - <?php echo $_SERVER['HTTP_HOST']?></h2></td></tr>
|
| 133 |
+
|
| 134 |
+
<tr><td align='left'>
|
| 135 |
+
|
| 136 |
+
<form action='' method='GET' name='form'>
|
| 137 |
+
|
| 138 |
+
<?php
|
| 139 |
+
|
| 140 |
+
|
| 141 |
+
|
| 142 |
+
switch ($_REQUEST[task]) {
|
| 143 |
+
case 'step2':
|
| 144 |
+
step2();
|
| 145 |
+
break;
|
| 146 |
+
case 'step1':
|
| 147 |
+
step1();
|
| 148 |
+
break;
|
| 149 |
+
case 'getinfo':
|
| 150 |
+
getPHPINFO();
|
| 151 |
+
break;
|
| 152 |
+
case 'info':
|
| 153 |
+
echo phpinfo();
|
| 154 |
+
break;
|
| 155 |
+
default :
|
| 156 |
+
start();
|
| 157 |
+
break;
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
?>
|
| 161 |
+
|
| 162 |
+
</form>
|
| 163 |
+
</td></tr>
|
| 164 |
+
<tr><td>
|
| 165 |
+
<hr />
|
| 166 |
+
<small>XCloner Automatic Restore(<b><?php echo $_CONFIG['my_version']?></b>) - <a href='http://www.xcloner.com' title='XCloner.com - Website Backup Application'>Website Backup and Restore</a>
|
| 167 |
+
</small>
|
| 168 |
+
</td></tr>
|
| 169 |
+
</table>
|
| 170 |
+
|
| 171 |
+
</body>
|
| 172 |
+
|
| 173 |
+
</html>
|
| 174 |
+
|
| 175 |
+
|
| 176 |
+
|
| 177 |
+
|
| 178 |
+
|
| 179 |
+
<?php
|
| 180 |
+
|
| 181 |
+
#####################################################################
|
| 182 |
+
|
| 183 |
+
|
| 184 |
+
##################### FUNCTIONS #####################################
|
| 185 |
+
|
| 186 |
+
function step2($file=""){
|
| 187 |
+
|
| 188 |
+
global $_CONFIG,$filepath ;
|
| 189 |
+
|
| 190 |
+
$DBcreated = $_REQUEST[DBcreated];
|
| 191 |
+
|
| 192 |
+
if ($DBcreated=='on'){
|
| 193 |
+
$DBhostname = $_REQUEST['mysql_server'];
|
| 194 |
+
$DBuserName = $_REQUEST['mysql_username'];
|
| 195 |
+
$DBpassword = $_REQUEST['mysql_pass'];
|
| 196 |
+
$DBname = $_REQUEST['mysql_db'];
|
| 197 |
+
|
| 198 |
+
$db = @mysql_connect($DBhostname, $DBuserName, $DBpassword) or die("<br />The database details provided are incorrect and/or empty. Unable to connect to mysql server");
|
| 199 |
+
@mysql_query("CREATE database $DBname;");
|
| 200 |
+
if (!@mysql_select_db($DBname)) {
|
| 201 |
+
die("<br /><span class='error'>Could not connect to $DBname database! Please make sure the database exists and that you assigned the mysql user to it...</span>");
|
| 202 |
+
}
|
| 203 |
+
mysql_query("SET sql_mode='';");
|
| 204 |
+
if($_REQUEST['charset_of_file']!="")
|
| 205 |
+
mysql_query("SET NAMES ".$_REQUEST['charset_of_file']."");
|
| 206 |
+
else
|
| 207 |
+
mysql_query("SET NAMES utf8;");
|
| 208 |
+
}
|
| 209 |
+
|
| 210 |
+
if($_REQUEST['do_database'] != 1){
|
| 211 |
+
|
| 212 |
+
############ DATABASE ONLY RESTRICTION##################################################
|
| 213 |
+
|
| 214 |
+
########################### START FTP MODE #################################
|
| 215 |
+
if($_REQUEST[transfer_mode]==2){
|
| 216 |
+
|
| 217 |
+
$_CONFIG[output_path] = $_CONFIG[output_path]."/archive_tmp/";
|
| 218 |
+
@mkdir($_CONFIG[output_path]);
|
| 219 |
+
|
| 220 |
+
// set up basic connection
|
| 221 |
+
$conn_id = @ftp_connect($_REQUEST[ftp_server], $_REQUEST[ftp_port]) or die("<span class='error'>Could not connect to $_REQUEST[ftp_server] on port $_REQUEST[ftp_port]! Ftp connection has failed!</span>");
|
| 222 |
+
|
| 223 |
+
// login with username and password
|
| 224 |
+
$login_result = @ftp_login($conn_id, $_REQUEST[ftp_user], $_REQUEST[ftp_pass]) or die("<span class='error'>Could not login to ftp server for user $_REQUEST[ftp_user] and provided pass! Ftp connection has failed!</span>");
|
| 225 |
+
|
| 226 |
+
// check connection
|
| 227 |
+
if ((!$conn_id) || (!$login_result)) {
|
| 228 |
+
echo "<b style='color:red'>FTP connection has failed!</b>";
|
| 229 |
+
echo "<b style='color:red'>Attempted to connect to ".$_REQUEST[ftp_server].":".$_REQUEST[ftp_port]." for user ".$_REQUEST[ftp_user]."</b>";
|
| 230 |
+
return;
|
| 231 |
+
} else {
|
| 232 |
+
echo "<br />Connected to $_REQUEST[ftp_server], for user $_REQUEST[ftp_user], starting transfer...<br />";
|
| 233 |
+
}
|
| 234 |
+
$ftp_dir_original = ftp_pwd($conn_id);
|
| 235 |
+
@ftp_mkdir($conn_id,$_REQUEST[ftp_path]);
|
| 236 |
+
|
| 237 |
+
// try to change the directory to somedir
|
| 238 |
+
if (@ftp_chdir($conn_id, $_REQUEST[ftp_path])) {
|
| 239 |
+
echo "Current directory is now: <b>" . ftp_pwd($conn_id) . "</b>\n";
|
| 240 |
+
} else {
|
| 241 |
+
echo "<b style='color:red'>Couldn't change directory to <b>$_REQUEST[ftp_path]</b>, please verify that the ftp location exists or use the \"Install files directly\" option!</b><br />\n";
|
| 242 |
+
return;
|
| 243 |
+
}
|
| 244 |
+
@ftp_chdir($conn_id, $ftp_dir_original);
|
| 245 |
+
|
| 246 |
+
}
|
| 247 |
+
|
| 248 |
+
########################## END FTP MODE ######################################
|
| 249 |
+
|
| 250 |
+
|
| 251 |
+
##### START extract ######
|
| 252 |
+
if($_REQUEST['refresh'] < 1){
|
| 253 |
+
|
| 254 |
+
$ext = substr($file, strlen($file)-4, strlen($file));
|
| 255 |
+
if($_REQUEST['file_utilities'] != '1'){
|
| 256 |
+
$tar_object = new Archive_Tar($file);
|
| 257 |
+
|
| 258 |
+
if($_REQUEST['manual_ftp']){
|
| 259 |
+
|
| 260 |
+
$tar_object->_openRead();
|
| 261 |
+
fseek($tar_object->_file, $_CONFIG['seek']);
|
| 262 |
+
$seek = $tar_object->_extractList($_CONFIG['output_path'], $return, "partial", "", "", $_CONFIG['filesLimit']);
|
| 263 |
+
$seek = $seek - 512;//reverse 512 bytes
|
| 264 |
+
if($seek > 0){
|
| 265 |
+
$backupSize = filesize($file);
|
| 266 |
+
$rurl = rurl($seek, $backupSize);
|
| 267 |
+
$percent = sprintf("%.2f",($seek*100)/$backupSize);
|
| 268 |
+
echo "<h3>Processing files - ".$percent."%</h3>";
|
| 269 |
+
echo "<script> document.location='".$rurl."'</script>";
|
| 270 |
+
return;
|
| 271 |
+
}
|
| 272 |
+
$_REQUEST['fpos'] = 0;
|
| 273 |
+
$_REQUEST['chunk'] = 0;
|
| 274 |
+
}
|
| 275 |
+
else{
|
| 276 |
+
$tar_object->extract($_CONFIG['output_path']);
|
| 277 |
+
#$tar_object->extractList("backups/perm.txt", $_CONFIG['output_path']);
|
| 278 |
+
}
|
| 279 |
+
|
| 280 |
+
}else{
|
| 281 |
+
if($ext == '.tgz') $compress = 'z';
|
| 282 |
+
else $compress = '';
|
| 283 |
+
shell_exec("tar -x".$compress."pf $file -C $_CONFIG[output_path]");
|
| 284 |
+
}
|
| 285 |
+
}
|
| 286 |
+
##### END extract ######
|
| 287 |
+
|
| 288 |
+
|
| 289 |
+
$new_arr = array();
|
| 290 |
+
#@chmod($_CONFIG[output_path], 0777);
|
| 291 |
+
$tran_file = $_CONFIG[output_path]."/transfer.txt";
|
| 292 |
+
|
| 293 |
+
if($_REQUEST[transfer_mode]==2){
|
| 294 |
+
# initialise list arrays, directories and files separately and array counters for them
|
| 295 |
+
$excludedFolders = array();
|
| 296 |
+
$d_arr = array(); $d = 0;
|
| 297 |
+
$ds_arr = array();
|
| 298 |
+
$f_arr = array(); $f = 0;
|
| 299 |
+
$s_arr = array(); $s = 0;
|
| 300 |
+
$d_arr[$d] = $_CONFIG[output_path];
|
| 301 |
+
|
| 302 |
+
if($_REQUEST['refresh'] < 1){
|
| 303 |
+
# obtain the list of files by recursing the mambo file store
|
| 304 |
+
recurseFiles($d_arr, $ds_arr, $f_arr, $s_arr, $d, $f, $s, $excludedFolders , '', $_CONFIG[output_path]);
|
| 305 |
+
recurseFiles($d_arr, $ds_arr, $f_arr, $s_arr, $d, $f, $s, $d_arr , '', $_CONFIG[output_path]);
|
| 306 |
+
sort($d_arr);
|
| 307 |
+
sort($f_arr);
|
| 308 |
+
$new_arr = array_merge($d_arr, $f_arr);
|
| 309 |
+
|
| 310 |
+
if($_REQUEST[transfer_mode]==2)
|
| 311 |
+
if($fp = fopen($tran_file, "w")){
|
| 312 |
+
foreach($new_arr as $file){
|
| 313 |
+
fwrite($fp, $file."\n");
|
| 314 |
+
}
|
| 315 |
+
fclose($fp);
|
| 316 |
+
}else{
|
| 317 |
+
echo "Unable to write to directory ".$_CONFIG[output_path]."! Please check that this directory is writeable!"; return;
|
| 318 |
+
}
|
| 319 |
+
else{};
|
| 320 |
+
|
| 321 |
+
}else{
|
| 322 |
+
$content = "";
|
| 323 |
+
$new_arr = file($tran_file);
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
if(sizeof($new_arr) != 0 )
|
| 327 |
+
$percn = sprintf("%.2f",($_REQUEST[next] * 100)/sizeof($new_arr));
|
| 328 |
+
if($percn > sizeof($new_arr))
|
| 329 |
+
$percn = sizeof($new_arr);
|
| 330 |
+
|
| 331 |
+
}
|
| 332 |
+
|
| 333 |
+
|
| 334 |
+
if($_REQUEST['refresh'] == 1){
|
| 335 |
+
echo "<h3>Transfering $percn% of ".sizeof($new_arr)." files through ftp</h3>";
|
| 336 |
+
echo "<textarea cols=70 rows=30 name='ftp_list'></textarea>";
|
| 337 |
+
}
|
| 338 |
+
elseif($_REQUEST['refresh'] == 2)
|
| 339 |
+
echo "Files transfer finished!";
|
| 340 |
+
|
| 341 |
+
$i = (int)$_REQUEST[next];
|
| 342 |
+
$j = 0;
|
| 343 |
+
|
| 344 |
+
### MOVING THE FILES THROUGH FTP
|
| 345 |
+
|
| 346 |
+
#foreach($new_arr as $key=>$file)
|
| 347 |
+
for($key=$i;$key<=sizeof($new_arr);$key++){
|
| 348 |
+
$file = str_replace(array("\r","\n"), array("",""), $new_arr[$key]);
|
| 349 |
+
if($_REQUEST['manual_ftp'] == 1)
|
| 350 |
+
if($j == 100){
|
| 351 |
+
#echo "Transfering files from line: ". (int)$_REQUEST[next];
|
| 352 |
+
$qstr = explode("&refresh=1&next=",$_SERVER['QUERY_STRING']);
|
| 353 |
+
$rurl = "XCloner.php?".$qstr[0]."&refresh=1&next=".($_REQUEST[next]+100);
|
| 354 |
+
ftp_close($conn_id);
|
| 355 |
+
echo "<script> document.location='".$rurl."'</script>";
|
| 356 |
+
exit;
|
| 357 |
+
}
|
| 358 |
+
|
| 359 |
+
$j++;
|
| 360 |
+
$sfile = str_replace($_CONFIG[output_path],"",$file);
|
| 361 |
+
$fsource = $_CONFIG[output_path]."/".$sfile;
|
| 362 |
+
if(($sfile != "")&&($sfile!="/"))
|
| 363 |
+
if($_REQUEST[transfer_mode]==2){
|
| 364 |
+
$upload = 1;
|
| 365 |
+
$ftarget = $_REQUEST[ftp_path]."/".$sfile;
|
| 366 |
+
if(is_dir($fsource)){
|
| 367 |
+
$upload1 = @ftp_mkdir($conn_id,$ftarget);
|
| 368 |
+
}else{
|
| 369 |
+
$upload = ftp_put($conn_id, $ftarget, $fsource, FTP_BINARY);
|
| 370 |
+
}
|
| 371 |
+
#echo "$i <br >";
|
| 372 |
+
|
| 373 |
+
if(!$upload){
|
| 374 |
+
echo "<br /><font color=red>Transfer fail for $fsource to $ftarget</font> <br />File already exists and/or doesn't have writing permissions!<br/>";
|
| 375 |
+
}else{
|
| 376 |
+
|
| 377 |
+
if($_REQUEST['manual_ftp'] == 1){
|
| 378 |
+
$ftarget .= '\n';
|
| 379 |
+
|
| 380 |
+
echo "<script>document.form.ftp_list.value = document.form.ftp_list.value + '".$ftarget."'; </script>";
|
| 381 |
+
#echo "$ftarget <br />\n";
|
| 382 |
+
}
|
| 383 |
+
}
|
| 384 |
+
}
|
| 385 |
+
}
|
| 386 |
+
|
| 387 |
+
|
| 388 |
+
if($_REQUEST['refresh'] == 1){
|
| 389 |
+
$qstr = explode("&refresh=1&next=",$_SERVER['QUERY_STRING']);
|
| 390 |
+
$rurl = "XCloner.php?".$qstr[0]."&refresh=2&next=".($_REQUEST[next]+102);
|
| 391 |
+
echo "<script> document.location='".$rurl."'</script>";
|
| 392 |
+
exit;
|
| 393 |
+
}
|
| 394 |
+
|
| 395 |
+
############### RESTORING HTACCESS AND CONFIGURATION PERM#####################################
|
| 396 |
+
|
| 397 |
+
if($_REQUEST[transfer_mode]==2){
|
| 398 |
+
$cmd = "CHMOD 0777 ".$_REQUEST[ftp_path]."/"."wp-config.php";
|
| 399 |
+
@ftp_site($conn_id, $cmd);
|
| 400 |
+
}else{
|
| 401 |
+
@chmod($_REQUEST[output_path]."/"."wp-config.php", 0777);
|
| 402 |
+
}
|
| 403 |
+
|
| 404 |
+
|
| 405 |
+
#### CUSTOM PERMISSIONS #####
|
| 406 |
+
if($_REQUEST['preserve_perm']){
|
| 407 |
+
$perm_data = "";
|
| 408 |
+
$perm_file = $_CONFIG[output_path]."/administrator/backups/perm.txt";
|
| 409 |
+
$per = 1;
|
| 410 |
+
|
| 411 |
+
@chmod($perm_file,0777);
|
| 412 |
+
$fp = @fopen($perm_file,'r');
|
| 413 |
+
if($fp){
|
| 414 |
+
while(!feof($fp))
|
| 415 |
+
$perm_data .= fread($fp, 1024);
|
| 416 |
+
fclose($fp);
|
| 417 |
+
}else{
|
| 418 |
+
|
| 419 |
+
echo "Could not set permissions! Permissions file $perm_file not found!<br />";
|
| 420 |
+
$per = 0;
|
| 421 |
+
}
|
| 422 |
+
|
| 423 |
+
$data = explode("\n",$perm_data);
|
| 424 |
+
foreach($data as $value){
|
| 425 |
+
$dir = explode("|", $value);
|
| 426 |
+
if($dir[1]=="")
|
| 427 |
+
$dir[1] = '0755';
|
| 428 |
+
|
| 429 |
+
if(strstr($dir[0],"wp-config.php"))
|
| 430 |
+
$dir[1] = '0777';
|
| 431 |
+
|
| 432 |
+
if($_REQUEST[transfer_mode]==2){
|
| 433 |
+
$cmd = "CHMOD ".$dir[1]." ".$_REQUEST[ftp_path]."/".$dir[0];
|
| 434 |
+
|
| 435 |
+
@ftp_site($conn_id, $cmd);
|
| 436 |
+
|
| 437 |
+
}else{
|
| 438 |
+
|
| 439 |
+
@chmod($_CONFIG[output_path]."/".$dir[0], octdec($dir[1]));
|
| 440 |
+
|
| 441 |
+
}
|
| 442 |
+
|
| 443 |
+
}
|
| 444 |
+
|
| 445 |
+
if($per){
|
| 446 |
+
echo "<h2>Permissions restored to their initial value...</h2>";
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
}
|
| 450 |
+
#### END CUSTOM PERMISSIONS #####
|
| 451 |
+
|
| 452 |
+
$_CONFIG[output_path] = str_replace("/archive_tmp/","",$_CONFIG[output_path]);
|
| 453 |
+
|
| 454 |
+
if($_REQUEST[transfer_mode]==2){
|
| 455 |
+
|
| 456 |
+
// close the FTP stream
|
| 457 |
+
@ftp_close($conn_id);
|
| 458 |
+
recursive_remove_directory($_CONFIG[output_path]."/archive_tmp/");
|
| 459 |
+
@unlink($_CONFIG[output_path]."/archive_tmp/");
|
| 460 |
+
echo "<h2>Files succesfully copied to ".$_REQUEST[ftp_path]." on $_REQUEST[ftp_server] using FTP</h2>";
|
| 461 |
+
|
| 462 |
+
}else{
|
| 463 |
+
echo "<h2>Files succesfully copied to ".$_CONFIG[output_path]."</h2>";
|
| 464 |
+
}
|
| 465 |
+
|
| 466 |
+
######### END DATABASE ONLY RESTRICT #########################################
|
| 467 |
+
|
| 468 |
+
}
|
| 469 |
+
|
| 470 |
+
|
| 471 |
+
##### RESTORE CONFIGURATION #####
|
| 472 |
+
$update_config = 1;
|
| 473 |
+
|
| 474 |
+
if(($_REQUEST['files_skip']) and (isset($_REQUEST['fpos']))){
|
| 475 |
+
|
| 476 |
+
$update_config = 0;
|
| 477 |
+
|
| 478 |
+
}
|
| 479 |
+
|
| 480 |
+
if(($_REQUEST['do_database'] != 1) || ($_REQUEST['files_skip'] == 1)){
|
| 481 |
+
$config_file = $_CONFIG[output_path]."/wp-config.php";
|
| 482 |
+
@chmod($config_file,0777);
|
| 483 |
+
@unlink($_CONFIG[output_path]."/administrator/backups/perm.txt");
|
| 484 |
+
if(($_CONFIG['sql_usefile'] == "database-sql.sql") and ($update_config))
|
| 485 |
+
if(write_config($config_file)){
|
| 486 |
+
echo "<H2>Configuration updated!</H2>";
|
| 487 |
+
}else{
|
| 488 |
+
echo "<span class='error'>Unable to write to configuration file $config_file... Aborting...</span>";return;
|
| 489 |
+
}
|
| 490 |
+
}
|
| 491 |
+
|
| 492 |
+
|
| 493 |
+
############ ATTEMPT DATABASE INSERT #####################################
|
| 494 |
+
|
| 495 |
+
if($DBcreated!='on'){
|
| 496 |
+
|
| 497 |
+
echo "<h2>Database import skipped!</h2>";
|
| 498 |
+
echo "<a href='".$_CONFIG[output_url]."'><b>All should be done! Click here to continue...</b></a><br />";
|
| 499 |
+
|
| 500 |
+
return ;
|
| 501 |
+
}
|
| 502 |
+
|
| 503 |
+
if (($DBcreated=='on')&&($_REQUEST['do_database'] == 1)){
|
| 504 |
+
|
| 505 |
+
$sqlfile = $_CONFIG[output_path]."/administrator/backups/".$_CONFIG['sql_usefile'];
|
| 506 |
+
|
| 507 |
+
if(!file_exists($sqlfile)){
|
| 508 |
+
echo "<span class='error'>Unable to read the database backup file $sqlfile , database was not imported!</span>";
|
| 509 |
+
}else{
|
| 510 |
+
|
| 511 |
+
if($_REQUEST['manual_sql'])
|
| 512 |
+
$errors = populate_db_manual( $db, $sqlfile);
|
| 513 |
+
else
|
| 514 |
+
$errors = populate_db( $db, $sqlfile);
|
| 515 |
+
|
| 516 |
+
if(sizeof($errors)>0){
|
| 517 |
+
|
| 518 |
+
echo "There were some errors while importing the database:<br />";
|
| 519 |
+
echo "<textarea cols=60 rows=30>".implode("\n",$errors)."</textarea>";
|
| 520 |
+
exit;
|
| 521 |
+
}else{
|
| 522 |
+
|
| 523 |
+
@unlink($_CONFIG[output_path]."/administrator/backups/".$_CONFIG['sql_usefile']);
|
| 524 |
+
|
| 525 |
+
}
|
| 526 |
+
|
| 527 |
+
echo "<h2>Database populated...</h2>";
|
| 528 |
+
|
| 529 |
+
}
|
| 530 |
+
}
|
| 531 |
+
|
| 532 |
+
###################################################################################
|
| 533 |
+
|
| 534 |
+
if($_REQUEST['do_database'] != 1) {
|
| 535 |
+
|
| 536 |
+
$vars = "";
|
| 537 |
+
foreach($_REQUEST as $key=>$value)
|
| 538 |
+
$vars .= $key.'='.@urlencode($value).'&';
|
| 539 |
+
|
| 540 |
+
#$href = "XCloner.php?".$vars."do_database=1";
|
| 541 |
+
$href = rurl()."&do_database=1";
|
| 542 |
+
echo "<br /><a href='$href'>Please click here to continue with database import...</a>";
|
| 543 |
+
|
| 544 |
+
return;
|
| 545 |
+
|
| 546 |
+
}else{
|
| 547 |
+
|
| 548 |
+
echo "<br /><a href='".$_CONFIG[output_url]."'><b>All should be done! Click here to continue...<br /></a><br />";
|
| 549 |
+
return ;
|
| 550 |
+
}
|
| 551 |
+
|
| 552 |
+
}
|
| 553 |
+
|
| 554 |
+
function write_config($file){
|
| 555 |
+
|
| 556 |
+
if(@$fp = fopen($file, "r")){
|
| 557 |
+
$config_data = "";
|
| 558 |
+
while(!feof($fp))
|
| 559 |
+
$config_data .= fread($fp, 1024);
|
| 560 |
+
fclose($fp);
|
| 561 |
+
}
|
| 562 |
+
|
| 563 |
+
if ($_REQUEST[DBcreated] == 'on'){
|
| 564 |
+
|
| 565 |
+
$config_data = str_replace("define('DB_HOST', '", "define('DB_HOST', '".$_REQUEST[mysql_server]."');#", $config_data);
|
| 566 |
+
$config_data = str_replace("define('DB_USER', '", "define('DB_USER', '".$_REQUEST[mysql_username]."');#", $config_data);
|
| 567 |
+
$config_data = str_replace("define('DB_PASSWORD', '", "define('DB_PASSWORD', '".$_REQUEST[mysql_pass]."');#", $config_data);
|
| 568 |
+
$config_data = str_replace("define('DB_NAME', '", "define('DB_NAME', '".$_REQUEST[mysql_db]."');#", $config_data);
|
| 569 |
+
$liveurl = $_REQUEST[output_url_pref]."://".$_REQUEST[output_url];
|
| 570 |
+
$config_data = str_replace("define('DB_HOST", "define('WP_SITEURL','".$liveurl."');\ndefine('WP_HOME','".$liveurl."');\ndefine('RELOCATE',true);\ndefine('DB_HOST", $config_data);
|
| 571 |
+
|
| 572 |
+
$config_data = str_replace("define('WP_SITEURL', '", "define('WP_SITEURL', '".$liveurl."');#", $config_data);
|
| 573 |
+
$config_data = str_replace("define('WP_HOME', '", "define('WP_HOME', '".$liveurl."');#", $config_data);
|
| 574 |
+
}
|
| 575 |
+
|
| 576 |
+
if($_REQUEST['transfer_mode'] == 2){
|
| 577 |
+
$config_data = str_replace('$'.'ftp_host =',"$"."ftp_host ='".$_REQUEST[ftp_server]."';#", $config_data);
|
| 578 |
+
$config_data = str_replace('$'.'ftp_port =',"$"."ftp_port ='".$_REQUEST[ftp_port]."';#", $config_data);
|
| 579 |
+
$config_data = str_replace('$'.'ftp_user =',"$"."ftp_user ='".$_REQUEST[ftp_user]."';#", $config_data);
|
| 580 |
+
$config_data = str_replace('$'.'ftp_pass =',"$"."ftp_pass ='".$_REQUEST[ftp_pass]."';#", $config_data);
|
| 581 |
+
$config_data = str_replace('$'.'ftp_root =',"$"."ftp_root ='".$_REQUEST[ftp_path]."';#", $config_data);
|
| 582 |
+
}else{
|
| 583 |
+
$config_data = str_replace('$'.'ftp_enable =',"$"."ftp_enable ='0';#", $config_data);
|
| 584 |
+
}
|
| 585 |
+
|
| 586 |
+
$_REQUEST[output_url] = str_replace("/###","",$_REQUEST[output_url]."###");
|
| 587 |
+
$_REQUEST[output_url] = str_replace("###","",$_REQUEST[output_url]);
|
| 588 |
+
|
| 589 |
+
$config_data = str_replace('$'.'live_site =',"$"."live_site ='".$_REQUEST[output_url_pref]."://".$_REQUEST[output_url]."';#", $config_data);
|
| 590 |
+
$config_data = str_replace('$'.'absolute_path =',"$"."absolute_path ='".$_REQUEST[output_path]."';#", $config_data);
|
| 591 |
+
|
| 592 |
+
if ($fp = fopen($file, "w")) {
|
| 593 |
+
fwrite( $fp, $config_data);
|
| 594 |
+
fclose( $fp );
|
| 595 |
+
} else {
|
| 596 |
+
return false;
|
| 597 |
+
} // if
|
| 598 |
+
return true;
|
| 599 |
+
}
|
| 600 |
+
|
| 601 |
+
|
| 602 |
+
function step1(){
|
| 603 |
+
|
| 604 |
+
global $_CONFIG;
|
| 605 |
+
|
| 606 |
+
$ftarget = $_CONFIG[output_path]."/".$_REQUEST[ver];
|
| 607 |
+
|
| 608 |
+
if($_REQUEST['refresh'] < 1)
|
| 609 |
+
|
| 610 |
+
if(!is_writable($_CONFIG[output_path])){
|
| 611 |
+
|
| 612 |
+
echo "<span class='error'>Directory ".$_CONFIG[output_path]." is not writeable or does not exists! Could not continue...</span>";
|
| 613 |
+
|
| 614 |
+
return ;
|
| 615 |
+
|
| 616 |
+
}
|
| 617 |
+
|
| 618 |
+
|
| 619 |
+
|
| 620 |
+
$ftarget = $_REQUEST[ver];
|
| 621 |
+
|
| 622 |
+
|
| 623 |
+
if((!file_exists($ftarget)) and (!$_REQUEST['files_skip'])){
|
| 624 |
+
echo "<span class='error'>Could not continue, unable to read the clone backup file! Please make sure you copied the backup in the same directory as XCloner.php </span>";
|
| 625 |
+
return;
|
| 626 |
+
}
|
| 627 |
+
|
| 628 |
+
step2($ftarget);
|
| 629 |
+
|
| 630 |
+
return;
|
| 631 |
+
|
| 632 |
+
}
|
| 633 |
+
|
| 634 |
+
|
| 635 |
+
|
| 636 |
+
function start() {
|
| 637 |
+
|
| 638 |
+
global $_CONFIG,$pathinfo;
|
| 639 |
+
|
| 640 |
+
$pdir = str_replace($_CONFIG['script_name'], "", $_SERVER["SCRIPT_FILENAME"]);
|
| 641 |
+
|
| 642 |
+
$purl = $_SERVER['HTTP_HOST'].str_replace("/".$_CONFIG['script_name'],"", $_SERVER['SCRIPT_NAME']);
|
| 643 |
+
|
| 644 |
+
?>
|
| 645 |
+
|
| 646 |
+
|
| 647 |
+
<script>
|
| 648 |
+
$(function() {
|
| 649 |
+
$( "#DBcreated" ).button();
|
| 650 |
+
$( "#phpinfo").button();
|
| 651 |
+
$( "#manual_sql" ).button();
|
| 652 |
+
$( "#transfer_mode-ftp" ).button();
|
| 653 |
+
$( "#transfer_mode-direct" ).button();
|
| 654 |
+
$( "input:submit", ".form" ).button();
|
| 655 |
+
});
|
| 656 |
+
$(function() {
|
| 657 |
+
$( "#tabs" ).tabs();
|
| 658 |
+
$( "#tabs2" ).tabs();
|
| 659 |
+
});
|
| 660 |
+
</script>
|
| 661 |
+
|
| 662 |
+
|
| 663 |
+
<!-- section 1-->
|
| 664 |
+
<div id="tabs2">
|
| 665 |
+
<ul>
|
| 666 |
+
<li><a href="#tabs2-1">New Path & Url Configuration</a></li>
|
| 667 |
+
</ul>
|
| 668 |
+
<div id="tabs2-1">
|
| 669 |
+
<table class="adminForm">
|
| 670 |
+
|
| 671 |
+
<tr><td nowrap>
|
| 672 |
+
1. Install directory: (server path where you want to restore your backup)<br />
|
| 673 |
+
<input type=text size=80 name='output_path' value='<?php echo str_replace("\\", "/", $pdir);?>'><br >
|
| 674 |
+
|
| 675 |
+
</td></tr>
|
| 676 |
+
<tr><td>
|
| 677 |
+
<br />2.Install Url: (the url correspondent of your Install directory:)<br />
|
| 678 |
+
<div style="display:inline">
|
| 679 |
+
<div style="float:left">
|
| 680 |
+
<select name='output_url_pref'>
|
| 681 |
+
<option selected value='http'>http://</option>
|
| 682 |
+
<option value='https'>https://</option>
|
| 683 |
+
</select>
|
| 684 |
+
</div>
|
| 685 |
+
<div style="float:left">
|
| 686 |
+
<input type=text size=65 name='output_url' value='<?php echo $purl?>'>
|
| 687 |
+
</div>
|
| 688 |
+
</div>
|
| 689 |
+
|
| 690 |
+
</td></tr>
|
| 691 |
+
<tr><td>
|
| 692 |
+
<br />3. Choose backup archive to restore:
|
| 693 |
+
<?php echo version_list('ver');?>
|
| 694 |
+
</td></tr>
|
| 695 |
+
</table>
|
| 696 |
+
</div>
|
| 697 |
+
</div>
|
| 698 |
+
<!-- end section 1-->
|
| 699 |
+
|
| 700 |
+
<div id="tabs">
|
| 701 |
+
<ul>
|
| 702 |
+
<li><a href="#tabs-1">New Mysql Configuration</a></li>
|
| 703 |
+
<li><a href="#tabs-2">File Restore Options</a></li>
|
| 704 |
+
</ul>
|
| 705 |
+
|
| 706 |
+
<div id="tabs-1">
|
| 707 |
+
<!--start tabs 1 -->
|
| 708 |
+
<table width="100%">
|
| 709 |
+
<tr><td>
|
| 710 |
+
<!--<h3><a href="#">Mysql configuration: </a></h3>-->
|
| 711 |
+
<input type=checkbox checked name='DBcreated' id="DBcreated"> <label for="DBcreated">Import mysql database</label>
|
| 712 |
+
<input type='checkbox' value='1' name='manual_sql' checked id="manual_sql"> <label for="manual_sql">Incremental sql import</label>
|
| 713 |
+
</td></tr>
|
| 714 |
+
<tr><td>
|
| 715 |
+
<!-- mysql details -->
|
| 716 |
+
<table width='100%'>
|
| 717 |
+
<tr>
|
| 718 |
+
<td nowrap>Mysql server:</td>
|
| 719 |
+
<td><input type=text size=40 name='mysql_server' value='localhost'></td>
|
| 720 |
+
<tr>
|
| 721 |
+
<td>Mysql username:</td>
|
| 722 |
+
<td><input type=text size=40 name='mysql_username' value=''></td>
|
| 723 |
+
</tr>
|
| 724 |
+
<tr>
|
| 725 |
+
<td>Mysql password:</td>
|
| 726 |
+
<td><input type=text size=40 name='mysql_pass' value=''></td>
|
| 727 |
+
</tr>
|
| 728 |
+
<tr>
|
| 729 |
+
<td>Mysql database:</td>
|
| 730 |
+
<td><input type=text size=40 name='mysql_db' value=''></td>
|
| 731 |
+
</tr>
|
| 732 |
+
<tr>
|
| 733 |
+
<td>Data encoding:</td>
|
| 734 |
+
<td>
|
| 735 |
+
<select name="charset_of_file">
|
| 736 |
+
|
| 737 |
+
<option value="" selected="selected">Default</option>
|
| 738 |
+
<option value="big5" title="Big5 Traditional Chinese">big5</option>
|
| 739 |
+
<option value="binary" title="Binary pseudo charset">binary</option>
|
| 740 |
+
<option value="cp1250" title="Windows Central European">cp1250</option>
|
| 741 |
+
<option value="cp932" title="SJIS for Windows Japanese">cp932</option>
|
| 742 |
+
<option value="euckr" title="EUC-KR Korean">euckr</option>
|
| 743 |
+
|
| 744 |
+
<option value="gb2312" title="GB2312 Simplified Chinese">gb2312</option>
|
| 745 |
+
<option value="gbk" title="GBK Simplified Chinese">gbk</option>
|
| 746 |
+
<option value="latin1" title="cp1252 West European">latin1</option>
|
| 747 |
+
<option value="latin2" title="ISO 8859-2 Central European">latin2</option>
|
| 748 |
+
<option value="sjis" title="Shift-JIS Japanese">sjis</option>
|
| 749 |
+
<option value="tis620" title="TIS620 Thai">tis620</option>
|
| 750 |
+
|
| 751 |
+
<option value="ucs2" title="UCS-2 Unicode">ucs2</option>
|
| 752 |
+
<option value="ujis" title="EUC-JP Japanese">ujis</option>
|
| 753 |
+
<option value="utf8" title="UTF-8 Unicode" >utf8</option>
|
| 754 |
+
</select>
|
| 755 |
+
</td>
|
| 756 |
+
</tr>
|
| 757 |
+
|
| 758 |
+
<?php
|
| 759 |
+
$dir = "administrator/backups/";
|
| 760 |
+
$sql_files =array();
|
| 761 |
+
if(@is_dir($dir)){
|
| 762 |
+
if ($handle = @opendir($dir)) {
|
| 763 |
+
/* This is the correct way to loop over the directory. */
|
| 764 |
+
while (false !== ($file = @readdir($handle))) {
|
| 765 |
+
if(strstr($file, ".sql"))
|
| 766 |
+
$sql_files[] = $file;
|
| 767 |
+
}
|
| 768 |
+
@closedir($handle);
|
| 769 |
+
}
|
| 770 |
+
|
| 771 |
+
if(sizeof($sql_files) > 0) {
|
| 772 |
+
$list = "";
|
| 773 |
+
for($i=0;$i<sizeof($sql_files);$i++){
|
| 774 |
+
$list .= "<option value='$sql_files[$i]'>$sql_files[$i]</option>";
|
| 775 |
+
}
|
| 776 |
+
|
| 777 |
+
echo "<tr><td>Import Mysql file:</td>
|
| 778 |
+
<td><select name='sql_setfile'><option value='database-sql.sql'>Default</option>$list</select></td> </tr>";
|
| 779 |
+
}
|
| 780 |
+
}
|
| 781 |
+
?>
|
| 782 |
+
</table>
|
| 783 |
+
</tr></td>
|
| 784 |
+
<!-- end mysql details -->
|
| 785 |
+
</table>
|
| 786 |
+
<!--end tabs 1 -->
|
| 787 |
+
</div>
|
| 788 |
+
|
| 789 |
+
<div id="tabs-2">
|
| 790 |
+
<!-- start tabs 2 -->
|
| 791 |
+
<table width="100%">
|
| 792 |
+
<tr bgcolor='#dddddd'><td>
|
| 793 |
+
<!--<h3><a href="#">Files transfer and configuration:</a></h3>-->
|
| 794 |
+
<input type=checkbox name='files_skip' value='1' > <font color='red'>Skip files restore</font><br />
|
| 795 |
+
<input type=checkbox name='preserve_perm' value='1'> Restore files permissions<br />
|
| 796 |
+
<input type=checkbox name='file_utilities' value='1' > Restore by using the server utilities(tar) <br />
|
| 797 |
+
<input type='checkbox' value='1' name='manual_ftp' checked> Incremental transfer
|
| 798 |
+
</td></tr>
|
| 799 |
+
|
| 800 |
+
<tr><td colspan=2>
|
| 801 |
+
|
| 802 |
+
<table width='100%'>
|
| 803 |
+
<tr><td colspan='2'>
|
| 804 |
+
<label for="transfer_mode-ftp">Install files throught ftp:</label>
|
| 805 |
+
<input type=radio name=transfer_mode value=2 id="transfer_mode-ftp">
|
| 806 |
+
<!--<small>this will attempt to transfer all files through ftp, so the owner keep it's permissions, can be used to send files to other hosts also, <font color=red>*recommended</font></small>-->
|
| 807 |
+
<label for="transfer_mode-direct">Install files directly</label>
|
| 808 |
+
<input type=radio name=transfer_mode value=1 checked id="transfer_mode-direct"><br />
|
| 809 |
+
<!--<small>transfering the files directly will cause some permissions problems in some cases, but it's faster than the other option </small>-->
|
| 810 |
+
</td></tr>
|
| 811 |
+
<tr>
|
| 812 |
+
<td valign="top" nowrap>Ftp server:</td>
|
| 813 |
+
<td><input type=text size=30 name='ftp_server' value='localhost'> : <input type=text size=3 name='ftp_port' value='21'></td>
|
| 814 |
+
</tr>
|
| 815 |
+
<tr>
|
| 816 |
+
<td valign="top">Ftp username:</td>
|
| 817 |
+
<td><input type=text size=30 name='ftp_user'></td>
|
| 818 |
+
</tr>
|
| 819 |
+
<tr>
|
| 820 |
+
<td valign="top">Ftp password:</td>
|
| 821 |
+
<td><input type=text size=30 name='ftp_pass'></td>
|
| 822 |
+
</tr>
|
| 823 |
+
<tr>
|
| 824 |
+
<td valign="top">Ftp upload path:</td>
|
| 825 |
+
<td><input type=text size=30 name='ftp_path'>
|
| 826 |
+
<br><small>ftp root path of where the backup will be restored</small>
|
| 827 |
+
</td>
|
| 828 |
+
</tr>
|
| 829 |
+
</table>
|
| 830 |
+
|
| 831 |
+
</td></tr>
|
| 832 |
+
</table>
|
| 833 |
+
<!--end tabs 2-->
|
| 834 |
+
</div>
|
| 835 |
+
</div>
|
| 836 |
+
|
| 837 |
+
<br />
|
| 838 |
+
<div class="form">
|
| 839 |
+
<input type=hidden name='task' value='step1'>
|
| 840 |
+
<input type=submit name=submit value='Start install' >
|
| 841 |
+
<button onclick="window.open('XCloner.php?task=getinfo', 'getInfo', 'toolbar,width=750,height=400'); return false;" id="phpinfo">phpinfo()</button>
|
| 842 |
+
</div>
|
| 843 |
+
<small>*after hitting submit please wait for the package to get unarchived and transfered through ftp if it is the case!</small>
|
| 844 |
+
|
| 845 |
+
<br />
|
| 846 |
+
<span class="ui-state-highlight">
|
| 847 |
+
<span style='color:red'>Security Note:</span> After restore <b>delete the XCloner.php</b> script from your server</span>
|
| 848 |
+
</span>
|
| 849 |
+
|
| 850 |
+
<?php
|
| 851 |
+
|
| 852 |
+
}
|
| 853 |
+
|
| 854 |
+
function getPHPINFO(){
|
| 855 |
+
|
| 856 |
+
?>
|
| 857 |
+
|
| 858 |
+
<table width='100%'>
|
| 859 |
+
<tr bgcolor='#dddddd'><td>
|
| 860 |
+
<b>PHP Configuration: <a target='_blank' href='XCloner.php?task=info'> phpinfo()</a></b>
|
| 861 |
+
</td></tr>
|
| 862 |
+
|
| 863 |
+
<tr><td>
|
| 864 |
+
<table bgcolor='#dddddd' width='65%' style='text-align:center;' border='1'>
|
| 865 |
+
<tr>
|
| 866 |
+
<td><b style='color:red'>PHP Setting</b></td>
|
| 867 |
+
<td><b style='color:orange'>Current Value</b></td>
|
| 868 |
+
<td><b style='color:green'>Recomemnded</b></td>
|
| 869 |
+
</tr>
|
| 870 |
+
<tr>
|
| 871 |
+
<td><b>Open_Basedir:</b> </td>
|
| 872 |
+
<td>
|
| 873 |
+
<?php echo (@ini_get('open_basedir') ? @ini_get('open_basedir') : 'No value')?>
|
| 874 |
+
</td>
|
| 875 |
+
<td><b>No Value</b></td>
|
| 876 |
+
</tr>
|
| 877 |
+
<tr>
|
| 878 |
+
<td><b>Max Execution Time:</b> </td>
|
| 879 |
+
<td>
|
| 880 |
+
<?php echo (@ini_get('max_execution_time') ? @ini_get('max_execution_time') : 'No value')?>
|
| 881 |
+
</td>
|
| 882 |
+
<td><b>>30</b></td>
|
| 883 |
+
</tr>
|
| 884 |
+
<tr>
|
| 885 |
+
<td><b>Safe mode:</b> </td>
|
| 886 |
+
<td>
|
| 887 |
+
<?php echo (@ini_get('safe_mode') ? @ini_get('safe_mode') : 'Off')?>
|
| 888 |
+
</td>
|
| 889 |
+
<td><b>Off</b></td>
|
| 890 |
+
</tr>
|
| 891 |
+
</table>
|
| 892 |
+
</td></tr>
|
| 893 |
+
</table>
|
| 894 |
+
|
| 895 |
+
<?php
|
| 896 |
+
}
|
| 897 |
+
|
| 898 |
+
|
| 899 |
+
###END
|
| 900 |
+
|
| 901 |
+
|
| 902 |
+
###Starting the manual sql backup
|
| 903 |
+
|
| 904 |
+
function populate_db_manual( $db, $sqlfile='administrator/backups/database-sql.sql'){
|
| 905 |
+
|
| 906 |
+
global $qstr;
|
| 907 |
+
|
| 908 |
+
$extra_que = $qstr[0];
|
| 909 |
+
|
| 910 |
+
$file = $sqlfile;
|
| 911 |
+
|
| 912 |
+
define ('DATA_CHUNK_LENGTH',16384); // How many chars are read per time
|
| 913 |
+
|
| 914 |
+
define ('MAX_QUERY_LINES',300); // How many lines may be considered to be one query (except text lines)
|
| 915 |
+
|
| 916 |
+
$lines = "";
|
| 917 |
+
|
| 918 |
+
$error = "";
|
| 919 |
+
|
| 920 |
+
$error_status = 0;
|
| 921 |
+
|
| 922 |
+
if((isset($_REQUEST['chunk']))&&((int)$_REQUEST['chunk'] != 0))
|
| 923 |
+
|
| 924 |
+
$chunk = $_REQUEST['chunk'];
|
| 925 |
+
|
| 926 |
+
else
|
| 927 |
+
|
| 928 |
+
$chunk = DATA_CHUNK_LENGTH;
|
| 929 |
+
|
| 930 |
+
if($_REQUEST['correct_query'] != 1){
|
| 931 |
+
|
| 932 |
+
$start_pos = (int)$_REQUEST['fpos'];
|
| 933 |
+
|
| 934 |
+
$fpos = read_file($file, MAX_QUERY_LINES, $start_pos, $chunk, $lines);
|
| 935 |
+
|
| 936 |
+
}else{
|
| 937 |
+
|
| 938 |
+
$lines[0] = stripslashes($_REQUEST['error_msg']);
|
| 939 |
+
|
| 940 |
+
$fpos = $_REQUEST['start_posf'] ;
|
| 941 |
+
|
| 942 |
+
}
|
| 943 |
+
|
| 944 |
+
foreach($lines as $line)
|
| 945 |
+
|
| 946 |
+
if(trim($line) != ''){
|
| 947 |
+
|
| 948 |
+
$query = $line;
|
| 949 |
+
|
| 950 |
+
$line = $line .";\n";
|
| 951 |
+
|
| 952 |
+
#$tmp = explode("DEFAULT CHARSET",$line);
|
| 953 |
+
|
| 954 |
+
$line_tmp = $line;
|
| 955 |
+
|
| 956 |
+
$start_pos = $start_pos + strlen($line);
|
| 957 |
+
|
| 958 |
+
if(isset($_REQUEST['strrep']))
|
| 959 |
+
|
| 960 |
+
{
|
| 961 |
+
|
| 962 |
+
$strrep = explode("\r\n", stripslashes($_REQUEST['strrep']));
|
| 963 |
+
|
| 964 |
+
foreach($strrep as $value)
|
| 965 |
+
|
| 966 |
+
if(trim($value)!= ""){
|
| 967 |
+
|
| 968 |
+
|
| 969 |
+
$tmp = explode("|", $value);
|
| 970 |
+
|
| 971 |
+
|
| 972 |
+
$line_tmp = str_replace(trim($tmp[0]),trim($tmp[1]),$line_tmp);
|
| 973 |
+
|
| 974 |
+
$query = str_replace(trim($tmp[0]),trim($tmp[1]),$query);
|
| 975 |
+
|
| 976 |
+
}
|
| 977 |
+
|
| 978 |
+
}
|
| 979 |
+
|
| 980 |
+
if(!mysql_query($line_tmp)){
|
| 981 |
+
|
| 982 |
+
if($_REQUEST['correct_query'] != 1)
|
| 983 |
+
|
| 984 |
+
$fpos = $start_pos ;
|
| 985 |
+
|
| 986 |
+
$form_url = rurl($fpos, $chunk);
|
| 987 |
+
|
| 988 |
+
echo "</form><form name='' action='".$form_url."' method='POST'>
|
| 989 |
+
|
| 990 |
+
<input type='hidden' name='correct_query' value = '1'>
|
| 991 |
+
|
| 992 |
+
<input type='hidden' name='start_pos' value='".$start_pos."'>
|
| 993 |
+
|
| 994 |
+
<input type='hidden' name='start_posf' value='".$fpos."'>
|
| 995 |
+
|
| 996 |
+
<input type='hidden' name='glen' value='".$qlen."'>
|
| 997 |
+
|
| 998 |
+
<center>";
|
| 999 |
+
|
| 1000 |
+
echo sprintf("<b>###MYSQL error</b>\n<br /><font color='red'>".mysql_error()."</font><br />\n<b>###On Query:</b><br />\n<br /><textarea cols=70 rows=15 name='error_msg'>%s</textarea><br />", $query);
|
| 1001 |
+
|
| 1002 |
+
echo "<b>Search and replace in query:</b><br /><textarea cols=70 rows=5 name='strrep'>".stripslashes($_REQUEST[strrep])."</textarea><br />
|
| 1003 |
+
|
| 1004 |
+
<small>
|
| 1005 |
+
|
| 1006 |
+
enter a string, one per line, which you would like to replace in the query above, example <i>string_to_search|text_to_replace_with</i>
|
| 1007 |
+
|
| 1008 |
+
</small>";
|
| 1009 |
+
|
| 1010 |
+
echo "<br /> <input type=submit name=submit value='Correct Query >>'>";
|
| 1011 |
+
|
| 1012 |
+
echo "</center></form>";
|
| 1013 |
+
|
| 1014 |
+
$error_status = 1;
|
| 1015 |
+
|
| 1016 |
+
break;
|
| 1017 |
+
|
| 1018 |
+
}
|
| 1019 |
+
|
| 1020 |
+
}
|
| 1021 |
+
|
| 1022 |
+
|
| 1023 |
+
$percent = sprintf("%.2f", (100*$fpos)/ filesize($file));
|
| 1024 |
+
|
| 1025 |
+
if($fpos!='-1'){
|
| 1026 |
+
|
| 1027 |
+
echo "<h3>Processed $percent% from sql backup!</h3>";
|
| 1028 |
+
|
| 1029 |
+
$red_url = rurl($fpos, $chunk);
|
| 1030 |
+
|
| 1031 |
+
if($error_status == 1 ){
|
| 1032 |
+
|
| 1033 |
+
echo "<h3><a href='".$red_url."'>To skip this query, click here to Continue</a></h3>";
|
| 1034 |
+
|
| 1035 |
+
exit;
|
| 1036 |
+
|
| 1037 |
+
}else{
|
| 1038 |
+
|
| 1039 |
+
echo "<h3><a href='".$red_url."'>Continue here</a></h3>";
|
| 1040 |
+
|
| 1041 |
+
echo "<script>window.location='".$red_url."'</script>";
|
| 1042 |
+
|
| 1043 |
+
exit;
|
| 1044 |
+
|
| 1045 |
+
}
|
| 1046 |
+
|
| 1047 |
+
} else {
|
| 1048 |
+
|
| 1049 |
+
echo "<h3>The sql import is finished!</h3>";
|
| 1050 |
+
|
| 1051 |
+
}
|
| 1052 |
+
|
| 1053 |
+
return;
|
| 1054 |
+
|
| 1055 |
+
}
|
| 1056 |
+
|
| 1057 |
+
########END
|
| 1058 |
+
|
| 1059 |
+
|
| 1060 |
+
|
| 1061 |
+
### STARTING THE AUTOMATIC BACKUP
|
| 1062 |
+
|
| 1063 |
+
function populate_db( $db, $sqlfile='administrator/backups/database-sql.sql') {
|
| 1064 |
+
|
| 1065 |
+
global $errors, $_CONFIG;
|
| 1066 |
+
|
| 1067 |
+
if($_REQUEST['use_mysqldump'] == 1){
|
| 1068 |
+
echo shell_exec($_REQUEST['mysqldump_path']." -u ".$_REQUEST[mysql_username]." -p".$_REQUEST[mysql_pass]." -h ".$_REQUEST[mysql_server]." ".$_REQUEST[mysql_db]." < ".$sqlfile);
|
| 1069 |
+
return;
|
| 1070 |
+
}
|
| 1071 |
+
|
| 1072 |
+
$mqr = @get_magic_quotes_runtime();
|
| 1073 |
+
|
| 1074 |
+
@set_magic_quotes_runtime(0);
|
| 1075 |
+
|
| 1076 |
+
@chmod($sqlfile,0777);
|
| 1077 |
+
|
| 1078 |
+
$query = fread( fopen( $sqlfile, 'r' ), filesize( $sqlfile ) );
|
| 1079 |
+
|
| 1080 |
+
@set_magic_quotes_runtime($mqr);
|
| 1081 |
+
|
| 1082 |
+
$pieces = split_sql($query);
|
| 1083 |
+
|
| 1084 |
+
|
| 1085 |
+
|
| 1086 |
+
for ($i=0; $i<count($pieces); $i++) {
|
| 1087 |
+
|
| 1088 |
+
$pieces[$i] = trim($pieces[$i]);
|
| 1089 |
+
|
| 1090 |
+
$tmp = explode("DEFAULT CHARSET",$pieces[$i]);
|
| 1091 |
+
|
| 1092 |
+
$pieces[$i] = $tmp[0].";";
|
| 1093 |
+
|
| 1094 |
+
if(!empty($pieces[$i]) && $pieces[$i] != "#") {
|
| 1095 |
+
|
| 1096 |
+
if (!mysql_query($pieces[$i], $db)) {
|
| 1097 |
+
|
| 1098 |
+
$errors[] = "\n\n##Mysql Query: \n########\n".
|
| 1099 |
+
|
| 1100 |
+
$pieces[$i].
|
| 1101 |
+
|
| 1102 |
+
"\n########\n##Error message: ".
|
| 1103 |
+
|
| 1104 |
+
mysql_error();
|
| 1105 |
+
|
| 1106 |
+
|
| 1107 |
+
|
| 1108 |
+
}
|
| 1109 |
+
|
| 1110 |
+
}
|
| 1111 |
+
|
| 1112 |
+
|
| 1113 |
+
|
| 1114 |
+
}
|
| 1115 |
+
|
| 1116 |
+
return $errors;
|
| 1117 |
+
|
| 1118 |
+
}
|
| 1119 |
+
|
| 1120 |
+
|
| 1121 |
+
function rurl($fpos = 0, $chunk = 0){
|
| 1122 |
+
|
| 1123 |
+
$get_query = "&";
|
| 1124 |
+
|
| 1125 |
+
foreach($_REQUEST as $key=>$value){
|
| 1126 |
+
if(($key != 'fpos')&&($key != 'chunk')&&($key != 'strrep_c')&&($key != 'strrep'))
|
| 1127 |
+
$get_query .= $key."=".$value."&";
|
| 1128 |
+
}
|
| 1129 |
+
$url = $_SERVER['PHP_SELF']."?fpos=".$fpos."&chunk=".$chunk.$get_query;
|
| 1130 |
+
|
| 1131 |
+
return $url;
|
| 1132 |
+
}
|
| 1133 |
+
|
| 1134 |
+
function read_file($file, $lines, $start_pos, &$chunk, &$text){
|
| 1135 |
+
|
| 1136 |
+
$cline = 0;
|
| 1137 |
+
|
| 1138 |
+
$fp = fopen($file, "r");
|
| 1139 |
+
fseek($fp, $start_pos);
|
| 1140 |
+
while((!feof($fp)) &&($cline <= $lines)){
|
| 1141 |
+
$btemp = fgets($fp, $chunk);
|
| 1142 |
+
$buffer .= $btemp;
|
| 1143 |
+
if(strstr($btemp, ";\n"))
|
| 1144 |
+
$cline++;
|
| 1145 |
+
$fpos = ftell($fp);
|
| 1146 |
+
}
|
| 1147 |
+
|
| 1148 |
+
$buffer = str_replace(";\r", ";\n", $buffer);
|
| 1149 |
+
$text = explode(";\n", $buffer);
|
| 1150 |
+
$fpos = $fpos - strlen($text[sizeof($text)-1]);
|
| 1151 |
+
if(sizeof($text) == 1)
|
| 1152 |
+
$chunk = DATA_CHUNK_LENGTH+$chunk;
|
| 1153 |
+
else
|
| 1154 |
+
$chunk = DATA_CHUNK_LENGTH;
|
| 1155 |
+
|
| 1156 |
+
if(feof($fp))
|
| 1157 |
+
$fpos = '-1';
|
| 1158 |
+
fclose ($fp);
|
| 1159 |
+
|
| 1160 |
+
return $fpos; // array_reverse is optional: you can also just return the $text array which consists of the file's lines.
|
| 1161 |
+
|
| 1162 |
+
}
|
| 1163 |
+
|
| 1164 |
+
|
| 1165 |
+
|
| 1166 |
+
/**
|
| 1167 |
+
|
| 1168 |
+
* @param string
|
| 1169 |
+
|
| 1170 |
+
*/
|
| 1171 |
+
|
| 1172 |
+
function split_sql($sql) {
|
| 1173 |
+
|
| 1174 |
+
$ret = array();
|
| 1175 |
+
$sql = str_replace("\n) ", "\n) ;\n#\n#", $sql);
|
| 1176 |
+
$sql = str_replace("\n--\n","\n#\n",$sql);
|
| 1177 |
+
$sql = str_replace("\n-- ","\n# ",$sql);
|
| 1178 |
+
$sql = str_replace("\n/*","\n#/*",$sql);
|
| 1179 |
+
$sql = str_replace("#\n", "#;\n", $sql);
|
| 1180 |
+
|
| 1181 |
+
// Processing the SQL file content
|
| 1182 |
+
|
| 1183 |
+
$file_content = explode("\n",$sql);
|
| 1184 |
+
$query = "";
|
| 1185 |
+
// Parsing the SQL file content
|
| 1186 |
+
foreach($file_content as $key=>$sql_line) {
|
| 1187 |
+
|
| 1188 |
+
if(substr($sql_line, 0, 2) == "--")
|
| 1189 |
+
$sql_line = "#".substr($sql_line, 2, strlen($sql_line));
|
| 1190 |
+
|
| 1191 |
+
if(trim($sql_line) != "" ){
|
| 1192 |
+
|
| 1193 |
+
$query .= $sql_line;
|
| 1194 |
+
|
| 1195 |
+
// Checking whether the line is a valid statement
|
| 1196 |
+
if(preg_match("/(.*);/", $sql_line)){
|
| 1197 |
+
|
| 1198 |
+
$query = substr($query, 0, strlen($query)-1);
|
| 1199 |
+
|
| 1200 |
+
//Executing the parsed string, returns the error code in failure
|
| 1201 |
+
$ret[] = $query;
|
| 1202 |
+
$query = "";
|
| 1203 |
+
}
|
| 1204 |
+
}
|
| 1205 |
+
} //End of foreach
|
| 1206 |
+
|
| 1207 |
+
return($ret);
|
| 1208 |
+
}
|
| 1209 |
+
|
| 1210 |
+
|
| 1211 |
+
|
| 1212 |
+
function recurseFiles(&$d_arr, &$ds_arr, &$f_arr, &$s_arr, &$d, &$f, &$s, &$includedFolders, $path, $mosConfig_absolute_path) {
|
| 1213 |
+
|
| 1214 |
+
$currentfullpath = $mosConfig_absolute_path.$path;
|
| 1215 |
+
|
| 1216 |
+
# Open possibly available directory
|
| 1217 |
+
|
| 1218 |
+
if( is_dir( $currentfullpath ) ) {
|
| 1219 |
+
|
| 1220 |
+
if( $handle = opendir( $currentfullpath ) ) {
|
| 1221 |
+
|
| 1222 |
+
while( false !== ( $file = readdir( $handle ) ) ) {
|
| 1223 |
+
|
| 1224 |
+
# Make sure we don't push parental directories or dotfiles (unix) into the arrays
|
| 1225 |
+
|
| 1226 |
+
if( $file != "." && $file != ".." ) {
|
| 1227 |
+
|
| 1228 |
+
if( is_dir( $currentfullpath . "/" . $file ) ) {
|
| 1229 |
+
|
| 1230 |
+
# Create array for directories
|
| 1231 |
+
|
| 1232 |
+
$d_arr[++$d] = $currentfullpath . "/" . $file;
|
| 1233 |
+
|
| 1234 |
+
recurseFiles($d_arr, $ds_arr, $f_arr, $s_arr, $d, $f, $s, $includedFolders, $path . "/" . $file, $mosConfig_absolute_path);
|
| 1235 |
+
|
| 1236 |
+
} else {
|
| 1237 |
+
|
| 1238 |
+
if ( in_array($currentfullpath, $includedFolders) ) {
|
| 1239 |
+
|
| 1240 |
+
# Create array for files
|
| 1241 |
+
|
| 1242 |
+
$s_arr[$f] = filesize($currentfullpath.'/'.$file);
|
| 1243 |
+
|
| 1244 |
+
$f_arr[$f++] = str_replace($mosConfig_absolute_path.'/', '', $currentfullpath.'/').$file;
|
| 1245 |
+
|
| 1246 |
+
$s += filesize($currentfullpath.'/'.$file);
|
| 1247 |
+
|
| 1248 |
+
}
|
| 1249 |
+
|
| 1250 |
+
}
|
| 1251 |
+
|
| 1252 |
+
}
|
| 1253 |
+
|
| 1254 |
+
}
|
| 1255 |
+
|
| 1256 |
+
}
|
| 1257 |
+
|
| 1258 |
+
# Wrap things up if we're in a directory
|
| 1259 |
+
|
| 1260 |
+
if( is_dir( $handle ) )
|
| 1261 |
+
|
| 1262 |
+
closedir( $handle );
|
| 1263 |
+
|
| 1264 |
+
}
|
| 1265 |
+
|
| 1266 |
+
}
|
| 1267 |
+
|
| 1268 |
+
|
| 1269 |
+
|
| 1270 |
+
|
| 1271 |
+
|
| 1272 |
+
function version_list($fname) {
|
| 1273 |
+
|
| 1274 |
+
global $_CONFIG;
|
| 1275 |
+
|
| 1276 |
+
$return = "<select name='$fname'><option value=''>Choose local clone archive</option>";
|
| 1277 |
+
|
| 1278 |
+
if(is_array($_CONFIG[versions])){
|
| 1279 |
+
|
| 1280 |
+
foreach($_CONFIG[versions] as $key=>$value){
|
| 1281 |
+
|
| 1282 |
+
$size = sprintf("%.2fM", filesize($value)/(1024*1024));
|
| 1283 |
+
|
| 1284 |
+
$return .= "<option selected value='$value'>$value($size)</option>";
|
| 1285 |
+
|
| 1286 |
+
}
|
| 1287 |
+
|
| 1288 |
+
}
|
| 1289 |
+
|
| 1290 |
+
$return .= "</select>";
|
| 1291 |
+
|
| 1292 |
+
return $return;
|
| 1293 |
+
|
| 1294 |
+
}
|
| 1295 |
+
|
| 1296 |
+
|
| 1297 |
+
function recursive_remove_directory($directory, $empty=FALSE){
|
| 1298 |
+
|
| 1299 |
+
// if the path has a slash at the end we remove it here
|
| 1300 |
+
if(substr($directory,-1) == '/'){
|
| 1301 |
+
$directory = substr($directory,0,-1);
|
| 1302 |
+
}
|
| 1303 |
+
|
| 1304 |
+
// if the path is not valid or is not a directory ...
|
| 1305 |
+
if(!file_exists($directory) || !is_dir($directory)){
|
| 1306 |
+
// ... we return false and exit the function
|
| 1307 |
+
return FALSE;
|
| 1308 |
+
|
| 1309 |
+
// ... if the path is not readable
|
| 1310 |
+
}elseif(!is_readable($directory)){
|
| 1311 |
+
// ... we return false and exit the function
|
| 1312 |
+
return FALSE;
|
| 1313 |
+
// ... else if the path is readable
|
| 1314 |
+
}else{
|
| 1315 |
+
// we open the directory
|
| 1316 |
+
$handle = opendir($directory);
|
| 1317 |
+
// and scan through the items inside
|
| 1318 |
+
while (FALSE !== ($item = readdir($handle))){
|
| 1319 |
+
// if the filepointer is not the current directory
|
| 1320 |
+
// or the parent directory
|
| 1321 |
+
if($item != '.' && $item != '..'){
|
| 1322 |
+
// we build the new path to delete
|
| 1323 |
+
$path = $directory.'/'.$item;
|
| 1324 |
+
// if the new path is a directory
|
| 1325 |
+
if(is_dir($path)){
|
| 1326 |
+
// we call this function with the new path
|
| 1327 |
+
recursive_remove_directory($path);
|
| 1328 |
+
// if the new path is a file
|
| 1329 |
+
}else{
|
| 1330 |
+
// we remove the file
|
| 1331 |
+
unlink($path);
|
| 1332 |
+
}
|
| 1333 |
+
}
|
| 1334 |
+
}
|
| 1335 |
+
// close the directory
|
| 1336 |
+
closedir($handle);
|
| 1337 |
+
|
| 1338 |
+
// if the option to empty is not set to true
|
| 1339 |
+
if($empty == FALSE){
|
| 1340 |
+
// try to delete the now empty directory
|
| 1341 |
+
if(!@rmdir($directory)){
|
| 1342 |
+
// return false if not possible
|
| 1343 |
+
return FALSE;
|
| 1344 |
+
}
|
| 1345 |
+
}
|
| 1346 |
+
// return success
|
| 1347 |
+
return TRUE;
|
| 1348 |
+
}
|
| 1349 |
+
}
|
| 1350 |
+
|
| 1351 |
+
|
| 1352 |
+
function setCache($time = 3600){
|
| 1353 |
+
|
| 1354 |
+
$seconds_to_cache = $time;
|
| 1355 |
+
$ts = gmdate("D, d M Y H:i:s", time() + $seconds_to_cache) . " GMT";
|
| 1356 |
+
@header("Expires: $ts");
|
| 1357 |
+
@header("Pragma: cache");
|
| 1358 |
+
@header("Cache-Control: maxage=$seconds_to_cache");
|
| 1359 |
+
|
| 1360 |
+
}
|
| 1361 |
+
|
| 1362 |
+
?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
screenshot-1.png
CHANGED
|
Binary file
|
screenshot-2.png
CHANGED
|
Binary file
|
screenshot-3.png
CHANGED
|
Binary file
|
screenshot-4.png
CHANGED
|
Binary file
|
screenshot-5.png
CHANGED
|
Binary file
|
screenshot-6.png
ADDED
|
Binary file
|
screenshot-7.png
ADDED
|
Binary file
|
screenshot-8.png
ADDED
|
Binary file
|
toolbar.cloner.html.php
CHANGED
|
@@ -4,7 +4,7 @@
|
|
| 4 |
* Oficial website: http://www.joomlaplug.com/
|
| 5 |
* -------------------------------------------
|
| 6 |
* Creator: Liuta Romulus Ovidiu
|
| 7 |
-
* License:
|
| 8 |
* Email: admin@joomlaplug.com
|
| 9 |
* Revision: 1.0
|
| 10 |
* Date: July 2007
|
|
@@ -15,11 +15,33 @@
|
|
| 15 |
defined( '_VALID_MOS' ) or die( 'Direct Access to this location is not allowed.' );
|
| 16 |
|
| 17 |
function button($action, $text='', $js=''){
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 23 |
}
|
| 24 |
|
| 25 |
class TOOLBAR_cloner {
|
|
@@ -45,25 +67,25 @@ class TOOLBAR_cloner {
|
|
| 45 |
button('config', 'Save');
|
| 46 |
button('cancel', 'Cancel');
|
| 47 |
}
|
| 48 |
-
|
| 49 |
function _LANG_EDIT() {
|
| 50 |
button('save_lang_apply','Apply');
|
| 51 |
button('save_lang', 'Save');
|
| 52 |
button('cancel_lang', 'Cancel');
|
| 53 |
}
|
| 54 |
-
|
| 55 |
function _LANG_ADD() {
|
| 56 |
button('add_lang_new', 'New');
|
| 57 |
button('cancel_lang', 'Cancel');
|
| 58 |
}
|
| 59 |
-
|
| 60 |
function _LANG() {
|
| 61 |
button('add_lang','New');
|
| 62 |
button('edit_lang', 'Edit');
|
| 63 |
button('del_lang', 'Delete');
|
| 64 |
button('cancel','Cancel');
|
| 65 |
}
|
| 66 |
-
|
| 67 |
function _RENAME() {
|
| 68 |
button('rename_save', 'Save');
|
| 69 |
button('rename_cancel', 'Cancel');
|
|
@@ -76,7 +98,7 @@ class TOOLBAR_cloner {
|
|
| 76 |
button('cancel','Cancel');
|
| 77 |
}
|
| 78 |
function _DEFAULT() {
|
| 79 |
-
|
| 80 |
button('logout','Logout');
|
| 81 |
button('cancel','Cancel');
|
| 82 |
|
| 4 |
* Oficial website: http://www.joomlaplug.com/
|
| 5 |
* -------------------------------------------
|
| 6 |
* Creator: Liuta Romulus Ovidiu
|
| 7 |
+
* License: GNU/GPL
|
| 8 |
* Email: admin@joomlaplug.com
|
| 9 |
* Revision: 1.0
|
| 10 |
* Date: July 2007
|
| 15 |
defined( '_VALID_MOS' ) or die( 'Direct Access to this location is not allowed.' );
|
| 16 |
|
| 17 |
function button($action, $text='', $js=''){
|
| 18 |
+
if($action == "cancel")
|
| 19 |
+
$icon = "ui-icon-cancel";
|
| 20 |
+
elseif($action == "generate")
|
| 21 |
+
$icon = "ui-icon-arrowthick-1-e";
|
| 22 |
+
elseif($action == "config")
|
| 23 |
+
$icon = "ui-icon-circle-check";
|
| 24 |
+
else
|
| 25 |
+
$icon = "ui-icon-arrowreturnthick-1-e";
|
| 26 |
+
?>
|
| 27 |
+
<script>
|
| 28 |
+
$(function() {
|
| 29 |
+
$( "#<?php echo $text?>" ).button({
|
| 30 |
+
icons:{
|
| 31 |
+
primary: '<?php echo $icon;?>'
|
| 32 |
+
}
|
| 33 |
+
})
|
| 34 |
+
.click(function(){
|
| 35 |
+
document.adminForm.task.value='<?php echo $action?>';document.adminForm.submit();
|
| 36 |
+
})
|
| 37 |
+
.css({ 'text-transform':'uppercase', width: '110px', 'padding-top': '10px', 'padding-bottom': '10px' });
|
| 38 |
+
});
|
| 39 |
+
</script>
|
| 40 |
+
|
| 41 |
+
<button id="<?php echo $text?>"><?php echo $text?></button>
|
| 42 |
+
|
| 43 |
+
<?php
|
| 44 |
+
|
| 45 |
}
|
| 46 |
|
| 47 |
class TOOLBAR_cloner {
|
| 67 |
button('config', 'Save');
|
| 68 |
button('cancel', 'Cancel');
|
| 69 |
}
|
| 70 |
+
|
| 71 |
function _LANG_EDIT() {
|
| 72 |
button('save_lang_apply','Apply');
|
| 73 |
button('save_lang', 'Save');
|
| 74 |
button('cancel_lang', 'Cancel');
|
| 75 |
}
|
| 76 |
+
|
| 77 |
function _LANG_ADD() {
|
| 78 |
button('add_lang_new', 'New');
|
| 79 |
button('cancel_lang', 'Cancel');
|
| 80 |
}
|
| 81 |
+
|
| 82 |
function _LANG() {
|
| 83 |
button('add_lang','New');
|
| 84 |
button('edit_lang', 'Edit');
|
| 85 |
button('del_lang', 'Delete');
|
| 86 |
button('cancel','Cancel');
|
| 87 |
}
|
| 88 |
+
|
| 89 |
function _RENAME() {
|
| 90 |
button('rename_save', 'Save');
|
| 91 |
button('rename_cancel', 'Cancel');
|
| 98 |
button('cancel','Cancel');
|
| 99 |
}
|
| 100 |
function _DEFAULT() {
|
| 101 |
+
|
| 102 |
button('logout','Logout');
|
| 103 |
button('cancel','Cancel');
|
| 104 |
|
toolbar.cloner.php
CHANGED
|
@@ -4,7 +4,7 @@
|
|
| 4 |
* Oficial website: http://www.joomlaplug.com/
|
| 5 |
* -------------------------------------------
|
| 6 |
* Creator: Liuta Romulus Ovidiu
|
| 7 |
-
* License:
|
| 8 |
* Email: admin@joomlaplug.com
|
| 9 |
* Revision: 1.0
|
| 10 |
* Date: July 2007
|
|
@@ -43,8 +43,8 @@ switch ( $task ) {
|
|
| 43 |
case 'view':
|
| 44 |
TOOLBAR_cloner::_VIEW();
|
| 45 |
break;
|
| 46 |
-
|
| 47 |
-
|
| 48 |
case 'add_lang':
|
| 49 |
TOOLBAR_cloner::_LANG_ADD();
|
| 50 |
break;
|
|
@@ -52,18 +52,19 @@ switch ( $task ) {
|
|
| 52 |
case 'edit_lang':
|
| 53 |
TOOLBAR_cloner::_LANG_EDIT();
|
| 54 |
break;
|
| 55 |
-
|
| 56 |
case 'del_lang':
|
| 57 |
case 'lang':
|
| 58 |
TOOLBAR_cloner::_LANG();
|
| 59 |
break;
|
| 60 |
-
|
| 61 |
case 'login':
|
| 62 |
TOOLBAR_cloner::_LOGIN();
|
| 63 |
-
break;
|
| 64 |
-
|
| 65 |
default:
|
| 66 |
TOOLBAR_cloner::_DEFAULT();
|
| 67 |
break;
|
| 68 |
}
|
|
|
|
| 69 |
?>
|
| 4 |
* Oficial website: http://www.joomlaplug.com/
|
| 5 |
* -------------------------------------------
|
| 6 |
* Creator: Liuta Romulus Ovidiu
|
| 7 |
+
* License: GNU/GPL
|
| 8 |
* Email: admin@joomlaplug.com
|
| 9 |
* Revision: 1.0
|
| 10 |
* Date: July 2007
|
| 43 |
case 'view':
|
| 44 |
TOOLBAR_cloner::_VIEW();
|
| 45 |
break;
|
| 46 |
+
|
| 47 |
+
|
| 48 |
case 'add_lang':
|
| 49 |
TOOLBAR_cloner::_LANG_ADD();
|
| 50 |
break;
|
| 52 |
case 'edit_lang':
|
| 53 |
TOOLBAR_cloner::_LANG_EDIT();
|
| 54 |
break;
|
| 55 |
+
|
| 56 |
case 'del_lang':
|
| 57 |
case 'lang':
|
| 58 |
TOOLBAR_cloner::_LANG();
|
| 59 |
break;
|
| 60 |
+
|
| 61 |
case 'login':
|
| 62 |
TOOLBAR_cloner::_LOGIN();
|
| 63 |
+
break;
|
| 64 |
+
|
| 65 |
default:
|
| 66 |
TOOLBAR_cloner::_DEFAULT();
|
| 67 |
break;
|
| 68 |
}
|
| 69 |
+
|
| 70 |
?>
|
xcloner.php
CHANGED
|
@@ -3,7 +3,7 @@
|
|
| 3 |
Plugin Name: XCloner
|
| 4 |
Plugin URI: http://www.xcloner.com
|
| 5 |
Description: XCloner is a tool that will help you manage your website backups, generate/restore/move so your website will be always secured! With XCloner you will be able to clone your site to any other location with just a few clicks. Don't forget to create the 'administrator/backups' directory in your Wordpress root and make it fully writeable. <a href="plugins.php?page=xcloner_show">Open XCloner</a> | <a href="http://www.xcloner.com/support/premium-support/">Get Premium Support</a> | <a href="https://www.paypal.com/cgi-bin/webscr?cmd=_donations&business=info%40xcloner%2ecom&lc=US&item_name=XCloner%20Support&no_note=0¤cy_code=USD&bn=PP%2dDonationsBF%3abtn_donateCC_LG%2egif%3aNonHostedGuest">Donate</a>
|
| 6 |
-
Version:
|
| 7 |
Author: Liuta Ovidiu
|
| 8 |
Author URI: http://www.xcloner.com
|
| 9 |
Plugin URI: http://www.xcloner.com
|
| 3 |
Plugin Name: XCloner
|
| 4 |
Plugin URI: http://www.xcloner.com
|
| 5 |
Description: XCloner is a tool that will help you manage your website backups, generate/restore/move so your website will be always secured! With XCloner you will be able to clone your site to any other location with just a few clicks. Don't forget to create the 'administrator/backups' directory in your Wordpress root and make it fully writeable. <a href="plugins.php?page=xcloner_show">Open XCloner</a> | <a href="http://www.xcloner.com/support/premium-support/">Get Premium Support</a> | <a href="https://www.paypal.com/cgi-bin/webscr?cmd=_donations&business=info%40xcloner%2ecom&lc=US&item_name=XCloner%20Support&no_note=0¤cy_code=USD&bn=PP%2dDonationsBF%3abtn_donateCC_LG%2egif%3aNonHostedGuest">Donate</a>
|
| 6 |
+
Version: 3.0
|
| 7 |
Author: Liuta Ovidiu
|
| 8 |
Author URI: http://www.xcloner.com
|
| 9 |
Plugin URI: http://www.xcloner.com
|
xcloner_j1.5.xml
CHANGED
|
@@ -1,113 +1,136 @@
|
|
| 1 |
-
<install type="component" version="1.5.0">
|
| 2 |
-
<name>XCloner</name>
|
| 3 |
-
<version>2.1
|
| 4 |
-
<license>
|
| 5 |
-
<author>
|
| 6 |
-
<authoremail>
|
| 7 |
-
<authorurl>http://www.
|
| 8 |
-
<creationDate>
|
| 9 |
-
<copyright>
|
| 10 |
<description><![CDATA[
|
| 11 |
-
<a href="http://www.joomlaplug.com"><img src="http://www.joomlaplug.com/logo.gif" border=0></a><br/>
|
| 12 |
<h2>XCloner Backup&Restore Utility</h2>
|
| 13 |
<pre>XCloner is a tool that will help you manage your website backups, generate/restore/move so your website will be always secured!
|
| 14 |
-
|
| 15 |
Features:
|
| 16 |
-cron script to generate backup
|
| 17 |
-multiple backup options
|
| 18 |
-restore tool to move the website rapidly to other locations
|
| 19 |
-multiple locations of where you could store the backup safelly
|
| 20 |
-
-comnpatible with both Joomla 1.
|
| 21 |
|
| 22 |
-
For reports and suggestions please contact us at
|
| 23 |
</pre>
|
| 24 |
-
<br
|
| 25 |
|
| 26 |
-
|
| 27 |
<br/><p/><br/>
|
| 28 |
]]>
|
| 29 |
</description>
|
| 30 |
<installfile>install.xcloner.php</installfile>
|
| 31 |
<administration>
|
| 32 |
-
<menu>.XCloner</menu>
|
| 33 |
<files>
|
| 34 |
-
<filename>admin.xcloner.php</filename>
|
| 35 |
-
<filename>xcloner.php</filename>
|
| 36 |
-
<filename>
|
| 37 |
-
<filename>
|
| 38 |
-
<filename>
|
| 39 |
-
<filename>
|
| 40 |
-
<filename>
|
| 41 |
-
<filename>
|
| 42 |
-
<filename>
|
| 43 |
-
<filename>
|
| 44 |
-
<filename>browser/
|
| 45 |
-
<filename>
|
| 46 |
-
<filename>
|
| 47 |
-
<filename>
|
| 48 |
-
<filename>
|
| 49 |
-
<filename>
|
| 50 |
-
<filename>
|
| 51 |
-
<filename>
|
| 52 |
-
<filename>
|
| 53 |
-
<filename>
|
| 54 |
-
<filename>
|
| 55 |
-
<filename>images/
|
| 56 |
-
<filename>images/
|
| 57 |
-
<filename>images/
|
| 58 |
-
<filename>images/
|
| 59 |
-
<filename>images/
|
| 60 |
-
<filename>images/
|
| 61 |
-
<filename>images/
|
| 62 |
-
<filename>images/
|
| 63 |
-
<filename>images/
|
| 64 |
-
<filename>images/
|
| 65 |
-
<filename>images/
|
| 66 |
-
<filename>images/
|
| 67 |
-
<filename>images/
|
| 68 |
-
<filename>images/
|
| 69 |
-
<filename>images/
|
| 70 |
-
<filename>images/
|
| 71 |
-
<filename>images/xcloner.png</filename>
|
| 72 |
-
<filename>images/minus.gif</filename>
|
| 73 |
-
<filename>images/minusbottom.gif</filename>
|
| 74 |
-
<filename>images/nolines_minus.gif</filename>
|
| 75 |
-
<filename>images/nolines_plus.gif</filename>
|
| 76 |
-
<filename>images/page.gif</filename>
|
| 77 |
-
<filename>images/plus.gif</filename>
|
| 78 |
-
<filename>images/plusbottom.gif</filename>
|
| 79 |
-
<filename>images/publish_x.png</filename>
|
| 80 |
-
<filename>images/settings.png</filename>
|
| 81 |
-
<filename>images/support.png</filename>
|
| 82 |
-
<filename>images/templatessm.png</filename>
|
| 83 |
-
<filename>images/website.png</filename>
|
| 84 |
-
<filename>images/wizard.png</filename>
|
| 85 |
-
<filename>images/wizardsm.png</filename>
|
| 86 |
-
<filename>images/wizardsm_restore.gif</filename>
|
| 87 |
-
<filename>images/wizardsm_restore.png</filename>
|
| 88 |
-
<filename>javascript/dtree.js</filename>
|
| 89 |
-
<filename>javascript/tabber.js</filename>
|
| 90 |
-
<filename>language/english.php</filename>
|
| 91 |
-
<filename>language/index.html</filename>
|
| 92 |
-
<filename>restore/TAR.php</filename>
|
| 93 |
-
<filename>restore/XCloner.php</filename>
|
| 94 |
-
<filename>.cloner.config.php</filename>
|
| 95 |
-
<filename>admin.cloner.html.php</filename>
|
| 96 |
-
<filename>admin.cloner.php</filename>
|
| 97 |
-
<filename>cloner.config.php</filename>
|
| 98 |
-
<filename>cloner.cron.php</filename>
|
| 99 |
-
<filename>cloner.functions.php</filename>
|
| 100 |
-
<filename>common.php</filename>
|
| 101 |
-
<filename>index.php</filename>
|
| 102 |
-
<filename>index2.php</filename>
|
| 103 |
-
<filename>install.xcloner.php</filename>
|
| 104 |
-
<filename>license.txt</filename>
|
| 105 |
-
<filename>readme.txt</filename>
|
| 106 |
-
<filename>recursive.php</filename>
|
| 107 |
-
<filename>toolbar.cloner.html.php</filename>
|
| 108 |
-
<filename>toolbar.cloner.php</filename>
|
| 109 |
-
|
| 110 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 111 |
</files>
|
| 112 |
</administration>
|
| 113 |
</install>
|
| 1 |
+
<install type="component" version="1.5.0" method="upgrade">
|
| 2 |
+
<name>XCloner-BackupandRestore</name>
|
| 3 |
+
<version>2.2.1</version>
|
| 4 |
+
<license>GNU/GPL</license>
|
| 5 |
+
<author>XCloner.com</author>
|
| 6 |
+
<authoremail>info@xcloner.com</authoremail>
|
| 7 |
+
<authorurl>http://www.xcloner.com</authorurl>
|
| 8 |
+
<creationDate>February 2011</creationDate>
|
| 9 |
+
<copyright>XCloner.com</copyright>
|
| 10 |
<description><![CDATA[
|
|
|
|
| 11 |
<h2>XCloner Backup&Restore Utility</h2>
|
| 12 |
<pre>XCloner is a tool that will help you manage your website backups, generate/restore/move so your website will be always secured!
|
| 13 |
+
<a href="http://www.xcloner.com"><img src="http://www.xcloner.com/xcloner_p.jpg" border=0 style="float:left; padding-right:10px;padding-bottom: 100px;padding-top:20px;"></a>
|
| 14 |
Features:
|
| 15 |
-cron script to generate backup
|
| 16 |
-multiple backup options
|
| 17 |
-restore tool to move the website rapidly to other locations
|
| 18 |
-multiple locations of where you could store the backup safelly
|
| 19 |
+
-comnpatible with both Joomla 1.5.x and 1.6.x
|
| 20 |
|
| 21 |
+
For reports and suggestions please contact us at info@xcloner.com or visit us on <a href='http://www.xcloner.com'>http://www.xcloner.com</a>
|
| 22 |
</pre>
|
| 23 |
+
<br/>
|
| 24 |
|
| 25 |
+
XCloner.com © 2006-2011 | <a href="http://www.xcloner.com">www.xcloner.com</a>
|
| 26 |
<br/><p/><br/>
|
| 27 |
]]>
|
| 28 |
</description>
|
| 29 |
<installfile>install.xcloner.php</installfile>
|
| 30 |
<administration>
|
| 31 |
+
<menu img="components/com_xcloner-backupandrestore/images/xcloner.png" alias="XCloner">.XCloner-Backup and Restore</menu>
|
| 32 |
<files>
|
| 33 |
+
<filename>admin.xcloner.php</filename>
|
| 34 |
+
<filename>admin.xcloner-backupandrestore.php</filename>
|
| 35 |
+
<filename>xcloner.php</filename>
|
| 36 |
+
<filename>classes/S3.php</filename>
|
| 37 |
+
<filename>classes/fileRecursion.php</filename>
|
| 38 |
+
<filename>classes/index.html</filename>
|
| 39 |
+
<filename>classes/main.class.php</filename>
|
| 40 |
+
<filename>classes/mysqlBackup.class.php</filename>
|
| 41 |
+
<filename>administrator/index.html</filename>
|
| 42 |
+
<filename>administrator/backups/index.html</filename>
|
| 43 |
+
<filename>browser/file.gif</filename>
|
| 44 |
+
<filename>browser/filebrowser.css</filename>
|
| 45 |
+
<filename>browser/files_inpage.php</filename>
|
| 46 |
+
<filename>browser/files_xml.php</filename>
|
| 47 |
+
<filename>browser/folder.gif</filename>
|
| 48 |
+
<filename>browser/timer.gif</filename>
|
| 49 |
+
<filename>browser/xmlhttp.js</filename>
|
| 50 |
+
<filename>configs/index.html</filename>
|
| 51 |
+
<filename>css/dtree.css</filename>
|
| 52 |
+
<filename>css/main.css</filename>
|
| 53 |
+
<filename>css/start/jquery-ui-1.8.9.custom.css</filename>
|
| 54 |
+
<filename>css/start/images/ui-bg_flat_55_999999_40x100.png</filename>
|
| 55 |
+
<filename>css/start/images/ui-bg_flat_75_aaaaaa_40x100.png</filename>
|
| 56 |
+
<filename>css/start/images/ui-bg_glass_75_79c9ec_1x400.png</filename>
|
| 57 |
+
<filename>css/start/images/ui-icons_056b93_256x240.png</filename>
|
| 58 |
+
<filename>css/start/images/ui-icons_d8e7f3_256x240.png</filename>
|
| 59 |
+
<filename>css/start/images/ui-icons_fcd113_256x240.png</filename>
|
| 60 |
+
<filename>css/start/images/ui-bg_glass_45_0078ae_1x400.png</filename>
|
| 61 |
+
<filename>css/start/images/ui-icons_f7a50d_256x240.png</filename>
|
| 62 |
+
<filename>css/start/images/ui-bg_gloss-wave_45_e14f1c_500x100.png</filename>
|
| 63 |
+
<filename>css/start/images/ui-icons_0078ae_256x240.png</filename>
|
| 64 |
+
<filename>css/start/images/ui-bg_glass_55_f8da4e_1x400.png</filename>
|
| 65 |
+
<filename>css/start/images/ui-icons_e0fdff_256x240.png</filename>
|
| 66 |
+
<filename>css/start/images/ui-bg_inset-hard_100_fcfdfd_1x100.png</filename>
|
| 67 |
+
<filename>css/start/images/ui-icons_f5e175_256x240.png</filename>
|
| 68 |
+
<filename>css/start/images/ui-bg_gloss-wave_50_6eac2c_500x100.png</filename>
|
| 69 |
+
<filename>css/start/images/ui-bg_gloss-wave_75_2191c0_500x100.png</filename>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 70 |
|
| 71 |
+
<filename>images/about.png</filename>
|
| 72 |
+
<filename>images/actions.gif</filename>
|
| 73 |
+
<filename>images/actions.png</filename>
|
| 74 |
+
<filename>images/backup.png</filename>
|
| 75 |
+
<filename>images/css.png</filename>
|
| 76 |
+
<filename>images/editions.png</filename>
|
| 77 |
+
<filename>images/editionssm.png</filename>
|
| 78 |
+
<filename>images/empty.gif</filename>
|
| 79 |
+
<filename>images/filesave.png</filename>
|
| 80 |
+
<filename>images/folder.png</filename>
|
| 81 |
+
<filename>images/forum.png</filename>
|
| 82 |
+
<filename>images/gen_settings.png</filename>
|
| 83 |
+
<filename>images/help.png</filename>
|
| 84 |
+
<filename>images/helpsm.png</filename>
|
| 85 |
+
<filename>images/join.gif</filename>
|
| 86 |
+
<filename>images/joinbottom.gif</filename>
|
| 87 |
+
<filename>images/keep_icon.gif</filename>
|
| 88 |
+
<filename>images/lang.png</filename>
|
| 89 |
+
<filename>images/lhelp.png</filename>
|
| 90 |
+
<filename>images/line.gif</filename>
|
| 91 |
+
<filename>images/logo.gif</filename>
|
| 92 |
+
<filename>images/logo.png</filename>
|
| 93 |
+
<filename>images/xcloner.png</filename>
|
| 94 |
+
<filename>images/minus.gif</filename>
|
| 95 |
+
<filename>images/minusbottom.gif</filename>
|
| 96 |
+
<filename>images/nolines_minus.gif</filename>
|
| 97 |
+
<filename>images/nolines_plus.gif</filename>
|
| 98 |
+
<filename>images/page.gif</filename>
|
| 99 |
+
<filename>images/plus.gif</filename>
|
| 100 |
+
<filename>images/plusbottom.gif</filename>
|
| 101 |
+
<filename>images/publish_x.png</filename>
|
| 102 |
+
<filename>images/settings.png</filename>
|
| 103 |
+
<filename>images/support.png</filename>
|
| 104 |
+
<filename>images/templatessm.png</filename>
|
| 105 |
+
<filename>images/website.png</filename>
|
| 106 |
+
<filename>images/wizard.png</filename>
|
| 107 |
+
<filename>images/wizardsm.png</filename>
|
| 108 |
+
<filename>images/wizardsm_restore.gif</filename>
|
| 109 |
+
<filename>images/wizardsm_restore.png</filename>
|
| 110 |
+
<filename>javascript/dtree.js</filename>
|
| 111 |
+
<filename>javascript/main.js</filename>
|
| 112 |
+
<filename>javascript/jquery-1.4.4.min.js</filename>
|
| 113 |
+
<filename>javascript/jquery-ui-1.8.9.custom.min.js</filename>
|
| 114 |
+
<filename>language/english.php</filename>
|
| 115 |
+
<filename>language/spanish.php</filename>
|
| 116 |
+
<filename>language/dutch.php</filename>
|
| 117 |
+
<filename>language/deutsch.php</filename>
|
| 118 |
+
<filename>language/index.html</filename>
|
| 119 |
+
<filename>restore/TAR.php</filename>
|
| 120 |
+
<filename>restore/XCloner.php</filename>
|
| 121 |
+
<filename>admin.cloner.html.php</filename>
|
| 122 |
+
<filename>admin.cloner.php</filename>
|
| 123 |
+
<filename>cloner.config.php</filename>
|
| 124 |
+
<filename>cloner.cron.php</filename>
|
| 125 |
+
<filename>cloner.functions.php</filename>
|
| 126 |
+
<filename>common.php</filename>
|
| 127 |
+
<filename>index.php</filename>
|
| 128 |
+
<filename>index2.php</filename>
|
| 129 |
+
<filename>install.xcloner.php</filename>
|
| 130 |
+
<filename>license.txt</filename>
|
| 131 |
+
<filename>readme.txt</filename>
|
| 132 |
+
<filename>toolbar.cloner.html.php</filename>
|
| 133 |
+
<filename>toolbar.cloner.php</filename>
|
| 134 |
</files>
|
| 135 |
</administration>
|
| 136 |
</install>
|
