Version Description
- Solved the unserialize problem.
- Design changes and typo corrections in the settings page.
Download this release
Release Info
Developer | socialdude |
Plugin | Social Media Share Buttons & Social Sharing Icons |
Version | 2.4.2 |
Comparing to | |
See all releases |
Code changes from version 2.4.1 to 2.4.2
- css/sfsi-admin-style.css +5285 -5286
- css/sfsi-style.css +3471 -3471
- js/custom-admin.js +3343 -3343
- libs/controllers/sfsi_socialhelper.php +8 -3
- libs/sfsi_install_uninstall.php +9 -3
- readme.txt +875 -870
- ultimate_social_media_icons.php +2 -2
- views/sfsi_option_view6.php +524 -524
- views/sfsi_options_view.php +244 -244
- views/sfsi_question3.php +142 -141
- views/subviews/que3/sfsi_que3_place_via_after_posts.php +59 -59
- views/subviews/que3/sfsi_que3_place_via_float.php +262 -262
css/sfsi-admin-style.css
CHANGED
@@ -1,5287 +1,5286 @@
|
|
1 |
-
@charset "utf-8";
|
2 |
-
@font-face {
|
3 |
-
font-family: helveticabold;
|
4 |
-
src: url(fonts/helvetica_bold_0-webfont.eot);
|
5 |
-
src: url(fonts/helvetica_bold_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_bold_0-webfont.woff) format('woff'), url(fonts/helvetica_bold_0-webfont.ttf) format('truetype'), url(fonts/helvetica_bold_0-webfont.svg#helveticabold) format('svg');
|
6 |
-
font-weight: 400;
|
7 |
-
font-style: normal;
|
8 |
-
}
|
9 |
-
@font-face {
|
10 |
-
font-family: helveticaregular;
|
11 |
-
src: url(fonts/helvetica_0-webfont.eot);
|
12 |
-
src: url(fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_0-webfont.woff) format('woff'), url(fonts/helvetica_0-webfont.ttf) format('truetype'), url(fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');
|
13 |
-
font-weight: 400;
|
14 |
-
font-style: normal;
|
15 |
-
}
|
16 |
-
@font-face {
|
17 |
-
font-family: helveticaneue-light;
|
18 |
-
src: url(fonts/helveticaneue-light.eot);
|
19 |
-
src: url(fonts/helveticaneue-light.eot?#iefix) format('embedded-opentype'),
|
20 |
-
url(fonts/helveticaneue-light.woff) format('woff'),
|
21 |
-
url(fonts/helveticaneue-light.ttf) format('truetype'),
|
22 |
-
url(fonts/helveticaneue-light.svg#helveticaneue-light) format('svg');
|
23 |
-
font-weight: 400;
|
24 |
-
font-style: normal;
|
25 |
-
}
|
26 |
-
body {
|
27 |
-
margin: 0;
|
28 |
-
padding: 0;
|
29 |
-
}
|
30 |
-
.sfsi_mainContainer {
|
31 |
-
font-family: helveticaregular;
|
32 |
-
}
|
33 |
-
.sfsi_mainContainer h1,
|
34 |
-
.sfsi_mainContainer h2,
|
35 |
-
.sfsi_mainContainer h3,
|
36 |
-
.sfsi_mainContainer h4,
|
37 |
-
.sfsi_mainContainer h5,
|
38 |
-
.sfsi_mainContainer h6,
|
39 |
-
.sfsi_mainContainer li,
|
40 |
-
.sfsi_mainContainer p,
|
41 |
-
.sfsi_mainContainer ul {
|
42 |
-
margin: 0;
|
43 |
-
padding: 0;
|
44 |
-
font-weight: 400;
|
45 |
-
}
|
46 |
-
.sfsi_mainContainer img {
|
47 |
-
border: 0;
|
48 |
-
vertical-align: middle;
|
49 |
-
}
|
50 |
-
.main_contant p,
|
51 |
-
.ui-accordion .ui-accordion-header {
|
52 |
-
/*font-family: helveticaregular;*/
|
53 |
-
font-family: 'helveticaneue-light';
|
54 |
-
}
|
55 |
-
.sfsi_mainContainer input,
|
56 |
-
.sfsi_mainContainer select {
|
57 |
-
outline: 0;
|
58 |
-
}
|
59 |
-
.wapper {
|
60 |
-
padding: 30px 40px 40px 40px;
|
61 |
-
display: block;
|
62 |
-
background: #f1f1f1;
|
63 |
-
}
|
64 |
-
.main_contant {
|
65 |
-
margin: 0;
|
66 |
-
padding: 20px 0 0 0;
|
67 |
-
width: 100%;
|
68 |
-
float: left;
|
69 |
-
}
|
70 |
-
.main_contant h1 {
|
71 |
-
padding: 0;
|
72 |
-
color: #1a1d20;
|
73 |
-
font-family: helveticabold;
|
74 |
-
font-size: 28px;
|
75 |
-
}
|
76 |
-
.main_contant p {
|
77 |
-
padding: 0;
|
78 |
-
color: #414951;
|
79 |
-
font-size: 17px;
|
80 |
-
line-height: 26px;
|
81 |
-
}
|
82 |
-
.main_contant p span {
|
83 |
-
text-decoration: underline;
|
84 |
-
font-family: helveticabold;
|
85 |
-
}
|
86 |
-
a#save_all_settings {
|
87 |
-
padding: 15px 10px;
|
88 |
-
}
|
89 |
-
#accordion p,
|
90 |
-
#accordion1 p {
|
91 |
-
color: #5a6570;
|
92 |
-
text-align: left;
|
93 |
-
/*font-family: helveticaregular;*/
|
94 |
-
font-family: 'helveticaneue-light';
|
95 |
-
font-size: 17px;
|
96 |
-
line-height: 26px;
|
97 |
-
padding-top: 19px;
|
98 |
-
}
|
99 |
-
#accordion p:first-child,
|
100 |
-
#accordion1 p:first-child {
|
101 |
-
padding-top: 5px;
|
102 |
-
|
103 |
-
/* padding-bottom: 10px;*/
|
104 |
-
|
105 |
-
padding-bottom: 5px;
|
106 |
-
}
|
107 |
-
#accordion h4,
|
108 |
-
#accordion1 h4 {
|
109 |
-
margin: 0;
|
110 |
-
padding: 30px 0 0;
|
111 |
-
color: #414951 !important;
|
112 |
-
font-size: 20px;
|
113 |
-
line-height: 22px;
|
114 |
-
font-family: helveticaregular;
|
115 |
-
}
|
116 |
-
#accordion1 h4.sfsi_dsplyatend {
|
117 |
-
width: 47%;
|
118 |
-
float: left;
|
119 |
-
}
|
120 |
-
#accordion h4:first-child,
|
121 |
-
#accordion1 h4:first-child {
|
122 |
-
padding-top: 0;
|
123 |
-
}
|
124 |
-
.tab1,
|
125 |
-
.tab2,
|
126 |
-
.tab3,
|
127 |
-
.tab4,
|
128 |
-
.tab5,
|
129 |
-
.tab6,
|
130 |
-
.tab7 {
|
131 |
-
color: #5a6570;
|
132 |
-
text-align: left;
|
133 |
-
font-family: helveticaneue-light;
|
134 |
-
font-size: 18px;
|
135 |
-
line-height: 26px;
|
136 |
-
}
|
137 |
-
|
138 |
-
/*Admin menu*/
|
139 |
-
ul#adminmenu li.toplevel_page_sfsi-options div.wp-menu-image {
|
140 |
-
display: none;
|
141 |
-
}
|
142 |
-
#adminmenu li.toplevel_page_sfsi-options a.toplevel_page_sfsi-options {
|
143 |
-
padding: 0 0 0 38px;
|
144 |
-
font-family: Arial, Helvetica, sans-serif !important;
|
145 |
-
|
146 |
-
/* font-family: helveticabold; */
|
147 |
-
}
|
148 |
-
ul#adminmenu li.toplevel_page_sfsi-options a.toplevel_page_sfsi-options {
|
149 |
-
color: #e12522;
|
150 |
-
transition: 0s;
|
151 |
-
background: url(images/left_log_icn.png) 6px 15px no-repeat #000;
|
152 |
-
background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;
|
153 |
-
color: #e12522;
|
154 |
-
font-family: Arial, Helvetica, sans-serif !important;
|
155 |
-
|
156 |
-
}
|
157 |
-
ul#adminmenu li.toplevel_page_sfsi-options a.toplevel_page_sfsi-options:hover {
|
158 |
-
background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;
|
159 |
-
color: #e12522;
|
160 |
-
|
161 |
-
}
|
162 |
-
|
163 |
-
ul#adminmenu li.toplevel_page_sfsi-options a.current,
|
164 |
-
ul#adminmenu li.toplevel_page_sfsi-options a.current:hover {
|
165 |
-
background: url(images/left_log_icn.png) 6px 15px no-repeat #000000;
|
166 |
-
/*background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;*/
|
167 |
-
color: #e12522;
|
168 |
-
}
|
169 |
-
/*Tab1*/
|
170 |
-
.tab1 ul.icn_listing {
|
171 |
-
list-style: none;
|
172 |
-
overflow: hidden;
|
173 |
-
border-top: #e7e8eb solid 1px;
|
174 |
-
margin: 35px 0 0;
|
175 |
-
}
|
176 |
-
.tab1 ul.icn_listing li {
|
177 |
-
border-bottom: #eaebed solid 1px;
|
178 |
-
padding: 11px 0 11px 8px;
|
179 |
-
float: left;
|
180 |
-
width: 100%
|
181 |
-
}
|
182 |
-
ul.icn_listing li .tb_4_ck {
|
183 |
-
float: left;
|
184 |
-
margin: 10px 0 0;
|
185 |
-
}
|
186 |
-
.tab1 ul.icn_listing li .custom,
|
187 |
-
.tab1 ul.icn_listing li .sfsicls_email,
|
188 |
-
.tab1 ul.icn_listing li .sfsicls_facebook,
|
189 |
-
.tab1 ul.icn_listing li .sfsicls_instagram,
|
190 |
-
.tab1 ul.icn_listing li .sfsicls_telegram,
|
191 |
-
.tab1 ul.icn_listing li .sfsicls_vk,
|
192 |
-
.tab1 ul.icn_listing li .sfsicls_ok,
|
193 |
-
.tab1 ul.icn_listing li .sfsicls_wechat,
|
194 |
-
.tab1 ul.icn_listing li .sfsicls_weibo,
|
195 |
-
.sfsicls_linkdin,
|
196 |
-
.tab1 ul.icn_listing li .sfsicls_pinterest,
|
197 |
-
.tab1 ul.icn_listing li .sfsicls_rs_s,
|
198 |
-
.tab1 ul.icn_listing li .sfsicls_share,
|
199 |
-
.tab1 ul.icn_listing li .sfsicls_twt,
|
200 |
-
.tab1 ul.icn_listing li .sfsicls_utube {
|
201 |
-
background: url(../images/tab_1_icn_list.png) no-repeat;
|
202 |
-
float: left;
|
203 |
-
padding: 0 0 0 59px;
|
204 |
-
margin: 0 0 0 17px;
|
205 |
-
height: 52px;
|
206 |
-
line-height: 51px;
|
207 |
-
font-family: helveticaregular;
|
208 |
-
font-size: 22px;
|
209 |
-
}
|
210 |
-
.tab1 ul.icn_listing li .sfsicls_telegram {
|
211 |
-
background: url(../images/icons_theme/default/default_telegram.png) no-repeat;
|
212 |
-
background-size: contain;
|
213 |
-
}
|
214 |
-
.tab1 ul.icn_listing li .sfsicls_vk {
|
215 |
-
background: url(../images/icons_theme/default/default_vk.png) no-repeat;
|
216 |
-
background-size: contain;
|
217 |
-
}
|
218 |
-
.tab1 ul.icn_listing li .sfsicls_ok {
|
219 |
-
background: url(../images/icons_theme/default/default_ok.png) no-repeat;
|
220 |
-
background-size: contain;
|
221 |
-
}
|
222 |
-
.tab1 ul.icn_listing li .sfsicls_wechat {
|
223 |
-
background: url(../images/icons_theme/default/default_wechat.png) no-repeat;
|
224 |
-
background-size: contain;
|
225 |
-
}
|
226 |
-
.tab1 ul.icn_listing li .sfsicls_weibo {
|
227 |
-
background: url(../images/icons_theme/default/default_weibo.png) no-repeat;
|
228 |
-
background-size: contain;
|
229 |
-
}
|
230 |
-
|
231 |
-
.tab1 ul.icn_listing li .sfsicls_rs_s {
|
232 |
-
background-position: 0 0;
|
233 |
-
color: #f7941d;
|
234 |
-
}
|
235 |
-
.tab1 ul.icn_listing li .sfsicls_email {
|
236 |
-
background-position: 0 -73px;
|
237 |
-
color: #d1c800;
|
238 |
-
}
|
239 |
-
.tab1 ul.icn_listing li .sfsicls_facebook {
|
240 |
-
background-position: 0 -145px;
|
241 |
-
color: #004088;
|
242 |
-
}
|
243 |
-
.tab1 ul.icn_listing li .sfsicls_twt {
|
244 |
-
background-position: 0 -221px;
|
245 |
-
color: #00abe3;
|
246 |
-
}
|
247 |
-
|
248 |
-
.tab1 ul.icn_listing li .sfsicls_share {
|
249 |
-
background-position: 0 -372px;
|
250 |
-
color: #ef4746;
|
251 |
-
}
|
252 |
-
.tab1 ul.icn_listing li .sfsicls_utube {
|
253 |
-
background-position: 0 -448px;
|
254 |
-
color: #f07963;
|
255 |
-
}
|
256 |
-
.tab1 ul.icn_listing li .sfsicls_linkdin {
|
257 |
-
background-position: 0 -548px;
|
258 |
-
color: #1e88c9;
|
259 |
-
}
|
260 |
-
.tab1 ul.icn_listing li .sfsicls_pinterest {
|
261 |
-
background-position: 0 -623px;
|
262 |
-
color: #f15f5d;
|
263 |
-
}
|
264 |
-
.tab1 ul.icn_listing li .sfsicls_instagram {
|
265 |
-
background-position: 0 -781px;
|
266 |
-
color: #369;
|
267 |
-
}
|
268 |
-
.tab1 ul.icn_listing li .custom {
|
269 |
-
background-position: 0 -702px;
|
270 |
-
color: #5a6570;
|
271 |
-
}
|
272 |
-
.tab1 ul.icn_listing li .right_info {
|
273 |
-
width: 70%;
|
274 |
-
float: right;
|
275 |
-
font-family: helveticaregular;
|
276 |
-
margin-right: 13px;
|
277 |
-
}
|
278 |
-
ul.icn_listing li .right_info a {
|
279 |
-
text-decoration: underline;
|
280 |
-
color: #a4a9ad;
|
281 |
-
font-size: 16px;
|
282 |
-
}
|
283 |
-
.tab1 .tab_2_sav {
|
284 |
-
padding-top: 30px;
|
285 |
-
}
|
286 |
-
/*Tab2*/
|
287 |
-
.tab2 {
|
288 |
-
overflow: hidden;
|
289 |
-
}
|
290 |
-
.tab2 .rss_url_row {
|
291 |
-
width: 100%;
|
292 |
-
float: left;
|
293 |
-
margin: 0 0 10px;
|
294 |
-
}
|
295 |
-
.tab2 .rss_url_row h4 {
|
296 |
-
float: left;
|
297 |
-
line-height: 43px;
|
298 |
-
}
|
299 |
-
.tab2 .inr_cont input.add,
|
300 |
-
.tab2 .inr_cont textarea.add_txt,
|
301 |
-
.tab2 .rss_url_row input.add {
|
302 |
-
width: 363px;
|
303 |
-
float: left;
|
304 |
-
background: #e5e5e5;
|
305 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
306 |
-
border: 0;
|
307 |
-
padding: 12px 10px 11px;
|
308 |
-
margin-left: 10px;
|
309 |
-
}
|
310 |
-
.tab2 .rss_url_row a.rit_link {
|
311 |
-
float: left;
|
312 |
-
margin: 10px 0 0 16px;
|
313 |
-
font-size: 17px;
|
314 |
-
}
|
315 |
-
.tab2 .row {
|
316 |
-
float: left;
|
317 |
-
border-top: 2px solid #f2f3f4;
|
318 |
-
clear: both;
|
319 |
-
padding: 0 0 15px;
|
320 |
-
width: 100%
|
321 |
-
}
|
322 |
-
.tab2 .row .tab_2_email_sec {
|
323 |
-
list-style: none;
|
324 |
-
margin: 17px 0 0;
|
325 |
-
overflow: hidden;
|
326 |
-
}
|
327 |
-
.row ul.tab_2_email_sec li {
|
328 |
-
float: left;
|
329 |
-
margin-right: 10px;
|
330 |
-
width: 32%;
|
331 |
-
}
|
332 |
-
.row ul.tab_2_email_sec li label span {
|
333 |
-
font-size: 15px;
|
334 |
-
color: #808080;
|
335 |
-
width: 100%;
|
336 |
-
float: left;
|
337 |
-
}
|
338 |
-
.row ul.tab_2_email_sec:first-child {
|
339 |
-
margin-right: 2%
|
340 |
-
}
|
341 |
-
.tab2 .row h2.sfsicls_email,
|
342 |
-
.tab2 .row h2.sfsicls_facebook,
|
343 |
-
.tab2 .row h2.sfsicls_telegram,
|
344 |
-
.tab2 .row h2.sfsicls_vk,
|
345 |
-
.tab2 .row h2.sfsicls_ok,
|
346 |
-
.tab2 .row h2.sfsicls_wechat,
|
347 |
-
.tab2 .row h2.sfsicls_weibo,
|
348 |
-
.tab2 .row h2.sfsicls_instagram,
|
349 |
-
.tab2 .row h2.sfsicls_linkdin,
|
350 |
-
.tab2 .row h2.sfsicls_pinterest,
|
351 |
-
.tab2 .row h2.sfsicls_rs_s,
|
352 |
-
.tab2 .row h2.sfsicls_share,
|
353 |
-
.tab2 .row h2.sfsicls_twt,
|
354 |
-
.tab2 .row h2.sfsicls_utube {
|
355 |
-
background: url(../images/tab_1_icn_list.png) no-repeat;
|
356 |
-
padding: 0 0 0 70px;
|
357 |
-
margin: 15px 0 7px 21px;
|
358 |
-
height: 52px;
|
359 |
-
line-height: 51px;
|
360 |
-
font-family: helveticaregular;
|
361 |
-
font-size: 22px;
|
362 |
-
}
|
363 |
-
.tab2 .row h2.sfsicls_rs_s {
|
364 |
-
background-position: 0 0;
|
365 |
-
color: #f7941d;
|
366 |
-
}
|
367 |
-
.tab2 .row h2.sfsicls_telegram {
|
368 |
-
background: url(../images/icons_theme/default/default_telegram.png) no-repeat;
|
369 |
-
background-size: contain;
|
370 |
-
}
|
371 |
-
.tab2 .row h2.sfsicls_vk {
|
372 |
-
background: url(../images/icons_theme/default/default_vk.png) no-repeat;
|
373 |
-
background-size: contain;
|
374 |
-
}
|
375 |
-
.tab2 .row h2.sfsicls_ok {
|
376 |
-
background: url(../images/icons_theme/default/default_ok.png) no-repeat;
|
377 |
-
background-size: contain;
|
378 |
-
}
|
379 |
-
.tab2 .row h2.sfsicls_wechat {
|
380 |
-
background: url(../images/icons_theme/default/default_wechat.png) no-repeat;
|
381 |
-
background-size: contain;
|
382 |
-
}
|
383 |
-
.tab2 .row h2.sfsicls_weibo {
|
384 |
-
background: url(../images/icons_theme/default/default_weibo.png) no-repeat;
|
385 |
-
background-size: contain;
|
386 |
-
}
|
387 |
-
.tab2 .row h2.sfsicls_email {
|
388 |
-
background-position: 0 -71px;
|
389 |
-
color: #d1c800;
|
390 |
-
}
|
391 |
-
.tab2 .row h2.sfsicls_facebook {
|
392 |
-
background-position: 0 -145px;
|
393 |
-
color: #004088;
|
394 |
-
}
|
395 |
-
.tab2 .row h2.sfsicls_twt {
|
396 |
-
background-position: 0 -221px;
|
397 |
-
color: #00abe3;
|
398 |
-
}
|
399 |
-
|
400 |
-
.tab2 .row h2.sfsicls_share {
|
401 |
-
background-position: 0 -372px;
|
402 |
-
color: #ef4746;
|
403 |
-
}
|
404 |
-
.tab2 .row h2.sfsicls_utube {
|
405 |
-
background-position: 0 -448px;
|
406 |
-
color: #f07963;
|
407 |
-
}
|
408 |
-
.tab2 .row h2.sfsicls_linkdin {
|
409 |
-
background-position: 0 -548px;
|
410 |
-
color: #1e88c9;
|
411 |
-
width: 100%;
|
412 |
-
}
|
413 |
-
.tab2 .row h2.sfsicls_pinterest {
|
414 |
-
background-position: 0 -623px;
|
415 |
-
color: #f15f5d;
|
416 |
-
}
|
417 |
-
.tab2 .row h2.sfsicls_instagram {
|
418 |
-
background-position: 0 -781px;
|
419 |
-
color: #369;
|
420 |
-
}
|
421 |
-
.tab2 .inr_cont {
|
422 |
-
margin: 0 0 12px 94px;
|
423 |
-
}
|
424 |
-
ul.tab_2_email_sec .sf_arow {
|
425 |
-
width: 52px;
|
426 |
-
height: 52px;
|
427 |
-
float: left;
|
428 |
-
background: url(../images/sf_arow_icn.png) no-repeat;
|
429 |
-
margin: 0 8px 0 6px;
|
430 |
-
}
|
431 |
-
ul.tab_2_email_sec .email_icn {
|
432 |
-
background: url(../images/tab_1_icn_list.png) 0 -71px no-repeat;
|
433 |
-
width: 52px;
|
434 |
-
height: 52px;
|
435 |
-
float: left;
|
436 |
-
margin: 0 8px;
|
437 |
-
}
|
438 |
-
ul.tab_2_email_sec .subscribe_icn {
|
439 |
-
background: url(../images/tab_1_icn_list.png) 0 -860px no-repeat;
|
440 |
-
width: 52px;
|
441 |
-
height: 52px;
|
442 |
-
float: left;
|
443 |
-
margin: 0 0 0 5px;
|
444 |
-
}
|
445 |
-
ul.tab_2_email_sec li .radio {
|
446 |
-
float: left;
|
447 |
-
margin: 8px 0 0;
|
448 |
-
}
|
449 |
-
.row ul.tab_2_email_sec li label {
|
450 |
-
margin: 13px 0 0 7px;
|
451 |
-
font-size: 16px;
|
452 |
-
float: left;
|
453 |
-
width: 160px;
|
454 |
-
}
|
455 |
-
/*Tab 3*/
|
456 |
-
.icns_tab_3 .row_10_1,
|
457 |
-
.icns_tab_3 .row_10_10,
|
458 |
-
.icns_tab_3 .row_10_11,
|
459 |
-
.icns_tab_3 .row_10_2,
|
460 |
-
.icns_tab_3 .row_10_3,
|
461 |
-
.icns_tab_3 .row_10_4,
|
462 |
-
.icns_tab_3 .row_10_5,
|
463 |
-
.icns_tab_3 .row_10_6,
|
464 |
-
.icns_tab_3 .row_10_7,
|
465 |
-
.icns_tab_3 .row_10_8,
|
466 |
-
.icns_tab_3 .row_10_9,
|
467 |
-
.icns_tab_3 .row_11_1,
|
468 |
-
.icns_tab_3 .row_11_10,
|
469 |
-
.icns_tab_3 .row_11_11,
|
470 |
-
.icns_tab_3 .row_11_2,
|
471 |
-
.icns_tab_3 .row_11_3,
|
472 |
-
.icns_tab_3 .row_11_4,
|
473 |
-
.icns_tab_3 .row_11_5,
|
474 |
-
.icns_tab_3 .row_11_6,
|
475 |
-
.icns_tab_3 .row_11_7,
|
476 |
-
.icns_tab_3 .row_11_8,
|
477 |
-
.icns_tab_3 .row_11_9,
|
478 |
-
.icns_tab_3 .row_12_1,
|
479 |
-
.icns_tab_3 .row_12_10,
|
480 |
-
.icns_tab_3 .row_12_11,
|
481 |
-
.icns_tab_3 .row_12_2,
|
482 |
-
.icns_tab_3 .row_12_3,
|
483 |
-
.icns_tab_3 .row_12_4,
|
484 |
-
.icns_tab_3 .row_12_5,
|
485 |
-
.icns_tab_3 .row_12_6,
|
486 |
-
.icns_tab_3 .row_12_7,
|
487 |
-
.icns_tab_3 .row_12_8,
|
488 |
-
.icns_tab_3 .row_12_9,
|
489 |
-
.icns_tab_3 .row_13_1,
|
490 |
-
.icns_tab_3 .row_13_10,
|
491 |
-
.icns_tab_3 .row_13_11,
|
492 |
-
.icns_tab_3 .row_13_2,
|
493 |
-
.icns_tab_3 .row_13_3,
|
494 |
-
.icns_tab_3 .row_13_4,
|
495 |
-
.icns_tab_3 .row_13_5,
|
496 |
-
.icns_tab_3 .row_13_6,
|
497 |
-
.icns_tab_3 .row_13_7,
|
498 |
-
.icns_tab_3 .row_13_8,
|
499 |
-
.icns_tab_3 .row_13_9,
|
500 |
-
.icns_tab_3 .row_14_1,
|
501 |
-
.icns_tab_3 .row_14_10,
|
502 |
-
.icns_tab_3 .row_14_11,
|
503 |
-
.icns_tab_3 .row_14_2,
|
504 |
-
.icns_tab_3 .row_14_3,
|
505 |
-
.icns_tab_3 .row_14_4,
|
506 |
-
.icns_tab_3 .row_14_5,
|
507 |
-
.icns_tab_3 .row_14_6,
|
508 |
-
.icns_tab_3 .row_14_7,
|
509 |
-
.icns_tab_3 .row_14_8,
|
510 |
-
.icns_tab_3 .row_14_9,
|
511 |
-
.icns_tab_3 .row_15_1,
|
512 |
-
.icns_tab_3 .row_15_10,
|
513 |
-
.icns_tab_3 .row_15_11,
|
514 |
-
.icns_tab_3 .row_15_2,
|
515 |
-
.icns_tab_3 .row_15_3,
|
516 |
-
.icns_tab_3 .row_15_4,
|
517 |
-
.icns_tab_3 .row_15_5,
|
518 |
-
.icns_tab_3 .row_15_6,
|
519 |
-
.icns_tab_3 .row_15_7,
|
520 |
-
.icns_tab_3 .row_15_8,
|
521 |
-
.icns_tab_3 .row_15_9,
|
522 |
-
.icns_tab_3 .row_16_1,
|
523 |
-
.icns_tab_3 .row_16_10,
|
524 |
-
.icns_tab_3 .row_16_11,
|
525 |
-
.icns_tab_3 .row_16_2,
|
526 |
-
.icns_tab_3 .row_16_3,
|
527 |
-
.icns_tab_3 .row_16_4,
|
528 |
-
.icns_tab_3 .row_16_5,
|
529 |
-
.icns_tab_3 .row_16_6,
|
530 |
-
.icns_tab_3 .row_16_7,
|
531 |
-
.icns_tab_3 .row_16_8,
|
532 |
-
.icns_tab_3 .row_16_9,
|
533 |
-
.icns_tab_3 .row_1_1,
|
534 |
-
.icns_tab_3 .row_1_10,
|
535 |
-
.icns_tab_3 .row_1_11,
|
536 |
-
.icns_tab_3 .row_1_14,
|
537 |
-
.icns_tab_3 .row_1_2,
|
538 |
-
.icns_tab_3 .row_1_3,
|
539 |
-
.icns_tab_3 .row_1_4,
|
540 |
-
.icns_tab_3 .row_1_5,
|
541 |
-
.icns_tab_3 .row_1_6,
|
542 |
-
.icns_tab_3 .row_1_7,
|
543 |
-
.icns_tab_3 .row_1_8,
|
544 |
-
.icns_tab_3 .row_1_9,
|
545 |
-
.icns_tab_3 .row_2_1,
|
546 |
-
.icns_tab_3 .row_2_10,
|
547 |
-
.icns_tab_3 .row_2_11,
|
548 |
-
.icns_tab_3 .row_2_14,
|
549 |
-
.icns_tab_3 .row_2_2,
|
550 |
-
.icns_tab_3 .row_2_3,
|
551 |
-
.icns_tab_3 .row_2_4,
|
552 |
-
.icns_tab_3 .row_2_5,
|
553 |
-
.icns_tab_3 .row_2_6,
|
554 |
-
.icns_tab_3 .row_2_7,
|
555 |
-
.icns_tab_3 .row_2_8,
|
556 |
-
.icns_tab_3 .row_2_9,
|
557 |
-
.icns_tab_3 .row_3_1,
|
558 |
-
.icns_tab_3 .row_3_10,
|
559 |
-
.icns_tab_3 .row_3_11,
|
560 |
-
.icns_tab_3 .row_3_14,
|
561 |
-
.icns_tab_3 .row_3_2,
|
562 |
-
.icns_tab_3 .row_3_3,
|
563 |
-
.icns_tab_3 .row_3_4,
|
564 |
-
.icns_tab_3 .row_3_5,
|
565 |
-
.icns_tab_3 .row_3_6,
|
566 |
-
.icns_tab_3 .row_3_7,
|
567 |
-
.icns_tab_3 .row_3_8,
|
568 |
-
.icns_tab_3 .row_3_9,
|
569 |
-
.icns_tab_3 .row_4_1,
|
570 |
-
.icns_tab_3 .row_4_10,
|
571 |
-
.icns_tab_3 .row_4_11,
|
572 |
-
.icns_tab_3 .row_4_14,
|
573 |
-
.icns_tab_3 .row_4_2,
|
574 |
-
.icns_tab_3 .row_4_3,
|
575 |
-
.icns_tab_3 .row_4_4,
|
576 |
-
.icns_tab_3 .row_4_5,
|
577 |
-
.icns_tab_3 .row_4_6,
|
578 |
-
.icns_tab_3 .row_4_7,
|
579 |
-
.icns_tab_3 .row_4_8,
|
580 |
-
.icns_tab_3 .row_4_9,
|
581 |
-
.icns_tab_3 .row_5_1,
|
582 |
-
.icns_tab_3 .row_5_10,
|
583 |
-
.icns_tab_3 .row_5_11,
|
584 |
-
.icns_tab_3 .row_5_14,
|
585 |
-
.icns_tab_3 .row_5_2,
|
586 |
-
.icns_tab_3 .row_5_3,
|
587 |
-
.icns_tab_3 .row_5_4,
|
588 |
-
.icns_tab_3 .row_5_5,
|
589 |
-
.icns_tab_3 .row_5_6,
|
590 |
-
.icns_tab_3 .row_5_7,
|
591 |
-
.icns_tab_3 .row_5_8,
|
592 |
-
.icns_tab_3 .row_5_9,
|
593 |
-
.icns_tab_3 .row_6_1,
|
594 |
-
.icns_tab_3 .row_6_10,
|
595 |
-
.icns_tab_3 .row_6_11,
|
596 |
-
.icns_tab_3 .row_6_14,
|
597 |
-
.icns_tab_3 .row_6_2,
|
598 |
-
.icns_tab_3 .row_6_3,
|
599 |
-
.icns_tab_3 .row_6_4,
|
600 |
-
.icns_tab_3 .row_6_5,
|
601 |
-
.icns_tab_3 .row_6_6,
|
602 |
-
.icns_tab_3 .row_6_7,
|
603 |
-
.icns_tab_3 .row_6_8,
|
604 |
-
.icns_tab_3 .row_6_9,
|
605 |
-
.icns_tab_3 .row_7_1,
|
606 |
-
.icns_tab_3 .row_7_10,
|
607 |
-
.icns_tab_3 .row_7_11,
|
608 |
-
.icns_tab_3 .row_7_2,
|
609 |
-
.icns_tab_3 .row_7_3,
|
610 |
-
.icns_tab_3 .row_7_4,
|
611 |
-
.icns_tab_3 .row_7_5,
|
612 |
-
.icns_tab_3 .row_7_6,
|
613 |
-
.icns_tab_3 .row_7_7,
|
614 |
-
.icns_tab_3 .row_7_8,
|
615 |
-
.icns_tab_3 .row_7_9,
|
616 |
-
.icns_tab_3 .row_8_1,
|
617 |
-
.icns_tab_3 .row_8_10,
|
618 |
-
.icns_tab_3 .row_8_11,
|
619 |
-
.icns_tab_3 .row_8_2,
|
620 |
-
.icns_tab_3 .row_8_3,
|
621 |
-
.icns_tab_3 .row_8_4,
|
622 |
-
.icns_tab_3 .row_8_5,
|
623 |
-
.icns_tab_3 .row_8_6,
|
624 |
-
.icns_tab_3 .row_8_7,
|
625 |
-
.icns_tab_3 .row_8_8,
|
626 |
-
.icns_tab_3 .row_8_9,
|
627 |
-
.icns_tab_3 .row_9_1,
|
628 |
-
.icns_tab_3 .row_9_10,
|
629 |
-
.icns_tab_3 .row_9_11,
|
630 |
-
.icns_tab_3 .row_9_2,
|
631 |
-
.icns_tab_3 .row_9_3,
|
632 |
-
.icns_tab_3 .row_9_4,
|
633 |
-
.icns_tab_3 .row_9_5,
|
634 |
-
.icns_tab_3 .row_9_6,
|
635 |
-
.icns_tab_3 .row_9_7,
|
636 |
-
.icns_tab_3 .row_9_8,
|
637 |
-
.icns_tab_3 .row_9_9,
|
638 |
-
.icns_tab_3 .row_17_1,
|
639 |
-
.icns_tab_3 .row_17_2,
|
640 |
-
.icns_tab_3 .row_17_3,
|
641 |
-
.icns_tab_3 .row_17_4,
|
642 |
-
.icns_tab_3 .row_17_5,
|
643 |
-
.icns_tab_3 .row_17_6,
|
644 |
-
.icns_tab_3 .row_17_7,
|
645 |
-
.icns_tab_3 .row_17_8,
|
646 |
-
.icns_tab_3 .row_17_9,
|
647 |
-
.icns_tab_3 .row_17_10,
|
648 |
-
.icns_tab_3 .row_17_14,
|
649 |
-
.icns_tab_3 .row_17_15,
|
650 |
-
.icns_tab_3 .row_17_16,
|
651 |
-
.icns_tab_3 .row_17_17,
|
652 |
-
.icns_tab_3 .row_17_18,
|
653 |
-
.icns_tab_3 .row_17_11,
|
654 |
-
.icns_tab_3 .row_7_14,
|
655 |
-
.icns_tab_3 .row_8_14,
|
656 |
-
.icns_tab_3 .row_9_14,
|
657 |
-
.icns_tab_3 .row_10_14,
|
658 |
-
.icns_tab_3 .row_11_14,
|
659 |
-
.icns_tab_3 .row_12_14,
|
660 |
-
.icns_tab_3 .row_13_14,
|
661 |
-
.icns_tab_3 .row_14_14,
|
662 |
-
.icns_tab_3 .row_15_22,
|
663 |
-
.icns_tab_3 .row_16_22,
|
664 |
-
.icns_tab_3 .row_17_22,
|
665 |
-
.icns_tab_3 .row_17_15,
|
666 |
-
.icns_tab_3 .row_17_16,
|
667 |
-
.icns_tab_3 .row_17_17,
|
668 |
-
.icns_tab_3 .row_1_15,
|
669 |
-
.icns_tab_3 .row_2_15,
|
670 |
-
.icns_tab_3 .row_3_15,
|
671 |
-
.icns_tab_3 .row_4_15,
|
672 |
-
.icns_tab_3 .row_5_15,
|
673 |
-
.icns_tab_3 .row_6_15,
|
674 |
-
.icns_tab_3 .row_7_15,
|
675 |
-
.icns_tab_3 .row_8_15,
|
676 |
-
.icns_tab_3 .row_9_15,
|
677 |
-
.icns_tab_3 .row_10_15,
|
678 |
-
.icns_tab_3 .row_11_15,
|
679 |
-
.icns_tab_3 .row_12_15,
|
680 |
-
.icns_tab_3 .row_13_15,
|
681 |
-
.icns_tab_3 .row_14_15,
|
682 |
-
.icns_tab_3 .row_15_15,
|
683 |
-
.icns_tab_3 .row_16_15,
|
684 |
-
|
685 |
-
.icns_tab_3 .row_1_16,
|
686 |
-
.icns_tab_3 .row_2_16,
|
687 |
-
.icns_tab_3 .row_3_16,
|
688 |
-
.icns_tab_3 .row_4_16,
|
689 |
-
.icns_tab_3 .row_5_16,
|
690 |
-
.icns_tab_3 .row_6_16,
|
691 |
-
.icns_tab_3 .row_7_16,
|
692 |
-
.icns_tab_3 .row_8_16,
|
693 |
-
.icns_tab_3 .row_9_16,
|
694 |
-
.icns_tab_3 .row_10_16,
|
695 |
-
.icns_tab_3 .row_11_16,
|
696 |
-
.icns_tab_3 .row_12_16,
|
697 |
-
.icns_tab_3 .row_13_16,
|
698 |
-
.icns_tab_3 .row_14_16,
|
699 |
-
.icns_tab_3 .row_15_16,
|
700 |
-
.icns_tab_3 .row_16_16,
|
701 |
-
|
702 |
-
.icns_tab_3 .row_1_17,
|
703 |
-
.icns_tab_3 .row_2_17,
|
704 |
-
.icns_tab_3 .row_3_17,
|
705 |
-
.icns_tab_3 .row_4_17,
|
706 |
-
.icns_tab_3 .row_5_17,
|
707 |
-
.icns_tab_3 .row_6_17,
|
708 |
-
.icns_tab_3 .row_7_17,
|
709 |
-
.icns_tab_3 .row_8_17,
|
710 |
-
.icns_tab_3 .row_9_17,
|
711 |
-
.icns_tab_3 .row_10_17,
|
712 |
-
.icns_tab_3 .row_11_17,
|
713 |
-
.icns_tab_3 .row_12_17,
|
714 |
-
.icns_tab_3 .row_13_17,
|
715 |
-
.icns_tab_3 .row_14_17,
|
716 |
-
.icns_tab_3 .row_15_17,
|
717 |
-
.icns_tab_3 .row_16_17,
|
718 |
-
|
719 |
-
.icns_tab_3 .row_1_18,
|
720 |
-
.icns_tab_3 .row_2_18,
|
721 |
-
.icns_tab_3 .row_3_18,
|
722 |
-
.icns_tab_3 .row_4_18,
|
723 |
-
.icns_tab_3 .row_5_18,
|
724 |
-
.icns_tab_3 .row_6_18,
|
725 |
-
.icns_tab_3 .row_7_18,
|
726 |
-
.icns_tab_3 .row_8_18,
|
727 |
-
.icns_tab_3 .row_9_18,
|
728 |
-
.icns_tab_3 .row_10_18,
|
729 |
-
.icns_tab_3 .row_11_18,
|
730 |
-
.icns_tab_3 .row_12_18,
|
731 |
-
.icns_tab_3 .row_13_18,
|
732 |
-
.icns_tab_3 .row_14_18,
|
733 |
-
.icns_tab_3 .row_15_18,
|
734 |
-
.icns_tab_3 .row_16_18,
|
735 |
-
.icns_tab_3 .row_17_18,
|
736 |
-
.icns_tab_3 .row_15_14,
|
737 |
-
.icns_tab_3 .row_16_14 {
|
738 |
-
background: url(../images/tab_3_icns.png) no-repeat;
|
739 |
-
width: 53px;
|
740 |
-
height: 52px;
|
741 |
-
float: left;
|
742 |
-
margin: 0 4px 0 0;
|
743 |
-
}
|
744 |
-
.icns_tab_3 .row_1_1 {
|
745 |
-
background-position: -1px 0;
|
746 |
-
}
|
747 |
-
.icns_tab_3 .row_1_2 {
|
748 |
-
background-position: -60px 0;
|
749 |
-
}
|
750 |
-
.icns_tab_3 .row_1_3 {
|
751 |
-
background-position: -118px 0;
|
752 |
-
}
|
753 |
-
.icns_tab_3 .row_1_4 {
|
754 |
-
background-position: -176px 0;
|
755 |
-
}
|
756 |
-
.icns_tab_3 .row_1_5 {
|
757 |
-
background-position: -235px 0;
|
758 |
-
}
|
759 |
-
.icns_tab_3 .row_1_6 {
|
760 |
-
background-position: -293px 0;
|
761 |
-
}
|
762 |
-
.icns_tab_3 .row_1_7 {
|
763 |
-
background-position: -350px 0;
|
764 |
-
}
|
765 |
-
.icns_tab_3 .row_1_8 {
|
766 |
-
background-position: -409px 0;
|
767 |
-
}
|
768 |
-
.icns_tab_3 .row_1_9 {
|
769 |
-
background-position: -467px 0;
|
770 |
-
}
|
771 |
-
.icns_tab_3 .row_1_10 {
|
772 |
-
background-position: -526px 0;
|
773 |
-
}
|
774 |
-
.icns_tab_3 .row_1_11 {
|
775 |
-
background-position: -711px 0;
|
776 |
-
}
|
777 |
-
|
778 |
-
.icns_tab_3 .row_1_14 {
|
779 |
-
background-position: -773px 0;
|
780 |
-
}
|
781 |
-
.icns_tab_3 .row_1_15 {
|
782 |
-
background-position: -838px 0;
|
783 |
-
}
|
784 |
-
.icns_tab_3 .row_1_16 {
|
785 |
-
background-position: -909px 0;
|
786 |
-
}
|
787 |
-
.icns_tab_3 .row_1_17 {
|
788 |
-
background-position: -977px 0;
|
789 |
-
}
|
790 |
-
.icns_tab_3 .row_1_18 {
|
791 |
-
background: url(../images/icons_theme/default/default_wechat.png) no-repeat;
|
792 |
-
background-size: contain;
|
793 |
-
}.icns_tab_3 .row_2_1 {
|
794 |
-
background-position: 0 -74px;
|
795 |
-
}
|
796 |
-
.icns_tab_3 .row_2_2 {
|
797 |
-
background-position: -60px -74px;
|
798 |
-
}
|
799 |
-
.icns_tab_3 .row_2_3 {
|
800 |
-
background-position: -118px -74px;
|
801 |
-
}
|
802 |
-
.icns_tab_3 .row_2_4 {
|
803 |
-
background-position: -176px -74px;
|
804 |
-
}
|
805 |
-
.icns_tab_3 .row_2_5 {
|
806 |
-
background-position: -235px -74px;
|
807 |
-
}
|
808 |
-
.icns_tab_3 .row_2_6 {
|
809 |
-
background-position: -293px -74px;
|
810 |
-
}
|
811 |
-
.icns_tab_3 .row_2_7 {
|
812 |
-
background-position: -350px -74px;
|
813 |
-
}
|
814 |
-
.icns_tab_3 .row_2_8 {
|
815 |
-
background-position: -409px -74px;
|
816 |
-
}
|
817 |
-
.icns_tab_3 .row_2_9 {
|
818 |
-
background-position: -467px -74px;
|
819 |
-
}
|
820 |
-
.icns_tab_3 .row_2_10 {
|
821 |
-
background-position: -526px -74px;
|
822 |
-
}
|
823 |
-
.icns_tab_3 .row_2_11 {
|
824 |
-
background-position: -711px -74px;
|
825 |
-
}
|
826 |
-
.icns_tab_3 .row_2_14 {
|
827 |
-
background-position: -773px -74px;
|
828 |
-
}
|
829 |
-
.icns_tab_3 .row_2_15 {
|
830 |
-
background-position: -838px -74px;
|
831 |
-
}
|
832 |
-
.icns_tab_3 .row_2_16 {
|
833 |
-
background-position: -909px -74px;
|
834 |
-
}
|
835 |
-
.icns_tab_3 .row_2_17 {
|
836 |
-
background-position: -977px -74px;
|
837 |
-
}
|
838 |
-
.icns_tab_3 .row_2_18 {
|
839 |
-
background: url(../images/icons_theme/flat/flat_wechat.png) no-repeat;
|
840 |
-
background-size: contain;
|
841 |
-
}
|
842 |
-
.icns_tab_3 .row_3_1 {
|
843 |
-
background-position: 0 -146px;
|
844 |
-
}
|
845 |
-
.icns_tab_3 .row_3_2 {
|
846 |
-
background-position: -60px -146px;
|
847 |
-
}
|
848 |
-
.icns_tab_3 .row_3_3 {
|
849 |
-
background-position: -118px -146px;
|
850 |
-
}
|
851 |
-
.icns_tab_3 .row_3_4 {
|
852 |
-
background-position: -176px -146px;
|
853 |
-
}
|
854 |
-
.icns_tab_3 .row_3_5 {
|
855 |
-
background-position: -235px -146px;
|
856 |
-
}
|
857 |
-
.icns_tab_3 .row_3_6 {
|
858 |
-
background-position: -293px -146px;
|
859 |
-
}
|
860 |
-
.icns_tab_3 .row_3_7 {
|
861 |
-
background-position: -350px -146px;
|
862 |
-
}
|
863 |
-
.icns_tab_3 .row_3_8 {
|
864 |
-
background-position: -409px -146px;
|
865 |
-
}
|
866 |
-
.icns_tab_3 .row_3_9 {
|
867 |
-
background-position: -467px -146px;
|
868 |
-
}
|
869 |
-
.icns_tab_3 .row_3_10 {
|
870 |
-
background-position: -526px -146px;
|
871 |
-
}
|
872 |
-
.icns_tab_3 .row_3_11 {
|
873 |
-
background-position: -711px -147px;
|
874 |
-
}
|
875 |
-
.icns_tab_3 .row_3_14 {
|
876 |
-
background-position: -773px -147px;
|
877 |
-
}
|
878 |
-
.icns_tab_3 .row_3_15 {
|
879 |
-
background-position: -838px -147px;
|
880 |
-
}
|
881 |
-
.icns_tab_3 .row_3_16 {
|
882 |
-
background-position: -909px -147px;
|
883 |
-
}
|
884 |
-
.icns_tab_3 .row_3_17 {
|
885 |
-
background-position: -977px -147px;
|
886 |
-
}
|
887 |
-
.icns_tab_3 .row_3_18 {
|
888 |
-
background: url(../images/icons_theme/thin/thin_wechat.png) no-repeat;
|
889 |
-
background-size: contain;
|
890 |
-
}
|
891 |
-
.icns_tab_3 .row_4_1 {
|
892 |
-
background-position: 0 -222px;
|
893 |
-
}
|
894 |
-
.icns_tab_3 .row_4_2 {
|
895 |
-
background-position: -60px -222px;
|
896 |
-
}
|
897 |
-
.icns_tab_3 .row_4_3 {
|
898 |
-
background-position: -118px -222px;
|
899 |
-
}
|
900 |
-
.icns_tab_3 .row_4_4 {
|
901 |
-
background-position: -176px -222px;
|
902 |
-
}
|
903 |
-
.icns_tab_3 .row_4_5 {
|
904 |
-
background-position: -235px -222px;
|
905 |
-
}
|
906 |
-
.icns_tab_3 .row_4_6 {
|
907 |
-
background-position: -293px -222px;
|
908 |
-
}
|
909 |
-
.icns_tab_3 .row_4_7 {
|
910 |
-
background-position: -350px -222px;
|
911 |
-
}
|
912 |
-
.icns_tab_3 .row_4_8 {
|
913 |
-
background-position: -409px -222px;
|
914 |
-
}
|
915 |
-
.icns_tab_3 .row_4_9 {
|
916 |
-
background-position: -467px -222px;
|
917 |
-
}
|
918 |
-
.icns_tab_3 .row_4_10 {
|
919 |
-
background-position: -526px -222px;
|
920 |
-
}
|
921 |
-
.icns_tab_3 .row_4_11 {
|
922 |
-
background-position: -711px -222px;
|
923 |
-
}
|
924 |
-
.icns_tab_3 .row_4_14 {
|
925 |
-
background-position: -773px -222px;
|
926 |
-
}
|
927 |
-
.icns_tab_3 .row_4_15 {
|
928 |
-
background-position: -838px -222px;
|
929 |
-
}
|
930 |
-
.icns_tab_3 .row_4_16 {
|
931 |
-
background-position: -909px -222px;
|
932 |
-
}
|
933 |
-
.icns_tab_3 .row_4_17 {
|
934 |
-
background-position: -977px -222px;
|
935 |
-
}
|
936 |
-
.icns_tab_3 .row_4_18 {
|
937 |
-
background: url(../images/icons_theme/cute/cute_wechat.png) no-repeat;
|
938 |
-
background-size: contain;
|
939 |
-
}
|
940 |
-
.icns_tab_3 .row_5_1 {
|
941 |
-
background-position: 0 -296px;
|
942 |
-
}
|
943 |
-
.icns_tab_3 .row_5_2 {
|
944 |
-
background-position: -60px -296px;
|
945 |
-
}
|
946 |
-
.icns_tab_3 .row_5_3 {
|
947 |
-
background-position: -118px -296px;
|
948 |
-
}
|
949 |
-
.icns_tab_3 .row_5_4 {
|
950 |
-
background-position: -176px -296px;
|
951 |
-
}
|
952 |
-
.icns_tab_3 .row_5_5 {
|
953 |
-
background-position: -235px -296px;
|
954 |
-
}
|
955 |
-
.icns_tab_3 .row_5_6 {
|
956 |
-
background-position: -293px -296px;
|
957 |
-
}
|
958 |
-
.icns_tab_3 .row_5_7 {
|
959 |
-
background-position: -350px -296px;
|
960 |
-
}
|
961 |
-
.icns_tab_3 .row_5_8 {
|
962 |
-
background-position: -409px -296px;
|
963 |
-
}
|
964 |
-
.icns_tab_3 .row_5_9 {
|
965 |
-
background-position: -467px -296px;
|
966 |
-
}
|
967 |
-
.icns_tab_3 .row_5_10 {
|
968 |
-
background-position: -526px -296px;
|
969 |
-
}
|
970 |
-
.icns_tab_3 .row_5_11 {
|
971 |
-
background-position: -711px -296px;
|
972 |
-
}
|
973 |
-
.icns_tab_3 .row_5_14 {
|
974 |
-
background-position: -773px -296px;
|
975 |
-
}
|
976 |
-
.icns_tab_3 .row_5_15 {
|
977 |
-
background-position: -838px -296px;
|
978 |
-
}
|
979 |
-
.icns_tab_3 .row_5_16 {
|
980 |
-
background-position: -909px -296px;
|
981 |
-
}
|
982 |
-
.icns_tab_3 .row_5_17 {
|
983 |
-
background-position: -977px -296px;
|
984 |
-
}
|
985 |
-
.icns_tab_3 .row_5_18 {
|
986 |
-
background: url(../images/icons_theme/cubes/cubes_wechat.png);
|
987 |
-
background-size: contain;
|
988 |
-
}
|
989 |
-
.icns_tab_3 .row_6_1 {
|
990 |
-
background-position: 0 -370px;
|
991 |
-
}
|
992 |
-
.icns_tab_3 .row_6_2 {
|
993 |
-
background-position: -60px -370px;
|
994 |
-
}
|
995 |
-
.icns_tab_3 .row_6_3 {
|
996 |
-
background-position: -118px -370px;
|
997 |
-
}
|
998 |
-
.icns_tab_3 .row_6_4 {
|
999 |
-
background-position: -176px -370px;
|
1000 |
-
}
|
1001 |
-
.icns_tab_3 .row_6_5 {
|
1002 |
-
background-position: -235px -370px;
|
1003 |
-
}
|
1004 |
-
.icns_tab_3 .row_6_6 {
|
1005 |
-
background-position: -293px -370px;
|
1006 |
-
}
|
1007 |
-
.icns_tab_3 .row_6_7 {
|
1008 |
-
background-position: -350px -370px;
|
1009 |
-
}
|
1010 |
-
.icns_tab_3 .row_6_8 {
|
1011 |
-
background-position: -409px -370px;
|
1012 |
-
}
|
1013 |
-
.icns_tab_3 .row_6_9 {
|
1014 |
-
background-position: -468px -370px;
|
1015 |
-
}
|
1016 |
-
.icns_tab_3 .row_6_10 {
|
1017 |
-
background-position: -526px -370px;
|
1018 |
-
}
|
1019 |
-
.icns_tab_3 .row_6_11 {
|
1020 |
-
background-position: -711px -370px;
|
1021 |
-
}
|
1022 |
-
.icns_tab_3 .row_6_14 {
|
1023 |
-
background-position: -773px -370px;
|
1024 |
-
}
|
1025 |
-
.icns_tab_3 .row_6_15 {
|
1026 |
-
background-position: -838px -370px;
|
1027 |
-
}
|
1028 |
-
.icns_tab_3 .row_6_16 {
|
1029 |
-
background-position: -909px -370px;
|
1030 |
-
}
|
1031 |
-
.icns_tab_3 .row_6_17 {
|
1032 |
-
background-position: -977px -370px;
|
1033 |
-
}
|
1034 |
-
.icns_tab_3 .row_6_18 {
|
1035 |
-
background: url(../images/icons_theme/chrome_blue/chrome_blue_wechat.png);
|
1036 |
-
background-size: contain;
|
1037 |
-
}
|
1038 |
-
.icns_tab_3 .row_7_1 {
|
1039 |
-
background-position: 0 -444px;
|
1040 |
-
}
|
1041 |
-
.icns_tab_3 .row_7_2 {
|
1042 |
-
background-position: -60px -444px;
|
1043 |
-
}
|
1044 |
-
.icns_tab_3 .row_7_3 {
|
1045 |
-
background-position: -118px -444px;
|
1046 |
-
}
|
1047 |
-
.icns_tab_3 .row_7_4 {
|
1048 |
-
background-position: -176px -444px;
|
1049 |
-
}
|
1050 |
-
.icns_tab_3 .row_7_5 {
|
1051 |
-
background-position: -235px -444px;
|
1052 |
-
}
|
1053 |
-
.icns_tab_3 .row_7_6 {
|
1054 |
-
background-position: -293px -444px;
|
1055 |
-
}
|
1056 |
-
.icns_tab_3 .row_7_7 {
|
1057 |
-
background-position: -350px -444px;
|
1058 |
-
}
|
1059 |
-
.icns_tab_3 .row_7_8 {
|
1060 |
-
background-position: -409px -444px;
|
1061 |
-
}
|
1062 |
-
.icns_tab_3 .row_7_9 {
|
1063 |
-
background-position: -466px -444px;
|
1064 |
-
}
|
1065 |
-
.icns_tab_3 .row_7_10 {
|
1066 |
-
background-position: -526px -444px;
|
1067 |
-
}
|
1068 |
-
.icns_tab_3 .row_7_11 {
|
1069 |
-
background-position: -711px -444px;
|
1070 |
-
}
|
1071 |
-
.icns_tab_3 .row_7_14 {
|
1072 |
-
background-position: -773px -444px;
|
1073 |
-
}
|
1074 |
-
.icns_tab_3 .row_7_15 {
|
1075 |
-
background-position: -838px -444px;
|
1076 |
-
}
|
1077 |
-
.icns_tab_3 .row_7_16 {
|
1078 |
-
background-position: -909px -444px;
|
1079 |
-
}
|
1080 |
-
.icns_tab_3 .row_7_17 {
|
1081 |
-
background-position: -977px -444px;
|
1082 |
-
}
|
1083 |
-
.icns_tab_3 .row_7_18 {
|
1084 |
-
background: url(../images/icons_theme/chrome_grey/chrome_grey_wechat.png);
|
1085 |
-
background-size: contain;
|
1086 |
-
}
|
1087 |
-
.icns_tab_3 .row_8_1 {
|
1088 |
-
background-position: 0 -518px;
|
1089 |
-
}
|
1090 |
-
.icns_tab_3 .row_8_2 {
|
1091 |
-
background-position: -60px -518px;
|
1092 |
-
}
|
1093 |
-
.icns_tab_3 .row_8_3 {
|
1094 |
-
background-position: -118px -518px;
|
1095 |
-
}
|
1096 |
-
.icns_tab_3 .row_8_4 {
|
1097 |
-
background-position: -176px -518px;
|
1098 |
-
}
|
1099 |
-
.icns_tab_3 .row_8_5 {
|
1100 |
-
background-position: -235px -518px;
|
1101 |
-
}
|
1102 |
-
.icns_tab_3 .row_8_6 {
|
1103 |
-
background-position: -293px -518px;
|
1104 |
-
}
|
1105 |
-
.icns_tab_3 .row_8_7 {
|
1106 |
-
background-position: -350px -518px;
|
1107 |
-
}
|
1108 |
-
.icns_tab_3 .row_8_8 {
|
1109 |
-
background-position: -409px -518px;
|
1110 |
-
}
|
1111 |
-
.icns_tab_3 .row_8_9 {
|
1112 |
-
background-position: -467px -518px;
|
1113 |
-
}
|
1114 |
-
.icns_tab_3 .row_8_10 {
|
1115 |
-
background-position: -526px -518px;
|
1116 |
-
}
|
1117 |
-
.icns_tab_3 .row_8_11 {
|
1118 |
-
background-position: -711px -518px;
|
1119 |
-
}
|
1120 |
-
.icns_tab_3 .row_8_14 {
|
1121 |
-
background-position: -773px -518px;
|
1122 |
-
}
|
1123 |
-
.icns_tab_3 .row_8_15 {
|
1124 |
-
background-position: -838px -518px;
|
1125 |
-
}
|
1126 |
-
.icns_tab_3 .row_8_16 {
|
1127 |
-
background-position: -909px -518px;
|
1128 |
-
}
|
1129 |
-
.icns_tab_3 .row_8_17 {
|
1130 |
-
background-position: -977px -518px;
|
1131 |
-
}
|
1132 |
-
.icns_tab_3 .row_8_18 {
|
1133 |
-
background: url(../images/icons_theme/splash/splash_wechat.png);
|
1134 |
-
background-size: contain;
|
1135 |
-
}
|
1136 |
-
.icns_tab_3 .row_9_1 {
|
1137 |
-
background-position: 0 -592px;
|
1138 |
-
}
|
1139 |
-
.icns_tab_3 .row_9_2 {
|
1140 |
-
background-position: -60px -592px;
|
1141 |
-
}
|
1142 |
-
.icns_tab_3 .row_9_3 {
|
1143 |
-
background-position: -118px -592px;
|
1144 |
-
}
|
1145 |
-
.icns_tab_3 .row_9_4 {
|
1146 |
-
background-position: -176px -592px;
|
1147 |
-
}
|
1148 |
-
.icns_tab_3 .row_9_5 {
|
1149 |
-
background-position: -235px -592px;
|
1150 |
-
}
|
1151 |
-
.icns_tab_3 .row_9_6 {
|
1152 |
-
background-position: -293px -592px;
|
1153 |
-
}
|
1154 |
-
.icns_tab_3 .row_9_7 {
|
1155 |
-
background-position: -350px -592px;
|
1156 |
-
}
|
1157 |
-
.icns_tab_3 .row_9_8 {
|
1158 |
-
background-position: -409px -592px;
|
1159 |
-
}
|
1160 |
-
.icns_tab_3 .row_9_9 {
|
1161 |
-
background-position: -467px -592px;
|
1162 |
-
}
|
1163 |
-
.icns_tab_3 .row_9_10 {
|
1164 |
-
background-position: -526px -592px;
|
1165 |
-
}
|
1166 |
-
.icns_tab_3 .row_9_11 {
|
1167 |
-
background-position: -711px -592px;
|
1168 |
-
}
|
1169 |
-
.icns_tab_3 .row_9_14 {
|
1170 |
-
background-position: -773px -592px;
|
1171 |
-
}
|
1172 |
-
.icns_tab_3 .row_9_15 {
|
1173 |
-
background-position: -838px -592px;
|
1174 |
-
}
|
1175 |
-
.icns_tab_3 .row_9_16 {
|
1176 |
-
background-position: -909px -592px;
|
1177 |
-
}
|
1178 |
-
.icns_tab_3 .row_9_17 {
|
1179 |
-
background-position: -977px -592px;
|
1180 |
-
}
|
1181 |
-
.icns_tab_3 .row_9_18 {
|
1182 |
-
background: url(../images/icons_theme/orange/orange_wechat.png);
|
1183 |
-
background-size: contain;
|
1184 |
-
}
|
1185 |
-
.icns_tab_3 .row_10_1 {
|
1186 |
-
background-position: 0 -666px;
|
1187 |
-
}
|
1188 |
-
.icns_tab_3 .row_10_2 {
|
1189 |
-
background-position: -60px -666px;
|
1190 |
-
}
|
1191 |
-
.icns_tab_3 .row_10_3 {
|
1192 |
-
background-position: -118px -666px;
|
1193 |
-
}
|
1194 |
-
.icns_tab_3 .row_10_4 {
|
1195 |
-
background-position: -176px -666px;
|
1196 |
-
}
|
1197 |
-
.icns_tab_3 .row_10_5 {
|
1198 |
-
background-position: -235px -666px;
|
1199 |
-
}
|
1200 |
-
.icns_tab_3 .row_10_6 {
|
1201 |
-
background-position: -293px -666px;
|
1202 |
-
}
|
1203 |
-
.icns_tab_3 .row_10_7 {
|
1204 |
-
background-position: -350px -666px;
|
1205 |
-
}
|
1206 |
-
.icns_tab_3 .row_10_8 {
|
1207 |
-
background-position: -409px -666px;
|
1208 |
-
}
|
1209 |
-
.icns_tab_3 .row_10_9 {
|
1210 |
-
background-position: -467px -666px;
|
1211 |
-
}
|
1212 |
-
.icns_tab_3 .row_10_10 {
|
1213 |
-
background-position: -526px -666px;
|
1214 |
-
}
|
1215 |
-
.icns_tab_3 .row_10_11 {
|
1216 |
-
background-position: -711px -666px;
|
1217 |
-
}
|
1218 |
-
.icns_tab_3 .row_10_14 {
|
1219 |
-
background-position: -773px -666px;
|
1220 |
-
}
|
1221 |
-
.icns_tab_3 .row_10_15 {
|
1222 |
-
background-position: -838px -666px;
|
1223 |
-
}
|
1224 |
-
.icns_tab_3 .row_10_16 {
|
1225 |
-
background-position: -909px -666px;
|
1226 |
-
}
|
1227 |
-
.icns_tab_3 .row_10_17 {
|
1228 |
-
background-position: -977px -666px;
|
1229 |
-
}
|
1230 |
-
.icns_tab_3 .row_10_18 {
|
1231 |
-
background: url(../images/icons_theme/crystal/crystal_wechat.png);
|
1232 |
-
background-size: contain;
|
1233 |
-
}
|
1234 |
-
.icns_tab_3 .row_11_1 {
|
1235 |
-
background-position: 0 -740px;
|
1236 |
-
}
|
1237 |
-
.icns_tab_3 .row_11_2 {
|
1238 |
-
background-position: -60px -740px;
|
1239 |
-
}
|
1240 |
-
.icns_tab_3 .row_11_3 {
|
1241 |
-
background-position: -118px -740px;
|
1242 |
-
}
|
1243 |
-
.icns_tab_3 .row_11_4 {
|
1244 |
-
background-position: -176px -740px;
|
1245 |
-
}
|
1246 |
-
.icns_tab_3 .row_11_5 {
|
1247 |
-
background-position: -235px -740px;
|
1248 |
-
}
|
1249 |
-
.icns_tab_3 .row_11_6 {
|
1250 |
-
background-position: -293px -740px;
|
1251 |
-
}
|
1252 |
-
.icns_tab_3 .row_11_7 {
|
1253 |
-
background-position: -350px -740px;
|
1254 |
-
}
|
1255 |
-
.icns_tab_3 .row_11_8 {
|
1256 |
-
background-position: -409px -740px;
|
1257 |
-
}
|
1258 |
-
.icns_tab_3 .row_11_9 {
|
1259 |
-
background-position: -467px -740px;
|
1260 |
-
}
|
1261 |
-
.icns_tab_3 .row_11_10 {
|
1262 |
-
background-position: -526px -740px;
|
1263 |
-
}
|
1264 |
-
.icns_tab_3 .row_11_11 {
|
1265 |
-
background-position: -711px -740px;
|
1266 |
-
}
|
1267 |
-
.icns_tab_3 .row_11_14 {
|
1268 |
-
background-position: -773px -740px;
|
1269 |
-
}
|
1270 |
-
.icns_tab_3 .row_11_15 {
|
1271 |
-
background-position: -838px -740px;
|
1272 |
-
}
|
1273 |
-
.icns_tab_3 .row_11_16 {
|
1274 |
-
background-position: -909px -740px;
|
1275 |
-
}
|
1276 |
-
.icns_tab_3 .row_11_17 {
|
1277 |
-
background-position: -977px -740px;
|
1278 |
-
}
|
1279 |
-
.icns_tab_3 .row_11_18 {
|
1280 |
-
background: url(../images/icons_theme/glossy/glossy_wechat.png);
|
1281 |
-
background-size: contain;
|
1282 |
-
}
|
1283 |
-
.icns_tab_3 .row_12_1 {
|
1284 |
-
background-position: 0 -814px;
|
1285 |
-
}
|
1286 |
-
.icns_tab_3 .row_12_2 {
|
1287 |
-
background-position: -60px -814px;
|
1288 |
-
}
|
1289 |
-
.icns_tab_3 .row_12_3 {
|
1290 |
-
background-position: -118px -814px;
|
1291 |
-
}
|
1292 |
-
.icns_tab_3 .row_12_4 {
|
1293 |
-
background-position: -176px -814px;
|
1294 |
-
}
|
1295 |
-
.icns_tab_3 .row_12_5 {
|
1296 |
-
background-position: -235px -814px;
|
1297 |
-
}
|
1298 |
-
.icns_tab_3 .row_12_6 {
|
1299 |
-
background-position: -293px -814px;
|
1300 |
-
}
|
1301 |
-
.icns_tab_3 .row_12_7 {
|
1302 |
-
background-position: -350px -814px;
|
1303 |
-
}
|
1304 |
-
.icns_tab_3 .row_12_8 {
|
1305 |
-
background-position: -409px -814px;
|
1306 |
-
}
|
1307 |
-
.icns_tab_3 .row_12_9 {
|
1308 |
-
background-position: -467px -814px;
|
1309 |
-
}
|
1310 |
-
.icns_tab_3 .row_12_10 {
|
1311 |
-
background-position: -526px -814px;
|
1312 |
-
}
|
1313 |
-
.icns_tab_3 .row_12_11 {
|
1314 |
-
background-position: -711px -814px;
|
1315 |
-
}
|
1316 |
-
.icns_tab_3 .row_12_14 {
|
1317 |
-
background-position: -773px -814px;
|
1318 |
-
}
|
1319 |
-
.icns_tab_3 .row_12_15 {
|
1320 |
-
background-position: -838px -814px;
|
1321 |
-
}
|
1322 |
-
.icns_tab_3 .row_12_16 {
|
1323 |
-
background-position: -909px -814px;
|
1324 |
-
}
|
1325 |
-
.icns_tab_3 .row_12_17 {
|
1326 |
-
background-position: -977px -814px;
|
1327 |
-
}
|
1328 |
-
.icns_tab_3 .row_12_18 {
|
1329 |
-
background: url(../images/icons_theme/black/black_wechat.png);
|
1330 |
-
background-size: contain;
|
1331 |
-
}
|
1332 |
-
.icns_tab_3 .row_13_1 {
|
1333 |
-
background-position: 0 -888px;
|
1334 |
-
}
|
1335 |
-
.icns_tab_3 .row_13_2 {
|
1336 |
-
background-position: -60px -888px;
|
1337 |
-
}
|
1338 |
-
.icns_tab_3 .row_13_3 {
|
1339 |
-
background-position: -118px -888px;
|
1340 |
-
}
|
1341 |
-
.icns_tab_3 .row_13_4 {
|
1342 |
-
background-position: -176px -888px;
|
1343 |
-
}
|
1344 |
-
.icns_tab_3 .row_13_5 {
|
1345 |
-
background-position: -235px -888px;
|
1346 |
-
}
|
1347 |
-
.icns_tab_3 .row_13_6 {
|
1348 |
-
background-position: -293px -888px;
|
1349 |
-
}
|
1350 |
-
.icns_tab_3 .row_13_7 {
|
1351 |
-
background-position: -350px -888px;
|
1352 |
-
}
|
1353 |
-
.icns_tab_3 .row_13_8 {
|
1354 |
-
background-position: -409px -888px;
|
1355 |
-
}
|
1356 |
-
.icns_tab_3 .row_13_9 {
|
1357 |
-
background-position: -467px -888px;
|
1358 |
-
}
|
1359 |
-
.icns_tab_3 .row_13_10 {
|
1360 |
-
background-position: -526px -888px;
|
1361 |
-
}
|
1362 |
-
.icns_tab_3 .row_13_11 {
|
1363 |
-
background-position: -711px -888px;
|
1364 |
-
}
|
1365 |
-
.icns_tab_3 .row_13_14 {
|
1366 |
-
background-position: -773px -888px;
|
1367 |
-
}
|
1368 |
-
.icns_tab_3 .row_13_15 {
|
1369 |
-
background-position: -838px -888px;
|
1370 |
-
}
|
1371 |
-
.icns_tab_3 .row_13_16 {
|
1372 |
-
background-position: -909px -888px;
|
1373 |
-
}
|
1374 |
-
.icns_tab_3 .row_13_17 {
|
1375 |
-
background-position: -977px -888px;
|
1376 |
-
}
|
1377 |
-
.icns_tab_3 .row_13_18 {
|
1378 |
-
background: url(../images/icons_theme/silver/silver_wechat.png);
|
1379 |
-
|
1380 |
-
background-size: contain;
|
1381 |
-
}
|
1382 |
-
.icns_tab_3 .row_14_1 {
|
1383 |
-
background-position: 0 -962px;
|
1384 |
-
}
|
1385 |
-
.icns_tab_3 .row_14_2 {
|
1386 |
-
background-position: -60px -962px;
|
1387 |
-
}
|
1388 |
-
.icns_tab_3 .row_14_3 {
|
1389 |
-
background-position: -118px -962px;
|
1390 |
-
}
|
1391 |
-
.icns_tab_3 .row_14_4 {
|
1392 |
-
background-position: -176px -962px;
|
1393 |
-
}
|
1394 |
-
.icns_tab_3 .row_14_5 {
|
1395 |
-
background-position: -235px -962px;
|
1396 |
-
}
|
1397 |
-
.icns_tab_3 .row_14_6 {
|
1398 |
-
background-position: -293px -962px;
|
1399 |
-
}
|
1400 |
-
.icns_tab_3 .row_14_7 {
|
1401 |
-
background-position: -350px -962px;
|
1402 |
-
}
|
1403 |
-
.icns_tab_3 .row_14_8 {
|
1404 |
-
background-position: -409px -962px;
|
1405 |
-
}
|
1406 |
-
.icns_tab_3 .row_14_9 {
|
1407 |
-
background-position: -467px -962px;
|
1408 |
-
}
|
1409 |
-
.icns_tab_3 .row_14_10 {
|
1410 |
-
background-position: -526px -962px;
|
1411 |
-
}
|
1412 |
-
.icns_tab_3 .row_14_11 {
|
1413 |
-
background-position: -711px -962px;
|
1414 |
-
}
|
1415 |
-
.icns_tab_3 .row_14_14 {
|
1416 |
-
background-position: -773px -962px;
|
1417 |
-
}
|
1418 |
-
.icns_tab_3 .row_14_15 {
|
1419 |
-
background-position: -838px -962px;
|
1420 |
-
}
|
1421 |
-
.icns_tab_3 .row_14_16 {
|
1422 |
-
background-position: -909px -962px;
|
1423 |
-
}
|
1424 |
-
.icns_tab_3 .row_14_17 {
|
1425 |
-
background-position: -977px -962px;
|
1426 |
-
}
|
1427 |
-
.icns_tab_3 .row_14_18 {
|
1428 |
-
background: url(../images/icons_theme/shaded_dark/shaded_dark_wechat.png);
|
1429 |
-
|
1430 |
-
background-size: contain;
|
1431 |
-
}
|
1432 |
-
.icns_tab_3 .row_15_1 {
|
1433 |
-
background-position: 0 -1036px;
|
1434 |
-
}
|
1435 |
-
.icns_tab_3 .row_15_2 {
|
1436 |
-
background-position: -60px -1036px;
|
1437 |
-
}
|
1438 |
-
.icns_tab_3 .row_15_3 {
|
1439 |
-
background-position: -118px -1036px;
|
1440 |
-
}
|
1441 |
-
.icns_tab_3 .row_15_4 {
|
1442 |
-
background-position: -176px -1036px;
|
1443 |
-
}
|
1444 |
-
.icns_tab_3 .row_15_5 {
|
1445 |
-
background-position: -235px -1036px;
|
1446 |
-
}
|
1447 |
-
.icns_tab_3 .row_15_6 {
|
1448 |
-
background-position: -293px -1036px;
|
1449 |
-
}
|
1450 |
-
.icns_tab_3 .row_15_7 {
|
1451 |
-
background-position: -350px -1036px;
|
1452 |
-
}
|
1453 |
-
.icns_tab_3 .row_15_8 {
|
1454 |
-
background-position: -409px -1036px;
|
1455 |
-
}
|
1456 |
-
.icns_tab_3 .row_15_9 {
|
1457 |
-
background-position: -467px -1036px;
|
1458 |
-
}
|
1459 |
-
.icns_tab_3 .row_15_10 {
|
1460 |
-
background-position: -526px -1036px;
|
1461 |
-
}
|
1462 |
-
.icns_tab_3 .row_15_11 {
|
1463 |
-
background-position: -711px -1036px;
|
1464 |
-
}
|
1465 |
-
.icns_tab_3 .row_15_14 {
|
1466 |
-
background-position: -773px -1036px;
|
1467 |
-
}
|
1468 |
-
.icns_tab_3 .row_15_15 {
|
1469 |
-
background-position: -838px -1036px;
|
1470 |
-
}
|
1471 |
-
.icns_tab_3 .row_15_16 {
|
1472 |
-
background-position: -909px -1036px;
|
1473 |
-
}
|
1474 |
-
.icns_tab_3 .row_15_17 {
|
1475 |
-
background-position: -977px -1036px;
|
1476 |
-
}
|
1477 |
-
.icns_tab_3 .row_15_18 {
|
1478 |
-
background: url(../images/icons_theme/shaded_light/shaded_light_wechat.png);
|
1479 |
-
background-size: contain;
|
1480 |
-
}
|
1481 |
-
.icns_tab_3 .row_16_1 {
|
1482 |
-
background-position: 0 -1109px;
|
1483 |
-
}
|
1484 |
-
.icns_tab_3 .row_16_2 {
|
1485 |
-
background-position: -60px -1109px;
|
1486 |
-
}
|
1487 |
-
.icns_tab_3 .row_16_3 {
|
1488 |
-
background-position: -118px -1109px;
|
1489 |
-
}
|
1490 |
-
.icns_tab_3 .row_16_4 {
|
1491 |
-
background-position: -176px -1109px;
|
1492 |
-
}
|
1493 |
-
.icns_tab_3 .row_16_5 {
|
1494 |
-
background-position: -235px -1109px;
|
1495 |
-
}
|
1496 |
-
.icns_tab_3 .row_16_6 {
|
1497 |
-
background-position: -293px -1109px;
|
1498 |
-
}
|
1499 |
-
.icns_tab_3 .row_16_7 {
|
1500 |
-
background-position: -350px -1109px;
|
1501 |
-
}
|
1502 |
-
.icns_tab_3 .row_16_8 {
|
1503 |
-
background-position: -409px -1109px;
|
1504 |
-
}
|
1505 |
-
.icns_tab_3 .row_16_9 {
|
1506 |
-
background-position: -467px -1109px;
|
1507 |
-
}
|
1508 |
-
.icns_tab_3 .row_16_10 {
|
1509 |
-
background-position: -526px -1109px;
|
1510 |
-
}
|
1511 |
-
.icns_tab_3 .row_16_11 {
|
1512 |
-
background-position: -711px -1109px;
|
1513 |
-
}
|
1514 |
-
.icns_tab_3 .row_16_14 {
|
1515 |
-
background-position: -773px -1109px;
|
1516 |
-
}
|
1517 |
-
.icns_tab_3 .row_16_15 {
|
1518 |
-
background-position: -838px -1109px;
|
1519 |
-
}
|
1520 |
-
.icns_tab_3 .row_16_16 {
|
1521 |
-
background-position: -909px -1109px;
|
1522 |
-
}
|
1523 |
-
.icns_tab_3 .row_16_17 {
|
1524 |
-
background-position: -977px -1109px;
|
1525 |
-
}
|
1526 |
-
.icns_tab_3 .row_16_18 {
|
1527 |
-
background: url(../images/icons_theme/transparent/transparent_wechat.png);
|
1528 |
-
background-size: contain;
|
1529 |
-
}
|
1530 |
-
|
1531 |
-
/*tab 6 css*/
|
1532 |
-
.tab6 .social_icon_like1 {
|
1533 |
-
width: 100%;
|
1534 |
-
float: left;
|
1535 |
-
margin: 0;
|
1536 |
-
|
1537 |
-
|
1538 |
-
|
1539 |
-
|
1540 |
-
|
1541 |
-
|
1542 |
-
|
1543 |
-
|
1544 |
-
|
1545 |
-
|
1546 |
-
|
1547 |
-
|
1548 |
-
|
1549 |
-
|
1550 |
-
|
1551 |
-
|
1552 |
-
|
1553 |
-
|
1554 |
-
|
1555 |
-
|
1556 |
-
|
1557 |
-
|
1558 |
-
|
1559 |
-
|
1560 |
-
font-
|
1561 |
-
|
1562 |
-
|
1563 |
-
|
1564 |
-
|
1565 |
-
|
1566 |
-
|
1567 |
-
|
1568 |
-
|
1569 |
-
|
1570 |
-
|
1571 |
-
|
1572 |
-
|
1573 |
-
|
1574 |
-
|
1575 |
-
|
1576 |
-
|
1577 |
-
|
1578 |
-
|
1579 |
-
|
1580 |
-
|
1581 |
-
|
1582 |
-
|
1583 |
-
|
1584 |
-
|
1585 |
-
|
1586 |
-
|
1587 |
-
|
1588 |
-
|
1589 |
-
|
1590 |
-
|
1591 |
-
|
1592 |
-
|
1593 |
-
|
1594 |
-
|
1595 |
-
|
1596 |
-
|
1597 |
-
|
1598 |
-
|
1599 |
-
|
1600 |
-
|
1601 |
-
|
1602 |
-
|
1603 |
-
|
1604 |
-
|
1605 |
-
|
1606 |
-
|
1607 |
-
|
1608 |
-
|
1609 |
-
font-
|
1610 |
-
font-
|
1611 |
-
|
1612 |
-
|
1613 |
-
|
1614 |
-
|
1615 |
-
|
1616 |
-
|
1617 |
-
|
1618 |
-
|
1619 |
-
|
1620 |
-
|
1621 |
-
|
1622 |
-
|
1623 |
-
|
1624 |
-
|
1625 |
-
|
1626 |
-
|
1627 |
-
|
1628 |
-
|
1629 |
-
|
1630 |
-
|
1631 |
-
|
1632 |
-
|
1633 |
-
|
1634 |
-
|
1635 |
-
|
1636 |
-
font-
|
1637 |
-
|
1638 |
-
|
1639 |
-
|
1640 |
-
|
1641 |
-
|
1642 |
-
|
1643 |
-
|
1644 |
-
|
1645 |
-
font-
|
1646 |
-
|
1647 |
-
|
1648 |
-
|
1649 |
-
|
1650 |
-
|
1651 |
-
|
1652 |
-
|
1653 |
-
|
1654 |
-
|
1655 |
-
|
1656 |
-
|
1657 |
-
|
1658 |
-
|
1659 |
-
|
1660 |
-
|
1661 |
-
|
1662 |
-
|
1663 |
-
|
1664 |
-
|
1665 |
-
|
1666 |
-
|
1667 |
-
|
1668 |
-
|
1669 |
-
|
1670 |
-
|
1671 |
-
|
1672 |
-
|
1673 |
-
|
1674 |
-
|
1675 |
-
|
1676 |
-
|
1677 |
-
|
1678 |
-
|
1679 |
-
|
1680 |
-
|
1681 |
-
|
1682 |
-
|
1683 |
-
|
1684 |
-
|
1685 |
-
|
1686 |
-
|
1687 |
-
|
1688 |
-
font-
|
1689 |
-
|
1690 |
-
|
1691 |
-
|
1692 |
-
|
1693 |
-
|
1694 |
-
|
1695 |
-
|
1696 |
-
|
1697 |
-
|
1698 |
-
|
1699 |
-
|
1700 |
-
|
1701 |
-
|
1702 |
-
|
1703 |
-
|
1704 |
-
|
1705 |
-
|
1706 |
-
|
1707 |
-
|
1708 |
-
|
1709 |
-
|
1710 |
-
|
1711 |
-
|
1712 |
-
|
1713 |
-
|
1714 |
-
|
1715 |
-
|
1716 |
-
|
1717 |
-
|
1718 |
-
|
1719 |
-
|
1720 |
-
|
1721 |
-
|
1722 |
-
|
1723 |
-
|
1724 |
-
|
1725 |
-
|
1726 |
-
|
1727 |
-
|
1728 |
-
|
1729 |
-
|
1730 |
-
|
1731 |
-
|
1732 |
-
|
1733 |
-
|
1734 |
-
|
1735 |
-
|
1736 |
-
|
1737 |
-
|
1738 |
-
|
1739 |
-
|
1740 |
-
|
1741 |
-
|
1742 |
-
|
1743 |
-
|
1744 |
-
|
1745 |
-
|
1746 |
-
|
1747 |
-
|
1748 |
-
|
1749 |
-
|
1750 |
-
|
1751 |
-
|
1752 |
-
|
1753 |
-
|
1754 |
-
|
1755 |
-
|
1756 |
-
|
1757 |
-
|
1758 |
-
|
1759 |
-
|
1760 |
-
|
1761 |
-
|
1762 |
-
|
1763 |
-
|
1764 |
-
|
1765 |
-
|
1766 |
-
|
1767 |
-
|
1768 |
-
|
1769 |
-
|
1770 |
-
|
1771 |
-
|
1772 |
-
|
1773 |
-
|
1774 |
-
|
1775 |
-
|
1776 |
-
|
1777 |
-
|
1778 |
-
|
1779 |
-
|
1780 |
-
|
1781 |
-
|
1782 |
-
|
1783 |
-
|
1784 |
-
|
1785 |
-
|
1786 |
-
|
1787 |
-
|
1788 |
-
|
1789 |
-
|
1790 |
-
|
1791 |
-
|
1792 |
-
|
1793 |
-
|
1794 |
-
|
1795 |
-
|
1796 |
-
|
1797 |
-
|
1798 |
-
|
1799 |
-
|
1800 |
-
|
1801 |
-
|
1802 |
-
|
1803 |
-
|
1804 |
-
|
1805 |
-
|
1806 |
-
font-
|
1807 |
-
font-
|
1808 |
-
|
1809 |
-
|
1810 |
-
|
1811 |
-
|
1812 |
-
|
1813 |
-
|
1814 |
-
|
1815 |
-
|
1816 |
-
|
1817 |
-
|
1818 |
-
|
1819 |
-
|
1820 |
-
|
1821 |
-
|
1822 |
-
|
1823 |
-
|
1824 |
-
|
1825 |
-
|
1826 |
-
|
1827 |
-
|
1828 |
-
|
1829 |
-
|
1830 |
-
|
1831 |
-
|
1832 |
-
|
1833 |
-
|
1834 |
-
|
1835 |
-
|
1836 |
-
font-
|
1837 |
-
|
1838 |
-
|
1839 |
-
|
1840 |
-
|
1841 |
-
|
1842 |
-
|
1843 |
-
|
1844 |
-
|
1845 |
-
|
1846 |
-
|
1847 |
-
|
1848 |
-
|
1849 |
-
|
1850 |
-
|
1851 |
-
|
1852 |
-
|
1853 |
-
|
1854 |
-
|
1855 |
-
|
1856 |
-
|
1857 |
-
|
1858 |
-
|
1859 |
-
|
1860 |
-
|
1861 |
-
|
1862 |
-
|
1863 |
-
|
1864 |
-
|
1865 |
-
|
1866 |
-
|
1867 |
-
|
1868 |
-
|
1869 |
-
|
1870 |
-
|
1871 |
-
font-
|
1872 |
-
|
1873 |
-
|
1874 |
-
|
1875 |
-
|
1876 |
-
|
1877 |
-
|
1878 |
-
|
1879 |
-
|
1880 |
-
|
1881 |
-
|
1882 |
-
|
1883 |
-
|
1884 |
-
|
1885 |
-
|
1886 |
-
|
1887 |
-
|
1888 |
-
|
1889 |
-
|
1890 |
-
|
1891 |
-
|
1892 |
-
|
1893 |
-
|
1894 |
-
|
1895 |
-
|
1896 |
-
|
1897 |
-
|
1898 |
-
|
1899 |
-
|
1900 |
-
|
1901 |
-
|
1902 |
-
|
1903 |
-
|
1904 |
-
|
1905 |
-
|
1906 |
-
|
1907 |
-
|
1908 |
-
|
1909 |
-
|
1910 |
-
|
1911 |
-
|
1912 |
-
|
1913 |
-
|
1914 |
-
|
1915 |
-
|
1916 |
-
|
1917 |
-
|
1918 |
-
|
1919 |
-
|
1920 |
-
|
1921 |
-
|
1922 |
-
|
1923 |
-
|
1924 |
-
|
1925 |
-
|
1926 |
-
|
1927 |
-
|
1928 |
-
|
1929 |
-
|
1930 |
-
|
1931 |
-
|
1932 |
-
|
1933 |
-
|
1934 |
-
|
1935 |
-
|
1936 |
-
|
1937 |
-
|
1938 |
-
|
1939 |
-
|
1940 |
-
|
1941 |
-
|
1942 |
-
|
1943 |
-
|
1944 |
-
|
1945 |
-
|
1946 |
-
|
1947 |
-
|
1948 |
-
|
1949 |
-
|
1950 |
-
|
1951 |
-
|
1952 |
-
|
1953 |
-
|
1954 |
-
|
1955 |
-
|
1956 |
-
|
1957 |
-
|
1958 |
-
|
1959 |
-
|
1960 |
-
|
1961 |
-
|
1962 |
-
|
1963 |
-
|
1964 |
-
|
1965 |
-
|
1966 |
-
|
1967 |
-
|
1968 |
-
|
1969 |
-
|
1970 |
-
|
1971 |
-
|
1972 |
-
|
1973 |
-
|
1974 |
-
|
1975 |
-
|
1976 |
-
|
1977 |
-
|
1978 |
-
|
1979 |
-
|
1980 |
-
|
1981 |
-
|
1982 |
-
|
1983 |
-
|
1984 |
-
|
1985 |
-
|
1986 |
-
|
1987 |
-
|
1988 |
-
|
1989 |
-
|
1990 |
-
|
1991 |
-
|
1992 |
-
|
1993 |
-
|
1994 |
-
|
1995 |
-
|
1996 |
-
|
1997 |
-
|
1998 |
-
|
1999 |
-
|
2000 |
-
|
2001 |
-
|
2002 |
-
|
2003 |
-
|
2004 |
-
|
2005 |
-
|
2006 |
-
|
2007 |
-
|
2008 |
-
|
2009 |
-
|
2010 |
-
|
2011 |
-
|
2012 |
-
|
2013 |
-
|
2014 |
-
|
2015 |
-
|
2016 |
-
|
2017 |
-
|
2018 |
-
|
2019 |
-
|
2020 |
-
|
2021 |
-
|
2022 |
-
|
2023 |
-
|
2024 |
-
|
2025 |
-
|
2026 |
-
|
2027 |
-
|
2028 |
-
|
2029 |
-
|
2030 |
-
|
2031 |
-
|
2032 |
-
|
2033 |
-
|
2034 |
-
|
2035 |
-
|
2036 |
-
|
2037 |
-
|
2038 |
-
|
2039 |
-
|
2040 |
-
|
2041 |
-
|
2042 |
-
|
2043 |
-
|
2044 |
-
|
2045 |
-
|
2046 |
-
|
2047 |
-
|
2048 |
-
|
2049 |
-
|
2050 |
-
|
2051 |
-
|
2052 |
-
|
2053 |
-
|
2054 |
-
|
2055 |
-
|
2056 |
-
|
2057 |
-
|
2058 |
-
|
2059 |
-
|
2060 |
-
|
2061 |
-
|
2062 |
-
|
2063 |
-
|
2064 |
-
|
2065 |
-
|
2066 |
-
|
2067 |
-
|
2068 |
-
|
2069 |
-
|
2070 |
-
|
2071 |
-
|
2072 |
-
|
2073 |
-
|
2074 |
-
|
2075 |
-
|
2076 |
-
|
2077 |
-
|
2078 |
-
|
2079 |
-
|
2080 |
-
|
2081 |
-
|
2082 |
-
|
2083 |
-
|
2084 |
-
|
2085 |
-
|
2086 |
-
|
2087 |
-
|
2088 |
-
|
2089 |
-
|
2090 |
-
|
2091 |
-
|
2092 |
-
|
2093 |
-
|
2094 |
-
|
2095 |
-
|
2096 |
-
|
2097 |
-
|
2098 |
-
appearance: none;
|
2099 |
-
-
|
2100 |
-
-
|
2101 |
-
background-
|
2102 |
-
background-
|
2103 |
-
|
2104 |
-
|
2105 |
-
|
2106 |
-
|
2107 |
-
|
2108 |
-
|
2109 |
-
|
2110 |
-
|
2111 |
-
|
2112 |
-
|
2113 |
-
|
2114 |
-
|
2115 |
-
|
2116 |
-
|
2117 |
-
|
2118 |
-
|
2119 |
-
|
2120 |
-
|
2121 |
-
|
2122 |
-
|
2123 |
-
|
2124 |
-
.sfsi_mainContainer .
|
2125 |
-
|
2126 |
-
|
2127 |
-
|
2128 |
-
.sfsi_mainContainer .
|
2129 |
-
|
2130 |
-
|
2131 |
-
|
2132 |
-
.sfsi_mainContainer .
|
2133 |
-
|
2134 |
-
|
2135 |
-
|
2136 |
-
|
2137 |
-
|
2138 |
-
|
2139 |
-
|
2140 |
-
|
2141 |
-
|
2142 |
-
|
2143 |
-
|
2144 |
-
|
2145 |
-
|
2146 |
-
|
2147 |
-
|
2148 |
-
|
2149 |
-
|
2150 |
-
|
2151 |
-
|
2152 |
-
|
2153 |
-
|
2154 |
-
|
2155 |
-
|
2156 |
-
|
2157 |
-
|
2158 |
-
|
2159 |
-
|
2160 |
-
|
2161 |
-
|
2162 |
-
|
2163 |
-
|
2164 |
-
|
2165 |
-
|
2166 |
-
|
2167 |
-
|
2168 |
-
|
2169 |
-
|
2170 |
-
|
2171 |
-
font-
|
2172 |
-
|
2173 |
-
|
2174 |
-
|
2175 |
-
|
2176 |
-
.
|
2177 |
-
.
|
2178 |
-
.
|
2179 |
-
|
2180 |
-
|
2181 |
-
|
2182 |
-
|
2183 |
-
|
2184 |
-
|
2185 |
-
|
2186 |
-
|
2187 |
-
font-
|
2188 |
-
|
2189 |
-
|
2190 |
-
|
2191 |
-
|
2192 |
-
|
2193 |
-
|
2194 |
-
|
2195 |
-
|
2196 |
-
|
2197 |
-
|
2198 |
-
|
2199 |
-
|
2200 |
-
|
2201 |
-
|
2202 |
-
|
2203 |
-
|
2204 |
-
|
2205 |
-
|
2206 |
-
|
2207 |
-
|
2208 |
-
|
2209 |
-
|
2210 |
-
|
2211 |
-
|
2212 |
-
|
2213 |
-
|
2214 |
-
|
2215 |
-
|
2216 |
-
|
2217 |
-
|
2218 |
-
|
2219 |
-
|
2220 |
-
font-
|
2221 |
-
|
2222 |
-
|
2223 |
-
|
2224 |
-
|
2225 |
-
|
2226 |
-
|
2227 |
-
|
2228 |
-
|
2229 |
-
|
2230 |
-
|
2231 |
-
|
2232 |
-
|
2233 |
-
|
2234 |
-
|
2235 |
-
|
2236 |
-
|
2237 |
-
|
2238 |
-
|
2239 |
-
|
2240 |
-
|
2241 |
-
|
2242 |
-
|
2243 |
-
|
2244 |
-
|
2245 |
-
|
2246 |
-
|
2247 |
-
|
2248 |
-
|
2249 |
-
|
2250 |
-
|
2251 |
-
|
2252 |
-
|
2253 |
-
|
2254 |
-
|
2255 |
-
|
2256 |
-
|
2257 |
-
|
2258 |
-
|
2259 |
-
|
2260 |
-
|
2261 |
-
|
2262 |
-
|
2263 |
-
|
2264 |
-
|
2265 |
-
|
2266 |
-
|
2267 |
-
|
2268 |
-
|
2269 |
-
|
2270 |
-
|
2271 |
-
|
2272 |
-
|
2273 |
-
|
2274 |
-
|
2275 |
-
|
2276 |
-
margin-
|
2277 |
-
|
2278 |
-
|
2279 |
-
|
2280 |
-
|
2281 |
-
|
2282 |
-
|
2283 |
-
|
2284 |
-
|
2285 |
-
|
2286 |
-
|
2287 |
-
|
2288 |
-
|
2289 |
-
|
2290 |
-
|
2291 |
-
|
2292 |
-
|
2293 |
-
|
2294 |
-
|
2295 |
-
|
2296 |
-
|
2297 |
-
|
2298 |
-
|
2299 |
-
|
2300 |
-
|
2301 |
-
|
2302 |
-
|
2303 |
-
|
2304 |
-
|
2305 |
-
|
2306 |
-
|
2307 |
-
|
2308 |
-
|
2309 |
-
|
2310 |
-
|
2311 |
-
|
2312 |
-
|
2313 |
-
|
2314 |
-
|
2315 |
-
|
2316 |
-
|
2317 |
-
|
2318 |
-
|
2319 |
-
|
2320 |
-
|
2321 |
-
|
2322 |
-
|
2323 |
-
|
2324 |
-
|
2325 |
-
|
2326 |
-
|
2327 |
-
|
2328 |
-
|
2329 |
-
|
2330 |
-
|
2331 |
-
|
2332 |
-
|
2333 |
-
|
2334 |
-
|
2335 |
-
|
2336 |
-
|
2337 |
-
|
2338 |
-
|
2339 |
-
|
2340 |
-
|
2341 |
-
|
2342 |
-
|
2343 |
-
|
2344 |
-
|
2345 |
-
|
2346 |
-
|
2347 |
-
|
2348 |
-
|
2349 |
-
.
|
2350 |
-
|
2351 |
-
|
2352 |
-
|
2353 |
-
.
|
2354 |
-
|
2355 |
-
|
2356 |
-
font-
|
2357 |
-
|
2358 |
-
|
2359 |
-
|
2360 |
-
|
2361 |
-
|
2362 |
-
|
2363 |
-
|
2364 |
-
|
2365 |
-
|
2366 |
-
|
2367 |
-
|
2368 |
-
.
|
2369 |
-
|
2370 |
-
|
2371 |
-
|
2372 |
-
|
2373 |
-
|
2374 |
-
|
2375 |
-
|
2376 |
-
|
2377 |
-
|
2378 |
-
|
2379 |
-
|
2380 |
-
|
2381 |
-
|
2382 |
-
|
2383 |
-
margin-
|
2384 |
-
|
2385 |
-
|
2386 |
-
|
2387 |
-
|
2388 |
-
|
2389 |
-
|
2390 |
-
|
2391 |
-
|
2392 |
-
|
2393 |
-
|
2394 |
-
|
2395 |
-
|
2396 |
-
|
2397 |
-
|
2398 |
-
|
2399 |
-
|
2400 |
-
|
2401 |
-
|
2402 |
-
|
2403 |
-
|
2404 |
-
|
2405 |
-
|
2406 |
-
|
2407 |
-
|
2408 |
-
|
2409 |
-
|
2410 |
-
|
2411 |
-
|
2412 |
-
|
2413 |
-
font-
|
2414 |
-
|
2415 |
-
|
2416 |
-
|
2417 |
-
|
2418 |
-
|
2419 |
-
|
2420 |
-
|
2421 |
-
|
2422 |
-
|
2423 |
-
|
2424 |
-
|
2425 |
-
|
2426 |
-
font-
|
2427 |
-
|
2428 |
-
|
2429 |
-
|
2430 |
-
|
2431 |
-
|
2432 |
-
|
2433 |
-
|
2434 |
-
|
2435 |
-
|
2436 |
-
|
2437 |
-
|
2438 |
-
|
2439 |
-
|
2440 |
-
|
2441 |
-
|
2442 |
-
|
2443 |
-
|
2444 |
-
|
2445 |
-
|
2446 |
-
|
2447 |
-
|
2448 |
-
|
2449 |
-
|
2450 |
-
|
2451 |
-
|
2452 |
-
|
2453 |
-
|
2454 |
-
|
2455 |
-
|
2456 |
-
|
2457 |
-
|
2458 |
-
|
2459 |
-
|
2460 |
-
|
2461 |
-
|
2462 |
-
|
2463 |
-
|
2464 |
-
|
2465 |
-
|
2466 |
-
|
2467 |
-
|
2468 |
-
|
2469 |
-
|
2470 |
-
|
2471 |
-
|
2472 |
-
|
2473 |
-
.
|
2474 |
-
|
2475 |
-
|
2476 |
-
|
2477 |
-
|
2478 |
-
|
2479 |
-
|
2480 |
-
|
2481 |
-
|
2482 |
-
|
2483 |
-
|
2484 |
-
|
2485 |
-
|
2486 |
-
|
2487 |
-
|
2488 |
-
|
2489 |
-
|
2490 |
-
|
2491 |
-
|
2492 |
-
|
2493 |
-
|
2494 |
-
|
2495 |
-
|
2496 |
-
|
2497 |
-
|
2498 |
-
|
2499 |
-
padding-
|
2500 |
-
|
2501 |
-
|
2502 |
-
|
2503 |
-
|
2504 |
-
|
2505 |
-
|
2506 |
-
|
2507 |
-
|
2508 |
-
|
2509 |
-
|
2510 |
-
|
2511 |
-
|
2512 |
-
|
2513 |
-
|
2514 |
-
|
2515 |
-
|
2516 |
-
|
2517 |
-
|
2518 |
-
|
2519 |
-
|
2520 |
-
|
2521 |
-
|
2522 |
-
|
2523 |
-
|
2524 |
-
|
2525 |
-
|
2526 |
-
|
2527 |
-
|
2528 |
-
|
2529 |
-
|
2530 |
-
display: -webkit-
|
2531 |
-
display: -
|
2532 |
-
display:
|
2533 |
-
|
2534 |
-
-webkit-
|
2535 |
-
-
|
2536 |
-
-
|
2537 |
-
|
2538 |
-
-webkit-
|
2539 |
-
-
|
2540 |
-
-
|
2541 |
-
|
2542 |
-
|
2543 |
-
|
2544 |
-
|
2545 |
-
|
2546 |
-
|
2547 |
-
|
2548 |
-
|
2549 |
-
|
2550 |
-
|
2551 |
-
|
2552 |
-
|
2553 |
-
|
2554 |
-
|
2555 |
-
|
2556 |
-
|
2557 |
-
|
2558 |
-
|
2559 |
-
|
2560 |
-
|
2561 |
-
font-
|
2562 |
-
|
2563 |
-
|
2564 |
-
|
2565 |
-
|
2566 |
-
|
2567 |
-
|
2568 |
-
|
2569 |
-
|
2570 |
-
|
2571 |
-
|
2572 |
-
display: -webkit-
|
2573 |
-
display: -
|
2574 |
-
display:
|
2575 |
-
|
2576 |
-
-webkit-
|
2577 |
-
-
|
2578 |
-
-
|
2579 |
-
|
2580 |
-
-webkit-
|
2581 |
-
-
|
2582 |
-
-
|
2583 |
-
|
2584 |
-
|
2585 |
-
|
2586 |
-
|
2587 |
-
|
2588 |
-
|
2589 |
-
|
2590 |
-
|
2591 |
-
|
2592 |
-
|
2593 |
-
|
2594 |
-
|
2595 |
-
|
2596 |
-
|
2597 |
-
|
2598 |
-
|
2599 |
-
|
2600 |
-
text-
|
2601 |
-
|
2602 |
-
font-
|
2603 |
-
|
2604 |
-
|
2605 |
-
margin-
|
2606 |
-
|
2607 |
-
|
2608 |
-
|
2609 |
-
|
2610 |
-
|
2611 |
-
|
2612 |
-
|
2613 |
-
text-
|
2614 |
-
|
2615 |
-
font-
|
2616 |
-
|
2617 |
-
|
2618 |
-
|
2619 |
-
|
2620 |
-
|
2621 |
-
|
2622 |
-
|
2623 |
-
|
2624 |
-
|
2625 |
-
|
2626 |
-
|
2627 |
-
|
2628 |
-
|
2629 |
-
|
2630 |
-
|
2631 |
-
|
2632 |
-
|
2633 |
-
|
2634 |
-
|
2635 |
-
|
2636 |
-
|
2637 |
-
|
2638 |
-
|
2639 |
-
|
2640 |
-
|
2641 |
-
|
2642 |
-
|
2643 |
-
|
2644 |
-
|
2645 |
-
|
2646 |
-
|
2647 |
-
|
2648 |
-
|
2649 |
-
|
2650 |
-
#
|
2651 |
-
|
2652 |
-
|
2653 |
-
font-
|
2654 |
-
|
2655 |
-
|
2656 |
-
|
2657 |
-
|
2658 |
-
|
2659 |
-
|
2660 |
-
|
2661 |
-
|
2662 |
-
|
2663 |
-
|
2664 |
-
|
2665 |
-
|
2666 |
-
|
2667 |
-
|
2668 |
-
|
2669 |
-
|
2670 |
-
|
2671 |
-
|
2672 |
-
|
2673 |
-
|
2674 |
-
|
2675 |
-
|
2676 |
-
margin-
|
2677 |
-
|
2678 |
-
|
2679 |
-
|
2680 |
-
|
2681 |
-
margin-
|
2682 |
-
|
2683 |
-
|
2684 |
-
|
2685 |
-
|
2686 |
-
|
2687 |
-
|
2688 |
-
|
2689 |
-
|
2690 |
-
|
2691 |
-
|
2692 |
-
|
2693 |
-
|
2694 |
-
|
2695 |
-
|
2696 |
-
|
2697 |
-
.
|
2698 |
-
|
2699 |
-
|
2700 |
-
|
2701 |
-
|
2702 |
-
|
2703 |
-
|
2704 |
-
|
2705 |
-
|
2706 |
-
|
2707 |
-
|
2708 |
-
|
2709 |
-
|
2710 |
-
|
2711 |
-
|
2712 |
-
|
2713 |
-
|
2714 |
-
|
2715 |
-
|
2716 |
-
|
2717 |
-
|
2718 |
-
|
2719 |
-
|
2720 |
-
|
2721 |
-
margin-
|
2722 |
-
|
2723 |
-
|
2724 |
-
|
2725 |
-
|
2726 |
-
|
2727 |
-
|
2728 |
-
text-
|
2729 |
-
|
2730 |
-
|
2731 |
-
|
2732 |
-
|
2733 |
-
|
2734 |
-
|
2735 |
-
|
2736 |
-
|
2737 |
-
|
2738 |
-
|
2739 |
-
|
2740 |
-
|
2741 |
-
|
2742 |
-
|
2743 |
-
|
2744 |
-
|
2745 |
-
|
2746 |
-
|
2747 |
-
|
2748 |
-
.
|
2749 |
-
|
2750 |
-
|
2751 |
-
|
2752 |
-
|
2753 |
-
|
2754 |
-
|
2755 |
-
|
2756 |
-
|
2757 |
-
|
2758 |
-
|
2759 |
-
|
2760 |
-
|
2761 |
-
|
2762 |
-
|
2763 |
-
|
2764 |
-
|
2765 |
-
|
2766 |
-
|
2767 |
-
|
2768 |
-
|
2769 |
-
|
2770 |
-
|
2771 |
-
|
2772 |
-
|
2773 |
-
|
2774 |
-
|
2775 |
-
|
2776 |
-
|
2777 |
-
|
2778 |
-
|
2779 |
-
|
2780 |
-
|
2781 |
-
|
2782 |
-
display: -
|
2783 |
-
display:
|
2784 |
-
|
2785 |
-
-webkit-
|
2786 |
-
-
|
2787 |
-
-
|
2788 |
-
|
2789 |
-
-webkit-
|
2790 |
-
-
|
2791 |
-
-
|
2792 |
-
|
2793 |
-
|
2794 |
-
|
2795 |
-
|
2796 |
-
|
2797 |
-
|
2798 |
-
|
2799 |
-
|
2800 |
-
|
2801 |
-
font-
|
2802 |
-
|
2803 |
-
|
2804 |
-
|
2805 |
-
|
2806 |
-
|
2807 |
-
|
2808 |
-
|
2809 |
-
|
2810 |
-
|
2811 |
-
|
2812 |
-
|
2813 |
-
|
2814 |
-
|
2815 |
-
|
2816 |
-
|
2817 |
-
|
2818 |
-
|
2819 |
-
|
2820 |
-
|
2821 |
-
|
2822 |
-
|
2823 |
-
font-
|
2824 |
-
|
2825 |
-
|
2826 |
-
|
2827 |
-
|
2828 |
-
|
2829 |
-
|
2830 |
-
|
2831 |
-
|
2832 |
-
|
2833 |
-
|
2834 |
-
text-
|
2835 |
-
|
2836 |
-
font-
|
2837 |
-
|
2838 |
-
|
2839 |
-
|
2840 |
-
|
2841 |
-
|
2842 |
-
|
2843 |
-
|
2844 |
-
display: -
|
2845 |
-
display:
|
2846 |
-
|
2847 |
-
-webkit-
|
2848 |
-
-
|
2849 |
-
-
|
2850 |
-
|
2851 |
-
-webkit-
|
2852 |
-
-
|
2853 |
-
-
|
2854 |
-
|
2855 |
-
|
2856 |
-
|
2857 |
-
|
2858 |
-
|
2859 |
-
|
2860 |
-
|
2861 |
-
|
2862 |
-
|
2863 |
-
|
2864 |
-
|
2865 |
-
|
2866 |
-
|
2867 |
-
|
2868 |
-
|
2869 |
-
|
2870 |
-
|
2871 |
-
|
2872 |
-
font-
|
2873 |
-
|
2874 |
-
|
2875 |
-
|
2876 |
-
|
2877 |
-
|
2878 |
-
|
2879 |
-
|
2880 |
-
|
2881 |
-
|
2882 |
-
|
2883 |
-
text-
|
2884 |
-
|
2885 |
-
font-
|
2886 |
-
|
2887 |
-
|
2888 |
-
|
2889 |
-
|
2890 |
-
|
2891 |
-
|
2892 |
-
|
2893 |
-
|
2894 |
-
|
2895 |
-
|
2896 |
-
|
2897 |
-
|
2898 |
-
|
2899 |
-
|
2900 |
-
|
2901 |
-
|
2902 |
-
|
2903 |
-
|
2904 |
-
|
2905 |
-
|
2906 |
-
|
2907 |
-
|
2908 |
-
|
2909 |
-
|
2910 |
-
|
2911 |
-
|
2912 |
-
|
2913 |
-
|
2914 |
-
|
2915 |
-
|
2916 |
-
|
2917 |
-
|
2918 |
-
|
2919 |
-
|
2920 |
-
|
2921 |
-
|
2922 |
-
margin-
|
2923 |
-
|
2924 |
-
|
2925 |
-
|
2926 |
-
|
2927 |
-
|
2928 |
-
|
2929 |
-
|
2930 |
-
|
2931 |
-
|
2932 |
-
|
2933 |
-
|
2934 |
-
|
2935 |
-
|
2936 |
-
|
2937 |
-
|
2938 |
-
|
2939 |
-
|
2940 |
-
|
2941 |
-
|
2942 |
-
|
2943 |
-
|
2944 |
-
|
2945 |
-
|
2946 |
-
|
2947 |
-
|
2948 |
-
|
2949 |
-
|
2950 |
-
|
2951 |
-
|
2952 |
-
|
2953 |
-
|
2954 |
-
|
2955 |
-
|
2956 |
-
|
2957 |
-
|
2958 |
-
|
2959 |
-
|
2960 |
-
|
2961 |
-
|
2962 |
-
|
2963 |
-
|
2964 |
-
|
2965 |
-
|
2966 |
-
|
2967 |
-
|
2968 |
-
#
|
2969 |
-
|
2970 |
-
|
2971 |
-
|
2972 |
-
|
2973 |
-
|
2974 |
-
|
2975 |
-
|
2976 |
-
|
2977 |
-
|
2978 |
-
|
2979 |
-
|
2980 |
-
|
2981 |
-
|
2982 |
-
|
2983 |
-
|
2984 |
-
|
2985 |
-
|
2986 |
-
margin-
|
2987 |
-
|
2988 |
-
|
2989 |
-
|
2990 |
-
|
2991 |
-
|
2992 |
-
|
2993 |
-
|
2994 |
-
|
2995 |
-
|
2996 |
-
|
2997 |
-
|
2998 |
-
|
2999 |
-
|
3000 |
-
|
3001 |
-
|
3002 |
-
|
3003 |
-
|
3004 |
-
|
3005 |
-
|
3006 |
-
|
3007 |
-
|
3008 |
-
|
3009 |
-
|
3010 |
-
|
3011 |
-
|
3012 |
-
|
3013 |
-
font-
|
3014 |
-
|
3015 |
-
|
3016 |
-
|
3017 |
-
|
3018 |
-
|
3019 |
-
margin-
|
3020 |
-
|
3021 |
-
|
3022 |
-
|
3023 |
-
margin-
|
3024 |
-
|
3025 |
-
|
3026 |
-
|
3027 |
-
|
3028 |
-
|
3029 |
-
|
3030 |
-
|
3031 |
-
|
3032 |
-
|
3033 |
-
|
3034 |
-
|
3035 |
-
|
3036 |
-
|
3037 |
-
|
3038 |
-
|
3039 |
-
|
3040 |
-
|
3041 |
-
|
3042 |
-
|
3043 |
-
|
3044 |
-
|
3045 |
-
|
3046 |
-
|
3047 |
-
|
3048 |
-
|
3049 |
-
|
3050 |
-
|
3051 |
-
|
3052 |
-
|
3053 |
-
|
3054 |
-
|
3055 |
-
|
3056 |
-
|
3057 |
-
|
3058 |
-
|
3059 |
-
|
3060 |
-
|
3061 |
-
|
3062 |
-
|
3063 |
-
|
3064 |
-
|
3065 |
-
|
3066 |
-
|
3067 |
-
|
3068 |
-
|
3069 |
-
|
3070 |
-
|
3071 |
-
|
3072 |
-
|
3073 |
-
|
3074 |
-
|
3075 |
-
|
3076 |
-
|
3077 |
-
|
3078 |
-
|
3079 |
-
|
3080 |
-
|
3081 |
-
|
3082 |
-
|
3083 |
-
|
3084 |
-
|
3085 |
-
|
3086 |
-
|
3087 |
-
|
3088 |
-
|
3089 |
-
|
3090 |
-
|
3091 |
-
|
3092 |
-
|
3093 |
-
|
3094 |
-
|
3095 |
-
|
3096 |
-
|
3097 |
-
|
3098 |
-
|
3099 |
-
|
3100 |
-
|
3101 |
-
|
3102 |
-
margin-
|
3103 |
-
|
3104 |
-
|
3105 |
-
|
3106 |
-
|
3107 |
-
|
3108 |
-
|
3109 |
-
|
3110 |
-
|
3111 |
-
|
3112 |
-
|
3113 |
-
padding-
|
3114 |
-
|
3115 |
-
|
3116 |
-
|
3117 |
-
|
3118 |
-
|
3119 |
-
|
3120 |
-
|
3121 |
-
|
3122 |
-
|
3123 |
-
|
3124 |
-
|
3125 |
-
|
3126 |
-
|
3127 |
-
|
3128 |
-
|
3129 |
-
|
3130 |
-
|
3131 |
-
|
3132 |
-
|
3133 |
-
|
3134 |
-
|
3135 |
-
|
3136 |
-
|
3137 |
-
|
3138 |
-
|
3139 |
-
|
3140 |
-
|
3141 |
-
|
3142 |
-
|
3143 |
-
|
3144 |
-
|
3145 |
-
|
3146 |
-
|
3147 |
-
|
3148 |
-
|
3149 |
-
|
3150 |
-
|
3151 |
-
|
3152 |
-
|
3153 |
-
|
3154 |
-
|
3155 |
-
|
3156 |
-
|
3157 |
-
.tab9 .
|
3158 |
-
|
3159 |
-
|
3160 |
-
|
3161 |
-
|
3162 |
-
.tab9 .
|
3163 |
-
|
3164 |
-
|
3165 |
-
|
3166 |
-
|
3167 |
-
|
3168 |
-
|
3169 |
-
|
3170 |
-
|
3171 |
-
|
3172 |
-
|
3173 |
-
|
3174 |
-
|
3175 |
-
|
3176 |
-
|
3177 |
-
|
3178 |
-
|
3179 |
-
|
3180 |
-
|
3181 |
-
|
3182 |
-
|
3183 |
-
|
3184 |
-
|
3185 |
-
|
3186 |
-
|
3187 |
-
|
3188 |
-
|
3189 |
-
|
3190 |
-
|
3191 |
-
|
3192 |
-
|
3193 |
-
width:
|
3194 |
-
|
3195 |
-
|
3196 |
-
|
3197 |
-
|
3198 |
-
|
3199 |
-
|
3200 |
-
font-
|
3201 |
-
|
3202 |
-
|
3203 |
-
|
3204 |
-
|
3205 |
-
|
3206 |
-
|
3207 |
-
border:
|
3208 |
-
|
3209 |
-
|
3210 |
-
|
3211 |
-
|
3212 |
-
|
3213 |
-
|
3214 |
-
|
3215 |
-
|
3216 |
-
|
3217 |
-
|
3218 |
-
padding-
|
3219 |
-
|
3220 |
-
|
3221 |
-
|
3222 |
-
|
3223 |
-
padding-
|
3224 |
-
|
3225 |
-
|
3226 |
-
|
3227 |
-
|
3228 |
-
|
3229 |
-
|
3230 |
-
|
3231 |
-
|
3232 |
-
|
3233 |
-
margin-
|
3234 |
-
|
3235 |
-
|
3236 |
-
|
3237 |
-
#accordion .tab9 ul.shwthmbfraftr .labelhdng4
|
3238 |
-
#
|
3239 |
-
|
3240 |
-
|
3241 |
-
|
3242 |
-
|
3243 |
-
|
3244 |
-
|
3245 |
-
|
3246 |
-
|
3247 |
-
|
3248 |
-
|
3249 |
-
|
3250 |
-
|
3251 |
-
|
3252 |
-
|
3253 |
-
|
3254 |
-
|
3255 |
-
|
3256 |
-
|
3257 |
-
|
3258 |
-
|
3259 |
-
|
3260 |
-
|
3261 |
-
|
3262 |
-
|
3263 |
-
|
3264 |
-
|
3265 |
-
|
3266 |
-
|
3267 |
-
|
3268 |
-
|
3269 |
-
|
3270 |
-
|
3271 |
-
|
3272 |
-
|
3273 |
-
|
3274 |
-
|
3275 |
-
|
3276 |
-
font-
|
3277 |
-
|
3278 |
-
|
3279 |
-
|
3280 |
-
|
3281 |
-
|
3282 |
-
|
3283 |
-
|
3284 |
-
|
3285 |
-
|
3286 |
-
|
3287 |
-
|
3288 |
-
|
3289 |
-
|
3290 |
-
|
3291 |
-
|
3292 |
-
|
3293 |
-
font-
|
3294 |
-
|
3295 |
-
|
3296 |
-
|
3297 |
-
|
3298 |
-
|
3299 |
-
|
3300 |
-
|
3301 |
-
|
3302 |
-
|
3303 |
-
|
3304 |
-
|
3305 |
-
|
3306 |
-
|
3307 |
-
|
3308 |
-
|
3309 |
-
|
3310 |
-
|
3311 |
-
|
3312 |
-
|
3313 |
-
|
3314 |
-
|
3315 |
-
|
3316 |
-
|
3317 |
-
|
3318 |
-
|
3319 |
-
|
3320 |
-
|
3321 |
-
|
3322 |
-
|
3323 |
-
|
3324 |
-
|
3325 |
-
|
3326 |
-
|
3327 |
-
|
3328 |
-
|
3329 |
-
|
3330 |
-
|
3331 |
-
|
3332 |
-
|
3333 |
-
|
3334 |
-
|
3335 |
-
|
3336 |
-
|
3337 |
-
.tab9 .
|
3338 |
-
|
3339 |
-
|
3340 |
-
|
3341 |
-
|
3342 |
-
|
3343 |
-
|
3344 |
-
|
3345 |
-
|
3346 |
-
|
3347 |
-
|
3348 |
-
|
3349 |
-
|
3350 |
-
|
3351 |
-
|
3352 |
-
|
3353 |
-
|
3354 |
-
|
3355 |
-
|
3356 |
-
|
3357 |
-
|
3358 |
-
|
3359 |
-
|
3360 |
-
|
3361 |
-
|
3362 |
-
|
3363 |
-
|
3364 |
-
|
3365 |
-
|
3366 |
-
|
3367 |
-
|
3368 |
-
|
3369 |
-
margin-
|
3370 |
-
|
3371 |
-
|
3372 |
-
|
3373 |
-
|
3374 |
-
|
3375 |
-
|
3376 |
-
|
3377 |
-
|
3378 |
-
|
3379 |
-
|
3380 |
-
|
3381 |
-
|
3382 |
-
|
3383 |
-
|
3384 |
-
|
3385 |
-
|
3386 |
-
|
3387 |
-
|
3388 |
-
|
3389 |
-
|
3390 |
-
|
3391 |
-
|
3392 |
-
|
3393 |
-
|
3394 |
-
|
3395 |
-
|
3396 |
-
|
3397 |
-
|
3398 |
-
|
3399 |
-
|
3400 |
-
|
3401 |
-
|
3402 |
-
|
3403 |
-
|
3404 |
-
.tab9 .
|
3405 |
-
|
3406 |
-
|
3407 |
-
|
3408 |
-
|
3409 |
-
|
3410 |
-
|
3411 |
-
|
3412 |
-
|
3413 |
-
|
3414 |
-
|
3415 |
-
|
3416 |
-
|
3417 |
-
|
3418 |
-
|
3419 |
-
|
3420 |
-
|
3421 |
-
|
3422 |
-
|
3423 |
-
|
3424 |
-
|
3425 |
-
|
3426 |
-
|
3427 |
-
|
3428 |
-
|
3429 |
-
|
3430 |
-
|
3431 |
-
|
3432 |
-
|
3433 |
-
|
3434 |
-
|
3435 |
-
|
3436 |
-
|
3437 |
-
|
3438 |
-
|
3439 |
-
|
3440 |
-
|
3441 |
-
|
3442 |
-
|
3443 |
-
|
3444 |
-
|
3445 |
-
|
3446 |
-
|
3447 |
-
padding-
|
3448 |
-
|
3449 |
-
|
3450 |
-
|
3451 |
-
|
3452 |
-
|
3453 |
-
|
3454 |
-
|
3455 |
-
|
3456 |
-
|
3457 |
-
|
3458 |
-
|
3459 |
-
|
3460 |
-
|
3461 |
-
|
3462 |
-
|
3463 |
-
|
3464 |
-
|
3465 |
-
|
3466 |
-
|
3467 |
-
|
3468 |
-
|
3469 |
-
|
3470 |
-
|
3471 |
-
|
3472 |
-
|
3473 |
-
|
3474 |
-
|
3475 |
-
|
3476 |
-
|
3477 |
-
|
3478 |
-
|
3479 |
-
|
3480 |
-
|
3481 |
-
|
3482 |
-
|
3483 |
-
|
3484 |
-
|
3485 |
-
|
3486 |
-
|
3487 |
-
|
3488 |
-
|
3489 |
-
margin-
|
3490 |
-
|
3491 |
-
|
3492 |
-
|
3493 |
-
|
3494 |
-
|
3495 |
-
|
3496 |
-
|
3497 |
-
|
3498 |
-
|
3499 |
-
|
3500 |
-
|
3501 |
-
|
3502 |
-
div#
|
3503 |
-
div#
|
3504 |
-
|
3505 |
-
|
3506 |
-
|
3507 |
-
|
3508 |
-
|
3509 |
-
|
3510 |
-
|
3511 |
-
|
3512 |
-
|
3513 |
-
|
3514 |
-
|
3515 |
-
|
3516 |
-
|
3517 |
-
|
3518 |
-
|
3519 |
-
|
3520 |
-
|
3521 |
-
|
3522 |
-
|
3523 |
-
|
3524 |
-
|
3525 |
-
|
3526 |
-
|
3527 |
-
|
3528 |
-
|
3529 |
-
|
3530 |
-
|
3531 |
-
|
3532 |
-
|
3533 |
-
|
3534 |
-
|
3535 |
-
|
3536 |
-
|
3537 |
-
|
3538 |
-
|
3539 |
-
|
3540 |
-
|
3541 |
-
|
3542 |
-
|
3543 |
-
|
3544 |
-
|
3545 |
-
|
3546 |
-
|
3547 |
-
|
3548 |
-
|
3549 |
-
|
3550 |
-
|
3551 |
-
|
3552 |
-
|
3553 |
-
|
3554 |
-
|
3555 |
-
.
|
3556 |
-
|
3557 |
-
|
3558 |
-
|
3559 |
-
|
3560 |
-
|
3561 |
-
|
3562 |
-
|
3563 |
-
|
3564 |
-
|
3565 |
-
|
3566 |
-
|
3567 |
-
|
3568 |
-
|
3569 |
-
|
3570 |
-
|
3571 |
-
|
3572 |
-
|
3573 |
-
|
3574 |
-
|
3575 |
-
|
3576 |
-
|
3577 |
-
|
3578 |
-
|
3579 |
-
|
3580 |
-
|
3581 |
-
|
3582 |
-
|
3583 |
-
|
3584 |
-
|
3585 |
-
|
3586 |
-
|
3587 |
-
|
3588 |
-
|
3589 |
-
|
3590 |
-
|
3591 |
-
|
3592 |
-
|
3593 |
-
|
3594 |
-
|
3595 |
-
|
3596 |
-
|
3597 |
-
|
3598 |
-
|
3599 |
-
|
3600 |
-
|
3601 |
-
|
3602 |
-
|
3603 |
-
|
3604 |
-
|
3605 |
-
|
3606 |
-
|
3607 |
-
|
3608 |
-
|
3609 |
-
|
3610 |
-
|
3611 |
-
|
3612 |
-
|
3613 |
-
|
3614 |
-
|
3615 |
-
|
3616 |
-
|
3617 |
-
|
3618 |
-
|
3619 |
-
|
3620 |
-
|
3621 |
-
|
3622 |
-
|
3623 |
-
|
3624 |
-
|
3625 |
-
.tab3 .other_icons_effects_options .
|
3626 |
-
|
3627 |
-
|
3628 |
-
|
3629 |
-
|
3630 |
-
|
3631 |
-
|
3632 |
-
|
3633 |
-
}
|
3634 |
-
.mouseover-premium-notice {
|
3635 |
-
|
3636 |
-
|
3637 |
-
|
3638 |
-
|
3639 |
-
|
3640 |
-
|
3641 |
-
|
3642 |
-
|
3643 |
-
|
3644 |
-
|
3645 |
-
|
3646 |
-
|
3647 |
-
|
3648 |
-
|
3649 |
-
|
3650 |
-
|
3651 |
-
|
3652 |
-
margin-
|
3653 |
-
|
3654 |
-
|
3655 |
-
|
3656 |
-
|
3657 |
-
|
3658 |
-
|
3659 |
-
|
3660 |
-
|
3661 |
-
|
3662 |
-
|
3663 |
-
|
3664 |
-
|
3665 |
-
|
3666 |
-
|
3667 |
-
|
3668 |
-
|
3669 |
-
|
3670 |
-
|
3671 |
-
|
3672 |
-
|
3673 |
-
margin-
|
3674 |
-
|
3675 |
-
|
3676 |
-
|
3677 |
-
|
3678 |
-
|
3679 |
-
|
3680 |
-
|
3681 |
-
|
3682 |
-
|
3683 |
-
|
3684 |
-
|
3685 |
-
|
3686 |
-
|
3687 |
-
|
3688 |
-
|
3689 |
-
|
3690 |
-
|
3691 |
-
|
3692 |
-
|
3693 |
-
|
3694 |
-
|
3695 |
-
|
3696 |
-
|
3697 |
-
|
3698 |
-
|
3699 |
-
|
3700 |
-
|
3701 |
-
.col-lg-
|
3702 |
-
.col-lg-
|
3703 |
-
.col-lg-
|
3704 |
-
.col-lg-
|
3705 |
-
.col-lg-
|
3706 |
-
.col-lg-
|
3707 |
-
.col-lg-
|
3708 |
-
.col-lg-
|
3709 |
-
.col-lg-
|
3710 |
-
.col-lg-
|
3711 |
-
.col-lg-
|
3712 |
-
.col-
|
3713 |
-
.col-md-
|
3714 |
-
.col-md-
|
3715 |
-
.col-md-
|
3716 |
-
.col-md-
|
3717 |
-
.col-md-
|
3718 |
-
.col-md-
|
3719 |
-
.col-md-
|
3720 |
-
.col-md-
|
3721 |
-
.col-md-
|
3722 |
-
.col-md-
|
3723 |
-
.col-md-
|
3724 |
-
.col-
|
3725 |
-
.col-sm-
|
3726 |
-
.col-sm-
|
3727 |
-
.col-sm-
|
3728 |
-
.col-sm-
|
3729 |
-
.col-sm-
|
3730 |
-
.col-sm-
|
3731 |
-
.col-sm-
|
3732 |
-
.col-sm-
|
3733 |
-
.col-sm-
|
3734 |
-
.col-sm-
|
3735 |
-
.col-sm-
|
3736 |
-
.col-
|
3737 |
-
.col-xs-
|
3738 |
-
.col-xs-
|
3739 |
-
.col-xs-
|
3740 |
-
.col-xs-
|
3741 |
-
.col-xs-
|
3742 |
-
.col-xs-
|
3743 |
-
.col-xs-
|
3744 |
-
.col-xs-
|
3745 |
-
.col-xs-
|
3746 |
-
.col-xs-
|
3747 |
-
.col-xs-
|
3748 |
-
|
3749 |
-
|
3750 |
-
|
3751 |
-
padding-
|
3752 |
-
|
3753 |
-
|
3754 |
-
|
3755 |
-
|
3756 |
-
|
3757 |
-
|
3758 |
-
|
3759 |
-
|
3760 |
-
|
3761 |
-
|
3762 |
-
|
3763 |
-
.col-md-
|
3764 |
-
.col-md-
|
3765 |
-
.col-md-
|
3766 |
-
.col-md-
|
3767 |
-
.col-md-
|
3768 |
-
.col-md-
|
3769 |
-
.col-md-
|
3770 |
-
.col-md-
|
3771 |
-
.col-md-
|
3772 |
-
.col-md-
|
3773 |
-
.col-md-
|
3774 |
-
|
3775 |
-
|
3776 |
-
|
3777 |
-
|
3778 |
-
|
3779 |
-
|
3780 |
-
|
3781 |
-
|
3782 |
-
|
3783 |
-
|
3784 |
-
|
3785 |
-
|
3786 |
-
|
3787 |
-
|
3788 |
-
|
3789 |
-
|
3790 |
-
|
3791 |
-
|
3792 |
-
|
3793 |
-
|
3794 |
-
|
3795 |
-
|
3796 |
-
|
3797 |
-
|
3798 |
-
|
3799 |
-
|
3800 |
-
|
3801 |
-
|
3802 |
-
|
3803 |
-
|
3804 |
-
|
3805 |
-
|
3806 |
-
|
3807 |
-
|
3808 |
-
|
3809 |
-
|
3810 |
-
|
3811 |
-
|
3812 |
-
|
3813 |
-
|
3814 |
-
|
3815 |
-
|
3816 |
-
|
3817 |
-
|
3818 |
-
|
3819 |
-
|
3820 |
-
|
3821 |
-
|
3822 |
-
|
3823 |
-
|
3824 |
-
|
3825 |
-
|
3826 |
-
|
3827 |
-
|
3828 |
-
|
3829 |
-
|
3830 |
-
|
3831 |
-
|
3832 |
-
|
3833 |
-
|
3834 |
-
|
3835 |
-
|
3836 |
-
|
3837 |
-
|
3838 |
-
|
3839 |
-
|
3840 |
-
|
3841 |
-
|
3842 |
-
|
3843 |
-
|
3844 |
-
|
3845 |
-
|
3846 |
-
|
3847 |
-
|
3848 |
-
|
3849 |
-
|
3850 |
-
|
3851 |
-
|
3852 |
-
|
3853 |
-
|
3854 |
-
|
3855 |
-
|
3856 |
-
|
3857 |
-
|
3858 |
-
|
3859 |
-
|
3860 |
-
|
3861 |
-
|
3862 |
-
|
3863 |
-
|
3864 |
-
|
3865 |
-
|
3866 |
-
|
3867 |
-
|
3868 |
-
|
3869 |
-
|
3870 |
-
|
3871 |
-
|
3872 |
-
|
3873 |
-
|
3874 |
-
|
3875 |
-
|
3876 |
-
|
3877 |
-
|
3878 |
-
|
3879 |
-
|
3880 |
-
|
3881 |
-
|
3882 |
-
|
3883 |
-
|
3884 |
-
|
3885 |
-
|
3886 |
-
|
3887 |
-
|
3888 |
-
|
3889 |
-
|
3890 |
-
|
3891 |
-
|
3892 |
-
|
3893 |
-
|
3894 |
-
|
3895 |
-
|
3896 |
-
|
3897 |
-
|
3898 |
-
|
3899 |
-
|
3900 |
-
|
3901 |
-
|
3902 |
-
|
3903 |
-
|
3904 |
-
|
3905 |
-
|
3906 |
-
|
3907 |
-
|
3908 |
-
|
3909 |
-
|
3910 |
-
|
3911 |
-
|
3912 |
-
|
3913 |
-
|
3914 |
-
|
3915 |
-
|
3916 |
-
|
3917 |
-
|
3918 |
-
|
3919 |
-
|
3920 |
-
|
3921 |
-
|
3922 |
-
|
3923 |
-
|
3924 |
-
|
3925 |
-
|
3926 |
-
|
3927 |
-
|
3928 |
-
|
3929 |
-
|
3930 |
-
|
3931 |
-
|
3932 |
-
|
3933 |
-
|
3934 |
-
|
3935 |
-
|
3936 |
-
|
3937 |
-
|
3938 |
-
|
3939 |
-
|
3940 |
-
|
3941 |
-
|
3942 |
-
|
3943 |
-
|
3944 |
-
|
3945 |
-
|
3946 |
-
|
3947 |
-
|
3948 |
-
|
3949 |
-
|
3950 |
-
|
3951 |
-
|
3952 |
-
|
3953 |
-
|
3954 |
-
|
3955 |
-
|
3956 |
-
|
3957 |
-
|
3958 |
-
|
3959 |
-
|
3960 |
-
|
3961 |
-
|
3962 |
-
|
3963 |
-
|
3964 |
-
|
3965 |
-
|
3966 |
-
|
3967 |
-
|
3968 |
-
|
3969 |
-
|
3970 |
-
|
3971 |
-
|
3972 |
-
|
3973 |
-
|
3974 |
-
|
3975 |
-
|
3976 |
-
|
3977 |
-
|
3978 |
-
|
3979 |
-
|
3980 |
-
|
3981 |
-
|
3982 |
-
|
3983 |
-
|
3984 |
-
.col-sm-
|
3985 |
-
.col-sm-
|
3986 |
-
.col-sm-
|
3987 |
-
.col-sm-
|
3988 |
-
.col-sm-
|
3989 |
-
.col-sm-
|
3990 |
-
.col-sm-
|
3991 |
-
.col-sm-
|
3992 |
-
.col-sm-
|
3993 |
-
.col-sm-
|
3994 |
-
.col-sm-
|
3995 |
-
|
3996 |
-
|
3997 |
-
|
3998 |
-
|
3999 |
-
|
4000 |
-
|
4001 |
-
|
4002 |
-
|
4003 |
-
|
4004 |
-
|
4005 |
-
|
4006 |
-
|
4007 |
-
|
4008 |
-
|
4009 |
-
|
4010 |
-
|
4011 |
-
|
4012 |
-
|
4013 |
-
|
4014 |
-
|
4015 |
-
|
4016 |
-
|
4017 |
-
|
4018 |
-
|
4019 |
-
|
4020 |
-
|
4021 |
-
|
4022 |
-
|
4023 |
-
|
4024 |
-
|
4025 |
-
|
4026 |
-
|
4027 |
-
|
4028 |
-
|
4029 |
-
|
4030 |
-
|
4031 |
-
|
4032 |
-
|
4033 |
-
|
4034 |
-
|
4035 |
-
|
4036 |
-
|
4037 |
-
|
4038 |
-
|
4039 |
-
|
4040 |
-
|
4041 |
-
|
4042 |
-
|
4043 |
-
|
4044 |
-
|
4045 |
-
|
4046 |
-
|
4047 |
-
|
4048 |
-
|
4049 |
-
|
4050 |
-
|
4051 |
-
|
4052 |
-
|
4053 |
-
|
4054 |
-
|
4055 |
-
|
4056 |
-
|
4057 |
-
|
4058 |
-
|
4059 |
-
|
4060 |
-
|
4061 |
-
|
4062 |
-
|
4063 |
-
|
4064 |
-
|
4065 |
-
|
4066 |
-
|
4067 |
-
|
4068 |
-
|
4069 |
-
|
4070 |
-
|
4071 |
-
|
4072 |
-
|
4073 |
-
|
4074 |
-
|
4075 |
-
|
4076 |
-
|
4077 |
-
|
4078 |
-
|
4079 |
-
|
4080 |
-
|
4081 |
-
|
4082 |
-
|
4083 |
-
|
4084 |
-
|
4085 |
-
|
4086 |
-
|
4087 |
-
|
4088 |
-
|
4089 |
-
|
4090 |
-
|
4091 |
-
|
4092 |
-
|
4093 |
-
|
4094 |
-
|
4095 |
-
|
4096 |
-
|
4097 |
-
|
4098 |
-
|
4099 |
-
|
4100 |
-
|
4101 |
-
|
4102 |
-
|
4103 |
-
|
4104 |
-
|
4105 |
-
|
4106 |
-
|
4107 |
-
|
4108 |
-
|
4109 |
-
|
4110 |
-
|
4111 |
-
|
4112 |
-
|
4113 |
-
|
4114 |
-
|
4115 |
-
|
4116 |
-
|
4117 |
-
|
4118 |
-
|
4119 |
-
|
4120 |
-
|
4121 |
-
|
4122 |
-
|
4123 |
-
|
4124 |
-
|
4125 |
-
|
4126 |
-
|
4127 |
-
|
4128 |
-
|
4129 |
-
|
4130 |
-
|
4131 |
-
|
4132 |
-
|
4133 |
-
|
4134 |
-
|
4135 |
-
|
4136 |
-
|
4137 |
-
|
4138 |
-
|
4139 |
-
|
4140 |
-
|
4141 |
-
|
4142 |
-
|
4143 |
-
|
4144 |
-
|
4145 |
-
|
4146 |
-
|
4147 |
-
|
4148 |
-
|
4149 |
-
|
4150 |
-
|
4151 |
-
|
4152 |
-
|
4153 |
-
|
4154 |
-
|
4155 |
-
|
4156 |
-
|
4157 |
-
|
4158 |
-
|
4159 |
-
|
4160 |
-
|
4161 |
-
|
4162 |
-
|
4163 |
-
|
4164 |
-
|
4165 |
-
|
4166 |
-
|
4167 |
-
|
4168 |
-
|
4169 |
-
|
4170 |
-
|
4171 |
-
|
4172 |
-
|
4173 |
-
|
4174 |
-
|
4175 |
-
|
4176 |
-
|
4177 |
-
|
4178 |
-
|
4179 |
-
|
4180 |
-
|
4181 |
-
|
4182 |
-
|
4183 |
-
|
4184 |
-
|
4185 |
-
|
4186 |
-
|
4187 |
-
|
4188 |
-
|
4189 |
-
|
4190 |
-
|
4191 |
-
|
4192 |
-
|
4193 |
-
|
4194 |
-
|
4195 |
-
|
4196 |
-
|
4197 |
-
|
4198 |
-
|
4199 |
-
|
4200 |
-
|
4201 |
-
|
4202 |
-
|
4203 |
-
|
4204 |
-
|
4205 |
-
.col-lg-
|
4206 |
-
.col-lg-
|
4207 |
-
.col-lg-
|
4208 |
-
.col-lg-
|
4209 |
-
.col-lg-
|
4210 |
-
.col-lg-
|
4211 |
-
.col-lg-
|
4212 |
-
.col-lg-
|
4213 |
-
.col-lg-
|
4214 |
-
.col-lg-
|
4215 |
-
.col-lg-
|
4216 |
-
|
4217 |
-
|
4218 |
-
|
4219 |
-
|
4220 |
-
|
4221 |
-
|
4222 |
-
|
4223 |
-
|
4224 |
-
|
4225 |
-
|
4226 |
-
|
4227 |
-
|
4228 |
-
|
4229 |
-
|
4230 |
-
|
4231 |
-
|
4232 |
-
|
4233 |
-
|
4234 |
-
|
4235 |
-
|
4236 |
-
|
4237 |
-
|
4238 |
-
|
4239 |
-
|
4240 |
-
|
4241 |
-
|
4242 |
-
|
4243 |
-
|
4244 |
-
|
4245 |
-
|
4246 |
-
|
4247 |
-
|
4248 |
-
|
4249 |
-
|
4250 |
-
|
4251 |
-
|
4252 |
-
|
4253 |
-
|
4254 |
-
|
4255 |
-
|
4256 |
-
|
4257 |
-
|
4258 |
-
|
4259 |
-
|
4260 |
-
|
4261 |
-
|
4262 |
-
|
4263 |
-
|
4264 |
-
|
4265 |
-
|
4266 |
-
|
4267 |
-
|
4268 |
-
|
4269 |
-
|
4270 |
-
|
4271 |
-
|
4272 |
-
|
4273 |
-
|
4274 |
-
|
4275 |
-
|
4276 |
-
|
4277 |
-
|
4278 |
-
|
4279 |
-
|
4280 |
-
|
4281 |
-
|
4282 |
-
|
4283 |
-
|
4284 |
-
|
4285 |
-
|
4286 |
-
|
4287 |
-
|
4288 |
-
|
4289 |
-
|
4290 |
-
|
4291 |
-
|
4292 |
-
|
4293 |
-
|
4294 |
-
|
4295 |
-
|
4296 |
-
|
4297 |
-
|
4298 |
-
|
4299 |
-
|
4300 |
-
|
4301 |
-
|
4302 |
-
|
4303 |
-
|
4304 |
-
|
4305 |
-
|
4306 |
-
|
4307 |
-
|
4308 |
-
|
4309 |
-
|
4310 |
-
|
4311 |
-
|
4312 |
-
|
4313 |
-
|
4314 |
-
|
4315 |
-
|
4316 |
-
|
4317 |
-
|
4318 |
-
|
4319 |
-
|
4320 |
-
|
4321 |
-
|
4322 |
-
|
4323 |
-
|
4324 |
-
|
4325 |
-
|
4326 |
-
|
4327 |
-
|
4328 |
-
|
4329 |
-
|
4330 |
-
|
4331 |
-
|
4332 |
-
|
4333 |
-
|
4334 |
-
|
4335 |
-
|
4336 |
-
|
4337 |
-
|
4338 |
-
|
4339 |
-
|
4340 |
-
|
4341 |
-
|
4342 |
-
|
4343 |
-
|
4344 |
-
|
4345 |
-
|
4346 |
-
|
4347 |
-
|
4348 |
-
|
4349 |
-
|
4350 |
-
|
4351 |
-
|
4352 |
-
|
4353 |
-
|
4354 |
-
|
4355 |
-
|
4356 |
-
|
4357 |
-
|
4358 |
-
|
4359 |
-
|
4360 |
-
|
4361 |
-
|
4362 |
-
|
4363 |
-
|
4364 |
-
|
4365 |
-
|
4366 |
-
|
4367 |
-
|
4368 |
-
|
4369 |
-
|
4370 |
-
|
4371 |
-
|
4372 |
-
|
4373 |
-
|
4374 |
-
|
4375 |
-
|
4376 |
-
|
4377 |
-
|
4378 |
-
|
4379 |
-
|
4380 |
-
|
4381 |
-
|
4382 |
-
|
4383 |
-
|
4384 |
-
|
4385 |
-
|
4386 |
-
|
4387 |
-
|
4388 |
-
|
4389 |
-
|
4390 |
-
|
4391 |
-
|
4392 |
-
|
4393 |
-
|
4394 |
-
|
4395 |
-
|
4396 |
-
|
4397 |
-
|
4398 |
-
|
4399 |
-
|
4400 |
-
|
4401 |
-
|
4402 |
-
|
4403 |
-
|
4404 |
-
|
4405 |
-
|
4406 |
-
|
4407 |
-
|
4408 |
-
|
4409 |
-
|
4410 |
-
|
4411 |
-
|
4412 |
-
|
4413 |
-
|
4414 |
-
|
4415 |
-
|
4416 |
-
|
4417 |
-
|
4418 |
-
|
4419 |
-
|
4420 |
-
|
4421 |
-
|
4422 |
-
|
4423 |
-
|
4424 |
-
|
4425 |
-
|
4426 |
-
|
4427 |
-
|
4428 |
-
|
4429 |
-
|
4430 |
-
|
4431 |
-
border-top-
|
4432 |
-
|
4433 |
-
|
4434 |
-
border:
|
4435 |
-
|
4436 |
-
|
4437 |
-
|
4438 |
-
font-
|
4439 |
-
|
4440 |
-
|
4441 |
-
|
4442 |
-
|
4443 |
-
font-
|
4444 |
-
|
4445 |
-
|
4446 |
-
|
4447 |
-
|
4448 |
-
|
4449 |
-
|
4450 |
-
|
4451 |
-
|
4452 |
-
|
4453 |
-
|
4454 |
-
|
4455 |
-
|
4456 |
-
|
4457 |
-
|
4458 |
-
|
4459 |
-
|
4460 |
-
|
4461 |
-
|
4462 |
-
|
4463 |
-
|
4464 |
-
|
4465 |
-
#
|
4466 |
-
|
4467 |
-
|
4468 |
-
|
4469 |
-
border-top-
|
4470 |
-
|
4471 |
-
|
4472 |
-
|
4473 |
-
|
4474 |
-
|
4475 |
-
|
4476 |
-
|
4477 |
-
|
4478 |
-
#
|
4479 |
-
|
4480 |
-
|
4481 |
-
|
4482 |
-
#
|
4483 |
-
|
4484 |
-
|
4485 |
-
|
4486 |
-
|
4487 |
-
|
4488 |
-
|
4489 |
-
|
4490 |
-
|
4491 |
-
|
4492 |
-
|
4493 |
-
|
4494 |
-
|
4495 |
-
|
4496 |
-
|
4497 |
-
|
4498 |
-
|
4499 |
-
|
4500 |
-
|
4501 |
-
|
4502 |
-
|
4503 |
-
|
4504 |
-
|
4505 |
-
margin:
|
4506 |
-
|
4507 |
-
|
4508 |
-
|
4509 |
-
|
4510 |
-
|
4511 |
-
|
4512 |
-
|
4513 |
-
|
4514 |
-
|
4515 |
-
|
4516 |
-
|
4517 |
-
|
4518 |
-
|
4519 |
-
|
4520 |
-
|
4521 |
-
|
4522 |
-
|
4523 |
-
|
4524 |
-
|
4525 |
-
|
4526 |
-
|
4527 |
-
#sfsi_jivo_offline_chat .tabs #sfsi_sales
|
4528 |
-
|
4529 |
-
|
4530 |
-
|
4531 |
-
|
4532 |
-
|
4533 |
-
|
4534 |
-
|
4535 |
-
|
4536 |
-
|
4537 |
-
|
4538 |
-
|
4539 |
-
|
4540 |
-
|
4541 |
-
#sfsi_jivo_offline_chat .tabs #sfsi_sales
|
4542 |
-
|
4543 |
-
|
4544 |
-
|
4545 |
-
|
4546 |
-
|
4547 |
-
|
4548 |
-
|
4549 |
-
|
4550 |
-
|
4551 |
-
|
4552 |
-
|
4553 |
-
|
4554 |
-
|
4555 |
-
|
4556 |
-
|
4557 |
-
|
4558 |
-
|
4559 |
-
|
4560 |
-
font-
|
4561 |
-
|
4562 |
-
|
4563 |
-
|
4564 |
-
|
4565 |
-
|
4566 |
-
|
4567 |
-
|
4568 |
-
|
4569 |
-
font-
|
4570 |
-
|
4571 |
-
/*
|
4572 |
-
|
4573 |
-
margin-
|
4574 |
-
|
4575 |
-
|
4576 |
-
|
4577 |
-
|
4578 |
-
|
4579 |
-
|
4580 |
-
|
4581 |
-
-
|
4582 |
-
-
|
4583 |
-
-
|
4584 |
-
|
4585 |
-
|
4586 |
-
|
4587 |
-
|
4588 |
-
|
4589 |
-
|
4590 |
-
|
4591 |
-
|
4592 |
-
|
4593 |
-
#
|
4594 |
-
|
4595 |
-
|
4596 |
-
|
4597 |
-
|
4598 |
-
|
4599 |
-
|
4600 |
-
|
4601 |
-
|
4602 |
-
|
4603 |
-
|
4604 |
-
|
4605 |
-
#
|
4606 |
-
|
4607 |
-
|
4608 |
-
|
4609 |
-
|
4610 |
-
|
4611 |
-
|
4612 |
-
font-
|
4613 |
-
|
4614 |
-
|
4615 |
-
|
4616 |
-
font-
|
4617 |
-
|
4618 |
-
|
4619 |
-
|
4620 |
-
|
4621 |
-
#
|
4622 |
-
|
4623 |
-
|
4624 |
-
|
4625 |
-
|
4626 |
-
|
4627 |
-
|
4628 |
-
|
4629 |
-
|
4630 |
-
font-
|
4631 |
-
|
4632 |
-
|
4633 |
-
|
4634 |
-
|
4635 |
-
|
4636 |
-
|
4637 |
-
|
4638 |
-
|
4639 |
-
|
4640 |
-
|
4641 |
-
|
4642 |
-
|
4643 |
-
|
4644 |
-
font-
|
4645 |
-
|
4646 |
-
|
4647 |
-
|
4648 |
-
|
4649 |
-
|
4650 |
-
|
4651 |
-
font-
|
4652 |
-
|
4653 |
-
|
4654 |
-
|
4655 |
-
|
4656 |
-
#sfsi_jivo_offline_chat .tabs #sfsi_sales
|
4657 |
-
|
4658 |
-
|
4659 |
-
|
4660 |
-
|
4661 |
-
|
4662 |
-
|
4663 |
-
|
4664 |
-
|
4665 |
-
|
4666 |
-
|
4667 |
-
|
4668 |
-
|
4669 |
-
|
4670 |
-
|
4671 |
-
|
4672 |
-
|
4673 |
-
|
4674 |
-
|
4675 |
-
|
4676 |
-
|
4677 |
-
|
4678 |
-
|
4679 |
-
font-
|
4680 |
-
|
4681 |
-
margin-
|
4682 |
-
|
4683 |
-
|
4684 |
-
|
4685 |
-
|
4686 |
-
|
4687 |
-
|
4688 |
-
|
4689 |
-
|
4690 |
-
|
4691 |
-
|
4692 |
-
|
4693 |
-
|
4694 |
-
|
4695 |
-
|
4696 |
-
|
4697 |
-
|
4698 |
-
|
4699 |
-
|
4700 |
-
|
4701 |
-
font-
|
4702 |
-
|
4703 |
-
|
4704 |
-
|
4705 |
-
|
4706 |
-
|
4707 |
-
|
4708 |
-
|
4709 |
-
|
4710 |
-
|
4711 |
-
|
4712 |
-
|
4713 |
-
|
4714 |
-
|
4715 |
-
|
4716 |
-
|
4717 |
-
|
4718 |
-
font-
|
4719 |
-
|
4720 |
-
|
4721 |
-
|
4722 |
-
|
4723 |
-
font-
|
4724 |
-
|
4725 |
-
|
4726 |
-
|
4727 |
-
|
4728 |
-
|
4729 |
-
|
4730 |
-
|
4731 |
-
|
4732 |
-
|
4733 |
-
|
4734 |
-
|
4735 |
-
|
4736 |
-
|
4737 |
-
|
4738 |
-
|
4739 |
-
|
4740 |
-
|
4741 |
-
|
4742 |
-
|
4743 |
-
|
4744 |
-
|
4745 |
-
|
4746 |
-
|
4747 |
-
|
4748 |
-
|
4749 |
-
|
4750 |
-
|
4751 |
-
|
4752 |
-
|
4753 |
-
|
4754 |
-
|
4755 |
-
|
4756 |
-
|
4757 |
-
|
4758 |
-
|
4759 |
-
|
4760 |
-
|
4761 |
-
|
4762 |
-
|
4763 |
-
|
4764 |
-
|
4765 |
-
|
4766 |
-
|
4767 |
-
|
4768 |
-
|
4769 |
-
|
4770 |
-
|
4771 |
-
|
4772 |
-
|
4773 |
-
|
4774 |
-
|
4775 |
-
|
4776 |
-
|
4777 |
-
|
4778 |
-
|
4779 |
-
|
4780 |
-
|
4781 |
-
|
4782 |
-
|
4783 |
-
|
4784 |
-
|
4785 |
-
|
4786 |
-
|
4787 |
-
|
4788 |
-
|
4789 |
-
|
4790 |
-
|
4791 |
-
|
4792 |
-
|
4793 |
-
|
4794 |
-
|
4795 |
-
|
4796 |
-
|
4797 |
-
|
4798 |
-
|
4799 |
-
|
4800 |
-
|
4801 |
-
|
4802 |
-
|
4803 |
-
|
4804 |
-
|
4805 |
-
|
4806 |
-
|
4807 |
-
|
4808 |
-
|
4809 |
-
|
4810 |
-
|
4811 |
-
|
4812 |
-
|
4813 |
-
|
4814 |
-
|
4815 |
-
|
4816 |
-
|
4817 |
-
|
4818 |
-
|
4819 |
-
|
4820 |
-
|
4821 |
-
|
4822 |
-
|
4823 |
-
|
4824 |
-
|
4825 |
-
|
4826 |
-
|
4827 |
-
font-
|
4828 |
-
font-
|
4829 |
-
|
4830 |
-
|
4831 |
-
|
4832 |
-
|
4833 |
-
|
4834 |
-
|
4835 |
-
|
4836 |
-
|
4837 |
-
|
4838 |
-
|
4839 |
-
|
4840 |
-
|
4841 |
-
|
4842 |
-
|
4843 |
-
|
4844 |
-
|
4845 |
-
|
4846 |
-
|
4847 |
-
|
4848 |
-
|
4849 |
-
|
4850 |
-
|
4851 |
-
|
4852 |
-
|
4853 |
-
|
4854 |
-
|
4855 |
-
|
4856 |
-
|
4857 |
-
|
4858 |
-
|
4859 |
-
|
4860 |
-
|
4861 |
-
|
4862 |
-
|
4863 |
-
|
4864 |
-
|
4865 |
-
|
4866 |
-
|
4867 |
-
|
4868 |
-
|
4869 |
-
|
4870 |
-
|
4871 |
-
|
4872 |
-
|
4873 |
-
|
4874 |
-
|
4875 |
-
|
4876 |
-
|
4877 |
-
|
4878 |
-
margin-
|
4879 |
-
|
4880 |
-
|
4881 |
-
|
4882 |
-
|
4883 |
-
|
4884 |
-
|
4885 |
-
box-shadow: unset !important;
|
4886 |
-
-
|
4887 |
-
max-
|
4888 |
-
|
4889 |
-
|
4890 |
-
|
4891 |
-
|
4892 |
-
|
4893 |
-
|
4894 |
-
box-shadow: unset !important;
|
4895 |
-
-
|
4896 |
-
|
4897 |
-
|
4898 |
-
|
4899 |
-
|
4900 |
-
|
4901 |
-
|
4902 |
-
|
4903 |
-
|
4904 |
-
|
4905 |
-
|
4906 |
-
|
4907 |
-
|
4908 |
-
|
4909 |
-
|
4910 |
-
|
4911 |
-
|
4912 |
-
flex-
|
4913 |
-
flex-
|
4914 |
-
|
4915 |
-
|
4916 |
-
|
4917 |
-
|
4918 |
-
font-
|
4919 |
-
|
4920 |
-
|
4921 |
-
|
4922 |
-
|
4923 |
-
|
4924 |
-
|
4925 |
-
font-
|
4926 |
-
|
4927 |
-
|
4928 |
-
|
4929 |
-
|
4930 |
-
.
|
4931 |
-
|
4932 |
-
|
4933 |
-
|
4934 |
-
margin-
|
4935 |
-
|
4936 |
-
|
4937 |
-
|
4938 |
-
.
|
4939 |
-
|
4940 |
-
max-
|
4941 |
-
|
4942 |
-
|
4943 |
-
|
4944 |
-
|
4945 |
-
|
4946 |
-
.
|
4947 |
-
|
4948 |
-
|
4949 |
-
|
4950 |
-
|
4951 |
-
|
4952 |
-
|
4953 |
-
|
4954 |
-
|
4955 |
-
.tab6 .
|
4956 |
-
|
4957 |
-
width:
|
4958 |
-
|
4959 |
-
|
4960 |
-
|
4961 |
-
|
4962 |
-
|
4963 |
-
|
4964 |
-
|
4965 |
-
|
4966 |
-
|
4967 |
-
|
4968 |
-
font-
|
4969 |
-
|
4970 |
-
|
4971 |
-
|
4972 |
-
.
|
4973 |
-
|
4974 |
-
|
4975 |
-
|
4976 |
-
|
4977 |
-
.
|
4978 |
-
.
|
4979 |
-
|
4980 |
-
|
4981 |
-
|
4982 |
-
|
4983 |
-
|
4984 |
-
|
4985 |
-
|
4986 |
-
|
4987 |
-
|
4988 |
-
|
4989 |
-
|
4990 |
-
|
4991 |
-
|
4992 |
-
|
4993 |
-
|
4994 |
-
|
4995 |
-
|
4996 |
-
|
4997 |
-
|
4998 |
-
|
4999 |
-
|
5000 |
-
|
5001 |
-
|
5002 |
-
|
5003 |
-
|
5004 |
-
/* .sfsi_responsive_custom_icon{line-height: 6px;} */
|
5005 |
-
/*
|
5006 |
-
/*
|
5007 |
-
/* .sfsi_responsive_fluid .
|
5008 |
-
|
5009 |
-
|
5010 |
-
|
5011 |
-
|
5012 |
-
|
5013 |
-
|
5014 |
-
|
5015 |
-
|
5016 |
-
|
5017 |
-
|
5018 |
-
|
5019 |
-
|
5020 |
-
|
5021 |
-
|
5022 |
-
|
5023 |
-
|
5024 |
-
|
5025 |
-
|
5026 |
-
|
5027 |
-
|
5028 |
-
|
5029 |
-
|
5030 |
-
|
5031 |
-
|
5032 |
-
|
5033 |
-
|
5034 |
-
|
5035 |
-
|
5036 |
-
overflow:
|
5037 |
-
|
5038 |
-
|
5039 |
-
|
5040 |
-
|
5041 |
-
.sfsi_right_info ul .sfsi_responsive_icon_option_li .options .field
|
5042 |
-
|
5043 |
-
|
5044 |
-
|
5045 |
-
|
5046 |
-
border:
|
5047 |
-
|
5048 |
-
|
5049 |
-
|
5050 |
-
|
5051 |
-
|
5052 |
-
|
5053 |
-
|
5054 |
-
|
5055 |
-
|
5056 |
-
|
5057 |
-
|
5058 |
-
|
5059 |
-
|
5060 |
-
|
5061 |
-
|
5062 |
-
|
5063 |
-
|
5064 |
-
|
5065 |
-
|
5066 |
-
|
5067 |
-
|
5068 |
-
|
5069 |
-
|
5070 |
-
|
5071 |
-
|
5072 |
-
|
5073 |
-
|
5074 |
-
|
5075 |
-
|
5076 |
-
|
5077 |
-
|
5078 |
-
|
5079 |
-
|
5080 |
-
|
5081 |
-
|
5082 |
-
|
5083 |
-
|
5084 |
-
|
5085 |
-
|
5086 |
-
|
5087 |
-
|
5088 |
-
|
5089 |
-
|
5090 |
-
|
5091 |
-
|
5092 |
-
|
5093 |
-
|
5094 |
-
|
5095 |
-
|
5096 |
-
|
5097 |
-
|
5098 |
-
|
5099 |
-
|
5100 |
-
|
5101 |
-
|
5102 |
-
|
5103 |
-
|
5104 |
-
|
5105 |
-
|
5106 |
-
|
5107 |
-
|
5108 |
-
|
5109 |
-
|
5110 |
-
|
5111 |
-
|
5112 |
-
|
5113 |
-
|
5114 |
-
|
5115 |
-
|
5116 |
-
|
5117 |
-
|
5118 |
-
|
5119 |
-
|
5120 |
-
|
5121 |
-
|
5122 |
-
|
5123 |
-
|
5124 |
-
|
5125 |
-
|
5126 |
-
|
5127 |
-
|
5128 |
-
|
5129 |
-
|
5130 |
-
|
5131 |
-
|
5132 |
-
|
5133 |
-
|
5134 |
-
|
5135 |
-
|
5136 |
-
|
5137 |
-
|
5138 |
-
|
5139 |
-
|
5140 |
-
|
5141 |
-
|
5142 |
-
|
5143 |
-
|
5144 |
-
|
5145 |
-
|
5146 |
-
|
5147 |
-
|
5148 |
-
|
5149 |
-
|
5150 |
-
|
5151 |
-
|
5152 |
-
|
5153 |
-
|
5154 |
-
|
5155 |
-
|
5156 |
-
|
5157 |
-
|
5158 |
-
|
5159 |
-
|
5160 |
-
|
5161 |
-
|
5162 |
-
|
5163 |
-
|
5164 |
-
|
5165 |
-
|
5166 |
-
|
5167 |
-
|
5168 |
-
|
5169 |
-
|
5170 |
-
|
5171 |
-
|
5172 |
-
|
5173 |
-
|
5174 |
-
|
5175 |
-
|
5176 |
-
|
5177 |
-
|
5178 |
-
|
5179 |
-
margin-
|
5180 |
-
|
5181 |
-
|
5182 |
-
|
5183 |
-
|
5184 |
-
font-
|
5185 |
-
font-
|
5186 |
-
|
5187 |
-
|
5188 |
-
|
5189 |
-
|
5190 |
-
|
5191 |
-
|
5192 |
-
|
5193 |
-
font-
|
5194 |
-
|
5195 |
-
|
5196 |
-
|
5197 |
-
|
5198 |
-
|
5199 |
-
|
5200 |
-
|
5201 |
-
|
5202 |
-
|
5203 |
-
|
5204 |
-
|
5205 |
-
|
5206 |
-
|
5207 |
-
|
5208 |
-
|
5209 |
-
|
5210 |
-
|
5211 |
-
|
5212 |
-
|
5213 |
-
|
5214 |
-
|
5215 |
-
|
5216 |
-
|
5217 |
-
|
5218 |
-
|
5219 |
-
|
5220 |
-
|
5221 |
-
|
5222 |
-
|
5223 |
-
|
5224 |
-
|
5225 |
-
|
5226 |
-
|
5227 |
-
|
5228 |
-
|
5229 |
-
|
5230 |
-
|
5231 |
-
|
5232 |
-
|
5233 |
-
|
5234 |
-
|
5235 |
-
font-
|
5236 |
-
|
5237 |
-
|
5238 |
-
|
5239 |
-
|
5240 |
-
|
5241 |
-
|
5242 |
-
|
5243 |
-
|
5244 |
-
|
5245 |
-
|
5246 |
-
|
5247 |
-
|
5248 |
-
|
5249 |
-
font-
|
5250 |
-
|
5251 |
-
|
5252 |
-
|
5253 |
-
|
5254 |
-
|
5255 |
-
|
5256 |
-
|
5257 |
-
|
5258 |
-
|
5259 |
-
|
5260 |
-
|
5261 |
-
|
5262 |
-
|
5263 |
-
font-
|
5264 |
-
|
5265 |
-
|
5266 |
-
|
5267 |
-
|
5268 |
-
|
5269 |
-
#
|
5270 |
-
|
5271 |
-
|
5272 |
-
|
5273 |
-
|
5274 |
-
|
5275 |
-
#
|
5276 |
-
|
5277 |
-
|
5278 |
-
|
5279 |
-
|
5280 |
-
|
5281 |
-
|
5282 |
-
|
5283 |
-
|
5284 |
-
|
5285 |
-
.
|
5286 |
-
opacity: 0.3;
|
5287 |
}
|
1 |
+
@charset "utf-8";
|
2 |
+
@font-face {
|
3 |
+
font-family: helveticabold;
|
4 |
+
src: url(fonts/helvetica_bold_0-webfont.eot);
|
5 |
+
src: url(fonts/helvetica_bold_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_bold_0-webfont.woff) format('woff'), url(fonts/helvetica_bold_0-webfont.ttf) format('truetype'), url(fonts/helvetica_bold_0-webfont.svg#helveticabold) format('svg');
|
6 |
+
font-weight: 400;
|
7 |
+
font-style: normal;
|
8 |
+
}
|
9 |
+
@font-face {
|
10 |
+
font-family: helveticaregular;
|
11 |
+
src: url(fonts/helvetica_0-webfont.eot);
|
12 |
+
src: url(fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_0-webfont.woff) format('woff'), url(fonts/helvetica_0-webfont.ttf) format('truetype'), url(fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');
|
13 |
+
font-weight: 400;
|
14 |
+
font-style: normal;
|
15 |
+
}
|
16 |
+
@font-face {
|
17 |
+
font-family: helveticaneue-light;
|
18 |
+
src: url(fonts/helveticaneue-light.eot);
|
19 |
+
src: url(fonts/helveticaneue-light.eot?#iefix) format('embedded-opentype'),
|
20 |
+
url(fonts/helveticaneue-light.woff) format('woff'),
|
21 |
+
url(fonts/helveticaneue-light.ttf) format('truetype'),
|
22 |
+
url(fonts/helveticaneue-light.svg#helveticaneue-light) format('svg');
|
23 |
+
font-weight: 400;
|
24 |
+
font-style: normal;
|
25 |
+
}
|
26 |
+
body {
|
27 |
+
margin: 0;
|
28 |
+
padding: 0;
|
29 |
+
}
|
30 |
+
.sfsi_mainContainer {
|
31 |
+
font-family: helveticaregular;
|
32 |
+
}
|
33 |
+
.sfsi_mainContainer h1,
|
34 |
+
.sfsi_mainContainer h2,
|
35 |
+
.sfsi_mainContainer h3,
|
36 |
+
.sfsi_mainContainer h4,
|
37 |
+
.sfsi_mainContainer h5,
|
38 |
+
.sfsi_mainContainer h6,
|
39 |
+
.sfsi_mainContainer li,
|
40 |
+
.sfsi_mainContainer p,
|
41 |
+
.sfsi_mainContainer ul {
|
42 |
+
margin: 0;
|
43 |
+
padding: 0;
|
44 |
+
font-weight: 400;
|
45 |
+
}
|
46 |
+
.sfsi_mainContainer img {
|
47 |
+
border: 0;
|
48 |
+
vertical-align: middle;
|
49 |
+
}
|
50 |
+
.main_contant p,
|
51 |
+
.ui-accordion .ui-accordion-header {
|
52 |
+
/*font-family: helveticaregular;*/
|
53 |
+
font-family: 'helveticaneue-light';
|
54 |
+
}
|
55 |
+
.sfsi_mainContainer input,
|
56 |
+
.sfsi_mainContainer select {
|
57 |
+
outline: 0;
|
58 |
+
}
|
59 |
+
.wapper {
|
60 |
+
padding: 30px 40px 40px 40px;
|
61 |
+
display: block;
|
62 |
+
background: #f1f1f1;
|
63 |
+
}
|
64 |
+
.main_contant {
|
65 |
+
margin: 0;
|
66 |
+
padding: 20px 0 0 0;
|
67 |
+
width: 100%;
|
68 |
+
float: left;
|
69 |
+
}
|
70 |
+
.main_contant h1 {
|
71 |
+
padding: 0;
|
72 |
+
color: #1a1d20;
|
73 |
+
font-family: helveticabold;
|
74 |
+
font-size: 28px;
|
75 |
+
}
|
76 |
+
.main_contant p {
|
77 |
+
padding: 0;
|
78 |
+
color: #414951;
|
79 |
+
font-size: 17px;
|
80 |
+
line-height: 26px;
|
81 |
+
}
|
82 |
+
.main_contant p span {
|
83 |
+
text-decoration: underline;
|
84 |
+
font-family: helveticabold;
|
85 |
+
}
|
86 |
+
a#save_all_settings {
|
87 |
+
padding: 15px 10px;
|
88 |
+
}
|
89 |
+
#accordion p,
|
90 |
+
#accordion1 p {
|
91 |
+
color: #5a6570;
|
92 |
+
text-align: left;
|
93 |
+
/*font-family: helveticaregular;*/
|
94 |
+
font-family: 'helveticaneue-light';
|
95 |
+
font-size: 17px;
|
96 |
+
line-height: 26px;
|
97 |
+
padding-top: 19px;
|
98 |
+
}
|
99 |
+
#accordion p:first-child,
|
100 |
+
#accordion1 p:first-child {
|
101 |
+
padding-top: 5px;
|
102 |
+
|
103 |
+
/* padding-bottom: 10px;*/
|
104 |
+
|
105 |
+
padding-bottom: 5px;
|
106 |
+
}
|
107 |
+
#accordion h4,
|
108 |
+
#accordion1 h4 {
|
109 |
+
margin: 0;
|
110 |
+
padding: 30px 0 0;
|
111 |
+
color: #414951 !important;
|
112 |
+
font-size: 20px;
|
113 |
+
line-height: 22px;
|
114 |
+
font-family: helveticaregular;
|
115 |
+
}
|
116 |
+
#accordion1 h4.sfsi_dsplyatend {
|
117 |
+
width: 47%;
|
118 |
+
float: left;
|
119 |
+
}
|
120 |
+
#accordion h4:first-child,
|
121 |
+
#accordion1 h4:first-child {
|
122 |
+
padding-top: 0;
|
123 |
+
}
|
124 |
+
.tab1,
|
125 |
+
.tab2,
|
126 |
+
.tab3,
|
127 |
+
.tab4,
|
128 |
+
.tab5,
|
129 |
+
.tab6,
|
130 |
+
.tab7 {
|
131 |
+
color: #5a6570;
|
132 |
+
text-align: left;
|
133 |
+
font-family: helveticaneue-light;
|
134 |
+
font-size: 18px;
|
135 |
+
line-height: 26px;
|
136 |
+
}
|
137 |
+
|
138 |
+
/*Admin menu*/
|
139 |
+
ul#adminmenu li.toplevel_page_sfsi-options div.wp-menu-image {
|
140 |
+
display: none;
|
141 |
+
}
|
142 |
+
#adminmenu li.toplevel_page_sfsi-options a.toplevel_page_sfsi-options {
|
143 |
+
padding: 0 0 0 38px;
|
144 |
+
font-family: Arial, Helvetica, sans-serif !important;
|
145 |
+
|
146 |
+
/* font-family: helveticabold; */
|
147 |
+
}
|
148 |
+
ul#adminmenu li.toplevel_page_sfsi-options a.toplevel_page_sfsi-options {
|
149 |
+
color: #e12522;
|
150 |
+
transition: 0s;
|
151 |
+
background: url(images/left_log_icn.png) 6px 15px no-repeat #000;
|
152 |
+
background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;
|
153 |
+
color: #e12522;
|
154 |
+
font-family: Arial, Helvetica, sans-serif !important;
|
155 |
+
|
156 |
+
}
|
157 |
+
ul#adminmenu li.toplevel_page_sfsi-options a.toplevel_page_sfsi-options:hover {
|
158 |
+
background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;
|
159 |
+
color: #e12522;
|
160 |
+
|
161 |
+
}
|
162 |
+
|
163 |
+
ul#adminmenu li.toplevel_page_sfsi-options a.current,
|
164 |
+
ul#adminmenu li.toplevel_page_sfsi-options a.current:hover {
|
165 |
+
background: url(images/left_log_icn.png) 6px 15px no-repeat #000000;
|
166 |
+
/*background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;*/
|
167 |
+
color: #e12522;
|
168 |
+
}
|
169 |
+
/*Tab1*/
|
170 |
+
.tab1 ul.icn_listing {
|
171 |
+
list-style: none;
|
172 |
+
overflow: hidden;
|
173 |
+
border-top: #e7e8eb solid 1px;
|
174 |
+
margin: 35px 0 0;
|
175 |
+
}
|
176 |
+
.tab1 ul.icn_listing li {
|
177 |
+
border-bottom: #eaebed solid 1px;
|
178 |
+
padding: 11px 0 11px 8px;
|
179 |
+
float: left;
|
180 |
+
width: 100%
|
181 |
+
}
|
182 |
+
ul.icn_listing li .tb_4_ck {
|
183 |
+
float: left;
|
184 |
+
margin: 10px 0 0;
|
185 |
+
}
|
186 |
+
.tab1 ul.icn_listing li .custom,
|
187 |
+
.tab1 ul.icn_listing li .sfsicls_email,
|
188 |
+
.tab1 ul.icn_listing li .sfsicls_facebook,
|
189 |
+
.tab1 ul.icn_listing li .sfsicls_instagram,
|
190 |
+
.tab1 ul.icn_listing li .sfsicls_telegram,
|
191 |
+
.tab1 ul.icn_listing li .sfsicls_vk,
|
192 |
+
.tab1 ul.icn_listing li .sfsicls_ok,
|
193 |
+
.tab1 ul.icn_listing li .sfsicls_wechat,
|
194 |
+
.tab1 ul.icn_listing li .sfsicls_weibo,
|
195 |
+
.sfsicls_linkdin,
|
196 |
+
.tab1 ul.icn_listing li .sfsicls_pinterest,
|
197 |
+
.tab1 ul.icn_listing li .sfsicls_rs_s,
|
198 |
+
.tab1 ul.icn_listing li .sfsicls_share,
|
199 |
+
.tab1 ul.icn_listing li .sfsicls_twt,
|
200 |
+
.tab1 ul.icn_listing li .sfsicls_utube {
|
201 |
+
background: url(../images/tab_1_icn_list.png) no-repeat;
|
202 |
+
float: left;
|
203 |
+
padding: 0 0 0 59px;
|
204 |
+
margin: 0 0 0 17px;
|
205 |
+
height: 52px;
|
206 |
+
line-height: 51px;
|
207 |
+
font-family: helveticaregular;
|
208 |
+
font-size: 22px;
|
209 |
+
}
|
210 |
+
.tab1 ul.icn_listing li .sfsicls_telegram {
|
211 |
+
background: url(../images/icons_theme/default/default_telegram.png) no-repeat;
|
212 |
+
background-size: contain;
|
213 |
+
}
|
214 |
+
.tab1 ul.icn_listing li .sfsicls_vk {
|
215 |
+
background: url(../images/icons_theme/default/default_vk.png) no-repeat;
|
216 |
+
background-size: contain;
|
217 |
+
}
|
218 |
+
.tab1 ul.icn_listing li .sfsicls_ok {
|
219 |
+
background: url(../images/icons_theme/default/default_ok.png) no-repeat;
|
220 |
+
background-size: contain;
|
221 |
+
}
|
222 |
+
.tab1 ul.icn_listing li .sfsicls_wechat {
|
223 |
+
background: url(../images/icons_theme/default/default_wechat.png) no-repeat;
|
224 |
+
background-size: contain;
|
225 |
+
}
|
226 |
+
.tab1 ul.icn_listing li .sfsicls_weibo {
|
227 |
+
background: url(../images/icons_theme/default/default_weibo.png) no-repeat;
|
228 |
+
background-size: contain;
|
229 |
+
}
|
230 |
+
|
231 |
+
.tab1 ul.icn_listing li .sfsicls_rs_s {
|
232 |
+
background-position: 0 0;
|
233 |
+
color: #f7941d;
|
234 |
+
}
|
235 |
+
.tab1 ul.icn_listing li .sfsicls_email {
|
236 |
+
background-position: 0 -73px;
|
237 |
+
color: #d1c800;
|
238 |
+
}
|
239 |
+
.tab1 ul.icn_listing li .sfsicls_facebook {
|
240 |
+
background-position: 0 -145px;
|
241 |
+
color: #004088;
|
242 |
+
}
|
243 |
+
.tab1 ul.icn_listing li .sfsicls_twt {
|
244 |
+
background-position: 0 -221px;
|
245 |
+
color: #00abe3;
|
246 |
+
}
|
247 |
+
|
248 |
+
.tab1 ul.icn_listing li .sfsicls_share {
|
249 |
+
background-position: 0 -372px;
|
250 |
+
color: #ef4746;
|
251 |
+
}
|
252 |
+
.tab1 ul.icn_listing li .sfsicls_utube {
|
253 |
+
background-position: 0 -448px;
|
254 |
+
color: #f07963;
|
255 |
+
}
|
256 |
+
.tab1 ul.icn_listing li .sfsicls_linkdin {
|
257 |
+
background-position: 0 -548px;
|
258 |
+
color: #1e88c9;
|
259 |
+
}
|
260 |
+
.tab1 ul.icn_listing li .sfsicls_pinterest {
|
261 |
+
background-position: 0 -623px;
|
262 |
+
color: #f15f5d;
|
263 |
+
}
|
264 |
+
.tab1 ul.icn_listing li .sfsicls_instagram {
|
265 |
+
background-position: 0 -781px;
|
266 |
+
color: #369;
|
267 |
+
}
|
268 |
+
.tab1 ul.icn_listing li .custom {
|
269 |
+
background-position: 0 -702px;
|
270 |
+
color: #5a6570;
|
271 |
+
}
|
272 |
+
.tab1 ul.icn_listing li .right_info {
|
273 |
+
width: 70%;
|
274 |
+
float: right;
|
275 |
+
font-family: helveticaregular;
|
276 |
+
margin-right: 13px;
|
277 |
+
}
|
278 |
+
ul.icn_listing li .right_info a {
|
279 |
+
text-decoration: underline;
|
280 |
+
color: #a4a9ad;
|
281 |
+
font-size: 16px;
|
282 |
+
}
|
283 |
+
.tab1 .tab_2_sav {
|
284 |
+
padding-top: 30px;
|
285 |
+
}
|
286 |
+
/*Tab2*/
|
287 |
+
.tab2 {
|
288 |
+
overflow: hidden;
|
289 |
+
}
|
290 |
+
.tab2 .rss_url_row {
|
291 |
+
width: 100%;
|
292 |
+
float: left;
|
293 |
+
margin: 0 0 10px;
|
294 |
+
}
|
295 |
+
.tab2 .rss_url_row h4 {
|
296 |
+
float: left;
|
297 |
+
line-height: 43px;
|
298 |
+
}
|
299 |
+
.tab2 .inr_cont input.add,
|
300 |
+
.tab2 .inr_cont textarea.add_txt,
|
301 |
+
.tab2 .rss_url_row input.add {
|
302 |
+
width: 363px;
|
303 |
+
float: left;
|
304 |
+
background: #e5e5e5;
|
305 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
306 |
+
border: 0;
|
307 |
+
padding: 12px 10px 11px;
|
308 |
+
margin-left: 10px;
|
309 |
+
}
|
310 |
+
.tab2 .rss_url_row a.rit_link {
|
311 |
+
float: left;
|
312 |
+
margin: 10px 0 0 16px;
|
313 |
+
font-size: 17px;
|
314 |
+
}
|
315 |
+
.tab2 .row {
|
316 |
+
float: left;
|
317 |
+
border-top: 2px solid #f2f3f4;
|
318 |
+
clear: both;
|
319 |
+
padding: 0 0 15px;
|
320 |
+
width: 100%
|
321 |
+
}
|
322 |
+
.tab2 .row .tab_2_email_sec {
|
323 |
+
list-style: none;
|
324 |
+
margin: 17px 0 0;
|
325 |
+
overflow: hidden;
|
326 |
+
}
|
327 |
+
.row ul.tab_2_email_sec li {
|
328 |
+
float: left;
|
329 |
+
margin-right: 10px;
|
330 |
+
width: 32%;
|
331 |
+
}
|
332 |
+
.row ul.tab_2_email_sec li label span {
|
333 |
+
font-size: 15px;
|
334 |
+
color: #808080;
|
335 |
+
width: 100%;
|
336 |
+
float: left;
|
337 |
+
}
|
338 |
+
.row ul.tab_2_email_sec:first-child {
|
339 |
+
margin-right: 2%
|
340 |
+
}
|
341 |
+
.tab2 .row h2.sfsicls_email,
|
342 |
+
.tab2 .row h2.sfsicls_facebook,
|
343 |
+
.tab2 .row h2.sfsicls_telegram,
|
344 |
+
.tab2 .row h2.sfsicls_vk,
|
345 |
+
.tab2 .row h2.sfsicls_ok,
|
346 |
+
.tab2 .row h2.sfsicls_wechat,
|
347 |
+
.tab2 .row h2.sfsicls_weibo,
|
348 |
+
.tab2 .row h2.sfsicls_instagram,
|
349 |
+
.tab2 .row h2.sfsicls_linkdin,
|
350 |
+
.tab2 .row h2.sfsicls_pinterest,
|
351 |
+
.tab2 .row h2.sfsicls_rs_s,
|
352 |
+
.tab2 .row h2.sfsicls_share,
|
353 |
+
.tab2 .row h2.sfsicls_twt,
|
354 |
+
.tab2 .row h2.sfsicls_utube {
|
355 |
+
background: url(../images/tab_1_icn_list.png) no-repeat;
|
356 |
+
padding: 0 0 0 70px;
|
357 |
+
margin: 15px 0 7px 21px;
|
358 |
+
height: 52px;
|
359 |
+
line-height: 51px;
|
360 |
+
font-family: helveticaregular;
|
361 |
+
font-size: 22px;
|
362 |
+
}
|
363 |
+
.tab2 .row h2.sfsicls_rs_s {
|
364 |
+
background-position: 0 0;
|
365 |
+
color: #f7941d;
|
366 |
+
}
|
367 |
+
.tab2 .row h2.sfsicls_telegram {
|
368 |
+
background: url(../images/icons_theme/default/default_telegram.png) no-repeat;
|
369 |
+
background-size: contain;
|
370 |
+
}
|
371 |
+
.tab2 .row h2.sfsicls_vk {
|
372 |
+
background: url(../images/icons_theme/default/default_vk.png) no-repeat;
|
373 |
+
background-size: contain;
|
374 |
+
}
|
375 |
+
.tab2 .row h2.sfsicls_ok {
|
376 |
+
background: url(../images/icons_theme/default/default_ok.png) no-repeat;
|
377 |
+
background-size: contain;
|
378 |
+
}
|
379 |
+
.tab2 .row h2.sfsicls_wechat {
|
380 |
+
background: url(../images/icons_theme/default/default_wechat.png) no-repeat;
|
381 |
+
background-size: contain;
|
382 |
+
}
|
383 |
+
.tab2 .row h2.sfsicls_weibo {
|
384 |
+
background: url(../images/icons_theme/default/default_weibo.png) no-repeat;
|
385 |
+
background-size: contain;
|
386 |
+
}
|
387 |
+
.tab2 .row h2.sfsicls_email {
|
388 |
+
background-position: 0 -71px;
|
389 |
+
color: #d1c800;
|
390 |
+
}
|
391 |
+
.tab2 .row h2.sfsicls_facebook {
|
392 |
+
background-position: 0 -145px;
|
393 |
+
color: #004088;
|
394 |
+
}
|
395 |
+
.tab2 .row h2.sfsicls_twt {
|
396 |
+
background-position: 0 -221px;
|
397 |
+
color: #00abe3;
|
398 |
+
}
|
399 |
+
|
400 |
+
.tab2 .row h2.sfsicls_share {
|
401 |
+
background-position: 0 -372px;
|
402 |
+
color: #ef4746;
|
403 |
+
}
|
404 |
+
.tab2 .row h2.sfsicls_utube {
|
405 |
+
background-position: 0 -448px;
|
406 |
+
color: #f07963;
|
407 |
+
}
|
408 |
+
.tab2 .row h2.sfsicls_linkdin {
|
409 |
+
background-position: 0 -548px;
|
410 |
+
color: #1e88c9;
|
411 |
+
width: 100%;
|
412 |
+
}
|
413 |
+
.tab2 .row h2.sfsicls_pinterest {
|
414 |
+
background-position: 0 -623px;
|
415 |
+
color: #f15f5d;
|
416 |
+
}
|
417 |
+
.tab2 .row h2.sfsicls_instagram {
|
418 |
+
background-position: 0 -781px;
|
419 |
+
color: #369;
|
420 |
+
}
|
421 |
+
.tab2 .inr_cont {
|
422 |
+
margin: 0 0 12px 94px;
|
423 |
+
}
|
424 |
+
ul.tab_2_email_sec .sf_arow {
|
425 |
+
width: 52px;
|
426 |
+
height: 52px;
|
427 |
+
float: left;
|
428 |
+
background: url(../images/sf_arow_icn.png) no-repeat;
|
429 |
+
margin: 0 8px 0 6px;
|
430 |
+
}
|
431 |
+
ul.tab_2_email_sec .email_icn {
|
432 |
+
background: url(../images/tab_1_icn_list.png) 0 -71px no-repeat;
|
433 |
+
width: 52px;
|
434 |
+
height: 52px;
|
435 |
+
float: left;
|
436 |
+
margin: 0 8px;
|
437 |
+
}
|
438 |
+
ul.tab_2_email_sec .subscribe_icn {
|
439 |
+
background: url(../images/tab_1_icn_list.png) 0 -860px no-repeat;
|
440 |
+
width: 52px;
|
441 |
+
height: 52px;
|
442 |
+
float: left;
|
443 |
+
margin: 0 0 0 5px;
|
444 |
+
}
|
445 |
+
ul.tab_2_email_sec li .radio {
|
446 |
+
float: left;
|
447 |
+
margin: 8px 0 0;
|
448 |
+
}
|
449 |
+
.row ul.tab_2_email_sec li label {
|
450 |
+
margin: 13px 0 0 7px;
|
451 |
+
font-size: 16px;
|
452 |
+
float: left;
|
453 |
+
width: 160px;
|
454 |
+
}
|
455 |
+
/*Tab 3*/
|
456 |
+
.icns_tab_3 .row_10_1,
|
457 |
+
.icns_tab_3 .row_10_10,
|
458 |
+
.icns_tab_3 .row_10_11,
|
459 |
+
.icns_tab_3 .row_10_2,
|
460 |
+
.icns_tab_3 .row_10_3,
|
461 |
+
.icns_tab_3 .row_10_4,
|
462 |
+
.icns_tab_3 .row_10_5,
|
463 |
+
.icns_tab_3 .row_10_6,
|
464 |
+
.icns_tab_3 .row_10_7,
|
465 |
+
.icns_tab_3 .row_10_8,
|
466 |
+
.icns_tab_3 .row_10_9,
|
467 |
+
.icns_tab_3 .row_11_1,
|
468 |
+
.icns_tab_3 .row_11_10,
|
469 |
+
.icns_tab_3 .row_11_11,
|
470 |
+
.icns_tab_3 .row_11_2,
|
471 |
+
.icns_tab_3 .row_11_3,
|
472 |
+
.icns_tab_3 .row_11_4,
|
473 |
+
.icns_tab_3 .row_11_5,
|
474 |
+
.icns_tab_3 .row_11_6,
|
475 |
+
.icns_tab_3 .row_11_7,
|
476 |
+
.icns_tab_3 .row_11_8,
|
477 |
+
.icns_tab_3 .row_11_9,
|
478 |
+
.icns_tab_3 .row_12_1,
|
479 |
+
.icns_tab_3 .row_12_10,
|
480 |
+
.icns_tab_3 .row_12_11,
|
481 |
+
.icns_tab_3 .row_12_2,
|
482 |
+
.icns_tab_3 .row_12_3,
|
483 |
+
.icns_tab_3 .row_12_4,
|
484 |
+
.icns_tab_3 .row_12_5,
|
485 |
+
.icns_tab_3 .row_12_6,
|
486 |
+
.icns_tab_3 .row_12_7,
|
487 |
+
.icns_tab_3 .row_12_8,
|
488 |
+
.icns_tab_3 .row_12_9,
|
489 |
+
.icns_tab_3 .row_13_1,
|
490 |
+
.icns_tab_3 .row_13_10,
|
491 |
+
.icns_tab_3 .row_13_11,
|
492 |
+
.icns_tab_3 .row_13_2,
|
493 |
+
.icns_tab_3 .row_13_3,
|
494 |
+
.icns_tab_3 .row_13_4,
|
495 |
+
.icns_tab_3 .row_13_5,
|
496 |
+
.icns_tab_3 .row_13_6,
|
497 |
+
.icns_tab_3 .row_13_7,
|
498 |
+
.icns_tab_3 .row_13_8,
|
499 |
+
.icns_tab_3 .row_13_9,
|
500 |
+
.icns_tab_3 .row_14_1,
|
501 |
+
.icns_tab_3 .row_14_10,
|
502 |
+
.icns_tab_3 .row_14_11,
|
503 |
+
.icns_tab_3 .row_14_2,
|
504 |
+
.icns_tab_3 .row_14_3,
|
505 |
+
.icns_tab_3 .row_14_4,
|
506 |
+
.icns_tab_3 .row_14_5,
|
507 |
+
.icns_tab_3 .row_14_6,
|
508 |
+
.icns_tab_3 .row_14_7,
|
509 |
+
.icns_tab_3 .row_14_8,
|
510 |
+
.icns_tab_3 .row_14_9,
|
511 |
+
.icns_tab_3 .row_15_1,
|
512 |
+
.icns_tab_3 .row_15_10,
|
513 |
+
.icns_tab_3 .row_15_11,
|
514 |
+
.icns_tab_3 .row_15_2,
|
515 |
+
.icns_tab_3 .row_15_3,
|
516 |
+
.icns_tab_3 .row_15_4,
|
517 |
+
.icns_tab_3 .row_15_5,
|
518 |
+
.icns_tab_3 .row_15_6,
|
519 |
+
.icns_tab_3 .row_15_7,
|
520 |
+
.icns_tab_3 .row_15_8,
|
521 |
+
.icns_tab_3 .row_15_9,
|
522 |
+
.icns_tab_3 .row_16_1,
|
523 |
+
.icns_tab_3 .row_16_10,
|
524 |
+
.icns_tab_3 .row_16_11,
|
525 |
+
.icns_tab_3 .row_16_2,
|
526 |
+
.icns_tab_3 .row_16_3,
|
527 |
+
.icns_tab_3 .row_16_4,
|
528 |
+
.icns_tab_3 .row_16_5,
|
529 |
+
.icns_tab_3 .row_16_6,
|
530 |
+
.icns_tab_3 .row_16_7,
|
531 |
+
.icns_tab_3 .row_16_8,
|
532 |
+
.icns_tab_3 .row_16_9,
|
533 |
+
.icns_tab_3 .row_1_1,
|
534 |
+
.icns_tab_3 .row_1_10,
|
535 |
+
.icns_tab_3 .row_1_11,
|
536 |
+
.icns_tab_3 .row_1_14,
|
537 |
+
.icns_tab_3 .row_1_2,
|
538 |
+
.icns_tab_3 .row_1_3,
|
539 |
+
.icns_tab_3 .row_1_4,
|
540 |
+
.icns_tab_3 .row_1_5,
|
541 |
+
.icns_tab_3 .row_1_6,
|
542 |
+
.icns_tab_3 .row_1_7,
|
543 |
+
.icns_tab_3 .row_1_8,
|
544 |
+
.icns_tab_3 .row_1_9,
|
545 |
+
.icns_tab_3 .row_2_1,
|
546 |
+
.icns_tab_3 .row_2_10,
|
547 |
+
.icns_tab_3 .row_2_11,
|
548 |
+
.icns_tab_3 .row_2_14,
|
549 |
+
.icns_tab_3 .row_2_2,
|
550 |
+
.icns_tab_3 .row_2_3,
|
551 |
+
.icns_tab_3 .row_2_4,
|
552 |
+
.icns_tab_3 .row_2_5,
|
553 |
+
.icns_tab_3 .row_2_6,
|
554 |
+
.icns_tab_3 .row_2_7,
|
555 |
+
.icns_tab_3 .row_2_8,
|
556 |
+
.icns_tab_3 .row_2_9,
|
557 |
+
.icns_tab_3 .row_3_1,
|
558 |
+
.icns_tab_3 .row_3_10,
|
559 |
+
.icns_tab_3 .row_3_11,
|
560 |
+
.icns_tab_3 .row_3_14,
|
561 |
+
.icns_tab_3 .row_3_2,
|
562 |
+
.icns_tab_3 .row_3_3,
|
563 |
+
.icns_tab_3 .row_3_4,
|
564 |
+
.icns_tab_3 .row_3_5,
|
565 |
+
.icns_tab_3 .row_3_6,
|
566 |
+
.icns_tab_3 .row_3_7,
|
567 |
+
.icns_tab_3 .row_3_8,
|
568 |
+
.icns_tab_3 .row_3_9,
|
569 |
+
.icns_tab_3 .row_4_1,
|
570 |
+
.icns_tab_3 .row_4_10,
|
571 |
+
.icns_tab_3 .row_4_11,
|
572 |
+
.icns_tab_3 .row_4_14,
|
573 |
+
.icns_tab_3 .row_4_2,
|
574 |
+
.icns_tab_3 .row_4_3,
|
575 |
+
.icns_tab_3 .row_4_4,
|
576 |
+
.icns_tab_3 .row_4_5,
|
577 |
+
.icns_tab_3 .row_4_6,
|
578 |
+
.icns_tab_3 .row_4_7,
|
579 |
+
.icns_tab_3 .row_4_8,
|
580 |
+
.icns_tab_3 .row_4_9,
|
581 |
+
.icns_tab_3 .row_5_1,
|
582 |
+
.icns_tab_3 .row_5_10,
|
583 |
+
.icns_tab_3 .row_5_11,
|
584 |
+
.icns_tab_3 .row_5_14,
|
585 |
+
.icns_tab_3 .row_5_2,
|
586 |
+
.icns_tab_3 .row_5_3,
|
587 |
+
.icns_tab_3 .row_5_4,
|
588 |
+
.icns_tab_3 .row_5_5,
|
589 |
+
.icns_tab_3 .row_5_6,
|
590 |
+
.icns_tab_3 .row_5_7,
|
591 |
+
.icns_tab_3 .row_5_8,
|
592 |
+
.icns_tab_3 .row_5_9,
|
593 |
+
.icns_tab_3 .row_6_1,
|
594 |
+
.icns_tab_3 .row_6_10,
|
595 |
+
.icns_tab_3 .row_6_11,
|
596 |
+
.icns_tab_3 .row_6_14,
|
597 |
+
.icns_tab_3 .row_6_2,
|
598 |
+
.icns_tab_3 .row_6_3,
|
599 |
+
.icns_tab_3 .row_6_4,
|
600 |
+
.icns_tab_3 .row_6_5,
|
601 |
+
.icns_tab_3 .row_6_6,
|
602 |
+
.icns_tab_3 .row_6_7,
|
603 |
+
.icns_tab_3 .row_6_8,
|
604 |
+
.icns_tab_3 .row_6_9,
|
605 |
+
.icns_tab_3 .row_7_1,
|
606 |
+
.icns_tab_3 .row_7_10,
|
607 |
+
.icns_tab_3 .row_7_11,
|
608 |
+
.icns_tab_3 .row_7_2,
|
609 |
+
.icns_tab_3 .row_7_3,
|
610 |
+
.icns_tab_3 .row_7_4,
|
611 |
+
.icns_tab_3 .row_7_5,
|
612 |
+
.icns_tab_3 .row_7_6,
|
613 |
+
.icns_tab_3 .row_7_7,
|
614 |
+
.icns_tab_3 .row_7_8,
|
615 |
+
.icns_tab_3 .row_7_9,
|
616 |
+
.icns_tab_3 .row_8_1,
|
617 |
+
.icns_tab_3 .row_8_10,
|
618 |
+
.icns_tab_3 .row_8_11,
|
619 |
+
.icns_tab_3 .row_8_2,
|
620 |
+
.icns_tab_3 .row_8_3,
|
621 |
+
.icns_tab_3 .row_8_4,
|
622 |
+
.icns_tab_3 .row_8_5,
|
623 |
+
.icns_tab_3 .row_8_6,
|
624 |
+
.icns_tab_3 .row_8_7,
|
625 |
+
.icns_tab_3 .row_8_8,
|
626 |
+
.icns_tab_3 .row_8_9,
|
627 |
+
.icns_tab_3 .row_9_1,
|
628 |
+
.icns_tab_3 .row_9_10,
|
629 |
+
.icns_tab_3 .row_9_11,
|
630 |
+
.icns_tab_3 .row_9_2,
|
631 |
+
.icns_tab_3 .row_9_3,
|
632 |
+
.icns_tab_3 .row_9_4,
|
633 |
+
.icns_tab_3 .row_9_5,
|
634 |
+
.icns_tab_3 .row_9_6,
|
635 |
+
.icns_tab_3 .row_9_7,
|
636 |
+
.icns_tab_3 .row_9_8,
|
637 |
+
.icns_tab_3 .row_9_9,
|
638 |
+
.icns_tab_3 .row_17_1,
|
639 |
+
.icns_tab_3 .row_17_2,
|
640 |
+
.icns_tab_3 .row_17_3,
|
641 |
+
.icns_tab_3 .row_17_4,
|
642 |
+
.icns_tab_3 .row_17_5,
|
643 |
+
.icns_tab_3 .row_17_6,
|
644 |
+
.icns_tab_3 .row_17_7,
|
645 |
+
.icns_tab_3 .row_17_8,
|
646 |
+
.icns_tab_3 .row_17_9,
|
647 |
+
.icns_tab_3 .row_17_10,
|
648 |
+
.icns_tab_3 .row_17_14,
|
649 |
+
.icns_tab_3 .row_17_15,
|
650 |
+
.icns_tab_3 .row_17_16,
|
651 |
+
.icns_tab_3 .row_17_17,
|
652 |
+
.icns_tab_3 .row_17_18,
|
653 |
+
.icns_tab_3 .row_17_11,
|
654 |
+
.icns_tab_3 .row_7_14,
|
655 |
+
.icns_tab_3 .row_8_14,
|
656 |
+
.icns_tab_3 .row_9_14,
|
657 |
+
.icns_tab_3 .row_10_14,
|
658 |
+
.icns_tab_3 .row_11_14,
|
659 |
+
.icns_tab_3 .row_12_14,
|
660 |
+
.icns_tab_3 .row_13_14,
|
661 |
+
.icns_tab_3 .row_14_14,
|
662 |
+
.icns_tab_3 .row_15_22,
|
663 |
+
.icns_tab_3 .row_16_22,
|
664 |
+
.icns_tab_3 .row_17_22,
|
665 |
+
.icns_tab_3 .row_17_15,
|
666 |
+
.icns_tab_3 .row_17_16,
|
667 |
+
.icns_tab_3 .row_17_17,
|
668 |
+
.icns_tab_3 .row_1_15,
|
669 |
+
.icns_tab_3 .row_2_15,
|
670 |
+
.icns_tab_3 .row_3_15,
|
671 |
+
.icns_tab_3 .row_4_15,
|
672 |
+
.icns_tab_3 .row_5_15,
|
673 |
+
.icns_tab_3 .row_6_15,
|
674 |
+
.icns_tab_3 .row_7_15,
|
675 |
+
.icns_tab_3 .row_8_15,
|
676 |
+
.icns_tab_3 .row_9_15,
|
677 |
+
.icns_tab_3 .row_10_15,
|
678 |
+
.icns_tab_3 .row_11_15,
|
679 |
+
.icns_tab_3 .row_12_15,
|
680 |
+
.icns_tab_3 .row_13_15,
|
681 |
+
.icns_tab_3 .row_14_15,
|
682 |
+
.icns_tab_3 .row_15_15,
|
683 |
+
.icns_tab_3 .row_16_15,
|
684 |
+
|
685 |
+
.icns_tab_3 .row_1_16,
|
686 |
+
.icns_tab_3 .row_2_16,
|
687 |
+
.icns_tab_3 .row_3_16,
|
688 |
+
.icns_tab_3 .row_4_16,
|
689 |
+
.icns_tab_3 .row_5_16,
|
690 |
+
.icns_tab_3 .row_6_16,
|
691 |
+
.icns_tab_3 .row_7_16,
|
692 |
+
.icns_tab_3 .row_8_16,
|
693 |
+
.icns_tab_3 .row_9_16,
|
694 |
+
.icns_tab_3 .row_10_16,
|
695 |
+
.icns_tab_3 .row_11_16,
|
696 |
+
.icns_tab_3 .row_12_16,
|
697 |
+
.icns_tab_3 .row_13_16,
|
698 |
+
.icns_tab_3 .row_14_16,
|
699 |
+
.icns_tab_3 .row_15_16,
|
700 |
+
.icns_tab_3 .row_16_16,
|
701 |
+
|
702 |
+
.icns_tab_3 .row_1_17,
|
703 |
+
.icns_tab_3 .row_2_17,
|
704 |
+
.icns_tab_3 .row_3_17,
|
705 |
+
.icns_tab_3 .row_4_17,
|
706 |
+
.icns_tab_3 .row_5_17,
|
707 |
+
.icns_tab_3 .row_6_17,
|
708 |
+
.icns_tab_3 .row_7_17,
|
709 |
+
.icns_tab_3 .row_8_17,
|
710 |
+
.icns_tab_3 .row_9_17,
|
711 |
+
.icns_tab_3 .row_10_17,
|
712 |
+
.icns_tab_3 .row_11_17,
|
713 |
+
.icns_tab_3 .row_12_17,
|
714 |
+
.icns_tab_3 .row_13_17,
|
715 |
+
.icns_tab_3 .row_14_17,
|
716 |
+
.icns_tab_3 .row_15_17,
|
717 |
+
.icns_tab_3 .row_16_17,
|
718 |
+
|
719 |
+
.icns_tab_3 .row_1_18,
|
720 |
+
.icns_tab_3 .row_2_18,
|
721 |
+
.icns_tab_3 .row_3_18,
|
722 |
+
.icns_tab_3 .row_4_18,
|
723 |
+
.icns_tab_3 .row_5_18,
|
724 |
+
.icns_tab_3 .row_6_18,
|
725 |
+
.icns_tab_3 .row_7_18,
|
726 |
+
.icns_tab_3 .row_8_18,
|
727 |
+
.icns_tab_3 .row_9_18,
|
728 |
+
.icns_tab_3 .row_10_18,
|
729 |
+
.icns_tab_3 .row_11_18,
|
730 |
+
.icns_tab_3 .row_12_18,
|
731 |
+
.icns_tab_3 .row_13_18,
|
732 |
+
.icns_tab_3 .row_14_18,
|
733 |
+
.icns_tab_3 .row_15_18,
|
734 |
+
.icns_tab_3 .row_16_18,
|
735 |
+
.icns_tab_3 .row_17_18,
|
736 |
+
.icns_tab_3 .row_15_14,
|
737 |
+
.icns_tab_3 .row_16_14 {
|
738 |
+
background: url(../images/tab_3_icns.png) no-repeat;
|
739 |
+
width: 53px;
|
740 |
+
height: 52px;
|
741 |
+
float: left;
|
742 |
+
margin: 0 4px 0 0;
|
743 |
+
}
|
744 |
+
.icns_tab_3 .row_1_1 {
|
745 |
+
background-position: -1px 0;
|
746 |
+
}
|
747 |
+
.icns_tab_3 .row_1_2 {
|
748 |
+
background-position: -60px 0;
|
749 |
+
}
|
750 |
+
.icns_tab_3 .row_1_3 {
|
751 |
+
background-position: -118px 0;
|
752 |
+
}
|
753 |
+
.icns_tab_3 .row_1_4 {
|
754 |
+
background-position: -176px 0;
|
755 |
+
}
|
756 |
+
.icns_tab_3 .row_1_5 {
|
757 |
+
background-position: -235px 0;
|
758 |
+
}
|
759 |
+
.icns_tab_3 .row_1_6 {
|
760 |
+
background-position: -293px 0;
|
761 |
+
}
|
762 |
+
.icns_tab_3 .row_1_7 {
|
763 |
+
background-position: -350px 0;
|
764 |
+
}
|
765 |
+
.icns_tab_3 .row_1_8 {
|
766 |
+
background-position: -409px 0;
|
767 |
+
}
|
768 |
+
.icns_tab_3 .row_1_9 {
|
769 |
+
background-position: -467px 0;
|
770 |
+
}
|
771 |
+
.icns_tab_3 .row_1_10 {
|
772 |
+
background-position: -526px 0;
|
773 |
+
}
|
774 |
+
.icns_tab_3 .row_1_11 {
|
775 |
+
background-position: -711px 0;
|
776 |
+
}
|
777 |
+
|
778 |
+
.icns_tab_3 .row_1_14 {
|
779 |
+
background-position: -773px 0;
|
780 |
+
}
|
781 |
+
.icns_tab_3 .row_1_15 {
|
782 |
+
background-position: -838px 0;
|
783 |
+
}
|
784 |
+
.icns_tab_3 .row_1_16 {
|
785 |
+
background-position: -909px 0;
|
786 |
+
}
|
787 |
+
.icns_tab_3 .row_1_17 {
|
788 |
+
background-position: -977px 0;
|
789 |
+
}
|
790 |
+
.icns_tab_3 .row_1_18 {
|
791 |
+
background: url(../images/icons_theme/default/default_wechat.png) no-repeat;
|
792 |
+
background-size: contain;
|
793 |
+
}.icns_tab_3 .row_2_1 {
|
794 |
+
background-position: 0 -74px;
|
795 |
+
}
|
796 |
+
.icns_tab_3 .row_2_2 {
|
797 |
+
background-position: -60px -74px;
|
798 |
+
}
|
799 |
+
.icns_tab_3 .row_2_3 {
|
800 |
+
background-position: -118px -74px;
|
801 |
+
}
|
802 |
+
.icns_tab_3 .row_2_4 {
|
803 |
+
background-position: -176px -74px;
|
804 |
+
}
|
805 |
+
.icns_tab_3 .row_2_5 {
|
806 |
+
background-position: -235px -74px;
|
807 |
+
}
|
808 |
+
.icns_tab_3 .row_2_6 {
|
809 |
+
background-position: -293px -74px;
|
810 |
+
}
|
811 |
+
.icns_tab_3 .row_2_7 {
|
812 |
+
background-position: -350px -74px;
|
813 |
+
}
|
814 |
+
.icns_tab_3 .row_2_8 {
|
815 |
+
background-position: -409px -74px;
|
816 |
+
}
|
817 |
+
.icns_tab_3 .row_2_9 {
|
818 |
+
background-position: -467px -74px;
|
819 |
+
}
|
820 |
+
.icns_tab_3 .row_2_10 {
|
821 |
+
background-position: -526px -74px;
|
822 |
+
}
|
823 |
+
.icns_tab_3 .row_2_11 {
|
824 |
+
background-position: -711px -74px;
|
825 |
+
}
|
826 |
+
.icns_tab_3 .row_2_14 {
|
827 |
+
background-position: -773px -74px;
|
828 |
+
}
|
829 |
+
.icns_tab_3 .row_2_15 {
|
830 |
+
background-position: -838px -74px;
|
831 |
+
}
|
832 |
+
.icns_tab_3 .row_2_16 {
|
833 |
+
background-position: -909px -74px;
|
834 |
+
}
|
835 |
+
.icns_tab_3 .row_2_17 {
|
836 |
+
background-position: -977px -74px;
|
837 |
+
}
|
838 |
+
.icns_tab_3 .row_2_18 {
|
839 |
+
background: url(../images/icons_theme/flat/flat_wechat.png) no-repeat;
|
840 |
+
background-size: contain;
|
841 |
+
}
|
842 |
+
.icns_tab_3 .row_3_1 {
|
843 |
+
background-position: 0 -146px;
|
844 |
+
}
|
845 |
+
.icns_tab_3 .row_3_2 {
|
846 |
+
background-position: -60px -146px;
|
847 |
+
}
|
848 |
+
.icns_tab_3 .row_3_3 {
|
849 |
+
background-position: -118px -146px;
|
850 |
+
}
|
851 |
+
.icns_tab_3 .row_3_4 {
|
852 |
+
background-position: -176px -146px;
|
853 |
+
}
|
854 |
+
.icns_tab_3 .row_3_5 {
|
855 |
+
background-position: -235px -146px;
|
856 |
+
}
|
857 |
+
.icns_tab_3 .row_3_6 {
|
858 |
+
background-position: -293px -146px;
|
859 |
+
}
|
860 |
+
.icns_tab_3 .row_3_7 {
|
861 |
+
background-position: -350px -146px;
|
862 |
+
}
|
863 |
+
.icns_tab_3 .row_3_8 {
|
864 |
+
background-position: -409px -146px;
|
865 |
+
}
|
866 |
+
.icns_tab_3 .row_3_9 {
|
867 |
+
background-position: -467px -146px;
|
868 |
+
}
|
869 |
+
.icns_tab_3 .row_3_10 {
|
870 |
+
background-position: -526px -146px;
|
871 |
+
}
|
872 |
+
.icns_tab_3 .row_3_11 {
|
873 |
+
background-position: -711px -147px;
|
874 |
+
}
|
875 |
+
.icns_tab_3 .row_3_14 {
|
876 |
+
background-position: -773px -147px;
|
877 |
+
}
|
878 |
+
.icns_tab_3 .row_3_15 {
|
879 |
+
background-position: -838px -147px;
|
880 |
+
}
|
881 |
+
.icns_tab_3 .row_3_16 {
|
882 |
+
background-position: -909px -147px;
|
883 |
+
}
|
884 |
+
.icns_tab_3 .row_3_17 {
|
885 |
+
background-position: -977px -147px;
|
886 |
+
}
|
887 |
+
.icns_tab_3 .row_3_18 {
|
888 |
+
background: url(../images/icons_theme/thin/thin_wechat.png) no-repeat;
|
889 |
+
background-size: contain;
|
890 |
+
}
|
891 |
+
.icns_tab_3 .row_4_1 {
|
892 |
+
background-position: 0 -222px;
|
893 |
+
}
|
894 |
+
.icns_tab_3 .row_4_2 {
|
895 |
+
background-position: -60px -222px;
|
896 |
+
}
|
897 |
+
.icns_tab_3 .row_4_3 {
|
898 |
+
background-position: -118px -222px;
|
899 |
+
}
|
900 |
+
.icns_tab_3 .row_4_4 {
|
901 |
+
background-position: -176px -222px;
|
902 |
+
}
|
903 |
+
.icns_tab_3 .row_4_5 {
|
904 |
+
background-position: -235px -222px;
|
905 |
+
}
|
906 |
+
.icns_tab_3 .row_4_6 {
|
907 |
+
background-position: -293px -222px;
|
908 |
+
}
|
909 |
+
.icns_tab_3 .row_4_7 {
|
910 |
+
background-position: -350px -222px;
|
911 |
+
}
|
912 |
+
.icns_tab_3 .row_4_8 {
|
913 |
+
background-position: -409px -222px;
|
914 |
+
}
|
915 |
+
.icns_tab_3 .row_4_9 {
|
916 |
+
background-position: -467px -222px;
|
917 |
+
}
|
918 |
+
.icns_tab_3 .row_4_10 {
|
919 |
+
background-position: -526px -222px;
|
920 |
+
}
|
921 |
+
.icns_tab_3 .row_4_11 {
|
922 |
+
background-position: -711px -222px;
|
923 |
+
}
|
924 |
+
.icns_tab_3 .row_4_14 {
|
925 |
+
background-position: -773px -222px;
|
926 |
+
}
|
927 |
+
.icns_tab_3 .row_4_15 {
|
928 |
+
background-position: -838px -222px;
|
929 |
+
}
|
930 |
+
.icns_tab_3 .row_4_16 {
|
931 |
+
background-position: -909px -222px;
|
932 |
+
}
|
933 |
+
.icns_tab_3 .row_4_17 {
|
934 |
+
background-position: -977px -222px;
|
935 |
+
}
|
936 |
+
.icns_tab_3 .row_4_18 {
|
937 |
+
background: url(../images/icons_theme/cute/cute_wechat.png) no-repeat;
|
938 |
+
background-size: contain;
|
939 |
+
}
|
940 |
+
.icns_tab_3 .row_5_1 {
|
941 |
+
background-position: 0 -296px;
|
942 |
+
}
|
943 |
+
.icns_tab_3 .row_5_2 {
|
944 |
+
background-position: -60px -296px;
|
945 |
+
}
|
946 |
+
.icns_tab_3 .row_5_3 {
|
947 |
+
background-position: -118px -296px;
|
948 |
+
}
|
949 |
+
.icns_tab_3 .row_5_4 {
|
950 |
+
background-position: -176px -296px;
|
951 |
+
}
|
952 |
+
.icns_tab_3 .row_5_5 {
|
953 |
+
background-position: -235px -296px;
|
954 |
+
}
|
955 |
+
.icns_tab_3 .row_5_6 {
|
956 |
+
background-position: -293px -296px;
|
957 |
+
}
|
958 |
+
.icns_tab_3 .row_5_7 {
|
959 |
+
background-position: -350px -296px;
|
960 |
+
}
|
961 |
+
.icns_tab_3 .row_5_8 {
|
962 |
+
background-position: -409px -296px;
|
963 |
+
}
|
964 |
+
.icns_tab_3 .row_5_9 {
|
965 |
+
background-position: -467px -296px;
|
966 |
+
}
|
967 |
+
.icns_tab_3 .row_5_10 {
|
968 |
+
background-position: -526px -296px;
|
969 |
+
}
|
970 |
+
.icns_tab_3 .row_5_11 {
|
971 |
+
background-position: -711px -296px;
|
972 |
+
}
|
973 |
+
.icns_tab_3 .row_5_14 {
|
974 |
+
background-position: -773px -296px;
|
975 |
+
}
|
976 |
+
.icns_tab_3 .row_5_15 {
|
977 |
+
background-position: -838px -296px;
|
978 |
+
}
|
979 |
+
.icns_tab_3 .row_5_16 {
|
980 |
+
background-position: -909px -296px;
|
981 |
+
}
|
982 |
+
.icns_tab_3 .row_5_17 {
|
983 |
+
background-position: -977px -296px;
|
984 |
+
}
|
985 |
+
.icns_tab_3 .row_5_18 {
|
986 |
+
background: url(../images/icons_theme/cubes/cubes_wechat.png);
|
987 |
+
background-size: contain;
|
988 |
+
}
|
989 |
+
.icns_tab_3 .row_6_1 {
|
990 |
+
background-position: 0 -370px;
|
991 |
+
}
|
992 |
+
.icns_tab_3 .row_6_2 {
|
993 |
+
background-position: -60px -370px;
|
994 |
+
}
|
995 |
+
.icns_tab_3 .row_6_3 {
|
996 |
+
background-position: -118px -370px;
|
997 |
+
}
|
998 |
+
.icns_tab_3 .row_6_4 {
|
999 |
+
background-position: -176px -370px;
|
1000 |
+
}
|
1001 |
+
.icns_tab_3 .row_6_5 {
|
1002 |
+
background-position: -235px -370px;
|
1003 |
+
}
|
1004 |
+
.icns_tab_3 .row_6_6 {
|
1005 |
+
background-position: -293px -370px;
|
1006 |
+
}
|
1007 |
+
.icns_tab_3 .row_6_7 {
|
1008 |
+
background-position: -350px -370px;
|
1009 |
+
}
|
1010 |
+
.icns_tab_3 .row_6_8 {
|
1011 |
+
background-position: -409px -370px;
|
1012 |
+
}
|
1013 |
+
.icns_tab_3 .row_6_9 {
|
1014 |
+
background-position: -468px -370px;
|
1015 |
+
}
|
1016 |
+
.icns_tab_3 .row_6_10 {
|
1017 |
+
background-position: -526px -370px;
|
1018 |
+
}
|
1019 |
+
.icns_tab_3 .row_6_11 {
|
1020 |
+
background-position: -711px -370px;
|
1021 |
+
}
|
1022 |
+
.icns_tab_3 .row_6_14 {
|
1023 |
+
background-position: -773px -370px;
|
1024 |
+
}
|
1025 |
+
.icns_tab_3 .row_6_15 {
|
1026 |
+
background-position: -838px -370px;
|
1027 |
+
}
|
1028 |
+
.icns_tab_3 .row_6_16 {
|
1029 |
+
background-position: -909px -370px;
|
1030 |
+
}
|
1031 |
+
.icns_tab_3 .row_6_17 {
|
1032 |
+
background-position: -977px -370px;
|
1033 |
+
}
|
1034 |
+
.icns_tab_3 .row_6_18 {
|
1035 |
+
background: url(../images/icons_theme/chrome_blue/chrome_blue_wechat.png);
|
1036 |
+
background-size: contain;
|
1037 |
+
}
|
1038 |
+
.icns_tab_3 .row_7_1 {
|
1039 |
+
background-position: 0 -444px;
|
1040 |
+
}
|
1041 |
+
.icns_tab_3 .row_7_2 {
|
1042 |
+
background-position: -60px -444px;
|
1043 |
+
}
|
1044 |
+
.icns_tab_3 .row_7_3 {
|
1045 |
+
background-position: -118px -444px;
|
1046 |
+
}
|
1047 |
+
.icns_tab_3 .row_7_4 {
|
1048 |
+
background-position: -176px -444px;
|
1049 |
+
}
|
1050 |
+
.icns_tab_3 .row_7_5 {
|
1051 |
+
background-position: -235px -444px;
|
1052 |
+
}
|
1053 |
+
.icns_tab_3 .row_7_6 {
|
1054 |
+
background-position: -293px -444px;
|
1055 |
+
}
|
1056 |
+
.icns_tab_3 .row_7_7 {
|
1057 |
+
background-position: -350px -444px;
|
1058 |
+
}
|
1059 |
+
.icns_tab_3 .row_7_8 {
|
1060 |
+
background-position: -409px -444px;
|
1061 |
+
}
|
1062 |
+
.icns_tab_3 .row_7_9 {
|
1063 |
+
background-position: -466px -444px;
|
1064 |
+
}
|
1065 |
+
.icns_tab_3 .row_7_10 {
|
1066 |
+
background-position: -526px -444px;
|
1067 |
+
}
|
1068 |
+
.icns_tab_3 .row_7_11 {
|
1069 |
+
background-position: -711px -444px;
|
1070 |
+
}
|
1071 |
+
.icns_tab_3 .row_7_14 {
|
1072 |
+
background-position: -773px -444px;
|
1073 |
+
}
|
1074 |
+
.icns_tab_3 .row_7_15 {
|
1075 |
+
background-position: -838px -444px;
|
1076 |
+
}
|
1077 |
+
.icns_tab_3 .row_7_16 {
|
1078 |
+
background-position: -909px -444px;
|
1079 |
+
}
|
1080 |
+
.icns_tab_3 .row_7_17 {
|
1081 |
+
background-position: -977px -444px;
|
1082 |
+
}
|
1083 |
+
.icns_tab_3 .row_7_18 {
|
1084 |
+
background: url(../images/icons_theme/chrome_grey/chrome_grey_wechat.png);
|
1085 |
+
background-size: contain;
|
1086 |
+
}
|
1087 |
+
.icns_tab_3 .row_8_1 {
|
1088 |
+
background-position: 0 -518px;
|
1089 |
+
}
|
1090 |
+
.icns_tab_3 .row_8_2 {
|
1091 |
+
background-position: -60px -518px;
|
1092 |
+
}
|
1093 |
+
.icns_tab_3 .row_8_3 {
|
1094 |
+
background-position: -118px -518px;
|
1095 |
+
}
|
1096 |
+
.icns_tab_3 .row_8_4 {
|
1097 |
+
background-position: -176px -518px;
|
1098 |
+
}
|
1099 |
+
.icns_tab_3 .row_8_5 {
|
1100 |
+
background-position: -235px -518px;
|
1101 |
+
}
|
1102 |
+
.icns_tab_3 .row_8_6 {
|
1103 |
+
background-position: -293px -518px;
|
1104 |
+
}
|
1105 |
+
.icns_tab_3 .row_8_7 {
|
1106 |
+
background-position: -350px -518px;
|
1107 |
+
}
|
1108 |
+
.icns_tab_3 .row_8_8 {
|
1109 |
+
background-position: -409px -518px;
|
1110 |
+
}
|
1111 |
+
.icns_tab_3 .row_8_9 {
|
1112 |
+
background-position: -467px -518px;
|
1113 |
+
}
|
1114 |
+
.icns_tab_3 .row_8_10 {
|
1115 |
+
background-position: -526px -518px;
|
1116 |
+
}
|
1117 |
+
.icns_tab_3 .row_8_11 {
|
1118 |
+
background-position: -711px -518px;
|
1119 |
+
}
|
1120 |
+
.icns_tab_3 .row_8_14 {
|
1121 |
+
background-position: -773px -518px;
|
1122 |
+
}
|
1123 |
+
.icns_tab_3 .row_8_15 {
|
1124 |
+
background-position: -838px -518px;
|
1125 |
+
}
|
1126 |
+
.icns_tab_3 .row_8_16 {
|
1127 |
+
background-position: -909px -518px;
|
1128 |
+
}
|
1129 |
+
.icns_tab_3 .row_8_17 {
|
1130 |
+
background-position: -977px -518px;
|
1131 |
+
}
|
1132 |
+
.icns_tab_3 .row_8_18 {
|
1133 |
+
background: url(../images/icons_theme/splash/splash_wechat.png);
|
1134 |
+
background-size: contain;
|
1135 |
+
}
|
1136 |
+
.icns_tab_3 .row_9_1 {
|
1137 |
+
background-position: 0 -592px;
|
1138 |
+
}
|
1139 |
+
.icns_tab_3 .row_9_2 {
|
1140 |
+
background-position: -60px -592px;
|
1141 |
+
}
|
1142 |
+
.icns_tab_3 .row_9_3 {
|
1143 |
+
background-position: -118px -592px;
|
1144 |
+
}
|
1145 |
+
.icns_tab_3 .row_9_4 {
|
1146 |
+
background-position: -176px -592px;
|
1147 |
+
}
|
1148 |
+
.icns_tab_3 .row_9_5 {
|
1149 |
+
background-position: -235px -592px;
|
1150 |
+
}
|
1151 |
+
.icns_tab_3 .row_9_6 {
|
1152 |
+
background-position: -293px -592px;
|
1153 |
+
}
|
1154 |
+
.icns_tab_3 .row_9_7 {
|
1155 |
+
background-position: -350px -592px;
|
1156 |
+
}
|
1157 |
+
.icns_tab_3 .row_9_8 {
|
1158 |
+
background-position: -409px -592px;
|
1159 |
+
}
|
1160 |
+
.icns_tab_3 .row_9_9 {
|
1161 |
+
background-position: -467px -592px;
|
1162 |
+
}
|
1163 |
+
.icns_tab_3 .row_9_10 {
|
1164 |
+
background-position: -526px -592px;
|
1165 |
+
}
|
1166 |
+
.icns_tab_3 .row_9_11 {
|
1167 |
+
background-position: -711px -592px;
|
1168 |
+
}
|
1169 |
+
.icns_tab_3 .row_9_14 {
|
1170 |
+
background-position: -773px -592px;
|
1171 |
+
}
|
1172 |
+
.icns_tab_3 .row_9_15 {
|
1173 |
+
background-position: -838px -592px;
|
1174 |
+
}
|
1175 |
+
.icns_tab_3 .row_9_16 {
|
1176 |
+
background-position: -909px -592px;
|
1177 |
+
}
|
1178 |
+
.icns_tab_3 .row_9_17 {
|
1179 |
+
background-position: -977px -592px;
|
1180 |
+
}
|
1181 |
+
.icns_tab_3 .row_9_18 {
|
1182 |
+
background: url(../images/icons_theme/orange/orange_wechat.png);
|
1183 |
+
background-size: contain;
|
1184 |
+
}
|
1185 |
+
.icns_tab_3 .row_10_1 {
|
1186 |
+
background-position: 0 -666px;
|
1187 |
+
}
|
1188 |
+
.icns_tab_3 .row_10_2 {
|
1189 |
+
background-position: -60px -666px;
|
1190 |
+
}
|
1191 |
+
.icns_tab_3 .row_10_3 {
|
1192 |
+
background-position: -118px -666px;
|
1193 |
+
}
|
1194 |
+
.icns_tab_3 .row_10_4 {
|
1195 |
+
background-position: -176px -666px;
|
1196 |
+
}
|
1197 |
+
.icns_tab_3 .row_10_5 {
|
1198 |
+
background-position: -235px -666px;
|
1199 |
+
}
|
1200 |
+
.icns_tab_3 .row_10_6 {
|
1201 |
+
background-position: -293px -666px;
|
1202 |
+
}
|
1203 |
+
.icns_tab_3 .row_10_7 {
|
1204 |
+
background-position: -350px -666px;
|
1205 |
+
}
|
1206 |
+
.icns_tab_3 .row_10_8 {
|
1207 |
+
background-position: -409px -666px;
|
1208 |
+
}
|
1209 |
+
.icns_tab_3 .row_10_9 {
|
1210 |
+
background-position: -467px -666px;
|
1211 |
+
}
|
1212 |
+
.icns_tab_3 .row_10_10 {
|
1213 |
+
background-position: -526px -666px;
|
1214 |
+
}
|
1215 |
+
.icns_tab_3 .row_10_11 {
|
1216 |
+
background-position: -711px -666px;
|
1217 |
+
}
|
1218 |
+
.icns_tab_3 .row_10_14 {
|
1219 |
+
background-position: -773px -666px;
|
1220 |
+
}
|
1221 |
+
.icns_tab_3 .row_10_15 {
|
1222 |
+
background-position: -838px -666px;
|
1223 |
+
}
|
1224 |
+
.icns_tab_3 .row_10_16 {
|
1225 |
+
background-position: -909px -666px;
|
1226 |
+
}
|
1227 |
+
.icns_tab_3 .row_10_17 {
|
1228 |
+
background-position: -977px -666px;
|
1229 |
+
}
|
1230 |
+
.icns_tab_3 .row_10_18 {
|
1231 |
+
background: url(../images/icons_theme/crystal/crystal_wechat.png);
|
1232 |
+
background-size: contain;
|
1233 |
+
}
|
1234 |
+
.icns_tab_3 .row_11_1 {
|
1235 |
+
background-position: 0 -740px;
|
1236 |
+
}
|
1237 |
+
.icns_tab_3 .row_11_2 {
|
1238 |
+
background-position: -60px -740px;
|
1239 |
+
}
|
1240 |
+
.icns_tab_3 .row_11_3 {
|
1241 |
+
background-position: -118px -740px;
|
1242 |
+
}
|
1243 |
+
.icns_tab_3 .row_11_4 {
|
1244 |
+
background-position: -176px -740px;
|
1245 |
+
}
|
1246 |
+
.icns_tab_3 .row_11_5 {
|
1247 |
+
background-position: -235px -740px;
|
1248 |
+
}
|
1249 |
+
.icns_tab_3 .row_11_6 {
|
1250 |
+
background-position: -293px -740px;
|
1251 |
+
}
|
1252 |
+
.icns_tab_3 .row_11_7 {
|
1253 |
+
background-position: -350px -740px;
|
1254 |
+
}
|
1255 |
+
.icns_tab_3 .row_11_8 {
|
1256 |
+
background-position: -409px -740px;
|
1257 |
+
}
|
1258 |
+
.icns_tab_3 .row_11_9 {
|
1259 |
+
background-position: -467px -740px;
|
1260 |
+
}
|
1261 |
+
.icns_tab_3 .row_11_10 {
|
1262 |
+
background-position: -526px -740px;
|
1263 |
+
}
|
1264 |
+
.icns_tab_3 .row_11_11 {
|
1265 |
+
background-position: -711px -740px;
|
1266 |
+
}
|
1267 |
+
.icns_tab_3 .row_11_14 {
|
1268 |
+
background-position: -773px -740px;
|
1269 |
+
}
|
1270 |
+
.icns_tab_3 .row_11_15 {
|
1271 |
+
background-position: -838px -740px;
|
1272 |
+
}
|
1273 |
+
.icns_tab_3 .row_11_16 {
|
1274 |
+
background-position: -909px -740px;
|
1275 |
+
}
|
1276 |
+
.icns_tab_3 .row_11_17 {
|
1277 |
+
background-position: -977px -740px;
|
1278 |
+
}
|
1279 |
+
.icns_tab_3 .row_11_18 {
|
1280 |
+
background: url(../images/icons_theme/glossy/glossy_wechat.png);
|
1281 |
+
background-size: contain;
|
1282 |
+
}
|
1283 |
+
.icns_tab_3 .row_12_1 {
|
1284 |
+
background-position: 0 -814px;
|
1285 |
+
}
|
1286 |
+
.icns_tab_3 .row_12_2 {
|
1287 |
+
background-position: -60px -814px;
|
1288 |
+
}
|
1289 |
+
.icns_tab_3 .row_12_3 {
|
1290 |
+
background-position: -118px -814px;
|
1291 |
+
}
|
1292 |
+
.icns_tab_3 .row_12_4 {
|
1293 |
+
background-position: -176px -814px;
|
1294 |
+
}
|
1295 |
+
.icns_tab_3 .row_12_5 {
|
1296 |
+
background-position: -235px -814px;
|
1297 |
+
}
|
1298 |
+
.icns_tab_3 .row_12_6 {
|
1299 |
+
background-position: -293px -814px;
|
1300 |
+
}
|
1301 |
+
.icns_tab_3 .row_12_7 {
|
1302 |
+
background-position: -350px -814px;
|
1303 |
+
}
|
1304 |
+
.icns_tab_3 .row_12_8 {
|
1305 |
+
background-position: -409px -814px;
|
1306 |
+
}
|
1307 |
+
.icns_tab_3 .row_12_9 {
|
1308 |
+
background-position: -467px -814px;
|
1309 |
+
}
|
1310 |
+
.icns_tab_3 .row_12_10 {
|
1311 |
+
background-position: -526px -814px;
|
1312 |
+
}
|
1313 |
+
.icns_tab_3 .row_12_11 {
|
1314 |
+
background-position: -711px -814px;
|
1315 |
+
}
|
1316 |
+
.icns_tab_3 .row_12_14 {
|
1317 |
+
background-position: -773px -814px;
|
1318 |
+
}
|
1319 |
+
.icns_tab_3 .row_12_15 {
|
1320 |
+
background-position: -838px -814px;
|
1321 |
+
}
|
1322 |
+
.icns_tab_3 .row_12_16 {
|
1323 |
+
background-position: -909px -814px;
|
1324 |
+
}
|
1325 |
+
.icns_tab_3 .row_12_17 {
|
1326 |
+
background-position: -977px -814px;
|
1327 |
+
}
|
1328 |
+
.icns_tab_3 .row_12_18 {
|
1329 |
+
background: url(../images/icons_theme/black/black_wechat.png);
|
1330 |
+
background-size: contain;
|
1331 |
+
}
|
1332 |
+
.icns_tab_3 .row_13_1 {
|
1333 |
+
background-position: 0 -888px;
|
1334 |
+
}
|
1335 |
+
.icns_tab_3 .row_13_2 {
|
1336 |
+
background-position: -60px -888px;
|
1337 |
+
}
|
1338 |
+
.icns_tab_3 .row_13_3 {
|
1339 |
+
background-position: -118px -888px;
|
1340 |
+
}
|
1341 |
+
.icns_tab_3 .row_13_4 {
|
1342 |
+
background-position: -176px -888px;
|
1343 |
+
}
|
1344 |
+
.icns_tab_3 .row_13_5 {
|
1345 |
+
background-position: -235px -888px;
|
1346 |
+
}
|
1347 |
+
.icns_tab_3 .row_13_6 {
|
1348 |
+
background-position: -293px -888px;
|
1349 |
+
}
|
1350 |
+
.icns_tab_3 .row_13_7 {
|
1351 |
+
background-position: -350px -888px;
|
1352 |
+
}
|
1353 |
+
.icns_tab_3 .row_13_8 {
|
1354 |
+
background-position: -409px -888px;
|
1355 |
+
}
|
1356 |
+
.icns_tab_3 .row_13_9 {
|
1357 |
+
background-position: -467px -888px;
|
1358 |
+
}
|
1359 |
+
.icns_tab_3 .row_13_10 {
|
1360 |
+
background-position: -526px -888px;
|
1361 |
+
}
|
1362 |
+
.icns_tab_3 .row_13_11 {
|
1363 |
+
background-position: -711px -888px;
|
1364 |
+
}
|
1365 |
+
.icns_tab_3 .row_13_14 {
|
1366 |
+
background-position: -773px -888px;
|
1367 |
+
}
|
1368 |
+
.icns_tab_3 .row_13_15 {
|
1369 |
+
background-position: -838px -888px;
|
1370 |
+
}
|
1371 |
+
.icns_tab_3 .row_13_16 {
|
1372 |
+
background-position: -909px -888px;
|
1373 |
+
}
|
1374 |
+
.icns_tab_3 .row_13_17 {
|
1375 |
+
background-position: -977px -888px;
|
1376 |
+
}
|
1377 |
+
.icns_tab_3 .row_13_18 {
|
1378 |
+
background: url(../images/icons_theme/silver/silver_wechat.png);
|
1379 |
+
|
1380 |
+
background-size: contain;
|
1381 |
+
}
|
1382 |
+
.icns_tab_3 .row_14_1 {
|
1383 |
+
background-position: 0 -962px;
|
1384 |
+
}
|
1385 |
+
.icns_tab_3 .row_14_2 {
|
1386 |
+
background-position: -60px -962px;
|
1387 |
+
}
|
1388 |
+
.icns_tab_3 .row_14_3 {
|
1389 |
+
background-position: -118px -962px;
|
1390 |
+
}
|
1391 |
+
.icns_tab_3 .row_14_4 {
|
1392 |
+
background-position: -176px -962px;
|
1393 |
+
}
|
1394 |
+
.icns_tab_3 .row_14_5 {
|
1395 |
+
background-position: -235px -962px;
|
1396 |
+
}
|
1397 |
+
.icns_tab_3 .row_14_6 {
|
1398 |
+
background-position: -293px -962px;
|
1399 |
+
}
|
1400 |
+
.icns_tab_3 .row_14_7 {
|
1401 |
+
background-position: -350px -962px;
|
1402 |
+
}
|
1403 |
+
.icns_tab_3 .row_14_8 {
|
1404 |
+
background-position: -409px -962px;
|
1405 |
+
}
|
1406 |
+
.icns_tab_3 .row_14_9 {
|
1407 |
+
background-position: -467px -962px;
|
1408 |
+
}
|
1409 |
+
.icns_tab_3 .row_14_10 {
|
1410 |
+
background-position: -526px -962px;
|
1411 |
+
}
|
1412 |
+
.icns_tab_3 .row_14_11 {
|
1413 |
+
background-position: -711px -962px;
|
1414 |
+
}
|
1415 |
+
.icns_tab_3 .row_14_14 {
|
1416 |
+
background-position: -773px -962px;
|
1417 |
+
}
|
1418 |
+
.icns_tab_3 .row_14_15 {
|
1419 |
+
background-position: -838px -962px;
|
1420 |
+
}
|
1421 |
+
.icns_tab_3 .row_14_16 {
|
1422 |
+
background-position: -909px -962px;
|
1423 |
+
}
|
1424 |
+
.icns_tab_3 .row_14_17 {
|
1425 |
+
background-position: -977px -962px;
|
1426 |
+
}
|
1427 |
+
.icns_tab_3 .row_14_18 {
|
1428 |
+
background: url(../images/icons_theme/shaded_dark/shaded_dark_wechat.png);
|
1429 |
+
|
1430 |
+
background-size: contain;
|
1431 |
+
}
|
1432 |
+
.icns_tab_3 .row_15_1 {
|
1433 |
+
background-position: 0 -1036px;
|
1434 |
+
}
|
1435 |
+
.icns_tab_3 .row_15_2 {
|
1436 |
+
background-position: -60px -1036px;
|
1437 |
+
}
|
1438 |
+
.icns_tab_3 .row_15_3 {
|
1439 |
+
background-position: -118px -1036px;
|
1440 |
+
}
|
1441 |
+
.icns_tab_3 .row_15_4 {
|
1442 |
+
background-position: -176px -1036px;
|
1443 |
+
}
|
1444 |
+
.icns_tab_3 .row_15_5 {
|
1445 |
+
background-position: -235px -1036px;
|
1446 |
+
}
|
1447 |
+
.icns_tab_3 .row_15_6 {
|
1448 |
+
background-position: -293px -1036px;
|
1449 |
+
}
|
1450 |
+
.icns_tab_3 .row_15_7 {
|
1451 |
+
background-position: -350px -1036px;
|
1452 |
+
}
|
1453 |
+
.icns_tab_3 .row_15_8 {
|
1454 |
+
background-position: -409px -1036px;
|
1455 |
+
}
|
1456 |
+
.icns_tab_3 .row_15_9 {
|
1457 |
+
background-position: -467px -1036px;
|
1458 |
+
}
|
1459 |
+
.icns_tab_3 .row_15_10 {
|
1460 |
+
background-position: -526px -1036px;
|
1461 |
+
}
|
1462 |
+
.icns_tab_3 .row_15_11 {
|
1463 |
+
background-position: -711px -1036px;
|
1464 |
+
}
|
1465 |
+
.icns_tab_3 .row_15_14 {
|
1466 |
+
background-position: -773px -1036px;
|
1467 |
+
}
|
1468 |
+
.icns_tab_3 .row_15_15 {
|
1469 |
+
background-position: -838px -1036px;
|
1470 |
+
}
|
1471 |
+
.icns_tab_3 .row_15_16 {
|
1472 |
+
background-position: -909px -1036px;
|
1473 |
+
}
|
1474 |
+
.icns_tab_3 .row_15_17 {
|
1475 |
+
background-position: -977px -1036px;
|
1476 |
+
}
|
1477 |
+
.icns_tab_3 .row_15_18 {
|
1478 |
+
background: url(../images/icons_theme/shaded_light/shaded_light_wechat.png);
|
1479 |
+
background-size: contain;
|
1480 |
+
}
|
1481 |
+
.icns_tab_3 .row_16_1 {
|
1482 |
+
background-position: 0 -1109px;
|
1483 |
+
}
|
1484 |
+
.icns_tab_3 .row_16_2 {
|
1485 |
+
background-position: -60px -1109px;
|
1486 |
+
}
|
1487 |
+
.icns_tab_3 .row_16_3 {
|
1488 |
+
background-position: -118px -1109px;
|
1489 |
+
}
|
1490 |
+
.icns_tab_3 .row_16_4 {
|
1491 |
+
background-position: -176px -1109px;
|
1492 |
+
}
|
1493 |
+
.icns_tab_3 .row_16_5 {
|
1494 |
+
background-position: -235px -1109px;
|
1495 |
+
}
|
1496 |
+
.icns_tab_3 .row_16_6 {
|
1497 |
+
background-position: -293px -1109px;
|
1498 |
+
}
|
1499 |
+
.icns_tab_3 .row_16_7 {
|
1500 |
+
background-position: -350px -1109px;
|
1501 |
+
}
|
1502 |
+
.icns_tab_3 .row_16_8 {
|
1503 |
+
background-position: -409px -1109px;
|
1504 |
+
}
|
1505 |
+
.icns_tab_3 .row_16_9 {
|
1506 |
+
background-position: -467px -1109px;
|
1507 |
+
}
|
1508 |
+
.icns_tab_3 .row_16_10 {
|
1509 |
+
background-position: -526px -1109px;
|
1510 |
+
}
|
1511 |
+
.icns_tab_3 .row_16_11 {
|
1512 |
+
background-position: -711px -1109px;
|
1513 |
+
}
|
1514 |
+
.icns_tab_3 .row_16_14 {
|
1515 |
+
background-position: -773px -1109px;
|
1516 |
+
}
|
1517 |
+
.icns_tab_3 .row_16_15 {
|
1518 |
+
background-position: -838px -1109px;
|
1519 |
+
}
|
1520 |
+
.icns_tab_3 .row_16_16 {
|
1521 |
+
background-position: -909px -1109px;
|
1522 |
+
}
|
1523 |
+
.icns_tab_3 .row_16_17 {
|
1524 |
+
background-position: -977px -1109px;
|
1525 |
+
}
|
1526 |
+
.icns_tab_3 .row_16_18 {
|
1527 |
+
background: url(../images/icons_theme/transparent/transparent_wechat.png);
|
1528 |
+
background-size: contain;
|
1529 |
+
}
|
1530 |
+
|
1531 |
+
/*tab 6 css*/
|
1532 |
+
.tab6 .social_icon_like1 {
|
1533 |
+
width: 100%;
|
1534 |
+
float: left;
|
1535 |
+
margin: 0;
|
1536 |
+
text-align: center;
|
1537 |
+
}
|
1538 |
+
.tab6 .social_icon_like1 ul {
|
1539 |
+
margin: 0;
|
1540 |
+
padding: 0;
|
1541 |
+
list-style: none;
|
1542 |
+
text-align: center;
|
1543 |
+
}
|
1544 |
+
.tab6 .social_icon_like1 li {
|
1545 |
+
margin: 0 10px 0 0;
|
1546 |
+
padding: 0;
|
1547 |
+
width: auto;
|
1548 |
+
list-style: none;
|
1549 |
+
display: inline-block;
|
1550 |
+
}
|
1551 |
+
.tab6 .social_icon_like1 li span {
|
1552 |
+
margin: 0;
|
1553 |
+
width: 44px;
|
1554 |
+
display: block;
|
1555 |
+
background: url(../images/count_bg1.png) no-repeat;
|
1556 |
+
height: 22px;
|
1557 |
+
overflow: hidden;
|
1558 |
+
padding: 2px 2px 2px 10px;
|
1559 |
+
font-family: helveticaregular;
|
1560 |
+
font-size: 15px;
|
1561 |
+
text-align: center;
|
1562 |
+
line-height: 20px;
|
1563 |
+
color: #5a6570;
|
1564 |
+
float: left;
|
1565 |
+
}
|
1566 |
+
.tab6 .social_icon_like1 li img {
|
1567 |
+
float: left;
|
1568 |
+
margin-right: 5px;
|
1569 |
+
display: block;
|
1570 |
+
}
|
1571 |
+
.tab6 .social_icon_like1 li a {
|
1572 |
+
color: #5a6570;
|
1573 |
+
text-decoration: none;
|
1574 |
+
display: block;
|
1575 |
+
}
|
1576 |
+
.tab6 ul.usually {
|
1577 |
+
margin: 7px 0 6px 60px;
|
1578 |
+
padding: 0;
|
1579 |
+
list-style: none;
|
1580 |
+
}
|
1581 |
+
.tab6 ul.usually li {
|
1582 |
+
margin: 0;
|
1583 |
+
padding: 0;
|
1584 |
+
width: auto;
|
1585 |
+
list-style: none;
|
1586 |
+
text-align: left;
|
1587 |
+
font-size: 17px;
|
1588 |
+
color: #5a6570;
|
1589 |
+
}
|
1590 |
+
.tab6 ul.enough_waffling {
|
1591 |
+
margin: 9px 0 0;
|
1592 |
+
padding: 0;
|
1593 |
+
list-style: none;
|
1594 |
+
text-align: center;
|
1595 |
+
}
|
1596 |
+
.tab6 ul.enough_waffling li {
|
1597 |
+
margin: 0 22px;
|
1598 |
+
padding: 0;
|
1599 |
+
list-style: none;
|
1600 |
+
display: inline-block;
|
1601 |
+
}
|
1602 |
+
.tab6 ul.enough_waffling li span {
|
1603 |
+
float: left;
|
1604 |
+
}
|
1605 |
+
.tab6 ul.enough_waffling li label {
|
1606 |
+
margin: 0 0 0 20px;
|
1607 |
+
float: left;
|
1608 |
+
font-family: helveticaregular;
|
1609 |
+
font-size: 18px;
|
1610 |
+
font-weight: 400;
|
1611 |
+
text-align: center;
|
1612 |
+
line-height: 38px;
|
1613 |
+
color: #5a6570;
|
1614 |
+
}
|
1615 |
+
.tab6 .row {
|
1616 |
+
border-top: 1px solid #eaebee;
|
1617 |
+
margin-top: 25px;
|
1618 |
+
padding-top: 15px;
|
1619 |
+
clear: both;
|
1620 |
+
display: block;
|
1621 |
+
width: 100%;
|
1622 |
+
float: left;
|
1623 |
+
font-family: "Helvetica CE 35 Thin";
|
1624 |
+
line-height: 42px;
|
1625 |
+
}
|
1626 |
+
.tab6 .options {
|
1627 |
+
margin-top: 25px;
|
1628 |
+
clear: both;
|
1629 |
+
width: 100%;
|
1630 |
+
float: left;
|
1631 |
+
}
|
1632 |
+
.tab6 .options label {
|
1633 |
+
width: 345px;
|
1634 |
+
float: left;
|
1635 |
+
font-size: 17px;
|
1636 |
+
/*font-family: helveticaregular;*/
|
1637 |
+
font-family: 'helveticaneue-light';
|
1638 |
+
color: #5a6570;
|
1639 |
+
line-height: 46px;
|
1640 |
+
}
|
1641 |
+
.tab6 .options label.first {
|
1642 |
+
/*font-family: helveticaregular;*/
|
1643 |
+
|
1644 |
+
font-family: 'helveticaneue-light';
|
1645 |
+
font-size: 17px;
|
1646 |
+
}
|
1647 |
+
.tab6 .options input {
|
1648 |
+
width: 308px;
|
1649 |
+
float: left;
|
1650 |
+
background: #e5e5e5;
|
1651 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
1652 |
+
border: 0;
|
1653 |
+
padding: 10px;
|
1654 |
+
}
|
1655 |
+
.tab6 .options .field {
|
1656 |
+
|
1657 |
+
float: left;
|
1658 |
+
position: relative;
|
1659 |
+
}
|
1660 |
+
.tab6 .options .field .select {
|
1661 |
+
width: 207px;
|
1662 |
+
background: url(../images/select_bg1.jpg) no-repeat;
|
1663 |
+
display: block;
|
1664 |
+
padding-left: 17px;
|
1665 |
+
font-family: helveticaregular;
|
1666 |
+
}.tab6 .cstmdsplyulwpr .radio_section.tb_4_ck { float: left;
|
1667 |
+
|
1668 |
+
width: auto;
|
1669 |
+
}
|
1670 |
+
.tab6 .social_icon_like1 li span.checkbox {
|
1671 |
+
background: rgba(0, 0, 0, 0) url(../images/check_bg.jpg) no-repeat scroll 0 0;
|
1672 |
+
display: inherit;
|
1673 |
+
height: 31px;
|
1674 |
+
width: 31px;
|
1675 |
+
}
|
1676 |
+
.tab6 .cstmdsplyulwpr a {
|
1677 |
+
margin-top: 3px;
|
1678 |
+
float: left;
|
1679 |
+
}
|
1680 |
+
/*tab 7 css*/
|
1681 |
+
.tab7 h3 {
|
1682 |
+
margin: 14px 0 6px;
|
1683 |
+
padding: 0;
|
1684 |
+
/* color: #a7a9ac;*/
|
1685 |
+
color: #414951;
|
1686 |
+
/* font-family: helveticaregular;*/
|
1687 |
+
font-family: 'helveticaneue-light';
|
1688 |
+
/* font-size: 20px;*/
|
1689 |
+
font-size: 18px;
|
1690 |
+
text-align: left;
|
1691 |
+
}
|
1692 |
+
|
1693 |
+
.tab7 .close {
|
1694 |
+
position: absolute;
|
1695 |
+
right: 18px;
|
1696 |
+
top: 18px;
|
1697 |
+
}
|
1698 |
+
.tab7 .text_options {
|
1699 |
+
width: 500px;
|
1700 |
+
float: left;
|
1701 |
+
}
|
1702 |
+
.tab7 .text_options.layout {
|
1703 |
+
margin-left: -25px;
|
1704 |
+
}
|
1705 |
+
.tab7 .row_tab {
|
1706 |
+
margin-top: 10px;
|
1707 |
+
width: 100%;
|
1708 |
+
float: left;
|
1709 |
+
}
|
1710 |
+
.tab7 .text_options label {
|
1711 |
+
width: 121px;
|
1712 |
+
float: left;
|
1713 |
+
line-height: 46px;
|
1714 |
+
font-size: 18px;
|
1715 |
+
}
|
1716 |
+
.tab7 .text_options.layout label {
|
1717 |
+
line-height: 20px;
|
1718 |
+
font-size: 18px;
|
1719 |
+
}
|
1720 |
+
.tab7 .text_options.layout label.border {
|
1721 |
+
line-height: 46px;
|
1722 |
+
}
|
1723 |
+
.tab7 .text_options input {
|
1724 |
+
width: 274px;
|
1725 |
+
float: left;
|
1726 |
+
background: #e5e5e5;
|
1727 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
1728 |
+
border: 0;
|
1729 |
+
padding: 13px 10px;
|
1730 |
+
font-size: 17px;
|
1731 |
+
color: #5a6570;
|
1732 |
+
}
|
1733 |
+
.tab7 .text_options input.small {
|
1734 |
+
width: 50px;
|
1735 |
+
}
|
1736 |
+
.tab7 .text_options .field {
|
1737 |
+
width: 223px;
|
1738 |
+
float: left;
|
1739 |
+
position: relative;
|
1740 |
+
}
|
1741 |
+
.tab7 .text_options .field .select {
|
1742 |
+
width: 183px;
|
1743 |
+
padding-right: 21px;
|
1744 |
+
height: 47px;
|
1745 |
+
background: url(../images/select_bg1.jpg) no-repeat;
|
1746 |
+
display: block;
|
1747 |
+
padding-left: 10px;
|
1748 |
+
line-height: 46px;
|
1749 |
+
font-size: 17px;
|
1750 |
+
color: #414951;
|
1751 |
+
}
|
1752 |
+
.tab7 .text_options .field select.styled {
|
1753 |
+
position: absolute;
|
1754 |
+
left: 0;
|
1755 |
+
top: 0;
|
1756 |
+
width: 213px;
|
1757 |
+
line-height: 46px;
|
1758 |
+
height: 46px;
|
1759 |
+
}
|
1760 |
+
.tab7 .color_box {
|
1761 |
+
width: 40px;
|
1762 |
+
height: 34px;
|
1763 |
+
border: 3px solid #fff;
|
1764 |
+
box-shadow: 1px 2px 2px #ccc;
|
1765 |
+
float: left;
|
1766 |
+
position: relative;
|
1767 |
+
margin-left: 13px;
|
1768 |
+
}
|
1769 |
+
.tab7 .color_box1 {
|
1770 |
+
width: 100%;
|
1771 |
+
height: 34px;
|
1772 |
+
background: #5a6570;
|
1773 |
+
box-shadow: 1px -2px 15px -2px #d3d3d3 inset;
|
1774 |
+
}
|
1775 |
+
.tab7 .corner {
|
1776 |
+
width: 10px;
|
1777 |
+
height: 10px;
|
1778 |
+
background: #fff;
|
1779 |
+
position: absolute;
|
1780 |
+
right: 0;
|
1781 |
+
bottom: 0;
|
1782 |
+
}
|
1783 |
+
.tab7 ul.border_shadow {
|
1784 |
+
margin: 0;
|
1785 |
+
padding: 5px 0 0;
|
1786 |
+
list-style: none;
|
1787 |
+
float: left;
|
1788 |
+
width: 257px;
|
1789 |
+
}
|
1790 |
+
.tab7 ul.border_shadow li {
|
1791 |
+
margin: 0;
|
1792 |
+
padding: 0 0 0 40px;
|
1793 |
+
list-style: none;
|
1794 |
+
float: left;
|
1795 |
+
}
|
1796 |
+
.tab7 ul.border_shadow li:first-child {
|
1797 |
+
padding: 0;
|
1798 |
+
}
|
1799 |
+
.tab7 ul.border_shadow li span {
|
1800 |
+
float: left;
|
1801 |
+
}
|
1802 |
+
.tab7 ul.border_shadow li label {
|
1803 |
+
float: left;
|
1804 |
+
width: auto;
|
1805 |
+
font-family: helveticaregular;
|
1806 |
+
font-size: 18px;
|
1807 |
+
font-weight: 400;
|
1808 |
+
text-align: center;
|
1809 |
+
line-height: 40px !important;
|
1810 |
+
color: #5a6570;
|
1811 |
+
padding: 0 0 0 20px;
|
1812 |
+
}
|
1813 |
+
.tab7 .row {
|
1814 |
+
border-top: 1px solid #eaebee;
|
1815 |
+
margin-top: 25px;
|
1816 |
+
padding-top: 15px;
|
1817 |
+
clear: both;
|
1818 |
+
display: block;
|
1819 |
+
width: 100%;
|
1820 |
+
float: left;
|
1821 |
+
font-family: helveticaregular;
|
1822 |
+
line-height: 42px;
|
1823 |
+
}
|
1824 |
+
.tab7 .pop_up_show {
|
1825 |
+
width: 100%;
|
1826 |
+
float: left;
|
1827 |
+
margin-top: 20px;
|
1828 |
+
}
|
1829 |
+
.tab7 .pop_up_show span {
|
1830 |
+
float: left;
|
1831 |
+
}
|
1832 |
+
.tab7 .pop_up_show label {
|
1833 |
+
float: left;
|
1834 |
+
width: auto;
|
1835 |
+
font-size: 18px;
|
1836 |
+
font-weight: 400;
|
1837 |
+
text-align: center;
|
1838 |
+
line-height: 38px !important;
|
1839 |
+
color: #5a6570;
|
1840 |
+
padding: 0 0 0 20px;
|
1841 |
+
}
|
1842 |
+
.tab7 .pop_up_show input.add {
|
1843 |
+
width: 257px;
|
1844 |
+
float: left;
|
1845 |
+
background: #e5e5e5;
|
1846 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
1847 |
+
border: 0;
|
1848 |
+
padding: 10px;
|
1849 |
+
margin-left: 40px;
|
1850 |
+
}
|
1851 |
+
.tab7 .pop_up_show input.seconds {
|
1852 |
+
width: 60px;
|
1853 |
+
background: #e5e5e5;
|
1854 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
1855 |
+
border: 0;
|
1856 |
+
padding: 10px;
|
1857 |
+
margin: 0 7px;
|
1858 |
+
}
|
1859 |
+
.tab7 .pop_up_show a {
|
1860 |
+
text-decoration: underline;
|
1861 |
+
color: #a4a9ad;
|
1862 |
+
font-size: 16px;
|
1863 |
+
margin-left: 20px;
|
1864 |
+
}
|
1865 |
+
.tab7 .pop_up_show .field {
|
1866 |
+
width: 135px;
|
1867 |
+
float: left;
|
1868 |
+
position: relative;
|
1869 |
+
margin-left: 20px;
|
1870 |
+
font-size: 17px;
|
1871 |
+
font-family: helveticaregular;
|
1872 |
+
}
|
1873 |
+
.tab7 .pop_up_show .field .select {
|
1874 |
+
width: 127px;
|
1875 |
+
height: 48px;
|
1876 |
+
background: url(../images/select_bg.jpg) no-repeat;
|
1877 |
+
display: block;
|
1878 |
+
padding-left: 10px;
|
1879 |
+
line-height: 46px;
|
1880 |
+
font-size: 16px;
|
1881 |
+
color: #5a6570;
|
1882 |
+
}
|
1883 |
+
.tab7 .pop_up_show .field select.styled {
|
1884 |
+
position: absolute;
|
1885 |
+
left: 0;
|
1886 |
+
top: 0;
|
1887 |
+
width: 135px;
|
1888 |
+
line-height: 46px;
|
1889 |
+
height: 46px;
|
1890 |
+
}
|
1891 |
+
/*tab 8 css*/
|
1892 |
+
.tab8 .sfsi_tab8_container {
|
1893 |
+
width: 100%;
|
1894 |
+
float: left;
|
1895 |
+
}
|
1896 |
+
.tab8 .sfsi_tab8_subcontainer {
|
1897 |
+
float: left;
|
1898 |
+
padding: 20px 0;
|
1899 |
+
width: 100%;
|
1900 |
+
}
|
1901 |
+
.tab8 h3.sfsi_section_title {
|
1902 |
+
font-weight: bold;
|
1903 |
+
}
|
1904 |
+
.tab8 .like_pop_box {
|
1905 |
+
width: 100%;
|
1906 |
+
margin: 35px auto auto;
|
1907 |
+
position: relative;
|
1908 |
+
text-align: center;
|
1909 |
+
}
|
1910 |
+
.tab8 .like_pop_box h2 {
|
1911 |
+
font-family: helveticabold;
|
1912 |
+
text-align: center;
|
1913 |
+
color: #414951;
|
1914 |
+
font-size: 26px;
|
1915 |
+
}
|
1916 |
+
.tab8 .sfsi_subscribe_Popinner {
|
1917 |
+
display: inline-block;
|
1918 |
+
padding: 18px 20px;
|
1919 |
+
-webkit-box-shadow: 0 0 5px #ccc;
|
1920 |
+
border: 1px solid #ededed;
|
1921 |
+
background: #FFF;
|
1922 |
+
position: relative;
|
1923 |
+
}
|
1924 |
+
.tab8 .sfsi_subscribe_Popinner .form-overlay {
|
1925 |
+
height: 100%;
|
1926 |
+
left: 0;
|
1927 |
+
position: absolute;
|
1928 |
+
top: 0;
|
1929 |
+
width: 100%;
|
1930 |
+
}
|
1931 |
+
.tab8 .like_pop_box .sfsi_subscribe_Popinner {
|
1932 |
+
box-shadow: 0 0 5px #ccc;
|
1933 |
+
}
|
1934 |
+
.tab8 .like_pop_box .sfsi_subscribe_Popinner h5 {
|
1935 |
+
margin: 0 0 10px;
|
1936 |
+
padding: 0;
|
1937 |
+
color: #414951;
|
1938 |
+
font-size: 22px;
|
1939 |
+
text-align: center;
|
1940 |
+
}
|
1941 |
+
.tab8 .sfsi_subscribe_Popinner h5 {
|
1942 |
+
margin: 0 0 10px;
|
1943 |
+
padding: 0;
|
1944 |
+
color: #414951;
|
1945 |
+
font-size: 18px;
|
1946 |
+
text-align: center;
|
1947 |
+
}
|
1948 |
+
.tab8 .sfsi_subscription_form_field {
|
1949 |
+
float: left;
|
1950 |
+
margin: 5px 0;
|
1951 |
+
width: 100%;
|
1952 |
+
}
|
1953 |
+
.tab8 .sfsi_subscription_form_field input {
|
1954 |
+
padding: 10px 0px;
|
1955 |
+
text-align: center;
|
1956 |
+
width: 100%;
|
1957 |
+
}
|
1958 |
+
.tab8 .sfsi_tab8_subcontainer label.sfsi_label_text {
|
1959 |
+
float: left;
|
1960 |
+
margin: 10px 0;
|
1961 |
+
width: 100%;
|
1962 |
+
}
|
1963 |
+
.tab8 ul.sfsi_form_info {
|
1964 |
+
list-style: none !important;
|
1965 |
+
margin-left: 32px;
|
1966 |
+
}
|
1967 |
+
.tab8 ul.sfsi_form_info li {
|
1968 |
+
margin: 3px 0;
|
1969 |
+
}
|
1970 |
+
.tab8 .sfsi_subscription_html {
|
1971 |
+
background-color: #e5e5e5;
|
1972 |
+
float: left;
|
1973 |
+
margin: 12px 0 0 30px;
|
1974 |
+
width: 90%;
|
1975 |
+
}
|
1976 |
+
.tab8 .sfsi_seprater {
|
1977 |
+
border-bottom: 1px solid #ccc;
|
1978 |
+
}
|
1979 |
+
.tab8 .sfsi_tab8_subcontainer h5.sfsi_section_subtitle {
|
1980 |
+
float: left;
|
1981 |
+
font-size: 18px;
|
1982 |
+
margin: 5px 0;
|
1983 |
+
width: 100%;
|
1984 |
+
}
|
1985 |
+
.tab8 .sfsi_left_container {
|
1986 |
+
margin-top: 30px;
|
1987 |
+
text-align: center;
|
1988 |
+
width: 24%;
|
1989 |
+
display: inline-block;
|
1990 |
+
}
|
1991 |
+
.tab8 .sfsi_right_container {
|
1992 |
+
display: inline-block;
|
1993 |
+
margin-top: 30px;
|
1994 |
+
padding: 0 20px;
|
1995 |
+
vertical-align: top;
|
1996 |
+
width: 72%;
|
1997 |
+
}
|
1998 |
+
.tab8 .row_tab {
|
1999 |
+
display: inline-block;
|
2000 |
+
margin-bottom: 30px;
|
2001 |
+
width: 100%;
|
2002 |
+
}
|
2003 |
+
.tab8 .row_tab label {
|
2004 |
+
color: #5a6570;
|
2005 |
+
font-size: 16px;
|
2006 |
+
}
|
2007 |
+
.tab8 .row_tab div.sfsi_field {
|
2008 |
+
display: inline-block;
|
2009 |
+
vertical-align: middle;
|
2010 |
+
width: auto;
|
2011 |
+
margin-right: 25px;
|
2012 |
+
padding-top: 10px;
|
2013 |
+
}
|
2014 |
+
.tab8 .color_box {
|
2015 |
+
width: 40px;
|
2016 |
+
height: 34px;
|
2017 |
+
border: 3px solid #fff;
|
2018 |
+
box-shadow: 1px 2px 2px #ccc;
|
2019 |
+
float: right;
|
2020 |
+
position: relative;
|
2021 |
+
margin-left: 13px;
|
2022 |
+
}
|
2023 |
+
.tab8 .color_box1 {
|
2024 |
+
width: 100%;
|
2025 |
+
height: 34px;
|
2026 |
+
background: #5a6570;
|
2027 |
+
box-shadow: 1px -2px 15px -2px #d3d3d3 inset;
|
2028 |
+
}
|
2029 |
+
.tab8 .corner {
|
2030 |
+
width: 10px;
|
2031 |
+
height: 10px;
|
2032 |
+
background: #fff;
|
2033 |
+
position: absolute;
|
2034 |
+
right: 0;
|
2035 |
+
bottom: 0;
|
2036 |
+
}
|
2037 |
+
.tab8 .sfsi_right_container label {
|
2038 |
+
color: #5a6570;
|
2039 |
+
font-size: 18px;
|
2040 |
+
}
|
2041 |
+
.tab8 label.sfsi_heding {
|
2042 |
+
display: inline-block;
|
2043 |
+
/* font-weight: bold; */
|
2044 |
+
padding-top: 10px;
|
2045 |
+
width: 303px;
|
2046 |
+
}
|
2047 |
+
.tab8 .border_shadow {
|
2048 |
+
display: inline-block;
|
2049 |
+
vertical-align: top;
|
2050 |
+
}
|
2051 |
+
.tab8 .border_shadow li {
|
2052 |
+
display: inline-block;
|
2053 |
+
vertical-align: top;
|
2054 |
+
padding-right: 20px;
|
2055 |
+
}
|
2056 |
+
.tab8 .border_shadow li span {
|
2057 |
+
vertical-align: middle;
|
2058 |
+
}
|
2059 |
+
.tab8 .border_shadow .radio {
|
2060 |
+
margin-right: 5px;
|
2061 |
+
}
|
2062 |
+
.tab8 .sfsi_field .rec-inp {
|
2063 |
+
background: #e5e5e5 none repeat scroll 0 0;
|
2064 |
+
height: 44px;
|
2065 |
+
text-align: center;
|
2066 |
+
width: 54px;
|
2067 |
+
}
|
2068 |
+
.tab8 .pix {
|
2069 |
+
color: #5a6570;
|
2070 |
+
font-size: 18px;
|
2071 |
+
vertical-align: middle;
|
2072 |
+
}
|
2073 |
+
.tab8 .sfsi_heding.autowidth {
|
2074 |
+
width: auto;
|
2075 |
+
margin-right: 15px;
|
2076 |
+
}
|
2077 |
+
.tab8 .sfsi_heding.fixwidth {
|
2078 |
+
width: 80px;
|
2079 |
+
}
|
2080 |
+
.tab8 .small {
|
2081 |
+
background-color: #e5e5e5;
|
2082 |
+
height: 44px;
|
2083 |
+
width: 200px;
|
2084 |
+
}
|
2085 |
+
.tab8 .small.new-inp {
|
2086 |
+
background-color: #e5e5e5;
|
2087 |
+
height: 44px;
|
2088 |
+
width: 277px;
|
2089 |
+
}
|
2090 |
+
.tab8 .small.color-code {
|
2091 |
+
width: 138px !important;
|
2092 |
+
}
|
2093 |
+
.tab8 .select-same {
|
2094 |
+
border: 1px solid #d6d6d6;
|
2095 |
+
height: 47px !important;
|
2096 |
+
width: 171px;
|
2097 |
+
appearance: none;
|
2098 |
+
-moz-appearance: none;
|
2099 |
+
-webkit-appearance: none;
|
2100 |
+
background-image: url(images/select-arrow.png);
|
2101 |
+
background-repeat: no-repeat;
|
2102 |
+
background-position: right 15px center;
|
2103 |
+
}
|
2104 |
+
.sfsi_mainContainer .tab8 .sfsi_same_width {
|
2105 |
+
display: inline-block;
|
2106 |
+
width: 100px !important;
|
2107 |
+
}
|
2108 |
+
.sfsi_mainContainer .tab7 .wp-picker-container input {
|
2109 |
+
background: rgba(0, 0, 0, 0) none repeat scroll 0 0 !important;
|
2110 |
+
border: 1px solid #ccc !important;
|
2111 |
+
box-shadow: none !important;
|
2112 |
+
float: left !important;
|
2113 |
+
height: auto !important;
|
2114 |
+
padding: 0 !important;
|
2115 |
+
width: auto !important;
|
2116 |
+
}
|
2117 |
+
.sfsi_mainContainer .tab7 .wp-picker-container input[type="text"] {
|
2118 |
+
padding: 3px !important;
|
2119 |
+
}
|
2120 |
+
.sfsi_mainContainer .tab7 .wp-picker-container input[type="button"] {
|
2121 |
+
padding: 0 5px !important;
|
2122 |
+
}
|
2123 |
+
.sfsi_mainContainer .tab7 .wp-picker-open .wp-picker-input-wrap,
|
2124 |
+
.sfsi_mainContainer .tab8 .wp-picker-open .wp-picker-input-wrap {
|
2125 |
+
vertical-align: middle !important;
|
2126 |
+
}
|
2127 |
+
.sfsi_mainContainer .tab7 .wp-color-result,
|
2128 |
+
.sfsi_mainContainer .tab8 .wp-color-result {
|
2129 |
+
margin: 0 6px 0 0 !important;
|
2130 |
+
}
|
2131 |
+
.sfsi_mainContainer .tab7 .wp-picker-holder,
|
2132 |
+
.sfsi_mainContainer .tab8 .wp-picker-holder {
|
2133 |
+
position: absolute !important;
|
2134 |
+
z-index: 999;
|
2135 |
+
}
|
2136 |
+
.sfsi_mainContainer .sfsi_subscribe_Popinner .sfsi_highlight {
|
2137 |
+
border: 3px solid red !important;
|
2138 |
+
}
|
2139 |
+
.sfsi_mainContainer .sfsi_subscription_html xmp {
|
2140 |
+
display: block;
|
2141 |
+
padding: 0 10px;
|
2142 |
+
white-space: pre-line;
|
2143 |
+
word-wrap: break-word;
|
2144 |
+
}
|
2145 |
+
ul.sfsi_floaticon_margin_sec {
|
2146 |
+
float: left;
|
2147 |
+
width: 600px;
|
2148 |
+
}
|
2149 |
+
ul.sfsi_floaticon_margin_sec li {
|
2150 |
+
float: left;
|
2151 |
+
width: 300px;
|
2152 |
+
margin-bottom: 20px;
|
2153 |
+
}
|
2154 |
+
ul.sfsi_floaticon_margin_sec label {
|
2155 |
+
float: left;
|
2156 |
+
font-size: 17px;
|
2157 |
+
padding-right: 20px;
|
2158 |
+
width: 65px;
|
2159 |
+
}
|
2160 |
+
ul.sfsi_floaticon_margin_sec li input {
|
2161 |
+
background-color: #E5E5E5;
|
2162 |
+
border: medium none;
|
2163 |
+
box-shadow: none;
|
2164 |
+
padding: 14px 8px;
|
2165 |
+
width: 80px;
|
2166 |
+
float: left;
|
2167 |
+
}
|
2168 |
+
ul.sfsi_floaticon_margin_sec li ins {
|
2169 |
+
float: left;
|
2170 |
+
font-size: 17px;
|
2171 |
+
font-weight: 400;
|
2172 |
+
margin-left: 15px;
|
2173 |
+
text-decoration: none;
|
2174 |
+
}
|
2175 |
+
.custom-img img,
|
2176 |
+
.custom_section img,
|
2177 |
+
.custom_iconOrder img,
|
2178 |
+
.sample_icons img {
|
2179 |
+
width: 51px;
|
2180 |
+
}
|
2181 |
+
.cstomskins_upload span.sfsi-bgimage {
|
2182 |
+
background-size: 51px 51px !important;
|
2183 |
+
}
|
2184 |
+
|
2185 |
+
.sfsi_feedClaimingOverlay h1 {
|
2186 |
+
font-size: 22px !important;
|
2187 |
+
font-weight: bolder !important;
|
2188 |
+
margin-top: 7px !important;
|
2189 |
+
}
|
2190 |
+
.sfsi_feedClaimingOverlay input[type="email"] {
|
2191 |
+
font-size: 16px;
|
2192 |
+
margin: 26px 0 0;
|
2193 |
+
padding: 10px 0;
|
2194 |
+
text-align: center;
|
2195 |
+
width: 100%;
|
2196 |
+
color: #bebebe !important;
|
2197 |
+
box-shadow: none;
|
2198 |
+
}
|
2199 |
+
.sfsi_feedClaimingOverlay input[type="email"]::-webkit-input-placeholder {
|
2200 |
+
color: #bebebe !important;
|
2201 |
+
}
|
2202 |
+
.sfsi_feedClaimingOverlay input[type="email"]:-moz-placeholder {
|
2203 |
+
/* Firefox 18- */
|
2204 |
+
color: #bebebe !important;
|
2205 |
+
}
|
2206 |
+
.sfsi_feedClaimingOverlay input[type="email"]::-moz-placeholder {
|
2207 |
+
/* Firefox 19+ */
|
2208 |
+
color: #bebebe !important;
|
2209 |
+
}
|
2210 |
+
.sfsi_feedClaimingOverlay input[type="email"]:-ms-input-placeholder {
|
2211 |
+
color: #bebebe !important;
|
2212 |
+
}
|
2213 |
+
.sfsi_feedClaimingOverlay .save_button {
|
2214 |
+
padding: 0 !important;
|
2215 |
+
width: 100%;
|
2216 |
+
}
|
2217 |
+
.sfsi_feedClaimingOverlay .save_button a#getMeFullAccess {
|
2218 |
+
border-radius: 4px;
|
2219 |
+
font-size: 18px;
|
2220 |
+
font-weight: bolder;
|
2221 |
+
}
|
2222 |
+
.sfsi_feedClaimingOverlay .sfsicloseBtn {
|
2223 |
+
right: 8px !important;
|
2224 |
+
top: 8px !important;
|
2225 |
+
}
|
2226 |
+
.sfsi_feedClaimingOverlay p {
|
2227 |
+
text-align: center !important;
|
2228 |
+
font-size: 12px !important;
|
2229 |
+
line-height: 23px !important;
|
2230 |
+
padding: 18px 0 0 !important;
|
2231 |
+
color: #bebebe !important;
|
2232 |
+
}
|
2233 |
+
.sfsi_feedClaimingOverlay p a {
|
2234 |
+
display: inline-block;
|
2235 |
+
font-size: 12px;
|
2236 |
+
margin: 0;
|
2237 |
+
padding: 0;
|
2238 |
+
width: auto;
|
2239 |
+
color: #274da3 !important;
|
2240 |
+
}
|
2241 |
+
.sfsi_feedClaimingOverlay .pop_up_box {
|
2242 |
+
padding: 25px 30px !important;
|
2243 |
+
width: 435px !important;
|
2244 |
+
min-height: 220px;
|
2245 |
+
}
|
2246 |
+
|
2247 |
+
@media (max-width:1160px) {
|
2248 |
+
.sfsi_subscription_html xmp {
|
2249 |
+
display: block;
|
2250 |
+
padding: 0 10px;
|
2251 |
+
white-space: pre-line;
|
2252 |
+
word-wrap: break-word;
|
2253 |
+
}
|
2254 |
+
}
|
2255 |
+
@media (max-width:1350px) {
|
2256 |
+
.tab8 .sfsi_left_container {
|
2257 |
+
width: 100% !important;
|
2258 |
+
}
|
2259 |
+
|
2260 |
+
.tab8 .sfsi_right_container {
|
2261 |
+
width: 100%;
|
2262 |
+
}
|
2263 |
+
|
2264 |
+
.tab8 .border_shadow {
|
2265 |
+
margin-top: 10px;
|
2266 |
+
}
|
2267 |
+
|
2268 |
+
.tab8 .row_tab div.sfsi_field {
|
2269 |
+
margin-bottom: 10px;
|
2270 |
+
}
|
2271 |
+
|
2272 |
+
}
|
2273 |
+
@media (max-width:770px) {
|
2274 |
+
#sfsi_form_heading_fontstyle {
|
2275 |
+
margin-left: 19px !important;
|
2276 |
+
margin-top: 10px !important;
|
2277 |
+
}
|
2278 |
+
}
|
2279 |
+
|
2280 |
+
/* premium plugin features */
|
2281 |
+
.tab5 .icons_prem_disc {
|
2282 |
+
float: left;
|
2283 |
+
padding-top: 20px;
|
2284 |
+
}
|
2285 |
+
.sfsi_prem_fbpgiddesc {
|
2286 |
+
font-size: 14px;
|
2287 |
+
padding: 4px 0 0 60px;
|
2288 |
+
width: 42%;
|
2289 |
+
float: right;
|
2290 |
+
line-height: 22px;
|
2291 |
+
color: #080808;
|
2292 |
+
}
|
2293 |
+
.instagram_userLi p.sfsi_shared_premium {
|
2294 |
+
float: right;
|
2295 |
+
width: 41%;
|
2296 |
+
line-height: 20px;
|
2297 |
+
color: #1f1d1d;
|
2298 |
+
font-size: 13px;
|
2299 |
+
}
|
2300 |
+
.sfsi_facebook_pagedeasc {
|
2301 |
+
font-size: 14px;
|
2302 |
+
padding: 15px 0 0 60px;
|
2303 |
+
width: 42%;
|
2304 |
+
float: right;
|
2305 |
+
line-height: 22px;
|
2306 |
+
color: #080808;
|
2307 |
+
}
|
2308 |
+
|
2309 |
+
.sf_si_default_design ul li {
|
2310 |
+
width: auto !important;
|
2311 |
+
display: inline-block;
|
2312 |
+
float: none !important;
|
2313 |
+
}.sf_si_our_prmium_plugin-add,
|
2314 |
+
.sfsi_prem_icons_added {
|
2315 |
+
background: #f3faf6;
|
2316 |
+
border: 1px solid #12a252;
|
2317 |
+
padding: 25px 38px 35px 40px;
|
2318 |
+
clear: both;
|
2319 |
+
}
|
2320 |
+
.sf_si_prmium_head h2 {
|
2321 |
+
font-size: 26px;
|
2322 |
+
color: #000;
|
2323 |
+
font-weight: bold;
|
2324 |
+
padding-bottom: 13px;
|
2325 |
+
margin-top: 0;
|
2326 |
+
}
|
2327 |
+
|
2328 |
+
.sfsi_new_prmium_follw {
|
2329 |
+
background: #f3faf6;
|
2330 |
+
border: 1px solid #12a252;
|
2331 |
+
padding: 25px 38px 35px 40px;
|
2332 |
+
float: left;
|
2333 |
+
clear: both;
|
2334 |
+
}
|
2335 |
+
.notice_custom_icons_premium.sfsi_new_prmium_follw {
|
2336 |
+
margin-left: 96px;
|
2337 |
+
}
|
2338 |
+
.sf_si_default_design ul {
|
2339 |
+
padding: 0;
|
2340 |
+
margin: 0;
|
2341 |
+
}
|
2342 |
+
.sf_si_default_design ul li {
|
2343 |
+
list-style: none;
|
2344 |
+
font-size: 20px;
|
2345 |
+
color: #1a1d20;
|
2346 |
+
clear: both;
|
2347 |
+
}
|
2348 |
+
.sfsi_need_another_tell_us,
|
2349 |
+
.sfsi_need_another_one_link {
|
2350 |
+
clear: both;
|
2351 |
+
}
|
2352 |
+
.sf_si_all_features_premium a,
|
2353 |
+
.sfsi_need_another_tell_us a {
|
2354 |
+
color: #12a252 !important;
|
2355 |
+
font-size: 18.9px;
|
2356 |
+
font-weight: bold;
|
2357 |
+
border-bottom: 1px solid #12a252;
|
2358 |
+
text-decoration: none;
|
2359 |
+
}
|
2360 |
+
.sf_si_default_design ul li b {
|
2361 |
+
font-weight: bold;
|
2362 |
+
}
|
2363 |
+
.sf_si_our_prmium_plugin-add .sf_si_prmium_head h2 {
|
2364 |
+
padding-bottom: 23px;
|
2365 |
+
}
|
2366 |
+
|
2367 |
+
.sf_si_default_design ul li img {}
|
2368 |
+
.sfsi_need_another_one_link p {
|
2369 |
+
color: #c1c3c5;
|
2370 |
+
font-size: 18.9px !important;
|
2371 |
+
}
|
2372 |
+
.sfsi_need_another_one_link p a {
|
2373 |
+
color: #12a252 !important;
|
2374 |
+
text-decoration: none;
|
2375 |
+
}
|
2376 |
+
.sfsi_brdr_box {
|
2377 |
+
box-sizing: border-box;
|
2378 |
+
}
|
2379 |
+
.sfsi_prem_cmn_rowlisting {
|
2380 |
+
width: 225px;
|
2381 |
+
float: left;
|
2382 |
+
margin-top: 10px;
|
2383 |
+
margin-bottom: 1px;
|
2384 |
+
}
|
2385 |
+
.sfsi_row {
|
2386 |
+
clear: both;
|
2387 |
+
}
|
2388 |
+
.sfsi_prem_cmn_rowlisting span {
|
2389 |
+
color: #1a1d20;
|
2390 |
+
font-size: 20px;
|
2391 |
+
display: table-cell;
|
2392 |
+
vertical-align: middle;
|
2393 |
+
padding-right: 10px;
|
2394 |
+
}
|
2395 |
+
.sfsi_need_another_one_link {
|
2396 |
+
padding: 23px 0 20px 5px;
|
2397 |
+
}
|
2398 |
+
.sfsi_need_another_tell_us a {
|
2399 |
+
margin-left: 5px;
|
2400 |
+
}
|
2401 |
+
.sfsi_new_prmium_follw {
|
2402 |
+
margin-top: 20px;
|
2403 |
+
display: inline-block;
|
2404 |
+
padding: 15px 75px 20px 24px;
|
2405 |
+
float: left;
|
2406 |
+
}
|
2407 |
+
.sfsi_new_prmium_follw p {
|
2408 |
+
margin: 0 !important;
|
2409 |
+
}
|
2410 |
+
.sfsi_new_prmium_follw p {
|
2411 |
+
color: #1a1d20 !important;
|
2412 |
+
font-size: 20px !important;
|
2413 |
+
font-family: helveticaregular !important;
|
2414 |
+
}
|
2415 |
+
.sfsi_new_prmium_follw p a {
|
2416 |
+
color: #12a252 !important;
|
2417 |
+
text-decoration: none;
|
2418 |
+
}
|
2419 |
+
.sfsi_new_prmium_follw p b {
|
2420 |
+
font-weight: bold;
|
2421 |
+
color: #1a1d20 !important;
|
2422 |
+
}
|
2423 |
+
.sf_si_default_design ul li h4 {
|
2424 |
+
color: #1a1d20 !important;
|
2425 |
+
font-size: 20px !important;
|
2426 |
+
font-weight: bold;
|
2427 |
+
padding-bottom: 21px !important;
|
2428 |
+
}
|
2429 |
+
.sf_si_default_design ul li h4 span {
|
2430 |
+
font-weight: normal;
|
2431 |
+
}
|
2432 |
+
p.sfsi_shared_premium {
|
2433 |
+
color: #1a1d20 !important;
|
2434 |
+
font-family: helveticaregular !important;
|
2435 |
+
padding-top: 0 !important;
|
2436 |
+
}
|
2437 |
+
p.sfsi_shared_premium a {
|
2438 |
+
text-decoration: none;
|
2439 |
+
color: #00a0d2 !important;
|
2440 |
+
}
|
2441 |
+
p.sfsi_shared_premium b {
|
2442 |
+
font-weight: bold;
|
2443 |
+
}
|
2444 |
+
.sfsi_fbpaget {
|
2445 |
+
float: left !important;
|
2446 |
+
padding: 4px 0 0 0px !important;
|
2447 |
+
width: 100% !important;
|
2448 |
+
margin-left: 60px;
|
2449 |
+
}
|
2450 |
+
.sfsi_fbpaget .sfsi_facebook_count {
|
2451 |
+
width: 100% !important;
|
2452 |
+
padding: 4px 0 0 0px !important;
|
2453 |
+
}
|
2454 |
+
.sfsi_prem_show a {
|
2455 |
+
color: #0c0b0b;
|
2456 |
+
margin: 2px;
|
2457 |
+
}
|
2458 |
+
.sfsi_prem_show {
|
2459 |
+
padding-top: 140px !important;
|
2460 |
+
}
|
2461 |
+
.sf_si_default_design ul li b span {
|
2462 |
+
font-weight: normal !important;
|
2463 |
+
}
|
2464 |
+
p.sfsi_prem_plu_desc a {
|
2465 |
+
text-decoration: none;
|
2466 |
+
color: #00a0d2 !important;
|
2467 |
+
}
|
2468 |
+
.sfsi_fb_popup_contain {
|
2469 |
+
width: 50%;
|
2470 |
+
display: inline-block;
|
2471 |
+
}
|
2472 |
+
.sfsi_first_icon_field,
|
2473 |
+
.sfsi_second_icon_img {
|
2474 |
+
display: table-cell;
|
2475 |
+
vertical-align: middle;
|
2476 |
+
padding: 5px 0;
|
2477 |
+
}
|
2478 |
+
.sfsi_first_icon_field {
|
2479 |
+
width: 125px;
|
2480 |
+
}
|
2481 |
+
.sfsi_first_icon_field h2 {
|
2482 |
+
font-size: 18px !important;
|
2483 |
+
color: #1a1d20 !important;
|
2484 |
+
margin: 0 !important;
|
2485 |
+
font-weight: bold;
|
2486 |
+
}
|
2487 |
+
.sfsi_first_icon_field p {
|
2488 |
+
color: #1a1d20 !important;
|
2489 |
+
font-size: 12px !important;
|
2490 |
+
margin: 0 !important;
|
2491 |
+
padding: 0 !important;
|
2492 |
+
line-height: 18px !important;
|
2493 |
+
}
|
2494 |
+
.sfsi_first_icon_more h2 {
|
2495 |
+
font-size: 18px !important;
|
2496 |
+
color: #1a1d20 !important;
|
2497 |
+
margin: 0 !important;
|
2498 |
+
padding-top: 17px;
|
2499 |
+
padding-bottom: 22px;
|
2500 |
+
}
|
2501 |
+
.sfsi_cool_font_weight h2 {
|
2502 |
+
font-weight: normal;
|
2503 |
+
}
|
2504 |
+
.sf_si_default_design ul li {
|
2505 |
+
margin: 0 !important;
|
2506 |
+
}
|
2507 |
+
.sf_si_default_design ul li h4.sfsi_second_themedTitle {
|
2508 |
+
padding-bottom: 16px !important;
|
2509 |
+
}
|
2510 |
+
.sfsi_mainContainer .sfsi_prem_cmn_rowlisting img {
|
2511 |
+
width: 52px;
|
2512 |
+
height: 52px;
|
2513 |
+
}
|
2514 |
+
.sfsi_icons_other_allign {
|
2515 |
+
width: auto;
|
2516 |
+
font-size: 15px !important;
|
2517 |
+
}
|
2518 |
+
|
2519 |
+
/* new notification bar css*/
|
2520 |
+
|
2521 |
+
.sfsi_new_notification {
|
2522 |
+
background-color: #fff;
|
2523 |
+
border: 4px dashed #00c853;
|
2524 |
+
margin-bottom: 30px;
|
2525 |
+
width: 100%;
|
2526 |
+
}
|
2527 |
+
.sfsi_new_notification_header {
|
2528 |
+
background-color: #e8faef;
|
2529 |
+
display: -webkit-box;
|
2530 |
+
display: -webkit-flex;
|
2531 |
+
display: -ms-flexbox;
|
2532 |
+
display: flex;
|
2533 |
+
-webkit-box-align: center;
|
2534 |
+
-webkit-align-items: center;
|
2535 |
+
-ms-flex-align: center;
|
2536 |
+
align-items: center;
|
2537 |
+
-webkit-box-pack: justify;
|
2538 |
+
-webkit-justify-content: space-between;
|
2539 |
+
-ms-flex-pack: justify;
|
2540 |
+
justify-content: space-between;
|
2541 |
+
padding: 10px 0 12px 0;
|
2542 |
+
}
|
2543 |
+
.sfsi_new_notification_header h1 {
|
2544 |
+
margin: 0;
|
2545 |
+
color: #00c853;
|
2546 |
+
font-size: 18px;
|
2547 |
+
margin: 0 auto;
|
2548 |
+
font-family: Arial, Helvetica, sans-serif;
|
2549 |
+
}
|
2550 |
+
.sfsi_new_notification_header h1 a {
|
2551 |
+
margin: 0;
|
2552 |
+
color: #00c853;
|
2553 |
+
font-size: 18px;
|
2554 |
+
margin: 0 auto;
|
2555 |
+
font-family: Arial, Helvetica, sans-serif;
|
2556 |
+
text-decoration: none;
|
2557 |
+
}
|
2558 |
+
.sfsi_new_notification_cross {
|
2559 |
+
float: right;
|
2560 |
+
font-size: 18px;
|
2561 |
+
font-weight: 700;
|
2562 |
+
line-height: 1;
|
2563 |
+
color: #00c853;
|
2564 |
+
font-family: Arial, Helvetica, sans-serif;
|
2565 |
+
margin-right: 15px;
|
2566 |
+
cursor: pointer;
|
2567 |
+
}
|
2568 |
+
.sfsi_new_notification_body {
|
2569 |
+
width: 100%;
|
2570 |
+
background-color: #fff;
|
2571 |
+
display: -webkit-box;
|
2572 |
+
display: -webkit-flex;
|
2573 |
+
display: -ms-flexbox;
|
2574 |
+
display: flex;
|
2575 |
+
-webkit-box-align: center;
|
2576 |
+
-webkit-align-items: center;
|
2577 |
+
-ms-flex-align: center;
|
2578 |
+
align-items: center;
|
2579 |
+
-webkit-box-pack: justify;
|
2580 |
+
-webkit-justify-content: space-between;
|
2581 |
+
-ms-flex-pack: justify;
|
2582 |
+
justify-content: space-between;
|
2583 |
+
}
|
2584 |
+
.sfsi_new_notification_image {
|
2585 |
+
margin: 0 20px 0px 20px;
|
2586 |
+
width: 100%;
|
2587 |
+
text-align: center;
|
2588 |
+
overflow: hidden;
|
2589 |
+
}
|
2590 |
+
.sfsi_new_notification_image img {
|
2591 |
+
width: auto;
|
2592 |
+
}
|
2593 |
+
.sfsi_new_notification_learnmore {
|
2594 |
+
float: right;
|
2595 |
+
}
|
2596 |
+
.sfsi_new_notification_learnmore {
|
2597 |
+
background-color: #00c853;
|
2598 |
+
display: block;
|
2599 |
+
text-decoration: none;
|
2600 |
+
text-align: center;
|
2601 |
+
font-size: 20px;
|
2602 |
+
font-family: Arial, Helvetica, sans-serif;
|
2603 |
+
width: 150px;
|
2604 |
+
margin-bottom: -4px;
|
2605 |
+
margin-right: -4px;
|
2606 |
+
position: relative;
|
2607 |
+
color: #fff;
|
2608 |
+
padding: 70px 10px;
|
2609 |
+
}
|
2610 |
+
.sfsi_new_notification_body_link a {
|
2611 |
+
display: block;
|
2612 |
+
text-decoration: none;
|
2613 |
+
text-align: center;
|
2614 |
+
font-size: 20px;
|
2615 |
+
font-family: Arial, Helvetica, sans-serif;
|
2616 |
+
color: #fff;
|
2617 |
+
}
|
2618 |
+
.tab4 .sfsi_tokenGenerateButton {
|
2619 |
+
margin: 25px 0;
|
2620 |
+
}
|
2621 |
+
.tab4 .sfsi_tokenGenerateButton p {
|
2622 |
+
display: inline-block;
|
2623 |
+
margin-bottom: 11px;
|
2624 |
+
vertical-align: middle;
|
2625 |
+
width: 100%;
|
2626 |
+
}
|
2627 |
+
.tab4 .sfsi_tokenGenerateButton a {
|
2628 |
+
background-color: #12a252;
|
2629 |
+
color: #fff;
|
2630 |
+
padding: 10px 20px;
|
2631 |
+
text-decoration: none;
|
2632 |
+
}
|
2633 |
+
|
2634 |
+
.tab4 .sfsi_instagramFields {
|
2635 |
+
float: left;
|
2636 |
+
margin-bottom: 12px;
|
2637 |
+
/* width: 550px;*/
|
2638 |
+
width: 50%;
|
2639 |
+
margin-left: 60px;
|
2640 |
+
}
|
2641 |
+
|
2642 |
+
.tab4 .sfsi_instagramInstruction {
|
2643 |
+
float: left;
|
2644 |
+
margin-bottom: 12px;
|
2645 |
+
/* width: 450px; */
|
2646 |
+
width: 40%;
|
2647 |
+
margin-left: 30px;
|
2648 |
+
}
|
2649 |
+
#accordion1 p {
|
2650 |
+
color: #5a6570;
|
2651 |
+
text-align: left;
|
2652 |
+
font-family: 'helveticaneue-light';
|
2653 |
+
font-size: 17px;
|
2654 |
+
line-height: 26px;
|
2655 |
+
padding-top: 19px;
|
2656 |
+
}
|
2657 |
+
.specify_counts .listing .sfsi_instagramInstruction ul {
|
2658 |
+
margin: 0;
|
2659 |
+
padding: 0;
|
2660 |
+
list-style: none;
|
2661 |
+
text-align: left;
|
2662 |
+
}
|
2663 |
+
.specify_counts .listing .sfsi_instagramInstruction ul {
|
2664 |
+
padding-left: 14px !important;
|
2665 |
+
}
|
2666 |
+
.specify_counts .listing .sfsi_instagramInstruction li {
|
2667 |
+
font-size: 13px !important;
|
2668 |
+
line-height: 20px !important;
|
2669 |
+
list-style: outside none bullets !important;
|
2670 |
+
margin-top: 5px !important;
|
2671 |
+
padding: 0 !important;
|
2672 |
+
}
|
2673 |
+
/* tab2 email section */
|
2674 |
+
.sfsi_service_row {
|
2675 |
+
margin-right: -15px;
|
2676 |
+
margin-left: -15px;
|
2677 |
+
}
|
2678 |
+
.sfsi_service_column {
|
2679 |
+
float: left;
|
2680 |
+
margin-bottom: 40px;
|
2681 |
+
margin-top: 15px;
|
2682 |
+
padding-left: 30px;
|
2683 |
+
width: 47%;
|
2684 |
+
}
|
2685 |
+
.sfsi_service_column ul {
|
2686 |
+
margin-left: 11% !important;
|
2687 |
+
}
|
2688 |
+
.sfsi_service_column ul li {
|
2689 |
+
padding-bottom: 10px;
|
2690 |
+
font-size: 16px;
|
2691 |
+
line-height: 25px;
|
2692 |
+
}
|
2693 |
+
.sfsi_service_column ul li span {
|
2694 |
+
color: #12a252;
|
2695 |
+
}
|
2696 |
+
.sfsi_service_column ul li::before {
|
2697 |
+
content: url(../images/tick-icon.png);
|
2698 |
+
position: relative;
|
2699 |
+
top: 0px;
|
2700 |
+
right: 10px;
|
2701 |
+
text-indent: -22px;
|
2702 |
+
float: left;
|
2703 |
+
}
|
2704 |
+
.sfsi_inputbtn {
|
2705 |
+
clear: both;
|
2706 |
+
display: block;
|
2707 |
+
}
|
2708 |
+
.sfsi_inputbtn input {
|
2709 |
+
width: 100%;
|
2710 |
+
padding: 15px 0px;
|
2711 |
+
text-align: center;
|
2712 |
+
margin-bottom: 10px;
|
2713 |
+
}
|
2714 |
+
.sfsi_email_services_text {
|
2715 |
+
clear: both;
|
2716 |
+
}
|
2717 |
+
.sfsi_email_services_paragraph {
|
2718 |
+
width: 600px;
|
2719 |
+
float: left;
|
2720 |
+
margin-top: 10px;
|
2721 |
+
margin-bottom: 40px;
|
2722 |
+
}
|
2723 |
+
.sfsi_more_services_link a {
|
2724 |
+
background-color: #12a252;
|
2725 |
+
color: #fff !important;
|
2726 |
+
padding: 20px 0px;
|
2727 |
+
text-decoration: none;
|
2728 |
+
text-align: center;
|
2729 |
+
font-size: 20px;
|
2730 |
+
display: block;
|
2731 |
+
clear: both;
|
2732 |
+
font-weight: bold;
|
2733 |
+
}
|
2734 |
+
.sfsi_subscribe_popbox_link a {
|
2735 |
+
color: #00a0d2 !important;
|
2736 |
+
}
|
2737 |
+
.sfsi_email_services_paragraph ul {
|
2738 |
+
margin-left: 11% !important;
|
2739 |
+
}
|
2740 |
+
.sfsi_email_services_paragraph ul li {
|
2741 |
+
padding-bottom: 10px;
|
2742 |
+
font-size: 16px;
|
2743 |
+
}
|
2744 |
+
.sfsi_email_services_paragraph ul li span {
|
2745 |
+
color: #12a252;
|
2746 |
+
}
|
2747 |
+
.sfsi_email_services_paragraph ul li::before {
|
2748 |
+
content: url(../images/tick-icon.png);
|
2749 |
+
position: relative;
|
2750 |
+
top: 5px;
|
2751 |
+
right: 10px;
|
2752 |
+
text-indent: -22px;
|
2753 |
+
float: left;
|
2754 |
+
}
|
2755 |
+
.sfsi_email_last_paragraph {
|
2756 |
+
width: 60%;
|
2757 |
+
text-align: center !important;
|
2758 |
+
margin: 20px auto ! important;
|
2759 |
+
font-size: 16px !important;
|
2760 |
+
color: #a4a9ad !important;
|
2761 |
+
padding-top: 0 !important;
|
2762 |
+
}
|
2763 |
+
.sfsi_email_last_paragraph a {
|
2764 |
+
color: #12a252 !important;
|
2765 |
+
font-family: 'helveticaneue-light' !important;
|
2766 |
+
}
|
2767 |
+
/*new banner styles*/
|
2768 |
+
.sfsi_new_notification_cat {
|
2769 |
+
width: 100%;
|
2770 |
+
min-height: 300px;
|
2771 |
+
max-width: 700px;
|
2772 |
+
}
|
2773 |
+
.sfsi_new_notification_cat {
|
2774 |
+
background-color: #fff;
|
2775 |
+
margin: 30px auto;
|
2776 |
+
width: 100%;
|
2777 |
+
}
|
2778 |
+
.sfsi_new_notification_header_cat {
|
2779 |
+
background-color: #e8faef;
|
2780 |
+
/*display: -webkit-box;
|
2781 |
+
display: -webkit-flex;
|
2782 |
+
display: -ms-flexbox;
|
2783 |
+
display: flex;
|
2784 |
+
-webkit-box-align: center;
|
2785 |
+
-webkit-align-items: center;
|
2786 |
+
-ms-flex-align: center;
|
2787 |
+
align-items: center;
|
2788 |
+
-webkit-box-pack: justify;
|
2789 |
+
-webkit-justify-content: space-between;
|
2790 |
+
-ms-flex-pack: justify;
|
2791 |
+
justify-content: space-between;*/
|
2792 |
+
padding: 21px 0 21px 0;
|
2793 |
+
text-align: center;
|
2794 |
+
}
|
2795 |
+
.sfsi_new_notification_header_cat h1 {
|
2796 |
+
margin: 0;
|
2797 |
+
color: #000000;
|
2798 |
+
font-size: 24px;
|
2799 |
+
margin: 0 auto;
|
2800 |
+
font-family: Arial, Helvetica, sans-serif;
|
2801 |
+
font-weight: bold;
|
2802 |
+
}
|
2803 |
+
.sfsi_new_notification_header_cat h3 {
|
2804 |
+
margin-top: 10px;
|
2805 |
+
font-size: 16px;
|
2806 |
+
color: #000000;
|
2807 |
+
}
|
2808 |
+
.sfsi_new_notification_header_cat h3 a {
|
2809 |
+
text-decoration: none;
|
2810 |
+
color: #38B54A
|
2811 |
+
}
|
2812 |
+
.sfsi_new_notification_header_cat h1 a {
|
2813 |
+
margin: 0;
|
2814 |
+
color: #00c853;
|
2815 |
+
font-size: 18px;
|
2816 |
+
margin: 0 auto;
|
2817 |
+
font-family: Arial, Helvetica, sans-serif;
|
2818 |
+
text-decoration: none;
|
2819 |
+
}
|
2820 |
+
.sfsi_new_notification_cross_cat {
|
2821 |
+
float: right;
|
2822 |
+
font-size: 18px;
|
2823 |
+
font-weight: 700;
|
2824 |
+
line-height: 1;
|
2825 |
+
color: #000000;
|
2826 |
+
font-family: Arial, Helvetica, sans-serif;
|
2827 |
+
margin-right: 15px;
|
2828 |
+
cursor: pointer;
|
2829 |
+
margin-top: -50px;
|
2830 |
+
}
|
2831 |
+
.sfsi_new_notification_body_link_cat a {
|
2832 |
+
display: block;
|
2833 |
+
text-decoration: none;
|
2834 |
+
text-align: center;
|
2835 |
+
font-size: 20px;
|
2836 |
+
font-family: Arial, Helvetica, sans-serif;
|
2837 |
+
color: #fff;
|
2838 |
+
}
|
2839 |
+
.sfsi_new_notification_body_cat {
|
2840 |
+
width: 100%;
|
2841 |
+
background-color: #fff;
|
2842 |
+
/*display: -webkit-box;
|
2843 |
+
display: -webkit-flex;
|
2844 |
+
display: -ms-flexbox;
|
2845 |
+
display: flex;
|
2846 |
+
-webkit-box-align: center;
|
2847 |
+
-webkit-align-items: center;
|
2848 |
+
-ms-flex-align: center;
|
2849 |
+
align-items: center;
|
2850 |
+
-webkit-box-pack: justify;
|
2851 |
+
-webkit-justify-content: space-between;
|
2852 |
+
-ms-flex-pack: justify;
|
2853 |
+
justify-content: space-between;*/
|
2854 |
+
}
|
2855 |
+
.sfsi_new_notification_image_cat {
|
2856 |
+
/* margin: 0 20px 0px 20px; */
|
2857 |
+
width: 100%;
|
2858 |
+
text-align: center;
|
2859 |
+
overflow: hidden;
|
2860 |
+
/*padding: 10px 0px;*/
|
2861 |
+
}
|
2862 |
+
.sfsi_new_notification_image_cat img {
|
2863 |
+
width: auto;
|
2864 |
+
border: 0;
|
2865 |
+
vertical-align: middle;
|
2866 |
+
}
|
2867 |
+
.bottom_text {
|
2868 |
+
background: #38B54A;
|
2869 |
+
text-align: center;
|
2870 |
+
padding: 15px 0px;
|
2871 |
+
font-size: 18px;
|
2872 |
+
font-weight: bold;
|
2873 |
+
color: #fff;
|
2874 |
+
}
|
2875 |
+
.sfsi_new_notification_image_cat p {
|
2876 |
+
color: #000000;
|
2877 |
+
padding: 10px;
|
2878 |
+
font-size: 16px;
|
2879 |
+
}
|
2880 |
+
.sfsi_new_notification_body_link_cat .tailored_icons_img {
|
2881 |
+
display: block;
|
2882 |
+
text-decoration: none;
|
2883 |
+
text-align: center;
|
2884 |
+
font-size: 20px;
|
2885 |
+
font-family: Arial, Helvetica, sans-serif;
|
2886 |
+
color: #fff;
|
2887 |
+
margin: 28px 0px;
|
2888 |
+
}
|
2889 |
+
/**curl error box*/
|
2890 |
+
.sfsi_curlerror {
|
2891 |
+
margin: 0px 0px 10px 94px;
|
2892 |
+
background: rgba(244, 67, 54, 0.08);
|
2893 |
+
padding: 20px;
|
2894 |
+
line-height: 20px;
|
2895 |
+
}
|
2896 |
+
.sfsi_curlerrorNotification .sfsi_curlerror {
|
2897 |
+
background: rgba(244, 67, 54, 0.08);
|
2898 |
+
padding: 20px;
|
2899 |
+
line-height: 20px;
|
2900 |
+
margin: 0px 0px 10px 0px;
|
2901 |
+
}
|
2902 |
+
.sfsi_curlerror_cross {
|
2903 |
+
float: right;
|
2904 |
+
text-decoration: underline;
|
2905 |
+
margin-top: 10px;
|
2906 |
+
}
|
2907 |
+
.sfsi_curlerrortab4 a {
|
2908 |
+
color: #0073aa !important;
|
2909 |
+
}
|
2910 |
+
.sfsi_curlerror a {
|
2911 |
+
color: #0073aa !important;
|
2912 |
+
}
|
2913 |
+
|
2914 |
+
.social_data_post_types {
|
2915 |
+
float: left;
|
2916 |
+
width: 100%;
|
2917 |
+
margin-top: 10px;
|
2918 |
+
}
|
2919 |
+
.social_data_post_types .checkbox {
|
2920 |
+
float: left;
|
2921 |
+
margin-top: 5px;
|
2922 |
+
margin-right: 5px;
|
2923 |
+
}
|
2924 |
+
.social_data_post_types ul {
|
2925 |
+
float: left;
|
2926 |
+
margin-top: 5px;
|
2927 |
+
}
|
2928 |
+
.social_data_post_types li {
|
2929 |
+
float: left;
|
2930 |
+
min-width: 90px;
|
2931 |
+
}
|
2932 |
+
.social_data_post_types .radio_section.tb_4_ck {
|
2933 |
+
float: left;
|
2934 |
+
margin-right: 5px;
|
2935 |
+
}
|
2936 |
+
.social_data_post_types .radio_section.tb_4_ck .cstmdsplsub {
|
2937 |
+
font-size: 16px;
|
2938 |
+
}
|
2939 |
+
.social_data_post_types ul {
|
2940 |
+
float: left;
|
2941 |
+
width: 84%;
|
2942 |
+
}
|
2943 |
+
.social_data_post_types .radio_section.tb_4_ck input.styled {
|
2944 |
+
margin-top: 20px;
|
2945 |
+
}
|
2946 |
+
ul.sfsi_show_hide_section {
|
2947 |
+
float: right;
|
2948 |
+
width: 16%;
|
2949 |
+
}
|
2950 |
+
|
2951 |
+
.sfsi_social_sharing {
|
2952 |
+
margin-bottom: 15px;
|
2953 |
+
float: left;
|
2954 |
+
width: 51%;
|
2955 |
+
}
|
2956 |
+
.socialPostTypesUl span {
|
2957 |
+
pointer-events: none
|
2958 |
+
}
|
2959 |
+
.bannerPopupQue6 {
|
2960 |
+
width: 98% !important;
|
2961 |
+
float: left !important;
|
2962 |
+
padding: 15px !important;
|
2963 |
+
}
|
2964 |
+
.pinterest_section .sfsi_new_prmium_follw a {
|
2965 |
+
font-weight: bold !important;
|
2966 |
+
}
|
2967 |
+
#accordion,
|
2968 |
+
#accordion1 {
|
2969 |
+
float: left;
|
2970 |
+
clear: both;
|
2971 |
+
width: 100%;
|
2972 |
+
}
|
2973 |
+
h2.optional {
|
2974 |
+
float: left;
|
2975 |
+
clear: both;
|
2976 |
+
margin-top: 25px !important;
|
2977 |
+
}
|
2978 |
+
|
2979 |
+
/*support forum*/
|
2980 |
+
.welcometext {
|
2981 |
+
float: left;
|
2982 |
+
width: 72%;
|
2983 |
+
}
|
2984 |
+
.welcometext p {
|
2985 |
+
margin-bottom: 8px !important;
|
2986 |
+
margin-top: 15px !important;
|
2987 |
+
font-size: 16px;
|
2988 |
+
}
|
2989 |
+
.supportforum {
|
2990 |
+
float: right;
|
2991 |
+
width: auto;
|
2992 |
+
background: #fff;
|
2993 |
+
text-align: center;
|
2994 |
+
padding: 0 20px 3px 7px;
|
2995 |
+
}
|
2996 |
+
.support-container p {
|
2997 |
+
font-family: helveticaregular !important;
|
2998 |
+
}
|
2999 |
+
.support-container {
|
3000 |
+
padding: 7px 4px;
|
3001 |
+
}
|
3002 |
+
.have-questions {
|
3003 |
+
text-align: center;
|
3004 |
+
font-size: 20px;
|
3005 |
+
}
|
3006 |
+
.have-questions img {
|
3007 |
+
width: 45px;
|
3008 |
+
display: inline-block;
|
3009 |
+
}
|
3010 |
+
.have-questions .have-quest {
|
3011 |
+
display: inline-block;
|
3012 |
+
font-size: 20px;
|
3013 |
+
font-weight: 700;
|
3014 |
+
margin: 0;
|
3015 |
+
vertical-align: sub;
|
3016 |
+
}
|
3017 |
+
.have-questions .ask-question {
|
3018 |
+
margin-bottom: 3px !important;
|
3019 |
+
margin-top: 2px !important;
|
3020 |
+
}
|
3021 |
+
.support-forum-green-bg {
|
3022 |
+
margin-top: 5px;
|
3023 |
+
margin-left: 20px;
|
3024 |
+
background: #26B654;
|
3025 |
+
width: 145px;
|
3026 |
+
border-radius: 5px;
|
3027 |
+
padding: 10px 16px 8px 15px;
|
3028 |
+
}
|
3029 |
+
.support-forum-green-bg img {
|
3030 |
+
display: inline-block;
|
3031 |
+
padding-right: 5px;
|
3032 |
+
}
|
3033 |
+
.support-forum-green-div p.support-forum {
|
3034 |
+
display: inline-block;
|
3035 |
+
color: #fff;
|
3036 |
+
font-weight: 700;
|
3037 |
+
margin: 0 !important;
|
3038 |
+
}
|
3039 |
+
.support-forum-green-div a {
|
3040 |
+
text-decoration: none !important;
|
3041 |
+
}
|
3042 |
+
.respond-text p {
|
3043 |
+
margin: 10px 0 0 0px !important
|
3044 |
+
}
|
3045 |
+
.respond-text {
|
3046 |
+
margin-left: 20px;
|
3047 |
+
float: left;
|
3048 |
+
margin-bottom: 8px;
|
3049 |
+
}
|
3050 |
+
|
3051 |
+
@media (min-width: 1631px) and (max-width: 1631px) {
|
3052 |
+
.premiumComponent {
|
3053 |
+
width: 52% !important;
|
3054 |
+
}
|
3055 |
+
.premiumButtonsContainer {
|
3056 |
+
width: 44% !important;
|
3057 |
+
}
|
3058 |
+
.premiumButtonsContainer .premiumSection2 {
|
3059 |
+
width: 41% !important;
|
3060 |
+
}
|
3061 |
+
.premiumButtonsContainer .premiumSection3 {
|
3062 |
+
width: 41% !important;
|
3063 |
+
}
|
3064 |
+
}
|
3065 |
+
|
3066 |
+
/************************************ Question 3-> Where shall they be displayed? CSS STARTS *************************/
|
3067 |
+
.tab9 h1 {
|
3068 |
+
font-size: 20px !important;
|
3069 |
+
ont-weight: bold !important;
|
3070 |
+
margin-bottom: 20px !important;
|
3071 |
+
}
|
3072 |
+
.tab9 span.checkbox {
|
3073 |
+
margin-top: 3px;
|
3074 |
+
}
|
3075 |
+
.tab9 input {
|
3076 |
+
width: 317px;
|
3077 |
+
background: #e5e5e5;
|
3078 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
3079 |
+
border: 0;
|
3080 |
+
padding: 13px 10px !important;
|
3081 |
+
font-size: 17px;
|
3082 |
+
color: #5a6570;
|
3083 |
+
}
|
3084 |
+
.tab9 ul.sfsi_icn_listing8 {
|
3085 |
+
list-style: outside none none;
|
3086 |
+
margin: 5px 0 0;
|
3087 |
+
overflow: hidden;
|
3088 |
+
}
|
3089 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_right_info {
|
3090 |
+
font-family: helveticaregular;
|
3091 |
+
width: 94.7%;
|
3092 |
+
float: left;
|
3093 |
+
}
|
3094 |
+
.tab9 ul.sfsi_icn_listing8 li {
|
3095 |
+
float: left;
|
3096 |
+
padding: 11px 0 15px 8px;
|
3097 |
+
width: 100%;
|
3098 |
+
margin: 0;
|
3099 |
+
}
|
3100 |
+
.tab9 .sfsi_float_position_icon_label img {
|
3101 |
+
margin-left: auto;
|
3102 |
+
margin-right: auto;
|
3103 |
+
display: block;
|
3104 |
+
margin-top: 7px;
|
3105 |
+
}
|
3106 |
+
.tab9 .sfsi_float_position_icon_label img.sfsi_img_center_bottom {
|
3107 |
+
position: absolute;
|
3108 |
+
bottom: 0px;
|
3109 |
+
left: 18%;
|
3110 |
+
}
|
3111 |
+
.tab9 .sfsiLocationli .cstmfltonpgstck p {
|
3112 |
+
padding-top: 5px !important;
|
3113 |
+
padding-left: 20px !important;
|
3114 |
+
display: table;
|
3115 |
+
font-size: 19px !important
|
3116 |
+
}
|
3117 |
+
.sfsi_mainContainer .checkbox {
|
3118 |
+
float: left;
|
3119 |
+
}#accordion .tab9 .sfsi_icn_listing8 li .sfsi_right_info .kckslctn p:first-child {
|
3120 |
+
margin-top: 17px !important;
|
3121 |
+
}
|
3122 |
+
#accordion .tab9 .sfsi_icn_listing8 li .sfsi_right_info p {
|
3123 |
+
padding-left: 20px;
|
3124 |
+
font-size: 19px !important;
|
3125 |
+
display: table
|
3126 |
+
}
|
3127 |
+
#accordion .tab9 .sfsi_icn_listing8 li.sfsi_show_via_shortcode .sfsi_right_info p:last-child {
|
3128 |
+
padding-top: 0px;
|
3129 |
+
}
|
3130 |
+
#accordion .tab9 .sfsi_icn_listing8 li.sfsi_show_via_shortcode .sfsi_right_info .kckslctn p:last-child {
|
3131 |
+
padding-top: 19px !important;
|
3132 |
+
}
|
3133 |
+
.tab9 .sfsi_feature_note {
|
3134 |
+
font-size: 18px !important;
|
3135 |
+
margin-left: 12px !important;
|
3136 |
+
padding-top: 0px !important;
|
3137 |
+
}
|
3138 |
+
.tab9 .ul.sfsi_make_icons.sfsi_mobile_float {
|
3139 |
+
float: left;
|
3140 |
+
}
|
3141 |
+
.tab9 .sfsi_disable_floatingicons_mobile {
|
3142 |
+
width: 88%;
|
3143 |
+
float: left;
|
3144 |
+
margin: 25px 0 0 27px
|
3145 |
+
}
|
3146 |
+
.tab9 .sfsi_disable_floatingicons_mobile h4 {
|
3147 |
+
float: left;
|
3148 |
+
line-height: 56px !important;
|
3149 |
+
margin-right: 40px !important;
|
3150 |
+
font-family: 'helveticaneue-light' !important;
|
3151 |
+
color: #5a6570 !important;
|
3152 |
+
}
|
3153 |
+
.tab9 .sfsi_toglepstpgspn {
|
3154 |
+
font-weight: bold;
|
3155 |
+
}
|
3156 |
+
.tab9 .sfsi_show_via_shortcode .kckslctn,
|
3157 |
+
.tab9 .sfsi_show_via_afterposts .kckslctn {
|
3158 |
+
font-size: 15px;
|
3159 |
+
margin-top: 5px;
|
3160 |
+
}
|
3161 |
+
.tab9 .sfsi_show_via_shortcode .kckslctn h4,
|
3162 |
+
.tab9 .sfsi_show_via_afterposts .kckslctn h4 {
|
3163 |
+
font-size: 18px !important;
|
3164 |
+
padding: 18px 0 0 0 !important;
|
3165 |
+
}
|
3166 |
+
.tab9 .sfsi_navigate_to_question7 {
|
3167 |
+
text-decoration: underline;
|
3168 |
+
cursor: pointer
|
3169 |
+
}
|
3170 |
+
.tab9 .sfsiLocationli h4 {
|
3171 |
+
font-size: 19px !important
|
3172 |
+
}
|
3173 |
+
.tab9 .sfsi_make_icons span.radio {
|
3174 |
+
background-position: 0 0;
|
3175 |
+
display: inline-block;
|
3176 |
+
vertical-align: middle;
|
3177 |
+
float: left;
|
3178 |
+
}
|
3179 |
+
.tab9 ul.sfsi_icn_listing8 li .flthmonpg li {
|
3180 |
+
min-width: 33%;
|
3181 |
+
width: 33% !important
|
3182 |
+
}
|
3183 |
+
|
3184 |
+
. .tab9 .radio_section.tb_4_ck {
|
3185 |
+
margin: 0 20px 0 0 !important;
|
3186 |
+
float: left
|
3187 |
+
}
|
3188 |
+
.tab9 .sfsi_tab_3_icns {
|
3189 |
+
display: block;
|
3190 |
+
}
|
3191 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns .sfsi_make_icons li {
|
3192 |
+
width: 13%;
|
3193 |
+
min-width: 35px
|
3194 |
+
}
|
3195 |
+
.tab9 .sfsi_make_icons .sfsi_flicnsoptn3 {
|
3196 |
+
color: #69737c;
|
3197 |
+
display: inline-block;
|
3198 |
+
float: none;
|
3199 |
+
font-family: helveticaneue-light;
|
3200 |
+
font-size: 20px;
|
3201 |
+
margin: 7px 0 0 15px;
|
3202 |
+
vertical-align: middle;
|
3203 |
+
width: auto
|
3204 |
+
}
|
3205 |
+
.tab9 .sfsi_float_position_icon_label {
|
3206 |
+
border: 1px solid #ccc;
|
3207 |
+
border-radius: 18px;
|
3208 |
+
margin-top: 3px;
|
3209 |
+
position: relative;
|
3210 |
+
width: 189px;
|
3211 |
+
height: 148px
|
3212 |
+
}
|
3213 |
+
.tab9 .save_button {
|
3214 |
+
padding-top: 0
|
3215 |
+
}
|
3216 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns li {
|
3217 |
+
padding-left: 0;
|
3218 |
+
padding-bottom: 15px
|
3219 |
+
}
|
3220 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns ul.sfsi_floaticon_margin_sec li {
|
3221 |
+
min-width: 50%;
|
3222 |
+
padding-left: 0;
|
3223 |
+
padding-bottom: 15px;
|
3224 |
+
float: left;
|
3225 |
+
width: 50%
|
3226 |
+
}
|
3227 |
+
.tab9 .sfsi_tab_3_icns.flthmonpg .radio {
|
3228 |
+
margin-top: 55px
|
3229 |
+
}
|
3230 |
+
.tab9 .sfsi_position_divider {
|
3231 |
+
float: left;
|
3232 |
+
margin-top: 0;
|
3233 |
+
margin-left: 15px;
|
3234 |
+
width: 100%
|
3235 |
+
}
|
3236 |
+
#accordion .tab9 ul.shwthmbfraftr .labelhdng4,
|
3237 |
+
#accordion .tab9 ul.shwthmbfraftr .row h4.labelhdng4 {
|
3238 |
+
color: #555;
|
3239 |
+
font-size: 20px;
|
3240 |
+
margin-left: 20px;
|
3241 |
+
font-family: helveticaregular
|
3242 |
+
}
|
3243 |
+
.tab9 .sfsiLocationli .sfsi_right_info .sfsi_tab_3_icns {
|
3244 |
+
float: left;
|
3245 |
+
clear: both
|
3246 |
+
}
|
3247 |
+
.tab9 ul.sfsi_tab_3_icns li .icns_tab_3,
|
3248 |
+
ul.sfsi_tab_3_icns li .radio {
|
3249 |
+
float: left
|
3250 |
+
}
|
3251 |
+
.tab9 ul.sfsi_tab_3_icns.flthmonpg {
|
3252 |
+
margin-top: 20px
|
3253 |
+
}
|
3254 |
+
.tab9 .sfsi_right_info ul.sfsi_floaticon_margin_sec li {
|
3255 |
+
float: left
|
3256 |
+
}
|
3257 |
+
.tab9 .sfsi_right_info ul.sfsi_floaticon_margin_sec label {
|
3258 |
+
font-size: 17px;
|
3259 |
+
padding-right: 7px;
|
3260 |
+
width: 63px !important;
|
3261 |
+
display: inline-block;
|
3262 |
+
margin-top: 10px
|
3263 |
+
}
|
3264 |
+
.tab9 .sfsi_right_info ul.sfsi_floaticon_margin_sec ins {
|
3265 |
+
margin-top: 10px
|
3266 |
+
}
|
3267 |
+
.tab9 .sfsi_right_info ul.sfsi_floaticon_margin_sec li input {
|
3268 |
+
background-color: #dedede;
|
3269 |
+
border: none;
|
3270 |
+
box-shadow: none;
|
3271 |
+
padding: 14px 8px;
|
3272 |
+
width: 80px
|
3273 |
+
}
|
3274 |
+
.tab9 .sfsi_right_info ul.sfsi_floaticon_margin_sec li ins {
|
3275 |
+
font-size: 17px;
|
3276 |
+
font-weight: 400;
|
3277 |
+
margin-left: 15px;
|
3278 |
+
text-decoration: none
|
3279 |
+
}
|
3280 |
+
.tab9 .sfsi_flicnsoptn3 {
|
3281 |
+
color: #69737c;
|
3282 |
+
float: left;
|
3283 |
+
font-size: 20px;
|
3284 |
+
margin: 62px 5px 0 20px;
|
3285 |
+
font-family: helveticaneue-light;
|
3286 |
+
width: 136px
|
3287 |
+
}
|
3288 |
+
.tab9 ul.sfsi_tab_3_icns label {
|
3289 |
+
float: left;
|
3290 |
+
line-height: 42px;
|
3291 |
+
color: #69737C;
|
3292 |
+
font-size: 18px;
|
3293 |
+
font-family: helveticaregular;
|
3294 |
+
min-width: 120px
|
3295 |
+
}
|
3296 |
+
|
3297 |
+
@media screen and (max-width: 823px) {
|
3298 |
+
.wapper {
|
3299 |
+
padding: 0 15px;
|
3300 |
+
}
|
3301 |
+
.welcometext {
|
3302 |
+
width: 62% !important;
|
3303 |
+
}
|
3304 |
+
.supportforum {
|
3305 |
+
margin-top: 22px;
|
3306 |
+
}
|
3307 |
+
.main_contant h1 {
|
3308 |
+
line-height: 35px;
|
3309 |
+
}
|
3310 |
+
#sfpageLoad {
|
3311 |
+
width: 100% !important;
|
3312 |
+
left: 0px !important;
|
3313 |
+
}
|
3314 |
+
.tab9 .sfsi_position_divider {
|
3315 |
+
margin-left: 0px !important;
|
3316 |
+
}
|
3317 |
+
.row ul.tab_2_email_sec li {
|
3318 |
+
width: 31%;
|
3319 |
+
}
|
3320 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_right_info {
|
3321 |
+
width: 89.7% !important;
|
3322 |
+
}
|
3323 |
+
.tab9 ul.sfsi_icn_listing8 li.sfsiLocationli .sfsi_right_info {
|
3324 |
+
width: 100% !important;
|
3325 |
+
}
|
3326 |
+
.tab9 .sfsi_float_position_icon_label {
|
3327 |
+
clear: both !important;
|
3328 |
+
}
|
3329 |
+
.tab9 .sfsi_tab_3_icns.flthmonpg .radio {
|
3330 |
+
margin-top: 0px !important;
|
3331 |
+
}
|
3332 |
+
.tab9 .sfsi_flicnsoptn3 {
|
3333 |
+
margin: 5px 5px 0 20px !important;
|
3334 |
+
width: 131px !important;
|
3335 |
+
}
|
3336 |
+
.tab9 .sfsiLocationli label,
|
3337 |
+
.tab9 .sfsi_float_position_icon_label {
|
3338 |
+
margin-top: 13px;
|
3339 |
+
clear: both !important;
|
3340 |
+
}
|
3341 |
+
.tab9 .sfsi_position_divider:nth-child(2) {
|
3342 |
+
margin: 20px 0;
|
3343 |
+
}
|
3344 |
+
.tab9 ul.sfsi_tab_3_icns.flthmonpg {
|
3345 |
+
margin-left: 44px;
|
3346 |
+
}
|
3347 |
+
|
3348 |
+
.tab9 ul.sfsi_make_icons.sfsi_mobile_float {
|
3349 |
+
float: left;
|
3350 |
+
clear: both;
|
3351 |
+
}
|
3352 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns .sfsi_make_icons li {
|
3353 |
+
width: 50% !important;
|
3354 |
+
}
|
3355 |
+
}
|
3356 |
+
@media screen and (min-width: 360px) and (max-width: 414px) {
|
3357 |
+
.tab9 ul.sfsi_icn_listing8 li .flthmonpg li {
|
3358 |
+
width: 100% !important;
|
3359 |
+
}
|
3360 |
+
}
|
3361 |
+
@media screen and (min-width: 640px) and (max-width: 640px) {
|
3362 |
+
.tab9 ul.sfsi_icn_listing8 li .flthmonpg li {
|
3363 |
+
width: 100% !important;
|
3364 |
+
}
|
3365 |
+
.tab9 .sfsi_img_center_bottom {
|
3366 |
+
padding-top: 0px !important;
|
3367 |
+
width: 62% !important;
|
3368 |
+
margin-top: -10px;
|
3369 |
+
margin-left: 5px;
|
3370 |
+
}
|
3371 |
+
}
|
3372 |
+
@media screen and (min-width: 1024px) and (max-width: 1024px) {
|
3373 |
+
.wapper {
|
3374 |
+
padding: 0 30px 0px 15px;
|
3375 |
+
}
|
3376 |
+
.welcometext {
|
3377 |
+
width: 62% !important;
|
3378 |
+
}
|
3379 |
+
.supportforum {
|
3380 |
+
margin-top: 22px;
|
3381 |
+
}
|
3382 |
+
.main_contant h1 {
|
3383 |
+
line-height: 35px;
|
3384 |
+
}
|
3385 |
+
#sfpageLoad {
|
3386 |
+
width: 100% !important;
|
3387 |
+
}
|
3388 |
+
.tab9 ul.sfsi_tab_3_icns.flthmonpg {
|
3389 |
+
margin-left: 45px;
|
3390 |
+
}
|
3391 |
+
.row ul.tab_2_email_sec li {
|
3392 |
+
width: 31%;
|
3393 |
+
}
|
3394 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_right_info {
|
3395 |
+
width: 90.7% !important;
|
3396 |
+
}
|
3397 |
+
.tab9 ul.sfsi_icn_listing8 li.sfsiLocationli .sfsi_right_info {
|
3398 |
+
width: 100% !important;
|
3399 |
+
}
|
3400 |
+
.tab9 .sfsi_float_position_icon_label {
|
3401 |
+
clear: both !important;
|
3402 |
+
}
|
3403 |
+
.tab9 .sfsiLocationli label,
|
3404 |
+
.tab9 .sfsi_float_position_icon_label {
|
3405 |
+
margin-top: 13px;
|
3406 |
+
clear: both;
|
3407 |
+
float: left;
|
3408 |
+
}
|
3409 |
+
.tab9 .sfsi_tab_3_icns.flthmonpg .radio {
|
3410 |
+
margin-top: 0px !important;
|
3411 |
+
}
|
3412 |
+
.tab9 .sfsi_flicnsoptn3 {
|
3413 |
+
margin-top: 3px !important
|
3414 |
+
}
|
3415 |
+
.tab9 .sfsi_position_divider:nth-child(2) {
|
3416 |
+
margin: 20px 0;
|
3417 |
+
}
|
3418 |
+
.tab9 .sfsi_position_divider {
|
3419 |
+
margin-left: 0px !important;
|
3420 |
+
}
|
3421 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns .sfsi_make_icons li {
|
3422 |
+
width: 30% !important;
|
3423 |
+
}
|
3424 |
+
.tab9 ul.sfsi_make_icons.sfsi_mobile_float {
|
3425 |
+
width: 100% !important;
|
3426 |
+
}
|
3427 |
+
}
|
3428 |
+
|
3429 |
+
@media screen and (min-width: 1080px) and (max-width: 1080px) {
|
3430 |
+
.tab9 ul.sfsi_tab_3_icns label {
|
3431 |
+
clear: both;
|
3432 |
+
margin-top: 20px;
|
3433 |
+
}
|
3434 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns ul.sfsi_make_icons {
|
3435 |
+
float: left;
|
3436 |
+
clear: both;
|
3437 |
+
width: 100%;
|
3438 |
+
}
|
3439 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns ul.sfsi_make_icons li {
|
3440 |
+
width: 50%;
|
3441 |
+
}
|
3442 |
+
}
|
3443 |
+
|
3444 |
+
@media screen and (min-width: 1920px) and (max-width: 1920px) {
|
3445 |
+
.tab9 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns ul.sfsi_make_icons li span.sfsi_flicnsoptn3 {
|
3446 |
+
padding-top: 6px;
|
3447 |
+
padding-left: 5px;
|
3448 |
+
}
|
3449 |
+
}
|
3450 |
+
|
3451 |
+
@media screen and (min-width: 1366px) and (max-width: 1366px) {
|
3452 |
+
.wapper {
|
3453 |
+
padding: 40px 40px 40px 10px;
|
3454 |
+
}
|
3455 |
+
.tab9 ul.sfsi_icn_listing8 li.sfsiLocationli .sfsi_right_info {
|
3456 |
+
width: 100% !important;
|
3457 |
+
}
|
3458 |
+
.tab9 .sfsi_flicnsoptn3 {
|
3459 |
+
font-size: 18px !important;
|
3460 |
+
min-width: 113px !important;
|
3461 |
+
margin: 60px 0px 0 10px !important;
|
3462 |
+
width: auto !important;
|
3463 |
+
}
|
3464 |
+
.tab9 .sfsi_position_divider {
|
3465 |
+
margin-left: 0px !important;
|
3466 |
+
}
|
3467 |
+
}
|
3468 |
+
/************************************ Question 3-> Where shall they be displayed? CSS CLOSES *************************/
|
3469 |
+
|
3470 |
+
/* Link to support forum left of every Save button */
|
3471 |
+
.ui-accordion .ui-accordion-content {
|
3472 |
+
position: relative;
|
3473 |
+
}
|
3474 |
+
.sfsi_askforhelp {
|
3475 |
+
float: left;
|
3476 |
+
width: 32%;
|
3477 |
+
position: absolute;
|
3478 |
+
bottom: 30px;
|
3479 |
+
}
|
3480 |
+
.sfsi_askforhelp img {
|
3481 |
+
float: left;
|
3482 |
+
width: 35px;
|
3483 |
+
height: 35px;
|
3484 |
+
vertical-align: middle;
|
3485 |
+
}
|
3486 |
+
.sfsi_askforhelp span {
|
3487 |
+
float: left;
|
3488 |
+
margin-left: 6px;
|
3489 |
+
margin-top: 8px;
|
3490 |
+
}
|
3491 |
+
.askhelpInview2 {
|
3492 |
+
bottom: 25px;
|
3493 |
+
}
|
3494 |
+
.askhelpInview3 {
|
3495 |
+
bottom: 38px;
|
3496 |
+
}
|
3497 |
+
.askhelpInview7 {
|
3498 |
+
bottom: 50px;
|
3499 |
+
}
|
3500 |
+
|
3501 |
+
div#sfsi_langnotice,
|
3502 |
+
div#sfsi_addThis_removal_notice,
|
3503 |
+
div#sfsi_error_reporting_notice {
|
3504 |
+
padding: 10px;
|
3505 |
+
margin-left: 0px;
|
3506 |
+
position: relative;
|
3507 |
+
}
|
3508 |
+
|
3509 |
+
.clear {
|
3510 |
+
clear: both;
|
3511 |
+
}
|
3512 |
+
.show {
|
3513 |
+
display: block;
|
3514 |
+
}
|
3515 |
+
.hide {
|
3516 |
+
display: none;
|
3517 |
+
}
|
3518 |
+
|
3519 |
+
.zeropadding {
|
3520 |
+
padding: 0px !important;
|
3521 |
+
}
|
3522 |
+
.zerotoppadding {
|
3523 |
+
padding-top: 0px !important;
|
3524 |
+
}
|
3525 |
+
.zerobottompadding {
|
3526 |
+
padding-bottom: 0px !important;
|
3527 |
+
}
|
3528 |
+
.zerotopmargin {
|
3529 |
+
margin-top: 0px !important;
|
3530 |
+
}
|
3531 |
+
|
3532 |
+
.rowpadding10 {
|
3533 |
+
padding: 10px 0 !important;
|
3534 |
+
}
|
3535 |
+
.rowmarginleft15 {
|
3536 |
+
margin-left: 15px !important;
|
3537 |
+
}
|
3538 |
+
.rowmarginleft25 {
|
3539 |
+
margin-left: 25px !important;
|
3540 |
+
}
|
3541 |
+
.rowmarginleft45 {
|
3542 |
+
margin-left: 45px !important;
|
3543 |
+
}
|
3544 |
+
|
3545 |
+
.bottommargin20 {
|
3546 |
+
margin-bottom: 20px !important;
|
3547 |
+
}
|
3548 |
+
.bottommargin30 {
|
3549 |
+
margin-bottom: 30px !important;
|
3550 |
+
}
|
3551 |
+
.bottommargin40 {
|
3552 |
+
margin-bottom: 40px !important;
|
3553 |
+
}
|
3554 |
+
.inactiveSection {
|
3555 |
+
opacity: 0.2;
|
3556 |
+
pointer-events: none;
|
3557 |
+
}
|
3558 |
+
|
3559 |
+
/* */
|
3560 |
+
.tab3 .sub_row {
|
3561 |
+
float: left;
|
3562 |
+
margin: 15px 0 0 4%;
|
3563 |
+
width: 80%;
|
3564 |
+
}
|
3565 |
+
.tab3 .sub_row label {
|
3566 |
+
float: left;
|
3567 |
+
margin: 0 0px 0 10px;
|
3568 |
+
line-height: 36px;
|
3569 |
+
font-size: 18px;
|
3570 |
+
}
|
3571 |
+
.tab3 .sub_row .effectContainer {
|
3572 |
+
float: left;
|
3573 |
+
width: 100%;
|
3574 |
+
margin-left: 45px;
|
3575 |
+
}
|
3576 |
+
.tab3 .sub_row .effectName {
|
3577 |
+
float: left;
|
3578 |
+
width: 35%;
|
3579 |
+
}
|
3580 |
+
.tab3 .tab_3_sav {
|
3581 |
+
padding-top: 0;
|
3582 |
+
margin: 0px auto 10px;
|
3583 |
+
position: relative;
|
3584 |
+
z-index: 9;
|
3585 |
+
}
|
3586 |
+
.tab3 .Shuffle_auto {
|
3587 |
+
float: left;
|
3588 |
+
width: 80%;
|
3589 |
+
clear: both;
|
3590 |
+
}
|
3591 |
+
.tab3 #animationSection label {
|
3592 |
+
font-family: 'helveticaneue-light';
|
3593 |
+
}
|
3594 |
+
|
3595 |
+
.tab3 select[name='mouseover_other_icons_transition_effect'] {
|
3596 |
+
margin-left: 10px;
|
3597 |
+
padding: 0px 11px;
|
3598 |
+
margin-top: 4px;
|
3599 |
+
font-size: 15px;
|
3600 |
+
border-radius: 5px;
|
3601 |
+
}
|
3602 |
+
.tab3 .other_icons_effects_options .mouseover_other_icon_label {
|
3603 |
+
float: left;
|
3604 |
+
width: 30%;
|
3605 |
+
font-size: 16px;
|
3606 |
+
}
|
3607 |
+
.tab3 .mouse-over-effects span.radio {
|
3608 |
+
float: left;
|
3609 |
+
display: inline-block;
|
3610 |
+
}
|
3611 |
+
.tab3 .same_icons_effects label span {
|
3612 |
+
float: left;
|
3613 |
+
clear: both;
|
3614 |
+
line-height: 20px;
|
3615 |
+
}
|
3616 |
+
.tab3 .same_icons_effects label span:nth-child(2) {
|
3617 |
+
font-size: 14px;
|
3618 |
+
}
|
3619 |
+
.tab3 .other_icons_effects_options .mouseover_other_icon_img {
|
3620 |
+
float: left;
|
3621 |
+
width: 40px;
|
3622 |
+
height: 40px;
|
3623 |
+
}
|
3624 |
+
.tab3 .other_icons_effects_options .mouseover_other_icon_change_link,
|
3625 |
+
.tab3 .other_icons_effects_options .mouseover_other_icon_revert_link {
|
3626 |
+
float: left;
|
3627 |
+
color: #337ab7;
|
3628 |
+
margin-left: 15px;
|
3629 |
+
padding: 5px 0px;
|
3630 |
+
font-size: 15px;
|
3631 |
+
text-decoration: underline;
|
3632 |
+
}
|
3633 |
+
.mouseover-premium-notice {}
|
3634 |
+
.mouseover-premium-notice label {
|
3635 |
+
width: auto !important;
|
3636 |
+
margin: 0 !important;
|
3637 |
+
}
|
3638 |
+
.mouseover-premium-notice a {
|
3639 |
+
float: left;
|
3640 |
+
color: #12a252 !important;
|
3641 |
+
padding-top: 5px;
|
3642 |
+
margin-left: 5px;
|
3643 |
+
font-size: 18px;
|
3644 |
+
}
|
3645 |
+
|
3646 |
+
@media (min-width:414px) and (max-width: 736px) and (orientation:portrait) {
|
3647 |
+
.tab3 .sub_row {
|
3648 |
+
width: 100%;
|
3649 |
+
}
|
3650 |
+
.tab3 .sub_row .effectContainer {
|
3651 |
+
margin-left: 25px;
|
3652 |
+
margin-bottom: 0px;
|
3653 |
+
clear: both;
|
3654 |
+
}
|
3655 |
+
.tab3 .sub_row .effectName {
|
3656 |
+
width: 100%;
|
3657 |
+
margin-bottom: 25px
|
3658 |
+
}
|
3659 |
+
.rowmarginleft45 {
|
3660 |
+
margin-left: 0px !important;
|
3661 |
+
}
|
3662 |
+
.bottommargin40 {
|
3663 |
+
margin-bottom: 0px !important;
|
3664 |
+
}
|
3665 |
+
}
|
3666 |
+
|
3667 |
+
@media (min-width:414px) and (max-width: 736px) and (orientation:landscape) {
|
3668 |
+
.tab3 .sub_row {
|
3669 |
+
width: 100%;
|
3670 |
+
}
|
3671 |
+
.tab3 .sub_row .effectContainer {
|
3672 |
+
margin-left: 25px;
|
3673 |
+
margin-bottom: 0px;
|
3674 |
+
clear: both;
|
3675 |
+
}
|
3676 |
+
.tab3 .sub_row .effectName {
|
3677 |
+
width: 50%;
|
3678 |
+
margin-bottom: 25px
|
3679 |
+
}
|
3680 |
+
.rowmarginleft45 {
|
3681 |
+
margin-left: 25px !important;
|
3682 |
+
}
|
3683 |
+
.bottommargin40 {
|
3684 |
+
margin-bottom: 0px !important;
|
3685 |
+
}
|
3686 |
+
}
|
3687 |
+
@media (min-width:768px) and (max-width: 1024px) {
|
3688 |
+
.tab3 .sub_row {
|
3689 |
+
width: 100%;
|
3690 |
+
}
|
3691 |
+
.tab3 .sub_row .effectContainer {
|
3692 |
+
margin-bottom: 25px;
|
3693 |
+
clear: both;
|
3694 |
+
}
|
3695 |
+
.tab3 .sub_row .effectName {
|
3696 |
+
width: 50%;
|
3697 |
+
}
|
3698 |
+
}/* */
|
3699 |
+
|
3700 |
+
.col-lg-1,
|
3701 |
+
.col-lg-10,
|
3702 |
+
.col-lg-11,
|
3703 |
+
.col-lg-12,
|
3704 |
+
.col-lg-2,
|
3705 |
+
.col-lg-3,
|
3706 |
+
.col-lg-4,
|
3707 |
+
.col-lg-5,
|
3708 |
+
.col-lg-6,
|
3709 |
+
.col-lg-7,
|
3710 |
+
.col-lg-8,
|
3711 |
+
.col-lg-9,
|
3712 |
+
.col-md-1,
|
3713 |
+
.col-md-10,
|
3714 |
+
.col-md-11,
|
3715 |
+
.col-md-12,
|
3716 |
+
.col-md-2,
|
3717 |
+
.col-md-3,
|
3718 |
+
.col-md-4,
|
3719 |
+
.col-md-5,
|
3720 |
+
.col-md-6,
|
3721 |
+
.col-md-7,
|
3722 |
+
.col-md-8,
|
3723 |
+
.col-md-9,
|
3724 |
+
.col-sm-1,
|
3725 |
+
.col-sm-10,
|
3726 |
+
.col-sm-11,
|
3727 |
+
.col-sm-12,
|
3728 |
+
.col-sm-2,
|
3729 |
+
.col-sm-3,
|
3730 |
+
.col-sm-4,
|
3731 |
+
.col-sm-5,
|
3732 |
+
.col-sm-6,
|
3733 |
+
.col-sm-7,
|
3734 |
+
.col-sm-8,
|
3735 |
+
.col-sm-9,
|
3736 |
+
.col-xs-1,
|
3737 |
+
.col-xs-10,
|
3738 |
+
.col-xs-11,
|
3739 |
+
.col-xs-12,
|
3740 |
+
.col-xs-2,
|
3741 |
+
.col-xs-3,
|
3742 |
+
.col-xs-4,
|
3743 |
+
.col-xs-5,
|
3744 |
+
.col-xs-6,
|
3745 |
+
.col-xs-7,
|
3746 |
+
.col-xs-8,
|
3747 |
+
.col-xs-9 {
|
3748 |
+
position: relative;
|
3749 |
+
min-height: 1px;
|
3750 |
+
padding-right: 15px;
|
3751 |
+
padding-left: 15px;
|
3752 |
+
}
|
3753 |
+
@media (min-width: 992px) {
|
3754 |
+
.col-md-12 {
|
3755 |
+
width: 100%;
|
3756 |
+
}
|
3757 |
+
|
3758 |
+
.col-md-3 {
|
3759 |
+
width: 25%;
|
3760 |
+
}
|
3761 |
+
|
3762 |
+
.col-md-1,
|
3763 |
+
.col-md-10,
|
3764 |
+
.col-md-11,
|
3765 |
+
.col-md-12,
|
3766 |
+
.col-md-2,
|
3767 |
+
.col-md-3,
|
3768 |
+
.col-md-4,
|
3769 |
+
.col-md-5,
|
3770 |
+
.col-md-6,
|
3771 |
+
.col-md-7,
|
3772 |
+
.col-md-8,
|
3773 |
+
.col-md-9 {
|
3774 |
+
float: left;
|
3775 |
+
}
|
3776 |
+
|
3777 |
+
.col-md-12 {
|
3778 |
+
width: 100%
|
3779 |
+
}
|
3780 |
+
|
3781 |
+
.col-md-11 {
|
3782 |
+
width: 91.66666667%
|
3783 |
+
}
|
3784 |
+
|
3785 |
+
.col-md-10 {
|
3786 |
+
width: 83.33333333%
|
3787 |
+
}
|
3788 |
+
|
3789 |
+
.col-md-9 {
|
3790 |
+
width: 75%
|
3791 |
+
}
|
3792 |
+
|
3793 |
+
.col-md-8 {
|
3794 |
+
width: 66.66666667%
|
3795 |
+
}
|
3796 |
+
|
3797 |
+
.col-md-7 {
|
3798 |
+
width: 58.33333333%
|
3799 |
+
}
|
3800 |
+
|
3801 |
+
.col-md-6 {
|
3802 |
+
width: 50%
|
3803 |
+
}
|
3804 |
+
|
3805 |
+
.col-md-5 {
|
3806 |
+
width: 41.66666667%
|
3807 |
+
}
|
3808 |
+
|
3809 |
+
.col-md-4 {
|
3810 |
+
width: 33.33333333%
|
3811 |
+
}
|
3812 |
+
|
3813 |
+
.col-md-3 {
|
3814 |
+
width: 25%
|
3815 |
+
}
|
3816 |
+
|
3817 |
+
.col-md-2 {
|
3818 |
+
width: 16.66666667%
|
3819 |
+
}
|
3820 |
+
|
3821 |
+
.col-md-1 {
|
3822 |
+
width: 8.33333333%
|
3823 |
+
}
|
3824 |
+
|
3825 |
+
.col-md-pull-12 {
|
3826 |
+
right: 100%
|
3827 |
+
}
|
3828 |
+
|
3829 |
+
.col-md-pull-11 {
|
3830 |
+
right: 91.66666667%
|
3831 |
+
}
|
3832 |
+
|
3833 |
+
.col-md-pull-10 {
|
3834 |
+
right: 83.33333333%
|
3835 |
+
}
|
3836 |
+
|
3837 |
+
.col-md-pull-9 {
|
3838 |
+
right: 75%
|
3839 |
+
}
|
3840 |
+
|
3841 |
+
.col-md-pull-8 {
|
3842 |
+
right: 66.66666667%
|
3843 |
+
}
|
3844 |
+
|
3845 |
+
.col-md-pull-7 {
|
3846 |
+
right: 58.33333333%
|
3847 |
+
}
|
3848 |
+
|
3849 |
+
.col-md-pull-6 {
|
3850 |
+
right: 50%
|
3851 |
+
}
|
3852 |
+
|
3853 |
+
.col-md-pull-5 {
|
3854 |
+
right: 41.66666667%
|
3855 |
+
}
|
3856 |
+
|
3857 |
+
.col-md-pull-4 {
|
3858 |
+
right: 33.33333333%
|
3859 |
+
}
|
3860 |
+
|
3861 |
+
.col-md-pull-3 {
|
3862 |
+
right: 25%
|
3863 |
+
}
|
3864 |
+
|
3865 |
+
.col-md-pull-2 {
|
3866 |
+
right: 16.66666667%
|
3867 |
+
}
|
3868 |
+
|
3869 |
+
.col-md-pull-1 {
|
3870 |
+
right: 8.33333333%
|
3871 |
+
}
|
3872 |
+
|
3873 |
+
.col-md-pull-0 {
|
3874 |
+
right: auto
|
3875 |
+
}
|
3876 |
+
|
3877 |
+
.col-md-push-12 {
|
3878 |
+
left: 100%
|
3879 |
+
}
|
3880 |
+
|
3881 |
+
.col-md-push-11 {
|
3882 |
+
left: 91.66666667%
|
3883 |
+
}
|
3884 |
+
|
3885 |
+
.col-md-push-10 {
|
3886 |
+
left: 83.33333333%
|
3887 |
+
}
|
3888 |
+
|
3889 |
+
.col-md-push-9 {
|
3890 |
+
left: 75%
|
3891 |
+
}
|
3892 |
+
|
3893 |
+
.col-md-push-8 {
|
3894 |
+
left: 66.66666667%
|
3895 |
+
}
|
3896 |
+
|
3897 |
+
.col-md-push-7 {
|
3898 |
+
left: 58.33333333%
|
3899 |
+
}
|
3900 |
+
|
3901 |
+
.col-md-push-6 {
|
3902 |
+
left: 50%
|
3903 |
+
}
|
3904 |
+
|
3905 |
+
.col-md-push-5 {
|
3906 |
+
left: 41.66666667%
|
3907 |
+
}
|
3908 |
+
|
3909 |
+
.col-md-push-4 {
|
3910 |
+
left: 33.33333333%
|
3911 |
+
}
|
3912 |
+
|
3913 |
+
.col-md-push-3 {
|
3914 |
+
left: 25%
|
3915 |
+
}
|
3916 |
+
|
3917 |
+
.col-md-push-2 {
|
3918 |
+
left: 16.66666667%
|
3919 |
+
}
|
3920 |
+
|
3921 |
+
.col-md-push-1 {
|
3922 |
+
left: 8.33333333%
|
3923 |
+
}
|
3924 |
+
|
3925 |
+
.col-md-push-0 {
|
3926 |
+
left: auto
|
3927 |
+
}
|
3928 |
+
|
3929 |
+
.col-md-offset-12 {
|
3930 |
+
margin-left: 100%
|
3931 |
+
}
|
3932 |
+
|
3933 |
+
.col-md-offset-11 {
|
3934 |
+
margin-left: 91.66666667%
|
3935 |
+
}
|
3936 |
+
|
3937 |
+
.col-md-offset-10 {
|
3938 |
+
margin-left: 83.33333333%
|
3939 |
+
}
|
3940 |
+
|
3941 |
+
.col-md-offset-9 {
|
3942 |
+
margin-left: 75%
|
3943 |
+
}
|
3944 |
+
|
3945 |
+
.col-md-offset-8 {
|
3946 |
+
margin-left: 66.66666667%
|
3947 |
+
}
|
3948 |
+
|
3949 |
+
.col-md-offset-7 {
|
3950 |
+
margin-left: 58.33333333%
|
3951 |
+
}
|
3952 |
+
|
3953 |
+
.col-md-offset-6 {
|
3954 |
+
margin-left: 50%
|
3955 |
+
}
|
3956 |
+
|
3957 |
+
.col-md-offset-5 {
|
3958 |
+
margin-left: 41.66666667%
|
3959 |
+
}
|
3960 |
+
|
3961 |
+
.col-md-offset-4 {
|
3962 |
+
margin-left: 33.33333333%
|
3963 |
+
}
|
3964 |
+
|
3965 |
+
.col-md-offset-3 {
|
3966 |
+
margin-left: 25%
|
3967 |
+
}
|
3968 |
+
|
3969 |
+
.col-md-offset-2 {
|
3970 |
+
margin-left: 16.66666667%
|
3971 |
+
}
|
3972 |
+
|
3973 |
+
.col-md-offset-1 {
|
3974 |
+
margin-left: 8.33333333%
|
3975 |
+
}
|
3976 |
+
|
3977 |
+
.col-md-offset-0 {
|
3978 |
+
margin-left: 0
|
3979 |
+
}
|
3980 |
+
}
|
3981 |
+
@media (min-width:768px) {
|
3982 |
+
|
3983 |
+
.col-sm-1,
|
3984 |
+
.col-sm-10,
|
3985 |
+
.col-sm-11,
|
3986 |
+
.col-sm-12,
|
3987 |
+
.col-sm-2,
|
3988 |
+
.col-sm-3,
|
3989 |
+
.col-sm-4,
|
3990 |
+
.col-sm-5,
|
3991 |
+
.col-sm-6,
|
3992 |
+
.col-sm-7,
|
3993 |
+
.col-sm-8,
|
3994 |
+
.col-sm-9 {
|
3995 |
+
float: left
|
3996 |
+
}
|
3997 |
+
|
3998 |
+
.col-sm-12 {
|
3999 |
+
width: 100%
|
4000 |
+
}
|
4001 |
+
|
4002 |
+
.col-sm-11 {
|
4003 |
+
width: 91.66666667%
|
4004 |
+
}
|
4005 |
+
|
4006 |
+
.col-sm-10 {
|
4007 |
+
width: 83.33333333%
|
4008 |
+
}
|
4009 |
+
|
4010 |
+
.col-sm-9 {
|
4011 |
+
width: 75%
|
4012 |
+
}
|
4013 |
+
|
4014 |
+
.col-sm-8 {
|
4015 |
+
width: 66.66666667%
|
4016 |
+
}
|
4017 |
+
|
4018 |
+
.col-sm-7 {
|
4019 |
+
width: 58.33333333%
|
4020 |
+
}
|
4021 |
+
|
4022 |
+
.col-sm-6 {
|
4023 |
+
width: 50%
|
4024 |
+
}
|
4025 |
+
|
4026 |
+
.col-sm-5 {
|
4027 |
+
width: 41.66666667%
|
4028 |
+
}
|
4029 |
+
|
4030 |
+
.col-sm-4 {
|
4031 |
+
width: 33.33333333%
|
4032 |
+
}
|
4033 |
+
|
4034 |
+
.col-sm-3 {
|
4035 |
+
width: 25%
|
4036 |
+
}
|
4037 |
+
|
4038 |
+
.col-sm-2 {
|
4039 |
+
width: 16.66666667%
|
4040 |
+
}
|
4041 |
+
|
4042 |
+
.col-sm-1 {
|
4043 |
+
width: 8.33333333%
|
4044 |
+
}
|
4045 |
+
|
4046 |
+
.col-sm-pull-12 {
|
4047 |
+
right: 100%
|
4048 |
+
}
|
4049 |
+
|
4050 |
+
.col-sm-pull-11 {
|
4051 |
+
right: 91.66666667%
|
4052 |
+
}
|
4053 |
+
|
4054 |
+
.col-sm-pull-10 {
|
4055 |
+
right: 83.33333333%
|
4056 |
+
}
|
4057 |
+
|
4058 |
+
.col-sm-pull-9 {
|
4059 |
+
right: 75%
|
4060 |
+
}
|
4061 |
+
|
4062 |
+
.col-sm-pull-8 {
|
4063 |
+
right: 66.66666667%
|
4064 |
+
}
|
4065 |
+
|
4066 |
+
.col-sm-pull-7 {
|
4067 |
+
right: 58.33333333%
|
4068 |
+
}
|
4069 |
+
|
4070 |
+
.col-sm-pull-6 {
|
4071 |
+
right: 50%
|
4072 |
+
}
|
4073 |
+
|
4074 |
+
.col-sm-pull-5 {
|
4075 |
+
right: 41.66666667%
|
4076 |
+
}
|
4077 |
+
|
4078 |
+
.col-sm-pull-4 {
|
4079 |
+
right: 33.33333333%
|
4080 |
+
}
|
4081 |
+
|
4082 |
+
.col-sm-pull-3 {
|
4083 |
+
right: 25%
|
4084 |
+
}
|
4085 |
+
|
4086 |
+
.col-sm-pull-2 {
|
4087 |
+
right: 16.66666667%
|
4088 |
+
}
|
4089 |
+
|
4090 |
+
.col-sm-pull-1 {
|
4091 |
+
right: 8.33333333%
|
4092 |
+
}
|
4093 |
+
|
4094 |
+
.col-sm-pull-0 {
|
4095 |
+
right: auto
|
4096 |
+
}
|
4097 |
+
|
4098 |
+
.col-sm-push-12 {
|
4099 |
+
left: 100%
|
4100 |
+
}
|
4101 |
+
|
4102 |
+
.col-sm-push-11 {
|
4103 |
+
left: 91.66666667%
|
4104 |
+
}
|
4105 |
+
|
4106 |
+
.col-sm-push-10 {
|
4107 |
+
left: 83.33333333%
|
4108 |
+
}
|
4109 |
+
|
4110 |
+
.col-sm-push-9 {
|
4111 |
+
left: 75%
|
4112 |
+
}
|
4113 |
+
|
4114 |
+
.col-sm-push-8 {
|
4115 |
+
left: 66.66666667%
|
4116 |
+
}
|
4117 |
+
|
4118 |
+
.col-sm-push-7 {
|
4119 |
+
left: 58.33333333%
|
4120 |
+
}
|
4121 |
+
|
4122 |
+
.col-sm-push-6 {
|
4123 |
+
left: 50%
|
4124 |
+
}
|
4125 |
+
|
4126 |
+
.col-sm-push-5 {
|
4127 |
+
left: 41.66666667%
|
4128 |
+
}
|
4129 |
+
|
4130 |
+
.col-sm-push-4 {
|
4131 |
+
left: 33.33333333%
|
4132 |
+
}
|
4133 |
+
|
4134 |
+
.col-sm-push-3 {
|
4135 |
+
left: 25%
|
4136 |
+
}
|
4137 |
+
|
4138 |
+
.col-sm-push-2 {
|
4139 |
+
left: 16.66666667%
|
4140 |
+
}
|
4141 |
+
|
4142 |
+
.col-sm-push-1 {
|
4143 |
+
left: 8.33333333%
|
4144 |
+
}
|
4145 |
+
|
4146 |
+
.col-sm-push-0 {
|
4147 |
+
left: auto
|
4148 |
+
}
|
4149 |
+
|
4150 |
+
.col-sm-offset-12 {
|
4151 |
+
margin-left: 100%
|
4152 |
+
}
|
4153 |
+
|
4154 |
+
.col-sm-offset-11 {
|
4155 |
+
margin-left: 91.66666667%
|
4156 |
+
}
|
4157 |
+
|
4158 |
+
.col-sm-offset-10 {
|
4159 |
+
margin-left: 83.33333333%
|
4160 |
+
}
|
4161 |
+
|
4162 |
+
.col-sm-offset-9 {
|
4163 |
+
margin-left: 75%
|
4164 |
+
}
|
4165 |
+
|
4166 |
+
.col-sm-offset-8 {
|
4167 |
+
margin-left: 66.66666667%
|
4168 |
+
}
|
4169 |
+
|
4170 |
+
.col-sm-offset-7 {
|
4171 |
+
margin-left: 58.33333333%
|
4172 |
+
}
|
4173 |
+
|
4174 |
+
.col-sm-offset-6 {
|
4175 |
+
margin-left: 50%
|
4176 |
+
}
|
4177 |
+
|
4178 |
+
.col-sm-offset-5 {
|
4179 |
+
margin-left: 41.66666667%
|
4180 |
+
}
|
4181 |
+
|
4182 |
+
.col-sm-offset-4 {
|
4183 |
+
margin-left: 33.33333333%
|
4184 |
+
}
|
4185 |
+
|
4186 |
+
.col-sm-offset-3 {
|
4187 |
+
margin-left: 25%
|
4188 |
+
}
|
4189 |
+
|
4190 |
+
.col-sm-offset-2 {
|
4191 |
+
margin-left: 16.66666667%
|
4192 |
+
}
|
4193 |
+
|
4194 |
+
.col-sm-offset-1 {
|
4195 |
+
margin-left: 8.33333333%
|
4196 |
+
}
|
4197 |
+
|
4198 |
+
.col-sm-offset-0 {
|
4199 |
+
margin-left: 0
|
4200 |
+
}
|
4201 |
+
}
|
4202 |
+
@media (min-width:1200px) {
|
4203 |
+
|
4204 |
+
.col-lg-1,
|
4205 |
+
.col-lg-10,
|
4206 |
+
.col-lg-11,
|
4207 |
+
.col-lg-12,
|
4208 |
+
.col-lg-2,
|
4209 |
+
.col-lg-3,
|
4210 |
+
.col-lg-4,
|
4211 |
+
.col-lg-5,
|
4212 |
+
.col-lg-6,
|
4213 |
+
.col-lg-7,
|
4214 |
+
.col-lg-8,
|
4215 |
+
.col-lg-9 {
|
4216 |
+
float: left
|
4217 |
+
}
|
4218 |
+
|
4219 |
+
.col-lg-12 {
|
4220 |
+
width: 100%
|
4221 |
+
}
|
4222 |
+
|
4223 |
+
.col-lg-11 {
|
4224 |
+
width: 91.66666667%
|
4225 |
+
}
|
4226 |
+
|
4227 |
+
.col-lg-10 {
|
4228 |
+
width: 83.33333333%
|
4229 |
+
}
|
4230 |
+
|
4231 |
+
.col-lg-9 {
|
4232 |
+
width: 75%
|
4233 |
+
}
|
4234 |
+
|
4235 |
+
.col-lg-8 {
|
4236 |
+
width: 66.66666667%
|
4237 |
+
}
|
4238 |
+
|
4239 |
+
.col-lg-7 {
|
4240 |
+
width: 58.33333333%
|
4241 |
+
}
|
4242 |
+
|
4243 |
+
.col-lg-6 {
|
4244 |
+
width: 50%
|
4245 |
+
}
|
4246 |
+
|
4247 |
+
.col-lg-5 {
|
4248 |
+
width: 41.66666667%
|
4249 |
+
}
|
4250 |
+
|
4251 |
+
.col-lg-4 {
|
4252 |
+
width: 33.33333333%
|
4253 |
+
}
|
4254 |
+
|
4255 |
+
.col-lg-3 {
|
4256 |
+
width: 25%
|
4257 |
+
}
|
4258 |
+
|
4259 |
+
.col-lg-2 {
|
4260 |
+
width: 16.66666667%
|
4261 |
+
}
|
4262 |
+
|
4263 |
+
.col-lg-1 {
|
4264 |
+
width: 8.33333333%
|
4265 |
+
}
|
4266 |
+
|
4267 |
+
.col-lg-pull-12 {
|
4268 |
+
right: 100%
|
4269 |
+
}
|
4270 |
+
|
4271 |
+
.col-lg-pull-11 {
|
4272 |
+
right: 91.66666667%
|
4273 |
+
}
|
4274 |
+
|
4275 |
+
.col-lg-pull-10 {
|
4276 |
+
right: 83.33333333%
|
4277 |
+
}
|
4278 |
+
|
4279 |
+
.col-lg-pull-9 {
|
4280 |
+
right: 75%
|
4281 |
+
}
|
4282 |
+
|
4283 |
+
.col-lg-pull-8 {
|
4284 |
+
right: 66.66666667%
|
4285 |
+
}
|
4286 |
+
|
4287 |
+
.col-lg-pull-7 {
|
4288 |
+
right: 58.33333333%
|
4289 |
+
}
|
4290 |
+
|
4291 |
+
.col-lg-pull-6 {
|
4292 |
+
right: 50%
|
4293 |
+
}
|
4294 |
+
|
4295 |
+
.col-lg-pull-5 {
|
4296 |
+
right: 41.66666667%
|
4297 |
+
}
|
4298 |
+
|
4299 |
+
.col-lg-pull-4 {
|
4300 |
+
right: 33.33333333%
|
4301 |
+
}
|
4302 |
+
|
4303 |
+
.col-lg-pull-3 {
|
4304 |
+
right: 25%
|
4305 |
+
}
|
4306 |
+
|
4307 |
+
.col-lg-pull-2 {
|
4308 |
+
right: 16.66666667%
|
4309 |
+
}
|
4310 |
+
|
4311 |
+
.col-lg-pull-1 {
|
4312 |
+
right: 8.33333333%
|
4313 |
+
}
|
4314 |
+
|
4315 |
+
.col-lg-pull-0 {
|
4316 |
+
right: auto
|
4317 |
+
}
|
4318 |
+
|
4319 |
+
.col-lg-push-12 {
|
4320 |
+
left: 100%
|
4321 |
+
}
|
4322 |
+
|
4323 |
+
.col-lg-push-11 {
|
4324 |
+
left: 91.66666667%
|
4325 |
+
}
|
4326 |
+
|
4327 |
+
.col-lg-push-10 {
|
4328 |
+
left: 83.33333333%
|
4329 |
+
}
|
4330 |
+
|
4331 |
+
.col-lg-push-9 {
|
4332 |
+
left: 75%
|
4333 |
+
}
|
4334 |
+
|
4335 |
+
.col-lg-push-8 {
|
4336 |
+
left: 66.66666667%
|
4337 |
+
}
|
4338 |
+
|
4339 |
+
.col-lg-push-7 {
|
4340 |
+
left: 58.33333333%
|
4341 |
+
}
|
4342 |
+
|
4343 |
+
.col-lg-push-6 {
|
4344 |
+
left: 50%
|
4345 |
+
}
|
4346 |
+
|
4347 |
+
.col-lg-push-5 {
|
4348 |
+
left: 41.66666667%
|
4349 |
+
}
|
4350 |
+
|
4351 |
+
.col-lg-push-4 {
|
4352 |
+
left: 33.33333333%
|
4353 |
+
}
|
4354 |
+
|
4355 |
+
.col-lg-push-3 {
|
4356 |
+
left: 25%
|
4357 |
+
}
|
4358 |
+
|
4359 |
+
.col-lg-push-2 {
|
4360 |
+
left: 16.66666667%
|
4361 |
+
}
|
4362 |
+
|
4363 |
+
.col-lg-push-1 {
|
4364 |
+
left: 8.33333333%
|
4365 |
+
}
|
4366 |
+
|
4367 |
+
.col-lg-push-0 {
|
4368 |
+
left: auto
|
4369 |
+
}
|
4370 |
+
|
4371 |
+
.col-lg-offset-12 {
|
4372 |
+
margin-left: 100%
|
4373 |
+
}
|
4374 |
+
|
4375 |
+
.col-lg-offset-11 {
|
4376 |
+
margin-left: 91.66666667%
|
4377 |
+
}
|
4378 |
+
|
4379 |
+
.col-lg-offset-10 {
|
4380 |
+
margin-left: 83.33333333%
|
4381 |
+
}
|
4382 |
+
|
4383 |
+
.col-lg-offset-9 {
|
4384 |
+
margin-left: 75%
|
4385 |
+
}
|
4386 |
+
|
4387 |
+
.col-lg-offset-8 {
|
4388 |
+
margin-left: 66.66666667%
|
4389 |
+
}
|
4390 |
+
|
4391 |
+
.col-lg-offset-7 {
|
4392 |
+
margin-left: 58.33333333%
|
4393 |
+
}
|
4394 |
+
|
4395 |
+
.col-lg-offset-6 {
|
4396 |
+
margin-left: 50%
|
4397 |
+
}
|
4398 |
+
|
4399 |
+
.col-lg-offset-5 {
|
4400 |
+
margin-left: 41.66666667%
|
4401 |
+
}
|
4402 |
+
|
4403 |
+
.col-lg-offset-4 {
|
4404 |
+
margin-left: 33.33333333%
|
4405 |
+
}
|
4406 |
+
|
4407 |
+
.col-lg-offset-3 {
|
4408 |
+
margin-left: 25%
|
4409 |
+
}
|
4410 |
+
|
4411 |
+
.col-lg-offset-2 {
|
4412 |
+
margin-left: 16.66666667%
|
4413 |
+
}
|
4414 |
+
|
4415 |
+
.col-lg-offset-1 {
|
4416 |
+
margin-left: 8.33333333%
|
4417 |
+
}
|
4418 |
+
|
4419 |
+
.col-lg-offset-0 {
|
4420 |
+
margin-left: 0
|
4421 |
+
}
|
4422 |
+
}
|
4423 |
+
#sfsi_jivo_offline_chat {
|
4424 |
+
position: fixed;
|
4425 |
+
bottom: 0;
|
4426 |
+
right: 30px;
|
4427 |
+
height: 350px;
|
4428 |
+
min-width: 45%;
|
4429 |
+
background: #fff;
|
4430 |
+
border-top-left-radius: 30px;
|
4431 |
+
border-top-right-radius: 30px;
|
4432 |
+
padding: 10px;
|
4433 |
+
border: 3px solid #ddd;
|
4434 |
+
border-bottom: 0;
|
4435 |
+
}
|
4436 |
+
#sfsi_jivo_offline_chat .heading-text {
|
4437 |
+
font-size: 16px;
|
4438 |
+
font-weight: 500;
|
4439 |
+
color: #999;
|
4440 |
+
}
|
4441 |
+
#sfsi_jivo_offline_chat .heading-text a {
|
4442 |
+
font-size: 16px;
|
4443 |
+
font-weight: 900;
|
4444 |
+
color: #999;
|
4445 |
+
}
|
4446 |
+
#sfsi_jivo_offline_chat .tab-changer {
|
4447 |
+
/*width:100%;*/
|
4448 |
+
padding: 0 15px;
|
4449 |
+
|
4450 |
+
}
|
4451 |
+
#sfsi_jivo_offline_chat .tab-changer .tab-link {
|
4452 |
+
float: left;
|
4453 |
+
width: 50%;
|
4454 |
+
text-align: center;
|
4455 |
+
background: #eee;
|
4456 |
+
border-bottom: 5px solid #24497B;
|
4457 |
+
}
|
4458 |
+
#sfsi_jivo_offline_chat .tab-changer .tab-link:first-child {
|
4459 |
+
border-top-left-radius: 8px;
|
4460 |
+
}
|
4461 |
+
#sfsi_jivo_offline_chat .tab-changer .tab-link:last-child {
|
4462 |
+
border-top-right-radius: 8px;
|
4463 |
+
}
|
4464 |
+
#sfsi_jivo_offline_chat .tab-changer .tab-link p {
|
4465 |
+
background: #eee;
|
4466 |
+
padding: 5px 0;
|
4467 |
+
margin: 0;
|
4468 |
+
border-top-left-radius: 10px;
|
4469 |
+
border-top-right-radius: 10px;
|
4470 |
+
font-size: 25px;
|
4471 |
+
cursor: pointer;
|
4472 |
+
line-height: 1;
|
4473 |
+
}
|
4474 |
+
#sfsi_jivo_offline_chat .tab-changer .tab-link p span {
|
4475 |
+
font-size: 15px;
|
4476 |
+
}
|
4477 |
+
#sfsi_jivo_offline_chat .tab-changer .tab-link.active p {
|
4478 |
+
background: #24497B;
|
4479 |
+
color: #fff;
|
4480 |
+
}
|
4481 |
+
#sfsi_jivo_offline_chat .tabs {
|
4482 |
+
/*background: #dbeef4;*/
|
4483 |
+
background: #ddd;
|
4484 |
+
margin: -6px 15px 0 15px;
|
4485 |
+
min-height: 250px;
|
4486 |
+
}
|
4487 |
+
#sfsi_jivo_offline_chat #sfsi_technical {
|
4488 |
+
padding: 50px;
|
4489 |
+
}
|
4490 |
+
#sfsi_jivo_offline_chat .tabs .support-forum-green-div {
|
4491 |
+
margin: 10px 0;
|
4492 |
+
}
|
4493 |
+
#sfsi_jivo_offline_chat .tabs .support-forum-green-div a {
|
4494 |
+
padding: 20px 26px 18px 25px;
|
4495 |
+
width: 245px;
|
4496 |
+
margin: 0;
|
4497 |
+
}
|
4498 |
+
#sfsi_jivo_offline_chat .tabs .support-forum-green-div a img {
|
4499 |
+
margin-top: 11px;
|
4500 |
+
}
|
4501 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_technical p {
|
4502 |
+
font-size: 20px;
|
4503 |
+
padding-top: 5px;
|
4504 |
+
margin: 0;
|
4505 |
+
margin-top: 20px;
|
4506 |
+
}
|
4507 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales {
|
4508 |
+
padding: 15px;
|
4509 |
+
}
|
4510 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .right-message {
|
4511 |
+
width: 50%;
|
4512 |
+
float: right;
|
4513 |
+
text-align: right;
|
4514 |
+
margin: 0;
|
4515 |
+
}
|
4516 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales form>div {
|
4517 |
+
margin-top: 5px;
|
4518 |
+
}
|
4519 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales label {
|
4520 |
+
font-size: 20px;
|
4521 |
+
color: #000;
|
4522 |
+
font-weight: 900;
|
4523 |
+
padding-bottom: 5px;
|
4524 |
+
}
|
4525 |
+
|
4526 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales input,
|
4527 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales textarea {
|
4528 |
+
margin-top: 5px;
|
4529 |
+
width: 100%;
|
4530 |
+
border: 0;
|
4531 |
+
box-shadow: 0 0 5px 0 #888;
|
4532 |
+
}
|
4533 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales input {
|
4534 |
+
height: 40px;
|
4535 |
+
}
|
4536 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales textarea {
|
4537 |
+
height: 80px;
|
4538 |
+
resize: none;
|
4539 |
+
}
|
4540 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales input[type="submit"],
|
4541 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent button {
|
4542 |
+
border: 0;
|
4543 |
+
background: #079345;
|
4544 |
+
color: #fff;
|
4545 |
+
margin-top: 23px;
|
4546 |
+
width: 100%;
|
4547 |
+
font-size: 16px;
|
4548 |
+
border-radius: 4px;
|
4549 |
+
cursor: pointer;
|
4550 |
+
box-shadow: none;
|
4551 |
+
}
|
4552 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent {
|
4553 |
+
text-align: center;
|
4554 |
+
}
|
4555 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent h2 {
|
4556 |
+
font-size: 35px;
|
4557 |
+
}
|
4558 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent h3 {
|
4559 |
+
font-size: 25px;
|
4560 |
+
font-weight: 300;
|
4561 |
+
}
|
4562 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent button {
|
4563 |
+
width: auto;
|
4564 |
+
margin-top: 0;
|
4565 |
+
padding: 10px;
|
4566 |
+
}
|
4567 |
+
#sfsi_jivo_offline_chat #sfsi_technical .sfsi-button-right-side {
|
4568 |
+
font-size: 13px !important;
|
4569 |
+
font-weight: 900;
|
4570 |
+
/*float: right;*/
|
4571 |
+
/*text-align: right;*/
|
4572 |
+
margin-top: -40px !important;
|
4573 |
+
margin-left: 320px !important;
|
4574 |
+
}
|
4575 |
+
#sfsi_jivo_offline_chat #sfsi_technical .sfsi-button-right-side .sfsi-button-right-side-icon {
|
4576 |
+
background-image: url('images/select-arrow.png');
|
4577 |
+
width: 15px;
|
4578 |
+
height: 9px;
|
4579 |
+
display: inline-block;
|
4580 |
+
-webkit-transform: rotate(90deg);
|
4581 |
+
-moz-transform: rotate(90deg);
|
4582 |
+
-ms-transform: rotate(90deg);
|
4583 |
+
-o-transform: rotate(90deg);
|
4584 |
+
transform: rotate(90deg);
|
4585 |
+
}
|
4586 |
+
@media (max-width: 543px) {
|
4587 |
+
#sfsi_jivo_offline_chat {
|
4588 |
+
width: 400px;
|
4589 |
+
}
|
4590 |
+
}
|
4591 |
+
|
4592 |
+
#sfsi_jivo_offline_chat {
|
4593 |
+
border: 3px solid #ececec;
|
4594 |
+
}
|
4595 |
+
|
4596 |
+
#sfsi_jivo_offline_chat {
|
4597 |
+
padding-bottom: 30px;
|
4598 |
+
}
|
4599 |
+
|
4600 |
+
#sfsi_jivo_offline_chat .heading-text {
|
4601 |
+
font-size: 14px;
|
4602 |
+
}
|
4603 |
+
|
4604 |
+
#sfsi_jivo_offline_chat .tabs {
|
4605 |
+
background-color: #ededed;
|
4606 |
+
}#sfsi_jivo_offline_chat .tab-changer li p {
|
4607 |
+
padding: 8px !important;
|
4608 |
+
}
|
4609 |
+
|
4610 |
+
#sfsi_jivo_offline_chat .tab-changer .tab-link p {
|
4611 |
+
font-size: 21px !important;
|
4612 |
+
font-weight: 500;
|
4613 |
+
color: #000000;
|
4614 |
+
}#sfsi_jivo_offline_chat .tab-changer .tab-link p span {
|
4615 |
+
font-size: 14px !important;
|
4616 |
+
font-weight: 400;
|
4617 |
+
color: #000000;
|
4618 |
+
}
|
4619 |
+
|
4620 |
+
#sfsi_jivo_offline_chat .tab-changer .active p span {
|
4621 |
+
color: #ffffff;
|
4622 |
+
}
|
4623 |
+
|
4624 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales {
|
4625 |
+
padding: 30px 30px 40px 30px;
|
4626 |
+
background: #ededed;
|
4627 |
+
}#sfsi_jivo_offline_chat .tabs #sfsi_sales .label {
|
4628 |
+
margin-bottom: 8px;
|
4629 |
+
font-size: 17px;
|
4630 |
+
font-weight: 500;
|
4631 |
+
color: #000000;
|
4632 |
+
}#sfsi_jivo_offline_chat .tabs #sfsi_sales .email {
|
4633 |
+
margin-top: 15px;
|
4634 |
+
}
|
4635 |
+
|
4636 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .right-message {
|
4637 |
+
font-size: 14px;
|
4638 |
+
color: #000000;
|
4639 |
+
}
|
4640 |
+
|
4641 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales textarea {
|
4642 |
+
padding: 10px !important;
|
4643 |
+
font-size: 14px;
|
4644 |
+
font-weight: 500;
|
4645 |
+
margin-top: 0 !important;
|
4646 |
+
}
|
4647 |
+
|
4648 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales input {
|
4649 |
+
padding: 10px;
|
4650 |
+
font-size: 14px;
|
4651 |
+
font-weight: 500;
|
4652 |
+
margin-top: 0 !important;
|
4653 |
+
}
|
4654 |
+
|
4655 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales input[type="submit"],
|
4656 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent button {
|
4657 |
+
background: #52b250;
|
4658 |
+
}#sfsi_jivo_offline_chat #sfsi_technical {
|
4659 |
+
padding: 57px;
|
4660 |
+
background-color: #ededed
|
4661 |
+
}
|
4662 |
+
|
4663 |
+
#sfsi_technical h5 {
|
4664 |
+
font-size: 18px;
|
4665 |
+
color: #000000;
|
4666 |
+
margin: 10px;
|
4667 |
+
}
|
4668 |
+
|
4669 |
+
#sfsi_technical h5 b {
|
4670 |
+
font-weight: 700;
|
4671 |
+
}
|
4672 |
+
|
4673 |
+
#sfsi_technical h5 b {
|
4674 |
+
font-weight: 700;
|
4675 |
+
}
|
4676 |
+
|
4677 |
+
#sfsi_jivo_offline_chat #sfsi_technical .sfsi-button-right-side {
|
4678 |
+
font-size: 12px !important;
|
4679 |
+
font-weight: 700;
|
4680 |
+
margin-top: 0px !important;
|
4681 |
+
margin-left: 0px !important;
|
4682 |
+
color: #000000;
|
4683 |
+
position: absolute;
|
4684 |
+
padding: 12px;
|
4685 |
+
}
|
4686 |
+
|
4687 |
+
#sfsi_jivo_offline_chat .tabs .support-forum-green-div {
|
4688 |
+
text-align: center;
|
4689 |
+
margin: 20px 0 25px 0;
|
4690 |
+
}
|
4691 |
+
|
4692 |
+
#sfsi_jivo_offline_chat .tabs .support-forum-green-div a {
|
4693 |
+
padding: 12px 25px;
|
4694 |
+
background: #52b250;
|
4695 |
+
}
|
4696 |
+
|
4697 |
+
#sfsi_jivo_offline_chat #sfsi_technical .support-forum-green-div .support-forum-green-bg p {
|
4698 |
+
padding: 0;
|
4699 |
+
margin: 0;
|
4700 |
+
font-size: 18px;
|
4701 |
+
font-weight: 500;
|
4702 |
+
}
|
4703 |
+
|
4704 |
+
#sfsi_jivo_offline_chat #sfsi_technical .support-forum-green-div .support-forum-green-bg img {
|
4705 |
+
height: 28px;
|
4706 |
+
position: relative;
|
4707 |
+
top: 9px;
|
4708 |
+
padding-right: 5px;
|
4709 |
+
margin-top: 0px;
|
4710 |
+
}
|
4711 |
+
|
4712 |
+
#sfsi_jivo_offline_chat #sfsi_technical .sfsi-button-right-side .sfsi-button-right-side-icon {
|
4713 |
+
padding-right: -1px;
|
4714 |
+
}
|
4715 |
+
|
4716 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent h3 {
|
4717 |
+
font-size: 20px;
|
4718 |
+
font-weight: 500;
|
4719 |
+
}
|
4720 |
+
|
4721 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent h2 {
|
4722 |
+
font-size: 35px;
|
4723 |
+
font-weight: 700;
|
4724 |
+
margin: 25px 0;
|
4725 |
+
}
|
4726 |
+
|
4727 |
+
#sfsi_jivo_offline_chat .tabs #sfsi_sales .after_message_sent button {
|
4728 |
+
width: auto;
|
4729 |
+
margin-top: 6px;
|
4730 |
+
padding: 8px 30px;
|
4731 |
+
font-size: 16px;
|
4732 |
+
background: #52b250;
|
4733 |
+
}
|
4734 |
+
@media (max-width: 543px) {
|
4735 |
+
#sfsi_jivo_offline_chat {
|
4736 |
+
width: 400px;
|
4737 |
+
}
|
4738 |
+
}
|
4739 |
+
.sfsi_unbold_link {
|
4740 |
+
font-family: inherit !important;
|
4741 |
+
}
|
4742 |
+
.sfsi_quickpay-overlay a {
|
4743 |
+
display: inline;
|
4744 |
+
font-size: inherit;
|
4745 |
+
text-decoration: underline;
|
4746 |
+
font-weight: 900;
|
4747 |
+
color: #666;
|
4748 |
+
}
|
4749 |
+
.sfsi_row {
|
4750 |
+
width: 100%;
|
4751 |
+
}
|
4752 |
+
.sfsi_col_6 {
|
4753 |
+
width: 49%;
|
4754 |
+
display: inline-block;
|
4755 |
+
}
|
4756 |
+
.sfsi_text_center {
|
4757 |
+
text-align: center;
|
4758 |
+
}
|
4759 |
+
.sfsi_col_6>div {
|
4760 |
+
padding: 18px 30px !important;
|
4761 |
+
margin: 20px 0 0 0;
|
4762 |
+
border: 1px solid #999;
|
4763 |
+
display: inline-block;
|
4764 |
+
float: none;
|
4765 |
+
/* height: 42px;
|
4766 |
+
width: 150px;*/
|
4767 |
+
}
|
4768 |
+
.sfsi_col_6>div:hover {
|
4769 |
+
background-image: radial-gradient(circle, #fff, #eee);
|
4770 |
+
}.sfsi_quickpay-overlay .sfsi_pop_up .sellcodes-quick-purchase img {
|
4771 |
+
vertical-align: middle;
|
4772 |
+
height: 40px;
|
4773 |
+
}
|
4774 |
+
|
4775 |
+
.sfsi_quickpay-overlay .sfsi_pop_up .sellcodes-quick-purchase p {
|
4776 |
+
text-align: center;
|
4777 |
+
}
|
4778 |
+
|
4779 |
+
.pop-overlay.read-overlay.sfsi_quickpay-overlay * {
|
4780 |
+
font-family: 'Josefin Sans', sans-serif;
|
4781 |
+
}
|
4782 |
+
.sfsi_quickpay-overlay a {
|
4783 |
+
display: inline !important;
|
4784 |
+
font-size: inherit !important;
|
4785 |
+
text-decoration: underline !important;
|
4786 |
+
font-weight: 900;
|
4787 |
+
color: #666;
|
4788 |
+
}
|
4789 |
+
|
4790 |
+
.wp-admin select {
|
4791 |
+
padding: 9px;
|
4792 |
+
}
|
4793 |
+
|
4794 |
+
.sfsi_mainContainer .no_check .checkbox {
|
4795 |
+
display: none;
|
4796 |
+
}
|
4797 |
+
|
4798 |
+
.sfsi_new_prmium_follw p .sfsi-share-op {
|
4799 |
+
color: #0c0b0b !important;
|
4800 |
+
text-decoration: none !important;
|
4801 |
+
border-bottom: none;
|
4802 |
+
}
|
4803 |
+
.sfsi_instagramInstruction ol>li {
|
4804 |
+
list-style-type: decimal !important;
|
4805 |
+
}
|
4806 |
+
.sfsi_instagramInstruction>p {
|
4807 |
+
list-style-type: decimal !important;
|
4808 |
+
}
|
4809 |
+
.sfsi_font_inherit {
|
4810 |
+
font-family: inherit !important;
|
4811 |
+
border: 0 !important;
|
4812 |
+
}
|
4813 |
+
|
4814 |
+
.pop-up {
|
4815 |
+
font-weight: normal;
|
4816 |
+
}
|
4817 |
+
/* by developer 23-05-2019 */
|
4818 |
+
|
4819 |
+
.sfsi_instagramFields .input_facebook {
|
4820 |
+
|
4821 |
+
margin-left: 0 !important;
|
4822 |
+
|
4823 |
+
}
|
4824 |
+
|
4825 |
+
body .specify_counts .listing .sfsi_instagramInstruction li {
|
4826 |
+
font-size: 17px !important;
|
4827 |
+
font-family: helveticaregular !important;
|
4828 |
+
font-weight: 400 !important;
|
4829 |
+
color: #1a1d20 !important;
|
4830 |
+
}
|
4831 |
+
|
4832 |
+
/* end */
|
4833 |
+
|
4834 |
+
/*start 4-6-19*/
|
4835 |
+
.wp-admin .sfsi_tool_tip_2.sfsi_tool_tip_2_inr.twt_tool_bdr {
|
4836 |
+
margin-bottom: -12px !important;
|
4837 |
+
}
|
4838 |
+
|
4839 |
+
.wp-admin .sfsi_tool_tip_2.sfsi_tool_tip_2_inr.printst_tool_bdr {
|
4840 |
+
margin-bottom: 2px;
|
4841 |
+
}
|
4842 |
+
|
4843 |
+
.wp-admin .pop-overlay .sfsi_tool_tip_2.sfsi_tool_tip_2_inr.printst_tool_bdr {
|
4844 |
+
margin-bottom: 2px;
|
4845 |
+
}
|
4846 |
+
|
4847 |
+
.wp-admin .sfsi_tool_tip_2.sfsi_tool_tip_2_inr.linkedin_tool_bdr {
|
4848 |
+
margin-bottom: -12px;
|
4849 |
+
}
|
4850 |
+
|
4851 |
+
/*end 4-6-19*/
|
4852 |
+
|
4853 |
+
.sfsi_border_left_0 {
|
4854 |
+
border-left: 0 !important;
|
4855 |
+
}
|
4856 |
+
|
4857 |
+
.tab8 .sfsi_inputSec input {
|
4858 |
+
width: 140px !important;
|
4859 |
+
padding: 13px;
|
4860 |
+
}
|
4861 |
+
|
4862 |
+
.tab8 .sfsi_inputSec span {
|
4863 |
+
width: auto;
|
4864 |
+
}
|
4865 |
+
|
4866 |
+
.tab8 .sfsi_inputSec span {
|
4867 |
+
display: inline-block;
|
4868 |
+
font-size: 18px;
|
4869 |
+
vertical-align: middle;
|
4870 |
+
width: 200px;
|
4871 |
+
color: #5A6570;
|
4872 |
+
}
|
4873 |
+
|
4874 |
+
.sfsi_responsive_icon_item_container {
|
4875 |
+
height: 40px;
|
4876 |
+
vertical-align: middle;
|
4877 |
+
margin-top: auto;
|
4878 |
+
margin-bottom: auto;
|
4879 |
+
}
|
4880 |
+
|
4881 |
+
.sfsi_responsive_icon_item_container img {
|
4882 |
+
padding: 7px;
|
4883 |
+
vertical-align: middle !important;
|
4884 |
+
box-shadow: unset !important;
|
4885 |
+
-webkit-box-shadow: unset !important;
|
4886 |
+
max-width: 40px !important;
|
4887 |
+
max-height: 40px;
|
4888 |
+
}
|
4889 |
+
|
4890 |
+
.sfsi_responsive_icon_item_container span {
|
4891 |
+
padding: 7px;
|
4892 |
+
vertical-align: middle !important;
|
4893 |
+
box-shadow: unset !important;
|
4894 |
+
-webkit-box-shadow: unset !important;
|
4895 |
+
line-height: 40px
|
4896 |
+
}.sfsi_responsive_icon_facebook_container {
|
4897 |
+
background-color: #336699;
|
4898 |
+
}
|
4899 |
+
|
4900 |
+
.sfsi_responsive_icon_follow_container {
|
4901 |
+
background-color: #00B04E;
|
4902 |
+
}
|
4903 |
+
|
4904 |
+
.sfsi_responsive_icon_twitter_container {
|
4905 |
+
background-color: #55ACEE;
|
4906 |
+
}.sfsi_icons_container_box_fully_container {
|
4907 |
+
flex-wrap: wrap;
|
4908 |
+
}
|
4909 |
+
|
4910 |
+
.sfsi_icons_container_box_fully_container a {
|
4911 |
+
flex-basis: auto !important;
|
4912 |
+
flex-grow: 1;
|
4913 |
+
flex-shrink: 1;
|
4914 |
+
}
|
4915 |
+
|
4916 |
+
.sfsi_responsive_icons .sfsi_icons_container span {
|
4917 |
+
font-family: sans-serif;
|
4918 |
+
font-size: 15px;
|
4919 |
+
}
|
4920 |
+
|
4921 |
+
.sfsi_widget_title {
|
4922 |
+
font-weight: 700;
|
4923 |
+
line-height: 1.2;
|
4924 |
+
font-size: 27px;
|
4925 |
+
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", "Roboto", "Oxygen", "Ubuntu", "Cantarell", "Fira Sans", "Droid Sans", "Helvetica Neue", sans-serif;
|
4926 |
+
|
4927 |
+
}
|
4928 |
+
|
4929 |
+
.sfsi_responsive_default_icon_container .sfsi_icon_container .sfsi_responsive_icon_item_container,
|
4930 |
+
.sfsi_responsive_custom_icon_container .sfsi_icon_container .sfsi_responsive_icon_item_container {
|
4931 |
+
width: 236px;
|
4932 |
+
text-align: center;
|
4933 |
+
margin-right: 8px;
|
4934 |
+
margin-top: -5px;
|
4935 |
+
}
|
4936 |
+
|
4937 |
+
.sfsi_responsive_default_icon_container .sfsi_icon_container .sfsi_responsive_icon_item_container img,
|
4938 |
+
.sfsi_responsive_custom_icon_container .sfsi_icon_container .sfsi_responsive_icon_item_container img {
|
4939 |
+
max-height: 25px !important;
|
4940 |
+
max-width: 40px !important;
|
4941 |
+
float: left;
|
4942 |
+
height: 25px;
|
4943 |
+
}
|
4944 |
+
|
4945 |
+
.sfsi_responsive_default_icon_container .sfsi_icon_container .sfsi_responsive_icon_item_container span,
|
4946 |
+
.sfsi_responsive_custom_icon_container .sfsi_icon_container .sfsi_responsive_icon_item_container span {
|
4947 |
+
color: #ffffff;
|
4948 |
+
font-size: 20px;
|
4949 |
+
padding: 0 10px;
|
4950 |
+
letter-spacing: 0.5px;
|
4951 |
+
font-weight: 500;
|
4952 |
+
}
|
4953 |
+
|
4954 |
+
.tab6 .sfsi_responsive_default_icon_container,
|
4955 |
+
.tab6 .sfsi_responsive_custom_icon_container {
|
4956 |
+
width: 100% !important;
|
4957 |
+
max-width: unset !important;
|
4958 |
+
/* padding-left: 60px!important; */
|
4959 |
+
}
|
4960 |
+
|
4961 |
+
.tab6 .sfsi_responsive_default_icon_container input {
|
4962 |
+
padding: 8px 11px;
|
4963 |
+
height: 39px;
|
4964 |
+
}
|
4965 |
+
|
4966 |
+
.tab6 .heading-label {
|
4967 |
+
font-size: 18px !important;
|
4968 |
+
font-weight: 400;
|
4969 |
+
}
|
4970 |
+
|
4971 |
+
.sfsi_responsive_default_icon_container,
|
4972 |
+
.sfsi_responsive_custom_icon_container {
|
4973 |
+
padding: 2px 0 !important;
|
4974 |
+
}
|
4975 |
+
|
4976 |
+
.sfsi_responsive_default_icon_container .sfsi_responsive_default_url_toggler,
|
4977 |
+
.sfsi_responsive_custom_icon_container .sfsi_responsive_default_url_toggler,
|
4978 |
+
.sfsi_responsive_default_icon_container .sfsi_responsive_default_url_hide {
|
4979 |
+
color: #337ab7 !important;
|
4980 |
+
font-size: 18px !important;
|
4981 |
+
letter-spacing: 1px;
|
4982 |
+
font-weight: 500;
|
4983 |
+
margin-left: 20px;
|
4984 |
+
text-decoration: none !important
|
4985 |
+
}
|
4986 |
+
|
4987 |
+
.sfsi_responsive_fluid {
|
4988 |
+
text-decoration: none !important;
|
4989 |
+
}
|
4990 |
+
|
4991 |
+
.sfsi_large_button_container {
|
4992 |
+
width: calc(100% - 81px) !important;
|
4993 |
+
}
|
4994 |
+
|
4995 |
+
.sfsi_medium_button_container {
|
4996 |
+
width: calc(100% - 70px) !important;
|
4997 |
+
}
|
4998 |
+
|
4999 |
+
.sfsi_small_button_container {
|
5000 |
+
width: calc(100% - 100px) !important;
|
5001 |
+
}
|
5002 |
+
|
5003 |
+
/* .sfsi_responsive_custom_icon{line-height: 6px;} */
|
5004 |
+
/* .sfsi_responsive_fixed_width .sfsi_responsive_custom_icon{line-height: 6px;} */
|
5005 |
+
/*Override for front end - icon of right height*/
|
5006 |
+
/* .sfsi_responsive_fluid .sfsi_large_button{padding: 13px !important;} */
|
5007 |
+
/* .sfsi_responsive_fluid .sfsi_medium_button{padding: 10px !important;} */
|
5008 |
+
|
5009 |
+
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_large_button {
|
5010 |
+
padding: 12px 13px 9px 13px !important;
|
5011 |
+
}
|
5012 |
+
|
5013 |
+
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_large_button h3 {
|
5014 |
+
margin: 0px 0px 15px 0px !important;
|
5015 |
+
}
|
5016 |
+
|
5017 |
+
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_medium_button {
|
5018 |
+
padding: 9px 10px 7px 10px !important;
|
5019 |
+
}
|
5020 |
+
|
5021 |
+
.sfsi_responsive_icons_count.sfsi_responsive_count_container.sfsi_large_button {
|
5022 |
+
padding: 12px 13px 9px 13px !important;
|
5023 |
+
}
|
5024 |
+
|
5025 |
+
.sfsi_responsive_icons_count.sfsi_responsive_count_container.sfsi_large_button h3 {
|
5026 |
+
margin: 0px 0px 15px 0px !important;
|
5027 |
+
}
|
5028 |
+
|
5029 |
+
.sfsi_responsive_icons_count.sfsi_responsive_count_container.sfsi_medium_button {
|
5030 |
+
padding: 9px 10px 7px 10px !important;
|
5031 |
+
}
|
5032 |
+
|
5033 |
+
.sfsi_responsive_icon_preview .sfsi_icons_container a .sfsi_responsive_icon_item_container {
|
5034 |
+
/* white-space: nowrap;
|
5035 |
+
overflow: hidden;
|
5036 |
+
text-overflow: ellipsis;*/
|
5037 |
+
display: inline-block;
|
5038 |
+
}
|
5039 |
+
|
5040 |
+
.sfsi_right_info ul .sfsi_responsive_icon_option_li .options .field .sfsi_responsive_icons_icon_width input,
|
5041 |
+
.sfsi_right_info ul .sfsi_responsive_icon_option_li .options .field input {
|
5042 |
+
width: 75px !important;
|
5043 |
+
background: #ffffff;
|
5044 |
+
box-shadow: none;
|
5045 |
+
border: 1px solid rgb(221, 221, 221);
|
5046 |
+
border-radius: 0px;
|
5047 |
+
}
|
5048 |
+
|
5049 |
+
input[type="number"] {
|
5050 |
+
height: 46px !important;
|
5051 |
+
}
|
5052 |
+
|
5053 |
+
.tab6 .sfsi_inputSec span {
|
5054 |
+
display: inline-block;
|
5055 |
+
font-size: 18px;
|
5056 |
+
margin-left: 10px;
|
5057 |
+
vertical-align: middle;
|
5058 |
+
width: 200px;
|
5059 |
+
color: #5A6570;
|
5060 |
+
}
|
5061 |
+
|
5062 |
+
.tab6 .sfsi_responsive_icon_item_container {
|
5063 |
+
width: 300px;
|
5064 |
+
/* padding: 5px 10px; */
|
5065 |
+
display: inline-block;
|
5066 |
+
box-sizing: border-box !important;
|
5067 |
+
}
|
5068 |
+
|
5069 |
+
.tab6 .options select.styled {
|
5070 |
+
line-height: 46px;
|
5071 |
+
}
|
5072 |
+
|
5073 |
+
.tab6 .options select.styled {
|
5074 |
+
height: 46px;
|
5075 |
+
left: 0;
|
5076 |
+
line-height: 46px;
|
5077 |
+
position: absolute;
|
5078 |
+
top: 0;
|
5079 |
+
width: 213px;
|
5080 |
+
}
|
5081 |
+
|
5082 |
+
.tab6 .sfsi_responsive_icon_option_li span{
|
5083 |
+
margin-left: 0!important;
|
5084 |
+
}
|
5085 |
+
|
5086 |
+
.tab6 ul.sfsi_icn_listing8 li .sfsi_right_info {
|
5087 |
+
font-family: helveticaregular;
|
5088 |
+
float: left;
|
5089 |
+
}
|
5090 |
+
.sfsi_margin_top_0{
|
5091 |
+
margin-top: 0 !important;
|
5092 |
+
}
|
5093 |
+
.sfsi_responsive_icon_preview .sfsi_icons_container a{
|
5094 |
+
text-decoration: none;
|
5095 |
+
}
|
5096 |
+
.sfsi_small_button {
|
5097 |
+
line-height: 0px;
|
5098 |
+
height: unset;
|
5099 |
+
padding: 6px !important;
|
5100 |
+
}
|
5101 |
+
.sfsi_small_button span {
|
5102 |
+
margin-left: 10px;
|
5103 |
+
font-size: 16px;
|
5104 |
+
padding: 0px;
|
5105 |
+
line-height: 16px;
|
5106 |
+
vertical-align: -webkit-baseline-middle !important;
|
5107 |
+
margin-left: 10px;
|
5108 |
+
}
|
5109 |
+
.sfsi_small_button img {
|
5110 |
+
max-height: 16px !important;
|
5111 |
+
padding: 0px;
|
5112 |
+
line-height: 0px;
|
5113 |
+
vertical-align: -webkit-baseline-middle !important;
|
5114 |
+
}
|
5115 |
+
.sfsi_medium_button span {
|
5116 |
+
margin-left: 10px;
|
5117 |
+
font-size: 18px;
|
5118 |
+
padding: 0px;
|
5119 |
+
line-height: 16px;
|
5120 |
+
vertical-align: -webkit-baseline-middle !important;
|
5121 |
+
margin-left: 10px;
|
5122 |
+
}
|
5123 |
+
.sfsi_medium_button img {
|
5124 |
+
max-height: 16px !important;
|
5125 |
+
padding: 0px;
|
5126 |
+
line-height: 0px;
|
5127 |
+
vertical-align: -webkit-baseline-middle !important;
|
5128 |
+
}
|
5129 |
+
.sfsi_medium_button {
|
5130 |
+
line-height: 0px;
|
5131 |
+
height: unset;
|
5132 |
+
padding: 10px !important;
|
5133 |
+
}
|
5134 |
+
|
5135 |
+
.sfsi_medium_button span {
|
5136 |
+
margin-left: 10px;
|
5137 |
+
font-size: 18px;
|
5138 |
+
padding: 0px;
|
5139 |
+
line-height: 16px;
|
5140 |
+
vertical-align: -webkit-baseline-middle !important;
|
5141 |
+
margin-left: 10px;
|
5142 |
+
}
|
5143 |
+
.sfsi_medium_button img {
|
5144 |
+
max-height: 16px !important;
|
5145 |
+
padding: 0px;
|
5146 |
+
line-height: 0px;
|
5147 |
+
vertical-align: -webkit-baseline-middle !important;
|
5148 |
+
}
|
5149 |
+
.sfsi_medium_button {
|
5150 |
+
line-height: 0px;
|
5151 |
+
height: unset;
|
5152 |
+
padding: 10px !important;
|
5153 |
+
}
|
5154 |
+
.sfsi_large_button span {
|
5155 |
+
font-size: 20px;
|
5156 |
+
padding: 0px;
|
5157 |
+
line-height: 16px;
|
5158 |
+
vertical-align: -webkit-baseline-middle !important;
|
5159 |
+
display: inline;
|
5160 |
+
margin-left: 10px;
|
5161 |
+
}
|
5162 |
+
.sfsi_large_button img {
|
5163 |
+
max-height: 16px !important;
|
5164 |
+
padding: 0px;
|
5165 |
+
line-height: 0px;
|
5166 |
+
vertical-align: -webkit-baseline-middle !important;
|
5167 |
+
display: inline;
|
5168 |
+
}
|
5169 |
+
.sfsi_large_button {
|
5170 |
+
line-height: 0px;
|
5171 |
+
height: unset;
|
5172 |
+
padding: 13px !important;
|
5173 |
+
}
|
5174 |
+
.sfsi_responsive_icons_count{
|
5175 |
+
padding: 5px 10px;
|
5176 |
+
float: left !important;
|
5177 |
+
display: inline-block;
|
5178 |
+
margin-right: 0px;
|
5179 |
+
margin-top: 2px;
|
5180 |
+
}
|
5181 |
+
|
5182 |
+
.sfsi_responsive_icons_count h3{
|
5183 |
+
font-family: 'sans-serif' !important;
|
5184 |
+
font-weight: 900;
|
5185 |
+
font-size: 32px !important;
|
5186 |
+
line-height: 0px !important;
|
5187 |
+
padding: 0px;
|
5188 |
+
margin: 0px;
|
5189 |
+
}
|
5190 |
+
|
5191 |
+
.sfsi_responsive_icons_count h6{
|
5192 |
+
font-family: 'sans-serif' !important;
|
5193 |
+
font-weight: 900;
|
5194 |
+
padding: 0px;
|
5195 |
+
margin: 0px;
|
5196 |
+
}
|
5197 |
+
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
5198 |
+
text-decoration: none!important;
|
5199 |
+
border: 0!important;
|
5200 |
+
}
|
5201 |
+
.sfsi_responsive_with_counter_icons{
|
5202 |
+
width: calc(100% - 100px)!important;
|
5203 |
+
}
|
5204 |
+
.sfsiresponsive_icon_preview {
|
5205 |
+
padding: 0px 0 20px 0;
|
5206 |
+
min-width: 100%;
|
5207 |
+
}
|
5208 |
+
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_large_button {
|
5209 |
+
padding: 12px 13px 9px 13px !important;
|
5210 |
+
}
|
5211 |
+
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_medium_button {
|
5212 |
+
padding: 9px 10px 7px 10px !important;
|
5213 |
+
}
|
5214 |
+
.sfsi_responsive_icons_count.sfsi_small_button {
|
5215 |
+
padding: 7px 6px !important;
|
5216 |
+
}
|
5217 |
+
.sfsi_responsive_icons_count.sfsi_small_button {
|
5218 |
+
padding: 7px 6px !important;
|
5219 |
+
margin-top: 2px;
|
5220 |
+
}
|
5221 |
+
.sfsi_responsive_icons_count.sfsi_small_button h6 {
|
5222 |
+
display: inline-block;
|
5223 |
+
font-size: 12px !important;
|
5224 |
+
vertical-align: middle;
|
5225 |
+
}
|
5226 |
+
.sfsi_responsive_icons_count.sfsi_responsive_count_container.sfsi_medium_button {
|
5227 |
+
padding: 9px 10px 7px 10px !important;
|
5228 |
+
}
|
5229 |
+
.sfsi_responsive_icons_count.sfsi_medium_button h3 {
|
5230 |
+
font-size: 21px !important;
|
5231 |
+
vertical-align: top;
|
5232 |
+
line-height: 8px !important;
|
5233 |
+
margin: 0px 0px 12px 0px !important;
|
5234 |
+
font-family: 'sans-serif' !important;
|
5235 |
+
font-weight: 900;
|
5236 |
+
padding: 0px;
|
5237 |
+
}
|
5238 |
+
.sfsi_esponsive_icons_count.sfsi_responsive_count_container.sfsi_large_button h3 {
|
5239 |
+
margin: 0px 0px 15px 0px !important;
|
5240 |
+
}
|
5241 |
+
.sfsi_responsive_icons_count.sfsi_large_button h3 {
|
5242 |
+
font-size: 26px !important;
|
5243 |
+
vertical-align: top;
|
5244 |
+
line-height: 6px !important;
|
5245 |
+
}
|
5246 |
+
|
5247 |
+
.sfsi_responsive_icons_count h3 {
|
5248 |
+
font-family: 'sans-serif' !important;
|
5249 |
+
font-weight: 900;
|
5250 |
+
padding: 0px;
|
5251 |
+
}
|
5252 |
+
|
5253 |
+
.sfsi_responsive_icons_count.sfsi_small_button h3 {
|
5254 |
+
font-size: 20px !important;
|
5255 |
+
display: inline-block;
|
5256 |
+
vertical-align: middle;
|
5257 |
+
}
|
5258 |
+
.sfsi_responsive_icons_count.sfsi_small_button h3 {
|
5259 |
+
margin: 0px !important;
|
5260 |
+
}
|
5261 |
+
.sfsi_responsive_icons_count h3 {
|
5262 |
+
font-family: 'sans-serif' !important;
|
5263 |
+
font-weight: 900;
|
5264 |
+
line-height: 0px !important;
|
5265 |
+
padding: 0px;
|
5266 |
+
margin: 0px;
|
5267 |
+
}
|
5268 |
+
#accordion .ui-state-active, #accordion1 .ui-state-active, #accordion2 .ui-state-active{
|
5269 |
+
background: #d22b30 url(../images/arrow.png) right -105px no-repeat !important;
|
5270 |
+
color: #eee !important;
|
5271 |
+
border: 0;
|
5272 |
+
}
|
5273 |
+
|
5274 |
+
#accordion .ui-state-hover, #accordion1 .ui-state-hover, #accordion2 .ui-state-hover {
|
5275 |
+
background: #d22b30 url(../images/arrow.png) right -105px no-repeat !important;
|
5276 |
+
color: #eee !important;
|
5277 |
+
}
|
5278 |
+
|
5279 |
+
|
5280 |
+
.sfsi_disable_radio .radio{
|
5281 |
+
background-position: 0px 0px !important;
|
5282 |
+
opacity: 0.3;
|
5283 |
+
}
|
5284 |
+
.sfsi_disable_radio .labelhdng4{
|
5285 |
+
opacity: 0.3;
|
|
|
5286 |
}
|
css/sfsi-style.css
CHANGED
@@ -1,3471 +1,3471 @@
|
|
1 |
-
@charset "utf-8";
|
2 |
-
|
3 |
-
@font-face {
|
4 |
-
font-family: helveticabold;
|
5 |
-
src: url(fonts/helvetica_bold_0-webfont.eot);
|
6 |
-
src: url(fonts/helvetica_bold_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_bold_0-webfont.woff) format('woff'), url(fonts/helvetica_bold_0-webfont.ttf) format('truetype'), url(fonts/helvetica_bold_0-webfont.svg#helveticabold) format('svg');
|
7 |
-
font-weight: 400;
|
8 |
-
font-style: normal;
|
9 |
-
}
|
10 |
-
|
11 |
-
@font-face {
|
12 |
-
font-family: helveticaregular;
|
13 |
-
src: url(fonts/helvetica_0-webfont.eot);
|
14 |
-
src: url(fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_0-webfont.woff) format('woff'), url(fonts/helvetica_0-webfont.ttf) format('truetype'), url(fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');
|
15 |
-
font-weight: 400;
|
16 |
-
font-style: normal;
|
17 |
-
}
|
18 |
-
|
19 |
-
@font-face {
|
20 |
-
font-family: helveticaneue-light;
|
21 |
-
src: url(fonts/helveticaneue-light.eot);
|
22 |
-
src: url(fonts/helveticaneue-light.eot?#iefix) format('embedded-opentype'), url(fonts/helveticaneue-light.woff) format('woff'), url(fonts/helveticaneue-light.ttf) format('truetype'), url(fonts/helveticaneue-light.svg#helveticaneue-light) format('svg');
|
23 |
-
font-weight: 400;
|
24 |
-
font-style: normal;
|
25 |
-
}
|
26 |
-
|
27 |
-
body {
|
28 |
-
margin: 0;
|
29 |
-
padding: 0;
|
30 |
-
}
|
31 |
-
|
32 |
-
.clear {
|
33 |
-
clear: both;
|
34 |
-
}
|
35 |
-
|
36 |
-
.space {
|
37 |
-
clear: both;
|
38 |
-
padding: 30px 0 0;
|
39 |
-
width: 100%;
|
40 |
-
float: left;
|
41 |
-
}
|
42 |
-
|
43 |
-
.like_txt {
|
44 |
-
margin: 30px 0 0;
|
45 |
-
padding: 0;
|
46 |
-
color: #12a252;
|
47 |
-
font-family: helveticaregular;
|
48 |
-
font-size: 20px;
|
49 |
-
line-height: 20px;
|
50 |
-
text-align: center;
|
51 |
-
}
|
52 |
-
|
53 |
-
.like_txt a {
|
54 |
-
color: #12a252;
|
55 |
-
}
|
56 |
-
|
57 |
-
.sfsibeforpstwpr iframe,
|
58 |
-
.sfsiaftrpstwpr iframe {
|
59 |
-
max-width: none;
|
60 |
-
}
|
61 |
-
|
62 |
-
.sfwp_fivestar_ul li {
|
63 |
-
display: block;
|
64 |
-
padding-right: 20px;
|
65 |
-
}
|
66 |
-
|
67 |
-
.shwthmbfraftr {
|
68 |
-
margin-top: 5px !important
|
69 |
-
}
|
70 |
-
|
71 |
-
label.toglpstpgsbttl {
|
72 |
-
float: left;
|
73 |
-
margin-top: 5px !important
|
74 |
-
}
|
75 |
-
|
76 |
-
.tab_3_icns.shwthmbfraftr .cstmdisplaysharingtxt {
|
77 |
-
float: left;
|
78 |
-
}
|
79 |
-
|
80 |
-
.tab6 ul.enough_waffling.sfsi_dsplyatend {
|
81 |
-
width: 24%;
|
82 |
-
float: left;
|
83 |
-
}
|
84 |
-
|
85 |
-
.tab4 ul.like_icon {
|
86 |
-
margin: 0;
|
87 |
-
padding: 20px 0 0;
|
88 |
-
list-style: none;
|
89 |
-
text-align: center;
|
90 |
-
}
|
91 |
-
|
92 |
-
.tab4 ul.like_icon li {
|
93 |
-
margin: 0;
|
94 |
-
padding: 0;
|
95 |
-
list-style: none;
|
96 |
-
display: inline-block;
|
97 |
-
}
|
98 |
-
|
99 |
-
.tab4 ul.like_icon li span {
|
100 |
-
margin: 0;
|
101 |
-
width: 54px;
|
102 |
-
display: block;
|
103 |
-
background: url(../images/count_bg.png) no-repeat;
|
104 |
-
height: 24px;
|
105 |
-
overflow: hidden;
|
106 |
-
padding: 10px 2px 2px;
|
107 |
-
font-size: 17px;
|
108 |
-
text-align: center;
|
109 |
-
line-height: 24px;
|
110 |
-
color: #5a6570;
|
111 |
-
}
|
112 |
-
|
113 |
-
.tab4 ul.like_icon li a {
|
114 |
-
color: #5a6570;
|
115 |
-
text-decoration: none;
|
116 |
-
}
|
117 |
-
|
118 |
-
.tab4 ul.enough_waffling {
|
119 |
-
margin: 0;
|
120 |
-
padding: 25px 0 27px;
|
121 |
-
list-style: none;
|
122 |
-
text-align: center;
|
123 |
-
}
|
124 |
-
|
125 |
-
.tab4 ul.enough_waffling li {
|
126 |
-
margin: 0 22px;
|
127 |
-
padding: 0;
|
128 |
-
list-style: none;
|
129 |
-
display: inline-block;
|
130 |
-
}
|
131 |
-
|
132 |
-
.tab4 ul.enough_waffling li span {
|
133 |
-
float: left;
|
134 |
-
}
|
135 |
-
|
136 |
-
.tab4 ul.enough_waffling li label {
|
137 |
-
margin: 0 0 0 20px;
|
138 |
-
float: left;
|
139 |
-
font-family: helveticaregular;
|
140 |
-
font-size: 18px;
|
141 |
-
font-weight: 400;
|
142 |
-
text-align: center;
|
143 |
-
line-height: 38px;
|
144 |
-
color: #5a6570;
|
145 |
-
}
|
146 |
-
|
147 |
-
.sfsi_mainContainer .checkbox {
|
148 |
-
width: 31px;
|
149 |
-
height: 31px;
|
150 |
-
background: url(../images/check_bg.jpg) no-repeat;
|
151 |
-
display: inherit;
|
152 |
-
}
|
153 |
-
|
154 |
-
.sfsi_mainContainer .radio {
|
155 |
-
width: 40px;
|
156 |
-
height: 40px;
|
157 |
-
background: url(../images/radio_bg.png) no-repeat;
|
158 |
-
display: inherit;
|
159 |
-
}
|
160 |
-
|
161 |
-
.sfsi_mainContainer .select {
|
162 |
-
width: 127px;
|
163 |
-
height: 47px;
|
164 |
-
font-size: 17px;
|
165 |
-
background: url(../images/select_bg.jpg) no-repeat;
|
166 |
-
display: block;
|
167 |
-
padding-left: 16px;
|
168 |
-
line-height: 49px;
|
169 |
-
}
|
170 |
-
|
171 |
-
.sfsi_mainContainer .line {
|
172 |
-
background: #eaebee;
|
173 |
-
height: 1px;
|
174 |
-
font-size: 0;
|
175 |
-
margin: 15px 0 0;
|
176 |
-
clear: both;
|
177 |
-
width: 100%;
|
178 |
-
float: left;
|
179 |
-
}
|
180 |
-
|
181 |
-
.specify_counts {
|
182 |
-
display: block;
|
183 |
-
margin-top: 15px;
|
184 |
-
padding-top: 15px;
|
185 |
-
clear: both;
|
186 |
-
width: 100%;
|
187 |
-
float: left;
|
188 |
-
border-top: 1px solid #eaebee;
|
189 |
-
}
|
190 |
-
|
191 |
-
.specify_counts .radio_section {
|
192 |
-
width: 30px;
|
193 |
-
float: left;
|
194 |
-
margin: 12px 10px 0 0;
|
195 |
-
}
|
196 |
-
|
197 |
-
.specify_counts .social_icon_like {
|
198 |
-
width: 54px;
|
199 |
-
float: left;
|
200 |
-
margin: 0 15px 0 0;
|
201 |
-
}
|
202 |
-
|
203 |
-
.specify_counts .social_icon_like ul {
|
204 |
-
margin: 0;
|
205 |
-
padding: 0;
|
206 |
-
list-style: none;
|
207 |
-
text-align: center;
|
208 |
-
}
|
209 |
-
|
210 |
-
.specify_counts .social_icon_like li {
|
211 |
-
margin: 0;
|
212 |
-
padding: 0;
|
213 |
-
list-style: none;
|
214 |
-
display: inline-block;
|
215 |
-
}
|
216 |
-
|
217 |
-
.specify_counts .social_icon_like li span {
|
218 |
-
margin: 0;
|
219 |
-
width: 54px;
|
220 |
-
display: block;
|
221 |
-
background: url(../images/count_bg.jpg) no-repeat;
|
222 |
-
height: 24px;
|
223 |
-
overflow: hidden;
|
224 |
-
padding: 10px 2px 2px;
|
225 |
-
font-family: helveticaregular;
|
226 |
-
font-size: 16px;
|
227 |
-
text-align: center;
|
228 |
-
line-height: 24px;
|
229 |
-
color: #5a6570;
|
230 |
-
}
|
231 |
-
|
232 |
-
.specify_counts .social_icon_like li a {
|
233 |
-
color: #5a6570;
|
234 |
-
text-decoration: none;
|
235 |
-
}
|
236 |
-
|
237 |
-
.specify_counts .listing {
|
238 |
-
width: 88%;
|
239 |
-
margin-top: -5px;
|
240 |
-
display: inherit;
|
241 |
-
float: left;
|
242 |
-
}
|
243 |
-
|
244 |
-
.specify_counts .listing ul {
|
245 |
-
margin: 0;
|
246 |
-
padding: 0;
|
247 |
-
list-style: none;
|
248 |
-
text-align: left;
|
249 |
-
}
|
250 |
-
|
251 |
-
.specify_counts .listing li {
|
252 |
-
margin: 15px 0 0;
|
253 |
-
padding: 0;
|
254 |
-
list-style: none;
|
255 |
-
clear: both;
|
256 |
-
line-height: 39px;
|
257 |
-
font-size: 17px;
|
258 |
-
}
|
259 |
-
|
260 |
-
.specify_counts .listing li span {
|
261 |
-
float: left;
|
262 |
-
margin-right: 20px;
|
263 |
-
}
|
264 |
-
|
265 |
-
.specify_counts .listing li .input {
|
266 |
-
background: #e5e5e5;
|
267 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
268 |
-
border: 0;
|
269 |
-
padding: 10px;
|
270 |
-
margin-left: 25px;
|
271 |
-
}
|
272 |
-
|
273 |
-
.specify_counts .listing li .input_facebook {
|
274 |
-
width: 288px;
|
275 |
-
background: #e5e5e5;
|
276 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
277 |
-
border: 0;
|
278 |
-
padding: 10px;
|
279 |
-
margin-left: 16px;
|
280 |
-
}
|
281 |
-
|
282 |
-
.save_button {
|
283 |
-
width: 450px;
|
284 |
-
padding-top: 30px;
|
285 |
-
clear: both;
|
286 |
-
margin: auto;
|
287 |
-
}
|
288 |
-
|
289 |
-
.save_button a {
|
290 |
-
background: #12a252;
|
291 |
-
text-align: center;
|
292 |
-
font-size: 23px;
|
293 |
-
color: #FFF !important;
|
294 |
-
display: block;
|
295 |
-
padding: 11px 0;
|
296 |
-
text-decoration: none;
|
297 |
-
}
|
298 |
-
|
299 |
-
.save_button a:hover {
|
300 |
-
background: #079345
|
301 |
-
}
|
302 |
-
|
303 |
-
.tab5 ul.share_icon_order {
|
304 |
-
margin: 0;
|
305 |
-
padding: 0;
|
306 |
-
list-style: none;
|
307 |
-
text-align: left;
|
308 |
-
}
|
309 |
-
|
310 |
-
.tab5 ul.share_icon_order li {
|
311 |
-
margin: 22px 6px 0 0;
|
312 |
-
padding: 0;
|
313 |
-
list-style: none;
|
314 |
-
float: left;
|
315 |
-
line-height: 37px;
|
316 |
-
}
|
317 |
-
|
318 |
-
.tab5 ul.share_icon_order li:last-child {
|
319 |
-
margin: 22px 0 0 3px;
|
320 |
-
}
|
321 |
-
|
322 |
-
.tab5 .row {
|
323 |
-
border-top: 1px solid #eaebee;
|
324 |
-
margin-top: 25px;
|
325 |
-
padding-top: 15px;
|
326 |
-
clear: both;
|
327 |
-
display: block;
|
328 |
-
width: 100%;
|
329 |
-
float: left;
|
330 |
-
font-family: helveticaregular;
|
331 |
-
line-height: 42px;
|
332 |
-
}
|
333 |
-
|
334 |
-
.tab5 .icons_size {
|
335 |
-
position: relative;
|
336 |
-
}
|
337 |
-
|
338 |
-
.tab5 .icons_size span {
|
339 |
-
margin-right: 18px;
|
340 |
-
display: block;
|
341 |
-
float: left;
|
342 |
-
font-size: 18px;
|
343 |
-
font-weight: 400;
|
344 |
-
line-height: 46px;
|
345 |
-
}
|
346 |
-
|
347 |
-
.tab5 .icons_size span.last {
|
348 |
-
margin-left: 55px;
|
349 |
-
}
|
350 |
-
|
351 |
-
.tab5 .icons_size input {
|
352 |
-
width: 73px;
|
353 |
-
background: #e5e5e5;
|
354 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
355 |
-
border: 0;
|
356 |
-
padding: 13px 13px 12px;
|
357 |
-
margin-right: 18px;
|
358 |
-
float: left;
|
359 |
-
display: block;
|
360 |
-
}
|
361 |
-
|
362 |
-
.tab5 .icons_size select.styled {
|
363 |
-
position: absolute;
|
364 |
-
left: 0;
|
365 |
-
width: 135px;
|
366 |
-
height: 46px;
|
367 |
-
line-height: 46px;
|
368 |
-
}
|
369 |
-
|
370 |
-
.tab5 .icons_size .field {
|
371 |
-
position: relative;
|
372 |
-
float: left;
|
373 |
-
display: block;
|
374 |
-
margin-right: 20px;
|
375 |
-
}
|
376 |
-
|
377 |
-
.tab5 .icons_size ins {
|
378 |
-
margin-right: 25px;
|
379 |
-
float: left;
|
380 |
-
font-size: 17px;
|
381 |
-
font-weight: 400;
|
382 |
-
text-decoration: none;
|
383 |
-
}
|
384 |
-
|
385 |
-
.tab5 .icons_size ins.leave_empty {
|
386 |
-
line-height: 23px;
|
387 |
-
}
|
388 |
-
|
389 |
-
.tab5 .icons_size {
|
390 |
-
padding-top: 15px;
|
391 |
-
}
|
392 |
-
|
393 |
-
.tab5 ul.enough_waffling {
|
394 |
-
margin: -5px 0 0;
|
395 |
-
padding: 0;
|
396 |
-
list-style: none;
|
397 |
-
text-align: center;
|
398 |
-
}
|
399 |
-
|
400 |
-
.tab5 .new_wind .row_onl ul.enough_waffling {
|
401 |
-
/*margin: 14px 0 0 167px;*/
|
402 |
-
margin: 20px 0 0 0;
|
403 |
-
padding: 0;
|
404 |
-
list-style: none;
|
405 |
-
height: 38px;
|
406 |
-
text-align: center;
|
407 |
-
width: 61%;
|
408 |
-
}
|
409 |
-
|
410 |
-
.tab5 ul.enough_waffling li {
|
411 |
-
margin: 0 22px;
|
412 |
-
padding: 0;
|
413 |
-
list-style: none;
|
414 |
-
display: inline-block;
|
415 |
-
float: left;
|
416 |
-
}
|
417 |
-
|
418 |
-
.tab5 ul.enough_waffling li span {
|
419 |
-
float: left;
|
420 |
-
}
|
421 |
-
|
422 |
-
.tab5 ul.enough_waffling li label {
|
423 |
-
margin: 0 0 0 20px;
|
424 |
-
float: left;
|
425 |
-
font-family: helveticaregular;
|
426 |
-
font-size: 18px;
|
427 |
-
font-weight: 400;
|
428 |
-
text-align: center;
|
429 |
-
line-height: 38px;
|
430 |
-
color: #5a6570;
|
431 |
-
}
|
432 |
-
|
433 |
-
.sticking p {
|
434 |
-
float: left;
|
435 |
-
font-size: 18px !important;
|
436 |
-
}
|
437 |
-
|
438 |
-
.sticking p.list {
|
439 |
-
width: 168px;
|
440 |
-
}
|
441 |
-
|
442 |
-
.sticking p.link {
|
443 |
-
margin: 3px 0 0 12px;
|
444 |
-
padding: 0 !important;
|
445 |
-
float: left;
|
446 |
-
}
|
447 |
-
|
448 |
-
.sticking .float {
|
449 |
-
margin-left: 188px;
|
450 |
-
margin-top: 3px;
|
451 |
-
float: left;
|
452 |
-
font-size: 17px;
|
453 |
-
}
|
454 |
-
|
455 |
-
.sticking ul {
|
456 |
-
margin: 0;
|
457 |
-
padding: 30px 0 0;
|
458 |
-
list-style: none;
|
459 |
-
float: left;
|
460 |
-
}
|
461 |
-
|
462 |
-
.sticking a {
|
463 |
-
color: #a4a9ad;
|
464 |
-
}
|
465 |
-
|
466 |
-
.sticking p {
|
467 |
-
line-height: 19px !important;
|
468 |
-
}
|
469 |
-
|
470 |
-
.sticking .field {
|
471 |
-
position: relative;
|
472 |
-
float: left;
|
473 |
-
display: block;
|
474 |
-
margin-left: 20px;
|
475 |
-
}
|
476 |
-
|
477 |
-
.sticking .field .select {
|
478 |
-
width: 206px;
|
479 |
-
height: 47px;
|
480 |
-
background: url(../images/select_bg1.jpg) no-repeat;
|
481 |
-
display: block;
|
482 |
-
padding-left: 10px;
|
483 |
-
}
|
484 |
-
|
485 |
-
.sticking .field select.styled {
|
486 |
-
position: absolute;
|
487 |
-
left: 0;
|
488 |
-
top: 0;
|
489 |
-
width: 211px;
|
490 |
-
line-height: 46px;
|
491 |
-
height: 46px;
|
492 |
-
}
|
493 |
-
|
494 |
-
.mouseover_field {
|
495 |
-
width: 455px;
|
496 |
-
float: left;
|
497 |
-
font-size: 18px;
|
498 |
-
margin-top: 10px;
|
499 |
-
}
|
500 |
-
|
501 |
-
.mouseover_field label {
|
502 |
-
width: 125px;
|
503 |
-
float: left;
|
504 |
-
}
|
505 |
-
|
506 |
-
.mouseover_field input {
|
507 |
-
width: 256px;
|
508 |
-
float: left;
|
509 |
-
background: #e5e5e5;
|
510 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
511 |
-
border: 0;
|
512 |
-
padding: 10px;
|
513 |
-
}
|
514 |
-
|
515 |
-
.pop_up_box {
|
516 |
-
width: 474px;
|
517 |
-
background: #FFF;
|
518 |
-
box-shadow: 0 0 5px 3px #d8d8d8;
|
519 |
-
margin: 200px auto;
|
520 |
-
padding: 20px 25px 0px;
|
521 |
-
font-family: helveticaregular;
|
522 |
-
color: #5a6570;
|
523 |
-
min-height: 250px;
|
524 |
-
position: relative;
|
525 |
-
}
|
526 |
-
|
527 |
-
.pop_up_box h4,
|
528 |
-
.pop_up_box_ex h4 {
|
529 |
-
font-size: 20px;
|
530 |
-
color: #5a6570;
|
531 |
-
text-align: center;
|
532 |
-
margin: 0;
|
533 |
-
padding: 0;
|
534 |
-
line-height: 22px;
|
535 |
-
}
|
536 |
-
|
537 |
-
.pop_up_box p,
|
538 |
-
.pop_up_box_ex p {
|
539 |
-
font-size: 17px;
|
540 |
-
line-height: 28px;
|
541 |
-
color: #5a6570;
|
542 |
-
text-align: left;
|
543 |
-
margin: 0;
|
544 |
-
padding: 25px 0 0;
|
545 |
-
font-family: helveticaregular;
|
546 |
-
}
|
547 |
-
|
548 |
-
.sfsi_popupcntnr {
|
549 |
-
float: left;
|
550 |
-
width: 100%
|
551 |
-
}
|
552 |
-
|
553 |
-
.sfsi_popupcntnr>h3 {
|
554 |
-
color: #000;
|
555 |
-
float: left;
|
556 |
-
font-weight: 700;
|
557 |
-
margin-bottom: 5px;
|
558 |
-
width: 100%
|
559 |
-
}
|
560 |
-
|
561 |
-
ul.flwstep {
|
562 |
-
float: left;
|
563 |
-
width: 100%
|
564 |
-
}
|
565 |
-
|
566 |
-
ul.flwstep>li {
|
567 |
-
color: #000;
|
568 |
-
font-size: 16px;
|
569 |
-
margin: 5px;
|
570 |
-
}
|
571 |
-
|
572 |
-
.upldbtn {
|
573 |
-
float: left;
|
574 |
-
text-align: center;
|
575 |
-
width: 100%
|
576 |
-
}
|
577 |
-
|
578 |
-
.upload_butt {
|
579 |
-
background-color: #12a252;
|
580 |
-
border: none;
|
581 |
-
color: #fff;
|
582 |
-
font-weight: 700;
|
583 |
-
margin-top: 10px;
|
584 |
-
padding: 7px 22px;
|
585 |
-
width: auto;
|
586 |
-
cursor: pointer;
|
587 |
-
font-size: 19px;
|
588 |
-
}
|
589 |
-
|
590 |
-
.pop_up_box .button {
|
591 |
-
background: #12a252;
|
592 |
-
font-size: 22px;
|
593 |
-
line-height: 24px;
|
594 |
-
color: #5a6570;
|
595 |
-
text-align: center;
|
596 |
-
min-height: 80px;
|
597 |
-
margin-top: 32px;
|
598 |
-
box-shadow: none;
|
599 |
-
}
|
600 |
-
|
601 |
-
.pop_up_box .button:hover {
|
602 |
-
box-shadow: none !important;
|
603 |
-
}
|
604 |
-
|
605 |
-
.pop_up_box .button a.activate {
|
606 |
-
padding: 0px 0;
|
607 |
-
}
|
608 |
-
|
609 |
-
.pop_up_box a,
|
610 |
-
.pop_up_box_ex a {
|
611 |
-
color: #a4a9ad;
|
612 |
-
font-size: 20px;
|
613 |
-
text-decoration: none;
|
614 |
-
text-align: center;
|
615 |
-
display: inline-block;
|
616 |
-
margin-top: 18px;
|
617 |
-
width: 100%;
|
618 |
-
}
|
619 |
-
|
620 |
-
.pop_up_box .upload {
|
621 |
-
width: 100%;
|
622 |
-
float: left;
|
623 |
-
text-align: left;
|
624 |
-
margin-top: 15px;
|
625 |
-
height: 46px;
|
626 |
-
}
|
627 |
-
|
628 |
-
.pop_up_box .upload label {
|
629 |
-
width: 135px;
|
630 |
-
float: left;
|
631 |
-
line-height: 45px;
|
632 |
-
font-size: 18px;
|
633 |
-
font-family: helveticaregular;
|
634 |
-
text-align: left;
|
635 |
-
}
|
636 |
-
|
637 |
-
.pop_up_box .upload input[type=text] {
|
638 |
-
width: 248px;
|
639 |
-
float: left;
|
640 |
-
background: #e5e5e5;
|
641 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
642 |
-
border: 0;
|
643 |
-
padding: 0 10px;
|
644 |
-
font-size: 16px;
|
645 |
-
height: 44px;
|
646 |
-
text-align: left;
|
647 |
-
color: #5a6570;
|
648 |
-
font-family: helveticaregular;
|
649 |
-
}
|
650 |
-
|
651 |
-
.pop_up_box .upload input.upload_butt {
|
652 |
-
width: 100px;
|
653 |
-
background: #12a252;
|
654 |
-
box-shadow: 0 0 0;
|
655 |
-
border: 0;
|
656 |
-
text-align: center;
|
657 |
-
font-size: 18px;
|
658 |
-
color: #fff;
|
659 |
-
font-family: helveticaregular;
|
660 |
-
height: 45px;
|
661 |
-
right: 32px;
|
662 |
-
top: 71px;
|
663 |
-
position: absolute;
|
664 |
-
}
|
665 |
-
|
666 |
-
.pop_up_box .upload a {
|
667 |
-
color: #12a252;
|
668 |
-
font-size: 18px;
|
669 |
-
text-decoration: underline;
|
670 |
-
font-family: helveticaregular;
|
671 |
-
margin: 0 0 16px 140px;
|
672 |
-
}
|
673 |
-
|
674 |
-
.pop_up_box a:hover,
|
675 |
-
.pop_up_box_ex a:hover {
|
676 |
-
color: #a4a9ad;
|
677 |
-
}
|
678 |
-
|
679 |
-
.inr_cont .fb_url {
|
680 |
-
clear: both;
|
681 |
-
}
|
682 |
-
|
683 |
-
.inr_cont .fb_url .checkbox,
|
684 |
-
.inr_cont .fb_url input.add,
|
685 |
-
.inr_cont .fb_url label,
|
686 |
-
.inr_cont .fb_url lable {
|
687 |
-
float: left;
|
688 |
-
}
|
689 |
-
|
690 |
-
.inr_cont .fb_url input.add {
|
691 |
-
margin-left: 19px;
|
692 |
-
}
|
693 |
-
|
694 |
-
.inr_cont .fb_url .checkbox {
|
695 |
-
margin: 6px 0 0;
|
696 |
-
}
|
697 |
-
|
698 |
-
.inr_cont .fb_url label {
|
699 |
-
/*line-height: 41px; margin: 0 0 0 15px;*/
|
700 |
-
line-height: 22px;
|
701 |
-
margin: 10px 0 0 15px;
|
702 |
-
font-size: 17px;
|
703 |
-
}
|
704 |
-
|
705 |
-
.inr_cont textarea.add_txt {
|
706 |
-
resize: none;
|
707 |
-
margin: 0 0 0 19px !important;
|
708 |
-
height: 60px;
|
709 |
-
}
|
710 |
-
|
711 |
-
.tab2 .inr_cont textarea.add_txt {
|
712 |
-
width: 382px !important;
|
713 |
-
height: 90px;
|
714 |
-
overflow: hidden;
|
715 |
-
}
|
716 |
-
|
717 |
-
.tab2 .inr_cont input.add {
|
718 |
-
width: 417px;
|
719 |
-
}
|
720 |
-
|
721 |
-
.red_txt,
|
722 |
-
.tab2 .red_txt {
|
723 |
-
color: #ef4745 !important;
|
724 |
-
text-align: center !important;
|
725 |
-
padding-top: 5px !important;
|
726 |
-
}
|
727 |
-
|
728 |
-
.green_txt {
|
729 |
-
color: #12A252 !important;
|
730 |
-
text-align: center !important;
|
731 |
-
padding-top: 5px !important;
|
732 |
-
}
|
733 |
-
|
734 |
-
.red_txt {
|
735 |
-
color: #f80000 !important;
|
736 |
-
text-align: center !important;
|
737 |
-
padding-top: 5px !important;
|
738 |
-
}
|
739 |
-
|
740 |
-
.linked_tab_2 .fb_url label {
|
741 |
-
/* width: 32%;*/
|
742 |
-
/* width: 26.99%;*/
|
743 |
-
width: 22%;
|
744 |
-
}
|
745 |
-
|
746 |
-
.twt_tab_2 label {
|
747 |
-
width: 18%
|
748 |
-
}
|
749 |
-
|
750 |
-
.bdr_top {
|
751 |
-
border-top: none !important;
|
752 |
-
}
|
753 |
-
|
754 |
-
.linked_tab_2 .fb_url input.link_dbl {
|
755 |
-
margin-bottom: 6px;
|
756 |
-
}
|
757 |
-
|
758 |
-
.tab3 {
|
759 |
-
overflow: hidden;
|
760 |
-
}
|
761 |
-
|
762 |
-
.tab3 .row {
|
763 |
-
/*border-top: 1px solid #EAEBEE;*/
|
764 |
-
padding: 25px 0;
|
765 |
-
clear: both;
|
766 |
-
overflow: hidden;
|
767 |
-
}
|
768 |
-
|
769 |
-
.tab3 ul.tab_3_list {
|
770 |
-
overflow: hidden;
|
771 |
-
margin: 4px 0 11px;
|
772 |
-
}
|
773 |
-
|
774 |
-
ul.tab_3_list li {
|
775 |
-
background: url(../images/tab_3_list_bg.jpg) 13px 7px no-repeat;
|
776 |
-
padding: 0 0 0 30px;
|
777 |
-
color: #778088;
|
778 |
-
font-family: helveticaregular;
|
779 |
-
font-size: 17px;
|
780 |
-
margin-bottom: 4px;
|
781 |
-
}
|
782 |
-
|
783 |
-
.tab5 ul.tab_3_list li {
|
784 |
-
background: url(../images/tab_3_list_bg.jpg) 13px 18px no-repeat;
|
785 |
-
}
|
786 |
-
|
787 |
-
.tab3 .row h3 {
|
788 |
-
/* margin: 0 0 20px;*/
|
789 |
-
margin: 20px 0 0px;
|
790 |
-
color: #414951;
|
791 |
-
font-family: helveticabold;
|
792 |
-
font-size: 20px;
|
793 |
-
}
|
794 |
-
|
795 |
-
ul.tab_3_icns {
|
796 |
-
list-style: none;
|
797 |
-
margin: 10px 0 0;
|
798 |
-
overflow: hidden;
|
799 |
-
}
|
800 |
-
|
801 |
-
ul.tab_3_icns li {
|
802 |
-
width: 100%;
|
803 |
-
margin: 0 0 21px;
|
804 |
-
float: left;
|
805 |
-
}
|
806 |
-
|
807 |
-
ul.tab_3_icns label {
|
808 |
-
float: left;
|
809 |
-
line-height: 42px;
|
810 |
-
/*margin: 0 20px;*/
|
811 |
-
color: #69737C;
|
812 |
-
font-size: 18px;
|
813 |
-
font-family: helveticaregular;
|
814 |
-
min-width: 125px;
|
815 |
-
}
|
816 |
-
|
817 |
-
ul.tab_3_icns li .icns_tab_3,
|
818 |
-
ul.tab_3_icns li .radio {
|
819 |
-
float: left;
|
820 |
-
}
|
821 |
-
|
822 |
-
.tab3 .sub_row h4 {
|
823 |
-
color: #a4a9ad !important;
|
824 |
-
}
|
825 |
-
|
826 |
-
.tab3 .sub_row p {
|
827 |
-
padding-top: 18px !important;
|
828 |
-
clear: both;
|
829 |
-
overflow: hidden;
|
830 |
-
}
|
831 |
-
|
832 |
-
.sub_row .sub_sub_box p {
|
833 |
-
padding-top: 18px !important;
|
834 |
-
}
|
835 |
-
|
836 |
-
.tab3 .sub_row .checkbox {
|
837 |
-
float: left;
|
838 |
-
margin-top: 4px;
|
839 |
-
}
|
840 |
-
|
841 |
-
.tab3 .sub_row .sub_sub_box {
|
842 |
-
width: 80%;
|
843 |
-
margin: 7px 0 15px 10%;
|
844 |
-
float: left;
|
845 |
-
}
|
846 |
-
|
847 |
-
.tab3 .sub_row input.smal_inpt {
|
848 |
-
width: 73px;
|
849 |
-
background: #e5e5e5;
|
850 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
851 |
-
border: 0;
|
852 |
-
padding: 10px;
|
853 |
-
float: left;
|
854 |
-
margin-left: 10px;
|
855 |
-
}
|
856 |
-
|
857 |
-
.tab3 .sub_row .drop_lst {
|
858 |
-
border: 1px solid #d6d6d6;
|
859 |
-
font-size: 16px;
|
860 |
-
color: #5a6570;
|
861 |
-
width: 120px;
|
862 |
-
}
|
863 |
-
|
864 |
-
.tab3 .first_row,
|
865 |
-
.tab3 .first_row p,
|
866 |
-
.tab3 .first_row p .radio,
|
867 |
-
.tab3 .first_row p label {
|
868 |
-
float: left;
|
869 |
-
}
|
870 |
-
|
871 |
-
.tab3 .first_row {
|
872 |
-
width: 90%;
|
873 |
-
float: left;
|
874 |
-
}
|
875 |
-
|
876 |
-
.tab3 .first_row p {
|
877 |
-
padding: 0 !important;
|
878 |
-
}
|
879 |
-
|
880 |
-
.tab3 .first_row p label {
|
881 |
-
line-height: 44px;
|
882 |
-
margin: 0 10px;
|
883 |
-
}
|
884 |
-
|
885 |
-
.tab3 .first_row p:last-child {
|
886 |
-
margin-left: 27%
|
887 |
-
}
|
888 |
-
|
889 |
-
.tab3 .tab_1_sav {
|
890 |
-
padding-top: 20px !important;
|
891 |
-
margin: 10px auto 20px;
|
892 |
-
}
|
893 |
-
|
894 |
-
.suc_msg {
|
895 |
-
background: #12A252;
|
896 |
-
color: #FFF;
|
897 |
-
display: none;
|
898 |
-
font-size: 23px;
|
899 |
-
padding: 10px;
|
900 |
-
text-align: left;
|
901 |
-
text-decoration: none;
|
902 |
-
}
|
903 |
-
|
904 |
-
.error_msg {
|
905 |
-
background: #D22B30;
|
906 |
-
color: #FFF;
|
907 |
-
display: none;
|
908 |
-
font-size: 23px;
|
909 |
-
padding: 10px;
|
910 |
-
text-align: left;
|
911 |
-
text-decoration: none;
|
912 |
-
}
|
913 |
-
|
914 |
-
.fileUPInput {
|
915 |
-
cursor: pointer;
|
916 |
-
position: relative;
|
917 |
-
top: -43px;
|
918 |
-
right: 0;
|
919 |
-
z-index: 99;
|
920 |
-
height: 42px;
|
921 |
-
font-size: 5px;
|
922 |
-
opacity: 0;
|
923 |
-
-moz-opacity: 0;
|
924 |
-
filter: alpha(opacity=0);
|
925 |
-
width: 100%
|
926 |
-
}
|
927 |
-
|
928 |
-
.inputWrapper {
|
929 |
-
height: 20px;
|
930 |
-
width: 50px;
|
931 |
-
overflow: hidden;
|
932 |
-
position: relative;
|
933 |
-
cursor: pointer;
|
934 |
-
}
|
935 |
-
|
936 |
-
.custom-txt {
|
937 |
-
background: none !important;
|
938 |
-
padding-left: 2px !important;
|
939 |
-
}
|
940 |
-
|
941 |
-
.custom-img {
|
942 |
-
float: left;
|
943 |
-
margin-left: 20px;
|
944 |
-
}
|
945 |
-
|
946 |
-
.loader-img {
|
947 |
-
float: left;
|
948 |
-
margin-left: -70px;
|
949 |
-
display: none;
|
950 |
-
}
|
951 |
-
|
952 |
-
.pop-overlay {
|
953 |
-
position: fixed;
|
954 |
-
top: 0;
|
955 |
-
left: 0;
|
956 |
-
width: 100%;
|
957 |
-
height: 100%;
|
958 |
-
backgound-color: #d3d3d3;
|
959 |
-
z-index: 10;
|
960 |
-
padding: 20px;
|
961 |
-
display: none;
|
962 |
-
}
|
963 |
-
|
964 |
-
.fb-overlay {
|
965 |
-
position: fixed;
|
966 |
-
top: 0;
|
967 |
-
left: 0;
|
968 |
-
width: 100%;
|
969 |
-
height: 100%;
|
970 |
-
backgound-color: #d3d3d3;
|
971 |
-
z-index: -1000;
|
972 |
-
padding: 20px;
|
973 |
-
opacity: 0;
|
974 |
-
display: block;
|
975 |
-
}
|
976 |
-
|
977 |
-
.inputError {
|
978 |
-
border: 1px solid #f80000 !important;
|
979 |
-
}
|
980 |
-
|
981 |
-
.sfsicloseBtn {
|
982 |
-
position: absolute;
|
983 |
-
top: 0;
|
984 |
-
right: 0;
|
985 |
-
cursor: pointer;
|
986 |
-
}
|
987 |
-
|
988 |
-
.top_arow {
|
989 |
-
background: url(../images/top_aro.png) no-repeat;
|
990 |
-
position: absolute;
|
991 |
-
top: -29px;
|
992 |
-
left: 38%;
|
993 |
-
width: 33px;
|
994 |
-
height: 29px;
|
995 |
-
backgoround-color: #fff;
|
996 |
-
}
|
997 |
-
|
998 |
-
.sfsi_tool_tip_2 .top_arow .sfsi_inside,
|
999 |
-
.top_arow .sfsi_inside {
|
1000 |
-
float: left;
|
1001 |
-
}
|
1002 |
-
|
1003 |
-
.sfsi_tool_tip_2 .tool_tip>img,
|
1004 |
-
.tool_tip>img {
|
1005 |
-
display: inline-block;
|
1006 |
-
margin-right: 4px;
|
1007 |
-
float: left;
|
1008 |
-
}
|
1009 |
-
|
1010 |
-
.norm_row {
|
1011 |
-
float: left;
|
1012 |
-
min-width: 25px;
|
1013 |
-
}
|
1014 |
-
|
1015 |
-
.norm_row a {
|
1016 |
-
border: none;
|
1017 |
-
display: inline-block;
|
1018 |
-
position: relative;
|
1019 |
-
float: left;
|
1020 |
-
}
|
1021 |
-
|
1022 |
-
.sfsi_tool_tip_2 a {
|
1023 |
-
min-height: 0 !important;
|
1024 |
-
}
|
1025 |
-
|
1026 |
-
.sfsi_widget {
|
1027 |
-
min-height: 55px;
|
1028 |
-
}
|
1029 |
-
|
1030 |
-
.sfsi_widget a img {
|
1031 |
-
box-shadow: none !important;
|
1032 |
-
outline: 0;
|
1033 |
-
}
|
1034 |
-
|
1035 |
-
.sfsi_wicons {
|
1036 |
-
display: inline-block;
|
1037 |
-
color: #000;
|
1038 |
-
}
|
1039 |
-
|
1040 |
-
.sel-active {
|
1041 |
-
background-color: #f7941d;
|
1042 |
-
}
|
1043 |
-
|
1044 |
-
.sfsi_outr_div .close {
|
1045 |
-
position: absolute;
|
1046 |
-
right: 18px;
|
1047 |
-
top: 18px;
|
1048 |
-
}
|
1049 |
-
|
1050 |
-
.sfsi_outr_div h2 {
|
1051 |
-
color: #778088;
|
1052 |
-
font-family: helveticaregular;
|
1053 |
-
font-size: 26px;
|
1054 |
-
margin: 0 0 9px;
|
1055 |
-
padding: 0;
|
1056 |
-
text-align: center;
|
1057 |
-
font-weight: 400;
|
1058 |
-
}
|
1059 |
-
|
1060 |
-
.sfsi_outr_div ul li a {
|
1061 |
-
color: #5A6570;
|
1062 |
-
text-decoration: none;
|
1063 |
-
}
|
1064 |
-
|
1065 |
-
.sfsi_outr_div ul li {
|
1066 |
-
display: inline-block;
|
1067 |
-
list-style: none;
|
1068 |
-
margin: 0;
|
1069 |
-
padding: 0;
|
1070 |
-
float: none;
|
1071 |
-
}
|
1072 |
-
|
1073 |
-
.expanded-area {
|
1074 |
-
display: none;
|
1075 |
-
}
|
1076 |
-
|
1077 |
-
.sfsi_wicons a {
|
1078 |
-
-webkit-transition: all .2s ease-in-out;
|
1079 |
-
-moz-transition: all .2s ease-in-out;
|
1080 |
-
-o-transition: all .2s ease-in-out;
|
1081 |
-
-ms-transition: all .2s ease-in-out;
|
1082 |
-
}
|
1083 |
-
|
1084 |
-
.scale,
|
1085 |
-
.scale-div {
|
1086 |
-
-webkit-transform: scale(1.1);
|
1087 |
-
-moz-transform: scale(1.1);
|
1088 |
-
-o-transform: scale(1.1);
|
1089 |
-
transform: scale(1.1);
|
1090 |
-
}
|
1091 |
-
|
1092 |
-
.sfsi_Sicons {
|
1093 |
-
float: left;
|
1094 |
-
}
|
1095 |
-
|
1096 |
-
.sfsi_Sicons .sf_subscrbe {
|
1097 |
-
margin: 2px 3px 3px 0;
|
1098 |
-
line-height: 20px;
|
1099 |
-
}
|
1100 |
-
|
1101 |
-
.sfsi_Sicons .sf_fb {
|
1102 |
-
margin: 0 4px 0 5px;
|
1103 |
-
line-height: 20px;
|
1104 |
-
}
|
1105 |
-
|
1106 |
-
.sfsi_Sicons .sf_twiter {
|
1107 |
-
margin: 2px 7px 0 4px;
|
1108 |
-
line-height: 17px;
|
1109 |
-
}
|
1110 |
-
|
1111 |
-
.sfsi_Sicons.left .sf_subscrbe {
|
1112 |
-
margin: 2px 8px 3px 0;
|
1113 |
-
}
|
1114 |
-
|
1115 |
-
.sfsi_Sicons.left .sf_fb {
|
1116 |
-
margin: 0 8px 0 0;
|
1117 |
-
}
|
1118 |
-
|
1119 |
-
.sfsi_Sicons.left .sf_twiter {
|
1120 |
-
margin: 2px 7px 0 0;
|
1121 |
-
}
|
1122 |
-
|
1123 |
-
.sfsi_Sicons.right .sf_subscrbe {
|
1124 |
-
margin: 2px 0 3px;
|
1125 |
-
}
|
1126 |
-
|
1127 |
-
.sfsi_Sicons.right .sf_fb {
|
1128 |
-
margin: 0 0 0 7px;
|
1129 |
-
}
|
1130 |
-
|
1131 |
-
.sfsi_Sicons.right .sf_twiter {
|
1132 |
-
margin: 2px 0 0 8px;
|
1133 |
-
}
|
1134 |
-
|
1135 |
-
.sfsi_Sicons .sf_subscrbe,
|
1136 |
-
.sfsi_Sicons .sf_twiter {
|
1137 |
-
position: relative;
|
1138 |
-
width: 75px;
|
1139 |
-
}
|
1140 |
-
|
1141 |
-
.sfsi_Sicons .sf_twiter iframe {
|
1142 |
-
margin: 0px;
|
1143 |
-
height: 20px !important;
|
1144 |
-
overflow: visible !important;
|
1145 |
-
}
|
1146 |
-
|
1147 |
-
.sfsi_Sicons .sf_twiter iframe #widget {
|
1148 |
-
overflow: visible !important;
|
1149 |
-
}
|
1150 |
-
|
1151 |
-
.sfsi_Sicons .sf_subscrbe a {
|
1152 |
-
width: auto;
|
1153 |
-
float: left;
|
1154 |
-
border: medium none;
|
1155 |
-
padding-top: 0px;
|
1156 |
-
}
|
1157 |
-
|
1158 |
-
.sfsi_Sicons .sf_subscrbe a:focus {
|
1159 |
-
outline: medium none;
|
1160 |
-
}
|
1161 |
-
|
1162 |
-
.sfsi_Sicons .sf_subscrbe a img {
|
1163 |
-
width: 65px;
|
1164 |
-
float: left;
|
1165 |
-
height: 20px !important;
|
1166 |
-
}
|
1167 |
-
|
1168 |
-
.sfsi_Sicons .sf_fb {
|
1169 |
-
position: relative;
|
1170 |
-
width: 75px;
|
1171 |
-
}
|
1172 |
-
|
1173 |
-
.sfsi_Sicons .fb_iframe_widget {
|
1174 |
-
float: left;
|
1175 |
-
/*min-width: 98px;*/
|
1176 |
-
width: 73px;
|
1177 |
-
margin: 2px 0 0;
|
1178 |
-
}
|
1179 |
-
|
1180 |
-
.sfsi_pop_up .button a:hover {
|
1181 |
-
color: #fff;
|
1182 |
-
}
|
1183 |
-
|
1184 |
-
.sfsi_pop_up .button:hover {
|
1185 |
-
background: #12a252;
|
1186 |
-
color: #fff;
|
1187 |
-
border: none;
|
1188 |
-
}
|
1189 |
-
|
1190 |
-
ul.icn_listing li .right_info a {
|
1191 |
-
outline: 0;
|
1192 |
-
font-family: helveticaregular;
|
1193 |
-
}
|
1194 |
-
|
1195 |
-
.upload_pop_up .upload_butt {
|
1196 |
-
line-height: 27px;
|
1197 |
-
margin-left: 6px;
|
1198 |
-
}
|
1199 |
-
|
1200 |
-
.drop_lsts {
|
1201 |
-
left: 220px;
|
1202 |
-
position: relative;
|
1203 |
-
top: -40px;
|
1204 |
-
}
|
1205 |
-
|
1206 |
-
.drop_lsts .styled {
|
1207 |
-
top: -42px;
|
1208 |
-
width: 127px;
|
1209 |
-
height: 33px;
|
1210 |
-
}
|
1211 |
-
|
1212 |
-
.drop_lsts span {
|
1213 |
-
line-height: 50px;
|
1214 |
-
}
|
1215 |
-
|
1216 |
-
.drag_drp {
|
1217 |
-
left: 11px;
|
1218 |
-
position: relative;
|
1219 |
-
top: 38px;
|
1220 |
-
font-size: 17px;
|
1221 |
-
}
|
1222 |
-
|
1223 |
-
.listing ul li label {
|
1224 |
-
width: 224px;
|
1225 |
-
float: left;
|
1226 |
-
}
|
1227 |
-
|
1228 |
-
.row_onl {
|
1229 |
-
width: 100%;
|
1230 |
-
float: left;
|
1231 |
-
}
|
1232 |
-
|
1233 |
-
#sfsi_Show_popupOn_PageIDs option.sel-active {
|
1234 |
-
background: #f7941d;
|
1235 |
-
}
|
1236 |
-
|
1237 |
-
.sfsi_inside div iframe {
|
1238 |
-
float: left;
|
1239 |
-
margin: 0;
|
1240 |
-
}
|
1241 |
-
|
1242 |
-
.sfsi_inside div #___plus_0,
|
1243 |
-
.sfsi_inside div #___plusone_0 {
|
1244 |
-
height: 27px;
|
1245 |
-
}
|
1246 |
-
|
1247 |
-
.sfsi_outr_div li {
|
1248 |
-
float: left;
|
1249 |
-
}
|
1250 |
-
|
1251 |
-
.sfsi_tool_tip_2 .sfsi_inside div {
|
1252 |
-
min-height: 0;
|
1253 |
-
}
|
1254 |
-
|
1255 |
-
#___plus_1>iframe {
|
1256 |
-
height: 30px;
|
1257 |
-
}
|
1258 |
-
|
1259 |
-
.main_contant h1 {
|
1260 |
-
margin: 0 0 19px;
|
1261 |
-
}
|
1262 |
-
|
1263 |
-
.main_contant p {
|
1264 |
-
margin: 0 0 26px;
|
1265 |
-
}
|
1266 |
-
|
1267 |
-
.main_contant p>a {
|
1268 |
-
color: #1a1d20;
|
1269 |
-
text-decoration: underline;
|
1270 |
-
}
|
1271 |
-
|
1272 |
-
.tab1 .gary_bg {
|
1273 |
-
background: #f1f1f1;
|
1274 |
-
}
|
1275 |
-
|
1276 |
-
#accordion {
|
1277 |
-
margin-top: 25px;
|
1278 |
-
}
|
1279 |
-
|
1280 |
-
.main_contant p>a,
|
1281 |
-
.tab1 p span {
|
1282 |
-
font-family: helveticabold;
|
1283 |
-
}
|
1284 |
-
|
1285 |
-
.wapper .ui-accordion-header-active {
|
1286 |
-
margin-top: 20px !important;
|
1287 |
-
}
|
1288 |
-
|
1289 |
-
.wapper .tab2 {
|
1290 |
-
padding: 20px 33px 12px 34px !important;
|
1291 |
-
}
|
1292 |
-
|
1293 |
-
.wapper .tab2 p {
|
1294 |
-
margin-bottom: 6px;
|
1295 |
-
}
|
1296 |
-
|
1297 |
-
.tab2 .twt_tab_2 label {
|
1298 |
-
width: 175px;
|
1299 |
-
}
|
1300 |
-
|
1301 |
-
.tab2 .twt_fld {
|
1302 |
-
margin: 16px 0 23px;
|
1303 |
-
float: left;
|
1304 |
-
}
|
1305 |
-
|
1306 |
-
.tab2 .twt_fld_2 {
|
1307 |
-
margin: 0 0 12px;
|
1308 |
-
float: left;
|
1309 |
-
}
|
1310 |
-
|
1311 |
-
.tab2 .utube_inn {
|
1312 |
-
padding-bottom: 2px;
|
1313 |
-
float: left;
|
1314 |
-
}
|
1315 |
-
|
1316 |
-
.tab2 .utube_inn label {
|
1317 |
-
max-width: 90%
|
1318 |
-
}
|
1319 |
-
|
1320 |
-
.tab2 .utube_inn label span {
|
1321 |
-
font-family: helveticabold;
|
1322 |
-
}
|
1323 |
-
|
1324 |
-
.tab2 .inr_cont p>a {
|
1325 |
-
font-family: helveticaneue-light;
|
1326 |
-
color: #778088;
|
1327 |
-
text-decoration: underline;
|
1328 |
-
}
|
1329 |
-
|
1330 |
-
.pinterest_section .inr_cont .pint_url {
|
1331 |
-
float: left;
|
1332 |
-
padding-top: 6px;
|
1333 |
-
clear: both;
|
1334 |
-
}
|
1335 |
-
|
1336 |
-
.pinterest_section .inr_cont .add {
|
1337 |
-
width: 417px !important;
|
1338 |
-
}
|
1339 |
-
|
1340 |
-
.linkedin_section .link_1,
|
1341 |
-
.linkedin_section .link_2,
|
1342 |
-
.linkedin_section .link_3,
|
1343 |
-
.linkedin_section .link_4 {
|
1344 |
-
float: left;
|
1345 |
-
width: 100%
|
1346 |
-
}
|
1347 |
-
|
1348 |
-
.linkedin_section .link_1 input.add,
|
1349 |
-
.linkedin_section .link_2 input.add,
|
1350 |
-
.linkedin_section .link_3 input.add,
|
1351 |
-
.linkedin_section .link_4 input.add {
|
1352 |
-
width: 417px;
|
1353 |
-
}
|
1354 |
-
|
1355 |
-
.linkedin_section .link_1 {
|
1356 |
-
margin-bottom: 7px;
|
1357 |
-
}
|
1358 |
-
|
1359 |
-
.linkedin_section .link_2 {
|
1360 |
-
margin-bottom: 12px;
|
1361 |
-
}
|
1362 |
-
|
1363 |
-
.linkedin_section .link_3,
|
1364 |
-
.linkedin_section .link_4 {
|
1365 |
-
margin-bottom: 13px;
|
1366 |
-
}
|
1367 |
-
|
1368 |
-
.tab2 .linkedin_section .link_4 {
|
1369 |
-
margin-bottom: 0;
|
1370 |
-
}
|
1371 |
-
|
1372 |
-
ul.tab_3_list li span {
|
1373 |
-
font-family: helveticaregular;
|
1374 |
-
}
|
1375 |
-
|
1376 |
-
#accordion .tab4 h4,
|
1377 |
-
#accordion1 .tab4 h4 {
|
1378 |
-
color: #414951;
|
1379 |
-
font-size: 20px;
|
1380 |
-
}
|
1381 |
-
|
1382 |
-
.specify_counts .listing li .input {
|
1383 |
-
width: 73px;
|
1384 |
-
}
|
1385 |
-
|
1386 |
-
.sfsi_fbpgidwpr {
|
1387 |
-
width: 160px;
|
1388 |
-
float: left;
|
1389 |
-
font-weight: bold;
|
1390 |
-
font-size: 17px;
|
1391 |
-
color: #000000;
|
1392 |
-
}
|
1393 |
-
|
1394 |
-
.sfsi_fbpgiddesc {
|
1395 |
-
font-weight: normal;
|
1396 |
-
width: 42%;
|
1397 |
-
font-size: 14px;
|
1398 |
-
color: #888888;
|
1399 |
-
padding: 4px 0 0 60px;
|
1400 |
-
}
|
1401 |
-
|
1402 |
-
.specify_counts .listing li .input.mypginpt {
|
1403 |
-
width: 288px;
|
1404 |
-
}
|
1405 |
-
|
1406 |
-
.tab3 .Shuffle_auto .sub_sub_box .tab_3_option {
|
1407 |
-
padding-top: 0 !important;
|
1408 |
-
margin-bottom: 10px !important;
|
1409 |
-
}
|
1410 |
-
|
1411 |
-
.tab4 {
|
1412 |
-
padding-top: 35px !important;
|
1413 |
-
}
|
1414 |
-
|
1415 |
-
.tab4 .save_button {
|
1416 |
-
padding-top: 46px;
|
1417 |
-
}
|
1418 |
-
|
1419 |
-
.tab5 {
|
1420 |
-
padding-top: 31px !important;
|
1421 |
-
}
|
1422 |
-
|
1423 |
-
.tab7 {
|
1424 |
-
padding-top: 28px !important;
|
1425 |
-
}
|
1426 |
-
|
1427 |
-
.tab5 .row_onl {
|
1428 |
-
margin-top: 15px;
|
1429 |
-
}
|
1430 |
-
|
1431 |
-
.tab5 .sticking .link>a {
|
1432 |
-
color: #a4a9ad;
|
1433 |
-
text-decoration: underline;
|
1434 |
-
}
|
1435 |
-
|
1436 |
-
.tab5 .mouse_txt h4 {
|
1437 |
-
/*margin-bottom: 8px!important;*/
|
1438 |
-
padding-bottom: 30px !important;
|
1439 |
-
}
|
1440 |
-
|
1441 |
-
.tab5 .save_button {
|
1442 |
-
padding-top: 54px;
|
1443 |
-
}
|
1444 |
-
|
1445 |
-
.tab7 .like_pop_box h2 {
|
1446 |
-
font-family: helveticabold;
|
1447 |
-
text-align: center;
|
1448 |
-
color: #414951;
|
1449 |
-
font-size: 26px;
|
1450 |
-
}
|
1451 |
-
|
1452 |
-
.tab1 ul.icn_listing li .right_info label:hover {
|
1453 |
-
text-decoration: none !important;
|
1454 |
-
}
|
1455 |
-
|
1456 |
-
.tab1 ul.icn_listing li .right_info label.expanded-area {
|
1457 |
-
clear: both;
|
1458 |
-
float: left;
|
1459 |
-
margin-top: 14px;
|
1460 |
-
width: 100%;
|
1461 |
-
}
|
1462 |
-
|
1463 |
-
.tab7 .space {
|
1464 |
-
margin-top: 14px;
|
1465 |
-
}
|
1466 |
-
|
1467 |
-
.tab7 .pop_up_show label {
|
1468 |
-
font-family: helveticaregular !important;
|
1469 |
-
}
|
1470 |
-
|
1471 |
-
.tab7 .save_button {
|
1472 |
-
padding-top: 78px;
|
1473 |
-
}
|
1474 |
-
|
1475 |
-
.like_txt a {
|
1476 |
-
text-decoration: none;
|
1477 |
-
font-family: helveticaregular;
|
1478 |
-
}
|
1479 |
-
|
1480 |
-
.bdr_btm_non {
|
1481 |
-
border-bottom: none !important;
|
1482 |
-
}
|
1483 |
-
|
1484 |
-
.tab1 .tab_1_sav {
|
1485 |
-
padding-top: 13px;
|
1486 |
-
}
|
1487 |
-
|
1488 |
-
#accordion .tab2 .facebook_section .inr_cont p.extra_sp,
|
1489 |
-
#accordion1 .tab2 .facebook_section .inr_cont p.extra_sp {
|
1490 |
-
padding-top: 7px;
|
1491 |
-
}
|
1492 |
-
|
1493 |
-
.tab2 .custom_section {
|
1494 |
-
width: 100%
|
1495 |
-
}
|
1496 |
-
|
1497 |
-
.tab7 {
|
1498 |
-
padding-bottom: 40px !important;
|
1499 |
-
}
|
1500 |
-
|
1501 |
-
.tab9 .save_button {
|
1502 |
-
padding-top: 40px;
|
1503 |
-
}
|
1504 |
-
|
1505 |
-
.tab9 .save_button a {
|
1506 |
-
padding: 16px 0;
|
1507 |
-
}
|
1508 |
-
|
1509 |
-
.tab2 .twitter_section .twt_fld input.add,
|
1510 |
-
.tab2 .twitter_section .twt_fld_2 textarea.add_txt {
|
1511 |
-
width: 464px !important;
|
1512 |
-
}
|
1513 |
-
|
1514 |
-
.tab2 .utube_inn .fb_url label span {
|
1515 |
-
font-family: helveticaneue-light;
|
1516 |
-
}
|
1517 |
-
|
1518 |
-
.tab1 label,
|
1519 |
-
.tab2 label,
|
1520 |
-
.tab3 label,
|
1521 |
-
.tab4 label,
|
1522 |
-
.tab5 label,
|
1523 |
-
.tab6 label,
|
1524 |
-
.tab7 label,
|
1525 |
-
.tab8 label {
|
1526 |
-
cursor: default !important;
|
1527 |
-
}
|
1528 |
-
|
1529 |
-
.tab5 .new_wind h4 {
|
1530 |
-
margin-bottom: 11px !important;
|
1531 |
-
}
|
1532 |
-
|
1533 |
-
.pop_up_box .fb_2 span {
|
1534 |
-
height: 28px !important;
|
1535 |
-
}
|
1536 |
-
|
1537 |
-
.pop_up_box .sfsi_tool_tip_2 .fbb .fb_1 a {
|
1538 |
-
margin-top: 0;
|
1539 |
-
}
|
1540 |
-
|
1541 |
-
.tab6 .social_icon_like1 ul li span {
|
1542 |
-
margin-top: -1px;
|
1543 |
-
}
|
1544 |
-
|
1545 |
-
#sfpageLoad {
|
1546 |
-
background: url(../images/ajax-loader.gif) 50% 50% no-repeat #F9F9F9;
|
1547 |
-
height: 100%;
|
1548 |
-
left: 160px;
|
1549 |
-
opacity: 1;
|
1550 |
-
position: fixed;
|
1551 |
-
top: 0;
|
1552 |
-
width: 92%;
|
1553 |
-
z-index: 9999;
|
1554 |
-
}
|
1555 |
-
|
1556 |
-
.sfsi_tool_tip_2,
|
1557 |
-
.tool_tip {
|
1558 |
-
background: #FFF;
|
1559 |
-
border: 1px solid #e7e7e7;
|
1560 |
-
box-shadow: #e7e7e7 0 0 2px 1px;
|
1561 |
-
display: block;
|
1562 |
-
float: left;
|
1563 |
-
margin: 0 0 0 -52px;
|
1564 |
-
padding: 5px 14px 5px 14px;
|
1565 |
-
position: absolute;
|
1566 |
-
z-index: 10000;
|
1567 |
-
border-bottom: #e5e5e5 solid 4px;
|
1568 |
-
width: 100px;
|
1569 |
-
}
|
1570 |
-
|
1571 |
-
.sfsi_tool_tip_2 {
|
1572 |
-
display: inline-table;
|
1573 |
-
}
|
1574 |
-
|
1575 |
-
.inerCnt,
|
1576 |
-
.inerCnt:hover,
|
1577 |
-
.inerCnt>a,
|
1578 |
-
.inerCnt>a:hover,
|
1579 |
-
.widget-area .widget a {
|
1580 |
-
outline: 0;
|
1581 |
-
}
|
1582 |
-
|
1583 |
-
.sfsi_tool_tip_2_inr {
|
1584 |
-
bottom: 90%;
|
1585 |
-
left: 20%;
|
1586 |
-
opacity: 0;
|
1587 |
-
}
|
1588 |
-
|
1589 |
-
.sfsi_tool_tip_2 .bot_arow {
|
1590 |
-
background: url(../images/bot_tip_icn.png) no-repeat;
|
1591 |
-
position: absolute;
|
1592 |
-
bottom: -21px;
|
1593 |
-
left: 50%;
|
1594 |
-
width: 15px;
|
1595 |
-
height: 21px;
|
1596 |
-
margin-left: -5px;
|
1597 |
-
}
|
1598 |
-
|
1599 |
-
.sfsi_tool_tip_2 .top_big_arow {
|
1600 |
-
position: absolute;
|
1601 |
-
-webkit-transform: rotate(180deg);
|
1602 |
-
-moz-transform: rotate(180deg);
|
1603 |
-
-ms-transform: rotate(180deg);
|
1604 |
-
-o-transform: rotate(180deg);
|
1605 |
-
transform: rotate(180deg);
|
1606 |
-
top: -21px;
|
1607 |
-
left: 50%;
|
1608 |
-
width: 15px;
|
1609 |
-
height: 21px;
|
1610 |
-
margin-right: -5px;
|
1611 |
-
}
|
1612 |
-
|
1613 |
-
.sfsi_tool_tip_2_inr .gpls_visit>a,
|
1614 |
-
.sfsi_tool_tip_2_inr .prints_visit_1 a,
|
1615 |
-
.sfsi_tool_tip_2_inr .utub_visit>a {
|
1616 |
-
margin-top: 0;
|
1617 |
-
}
|
1618 |
-
|
1619 |
-
.sfsi_tool_tip_2_inr .linkin_1 a,
|
1620 |
-
.sfsi_tool_tip_2_inr .linkin_2 a,
|
1621 |
-
.sfsi_tool_tip_2_inr .linkin_3 a,
|
1622 |
-
.sfsi_tool_tip_2_inr .linkin_4 a,
|
1623 |
-
.sfsi_tool_tip_2_inr .prints_visit a {
|
1624 |
-
margin: 0;
|
1625 |
-
}
|
1626 |
-
|
1627 |
-
.sfsiTlleftBig {
|
1628 |
-
bottom: 121%;
|
1629 |
-
left: 22%;
|
1630 |
-
margin-left: -54%
|
1631 |
-
}
|
1632 |
-
|
1633 |
-
.sfsiTlleft {
|
1634 |
-
bottom: 100%;
|
1635 |
-
left: 50%;
|
1636 |
-
margin-left: -66px;
|
1637 |
-
margin-bottom: 2px;
|
1638 |
-
}
|
1639 |
-
|
1640 |
-
.sfsi_plc_btm {
|
1641 |
-
bottom: auto;
|
1642 |
-
top: 100%;
|
1643 |
-
left: 50%;
|
1644 |
-
margin-left: -63px;
|
1645 |
-
margin-top: -6px;
|
1646 |
-
margin-bottom: auto;
|
1647 |
-
}
|
1648 |
-
|
1649 |
-
.inerCnt {
|
1650 |
-
position: relative;
|
1651 |
-
z-index: inherit !important;
|
1652 |
-
float: left;
|
1653 |
-
width: 100%;
|
1654 |
-
float: left;
|
1655 |
-
}
|
1656 |
-
|
1657 |
-
.sfsi_wicons {
|
1658 |
-
margin-bottom: 30px;
|
1659 |
-
position: relative;
|
1660 |
-
padding-top: 5px;
|
1661 |
-
}
|
1662 |
-
|
1663 |
-
.norm_row .bot_no {
|
1664 |
-
position: absolute;
|
1665 |
-
padding: 1px 0;
|
1666 |
-
font-size: 12px !important;
|
1667 |
-
text-align: center;
|
1668 |
-
line-height: 12px !important;
|
1669 |
-
background: #fff;
|
1670 |
-
border-radius: 5px;
|
1671 |
-
left: 50%;
|
1672 |
-
margin-left: -20px;
|
1673 |
-
z-index: 9;
|
1674 |
-
border: 1px solid #333;
|
1675 |
-
top: 100%;
|
1676 |
-
white-space: pre;
|
1677 |
-
-webkit-box-sizing: border-box;
|
1678 |
-
-moz-box-sizing: border-box;
|
1679 |
-
box-sizing: border-box;
|
1680 |
-
margin-top: 0px;
|
1681 |
-
width: 40px;
|
1682 |
-
}
|
1683 |
-
|
1684 |
-
.norm_row .bot_no:before {
|
1685 |
-
content: url(images/count_top_arow.png);
|
1686 |
-
position: absolute;
|
1687 |
-
height: 9px;
|
1688 |
-
margin-left: -7.5px;
|
1689 |
-
top: -10px;
|
1690 |
-
left: 50%;
|
1691 |
-
width: 15px;
|
1692 |
-
}
|
1693 |
-
|
1694 |
-
.bot_no.sfsiSmBtn {
|
1695 |
-
font-size: 10px;
|
1696 |
-
margin-top: 4px;
|
1697 |
-
}
|
1698 |
-
|
1699 |
-
.bot_no.sfsiSmBtn:before {
|
1700 |
-
margin-left: -8px;
|
1701 |
-
top: -9px;
|
1702 |
-
}
|
1703 |
-
|
1704 |
-
.norm_row .cbtn_vsmall {
|
1705 |
-
font-size: 9px;
|
1706 |
-
left: -28%;
|
1707 |
-
top: 4px;
|
1708 |
-
}
|
1709 |
-
|
1710 |
-
.norm_row .cbtn_vsmall:before {
|
1711 |
-
left: 31%;
|
1712 |
-
top: -9px;
|
1713 |
-
margin-left: -31%
|
1714 |
-
}
|
1715 |
-
|
1716 |
-
h2.optional {
|
1717 |
-
font-family: helveticaregular;
|
1718 |
-
font-size: 25px;
|
1719 |
-
margin: 14px 0 19px;
|
1720 |
-
color: #5a6570;
|
1721 |
-
}
|
1722 |
-
|
1723 |
-
.utube_tool_bdr .utub_visit {
|
1724 |
-
margin: 9px 0 0;
|
1725 |
-
height: 24px;
|
1726 |
-
display: inline-block;
|
1727 |
-
float: none;
|
1728 |
-
}
|
1729 |
-
|
1730 |
-
.utube_tool_bdr .utub_2 {
|
1731 |
-
margin: 9px 0 0;
|
1732 |
-
height: 24px;
|
1733 |
-
width: 86px;
|
1734 |
-
display: inline-block;
|
1735 |
-
float: none;
|
1736 |
-
}
|
1737 |
-
|
1738 |
-
.printst_tool_bdr {
|
1739 |
-
width: 79px;
|
1740 |
-
}
|
1741 |
-
|
1742 |
-
.printst_tool_bdr .prints_visit {
|
1743 |
-
margin: 0 0 10px -22px;
|
1744 |
-
}
|
1745 |
-
|
1746 |
-
.printst_tool_bdr .prints_visit_1 {
|
1747 |
-
margin: 0 0 0 -53px;
|
1748 |
-
}
|
1749 |
-
|
1750 |
-
.fb_tool_bdr {
|
1751 |
-
width: 68px;
|
1752 |
-
height: auto;
|
1753 |
-
}
|
1754 |
-
|
1755 |
-
.fb_tool_bdr .sfsi_inside {
|
1756 |
-
text-align: center;
|
1757 |
-
width: 100%;
|
1758 |
-
float: left;
|
1759 |
-
overflow: hidden;
|
1760 |
-
}
|
1761 |
-
|
1762 |
-
.fb_tool_bdr .sfsi_inside .icon1 {
|
1763 |
-
/* margin: 0 0 -5px 0;*/
|
1764 |
-
margin: 2px 0px 4px 0;
|
1765 |
-
height: auto;
|
1766 |
-
display: inline-block;
|
1767 |
-
float: none;
|
1768 |
-
width: 62px;
|
1769 |
-
}
|
1770 |
-
|
1771 |
-
.fb_tool_bdr .sfsi_inside .icon2 {
|
1772 |
-
margin: 2px 0 3px 0 !important;
|
1773 |
-
height: auto;
|
1774 |
-
width: 53px;
|
1775 |
-
display: inline-block;
|
1776 |
-
overflow: hidden;
|
1777 |
-
}
|
1778 |
-
|
1779 |
-
.fb_tool_bdr .sfsi_inside .icon3 {
|
1780 |
-
margin: 2px 0 2px 0;
|
1781 |
-
height: auto;
|
1782 |
-
width: 62px;
|
1783 |
-
display: inline-block;
|
1784 |
-
float: none;
|
1785 |
-
}
|
1786 |
-
|
1787 |
-
.fb_tool_bdr .sfsi_inside .fb_1,
|
1788 |
-
.fb_tool_bdr .sfsi_inside .fb_2,
|
1789 |
-
.fb_tool_bdr .sfsi_inside .fb_3 {
|
1790 |
-
margin: 9px 0 0;
|
1791 |
-
height: 25px;
|
1792 |
-
}
|
1793 |
-
|
1794 |
-
.printst_tool_bdr .sfsi_inside {
|
1795 |
-
text-align: center;
|
1796 |
-
float: left;
|
1797 |
-
width: 100%
|
1798 |
-
}
|
1799 |
-
|
1800 |
-
.printst_tool_bdr .sfsi_inside .icon1 {
|
1801 |
-
/* margin: 2px 0;*/
|
1802 |
-
margin: 3px 0 3px 0;
|
1803 |
-
/* height: 24px;*/
|
1804 |
-
height: auto;
|
1805 |
-
display: inline-block;
|
1806 |
-
float: none;
|
1807 |
-
width: 73px;
|
1808 |
-
}
|
1809 |
-
|
1810 |
-
.printst_tool_bdr .sfsi_inside .icon2 {
|
1811 |
-
/* margin: 2px 0;*/
|
1812 |
-
margin: 2px 0 2px 0;
|
1813 |
-
height: auto;
|
1814 |
-
display: inline-block;
|
1815 |
-
float: none;
|
1816 |
-
max-width: 73px;
|
1817 |
-
width: auto;
|
1818 |
-
}
|
1819 |
-
|
1820 |
-
.printst_tool_bdr .sfsi_inside .prints_visit,
|
1821 |
-
.printst_tool_bdr .sfsi_inside .prints_visit_1 {
|
1822 |
-
margin: 9px 0 0;
|
1823 |
-
height: 20px;
|
1824 |
-
float: none;
|
1825 |
-
display: inline-block;
|
1826 |
-
}
|
1827 |
-
|
1828 |
-
.printst_tool_bdr {
|
1829 |
-
margin-left: -59px;
|
1830 |
-
}
|
1831 |
-
|
1832 |
-
.fb_tool_bdr .sfsi_inside .icon1>a>img,
|
1833 |
-
.gpls_tool_bdr .sfsi_inside .icon1>a>img,
|
1834 |
-
.linkedin_tool_bdr .sfsi_inside .icon1>a>img,
|
1835 |
-
.linkedin_tool_bdr .sfsi_inside .icon4>a>img,
|
1836 |
-
.printst_tool_bdr .sfsi_inside .icon1>a>img,
|
1837 |
-
.printst_tool_bdr .sfsi_inside .icon2>a>img,
|
1838 |
-
.utube_tool_bdr .sfsi_inside .icon1>a>img {
|
1839 |
-
padding-top: 0;
|
1840 |
-
}
|
1841 |
-
|
1842 |
-
.gpls_tool_bdr {
|
1843 |
-
width: 76px;
|
1844 |
-
}
|
1845 |
-
|
1846 |
-
.gpls_tool_bdr .sfsi_inside .icon1>a>img {
|
1847 |
-
padding-top: 0;
|
1848 |
-
}
|
1849 |
-
|
1850 |
-
.gpls_tool_bdr .sfsi_inside {
|
1851 |
-
text-align: center;
|
1852 |
-
width: 100%;
|
1853 |
-
float: left;
|
1854 |
-
}
|
1855 |
-
|
1856 |
-
.gpls_tool_bdr .sfsi_inside .icon1 {
|
1857 |
-
margin: 2px 0;
|
1858 |
-
display: inline-block;
|
1859 |
-
float: none;
|
1860 |
-
height: 29px;
|
1861 |
-
width: 76px;
|
1862 |
-
}
|
1863 |
-
|
1864 |
-
.gpls_tool_bdr .sfsi_inside .icon2 {
|
1865 |
-
margin: 2px 0 3px 0;
|
1866 |
-
display: inline-block;
|
1867 |
-
float: none;
|
1868 |
-
height: 24px;
|
1869 |
-
width: 38px;
|
1870 |
-
}
|
1871 |
-
|
1872 |
-
.gpls_tool_bdr .sfsi_inside .icon3 {
|
1873 |
-
margin: 3px 0 2px 0;
|
1874 |
-
display: inline-block;
|
1875 |
-
float: none;
|
1876 |
-
height: 24px;
|
1877 |
-
width: 76px;
|
1878 |
-
}
|
1879 |
-
|
1880 |
-
.gpls_tool_bdr .sfsi_inside .gpls_visit,
|
1881 |
-
.gpls_tool_bdr .sfsi_inside .gtalk_2,
|
1882 |
-
.gpls_tool_bdr .sfsi_inside .gtalk_3 {
|
1883 |
-
margin: 9px 0 0;
|
1884 |
-
height: 29px;
|
1885 |
-
}
|
1886 |
-
|
1887 |
-
.pop_up_box_ex.sfsi_pop_up .fb_tool_bdr,
|
1888 |
-
.gpls_tool_bdr,
|
1889 |
-
.linkedin_tool_bdr,
|
1890 |
-
.twt_tool_bdr {
|
1891 |
-
bottom: 100%;
|
1892 |
-
left: 50%;
|
1893 |
-
margin-bottom: -12px;
|
1894 |
-
}
|
1895 |
-
|
1896 |
-
.fb_tool_bdr,
|
1897 |
-
.gpls_tool_bdr,
|
1898 |
-
.linkedin_tool_bdr,
|
1899 |
-
.twt_tool_bdr {
|
1900 |
-
bottom: 100%;
|
1901 |
-
left: 50%;
|
1902 |
-
margin-bottom: 8px;
|
1903 |
-
}
|
1904 |
-
|
1905 |
-
.printst_tool_bdr {
|
1906 |
-
bottom: 80%;
|
1907 |
-
left: 50%;
|
1908 |
-
/* margin-bottom: 2px;*/
|
1909 |
-
margin-bottom: 0px;
|
1910 |
-
margin-bottom: 18px;
|
1911 |
-
}
|
1912 |
-
|
1913 |
-
.printst_tool_bdr {
|
1914 |
-
bottom: 80%;
|
1915 |
-
left: 50%;
|
1916 |
-
margin-bottom: 18px;
|
1917 |
-
}
|
1918 |
-
|
1919 |
-
.twt_tool_bdr .sfsi_inside {
|
1920 |
-
text-align: center;
|
1921 |
-
width: 100%;
|
1922 |
-
float: left;
|
1923 |
-
}
|
1924 |
-
|
1925 |
-
.twt_tool_bdr .sfsi_inside .cstmicon1 {
|
1926 |
-
margin: 2px 0px 2px 0 !important;
|
1927 |
-
/*margin: 2px 0!important; display: inline-block;*/
|
1928 |
-
float: none;
|
1929 |
-
width: 62px;
|
1930 |
-
/* overflow: hidden;*/
|
1931 |
-
/*height: 20px;*/
|
1932 |
-
}
|
1933 |
-
|
1934 |
-
.twt_tool_bdr .sfsi_inside .cstmicon1 a img {
|
1935 |
-
float: left;
|
1936 |
-
}
|
1937 |
-
|
1938 |
-
.twt_tool_bdr .sfsi_inside .icon1 {
|
1939 |
-
/*margin: -4px 0 -5px 0 !important;*/
|
1940 |
-
margin: 5px 0px 3px 0 !important;
|
1941 |
-
display: inline-block;
|
1942 |
-
float: none;
|
1943 |
-
width: 61px;
|
1944 |
-
/* overflow: hidden;*/
|
1945 |
-
height: auto;
|
1946 |
-
}
|
1947 |
-
|
1948 |
-
.twt_tool_bdr .sfsi_inside .icon1 iframe {
|
1949 |
-
width: 61px !important;
|
1950 |
-
}
|
1951 |
-
|
1952 |
-
.twt_tool_bdr .sfsi_inside .icon2 {
|
1953 |
-
margin: 3px 0px 2px 0px !important;
|
1954 |
-
display: inline-block;
|
1955 |
-
float: none;
|
1956 |
-
height: auto;
|
1957 |
-
width: 58px;
|
1958 |
-
}
|
1959 |
-
|
1960 |
-
.twt_tool_bdr .sfsi_inside .twt_1 {
|
1961 |
-
margin: 9px 0 0;
|
1962 |
-
display: inline-block;
|
1963 |
-
float: none;
|
1964 |
-
width: 58px;
|
1965 |
-
height: 20px;
|
1966 |
-
overflow: hidden;
|
1967 |
-
}
|
1968 |
-
|
1969 |
-
.twt_tool_bdr .sfsi_inside .twt_1 iframe {
|
1970 |
-
width: 100% !important;
|
1971 |
-
}
|
1972 |
-
|
1973 |
-
.twt_tool_bdr .sfsi_inside .twt_2 {
|
1974 |
-
margin: 9px 0 0;
|
1975 |
-
height: 20px;
|
1976 |
-
display: inline-block;
|
1977 |
-
float: none;
|
1978 |
-
width: 58px;
|
1979 |
-
}
|
1980 |
-
|
1981 |
-
.utube_tool_bdr .sfsi_inside {
|
1982 |
-
text-align: center;
|
1983 |
-
width: 100%;
|
1984 |
-
float: left;
|
1985 |
-
}
|
1986 |
-
|
1987 |
-
.utube_tool_bdr .sfsi_inside .icon1 {
|
1988 |
-
/*margin: 5px 0 0;*/
|
1989 |
-
margin: 4px 0px 3px 0;
|
1990 |
-
height: 24px;
|
1991 |
-
display: inline-block;
|
1992 |
-
float: none;
|
1993 |
-
width: 96px;
|
1994 |
-
}
|
1995 |
-
|
1996 |
-
.utube_tool_bdr .sfsi_inside .icon2 {
|
1997 |
-
/* margin: 9px 0 0;*/
|
1998 |
-
margin: 2px 0 3px 0 !important;
|
1999 |
-
height: 24px;
|
2000 |
-
display: inline-block;
|
2001 |
-
float: none;
|
2002 |
-
max-width: 96px;
|
2003 |
-
width: 82px;
|
2004 |
-
}
|
2005 |
-
|
2006 |
-
.pop-overlay.read-overlay.ytex-s2 .utube_tool_bdr {
|
2007 |
-
width: 93px;
|
2008 |
-
bottom: 100%;
|
2009 |
-
left: 50%;
|
2010 |
-
margin-bottom: -12px;
|
2011 |
-
}
|
2012 |
-
|
2013 |
-
.utube_tool_bdr {
|
2014 |
-
width: 93px;
|
2015 |
-
bottom: 100%;
|
2016 |
-
left: 50%;
|
2017 |
-
margin-bottom: 8px;
|
2018 |
-
}
|
2019 |
-
|
2020 |
-
.linkedin_tool_bdr {
|
2021 |
-
width: 66px;
|
2022 |
-
}
|
2023 |
-
|
2024 |
-
.linkedin_tool_bdr .sfsi_inside {
|
2025 |
-
text-align: center;
|
2026 |
-
float: left;
|
2027 |
-
width: 100%
|
2028 |
-
}
|
2029 |
-
|
2030 |
-
.linkedin_tool_bdr .sfsi_inside .icon1 {
|
2031 |
-
margin: 2px 0 2px 0px;
|
2032 |
-
display: inline-block;
|
2033 |
-
float: none;
|
2034 |
-
/* height: 20px;*/
|
2035 |
-
width: 100%;
|
2036 |
-
}
|
2037 |
-
|
2038 |
-
.linkedin_tool_bdr .sfsi_inside .icon2 {
|
2039 |
-
margin: 2px 0 2px 0px;
|
2040 |
-
display: inline-block;
|
2041 |
-
float: none;
|
2042 |
-
/* height: 20px;*/
|
2043 |
-
width: 100%;
|
2044 |
-
}
|
2045 |
-
|
2046 |
-
.linkedin_tool_bdr .sfsi_inside .icon3 {
|
2047 |
-
margin: 2px 0 2px 0px;
|
2048 |
-
display: inline-block;
|
2049 |
-
float: none;
|
2050 |
-
/* height: 20px;*/
|
2051 |
-
width: 100%;
|
2052 |
-
}
|
2053 |
-
|
2054 |
-
.linkedin_tool_bdr .sfsi_inside .icon4 {
|
2055 |
-
margin: 2px 0 1px 0px;
|
2056 |
-
display: inline-block;
|
2057 |
-
float: none;
|
2058 |
-
/* height: 25px !important;*/
|
2059 |
-
width: 100%;
|
2060 |
-
}
|
2061 |
-
|
2062 |
-
.sfsi_FrntInner_chg .linkedin_tool_bdr .sfsi_inside .icon1 {
|
2063 |
-
margin: 7px 0;
|
2064 |
-
}
|
2065 |
-
|
2066 |
-
.sfsi_widget .linkedin_tool_bdr .sfsi_inside .icon4,
|
2067 |
-
.sfsi_widget .gpls_tool_bdr .sfsi_inside .icon1,
|
2068 |
-
.sfsi_widget .fb_tool_bdr .sfsi_inside .icon1 {
|
2069 |
-
height: auto
|
2070 |
-
}
|
2071 |
-
|
2072 |
-
.linkedin_tool_bdr .linkin_1,
|
2073 |
-
.linkedin_tool_bdr .linkin_2,
|
2074 |
-
.linkedin_tool_bdr .linkin_3,
|
2075 |
-
.linkedin_tool_bdr .linkin_4 {
|
2076 |
-
margin: 9px 0 0 !important;
|
2077 |
-
height: 20px;
|
2078 |
-
display: inline-block;
|
2079 |
-
float: none;
|
2080 |
-
overflow: hidden;
|
2081 |
-
}
|
2082 |
-
|
2083 |
-
.twt_tool_bdr {
|
2084 |
-
width: 62px;
|
2085 |
-
height: auto;
|
2086 |
-
}
|
2087 |
-
|
2088 |
-
.twt_tool_bdr .sfsi_inside .icon1>iframe {
|
2089 |
-
margin: 0 auto !important;
|
2090 |
-
float: none !important;
|
2091 |
-
width: 100%
|
2092 |
-
}
|
2093 |
-
|
2094 |
-
.twt_tool_bdr .sfsi_inside .icon1>iframe #widget {
|
2095 |
-
text-align: center;
|
2096 |
-
}
|
2097 |
-
|
2098 |
-
.sfsi_pop_up .button {
|
2099 |
-
border: none;
|
2100 |
-
padding: 0;
|
2101 |
-
}
|
2102 |
-
|
2103 |
-
.pop_up_box .button a {
|
2104 |
-
color: #fff;
|
2105 |
-
line-height: normal;
|
2106 |
-
font-size: 22px;
|
2107 |
-
text-decoration: none;
|
2108 |
-
text-align: center;
|
2109 |
-
width: 482px;
|
2110 |
-
height: 80px;
|
2111 |
-
margin: 0;
|
2112 |
-
display: table-cell;
|
2113 |
-
vertical-align: middle;
|
2114 |
-
font-family: helveticabold;
|
2115 |
-
}
|
2116 |
-
|
2117 |
-
.tab3 ul.tab_3_icns li .radio {
|
2118 |
-
margin-top: 7px;
|
2119 |
-
}
|
2120 |
-
|
2121 |
-
.tab3 ul.tab_3_icns li label {
|
2122 |
-
line-height: 50px !important;
|
2123 |
-
margin-left: 20px;
|
2124 |
-
}
|
2125 |
-
|
2126 |
-
.sfsi_mainContainer input[type=email],
|
2127 |
-
.sfsi_mainContainer input[type=number],
|
2128 |
-
.sfsi_mainContainer input[type=password],
|
2129 |
-
.sfsi_mainContainer input[type=search],
|
2130 |
-
.sfsi_mainContainer input[type=tel],
|
2131 |
-
.sfsi_mainContainer input[type=text],
|
2132 |
-
.sfsi_mainContainer input[type=url],
|
2133 |
-
.sfsi_mainContainer select,
|
2134 |
-
.sfsi_mainContainer textarea {
|
2135 |
-
color: #5a6570 !important;
|
2136 |
-
}
|
2137 |
-
|
2138 |
-
.adminTooltip {
|
2139 |
-
left: 142px;
|
2140 |
-
position: absolute;
|
2141 |
-
}
|
2142 |
-
|
2143 |
-
.adPopWidth {
|
2144 |
-
min-height: 100px !important;
|
2145 |
-
}
|
2146 |
-
|
2147 |
-
.main_contant p>a.lit_txt,
|
2148 |
-
.tab4 p>a {
|
2149 |
-
font-family: helveticaregular;
|
2150 |
-
color: #414951;
|
2151 |
-
}
|
2152 |
-
|
2153 |
-
.tab1 ul.icn_listing li .custom-txt {
|
2154 |
-
margin-left: 5px;
|
2155 |
-
}
|
2156 |
-
|
2157 |
-
.tab1 ul.icn_listing li .custom-img {
|
2158 |
-
margin-left: 18px;
|
2159 |
-
}
|
2160 |
-
|
2161 |
-
.linkedin_section .link_4>label.anthr_labl {
|
2162 |
-
height: 94px;
|
2163 |
-
}
|
2164 |
-
|
2165 |
-
.mediam_txt {
|
2166 |
-
font-family: helveticabold;
|
2167 |
-
}
|
2168 |
-
|
2169 |
-
.sfsiCtxt {
|
2170 |
-
line-height: 51px;
|
2171 |
-
font-family: helveticaregular;
|
2172 |
-
font-size: 22px;
|
2173 |
-
float: left;
|
2174 |
-
padding-left: 19px;
|
2175 |
-
color: #5a6570;
|
2176 |
-
}
|
2177 |
-
|
2178 |
-
.customstep2-img {
|
2179 |
-
width: 51px;
|
2180 |
-
float: left;
|
2181 |
-
}
|
2182 |
-
|
2183 |
-
.tab2 .row h2.custom {
|
2184 |
-
margin: 15px 0 7px 21px;
|
2185 |
-
height: 52px;
|
2186 |
-
line-height: 51px;
|
2187 |
-
font-family: helveticaregular;
|
2188 |
-
font-size: 22px;
|
2189 |
-
}
|
2190 |
-
|
2191 |
-
.custom-links p.cus_link label {
|
2192 |
-
margin-left: 0;
|
2193 |
-
}
|
2194 |
-
|
2195 |
-
.pop_up_box .sfsi_tool_tip_2 .fbb .fb_1 a>img:hover {
|
2196 |
-
opacity: .9;
|
2197 |
-
}
|
2198 |
-
|
2199 |
-
.tab2 .rss_url_row .sfrsTxt {
|
2200 |
-
font-size: 17px;
|
2201 |
-
line-height: 47px;
|
2202 |
-
margin: 0 0 0 4px;
|
2203 |
-
font-family: helveticaregular;
|
2204 |
-
}
|
2205 |
-
|
2206 |
-
.tab2 .rss_url_row .sfrsTxt>strong {
|
2207 |
-
font-family: helveticaregular;
|
2208 |
-
}
|
2209 |
-
|
2210 |
-
.tab2 .utube_inn p.extra_pp {
|
2211 |
-
float: left;
|
2212 |
-
width: 100%;
|
2213 |
-
margin: 0 0 0 48px;
|
2214 |
-
}
|
2215 |
-
|
2216 |
-
.tab2 .utube_inn p.extra_pp label {
|
2217 |
-
float: left;
|
2218 |
-
line-height: 41px;
|
2219 |
-
margin-right: 8px;
|
2220 |
-
}
|
2221 |
-
|
2222 |
-
.sfsi_inside .icon2 .fb_iframe_widget span {
|
2223 |
-
width: 500px !important;
|
2224 |
-
}
|
2225 |
-
|
2226 |
-
@media (max-width:767px) {
|
2227 |
-
.sfsi_inside .icon2 .fb_iframe_widget span {
|
2228 |
-
width: auto;
|
2229 |
-
}
|
2230 |
-
|
2231 |
-
.sfsi_outr_div {
|
2232 |
-
top: 10%
|
2233 |
-
}
|
2234 |
-
|
2235 |
-
.sfsi_outr_div h2 {
|
2236 |
-
font-size: 22px !important;
|
2237 |
-
line-height: 28px;
|
2238 |
-
}
|
2239 |
-
|
2240 |
-
.sfsi_wicons {
|
2241 |
-
padding-top: 0;
|
2242 |
-
}
|
2243 |
-
}
|
2244 |
-
|
2245 |
-
.specify_counts .listing li .high_prb {
|
2246 |
-
height: 41px;
|
2247 |
-
}
|
2248 |
-
|
2249 |
-
.sfsi_Sicons {
|
2250 |
-
position: relative;
|
2251 |
-
}
|
2252 |
-
|
2253 |
-
.sfsi_Sicons .sf_fb {
|
2254 |
-
position: relative;
|
2255 |
-
/*z-index: 1;*/
|
2256 |
-
width: 75px;
|
2257 |
-
}
|
2258 |
-
|
2259 |
-
.sfsi_Sicons .fb_iframe_widget {
|
2260 |
-
float: left;
|
2261 |
-
width: 73px;
|
2262 |
-
margin: 2px 0 0;
|
2263 |
-
}
|
2264 |
-
|
2265 |
-
.sfsi_Sicons .sf_fb .fb_iframe_widget>span {
|
2266 |
-
position: absolute;
|
2267 |
-
/*width: 450px!important; z-index: 1;*/
|
2268 |
-
}
|
2269 |
-
|
2270 |
-
.tab2 .utube_inn label {
|
2271 |
-
font-size: 17px;
|
2272 |
-
}
|
2273 |
-
|
2274 |
-
.sfsi_plc_btm {
|
2275 |
-
padding: 5px 14px 9px;
|
2276 |
-
}
|
2277 |
-
|
2278 |
-
.tab7 .field {
|
2279 |
-
margin-top: 7px;
|
2280 |
-
}
|
2281 |
-
|
2282 |
-
.sfsi_outr_div ul li .cmcls img {
|
2283 |
-
margin-top: 0 !important;
|
2284 |
-
}
|
2285 |
-
|
2286 |
-
.sfsi_outr_div ul li .inerCnt {
|
2287 |
-
float: left;
|
2288 |
-
}
|
2289 |
-
|
2290 |
-
.sfsi_outr_div ul li .inerCnt .bot_no {
|
2291 |
-
position: absolute;
|
2292 |
-
padding: 1px 0;
|
2293 |
-
font-size: 12px !important;
|
2294 |
-
line-height: 12px !important;
|
2295 |
-
text-align: center;
|
2296 |
-
background: #fff;
|
2297 |
-
border-radius: 5px;
|
2298 |
-
display: block;
|
2299 |
-
left: 50%;
|
2300 |
-
margin-left: -20px;
|
2301 |
-
border: 1px solid #333;
|
2302 |
-
white-space: pre;
|
2303 |
-
-webkit-box-sizing: border-box;
|
2304 |
-
-moz-box-sizing: border-box;
|
2305 |
-
box-sizing: border-box;
|
2306 |
-
margin-top: 6px;
|
2307 |
-
width: 40px;
|
2308 |
-
word-break: break-all;
|
2309 |
-
word-wrap: break-word;
|
2310 |
-
}
|
2311 |
-
|
2312 |
-
.sfsi_outr_div ul li .inerCnt .bot_no:before {
|
2313 |
-
content: url(images/count_top_arow.png);
|
2314 |
-
position: absolute;
|
2315 |
-
height: 9px;
|
2316 |
-
margin-left: -7.5px;
|
2317 |
-
top: -10px;
|
2318 |
-
left: 50%;
|
2319 |
-
width: 15px;
|
2320 |
-
}
|
2321 |
-
|
2322 |
-
.sfsi_outr_div {
|
2323 |
-
position: fixed;
|
2324 |
-
width: 100%;
|
2325 |
-
float: none;
|
2326 |
-
left: 50%;
|
2327 |
-
top: 20%;
|
2328 |
-
margin-left: -50%;
|
2329 |
-
opacity: 0;
|
2330 |
-
z-index: -1;
|
2331 |
-
display: block;
|
2332 |
-
text-align: center;
|
2333 |
-
}
|
2334 |
-
|
2335 |
-
.sfsi_outr_div .sfsi_FrntInner_chg {
|
2336 |
-
display: inline-block;
|
2337 |
-
padding: 15px 17px 27px 18px;
|
2338 |
-
background: #FFF;
|
2339 |
-
border: 1px solid #EDEDED;
|
2340 |
-
box-shadow: 0 0 5px #CCC;
|
2341 |
-
margin: 20px;
|
2342 |
-
position: relative;
|
2343 |
-
}
|
2344 |
-
|
2345 |
-
.sfsi_FrntInner_chg .sfsiclpupwpr {
|
2346 |
-
position: absolute;
|
2347 |
-
right: -10px;
|
2348 |
-
top: -10px;
|
2349 |
-
width: 25px;
|
2350 |
-
cursor: pointer;
|
2351 |
-
}
|
2352 |
-
|
2353 |
-
.sfsi_FrntInner_chg .sfsiclpupwpr img {
|
2354 |
-
width: auto;
|
2355 |
-
float: left;
|
2356 |
-
border: medium none;
|
2357 |
-
}
|
2358 |
-
|
2359 |
-
.tab7 .like_pop_box {
|
2360 |
-
width: 100%;
|
2361 |
-
margin: 35px auto auto;
|
2362 |
-
position: relative;
|
2363 |
-
text-align: center;
|
2364 |
-
}
|
2365 |
-
|
2366 |
-
.tab7 .like_pop_box .sfsi_Popinner {
|
2367 |
-
display: inline-block;
|
2368 |
-
padding: 18px 20px;
|
2369 |
-
box-shadow: 0 0 5px #ccc;
|
2370 |
-
-webkit-box-shadow: 0 0 5px #ccc;
|
2371 |
-
border: 1px solid #ededed;
|
2372 |
-
background: #FFF;
|
2373 |
-
}
|
2374 |
-
|
2375 |
-
.tab7 .like_pop_box .sfsi_Popinner h2 {
|
2376 |
-
margin: 0 0 23px;
|
2377 |
-
padding: 0;
|
2378 |
-
color: #414951;
|
2379 |
-
font-family: helveticabold;
|
2380 |
-
font-size: 26px;
|
2381 |
-
text-align: center;
|
2382 |
-
}
|
2383 |
-
|
2384 |
-
.tab7 .like_pop_box .sfsi_Popinner ul {
|
2385 |
-
margin: 0;
|
2386 |
-
padding: 0;
|
2387 |
-
list-style: none;
|
2388 |
-
text-align: center;
|
2389 |
-
}
|
2390 |
-
|
2391 |
-
.tab7 .like_pop_box .sfsi_Popinner ul li {
|
2392 |
-
margin: 0;
|
2393 |
-
padding: 0;
|
2394 |
-
list-style: none;
|
2395 |
-
display: inline-block;
|
2396 |
-
}
|
2397 |
-
|
2398 |
-
.tab7 .like_pop_box .sfsi_Popinner ul li span {
|
2399 |
-
margin: 0;
|
2400 |
-
width: 54px;
|
2401 |
-
display: block;
|
2402 |
-
background: url(../images/count_bg.png) no-repeat;
|
2403 |
-
height: 24px;
|
2404 |
-
overflow: hidden;
|
2405 |
-
padding: 10px 2px 2px;
|
2406 |
-
font-family: helveticaregular;
|
2407 |
-
font-size: 16px;
|
2408 |
-
text-align: center;
|
2409 |
-
line-height: 24px;
|
2410 |
-
color: #5a6570;
|
2411 |
-
}
|
2412 |
-
|
2413 |
-
.tab7 .like_pop_box .sfsi_Popinner ul li a {
|
2414 |
-
color: #5a6570;
|
2415 |
-
text-decoration: none;
|
2416 |
-
}
|
2417 |
-
|
2418 |
-
.sfsi_outr_div .sfsi_FrntInner_chg .sfsi_wicons {
|
2419 |
-
margin-bottom: 0;
|
2420 |
-
}
|
2421 |
-
|
2422 |
-
.sfsi_outr_div ul {
|
2423 |
-
list-style: none;
|
2424 |
-
margin: 0 0 24px;
|
2425 |
-
padding: 0;
|
2426 |
-
text-align: center;
|
2427 |
-
}
|
2428 |
-
|
2429 |
-
a.sfsiColbtn {
|
2430 |
-
color: #5a6570 !important;
|
2431 |
-
float: right;
|
2432 |
-
font-size: 14px;
|
2433 |
-
margin: -35px -30px 0 0;
|
2434 |
-
position: relative;
|
2435 |
-
right: 0;
|
2436 |
-
font-family: helveticaregular;
|
2437 |
-
width: 100px;
|
2438 |
-
text-decoration: none;
|
2439 |
-
}
|
2440 |
-
|
2441 |
-
.tab3 a.sfsiColbtn {
|
2442 |
-
margin-top: -43px;
|
2443 |
-
}
|
2444 |
-
|
2445 |
-
.sfsi_FrntInner_chg ul li:first-of-type .sfsi_wicons {
|
2446 |
-
margin-left: 0 !important;
|
2447 |
-
}
|
2448 |
-
|
2449 |
-
ul.tab_3_icns li .trans_bg {
|
2450 |
-
background: #000;
|
2451 |
-
padding-left: 3px;
|
2452 |
-
}
|
2453 |
-
|
2454 |
-
.tab2 .instagram_section {
|
2455 |
-
padding-bottom: 20px;
|
2456 |
-
}
|
2457 |
-
|
2458 |
-
h1.abt_titl {
|
2459 |
-
text-align: center;
|
2460 |
-
margin: 19% 0 0;
|
2461 |
-
}
|
2462 |
-
|
2463 |
-
.sfcm.sfsi_wicon {
|
2464 |
-
padding: 0;
|
2465 |
-
width: 100%;
|
2466 |
-
border: medium none;
|
2467 |
-
}
|
2468 |
-
|
2469 |
-
.fb_iframe_widget span {
|
2470 |
-
vertical-align: top !important;
|
2471 |
-
}
|
2472 |
-
|
2473 |
-
.sfsi_outr_div .sfsi_FrntInner_chg ul {
|
2474 |
-
margin: 0 0 0 3px;
|
2475 |
-
}
|
2476 |
-
|
2477 |
-
.sfsi_outr_div .sfsi_FrntInner_chg ul li {
|
2478 |
-
margin: 0 3px 0 0;
|
2479 |
-
}
|
2480 |
-
|
2481 |
-
.sfcm.sfsi_wicon {
|
2482 |
-
margin: -1px;
|
2483 |
-
padding: 0;
|
2484 |
-
}
|
2485 |
-
|
2486 |
-
@media (min-width:320px) and (max-width:480px) {
|
2487 |
-
|
2488 |
-
.sfsi_tool_tip_2,
|
2489 |
-
.tool_tip {
|
2490 |
-
padding: 5px 14px 0;
|
2491 |
-
}
|
2492 |
-
|
2493 |
-
.sfsi_inside:last-child {
|
2494 |
-
margin-bottom: 18px;
|
2495 |
-
clear: both;
|
2496 |
-
}
|
2497 |
-
|
2498 |
-
.sfsi_outr_div {
|
2499 |
-
top: 10%;
|
2500 |
-
}
|
2501 |
-
|
2502 |
-
.sfsi_FrntInner_chg .sfsi_wicons {
|
2503 |
-
width: 31px !important;
|
2504 |
-
height: 31px !important;
|
2505 |
-
}
|
2506 |
-
|
2507 |
-
.sfsi_FrntInner_chg .sfsi_wicons img {
|
2508 |
-
width: 100%;
|
2509 |
-
}
|
2510 |
-
|
2511 |
-
.sfsi_Sicons .sf_fb {
|
2512 |
-
margin-bottom: 24px;
|
2513 |
-
}
|
2514 |
-
|
2515 |
-
.sfsi_Sicons .sf_twiter {
|
2516 |
-
margin-bottom: 4px;
|
2517 |
-
}
|
2518 |
-
}
|
2519 |
-
|
2520 |
-
@media (max-width:320px) {
|
2521 |
-
|
2522 |
-
.sfsi_tool_tip_2,
|
2523 |
-
.tool_tip {
|
2524 |
-
padding: 5px 14px 0;
|
2525 |
-
}
|
2526 |
-
|
2527 |
-
.sfsi_inside:last-child {
|
2528 |
-
margin-bottom: 18px;
|
2529 |
-
clear: both;
|
2530 |
-
}
|
2531 |
-
|
2532 |
-
.sfsi_FrntInner_chg .sfsi_wicons {
|
2533 |
-
width: 31px !important;
|
2534 |
-
height: 31px !important;
|
2535 |
-
}
|
2536 |
-
|
2537 |
-
.sfsi_FrntInner_chg .sfsi_wicons img {
|
2538 |
-
width: 100%
|
2539 |
-
}
|
2540 |
-
}
|
2541 |
-
|
2542 |
-
ul.SFSI_lsngfrm {
|
2543 |
-
float: left;
|
2544 |
-
/* width: 61%;*/
|
2545 |
-
width: 51.33%;
|
2546 |
-
padding-left: 60px !important;
|
2547 |
-
}
|
2548 |
-
|
2549 |
-
ul.SFSI_instructions {
|
2550 |
-
float: left;
|
2551 |
-
width: 35%;
|
2552 |
-
}
|
2553 |
-
|
2554 |
-
li.youtube_options {
|
2555 |
-
padding-left: 60px !important;
|
2556 |
-
}
|
2557 |
-
|
2558 |
-
input[name="sfsi_pinterest_manualCounts"] {
|
2559 |
-
margin-left: -20px !important;
|
2560 |
-
}
|
2561 |
-
|
2562 |
-
ul.SFSI_instructions li {
|
2563 |
-
font-size: 12px !important;
|
2564 |
-
line-height: 25px !important;
|
2565 |
-
margin: 0 !important;
|
2566 |
-
padding: 0 0 0 15px !important;
|
2567 |
-
width: 100%
|
2568 |
-
}
|
2569 |
-
|
2570 |
-
/*{Monad}*/
|
2571 |
-
/*Upload Skins css*/
|
2572 |
-
.cstmskin_popup {
|
2573 |
-
width: 500px;
|
2574 |
-
background: #FFF;
|
2575 |
-
box-shadow: 0 0 5px 3px #d8d8d8;
|
2576 |
-
margin: 40px 0px auto;
|
2577 |
-
padding: 20px 25px 20px;
|
2578 |
-
font-family: helveticaregular;
|
2579 |
-
color: #5a6570;
|
2580 |
-
height: auto;
|
2581 |
-
float: left;
|
2582 |
-
position: relative;
|
2583 |
-
left: 35%;
|
2584 |
-
}
|
2585 |
-
|
2586 |
-
.cstomskins_wrpr {
|
2587 |
-
float: left;
|
2588 |
-
width: 100%;
|
2589 |
-
}
|
2590 |
-
|
2591 |
-
.custskinmsg {
|
2592 |
-
float: left;
|
2593 |
-
font-size: 15px;
|
2594 |
-
margin-top: 10px;
|
2595 |
-
width: 100%;
|
2596 |
-
}
|
2597 |
-
|
2598 |
-
.custskinmsg>ul {
|
2599 |
-
color: #000;
|
2600 |
-
float: left;
|
2601 |
-
margin-top: 8px;
|
2602 |
-
width: 100%;
|
2603 |
-
}
|
2604 |
-
|
2605 |
-
ul.cstmskin_iconlist {
|
2606 |
-
float: left;
|
2607 |
-
padding: 11px 0 40px 8px;
|
2608 |
-
width: 100%;
|
2609 |
-
max-width: 1000px;
|
2610 |
-
margin: 0;
|
2611 |
-
height: 307px;
|
2612 |
-
overflow-y: scroll;
|
2613 |
-
}
|
2614 |
-
|
2615 |
-
.placethemanulywpr {
|
2616 |
-
max-width: 98% !important
|
2617 |
-
}
|
2618 |
-
|
2619 |
-
.cstmskin_iconlist>li {
|
2620 |
-
float: left;
|
2621 |
-
margin: 3px 0;
|
2622 |
-
width: 100%;
|
2623 |
-
}
|
2624 |
-
|
2625 |
-
.cstm_icnname {
|
2626 |
-
float: left;
|
2627 |
-
width: 30%;
|
2628 |
-
}
|
2629 |
-
|
2630 |
-
.cstmskins_btn>img {
|
2631 |
-
float: left;
|
2632 |
-
margin-right: 25px;
|
2633 |
-
}
|
2634 |
-
|
2635 |
-
.cstmskin_btn {
|
2636 |
-
width: auto;
|
2637 |
-
float: left;
|
2638 |
-
padding: 3px 20px;
|
2639 |
-
color: #fff;
|
2640 |
-
background-color: #12a252;
|
2641 |
-
text-decoration: none;
|
2642 |
-
margin: 0 10px;
|
2643 |
-
}
|
2644 |
-
|
2645 |
-
.cstmskins_sbmt {
|
2646 |
-
width: 100%;
|
2647 |
-
float: left;
|
2648 |
-
text-align: center;
|
2649 |
-
margin-top: 15px;
|
2650 |
-
}
|
2651 |
-
|
2652 |
-
.done_btn {
|
2653 |
-
width: auto;
|
2654 |
-
padding: 3px 80px;
|
2655 |
-
color: #fff;
|
2656 |
-
background-color: #12a252;
|
2657 |
-
text-decoration: none;
|
2658 |
-
font-size: 18px;
|
2659 |
-
}
|
2660 |
-
|
2661 |
-
.cstmskin_btn:hover,
|
2662 |
-
.done_btn:hover,
|
2663 |
-
.cstmskin_btn:focus,
|
2664 |
-
.done_btn:focus {
|
2665 |
-
color: #fff;
|
2666 |
-
}
|
2667 |
-
|
2668 |
-
.skswrpr,
|
2669 |
-
.dlt_btn {
|
2670 |
-
display: none;
|
2671 |
-
}
|
2672 |
-
|
2673 |
-
.cstmutbewpr {
|
2674 |
-
width: 100%;
|
2675 |
-
float: left;
|
2676 |
-
margin-top: 10px;
|
2677 |
-
margin-left: 40px;
|
2678 |
-
}
|
2679 |
-
|
2680 |
-
.cstmutbewpr ul.enough_waffling li {
|
2681 |
-
width: auto;
|
2682 |
-
float: left;
|
2683 |
-
margin-right: 20px;
|
2684 |
-
}
|
2685 |
-
|
2686 |
-
.cstmutbewpr ul.enough_waffling li span {
|
2687 |
-
float: left;
|
2688 |
-
}
|
2689 |
-
|
2690 |
-
.cstmutbewpr ul.enough_waffling li label {
|
2691 |
-
width: auto;
|
2692 |
-
float: left;
|
2693 |
-
margin-top: 10px;
|
2694 |
-
margin-left: 10px;
|
2695 |
-
}
|
2696 |
-
|
2697 |
-
.cstmutbewpr .cstmutbtxtwpr {
|
2698 |
-
width: 100%;
|
2699 |
-
float: left;
|
2700 |
-
padding-top: 10px;
|
2701 |
-
}
|
2702 |
-
|
2703 |
-
.cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr {
|
2704 |
-
width: 100%;
|
2705 |
-
float: left;
|
2706 |
-
display: none;
|
2707 |
-
}
|
2708 |
-
|
2709 |
-
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr p,
|
2710 |
-
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr p {
|
2711 |
-
margin-left: 0px;
|
2712 |
-
}
|
2713 |
-
|
2714 |
-
.cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr {
|
2715 |
-
width: 100%;
|
2716 |
-
float: left;
|
2717 |
-
display: none;
|
2718 |
-
}
|
2719 |
-
|
2720 |
-
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr p label,
|
2721 |
-
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr p label {
|
2722 |
-
width: 120px;
|
2723 |
-
}
|
2724 |
-
|
2725 |
-
.sfsi_widget .sfsi_wDiv .sfsi_wicons .inerCnt a,
|
2726 |
-
.sfsi_widget .sfsi_wDiv .sfsi_wicons .inerCnt a.sficn {
|
2727 |
-
padding: 0px;
|
2728 |
-
margin: 0px;
|
2729 |
-
width: 100%;
|
2730 |
-
float: left;
|
2731 |
-
border: medium none;
|
2732 |
-
}
|
2733 |
-
|
2734 |
-
.sfsi_socialwpr {
|
2735 |
-
width: auto;
|
2736 |
-
display: inline-block;
|
2737 |
-
vertical-align: middle;
|
2738 |
-
}
|
2739 |
-
|
2740 |
-
.sfsi_socialwpr .sf_fb {
|
2741 |
-
float: left;
|
2742 |
-
}
|
2743 |
-
|
2744 |
-
.sfsipyplfrm {
|
2745 |
-
float: left;
|
2746 |
-
margin-top: 10px;
|
2747 |
-
width: 100%;
|
2748 |
-
}
|
2749 |
-
|
2750 |
-
.sfsipyplfrm input[type="submit"] {
|
2751 |
-
background: none repeat scroll 0 0 rgba(0, 0, 0, 0);
|
2752 |
-
border: medium none;
|
2753 |
-
color: #0074a2;
|
2754 |
-
cursor: pointer;
|
2755 |
-
font-weight: normal;
|
2756 |
-
margin: 0;
|
2757 |
-
padding: 5px 10px;
|
2758 |
-
text-decoration: underline;
|
2759 |
-
}
|
2760 |
-
|
2761 |
-
.sfsipyplfrm input[type="submit"]:hover {
|
2762 |
-
color: #2ea2cc
|
2763 |
-
}
|
2764 |
-
|
2765 |
-
.pop_up_box_ex {
|
2766 |
-
background: none repeat scroll 0 0 #fff;
|
2767 |
-
box-shadow: 0 0 5px 3px #d8d8d8;
|
2768 |
-
color: #5a6570;
|
2769 |
-
font-family: helveticaregular;
|
2770 |
-
margin: 200px auto;
|
2771 |
-
min-height: 150px;
|
2772 |
-
padding: 20px 25px 0px;
|
2773 |
-
position: relative;
|
2774 |
-
width: 290px;
|
2775 |
-
}
|
2776 |
-
|
2777 |
-
.pop_up_box_ex {
|
2778 |
-
color: #5a6570;
|
2779 |
-
font-family: helveticaregular;
|
2780 |
-
}
|
2781 |
-
|
2782 |
-
.cstmutbchnlidwpr .utbe_instruction,
|
2783 |
-
.cstmutbchnlnmewpr .utbe_instruction,
|
2784 |
-
.lnkdin_instruction {
|
2785 |
-
float: left;
|
2786 |
-
line-height: 22px;
|
2787 |
-
margin-top: 10px;
|
2788 |
-
width: 100%;
|
2789 |
-
}
|
2790 |
-
|
2791 |
-
.fb_iframe_widget iframe {
|
2792 |
-
max-width: none;
|
2793 |
-
}
|
2794 |
-
|
2795 |
-
.sfsi_mainContainer p.bldtxtmsg {
|
2796 |
-
float: left;
|
2797 |
-
font-size: 15px;
|
2798 |
-
font-weight: bold;
|
2799 |
-
margin-top: 12px;
|
2800 |
-
width: 100%;
|
2801 |
-
text-align: center;
|
2802 |
-
}
|
2803 |
-
|
2804 |
-
.sfsinewplgndesc {
|
2805 |
-
background: none repeat scroll 0 0 #e5e5e5;
|
2806 |
-
float: left;
|
2807 |
-
padding: 5px 10px 8px;
|
2808 |
-
margin-top: 25px;
|
2809 |
-
}
|
2810 |
-
|
2811 |
-
.sfsinewplgndesc>.clear>a {
|
2812 |
-
color: #5a6570;
|
2813 |
-
font-weight: bold;
|
2814 |
-
}
|
2815 |
-
|
2816 |
-
.sfsiicnsdvwrp {
|
2817 |
-
float: left;
|
2818 |
-
width: 110px;
|
2819 |
-
}
|
2820 |
-
|
2821 |
-
.sfsi_Sicons .sf_subscrbe .bot_no {
|
2822 |
-
background: rgba(0, 0, 0, 0) url(images/count_left_arow.png) no-repeat scroll 0 0 / 27px auto;
|
2823 |
-
font-size: 12px !important;
|
2824 |
-
left: 67px;
|
2825 |
-
line-height: 18px !important;
|
2826 |
-
margin-left: 0px;
|
2827 |
-
margin-top: 8px;
|
2828 |
-
padding: 1px 0;
|
2829 |
-
position: absolute;
|
2830 |
-
text-align: center;
|
2831 |
-
top: -8px;
|
2832 |
-
white-space: pre;
|
2833 |
-
width: 33px;
|
2834 |
-
height: 24px;
|
2835 |
-
z-index: 9;
|
2836 |
-
}
|
2837 |
-
|
2838 |
-
.sfsi_wicons a.sficn,
|
2839 |
-
.sfsi_wicons .sfsi_inside a,
|
2840 |
-
.sfsi_Sicons div a {
|
2841 |
-
box-shadow: none;
|
2842 |
-
border: none;
|
2843 |
-
}
|
2844 |
-
|
2845 |
-
.sfsi_Sicons .sf_pinit>span {
|
2846 |
-
height: 20px !important;
|
2847 |
-
}
|
2848 |
-
|
2849 |
-
.sfsi_Sicons .sf_pinit>span>span {
|
2850 |
-
width: 38px !important;
|
2851 |
-
right: -45px !important;
|
2852 |
-
}
|
2853 |
-
|
2854 |
-
.sfsi_wicons a {
|
2855 |
-
box-shadow: none !important;
|
2856 |
-
}
|
2857 |
-
|
2858 |
-
a.sficn {
|
2859 |
-
cursor: pointer;
|
2860 |
-
}
|
2861 |
-
|
2862 |
-
.sfsi_Sicons .fb_iframe_widget>span {
|
2863 |
-
vertical-align: top !important;
|
2864 |
-
}
|
2865 |
-
|
2866 |
-
.sfsi_Sicons .sf_fb {
|
2867 |
-
margin: 0 0 0 5px !important;
|
2868 |
-
}
|
2869 |
-
|
2870 |
-
.disabled_checkbox .sfsi_right_info:before {
|
2871 |
-
position: absolute;
|
2872 |
-
content: "";
|
2873 |
-
width: 500px;
|
2874 |
-
height: 60px;
|
2875 |
-
display: inline-block;
|
2876 |
-
z-index: 99;
|
2877 |
-
margin-left: -66px;
|
2878 |
-
margin-top: -14px;
|
2879 |
-
background: rgba(255, 255, 255, .8);
|
2880 |
-
}
|
2881 |
-
|
2882 |
-
#sfsi_floater .fb_tool_bdr .sfsi_inside .icon2 {
|
2883 |
-
/*margin: -2px 0 -5px 0;*/
|
2884 |
-
}
|
2885 |
-
|
2886 |
-
.sfsi_wechat_follow_overlay {
|
2887 |
-
position: fixed;
|
2888 |
-
top: 0;
|
2889 |
-
width: 100%;
|
2890 |
-
z-index: 99999;
|
2891 |
-
background: rgba(0, 0, 0, 0.7);
|
2892 |
-
}
|
2893 |
-
|
2894 |
-
.sfsi_wechat_follow_overlay .close_btn {
|
2895 |
-
position: absolute;
|
2896 |
-
right: 60px;
|
2897 |
-
top: 60px;
|
2898 |
-
font-size: 40px;
|
2899 |
-
line-height: 40px;
|
2900 |
-
text-decoration: none;
|
2901 |
-
border: 1px solid #fff;
|
2902 |
-
padding: 0 10px;
|
2903 |
-
border-radius: 60px;
|
2904 |
-
color: #333;
|
2905 |
-
background-color: #ffff;
|
2906 |
-
text-decoration: none;
|
2907 |
-
}
|
2908 |
-
|
2909 |
-
@media (max-width:786px) {
|
2910 |
-
.sfsi_upload_butt_container {
|
2911 |
-
display: inline-block;
|
2912 |
-
}
|
2913 |
-
|
2914 |
-
.upload_butt {
|
2915 |
-
height: 38px;
|
2916 |
-
}
|
2917 |
-
|
2918 |
-
.sfsi_wechat_follow_overlay .sfsi_inner_display>div div.sfsi_upload_butt_container:first-child {
|
2919 |
-
margin-left: 0;
|
2920 |
-
margin-right: 20px;
|
2921 |
-
}
|
2922 |
-
}
|
2923 |
-
|
2924 |
-
/*added by Developer */
|
2925 |
-
#accordion1 p:nth-child(2) {
|
2926 |
-
padding-top: 0px !important;
|
2927 |
-
}
|
2928 |
-
|
2929 |
-
input[name="sfsi_instagram_manualCounts"] {
|
2930 |
-
margin-left: -15px !important;
|
2931 |
-
}
|
2932 |
-
|
2933 |
-
.sfsi_prem_cmn_rowlisting {
|
2934 |
-
width: 33.33%;
|
2935 |
-
}
|
2936 |
-
|
2937 |
-
.rss_url_row h4 {
|
2938 |
-
line-height: 43px !important;
|
2939 |
-
font-size: 17px !important;
|
2940 |
-
font-family: 'helveticaneue-light' !important;
|
2941 |
-
}
|
2942 |
-
|
2943 |
-
.cstmutbchnlnmewpr p.extra_pp label {
|
2944 |
-
width: auto !important;
|
2945 |
-
}
|
2946 |
-
|
2947 |
-
.cstmutbchnlidwpr p.extra_pp label {
|
2948 |
-
width: auto !important;
|
2949 |
-
}
|
2950 |
-
|
2951 |
-
.tab_3_option {
|
2952 |
-
margin: 10px 0 0;
|
2953 |
-
}
|
2954 |
-
|
2955 |
-
div.tab3 .sub_row.stand.sec_new {
|
2956 |
-
margin: 0;
|
2957 |
-
}
|
2958 |
-
|
2959 |
-
div#custom_social_data_setting h4 {
|
2960 |
-
padding-bottom: 30px;
|
2961 |
-
}
|
2962 |
-
|
2963 |
-
.like_pop_box img.sfcm {
|
2964 |
-
height: 50px;
|
2965 |
-
width: 50px;
|
2966 |
-
}
|
2967 |
-
|
2968 |
-
.linkedin_tool_bdr {
|
2969 |
-
line-height: 0 !important;
|
2970 |
-
}
|
2971 |
-
|
2972 |
-
.twt_tool_bdr {
|
2973 |
-
line-height: 0 !important;
|
2974 |
-
}
|
2975 |
-
|
2976 |
-
div#sfsiid_facebook {
|
2977 |
-
line-height: 0 !important;
|
2978 |
-
}
|
2979 |
-
|
2980 |
-
div#sfsiid_youtube {
|
2981 |
-
line-height: 0 !important;
|
2982 |
-
}
|
2983 |
-
|
2984 |
-
.printst_tool_bdr {
|
2985 |
-
line-height: 0 !important;
|
2986 |
-
}
|
2987 |
-
|
2988 |
-
/*end added by Developer */
|
2989 |
-
/*by developer - 29-5-2019 */
|
2990 |
-
ul.SFSI_instructions li,
|
2991 |
-
ul.SFSI_instructions li a {
|
2992 |
-
font-size: 17px !important;
|
2993 |
-
font-family: helveticaregular !important;
|
2994 |
-
font-weight: 400;
|
2995 |
-
color: #1a1d20 !important;
|
2996 |
-
}
|
2997 |
-
|
2998 |
-
body .specify_counts .listing .sfsi_instagramInstruction li {
|
2999 |
-
font-size: 17px !important;
|
3000 |
-
font-family: helveticaregular !important;
|
3001 |
-
font-weight: 400 !important;
|
3002 |
-
color: #1a1d20 !important;
|
3003 |
-
line-height: 26px !important;
|
3004 |
-
}
|
3005 |
-
|
3006 |
-
/*end - 29-5-2019*/
|
3007 |
-
|
3008 |
-
a.pop-up .radio{
|
3009 |
-
opacity: 0.5;
|
3010 |
-
background-position: 0px 0px !important;
|
3011 |
-
/* padding-right: 3px; */
|
3012 |
-
}
|
3013 |
-
|
3014 |
-
.sfsi_vertically_center{
|
3015 |
-
display: flex;
|
3016 |
-
justify-content: space-between;
|
3017 |
-
align-items: center;
|
3018 |
-
}
|
3019 |
-
.sfsi_center{
|
3020 |
-
display: flex;
|
3021 |
-
justify-content: center;
|
3022 |
-
}
|
3023 |
-
.sfsi_custom_icons_q4{
|
3024 |
-
display: flex;
|
3025 |
-
align-items: center;
|
3026 |
-
}
|
3027 |
-
.tab6 .sfsi_responsive_icon_option_li .options .first.first.first {
|
3028 |
-
width: 25%!important;
|
3029 |
-
}
|
3030 |
-
.sfsi_responsive_icon_gradient{
|
3031 |
-
background-image: -webkit-linear-gradient(bottom,rgba(0, 0, 0, 0.17) 0%,rgba(255, 255, 255, 0.17) 100%);
|
3032 |
-
background-image: -moz-linear-gradient(bottom,rgba(0, 0, 0, 0.17) 0%,rgba(255, 255, 255, 0.17) 100%);
|
3033 |
-
background-image: linear-gradient(bottom,rgba(0,0,0,.17) 0%,rgba(255,255,255,.17) 100%);
|
3034 |
-
}
|
3035 |
-
.tab6 ul.sfsi_icn_listing8 ul.sfsi_tab_3_icns li {
|
3036 |
-
width: 50%;
|
3037 |
-
max-width: 450px;
|
3038 |
-
padding-left: 0;
|
3039 |
-
padding-bottom: 0;
|
3040 |
-
}
|
3041 |
-
.tab6 .sfsi_tab_3_icns.sfsi_shwthmbfraftr > li {
|
3042 |
-
width:100% !important;
|
3043 |
-
max-width:100% !important;
|
3044 |
-
border-left: 45px solid transparent;
|
3045 |
-
}
|
3046 |
-
|
3047 |
-
.tab6 ul.sfsi_icn_listing8 li {
|
3048 |
-
float: left;
|
3049 |
-
padding: 11px 0 40px 8px;
|
3050 |
-
width: 100%;
|
3051 |
-
max-width: 1000px;
|
3052 |
-
margin: 0;
|
3053 |
-
}
|
3054 |
-
|
3055 |
-
ul.sfsi_icn_listing8 li .sfsi_right_info a {
|
3056 |
-
outline: 0;
|
3057 |
-
font-family: helveticaregular;
|
3058 |
-
}
|
3059 |
-
#accordion .tab6 ul.sfsi_tab_3_icns {
|
3060 |
-
margin-top: 25px;
|
3061 |
-
}
|
3062 |
-
.sfsi_tab_3_icns.sfsi_shwthmbfraftr {
|
3063 |
-
overflow: visible;
|
3064 |
-
}
|
3065 |
-
ul.sfsi_tab_3_icns {
|
3066 |
-
list-style: none;
|
3067 |
-
margin: 34px 0 0;
|
3068 |
-
overflow: hidden;
|
3069 |
-
}
|
3070 |
-
|
3071 |
-
.tab6 ul.sfsi_icn_listing8 li {
|
3072 |
-
float: left;
|
3073 |
-
padding: 11px 0 40px 8px;
|
3074 |
-
width: 100%;
|
3075 |
-
max-width: 1000px;
|
3076 |
-
margin: 0;
|
3077 |
-
}
|
3078 |
-
.tab6 .sfsi_tab_3_icns.sfsi_shwthmbfraftr .social_icon_like1 li {
|
3079 |
-
width: auto;
|
3080 |
-
max-width: auto;
|
3081 |
-
min-width: auto;
|
3082 |
-
margin: 0 30px 0 0;
|
3083 |
-
}
|
3084 |
-
|
3085 |
-
ul.sfsi_tab_3_icns label {
|
3086 |
-
float: left;
|
3087 |
-
line-height: 42px;
|
3088 |
-
color: #69737C;
|
3089 |
-
font-size: 18px;
|
3090 |
-
font-family: helveticaregular;
|
3091 |
-
min-width: 120px;
|
3092 |
-
}
|
3093 |
-
.tab6 ul.sfsi_tab_3_icns li label {
|
3094 |
-
line-height: 50px !important;
|
3095 |
-
}
|
3096 |
-
|
3097 |
-
#accordion1 .tab6 ul.sfsi_shwthmbfraftr .labelhdng4, #accordion .tab6 ul.sfsi_shwthmbfraftr .row h4.labelhdng4, #accordion .tab6 ul.sfsi_shwthmbfraftr .labelhdng4, #accordion .tab6 ul.sfsi_shwthmbfraftr .row h4.labelhdng4 {
|
3098 |
-
color: #555;
|
3099 |
-
font-size: 20px;
|
3100 |
-
margin-left: 20px;
|
3101 |
-
font-family: 'helveticaregular';
|
3102 |
-
}
|
3103 |
-
.tab6 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns.sfsi_shwthmbfraftr>li:nth-child(1), .tab6 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns.sfsi_shwthmbfraftr>li:nth-child(2){
|
3104 |
-
width: 27% !important;
|
3105 |
-
}
|
3106 |
-
|
3107 |
-
.tab6 ul.sfsi_tab_3_icns li .radio{
|
3108 |
-
margin-top: 7px;
|
3109 |
-
}
|
3110 |
-
|
3111 |
-
ul.sfsi_icn_listing8 li .tb_4_ck{
|
3112 |
-
float: left;
|
3113 |
-
}
|
3114 |
-
.sfsi_responsive_default_icon_container .radio_section.tb_4_ck, .sfsi_responsive_custom_icon_container .radio_section.tb_4_ck {
|
3115 |
-
margin: 5px 20px 0 0 !important;
|
3116 |
-
}
|
3117 |
-
|
3118 |
-
.sfsi_responsive_icon_option_li .options .field .select {
|
3119 |
-
font-family: helveticaregular;
|
3120 |
-
font-weight: 400;
|
3121 |
-
font-size: 17px;
|
3122 |
-
color: #5a6570!important;
|
3123 |
-
}
|
3124 |
-
|
3125 |
-
.tab6 ul.sfsi_icn_listing8 ul.sfsi_tab_3_icns .usually li {
|
3126 |
-
width: 100% !important;
|
3127 |
-
max-width: 1000px !important;
|
3128 |
-
padding: 3px 0 5px 5px !important;
|
3129 |
-
}
|
3130 |
-
.sfsi_responsive_icons a{
|
3131 |
-
text-decoration: none!important;
|
3132 |
-
box-shadow: none!important;
|
3133 |
-
}
|
3134 |
-
.sfsi_responsive_icons .sfsi_responsive_icon_facebook_container{ background-color:#336699;}
|
3135 |
-
.sfsi_responsive_icons .sfsi_responsive_icon_follow_container{ background-color:#00B04E;}
|
3136 |
-
.sfsi_responsive_icons .sfsi_responsive_icon_twitter_container{ background-color:#55ACEE;}
|
3137 |
-
.sfsi_small_button {
|
3138 |
-
line-height: 0px;
|
3139 |
-
height: unset;
|
3140 |
-
padding: 6px !important;
|
3141 |
-
}
|
3142 |
-
.sfsi_small_button span {
|
3143 |
-
margin-left: 10px;
|
3144 |
-
font-size: 16px;
|
3145 |
-
padding: 0px;
|
3146 |
-
line-height: 16px;
|
3147 |
-
vertical-align: -webkit-baseline-middle !important;
|
3148 |
-
margin-left: 10px;
|
3149 |
-
}
|
3150 |
-
.sfsi_small_button img {
|
3151 |
-
max-height: 16px !important;
|
3152 |
-
padding: 0px;
|
3153 |
-
line-height: 0px;
|
3154 |
-
vertical-align: -webkit-baseline-middle !important;
|
3155 |
-
}
|
3156 |
-
.sfsi_medium_button span {
|
3157 |
-
margin-left: 10px;
|
3158 |
-
font-size: 18px;
|
3159 |
-
padding: 0px;
|
3160 |
-
line-height: 16px;
|
3161 |
-
vertical-align: -webkit-baseline-middle !important;
|
3162 |
-
margin-left: 10px;
|
3163 |
-
}
|
3164 |
-
.sfsi_medium_button img {
|
3165 |
-
max-height: 16px !important;
|
3166 |
-
padding: 0px;
|
3167 |
-
line-height: 0px;
|
3168 |
-
vertical-align: -webkit-baseline-middle !important;
|
3169 |
-
}
|
3170 |
-
.sfsi_medium_button {
|
3171 |
-
line-height: 0px;
|
3172 |
-
height: unset;
|
3173 |
-
padding: 10px !important;
|
3174 |
-
}
|
3175 |
-
|
3176 |
-
.sfsi_medium_button span {
|
3177 |
-
margin-left: 10px;
|
3178 |
-
font-size: 18px;
|
3179 |
-
padding: 0px;
|
3180 |
-
line-height: 16px;
|
3181 |
-
vertical-align: -webkit-baseline-middle !important;
|
3182 |
-
margin-left: 10px;
|
3183 |
-
}
|
3184 |
-
.sfsi_medium_button img {
|
3185 |
-
max-height: 16px !important;
|
3186 |
-
padding: 0px;
|
3187 |
-
line-height: 0px;
|
3188 |
-
vertical-align: -webkit-baseline-middle !important;
|
3189 |
-
}
|
3190 |
-
.sfsi_medium_button {
|
3191 |
-
line-height: 0px;
|
3192 |
-
height: unset;
|
3193 |
-
padding: 10px !important;
|
3194 |
-
}
|
3195 |
-
.sfsi_large_button span {
|
3196 |
-
font-size: 20px;
|
3197 |
-
padding: 0px;
|
3198 |
-
line-height: 16px;
|
3199 |
-
vertical-align: -webkit-baseline-middle !important;
|
3200 |
-
display: inline;
|
3201 |
-
margin-left: 10px;
|
3202 |
-
}
|
3203 |
-
.sfsi_large_button img {
|
3204 |
-
max-height: 16px !important;
|
3205 |
-
padding: 0px;
|
3206 |
-
line-height: 0px;
|
3207 |
-
vertical-align: -webkit-baseline-middle !important;
|
3208 |
-
display: inline;
|
3209 |
-
}
|
3210 |
-
.sfsi_large_button {
|
3211 |
-
line-height: 0px;
|
3212 |
-
height: unset;
|
3213 |
-
padding: 13px !important;
|
3214 |
-
}
|
3215 |
-
.sfsi_responsive_icons .sfsi_icons_container span {
|
3216 |
-
font-family: sans-serif;
|
3217 |
-
font-size: 15px;
|
3218 |
-
}
|
3219 |
-
.sfsi_icons_container_box_fully_container {
|
3220 |
-
flex-wrap: wrap;
|
3221 |
-
}
|
3222 |
-
.sfsi_icons_container_box_fully_container a {
|
3223 |
-
flex-basis: auto !important;
|
3224 |
-
flex-grow: 1;
|
3225 |
-
flex-shrink: 1;
|
3226 |
-
margin-bottom: 5px;
|
3227 |
-
}
|
3228 |
-
.sfsi_icons_container>a {
|
3229 |
-
float: left!important;
|
3230 |
-
text-decoration: none!important;
|
3231 |
-
-webkit-box-shadow: unset!important;
|
3232 |
-
box-shadow: unset!important;
|
3233 |
-
-webkit-transition: unset!important;
|
3234 |
-
transition: unset!important;
|
3235 |
-
margin-bottom:5px!important;
|
3236 |
-
}
|
3237 |
-
.sfsi_small_button {
|
3238 |
-
line-height: 0px;
|
3239 |
-
height: unset;
|
3240 |
-
padding: 6px !important;
|
3241 |
-
}
|
3242 |
-
.sfsi_small_button span {
|
3243 |
-
margin-left: 10px;
|
3244 |
-
font-size: 16px;
|
3245 |
-
padding: 0px;
|
3246 |
-
line-height: 16px;
|
3247 |
-
vertical-align: -webkit-baseline-middle !important;
|
3248 |
-
margin-left: 10px;
|
3249 |
-
}
|
3250 |
-
.sfsi_small_button img {
|
3251 |
-
max-height: 16px !important;
|
3252 |
-
padding: 0px;
|
3253 |
-
line-height: 0px;
|
3254 |
-
vertical-align: -webkit-baseline-middle !important;
|
3255 |
-
}
|
3256 |
-
.sfsi_medium_button span {
|
3257 |
-
margin-left: 10px;
|
3258 |
-
font-size: 18px;
|
3259 |
-
padding: 0px;
|
3260 |
-
line-height: 16px;
|
3261 |
-
vertical-align: -webkit-baseline-middle !important;
|
3262 |
-
margin-left: 10px;
|
3263 |
-
}
|
3264 |
-
.sfsi_medium_button img {
|
3265 |
-
max-height: 16px !important;
|
3266 |
-
padding: 0px;
|
3267 |
-
line-height: 0px;
|
3268 |
-
vertical-align: -webkit-baseline-middle !important;
|
3269 |
-
}
|
3270 |
-
.sfsi_medium_button {
|
3271 |
-
line-height: 0px;
|
3272 |
-
height: unset;
|
3273 |
-
padding: 10px !important;
|
3274 |
-
}
|
3275 |
-
|
3276 |
-
.sfsi_medium_button span {
|
3277 |
-
margin-left: 10px;
|
3278 |
-
font-size: 18px;
|
3279 |
-
padding: 0px;
|
3280 |
-
line-height: 16px;
|
3281 |
-
vertical-align: -webkit-baseline-middle !important;
|
3282 |
-
margin-left: 10px;
|
3283 |
-
}
|
3284 |
-
.sfsi_medium_button img {
|
3285 |
-
max-height: 16px !important;
|
3286 |
-
padding: 0px;
|
3287 |
-
line-height: 0px;
|
3288 |
-
vertical-align: -webkit-baseline-middle !important;
|
3289 |
-
}
|
3290 |
-
.sfsi_medium_button {
|
3291 |
-
line-height: 0px;
|
3292 |
-
height: unset;
|
3293 |
-
padding: 10px !important;
|
3294 |
-
}
|
3295 |
-
.sfsi_large_button span {
|
3296 |
-
font-size: 20px;
|
3297 |
-
padding: 0px;
|
3298 |
-
line-height: 16px;
|
3299 |
-
vertical-align: -webkit-baseline-middle !important;
|
3300 |
-
display: inline;
|
3301 |
-
margin-left: 10px;
|
3302 |
-
}
|
3303 |
-
.sfsi_large_button img {
|
3304 |
-
max-height: 16px !important;
|
3305 |
-
padding: 0px;
|
3306 |
-
line-height: 0px;
|
3307 |
-
vertical-align: -webkit-baseline-middle !important;
|
3308 |
-
display: inline;
|
3309 |
-
}
|
3310 |
-
.sfsi_large_button {
|
3311 |
-
line-height: 0px;
|
3312 |
-
height: unset;
|
3313 |
-
padding: 13px !important;
|
3314 |
-
}
|
3315 |
-
.sfsi_responsive_icons_count{
|
3316 |
-
padding: 5px 10px;
|
3317 |
-
float: left !important;
|
3318 |
-
display: inline-block;
|
3319 |
-
margin-right: 0px;
|
3320 |
-
margin-top: 2px;
|
3321 |
-
}
|
3322 |
-
|
3323 |
-
.sfsi_responsive_icons_count h3{
|
3324 |
-
font-family: 'sans-serif' !important;
|
3325 |
-
font-weight: 900;
|
3326 |
-
font-size: 32px !important;
|
3327 |
-
line-height: 0px !important;
|
3328 |
-
padding: 0px;
|
3329 |
-
margin: 0px;
|
3330 |
-
}
|
3331 |
-
|
3332 |
-
.sfsi_responsive_icons_count h6{
|
3333 |
-
font-family: 'sans-serif' !important;
|
3334 |
-
font-weight: 900;
|
3335 |
-
padding: 0px;
|
3336 |
-
margin: 0px;
|
3337 |
-
}
|
3338 |
-
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
3339 |
-
text-decoration: none!important;
|
3340 |
-
border: 0!important;
|
3341 |
-
}
|
3342 |
-
.sfsi_responsive_with_counter_icons{
|
3343 |
-
width: calc(100% - 100px)!important;
|
3344 |
-
}
|
3345 |
-
.sfsiresponsive_icon_preview {
|
3346 |
-
padding: 0px 0 20px 0;
|
3347 |
-
min-width: 100%;
|
3348 |
-
}
|
3349 |
-
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_large_button {
|
3350 |
-
padding: 12px 13px 9px 13px !important;
|
3351 |
-
}
|
3352 |
-
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_medium_button {
|
3353 |
-
padding: 9px 10px 7px 10px !important;
|
3354 |
-
}
|
3355 |
-
.sfsi_responsive_icons_count.sfsi_small_button {
|
3356 |
-
padding: 7px 6px !important;
|
3357 |
-
}
|
3358 |
-
.sfsi_responsive_icons_count.sfsi_small_button {
|
3359 |
-
padding: 7px 6px !important;
|
3360 |
-
margin-top: 2px;
|
3361 |
-
}
|
3362 |
-
.sfsi_responsive_icons_count.sfsi_small_button h6 {
|
3363 |
-
display: inline-block;
|
3364 |
-
font-size: 12px !important;
|
3365 |
-
vertical-align: middle;
|
3366 |
-
}
|
3367 |
-
.sfsi_responsive_icons_count.sfsi_responsive_count_container.sfsi_medium_button {
|
3368 |
-
padding: 9px 10px 7px 10px !important;
|
3369 |
-
}
|
3370 |
-
.sfsi_responsive_icons_count.sfsi_medium_button h3 {
|
3371 |
-
font-size: 21px !important;
|
3372 |
-
vertical-align: top;
|
3373 |
-
line-height: 8px !important;
|
3374 |
-
margin: 0px 0px 12px 0px !important;
|
3375 |
-
font-weight: 900;
|
3376 |
-
padding: 0px;
|
3377 |
-
}
|
3378 |
-
.sfsi_esponsive_icons_count.sfsi_responsive_count_container.sfsi_large_button h3 {
|
3379 |
-
margin: 0px 0px 15px 0px !important;
|
3380 |
-
}
|
3381 |
-
.sfsi_responsive_icons_count.sfsi_large_button h3 {
|
3382 |
-
font-size: 26px !important;
|
3383 |
-
vertical-align: top;
|
3384 |
-
line-height: 6px !important;
|
3385 |
-
}
|
3386 |
-
|
3387 |
-
.sfsi_responsive_icons_count h3 {
|
3388 |
-
font-family: 'sans-serif' !important;
|
3389 |
-
font-weight: 900;
|
3390 |
-
padding: 0px;
|
3391 |
-
}
|
3392 |
-
|
3393 |
-
.sfsi_responsive_icons_count.sfsi_small_button h3 {
|
3394 |
-
font-size: 20px !important;
|
3395 |
-
display: inline-block;
|
3396 |
-
vertical-align: middle;
|
3397 |
-
}
|
3398 |
-
.sfsi_responsive_icons_count.sfsi_small_button h3 {
|
3399 |
-
margin: 0px !important;
|
3400 |
-
}
|
3401 |
-
.sfsi_responsive_icons_count h3 {
|
3402 |
-
font-family: 'sans-serif' !important;
|
3403 |
-
font-weight: 900;
|
3404 |
-
line-height: 0px !important;
|
3405 |
-
padding: 0px;
|
3406 |
-
margin: 0px;
|
3407 |
-
}
|
3408 |
-
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
3409 |
-
text-decoration: none!important;
|
3410 |
-
border: 0!important;
|
3411 |
-
}
|
3412 |
-
.sfsi_responsive_icons_count.sfsi_small_button {
|
3413 |
-
padding: 7px 6px !important;
|
3414 |
-
margin-top: 2px;
|
3415 |
-
}
|
3416 |
-
|
3417 |
-
.sfsi_responsive_icons_count {
|
3418 |
-
vertical-align: top;
|
3419 |
-
}
|
3420 |
-
.sfsi_responsive_icons_count {
|
3421 |
-
float: left;
|
3422 |
-
}
|
3423 |
-
.sfsi_small_button {
|
3424 |
-
line-height: 0px;
|
3425 |
-
height: unset;
|
3426 |
-
}
|
3427 |
-
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
3428 |
-
text-decoration: none!important;
|
3429 |
-
border: 0!important;
|
3430 |
-
}
|
3431 |
-
.sfsi_responsive_icons_count.sfsi_small_button h3 {
|
3432 |
-
font-size: 20px !important;
|
3433 |
-
display: inline-block;
|
3434 |
-
vertical-align: middle;
|
3435 |
-
margin: 0px !important;
|
3436 |
-
}
|
3437 |
-
|
3438 |
-
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
3439 |
-
text-decoration: none!important;
|
3440 |
-
font-family: helveticaregular!important;
|
3441 |
-
border: 0!important;
|
3442 |
-
}
|
3443 |
-
.sfsi_responsive_icons_count h3 {
|
3444 |
-
line-height: 0px !important;
|
3445 |
-
padding: 0px;
|
3446 |
-
}
|
3447 |
-
.sfsi_responsive_icons_count.sfsi_small_button h6 {
|
3448 |
-
display: inline-block;
|
3449 |
-
font-size: 12px !important;
|
3450 |
-
/*vertical-align: middle;*/
|
3451 |
-
margin: 0px !important;
|
3452 |
-
line-height: initial !important;
|
3453 |
-
padding: 0;
|
3454 |
-
margin: 0;
|
3455 |
-
}
|
3456 |
-
.sfsi_responsive_icons_count h6{
|
3457 |
-
margin:0!important;
|
3458 |
-
}
|
3459 |
-
.sfsi_responsive_icons_count h6 {
|
3460 |
-
padding: 0px;
|
3461 |
-
}
|
3462 |
-
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6{
|
3463 |
-
text-decoration: none!important;
|
3464 |
-
font-family: helveticaregular!important;
|
3465 |
-
border: 0!important;
|
3466 |
-
}
|
3467 |
-
.sfsi_responsive_icons_count.sfsi_medium_button h6{
|
3468 |
-
font-size: 11px !important;
|
3469 |
-
line-height: 0px !important;
|
3470 |
-
margin: 0px 0px 0px 0px !important;
|
3471 |
-
}
|
1 |
+
@charset "utf-8";
|
2 |
+
|
3 |
+
@font-face {
|
4 |
+
font-family: helveticabold;
|
5 |
+
src: url(fonts/helvetica_bold_0-webfont.eot);
|
6 |
+
src: url(fonts/helvetica_bold_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_bold_0-webfont.woff) format('woff'), url(fonts/helvetica_bold_0-webfont.ttf) format('truetype'), url(fonts/helvetica_bold_0-webfont.svg#helveticabold) format('svg');
|
7 |
+
font-weight: 400;
|
8 |
+
font-style: normal;
|
9 |
+
}
|
10 |
+
|
11 |
+
@font-face {
|
12 |
+
font-family: helveticaregular;
|
13 |
+
src: url(fonts/helvetica_0-webfont.eot);
|
14 |
+
src: url(fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_0-webfont.woff) format('woff'), url(fonts/helvetica_0-webfont.ttf) format('truetype'), url(fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');
|
15 |
+
font-weight: 400;
|
16 |
+
font-style: normal;
|
17 |
+
}
|
18 |
+
|
19 |
+
@font-face {
|
20 |
+
font-family: helveticaneue-light;
|
21 |
+
src: url(fonts/helveticaneue-light.eot);
|
22 |
+
src: url(fonts/helveticaneue-light.eot?#iefix) format('embedded-opentype'), url(fonts/helveticaneue-light.woff) format('woff'), url(fonts/helveticaneue-light.ttf) format('truetype'), url(fonts/helveticaneue-light.svg#helveticaneue-light) format('svg');
|
23 |
+
font-weight: 400;
|
24 |
+
font-style: normal;
|
25 |
+
}
|
26 |
+
|
27 |
+
body {
|
28 |
+
margin: 0;
|
29 |
+
padding: 0;
|
30 |
+
}
|
31 |
+
|
32 |
+
.clear {
|
33 |
+
clear: both;
|
34 |
+
}
|
35 |
+
|
36 |
+
.space {
|
37 |
+
clear: both;
|
38 |
+
padding: 30px 0 0;
|
39 |
+
width: 100%;
|
40 |
+
float: left;
|
41 |
+
}
|
42 |
+
|
43 |
+
.like_txt {
|
44 |
+
margin: 30px 0 0;
|
45 |
+
padding: 0;
|
46 |
+
color: #12a252;
|
47 |
+
font-family: helveticaregular;
|
48 |
+
font-size: 20px;
|
49 |
+
line-height: 20px;
|
50 |
+
text-align: center;
|
51 |
+
}
|
52 |
+
|
53 |
+
.like_txt a {
|
54 |
+
color: #12a252;
|
55 |
+
}
|
56 |
+
|
57 |
+
.sfsibeforpstwpr iframe,
|
58 |
+
.sfsiaftrpstwpr iframe {
|
59 |
+
max-width: none;
|
60 |
+
}
|
61 |
+
|
62 |
+
.sfwp_fivestar_ul li {
|
63 |
+
display: block;
|
64 |
+
padding-right: 20px;
|
65 |
+
}
|
66 |
+
|
67 |
+
.shwthmbfraftr {
|
68 |
+
margin-top: 5px !important
|
69 |
+
}
|
70 |
+
|
71 |
+
label.toglpstpgsbttl {
|
72 |
+
float: left;
|
73 |
+
margin-top: 5px !important
|
74 |
+
}
|
75 |
+
|
76 |
+
.tab_3_icns.shwthmbfraftr .cstmdisplaysharingtxt {
|
77 |
+
float: left;
|
78 |
+
}
|
79 |
+
|
80 |
+
.tab6 ul.enough_waffling.sfsi_dsplyatend {
|
81 |
+
width: 24%;
|
82 |
+
float: left;
|
83 |
+
}
|
84 |
+
|
85 |
+
.tab4 ul.like_icon {
|
86 |
+
margin: 0;
|
87 |
+
padding: 20px 0 0;
|
88 |
+
list-style: none;
|
89 |
+
text-align: center;
|
90 |
+
}
|
91 |
+
|
92 |
+
.tab4 ul.like_icon li {
|
93 |
+
margin: 0;
|
94 |
+
padding: 0;
|
95 |
+
list-style: none;
|
96 |
+
display: inline-block;
|
97 |
+
}
|
98 |
+
|
99 |
+
.tab4 ul.like_icon li span {
|
100 |
+
margin: 0;
|
101 |
+
width: 54px;
|
102 |
+
display: block;
|
103 |
+
background: url(../images/count_bg.png) no-repeat;
|
104 |
+
height: 24px;
|
105 |
+
overflow: hidden;
|
106 |
+
padding: 10px 2px 2px;
|
107 |
+
font-size: 17px;
|
108 |
+
text-align: center;
|
109 |
+
line-height: 24px;
|
110 |
+
color: #5a6570;
|
111 |
+
}
|
112 |
+
|
113 |
+
.tab4 ul.like_icon li a {
|
114 |
+
color: #5a6570;
|
115 |
+
text-decoration: none;
|
116 |
+
}
|
117 |
+
|
118 |
+
.tab4 ul.enough_waffling {
|
119 |
+
margin: 0;
|
120 |
+
padding: 25px 0 27px;
|
121 |
+
list-style: none;
|
122 |
+
text-align: center;
|
123 |
+
}
|
124 |
+
|
125 |
+
.tab4 ul.enough_waffling li {
|
126 |
+
margin: 0 22px;
|
127 |
+
padding: 0;
|
128 |
+
list-style: none;
|
129 |
+
display: inline-block;
|
130 |
+
}
|
131 |
+
|
132 |
+
.tab4 ul.enough_waffling li span {
|
133 |
+
float: left;
|
134 |
+
}
|
135 |
+
|
136 |
+
.tab4 ul.enough_waffling li label {
|
137 |
+
margin: 0 0 0 20px;
|
138 |
+
float: left;
|
139 |
+
font-family: helveticaregular;
|
140 |
+
font-size: 18px;
|
141 |
+
font-weight: 400;
|
142 |
+
text-align: center;
|
143 |
+
line-height: 38px;
|
144 |
+
color: #5a6570;
|
145 |
+
}
|
146 |
+
|
147 |
+
.sfsi_mainContainer .checkbox {
|
148 |
+
width: 31px;
|
149 |
+
height: 31px;
|
150 |
+
background: url(../images/check_bg.jpg) no-repeat;
|
151 |
+
display: inherit;
|
152 |
+
}
|
153 |
+
|
154 |
+
.sfsi_mainContainer .radio {
|
155 |
+
width: 40px;
|
156 |
+
height: 40px;
|
157 |
+
background: url(../images/radio_bg.png) no-repeat;
|
158 |
+
display: inherit;
|
159 |
+
}
|
160 |
+
|
161 |
+
.sfsi_mainContainer .select {
|
162 |
+
width: 127px;
|
163 |
+
height: 47px;
|
164 |
+
font-size: 17px;
|
165 |
+
background: url(../images/select_bg.jpg) no-repeat;
|
166 |
+
display: block;
|
167 |
+
padding-left: 16px;
|
168 |
+
line-height: 49px;
|
169 |
+
}
|
170 |
+
|
171 |
+
.sfsi_mainContainer .line {
|
172 |
+
background: #eaebee;
|
173 |
+
height: 1px;
|
174 |
+
font-size: 0;
|
175 |
+
margin: 15px 0 0;
|
176 |
+
clear: both;
|
177 |
+
width: 100%;
|
178 |
+
float: left;
|
179 |
+
}
|
180 |
+
|
181 |
+
.specify_counts {
|
182 |
+
display: block;
|
183 |
+
margin-top: 15px;
|
184 |
+
padding-top: 15px;
|
185 |
+
clear: both;
|
186 |
+
width: 100%;
|
187 |
+
float: left;
|
188 |
+
border-top: 1px solid #eaebee;
|
189 |
+
}
|
190 |
+
|
191 |
+
.specify_counts .radio_section {
|
192 |
+
width: 30px;
|
193 |
+
float: left;
|
194 |
+
margin: 12px 10px 0 0;
|
195 |
+
}
|
196 |
+
|
197 |
+
.specify_counts .social_icon_like {
|
198 |
+
width: 54px;
|
199 |
+
float: left;
|
200 |
+
margin: 0 15px 0 0;
|
201 |
+
}
|
202 |
+
|
203 |
+
.specify_counts .social_icon_like ul {
|
204 |
+
margin: 0;
|
205 |
+
padding: 0;
|
206 |
+
list-style: none;
|
207 |
+
text-align: center;
|
208 |
+
}
|
209 |
+
|
210 |
+
.specify_counts .social_icon_like li {
|
211 |
+
margin: 0;
|
212 |
+
padding: 0;
|
213 |
+
list-style: none;
|
214 |
+
display: inline-block;
|
215 |
+
}
|
216 |
+
|
217 |
+
.specify_counts .social_icon_like li span {
|
218 |
+
margin: 0;
|
219 |
+
width: 54px;
|
220 |
+
display: block;
|
221 |
+
background: url(../images/count_bg.jpg) no-repeat;
|
222 |
+
height: 24px;
|
223 |
+
overflow: hidden;
|
224 |
+
padding: 10px 2px 2px;
|
225 |
+
font-family: helveticaregular;
|
226 |
+
font-size: 16px;
|
227 |
+
text-align: center;
|
228 |
+
line-height: 24px;
|
229 |
+
color: #5a6570;
|
230 |
+
}
|
231 |
+
|
232 |
+
.specify_counts .social_icon_like li a {
|
233 |
+
color: #5a6570;
|
234 |
+
text-decoration: none;
|
235 |
+
}
|
236 |
+
|
237 |
+
.specify_counts .listing {
|
238 |
+
width: 88%;
|
239 |
+
margin-top: -5px;
|
240 |
+
display: inherit;
|
241 |
+
float: left;
|
242 |
+
}
|
243 |
+
|
244 |
+
.specify_counts .listing ul {
|
245 |
+
margin: 0;
|
246 |
+
padding: 0;
|
247 |
+
list-style: none;
|
248 |
+
text-align: left;
|
249 |
+
}
|
250 |
+
|
251 |
+
.specify_counts .listing li {
|
252 |
+
margin: 15px 0 0;
|
253 |
+
padding: 0;
|
254 |
+
list-style: none;
|
255 |
+
clear: both;
|
256 |
+
line-height: 39px;
|
257 |
+
font-size: 17px;
|
258 |
+
}
|
259 |
+
|
260 |
+
.specify_counts .listing li span {
|
261 |
+
float: left;
|
262 |
+
margin-right: 20px;
|
263 |
+
}
|
264 |
+
|
265 |
+
.specify_counts .listing li .input {
|
266 |
+
background: #e5e5e5;
|
267 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
268 |
+
border: 0;
|
269 |
+
padding: 10px;
|
270 |
+
margin-left: 25px;
|
271 |
+
}
|
272 |
+
|
273 |
+
.specify_counts .listing li .input_facebook {
|
274 |
+
width: 288px;
|
275 |
+
background: #e5e5e5;
|
276 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
277 |
+
border: 0;
|
278 |
+
padding: 10px;
|
279 |
+
margin-left: 16px;
|
280 |
+
}
|
281 |
+
|
282 |
+
.save_button {
|
283 |
+
width: 450px;
|
284 |
+
padding-top: 30px;
|
285 |
+
clear: both;
|
286 |
+
margin: auto;
|
287 |
+
}
|
288 |
+
|
289 |
+
.save_button a {
|
290 |
+
background: #12a252;
|
291 |
+
text-align: center;
|
292 |
+
font-size: 23px;
|
293 |
+
color: #FFF !important;
|
294 |
+
display: block;
|
295 |
+
padding: 11px 0;
|
296 |
+
text-decoration: none;
|
297 |
+
}
|
298 |
+
|
299 |
+
.save_button a:hover {
|
300 |
+
background: #079345
|
301 |
+
}
|
302 |
+
|
303 |
+
.tab5 ul.share_icon_order {
|
304 |
+
margin: 0;
|
305 |
+
padding: 0;
|
306 |
+
list-style: none;
|
307 |
+
text-align: left;
|
308 |
+
}
|
309 |
+
|
310 |
+
.tab5 ul.share_icon_order li {
|
311 |
+
margin: 22px 6px 0 0;
|
312 |
+
padding: 0;
|
313 |
+
list-style: none;
|
314 |
+
float: left;
|
315 |
+
line-height: 37px;
|
316 |
+
}
|
317 |
+
|
318 |
+
.tab5 ul.share_icon_order li:last-child {
|
319 |
+
margin: 22px 0 0 3px;
|
320 |
+
}
|
321 |
+
|
322 |
+
.tab5 .row {
|
323 |
+
border-top: 1px solid #eaebee;
|
324 |
+
margin-top: 25px;
|
325 |
+
padding-top: 15px;
|
326 |
+
clear: both;
|
327 |
+
display: block;
|
328 |
+
width: 100%;
|
329 |
+
float: left;
|
330 |
+
font-family: helveticaregular;
|
331 |
+
line-height: 42px;
|
332 |
+
}
|
333 |
+
|
334 |
+
.tab5 .icons_size {
|
335 |
+
position: relative;
|
336 |
+
}
|
337 |
+
|
338 |
+
.tab5 .icons_size span {
|
339 |
+
margin-right: 18px;
|
340 |
+
display: block;
|
341 |
+
float: left;
|
342 |
+
font-size: 18px;
|
343 |
+
font-weight: 400;
|
344 |
+
line-height: 46px;
|
345 |
+
}
|
346 |
+
|
347 |
+
.tab5 .icons_size span.last {
|
348 |
+
margin-left: 55px;
|
349 |
+
}
|
350 |
+
|
351 |
+
.tab5 .icons_size input {
|
352 |
+
width: 73px;
|
353 |
+
background: #e5e5e5;
|
354 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
355 |
+
border: 0;
|
356 |
+
padding: 13px 13px 12px;
|
357 |
+
margin-right: 18px;
|
358 |
+
float: left;
|
359 |
+
display: block;
|
360 |
+
}
|
361 |
+
|
362 |
+
.tab5 .icons_size select.styled {
|
363 |
+
position: absolute;
|
364 |
+
left: 0;
|
365 |
+
width: 135px;
|
366 |
+
height: 46px;
|
367 |
+
line-height: 46px;
|
368 |
+
}
|
369 |
+
|
370 |
+
.tab5 .icons_size .field {
|
371 |
+
position: relative;
|
372 |
+
float: left;
|
373 |
+
display: block;
|
374 |
+
margin-right: 20px;
|
375 |
+
}
|
376 |
+
|
377 |
+
.tab5 .icons_size ins {
|
378 |
+
margin-right: 25px;
|
379 |
+
float: left;
|
380 |
+
font-size: 17px;
|
381 |
+
font-weight: 400;
|
382 |
+
text-decoration: none;
|
383 |
+
}
|
384 |
+
|
385 |
+
.tab5 .icons_size ins.leave_empty {
|
386 |
+
line-height: 23px;
|
387 |
+
}
|
388 |
+
|
389 |
+
.tab5 .icons_size {
|
390 |
+
padding-top: 15px;
|
391 |
+
}
|
392 |
+
|
393 |
+
.tab5 ul.enough_waffling {
|
394 |
+
margin: -5px 0 0;
|
395 |
+
padding: 0;
|
396 |
+
list-style: none;
|
397 |
+
text-align: center;
|
398 |
+
}
|
399 |
+
|
400 |
+
.tab5 .new_wind .row_onl ul.enough_waffling {
|
401 |
+
/*margin: 14px 0 0 167px;*/
|
402 |
+
margin: 20px 0 0 0;
|
403 |
+
padding: 0;
|
404 |
+
list-style: none;
|
405 |
+
height: 38px;
|
406 |
+
text-align: center;
|
407 |
+
width: 61%;
|
408 |
+
}
|
409 |
+
|
410 |
+
.tab5 ul.enough_waffling li {
|
411 |
+
margin: 0 22px;
|
412 |
+
padding: 0;
|
413 |
+
list-style: none;
|
414 |
+
display: inline-block;
|
415 |
+
float: left;
|
416 |
+
}
|
417 |
+
|
418 |
+
.tab5 ul.enough_waffling li span {
|
419 |
+
float: left;
|
420 |
+
}
|
421 |
+
|
422 |
+
.tab5 ul.enough_waffling li label {
|
423 |
+
margin: 0 0 0 20px;
|
424 |
+
float: left;
|
425 |
+
font-family: helveticaregular;
|
426 |
+
font-size: 18px;
|
427 |
+
font-weight: 400;
|
428 |
+
text-align: center;
|
429 |
+
line-height: 38px;
|
430 |
+
color: #5a6570;
|
431 |
+
}
|
432 |
+
|
433 |
+
.sticking p {
|
434 |
+
float: left;
|
435 |
+
font-size: 18px !important;
|
436 |
+
}
|
437 |
+
|
438 |
+
.sticking p.list {
|
439 |
+
width: 168px;
|
440 |
+
}
|
441 |
+
|
442 |
+
.sticking p.link {
|
443 |
+
margin: 3px 0 0 12px;
|
444 |
+
padding: 0 !important;
|
445 |
+
float: left;
|
446 |
+
}
|
447 |
+
|
448 |
+
.sticking .float {
|
449 |
+
margin-left: 188px;
|
450 |
+
margin-top: 3px;
|
451 |
+
float: left;
|
452 |
+
font-size: 17px;
|
453 |
+
}
|
454 |
+
|
455 |
+
.sticking ul {
|
456 |
+
margin: 0;
|
457 |
+
padding: 30px 0 0;
|
458 |
+
list-style: none;
|
459 |
+
float: left;
|
460 |
+
}
|
461 |
+
|
462 |
+
.sticking a {
|
463 |
+
color: #a4a9ad;
|
464 |
+
}
|
465 |
+
|
466 |
+
.sticking p {
|
467 |
+
line-height: 19px !important;
|
468 |
+
}
|
469 |
+
|
470 |
+
.sticking .field {
|
471 |
+
position: relative;
|
472 |
+
float: left;
|
473 |
+
display: block;
|
474 |
+
margin-left: 20px;
|
475 |
+
}
|
476 |
+
|
477 |
+
.sticking .field .select {
|
478 |
+
width: 206px;
|
479 |
+
height: 47px;
|
480 |
+
background: url(../images/select_bg1.jpg) no-repeat;
|
481 |
+
display: block;
|
482 |
+
padding-left: 10px;
|
483 |
+
}
|
484 |
+
|
485 |
+
.sticking .field select.styled {
|
486 |
+
position: absolute;
|
487 |
+
left: 0;
|
488 |
+
top: 0;
|
489 |
+
width: 211px;
|
490 |
+
line-height: 46px;
|
491 |
+
height: 46px;
|
492 |
+
}
|
493 |
+
|
494 |
+
.mouseover_field {
|
495 |
+
width: 455px;
|
496 |
+
float: left;
|
497 |
+
font-size: 18px;
|
498 |
+
margin-top: 10px;
|
499 |
+
}
|
500 |
+
|
501 |
+
.mouseover_field label {
|
502 |
+
width: 125px;
|
503 |
+
float: left;
|
504 |
+
}
|
505 |
+
|
506 |
+
.mouseover_field input {
|
507 |
+
width: 256px;
|
508 |
+
float: left;
|
509 |
+
background: #e5e5e5;
|
510 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
511 |
+
border: 0;
|
512 |
+
padding: 10px;
|
513 |
+
}
|
514 |
+
|
515 |
+
.pop_up_box {
|
516 |
+
width: 474px;
|
517 |
+
background: #FFF;
|
518 |
+
box-shadow: 0 0 5px 3px #d8d8d8;
|
519 |
+
margin: 200px auto;
|
520 |
+
padding: 20px 25px 0px;
|
521 |
+
font-family: helveticaregular;
|
522 |
+
color: #5a6570;
|
523 |
+
min-height: 250px;
|
524 |
+
position: relative;
|
525 |
+
}
|
526 |
+
|
527 |
+
.pop_up_box h4,
|
528 |
+
.pop_up_box_ex h4 {
|
529 |
+
font-size: 20px;
|
530 |
+
color: #5a6570;
|
531 |
+
text-align: center;
|
532 |
+
margin: 0;
|
533 |
+
padding: 0;
|
534 |
+
line-height: 22px;
|
535 |
+
}
|
536 |
+
|
537 |
+
.pop_up_box p,
|
538 |
+
.pop_up_box_ex p {
|
539 |
+
font-size: 17px;
|
540 |
+
line-height: 28px;
|
541 |
+
color: #5a6570;
|
542 |
+
text-align: left;
|
543 |
+
margin: 0;
|
544 |
+
padding: 25px 0 0;
|
545 |
+
font-family: helveticaregular;
|
546 |
+
}
|
547 |
+
|
548 |
+
.sfsi_popupcntnr {
|
549 |
+
float: left;
|
550 |
+
width: 100%
|
551 |
+
}
|
552 |
+
|
553 |
+
.sfsi_popupcntnr>h3 {
|
554 |
+
color: #000;
|
555 |
+
float: left;
|
556 |
+
font-weight: 700;
|
557 |
+
margin-bottom: 5px;
|
558 |
+
width: 100%
|
559 |
+
}
|
560 |
+
|
561 |
+
ul.flwstep {
|
562 |
+
float: left;
|
563 |
+
width: 100%
|
564 |
+
}
|
565 |
+
|
566 |
+
ul.flwstep>li {
|
567 |
+
color: #000;
|
568 |
+
font-size: 16px;
|
569 |
+
margin: 5px;
|
570 |
+
}
|
571 |
+
|
572 |
+
.upldbtn {
|
573 |
+
float: left;
|
574 |
+
text-align: center;
|
575 |
+
width: 100%
|
576 |
+
}
|
577 |
+
|
578 |
+
.upload_butt {
|
579 |
+
background-color: #12a252;
|
580 |
+
border: none;
|
581 |
+
color: #fff;
|
582 |
+
font-weight: 700;
|
583 |
+
margin-top: 10px;
|
584 |
+
padding: 7px 22px;
|
585 |
+
width: auto;
|
586 |
+
cursor: pointer;
|
587 |
+
font-size: 19px;
|
588 |
+
}
|
589 |
+
|
590 |
+
.pop_up_box .button {
|
591 |
+
background: #12a252;
|
592 |
+
font-size: 22px;
|
593 |
+
line-height: 24px;
|
594 |
+
color: #5a6570;
|
595 |
+
text-align: center;
|
596 |
+
min-height: 80px;
|
597 |
+
margin-top: 32px;
|
598 |
+
box-shadow: none;
|
599 |
+
}
|
600 |
+
|
601 |
+
.pop_up_box .button:hover {
|
602 |
+
box-shadow: none !important;
|
603 |
+
}
|
604 |
+
|
605 |
+
.pop_up_box .button a.activate {
|
606 |
+
padding: 0px 0;
|
607 |
+
}
|
608 |
+
|
609 |
+
.pop_up_box a,
|
610 |
+
.pop_up_box_ex a {
|
611 |
+
color: #a4a9ad;
|
612 |
+
font-size: 20px;
|
613 |
+
text-decoration: none;
|
614 |
+
text-align: center;
|
615 |
+
display: inline-block;
|
616 |
+
margin-top: 18px;
|
617 |
+
width: 100%;
|
618 |
+
}
|
619 |
+
|
620 |
+
.pop_up_box .upload {
|
621 |
+
width: 100%;
|
622 |
+
float: left;
|
623 |
+
text-align: left;
|
624 |
+
margin-top: 15px;
|
625 |
+
height: 46px;
|
626 |
+
}
|
627 |
+
|
628 |
+
.pop_up_box .upload label {
|
629 |
+
width: 135px;
|
630 |
+
float: left;
|
631 |
+
line-height: 45px;
|
632 |
+
font-size: 18px;
|
633 |
+
font-family: helveticaregular;
|
634 |
+
text-align: left;
|
635 |
+
}
|
636 |
+
|
637 |
+
.pop_up_box .upload input[type=text] {
|
638 |
+
width: 248px;
|
639 |
+
float: left;
|
640 |
+
background: #e5e5e5;
|
641 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
642 |
+
border: 0;
|
643 |
+
padding: 0 10px;
|
644 |
+
font-size: 16px;
|
645 |
+
height: 44px;
|
646 |
+
text-align: left;
|
647 |
+
color: #5a6570;
|
648 |
+
font-family: helveticaregular;
|
649 |
+
}
|
650 |
+
|
651 |
+
.pop_up_box .upload input.upload_butt {
|
652 |
+
width: 100px;
|
653 |
+
background: #12a252;
|
654 |
+
box-shadow: 0 0 0;
|
655 |
+
border: 0;
|
656 |
+
text-align: center;
|
657 |
+
font-size: 18px;
|
658 |
+
color: #fff;
|
659 |
+
font-family: helveticaregular;
|
660 |
+
height: 45px;
|
661 |
+
right: 32px;
|
662 |
+
top: 71px;
|
663 |
+
position: absolute;
|
664 |
+
}
|
665 |
+
|
666 |
+
.pop_up_box .upload a {
|
667 |
+
color: #12a252;
|
668 |
+
font-size: 18px;
|
669 |
+
text-decoration: underline;
|
670 |
+
font-family: helveticaregular;
|
671 |
+
margin: 0 0 16px 140px;
|
672 |
+
}
|
673 |
+
|
674 |
+
.pop_up_box a:hover,
|
675 |
+
.pop_up_box_ex a:hover {
|
676 |
+
color: #a4a9ad;
|
677 |
+
}
|
678 |
+
|
679 |
+
.inr_cont .fb_url {
|
680 |
+
clear: both;
|
681 |
+
}
|
682 |
+
|
683 |
+
.inr_cont .fb_url .checkbox,
|
684 |
+
.inr_cont .fb_url input.add,
|
685 |
+
.inr_cont .fb_url label,
|
686 |
+
.inr_cont .fb_url lable {
|
687 |
+
float: left;
|
688 |
+
}
|
689 |
+
|
690 |
+
.inr_cont .fb_url input.add {
|
691 |
+
margin-left: 19px;
|
692 |
+
}
|
693 |
+
|
694 |
+
.inr_cont .fb_url .checkbox {
|
695 |
+
margin: 6px 0 0;
|
696 |
+
}
|
697 |
+
|
698 |
+
.inr_cont .fb_url label {
|
699 |
+
/*line-height: 41px; margin: 0 0 0 15px;*/
|
700 |
+
line-height: 22px;
|
701 |
+
margin: 10px 0 0 15px;
|
702 |
+
font-size: 17px;
|
703 |
+
}
|
704 |
+
|
705 |
+
.inr_cont textarea.add_txt {
|
706 |
+
resize: none;
|
707 |
+
margin: 0 0 0 19px !important;
|
708 |
+
height: 60px;
|
709 |
+
}
|
710 |
+
|
711 |
+
.tab2 .inr_cont textarea.add_txt {
|
712 |
+
width: 382px !important;
|
713 |
+
height: 90px;
|
714 |
+
overflow: hidden;
|
715 |
+
}
|
716 |
+
|
717 |
+
.tab2 .inr_cont input.add {
|
718 |
+
width: 417px;
|
719 |
+
}
|
720 |
+
|
721 |
+
.red_txt,
|
722 |
+
.tab2 .red_txt {
|
723 |
+
color: #ef4745 !important;
|
724 |
+
text-align: center !important;
|
725 |
+
padding-top: 5px !important;
|
726 |
+
}
|
727 |
+
|
728 |
+
.green_txt {
|
729 |
+
color: #12A252 !important;
|
730 |
+
text-align: center !important;
|
731 |
+
padding-top: 5px !important;
|
732 |
+
}
|
733 |
+
|
734 |
+
.red_txt {
|
735 |
+
color: #f80000 !important;
|
736 |
+
text-align: center !important;
|
737 |
+
padding-top: 5px !important;
|
738 |
+
}
|
739 |
+
|
740 |
+
.linked_tab_2 .fb_url label {
|
741 |
+
/* width: 32%;*/
|
742 |
+
/* width: 26.99%;*/
|
743 |
+
width: 22%;
|
744 |
+
}
|
745 |
+
|
746 |
+
.twt_tab_2 label {
|
747 |
+
width: 18%
|
748 |
+
}
|
749 |
+
|
750 |
+
.bdr_top {
|
751 |
+
border-top: none !important;
|
752 |
+
}
|
753 |
+
|
754 |
+
.linked_tab_2 .fb_url input.link_dbl {
|
755 |
+
margin-bottom: 6px;
|
756 |
+
}
|
757 |
+
|
758 |
+
.tab3 {
|
759 |
+
overflow: hidden;
|
760 |
+
}
|
761 |
+
|
762 |
+
.tab3 .row {
|
763 |
+
/*border-top: 1px solid #EAEBEE;*/
|
764 |
+
padding: 25px 0;
|
765 |
+
clear: both;
|
766 |
+
overflow: hidden;
|
767 |
+
}
|
768 |
+
|
769 |
+
.tab3 ul.tab_3_list {
|
770 |
+
overflow: hidden;
|
771 |
+
margin: 4px 0 11px;
|
772 |
+
}
|
773 |
+
|
774 |
+
ul.tab_3_list li {
|
775 |
+
background: url(../images/tab_3_list_bg.jpg) 13px 7px no-repeat;
|
776 |
+
padding: 0 0 0 30px;
|
777 |
+
color: #778088;
|
778 |
+
font-family: helveticaregular;
|
779 |
+
font-size: 17px;
|
780 |
+
margin-bottom: 4px;
|
781 |
+
}
|
782 |
+
|
783 |
+
.tab5 ul.tab_3_list li {
|
784 |
+
background: url(../images/tab_3_list_bg.jpg) 13px 18px no-repeat;
|
785 |
+
}
|
786 |
+
|
787 |
+
.tab3 .row h3 {
|
788 |
+
/* margin: 0 0 20px;*/
|
789 |
+
margin: 20px 0 0px;
|
790 |
+
color: #414951;
|
791 |
+
font-family: helveticabold;
|
792 |
+
font-size: 20px;
|
793 |
+
}
|
794 |
+
|
795 |
+
ul.tab_3_icns {
|
796 |
+
list-style: none;
|
797 |
+
margin: 10px 0 0;
|
798 |
+
overflow: hidden;
|
799 |
+
}
|
800 |
+
|
801 |
+
ul.tab_3_icns li {
|
802 |
+
width: 100%;
|
803 |
+
margin: 0 0 21px;
|
804 |
+
float: left;
|
805 |
+
}
|
806 |
+
|
807 |
+
ul.tab_3_icns label {
|
808 |
+
float: left;
|
809 |
+
line-height: 42px;
|
810 |
+
/*margin: 0 20px;*/
|
811 |
+
color: #69737C;
|
812 |
+
font-size: 18px;
|
813 |
+
font-family: helveticaregular;
|
814 |
+
min-width: 125px;
|
815 |
+
}
|
816 |
+
|
817 |
+
ul.tab_3_icns li .icns_tab_3,
|
818 |
+
ul.tab_3_icns li .radio {
|
819 |
+
float: left;
|
820 |
+
}
|
821 |
+
|
822 |
+
.tab3 .sub_row h4 {
|
823 |
+
color: #a4a9ad !important;
|
824 |
+
}
|
825 |
+
|
826 |
+
.tab3 .sub_row p {
|
827 |
+
padding-top: 18px !important;
|
828 |
+
clear: both;
|
829 |
+
overflow: hidden;
|
830 |
+
}
|
831 |
+
|
832 |
+
.sub_row .sub_sub_box p {
|
833 |
+
padding-top: 18px !important;
|
834 |
+
}
|
835 |
+
|
836 |
+
.tab3 .sub_row .checkbox {
|
837 |
+
float: left;
|
838 |
+
margin-top: 4px;
|
839 |
+
}
|
840 |
+
|
841 |
+
.tab3 .sub_row .sub_sub_box {
|
842 |
+
width: 80%;
|
843 |
+
margin: 7px 0 15px 10%;
|
844 |
+
float: left;
|
845 |
+
}
|
846 |
+
|
847 |
+
.tab3 .sub_row input.smal_inpt {
|
848 |
+
width: 73px;
|
849 |
+
background: #e5e5e5;
|
850 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
851 |
+
border: 0;
|
852 |
+
padding: 10px;
|
853 |
+
float: left;
|
854 |
+
margin-left: 10px;
|
855 |
+
}
|
856 |
+
|
857 |
+
.tab3 .sub_row .drop_lst {
|
858 |
+
border: 1px solid #d6d6d6;
|
859 |
+
font-size: 16px;
|
860 |
+
color: #5a6570;
|
861 |
+
width: 120px;
|
862 |
+
}
|
863 |
+
|
864 |
+
.tab3 .first_row,
|
865 |
+
.tab3 .first_row p,
|
866 |
+
.tab3 .first_row p .radio,
|
867 |
+
.tab3 .first_row p label {
|
868 |
+
float: left;
|
869 |
+
}
|
870 |
+
|
871 |
+
.tab3 .first_row {
|
872 |
+
width: 90%;
|
873 |
+
float: left;
|
874 |
+
}
|
875 |
+
|
876 |
+
.tab3 .first_row p {
|
877 |
+
padding: 0 !important;
|
878 |
+
}
|
879 |
+
|
880 |
+
.tab3 .first_row p label {
|
881 |
+
line-height: 44px;
|
882 |
+
margin: 0 10px;
|
883 |
+
}
|
884 |
+
|
885 |
+
.tab3 .first_row p:last-child {
|
886 |
+
margin-left: 27%
|
887 |
+
}
|
888 |
+
|
889 |
+
.tab3 .tab_1_sav {
|
890 |
+
padding-top: 20px !important;
|
891 |
+
margin: 10px auto 20px;
|
892 |
+
}
|
893 |
+
|
894 |
+
.suc_msg {
|
895 |
+
background: #12A252;
|
896 |
+
color: #FFF;
|
897 |
+
display: none;
|
898 |
+
font-size: 23px;
|
899 |
+
padding: 10px;
|
900 |
+
text-align: left;
|
901 |
+
text-decoration: none;
|
902 |
+
}
|
903 |
+
|
904 |
+
.error_msg {
|
905 |
+
background: #D22B30;
|
906 |
+
color: #FFF;
|
907 |
+
display: none;
|
908 |
+
font-size: 23px;
|
909 |
+
padding: 10px;
|
910 |
+
text-align: left;
|
911 |
+
text-decoration: none;
|
912 |
+
}
|
913 |
+
|
914 |
+
.fileUPInput {
|
915 |
+
cursor: pointer;
|
916 |
+
position: relative;
|
917 |
+
top: -43px;
|
918 |
+
right: 0;
|
919 |
+
z-index: 99;
|
920 |
+
height: 42px;
|
921 |
+
font-size: 5px;
|
922 |
+
opacity: 0;
|
923 |
+
-moz-opacity: 0;
|
924 |
+
filter: alpha(opacity=0);
|
925 |
+
width: 100%
|
926 |
+
}
|
927 |
+
|
928 |
+
.inputWrapper {
|
929 |
+
height: 20px;
|
930 |
+
width: 50px;
|
931 |
+
overflow: hidden;
|
932 |
+
position: relative;
|
933 |
+
cursor: pointer;
|
934 |
+
}
|
935 |
+
|
936 |
+
.custom-txt {
|
937 |
+
background: none !important;
|
938 |
+
padding-left: 2px !important;
|
939 |
+
}
|
940 |
+
|
941 |
+
.custom-img {
|
942 |
+
float: left;
|
943 |
+
margin-left: 20px;
|
944 |
+
}
|
945 |
+
|
946 |
+
.loader-img {
|
947 |
+
float: left;
|
948 |
+
margin-left: -70px;
|
949 |
+
display: none;
|
950 |
+
}
|
951 |
+
|
952 |
+
.pop-overlay {
|
953 |
+
position: fixed;
|
954 |
+
top: 0;
|
955 |
+
left: 0;
|
956 |
+
width: 100%;
|
957 |
+
height: 100%;
|
958 |
+
backgound-color: #d3d3d3;
|
959 |
+
z-index: 10;
|
960 |
+
padding: 20px;
|
961 |
+
display: none;
|
962 |
+
}
|
963 |
+
|
964 |
+
.fb-overlay {
|
965 |
+
position: fixed;
|
966 |
+
top: 0;
|
967 |
+
left: 0;
|
968 |
+
width: 100%;
|
969 |
+
height: 100%;
|
970 |
+
backgound-color: #d3d3d3;
|
971 |
+
z-index: -1000;
|
972 |
+
padding: 20px;
|
973 |
+
opacity: 0;
|
974 |
+
display: block;
|
975 |
+
}
|
976 |
+
|
977 |
+
.inputError {
|
978 |
+
border: 1px solid #f80000 !important;
|
979 |
+
}
|
980 |
+
|
981 |
+
.sfsicloseBtn {
|
982 |
+
position: absolute;
|
983 |
+
top: 0;
|
984 |
+
right: 0;
|
985 |
+
cursor: pointer;
|
986 |
+
}
|
987 |
+
|
988 |
+
.top_arow {
|
989 |
+
background: url(../images/top_aro.png) no-repeat;
|
990 |
+
position: absolute;
|
991 |
+
top: -29px;
|
992 |
+
left: 38%;
|
993 |
+
width: 33px;
|
994 |
+
height: 29px;
|
995 |
+
backgoround-color: #fff;
|
996 |
+
}
|
997 |
+
|
998 |
+
.sfsi_tool_tip_2 .top_arow .sfsi_inside,
|
999 |
+
.top_arow .sfsi_inside {
|
1000 |
+
float: left;
|
1001 |
+
}
|
1002 |
+
|
1003 |
+
.sfsi_tool_tip_2 .tool_tip>img,
|
1004 |
+
.tool_tip>img {
|
1005 |
+
display: inline-block;
|
1006 |
+
margin-right: 4px;
|
1007 |
+
float: left;
|
1008 |
+
}
|
1009 |
+
|
1010 |
+
.norm_row {
|
1011 |
+
float: left;
|
1012 |
+
min-width: 25px;
|
1013 |
+
}
|
1014 |
+
|
1015 |
+
.norm_row a {
|
1016 |
+
border: none;
|
1017 |
+
display: inline-block;
|
1018 |
+
position: relative;
|
1019 |
+
float: left;
|
1020 |
+
}
|
1021 |
+
|
1022 |
+
.sfsi_tool_tip_2 a {
|
1023 |
+
min-height: 0 !important;
|
1024 |
+
}
|
1025 |
+
|
1026 |
+
.sfsi_widget {
|
1027 |
+
min-height: 55px;
|
1028 |
+
}
|
1029 |
+
|
1030 |
+
.sfsi_widget a img {
|
1031 |
+
box-shadow: none !important;
|
1032 |
+
outline: 0;
|
1033 |
+
}
|
1034 |
+
|
1035 |
+
.sfsi_wicons {
|
1036 |
+
display: inline-block;
|
1037 |
+
color: #000;
|
1038 |
+
}
|
1039 |
+
|
1040 |
+
.sel-active {
|
1041 |
+
background-color: #f7941d;
|
1042 |
+
}
|
1043 |
+
|
1044 |
+
.sfsi_outr_div .close {
|
1045 |
+
position: absolute;
|
1046 |
+
right: 18px;
|
1047 |
+
top: 18px;
|
1048 |
+
}
|
1049 |
+
|
1050 |
+
.sfsi_outr_div h2 {
|
1051 |
+
color: #778088;
|
1052 |
+
font-family: helveticaregular;
|
1053 |
+
font-size: 26px;
|
1054 |
+
margin: 0 0 9px;
|
1055 |
+
padding: 0;
|
1056 |
+
text-align: center;
|
1057 |
+
font-weight: 400;
|
1058 |
+
}
|
1059 |
+
|
1060 |
+
.sfsi_outr_div ul li a {
|
1061 |
+
color: #5A6570;
|
1062 |
+
text-decoration: none;
|
1063 |
+
}
|
1064 |
+
|
1065 |
+
.sfsi_outr_div ul li {
|
1066 |
+
display: inline-block;
|
1067 |
+
list-style: none;
|
1068 |
+
margin: 0;
|
1069 |
+
padding: 0;
|
1070 |
+
float: none;
|
1071 |
+
}
|
1072 |
+
|
1073 |
+
.expanded-area {
|
1074 |
+
display: none;
|
1075 |
+
}
|
1076 |
+
|
1077 |
+
.sfsi_wicons a {
|
1078 |
+
-webkit-transition: all .2s ease-in-out;
|
1079 |
+
-moz-transition: all .2s ease-in-out;
|
1080 |
+
-o-transition: all .2s ease-in-out;
|
1081 |
+
-ms-transition: all .2s ease-in-out;
|
1082 |
+
}
|
1083 |
+
|
1084 |
+
.scale,
|
1085 |
+
.scale-div {
|
1086 |
+
-webkit-transform: scale(1.1);
|
1087 |
+
-moz-transform: scale(1.1);
|
1088 |
+
-o-transform: scale(1.1);
|
1089 |
+
transform: scale(1.1);
|
1090 |
+
}
|
1091 |
+
|
1092 |
+
.sfsi_Sicons {
|
1093 |
+
float: left;
|
1094 |
+
}
|
1095 |
+
|
1096 |
+
.sfsi_Sicons .sf_subscrbe {
|
1097 |
+
margin: 2px 3px 3px 0;
|
1098 |
+
line-height: 20px;
|
1099 |
+
}
|
1100 |
+
|
1101 |
+
.sfsi_Sicons .sf_fb {
|
1102 |
+
margin: 0 4px 0 5px;
|
1103 |
+
line-height: 20px;
|
1104 |
+
}
|
1105 |
+
|
1106 |
+
.sfsi_Sicons .sf_twiter {
|
1107 |
+
margin: 2px 7px 0 4px;
|
1108 |
+
line-height: 17px;
|
1109 |
+
}
|
1110 |
+
|
1111 |
+
.sfsi_Sicons.left .sf_subscrbe {
|
1112 |
+
margin: 2px 8px 3px 0;
|
1113 |
+
}
|
1114 |
+
|
1115 |
+
.sfsi_Sicons.left .sf_fb {
|
1116 |
+
margin: 0 8px 0 0;
|
1117 |
+
}
|
1118 |
+
|
1119 |
+
.sfsi_Sicons.left .sf_twiter {
|
1120 |
+
margin: 2px 7px 0 0;
|
1121 |
+
}
|
1122 |
+
|
1123 |
+
.sfsi_Sicons.right .sf_subscrbe {
|
1124 |
+
margin: 2px 0 3px;
|
1125 |
+
}
|
1126 |
+
|
1127 |
+
.sfsi_Sicons.right .sf_fb {
|
1128 |
+
margin: 0 0 0 7px;
|
1129 |
+
}
|
1130 |
+
|
1131 |
+
.sfsi_Sicons.right .sf_twiter {
|
1132 |
+
margin: 2px 0 0 8px;
|
1133 |
+
}
|
1134 |
+
|
1135 |
+
.sfsi_Sicons .sf_subscrbe,
|
1136 |
+
.sfsi_Sicons .sf_twiter {
|
1137 |
+
position: relative;
|
1138 |
+
width: 75px;
|
1139 |
+
}
|
1140 |
+
|
1141 |
+
.sfsi_Sicons .sf_twiter iframe {
|
1142 |
+
margin: 0px;
|
1143 |
+
height: 20px !important;
|
1144 |
+
overflow: visible !important;
|
1145 |
+
}
|
1146 |
+
|
1147 |
+
.sfsi_Sicons .sf_twiter iframe #widget {
|
1148 |
+
overflow: visible !important;
|
1149 |
+
}
|
1150 |
+
|
1151 |
+
.sfsi_Sicons .sf_subscrbe a {
|
1152 |
+
width: auto;
|
1153 |
+
float: left;
|
1154 |
+
border: medium none;
|
1155 |
+
padding-top: 0px;
|
1156 |
+
}
|
1157 |
+
|
1158 |
+
.sfsi_Sicons .sf_subscrbe a:focus {
|
1159 |
+
outline: medium none;
|
1160 |
+
}
|
1161 |
+
|
1162 |
+
.sfsi_Sicons .sf_subscrbe a img {
|
1163 |
+
width: 65px;
|
1164 |
+
float: left;
|
1165 |
+
height: 20px !important;
|
1166 |
+
}
|
1167 |
+
|
1168 |
+
.sfsi_Sicons .sf_fb {
|
1169 |
+
position: relative;
|
1170 |
+
width: 75px;
|
1171 |
+
}
|
1172 |
+
|
1173 |
+
.sfsi_Sicons .fb_iframe_widget {
|
1174 |
+
float: left;
|
1175 |
+
/*min-width: 98px;*/
|
1176 |
+
width: 73px;
|
1177 |
+
margin: 2px 0 0;
|
1178 |
+
}
|
1179 |
+
|
1180 |
+
.sfsi_pop_up .button a:hover {
|
1181 |
+
color: #fff;
|
1182 |
+
}
|
1183 |
+
|
1184 |
+
.sfsi_pop_up .button:hover {
|
1185 |
+
background: #12a252;
|
1186 |
+
color: #fff;
|
1187 |
+
border: none;
|
1188 |
+
}
|
1189 |
+
|
1190 |
+
ul.icn_listing li .right_info a {
|
1191 |
+
outline: 0;
|
1192 |
+
font-family: helveticaregular;
|
1193 |
+
}
|
1194 |
+
|
1195 |
+
.upload_pop_up .upload_butt {
|
1196 |
+
line-height: 27px;
|
1197 |
+
margin-left: 6px;
|
1198 |
+
}
|
1199 |
+
|
1200 |
+
.drop_lsts {
|
1201 |
+
left: 220px;
|
1202 |
+
position: relative;
|
1203 |
+
top: -40px;
|
1204 |
+
}
|
1205 |
+
|
1206 |
+
.drop_lsts .styled {
|
1207 |
+
top: -42px;
|
1208 |
+
width: 127px;
|
1209 |
+
height: 33px;
|
1210 |
+
}
|
1211 |
+
|
1212 |
+
.drop_lsts span {
|
1213 |
+
line-height: 50px;
|
1214 |
+
}
|
1215 |
+
|
1216 |
+
.drag_drp {
|
1217 |
+
left: 11px;
|
1218 |
+
position: relative;
|
1219 |
+
top: 38px;
|
1220 |
+
font-size: 17px;
|
1221 |
+
}
|
1222 |
+
|
1223 |
+
.listing ul li label {
|
1224 |
+
width: 224px;
|
1225 |
+
float: left;
|
1226 |
+
}
|
1227 |
+
|
1228 |
+
.row_onl {
|
1229 |
+
width: 100%;
|
1230 |
+
float: left;
|
1231 |
+
}
|
1232 |
+
|
1233 |
+
#sfsi_Show_popupOn_PageIDs option.sel-active {
|
1234 |
+
background: #f7941d;
|
1235 |
+
}
|
1236 |
+
|
1237 |
+
.sfsi_inside div iframe {
|
1238 |
+
float: left;
|
1239 |
+
margin: 0;
|
1240 |
+
}
|
1241 |
+
|
1242 |
+
.sfsi_inside div #___plus_0,
|
1243 |
+
.sfsi_inside div #___plusone_0 {
|
1244 |
+
height: 27px;
|
1245 |
+
}
|
1246 |
+
|
1247 |
+
.sfsi_outr_div li {
|
1248 |
+
float: left;
|
1249 |
+
}
|
1250 |
+
|
1251 |
+
.sfsi_tool_tip_2 .sfsi_inside div {
|
1252 |
+
min-height: 0;
|
1253 |
+
}
|
1254 |
+
|
1255 |
+
#___plus_1>iframe {
|
1256 |
+
height: 30px;
|
1257 |
+
}
|
1258 |
+
|
1259 |
+
.main_contant h1 {
|
1260 |
+
margin: 0 0 19px;
|
1261 |
+
}
|
1262 |
+
|
1263 |
+
.main_contant p {
|
1264 |
+
margin: 0 0 26px;
|
1265 |
+
}
|
1266 |
+
|
1267 |
+
.main_contant p>a {
|
1268 |
+
color: #1a1d20;
|
1269 |
+
text-decoration: underline;
|
1270 |
+
}
|
1271 |
+
|
1272 |
+
.tab1 .gary_bg {
|
1273 |
+
background: #f1f1f1;
|
1274 |
+
}
|
1275 |
+
|
1276 |
+
#accordion {
|
1277 |
+
margin-top: 25px;
|
1278 |
+
}
|
1279 |
+
|
1280 |
+
.main_contant p>a,
|
1281 |
+
.tab1 p span {
|
1282 |
+
font-family: helveticabold;
|
1283 |
+
}
|
1284 |
+
|
1285 |
+
.wapper .ui-accordion-header-active {
|
1286 |
+
margin-top: 20px !important;
|
1287 |
+
}
|
1288 |
+
|
1289 |
+
.wapper .tab2 {
|
1290 |
+
padding: 20px 33px 12px 34px !important;
|
1291 |
+
}
|
1292 |
+
|
1293 |
+
.wapper .tab2 p {
|
1294 |
+
margin-bottom: 6px;
|
1295 |
+
}
|
1296 |
+
|
1297 |
+
.tab2 .twt_tab_2 label {
|
1298 |
+
width: 175px;
|
1299 |
+
}
|
1300 |
+
|
1301 |
+
.tab2 .twt_fld {
|
1302 |
+
margin: 16px 0 23px;
|
1303 |
+
float: left;
|
1304 |
+
}
|
1305 |
+
|
1306 |
+
.tab2 .twt_fld_2 {
|
1307 |
+
margin: 0 0 12px;
|
1308 |
+
float: left;
|
1309 |
+
}
|
1310 |
+
|
1311 |
+
.tab2 .utube_inn {
|
1312 |
+
padding-bottom: 2px;
|
1313 |
+
float: left;
|
1314 |
+
}
|
1315 |
+
|
1316 |
+
.tab2 .utube_inn label {
|
1317 |
+
max-width: 90%
|
1318 |
+
}
|
1319 |
+
|
1320 |
+
.tab2 .utube_inn label span {
|
1321 |
+
font-family: helveticabold;
|
1322 |
+
}
|
1323 |
+
|
1324 |
+
.tab2 .inr_cont p>a {
|
1325 |
+
font-family: helveticaneue-light;
|
1326 |
+
color: #778088;
|
1327 |
+
text-decoration: underline;
|
1328 |
+
}
|
1329 |
+
|
1330 |
+
.pinterest_section .inr_cont .pint_url {
|
1331 |
+
float: left;
|
1332 |
+
padding-top: 6px;
|
1333 |
+
clear: both;
|
1334 |
+
}
|
1335 |
+
|
1336 |
+
.pinterest_section .inr_cont .add {
|
1337 |
+
width: 417px !important;
|
1338 |
+
}
|
1339 |
+
|
1340 |
+
.linkedin_section .link_1,
|
1341 |
+
.linkedin_section .link_2,
|
1342 |
+
.linkedin_section .link_3,
|
1343 |
+
.linkedin_section .link_4 {
|
1344 |
+
float: left;
|
1345 |
+
width: 100%
|
1346 |
+
}
|
1347 |
+
|
1348 |
+
.linkedin_section .link_1 input.add,
|
1349 |
+
.linkedin_section .link_2 input.add,
|
1350 |
+
.linkedin_section .link_3 input.add,
|
1351 |
+
.linkedin_section .link_4 input.add {
|
1352 |
+
width: 417px;
|
1353 |
+
}
|
1354 |
+
|
1355 |
+
.linkedin_section .link_1 {
|
1356 |
+
margin-bottom: 7px;
|
1357 |
+
}
|
1358 |
+
|
1359 |
+
.linkedin_section .link_2 {
|
1360 |
+
margin-bottom: 12px;
|
1361 |
+
}
|
1362 |
+
|
1363 |
+
.linkedin_section .link_3,
|
1364 |
+
.linkedin_section .link_4 {
|
1365 |
+
margin-bottom: 13px;
|
1366 |
+
}
|
1367 |
+
|
1368 |
+
.tab2 .linkedin_section .link_4 {
|
1369 |
+
margin-bottom: 0;
|
1370 |
+
}
|
1371 |
+
|
1372 |
+
ul.tab_3_list li span {
|
1373 |
+
font-family: helveticaregular;
|
1374 |
+
}
|
1375 |
+
|
1376 |
+
#accordion .tab4 h4,
|
1377 |
+
#accordion1 .tab4 h4 {
|
1378 |
+
color: #414951;
|
1379 |
+
font-size: 20px;
|
1380 |
+
}
|
1381 |
+
|
1382 |
+
.specify_counts .listing li .input {
|
1383 |
+
width: 73px;
|
1384 |
+
}
|
1385 |
+
|
1386 |
+
.sfsi_fbpgidwpr {
|
1387 |
+
width: 160px;
|
1388 |
+
float: left;
|
1389 |
+
font-weight: bold;
|
1390 |
+
font-size: 17px;
|
1391 |
+
color: #000000;
|
1392 |
+
}
|
1393 |
+
|
1394 |
+
.sfsi_fbpgiddesc {
|
1395 |
+
font-weight: normal;
|
1396 |
+
width: 42%;
|
1397 |
+
font-size: 14px;
|
1398 |
+
color: #888888;
|
1399 |
+
padding: 4px 0 0 60px;
|
1400 |
+
}
|
1401 |
+
|
1402 |
+
.specify_counts .listing li .input.mypginpt {
|
1403 |
+
width: 288px;
|
1404 |
+
}
|
1405 |
+
|
1406 |
+
.tab3 .Shuffle_auto .sub_sub_box .tab_3_option {
|
1407 |
+
padding-top: 0 !important;
|
1408 |
+
margin-bottom: 10px !important;
|
1409 |
+
}
|
1410 |
+
|
1411 |
+
.tab4 {
|
1412 |
+
padding-top: 35px !important;
|
1413 |
+
}
|
1414 |
+
|
1415 |
+
.tab4 .save_button {
|
1416 |
+
padding-top: 46px;
|
1417 |
+
}
|
1418 |
+
|
1419 |
+
.tab5 {
|
1420 |
+
padding-top: 31px !important;
|
1421 |
+
}
|
1422 |
+
|
1423 |
+
.tab7 {
|
1424 |
+
padding-top: 28px !important;
|
1425 |
+
}
|
1426 |
+
|
1427 |
+
.tab5 .row_onl {
|
1428 |
+
margin-top: 15px;
|
1429 |
+
}
|
1430 |
+
|
1431 |
+
.tab5 .sticking .link>a {
|
1432 |
+
color: #a4a9ad;
|
1433 |
+
text-decoration: underline;
|
1434 |
+
}
|
1435 |
+
|
1436 |
+
.tab5 .mouse_txt h4 {
|
1437 |
+
/*margin-bottom: 8px!important;*/
|
1438 |
+
padding-bottom: 30px !important;
|
1439 |
+
}
|
1440 |
+
|
1441 |
+
.tab5 .save_button {
|
1442 |
+
padding-top: 54px;
|
1443 |
+
}
|
1444 |
+
|
1445 |
+
.tab7 .like_pop_box h2 {
|
1446 |
+
font-family: helveticabold;
|
1447 |
+
text-align: center;
|
1448 |
+
color: #414951;
|
1449 |
+
font-size: 26px;
|
1450 |
+
}
|
1451 |
+
|
1452 |
+
.tab1 ul.icn_listing li .right_info label:hover {
|
1453 |
+
text-decoration: none !important;
|
1454 |
+
}
|
1455 |
+
|
1456 |
+
.tab1 ul.icn_listing li .right_info label.expanded-area {
|
1457 |
+
clear: both;
|
1458 |
+
float: left;
|
1459 |
+
margin-top: 14px;
|
1460 |
+
width: 100%;
|
1461 |
+
}
|
1462 |
+
|
1463 |
+
.tab7 .space {
|
1464 |
+
margin-top: 14px;
|
1465 |
+
}
|
1466 |
+
|
1467 |
+
.tab7 .pop_up_show label {
|
1468 |
+
font-family: helveticaregular !important;
|
1469 |
+
}
|
1470 |
+
|
1471 |
+
.tab7 .save_button {
|
1472 |
+
padding-top: 78px;
|
1473 |
+
}
|
1474 |
+
|
1475 |
+
.like_txt a {
|
1476 |
+
text-decoration: none;
|
1477 |
+
font-family: helveticaregular;
|
1478 |
+
}
|
1479 |
+
|
1480 |
+
.bdr_btm_non {
|
1481 |
+
border-bottom: none !important;
|
1482 |
+
}
|
1483 |
+
|
1484 |
+
.tab1 .tab_1_sav {
|
1485 |
+
padding-top: 13px;
|
1486 |
+
}
|
1487 |
+
|
1488 |
+
#accordion .tab2 .facebook_section .inr_cont p.extra_sp,
|
1489 |
+
#accordion1 .tab2 .facebook_section .inr_cont p.extra_sp {
|
1490 |
+
padding-top: 7px;
|
1491 |
+
}
|
1492 |
+
|
1493 |
+
.tab2 .custom_section {
|
1494 |
+
width: 100%
|
1495 |
+
}
|
1496 |
+
|
1497 |
+
.tab7 {
|
1498 |
+
padding-bottom: 40px !important;
|
1499 |
+
}
|
1500 |
+
|
1501 |
+
.tab9 .save_button {
|
1502 |
+
padding-top: 40px;
|
1503 |
+
}
|
1504 |
+
|
1505 |
+
.tab9 .save_button a {
|
1506 |
+
padding: 16px 0;
|
1507 |
+
}
|
1508 |
+
|
1509 |
+
.tab2 .twitter_section .twt_fld input.add,
|
1510 |
+
.tab2 .twitter_section .twt_fld_2 textarea.add_txt {
|
1511 |
+
width: 464px !important;
|
1512 |
+
}
|
1513 |
+
|
1514 |
+
.tab2 .utube_inn .fb_url label span {
|
1515 |
+
font-family: helveticaneue-light;
|
1516 |
+
}
|
1517 |
+
|
1518 |
+
.tab1 label,
|
1519 |
+
.tab2 label,
|
1520 |
+
.tab3 label,
|
1521 |
+
.tab4 label,
|
1522 |
+
.tab5 label,
|
1523 |
+
.tab6 label,
|
1524 |
+
.tab7 label,
|
1525 |
+
.tab8 label {
|
1526 |
+
cursor: default !important;
|
1527 |
+
}
|
1528 |
+
|
1529 |
+
.tab5 .new_wind h4 {
|
1530 |
+
margin-bottom: 11px !important;
|
1531 |
+
}
|
1532 |
+
|
1533 |
+
.pop_up_box .fb_2 span {
|
1534 |
+
height: 28px !important;
|
1535 |
+
}
|
1536 |
+
|
1537 |
+
.pop_up_box .sfsi_tool_tip_2 .fbb .fb_1 a {
|
1538 |
+
margin-top: 0;
|
1539 |
+
}
|
1540 |
+
|
1541 |
+
.tab6 .social_icon_like1 ul li span {
|
1542 |
+
margin-top: -1px;
|
1543 |
+
}
|
1544 |
+
|
1545 |
+
#sfpageLoad {
|
1546 |
+
background: url(../images/ajax-loader.gif) 50% 50% no-repeat #F9F9F9;
|
1547 |
+
height: 100%;
|
1548 |
+
left: 160px;
|
1549 |
+
opacity: 1;
|
1550 |
+
position: fixed;
|
1551 |
+
top: 0;
|
1552 |
+
width: 92%;
|
1553 |
+
z-index: 9999;
|
1554 |
+
}
|
1555 |
+
|
1556 |
+
.sfsi_tool_tip_2,
|
1557 |
+
.tool_tip {
|
1558 |
+
background: #FFF;
|
1559 |
+
border: 1px solid #e7e7e7;
|
1560 |
+
box-shadow: #e7e7e7 0 0 2px 1px;
|
1561 |
+
display: block;
|
1562 |
+
float: left;
|
1563 |
+
margin: 0 0 0 -52px;
|
1564 |
+
padding: 5px 14px 5px 14px;
|
1565 |
+
position: absolute;
|
1566 |
+
z-index: 10000;
|
1567 |
+
border-bottom: #e5e5e5 solid 4px;
|
1568 |
+
width: 100px;
|
1569 |
+
}
|
1570 |
+
|
1571 |
+
.sfsi_tool_tip_2 {
|
1572 |
+
display: inline-table;
|
1573 |
+
}
|
1574 |
+
|
1575 |
+
.inerCnt,
|
1576 |
+
.inerCnt:hover,
|
1577 |
+
.inerCnt>a,
|
1578 |
+
.inerCnt>a:hover,
|
1579 |
+
.widget-area .widget a {
|
1580 |
+
outline: 0;
|
1581 |
+
}
|
1582 |
+
|
1583 |
+
.sfsi_tool_tip_2_inr {
|
1584 |
+
bottom: 90%;
|
1585 |
+
left: 20%;
|
1586 |
+
opacity: 0;
|
1587 |
+
}
|
1588 |
+
|
1589 |
+
.sfsi_tool_tip_2 .bot_arow {
|
1590 |
+
background: url(../images/bot_tip_icn.png) no-repeat;
|
1591 |
+
position: absolute;
|
1592 |
+
bottom: -21px;
|
1593 |
+
left: 50%;
|
1594 |
+
width: 15px;
|
1595 |
+
height: 21px;
|
1596 |
+
margin-left: -5px;
|
1597 |
+
}
|
1598 |
+
|
1599 |
+
.sfsi_tool_tip_2 .top_big_arow {
|
1600 |
+
position: absolute;
|
1601 |
+
-webkit-transform: rotate(180deg);
|
1602 |
+
-moz-transform: rotate(180deg);
|
1603 |
+
-ms-transform: rotate(180deg);
|
1604 |
+
-o-transform: rotate(180deg);
|
1605 |
+
transform: rotate(180deg);
|
1606 |
+
top: -21px;
|
1607 |
+
left: 50%;
|
1608 |
+
width: 15px;
|
1609 |
+
height: 21px;
|
1610 |
+
margin-right: -5px;
|
1611 |
+
}
|
1612 |
+
|
1613 |
+
.sfsi_tool_tip_2_inr .gpls_visit>a,
|
1614 |
+
.sfsi_tool_tip_2_inr .prints_visit_1 a,
|
1615 |
+
.sfsi_tool_tip_2_inr .utub_visit>a {
|
1616 |
+
margin-top: 0;
|
1617 |
+
}
|
1618 |
+
|
1619 |
+
.sfsi_tool_tip_2_inr .linkin_1 a,
|
1620 |
+
.sfsi_tool_tip_2_inr .linkin_2 a,
|
1621 |
+
.sfsi_tool_tip_2_inr .linkin_3 a,
|
1622 |
+
.sfsi_tool_tip_2_inr .linkin_4 a,
|
1623 |
+
.sfsi_tool_tip_2_inr .prints_visit a {
|
1624 |
+
margin: 0;
|
1625 |
+
}
|
1626 |
+
|
1627 |
+
.sfsiTlleftBig {
|
1628 |
+
bottom: 121%;
|
1629 |
+
left: 22%;
|
1630 |
+
margin-left: -54%
|
1631 |
+
}
|
1632 |
+
|
1633 |
+
.sfsiTlleft {
|
1634 |
+
bottom: 100%;
|
1635 |
+
left: 50%;
|
1636 |
+
margin-left: -66px;
|
1637 |
+
margin-bottom: 2px;
|
1638 |
+
}
|
1639 |
+
|
1640 |
+
.sfsi_plc_btm {
|
1641 |
+
bottom: auto;
|
1642 |
+
top: 100%;
|
1643 |
+
left: 50%;
|
1644 |
+
margin-left: -63px;
|
1645 |
+
margin-top: -6px;
|
1646 |
+
margin-bottom: auto;
|
1647 |
+
}
|
1648 |
+
|
1649 |
+
.inerCnt {
|
1650 |
+
position: relative;
|
1651 |
+
z-index: inherit !important;
|
1652 |
+
float: left;
|
1653 |
+
width: 100%;
|
1654 |
+
float: left;
|
1655 |
+
}
|
1656 |
+
|
1657 |
+
.sfsi_wicons {
|
1658 |
+
margin-bottom: 30px;
|
1659 |
+
position: relative;
|
1660 |
+
padding-top: 5px;
|
1661 |
+
}
|
1662 |
+
|
1663 |
+
.norm_row .bot_no {
|
1664 |
+
position: absolute;
|
1665 |
+
padding: 1px 0;
|
1666 |
+
font-size: 12px !important;
|
1667 |
+
text-align: center;
|
1668 |
+
line-height: 12px !important;
|
1669 |
+
background: #fff;
|
1670 |
+
border-radius: 5px;
|
1671 |
+
left: 50%;
|
1672 |
+
margin-left: -20px;
|
1673 |
+
z-index: 9;
|
1674 |
+
border: 1px solid #333;
|
1675 |
+
top: 100%;
|
1676 |
+
white-space: pre;
|
1677 |
+
-webkit-box-sizing: border-box;
|
1678 |
+
-moz-box-sizing: border-box;
|
1679 |
+
box-sizing: border-box;
|
1680 |
+
margin-top: 0px;
|
1681 |
+
width: 40px;
|
1682 |
+
}
|
1683 |
+
|
1684 |
+
.norm_row .bot_no:before {
|
1685 |
+
content: url(images/count_top_arow.png);
|
1686 |
+
position: absolute;
|
1687 |
+
height: 9px;
|
1688 |
+
margin-left: -7.5px;
|
1689 |
+
top: -10px;
|
1690 |
+
left: 50%;
|
1691 |
+
width: 15px;
|
1692 |
+
}
|
1693 |
+
|
1694 |
+
.bot_no.sfsiSmBtn {
|
1695 |
+
font-size: 10px;
|
1696 |
+
margin-top: 4px;
|
1697 |
+
}
|
1698 |
+
|
1699 |
+
.bot_no.sfsiSmBtn:before {
|
1700 |
+
margin-left: -8px;
|
1701 |
+
top: -9px;
|
1702 |
+
}
|
1703 |
+
|
1704 |
+
.norm_row .cbtn_vsmall {
|
1705 |
+
font-size: 9px;
|
1706 |
+
left: -28%;
|
1707 |
+
top: 4px;
|
1708 |
+
}
|
1709 |
+
|
1710 |
+
.norm_row .cbtn_vsmall:before {
|
1711 |
+
left: 31%;
|
1712 |
+
top: -9px;
|
1713 |
+
margin-left: -31%
|
1714 |
+
}
|
1715 |
+
|
1716 |
+
h2.optional {
|
1717 |
+
font-family: helveticaregular;
|
1718 |
+
font-size: 25px;
|
1719 |
+
margin: 14px 0 19px;
|
1720 |
+
color: #5a6570;
|
1721 |
+
}
|
1722 |
+
|
1723 |
+
.utube_tool_bdr .utub_visit {
|
1724 |
+
margin: 9px 0 0;
|
1725 |
+
height: 24px;
|
1726 |
+
display: inline-block;
|
1727 |
+
float: none;
|
1728 |
+
}
|
1729 |
+
|
1730 |
+
.utube_tool_bdr .utub_2 {
|
1731 |
+
margin: 9px 0 0;
|
1732 |
+
height: 24px;
|
1733 |
+
width: 86px;
|
1734 |
+
display: inline-block;
|
1735 |
+
float: none;
|
1736 |
+
}
|
1737 |
+
|
1738 |
+
.printst_tool_bdr {
|
1739 |
+
width: 79px;
|
1740 |
+
}
|
1741 |
+
|
1742 |
+
.printst_tool_bdr .prints_visit {
|
1743 |
+
margin: 0 0 10px -22px;
|
1744 |
+
}
|
1745 |
+
|
1746 |
+
.printst_tool_bdr .prints_visit_1 {
|
1747 |
+
margin: 0 0 0 -53px;
|
1748 |
+
}
|
1749 |
+
|
1750 |
+
.fb_tool_bdr {
|
1751 |
+
width: 68px;
|
1752 |
+
height: auto;
|
1753 |
+
}
|
1754 |
+
|
1755 |
+
.fb_tool_bdr .sfsi_inside {
|
1756 |
+
text-align: center;
|
1757 |
+
width: 100%;
|
1758 |
+
float: left;
|
1759 |
+
overflow: hidden;
|
1760 |
+
}
|
1761 |
+
|
1762 |
+
.fb_tool_bdr .sfsi_inside .icon1 {
|
1763 |
+
/* margin: 0 0 -5px 0;*/
|
1764 |
+
margin: 2px 0px 4px 0;
|
1765 |
+
height: auto;
|
1766 |
+
display: inline-block;
|
1767 |
+
float: none;
|
1768 |
+
width: 62px;
|
1769 |
+
}
|
1770 |
+
|
1771 |
+
.fb_tool_bdr .sfsi_inside .icon2 {
|
1772 |
+
margin: 2px 0 3px 0 !important;
|
1773 |
+
height: auto;
|
1774 |
+
width: 53px;
|
1775 |
+
display: inline-block;
|
1776 |
+
overflow: hidden;
|
1777 |
+
}
|
1778 |
+
|
1779 |
+
.fb_tool_bdr .sfsi_inside .icon3 {
|
1780 |
+
margin: 2px 0 2px 0;
|
1781 |
+
height: auto;
|
1782 |
+
width: 62px;
|
1783 |
+
display: inline-block;
|
1784 |
+
float: none;
|
1785 |
+
}
|
1786 |
+
|
1787 |
+
.fb_tool_bdr .sfsi_inside .fb_1,
|
1788 |
+
.fb_tool_bdr .sfsi_inside .fb_2,
|
1789 |
+
.fb_tool_bdr .sfsi_inside .fb_3 {
|
1790 |
+
margin: 9px 0 0;
|
1791 |
+
height: 25px;
|
1792 |
+
}
|
1793 |
+
|
1794 |
+
.printst_tool_bdr .sfsi_inside {
|
1795 |
+
text-align: center;
|
1796 |
+
float: left;
|
1797 |
+
width: 100%
|
1798 |
+
}
|
1799 |
+
|
1800 |
+
.printst_tool_bdr .sfsi_inside .icon1 {
|
1801 |
+
/* margin: 2px 0;*/
|
1802 |
+
margin: 3px 0 3px 0;
|
1803 |
+
/* height: 24px;*/
|
1804 |
+
height: auto;
|
1805 |
+
display: inline-block;
|
1806 |
+
float: none;
|
1807 |
+
width: 73px;
|
1808 |
+
}
|
1809 |
+
|
1810 |
+
.printst_tool_bdr .sfsi_inside .icon2 {
|
1811 |
+
/* margin: 2px 0;*/
|
1812 |
+
margin: 2px 0 2px 0;
|
1813 |
+
height: auto;
|
1814 |
+
display: inline-block;
|
1815 |
+
float: none;
|
1816 |
+
max-width: 73px;
|
1817 |
+
width: auto;
|
1818 |
+
}
|
1819 |
+
|
1820 |
+
.printst_tool_bdr .sfsi_inside .prints_visit,
|
1821 |
+
.printst_tool_bdr .sfsi_inside .prints_visit_1 {
|
1822 |
+
margin: 9px 0 0;
|
1823 |
+
height: 20px;
|
1824 |
+
float: none;
|
1825 |
+
display: inline-block;
|
1826 |
+
}
|
1827 |
+
|
1828 |
+
.printst_tool_bdr {
|
1829 |
+
margin-left: -59px;
|
1830 |
+
}
|
1831 |
+
|
1832 |
+
.fb_tool_bdr .sfsi_inside .icon1>a>img,
|
1833 |
+
.gpls_tool_bdr .sfsi_inside .icon1>a>img,
|
1834 |
+
.linkedin_tool_bdr .sfsi_inside .icon1>a>img,
|
1835 |
+
.linkedin_tool_bdr .sfsi_inside .icon4>a>img,
|
1836 |
+
.printst_tool_bdr .sfsi_inside .icon1>a>img,
|
1837 |
+
.printst_tool_bdr .sfsi_inside .icon2>a>img,
|
1838 |
+
.utube_tool_bdr .sfsi_inside .icon1>a>img {
|
1839 |
+
padding-top: 0;
|
1840 |
+
}
|
1841 |
+
|
1842 |
+
.gpls_tool_bdr {
|
1843 |
+
width: 76px;
|
1844 |
+
}
|
1845 |
+
|
1846 |
+
.gpls_tool_bdr .sfsi_inside .icon1>a>img {
|
1847 |
+
padding-top: 0;
|
1848 |
+
}
|
1849 |
+
|
1850 |
+
.gpls_tool_bdr .sfsi_inside {
|
1851 |
+
text-align: center;
|
1852 |
+
width: 100%;
|
1853 |
+
float: left;
|
1854 |
+
}
|
1855 |
+
|
1856 |
+
.gpls_tool_bdr .sfsi_inside .icon1 {
|
1857 |
+
margin: 2px 0;
|
1858 |
+
display: inline-block;
|
1859 |
+
float: none;
|
1860 |
+
height: 29px;
|
1861 |
+
width: 76px;
|
1862 |
+
}
|
1863 |
+
|
1864 |
+
.gpls_tool_bdr .sfsi_inside .icon2 {
|
1865 |
+
margin: 2px 0 3px 0;
|
1866 |
+
display: inline-block;
|
1867 |
+
float: none;
|
1868 |
+
height: 24px;
|
1869 |
+
width: 38px;
|
1870 |
+
}
|
1871 |
+
|
1872 |
+
.gpls_tool_bdr .sfsi_inside .icon3 {
|
1873 |
+
margin: 3px 0 2px 0;
|
1874 |
+
display: inline-block;
|
1875 |
+
float: none;
|
1876 |
+
height: 24px;
|
1877 |
+
width: 76px;
|
1878 |
+
}
|
1879 |
+
|
1880 |
+
.gpls_tool_bdr .sfsi_inside .gpls_visit,
|
1881 |
+
.gpls_tool_bdr .sfsi_inside .gtalk_2,
|
1882 |
+
.gpls_tool_bdr .sfsi_inside .gtalk_3 {
|
1883 |
+
margin: 9px 0 0;
|
1884 |
+
height: 29px;
|
1885 |
+
}
|
1886 |
+
|
1887 |
+
.pop_up_box_ex.sfsi_pop_up .fb_tool_bdr,
|
1888 |
+
.gpls_tool_bdr,
|
1889 |
+
.linkedin_tool_bdr,
|
1890 |
+
.twt_tool_bdr {
|
1891 |
+
bottom: 100%;
|
1892 |
+
left: 50%;
|
1893 |
+
margin-bottom: -12px;
|
1894 |
+
}
|
1895 |
+
|
1896 |
+
.fb_tool_bdr,
|
1897 |
+
.gpls_tool_bdr,
|
1898 |
+
.linkedin_tool_bdr,
|
1899 |
+
.twt_tool_bdr {
|
1900 |
+
bottom: 100%;
|
1901 |
+
left: 50%;
|
1902 |
+
margin-bottom: 8px;
|
1903 |
+
}
|
1904 |
+
|
1905 |
+
.printst_tool_bdr {
|
1906 |
+
bottom: 80%;
|
1907 |
+
left: 50%;
|
1908 |
+
/* margin-bottom: 2px;*/
|
1909 |
+
margin-bottom: 0px;
|
1910 |
+
margin-bottom: 18px;
|
1911 |
+
}
|
1912 |
+
|
1913 |
+
.printst_tool_bdr {
|
1914 |
+
bottom: 80%;
|
1915 |
+
left: 50%;
|
1916 |
+
margin-bottom: 18px;
|
1917 |
+
}
|
1918 |
+
|
1919 |
+
.twt_tool_bdr .sfsi_inside {
|
1920 |
+
text-align: center;
|
1921 |
+
width: 100%;
|
1922 |
+
float: left;
|
1923 |
+
}
|
1924 |
+
|
1925 |
+
.twt_tool_bdr .sfsi_inside .cstmicon1 {
|
1926 |
+
margin: 2px 0px 2px 0 !important;
|
1927 |
+
/*margin: 2px 0!important; display: inline-block;*/
|
1928 |
+
float: none;
|
1929 |
+
width: 62px;
|
1930 |
+
/* overflow: hidden;*/
|
1931 |
+
/*height: 20px;*/
|
1932 |
+
}
|
1933 |
+
|
1934 |
+
.twt_tool_bdr .sfsi_inside .cstmicon1 a img {
|
1935 |
+
float: left;
|
1936 |
+
}
|
1937 |
+
|
1938 |
+
.twt_tool_bdr .sfsi_inside .icon1 {
|
1939 |
+
/*margin: -4px 0 -5px 0 !important;*/
|
1940 |
+
margin: 5px 0px 3px 0 !important;
|
1941 |
+
display: inline-block;
|
1942 |
+
float: none;
|
1943 |
+
width: 61px;
|
1944 |
+
/* overflow: hidden;*/
|
1945 |
+
height: auto;
|
1946 |
+
}
|
1947 |
+
|
1948 |
+
.twt_tool_bdr .sfsi_inside .icon1 iframe {
|
1949 |
+
width: 61px !important;
|
1950 |
+
}
|
1951 |
+
|
1952 |
+
.twt_tool_bdr .sfsi_inside .icon2 {
|
1953 |
+
margin: 3px 0px 2px 0px !important;
|
1954 |
+
display: inline-block;
|
1955 |
+
float: none;
|
1956 |
+
height: auto;
|
1957 |
+
width: 58px;
|
1958 |
+
}
|
1959 |
+
|
1960 |
+
.twt_tool_bdr .sfsi_inside .twt_1 {
|
1961 |
+
margin: 9px 0 0;
|
1962 |
+
display: inline-block;
|
1963 |
+
float: none;
|
1964 |
+
width: 58px;
|
1965 |
+
height: 20px;
|
1966 |
+
overflow: hidden;
|
1967 |
+
}
|
1968 |
+
|
1969 |
+
.twt_tool_bdr .sfsi_inside .twt_1 iframe {
|
1970 |
+
width: 100% !important;
|
1971 |
+
}
|
1972 |
+
|
1973 |
+
.twt_tool_bdr .sfsi_inside .twt_2 {
|
1974 |
+
margin: 9px 0 0;
|
1975 |
+
height: 20px;
|
1976 |
+
display: inline-block;
|
1977 |
+
float: none;
|
1978 |
+
width: 58px;
|
1979 |
+
}
|
1980 |
+
|
1981 |
+
.utube_tool_bdr .sfsi_inside {
|
1982 |
+
text-align: center;
|
1983 |
+
width: 100%;
|
1984 |
+
float: left;
|
1985 |
+
}
|
1986 |
+
|
1987 |
+
.utube_tool_bdr .sfsi_inside .icon1 {
|
1988 |
+
/*margin: 5px 0 0;*/
|
1989 |
+
margin: 4px 0px 3px 0;
|
1990 |
+
height: 24px;
|
1991 |
+
display: inline-block;
|
1992 |
+
float: none;
|
1993 |
+
width: 96px;
|
1994 |
+
}
|
1995 |
+
|
1996 |
+
.utube_tool_bdr .sfsi_inside .icon2 {
|
1997 |
+
/* margin: 9px 0 0;*/
|
1998 |
+
margin: 2px 0 3px 0 !important;
|
1999 |
+
height: 24px;
|
2000 |
+
display: inline-block;
|
2001 |
+
float: none;
|
2002 |
+
max-width: 96px;
|
2003 |
+
width: 82px;
|
2004 |
+
}
|
2005 |
+
|
2006 |
+
.pop-overlay.read-overlay.ytex-s2 .utube_tool_bdr {
|
2007 |
+
width: 93px;
|
2008 |
+
bottom: 100%;
|
2009 |
+
left: 50%;
|
2010 |
+
margin-bottom: -12px;
|
2011 |
+
}
|
2012 |
+
|
2013 |
+
.utube_tool_bdr {
|
2014 |
+
width: 93px;
|
2015 |
+
bottom: 100%;
|
2016 |
+
left: 50%;
|
2017 |
+
margin-bottom: 8px;
|
2018 |
+
}
|
2019 |
+
|
2020 |
+
.linkedin_tool_bdr {
|
2021 |
+
width: 66px;
|
2022 |
+
}
|
2023 |
+
|
2024 |
+
.linkedin_tool_bdr .sfsi_inside {
|
2025 |
+
text-align: center;
|
2026 |
+
float: left;
|
2027 |
+
width: 100%
|
2028 |
+
}
|
2029 |
+
|
2030 |
+
.linkedin_tool_bdr .sfsi_inside .icon1 {
|
2031 |
+
margin: 2px 0 2px 0px;
|
2032 |
+
display: inline-block;
|
2033 |
+
float: none;
|
2034 |
+
/* height: 20px;*/
|
2035 |
+
width: 100%;
|
2036 |
+
}
|
2037 |
+
|
2038 |
+
.linkedin_tool_bdr .sfsi_inside .icon2 {
|
2039 |
+
margin: 2px 0 2px 0px;
|
2040 |
+
display: inline-block;
|
2041 |
+
float: none;
|
2042 |
+
/* height: 20px;*/
|
2043 |
+
width: 100%;
|
2044 |
+
}
|
2045 |
+
|
2046 |
+
.linkedin_tool_bdr .sfsi_inside .icon3 {
|
2047 |
+
margin: 2px 0 2px 0px;
|
2048 |
+
display: inline-block;
|
2049 |
+
float: none;
|
2050 |
+
/* height: 20px;*/
|
2051 |
+
width: 100%;
|
2052 |
+
}
|
2053 |
+
|
2054 |
+
.linkedin_tool_bdr .sfsi_inside .icon4 {
|
2055 |
+
margin: 2px 0 1px 0px;
|
2056 |
+
display: inline-block;
|
2057 |
+
float: none;
|
2058 |
+
/* height: 25px !important;*/
|
2059 |
+
width: 100%;
|
2060 |
+
}
|
2061 |
+
|
2062 |
+
.sfsi_FrntInner_chg .linkedin_tool_bdr .sfsi_inside .icon1 {
|
2063 |
+
margin: 7px 0;
|
2064 |
+
}
|
2065 |
+
|
2066 |
+
.sfsi_widget .linkedin_tool_bdr .sfsi_inside .icon4,
|
2067 |
+
.sfsi_widget .gpls_tool_bdr .sfsi_inside .icon1,
|
2068 |
+
.sfsi_widget .fb_tool_bdr .sfsi_inside .icon1 {
|
2069 |
+
height: auto
|
2070 |
+
}
|
2071 |
+
|
2072 |
+
.linkedin_tool_bdr .linkin_1,
|
2073 |
+
.linkedin_tool_bdr .linkin_2,
|
2074 |
+
.linkedin_tool_bdr .linkin_3,
|
2075 |
+
.linkedin_tool_bdr .linkin_4 {
|
2076 |
+
margin: 9px 0 0 !important;
|
2077 |
+
height: 20px;
|
2078 |
+
display: inline-block;
|
2079 |
+
float: none;
|
2080 |
+
overflow: hidden;
|
2081 |
+
}
|
2082 |
+
|
2083 |
+
.twt_tool_bdr {
|
2084 |
+
width: 62px;
|
2085 |
+
height: auto;
|
2086 |
+
}
|
2087 |
+
|
2088 |
+
.twt_tool_bdr .sfsi_inside .icon1>iframe {
|
2089 |
+
margin: 0 auto !important;
|
2090 |
+
float: none !important;
|
2091 |
+
width: 100%
|
2092 |
+
}
|
2093 |
+
|
2094 |
+
.twt_tool_bdr .sfsi_inside .icon1>iframe #widget {
|
2095 |
+
text-align: center;
|
2096 |
+
}
|
2097 |
+
|
2098 |
+
.sfsi_pop_up .button {
|
2099 |
+
border: none;
|
2100 |
+
padding: 0;
|
2101 |
+
}
|
2102 |
+
|
2103 |
+
.pop_up_box .button a {
|
2104 |
+
color: #fff;
|
2105 |
+
line-height: normal;
|
2106 |
+
font-size: 22px;
|
2107 |
+
text-decoration: none;
|
2108 |
+
text-align: center;
|
2109 |
+
width: 482px;
|
2110 |
+
height: 80px;
|
2111 |
+
margin: 0;
|
2112 |
+
display: table-cell;
|
2113 |
+
vertical-align: middle;
|
2114 |
+
font-family: helveticabold;
|
2115 |
+
}
|
2116 |
+
|
2117 |
+
.tab3 ul.tab_3_icns li .radio {
|
2118 |
+
margin-top: 7px;
|
2119 |
+
}
|
2120 |
+
|
2121 |
+
.tab3 ul.tab_3_icns li label {
|
2122 |
+
line-height: 50px !important;
|
2123 |
+
margin-left: 20px;
|
2124 |
+
}
|
2125 |
+
|
2126 |
+
.sfsi_mainContainer input[type=email],
|
2127 |
+
.sfsi_mainContainer input[type=number],
|
2128 |
+
.sfsi_mainContainer input[type=password],
|
2129 |
+
.sfsi_mainContainer input[type=search],
|
2130 |
+
.sfsi_mainContainer input[type=tel],
|
2131 |
+
.sfsi_mainContainer input[type=text],
|
2132 |
+
.sfsi_mainContainer input[type=url],
|
2133 |
+
.sfsi_mainContainer select,
|
2134 |
+
.sfsi_mainContainer textarea {
|
2135 |
+
color: #5a6570 !important;
|
2136 |
+
}
|
2137 |
+
|
2138 |
+
.adminTooltip {
|
2139 |
+
left: 142px;
|
2140 |
+
position: absolute;
|
2141 |
+
}
|
2142 |
+
|
2143 |
+
.adPopWidth {
|
2144 |
+
min-height: 100px !important;
|
2145 |
+
}
|
2146 |
+
|
2147 |
+
.main_contant p>a.lit_txt,
|
2148 |
+
.tab4 p>a {
|
2149 |
+
font-family: helveticaregular;
|
2150 |
+
color: #414951;
|
2151 |
+
}
|
2152 |
+
|
2153 |
+
.tab1 ul.icn_listing li .custom-txt {
|
2154 |
+
margin-left: 5px;
|
2155 |
+
}
|
2156 |
+
|
2157 |
+
.tab1 ul.icn_listing li .custom-img {
|
2158 |
+
margin-left: 18px;
|
2159 |
+
}
|
2160 |
+
|
2161 |
+
.linkedin_section .link_4>label.anthr_labl {
|
2162 |
+
height: 94px;
|
2163 |
+
}
|
2164 |
+
|
2165 |
+
.mediam_txt {
|
2166 |
+
font-family: helveticabold;
|
2167 |
+
}
|
2168 |
+
|
2169 |
+
.sfsiCtxt {
|
2170 |
+
line-height: 51px;
|
2171 |
+
font-family: helveticaregular;
|
2172 |
+
font-size: 22px;
|
2173 |
+
float: left;
|
2174 |
+
padding-left: 19px;
|
2175 |
+
color: #5a6570;
|
2176 |
+
}
|
2177 |
+
|
2178 |
+
.customstep2-img {
|
2179 |
+
width: 51px;
|
2180 |
+
float: left;
|
2181 |
+
}
|
2182 |
+
|
2183 |
+
.tab2 .row h2.custom {
|
2184 |
+
margin: 15px 0 7px 21px;
|
2185 |
+
height: 52px;
|
2186 |
+
line-height: 51px;
|
2187 |
+
font-family: helveticaregular;
|
2188 |
+
font-size: 22px;
|
2189 |
+
}
|
2190 |
+
|
2191 |
+
.custom-links p.cus_link label {
|
2192 |
+
margin-left: 0;
|
2193 |
+
}
|
2194 |
+
|
2195 |
+
.pop_up_box .sfsi_tool_tip_2 .fbb .fb_1 a>img:hover {
|
2196 |
+
opacity: .9;
|
2197 |
+
}
|
2198 |
+
|
2199 |
+
.tab2 .rss_url_row .sfrsTxt {
|
2200 |
+
font-size: 17px;
|
2201 |
+
line-height: 47px;
|
2202 |
+
margin: 0 0 0 4px;
|
2203 |
+
font-family: helveticaregular;
|
2204 |
+
}
|
2205 |
+
|
2206 |
+
.tab2 .rss_url_row .sfrsTxt>strong {
|
2207 |
+
font-family: helveticaregular;
|
2208 |
+
}
|
2209 |
+
|
2210 |
+
.tab2 .utube_inn p.extra_pp {
|
2211 |
+
float: left;
|
2212 |
+
width: 100%;
|
2213 |
+
margin: 0 0 0 48px;
|
2214 |
+
}
|
2215 |
+
|
2216 |
+
.tab2 .utube_inn p.extra_pp label {
|
2217 |
+
float: left;
|
2218 |
+
line-height: 41px;
|
2219 |
+
margin-right: 8px;
|
2220 |
+
}
|
2221 |
+
|
2222 |
+
.sfsi_inside .icon2 .fb_iframe_widget span {
|
2223 |
+
width: 500px !important;
|
2224 |
+
}
|
2225 |
+
|
2226 |
+
@media (max-width:767px) {
|
2227 |
+
.sfsi_inside .icon2 .fb_iframe_widget span {
|
2228 |
+
width: auto;
|
2229 |
+
}
|
2230 |
+
|
2231 |
+
.sfsi_outr_div {
|
2232 |
+
top: 10%
|
2233 |
+
}
|
2234 |
+
|
2235 |
+
.sfsi_outr_div h2 {
|
2236 |
+
font-size: 22px !important;
|
2237 |
+
line-height: 28px;
|
2238 |
+
}
|
2239 |
+
|
2240 |
+
.sfsi_wicons {
|
2241 |
+
padding-top: 0;
|
2242 |
+
}
|
2243 |
+
}
|
2244 |
+
|
2245 |
+
.specify_counts .listing li .high_prb {
|
2246 |
+
height: 41px;
|
2247 |
+
}
|
2248 |
+
|
2249 |
+
.sfsi_Sicons {
|
2250 |
+
position: relative;
|
2251 |
+
}
|
2252 |
+
|
2253 |
+
.sfsi_Sicons .sf_fb {
|
2254 |
+
position: relative;
|
2255 |
+
/*z-index: 1;*/
|
2256 |
+
width: 75px;
|
2257 |
+
}
|
2258 |
+
|
2259 |
+
.sfsi_Sicons .fb_iframe_widget {
|
2260 |
+
float: left;
|
2261 |
+
width: 73px;
|
2262 |
+
margin: 2px 0 0;
|
2263 |
+
}
|
2264 |
+
|
2265 |
+
.sfsi_Sicons .sf_fb .fb_iframe_widget>span {
|
2266 |
+
position: absolute;
|
2267 |
+
/*width: 450px!important; z-index: 1;*/
|
2268 |
+
}
|
2269 |
+
|
2270 |
+
.tab2 .utube_inn label {
|
2271 |
+
font-size: 17px;
|
2272 |
+
}
|
2273 |
+
|
2274 |
+
.sfsi_plc_btm {
|
2275 |
+
padding: 5px 14px 9px;
|
2276 |
+
}
|
2277 |
+
|
2278 |
+
.tab7 .field {
|
2279 |
+
margin-top: 7px;
|
2280 |
+
}
|
2281 |
+
|
2282 |
+
.sfsi_outr_div ul li .cmcls img {
|
2283 |
+
margin-top: 0 !important;
|
2284 |
+
}
|
2285 |
+
|
2286 |
+
.sfsi_outr_div ul li .inerCnt {
|
2287 |
+
float: left;
|
2288 |
+
}
|
2289 |
+
|
2290 |
+
.sfsi_outr_div ul li .inerCnt .bot_no {
|
2291 |
+
position: absolute;
|
2292 |
+
padding: 1px 0;
|
2293 |
+
font-size: 12px !important;
|
2294 |
+
line-height: 12px !important;
|
2295 |
+
text-align: center;
|
2296 |
+
background: #fff;
|
2297 |
+
border-radius: 5px;
|
2298 |
+
display: block;
|
2299 |
+
left: 50%;
|
2300 |
+
margin-left: -20px;
|
2301 |
+
border: 1px solid #333;
|
2302 |
+
white-space: pre;
|
2303 |
+
-webkit-box-sizing: border-box;
|
2304 |
+
-moz-box-sizing: border-box;
|
2305 |
+
box-sizing: border-box;
|
2306 |
+
margin-top: 6px;
|
2307 |
+
width: 40px;
|
2308 |
+
word-break: break-all;
|
2309 |
+
word-wrap: break-word;
|
2310 |
+
}
|
2311 |
+
|
2312 |
+
.sfsi_outr_div ul li .inerCnt .bot_no:before {
|
2313 |
+
content: url(images/count_top_arow.png);
|
2314 |
+
position: absolute;
|
2315 |
+
height: 9px;
|
2316 |
+
margin-left: -7.5px;
|
2317 |
+
top: -10px;
|
2318 |
+
left: 50%;
|
2319 |
+
width: 15px;
|
2320 |
+
}
|
2321 |
+
|
2322 |
+
.sfsi_outr_div {
|
2323 |
+
position: fixed;
|
2324 |
+
width: 100%;
|
2325 |
+
float: none;
|
2326 |
+
left: 50%;
|
2327 |
+
top: 20%;
|
2328 |
+
margin-left: -50%;
|
2329 |
+
opacity: 0;
|
2330 |
+
z-index: -1;
|
2331 |
+
display: block;
|
2332 |
+
text-align: center;
|
2333 |
+
}
|
2334 |
+
|
2335 |
+
.sfsi_outr_div .sfsi_FrntInner_chg {
|
2336 |
+
display: inline-block;
|
2337 |
+
padding: 15px 17px 27px 18px;
|
2338 |
+
background: #FFF;
|
2339 |
+
border: 1px solid #EDEDED;
|
2340 |
+
box-shadow: 0 0 5px #CCC;
|
2341 |
+
margin: 20px;
|
2342 |
+
position: relative;
|
2343 |
+
}
|
2344 |
+
|
2345 |
+
.sfsi_FrntInner_chg .sfsiclpupwpr {
|
2346 |
+
position: absolute;
|
2347 |
+
right: -10px;
|
2348 |
+
top: -10px;
|
2349 |
+
width: 25px;
|
2350 |
+
cursor: pointer;
|
2351 |
+
}
|
2352 |
+
|
2353 |
+
.sfsi_FrntInner_chg .sfsiclpupwpr img {
|
2354 |
+
width: auto;
|
2355 |
+
float: left;
|
2356 |
+
border: medium none;
|
2357 |
+
}
|
2358 |
+
|
2359 |
+
.tab7 .like_pop_box {
|
2360 |
+
width: 100%;
|
2361 |
+
margin: 35px auto auto;
|
2362 |
+
position: relative;
|
2363 |
+
text-align: center;
|
2364 |
+
}
|
2365 |
+
|
2366 |
+
.tab7 .like_pop_box .sfsi_Popinner {
|
2367 |
+
display: inline-block;
|
2368 |
+
padding: 18px 20px;
|
2369 |
+
box-shadow: 0 0 5px #ccc;
|
2370 |
+
-webkit-box-shadow: 0 0 5px #ccc;
|
2371 |
+
border: 1px solid #ededed;
|
2372 |
+
background: #FFF;
|
2373 |
+
}
|
2374 |
+
|
2375 |
+
.tab7 .like_pop_box .sfsi_Popinner h2 {
|
2376 |
+
margin: 0 0 23px;
|
2377 |
+
padding: 0;
|
2378 |
+
color: #414951;
|
2379 |
+
font-family: helveticabold;
|
2380 |
+
font-size: 26px;
|
2381 |
+
text-align: center;
|
2382 |
+
}
|
2383 |
+
|
2384 |
+
.tab7 .like_pop_box .sfsi_Popinner ul {
|
2385 |
+
margin: 0;
|
2386 |
+
padding: 0;
|
2387 |
+
list-style: none;
|
2388 |
+
text-align: center;
|
2389 |
+
}
|
2390 |
+
|
2391 |
+
.tab7 .like_pop_box .sfsi_Popinner ul li {
|
2392 |
+
margin: 0;
|
2393 |
+
padding: 0;
|
2394 |
+
list-style: none;
|
2395 |
+
display: inline-block;
|
2396 |
+
}
|
2397 |
+
|
2398 |
+
.tab7 .like_pop_box .sfsi_Popinner ul li span {
|
2399 |
+
margin: 0;
|
2400 |
+
width: 54px;
|
2401 |
+
display: block;
|
2402 |
+
background: url(../images/count_bg.png) no-repeat;
|
2403 |
+
height: 24px;
|
2404 |
+
overflow: hidden;
|
2405 |
+
padding: 10px 2px 2px;
|
2406 |
+
font-family: helveticaregular;
|
2407 |
+
font-size: 16px;
|
2408 |
+
text-align: center;
|
2409 |
+
line-height: 24px;
|
2410 |
+
color: #5a6570;
|
2411 |
+
}
|
2412 |
+
|
2413 |
+
.tab7 .like_pop_box .sfsi_Popinner ul li a {
|
2414 |
+
color: #5a6570;
|
2415 |
+
text-decoration: none;
|
2416 |
+
}
|
2417 |
+
|
2418 |
+
.sfsi_outr_div .sfsi_FrntInner_chg .sfsi_wicons {
|
2419 |
+
margin-bottom: 0;
|
2420 |
+
}
|
2421 |
+
|
2422 |
+
.sfsi_outr_div ul {
|
2423 |
+
list-style: none;
|
2424 |
+
margin: 0 0 24px;
|
2425 |
+
padding: 0;
|
2426 |
+
text-align: center;
|
2427 |
+
}
|
2428 |
+
|
2429 |
+
a.sfsiColbtn {
|
2430 |
+
color: #5a6570 !important;
|
2431 |
+
float: right;
|
2432 |
+
font-size: 14px;
|
2433 |
+
margin: -35px -30px 0 0;
|
2434 |
+
position: relative;
|
2435 |
+
right: 0;
|
2436 |
+
font-family: helveticaregular;
|
2437 |
+
width: 100px;
|
2438 |
+
text-decoration: none;
|
2439 |
+
}
|
2440 |
+
|
2441 |
+
.tab3 a.sfsiColbtn {
|
2442 |
+
margin-top: -43px;
|
2443 |
+
}
|
2444 |
+
|
2445 |
+
.sfsi_FrntInner_chg ul li:first-of-type .sfsi_wicons {
|
2446 |
+
margin-left: 0 !important;
|
2447 |
+
}
|
2448 |
+
|
2449 |
+
ul.tab_3_icns li .trans_bg {
|
2450 |
+
background: #000;
|
2451 |
+
padding-left: 3px;
|
2452 |
+
}
|
2453 |
+
|
2454 |
+
.tab2 .instagram_section {
|
2455 |
+
padding-bottom: 20px;
|
2456 |
+
}
|
2457 |
+
|
2458 |
+
h1.abt_titl {
|
2459 |
+
text-align: center;
|
2460 |
+
margin: 19% 0 0;
|
2461 |
+
}
|
2462 |
+
|
2463 |
+
.sfcm.sfsi_wicon {
|
2464 |
+
padding: 0;
|
2465 |
+
width: 100%;
|
2466 |
+
border: medium none;
|
2467 |
+
}
|
2468 |
+
|
2469 |
+
.fb_iframe_widget span {
|
2470 |
+
vertical-align: top !important;
|
2471 |
+
}
|
2472 |
+
|
2473 |
+
.sfsi_outr_div .sfsi_FrntInner_chg ul {
|
2474 |
+
margin: 0 0 0 3px;
|
2475 |
+
}
|
2476 |
+
|
2477 |
+
.sfsi_outr_div .sfsi_FrntInner_chg ul li {
|
2478 |
+
margin: 0 3px 0 0;
|
2479 |
+
}
|
2480 |
+
|
2481 |
+
.sfcm.sfsi_wicon {
|
2482 |
+
margin: -1px;
|
2483 |
+
padding: 0;
|
2484 |
+
}
|
2485 |
+
|
2486 |
+
@media (min-width:320px) and (max-width:480px) {
|
2487 |
+
|
2488 |
+
.sfsi_tool_tip_2,
|
2489 |
+
.tool_tip {
|
2490 |
+
padding: 5px 14px 0;
|
2491 |
+
}
|
2492 |
+
|
2493 |
+
.sfsi_inside:last-child {
|
2494 |
+
margin-bottom: 18px;
|
2495 |
+
clear: both;
|
2496 |
+
}
|
2497 |
+
|
2498 |
+
.sfsi_outr_div {
|
2499 |
+
top: 10%;
|
2500 |
+
}
|
2501 |
+
|
2502 |
+
.sfsi_FrntInner_chg .sfsi_wicons {
|
2503 |
+
width: 31px !important;
|
2504 |
+
height: 31px !important;
|
2505 |
+
}
|
2506 |
+
|
2507 |
+
.sfsi_FrntInner_chg .sfsi_wicons img {
|
2508 |
+
width: 100%;
|
2509 |
+
}
|
2510 |
+
|
2511 |
+
.sfsi_Sicons .sf_fb {
|
2512 |
+
margin-bottom: 24px;
|
2513 |
+
}
|
2514 |
+
|
2515 |
+
.sfsi_Sicons .sf_twiter {
|
2516 |
+
margin-bottom: 4px;
|
2517 |
+
}
|
2518 |
+
}
|
2519 |
+
|
2520 |
+
@media (max-width:320px) {
|
2521 |
+
|
2522 |
+
.sfsi_tool_tip_2,
|
2523 |
+
.tool_tip {
|
2524 |
+
padding: 5px 14px 0;
|
2525 |
+
}
|
2526 |
+
|
2527 |
+
.sfsi_inside:last-child {
|
2528 |
+
margin-bottom: 18px;
|
2529 |
+
clear: both;
|
2530 |
+
}
|
2531 |
+
|
2532 |
+
.sfsi_FrntInner_chg .sfsi_wicons {
|
2533 |
+
width: 31px !important;
|
2534 |
+
height: 31px !important;
|
2535 |
+
}
|
2536 |
+
|
2537 |
+
.sfsi_FrntInner_chg .sfsi_wicons img {
|
2538 |
+
width: 100%
|
2539 |
+
}
|
2540 |
+
}
|
2541 |
+
|
2542 |
+
ul.SFSI_lsngfrm {
|
2543 |
+
float: left;
|
2544 |
+
/* width: 61%;*/
|
2545 |
+
width: 51.33%;
|
2546 |
+
padding-left: 60px !important;
|
2547 |
+
}
|
2548 |
+
|
2549 |
+
ul.SFSI_instructions {
|
2550 |
+
float: left;
|
2551 |
+
width: 35%;
|
2552 |
+
}
|
2553 |
+
|
2554 |
+
li.youtube_options {
|
2555 |
+
padding-left: 60px !important;
|
2556 |
+
}
|
2557 |
+
|
2558 |
+
input[name="sfsi_pinterest_manualCounts"] {
|
2559 |
+
margin-left: -20px !important;
|
2560 |
+
}
|
2561 |
+
|
2562 |
+
ul.SFSI_instructions li {
|
2563 |
+
font-size: 12px !important;
|
2564 |
+
line-height: 25px !important;
|
2565 |
+
margin: 0 !important;
|
2566 |
+
padding: 0 0 0 15px !important;
|
2567 |
+
width: 100%
|
2568 |
+
}
|
2569 |
+
|
2570 |
+
/*{Monad}*/
|
2571 |
+
/*Upload Skins css*/
|
2572 |
+
.cstmskin_popup {
|
2573 |
+
width: 500px;
|
2574 |
+
background: #FFF;
|
2575 |
+
box-shadow: 0 0 5px 3px #d8d8d8;
|
2576 |
+
margin: 40px 0px auto;
|
2577 |
+
padding: 20px 25px 20px;
|
2578 |
+
font-family: helveticaregular;
|
2579 |
+
color: #5a6570;
|
2580 |
+
height: auto;
|
2581 |
+
float: left;
|
2582 |
+
position: relative;
|
2583 |
+
left: 35%;
|
2584 |
+
}
|
2585 |
+
|
2586 |
+
.cstomskins_wrpr {
|
2587 |
+
float: left;
|
2588 |
+
width: 100%;
|
2589 |
+
}
|
2590 |
+
|
2591 |
+
.custskinmsg {
|
2592 |
+
float: left;
|
2593 |
+
font-size: 15px;
|
2594 |
+
margin-top: 10px;
|
2595 |
+
width: 100%;
|
2596 |
+
}
|
2597 |
+
|
2598 |
+
.custskinmsg>ul {
|
2599 |
+
color: #000;
|
2600 |
+
float: left;
|
2601 |
+
margin-top: 8px;
|
2602 |
+
width: 100%;
|
2603 |
+
}
|
2604 |
+
|
2605 |
+
ul.cstmskin_iconlist {
|
2606 |
+
float: left;
|
2607 |
+
padding: 11px 0 40px 8px;
|
2608 |
+
width: 100%;
|
2609 |
+
max-width: 1000px;
|
2610 |
+
margin: 0;
|
2611 |
+
height: 307px;
|
2612 |
+
overflow-y: scroll;
|
2613 |
+
}
|
2614 |
+
|
2615 |
+
.placethemanulywpr {
|
2616 |
+
max-width: 98% !important
|
2617 |
+
}
|
2618 |
+
|
2619 |
+
.cstmskin_iconlist>li {
|
2620 |
+
float: left;
|
2621 |
+
margin: 3px 0;
|
2622 |
+
width: 100%;
|
2623 |
+
}
|
2624 |
+
|
2625 |
+
.cstm_icnname {
|
2626 |
+
float: left;
|
2627 |
+
width: 30%;
|
2628 |
+
}
|
2629 |
+
|
2630 |
+
.cstmskins_btn>img {
|
2631 |
+
float: left;
|
2632 |
+
margin-right: 25px;
|
2633 |
+
}
|
2634 |
+
|
2635 |
+
.cstmskin_btn {
|
2636 |
+
width: auto;
|
2637 |
+
float: left;
|
2638 |
+
padding: 3px 20px;
|
2639 |
+
color: #fff;
|
2640 |
+
background-color: #12a252;
|
2641 |
+
text-decoration: none;
|
2642 |
+
margin: 0 10px;
|
2643 |
+
}
|
2644 |
+
|
2645 |
+
.cstmskins_sbmt {
|
2646 |
+
width: 100%;
|
2647 |
+
float: left;
|
2648 |
+
text-align: center;
|
2649 |
+
margin-top: 15px;
|
2650 |
+
}
|
2651 |
+
|
2652 |
+
.done_btn {
|
2653 |
+
width: auto;
|
2654 |
+
padding: 3px 80px;
|
2655 |
+
color: #fff;
|
2656 |
+
background-color: #12a252;
|
2657 |
+
text-decoration: none;
|
2658 |
+
font-size: 18px;
|
2659 |
+
}
|
2660 |
+
|
2661 |
+
.cstmskin_btn:hover,
|
2662 |
+
.done_btn:hover,
|
2663 |
+
.cstmskin_btn:focus,
|
2664 |
+
.done_btn:focus {
|
2665 |
+
color: #fff;
|
2666 |
+
}
|
2667 |
+
|
2668 |
+
.skswrpr,
|
2669 |
+
.dlt_btn {
|
2670 |
+
display: none;
|
2671 |
+
}
|
2672 |
+
|
2673 |
+
.cstmutbewpr {
|
2674 |
+
width: 100%;
|
2675 |
+
float: left;
|
2676 |
+
margin-top: 10px;
|
2677 |
+
margin-left: 40px;
|
2678 |
+
}
|
2679 |
+
|
2680 |
+
.cstmutbewpr ul.enough_waffling li {
|
2681 |
+
width: auto;
|
2682 |
+
float: left;
|
2683 |
+
margin-right: 20px;
|
2684 |
+
}
|
2685 |
+
|
2686 |
+
.cstmutbewpr ul.enough_waffling li span {
|
2687 |
+
float: left;
|
2688 |
+
}
|
2689 |
+
|
2690 |
+
.cstmutbewpr ul.enough_waffling li label {
|
2691 |
+
width: auto;
|
2692 |
+
float: left;
|
2693 |
+
margin-top: 10px;
|
2694 |
+
margin-left: 10px;
|
2695 |
+
}
|
2696 |
+
|
2697 |
+
.cstmutbewpr .cstmutbtxtwpr {
|
2698 |
+
width: 100%;
|
2699 |
+
float: left;
|
2700 |
+
padding-top: 10px;
|
2701 |
+
}
|
2702 |
+
|
2703 |
+
.cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr {
|
2704 |
+
width: 100%;
|
2705 |
+
float: left;
|
2706 |
+
display: none;
|
2707 |
+
}
|
2708 |
+
|
2709 |
+
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr p,
|
2710 |
+
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr p {
|
2711 |
+
margin-left: 0px;
|
2712 |
+
}
|
2713 |
+
|
2714 |
+
.cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr {
|
2715 |
+
width: 100%;
|
2716 |
+
float: left;
|
2717 |
+
display: none;
|
2718 |
+
}
|
2719 |
+
|
2720 |
+
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr p label,
|
2721 |
+
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr p label {
|
2722 |
+
width: 120px;
|
2723 |
+
}
|
2724 |
+
|
2725 |
+
.sfsi_widget .sfsi_wDiv .sfsi_wicons .inerCnt a,
|
2726 |
+
.sfsi_widget .sfsi_wDiv .sfsi_wicons .inerCnt a.sficn {
|
2727 |
+
padding: 0px;
|
2728 |
+
margin: 0px;
|
2729 |
+
width: 100%;
|
2730 |
+
float: left;
|
2731 |
+
border: medium none;
|
2732 |
+
}
|
2733 |
+
|
2734 |
+
.sfsi_socialwpr {
|
2735 |
+
width: auto;
|
2736 |
+
display: inline-block;
|
2737 |
+
vertical-align: middle;
|
2738 |
+
}
|
2739 |
+
|
2740 |
+
.sfsi_socialwpr .sf_fb {
|
2741 |
+
float: left;
|
2742 |
+
}
|
2743 |
+
|
2744 |
+
.sfsipyplfrm {
|
2745 |
+
float: left;
|
2746 |
+
margin-top: 10px;
|
2747 |
+
width: 100%;
|
2748 |
+
}
|
2749 |
+
|
2750 |
+
.sfsipyplfrm input[type="submit"] {
|
2751 |
+
background: none repeat scroll 0 0 rgba(0, 0, 0, 0);
|
2752 |
+
border: medium none;
|
2753 |
+
color: #0074a2;
|
2754 |
+
cursor: pointer;
|
2755 |
+
font-weight: normal;
|
2756 |
+
margin: 0;
|
2757 |
+
padding: 5px 10px;
|
2758 |
+
text-decoration: underline;
|
2759 |
+
}
|
2760 |
+
|
2761 |
+
.sfsipyplfrm input[type="submit"]:hover {
|
2762 |
+
color: #2ea2cc
|
2763 |
+
}
|
2764 |
+
|
2765 |
+
.pop_up_box_ex {
|
2766 |
+
background: none repeat scroll 0 0 #fff;
|
2767 |
+
box-shadow: 0 0 5px 3px #d8d8d8;
|
2768 |
+
color: #5a6570;
|
2769 |
+
font-family: helveticaregular;
|
2770 |
+
margin: 200px auto;
|
2771 |
+
min-height: 150px;
|
2772 |
+
padding: 20px 25px 0px;
|
2773 |
+
position: relative;
|
2774 |
+
width: 290px;
|
2775 |
+
}
|
2776 |
+
|
2777 |
+
.pop_up_box_ex {
|
2778 |
+
color: #5a6570;
|
2779 |
+
font-family: helveticaregular;
|
2780 |
+
}
|
2781 |
+
|
2782 |
+
.cstmutbchnlidwpr .utbe_instruction,
|
2783 |
+
.cstmutbchnlnmewpr .utbe_instruction,
|
2784 |
+
.lnkdin_instruction {
|
2785 |
+
float: left;
|
2786 |
+
line-height: 22px;
|
2787 |
+
margin-top: 10px;
|
2788 |
+
width: 100%;
|
2789 |
+
}
|
2790 |
+
|
2791 |
+
.fb_iframe_widget iframe {
|
2792 |
+
max-width: none;
|
2793 |
+
}
|
2794 |
+
|
2795 |
+
.sfsi_mainContainer p.bldtxtmsg {
|
2796 |
+
float: left;
|
2797 |
+
font-size: 15px;
|
2798 |
+
font-weight: bold;
|
2799 |
+
margin-top: 12px;
|
2800 |
+
width: 100%;
|
2801 |
+
text-align: center;
|
2802 |
+
}
|
2803 |
+
|
2804 |
+
.sfsinewplgndesc {
|
2805 |
+
background: none repeat scroll 0 0 #e5e5e5;
|
2806 |
+
float: left;
|
2807 |
+
padding: 5px 10px 8px;
|
2808 |
+
margin-top: 25px;
|
2809 |
+
}
|
2810 |
+
|
2811 |
+
.sfsinewplgndesc>.clear>a {
|
2812 |
+
color: #5a6570;
|
2813 |
+
font-weight: bold;
|
2814 |
+
}
|
2815 |
+
|
2816 |
+
.sfsiicnsdvwrp {
|
2817 |
+
float: left;
|
2818 |
+
width: 110px;
|
2819 |
+
}
|
2820 |
+
|
2821 |
+
.sfsi_Sicons .sf_subscrbe .bot_no {
|
2822 |
+
background: rgba(0, 0, 0, 0) url(images/count_left_arow.png) no-repeat scroll 0 0 / 27px auto;
|
2823 |
+
font-size: 12px !important;
|
2824 |
+
left: 67px;
|
2825 |
+
line-height: 18px !important;
|
2826 |
+
margin-left: 0px;
|
2827 |
+
margin-top: 8px;
|
2828 |
+
padding: 1px 0;
|
2829 |
+
position: absolute;
|
2830 |
+
text-align: center;
|
2831 |
+
top: -8px;
|
2832 |
+
white-space: pre;
|
2833 |
+
width: 33px;
|
2834 |
+
height: 24px;
|
2835 |
+
z-index: 9;
|
2836 |
+
}
|
2837 |
+
|
2838 |
+
.sfsi_wicons a.sficn,
|
2839 |
+
.sfsi_wicons .sfsi_inside a,
|
2840 |
+
.sfsi_Sicons div a {
|
2841 |
+
box-shadow: none;
|
2842 |
+
border: none;
|
2843 |
+
}
|
2844 |
+
|
2845 |
+
.sfsi_Sicons .sf_pinit>span {
|
2846 |
+
height: 20px !important;
|
2847 |
+
}
|
2848 |
+
|
2849 |
+
.sfsi_Sicons .sf_pinit>span>span {
|
2850 |
+
width: 38px !important;
|
2851 |
+
right: -45px !important;
|
2852 |
+
}
|
2853 |
+
|
2854 |
+
.sfsi_wicons a {
|
2855 |
+
box-shadow: none !important;
|
2856 |
+
}
|
2857 |
+
|
2858 |
+
a.sficn {
|
2859 |
+
cursor: pointer;
|
2860 |
+
}
|
2861 |
+
|
2862 |
+
.sfsi_Sicons .fb_iframe_widget>span {
|
2863 |
+
vertical-align: top !important;
|
2864 |
+
}
|
2865 |
+
|
2866 |
+
.sfsi_Sicons .sf_fb {
|
2867 |
+
margin: 0 0 0 5px !important;
|
2868 |
+
}
|
2869 |
+
|
2870 |
+
.disabled_checkbox .sfsi_right_info:before {
|
2871 |
+
position: absolute;
|
2872 |
+
content: "";
|
2873 |
+
width: 500px;
|
2874 |
+
height: 60px;
|
2875 |
+
display: inline-block;
|
2876 |
+
z-index: 99;
|
2877 |
+
margin-left: -66px;
|
2878 |
+
margin-top: -14px;
|
2879 |
+
background: rgba(255, 255, 255, .8);
|
2880 |
+
}
|
2881 |
+
|
2882 |
+
#sfsi_floater .fb_tool_bdr .sfsi_inside .icon2 {
|
2883 |
+
/*margin: -2px 0 -5px 0;*/
|
2884 |
+
}
|
2885 |
+
|
2886 |
+
.sfsi_wechat_follow_overlay {
|
2887 |
+
position: fixed;
|
2888 |
+
top: 0;
|
2889 |
+
width: 100%;
|
2890 |
+
z-index: 99999;
|
2891 |
+
background: rgba(0, 0, 0, 0.7);
|
2892 |
+
}
|
2893 |
+
|
2894 |
+
.sfsi_wechat_follow_overlay .close_btn {
|
2895 |
+
position: absolute;
|
2896 |
+
right: 60px;
|
2897 |
+
top: 60px;
|
2898 |
+
font-size: 40px;
|
2899 |
+
line-height: 40px;
|
2900 |
+
text-decoration: none;
|
2901 |
+
border: 1px solid #fff;
|
2902 |
+
padding: 0 10px;
|
2903 |
+
border-radius: 60px;
|
2904 |
+
color: #333;
|
2905 |
+
background-color: #ffff;
|
2906 |
+
text-decoration: none;
|
2907 |
+
}
|
2908 |
+
|
2909 |
+
@media (max-width:786px) {
|
2910 |
+
.sfsi_upload_butt_container {
|
2911 |
+
display: inline-block;
|
2912 |
+
}
|
2913 |
+
|
2914 |
+
.upload_butt {
|
2915 |
+
height: 38px;
|
2916 |
+
}
|
2917 |
+
|
2918 |
+
.sfsi_wechat_follow_overlay .sfsi_inner_display>div div.sfsi_upload_butt_container:first-child {
|
2919 |
+
margin-left: 0;
|
2920 |
+
margin-right: 20px;
|
2921 |
+
}
|
2922 |
+
}
|
2923 |
+
|
2924 |
+
/*added by Developer */
|
2925 |
+
#accordion1 p:nth-child(2) {
|
2926 |
+
padding-top: 0px !important;
|
2927 |
+
}
|
2928 |
+
|
2929 |
+
input[name="sfsi_instagram_manualCounts"] {
|
2930 |
+
margin-left: -15px !important;
|
2931 |
+
}
|
2932 |
+
|
2933 |
+
.sfsi_prem_cmn_rowlisting {
|
2934 |
+
width: 33.33%;
|
2935 |
+
}
|
2936 |
+
|
2937 |
+
.rss_url_row h4 {
|
2938 |
+
line-height: 43px !important;
|
2939 |
+
font-size: 17px !important;
|
2940 |
+
font-family: 'helveticaneue-light' !important;
|
2941 |
+
}
|
2942 |
+
|
2943 |
+
.cstmutbchnlnmewpr p.extra_pp label {
|
2944 |
+
width: auto !important;
|
2945 |
+
}
|
2946 |
+
|
2947 |
+
.cstmutbchnlidwpr p.extra_pp label {
|
2948 |
+
width: auto !important;
|
2949 |
+
}
|
2950 |
+
|
2951 |
+
.tab_3_option {
|
2952 |
+
margin: 10px 0 0;
|
2953 |
+
}
|
2954 |
+
|
2955 |
+
div.tab3 .sub_row.stand.sec_new {
|
2956 |
+
margin: 0;
|
2957 |
+
}
|
2958 |
+
|
2959 |
+
div#custom_social_data_setting h4 {
|
2960 |
+
padding-bottom: 30px;
|
2961 |
+
}
|
2962 |
+
|
2963 |
+
.like_pop_box img.sfcm {
|
2964 |
+
height: 50px;
|
2965 |
+
width: 50px;
|
2966 |
+
}
|
2967 |
+
|
2968 |
+
.linkedin_tool_bdr {
|
2969 |
+
line-height: 0 !important;
|
2970 |
+
}
|
2971 |
+
|
2972 |
+
.twt_tool_bdr {
|
2973 |
+
line-height: 0 !important;
|
2974 |
+
}
|
2975 |
+
|
2976 |
+
div#sfsiid_facebook {
|
2977 |
+
line-height: 0 !important;
|
2978 |
+
}
|
2979 |
+
|
2980 |
+
div#sfsiid_youtube {
|
2981 |
+
line-height: 0 !important;
|
2982 |
+
}
|
2983 |
+
|
2984 |
+
.printst_tool_bdr {
|
2985 |
+
line-height: 0 !important;
|
2986 |
+
}
|
2987 |
+
|
2988 |
+
/*end added by Developer */
|
2989 |
+
/*by developer - 29-5-2019 */
|
2990 |
+
ul.SFSI_instructions li,
|
2991 |
+
ul.SFSI_instructions li a {
|
2992 |
+
font-size: 17px !important;
|
2993 |
+
font-family: helveticaregular !important;
|
2994 |
+
font-weight: 400;
|
2995 |
+
color: #1a1d20 !important;
|
2996 |
+
}
|
2997 |
+
|
2998 |
+
body .specify_counts .listing .sfsi_instagramInstruction li {
|
2999 |
+
font-size: 17px !important;
|
3000 |
+
font-family: helveticaregular !important;
|
3001 |
+
font-weight: 400 !important;
|
3002 |
+
color: #1a1d20 !important;
|
3003 |
+
line-height: 26px !important;
|
3004 |
+
}
|
3005 |
+
|
3006 |
+
/*end - 29-5-2019*/
|
3007 |
+
|
3008 |
+
a.pop-up .radio{
|
3009 |
+
opacity: 0.5;
|
3010 |
+
background-position: 0px 0px !important;
|
3011 |
+
/* padding-right: 3px; */
|
3012 |
+
}
|
3013 |
+
|
3014 |
+
.sfsi_vertically_center{
|
3015 |
+
display: flex;
|
3016 |
+
justify-content: space-between;
|
3017 |
+
align-items: center;
|
3018 |
+
}
|
3019 |
+
.sfsi_center{
|
3020 |
+
display: flex;
|
3021 |
+
justify-content: center;
|
3022 |
+
}
|
3023 |
+
.sfsi_custom_icons_q4{
|
3024 |
+
display: flex;
|
3025 |
+
align-items: center;
|
3026 |
+
}
|
3027 |
+
.tab6 .sfsi_responsive_icon_option_li .options .first.first.first {
|
3028 |
+
width: 25%!important;
|
3029 |
+
}
|
3030 |
+
.sfsi_responsive_icon_gradient{
|
3031 |
+
background-image: -webkit-linear-gradient(bottom,rgba(0, 0, 0, 0.17) 0%,rgba(255, 255, 255, 0.17) 100%);
|
3032 |
+
background-image: -moz-linear-gradient(bottom,rgba(0, 0, 0, 0.17) 0%,rgba(255, 255, 255, 0.17) 100%);
|
3033 |
+
background-image: linear-gradient(bottom,rgba(0,0,0,.17) 0%,rgba(255,255,255,.17) 100%);
|
3034 |
+
}
|
3035 |
+
.tab6 ul.sfsi_icn_listing8 ul.sfsi_tab_3_icns li {
|
3036 |
+
width: 50%;
|
3037 |
+
max-width: 450px;
|
3038 |
+
padding-left: 0;
|
3039 |
+
padding-bottom: 0;
|
3040 |
+
}
|
3041 |
+
.tab6 .sfsi_tab_3_icns.sfsi_shwthmbfraftr > li {
|
3042 |
+
width:100% !important;
|
3043 |
+
max-width:100% !important;
|
3044 |
+
border-left: 45px solid transparent;
|
3045 |
+
}
|
3046 |
+
|
3047 |
+
.tab6 ul.sfsi_icn_listing8 li {
|
3048 |
+
float: left;
|
3049 |
+
padding: 11px 0 40px 8px;
|
3050 |
+
width: 100%;
|
3051 |
+
max-width: 1000px;
|
3052 |
+
margin: 0;
|
3053 |
+
}
|
3054 |
+
|
3055 |
+
ul.sfsi_icn_listing8 li .sfsi_right_info a {
|
3056 |
+
outline: 0;
|
3057 |
+
font-family: helveticaregular;
|
3058 |
+
}
|
3059 |
+
#accordion .tab6 ul.sfsi_tab_3_icns {
|
3060 |
+
margin-top: 25px;
|
3061 |
+
}
|
3062 |
+
.sfsi_tab_3_icns.sfsi_shwthmbfraftr {
|
3063 |
+
overflow: visible;
|
3064 |
+
}
|
3065 |
+
ul.sfsi_tab_3_icns {
|
3066 |
+
list-style: none;
|
3067 |
+
margin: 34px 0 0;
|
3068 |
+
overflow: hidden;
|
3069 |
+
}
|
3070 |
+
|
3071 |
+
.tab6 ul.sfsi_icn_listing8 li {
|
3072 |
+
float: left;
|
3073 |
+
padding: 11px 0 40px 8px;
|
3074 |
+
width: 100%;
|
3075 |
+
max-width: 1000px;
|
3076 |
+
margin: 0;
|
3077 |
+
}
|
3078 |
+
.tab6 .sfsi_tab_3_icns.sfsi_shwthmbfraftr .social_icon_like1 li {
|
3079 |
+
width: auto;
|
3080 |
+
max-width: auto;
|
3081 |
+
min-width: auto;
|
3082 |
+
margin: 0 30px 0 0;
|
3083 |
+
}
|
3084 |
+
|
3085 |
+
ul.sfsi_tab_3_icns label {
|
3086 |
+
float: left;
|
3087 |
+
line-height: 42px;
|
3088 |
+
color: #69737C;
|
3089 |
+
font-size: 18px;
|
3090 |
+
font-family: helveticaregular;
|
3091 |
+
min-width: 120px;
|
3092 |
+
}
|
3093 |
+
.tab6 ul.sfsi_tab_3_icns li label {
|
3094 |
+
line-height: 50px !important;
|
3095 |
+
}
|
3096 |
+
|
3097 |
+
#accordion1 .tab6 ul.sfsi_shwthmbfraftr .labelhdng4, #accordion .tab6 ul.sfsi_shwthmbfraftr .row h4.labelhdng4, #accordion .tab6 ul.sfsi_shwthmbfraftr .labelhdng4, #accordion .tab6 ul.sfsi_shwthmbfraftr .row h4.labelhdng4 {
|
3098 |
+
color: #555;
|
3099 |
+
font-size: 20px;
|
3100 |
+
margin-left: 20px;
|
3101 |
+
font-family: 'helveticaregular';
|
3102 |
+
}
|
3103 |
+
.tab6 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns.sfsi_shwthmbfraftr>li:nth-child(1), .tab6 ul.sfsi_icn_listing8 li .sfsi_tab_3_icns.sfsi_shwthmbfraftr>li:nth-child(2){
|
3104 |
+
width: 27% !important;
|
3105 |
+
}
|
3106 |
+
|
3107 |
+
.tab6 ul.sfsi_tab_3_icns li .radio{
|
3108 |
+
margin-top: 7px;
|
3109 |
+
}
|
3110 |
+
|
3111 |
+
ul.sfsi_icn_listing8 li .tb_4_ck{
|
3112 |
+
float: left;
|
3113 |
+
}
|
3114 |
+
.sfsi_responsive_default_icon_container .radio_section.tb_4_ck, .sfsi_responsive_custom_icon_container .radio_section.tb_4_ck {
|
3115 |
+
margin: 5px 20px 0 0 !important;
|
3116 |
+
}
|
3117 |
+
|
3118 |
+
.sfsi_responsive_icon_option_li .options .field .select {
|
3119 |
+
font-family: helveticaregular;
|
3120 |
+
font-weight: 400;
|
3121 |
+
font-size: 17px;
|
3122 |
+
color: #5a6570!important;
|
3123 |
+
}
|
3124 |
+
|
3125 |
+
.tab6 ul.sfsi_icn_listing8 ul.sfsi_tab_3_icns .usually li {
|
3126 |
+
width: 100% !important;
|
3127 |
+
max-width: 1000px !important;
|
3128 |
+
padding: 3px 0 5px 5px !important;
|
3129 |
+
}
|
3130 |
+
.sfsi_responsive_icons a{
|
3131 |
+
text-decoration: none!important;
|
3132 |
+
box-shadow: none!important;
|
3133 |
+
}
|
3134 |
+
.sfsi_responsive_icons .sfsi_responsive_icon_facebook_container{ background-color:#336699;}
|
3135 |
+
.sfsi_responsive_icons .sfsi_responsive_icon_follow_container{ background-color:#00B04E;}
|
3136 |
+
.sfsi_responsive_icons .sfsi_responsive_icon_twitter_container{ background-color:#55ACEE;}
|
3137 |
+
.sfsi_small_button {
|
3138 |
+
line-height: 0px;
|
3139 |
+
height: unset;
|
3140 |
+
padding: 6px !important;
|
3141 |
+
}
|
3142 |
+
.sfsi_small_button span {
|
3143 |
+
margin-left: 10px;
|
3144 |
+
font-size: 16px;
|
3145 |
+
padding: 0px;
|
3146 |
+
line-height: 16px;
|
3147 |
+
vertical-align: -webkit-baseline-middle !important;
|
3148 |
+
margin-left: 10px;
|
3149 |
+
}
|
3150 |
+
.sfsi_small_button img {
|
3151 |
+
max-height: 16px !important;
|
3152 |
+
padding: 0px;
|
3153 |
+
line-height: 0px;
|
3154 |
+
vertical-align: -webkit-baseline-middle !important;
|
3155 |
+
}
|
3156 |
+
.sfsi_medium_button span {
|
3157 |
+
margin-left: 10px;
|
3158 |
+
font-size: 18px;
|
3159 |
+
padding: 0px;
|
3160 |
+
line-height: 16px;
|
3161 |
+
vertical-align: -webkit-baseline-middle !important;
|
3162 |
+
margin-left: 10px;
|
3163 |
+
}
|
3164 |
+
.sfsi_medium_button img {
|
3165 |
+
max-height: 16px !important;
|
3166 |
+
padding: 0px;
|
3167 |
+
line-height: 0px;
|
3168 |
+
vertical-align: -webkit-baseline-middle !important;
|
3169 |
+
}
|
3170 |
+
.sfsi_medium_button {
|
3171 |
+
line-height: 0px;
|
3172 |
+
height: unset;
|
3173 |
+
padding: 10px !important;
|
3174 |
+
}
|
3175 |
+
|
3176 |
+
.sfsi_medium_button span {
|
3177 |
+
margin-left: 10px;
|
3178 |
+
font-size: 18px;
|
3179 |
+
padding: 0px;
|
3180 |
+
line-height: 16px;
|
3181 |
+
vertical-align: -webkit-baseline-middle !important;
|
3182 |
+
margin-left: 10px;
|
3183 |
+
}
|
3184 |
+
.sfsi_medium_button img {
|
3185 |
+
max-height: 16px !important;
|
3186 |
+
padding: 0px;
|
3187 |
+
line-height: 0px;
|
3188 |
+
vertical-align: -webkit-baseline-middle !important;
|
3189 |
+
}
|
3190 |
+
.sfsi_medium_button {
|
3191 |
+
line-height: 0px;
|
3192 |
+
height: unset;
|
3193 |
+
padding: 10px !important;
|
3194 |
+
}
|
3195 |
+
.sfsi_large_button span {
|
3196 |
+
font-size: 20px;
|
3197 |
+
padding: 0px;
|
3198 |
+
line-height: 16px;
|
3199 |
+
vertical-align: -webkit-baseline-middle !important;
|
3200 |
+
display: inline;
|
3201 |
+
margin-left: 10px;
|
3202 |
+
}
|
3203 |
+
.sfsi_large_button img {
|
3204 |
+
max-height: 16px !important;
|
3205 |
+
padding: 0px;
|
3206 |
+
line-height: 0px;
|
3207 |
+
vertical-align: -webkit-baseline-middle !important;
|
3208 |
+
display: inline;
|
3209 |
+
}
|
3210 |
+
.sfsi_large_button {
|
3211 |
+
line-height: 0px;
|
3212 |
+
height: unset;
|
3213 |
+
padding: 13px !important;
|
3214 |
+
}
|
3215 |
+
.sfsi_responsive_icons .sfsi_icons_container span {
|
3216 |
+
font-family: sans-serif;
|
3217 |
+
font-size: 15px;
|
3218 |
+
}
|
3219 |
+
.sfsi_icons_container_box_fully_container {
|
3220 |
+
flex-wrap: wrap;
|
3221 |
+
}
|
3222 |
+
.sfsi_icons_container_box_fully_container a {
|
3223 |
+
flex-basis: auto !important;
|
3224 |
+
flex-grow: 1;
|
3225 |
+
flex-shrink: 1;
|
3226 |
+
margin-bottom: 5px;
|
3227 |
+
}
|
3228 |
+
.sfsi_icons_container>a {
|
3229 |
+
float: left!important;
|
3230 |
+
text-decoration: none!important;
|
3231 |
+
-webkit-box-shadow: unset!important;
|
3232 |
+
box-shadow: unset!important;
|
3233 |
+
-webkit-transition: unset!important;
|
3234 |
+
transition: unset!important;
|
3235 |
+
margin-bottom:5px!important;
|
3236 |
+
}
|
3237 |
+
.sfsi_small_button {
|
3238 |
+
line-height: 0px;
|
3239 |
+
height: unset;
|
3240 |
+
padding: 6px !important;
|
3241 |
+
}
|
3242 |
+
.sfsi_small_button span {
|
3243 |
+
margin-left: 10px;
|
3244 |
+
font-size: 16px;
|
3245 |
+
padding: 0px;
|
3246 |
+
line-height: 16px;
|
3247 |
+
vertical-align: -webkit-baseline-middle !important;
|
3248 |
+
margin-left: 10px;
|
3249 |
+
}
|
3250 |
+
.sfsi_small_button img {
|
3251 |
+
max-height: 16px !important;
|
3252 |
+
padding: 0px;
|
3253 |
+
line-height: 0px;
|
3254 |
+
vertical-align: -webkit-baseline-middle !important;
|
3255 |
+
}
|
3256 |
+
.sfsi_medium_button span {
|
3257 |
+
margin-left: 10px;
|
3258 |
+
font-size: 18px;
|
3259 |
+
padding: 0px;
|
3260 |
+
line-height: 16px;
|
3261 |
+
vertical-align: -webkit-baseline-middle !important;
|
3262 |
+
margin-left: 10px;
|
3263 |
+
}
|
3264 |
+
.sfsi_medium_button img {
|
3265 |
+
max-height: 16px !important;
|
3266 |
+
padding: 0px;
|
3267 |
+
line-height: 0px;
|
3268 |
+
vertical-align: -webkit-baseline-middle !important;
|
3269 |
+
}
|
3270 |
+
.sfsi_medium_button {
|
3271 |
+
line-height: 0px;
|
3272 |
+
height: unset;
|
3273 |
+
padding: 10px !important;
|
3274 |
+
}
|
3275 |
+
|
3276 |
+
.sfsi_medium_button span {
|
3277 |
+
margin-left: 10px;
|
3278 |
+
font-size: 18px;
|
3279 |
+
padding: 0px;
|
3280 |
+
line-height: 16px;
|
3281 |
+
vertical-align: -webkit-baseline-middle !important;
|
3282 |
+
margin-left: 10px;
|
3283 |
+
}
|
3284 |
+
.sfsi_medium_button img {
|
3285 |
+
max-height: 16px !important;
|
3286 |
+
padding: 0px;
|
3287 |
+
line-height: 0px;
|
3288 |
+
vertical-align: -webkit-baseline-middle !important;
|
3289 |
+
}
|
3290 |
+
.sfsi_medium_button {
|
3291 |
+
line-height: 0px;
|
3292 |
+
height: unset;
|
3293 |
+
padding: 10px !important;
|
3294 |
+
}
|
3295 |
+
.sfsi_large_button span {
|
3296 |
+
font-size: 20px;
|
3297 |
+
padding: 0px;
|
3298 |
+
line-height: 16px;
|
3299 |
+
vertical-align: -webkit-baseline-middle !important;
|
3300 |
+
display: inline;
|
3301 |
+
margin-left: 10px;
|
3302 |
+
}
|
3303 |
+
.sfsi_large_button img {
|
3304 |
+
max-height: 16px !important;
|
3305 |
+
padding: 0px;
|
3306 |
+
line-height: 0px;
|
3307 |
+
vertical-align: -webkit-baseline-middle !important;
|
3308 |
+
display: inline;
|
3309 |
+
}
|
3310 |
+
.sfsi_large_button {
|
3311 |
+
line-height: 0px;
|
3312 |
+
height: unset;
|
3313 |
+
padding: 13px !important;
|
3314 |
+
}
|
3315 |
+
.sfsi_responsive_icons_count{
|
3316 |
+
padding: 5px 10px;
|
3317 |
+
float: left !important;
|
3318 |
+
display: inline-block;
|
3319 |
+
margin-right: 0px;
|
3320 |
+
margin-top: 2px;
|
3321 |
+
}
|
3322 |
+
|
3323 |
+
.sfsi_responsive_icons_count h3{
|
3324 |
+
font-family: 'sans-serif' !important;
|
3325 |
+
font-weight: 900;
|
3326 |
+
font-size: 32px !important;
|
3327 |
+
line-height: 0px !important;
|
3328 |
+
padding: 0px;
|
3329 |
+
margin: 0px;
|
3330 |
+
}
|
3331 |
+
|
3332 |
+
.sfsi_responsive_icons_count h6{
|
3333 |
+
font-family: 'sans-serif' !important;
|
3334 |
+
font-weight: 900;
|
3335 |
+
padding: 0px;
|
3336 |
+
margin: 0px;
|
3337 |
+
}
|
3338 |
+
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
3339 |
+
text-decoration: none!important;
|
3340 |
+
border: 0!important;
|
3341 |
+
}
|
3342 |
+
.sfsi_responsive_with_counter_icons{
|
3343 |
+
width: calc(100% - 100px)!important;
|
3344 |
+
}
|
3345 |
+
.sfsiresponsive_icon_preview {
|
3346 |
+
padding: 0px 0 20px 0;
|
3347 |
+
min-width: 100%;
|
3348 |
+
}
|
3349 |
+
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_large_button {
|
3350 |
+
padding: 12px 13px 9px 13px !important;
|
3351 |
+
}
|
3352 |
+
.sfsi_responsive_icons_count.sfsi_fixed_count_container.sfsi_medium_button {
|
3353 |
+
padding: 9px 10px 7px 10px !important;
|
3354 |
+
}
|
3355 |
+
.sfsi_responsive_icons_count.sfsi_small_button {
|
3356 |
+
padding: 7px 6px !important;
|
3357 |
+
}
|
3358 |
+
.sfsi_responsive_icons_count.sfsi_small_button {
|
3359 |
+
padding: 7px 6px !important;
|
3360 |
+
margin-top: 2px;
|
3361 |
+
}
|
3362 |
+
.sfsi_responsive_icons_count.sfsi_small_button h6 {
|
3363 |
+
display: inline-block;
|
3364 |
+
font-size: 12px !important;
|
3365 |
+
vertical-align: middle;
|
3366 |
+
}
|
3367 |
+
.sfsi_responsive_icons_count.sfsi_responsive_count_container.sfsi_medium_button {
|
3368 |
+
padding: 9px 10px 7px 10px !important;
|
3369 |
+
}
|
3370 |
+
.sfsi_responsive_icons_count.sfsi_medium_button h3 {
|
3371 |
+
font-size: 21px !important;
|
3372 |
+
vertical-align: top;
|
3373 |
+
line-height: 8px !important;
|
3374 |
+
margin: 0px 0px 12px 0px !important;
|
3375 |
+
font-weight: 900;
|
3376 |
+
padding: 0px;
|
3377 |
+
}
|
3378 |
+
.sfsi_esponsive_icons_count.sfsi_responsive_count_container.sfsi_large_button h3 {
|
3379 |
+
margin: 0px 0px 15px 0px !important;
|
3380 |
+
}
|
3381 |
+
.sfsi_responsive_icons_count.sfsi_large_button h3 {
|
3382 |
+
font-size: 26px !important;
|
3383 |
+
vertical-align: top;
|
3384 |
+
line-height: 6px !important;
|
3385 |
+
}
|
3386 |
+
|
3387 |
+
.sfsi_responsive_icons_count h3 {
|
3388 |
+
font-family: 'sans-serif' !important;
|
3389 |
+
font-weight: 900;
|
3390 |
+
padding: 0px;
|
3391 |
+
}
|
3392 |
+
|
3393 |
+
.sfsi_responsive_icons_count.sfsi_small_button h3 {
|
3394 |
+
font-size: 20px !important;
|
3395 |
+
display: inline-block;
|
3396 |
+
vertical-align: middle;
|
3397 |
+
}
|
3398 |
+
.sfsi_responsive_icons_count.sfsi_small_button h3 {
|
3399 |
+
margin: 0px !important;
|
3400 |
+
}
|
3401 |
+
.sfsi_responsive_icons_count h3 {
|
3402 |
+
font-family: 'sans-serif' !important;
|
3403 |
+
font-weight: 900;
|
3404 |
+
line-height: 0px !important;
|
3405 |
+
padding: 0px;
|
3406 |
+
margin: 0px;
|
3407 |
+
}
|
3408 |
+
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
3409 |
+
text-decoration: none!important;
|
3410 |
+
border: 0!important;
|
3411 |
+
}
|
3412 |
+
.sfsi_responsive_icons_count.sfsi_small_button {
|
3413 |
+
padding: 7px 6px !important;
|
3414 |
+
margin-top: 2px;
|
3415 |
+
}
|
3416 |
+
|
3417 |
+
.sfsi_responsive_icons_count {
|
3418 |
+
vertical-align: top;
|
3419 |
+
}
|
3420 |
+
.sfsi_responsive_icons_count {
|
3421 |
+
float: left;
|
3422 |
+
}
|
3423 |
+
.sfsi_small_button {
|
3424 |
+
line-height: 0px;
|
3425 |
+
height: unset;
|
3426 |
+
}
|
3427 |
+
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
3428 |
+
text-decoration: none!important;
|
3429 |
+
border: 0!important;
|
3430 |
+
}
|
3431 |
+
.sfsi_responsive_icons_count.sfsi_small_button h3 {
|
3432 |
+
font-size: 20px !important;
|
3433 |
+
display: inline-block;
|
3434 |
+
vertical-align: middle;
|
3435 |
+
margin: 0px !important;
|
3436 |
+
}
|
3437 |
+
|
3438 |
+
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6 {
|
3439 |
+
text-decoration: none!important;
|
3440 |
+
font-family: helveticaregular!important;
|
3441 |
+
border: 0!important;
|
3442 |
+
}
|
3443 |
+
.sfsi_responsive_icons_count h3 {
|
3444 |
+
line-height: 0px !important;
|
3445 |
+
padding: 0px;
|
3446 |
+
}
|
3447 |
+
.sfsi_responsive_icons_count.sfsi_small_button h6 {
|
3448 |
+
display: inline-block;
|
3449 |
+
font-size: 12px !important;
|
3450 |
+
/*vertical-align: middle;*/
|
3451 |
+
margin: 0px !important;
|
3452 |
+
line-height: initial !important;
|
3453 |
+
padding: 0;
|
3454 |
+
margin: 0;
|
3455 |
+
}
|
3456 |
+
.sfsi_responsive_icons_count h6{
|
3457 |
+
margin:0!important;
|
3458 |
+
}
|
3459 |
+
.sfsi_responsive_icons_count h6 {
|
3460 |
+
padding: 0px;
|
3461 |
+
}
|
3462 |
+
.sfsi_responsive_icons a, .sfsi_responsive_icons h3, .sfsi_responsive_icons h6{
|
3463 |
+
text-decoration: none!important;
|
3464 |
+
font-family: helveticaregular!important;
|
3465 |
+
border: 0!important;
|
3466 |
+
}
|
3467 |
+
.sfsi_responsive_icons_count.sfsi_medium_button h6{
|
3468 |
+
font-size: 11px !important;
|
3469 |
+
line-height: 0px !important;
|
3470 |
+
margin: 0px 0px 0px 0px !important;
|
3471 |
+
}
|
js/custom-admin.js
CHANGED
@@ -1,3343 +1,3343 @@
|
|
1 |
-
function sfsi_update_index() {
|
2 |
-
var s = 1;
|
3 |
-
SFSI("ul.icn_listing li.custom").each(function () {
|
4 |
-
SFSI(this).children("span.custom-txt").html("Custom " + s), s++;
|
5 |
-
}), cntt = 1, SFSI("div.cm_lnk").each(function () {
|
6 |
-
SFSI(this).find("h2.custom").find("span.sfsiCtxt").html("Custom " + cntt + ":"),
|
7 |
-
cntt++;
|
8 |
-
}), cntt = 1, SFSI("div.custom_m").find("div.custom_section").each(function () {
|
9 |
-
SFSI(this).find("label").html("Custom " + cntt + ":"), cntt++;
|
10 |
-
});
|
11 |
-
}
|
12 |
-
|
13 |
-
function sfsicollapse(s) {
|
14 |
-
var i = !0,
|
15 |
-
e = SFSI(s).closest("div.ui-accordion-content").prev("h3.ui-accordion-header"),
|
16 |
-
t = SFSI(s).closest("div.ui-accordion-content").first();
|
17 |
-
e.toggleClass("ui-corner-all", i).toggleClass("accordion-header-active ui-state-active ui-corner-top", !i).attr("aria-selected", (!i).toString()),
|
18 |
-
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", i).toggleClass("ui-icon-triangle-1-s", !i),
|
19 |
-
t.toggleClass("accordion-content-active", !i), i ? t.slideUp() : t.slideDown();
|
20 |
-
}
|
21 |
-
|
22 |
-
function sfsi_delete_CusIcon(s, i) {
|
23 |
-
beForeLoad();
|
24 |
-
var e = {
|
25 |
-
action: "deleteIcons",
|
26 |
-
icon_name: i.attr("name"),
|
27 |
-
nonce: SFSI(i).parents('.custom').find('input[name="nonce"]').val()
|
28 |
-
};
|
29 |
-
SFSI.ajax({
|
30 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
31 |
-
type: "post",
|
32 |
-
data: e,
|
33 |
-
dataType: "json",
|
34 |
-
success: function (e) {
|
35 |
-
if ("success" == e.res) {
|
36 |
-
showErrorSuc("success", "Saved !", 1);
|
37 |
-
var t = e.last_index + 1;
|
38 |
-
SFSI("#total_cusotm_icons").val(e.total_up), SFSI(s).closest(".custom").remove(),
|
39 |
-
SFSI("li.custom:last-child").addClass("bdr_btm_non"), SFSI(".custom-links").find("div." + i.attr("name")).remove(),
|
40 |
-
SFSI(".custom_m").find("div." + i.attr("name")).remove(), SFSI(".share_icon_order").children("li." + i.attr("name")).remove(),
|
41 |
-
SFSI("ul.sfsi_sample_icons").children("li." + i.attr("name")).remove();
|
42 |
-
|
43 |
-
if (e.total_up == 0) {
|
44 |
-
SFSI(".notice_custom_icons_premium").hide();
|
45 |
-
}
|
46 |
-
var n = e.total_up + 1;
|
47 |
-
4 == e.total_up && SFSI(".icn_listing").append('<li id="c' + t + '" class="custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style=" 0px 0px;"></span><input name="sfsiICON_' + t + '_display" type="checkbox" value="yes" class="styled" style="display:none;" isNew="yes" /></div> <span class="custom-img"><img src="' + SFSI("#plugin_url").val() + 'images/custom.png" id="CImg_' + t + '" alt="error" /> </span> <span class="custom custom-txt">Custom' + n + ' </span> <div class="right_info"> <p><span>It depends:</span> Upload a custom icon if you have other accounts/websites you want to link to.</p><div class="inputWrapper"></div></li>');
|
48 |
-
} else showErrorSuc("error", "Unkown error , please try again", 1);
|
49 |
-
return sfsi_update_index(), update_Sec5Iconorder(), sfsi_update_step1(), sfsi_update_step5(),
|
50 |
-
afterLoad(), "suc";
|
51 |
-
}
|
52 |
-
});
|
53 |
-
}
|
54 |
-
|
55 |
-
function update_Sec5Iconorder() {
|
56 |
-
SFSI("ul.share_icon_order").children("li").each(function () {
|
57 |
-
SFSI(this).attr("data-index", SFSI(this).index() + 1);
|
58 |
-
});
|
59 |
-
}
|
60 |
-
|
61 |
-
function sfsi_section_Display(s, i) {
|
62 |
-
"hide" == i ? (SFSI("." + s + " :input").prop("disabled", !0), SFSI("." + s + " :button").prop("disabled", !0),
|
63 |
-
SFSI("." + s).hide()) : (SFSI("." + s + " :input").removeAttr("disabled", !0), SFSI("." + s + " :button").removeAttr("disabled", !0),
|
64 |
-
SFSI("." + s).show());
|
65 |
-
}
|
66 |
-
|
67 |
-
function sfsi_depened_sections() {
|
68 |
-
if ("sfsi" == SFSI("input[name='sfsi_rss_icons']:checked").val()) {
|
69 |
-
for (i = 0; 16 > i; i++) {
|
70 |
-
var s = i + 1,
|
71 |
-
e = 74 * i;
|
72 |
-
SFSI(".row_" + s + "_2").css("background-position", "-588px -" + e + "px");
|
73 |
-
}
|
74 |
-
var t = SFSI(".icon_img").attr("src");
|
75 |
-
if (t) {
|
76 |
-
if (t.indexOf("subscribe") != -1) {
|
77 |
-
var n = t.replace("subscribe.png", "sf_arow_icn.png");
|
78 |
-
} else {
|
79 |
-
var n = t.replace("email.png", "sf_arow_icn.png");
|
80 |
-
}
|
81 |
-
SFSI(".icon_img").attr("src", n);
|
82 |
-
}
|
83 |
-
} else {
|
84 |
-
if ("email" == SFSI("input[name='sfsi_rss_icons']:checked").val()) {
|
85 |
-
for (SFSI(".row_1_2").css("background-position", "-58px 0"), i = 0; 16 > i; i++) {
|
86 |
-
var s = i + 1,
|
87 |
-
e = 74 * i;
|
88 |
-
SFSI(".row_" + s + "_2").css("background-position", "-58px -" + e + "px");
|
89 |
-
}
|
90 |
-
var t = SFSI(".icon_img").attr("src");
|
91 |
-
if (t) {
|
92 |
-
if (t.indexOf("sf_arow_icn") != -1) {
|
93 |
-
var n = t.replace("sf_arow_icn.png", "email.png");
|
94 |
-
} else {
|
95 |
-
var n = t.replace("subscribe.png", "email.png");
|
96 |
-
}
|
97 |
-
SFSI(".icon_img").attr("src", n);
|
98 |
-
}
|
99 |
-
} else {
|
100 |
-
for (SFSI(".row_1_2").css("background-position", "-649px 0"), i = 0; 16 > i; i++) {
|
101 |
-
var s = i + 1,
|
102 |
-
e = 74 * i;
|
103 |
-
SFSI(".row_" + s + "_2").css("background-position", "-649px -" + e + "px");
|
104 |
-
}
|
105 |
-
var t = SFSI(".icon_img").attr("src");
|
106 |
-
if (t) {
|
107 |
-
if (t.indexOf("email") != -1) {
|
108 |
-
var n = t.replace("email.png", "subscribe.png");
|
109 |
-
} else {
|
110 |
-
var n = t.replace("sf_arow_icn.png", "subscribe.png");
|
111 |
-
}
|
112 |
-
SFSI(".icon_img").attr("src", n);
|
113 |
-
}
|
114 |
-
}
|
115 |
-
}
|
116 |
-
SFSI("input[name='sfsi_rss_display']").prop("checked") ? sfsi_section_Display("rss_section", "show") : sfsi_section_Display("rss_section", "hide"),
|
117 |
-
SFSI("input[name='sfsi_email_display']").prop("checked") ? sfsi_section_Display("email_section", "show") : sfsi_section_Display("email_section", "hide"),
|
118 |
-
SFSI("input[name='sfsi_facebook_display']").prop("checked") ? sfsi_section_Display("facebook_section", "show") : sfsi_section_Display("facebook_section", "hide"),
|
119 |
-
SFSI("input[name='sfsi_twitter_display']").prop("checked") ? sfsi_section_Display("twitter_section", "show") : sfsi_section_Display("twitter_section", "hide"),
|
120 |
-
SFSI("input[name='sfsi_youtube_display']").prop("checked") ? sfsi_section_Display("youtube_section", "show") : sfsi_section_Display("youtube_section", "hide"),
|
121 |
-
SFSI("input[name='sfsi_pinterest_display']").prop("checked") ? sfsi_section_Display("pinterest_section", "show") : sfsi_section_Display("pinterest_section", "hide"),
|
122 |
-
SFSI("input[name='sfsi_telegram_display']").prop("checked") ? sfsi_section_Display("telegram_section", "show") : sfsi_section_Display("telegram_section", "hide"),
|
123 |
-
SFSI("input[name='sfsi_vk_display']").prop("checked") ? sfsi_section_Display("vk_section", "show") : sfsi_section_Display("vk_section", "hide"),
|
124 |
-
SFSI("input[name='sfsi_ok_display']").prop("checked") ? sfsi_section_Display("ok_section", "show") : sfsi_section_Display("ok_section", "hide"),
|
125 |
-
SFSI("input[name='sfsi_wechat_display']").prop("checked") ? sfsi_section_Display("wechat_section", "show") : sfsi_section_Display("wechat_section", "hide"),
|
126 |
-
SFSI("input[name='sfsi_weibo_display']").prop("checked") ? sfsi_section_Display("weibo_section", "show") : sfsi_section_Display("weibo_section", "hide"),
|
127 |
-
SFSI("input[name='sfsi_instagram_display']").prop("checked") ? sfsi_section_Display("instagram_section", "show") : sfsi_section_Display("instagram_section", "hide"),
|
128 |
-
SFSI("input[name='sfsi_linkedin_display']").prop("checked") ? sfsi_section_Display("linkedin_section", "show") : sfsi_section_Display("linkedin_section", "hide"),
|
129 |
-
SFSI("input[element-type='cusotm-icon']").prop("checked") ? sfsi_section_Display("custom_section", "show") : sfsi_section_Display("custom_section", "hide");
|
130 |
-
}
|
131 |
-
|
132 |
-
function CustomIConSectionsUpdate() {
|
133 |
-
sfsi_section_Display("counter".ele, show);
|
134 |
-
}
|
135 |
-
|
136 |
-
// Upload Custom Skin {Monad}
|
137 |
-
function sfsi_customskin_upload(s, ref, nonce) {
|
138 |
-
var ttl = jQuery(ref).attr("title");
|
139 |
-
var i = s,
|
140 |
-
e = {
|
141 |
-
action: "UploadSkins",
|
142 |
-
custom_imgurl: i,
|
143 |
-
nonce: nonce
|
144 |
-
};
|
145 |
-
SFSI.ajax({
|
146 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
147 |
-
type: "post",
|
148 |
-
data: e,
|
149 |
-
success: function (msg) {
|
150 |
-
if (msg.res = "success") {
|
151 |
-
var arr = s.split('=');
|
152 |
-
jQuery(ref).prev('.imgskin').attr('src', arr[1]);
|
153 |
-
jQuery(ref).prev('.imgskin').css("display", "block");
|
154 |
-
jQuery(ref).text("Update");
|
155 |
-
jQuery(ref).next('.dlt_btn').css("display", "block");
|
156 |
-
}
|
157 |
-
}
|
158 |
-
});
|
159 |
-
}
|
160 |
-
|
161 |
-
// Delete Custom Skin {Monad}
|
162 |
-
function deleteskin_icon(s) {
|
163 |
-
var iconname = jQuery(s).attr("title");
|
164 |
-
var nonce = jQuery(s).attr("data-nonce");
|
165 |
-
var i = iconname,
|
166 |
-
e = {
|
167 |
-
action: "DeleteSkin",
|
168 |
-
iconname: i,
|
169 |
-
nonce: nonce
|
170 |
-
};
|
171 |
-
console.log('delete sin icon', i, iconname, nonce);
|
172 |
-
SFSI.ajax({
|
173 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
174 |
-
type: "post",
|
175 |
-
data: e,
|
176 |
-
dataType: "json",
|
177 |
-
success: function (msg) {
|
178 |
-
console.log(s, e, msg);
|
179 |
-
|
180 |
-
if (msg.res === "success") {
|
181 |
-
SFSI(s).prev("a").text("Upload");
|
182 |
-
SFSI(s).prev("a").prev("img").attr("src", '');
|
183 |
-
SFSI(s).prev("a").prev("img").css("display", "none");
|
184 |
-
SFSI(s).css("display", "none");
|
185 |
-
} else {
|
186 |
-
alert("Whoops! something went wrong.")
|
187 |
-
}
|
188 |
-
}
|
189 |
-
});
|
190 |
-
}
|
191 |
-
|
192 |
-
// Save Custom Skin {Monad}
|
193 |
-
function SFSI_done(nonce) {
|
194 |
-
e = {
|
195 |
-
action: "Iamdone",
|
196 |
-
nonce: nonce
|
197 |
-
};
|
198 |
-
|
199 |
-
SFSI.ajax({
|
200 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
201 |
-
type: "post",
|
202 |
-
data: e,
|
203 |
-
success: function (msg) {
|
204 |
-
if (msg.res === "success") {
|
205 |
-
|
206 |
-
|
207 |
-
jQuery("li.cstomskins_upload").children(".icns_tab_3").html(msg);
|
208 |
-
SFSI("input[name='sfsi_rss_display']").prop("checked") ? sfsi_section_Display("rss_section", "show") : sfsi_section_Display("rss_section", "hide"), SFSI("input[name='sfsi_email_display']").prop("checked") ? sfsi_section_Display("email_section", "show") : sfsi_section_Display("email_section", "hide"), SFSI("input[name='sfsi_facebook_display']").prop("checked") ? sfsi_section_Display("facebook_section", "show") : sfsi_section_Display("facebook_section", "hide"), SFSI("input[name='sfsi_twitter_display']").prop("checked") ? sfsi_section_Display("twitter_section", "show") : sfsi_section_Display("twitter_section", "hide"), SFSI("input[name='sfsi_youtube_display']").prop("checked") ? sfsi_section_Display("youtube_section", "show") : sfsi_section_Display("youtube_section", "hide"), SFSI("input[name='sfsi_pinterest_display']").prop("checked") ? sfsi_section_Display("pinterest_section", "show") : sfsi_section_Display("pinterest_section", "hide"), SFSI("input[name='sfsi_instagram_display']").prop("checked") ? sfsi_section_Display("instagram_section", "show") : sfsi_section_Display("instagram_section", "hide"), SFSI("input[name='sfsi_linkedin_display']").prop("checked") ? sfsi_section_Display("linkedin_section", "show") : sfsi_section_Display("linkedin_section", "hide"), SFSI("input[element-type='cusotm-icon']").prop("checked") ? sfsi_section_Display("custom_section", "show") : sfsi_section_Display("custom_section", "hide");
|
209 |
-
SFSI(".cstmskins-overlay").hide("slow");
|
210 |
-
sfsi_update_step3() && sfsicollapse(this);
|
211 |
-
}
|
212 |
-
}
|
213 |
-
});
|
214 |
-
}
|
215 |
-
|
216 |
-
// Upload Custom Icons {Monad}
|
217 |
-
function sfsi_newcustomicon_upload(s, nonce, nonce2) {
|
218 |
-
var i = s,
|
219 |
-
e = {
|
220 |
-
action: "UploadIcons",
|
221 |
-
custom_imgurl: i,
|
222 |
-
nonce: nonce
|
223 |
-
};
|
224 |
-
SFSI.ajax({
|
225 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
226 |
-
type: "post",
|
227 |
-
data: e,
|
228 |
-
dataType: "json",
|
229 |
-
async: !0,
|
230 |
-
success: function (s) {
|
231 |
-
if (s.res == 'success') {
|
232 |
-
afterIconSuccess(s, nonce2);
|
233 |
-
} else {
|
234 |
-
SFSI(".upload-overlay").hide("slow");
|
235 |
-
SFSI(".uperror").html(s.res);
|
236 |
-
showErrorSuc("Error", "Some Error Occured During Upload Custom Icon", 1)
|
237 |
-
}
|
238 |
-
}
|
239 |
-
});
|
240 |
-
}
|
241 |
-
|
242 |
-
function sfsi_update_step1() {
|
243 |
-
var nonce = SFSI("#sfsi_save1").attr("data-nonce");
|
244 |
-
global_error = 0, beForeLoad(), sfsi_depened_sections();
|
245 |
-
var s = !1,
|
246 |
-
i = SFSI("input[name='sfsi_rss_display']:checked").val(),
|
247 |
-
e = SFSI("input[name='sfsi_email_display']:checked").val(),
|
248 |
-
t = SFSI("input[name='sfsi_facebook_display']:checked").val(),
|
249 |
-
n = SFSI("input[name='sfsi_twitter_display']:checked").val(),
|
250 |
-
r = SFSI("input[name='sfsi_youtube_display']:checked").val(),
|
251 |
-
c = SFSI("input[name='sfsi_pinterest_display']:checked").val(),
|
252 |
-
p = SFSI("input[name='sfsi_linkedin_display']:checked").val(),
|
253 |
-
tg = SFSI("input[name='sfsi_telegram_display']:checked").val(),
|
254 |
-
vk = SFSI("input[name='sfsi_vk_display']:checked").val(),
|
255 |
-
ok = SFSI("input[name='sfsi_ok_display']:checked").val(),
|
256 |
-
wc = SFSI("input[name='sfsi_wechat_display']:checked").val(),
|
257 |
-
wb = SFSI("input[name='sfsi_weibo_display']:checked").val(),
|
258 |
-
_ = SFSI("input[name='sfsi_instagram_display']:checked").val(),
|
259 |
-
l = SFSI("input[name='sfsi_custom1_display']:checked").val(),
|
260 |
-
S = SFSI("input[name='sfsi_custom2_display']:checked").val(),
|
261 |
-
u = SFSI("input[name='sfsi_custom3_display']:checked").val(),
|
262 |
-
f = SFSI("input[name='sfsi_custom4_display']:checked").val(),
|
263 |
-
d = SFSI("input[name='sfsi_custom5_display']:checked").val(),
|
264 |
-
I = {
|
265 |
-
action: "updateSrcn1",
|
266 |
-
sfsi_rss_display: i,
|
267 |
-
sfsi_email_display: e,
|
268 |
-
sfsi_facebook_display: t,
|
269 |
-
sfsi_twitter_display: n,
|
270 |
-
sfsi_youtube_display: r,
|
271 |
-
sfsi_pinterest_display: c,
|
272 |
-
sfsi_linkedin_display: p,
|
273 |
-
sfsi_telegram_display: tg,
|
274 |
-
sfsi_vk_display: vk,
|
275 |
-
sfsi_ok_display: ok,
|
276 |
-
sfsi_wechat_display: wc,
|
277 |
-
sfsi_weibo_display: wb,
|
278 |
-
sfsi_instagram_display: _,
|
279 |
-
sfsi_custom1_display: l,
|
280 |
-
sfsi_custom2_display: S,
|
281 |
-
sfsi_custom3_display: u,
|
282 |
-
sfsi_custom4_display: f,
|
283 |
-
sfsi_custom5_display: d,
|
284 |
-
nonce: nonce
|
285 |
-
};
|
286 |
-
SFSI.ajax({
|
287 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
288 |
-
type: "post",
|
289 |
-
data: I,
|
290 |
-
async: !0,
|
291 |
-
dataType: "json",
|
292 |
-
success: function (i) {
|
293 |
-
if (i == "wrong_nonce") {
|
294 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 1);
|
295 |
-
s = !1;
|
296 |
-
afterLoad();
|
297 |
-
} else {
|
298 |
-
"success" == i ? (showErrorSuc("success", "Saved !", 1), sfsicollapse("#sfsi_save1"),
|
299 |
-
sfsi_make_popBox()) : (global_error = 1, showErrorSuc("error", "Unkown error , please try again", 1),
|
300 |
-
s = !1), afterLoad();
|
301 |
-
}
|
302 |
-
}
|
303 |
-
});
|
304 |
-
}
|
305 |
-
|
306 |
-
function sfsi_update_step2() {
|
307 |
-
|
308 |
-
var nonce = SFSI("#sfsi_save2").attr("data-nonce");
|
309 |
-
var s = sfsi_validationStep2();
|
310 |
-
if (!s) return global_error = 1, !1;
|
311 |
-
beForeLoad();
|
312 |
-
var i = 1 == SFSI("input[name='sfsi_rss_url']").prop("disabled") ? "" : SFSI("input[name='sfsi_rss_url']").val(),
|
313 |
-
e = 1 == SFSI("input[name='sfsi_rss_icons']").prop("disabled") ? "" : SFSI("input[name='sfsi_rss_icons']:checked").val(),
|
314 |
-
|
315 |
-
t = 1 == SFSI("input[name='sfsi_facebookPage_option']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebookPage_option']:checked").val(),
|
316 |
-
n = 1 == SFSI("input[name='sfsi_facebookLike_option']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebookLike_option']:checked").val(),
|
317 |
-
o = 1 == SFSI("input[name='sfsi_facebookShare_option']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebookShare_option']:checked").val(),
|
318 |
-
a = SFSI("input[name='sfsi_facebookPage_url']").val(),
|
319 |
-
r = 1 == SFSI("input[name='sfsi_twitter_followme']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_followme']:checked").val(),
|
320 |
-
c = 1 == SFSI("input[name='sfsi_twitter_followUserName']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_followUserName']").val(),
|
321 |
-
p = 1 == SFSI("input[name='sfsi_twitter_aboutPage']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_aboutPage']:checked").val(),
|
322 |
-
_ = 1 == SFSI("input[name='sfsi_twitter_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_page']:checked").val(),
|
323 |
-
l = SFSI("input[name='sfsi_twitter_pageURL']").val(),
|
324 |
-
S = SFSI("textarea[name='sfsi_twitter_aboutPageText']").val(),
|
325 |
-
m = 1 == SFSI("input[name='sfsi_youtube_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_page']:checked").val(),
|
326 |
-
F = 1 == SFSI("input[name='sfsi_youtube_pageUrl']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_pageUrl']").val(),
|
327 |
-
h = 1 == SFSI("input[name='sfsi_youtube_follow']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_follow']:checked").val(),
|
328 |
-
cls = SFSI("input[name='sfsi_youtubeusernameorid']:checked").val(),
|
329 |
-
v = SFSI("input[name='sfsi_ytube_user']").val(),
|
330 |
-
vchid = SFSI("input[name='sfsi_ytube_chnlid']").val(),
|
331 |
-
g = 1 == SFSI("input[name='sfsi_pinterest_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_page']:checked").val(),
|
332 |
-
k = 1 == SFSI("input[name='sfsi_pinterest_pageUrl']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_pageUrl']").val(),
|
333 |
-
y = 1 == SFSI("input[name='sfsi_pinterest_pingBlog']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_pingBlog']:checked").val(),
|
334 |
-
b = 1 == SFSI("input[name='sfsi_instagram_pageUrl']").prop("disabled") ? "" : SFSI("input[name='sfsi_instagram_pageUrl']").val(),
|
335 |
-
w = 1 == SFSI("input[name='sfsi_linkedin_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedin_page']:checked").val(),
|
336 |
-
x = 1 == SFSI("input[name='sfsi_linkedin_pageURL']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedin_pageURL']").val(),
|
337 |
-
C = 1 == SFSI("input[name='sfsi_linkedin_follow']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedin_follow']:checked").val(),
|
338 |
-
D = SFSI("input[name='sfsi_linkedin_followCompany']").val(),
|
339 |
-
U = 1 == SFSI("input[name='sfsi_linkedin_SharePage']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedin_SharePage']:checked").val(),
|
340 |
-
O = SFSI("input[name='sfsi_linkedin_recommendBusines']:checked").val(),
|
341 |
-
T = SFSI("input[name='sfsi_linkedin_recommendProductId']").val(),
|
342 |
-
j = SFSI("input[name='sfsi_linkedin_recommendCompany']").val(),
|
343 |
-
tp = 1 == SFSI("input[name='sfsi_telegram_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_telegram_page']:checked").val(),
|
344 |
-
tpu = SFSI("input[name='sfsi_telegram_pageURL']").val(),
|
345 |
-
tm = SFSI("input[name='sfsi_telegram_message']").val(),
|
346 |
-
tmn = SFSI("input[name='sfsi_telegram_username']").val(),
|
347 |
-
wp = 1 == SFSI("input[name='sfsi_weibo_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_weibo_page']:checked").val(),
|
348 |
-
wpu = SFSI("input[name='sfsi_weibo_pageURL']").val(),
|
349 |
-
vp = 1 == SFSI("input[name='sfsi_vk_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_vk_page']:checked").val(),
|
350 |
-
vpu = SFSI("input[name='sfsi_vk_pageURL']").val(),
|
351 |
-
op = 1 == SFSI("input[name='sfsi_ok_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_ok_page']:checked").val(),
|
352 |
-
opu = SFSI("input[name='sfsi_ok_pageURL']").val(),
|
353 |
-
P = {};
|
354 |
-
SFSI("input[name='sfsi_CustomIcon_links[]']").each(function () {
|
355 |
-
P[SFSI(this).attr("file-id")] = this.value;
|
356 |
-
});
|
357 |
-
var M = {
|
358 |
-
action: "updateSrcn2",
|
359 |
-
sfsi_rss_url: i,
|
360 |
-
sfsi_rss_icons: e,
|
361 |
-
sfsi_facebookPage_option: t,
|
362 |
-
sfsi_facebookLike_option: n,
|
363 |
-
sfsi_facebookShare_option: o,
|
364 |
-
sfsi_facebookPage_url: a,
|
365 |
-
sfsi_twitter_followme: r,
|
366 |
-
sfsi_twitter_followUserName: c,
|
367 |
-
sfsi_twitter_aboutPage: p,
|
368 |
-
sfsi_twitter_page: _,
|
369 |
-
sfsi_twitter_pageURL: l,
|
370 |
-
sfsi_twitter_aboutPageText: S,
|
371 |
-
sfsi_youtube_page: m,
|
372 |
-
sfsi_youtube_pageUrl: F,
|
373 |
-
sfsi_youtube_follow: h,
|
374 |
-
sfsi_youtubeusernameorid: cls,
|
375 |
-
sfsi_ytube_user: v,
|
376 |
-
sfsi_ytube_chnlid: vchid,
|
377 |
-
sfsi_pinterest_page: g,
|
378 |
-
sfsi_pinterest_pageUrl: k,
|
379 |
-
sfsi_instagram_pageUrl: b,
|
380 |
-
sfsi_pinterest_pingBlog: y,
|
381 |
-
sfsi_linkedin_page: w,
|
382 |
-
sfsi_linkedin_pageURL: x,
|
383 |
-
sfsi_linkedin_follow: C,
|
384 |
-
sfsi_linkedin_followCompany: D,
|
385 |
-
sfsi_linkedin_SharePage: U,
|
386 |
-
sfsi_linkedin_recommendBusines: O,
|
387 |
-
sfsi_linkedin_recommendCompany: j,
|
388 |
-
sfsi_linkedin_recommendProductId: T,
|
389 |
-
sfsi_custom_links: P,
|
390 |
-
sfsi_telegram_page: tp,
|
391 |
-
sfsi_telegram_pageURL: tpu,
|
392 |
-
sfsi_telegram_message: tm,
|
393 |
-
sfsi_telegram_username: tmn,
|
394 |
-
sfsi_weibo_page: wp,
|
395 |
-
sfsi_weibo_pageURL: wpu,
|
396 |
-
sfsi_vk_page: vp,
|
397 |
-
sfsi_vk_pageURL: vpu,
|
398 |
-
sfsi_ok_page: op,
|
399 |
-
sfsi_ok_pageURL: opu,
|
400 |
-
nonce: nonce
|
401 |
-
};
|
402 |
-
SFSI.ajax({
|
403 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
404 |
-
type: "post",
|
405 |
-
data: M,
|
406 |
-
async: !0,
|
407 |
-
dataType: "json",
|
408 |
-
success: function (s) {
|
409 |
-
if (s == "wrong_nonce") {
|
410 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 2);
|
411 |
-
return_value = !1;
|
412 |
-
afterLoad();
|
413 |
-
} else {
|
414 |
-
"success" == s ? (showErrorSuc("success", "Saved !", 2), sfsicollapse("#sfsi_save2"),
|
415 |
-
sfsi_depened_sections()) : (global_error = 1, showErrorSuc("error", "Unkown error , please try again", 2),
|
416 |
-
return_value = !1), afterLoad();
|
417 |
-
}
|
418 |
-
}
|
419 |
-
});
|
420 |
-
}
|
421 |
-
|
422 |
-
function sfsi_update_step3() {
|
423 |
-
var nonce = SFSI("#sfsi_save3").attr("data-nonce");
|
424 |
-
var s = sfsi_validationStep3();
|
425 |
-
if (!s) return global_error = 1, !1;
|
426 |
-
beForeLoad();
|
427 |
-
var i = SFSI("input[name='sfsi_actvite_theme']:checked").val(),
|
428 |
-
e = SFSI("input[name='sfsi_mouseOver']:checked").val(),
|
429 |
-
t = SFSI("input[name='sfsi_shuffle_icons']:checked").val(),
|
430 |
-
n = SFSI("input[name='sfsi_shuffle_Firstload']:checked").val(),
|
431 |
-
o = SFSI("input[name='sfsi_same_icons_mouseOver_effect']:checked").val(),
|
432 |
-
a = SFSI("input[name='sfsi_shuffle_interval']:checked").val(),
|
433 |
-
r = SFSI("input[name='sfsi_shuffle_intervalTime']").val(),
|
434 |
-
c = SFSI("input[name='sfsi_specialIcon_animation']:checked").val(),
|
435 |
-
p = SFSI("input[name='sfsi_specialIcon_MouseOver']:checked").val(),
|
436 |
-
_ = SFSI("input[name='sfsi_specialIcon_Firstload']:checked").val(),
|
437 |
-
l = SFSI("#sfsi_specialIcon_Firstload_Icons option:selected").val(),
|
438 |
-
S = SFSI("input[name='sfsi_specialIcon_interval']:checked").val(),
|
439 |
-
u = SFSI("input[name='sfsi_specialIcon_intervalTime']").val(),
|
440 |
-
f = SFSI("#sfsi_specialIcon_intervalIcons option:selected").val();
|
441 |
-
|
442 |
-
var mouseover_effect_type = 'same_icons'; //SFSI("input[name='sfsi_mouseOver_effect_type']:checked").val();
|
443 |
-
|
444 |
-
d = {
|
445 |
-
action: "updateSrcn3",
|
446 |
-
sfsi_actvite_theme: i,
|
447 |
-
sfsi_mouseOver: e,
|
448 |
-
sfsi_shuffle_icons: t,
|
449 |
-
sfsi_shuffle_Firstload: n,
|
450 |
-
sfsi_mouseOver_effect: o,
|
451 |
-
sfsi_mouseover_effect_type: mouseover_effect_type,
|
452 |
-
sfsi_shuffle_interval: a,
|
453 |
-
sfsi_shuffle_intervalTime: r,
|
454 |
-
sfsi_specialIcon_animation: c,
|
455 |
-
sfsi_specialIcon_MouseOver: p,
|
456 |
-
sfsi_specialIcon_Firstload: _,
|
457 |
-
sfsi_specialIcon_Firstload_Icons: l,
|
458 |
-
sfsi_specialIcon_interval: S,
|
459 |
-
sfsi_specialIcon_intervalTime: u,
|
460 |
-
sfsi_specialIcon_intervalIcons: f,
|
461 |
-
nonce: nonce
|
462 |
-
};
|
463 |
-
SFSI.ajax({
|
464 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
465 |
-
type: "post",
|
466 |
-
data: d,
|
467 |
-
async: !0,
|
468 |
-
dataType: "json",
|
469 |
-
success: function (s) {
|
470 |
-
if (s == "wrong_nonce") {
|
471 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 3);
|
472 |
-
return_value = !1;
|
473 |
-
afterLoad();
|
474 |
-
} else {
|
475 |
-
"success" == s ? (showErrorSuc("success", "Saved !", 3), sfsicollapse("#sfsi_save3")) : (showErrorSuc("error", "Unkown error , please try again", 3),
|
476 |
-
return_value = !1), afterLoad();
|
477 |
-
}
|
478 |
-
}
|
479 |
-
});
|
480 |
-
}
|
481 |
-
|
482 |
-
function sfsi_show_counts() {
|
483 |
-
"yes" == SFSI("input[name='sfsi_display_counts']:checked").val() ? (SFSI(".count_sections").slideDown(),
|
484 |
-
sfsi_showPreviewCounts()) : (SFSI(".count_sections").slideUp(), sfsi_showPreviewCounts());
|
485 |
-
}
|
486 |
-
|
487 |
-
function sfsi_showPreviewCounts() {
|
488 |
-
var s = 0;
|
489 |
-
1 == SFSI("input[name='sfsi_rss_countsDisplay']").prop("checked") ? (SFSI("#sfsi_rss_countsDisplay").css("opacity", 1), s = 1) : SFSI("#sfsi_rss_countsDisplay").css("opacity", 0),
|
490 |
-
1 == SFSI("input[name='sfsi_email_countsDisplay']").prop("checked") ? (SFSI("#sfsi_email_countsDisplay").css("opacity", 1),
|
491 |
-
s = 1) : SFSI("#sfsi_email_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_facebook_countsDisplay']").prop("checked") ? (SFSI("#sfsi_facebook_countsDisplay").css("opacity", 1),
|
492 |
-
s = 1) : SFSI("#sfsi_facebook_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_twitter_countsDisplay']").prop("checked") ? (SFSI("#sfsi_twitter_countsDisplay").css("opacity", 1),
|
493 |
-
s = 1) : SFSI("#sfsi_twitter_countsDisplay").css("opacity", 0),
|
494 |
-
1 == SFSI("input[name='sfsi_linkedIn_countsDisplay']").prop("checked") ? (SFSI("#sfsi_linkedIn_countsDisplay").css("opacity", 1), s = 1) : SFSI("#sfsi_linkedIn_countsDisplay").css("opacity", 0),
|
495 |
-
1 == SFSI("input[name='sfsi_youtube_countsDisplay']").prop("checked") ? (SFSI("#sfsi_youtube_countsDisplay").css("opacity", 1),
|
496 |
-
s = 1) : SFSI("#sfsi_youtube_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_pinterest_countsDisplay']").prop("checked") ? (SFSI("#sfsi_pinterest_countsDisplay").css("opacity", 1),
|
497 |
-
s = 1) : SFSI("#sfsi_pinterest_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_instagram_countsDisplay']").prop("checked") ? (SFSI("#sfsi_instagram_countsDisplay").css("opacity", 1),
|
498 |
-
s = 1) : SFSI("#sfsi_instagram_countsDisplay").css("opacity", 0),
|
499 |
-
1 == SFSI("input[name='sfsi_telegram_countsDisplay']").prop("checked") ? (SFSI("#sfsi_telegram_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_telegram_countsDisplay").css("opacity", 0),
|
500 |
-
1 == SFSI("input[name='sfsi_vk_countsDisplay']").prop("checked") ? (SFSI("#sfsi_vk_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_vk_countsDisplay").css("opacity", 0),
|
501 |
-
1 == SFSI("input[name='sfsi_ok_countsDisplay']").prop("checked") ? (SFSI("#sfsi_ok_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_ok_countsDisplay").css("opacity", 0),
|
502 |
-
1 == SFSI("input[name='sfsi_weibo_countsDisplay']").prop("checked") ? (SFSI("#sfsi_weibo_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_weibo_countsDisplay").css("opacity", 0),
|
503 |
-
1 == SFSI("input[name='sfsi_wechat_countsDisplay']").prop("checked") ? (SFSI("#sfsi_wechat_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_wechat_countsDisplay").css("opacity", 0),
|
504 |
-
|
505 |
-
0 == s || "no" == SFSI("input[name='sfsi_display_counts']:checked").val() ? SFSI(".sfsi_Cdisplay").hide() : SFSI(".sfsi_Cdisplay").show();
|
506 |
-
}
|
507 |
-
|
508 |
-
function sfsi_show_OnpostsDisplay() {
|
509 |
-
//"yes" == SFSI("input[name='sfsi_show_Onposts']:checked").val() ? SFSI(".PostsSettings_section").slideDown() :SFSI(".PostsSettings_section").slideUp();
|
510 |
-
}
|
511 |
-
|
512 |
-
function sfsi_update_step4() {
|
513 |
-
var nonce = SFSI("#sfsi_save4").attr("data-nonce");
|
514 |
-
var s = !1,
|
515 |
-
i = sfsi_validationStep4();
|
516 |
-
if (!i) return global_error = 1, !1;
|
517 |
-
beForeLoad();
|
518 |
-
var e = SFSI("input[name='sfsi_display_counts']:checked").val(),
|
519 |
-
t = 1 == SFSI("input[name='sfsi_email_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_email_countsDisplay']:checked").val(),
|
520 |
-
n = 1 == SFSI("input[name='sfsi_email_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_email_countsFrom']:checked").val(),
|
521 |
-
o = SFSI("input[name='sfsi_email_manualCounts']").val(),
|
522 |
-
r = 1 == SFSI("input[name='sfsi_rss_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_rss_countsDisplay']:checked").val(),
|
523 |
-
c = SFSI("input[name='sfsi_rss_manualCounts']").val(),
|
524 |
-
p = 1 == SFSI("input[name='sfsi_facebook_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebook_countsDisplay']:checked").val(),
|
525 |
-
_ = 1 == SFSI("input[name='sfsi_facebook_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebook_countsFrom']:checked").val(),
|
526 |
-
mp = SFSI("input[name='sfsi_facebook_mypageCounts']").val(),
|
527 |
-
l = SFSI("input[name='sfsi_facebook_manualCounts']").val(),
|
528 |
-
S = 1 == SFSI("input[name='sfsi_twitter_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_countsDisplay']:checked").val(),
|
529 |
-
u = 1 == SFSI("input[name='sfsi_twitter_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_countsFrom']:checked").val(),
|
530 |
-
f = SFSI("input[name='sfsi_twitter_manualCounts']").val(),
|
531 |
-
d = SFSI("input[name='tw_consumer_key']").val(),
|
532 |
-
I = SFSI("input[name='tw_consumer_secret']").val(),
|
533 |
-
m = SFSI("input[name='tw_oauth_access_token']").val(),
|
534 |
-
F = SFSI("input[name='tw_oauth_access_token_secret']").val(),
|
535 |
-
k = 1 == SFSI("input[name='sfsi_linkedIn_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val(),
|
536 |
-
y = SFSI("input[name='sfsi_linkedIn_manualCounts']").val(),
|
537 |
-
b = SFSI("input[name='ln_company']").val(),
|
538 |
-
w = SFSI("input[name='ln_api_key']").val(),
|
539 |
-
x = SFSI("input[name='ln_secret_key']").val(),
|
540 |
-
C = SFSI("input[name='ln_oAuth_user_token']").val(),
|
541 |
-
D = 1 == SFSI("input[name='sfsi_linkedIn_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedIn_countsDisplay']:checked").val(),
|
542 |
-
k = 1 == SFSI("input[name='sfsi_linkedIn_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val(),
|
543 |
-
y = SFSI("input[name='sfsi_linkedIn_manualCounts']").val(),
|
544 |
-
U = 1 == SFSI("input[name='sfsi_youtube_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_countsDisplay']:checked").val(),
|
545 |
-
O = 1 == SFSI("input[name='sfsi_youtube_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_countsFrom']:checked").val(),
|
546 |
-
T = SFSI("input[name='sfsi_youtube_manualCounts']").val(),
|
547 |
-
j = SFSI("input[name='sfsi_youtube_user']").val(),
|
548 |
-
P = 1 == SFSI("input[name='sfsi_pinterest_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_countsDisplay']:checked").val(),
|
549 |
-
M = 1 == SFSI("input[name='sfsi_pinterest_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_countsFrom']:checked").val(),
|
550 |
-
L = SFSI("input[name='sfsi_pinterest_manualCounts']").val(),
|
551 |
-
B = SFSI("input[name='sfsi_pinterest_user']").val(),
|
552 |
-
E = SFSI("input[name='sfsi_pinterest_board']").val(),
|
553 |
-
z = 1 == SFSI("input[name='sfsi_instagram_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_instagram_countsDisplay']:checked").val(),
|
554 |
-
A = 1 == SFSI("input[name='sfsi_instagram_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_instagram_countsFrom']:checked").val(),
|
555 |
-
N = SFSI("input[name='sfsi_instagram_manualCounts']").val(),
|
556 |
-
H = SFSI("input[name='sfsi_instagram_User']").val(),
|
557 |
-
ha = SFSI("input[name='sfsi_instagram_clientid']").val(),
|
558 |
-
ia = SFSI("input[name='sfsi_instagram_appurl']").val(),
|
559 |
-
ja = SFSI("input[name='sfsi_instagram_token']").val(),
|
560 |
-
|
561 |
-
tc = 1 == SFSI("input[name='sfsi_telegram_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_telegram_countsDisplay']:checked").val(),
|
562 |
-
tm = SFSI("input[name='sfsi_telegram_manualCounts']").val(),
|
563 |
-
|
564 |
-
vc = 1 == SFSI("input[name='sfsi_vk_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_vk_countsDisplay']:checked").val(),
|
565 |
-
vm = SFSI("input[name='sfsi_vk_manualCounts']").val(),
|
566 |
-
|
567 |
-
|
568 |
-
oc = 1 == SFSI("input[name='sfsi_ok_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_ok_countsDisplay']:checked").val(),
|
569 |
-
om = SFSI("input[name='sfsi_ok_manualCounts']").val(),
|
570 |
-
|
571 |
-
|
572 |
-
wc = 1 == SFSI("input[name='sfsi_weibo_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_weibo_countsDisplay']:checked").val(),
|
573 |
-
wm = SFSI("input[name='sfsi_weibo_manualCounts']").val(),
|
574 |
-
|
575 |
-
wcc = 1 == SFSI("input[name='sfsi_wechat_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_wechat_countsDisplay']:checked").val(),
|
576 |
-
wcm = SFSI("input[name='sfsi_wechat_manualCounts']").val(),
|
577 |
-
$ = {
|
578 |
-
action: "updateSrcn4",
|
579 |
-
sfsi_display_counts: e,
|
580 |
-
sfsi_email_countsDisplay: t,
|
581 |
-
sfsi_email_countsFrom: n,
|
582 |
-
sfsi_email_manualCounts: o,
|
583 |
-
sfsi_rss_countsDisplay: r,
|
584 |
-
sfsi_rss_manualCounts: c,
|
585 |
-
sfsi_facebook_countsDisplay: p,
|
586 |
-
sfsi_facebook_countsFrom: _,
|
587 |
-
sfsi_facebook_mypageCounts: mp,
|
588 |
-
sfsi_facebook_manualCounts: l,
|
589 |
-
sfsi_twitter_countsDisplay: S,
|
590 |
-
sfsi_twitter_countsFrom: u,
|
591 |
-
sfsi_twitter_manualCounts: f,
|
592 |
-
tw_consumer_key: d,
|
593 |
-
tw_consumer_secret: I,
|
594 |
-
tw_oauth_access_token: m,
|
595 |
-
tw_oauth_access_token_secret: F,
|
596 |
-
sfsi_linkedIn_countsDisplay: D,
|
597 |
-
sfsi_linkedIn_countsFrom: k,
|
598 |
-
sfsi_linkedIn_manualCounts: y,
|
599 |
-
ln_company: b,
|
600 |
-
ln_api_key: w,
|
601 |
-
ln_secret_key: x,
|
602 |
-
ln_oAuth_user_token: C,
|
603 |
-
sfsi_youtube_countsDisplay: U,
|
604 |
-
sfsi_youtube_countsFrom: O,
|
605 |
-
sfsi_youtube_manualCounts: T,
|
606 |
-
sfsi_youtube_user: j,
|
607 |
-
sfsi_youtube_channelId: SFSI("input[name='sfsi_youtube_channelId']").val(),
|
608 |
-
sfsi_pinterest_countsDisplay: P,
|
609 |
-
sfsi_pinterest_countsFrom: M,
|
610 |
-
sfsi_pinterest_manualCounts: L,
|
611 |
-
sfsi_pinterest_user: B,
|
612 |
-
sfsi_pinterest_board: E,
|
613 |
-
sfsi_instagram_countsDisplay: z,
|
614 |
-
sfsi_instagram_countsFrom: A,
|
615 |
-
sfsi_instagram_manualCounts: N,
|
616 |
-
sfsi_instagram_User: H,
|
617 |
-
sfsi_instagram_clientid: ha,
|
618 |
-
sfsi_instagram_appurl: ia,
|
619 |
-
sfsi_instagram_token: ja,
|
620 |
-
sfsi_telegram_countsDisplay: tc,
|
621 |
-
sfsi_telegram_manualCounts: tm,
|
622 |
-
sfsi_vk_countsDisplay: vc,
|
623 |
-
sfsi_vk_manualCounts: vm,
|
624 |
-
sfsi_ok_countsDisplay: oc,
|
625 |
-
sfsi_ok_manualCounts: om,
|
626 |
-
sfsi_weibo_countsDisplay: wc,
|
627 |
-
sfsi_weibo_manualCounts: wm,
|
628 |
-
sfsi_wechat_countsDisplay: wcc,
|
629 |
-
sfsi_wechat_manualCounts: wcm,
|
630 |
-
nonce: nonce
|
631 |
-
};
|
632 |
-
console.log($);
|
633 |
-
return SFSI.ajax({
|
634 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
635 |
-
type: "post",
|
636 |
-
data: $,
|
637 |
-
dataType: "json",
|
638 |
-
async: !0,
|
639 |
-
success: function (s) {
|
640 |
-
if (s == "wrong_nonce") {
|
641 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 4);
|
642 |
-
global_error = 1;
|
643 |
-
afterLoad();
|
644 |
-
} else {
|
645 |
-
"success" == s.res ? (showErrorSuc("success", "Saved !", 4), sfsicollapse("#sfsi_save4"),
|
646 |
-
sfsi_showPreviewCounts()) : (showErrorSuc("error", "Unkown error , please try again", 4),
|
647 |
-
global_error = 1), afterLoad();
|
648 |
-
}
|
649 |
-
}
|
650 |
-
}), s;
|
651 |
-
}
|
652 |
-
|
653 |
-
function sfsi_update_step5() {
|
654 |
-
var nonce = SFSI("#sfsi_save5").attr("data-nonce");
|
655 |
-
sfsi_update_step3();
|
656 |
-
|
657 |
-
var s = sfsi_validationStep5();
|
658 |
-
|
659 |
-
if (!s) return global_error = 1, !1;
|
660 |
-
|
661 |
-
beForeLoad();
|
662 |
-
|
663 |
-
var i = SFSI("input[name='sfsi_icons_size']").val(),
|
664 |
-
e = SFSI("input[name='sfsi_icons_perRow']").val(),
|
665 |
-
t = SFSI("input[name='sfsi_icons_spacing']").val(),
|
666 |
-
n = SFSI("#sfsi_icons_Alignment").val(),
|
667 |
-
o = SFSI("input[name='sfsi_icons_ClickPageOpen']:checked").val(),
|
668 |
-
|
669 |
-
se = SFSI("input[name='sfsi_icons_suppress_errors']:checked").val(),
|
670 |
-
c = SFSI("input[name='sfsi_icons_stick']:checked").val(),
|
671 |
-
p = SFSI("#sfsi_rssIcon_order").attr("data-index"),
|
672 |
-
_ = SFSI("#sfsi_emailIcon_order").attr("data-index"),
|
673 |
-
S = SFSI("#sfsi_facebookIcon_order").attr("data-index"),
|
674 |
-
u = SFSI("#sfsi_twitterIcon_order").attr("data-index"),
|
675 |
-
f = SFSI("#sfsi_youtubeIcon_order").attr("data-index"),
|
676 |
-
d = SFSI("#sfsi_pinterestIcon_order").attr("data-index"),
|
677 |
-
I = SFSI("#sfsi_instagramIcon_order").attr("data-index"),
|
678 |
-
F = SFSI("#sfsi_linkedinIcon_order").attr("data-index"),
|
679 |
-
tgi = SFSI("#sfsi_telegramIcon_order").attr("data-index"),
|
680 |
-
vki = SFSI("#sfsi_vkIcon_order").attr("data-index"),
|
681 |
-
oki = SFSI("#sfsi_okIcon_order").attr("data-index"),
|
682 |
-
wbi = SFSI("#sfsi_weiboIcon_order").attr("data-index"),
|
683 |
-
wci = SFSI("#sfsi_wechatIcon_order").attr("data-index"),
|
684 |
-
|
685 |
-
h = new Array();
|
686 |
-
|
687 |
-
SFSI(".custom_iconOrder").each(function () {
|
688 |
-
h.push({
|
689 |
-
order: SFSI(this).attr("data-index"),
|
690 |
-
ele: SFSI(this).attr("element-id")
|
691 |
-
});
|
692 |
-
});
|
693 |
-
|
694 |
-
var v = 1 == SFSI("input[name='sfsi_rss_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_rss_MouseOverText']").val(),
|
695 |
-
g = 1 == SFSI("input[name='sfsi_email_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_email_MouseOverText']").val(),
|
696 |
-
k = 1 == SFSI("input[name='sfsi_twitter_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_MouseOverText']").val(),
|
697 |
-
y = 1 == SFSI("input[name='sfsi_facebook_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebook_MouseOverText']").val(),
|
698 |
-
w = 1 == SFSI("input[name='sfsi_linkedIn_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedIn_MouseOverText']").val(),
|
699 |
-
x = 1 == SFSI("input[name='sfsi_youtube_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_MouseOverText']").val(),
|
700 |
-
C = 1 == SFSI("input[name='sfsi_pinterest_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_MouseOverText']").val(),
|
701 |
-
D = 1 == SFSI("input[name='sfsi_instagram_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_instagram_MouseOverText']").val(),
|
702 |
-
tg = 1 == SFSI("input[name='sfsi_telegram_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_telegram_MouseOverText']").val(),
|
703 |
-
vk = 1 == SFSI("input[name='sfsi_vk_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_vk_MouseOverText']").val(),
|
704 |
-
ok = 1 == SFSI("input[name='sfsi_ok_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_ok_MouseOverText']").val(),
|
705 |
-
wb = 1 == SFSI("input[name='sfsi_weibo_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_weibo_MouseOverText']").val(),
|
706 |
-
wc = 1 == SFSI("input[name='sfsi_wechat_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_wechat_MouseOverText']").val(),
|
707 |
-
|
708 |
-
O = {};
|
709 |
-
SFSI("input[name='sfsi_custom_MouseOverTexts[]']").each(function () {
|
710 |
-
O[SFSI(this).attr("file-id")] = this.value;
|
711 |
-
});
|
712 |
-
|
713 |
-
var sfsi_custom_social_hide = SFSI("input[name='sfsi_custom_social_hide']").val();
|
714 |
-
|
715 |
-
var T = {
|
716 |
-
action: "updateSrcn5",
|
717 |
-
sfsi_icons_size: i,
|
718 |
-
sfsi_icons_Alignment: n,
|
719 |
-
sfsi_icons_perRow: e,
|
720 |
-
sfsi_icons_spacing: t,
|
721 |
-
sfsi_icons_ClickPageOpen: o,
|
722 |
-
sfsi_icons_suppress_errors: se,
|
723 |
-
sfsi_icons_stick: c,
|
724 |
-
sfsi_rss_MouseOverText: v,
|
725 |
-
sfsi_email_MouseOverText: g,
|
726 |
-
sfsi_twitter_MouseOverText: k,
|
727 |
-
sfsi_facebook_MouseOverText: y,
|
728 |
-
sfsi_youtube_MouseOverText: x,
|
729 |
-
sfsi_linkedIn_MouseOverText: w,
|
730 |
-
sfsi_pinterest_MouseOverText: C,
|
731 |
-
sfsi_instagram_MouseOverText: D,
|
732 |
-
sfsi_telegram_MouseOverText: tg,
|
733 |
-
sfsi_vk_MouseOverText: vk,
|
734 |
-
sfsi_ok_MouseOverText: ok,
|
735 |
-
sfsi_weibo_MouseOverText: wb,
|
736 |
-
sfsi_wechat_MouseOverText: wc,
|
737 |
-
sfsi_custom_MouseOverTexts: O,
|
738 |
-
sfsi_rssIcon_order: p,
|
739 |
-
sfsi_emailIcon_order: _,
|
740 |
-
sfsi_facebookIcon_order: S,
|
741 |
-
sfsi_twitterIcon_order: u,
|
742 |
-
sfsi_youtubeIcon_order: f,
|
743 |
-
sfsi_pinterestIcon_order: d,
|
744 |
-
sfsi_instagramIcon_order: I,
|
745 |
-
sfsi_linkedinIcon_order: F,
|
746 |
-
sfsi_telegramIcon_order: tgi,
|
747 |
-
sfsi_vkIcon_order: vki,
|
748 |
-
sfsi_okIcon_order: oki,
|
749 |
-
sfsi_weiboIcon_order: wbi,
|
750 |
-
sfsi_wechatIcon_order: wci,
|
751 |
-
|
752 |
-
sfsi_custom_orders: h,
|
753 |
-
sfsi_custom_social_hide: sfsi_custom_social_hide,
|
754 |
-
nonce: nonce
|
755 |
-
};
|
756 |
-
console.log(T);
|
757 |
-
SFSI.ajax({
|
758 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
759 |
-
type: "post",
|
760 |
-
data: T,
|
761 |
-
dataType: "json",
|
762 |
-
async: !0,
|
763 |
-
success: function (s) {
|
764 |
-
if (s == "wrong_nonce") {
|
765 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 5);
|
766 |
-
global_error = 1;
|
767 |
-
afterLoad();
|
768 |
-
} else {
|
769 |
-
"success" == s ? (showErrorSuc("success", "Saved !", 5), sfsicollapse("#sfsi_save5")) : (global_error = 1,
|
770 |
-
showErrorSuc("error", "Unkown error , please try again", 5)), afterLoad();
|
771 |
-
}
|
772 |
-
}
|
773 |
-
});
|
774 |
-
}
|
775 |
-
|
776 |
-
function sfsi_update_step6() {
|
777 |
-
var nonce = SFSI("#sfsi_save9").attr("data-nonce2");
|
778 |
-
beForeLoad();
|
779 |
-
var s = SFSI("input[name='sfsi_show_Onposts']:checked").val(),
|
780 |
-
i = SFSI("input[name='sfsi_textBefor_icons']").val(),
|
781 |
-
e = SFSI("#sfsi_icons_alignment").val(),
|
782 |
-
t = SFSI("#sfsi_icons_DisplayCounts").val(),
|
783 |
-
rsub = SFSI("input[name='sfsi_rectsub']:checked").val(),
|
784 |
-
rfb = SFSI("input[name='sfsi_rectfb']:checked").val(),
|
785 |
-
rpin = SFSI("input[name='sfsi_rectpinit']:checked").val(),
|
786 |
-
rshr = SFSI("input[name='sfsi_rectshr']:checked").val(),
|
787 |
-
rtwr = SFSI("input[name='sfsi_recttwtr']:checked").val(),
|
788 |
-
rfbshare = SFSI("input[name='sfsi_rectfbshare']:checked").val(),
|
789 |
-
a = SFSI("input[name='sfsi_display_button_type']:checked").val();
|
790 |
-
countshare = SFSI("input[name='sfsi_share_count']:checked").val();
|
791 |
-
endpost = SFSI("input[name='sfsi_responsive_icons_end_post']:checked").val();
|
792 |
-
|
793 |
-
var responsive_icons = {
|
794 |
-
"default_icons": {},
|
795 |
-
"settings": {}
|
796 |
-
};
|
797 |
-
SFSI('.sfsi_responsive_default_icon_container input[type="checkbox"]').each(function (index, obj) {
|
798 |
-
var data_obj = {};
|
799 |
-
data_obj.active = ('checked' == SFSI(obj).attr('checked')) ? 'yes' : 'no';
|
800 |
-
var iconname = SFSI(obj).attr('data-icon');
|
801 |
-
var next_section = SFSI(obj).parent().parent();
|
802 |
-
data_obj.text = next_section.find('input[name="sfsi_responsive_' + iconname + '_input"]').val();
|
803 |
-
data_obj.url = next_section.find('input[name="sfsi_responsive_' + iconname + '_url_input"]').val();
|
804 |
-
responsive_icons.default_icons[iconname] = data_obj;
|
805 |
-
});
|
806 |
-
SFSI('.sfsi_responsive_custom_icon_container input[type="checkbox"]').each(function (index, obj) {
|
807 |
-
if (SFSI(obj).attr('id') != "sfsi_responsive_custom_new_display") {
|
808 |
-
var data_obj = {};
|
809 |
-
data_obj.active = 'checked' == SFSI(obj).attr('checked') ? 'yes' : 'no';
|
810 |
-
var icon_index = SFSI(obj).attr('data-custom-index');
|
811 |
-
var next_section = SFSI(obj).parent().parent();
|
812 |
-
data_obj['added'] = SFSI('input[name="sfsi_responsive_custom_' + index + '_added"]').val();
|
813 |
-
data_obj.icon = next_section.find('img').attr('src');
|
814 |
-
data_obj["bg-color"] = next_section.find('.sfsi_bg-color-picker').val();
|
815 |
-
|
816 |
-
data_obj.text = next_section.find('input[name="sfsi_responsive_custom_' + icon_index + '_input"]').val();
|
817 |
-
data_obj.url = next_section.find('input[name="sfsi_responsive_custom_' + icon_index + '_url_input"]').val();
|
818 |
-
responsive_icons.custom_icons[index] = data_obj;
|
819 |
-
}
|
820 |
-
});
|
821 |
-
responsive_icons.settings.icon_size = SFSI('select[name="sfsi_responsive_icons_settings_icon_size"]').val();
|
822 |
-
responsive_icons.settings.icon_width_type = SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val();
|
823 |
-
responsive_icons.settings.icon_width_size = SFSI('input[name="sfsi_responsive_icons_sttings_icon_width_size"]').val();
|
824 |
-
responsive_icons.settings.edge_type = SFSI('select[name="sfsi_responsive_icons_settings_edge_type"]').val();
|
825 |
-
responsive_icons.settings.edge_radius = SFSI('select[name="sfsi_responsive_icons_settings_edge_radius"]').val();
|
826 |
-
responsive_icons.settings.style = SFSI('select[name="sfsi_responsive_icons_settings_style"]').val();
|
827 |
-
responsive_icons.settings.margin = SFSI('input[name="sfsi_responsive_icons_settings_margin"]').val();
|
828 |
-
responsive_icons.settings.text_align = SFSI('select[name="sfsi_responsive_icons_settings_text_align"]').val();
|
829 |
-
responsive_icons.settings.show_count = SFSI('input[name="sfsi_responsive_icon_show_count"]:checked').val();
|
830 |
-
responsive_icons.settings.counter_color = SFSI('input[name="sfsi_responsive_counter_color"]').val();
|
831 |
-
responsive_icons.settings.counter_bg_color = SFSI('input[name="sfsi_responsive_counter_bg_color"]').val();
|
832 |
-
responsive_icons.settings.share_count_text = SFSI('input[name="sfsi_responsive_counter_share_count_text"]').val();
|
833 |
-
responsive_icons.settings.show_count = countshare;
|
834 |
-
n = {
|
835 |
-
action: "updateSrcn6",
|
836 |
-
sfsi_show_Onposts: s,
|
837 |
-
sfsi_icons_DisplayCounts: t,
|
838 |
-
sfsi_icons_alignment: e,
|
839 |
-
sfsi_textBefor_icons: i,
|
840 |
-
sfsi_rectsub: rsub,
|
841 |
-
sfsi_rectfb: rfb,
|
842 |
-
sfsi_rectpinit: rpin,
|
843 |
-
sfsi_rectshr: rshr,
|
844 |
-
sfsi_recttwtr: rtwr,
|
845 |
-
sfsi_rectfbshare: rfbshare,
|
846 |
-
sfsi_responsive_icons: responsive_icons,
|
847 |
-
sfsi_display_button_type: a,
|
848 |
-
sfsi_responsive_icons_end_post:endpost,
|
849 |
-
sfsi_share_count: countshare,
|
850 |
-
nonce: nonce
|
851 |
-
};
|
852 |
-
SFSI.ajax({
|
853 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
854 |
-
type: "post",
|
855 |
-
data: n,
|
856 |
-
dataType: "json",
|
857 |
-
async: !0,
|
858 |
-
success: function (s) {
|
859 |
-
if (s == "wrong_nonce") {
|
860 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 6);
|
861 |
-
global_error = 1;
|
862 |
-
afterLoad();
|
863 |
-
} else {
|
864 |
-
"success" == s ? (showErrorSuc("success", "Saved !", 6), sfsicollapse("#sfsi_save6")) : (global_error = 1,
|
865 |
-
showErrorSuc("error", "Unkown error , please try again", 6)), afterLoad();
|
866 |
-
}
|
867 |
-
}
|
868 |
-
});
|
869 |
-
}
|
870 |
-
|
871 |
-
function sfsi_update_step7() {
|
872 |
-
var nonce = SFSI("#sfsi_save7").attr("data-nonce");
|
873 |
-
var s = sfsi_validationStep7();
|
874 |
-
if (!s) return global_error = 1, !1;
|
875 |
-
beForeLoad();
|
876 |
-
var i = SFSI("input[name='sfsi_popup_text']").val(),
|
877 |
-
e = SFSI("#sfsi_popup_font option:selected").val(),
|
878 |
-
t = SFSI("#sfsi_popup_fontStyle option:selected").val(),
|
879 |
-
color = SFSI("input[name='sfsi_popup_fontColor']").val(),
|
880 |
-
n = SFSI("input[name='sfsi_popup_fontSize']").val(),
|
881 |
-
o = SFSI("input[name='sfsi_popup_background_color']").val(),
|
882 |
-
a = SFSI("input[name='sfsi_popup_border_color']").val(),
|
883 |
-
r = SFSI("input[name='sfsi_popup_border_thickness']").val(),
|
884 |
-
c = SFSI("input[name='sfsi_popup_border_shadow']:checked").val(),
|
885 |
-
p = SFSI("input[name='sfsi_Show_popupOn']:checked").val(),
|
886 |
-
_ = [];
|
887 |
-
SFSI("#sfsi_Show_popupOn_PageIDs :selected").each(function (s, i) {
|
888 |
-
_[s] = SFSI(i).val();
|
889 |
-
});
|
890 |
-
var l = SFSI("input[name='sfsi_Shown_pop']:checked").val(),
|
891 |
-
S = SFSI("input[name='sfsi_Shown_popupOnceTime']").val(),
|
892 |
-
u = SFSI("#sfsi_Shown_popuplimitPerUserTime").val(),
|
893 |
-
f = {
|
894 |
-
action: "updateSrcn7",
|
895 |
-
sfsi_popup_text: i,
|
896 |
-
sfsi_popup_font: e,
|
897 |
-
sfsi_popup_fontColor: color,
|
898 |
-
/*sfsi_popup_fontStyle: t,*/
|
899 |
-
sfsi_popup_fontSize: n,
|
900 |
-
sfsi_popup_background_color: o,
|
901 |
-
sfsi_popup_border_color: a,
|
902 |
-
sfsi_popup_border_thickness: r,
|
903 |
-
sfsi_popup_border_shadow: c,
|
904 |
-
sfsi_Show_popupOn: p,
|
905 |
-
sfsi_Show_popupOn_PageIDs: _,
|
906 |
-
sfsi_Shown_pop: l,
|
907 |
-
sfsi_Shown_popupOnceTime: S,
|
908 |
-
sfsi_Shown_popuplimitPerUserTime: u,
|
909 |
-
nonce: nonce
|
910 |
-
};
|
911 |
-
SFSI.ajax({
|
912 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
913 |
-
type: "post",
|
914 |
-
data: f,
|
915 |
-
dataType: "json",
|
916 |
-
async: !0,
|
917 |
-
success: function (s) {
|
918 |
-
if (s == "wrong_nonce") {
|
919 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 7);
|
920 |
-
afterLoad();
|
921 |
-
} else {
|
922 |
-
"success" == s ? (showErrorSuc("success", "Saved !", 7), sfsicollapse("#sfsi_save7")) : showErrorSuc("error", "Unkown error , please try again", 7),
|
923 |
-
afterLoad();
|
924 |
-
}
|
925 |
-
}
|
926 |
-
});
|
927 |
-
}
|
928 |
-
|
929 |
-
function sfsi_update_step8() {
|
930 |
-
var nonce = SFSI("#sfsi_save8").attr("data-nonce");
|
931 |
-
beForeLoad();
|
932 |
-
var ie = SFSI("input[name='sfsi_form_adjustment']:checked").val(),
|
933 |
-
je = SFSI("input[name='sfsi_form_height']").val(),
|
934 |
-
ke = SFSI("input[name='sfsi_form_width']").val(),
|
935 |
-
le = SFSI("input[name='sfsi_form_border']:checked").val(),
|
936 |
-
me = SFSI("input[name='sfsi_form_border_thickness']").val(),
|
937 |
-
ne = SFSI("input[name='sfsi_form_border_color']").val(),
|
938 |
-
oe = SFSI("input[name='sfsi_form_background']").val(),
|
939 |
-
|
940 |
-
ae = SFSI("input[name='sfsi_form_heading_text']").val(),
|
941 |
-
be = SFSI("#sfsi_form_heading_font option:selected").val(),
|
942 |
-
ce = SFSI("#sfsi_form_heading_fontstyle option:selected").val(),
|
943 |
-
de = SFSI("input[name='sfsi_form_heading_fontcolor']").val(),
|
944 |
-
ee = SFSI("input[name='sfsi_form_heading_fontsize']").val(),
|
945 |
-
fe = SFSI("#sfsi_form_heading_fontalign option:selected").val(),
|
946 |
-
|
947 |
-
ue = SFSI("input[name='sfsi_form_field_text']").val(),
|
948 |
-
ve = SFSI("#sfsi_form_field_font option:selected").val(),
|
949 |
-
we = SFSI("#sfsi_form_field_fontstyle option:selected").val(),
|
950 |
-
xe = SFSI("input[name='sfsi_form_field_fontcolor']").val(),
|
951 |
-
ye = SFSI("input[name='sfsi_form_field_fontsize']").val(),
|
952 |
-
ze = SFSI("#sfsi_form_field_fontalign option:selected").val(),
|
953 |
-
|
954 |
-
i = SFSI("input[name='sfsi_form_button_text']").val(),
|
955 |
-
j = SFSI("#sfsi_form_button_font option:selected").val(),
|
956 |
-
k = SFSI("#sfsi_form_button_fontstyle option:selected").val(),
|
957 |
-
l = SFSI("input[name='sfsi_form_button_fontcolor']").val(),
|
958 |
-
m = SFSI("input[name='sfsi_form_button_fontsize']").val(),
|
959 |
-
n = SFSI("#sfsi_form_button_fontalign option:selected").val(),
|
960 |
-
o = SFSI("input[name='sfsi_form_button_background']").val();
|
961 |
-
|
962 |
-
var f = {
|
963 |
-
action: "updateSrcn8",
|
964 |
-
sfsi_form_adjustment: ie,
|
965 |
-
sfsi_form_height: je,
|
966 |
-
sfsi_form_width: ke,
|
967 |
-
sfsi_form_border: le,
|
968 |
-
sfsi_form_border_thickness: me,
|
969 |
-
sfsi_form_border_color: ne,
|
970 |
-
sfsi_form_background: oe,
|
971 |
-
|
972 |
-
sfsi_form_heading_text: ae,
|
973 |
-
sfsi_form_heading_font: be,
|
974 |
-
sfsi_form_heading_fontstyle: ce,
|
975 |
-
sfsi_form_heading_fontcolor: de,
|
976 |
-
sfsi_form_heading_fontsize: ee,
|
977 |
-
sfsi_form_heading_fontalign: fe,
|
978 |
-
|
979 |
-
sfsi_form_field_text: ue,
|
980 |
-
sfsi_form_field_font: ve,
|
981 |
-
sfsi_form_field_fontstyle: we,
|
982 |
-
sfsi_form_field_fontcolor: xe,
|
983 |
-
sfsi_form_field_fontsize: ye,
|
984 |
-
sfsi_form_field_fontalign: ze,
|
985 |
-
|
986 |
-
sfsi_form_button_text: i,
|
987 |
-
sfsi_form_button_font: j,
|
988 |
-
sfsi_form_button_fontstyle: k,
|
989 |
-
sfsi_form_button_fontcolor: l,
|
990 |
-
sfsi_form_button_fontsize: m,
|
991 |
-
sfsi_form_button_fontalign: n,
|
992 |
-
sfsi_form_button_background: o,
|
993 |
-
|
994 |
-
nonce: nonce
|
995 |
-
};
|
996 |
-
SFSI.ajax({
|
997 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
998 |
-
type: "post",
|
999 |
-
data: f,
|
1000 |
-
dataType: "json",
|
1001 |
-
async: !0,
|
1002 |
-
success: function (s) {
|
1003 |
-
if (s == "wrong_nonce") {
|
1004 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 7);
|
1005 |
-
afterLoad();
|
1006 |
-
} else {
|
1007 |
-
"success" == s ? (showErrorSuc("success", "Saved !", 8), sfsicollapse("#sfsi_save8"), create_suscriber_form()) : showErrorSuc("error", "Unkown error , please try again", 8),
|
1008 |
-
afterLoad();
|
1009 |
-
}
|
1010 |
-
}
|
1011 |
-
});
|
1012 |
-
}
|
1013 |
-
|
1014 |
-
// Queestion 3
|
1015 |
-
function sfsi_update_step9() {
|
1016 |
-
sfsi_update_step6();
|
1017 |
-
var nonce = SFSI("#sfsi_save9").attr("data-nonce");
|
1018 |
-
beForeLoad();
|
1019 |
-
|
1020 |
-
var i_float = SFSI("input[name='sfsi_icons_float']:checked").val(),
|
1021 |
-
i_floatP = SFSI("input[name='sfsi_icons_floatPosition']:checked").val(),
|
1022 |
-
i_floatMt = SFSI("input[name='sfsi_icons_floatMargin_top']").val(),
|
1023 |
-
i_floatMb = SFSI("input[name='sfsi_icons_floatMargin_bottom']").val(),
|
1024 |
-
i_floatMl = SFSI("input[name='sfsi_icons_floatMargin_left']").val(),
|
1025 |
-
i_floatMr = SFSI("input[name='sfsi_icons_floatMargin_right']").val(),
|
1026 |
-
i_disableFloat = SFSI("input[name='sfsi_disable_floaticons']:checked").val(),
|
1027 |
-
|
1028 |
-
show_via_widget = SFSI("input[name='sfsi_show_via_widget']").val(),
|
1029 |
-
show_via__shortcode = SFSI("input[name='sfsi_show_via_shortcode']:checked").length==0?"no":"yes",
|
1030 |
-
sfsi_show_via_afterposts = SFSI("input[name='sfsi_show_via_afterposts']").val();
|
1031 |
-
|
1032 |
-
var f = {
|
1033 |
-
|
1034 |
-
action: "updateSrcn9",
|
1035 |
-
|
1036 |
-
sfsi_icons_float: i_float,
|
1037 |
-
sfsi_icons_floatPosition: i_floatP,
|
1038 |
-
sfsi_icons_floatMargin_top: i_floatMt,
|
1039 |
-
sfsi_icons_floatMargin_bottom: i_floatMb,
|
1040 |
-
sfsi_icons_floatMargin_left: i_floatMl,
|
1041 |
-
sfsi_icons_floatMargin_right: i_floatMr,
|
1042 |
-
sfsi_disable_floaticons: i_disableFloat,
|
1043 |
-
|
1044 |
-
sfsi_show_via_widget: show_via_widget,
|
1045 |
-
sfsi_show_via_shortcode: show_via__shortcode,
|
1046 |
-
sfsi_show_via_afterposts: sfsi_show_via_afterposts,
|
1047 |
-
nonce: nonce
|
1048 |
-
};
|
1049 |
-
SFSI.ajax({
|
1050 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
1051 |
-
type: "post",
|
1052 |
-
data: f,
|
1053 |
-
dataType: "json",
|
1054 |
-
async: !0,
|
1055 |
-
success: function (s) {
|
1056 |
-
if (s == "wrong_nonce") {
|
1057 |
-
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 9);
|
1058 |
-
afterLoad();
|
1059 |
-
} else {
|
1060 |
-
"success" == s ? (showErrorSuc("success", "Saved !", 9), sfsicollapse("#sfsi_save9")) : showErrorSuc("error", "Unkown error , please try again", 9),
|
1061 |
-
afterLoad();
|
1062 |
-
}
|
1063 |
-
}
|
1064 |
-
});
|
1065 |
-
}
|
1066 |
-
|
1067 |
-
function sfsi_validationStep2() {
|
1068 |
-
//var class_name= SFSI(element).hasAttr('sfsi_validate');
|
1069 |
-
SFSI('input').removeClass('inputError'); // remove previous error
|
1070 |
-
if (sfsi_validator(SFSI('input[name="sfsi_rss_display"]'), 'checked')) {
|
1071 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_rss_url"]'), 'url')) {
|
1072 |
-
showErrorSuc("error", "Error : Invalid Rss url ", 2);
|
1073 |
-
SFSI('input[name="sfsi_rss_url"]').addClass('inputError');
|
1074 |
-
|
1075 |
-
return false;
|
1076 |
-
}
|
1077 |
-
}
|
1078 |
-
/* validate facebook */
|
1079 |
-
if (sfsi_validator(SFSI('input[name="sfsi_facebookPage_option"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_facebookPage_option"]'), 'checked')) {
|
1080 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_facebookPage_url"]'), 'blank')) {
|
1081 |
-
showErrorSuc("error", "Error : Invalid Facebook page url ", 2);
|
1082 |
-
SFSI('input[name="sfsi_facebookPage_url"]').addClass('inputError');
|
1083 |
-
|
1084 |
-
return false;
|
1085 |
-
}
|
1086 |
-
}
|
1087 |
-
/* validate twitter user name */
|
1088 |
-
if (sfsi_validator(SFSI('input[name="sfsi_twitter_followme"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_twitter_followme"]'), 'checked')) {
|
1089 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_twitter_followUserName"]'), 'blank')) {
|
1090 |
-
showErrorSuc("error", "Error : Invalid Twitter UserName ", 2);
|
1091 |
-
SFSI('input[name="sfsi_twitter_followUserName"]').addClass('inputError');
|
1092 |
-
return false;
|
1093 |
-
}
|
1094 |
-
}
|
1095 |
-
/* validate twitter about page */
|
1096 |
-
if (sfsi_validator(SFSI('input[name="sfsi_twitter_aboutPage"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_twitter_aboutPage"]'), 'checked')) {
|
1097 |
-
if (!sfsi_validator(SFSI('#sfsi_twitter_aboutPageText'), 'blank')) {
|
1098 |
-
showErrorSuc("error", "Error : Tweet about my page is blank ", 2);
|
1099 |
-
SFSI('#sfsi_twitter_aboutPageText').addClass('inputError');
|
1100 |
-
return false;
|
1101 |
-
}
|
1102 |
-
}
|
1103 |
-
/* twitter validation */
|
1104 |
-
if (sfsi_validator(SFSI('input[name="sfsi_twitter_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_twitter_page"]'), 'checked')) {
|
1105 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_twitter_pageURL"]'), 'blank')) {
|
1106 |
-
showErrorSuc("error", "Error : Invalid twitter page Url ", 2);
|
1107 |
-
SFSI('input[name="sfsi_twitter_pageURL"]').addClass('inputError');
|
1108 |
-
return false;
|
1109 |
-
}
|
1110 |
-
}
|
1111 |
-
|
1112 |
-
/* youtube validation */
|
1113 |
-
if (sfsi_validator(SFSI('input[name="sfsi_youtube_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_youtube_page"]'), 'checked')) {
|
1114 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_youtube_pageUrl"]'), 'blank')) {
|
1115 |
-
showErrorSuc("error", "Error : Invalid youtube Url ", 2);
|
1116 |
-
SFSI('input[name="sfsi_youtube_pageUrl"]').addClass('inputError');
|
1117 |
-
return false;
|
1118 |
-
}
|
1119 |
-
}
|
1120 |
-
/* youtube validation */
|
1121 |
-
if (sfsi_validator(SFSI('input[name="sfsi_youtube_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_youtube_follow"]'), 'checked')) {
|
1122 |
-
cls = SFSI("input[name='sfsi_youtubeusernameorid']:checked").val();
|
1123 |
-
if (cls == 'name' && !sfsi_validator(SFSI('input[name="sfsi_ytube_user"]'), 'blank')) {
|
1124 |
-
showErrorSuc("error", "Error : Invalid youtube user name", 2);
|
1125 |
-
SFSI('input[name="sfsi_ytube_user"]').addClass('inputError');
|
1126 |
-
return false;
|
1127 |
-
}
|
1128 |
-
|
1129 |
-
if (cls == 'id' && !sfsi_validator(SFSI('input[name="sfsi_ytube_chnlid"]'), 'blank')) {
|
1130 |
-
showErrorSuc("error", "Error : Invalid youtube Channel ID ", 2);
|
1131 |
-
SFSI('input[name="sfsi_ytube_user"]').addClass('inputError');
|
1132 |
-
return false;
|
1133 |
-
}
|
1134 |
-
}
|
1135 |
-
/* pinterest validation */
|
1136 |
-
if (sfsi_validator(SFSI('input[name="sfsi_pinterest_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_pinterest_page"]'), 'checked')) {
|
1137 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_pinterest_pageUrl"]'), 'blank')) {
|
1138 |
-
showErrorSuc("error", "Error : Invalid pinterest page url ", 2);
|
1139 |
-
SFSI('input[name="sfsi_pinterest_pageUrl"]').addClass('inputError');
|
1140 |
-
return false;
|
1141 |
-
}
|
1142 |
-
}
|
1143 |
-
/* instagram validation */
|
1144 |
-
if (sfsi_validator(SFSI('input[name="sfsi_instagram_display"]'), 'checked')) {
|
1145 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_instagram_pageUrl"]'), 'blank')) {
|
1146 |
-
showErrorSuc("error", "Error : Invalid Instagram url ", 2);
|
1147 |
-
SFSI('input[name="sfsi_instagram_pageUrl"]').addClass('inputError');
|
1148 |
-
return false;
|
1149 |
-
}
|
1150 |
-
}
|
1151 |
-
/* telegram validation */
|
1152 |
-
if (sfsi_validator(SFSI('input[name="sfsi_telegram_display"]'), 'checked')) {
|
1153 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_telegram_username"]'), 'blank')) {
|
1154 |
-
showErrorSuc("error", "Error : Invalid telegram username ", 2);
|
1155 |
-
SFSI('input[name="sfsi_telegram_username"]').addClass('inputError');
|
1156 |
-
return false;
|
1157 |
-
}
|
1158 |
-
}
|
1159 |
-
/* telegram validation */
|
1160 |
-
if (sfsi_validator(SFSI('input[name="sfsi_telegram_display"]'), 'checked')) {
|
1161 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_telegram_message"]'), 'blank')) {
|
1162 |
-
showErrorSuc("error", "Error : Invalid Message ", 2);
|
1163 |
-
SFSI('input[name="sfsi_telegram_message"]').addClass('inputError');
|
1164 |
-
return false;
|
1165 |
-
}
|
1166 |
-
}
|
1167 |
-
/* vk validation */
|
1168 |
-
if (sfsi_validator(SFSI('input[name="sfsi_vk_display"]'), 'checked')) {
|
1169 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_vk_pageURL"]'), 'blank')) {
|
1170 |
-
showErrorSuc("error", "Error : Invalid vk url ", 2);
|
1171 |
-
SFSI('input[name="sfsi_vk_pageURL"]').addClass('inputError');
|
1172 |
-
return false;
|
1173 |
-
}
|
1174 |
-
}
|
1175 |
-
/* ok validation */
|
1176 |
-
if (sfsi_validator(SFSI('input[name="sfsi_ok_display"]'), 'checked')) {
|
1177 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_ok_pageURL"]'), 'blank')) {
|
1178 |
-
showErrorSuc("error", "Error : Invalid ok url ", 2);
|
1179 |
-
SFSI('input[name="sfsi_ok_pageURL"]').addClass('inputError');
|
1180 |
-
return false;
|
1181 |
-
}
|
1182 |
-
}
|
1183 |
-
/* weibo validation */
|
1184 |
-
if (sfsi_validator(SFSI('input[name="sfsi_weibo_display"]'), 'checked')) {
|
1185 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_weibo_pageURL"]'), 'blank')) {
|
1186 |
-
showErrorSuc("error", "Error : Invalid weibo url ", 2);
|
1187 |
-
SFSI('input[name="sfsi_weibo_pageURL"]').addClass('inputError');
|
1188 |
-
return false;
|
1189 |
-
}
|
1190 |
-
}
|
1191 |
-
/* LinkedIn validation */
|
1192 |
-
if (sfsi_validator(SFSI('input[name="sfsi_linkedin_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_linkedin_page"]'), 'checked')) {
|
1193 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_linkedin_pageURL"]'), 'blank')) {
|
1194 |
-
showErrorSuc("error", "Error : Invalid LinkedIn page url ", 2);
|
1195 |
-
SFSI('input[name="sfsi_linkedin_pageURL"]').addClass('inputError');
|
1196 |
-
return false;
|
1197 |
-
}
|
1198 |
-
}
|
1199 |
-
if (sfsi_validator(SFSI('input[name="sfsi_linkedin_recommendBusines"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_linkedin_recommendBusines"]'), 'checked')) {
|
1200 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_linkedin_recommendProductId"]'), 'blank') || !sfsi_validator(SFSI('input[name="sfsi_linkedin_recommendCompany"]'), 'blank')) {
|
1201 |
-
showErrorSuc("error", "Error : Please Enter Product Id and Company for LinkedIn Recommendation ", 2);
|
1202 |
-
SFSI('input[name="sfsi_linkedin_recommendProductId"]').addClass('inputError');
|
1203 |
-
SFSI('input[name="sfsi_linkedin_recommendCompany"]').addClass('inputError');
|
1204 |
-
return false;
|
1205 |
-
}
|
1206 |
-
}
|
1207 |
-
/* validate custom links */
|
1208 |
-
var er = 0;
|
1209 |
-
SFSI("input[name='sfsi_CustomIcon_links[]']").each(function () {
|
1210 |
-
|
1211 |
-
//if(!sfsi_validator(SFSI(this),'blank') || !sfsi_validator(SFSI(SFSI(this)),'url') )
|
1212 |
-
if (!sfsi_validator(SFSI(this), 'blank')) {
|
1213 |
-
showErrorSuc("error", "Error : Please Enter a valid Custom link ", 2);
|
1214 |
-
SFSI(this).addClass('inputError');
|
1215 |
-
er = 1;
|
1216 |
-
}
|
1217 |
-
});
|
1218 |
-
if (!er) return true;
|
1219 |
-
else return false;
|
1220 |
-
}
|
1221 |
-
|
1222 |
-
function sfsi_validationStep3() {
|
1223 |
-
SFSI('input').removeClass('inputError'); // remove previous error
|
1224 |
-
/* validate shuffle effect */
|
1225 |
-
if (sfsi_validator(SFSI('input[name="sfsi_shuffle_icons"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_shuffle_icons"]'), 'checked')) {
|
1226 |
-
if ((!sfsi_validator(SFSI('input[name="sfsi_shuffle_Firstload"]'), 'activte') || !sfsi_validator(SFSI('input[name="sfsi_shuffle_Firstload"]'), 'checked')) && (!sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'activte') || !sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'checked'))) {
|
1227 |
-
showErrorSuc("error", "Error : Please Chose a Shuffle option ", 3);
|
1228 |
-
SFSI('input[name="sfsi_shuffle_Firstload"]').addClass('inputError');
|
1229 |
-
SFSI('input[name="sfsi_shuffle_interval"]').addClass('inputError');
|
1230 |
-
return false;
|
1231 |
-
}
|
1232 |
-
}
|
1233 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_shuffle_icons"]'), 'checked') && (sfsi_validator(SFSI('input[name="sfsi_shuffle_Firstload"]'), 'checked') || sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'checked'))) {
|
1234 |
-
showErrorSuc("error", "Error : Please check \"Shuffle them automatically\" option also ", 3);
|
1235 |
-
SFSI('input[name="sfsi_shuffle_Firstload"]').addClass('inputError');
|
1236 |
-
SFSI('input[name="sfsi_shuffle_interval"]').addClass('inputError');
|
1237 |
-
return false;
|
1238 |
-
}
|
1239 |
-
|
1240 |
-
/* validate twitter user name */
|
1241 |
-
if (sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'checked')) {
|
1242 |
-
|
1243 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_shuffle_intervalTime"]'), 'blank') || !sfsi_validator(SFSI('input[name="sfsi_shuffle_intervalTime"]'), 'int')) {
|
1244 |
-
showErrorSuc("error", "Error : Invalid shuffle time interval", 3);
|
1245 |
-
SFSI('input[name="sfsi_shuffle_intervalTime"]').addClass('inputError');
|
1246 |
-
return false;
|
1247 |
-
}
|
1248 |
-
}
|
1249 |
-
return true;
|
1250 |
-
}
|
1251 |
-
|
1252 |
-
function sfsi_validationStep4() {
|
1253 |
-
//var class_name= SFSI(element).hasAttr('sfsi_validate');
|
1254 |
-
/* validate email */
|
1255 |
-
if (sfsi_validator(SFSI('input[name="sfsi_email_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_email_countsDisplay"]'), 'checked')) {
|
1256 |
-
if (SFSI('input[name="sfsi_email_countsFrom"]:checked').val() == 'manual') {
|
1257 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_email_manualCounts"]'), 'blank')) {
|
1258 |
-
showErrorSuc("error", "Error : Please Enter manual counts for Email icon ", 4);
|
1259 |
-
SFSI('input[name="sfsi_email_manualCounts"]').addClass('inputError');
|
1260 |
-
return false;
|
1261 |
-
}
|
1262 |
-
}
|
1263 |
-
}
|
1264 |
-
/* validate RSS count */
|
1265 |
-
if (sfsi_validator(SFSI('input[name="sfsi_rss_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_rss_countsDisplay"]'), 'checked')) {
|
1266 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_rss_manualCounts"]'), 'blank')) {
|
1267 |
-
showErrorSuc("error", "Error : Please Enter manual counts for Rss icon ", 4);
|
1268 |
-
SFSI('input[name="sfsi_rss_countsDisplay"]').addClass('inputError');
|
1269 |
-
return false;
|
1270 |
-
}
|
1271 |
-
}
|
1272 |
-
/* validate facebook */
|
1273 |
-
if (sfsi_validator(SFSI('input[name="sfsi_facebook_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_facebook_countsDisplay"]'), 'checked')) {
|
1274 |
-
/*if(SFSI('input[name="sfsi_facebook_countsFrom"]:checked').val()=='likes' )
|
1275 |
-
{
|
1276 |
-
if(!sfsi_validator(SFSI('input[name="sfsi_facebook_PageLink"]'),'blank'))
|
1277 |
-
{ showErrorSuc("error","Error : Please Enter facebook page Url ",4);
|
1278 |
-
SFSI('input[name="sfsi_facebook_PageLink"]').addClass('inputError');
|
1279 |
-
return false;
|
1280 |
-
}
|
1281 |
-
} */
|
1282 |
-
if (SFSI('input[name="sfsi_facebook_countsFrom"]:checked').val() == 'manual') {
|
1283 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_facebook_manualCounts"]'), 'blank') && !sfsi_validator(SFSI('input[name="sfsi_facebook_manualCounts"]'), 'url')) {
|
1284 |
-
showErrorSuc("error", "Error : Please Enter a valid facebook manual counts ", 4);
|
1285 |
-
SFSI('input[name="sfsi_facebook_manualCounts"]').addClass('inputError');
|
1286 |
-
return false;
|
1287 |
-
}
|
1288 |
-
}
|
1289 |
-
}
|
1290 |
-
|
1291 |
-
/* validate twitter */
|
1292 |
-
if (sfsi_validator(SFSI('input[name="sfsi_twitter_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_twitter_countsDisplay"]'), 'checked')) {
|
1293 |
-
if (SFSI('input[name="sfsi_twitter_countsFrom"]:checked').val() == 'source') {
|
1294 |
-
if (!sfsi_validator(SFSI('input[name="tw_consumer_key"]'), 'blank')) {
|
1295 |
-
showErrorSuc("error", "Error : Please Enter a valid consumer key", 4);
|
1296 |
-
SFSI('input[name="tw_consumer_key"]').addClass('inputError');
|
1297 |
-
return false;
|
1298 |
-
}
|
1299 |
-
if (!sfsi_validator(SFSI('input[name="tw_consumer_secret"]'), 'blank')) {
|
1300 |
-
showErrorSuc("error", "Error : Please Enter a valid consume secret ", 4);
|
1301 |
-
SFSI('input[name="tw_consumer_secret"]').addClass('inputError');
|
1302 |
-
return false;
|
1303 |
-
}
|
1304 |
-
if (!sfsi_validator(SFSI('input[name="tw_oauth_access_token"]'), 'blank')) {
|
1305 |
-
showErrorSuc("error", "Error : Please Enter a valid oauth access token", 4);
|
1306 |
-
SFSI('input[name="tw_oauth_access_token"]').addClass('inputError');
|
1307 |
-
return false;
|
1308 |
-
}
|
1309 |
-
if (!sfsi_validator(SFSI('input[name="tw_oauth_access_token_secret"]'), 'blank')) {
|
1310 |
-
showErrorSuc("error", "Error : Please Enter a oAuth access token secret", 4);
|
1311 |
-
SFSI('input[name="tw_oauth_access_token_secret"]').addClass('inputError');
|
1312 |
-
return false;
|
1313 |
-
}
|
1314 |
-
}
|
1315 |
-
if (SFSI('input[name="sfsi_linkedIn_countsFrom"]:checked').val() == 'manual') {
|
1316 |
-
|
1317 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_twitter_manualCounts"]'), 'blank')) {
|
1318 |
-
showErrorSuc("error", "Error : Please Enter Twitter manual counts ", 4);
|
1319 |
-
SFSI('input[name="sfsi_twitter_manualCounts"]').addClass('inputError');
|
1320 |
-
return false;
|
1321 |
-
}
|
1322 |
-
}
|
1323 |
-
}
|
1324 |
-
/* validate LinkedIn */
|
1325 |
-
if (sfsi_validator(SFSI('input[name="sfsi_linkedIn_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_linkedIn_countsDisplay"]'), 'checked')) {
|
1326 |
-
if (SFSI('input[name="sfsi_linkedIn_countsFrom"]:checked').val() == 'follower') {
|
1327 |
-
if (!sfsi_validator(SFSI('input[name="ln_company"]'), 'blank')) {
|
1328 |
-
showErrorSuc("error", "Error : Please Enter a valid company name", 4);
|
1329 |
-
SFSI('input[name="ln_company"]').addClass('inputError');
|
1330 |
-
return false;
|
1331 |
-
}
|
1332 |
-
if (!sfsi_validator(SFSI('input[name="ln_api_key"]'), 'blank')) {
|
1333 |
-
showErrorSuc("error", "Error : Please Enter a valid API key ", 4);
|
1334 |
-
SFSI('input[name="ln_api_key"]').addClass('inputError');
|
1335 |
-
return false;
|
1336 |
-
}
|
1337 |
-
if (!sfsi_validator(SFSI('input[name="ln_secret_key"]'), 'blank')) {
|
1338 |
-
showErrorSuc("error", "Error : Please Enter a valid secret ", 4);
|
1339 |
-
SFSI('input[name="ln_secret_key"]').addClass('inputError');
|
1340 |
-
return false;
|
1341 |
-
}
|
1342 |
-
if (!sfsi_validator(SFSI('input[name="ln_oAuth_user_token"]'), 'blank')) {
|
1343 |
-
showErrorSuc("error", "Error : Please Enter a oAuth Access Token", 4);
|
1344 |
-
SFSI('input[name="ln_oAuth_user_token"]').addClass('inputError');
|
1345 |
-
return false;
|
1346 |
-
}
|
1347 |
-
}
|
1348 |
-
if (SFSI('input[name="sfsi_linkedIn_countsFrom"]:checked').val() == 'manual') {
|
1349 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_linkedIn_manualCounts"]'), 'blank')) {
|
1350 |
-
showErrorSuc("error", "Error : Please Enter LinkedIn manual counts ", 4);
|
1351 |
-
SFSI('input[name="sfsi_linkedIn_manualCounts"]').addClass('inputError');
|
1352 |
-
return false;
|
1353 |
-
}
|
1354 |
-
}
|
1355 |
-
}
|
1356 |
-
/* validate youtube */
|
1357 |
-
if (sfsi_validator(SFSI('input[name="sfsi_youtube_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_youtube_countsDisplay"]'), 'checked')) {
|
1358 |
-
if (SFSI('input[name="sfsi_youtube_countsFrom"]:checked').val() == 'subscriber') {
|
1359 |
-
if (
|
1360 |
-
!sfsi_validator(SFSI('input[name="sfsi_youtube_user"]'), 'blank') &&
|
1361 |
-
!sfsi_validator(SFSI('input[name="sfsi_youtube_channelId"]'), 'blank')
|
1362 |
-
) {
|
1363 |
-
showErrorSuc("error", "Error : Please Enter a youtube user name or channel id", 4);
|
1364 |
-
SFSI('input[name="sfsi_youtube_user"]').addClass('inputError');
|
1365 |
-
SFSI('input[name="sfsi_youtube_channelId"]').addClass('inputError');
|
1366 |
-
return false;
|
1367 |
-
}
|
1368 |
-
}
|
1369 |
-
if (SFSI('input[name="sfsi_youtube_countsFrom"]:checked').val() == 'manual') {
|
1370 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_youtube_manualCounts"]'), 'blank')) {
|
1371 |
-
showErrorSuc("error", "Error : Please Enter youtube manual counts ", 4);
|
1372 |
-
SFSI('input[name="sfsi_youtube_manualCounts"]').addClass('inputError');
|
1373 |
-
return false;
|
1374 |
-
}
|
1375 |
-
}
|
1376 |
-
}
|
1377 |
-
/* validate pinterest */
|
1378 |
-
if (sfsi_validator(SFSI('input[name="sfsi_pinterest_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_pinterest_countsDisplay"]'), 'checked')) {
|
1379 |
-
if (SFSI('input[name="sfsi_pinterest_countsFrom"]:checked').val() == 'manual') {
|
1380 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_pinterest_manualCounts"]'), 'blank')) {
|
1381 |
-
showErrorSuc("error", "Error : Please Enter Pinterest manual counts ", 4);
|
1382 |
-
SFSI('input[name="sfsi_pinterest_manualCounts"]').addClass('inputError');
|
1383 |
-
return false;
|
1384 |
-
}
|
1385 |
-
}
|
1386 |
-
}
|
1387 |
-
/* validate instagram */
|
1388 |
-
if (sfsi_validator(SFSI('input[name="sfsi_instagram_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_instagram_countsDisplay"]'), 'checked')) {
|
1389 |
-
if (SFSI('input[name="sfsi_instagram_countsFrom"]:checked').val() == 'manual') {
|
1390 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_instagram_manualCounts"]'), 'blank')) {
|
1391 |
-
showErrorSuc("error", "Error : Please Enter Instagram manual counts ", 4);
|
1392 |
-
SFSI('input[name="sfsi_instagram_manualCounts"]').addClass('inputError');
|
1393 |
-
return false;
|
1394 |
-
}
|
1395 |
-
}
|
1396 |
-
if (SFSI('input[name="sfsi_instagram_countsFrom"]:checked').val() == 'followers') {
|
1397 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_instagram_User"]'), 'blank')) {
|
1398 |
-
showErrorSuc("error", "Error : Please Enter a instagram user name", 4);
|
1399 |
-
SFSI('input[name="sfsi_instagram_User"]').addClass('inputError');
|
1400 |
-
return false;
|
1401 |
-
}
|
1402 |
-
}
|
1403 |
-
}
|
1404 |
-
return true;
|
1405 |
-
}
|
1406 |
-
|
1407 |
-
function sfsi_validationStep5() {
|
1408 |
-
//var class_name= SFSI(element).hasAttr('sfsi_validate');
|
1409 |
-
/* validate size */
|
1410 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_icons_size"]'), 'int')) {
|
1411 |
-
showErrorSuc("error", "Error : Please enter a numeric value only ", 5);
|
1412 |
-
SFSI('input[name="sfsi_icons_size"]').addClass('inputError');
|
1413 |
-
return false;
|
1414 |
-
}
|
1415 |
-
if (parseInt(SFSI('input[name="sfsi_icons_size"]').val()) > 100) {
|
1416 |
-
showErrorSuc("error", "Error : Icons Size allow 100px maximum ", 5);
|
1417 |
-
SFSI('input[name="sfsi_icons_size"]').addClass('inputError');
|
1418 |
-
return false;
|
1419 |
-
}
|
1420 |
-
if (parseInt(SFSI('input[name="sfsi_icons_size"]').val()) <= 0) {
|
1421 |
-
showErrorSuc("error", "Error : Icons Size should be more than 0 ", 5);
|
1422 |
-
SFSI('input[name="sfsi_icons_size"]').addClass('inputError');
|
1423 |
-
return false;
|
1424 |
-
}
|
1425 |
-
/* validate spacing */
|
1426 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_icons_spacing"]'), 'int')) {
|
1427 |
-
showErrorSuc("error", "Error : Please enter a numeric value only ", 5);
|
1428 |
-
SFSI('input[name="sfsi_icons_spacing"]').addClass('inputError');
|
1429 |
-
return false;
|
1430 |
-
}
|
1431 |
-
if (parseInt(SFSI('input[name="sfsi_icons_spacing"]').val()) < 0) {
|
1432 |
-
showErrorSuc("error", "Error : Icons Spacing should be 0 or more", 5);
|
1433 |
-
SFSI('input[name="sfsi_icons_spacing"]').addClass('inputError');
|
1434 |
-
return false;
|
1435 |
-
}
|
1436 |
-
/* icons per row spacing */
|
1437 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_icons_perRow"]'), 'int')) {
|
1438 |
-
showErrorSuc("error", "Error : Please enter a numeric value only ", 5);
|
1439 |
-
SFSI('input[name="sfsi_icons_perRow"]').addClass('inputError');
|
1440 |
-
return false;
|
1441 |
-
}
|
1442 |
-
if (parseInt(SFSI('input[name="sfsi_icons_perRow"]').val()) <= 0) {
|
1443 |
-
showErrorSuc("error", "Error : Icons Per row should be more than 0", 5);
|
1444 |
-
SFSI('input[name="sfsi_icons_perRow"]').addClass('inputError');
|
1445 |
-
return false;
|
1446 |
-
}
|
1447 |
-
/* validate icons effects */
|
1448 |
-
// if(SFSI('input[name="sfsi_icons_float"]:checked').val()=="yes" && SFSI('input[name="sfsi_icons_stick"]:checked').val()=="yes")
|
1449 |
-
// {
|
1450 |
-
// showErrorSuc("error","Error : Only one allow from Sticking & floating ",5);
|
1451 |
-
// SFSI('input[name="sfsi_icons_float"][value="no"]').prop("checked", true);
|
1452 |
-
// return false;
|
1453 |
-
// }
|
1454 |
-
return true;
|
1455 |
-
}
|
1456 |
-
|
1457 |
-
function sfsi_validationStep7() {
|
1458 |
-
//var class_name= SFSI(element).hasAttr('sfsi_validate');
|
1459 |
-
/* validate border thikness */
|
1460 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_popup_border_thickness"]'), 'int')) {
|
1461 |
-
showErrorSuc("error", "Error : Please enter a numeric value only ", 7);
|
1462 |
-
SFSI('input[name="sfsi_popup_border_thickness"]').addClass('inputError');
|
1463 |
-
return false;
|
1464 |
-
}
|
1465 |
-
/* validate fotn size */
|
1466 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_popup_fontSize"]'), 'int')) {
|
1467 |
-
showErrorSuc("error", "Error : Please enter a numeric value only ", 7);
|
1468 |
-
SFSI('input[name="sfsi_popup_fontSize"]').addClass('inputError');
|
1469 |
-
return false;
|
1470 |
-
}
|
1471 |
-
/* validate pop up shown */
|
1472 |
-
if (SFSI('input[name="sfsi_Shown_pop"]:checked').val() == 'once') {
|
1473 |
-
|
1474 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_Shown_popupOnceTime"]'), 'blank') && !sfsi_validator(SFSI('input[name="sfsi_Shown_popupOnceTime"]'), 'url')) {
|
1475 |
-
showErrorSuc("error", "Error : Please Enter a valid pop up shown time ", 7);
|
1476 |
-
SFSI('input[name="sfsi_Shown_popupOnceTime"]').addClass('inputError');
|
1477 |
-
return false;
|
1478 |
-
}
|
1479 |
-
}
|
1480 |
-
/* validate page ids */
|
1481 |
-
if (SFSI('input[name="sfsi_Show_popupOn"]:checked').val() == 'selectedpage') {
|
1482 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_Show_popupOn"]'), 'blank')) {
|
1483 |
-
showErrorSuc("error", "Error : Please Enter page ids with comma ", 7);
|
1484 |
-
SFSI('input[name="sfsi_Show_popupOn"]').addClass('inputError');
|
1485 |
-
return false;
|
1486 |
-
}
|
1487 |
-
}
|
1488 |
-
/* validate spacing */
|
1489 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_icons_spacing"]'), 'int')) {
|
1490 |
-
showErrorSuc("error", "Error : Please enter a numeric value only ", 7);
|
1491 |
-
SFSI('input[name="sfsi_icons_spacing"]').addClass('inputError');
|
1492 |
-
return false;
|
1493 |
-
}
|
1494 |
-
/* icons per row spacing */
|
1495 |
-
if (!sfsi_validator(SFSI('input[name="sfsi_icons_perRow"]'), 'int')) {
|
1496 |
-
showErrorSuc("error", "Error : Please enter a numeric value only ", 7);
|
1497 |
-
SFSI('input[name="sfsi_icons_perRow"]').addClass('inputError');
|
1498 |
-
return false;
|
1499 |
-
}
|
1500 |
-
return true;
|
1501 |
-
}
|
1502 |
-
|
1503 |
-
function sfsi_validator(element, valType) {
|
1504 |
-
var Vurl = new RegExp("^(http|https|ftp)\://([a-zA-Z0-9\.\-]+(\:[a-zA-Z0-9\.&%\$\-]+)*@)*((25[0-5]|2[0-4][0-9]|[0-1]{1}[0-9]{2}|[1-9]{1}[0-9]{1}|[1-9])\.(25[0-5]|2[0-4][0-9]|[0-1]{1}[0-9]{2}|[1-9]{1}[0-9]{1}|[1-9]|0)\.(25[0-5]|2[0-4][0-9]|[0-1]{1}[0-9]{2}|[1-9]{1}[0-9]{1}|[1-9]|0)\.(25[0-5]|2[0-4][0-9]|[0-1]{1}[0-9]{2}|[1-9]{1}[0-9]{1}|[0-9])|([a-zA-Z0-9\-]+\.)*[a-zA-Z0-9\-]+\.(com|edu|gov|int|mil|net|org|biz|arpa|info|name|pro|aero|coop|museum|[a-zA-Z]{2}))(\:[0-9]+)*(/($|[a-zA-Z0-9\.\,\@\?\'\\\+&%\$#\=~_\-]+))*$");
|
1505 |
-
//var Vurl = /http:\/\/[A-Za-z0-9\.-]{3,}\.[A-Za-z]{3}/;
|
1506 |
-
|
1507 |
-
switch (valType) {
|
1508 |
-
case "blank":
|
1509 |
-
if (!element.val().trim()) return false;
|
1510 |
-
else return true;
|
1511 |
-
break;
|
1512 |
-
case "url":
|
1513 |
-
if (!Vurl.test(element.val().trim())) return false;
|
1514 |
-
else return true;
|
1515 |
-
break;
|
1516 |
-
case "checked":
|
1517 |
-
if (!element.attr('checked') === true) return false;
|
1518 |
-
else return true;
|
1519 |
-
break;
|
1520 |
-
case "activte":
|
1521 |
-
if (!element.attr('disabled')) return true;
|
1522 |
-
else return false;
|
1523 |
-
break;
|
1524 |
-
case "int":
|
1525 |
-
if (!isNaN(element.val())) return true;
|
1526 |
-
else return false;
|
1527 |
-
break;
|
1528 |
-
|
1529 |
-
}
|
1530 |
-
}
|
1531 |
-
|
1532 |
-
function afterIconSuccess(s, nonce) {
|
1533 |
-
if (s.res = "success") {
|
1534 |
-
var i = s.key + 1,
|
1535 |
-
e = s.element,
|
1536 |
-
t = e + 1;
|
1537 |
-
SFSI("#total_cusotm_icons").val(s.element);
|
1538 |
-
SFSI(".upload-overlay").hide("slow");
|
1539 |
-
SFSI(".uperror").html("");
|
1540 |
-
showErrorSuc("success", "Custom Icon updated successfully", 1);
|
1541 |
-
d = new Date();
|
1542 |
-
|
1543 |
-
var ele = SFSI(".notice_custom_icons_premium");
|
1544 |
-
|
1545 |
-
SFSI("li.custom:last-child").removeClass("bdr_btm_non");
|
1546 |
-
SFSI("li.custom:last-child").children("span.custom-img").children("img").attr("src", s.img_path + "?" + d.getTime());
|
1547 |
-
SFSI("input[name=sfsiICON_" + s.key + "]").removeAttr("ele-type");
|
1548 |
-
SFSI("input[name=sfsiICON_" + s.key + "]").removeAttr("isnew");
|
1549 |
-
icons_name = SFSI("li.custom:last-child").find("input.styled").attr("name");
|
1550 |
-
var n = icons_name.split("_");
|
1551 |
-
s.key = s.key, s.img_path += "?" + d.getTime(), 5 > e && SFSI(".icn_listing").append('<li id="c' + i + '" class="custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style=" 0px 0px;"></span><input name="sfsiICON_' + i + '" type="checkbox" value="yes" class="styled" style="display:none;" element-type="cusotm-icon" isNew="yes" /></div> <span class="custom-img"><img src="' + SFSI("#plugin_url").val() + 'images/custom.png" id="CImg_' + i + '" alt="error" /> </span> <span class="custom custom-txt">Custom' + t + ' </span> <div class="right_info"> <p><span>It depends:</span> Upload a custom icon if you have other accounts/websites you want to link to.</p><div class="inputWrapper"></div></li>'),
|
1552 |
-
SFSI(".custom_section").show(),
|
1553 |
-
SFSI('<div class="row sfsiICON_' + s.key + ' cm_lnk"> <h2 class="custom"> <span class="customstep2-img"> <img src="' + s.img_path + "?" + d.getTime() + '" style="border-radius:48%" alt="error" /> </span> <span class="sfsiCtxt">Custom ' + e + '</span> </h2> <div class="inr_cont "><p>Where do you want this icon to link to?</p> <p class="radio_section fb_url custom_section sfsiICON_' + s.key + '" ><label>Link :</label><input file-id="' + s.key + '" name="sfsi_CustomIcon_links[]" type="text" value="" placeholder="http://" class="add" /></p></div></div>').insertBefore('.notice_custom_icons_premium');
|
1554 |
-
//SFSI(".custom-links").append(' <div class="row sfsiICON_' + s.key + ' cm_lnk"> <h2 class="custom"> <span class="customstep2-img"> <img src="' + s.img_path + "?" + d.getTime() + '" style="border-radius:48%" /> </span> <span class="sfsiCtxt">Custom ' + e + '</span> </h2> <div class="inr_cont "><p>Where do you want this icon to link to?</p> <p class="radio_section fb_url custom_section sfsiICON_' + s.key + '" ><label>Link :</label><input file-id="' + s.key + '" name="sfsi_CustomIcon_links[]" type="text" value="" placeholder="http://" class="add" /></p></div></div>');
|
1555 |
-
SFSI(".notice_custom_icons_premium").show();
|
1556 |
-
SFSI("#c" + s.key).append('<input type="hidden" name="nonce" value="' + nonce + '">');
|
1557 |
-
var o = SFSI("div.custom_m").find("div.mouseover_field").length;
|
1558 |
-
SFSI("div.custom_m").append(0 == o % 2 ? '<div class="clear"> </div> <div class="mouseover_field custom_section sfsiICON_' + s.key + '"><label>Custom ' + e + ':</label><input name="sfsi_custom_MouseOverTexts[]" value="" type="text" file-id="' + s.key + '" /></div>' : '<div class="cHover " ><div class="mouseover_field custom_section sfsiICON_' + s.key + '"><label>Custom ' + e + ':</label><input name="sfsi_custom_MouseOverTexts[]" value="" type="text" file-id="' + s.key + '" /></div>'),
|
1559 |
-
SFSI("ul.share_icon_order").append('<li class="custom_iconOrder sfsiICON_' + s.key + '" data-index="" element-id="' + s.key + '" id=""><a href="#" title="Custom Icon" ><img src="' + s.img_path + '" alt="Linked In" class="sfcm"/></a></li>'),
|
1560 |
-
SFSI("ul.sfsi_sample_icons").append('<li class="sfsiICON_' + s.key + '" element-id="' + s.key + '" ><div><img src="' + s.img_path + '" alt="Linked In" class="sfcm"/><span class="sfsi_Cdisplay">12k</span></div></li>'),
|
1561 |
-
sfsi_update_index(), update_Sec5Iconorder(), sfsi_update_step1(), sfsi_update_step2(),
|
1562 |
-
sfsi_update_step5(), SFSI(".upload-overlay").css("pointer-events", "auto"), sfsi_showPreviewCounts(),
|
1563 |
-
afterLoad();
|
1564 |
-
}
|
1565 |
-
}
|
1566 |
-
|
1567 |
-
function beforeIconSubmit(s) {
|
1568 |
-
if (SFSI(".uperror").html("Uploading....."), window.File && window.FileReader && window.FileList && window.Blob) {
|
1569 |
-
SFSI(s).val() || SFSI(".uperror").html("File is empty");
|
1570 |
-
var i = s.files[0].size,
|
1571 |
-
e = s.files[0].type;
|
1572 |
-
switch (e) {
|
1573 |
-
case "image/png":
|
1574 |
-
case "image/gif":
|
1575 |
-
case "image/jpeg":
|
1576 |
-
case "image/pjpeg":
|
1577 |
-
break;
|
1578 |
-
|
1579 |
-
default:
|
1580 |
-
return SFSI(".uperror").html("Unsupported file"), !1;
|
1581 |
-
}
|
1582 |
-
return i > 1048576 ? (SFSI(".uperror").html("Image should be less than 1 MB"), !1) : !0;
|
1583 |
-
}
|
1584 |
-
return !0;
|
1585 |
-
}
|
1586 |
-
|
1587 |
-
function bytesToSize(s) {
|
1588 |
-
var i = ["Bytes", "KB", "MB", "GB", "TB"];
|
1589 |
-
if (0 == s) return "0 Bytes";
|
1590 |
-
var e = parseInt(Math.floor(Math.log(s) / Math.log(1024)));
|
1591 |
-
return Math.round(s / Math.pow(1024, e), 2) + " " + i[e];
|
1592 |
-
}
|
1593 |
-
|
1594 |
-
function showErrorSuc(s, i, e) {
|
1595 |
-
if ("error" == s) var t = "errorMsg";
|
1596 |
-
else var t = "sucMsg";
|
1597 |
-
return SFSI(".tab" + e + ">." + t).html(i), SFSI(".tab" + e + ">." + t).show(),
|
1598 |
-
SFSI(".tab" + e + ">." + t).effect("highlight", {}, 5e3), setTimeout(function () {
|
1599 |
-
SFSI("." + t).slideUp("slow");
|
1600 |
-
}, 5e3), !1;
|
1601 |
-
}
|
1602 |
-
|
1603 |
-
function beForeLoad() {
|
1604 |
-
SFSI(".loader-img").show(), SFSI(".save_button >a").html("Saving..."), SFSI(".save_button >a").css("pointer-events", "none");
|
1605 |
-
}
|
1606 |
-
|
1607 |
-
function afterLoad() {
|
1608 |
-
SFSI("input").removeClass("inputError"), SFSI(".save_button >a").html("Save"), SFSI(".tab10>div.save_button >a").html("Save All Settings"),
|
1609 |
-
SFSI(".save_button >a").css("pointer-events", "auto"), SFSI(".save_button >a").removeAttr("onclick"),
|
1610 |
-
SFSI(".loader-img").hide();
|
1611 |
-
}
|
1612 |
-
|
1613 |
-
function sfsi_make_popBox() {
|
1614 |
-
var s = 0;
|
1615 |
-
SFSI(".sfsi_sample_icons >li").each(function () {
|
1616 |
-
"none" != SFSI(this).css("display") && (s = 1);
|
1617 |
-
}),
|
1618 |
-
0 == s ? SFSI(".sfsi_Popinner").hide() : SFSI(".sfsi_Popinner").show(),
|
1619 |
-
"" != SFSI('input[name="sfsi_popup_text"]').val() ? (SFSI(".sfsi_Popinner >h2").html(SFSI('input[name="sfsi_popup_text"]').val()),
|
1620 |
-
SFSI(".sfsi_Popinner >h2").show()) : SFSI(".sfsi_Popinner >h2").hide(), SFSI(".sfsi_Popinner").css({
|
1621 |
-
"border-color": SFSI('input[name="sfsi_popup_border_color"]').val(),
|
1622 |
-
"border-width": SFSI('input[name="sfsi_popup_border_thickness"]').val(),
|
1623 |
-
"border-style": "solid"
|
1624 |
-
}),
|
1625 |
-
SFSI(".sfsi_Popinner").css("background-color", SFSI('input[name="sfsi_popup_background_color"]').val()),
|
1626 |
-
SFSI(".sfsi_Popinner h2").css("font-family", SFSI("#sfsi_popup_font").val()), SFSI(".sfsi_Popinner h2").css("font-style", SFSI("#sfsi_popup_fontStyle").val()),
|
1627 |
-
SFSI(".sfsi_Popinner >h2").css("font-size", parseInt(SFSI('input[name="sfsi_popup_fontSize"]').val())),
|
1628 |
-
SFSI(".sfsi_Popinner >h2").css("color", SFSI('input[name="sfsi_popup_fontColor"]').val() + " !important"),
|
1629 |
-
"yes" == SFSI('input[name="sfsi_popup_border_shadow"]:checked').val() ? SFSI(".sfsi_Popinner").css("box-shadow", "12px 30px 18px #CCCCCC") : SFSI(".sfsi_Popinner").css("box-shadow", "none");
|
1630 |
-
}
|
1631 |
-
|
1632 |
-
function sfsi_stick_widget(s) {
|
1633 |
-
0 == initTop.length && (SFSI(".sfsi_widget").each(function (s) {
|
1634 |
-
initTop[s] = SFSI(this).position().top;
|
1635 |
-
}), console.log(initTop));
|
1636 |
-
var i = SFSI(window).scrollTop(),
|
1637 |
-
e = [],
|
1638 |
-
t = [];
|
1639 |
-
SFSI(".sfsi_widget").each(function (s) {
|
1640 |
-
e[s] = SFSI(this).position().top, t[s] = SFSI(this);
|
1641 |
-
});
|
1642 |
-
var n = !1;
|
1643 |
-
for (var o in e) {
|
1644 |
-
var a = parseInt(o) + 1;
|
1645 |
-
e[o] < i && e[a] > i && a < e.length ? (SFSI(t[o]).css({
|
1646 |
-
position: "fixed",
|
1647 |
-
top: s
|
1648 |
-
}), SFSI(t[a]).css({
|
1649 |
-
position: "",
|
1650 |
-
top: initTop[a]
|
1651 |
-
}), n = !0) : SFSI(t[o]).css({
|
1652 |
-
position: "",
|
1653 |
-
top: initTop[o]
|
1654 |
-
});
|
1655 |
-
}
|
1656 |
-
if (!n) {
|
1657 |
-
var r = e.length - 1,
|
1658 |
-
c = -1;
|
1659 |
-
e.length > 1 && (c = e.length - 2), initTop[r] < i ? (SFSI(t[r]).css({
|
1660 |
-
position: "fixed",
|
1661 |
-
top: s
|
1662 |
-
}), c >= 0 && SFSI(t[c]).css({
|
1663 |
-
position: "",
|
1664 |
-
top: initTop[c]
|
1665 |
-
})) : (SFSI(t[r]).css({
|
1666 |
-
position: "",
|
1667 |
-
top: initTop[r]
|
1668 |
-
}), c >= 0 && e[c] < i);
|
1669 |
-
}
|
1670 |
-
}
|
1671 |
-
|
1672 |
-
function sfsi_setCookie(s, i, e) {
|
1673 |
-
var t = new Date();
|
1674 |
-
t.setTime(t.getTime() + 1e3 * 60 * 60 * 24 * e);
|
1675 |
-
var n = "expires=" + t.toGMTString();
|
1676 |
-
document.cookie = s + "=" + i + "; " + n;
|
1677 |
-
}
|
1678 |
-
|
1679 |
-
function sfsfi_getCookie(s) {
|
1680 |
-
for (var i = s + "=", e = document.cookie.split(";"), t = 0; t < e.length; t++) {
|
1681 |
-
var n = e[t].trim();
|
1682 |
-
if (0 == n.indexOf(i)) return n.substring(i.length, n.length);
|
1683 |
-
}
|
1684 |
-
return "";
|
1685 |
-
}
|
1686 |
-
|
1687 |
-
function sfsi_hideFooter() {}
|
1688 |
-
|
1689 |
-
window.onerror = function () {},
|
1690 |
-
SFSI = jQuery,
|
1691 |
-
SFSI(window).on('load', function () {
|
1692 |
-
SFSI("#sfpageLoad").fadeOut(2e3);
|
1693 |
-
});
|
1694 |
-
|
1695 |
-
//changes done {Monad}
|
1696 |
-
function selectText(containerid) {
|
1697 |
-
if (document.selection) {
|
1698 |
-
var range = document.body.createTextRange();
|
1699 |
-
range.moveToElementText(document.getElementById(containerid));
|
1700 |
-
range.select();
|
1701 |
-
} else if (window.getSelection()) {
|
1702 |
-
var range = document.createRange();
|
1703 |
-
range.selectNode(document.getElementById(containerid));
|
1704 |
-
window.getSelection().removeAllRanges();
|
1705 |
-
window.getSelection().addRange(range);
|
1706 |
-
}
|
1707 |
-
}
|
1708 |
-
|
1709 |
-
function create_suscriber_form() {
|
1710 |
-
//Popbox customization
|
1711 |
-
"no" == SFSI('input[name="sfsi_form_adjustment"]:checked').val() ? SFSI(".sfsi_subscribe_Popinner").css({
|
1712 |
-
"width": parseInt(SFSI('input[name="sfsi_form_width"]').val()),
|
1713 |
-
"height": parseInt(SFSI('input[name="sfsi_form_height"]').val())
|
1714 |
-
}) : SFSI(".sfsi_subscribe_Popinner").css({
|
1715 |
-
"width": '',
|
1716 |
-
"height": ''
|
1717 |
-
});
|
1718 |
-
|
1719 |
-
"yes" == SFSI('input[name="sfsi_form_adjustment"]:checked').val() ? SFSI(".sfsi_html > .sfsi_subscribe_Popinner").css({
|
1720 |
-
"width": "100%"
|
1721 |
-
}) : '';
|
1722 |
-
|
1723 |
-
"yes" == SFSI('input[name="sfsi_form_border"]:checked').val() ? SFSI(".sfsi_subscribe_Popinner").css({
|
1724 |
-
"border": SFSI('input[name="sfsi_form_border_thickness"]').val() + "px solid " + SFSI('input[name="sfsi_form_border_color"]').val()
|
1725 |
-
}) : SFSI(".sfsi_subscribe_Popinner").css("border", "none");
|
1726 |
-
|
1727 |
-
SFSI('input[name="sfsi_form_background"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").css("background-color", SFSI('input[name="sfsi_form_background"]').val())) : '';
|
1728 |
-
|
1729 |
-
//Heading customization
|
1730 |
-
SFSI('input[name="sfsi_form_heading_text"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").html(SFSI('input[name="sfsi_form_heading_text"]').val())) : SFSI(".sfsi_subscribe_Popinner > form > h5").html('');
|
1731 |
-
|
1732 |
-
SFSI('#sfsi_form_heading_font').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-family", SFSI("#sfsi_form_heading_font").val())) : '';
|
1733 |
-
|
1734 |
-
if (SFSI('#sfsi_form_heading_fontstyle').val() != 'bold') {
|
1735 |
-
SFSI('#sfsi_form_heading_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-style", SFSI("#sfsi_form_heading_fontstyle").val())) : '';
|
1736 |
-
SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-weight", '');
|
1737 |
-
} else {
|
1738 |
-
SFSI('#sfsi_form_heading_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-weight", "bold")) : '';
|
1739 |
-
SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-style", '');
|
1740 |
-
}
|
1741 |
-
|
1742 |
-
SFSI('input[name="sfsi_form_heading_fontcolor"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("color", SFSI('input[name="sfsi_form_heading_fontcolor"]').val())) : '';
|
1743 |
-
|
1744 |
-
SFSI('input[name="sfsi_form_heading_fontsize"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css({
|
1745 |
-
"font-size": parseInt(SFSI('input[name="sfsi_form_heading_fontsize"]').val())
|
1746 |
-
})) : '';
|
1747 |
-
|
1748 |
-
SFSI('#sfsi_form_heading_fontalign').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("text-align", SFSI("#sfsi_form_heading_fontalign").val())) : '';
|
1749 |
-
|
1750 |
-
//Field customization
|
1751 |
-
SFSI('input[name="sfsi_form_field_text"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').attr("placeholder", SFSI('input[name="sfsi_form_field_text"]').val())) : SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').attr("placeholder", '');
|
1752 |
-
|
1753 |
-
SFSI('input[name="sfsi_form_field_text"]').val() != "" ? (SFSI(".sfsi_left_container > .sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').val(SFSI('input[name="sfsi_form_field_text"]').val())) : SFSI(".sfsi_left_container > .sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').val('');
|
1754 |
-
|
1755 |
-
SFSI('input[name="sfsi_form_field_text"]').val() != "" ? (SFSI(".like_pop_box > .sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').val(SFSI('input[name="sfsi_form_field_text"]').val())) : SFSI(".like_pop_box > .sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').val('');
|
1756 |
-
|
1757 |
-
SFSI('#sfsi_form_field_font').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-family", SFSI("#sfsi_form_field_font").val())) : '';
|
1758 |
-
|
1759 |
-
if (SFSI('#sfsi_form_field_fontstyle').val() != "bold") {
|
1760 |
-
SFSI('#sfsi_form_field_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-style", SFSI("#sfsi_form_field_fontstyle").val())) : '';
|
1761 |
-
SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-weight", '');
|
1762 |
-
} else {
|
1763 |
-
SFSI('#sfsi_form_field_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-weight", 'bold')) : '';
|
1764 |
-
SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-style", '');
|
1765 |
-
}
|
1766 |
-
|
1767 |
-
SFSI('input[name="sfsi_form_field_fontcolor"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("color", SFSI('input[name="sfsi_form_field_fontcolor"]').val())) : '';
|
1768 |
-
|
1769 |
-
SFSI('input[name="sfsi_form_field_fontsize"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css({
|
1770 |
-
"font-size": parseInt(SFSI('input[name="sfsi_form_field_fontsize"]').val())
|
1771 |
-
})) : '';
|
1772 |
-
|
1773 |
-
SFSI('#sfsi_form_field_fontalign').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("text-align", SFSI("#sfsi_form_field_fontalign").val())) : '';
|
1774 |
-
|
1775 |
-
//Button customization
|
1776 |
-
SFSI('input[name="sfsi_form_button_text"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').attr("value", SFSI('input[name="sfsi_form_button_text"]').val())) : '';
|
1777 |
-
|
1778 |
-
SFSI('#sfsi_form_button_font').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-family", SFSI("#sfsi_form_button_font").val())) : '';
|
1779 |
-
|
1780 |
-
if (SFSI('#sfsi_form_button_fontstyle').val() != "bold") {
|
1781 |
-
SFSI('#sfsi_form_button_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-style", SFSI("#sfsi_form_button_fontstyle").val())) : '';
|
1782 |
-
SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-weight", '');
|
1783 |
-
} else {
|
1784 |
-
SFSI('#sfsi_form_button_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-weight", 'bold')) : '';
|
1785 |
-
SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-style", '');
|
1786 |
-
}
|
1787 |
-
|
1788 |
-
SFSI('input[name="sfsi_form_button_fontcolor"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("color", SFSI('input[name="sfsi_form_button_fontcolor"]').val())) : '';
|
1789 |
-
|
1790 |
-
SFSI('input[name="sfsi_form_button_fontsize"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css({
|
1791 |
-
"font-size": parseInt(SFSI('input[name="sfsi_form_button_fontsize"]').val())
|
1792 |
-
})) : '';
|
1793 |
-
|
1794 |
-
SFSI('#sfsi_form_button_fontalign').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("text-align", SFSI("#sfsi_form_button_fontalign").val())) : '';
|
1795 |
-
|
1796 |
-
SFSI('input[name="sfsi_form_button_background"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("background-color", SFSI('input[name="sfsi_form_button_background"]').val())) : '';
|
1797 |
-
|
1798 |
-
var innerHTML = SFSI(".sfsi_html > .sfsi_subscribe_Popinner").html();
|
1799 |
-
var styleCss = SFSI(".sfsi_html > .sfsi_subscribe_Popinner").attr("style");
|
1800 |
-
innerHTML = '<div style="' + styleCss + '">' + innerHTML + '</div>';
|
1801 |
-
SFSI(".sfsi_subscription_html > xmp").html(innerHTML);
|
1802 |
-
|
1803 |
-
/*var data = {
|
1804 |
-
action:"getForm",
|
1805 |
-
heading: SFSI('input[name="sfsi_form_heading_text"]').val(),
|
1806 |
-
placeholder:SFSI('input[name="sfsi_form_field_text"]').val(),
|
1807 |
-
button:SFSI('input[name="sfsi_form_button_text"]').val()
|
1808 |
-
};
|
1809 |
-
SFSI.ajax({
|
1810 |
-
url:sfsi_icon_ajax_object.ajax_url,
|
1811 |
-
type:"post",
|
1812 |
-
data:data,
|
1813 |
-
success:function(s) {
|
1814 |
-
SFSI(".sfsi_subscription_html").html(s);
|
1815 |
-
}
|
1816 |
-
});*/
|
1817 |
-
}
|
1818 |
-
|
1819 |
-
var global_error = 0;
|
1820 |
-
if (typeof SFSI != 'undefined') {
|
1821 |
-
|
1822 |
-
function sfsi_dismiss_notice(btnClass, ajaxAction) {
|
1823 |
-
|
1824 |
-
var btnClass = "." + btnClass;
|
1825 |
-
|
1826 |
-
SFSI(document).on("click", btnClass, function () {
|
1827 |
-
|
1828 |
-
SFSI.ajax({
|
1829 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
1830 |
-
type: "post",
|
1831 |
-
data: {
|
1832 |
-
action: ajaxAction
|
1833 |
-
},
|
1834 |
-
success: function (e) {
|
1835 |
-
if (false != e) {
|
1836 |
-
SFSI(btnClass).parent().remove();
|
1837 |
-
}
|
1838 |
-
}
|
1839 |
-
});
|
1840 |
-
});
|
1841 |
-
}
|
1842 |
-
}
|
1843 |
-
|
1844 |
-
SFSI(document).ready(function (s) {
|
1845 |
-
|
1846 |
-
var arrDismiss = [
|
1847 |
-
|
1848 |
-
{
|
1849 |
-
"btnClass": "sfsi-notice-dismiss",
|
1850 |
-
"action": "sfsi_dismiss_lang_notice"
|
1851 |
-
},
|
1852 |
-
|
1853 |
-
{
|
1854 |
-
"btnClass": "sfsi-AddThis-notice-dismiss",
|
1855 |
-
"action": "sfsi_dismiss_addThis_icon_notice"
|
1856 |
-
},
|
1857 |
-
|
1858 |
-
{
|
1859 |
-
"btnClass": "sfsi_error_reporting_notice-dismiss",
|
1860 |
-
"action": "sfsi_dismiss_error_reporting_notice"
|
1861 |
-
}
|
1862 |
-
];
|
1863 |
-
|
1864 |
-
SFSI.each(arrDismiss, function (key, valueObj) {
|
1865 |
-
sfsi_dismiss_notice(valueObj.btnClass, valueObj.action);
|
1866 |
-
});
|
1867 |
-
|
1868 |
-
//changes done {Monad}
|
1869 |
-
SFSI(".tab_3_icns").on("click", ".cstomskins_upload", function () {
|
1870 |
-
SFSI(".cstmskins-overlay").show("slow", function () {
|
1871 |
-
e = 0;
|
1872 |
-
});
|
1873 |
-
});
|
1874 |
-
/*SFSI("#custmskin_clspop").live("click", function() {*/
|
1875 |
-
SFSI(document).on("click", '#custmskin_clspop', function () {
|
1876 |
-
SFSI_done();
|
1877 |
-
SFSI(".cstmskins-overlay").hide("slow");
|
1878 |
-
});
|
1879 |
-
|
1880 |
-
create_suscriber_form();
|
1881 |
-
SFSI('input[name="sfsi_form_heading_text"], input[name="sfsi_form_border_thickness"], input[name="sfsi_form_height"], input[name="sfsi_form_width"], input[name="sfsi_form_heading_fontsize"], input[name="sfsi_form_field_text"], input[name="sfsi_form_field_fontsize"], input[name="sfsi_form_button_text"], input[name="sfsi_form_button_fontsize"]').on("keyup", create_suscriber_form);
|
1882 |
-
|
1883 |
-
SFSI('input[name="sfsi_form_border_color"], input[name="sfsi_form_background"] ,input[name="sfsi_form_heading_fontcolor"], input[name="sfsi_form_field_fontcolor"] ,input[name="sfsi_form_button_fontcolor"],input[name="sfsi_form_button_background"]').on("focus", create_suscriber_form);
|
1884 |
-
|
1885 |
-
SFSI("#sfsi_form_heading_font, #sfsi_form_heading_fontstyle, #sfsi_form_heading_fontalign, #sfsi_form_field_font, #sfsi_form_field_fontstyle, #sfsi_form_field_fontalign, #sfsi_form_button_font, #sfsi_form_button_fontstyle, #sfsi_form_button_fontalign").on("change", create_suscriber_form);
|
1886 |
-
|
1887 |
-
/*SFSI(".radio").live("click", function() {*/
|
1888 |
-
SFSI(document).on("click", '.radio', function () {
|
1889 |
-
|
1890 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
1891 |
-
|
1892 |
-
var inputName = s.attr("name");
|
1893 |
-
var inputChecked = s.attr("checked");
|
1894 |
-
|
1895 |
-
switch (inputName) {
|
1896 |
-
case 'sfsi_form_adjustment':
|
1897 |
-
if (s.val() == 'no')
|
1898 |
-
s.parents(".row_tab").next(".row_tab").show("fast");
|
1899 |
-
else
|
1900 |
-
s.parents(".row_tab").next(".row_tab").hide("fast");
|
1901 |
-
create_suscriber_form()
|
1902 |
-
break;
|
1903 |
-
case 'sfsi_form_border':
|
1904 |
-
if (s.val() == 'yes')
|
1905 |
-
s.parents(".row_tab").next(".row_tab").show("fast");
|
1906 |
-
else
|
1907 |
-
s.parents(".row_tab").next(".row_tab").hide("fast");
|
1908 |
-
create_suscriber_form()
|
1909 |
-
break;
|
1910 |
-
case 'sfsi_icons_suppress_errors':
|
1911 |
-
|
1912 |
-
SFSI('input[name="sfsi_icons_suppress_errors"]').removeAttr('checked');
|
1913 |
-
|
1914 |
-
if (s.val() == 'yes')
|
1915 |
-
SFSI('input[name="sfsi_icons_suppress_errors"][value="yes"]').attr('checked', 'true');
|
1916 |
-
else
|
1917 |
-
SFSI('input[name="sfsi_icons_suppress_errors"][value="no"]').attr('checked', 'true');
|
1918 |
-
break;
|
1919 |
-
|
1920 |
-
default:
|
1921 |
-
case 'sfsi_responsive_icons_end_post':
|
1922 |
-
if("yes" == s.val()){
|
1923 |
-
jQuery('.sfsi_responsive_icon_option_li.sfsi_responsive_show').show();
|
1924 |
-
}else{
|
1925 |
-
jQuery('.sfsi_responsive_icon_option_li.sfsi_responsive_show').hide();
|
1926 |
-
}
|
1927 |
-
}
|
1928 |
-
});
|
1929 |
-
|
1930 |
-
SFSI('#sfsi_form_border_color').wpColorPicker({
|
1931 |
-
defaultColor: false,
|
1932 |
-
change: function (event, ui) {
|
1933 |
-
create_suscriber_form()
|
1934 |
-
},
|
1935 |
-
clear: function () {
|
1936 |
-
create_suscriber_form()
|
1937 |
-
},
|
1938 |
-
hide: true,
|
1939 |
-
palettes: true
|
1940 |
-
}),
|
1941 |
-
SFSI('#sfsi_form_background').wpColorPicker({
|
1942 |
-
defaultColor: false,
|
1943 |
-
change: function (event, ui) {
|
1944 |
-
create_suscriber_form()
|
1945 |
-
},
|
1946 |
-
clear: function () {
|
1947 |
-
create_suscriber_form()
|
1948 |
-
},
|
1949 |
-
hide: true,
|
1950 |
-
palettes: true
|
1951 |
-
}),
|
1952 |
-
SFSI('#sfsi_form_heading_fontcolor').wpColorPicker({
|
1953 |
-
defaultColor: false,
|
1954 |
-
change: function (event, ui) {
|
1955 |
-
create_suscriber_form()
|
1956 |
-
},
|
1957 |
-
clear: function () {
|
1958 |
-
create_suscriber_form()
|
1959 |
-
},
|
1960 |
-
hide: true,
|
1961 |
-
palettes: true
|
1962 |
-
}),
|
1963 |
-
SFSI('#sfsi_form_button_fontcolor').wpColorPicker({
|
1964 |
-
defaultColor: false,
|
1965 |
-
change: function (event, ui) {
|
1966 |
-
create_suscriber_form()
|
1967 |
-
},
|
1968 |
-
clear: function () {
|
1969 |
-
create_suscriber_form()
|
1970 |
-
},
|
1971 |
-
hide: true,
|
1972 |
-
palettes: true
|
1973 |
-
}),
|
1974 |
-
SFSI('#sfsi_form_button_background').wpColorPicker({
|
1975 |
-
defaultColor: false,
|
1976 |
-
change: function (event, ui) {
|
1977 |
-
create_suscriber_form()
|
1978 |
-
},
|
1979 |
-
clear: function () {
|
1980 |
-
create_suscriber_form()
|
1981 |
-
},
|
1982 |
-
hide: true,
|
1983 |
-
palettes: true
|
1984 |
-
});
|
1985 |
-
//changes done {Monad}
|
1986 |
-
|
1987 |
-
function i() {
|
1988 |
-
SFSI(".uperror").html(""), afterLoad();
|
1989 |
-
var s = SFSI('input[name="' + SFSI("#upload_id").val() + '"]');
|
1990 |
-
s.removeAttr("checked");
|
1991 |
-
var i = SFSI(s).parent().find("span:first");
|
1992 |
-
return SFSI(i).css("background-position", "0px 0px"), SFSI(".upload-overlay").hide("slow"),
|
1993 |
-
!1;
|
1994 |
-
}
|
1995 |
-
SFSI("#accordion").accordion({
|
1996 |
-
collapsible: !0,
|
1997 |
-
active: !1,
|
1998 |
-
heightStyle: "content",
|
1999 |
-
event: "click",
|
2000 |
-
beforeActivate: function (s, i) {
|
2001 |
-
if (i.newHeader[0]) var e = i.newHeader,
|
2002 |
-
t = e.next(".ui-accordion-content");
|
2003 |
-
else var e = i.oldHeader,
|
2004 |
-
t = e.next(".ui-accordion-content");
|
2005 |
-
var n = "true" == e.attr("aria-selected");
|
2006 |
-
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
2007 |
-
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
2008 |
-
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() : t.slideDown(), !1;
|
2009 |
-
}
|
2010 |
-
}),
|
2011 |
-
SFSI("#accordion1").accordion({
|
2012 |
-
collapsible: !0,
|
2013 |
-
active: !1,
|
2014 |
-
heightStyle: "content",
|
2015 |
-
event: "click",
|
2016 |
-
beforeActivate: function (s, i) {
|
2017 |
-
if (i.newHeader[0]) var e = i.newHeader,
|
2018 |
-
t = e.next(".ui-accordion-content");
|
2019 |
-
else var e = i.oldHeader,
|
2020 |
-
t = e.next(".ui-accordion-content");
|
2021 |
-
var n = "true" == e.attr("aria-selected");
|
2022 |
-
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
2023 |
-
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
2024 |
-
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() : t.slideDown(), !1;
|
2025 |
-
}
|
2026 |
-
}),
|
2027 |
-
|
2028 |
-
SFSI("#accordion2").accordion({
|
2029 |
-
collapsible: !0,
|
2030 |
-
active: !1,
|
2031 |
-
heightStyle: "content",
|
2032 |
-
event: "click",
|
2033 |
-
beforeActivate: function (s, i) {
|
2034 |
-
if (i.newHeader[0]) var e = i.newHeader,
|
2035 |
-
t = e.next(".ui-accordion-content");
|
2036 |
-
else var e = i.oldHeader,
|
2037 |
-
t = e.next(".ui-accordion-content");
|
2038 |
-
var n = "true" == e.attr("aria-selected");
|
2039 |
-
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
2040 |
-
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
2041 |
-
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() : t.slideDown(), !1;
|
2042 |
-
}
|
2043 |
-
}),
|
2044 |
-
SFSI(".closeSec").on("click", function () {
|
2045 |
-
var s = !0,
|
2046 |
-
i = SFSI(this).closest("div.ui-accordion-content").prev("h3.ui-accordion-header").first(),
|
2047 |
-
e = SFSI(this).closest("div.ui-accordion-content").first();
|
2048 |
-
i.toggleClass("ui-corner-all", s).toggleClass("accordion-header-active ui-state-active ui-corner-top", !s).attr("aria-selected", (!s).toString()),
|
2049 |
-
i.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", s).toggleClass("ui-icon-triangle-1-s", !s),
|
2050 |
-
e.toggleClass("accordion-content-active", !s), s ? e.slideUp() : e.slideDown();
|
2051 |
-
}),
|
2052 |
-
SFSI(document).click(function (s) {
|
2053 |
-
var i = SFSI(".sfsi_FrntInner_chg"),
|
2054 |
-
e = SFSI(".sfsi_wDiv"),
|
2055 |
-
t = SFSI("#at15s");
|
2056 |
-
i.is(s.target) || 0 !== i.has(s.target).length || e.is(s.target) || 0 !== e.has(s.target).length || t.is(s.target) || 0 !== t.has(s.target).length || i.fadeOut();
|
2057 |
-
}),
|
2058 |
-
SFSI('#sfsi_popup_background_color').wpColorPicker({
|
2059 |
-
defaultColor: false,
|
2060 |
-
change: function (event, ui) {
|
2061 |
-
sfsi_make_popBox()
|
2062 |
-
},
|
2063 |
-
clear: function () {
|
2064 |
-
sfsi_make_popBox()
|
2065 |
-
},
|
2066 |
-
hide: true,
|
2067 |
-
palettes: true
|
2068 |
-
}),
|
2069 |
-
SFSI('#sfsi_popup_border_color').wpColorPicker({
|
2070 |
-
defaultColor: false,
|
2071 |
-
change: function (event, ui) {
|
2072 |
-
sfsi_make_popBox()
|
2073 |
-
},
|
2074 |
-
clear: function () {
|
2075 |
-
sfsi_make_popBox()
|
2076 |
-
},
|
2077 |
-
hide: true,
|
2078 |
-
palettes: true
|
2079 |
-
}),
|
2080 |
-
SFSI('#sfsi_popup_fontColor').wpColorPicker({
|
2081 |
-
defaultColor: false,
|
2082 |
-
change: function (event, ui) {
|
2083 |
-
sfsi_make_popBox()
|
2084 |
-
},
|
2085 |
-
clear: function () {
|
2086 |
-
sfsi_make_popBox()
|
2087 |
-
},
|
2088 |
-
hide: true,
|
2089 |
-
palettes: true
|
2090 |
-
}),
|
2091 |
-
SFSI("div#sfsiid_linkedin").find(".icon4").find("a").find("img").mouseover(function () {
|
2092 |
-
SFSI(this).attr("src", sfsi_icon_ajax_object.plugin_url + "images/visit_icons/linkedIn_hover.svg");
|
2093 |
-
}),
|
2094 |
-
SFSI("div#sfsiid_linkedin").find(".icon4").find("a").find("img").mouseleave(function () {
|
2095 |
-
SFSI(this).attr("src", sfsi_icon_ajax_object.plugin_url + "images/visit_icons/linkedIn.svg");
|
2096 |
-
}),
|
2097 |
-
SFSI("div#sfsiid_youtube").find(".icon1").find("a").find("img").mouseover(function () {
|
2098 |
-
SFSI(this).attr("src", sfsi_icon_ajax_object.plugin_url + "images/visit_icons/youtube_hover.svg");
|
2099 |
-
}),
|
2100 |
-
SFSI("div#sfsiid_youtube").find(".icon1").find("a").find("img").mouseleave(function () {
|
2101 |
-
SFSI(this).attr("src", sfsi_icon_ajax_object.plugin_url + "images/visit_icons/youtube.svg");
|
2102 |
-
}),
|
2103 |
-
SFSI("div#sfsiid_facebook").find(".icon1").find("a").find("img").mouseover(function () {
|
2104 |
-
SFSI(this).css("opacity", "0.9");
|
2105 |
-
}),
|
2106 |
-
SFSI("div#sfsiid_facebook").find(".icon1").find("a").find("img").mouseleave(function () {
|
2107 |
-
SFSI(this).css("opacity", "1");
|
2108 |
-
}),
|
2109 |
-
SFSI("div#sfsiid_twitter").find(".cstmicon1").find("a").find("img").mouseover(function () {
|
2110 |
-
SFSI(this).css("opacity", "0.9");
|
2111 |
-
}),
|
2112 |
-
SFSI("div#sfsiid_twitter").find(".cstmicon1").find("a").find("img").mouseleave(function () {
|
2113 |
-
SFSI(this).css("opacity", "1");
|
2114 |
-
}),
|
2115 |
-
SFSI("#sfsi_save1").on("click", function () {
|
2116 |
-
// console.log('save1',sfsi_update_step1());
|
2117 |
-
sfsi_update_step1() && sfsicollapse(this);
|
2118 |
-
}),
|
2119 |
-
SFSI("#sfsi_save2").on("click", function () {
|
2120 |
-
sfsi_update_step2() && sfsicollapse(this);
|
2121 |
-
}),
|
2122 |
-
SFSI("#sfsi_save3").on("click", function () {
|
2123 |
-
sfsi_update_step3() && sfsicollapse(this);
|
2124 |
-
}),
|
2125 |
-
SFSI("#sfsi_save4").on("click", function () {
|
2126 |
-
sfsi_update_step4() && sfsicollapse(this);
|
2127 |
-
}),
|
2128 |
-
SFSI("#sfsi_save5").on("click", function () {
|
2129 |
-
sfsi_update_step5() && sfsicollapse(this);
|
2130 |
-
}),
|
2131 |
-
SFSI("#sfsi_save6").on("click", function () {
|
2132 |
-
sfsi_update_step6() && sfsicollapse(this);
|
2133 |
-
}),
|
2134 |
-
SFSI("#sfsi_save7").on("click", function () {
|
2135 |
-
sfsi_update_step7() && sfsicollapse(this);
|
2136 |
-
}),
|
2137 |
-
SFSI("#sfsi_save8").on("click", function () {
|
2138 |
-
sfsi_update_step8() && sfsicollapse(this);
|
2139 |
-
}),
|
2140 |
-
SFSI("#sfsi_save9").on("click", function () {
|
2141 |
-
sfsi_update_step9() && sfsicollapse(this);
|
2142 |
-
}),
|
2143 |
-
SFSI("#save_all_settings").on("click", function () {
|
2144 |
-
return SFSI("#save_all_settings").text("Saving.."), SFSI(".save_button >a").css("pointer-events", "none"),
|
2145 |
-
sfsi_update_step1(), sfsi_update_step8(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Which icons do you want to show on your site?" tab.', 8),
|
2146 |
-
global_error = 0, !1) : (sfsi_update_step2(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "What do you want the icons to do?" tab.', 8),
|
2147 |
-
global_error = 0, !1) : (sfsi_update_step3(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "What design & animation do you want to give your icons?" tab.', 8),
|
2148 |
-
global_error = 0, !1) : (sfsi_update_step4(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Do you want to display "counts" next to your icons?" tab.', 8),
|
2149 |
-
global_error = 0, !1) : (sfsi_update_step5(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Any other wishes for your main icons?" tab.', 8),
|
2150 |
-
global_error = 0, !1) : (sfsi_update_step6(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Do you want to display icons at the end of every post?" tab.', 8),
|
2151 |
-
global_error = 0, !1) : (sfsi_update_step7(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Do you want to display a pop-up, asking people to subscribe?" tab.', 8),
|
2152 |
-
/*global_error = 0, !1) :void (0 == global_error && showErrorSuc("success", 'Saved! Now go to the <a href="widgets.php">widget</a> area and place the widget into your sidebar (if not done already)', 8))))))));*/
|
2153 |
-
global_error = 0, !1) : void(0 == global_error && showErrorSuc("success", '', 8))))))));
|
2154 |
-
}),
|
2155 |
-
/*SFSI(".fileUPInput").live("change", function() {*/
|
2156 |
-
SFSI(document).on("change", '.fileUPInput', function () {
|
2157 |
-
beForeLoad(), beforeIconSubmit(this) && (SFSI(".upload-overlay").css("pointer-events", "none"),
|
2158 |
-
SFSI("#customIconFrm").ajaxForm({
|
2159 |
-
dataType: "json",
|
2160 |
-
success: afterIconSuccess,
|
2161 |
-
resetForm: !0
|
2162 |
-
}).submit());
|
2163 |
-
}),
|
2164 |
-
SFSI(".pop-up").on("click", function () {
|
2165 |
-
("fbex-s2" == SFSI(this).attr("data-id") || "linkex-s2" == SFSI(this).attr("data-id")) && (SFSI("." + SFSI(this).attr("data-id")).hide(),
|
2166 |
-
SFSI("." + SFSI(this).attr("data-id")).css("opacity", "1"), SFSI("." + SFSI(this).attr("data-id")).css("z-index", "1000")),
|
2167 |
-
SFSI("." + SFSI(this).attr("data-id")).show("slow");
|
2168 |
-
}),
|
2169 |
-
/*SFSI("#close_popup").live("click", function() {*/
|
2170 |
-
SFSI(document).on("click", '#close_popup', function () {
|
2171 |
-
SFSI(".read-overlay").hide("slow");
|
2172 |
-
});
|
2173 |
-
|
2174 |
-
var e = 0;
|
2175 |
-
SFSI(".icn_listing").on("click", ".checkbox", function () {
|
2176 |
-
if (1 == e) return !1;
|
2177 |
-
"yes" == SFSI(this).attr("dynamic_ele") && (s = SFSI(this).parent().find("input:checkbox:first"),
|
2178 |
-
s.is(":checked") ? SFSI(s).attr("checked", !1) : SFSI(s).attr("checked", !0)), s = SFSI(this).parent().find("input:checkbox:first"),
|
2179 |
-
"yes" == SFSI(s).attr("isNew") && ("0px 0px" == SFSI(this).css("background-position") ? (SFSI(s).attr("checked", !0),
|
2180 |
-
SFSI(this).css("background-position", "0px -36px")) : (SFSI(s).removeAttr("checked", !0),
|
2181 |
-
SFSI(this).css("background-position", "0px 0px")));
|
2182 |
-
var s = SFSI(this).parent().find("input:checkbox:first");
|
2183 |
-
if (s.is(":checked") && "cusotm-icon" == s.attr("element-type")) SFSI(".fileUPInput").attr("name", "custom_icons[]"),
|
2184 |
-
SFSI(".upload-overlay").show("slow", function () {
|
2185 |
-
e = 0;
|
2186 |
-
}), SFSI("#upload_id").val(s.attr("name"));
|
2187 |
-
else if (!s.is(":checked") && "cusotm-icon" == s.attr("element-type")) return s.attr("ele-type") ? (SFSI(this).attr("checked", !0),
|
2188 |
-
SFSI(this).css("background-position", "0px -36px"), e = 0, !1) : confirm("Are you sure want to delete this Icon..?? ") ? "suc" == sfsi_delete_CusIcon(this, s) ? (s.attr("checked", !1),
|
2189 |
-
SFSI(this).css("background-position", "0px 0px"), e = 0, !1) : (e = 0, !1) : (s.attr("checked", !0),
|
2190 |
-
SFSI(this).css("background-position", "0px -36px"), e = 0, !1);
|
2191 |
-
}),
|
2192 |
-
SFSI(".icn_listing").on("click", ".checkbox", function () {
|
2193 |
-
checked = SFSI(this).parent().find("input:checkbox:first"), "sfsi_email_display" != checked.attr("name") || checked.is(":checked") || SFSI(".demail-1").show("slow");
|
2194 |
-
}),
|
2195 |
-
SFSI("#deac_email2").on("click", function () {
|
2196 |
-
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").show("slow");
|
2197 |
-
}),
|
2198 |
-
SFSI("#deac_email3").on("click", function () {
|
2199 |
-
SFSI(".demail-2").hide("slow"), SFSI(".demail-3").show("slow");
|
2200 |
-
}),
|
2201 |
-
SFSI(".hideemailpop").on("click", function () {
|
2202 |
-
SFSI('input[name="sfsi_email_display"]').attr("checked", !0), SFSI('input[name="sfsi_email_display"]').parent().find("span:first").css("background-position", "0px -36px"),
|
2203 |
-
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"), SFSI(".demail-3").hide("slow");
|
2204 |
-
}),
|
2205 |
-
SFSI(".hidePop").on("click", function () {
|
2206 |
-
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"), SFSI(".demail-3").hide("slow");
|
2207 |
-
}),
|
2208 |
-
SFSI(".activate_footer").on("click", function () {
|
2209 |
-
var nonce = SFSI(this).attr("data-nonce");
|
2210 |
-
SFSI(this).text("activating....");
|
2211 |
-
var s = {
|
2212 |
-
action: "activateFooter",
|
2213 |
-
nonce: nonce
|
2214 |
-
};
|
2215 |
-
SFSI.ajax({
|
2216 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
2217 |
-
type: "post",
|
2218 |
-
data: s,
|
2219 |
-
dataType: "json",
|
2220 |
-
success: function (s) {
|
2221 |
-
if (s.res == "wrong_nonce") {
|
2222 |
-
SFSI(".activate_footer").css("font-size", "18px");
|
2223 |
-
SFSI(".activate_footer").text("Unauthorised Request, Try again after refreshing page");
|
2224 |
-
} else {
|
2225 |
-
"success" == s.res && (SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"),
|
2226 |
-
SFSI(".demail-3").hide("slow"), SFSI(".activate_footer").text("Ok, activate link"));
|
2227 |
-
}
|
2228 |
-
}
|
2229 |
-
});
|
2230 |
-
}),
|
2231 |
-
SFSI(".sfsi_removeFooter").on("click", function () {
|
2232 |
-
var nonce = SFSI(this).attr("data-nonce");
|
2233 |
-
SFSI(this).text("working....");
|
2234 |
-
var s = {
|
2235 |
-
action: "removeFooter",
|
2236 |
-
nonce: nonce
|
2237 |
-
};
|
2238 |
-
SFSI.ajax({
|
2239 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
2240 |
-
type: "post",
|
2241 |
-
data: s,
|
2242 |
-
dataType: "json",
|
2243 |
-
success: function (s) {
|
2244 |
-
if (s.res == "wrong_nonce") {
|
2245 |
-
SFSI(".sfsi_removeFooter").text("Unauthorised Request, Try again after refreshing page");
|
2246 |
-
} else {
|
2247 |
-
"success" == s.res && (SFSI(".sfsi_removeFooter").fadeOut("slow"), SFSI(".sfsi_footerLnk").fadeOut("slow"));
|
2248 |
-
}
|
2249 |
-
}
|
2250 |
-
});
|
2251 |
-
}),
|
2252 |
-
/*SFSI(".radio").live("click", function() {*/
|
2253 |
-
SFSI(document).on("click", '.radio', function () {
|
2254 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
2255 |
-
"sfsi_display_counts" == s.attr("name") && sfsi_show_counts();
|
2256 |
-
}),
|
2257 |
-
SFSI("#close_Uploadpopup").on("click", i), /*SFSI(".radio").live("click", function() {*/ SFSI(document).on("click", '.radio', function () {
|
2258 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
2259 |
-
"sfsi_show_Onposts" == s.attr("name") && sfsi_show_OnpostsDisplay();
|
2260 |
-
}),
|
2261 |
-
sfsi_show_OnpostsDisplay(), sfsi_depened_sections(), sfsi_show_counts(), sfsi_showPreviewCounts(),
|
2262 |
-
SFSI(".share_icon_order").sortable({
|
2263 |
-
update: function () {
|
2264 |
-
SFSI(".share_icon_order li").each(function () {
|
2265 |
-
SFSI(this).attr("data-index", SFSI(this).index() + 1);
|
2266 |
-
});
|
2267 |
-
},
|
2268 |
-
revert: !0
|
2269 |
-
}),
|
2270 |
-
|
2271 |
-
//*------------------------------- Sharing text & pcitures checkbox for showing section in Page, Post STARTS -------------------------------------//
|
2272 |
-
|
2273 |
-
SFSI(document).on("click", '.checkbox', function () {
|
2274 |
-
|
2275 |
-
var s = SFSI(this).parent().find("input:checkbox:first");
|
2276 |
-
var backgroundPos = jQuery(this).css('background-position').split(" ");
|
2277 |
-
var xPos = backgroundPos[0],
|
2278 |
-
yPos = backgroundPos[1];
|
2279 |
-
|
2280 |
-
var inputName = s.attr('name');
|
2281 |
-
var inputChecked = s.attr("checked");
|
2282 |
-
|
2283 |
-
switch (inputName) {
|
2284 |
-
|
2285 |
-
case "sfsi_custom_social_hide":
|
2286 |
-
|
2287 |
-
var val = (yPos == "0px") ? "no" : "yes";
|
2288 |
-
SFSI('input[name="sfsi_custom_social_hide"]').val(val);
|
2289 |
-
|
2290 |
-
break;
|
2291 |
-
|
2292 |
-
case "sfsi_show_via_widget":
|
2293 |
-
case "sfsi_show_via_widget":
|
2294 |
-
case "sfsi_show_via_afterposts":
|
2295 |
-
case "sfsi_custom_social_hide":
|
2296 |
-
|
2297 |
-
var val = (yPos == "0px") ? "no" : "yes";
|
2298 |
-
SFSI('input[name="' + s.attr('name') + '"]').val(val);
|
2299 |
-
|
2300 |
-
break;
|
2301 |
-
|
2302 |
-
case 'sfsi_mouseOver':
|
2303 |
-
|
2304 |
-
var elem = SFSI('input[name="' + inputName + '"]');
|
2305 |
-
|
2306 |
-
var togglelem = SFSI('.mouse-over-effects');
|
2307 |
-
|
2308 |
-
if (inputChecked) {
|
2309 |
-
togglelem.removeClass('hide').addClass('show');
|
2310 |
-
} else {
|
2311 |
-
togglelem.removeClass('show').addClass('hide');
|
2312 |
-
}
|
2313 |
-
|
2314 |
-
break;
|
2315 |
-
case 'sfsi_responsive_facebook_display':
|
2316 |
-
if(inputChecked){
|
2317 |
-
SFSI('.sfsi_responsive_icon_facebook_container').parents('a').show();
|
2318 |
-
var icon= inputName.replace('sfsi_responsive_','').replace('_display','');
|
2319 |
-
if(SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val()!=="Fully responsive"){
|
2320 |
-
window.sfsi_fittext_shouldDisplay=true;
|
2321 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2322 |
-
if(jQuery(a_container).css('display')!=="none"){
|
2323 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2324 |
-
}
|
2325 |
-
})
|
2326 |
-
}
|
2327 |
-
}else{
|
2328 |
-
|
2329 |
-
SFSI('.sfsi_responsive_icon_facebook_container').parents('a').hide();
|
2330 |
-
if(SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val()!=="Fully responsive"){
|
2331 |
-
window.sfsi_fittext_shouldDisplay=true;
|
2332 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2333 |
-
if(jQuery(a_container).css('display')!=="none"){
|
2334 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2335 |
-
}
|
2336 |
-
})
|
2337 |
-
}
|
2338 |
-
}
|
2339 |
-
break;
|
2340 |
-
case 'sfsi_responsive_Twitter_display':
|
2341 |
-
if(inputChecked){
|
2342 |
-
SFSI('.sfsi_responsive_icon_twitter_container').parents('a').show();
|
2343 |
-
var icon= inputName.replace('sfsi_responsive_','').replace('_display','');
|
2344 |
-
if(SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val()!=="Fully responsive"){
|
2345 |
-
window.sfsi_fittext_shouldDisplay=true;
|
2346 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2347 |
-
if(jQuery(a_container).css('display')!=="none"){
|
2348 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2349 |
-
}
|
2350 |
-
})
|
2351 |
-
}
|
2352 |
-
}else{
|
2353 |
-
SFSI('.sfsi_responsive_icon_twitter_container').parents('a').hide();
|
2354 |
-
if(SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val()!=="Fully responsive"){
|
2355 |
-
window.sfsi_fittext_shouldDisplay=true;
|
2356 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2357 |
-
if(jQuery(a_container).css('display')!=="none"){
|
2358 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2359 |
-
}
|
2360 |
-
})
|
2361 |
-
}
|
2362 |
-
}
|
2363 |
-
break;
|
2364 |
-
case 'sfsi_responsive_Follow_display':
|
2365 |
-
if(inputChecked){
|
2366 |
-
SFSI('.sfsi_responsive_icon_follow_container').parents('a').show();
|
2367 |
-
var icon= inputName.replace('sfsi_responsive_','').replace('_display','');
|
2368 |
-
}else{
|
2369 |
-
SFSI('.sfsi_responsive_icon_follow_container').parents('a').hide();
|
2370 |
-
}
|
2371 |
-
window.sfsi_fittext_shouldDisplay=true;
|
2372 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2373 |
-
if(jQuery(a_container).css('display')!=="none"){
|
2374 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2375 |
-
}
|
2376 |
-
})
|
2377 |
-
break;
|
2378 |
-
}
|
2379 |
-
|
2380 |
-
});
|
2381 |
-
|
2382 |
-
//*------------------------------- Sharing text & pcitures checkbox for showing section in Page, Post CLOSES -------------------------------------//
|
2383 |
-
|
2384 |
-
SFSI(document).on("click", '.radio', function () {
|
2385 |
-
|
2386 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
2387 |
-
|
2388 |
-
switch (s.attr("name")) {
|
2389 |
-
|
2390 |
-
case 'sfsi_mouseOver_effect_type':
|
2391 |
-
|
2392 |
-
var _val = s.val();
|
2393 |
-
var _name = s.attr("name");
|
2394 |
-
|
2395 |
-
if ('same_icons' == _val) {
|
2396 |
-
SFSI('.same_icons_effects').removeClass('hide').addClass('show');
|
2397 |
-
SFSI('.other_icons_effects_options').removeClass('show').addClass('hide');
|
2398 |
-
} else if ('other_icons' == _val) {
|
2399 |
-
SFSI('.same_icons_effects').removeClass('show').addClass('hide');
|
2400 |
-
SFSI('.other_icons_effects_options').removeClass('hide').addClass('show');
|
2401 |
-
}
|
2402 |
-
|
2403 |
-
break;
|
2404 |
-
}
|
2405 |
-
|
2406 |
-
});
|
2407 |
-
|
2408 |
-
SFSI(document).on("click", '.radio', function () {
|
2409 |
-
|
2410 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
2411 |
-
"sfsi_email_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_email_countsDisplay"]').prop("checked", !0),
|
2412 |
-
SFSI('input[name="sfsi_email_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2413 |
-
"manual" == SFSI("input[name='sfsi_email_countsFrom']:checked").val() ? SFSI("input[name='sfsi_email_manualCounts']").slideDown() : SFSI("input[name='sfsi_email_manualCounts']").slideUp()),
|
2414 |
-
|
2415 |
-
"sfsi_facebook_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_facebook_countsDisplay"]').prop("checked", !0),
|
2416 |
-
SFSI('input[name="sfsi_facebook_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2417 |
-
"mypage" == SFSI("input[name='sfsi_facebook_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_facebook_mypageCounts']").slideDown(), SFSI(".sfsi_fbpgidwpr").slideDown()) : (SFSI("input[name='sfsi_facebook_mypageCounts']").slideUp(), SFSI(".sfsi_fbpgidwpr").slideUp()),
|
2418 |
-
|
2419 |
-
"manual" == SFSI("input[name='sfsi_facebook_countsFrom']:checked").val() ? SFSI("input[name='sfsi_facebook_manualCounts']").slideDown() : SFSI("input[name='sfsi_facebook_manualCounts']").slideUp()),
|
2420 |
-
|
2421 |
-
"sfsi_facebook_countsFrom" == s.attr("name") && (("mypage" == SFSI("input[name='sfsi_facebook_countsFrom']:checked").val() || "likes" == SFSI("input[name='sfsi_facebook_countsFrom']:checked").val()) ? (SFSI(".sfsi_facebook_pagedeasc").slideDown()) : (SFSI(".sfsi_facebook_pagedeasc").slideUp())),
|
2422 |
-
|
2423 |
-
"sfsi_twitter_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_twitter_countsDisplay"]').prop("checked", !0),
|
2424 |
-
SFSI('input[name="sfsi_twitter_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2425 |
-
"manual" == SFSI("input[name='sfsi_twitter_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_twitter_manualCounts']").slideDown(),
|
2426 |
-
SFSI(".tw_follow_options").slideUp()) : (SFSI("input[name='sfsi_twitter_manualCounts']").slideUp(),
|
2427 |
-
SFSI(".tw_follow_options").slideDown())),
|
2428 |
-
|
2429 |
-
|
2430 |
-
"sfsi_linkedIn_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_linkedIn_countsDisplay"]').prop("checked", !0),
|
2431 |
-
SFSI('input[name="sfsi_linkedIn_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2432 |
-
"manual" == SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_linkedIn_manualCounts']").slideDown(),
|
2433 |
-
SFSI(".linkedIn_options").slideUp()) : (SFSI("input[name='sfsi_linkedIn_manualCounts']").slideUp(),
|
2434 |
-
SFSI(".linkedIn_options").slideDown())),
|
2435 |
-
|
2436 |
-
"sfsi_youtube_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_youtube_countsDisplay"]').prop("checked", !0),
|
2437 |
-
SFSI('input[name="sfsi_youtube_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2438 |
-
"manual" == SFSI("input[name='sfsi_youtube_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_youtube_manualCounts']").slideDown(),
|
2439 |
-
SFSI(".youtube_options").slideUp()) : (SFSI("input[name='sfsi_youtube_manualCounts']").slideUp(),
|
2440 |
-
SFSI(".youtube_options").slideDown())), "sfsi_pinterest_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_pinterest_countsDisplay"]').prop("checked", !0),
|
2441 |
-
SFSI('input[name="sfsi_pinterest_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2442 |
-
"manual" == SFSI("input[name='sfsi_pinterest_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_pinterest_manualCounts']").slideDown(),
|
2443 |
-
SFSI(".pin_options").slideUp()) : SFSI("input[name='sfsi_pinterest_manualCounts']").slideUp()),
|
2444 |
-
|
2445 |
-
"sfsi_instagram_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_instagram_countsDisplay"]').prop("checked", !0),
|
2446 |
-
SFSI('input[name="sfsi_instagram_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2447 |
-
"manual" == SFSI("input[name='sfsi_instagram_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_instagram_manualCounts']").slideDown(),
|
2448 |
-
SFSI(".instagram_userLi").slideUp()) : (SFSI("input[name='sfsi_instagram_manualCounts']").slideUp(),
|
2449 |
-
SFSI(".instagram_userLi").slideDown()));
|
2450 |
-
|
2451 |
-
}),
|
2452 |
-
|
2453 |
-
sfsi_make_popBox(),
|
2454 |
-
|
2455 |
-
SFSI('input[name="sfsi_popup_text"] ,input[name="sfsi_popup_background_color"],input[name="sfsi_popup_border_color"],input[name="sfsi_popup_border_thickness"],input[name="sfsi_popup_fontSize"],input[name="sfsi_popup_fontColor"]').on("keyup", sfsi_make_popBox),
|
2456 |
-
SFSI('input[name="sfsi_popup_text"] ,input[name="sfsi_popup_background_color"],input[name="sfsi_popup_border_color"],input[name="sfsi_popup_border_thickness"],input[name="sfsi_popup_fontSize"],input[name="sfsi_popup_fontColor"]').on("focus", sfsi_make_popBox),
|
2457 |
-
|
2458 |
-
SFSI("#sfsi_popup_font ,#sfsi_popup_fontStyle").on("change", sfsi_make_popBox),
|
2459 |
-
|
2460 |
-
/*SFSI(".radio").live("click", function(){*/
|
2461 |
-
SFSI(document).on("click", '.radio', function () {
|
2462 |
-
|
2463 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
2464 |
-
|
2465 |
-
if ("sfsi_icons_floatPosition" == s.attr("name")) {
|
2466 |
-
SFSI('input[name="sfsi_icons_floatPosition"]').removeAttr("checked");
|
2467 |
-
s.attr("checked", true);
|
2468 |
-
}
|
2469 |
-
|
2470 |
-
if ("sfsi_disable_floaticons" == s.attr("name")) {
|
2471 |
-
SFSI('input[name="sfsi_disable_floaticons"]').removeAttr("checked");
|
2472 |
-
s.attr("checked", true);
|
2473 |
-
}
|
2474 |
-
|
2475 |
-
"sfsi_popup_border_shadow" == s.attr("name") && sfsi_make_popBox();
|
2476 |
-
}), /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent) ? SFSI("img.sfsi_wicon").on("click", function (s) {
|
2477 |
-
s.stopPropagation();
|
2478 |
-
var i = SFSI("#sfsi_floater_sec").val();
|
2479 |
-
SFSI("div.sfsi_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_wicons").find(".inerCnt").find("div.sfsi_tool_tip_2").hide(),
|
2480 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_tool_tip_2").css("z-index", "0"),
|
2481 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_wicons").find(".inerCnt").find("div.sfsi_tool_tip_2").hide()),
|
2482 |
-
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
2483 |
-
"z-index": "999"
|
2484 |
-
}), SFSI(this).attr("data-effect") && "fade_in" == SFSI(this).attr("data-effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2485 |
-
opacity: 1,
|
2486 |
-
"z-index": 10
|
2487 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("data-effect") && "scale" == SFSI(this).attr("data-effect") && (SFSI(this).parent().addClass("scale"),
|
2488 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2489 |
-
opacity: 1,
|
2490 |
-
"z-index": 10
|
2491 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("data-effect") && "combo" == SFSI(this).attr("data-effect") && (SFSI(this).parent().addClass("scale"),
|
2492 |
-
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2493 |
-
opacity: 1,
|
2494 |
-
"z-index": 10
|
2495 |
-
})), ("top-left" == i || "top-right" == i) && SFSI(this).parent().parent().parent().parent("#sfsi_floater").length > 0 && "sfsi_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").addClass("sfsi_plc_btm"),
|
2496 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
2497 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2498 |
-
opacity: 1,
|
2499 |
-
"z-index": 10
|
2500 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").show()) : (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
2501 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").removeClass("sfsi_plc_btm"),
|
2502 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2503 |
-
opacity: 1,
|
2504 |
-
"z-index": 1e3
|
2505 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").show());
|
2506 |
-
}) : SFSI("img.sfsi_wicon").on("mouseenter", function () {
|
2507 |
-
var s = SFSI("#sfsi_floater_sec").val();
|
2508 |
-
SFSI("div.sfsi_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_wicons").find(".inerCnt").find("div.sfsi_tool_tip_2").hide(),
|
2509 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_tool_tip_2").css("z-index", "0"),
|
2510 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_wicons").find(".inerCnt").find("div.sfsi_tool_tip_2").hide()),
|
2511 |
-
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
2512 |
-
"z-index": "999"
|
2513 |
-
}), SFSI(this).attr("data-effect") && "fade_in" == SFSI(this).attr("data-effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2514 |
-
opacity: 1,
|
2515 |
-
"z-index": 10
|
2516 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("data-effect") && "scale" == SFSI(this).attr("data-effect") && (SFSI(this).parent().addClass("scale"),
|
2517 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2518 |
-
opacity: 1,
|
2519 |
-
"z-index": 10
|
2520 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("data-effect") && "combo" == SFSI(this).attr("data-effect") && (SFSI(this).parent().addClass("scale"),
|
2521 |
-
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2522 |
-
opacity: 1,
|
2523 |
-
"z-index": 10
|
2524 |
-
})), ("top-left" == s || "top-right" == s) && SFSI(this).parent().parent().parent().parent("#sfsi_floater").length > 0 && "sfsi_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").addClass("sfsi_plc_btm"),
|
2525 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
2526 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2527 |
-
opacity: 1,
|
2528 |
-
"z-index": 10
|
2529 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").show()) : (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
2530 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").removeClass("sfsi_plc_btm"),
|
2531 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2532 |
-
opacity: 1,
|
2533 |
-
"z-index": 10
|
2534 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").show());
|
2535 |
-
}), SFSI("div.sfsi_wicons").on("mouseleave", function () {
|
2536 |
-
SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && "fade_in" == SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && SFSI(this).children("div.inerCnt").find("a.sficn").css("opacity", "0.6"),
|
2537 |
-
SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && "scale" == SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && SFSI(this).children("div.inerCnt").find("a.sficn").removeClass("scale"),
|
2538 |
-
SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && "combo" == SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && (SFSI(this).children("div.inerCnt").find("a.sficn").css("opacity", "0.6"),
|
2539 |
-
SFSI(this).children("div.inerCnt").find("a.sficn").removeClass("scale")), SFSI(this).children(".inerCnt").find("div.sfsi_tool_tip_2").hide();
|
2540 |
-
}), SFSI("body").on("click", function () {
|
2541 |
-
SFSI(".inerCnt").find("div.sfsi_tool_tip_2").hide();
|
2542 |
-
}), SFSI(".adminTooltip >a").on("hover", function () {
|
2543 |
-
SFSI(this).offset().top, SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").css("opacity", "1"),
|
2544 |
-
SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").show();
|
2545 |
-
}), SFSI(".adminTooltip").on("mouseleave", function () {
|
2546 |
-
"none" != SFSI(".gpls_tool_bdr").css("display") && 0 != SFSI(".gpls_tool_bdr").css("opacity") ? SFSI(".pop_up_box ").on("click", function () {
|
2547 |
-
SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").css("opacity", "0"), SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").hide();
|
2548 |
-
}) : (SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").css("opacity", "0"),
|
2549 |
-
SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").hide());
|
2550 |
-
}), SFSI(".expand-area").on("click", function () {
|
2551 |
-
"Read more" == SFSI(this).text() ? (SFSI(this).siblings("p").children("label").fadeIn("slow"),
|
2552 |
-
SFSI(this).text("Collapse")) : (SFSI(this).siblings("p").children("label").fadeOut("slow"),
|
2553 |
-
SFSI(this).text("Read more"));
|
2554 |
-
}), /*SFSI(".radio").live("click", function() {*/ SFSI(document).on("click", '.radio', function () {
|
2555 |
-
|
2556 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
2557 |
-
|
2558 |
-
"sfsi_icons_float" == s.attr("name") && "yes" == s.val() && (SFSI(".float_options").slideDown("slow"),
|
2559 |
-
|
2560 |
-
SFSI('input[name="sfsi_icons_stick"][value="no"]').attr("checked", !0), SFSI('input[name="sfsi_icons_stick"][value="yes"]').removeAttr("checked"),
|
2561 |
-
SFSI('input[name="sfsi_icons_stick"][value="no"]').parent().find("span").attr("style", "0px -41px;"),
|
2562 |
-
SFSI('input[name="sfsi_icons_stick"][value="yes"]').parent().find("span").attr("style", "0px -0px;")),
|
2563 |
-
|
2564 |
-
//("sfsi_icons_stick" == s.attr("name") && "yes" == s.val() || "sfsi_icons_float" == s.attr("name") && "no" == s.val()) && (SFSI(".float_options").slideUp("slow"),
|
2565 |
-
("sfsi_icons_stick" == s.attr("name") && "yes" == s.val()) && (SFSI(".float_options").slideUp("slow"),
|
2566 |
-
|
2567 |
-
SFSI('input[name="sfsi_icons_float"][value="no"]').prop("checked", !0), SFSI('input[name="sfsi_icons_float"][value="yes"]').prop("checked", !1),
|
2568 |
-
SFSI('input[name="sfsi_icons_float"][value="no"]').parent().find("span.radio").attr("style", "0px -41px;"),
|
2569 |
-
SFSI('input[name="sfsi_icons_float"][value="yes"]').parent().find("span.radio").attr("style", "0px -0px;"));
|
2570 |
-
|
2571 |
-
}),
|
2572 |
-
|
2573 |
-
SFSI(".sfsi_wDiv").length > 0 && setTimeout(function () {
|
2574 |
-
var s = parseInt(SFSI(".sfsi_wDiv").height()) + 0 + "px";
|
2575 |
-
SFSI(".sfsi_holders").each(function () {
|
2576 |
-
SFSI(this).css("height", s);
|
2577 |
-
});
|
2578 |
-
}, 200),
|
2579 |
-
/*SFSI(".checkbox").live("click", function() {*/
|
2580 |
-
SFSI(document).on("click", '.checkbox', function () {
|
2581 |
-
var s = SFSI(this).parent().find("input:checkbox:first");
|
2582 |
-
("sfsi_shuffle_Firstload" == s.attr("name") && "checked" == s.attr("checked") || "sfsi_shuffle_interval" == s.attr("name") && "checked" == s.attr("checked")) && (SFSI('input[name="sfsi_shuffle_icons"]').parent().find("span").css("background-position", "0px -36px"),
|
2583 |
-
SFSI('input[name="sfsi_shuffle_icons"]').attr("checked", "checked")), "sfsi_shuffle_icons" == s.attr("name") && "checked" != s.attr("checked") && (SFSI('input[name="sfsi_shuffle_Firstload"]').removeAttr("checked"),
|
2584 |
-
SFSI('input[name="sfsi_shuffle_Firstload"]').parent().find("span").css("background-position", "0px 0px"),
|
2585 |
-
SFSI('input[name="sfsi_shuffle_interval"]').removeAttr("checked"), SFSI('input[name="sfsi_shuffle_interval"]').parent().find("span").css("background-position", "0px 0px"));
|
2586 |
-
});
|
2587 |
-
|
2588 |
-
SFSI("body").on("click", "#sfsi_getMeFullAccess", function () {
|
2589 |
-
var email = SFSI(this).parents("form").find("input[type='email']").val();
|
2590 |
-
var feedid = SFSI(this).parents("form").find("input[name='feed_id']").val();
|
2591 |
-
var error = false;
|
2592 |
-
var regEx = /^\w+([-+.']\w+)*@\w+([-.]\w+)*\.\w+([-.]\w+)*$/;
|
2593 |
-
|
2594 |
-
if (email === '') {
|
2595 |
-
error = true;
|
2596 |
-
}
|
2597 |
-
|
2598 |
-
if (!regEx.test(email)) {
|
2599 |
-
error = true;
|
2600 |
-
}
|
2601 |
-
|
2602 |
-
if (!error) {
|
2603 |
-
console.log("feedid",feedid);
|
2604 |
-
if (feedid=="" || undefined==feedid){
|
2605 |
-
var nonce = SFSI(this).attr('data-nonce-fetch-feed-id');
|
2606 |
-
e = {
|
2607 |
-
action: "sfsi_get_feed_id",
|
2608 |
-
nonce: nonce,
|
2609 |
-
};
|
2610 |
-
SFSI.ajax({
|
2611 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
2612 |
-
type: "post",
|
2613 |
-
data: e,
|
2614 |
-
dataType: "json",
|
2615 |
-
async: !0,
|
2616 |
-
success: function (s) {
|
2617 |
-
if (s.res == "wrong_nonce") {
|
2618 |
-
alert("Error: Unauthorised Request, Try again after refreshing page.");
|
2619 |
-
} else {
|
2620 |
-
if("success" == s.res){
|
2621 |
-
var feedid = s.feed_id;
|
2622 |
-
if(feedid=="" || null == feedid){
|
2623 |
-
alert("Error: Claiming didn't work. Please try again later.")
|
2624 |
-
}else{
|
2625 |
-
jQuery('#calimingOptimizationForm input[name="feed_id"]').val(feedid);
|
2626 |
-
console.log("feedid",feedid,SFSI("#calimingOptimizationForm input[name='feed_id']"),SFSI('#calimingOptimizationForm input[name="feedid"]').val());
|
2627 |
-
SFSI('#calimingOptimizationForm').submit();
|
2628 |
-
}
|
2629 |
-
}else{
|
2630 |
-
if("failed"==s.res){
|
2631 |
-
alert("Error: "+s.message+".");
|
2632 |
-
|
2633 |
-
}else{
|
2634 |
-
alert("Error: Please try again.");
|
2635 |
-
}
|
2636 |
-
}
|
2637 |
-
}
|
2638 |
-
}
|
2639 |
-
});
|
2640 |
-
}else{
|
2641 |
-
SFSI(this).parents("form").submit();
|
2642 |
-
}
|
2643 |
-
} else {
|
2644 |
-
alert("Error: Please provide your email address.");
|
2645 |
-
}
|
2646 |
-
});
|
2647 |
-
|
2648 |
-
SFSI('form#calimingOptimizationForm').on('keypress', function (e) {
|
2649 |
-
var keyCode = e.keyCode || e.which;
|
2650 |
-
if (keyCode === 13) {
|
2651 |
-
e.preventDefault();
|
2652 |
-
return false;
|
2653 |
-
}
|
2654 |
-
});
|
2655 |
-
|
2656 |
-
/*SFSI(".checkbox").live("click", function()
|
2657 |
-
{
|
2658 |
-
var s = SFSI(this).parent().find("input:checkbox:first");
|
2659 |
-
"float_on_page" == s.attr("name") && "yes" == s.val() && (
|
2660 |
-
SFSI('input[name="sfsi_icons_stick"][value="no"]').attr("checked", !0), SFSI('input[name="sfsi_icons_stick"][value="yes"]').removeAttr("checked"),
|
2661 |
-
SFSI('input[name="sfsi_icons_stick"][value="no"]').parent().find("span").attr("style", "0px -41px;"),
|
2662 |
-
SFSI('input[name="sfsi_icons_stick"][value="yes"]').parent().find("span").attr("style", "0px -0px;"));
|
2663 |
-
});
|
2664 |
-
SFSI(".radio").live("click", function()
|
2665 |
-
{
|
2666 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
2667 |
-
var a = SFSI(".cstmfltonpgstck");
|
2668 |
-
("sfsi_icons_stick" == s.attr("name") && "yes" == s.val()) && (
|
2669 |
-
SFSI('input[name="float_on_page"][value="no"]').prop("checked", !0), SFSI('input[name="float_on_page"][value="yes"]').prop("checked", !1),
|
2670 |
-
SFSI('input[name="float_on_page"][value="no"]').parent().find("span.checkbox").attr("style", "0px -41px;"),
|
2671 |
-
SFSI('input[name="float_on_page"][value="yes"]').parent().find("span.checkbox").attr("style", "0px -0px;"),
|
2672 |
-
jQuery(a).children(".checkbox").css("background-position", "0px 0px" ), toggleflotpage(a));
|
2673 |
-
});*/
|
2674 |
-
window.sfsi_initialization_checkbox_count = 0;
|
2675 |
-
window.sfsi_initialization_checkbox = setInterval(function () {
|
2676 |
-
// console.log(jQuery('.radio_section.tb_4_ck>span.checkbox').length,jQuery('.radio_section.tb_4_ck>input.styled').length);
|
2677 |
-
if (jQuery('.radio_section.tb_4_ck>span.checkbox').length < jQuery('.radio_section.tb_4_ck>input.styled').length) {
|
2678 |
-
window.sfsi_initialization_checkbox_count++;
|
2679 |
-
// console.log('not initialized',window.sfsi_initialization_checkbox_count);
|
2680 |
-
if (window.sfsi_initialization_checkbox_count > 12) {
|
2681 |
-
// alert('Some script from diffrent plugin is interfearing with "Ultimate Social Icons" js files and checkbox couldn\'t be initialized. ');
|
2682 |
-
// window.clearInterval(window.sfsi_initialization_checkbox);
|
2683 |
-
}
|
2684 |
-
} else {
|
2685 |
-
// console.log('all initialized',window.sfsi_initialization_checkbox_count);
|
2686 |
-
window.clearInterval(window.sfsi_initialization_checkbox);
|
2687 |
-
}
|
2688 |
-
}, 1000);
|
2689 |
-
sfsi_responsive_icon_intraction_handler();
|
2690 |
-
|
2691 |
-
});
|
2692 |
-
|
2693 |
-
//for utube channel name and id
|
2694 |
-
function showhideutube(ref) {
|
2695 |
-
var chnlslctn = SFSI(ref).children("input").val();
|
2696 |
-
if (chnlslctn == "name") {
|
2697 |
-
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideDown();
|
2698 |
-
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideUp();
|
2699 |
-
} else {
|
2700 |
-
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideDown();
|
2701 |
-
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideUp();
|
2702 |
-
}
|
2703 |
-
}
|
2704 |
-
|
2705 |
-
function checkforinfoslction(ref) {
|
2706 |
-
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
2707 |
-
|
2708 |
-
var rightInfoClass = jQuery(ref).next().attr('class');
|
2709 |
-
|
2710 |
-
var rightInfoPElem = jQuery(ref).next("." + rightInfoClass).children("p").first();
|
2711 |
-
|
2712 |
-
var elemName = 'label';
|
2713 |
-
|
2714 |
-
if (pos == "0px 0px") {
|
2715 |
-
rightInfoPElem.children(elemName).hide();
|
2716 |
-
} else {
|
2717 |
-
rightInfoPElem.children(elemName).show();
|
2718 |
-
}
|
2719 |
-
}
|
2720 |
-
|
2721 |
-
function checkforinfoslction_checkbox(ref) {
|
2722 |
-
|
2723 |
-
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
2724 |
-
|
2725 |
-
var elem = jQuery(ref).parent().children('.sfsi_right_info').find('.kckslctn');
|
2726 |
-
|
2727 |
-
if (pos == "0px 0px") {
|
2728 |
-
elem.hide();
|
2729 |
-
} else {
|
2730 |
-
elem.show();
|
2731 |
-
}
|
2732 |
-
}
|
2733 |
-
|
2734 |
-
function sfsi_toggleflotpage_que3(ref) {
|
2735 |
-
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
2736 |
-
if (pos == "0px 0px") {
|
2737 |
-
jQuery(ref).next(".sfsi_right_info").hide();
|
2738 |
-
|
2739 |
-
} else {
|
2740 |
-
jQuery(ref).next(".sfsi_right_info").show();
|
2741 |
-
}
|
2742 |
-
}
|
2743 |
-
|
2744 |
-
var initTop = new Array();
|
2745 |
-
|
2746 |
-
SFSI('.sfsi_navigate_to_question7').on("click", function () {
|
2747 |
-
|
2748 |
-
var elem = SFSI('#ui-id-6');
|
2749 |
-
|
2750 |
-
if (elem.hasClass('accordion-content-active')) {
|
2751 |
-
|
2752 |
-
// Cloase tab of Question 3
|
2753 |
-
elem.find('.sfsiColbtn').trigger('click');
|
2754 |
-
|
2755 |
-
// Open tab of Question 7
|
2756 |
-
if (!SFSI('#ui-id-14').hasClass('accordion-content-active')) {
|
2757 |
-
SFSI('#ui-id-13').trigger('click');
|
2758 |
-
}
|
2759 |
-
|
2760 |
-
var pos = SFSI("#ui-id-13").offset();
|
2761 |
-
var scrollToPos = pos.top - SFSI(window).height() * 0.99 + 30;
|
2762 |
-
SFSI('html,body').animate({
|
2763 |
-
scrollTop: scrollToPos
|
2764 |
-
}, 500);
|
2765 |
-
}
|
2766 |
-
});
|
2767 |
-
|
2768 |
-
SFSI("body").on("click", ".sfsi_tokenGenerateButton a", function () {
|
2769 |
-
var clienId = SFSI("input[name='sfsi_instagram_clientid']").val();
|
2770 |
-
var redirectUrl = SFSI("input[name='sfsi_instagram_appurl']").val();
|
2771 |
-
|
2772 |
-
var scope = "basic";
|
2773 |
-
var instaUrl = "https://www.instagram.com/oauth/authorize/?client_id=<id>&redirect_uri=<url>&response_type=token&scope=" + scope;
|
2774 |
-
|
2775 |
-
if (clienId !== '' && redirectUrl !== '') {
|
2776 |
-
instaUrl = instaUrl.replace('<id>', clienId);
|
2777 |
-
instaUrl = instaUrl.replace('<url>', redirectUrl);
|
2778 |
-
|
2779 |
-
window.open(instaUrl, '_blank');
|
2780 |
-
} else {
|
2781 |
-
alert("Please enter client id and redirect url first");
|
2782 |
-
}
|
2783 |
-
|
2784 |
-
});
|
2785 |
-
SFSI(document).ready(function () {
|
2786 |
-
|
2787 |
-
SFSI('#sfsi_jivo_offline_chat .tab-link').click(function () {
|
2788 |
-
var cur = SFSI(this);
|
2789 |
-
if (!cur.hasClass('active')) {
|
2790 |
-
var target = cur.find('a').attr('href');
|
2791 |
-
cur.parent().children().removeClass('active');
|
2792 |
-
cur.addClass('active');
|
2793 |
-
SFSI('#sfsi_jivo_offline_chat .tabs').children().hide();
|
2794 |
-
SFSI(target).show();
|
2795 |
-
}
|
2796 |
-
});
|
2797 |
-
SFSI('#sfsi_jivo_offline_chat #sfsi_sales form').submit(function (event) {
|
2798 |
-
event & event.preventDefault();
|
2799 |
-
// console.log(event);
|
2800 |
-
var target = SFSI(this).parents('.tab-content');
|
2801 |
-
var message = SFSI(this).find('textarea[name="question"]').val();
|
2802 |
-
var email = SFSI(this).find('input[name="email"]').val();
|
2803 |
-
var re = /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/;
|
2804 |
-
var nonce = SFSI(this).find('input[name="nonce"]').val();
|
2805 |
-
|
2806 |
-
if ("" === email || false === re.test(String(email).toLowerCase())) {
|
2807 |
-
// console.log(SFSI(this).find('input[name="email"]'));
|
2808 |
-
SFSI(this).find('input[name="email"]').css('background-color', 'red');
|
2809 |
-
SFSI(this).find('input[name="email"]').on('keyup', function () {
|
2810 |
-
var re = /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/;
|
2811 |
-
var email = SFSI(this).val();
|
2812 |
-
// console.log(email,re.test(String(email).toLowerCase()) );
|
2813 |
-
if ("" !== email && true === re.test(String(email).toLowerCase())) {
|
2814 |
-
SFSI(this).css('background-color', '#fff');
|
2815 |
-
}
|
2816 |
-
})
|
2817 |
-
return false;
|
2818 |
-
|
2819 |
-
}
|
2820 |
-
SFSI.ajax({
|
2821 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
2822 |
-
type: "post",
|
2823 |
-
data: {
|
2824 |
-
action: "sfsiOfflineChatMessage",
|
2825 |
-
message: message,
|
2826 |
-
email: email,
|
2827 |
-
'nonce': nonce
|
2828 |
-
}
|
2829 |
-
}).done(function () {
|
2830 |
-
target.find('.before_message_sent').hide();
|
2831 |
-
target.find('.after_message_sent').show();
|
2832 |
-
});
|
2833 |
-
})
|
2834 |
-
});
|
2835 |
-
|
2836 |
-
function sfsi_close_offline_chat(e) {
|
2837 |
-
e && e.preventDefault();
|
2838 |
-
|
2839 |
-
SFSI('#sfsi_jivo_offline_chat').hide();
|
2840 |
-
SFSI('#sfsi_dummy_chat_icon').show();
|
2841 |
-
}
|
2842 |
-
|
2843 |
-
function sfsi_open_quick_checkout(e) {
|
2844 |
-
e && e.preventDefault();
|
2845 |
-
// console.log(jQuery('.sfsi_quick-pay-box'));
|
2846 |
-
jQuery('.sfsi_quick-pay-box').show();
|
2847 |
-
}
|
2848 |
-
|
2849 |
-
function sfsi_close_quickpay(e) {
|
2850 |
-
e && e.preventDefault();
|
2851 |
-
jQuery('.sfsi_quickpay-overlay').hide();
|
2852 |
-
}
|
2853 |
-
|
2854 |
-
function sfsi_quickpay_container_click(event) {
|
2855 |
-
if (jQuery(event.target).hasClass('sellcodes-quick-purchase')) {
|
2856 |
-
jQuery(jQuery(event.target).find('p.sc-button img')[0]).click();
|
2857 |
-
}
|
2858 |
-
}
|
2859 |
-
|
2860 |
-
|
2861 |
-
|
2862 |
-
// <------------------------* Responsive icon *----------------------->
|
2863 |
-
|
2864 |
-
function sfsi_responsive_icon_intraction_handler() {
|
2865 |
-
window.sfsi_fittext_shouldDisplay = true;
|
2866 |
-
SFSI('select[name="sfsi_responsive_icons_settings_edge_type"]').on('change', function () {
|
2867 |
-
$target_div = (SFSI(this).parent());
|
2868 |
-
if (SFSI(this).val() === "Round") {
|
2869 |
-
console.log('Round', 'Round', SFSI(this).val());
|
2870 |
-
|
2871 |
-
$target_div.parent().children().css('display', 'inline-block');
|
2872 |
-
$target_div.parent().next().css("display","inline-block");
|
2873 |
-
var radius = jQuery('select[name="sfsi_responsive_icons_settings_edge_radius"]').val() + 'px'
|
2874 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('border-radius', radius);
|
2875 |
-
|
2876 |
-
} else {
|
2877 |
-
console.log('sharp', 'sharp', SFSI(this).val(), $target_div.parent().children(), $target_div.parent().children().hide());
|
2878 |
-
|
2879 |
-
$target_div.parent().children().hide();
|
2880 |
-
$target_div.show();
|
2881 |
-
$target_div.parent().next().hide();
|
2882 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('border-radius', 'unset');
|
2883 |
-
|
2884 |
-
}
|
2885 |
-
});
|
2886 |
-
SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').on('change', function () {
|
2887 |
-
$target_div = (SFSI(this).parent());
|
2888 |
-
if (SFSI(this).val() === "Fixed icon width") {
|
2889 |
-
$target_div.parent().children().css('display', 'inline-block');
|
2890 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').css('width', 'auto').css('display', 'flex');
|
2891 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a').css('flex-basis', 'unset');
|
2892 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').css('width', jQuery('input[name="sfsi_responsive_icons_sttings_icon_width_size"]').val());
|
2893 |
-
|
2894 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container_box_fully_container').removeClass('sfsi_icons_container_box_fully_container').addClass('sfsi_icons_container_box_fixed_container');
|
2895 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container_box_fixed_container').removeClass('sfsi_icons_container_box_fully_container').addClass('sfsi_icons_container_box_fixed_container');
|
2896 |
-
window.sfsi_fittext_shouldDisplay = true;
|
2897 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2898 |
-
if (jQuery(a_container).css('display') !== "none") {
|
2899 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2900 |
-
}
|
2901 |
-
})
|
2902 |
-
} else {
|
2903 |
-
$target_div.parent().children().hide();
|
2904 |
-
$target_div.show();
|
2905 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').css('width', '100%').css('display', 'flex');
|
2906 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a').css('flex-basis', '100%');
|
2907 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').css('width', '100%');
|
2908 |
-
|
2909 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container_box_fixed_container').removeClass('sfsi_icons_container_box_fixed_container').addClass('sfsi_icons_container_box_fully_container');
|
2910 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container_box_fully_container').removeClass('sfsi_icons_container_box_fixed_container').addClass('sfsi_icons_container_box_fully_container');
|
2911 |
-
window.sfsi_fittext_shouldDisplay = true;
|
2912 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2913 |
-
if (jQuery(a_container).css('display') !== "none") {
|
2914 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2915 |
-
}
|
2916 |
-
})
|
2917 |
-
}
|
2918 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').removeClass('sfsi_fixed_count_container').removeClass('sfsi_responsive_count_container').addClass('sfsi_' + (jQuery(this).val() == "Fully responsive" ? 'responsive' : 'fixed') + '_count_container')
|
2919 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container>a').removeClass('sfsi_responsive_fluid').removeClass('sfsi_responsive_fixed_width').addClass('sfsi_responsive_' + (jQuery(this).val() == "Fully responsive" ? 'fluid' : 'fixed_width'))
|
2920 |
-
sfsi_resize_icons_container();
|
2921 |
-
|
2922 |
-
})
|
2923 |
-
jQuery(document).on('keyup', 'input[name="sfsi_responsive_icons_sttings_icon_width_size"]', function () {
|
2924 |
-
if (SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val() === "Fixed icon width") {
|
2925 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').css('width', jQuery(this).val() + 'px');
|
2926 |
-
window.sfsi_fittext_shouldDisplay = true;
|
2927 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2928 |
-
if (jQuery(a_container).css('display') !== "none") {
|
2929 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2930 |
-
}
|
2931 |
-
})
|
2932 |
-
}
|
2933 |
-
sfsi_resize_icons_container();
|
2934 |
-
});
|
2935 |
-
jQuery(document).on('change', 'input[name="sfsi_responsive_icons_sttings_icon_width_size"]', function () {
|
2936 |
-
if (SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val() === "Fixed icon width") {
|
2937 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').css('width', jQuery(this).val() + 'px');
|
2938 |
-
}
|
2939 |
-
});
|
2940 |
-
jQuery(document).on('keyup', 'input[name="sfsi_responsive_icons_settings_margin"]', function () {
|
2941 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('margin-right', jQuery(this).val() + 'px');
|
2942 |
-
});
|
2943 |
-
jQuery(document).on('change', 'input[name="sfsi_responsive_icons_settings_margin"]', function () {
|
2944 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('margin-right', jQuery(this).val() + 'px');
|
2945 |
-
// jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').css('width',(jQuery('.sfsi_responsive_icons').width()-(jQuery('.sfsi_responsive_icons_count').width()+jQuery(this).val()))+'px');
|
2946 |
-
|
2947 |
-
});
|
2948 |
-
jQuery(document).on('change', 'select[name="sfsi_responsive_icons_settings_text_align"]', function () {
|
2949 |
-
if (jQuery(this).val() === "Centered") {
|
2950 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a').css('text-align', 'center');
|
2951 |
-
} else {
|
2952 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a').css('text-align', 'left');
|
2953 |
-
}
|
2954 |
-
});
|
2955 |
-
jQuery('.sfsi_responsive_default_icon_container input.sfsi_responsive_input').on('keyup', function () {
|
2956 |
-
jQuery(this).parent().find('.sfsi_responsive_icon_item_container').find('span').text(jQuery(this).val());
|
2957 |
-
var iconName = jQuery(this).attr('name');
|
2958 |
-
var icon = iconName.replace('sfsi_responsive_', '').replace('_input', '');
|
2959 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_' + (icon.toLowerCase()) + '_container span').text(jQuery(this).val());
|
2960 |
-
window.sfsi_fittext_shouldDisplay = true;
|
2961 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2962 |
-
if (jQuery(a_container).css('display') !== "none") {
|
2963 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2964 |
-
}
|
2965 |
-
})
|
2966 |
-
sfsi_resize_icons_container();
|
2967 |
-
})
|
2968 |
-
jQuery('.sfsi_responsive_custom_icon_container input.sfsi_responsive_input').on('keyup', function () {
|
2969 |
-
jQuery(this).parent().find('.sfsi_responsive_icon_item_container').find('span').text(jQuery(this).val());
|
2970 |
-
var iconName = jQuery(this).attr('name');
|
2971 |
-
var icon = iconName.replace('sfsi_responsive_custom_', '').replace('_input', '');
|
2972 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_' + icon + '_container span').text(jQuery(this).val())
|
2973 |
-
window.sfsi_fittext_shouldDisplay = true;
|
2974 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2975 |
-
if (jQuery(a_container).css('display') !== "none") {
|
2976 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2977 |
-
}
|
2978 |
-
})
|
2979 |
-
sfsi_resize_icons_container();
|
2980 |
-
|
2981 |
-
})
|
2982 |
-
|
2983 |
-
jQuery('.sfsi_responsive_default_url_toggler').click(function (event) {
|
2984 |
-
|
2985 |
-
event.preventDefault();
|
2986 |
-
sfsi_responsive_open_url(event);
|
2987 |
-
});
|
2988 |
-
jQuery('.sfsi_responsive_default_url_toggler').click(function (event) {
|
2989 |
-
event.preventDefault();
|
2990 |
-
sfsi_responsive_open_url(event);
|
2991 |
-
})
|
2992 |
-
jQuery('.sfsi_responsive_custom_url_hide, .sfsi_responsive_default_url_hide').click(function (event) {
|
2993 |
-
event.preventDefault();
|
2994 |
-
/* console.log(event,jQuery(event.target)); */
|
2995 |
-
jQuery(event.target).parent().parent().find('.sfsi_responsive_custom_url_hide').hide();
|
2996 |
-
jQuery(event.target).parent().parent().find('.sfsi_responsive_url_input').hide();
|
2997 |
-
jQuery(event.target).parent().parent().find('.sfsi_responsive_default_url_hide').hide();
|
2998 |
-
jQuery(event.target).parent().parent().find('.sfsi_responsive_default_url_toggler').show();
|
2999 |
-
});
|
3000 |
-
jQuery('select[name="sfsi_responsive_icons_settings_icon_size"]').change(function (event) {
|
3001 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').removeClass('sfsi_small_button').removeClass('sfsi_medium_button').removeClass('sfsi_large_button').addClass('sfsi_' + (jQuery(this).val().toLowerCase()) + '_button');
|
3002 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').removeClass('sfsi_small_button_container').removeClass('sfsi_medium_button_container').removeClass('sfsi_large_button_container').addClass('sfsi_' + (jQuery(this).val().toLowerCase()) + '_button_container')
|
3003 |
-
})
|
3004 |
-
jQuery(document).on('change', 'select[name="sfsi_responsive_icons_settings_edge_radius"]', function (event) {
|
3005 |
-
var radius = jQuery(this).val() + 'px'
|
3006 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('border-radius', radius);
|
3007 |
-
|
3008 |
-
});
|
3009 |
-
jQuery(document).on('change', 'select[name="sfsi_responsive_icons_settings_style"]', function (event) {
|
3010 |
-
if ('Flat' === jQuery(this).val()) {
|
3011 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').removeClass('sfsi_responsive_icon_gradient');
|
3012 |
-
} else {
|
3013 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').addClass('sfsi_responsive_icon_gradient');
|
3014 |
-
}
|
3015 |
-
});
|
3016 |
-
jQuery(document).on('mouseenter', '.sfsi_responsive_icon_preview .sfsi_icons_container a', function () {
|
3017 |
-
jQuery(this).css('opacity', 0.8);
|
3018 |
-
})
|
3019 |
-
jQuery(document).on('mouseleave', '.sfsi_responsive_icon_preview .sfsi_icons_container a', function () {
|
3020 |
-
jQuery(this).css('opacity', 1);
|
3021 |
-
})
|
3022 |
-
window.sfsi_fittext_shouldDisplay = true;
|
3023 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
3024 |
-
if (jQuery(a_container).css('display') !== "none") {
|
3025 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
3026 |
-
}
|
3027 |
-
})
|
3028 |
-
sfsi_resize_icons_container();
|
3029 |
-
jQuery('.ui-accordion-header.ui-state-default.ui-accordion-icons').click(function (data) {
|
3030 |
-
window.sfsi_fittext_shouldDisplay = true;
|
3031 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
3032 |
-
if (jQuery(a_container).css('display') !== "none") {
|
3033 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
3034 |
-
}
|
3035 |
-
})
|
3036 |
-
sfsi_resize_icons_container();
|
3037 |
-
});
|
3038 |
-
jQuery('select[name="sfsi_responsive_icons_settings_text_align"]').change(function (event) {
|
3039 |
-
var data = jQuery(event.target).val();
|
3040 |
-
if (data == "Centered") {
|
3041 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').removeClass('sfsi_left-align_icon').addClass('sfsi_centered_icon');
|
3042 |
-
} else {
|
3043 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').removeClass('sfsi_centered_icon').addClass('sfsi_left-align_icon');
|
3044 |
-
}
|
3045 |
-
});
|
3046 |
-
jQuery('a.sfsi_responsive_custom_delete_btn').click(function (event) {
|
3047 |
-
event.preventDefault();
|
3048 |
-
var icon_num = jQuery(this).attr('data-id');
|
3049 |
-
//reset the current block;
|
3050 |
-
// var last_block = jQuery('.sfsi_responsive_custom_icon_4_container').clone();
|
3051 |
-
var cur_block = jQuery('.sfsi_responsive_custom_icon_' + icon_num + '_container');
|
3052 |
-
cur_block.find('.sfsi_responsive_custom_delete_btn').hide();
|
3053 |
-
cur_block.find('input[name="sfsi_responsive_custom_' + icon_num + '_added"]').val('no');
|
3054 |
-
cur_block.find('.sfsi_responsive_custom_' + icon_num + '_added').attr('value', 'no');
|
3055 |
-
cur_block.find('.radio_section.tb_4_ck .checkbox').click();
|
3056 |
-
cur_block.hide();
|
3057 |
-
|
3058 |
-
|
3059 |
-
if (icon_num > 0) {
|
3060 |
-
var prev_block = jQuery('.sfsi_responsive_custom_icon_' + (icon_num - 1) + '_container');
|
3061 |
-
prev_block.find('.sfsi_responsive_custom_delete_btn').show();
|
3062 |
-
}
|
3063 |
-
// jQuery('.sfsi_responsive_custom_icon_container').each(function(index,custom_icon){
|
3064 |
-
// var target= jQuery(custom_icon);
|
3065 |
-
// target.find('.sfsi_responsive_custom_delete_btn');
|
3066 |
-
// var custom_id = target.find('.sfsi_responsive_custom_delete_btn').attr('data-id');
|
3067 |
-
// if(custom_id>icon_num){
|
3068 |
-
// target.removeClass('sfsi_responsive_custom_icon_'+custom_id+'_container').addClass('sfsi_responsive_custom_icon_'+(custom_id-1)+'_container');
|
3069 |
-
// target.find('input[name="sfsi_responsive_custom_'+custom_id+'_added"]').attr('name',"sfsi_responsive_custom_"+(custom_id-1)+"_added");
|
3070 |
-
// target.find('#sfsi_responsive_'+custom_id+'_display').removeClass('sfsi_responsive_custom_'+custom_id+'_display').addClass('sfsi_responsive_custom_'+(custom_id-1)+'_display').attr('id','sfsi_responsive_'+(custom_id-1)+'_display').attr('name','sfsi_responsive_custom_'+(custom_id-1)+'_display').attr('data-custom-index',(custom_id-1));
|
3071 |
-
// target.find('.sfsi_responsive_icon_item_container').removeClass('sfsi_responsive_icon_custom_'+custom_id+'_container').addClass('sfsi_responsive_icon_custom_'+(custom_id-1)+'_container');
|
3072 |
-
// target.find('.sfsi_responsive_input').attr('name','sfsi_responsive_custom_'+(custom_id-1)+'_input');
|
3073 |
-
// target.find('.sfsi_responsive_url_input').attr('name','sfsi_responsive_custom_'+(custom_id-1)+'_url_input');
|
3074 |
-
// target.find('.sfsi_bg-color-picker').attr('name','sfsi_responsive_icon_'+(custom_id-1)+'_bg_color');
|
3075 |
-
// target.find('.sfsi_logo_upload sfsi_logo_custom_'+custom_id+'_upload').removeClass('sfsi_logo_upload sfsi_logo_custom_'+custom_id+'_upload').addClass('sfsi_logo_upload sfsi_logo_custom_'+(custom_id-1)+'_upload');
|
3076 |
-
// target.find('input[type="sfsi_responsive_icons_custom_'+custom_id+'_icon"]').attr('name','input[type="sfsi_responsive_icons_custom_'+(custom_id-1)+'_icon"]');
|
3077 |
-
// target.find('.sfsi_responsive_custom_delete_btn').attr('data-id',''+(custom_id-1));
|
3078 |
-
// }
|
3079 |
-
// });
|
3080 |
-
// // sfsi_backend_section_beforeafter_set_fixed_width();
|
3081 |
-
// // jQuery(window).on('resize',sfsi_backend_section_beforeafter_set_fixed_width);
|
3082 |
-
// var new_block=jQuery('.sfsi_responsive_custom_icon_container').clone();
|
3083 |
-
// jQuery('.sfsi_responsive_custom_icon_container').remove();
|
3084 |
-
// jQuery('.sfsi_responsive_default_icon_container').parent().append(last_block).append();
|
3085 |
-
// jQuery('.sfsi_responsive_default_icon_container').parent().append(new_block);
|
3086 |
-
// return false;
|
3087 |
-
})
|
3088 |
-
}
|
3089 |
-
|
3090 |
-
function sfsi_responsive_icon_counter_tgl(hide, show, ref = null) {
|
3091 |
-
if (null !== hide && '' !== hide) {
|
3092 |
-
jQuery('.' + hide).hide();
|
3093 |
-
}
|
3094 |
-
if (null !== show && '' !== show) {
|
3095 |
-
jQuery('.' + show).show();
|
3096 |
-
}
|
3097 |
-
}
|
3098 |
-
|
3099 |
-
function sfsi_responsive_toggle_count() {
|
3100 |
-
var data = jQuery('input[name="sfsi_share_count"]:checked').val();
|
3101 |
-
var data2 = jQuery('input[name="sfsi_display_counts"]:checked').val();
|
3102 |
-
/* console.log('toggleer ',data,data2); */
|
3103 |
-
if (data2 == "yes" && 'yes' == data) {
|
3104 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('display', 'inline-block');
|
3105 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').removeClass('sfsi_responsive_without_counter_icons').addClass('sfsi_responsive_with_counter_icons');
|
3106 |
-
sfsi_resize_icons_container();
|
3107 |
-
} else {
|
3108 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('display', 'none');
|
3109 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').removeClass('sfsi_responsive_with_counter_icons').addClass('sfsi_responsive_without_counter_icons');
|
3110 |
-
sfsi_resize_icons_container();
|
3111 |
-
}
|
3112 |
-
}
|
3113 |
-
|
3114 |
-
function sfsi_responsive_open_url(event) {
|
3115 |
-
jQuery(event.target).parent().find('.sfsi_responsive_custom_url_hide').show();
|
3116 |
-
jQuery(event.target).parent().find('.sfsi_responsive_default_url_hide').show();
|
3117 |
-
jQuery(event.target).parent().find('.sfsi_responsive_url_input').show();
|
3118 |
-
jQuery(event.target).hide();
|
3119 |
-
}
|
3120 |
-
|
3121 |
-
function sfsi_responsive_icon_hide_responsive_options() {
|
3122 |
-
jQuery('.sfsi_PostsSettings_section').show();
|
3123 |
-
jQuery('.sfsi_choose_post_types_section').show();
|
3124 |
-
jQuery('.sfsi_not_responsive').show();
|
3125 |
-
// jQuery('.sfsi_icn_listing8.sfsi_closerli').hide();
|
3126 |
-
}
|
3127 |
-
|
3128 |
-
function sfsi_responsive_icon_show_responsive_options() {
|
3129 |
-
jQuery('.sfsi_PostsSettings_section').hide();
|
3130 |
-
// jQuery('.sfsi_PostsSettings_section').show();
|
3131 |
-
jQuery('.sfsi_choose_post_types_section').hide();
|
3132 |
-
jQuery('.sfsi_not_responsive').hide();
|
3133 |
-
window.sfsi_fittext_shouldDisplay = true;
|
3134 |
-
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
3135 |
-
if (jQuery(a_container).css('display') !== "none") {
|
3136 |
-
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
3137 |
-
}
|
3138 |
-
})
|
3139 |
-
sfsi_resize_icons_container();
|
3140 |
-
}
|
3141 |
-
|
3142 |
-
function sfsi_scroll_to_div(option_id, scroll_selector) {
|
3143 |
-
jQuery('#' + option_id + '.ui-accordion-header[aria-selected="false"]').click() //opened the option
|
3144 |
-
//scroll to it.
|
3145 |
-
if (scroll_selector && scroll_selector !== '') {
|
3146 |
-
scroll_selector = scroll_selector;
|
3147 |
-
} else {
|
3148 |
-
scroll_selector = '#' + option_id + '.ui-accordion-header';
|
3149 |
-
}
|
3150 |
-
jQuery('html, body').stop().animate({
|
3151 |
-
scrollTop: jQuery(scroll_selector).offset().top
|
3152 |
-
}, 1000);
|
3153 |
-
}
|
3154 |
-
|
3155 |
-
function sfsi_fitText(container) {
|
3156 |
-
/* console.log(container,container.parent().parent(),container.parent().parent().hasClass('sfsi_icons_container_box_fixed_container')); */
|
3157 |
-
if (container.parent().parent().hasClass('sfsi_icons_container_box_fixed_container')) {
|
3158 |
-
/* console.log(window.sfsi_fittext_shouldDisplay); */
|
3159 |
-
if (window.sfsi_fittext_shouldDisplay === true) {
|
3160 |
-
if (jQuery('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val() == "Fully responsive") {
|
3161 |
-
var all_icon_width = jQuery('.sfsi_responsive_icons .sfsi_icons_container').width();
|
3162 |
-
var total_active_icons = jQuery('.sfsi_responsive_icons .sfsi_icons_container a').filter(function (i, icon) {
|
3163 |
-
return jQuery(icon).css('display') && (jQuery(icon).css('display').toLowerCase() !== "none");
|
3164 |
-
}).length;
|
3165 |
-
|
3166 |
-
var distance_between_icon = jQuery('input[name="sfsi_responsive_icons_settings_margin"]').val()
|
3167 |
-
var container_width = ((all_icon_width - distance_between_icon) / total_active_icons) - 5;
|
3168 |
-
container_width = (container_width - distance_between_icon);
|
3169 |
-
} else {
|
3170 |
-
var container_width = container.width();
|
3171 |
-
}
|
3172 |
-
// var container_img_width = container.find('img').width();
|
3173 |
-
var container_img_width = 70;
|
3174 |
-
// var span=container.find('span').clone();
|
3175 |
-
var span = container.find('span');
|
3176 |
-
// var span_original_width = container.find('span').width();
|
3177 |
-
var span_original_width = container_width - (container_img_width)
|
3178 |
-
span
|
3179 |
-
// .css('display','inline-block')
|
3180 |
-
.css('white-space', 'nowrap')
|
3181 |
-
// .css('width','auto')
|
3182 |
-
;
|
3183 |
-
var span_flatted_width = span.width();
|
3184 |
-
if (span_flatted_width == 0) {
|
3185 |
-
span_flatted_width = span_original_width;
|
3186 |
-
}
|
3187 |
-
span
|
3188 |
-
// .css('display','inline-block')
|
3189 |
-
.css('white-space', 'unset')
|
3190 |
-
// .css('width','auto')
|
3191 |
-
;
|
3192 |
-
var shouldDisplay = ((undefined === window.sfsi_fittext_shouldDisplay) ? true : window.sfsi_fittext_shouldDisplay = true);
|
3193 |
-
var fontSize = parseInt(span.css('font-size'));
|
3194 |
-
|
3195 |
-
if (6 > fontSize) {
|
3196 |
-
fontSize = 20;
|
3197 |
-
}
|
3198 |
-
|
3199 |
-
var computed_fontSize = (Math.floor((fontSize * span_original_width) / span_flatted_width));
|
3200 |
-
|
3201 |
-
if (computed_fontSize < 8) {
|
3202 |
-
shouldDisplay = false;
|
3203 |
-
window.sfsi_fittext_shouldDisplay = false;
|
3204 |
-
computed_fontSize = 20;
|
3205 |
-
}
|
3206 |
-
span.css('font-size', Math.min(computed_fontSize, 20));
|
3207 |
-
span
|
3208 |
-
// .css('display','inline-block')
|
3209 |
-
.css('white-space', 'nowrap')
|
3210 |
-
// .css('width','auto')
|
3211 |
-
;
|
3212 |
-
if (shouldDisplay) {
|
3213 |
-
span.show();
|
3214 |
-
} else {
|
3215 |
-
span.hide();
|
3216 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container span').hide();
|
3217 |
-
}
|
3218 |
-
}
|
3219 |
-
} else {
|
3220 |
-
var span = container.find('span');
|
3221 |
-
/* console.log(span); */
|
3222 |
-
span.css('font-size', 'initial');
|
3223 |
-
span.show();
|
3224 |
-
}
|
3225 |
-
|
3226 |
-
}
|
3227 |
-
|
3228 |
-
function sfsi_fixedWidth_fitText(container) {
|
3229 |
-
return;
|
3230 |
-
/* console.log(sfsi_fittext_shouldDisplay); */
|
3231 |
-
if (window.sfsi_fittext_shouldDisplay === true) {
|
3232 |
-
if (jQuery('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val() == "Fixed icon width") {
|
3233 |
-
var all_icon_width = jQuery('.sfsi_responsive_icons .sfsi_icons_container').width();
|
3234 |
-
var total_active_icons = jQuery('.sfsi_responsive_icons .sfsi_icons_container a').filter(function (i, icon) {
|
3235 |
-
return jQuery(icon).css('display') && (jQuery(icon).css('display').toLowerCase() !== "none");
|
3236 |
-
}).length;
|
3237 |
-
var distance_between_icon = jQuery('input[name="sfsi_responsive_icons_settings_margin"]').val()
|
3238 |
-
var container_width = ((all_icon_width - distance_between_icon) / total_active_icons) - 5;
|
3239 |
-
container_width = (container_width - distance_between_icon);
|
3240 |
-
} else {
|
3241 |
-
var container_width = container.width();
|
3242 |
-
}
|
3243 |
-
// var container_img_width = container.find('img').width();
|
3244 |
-
var container_img_width = 70;
|
3245 |
-
// var span=container.find('span').clone();
|
3246 |
-
var span = container.find('span');
|
3247 |
-
// var span_original_width = container.find('span').width();
|
3248 |
-
var span_original_width = container_width - (container_img_width)
|
3249 |
-
span
|
3250 |
-
// .css('display','inline-block')
|
3251 |
-
.css('white-space', 'nowrap')
|
3252 |
-
// .css('width','auto')
|
3253 |
-
;
|
3254 |
-
var span_flatted_width = span.width();
|
3255 |
-
if (span_flatted_width == 0) {
|
3256 |
-
span_flatted_width = span_original_width;
|
3257 |
-
}
|
3258 |
-
span
|
3259 |
-
// .css('display','inline-block')
|
3260 |
-
.css('white-space', 'unset')
|
3261 |
-
// .css('width','auto')
|
3262 |
-
;
|
3263 |
-
var shouldDisplay = undefined === window.sfsi_fittext_shouldDisplay ? true : window.sfsi_fittext_shouldDisplay = true;;
|
3264 |
-
var fontSize = parseInt(span.css('font-size'));
|
3265 |
-
|
3266 |
-
if (6 > fontSize) {
|
3267 |
-
fontSize = 15;
|
3268 |
-
}
|
3269 |
-
|
3270 |
-
var computed_fontSize = (Math.floor((fontSize * span_original_width) / span_flatted_width));
|
3271 |
-
|
3272 |
-
if (computed_fontSize < 8) {
|
3273 |
-
shouldDisplay = false;
|
3274 |
-
window.sfsi_fittext_shouldDisplay = false;
|
3275 |
-
computed_fontSize = 15;
|
3276 |
-
}
|
3277 |
-
span.css('font-size', Math.min(computed_fontSize, 15));
|
3278 |
-
span
|
3279 |
-
// .css('display','inline-block')
|
3280 |
-
.css('white-space', 'nowrap')
|
3281 |
-
// .css('width','auto')
|
3282 |
-
;
|
3283 |
-
// var heightOfResIcons = jQuery('.sfsi_responsive_icon_item_container').height();
|
3284 |
-
|
3285 |
-
// if(heightOfResIcons < 17){
|
3286 |
-
// span.show();
|
3287 |
-
// }else{
|
3288 |
-
// span.hide();
|
3289 |
-
// }
|
3290 |
-
|
3291 |
-
if (shouldDisplay) {
|
3292 |
-
span.show();
|
3293 |
-
} else {
|
3294 |
-
span.hide();
|
3295 |
-
}
|
3296 |
-
}
|
3297 |
-
}
|
3298 |
-
|
3299 |
-
function sfsi_resize_icons_container() {
|
3300 |
-
// resize icon container based on the size of count
|
3301 |
-
sfsi_cloned_icon_list = jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').clone();
|
3302 |
-
sfsi_cloned_icon_list.removeClass('.sfsi_responsive_icon_preview .sfsi_responsive_with_counter_icons').addClass('sfsi_responsive_cloned_list');
|
3303 |
-
sfsi_cloned_icon_list.css('width', '100%');
|
3304 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').parent().append(sfsi_cloned_icon_list);
|
3305 |
-
|
3306 |
-
// sfsi_cloned_icon_list.css({
|
3307 |
-
// position: "absolute",
|
3308 |
-
// left: "-10000px"
|
3309 |
-
// }).appendTo("body");
|
3310 |
-
actual_width = sfsi_cloned_icon_list.width();
|
3311 |
-
count_width = jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').width();
|
3312 |
-
jQuery('.sfsi_responsive_cloned_list').remove();
|
3313 |
-
sfsi_inline_style = jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').attr('style');
|
3314 |
-
// remove_width
|
3315 |
-
sfsi_inline_style = sfsi_inline_style.replace(/width:auto($|!important|)(;|$)/g, '').replace(/width:\s*(-|)\d*\s*(px|%)\s*($|!important|)(;|$)/g, '');
|
3316 |
-
if (!(jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').hasClass('sfsi_responsive_without_counter_icons') && jQuery('.sfsi_icons_container').hasClass('sfsi_icons_container_box_fixed_container'))) {
|
3317 |
-
sfsi_inline_style += "width:" + (actual_width - count_width - 1) + 'px!important;'
|
3318 |
-
} else {
|
3319 |
-
sfsi_inline_style += "width:auto!important;";
|
3320 |
-
}
|
3321 |
-
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').attr('style', sfsi_inline_style);
|
3322 |
-
|
3323 |
-
}
|
3324 |
-
|
3325 |
-
function sfsi_togglbtmsection(show, hide, ref) {
|
3326 |
-
console.log(show,hide);
|
3327 |
-
jQuery(ref).parent("ul").children("li.clckbltglcls").each(function (index, element) {
|
3328 |
-
jQuery(this).children(".radio").css("background-position", "0px 0px");
|
3329 |
-
jQuery(this).children(".styled").attr("checked", "false");
|
3330 |
-
});
|
3331 |
-
jQuery(ref).children(".radio").css("background-position", "0px -41px");
|
3332 |
-
jQuery(ref).children(".styled").attr("checked", "true");
|
3333 |
-
console.log(show,hide);
|
3334 |
-
|
3335 |
-
jQuery("." + show).show();
|
3336 |
-
jQuery("." + show).children(".radiodisplaysection").show();
|
3337 |
-
jQuery("." + hide).hide();
|
3338 |
-
jQuery("." + hide).children(".radiodisplaysection").hide();
|
3339 |
-
}
|
3340 |
-
jQuery(document).ready(function(){
|
3341 |
-
var sfsi_functions_loaded = new CustomEvent('sfsi_functions_loaded',{detail:{"abc":"def"}});
|
3342 |
-
window.dispatchEvent(sfsi_functions_loaded);
|
3343 |
-
});
|
1 |
+
function sfsi_update_index() {
|
2 |
+
var s = 1;
|
3 |
+
SFSI("ul.icn_listing li.custom").each(function () {
|
4 |
+
SFSI(this).children("span.custom-txt").html("Custom " + s), s++;
|
5 |
+
}), cntt = 1, SFSI("div.cm_lnk").each(function () {
|
6 |
+
SFSI(this).find("h2.custom").find("span.sfsiCtxt").html("Custom " + cntt + ":"),
|
7 |
+
cntt++;
|
8 |
+
}), cntt = 1, SFSI("div.custom_m").find("div.custom_section").each(function () {
|
9 |
+
SFSI(this).find("label").html("Custom " + cntt + ":"), cntt++;
|
10 |
+
});
|
11 |
+
}
|
12 |
+
|
13 |
+
function sfsicollapse(s) {
|
14 |
+
var i = !0,
|
15 |
+
e = SFSI(s).closest("div.ui-accordion-content").prev("h3.ui-accordion-header"),
|
16 |
+
t = SFSI(s).closest("div.ui-accordion-content").first();
|
17 |
+
e.toggleClass("ui-corner-all", i).toggleClass("accordion-header-active ui-state-active ui-corner-top", !i).attr("aria-selected", (!i).toString()),
|
18 |
+
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", i).toggleClass("ui-icon-triangle-1-s", !i),
|
19 |
+
t.toggleClass("accordion-content-active", !i), i ? t.slideUp() : t.slideDown();
|
20 |
+
}
|
21 |
+
|
22 |
+
function sfsi_delete_CusIcon(s, i) {
|
23 |
+
beForeLoad();
|
24 |
+
var e = {
|
25 |
+
action: "deleteIcons",
|
26 |
+
icon_name: i.attr("name"),
|
27 |
+
nonce: SFSI(i).parents('.custom').find('input[name="nonce"]').val()
|
28 |
+
};
|
29 |
+
SFSI.ajax({
|
30 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
31 |
+
type: "post",
|
32 |
+
data: e,
|
33 |
+
dataType: "json",
|
34 |
+
success: function (e) {
|
35 |
+
if ("success" == e.res) {
|
36 |
+
showErrorSuc("success", "Saved !", 1);
|
37 |
+
var t = e.last_index + 1;
|
38 |
+
SFSI("#total_cusotm_icons").val(e.total_up), SFSI(s).closest(".custom").remove(),
|
39 |
+
SFSI("li.custom:last-child").addClass("bdr_btm_non"), SFSI(".custom-links").find("div." + i.attr("name")).remove(),
|
40 |
+
SFSI(".custom_m").find("div." + i.attr("name")).remove(), SFSI(".share_icon_order").children("li." + i.attr("name")).remove(),
|
41 |
+
SFSI("ul.sfsi_sample_icons").children("li." + i.attr("name")).remove();
|
42 |
+
|
43 |
+
if (e.total_up == 0) {
|
44 |
+
SFSI(".notice_custom_icons_premium").hide();
|
45 |
+
}
|
46 |
+
var n = e.total_up + 1;
|
47 |
+
4 == e.total_up && SFSI(".icn_listing").append('<li id="c' + t + '" class="custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style=" 0px 0px;"></span><input name="sfsiICON_' + t + '_display" type="checkbox" value="yes" class="styled" style="display:none;" isNew="yes" /></div> <span class="custom-img"><img src="' + SFSI("#plugin_url").val() + 'images/custom.png" id="CImg_' + t + '" alt="error" /> </span> <span class="custom custom-txt">Custom' + n + ' </span> <div class="right_info"> <p><span>It depends:</span> Upload a custom icon if you have other accounts/websites you want to link to.</p><div class="inputWrapper"></div></li>');
|
48 |
+
} else showErrorSuc("error", "Unkown error , please try again", 1);
|
49 |
+
return sfsi_update_index(), update_Sec5Iconorder(), sfsi_update_step1(), sfsi_update_step5(),
|
50 |
+
afterLoad(), "suc";
|
51 |
+
}
|
52 |
+
});
|
53 |
+
}
|
54 |
+
|
55 |
+
function update_Sec5Iconorder() {
|
56 |
+
SFSI("ul.share_icon_order").children("li").each(function () {
|
57 |
+
SFSI(this).attr("data-index", SFSI(this).index() + 1);
|
58 |
+
});
|
59 |
+
}
|
60 |
+
|
61 |
+
function sfsi_section_Display(s, i) {
|
62 |
+
"hide" == i ? (SFSI("." + s + " :input").prop("disabled", !0), SFSI("." + s + " :button").prop("disabled", !0),
|
63 |
+
SFSI("." + s).hide()) : (SFSI("." + s + " :input").removeAttr("disabled", !0), SFSI("." + s + " :button").removeAttr("disabled", !0),
|
64 |
+
SFSI("." + s).show());
|
65 |
+
}
|
66 |
+
|
67 |
+
function sfsi_depened_sections() {
|
68 |
+
if ("sfsi" == SFSI("input[name='sfsi_rss_icons']:checked").val()) {
|
69 |
+
for (i = 0; 16 > i; i++) {
|
70 |
+
var s = i + 1,
|
71 |
+
e = 74 * i;
|
72 |
+
SFSI(".row_" + s + "_2").css("background-position", "-588px -" + e + "px");
|
73 |
+
}
|
74 |
+
var t = SFSI(".icon_img").attr("src");
|
75 |
+
if (t) {
|
76 |
+
if (t.indexOf("subscribe") != -1) {
|
77 |
+
var n = t.replace("subscribe.png", "sf_arow_icn.png");
|
78 |
+
} else {
|
79 |
+
var n = t.replace("email.png", "sf_arow_icn.png");
|
80 |
+
}
|
81 |
+
SFSI(".icon_img").attr("src", n);
|
82 |
+
}
|
83 |
+
} else {
|
84 |
+
if ("email" == SFSI("input[name='sfsi_rss_icons']:checked").val()) {
|
85 |
+
for (SFSI(".row_1_2").css("background-position", "-58px 0"), i = 0; 16 > i; i++) {
|
86 |
+
var s = i + 1,
|
87 |
+
e = 74 * i;
|
88 |
+
SFSI(".row_" + s + "_2").css("background-position", "-58px -" + e + "px");
|
89 |
+
}
|
90 |
+
var t = SFSI(".icon_img").attr("src");
|
91 |
+
if (t) {
|
92 |
+
if (t.indexOf("sf_arow_icn") != -1) {
|
93 |
+
var n = t.replace("sf_arow_icn.png", "email.png");
|
94 |
+
} else {
|
95 |
+
var n = t.replace("subscribe.png", "email.png");
|
96 |
+
}
|
97 |
+
SFSI(".icon_img").attr("src", n);
|
98 |
+
}
|
99 |
+
} else {
|
100 |
+
for (SFSI(".row_1_2").css("background-position", "-649px 0"), i = 0; 16 > i; i++) {
|
101 |
+
var s = i + 1,
|
102 |
+
e = 74 * i;
|
103 |
+
SFSI(".row_" + s + "_2").css("background-position", "-649px -" + e + "px");
|
104 |
+
}
|
105 |
+
var t = SFSI(".icon_img").attr("src");
|
106 |
+
if (t) {
|
107 |
+
if (t.indexOf("email") != -1) {
|
108 |
+
var n = t.replace("email.png", "subscribe.png");
|
109 |
+
} else {
|
110 |
+
var n = t.replace("sf_arow_icn.png", "subscribe.png");
|
111 |
+
}
|
112 |
+
SFSI(".icon_img").attr("src", n);
|
113 |
+
}
|
114 |
+
}
|
115 |
+
}
|
116 |
+
SFSI("input[name='sfsi_rss_display']").prop("checked") ? sfsi_section_Display("rss_section", "show") : sfsi_section_Display("rss_section", "hide"),
|
117 |
+
SFSI("input[name='sfsi_email_display']").prop("checked") ? sfsi_section_Display("email_section", "show") : sfsi_section_Display("email_section", "hide"),
|
118 |
+
SFSI("input[name='sfsi_facebook_display']").prop("checked") ? sfsi_section_Display("facebook_section", "show") : sfsi_section_Display("facebook_section", "hide"),
|
119 |
+
SFSI("input[name='sfsi_twitter_display']").prop("checked") ? sfsi_section_Display("twitter_section", "show") : sfsi_section_Display("twitter_section", "hide"),
|
120 |
+
SFSI("input[name='sfsi_youtube_display']").prop("checked") ? sfsi_section_Display("youtube_section", "show") : sfsi_section_Display("youtube_section", "hide"),
|
121 |
+
SFSI("input[name='sfsi_pinterest_display']").prop("checked") ? sfsi_section_Display("pinterest_section", "show") : sfsi_section_Display("pinterest_section", "hide"),
|
122 |
+
SFSI("input[name='sfsi_telegram_display']").prop("checked") ? sfsi_section_Display("telegram_section", "show") : sfsi_section_Display("telegram_section", "hide"),
|
123 |
+
SFSI("input[name='sfsi_vk_display']").prop("checked") ? sfsi_section_Display("vk_section", "show") : sfsi_section_Display("vk_section", "hide"),
|
124 |
+
SFSI("input[name='sfsi_ok_display']").prop("checked") ? sfsi_section_Display("ok_section", "show") : sfsi_section_Display("ok_section", "hide"),
|
125 |
+
SFSI("input[name='sfsi_wechat_display']").prop("checked") ? sfsi_section_Display("wechat_section", "show") : sfsi_section_Display("wechat_section", "hide"),
|
126 |
+
SFSI("input[name='sfsi_weibo_display']").prop("checked") ? sfsi_section_Display("weibo_section", "show") : sfsi_section_Display("weibo_section", "hide"),
|
127 |
+
SFSI("input[name='sfsi_instagram_display']").prop("checked") ? sfsi_section_Display("instagram_section", "show") : sfsi_section_Display("instagram_section", "hide"),
|
128 |
+
SFSI("input[name='sfsi_linkedin_display']").prop("checked") ? sfsi_section_Display("linkedin_section", "show") : sfsi_section_Display("linkedin_section", "hide"),
|
129 |
+
SFSI("input[element-type='cusotm-icon']").prop("checked") ? sfsi_section_Display("custom_section", "show") : sfsi_section_Display("custom_section", "hide");
|
130 |
+
}
|
131 |
+
|
132 |
+
function CustomIConSectionsUpdate() {
|
133 |
+
sfsi_section_Display("counter".ele, show);
|
134 |
+
}
|
135 |
+
|
136 |
+
// Upload Custom Skin {Monad}
|
137 |
+
function sfsi_customskin_upload(s, ref, nonce) {
|
138 |
+
var ttl = jQuery(ref).attr("title");
|
139 |
+
var i = s,
|
140 |
+
e = {
|
141 |
+
action: "UploadSkins",
|
142 |
+
custom_imgurl: i,
|
143 |
+
nonce: nonce
|
144 |
+
};
|
145 |
+
SFSI.ajax({
|
146 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
147 |
+
type: "post",
|
148 |
+
data: e,
|
149 |
+
success: function (msg) {
|
150 |
+
if (msg.res = "success") {
|
151 |
+
var arr = s.split('=');
|
152 |
+
jQuery(ref).prev('.imgskin').attr('src', arr[1]);
|
153 |
+
jQuery(ref).prev('.imgskin').css("display", "block");
|
154 |
+
jQuery(ref).text("Update");
|
155 |
+
jQuery(ref).next('.dlt_btn').css("display", "block");
|
156 |
+
}
|
157 |
+
}
|
158 |
+
});
|
159 |
+
}
|
160 |
+
|
161 |
+
// Delete Custom Skin {Monad}
|
162 |
+
function deleteskin_icon(s) {
|
163 |
+
var iconname = jQuery(s).attr("title");
|
164 |
+
var nonce = jQuery(s).attr("data-nonce");
|
165 |
+
var i = iconname,
|
166 |
+
e = {
|
167 |
+
action: "DeleteSkin",
|
168 |
+
iconname: i,
|
169 |
+
nonce: nonce
|
170 |
+
};
|
171 |
+
console.log('delete sin icon', i, iconname, nonce);
|
172 |
+
SFSI.ajax({
|
173 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
174 |
+
type: "post",
|
175 |
+
data: e,
|
176 |
+
dataType: "json",
|
177 |
+
success: function (msg) {
|
178 |
+
console.log(s, e, msg);
|
179 |
+
|
180 |
+
if (msg.res === "success") {
|
181 |
+
SFSI(s).prev("a").text("Upload");
|
182 |
+
SFSI(s).prev("a").prev("img").attr("src", '');
|
183 |
+
SFSI(s).prev("a").prev("img").css("display", "none");
|
184 |
+
SFSI(s).css("display", "none");
|
185 |
+
} else {
|
186 |
+
alert("Whoops! something went wrong.")
|
187 |
+
}
|
188 |
+
}
|
189 |
+
});
|
190 |
+
}
|
191 |
+
|
192 |
+
// Save Custom Skin {Monad}
|
193 |
+
function SFSI_done(nonce) {
|
194 |
+
e = {
|
195 |
+
action: "Iamdone",
|
196 |
+
nonce: nonce
|
197 |
+
};
|
198 |
+
|
199 |
+
SFSI.ajax({
|
200 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
201 |
+
type: "post",
|
202 |
+
data: e,
|
203 |
+
success: function (msg) {
|
204 |
+
if (msg.res === "success") {
|
205 |
+
|
206 |
+
|
207 |
+
jQuery("li.cstomskins_upload").children(".icns_tab_3").html(msg);
|
208 |
+
SFSI("input[name='sfsi_rss_display']").prop("checked") ? sfsi_section_Display("rss_section", "show") : sfsi_section_Display("rss_section", "hide"), SFSI("input[name='sfsi_email_display']").prop("checked") ? sfsi_section_Display("email_section", "show") : sfsi_section_Display("email_section", "hide"), SFSI("input[name='sfsi_facebook_display']").prop("checked") ? sfsi_section_Display("facebook_section", "show") : sfsi_section_Display("facebook_section", "hide"), SFSI("input[name='sfsi_twitter_display']").prop("checked") ? sfsi_section_Display("twitter_section", "show") : sfsi_section_Display("twitter_section", "hide"), SFSI("input[name='sfsi_youtube_display']").prop("checked") ? sfsi_section_Display("youtube_section", "show") : sfsi_section_Display("youtube_section", "hide"), SFSI("input[name='sfsi_pinterest_display']").prop("checked") ? sfsi_section_Display("pinterest_section", "show") : sfsi_section_Display("pinterest_section", "hide"), SFSI("input[name='sfsi_instagram_display']").prop("checked") ? sfsi_section_Display("instagram_section", "show") : sfsi_section_Display("instagram_section", "hide"), SFSI("input[name='sfsi_linkedin_display']").prop("checked") ? sfsi_section_Display("linkedin_section", "show") : sfsi_section_Display("linkedin_section", "hide"), SFSI("input[element-type='cusotm-icon']").prop("checked") ? sfsi_section_Display("custom_section", "show") : sfsi_section_Display("custom_section", "hide");
|
209 |
+
SFSI(".cstmskins-overlay").hide("slow");
|
210 |
+
sfsi_update_step3() && sfsicollapse(this);
|
211 |
+
}
|
212 |
+
}
|
213 |
+
});
|
214 |
+
}
|
215 |
+
|
216 |
+
// Upload Custom Icons {Monad}
|
217 |
+
function sfsi_newcustomicon_upload(s, nonce, nonce2) {
|
218 |
+
var i = s,
|
219 |
+
e = {
|
220 |
+
action: "UploadIcons",
|
221 |
+
custom_imgurl: i,
|
222 |
+
nonce: nonce
|
223 |
+
};
|
224 |
+
SFSI.ajax({
|
225 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
226 |
+
type: "post",
|
227 |
+
data: e,
|
228 |
+
dataType: "json",
|
229 |
+
async: !0,
|
230 |
+
success: function (s) {
|
231 |
+
if (s.res == 'success') {
|
232 |
+
afterIconSuccess(s, nonce2);
|
233 |
+
} else {
|
234 |
+
SFSI(".upload-overlay").hide("slow");
|
235 |
+
SFSI(".uperror").html(s.res);
|
236 |
+
showErrorSuc("Error", "Some Error Occured During Upload Custom Icon", 1)
|
237 |
+
}
|
238 |
+
}
|
239 |
+
});
|
240 |
+
}
|
241 |
+
|
242 |
+
function sfsi_update_step1() {
|
243 |
+
var nonce = SFSI("#sfsi_save1").attr("data-nonce");
|
244 |
+
global_error = 0, beForeLoad(), sfsi_depened_sections();
|
245 |
+
var s = !1,
|
246 |
+
i = SFSI("input[name='sfsi_rss_display']:checked").val(),
|
247 |
+
e = SFSI("input[name='sfsi_email_display']:checked").val(),
|
248 |
+
t = SFSI("input[name='sfsi_facebook_display']:checked").val(),
|
249 |
+
n = SFSI("input[name='sfsi_twitter_display']:checked").val(),
|
250 |
+
r = SFSI("input[name='sfsi_youtube_display']:checked").val(),
|
251 |
+
c = SFSI("input[name='sfsi_pinterest_display']:checked").val(),
|
252 |
+
p = SFSI("input[name='sfsi_linkedin_display']:checked").val(),
|
253 |
+
tg = SFSI("input[name='sfsi_telegram_display']:checked").val(),
|
254 |
+
vk = SFSI("input[name='sfsi_vk_display']:checked").val(),
|
255 |
+
ok = SFSI("input[name='sfsi_ok_display']:checked").val(),
|
256 |
+
wc = SFSI("input[name='sfsi_wechat_display']:checked").val(),
|
257 |
+
wb = SFSI("input[name='sfsi_weibo_display']:checked").val(),
|
258 |
+
_ = SFSI("input[name='sfsi_instagram_display']:checked").val(),
|
259 |
+
l = SFSI("input[name='sfsi_custom1_display']:checked").val(),
|
260 |
+
S = SFSI("input[name='sfsi_custom2_display']:checked").val(),
|
261 |
+
u = SFSI("input[name='sfsi_custom3_display']:checked").val(),
|
262 |
+
f = SFSI("input[name='sfsi_custom4_display']:checked").val(),
|
263 |
+
d = SFSI("input[name='sfsi_custom5_display']:checked").val(),
|
264 |
+
I = {
|
265 |
+
action: "updateSrcn1",
|
266 |
+
sfsi_rss_display: i,
|
267 |
+
sfsi_email_display: e,
|
268 |
+
sfsi_facebook_display: t,
|
269 |
+
sfsi_twitter_display: n,
|
270 |
+
sfsi_youtube_display: r,
|
271 |
+
sfsi_pinterest_display: c,
|
272 |
+
sfsi_linkedin_display: p,
|
273 |
+
sfsi_telegram_display: tg,
|
274 |
+
sfsi_vk_display: vk,
|
275 |
+
sfsi_ok_display: ok,
|
276 |
+
sfsi_wechat_display: wc,
|
277 |
+
sfsi_weibo_display: wb,
|
278 |
+
sfsi_instagram_display: _,
|
279 |
+
sfsi_custom1_display: l,
|
280 |
+
sfsi_custom2_display: S,
|
281 |
+
sfsi_custom3_display: u,
|
282 |
+
sfsi_custom4_display: f,
|
283 |
+
sfsi_custom5_display: d,
|
284 |
+
nonce: nonce
|
285 |
+
};
|
286 |
+
SFSI.ajax({
|
287 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
288 |
+
type: "post",
|
289 |
+
data: I,
|
290 |
+
async: !0,
|
291 |
+
dataType: "json",
|
292 |
+
success: function (i) {
|
293 |
+
if (i == "wrong_nonce") {
|
294 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 1);
|
295 |
+
s = !1;
|
296 |
+
afterLoad();
|
297 |
+
} else {
|
298 |
+
"success" == i ? (showErrorSuc("success", "Saved !", 1), sfsicollapse("#sfsi_save1"),
|
299 |
+
sfsi_make_popBox()) : (global_error = 1, showErrorSuc("error", "Unkown error , please try again", 1),
|
300 |
+
s = !1), afterLoad();
|
301 |
+
}
|
302 |
+
}
|
303 |
+
});
|
304 |
+
}
|
305 |
+
|
306 |
+
function sfsi_update_step2() {
|
307 |
+
|
308 |
+
var nonce = SFSI("#sfsi_save2").attr("data-nonce");
|
309 |
+
var s = sfsi_validationStep2();
|
310 |
+
if (!s) return global_error = 1, !1;
|
311 |
+
beForeLoad();
|
312 |
+
var i = 1 == SFSI("input[name='sfsi_rss_url']").prop("disabled") ? "" : SFSI("input[name='sfsi_rss_url']").val(),
|
313 |
+
e = 1 == SFSI("input[name='sfsi_rss_icons']").prop("disabled") ? "" : SFSI("input[name='sfsi_rss_icons']:checked").val(),
|
314 |
+
|
315 |
+
t = 1 == SFSI("input[name='sfsi_facebookPage_option']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebookPage_option']:checked").val(),
|
316 |
+
n = 1 == SFSI("input[name='sfsi_facebookLike_option']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebookLike_option']:checked").val(),
|
317 |
+
o = 1 == SFSI("input[name='sfsi_facebookShare_option']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebookShare_option']:checked").val(),
|
318 |
+
a = SFSI("input[name='sfsi_facebookPage_url']").val(),
|
319 |
+
r = 1 == SFSI("input[name='sfsi_twitter_followme']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_followme']:checked").val(),
|
320 |
+
c = 1 == SFSI("input[name='sfsi_twitter_followUserName']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_followUserName']").val(),
|
321 |
+
p = 1 == SFSI("input[name='sfsi_twitter_aboutPage']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_aboutPage']:checked").val(),
|
322 |
+
_ = 1 == SFSI("input[name='sfsi_twitter_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_page']:checked").val(),
|
323 |
+
l = SFSI("input[name='sfsi_twitter_pageURL']").val(),
|
324 |
+
S = SFSI("textarea[name='sfsi_twitter_aboutPageText']").val(),
|
325 |
+
m = 1 == SFSI("input[name='sfsi_youtube_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_page']:checked").val(),
|
326 |
+
F = 1 == SFSI("input[name='sfsi_youtube_pageUrl']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_pageUrl']").val(),
|
327 |
+
h = 1 == SFSI("input[name='sfsi_youtube_follow']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_follow']:checked").val(),
|
328 |
+
cls = SFSI("input[name='sfsi_youtubeusernameorid']:checked").val(),
|
329 |
+
v = SFSI("input[name='sfsi_ytube_user']").val(),
|
330 |
+
vchid = SFSI("input[name='sfsi_ytube_chnlid']").val(),
|
331 |
+
g = 1 == SFSI("input[name='sfsi_pinterest_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_page']:checked").val(),
|
332 |
+
k = 1 == SFSI("input[name='sfsi_pinterest_pageUrl']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_pageUrl']").val(),
|
333 |
+
y = 1 == SFSI("input[name='sfsi_pinterest_pingBlog']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_pingBlog']:checked").val(),
|
334 |
+
b = 1 == SFSI("input[name='sfsi_instagram_pageUrl']").prop("disabled") ? "" : SFSI("input[name='sfsi_instagram_pageUrl']").val(),
|
335 |
+
w = 1 == SFSI("input[name='sfsi_linkedin_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedin_page']:checked").val(),
|
336 |
+
x = 1 == SFSI("input[name='sfsi_linkedin_pageURL']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedin_pageURL']").val(),
|
337 |
+
C = 1 == SFSI("input[name='sfsi_linkedin_follow']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedin_follow']:checked").val(),
|
338 |
+
D = SFSI("input[name='sfsi_linkedin_followCompany']").val(),
|
339 |
+
U = 1 == SFSI("input[name='sfsi_linkedin_SharePage']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedin_SharePage']:checked").val(),
|
340 |
+
O = SFSI("input[name='sfsi_linkedin_recommendBusines']:checked").val(),
|
341 |
+
T = SFSI("input[name='sfsi_linkedin_recommendProductId']").val(),
|
342 |
+
j = SFSI("input[name='sfsi_linkedin_recommendCompany']").val(),
|
343 |
+
tp = 1 == SFSI("input[name='sfsi_telegram_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_telegram_page']:checked").val(),
|
344 |
+
tpu = SFSI("input[name='sfsi_telegram_pageURL']").val(),
|
345 |
+
tm = SFSI("input[name='sfsi_telegram_message']").val(),
|
346 |
+
tmn = SFSI("input[name='sfsi_telegram_username']").val(),
|
347 |
+
wp = 1 == SFSI("input[name='sfsi_weibo_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_weibo_page']:checked").val(),
|
348 |
+
wpu = SFSI("input[name='sfsi_weibo_pageURL']").val(),
|
349 |
+
vp = 1 == SFSI("input[name='sfsi_vk_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_vk_page']:checked").val(),
|
350 |
+
vpu = SFSI("input[name='sfsi_vk_pageURL']").val(),
|
351 |
+
op = 1 == SFSI("input[name='sfsi_ok_page']").prop("disabled") ? "" : SFSI("input[name='sfsi_ok_page']:checked").val(),
|
352 |
+
opu = SFSI("input[name='sfsi_ok_pageURL']").val(),
|
353 |
+
P = {};
|
354 |
+
SFSI("input[name='sfsi_CustomIcon_links[]']").each(function () {
|
355 |
+
P[SFSI(this).attr("file-id")] = this.value;
|
356 |
+
});
|
357 |
+
var M = {
|
358 |
+
action: "updateSrcn2",
|
359 |
+
sfsi_rss_url: i,
|
360 |
+
sfsi_rss_icons: e,
|
361 |
+
sfsi_facebookPage_option: t,
|
362 |
+
sfsi_facebookLike_option: n,
|
363 |
+
sfsi_facebookShare_option: o,
|
364 |
+
sfsi_facebookPage_url: a,
|
365 |
+
sfsi_twitter_followme: r,
|
366 |
+
sfsi_twitter_followUserName: c,
|
367 |
+
sfsi_twitter_aboutPage: p,
|
368 |
+
sfsi_twitter_page: _,
|
369 |
+
sfsi_twitter_pageURL: l,
|
370 |
+
sfsi_twitter_aboutPageText: S,
|
371 |
+
sfsi_youtube_page: m,
|
372 |
+
sfsi_youtube_pageUrl: F,
|
373 |
+
sfsi_youtube_follow: h,
|
374 |
+
sfsi_youtubeusernameorid: cls,
|
375 |
+
sfsi_ytube_user: v,
|
376 |
+
sfsi_ytube_chnlid: vchid,
|
377 |
+
sfsi_pinterest_page: g,
|
378 |
+
sfsi_pinterest_pageUrl: k,
|
379 |
+
sfsi_instagram_pageUrl: b,
|
380 |
+
sfsi_pinterest_pingBlog: y,
|
381 |
+
sfsi_linkedin_page: w,
|
382 |
+
sfsi_linkedin_pageURL: x,
|
383 |
+
sfsi_linkedin_follow: C,
|
384 |
+
sfsi_linkedin_followCompany: D,
|
385 |
+
sfsi_linkedin_SharePage: U,
|
386 |
+
sfsi_linkedin_recommendBusines: O,
|
387 |
+
sfsi_linkedin_recommendCompany: j,
|
388 |
+
sfsi_linkedin_recommendProductId: T,
|
389 |
+
sfsi_custom_links: P,
|
390 |
+
sfsi_telegram_page: tp,
|
391 |
+
sfsi_telegram_pageURL: tpu,
|
392 |
+
sfsi_telegram_message: tm,
|
393 |
+
sfsi_telegram_username: tmn,
|
394 |
+
sfsi_weibo_page: wp,
|
395 |
+
sfsi_weibo_pageURL: wpu,
|
396 |
+
sfsi_vk_page: vp,
|
397 |
+
sfsi_vk_pageURL: vpu,
|
398 |
+
sfsi_ok_page: op,
|
399 |
+
sfsi_ok_pageURL: opu,
|
400 |
+
nonce: nonce
|
401 |
+
};
|
402 |
+
SFSI.ajax({
|
403 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
404 |
+
type: "post",
|
405 |
+
data: M,
|
406 |
+
async: !0,
|
407 |
+
dataType: "json",
|
408 |
+
success: function (s) {
|
409 |
+
if (s == "wrong_nonce") {
|
410 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 2);
|
411 |
+
return_value = !1;
|
412 |
+
afterLoad();
|
413 |
+
} else {
|
414 |
+
"success" == s ? (showErrorSuc("success", "Saved !", 2), sfsicollapse("#sfsi_save2"),
|
415 |
+
sfsi_depened_sections()) : (global_error = 1, showErrorSuc("error", "Unkown error , please try again", 2),
|
416 |
+
return_value = !1), afterLoad();
|
417 |
+
}
|
418 |
+
}
|
419 |
+
});
|
420 |
+
}
|
421 |
+
|
422 |
+
function sfsi_update_step3() {
|
423 |
+
var nonce = SFSI("#sfsi_save3").attr("data-nonce");
|
424 |
+
var s = sfsi_validationStep3();
|
425 |
+
if (!s) return global_error = 1, !1;
|
426 |
+
beForeLoad();
|
427 |
+
var i = SFSI("input[name='sfsi_actvite_theme']:checked").val(),
|
428 |
+
e = SFSI("input[name='sfsi_mouseOver']:checked").val(),
|
429 |
+
t = SFSI("input[name='sfsi_shuffle_icons']:checked").val(),
|
430 |
+
n = SFSI("input[name='sfsi_shuffle_Firstload']:checked").val(),
|
431 |
+
o = SFSI("input[name='sfsi_same_icons_mouseOver_effect']:checked").val(),
|
432 |
+
a = SFSI("input[name='sfsi_shuffle_interval']:checked").val(),
|
433 |
+
r = SFSI("input[name='sfsi_shuffle_intervalTime']").val(),
|
434 |
+
c = SFSI("input[name='sfsi_specialIcon_animation']:checked").val(),
|
435 |
+
p = SFSI("input[name='sfsi_specialIcon_MouseOver']:checked").val(),
|
436 |
+
_ = SFSI("input[name='sfsi_specialIcon_Firstload']:checked").val(),
|
437 |
+
l = SFSI("#sfsi_specialIcon_Firstload_Icons option:selected").val(),
|
438 |
+
S = SFSI("input[name='sfsi_specialIcon_interval']:checked").val(),
|
439 |
+
u = SFSI("input[name='sfsi_specialIcon_intervalTime']").val(),
|
440 |
+
f = SFSI("#sfsi_specialIcon_intervalIcons option:selected").val();
|
441 |
+
|
442 |
+
var mouseover_effect_type = 'same_icons'; //SFSI("input[name='sfsi_mouseOver_effect_type']:checked").val();
|
443 |
+
|
444 |
+
d = {
|
445 |
+
action: "updateSrcn3",
|
446 |
+
sfsi_actvite_theme: i,
|
447 |
+
sfsi_mouseOver: e,
|
448 |
+
sfsi_shuffle_icons: t,
|
449 |
+
sfsi_shuffle_Firstload: n,
|
450 |
+
sfsi_mouseOver_effect: o,
|
451 |
+
sfsi_mouseover_effect_type: mouseover_effect_type,
|
452 |
+
sfsi_shuffle_interval: a,
|
453 |
+
sfsi_shuffle_intervalTime: r,
|
454 |
+
sfsi_specialIcon_animation: c,
|
455 |
+
sfsi_specialIcon_MouseOver: p,
|
456 |
+
sfsi_specialIcon_Firstload: _,
|
457 |
+
sfsi_specialIcon_Firstload_Icons: l,
|
458 |
+
sfsi_specialIcon_interval: S,
|
459 |
+
sfsi_specialIcon_intervalTime: u,
|
460 |
+
sfsi_specialIcon_intervalIcons: f,
|
461 |
+
nonce: nonce
|
462 |
+
};
|
463 |
+
SFSI.ajax({
|
464 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
465 |
+
type: "post",
|
466 |
+
data: d,
|
467 |
+
async: !0,
|
468 |
+
dataType: "json",
|
469 |
+
success: function (s) {
|
470 |
+
if (s == "wrong_nonce") {
|
471 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 3);
|
472 |
+
return_value = !1;
|
473 |
+
afterLoad();
|
474 |
+
} else {
|
475 |
+
"success" == s ? (showErrorSuc("success", "Saved !", 3), sfsicollapse("#sfsi_save3")) : (showErrorSuc("error", "Unkown error , please try again", 3),
|
476 |
+
return_value = !1), afterLoad();
|
477 |
+
}
|
478 |
+
}
|
479 |
+
});
|
480 |
+
}
|
481 |
+
|
482 |
+
function sfsi_show_counts() {
|
483 |
+
"yes" == SFSI("input[name='sfsi_display_counts']:checked").val() ? (SFSI(".count_sections").slideDown(),
|
484 |
+
sfsi_showPreviewCounts()) : (SFSI(".count_sections").slideUp(), sfsi_showPreviewCounts());
|
485 |
+
}
|
486 |
+
|
487 |
+
function sfsi_showPreviewCounts() {
|
488 |
+
var s = 0;
|
489 |
+
1 == SFSI("input[name='sfsi_rss_countsDisplay']").prop("checked") ? (SFSI("#sfsi_rss_countsDisplay").css("opacity", 1), s = 1) : SFSI("#sfsi_rss_countsDisplay").css("opacity", 0),
|
490 |
+
1 == SFSI("input[name='sfsi_email_countsDisplay']").prop("checked") ? (SFSI("#sfsi_email_countsDisplay").css("opacity", 1),
|
491 |
+
s = 1) : SFSI("#sfsi_email_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_facebook_countsDisplay']").prop("checked") ? (SFSI("#sfsi_facebook_countsDisplay").css("opacity", 1),
|
492 |
+
s = 1) : SFSI("#sfsi_facebook_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_twitter_countsDisplay']").prop("checked") ? (SFSI("#sfsi_twitter_countsDisplay").css("opacity", 1),
|
493 |
+
s = 1) : SFSI("#sfsi_twitter_countsDisplay").css("opacity", 0),
|
494 |
+
1 == SFSI("input[name='sfsi_linkedIn_countsDisplay']").prop("checked") ? (SFSI("#sfsi_linkedIn_countsDisplay").css("opacity", 1), s = 1) : SFSI("#sfsi_linkedIn_countsDisplay").css("opacity", 0),
|
495 |
+
1 == SFSI("input[name='sfsi_youtube_countsDisplay']").prop("checked") ? (SFSI("#sfsi_youtube_countsDisplay").css("opacity", 1),
|
496 |
+
s = 1) : SFSI("#sfsi_youtube_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_pinterest_countsDisplay']").prop("checked") ? (SFSI("#sfsi_pinterest_countsDisplay").css("opacity", 1),
|
497 |
+
s = 1) : SFSI("#sfsi_pinterest_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_instagram_countsDisplay']").prop("checked") ? (SFSI("#sfsi_instagram_countsDisplay").css("opacity", 1),
|
498 |
+
s = 1) : SFSI("#sfsi_instagram_countsDisplay").css("opacity", 0),
|
499 |
+
1 == SFSI("input[name='sfsi_telegram_countsDisplay']").prop("checked") ? (SFSI("#sfsi_telegram_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_telegram_countsDisplay").css("opacity", 0),
|
500 |
+
1 == SFSI("input[name='sfsi_vk_countsDisplay']").prop("checked") ? (SFSI("#sfsi_vk_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_vk_countsDisplay").css("opacity", 0),
|
501 |
+
1 == SFSI("input[name='sfsi_ok_countsDisplay']").prop("checked") ? (SFSI("#sfsi_ok_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_ok_countsDisplay").css("opacity", 0),
|
502 |
+
1 == SFSI("input[name='sfsi_weibo_countsDisplay']").prop("checked") ? (SFSI("#sfsi_weibo_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_weibo_countsDisplay").css("opacity", 0),
|
503 |
+
1 == SFSI("input[name='sfsi_wechat_countsDisplay']").prop("checked") ? (SFSI("#sfsi_wechat_countsDisplay").css("opacity", 0), s = 1) : SFSI("#sfsi_wechat_countsDisplay").css("opacity", 0),
|
504 |
+
|
505 |
+
0 == s || "no" == SFSI("input[name='sfsi_display_counts']:checked").val() ? SFSI(".sfsi_Cdisplay").hide() : SFSI(".sfsi_Cdisplay").show();
|
506 |
+
}
|
507 |
+
|
508 |
+
function sfsi_show_OnpostsDisplay() {
|
509 |
+
//"yes" == SFSI("input[name='sfsi_show_Onposts']:checked").val() ? SFSI(".PostsSettings_section").slideDown() :SFSI(".PostsSettings_section").slideUp();
|
510 |
+
}
|
511 |
+
|
512 |
+
function sfsi_update_step4() {
|
513 |
+
var nonce = SFSI("#sfsi_save4").attr("data-nonce");
|
514 |
+
var s = !1,
|
515 |
+
i = sfsi_validationStep4();
|
516 |
+
if (!i) return global_error = 1, !1;
|
517 |
+
beForeLoad();
|
518 |
+
var e = SFSI("input[name='sfsi_display_counts']:checked").val(),
|
519 |
+
t = 1 == SFSI("input[name='sfsi_email_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_email_countsDisplay']:checked").val(),
|
520 |
+
n = 1 == SFSI("input[name='sfsi_email_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_email_countsFrom']:checked").val(),
|
521 |
+
o = SFSI("input[name='sfsi_email_manualCounts']").val(),
|
522 |
+
r = 1 == SFSI("input[name='sfsi_rss_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_rss_countsDisplay']:checked").val(),
|
523 |
+
c = SFSI("input[name='sfsi_rss_manualCounts']").val(),
|
524 |
+
p = 1 == SFSI("input[name='sfsi_facebook_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebook_countsDisplay']:checked").val(),
|
525 |
+
_ = 1 == SFSI("input[name='sfsi_facebook_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebook_countsFrom']:checked").val(),
|
526 |
+
mp = SFSI("input[name='sfsi_facebook_mypageCounts']").val(),
|
527 |
+
l = SFSI("input[name='sfsi_facebook_manualCounts']").val(),
|
528 |
+
S = 1 == SFSI("input[name='sfsi_twitter_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_countsDisplay']:checked").val(),
|
529 |
+
u = 1 == SFSI("input[name='sfsi_twitter_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_countsFrom']:checked").val(),
|
530 |
+
f = SFSI("input[name='sfsi_twitter_manualCounts']").val(),
|
531 |
+
d = SFSI("input[name='tw_consumer_key']").val(),
|
532 |
+
I = SFSI("input[name='tw_consumer_secret']").val(),
|
533 |
+
m = SFSI("input[name='tw_oauth_access_token']").val(),
|
534 |
+
F = SFSI("input[name='tw_oauth_access_token_secret']").val(),
|
535 |
+
k = 1 == SFSI("input[name='sfsi_linkedIn_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val(),
|
536 |
+
y = SFSI("input[name='sfsi_linkedIn_manualCounts']").val(),
|
537 |
+
b = SFSI("input[name='ln_company']").val(),
|
538 |
+
w = SFSI("input[name='ln_api_key']").val(),
|
539 |
+
x = SFSI("input[name='ln_secret_key']").val(),
|
540 |
+
C = SFSI("input[name='ln_oAuth_user_token']").val(),
|
541 |
+
D = 1 == SFSI("input[name='sfsi_linkedIn_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedIn_countsDisplay']:checked").val(),
|
542 |
+
k = 1 == SFSI("input[name='sfsi_linkedIn_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val(),
|
543 |
+
y = SFSI("input[name='sfsi_linkedIn_manualCounts']").val(),
|
544 |
+
U = 1 == SFSI("input[name='sfsi_youtube_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_countsDisplay']:checked").val(),
|
545 |
+
O = 1 == SFSI("input[name='sfsi_youtube_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_countsFrom']:checked").val(),
|
546 |
+
T = SFSI("input[name='sfsi_youtube_manualCounts']").val(),
|
547 |
+
j = SFSI("input[name='sfsi_youtube_user']").val(),
|
548 |
+
P = 1 == SFSI("input[name='sfsi_pinterest_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_countsDisplay']:checked").val(),
|
549 |
+
M = 1 == SFSI("input[name='sfsi_pinterest_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_countsFrom']:checked").val(),
|
550 |
+
L = SFSI("input[name='sfsi_pinterest_manualCounts']").val(),
|
551 |
+
B = SFSI("input[name='sfsi_pinterest_user']").val(),
|
552 |
+
E = SFSI("input[name='sfsi_pinterest_board']").val(),
|
553 |
+
z = 1 == SFSI("input[name='sfsi_instagram_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_instagram_countsDisplay']:checked").val(),
|
554 |
+
A = 1 == SFSI("input[name='sfsi_instagram_countsFrom']").prop("disabled") ? "" : SFSI("input[name='sfsi_instagram_countsFrom']:checked").val(),
|
555 |
+
N = SFSI("input[name='sfsi_instagram_manualCounts']").val(),
|
556 |
+
H = SFSI("input[name='sfsi_instagram_User']").val(),
|
557 |
+
ha = SFSI("input[name='sfsi_instagram_clientid']").val(),
|
558 |
+
ia = SFSI("input[name='sfsi_instagram_appurl']").val(),
|
559 |
+
ja = SFSI("input[name='sfsi_instagram_token']").val(),
|
560 |
+
|
561 |
+
tc = 1 == SFSI("input[name='sfsi_telegram_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_telegram_countsDisplay']:checked").val(),
|
562 |
+
tm = SFSI("input[name='sfsi_telegram_manualCounts']").val(),
|
563 |
+
|
564 |
+
vc = 1 == SFSI("input[name='sfsi_vk_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_vk_countsDisplay']:checked").val(),
|
565 |
+
vm = SFSI("input[name='sfsi_vk_manualCounts']").val(),
|
566 |
+
|
567 |
+
|
568 |
+
oc = 1 == SFSI("input[name='sfsi_ok_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_ok_countsDisplay']:checked").val(),
|
569 |
+
om = SFSI("input[name='sfsi_ok_manualCounts']").val(),
|
570 |
+
|
571 |
+
|
572 |
+
wc = 1 == SFSI("input[name='sfsi_weibo_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_weibo_countsDisplay']:checked").val(),
|
573 |
+
wm = SFSI("input[name='sfsi_weibo_manualCounts']").val(),
|
574 |
+
|
575 |
+
wcc = 1 == SFSI("input[name='sfsi_wechat_countsDisplay']").prop("disabled") ? "" : SFSI("input[name='sfsi_wechat_countsDisplay']:checked").val(),
|
576 |
+
wcm = SFSI("input[name='sfsi_wechat_manualCounts']").val(),
|
577 |
+
$ = {
|
578 |
+
action: "updateSrcn4",
|
579 |
+
sfsi_display_counts: e,
|
580 |
+
sfsi_email_countsDisplay: t,
|
581 |
+
sfsi_email_countsFrom: n,
|
582 |
+
sfsi_email_manualCounts: o,
|
583 |
+
sfsi_rss_countsDisplay: r,
|
584 |
+
sfsi_rss_manualCounts: c,
|
585 |
+
sfsi_facebook_countsDisplay: p,
|
586 |
+
sfsi_facebook_countsFrom: _,
|
587 |
+
sfsi_facebook_mypageCounts: mp,
|
588 |
+
sfsi_facebook_manualCounts: l,
|
589 |
+
sfsi_twitter_countsDisplay: S,
|
590 |
+
sfsi_twitter_countsFrom: u,
|
591 |
+
sfsi_twitter_manualCounts: f,
|
592 |
+
tw_consumer_key: d,
|
593 |
+
tw_consumer_secret: I,
|
594 |
+
tw_oauth_access_token: m,
|
595 |
+
tw_oauth_access_token_secret: F,
|
596 |
+
sfsi_linkedIn_countsDisplay: D,
|
597 |
+
sfsi_linkedIn_countsFrom: k,
|
598 |
+
sfsi_linkedIn_manualCounts: y,
|
599 |
+
ln_company: b,
|
600 |
+
ln_api_key: w,
|
601 |
+
ln_secret_key: x,
|
602 |
+
ln_oAuth_user_token: C,
|
603 |
+
sfsi_youtube_countsDisplay: U,
|
604 |
+
sfsi_youtube_countsFrom: O,
|
605 |
+
sfsi_youtube_manualCounts: T,
|
606 |
+
sfsi_youtube_user: j,
|
607 |
+
sfsi_youtube_channelId: SFSI("input[name='sfsi_youtube_channelId']").val(),
|
608 |
+
sfsi_pinterest_countsDisplay: P,
|
609 |
+
sfsi_pinterest_countsFrom: M,
|
610 |
+
sfsi_pinterest_manualCounts: L,
|
611 |
+
sfsi_pinterest_user: B,
|
612 |
+
sfsi_pinterest_board: E,
|
613 |
+
sfsi_instagram_countsDisplay: z,
|
614 |
+
sfsi_instagram_countsFrom: A,
|
615 |
+
sfsi_instagram_manualCounts: N,
|
616 |
+
sfsi_instagram_User: H,
|
617 |
+
sfsi_instagram_clientid: ha,
|
618 |
+
sfsi_instagram_appurl: ia,
|
619 |
+
sfsi_instagram_token: ja,
|
620 |
+
sfsi_telegram_countsDisplay: tc,
|
621 |
+
sfsi_telegram_manualCounts: tm,
|
622 |
+
sfsi_vk_countsDisplay: vc,
|
623 |
+
sfsi_vk_manualCounts: vm,
|
624 |
+
sfsi_ok_countsDisplay: oc,
|
625 |
+
sfsi_ok_manualCounts: om,
|
626 |
+
sfsi_weibo_countsDisplay: wc,
|
627 |
+
sfsi_weibo_manualCounts: wm,
|
628 |
+
sfsi_wechat_countsDisplay: wcc,
|
629 |
+
sfsi_wechat_manualCounts: wcm,
|
630 |
+
nonce: nonce
|
631 |
+
};
|
632 |
+
console.log($);
|
633 |
+
return SFSI.ajax({
|
634 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
635 |
+
type: "post",
|
636 |
+
data: $,
|
637 |
+
dataType: "json",
|
638 |
+
async: !0,
|
639 |
+
success: function (s) {
|
640 |
+
if (s == "wrong_nonce") {
|
641 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 4);
|
642 |
+
global_error = 1;
|
643 |
+
afterLoad();
|
644 |
+
} else {
|
645 |
+
"success" == s.res ? (showErrorSuc("success", "Saved !", 4), sfsicollapse("#sfsi_save4"),
|
646 |
+
sfsi_showPreviewCounts()) : (showErrorSuc("error", "Unkown error , please try again", 4),
|
647 |
+
global_error = 1), afterLoad();
|
648 |
+
}
|
649 |
+
}
|
650 |
+
}), s;
|
651 |
+
}
|
652 |
+
|
653 |
+
function sfsi_update_step5() {
|
654 |
+
var nonce = SFSI("#sfsi_save5").attr("data-nonce");
|
655 |
+
sfsi_update_step3();
|
656 |
+
|
657 |
+
var s = sfsi_validationStep5();
|
658 |
+
|
659 |
+
if (!s) return global_error = 1, !1;
|
660 |
+
|
661 |
+
beForeLoad();
|
662 |
+
|
663 |
+
var i = SFSI("input[name='sfsi_icons_size']").val(),
|
664 |
+
e = SFSI("input[name='sfsi_icons_perRow']").val(),
|
665 |
+
t = SFSI("input[name='sfsi_icons_spacing']").val(),
|
666 |
+
n = SFSI("#sfsi_icons_Alignment").val(),
|
667 |
+
o = SFSI("input[name='sfsi_icons_ClickPageOpen']:checked").val(),
|
668 |
+
|
669 |
+
se = SFSI("input[name='sfsi_icons_suppress_errors']:checked").val(),
|
670 |
+
c = SFSI("input[name='sfsi_icons_stick']:checked").val(),
|
671 |
+
p = SFSI("#sfsi_rssIcon_order").attr("data-index"),
|
672 |
+
_ = SFSI("#sfsi_emailIcon_order").attr("data-index"),
|
673 |
+
S = SFSI("#sfsi_facebookIcon_order").attr("data-index"),
|
674 |
+
u = SFSI("#sfsi_twitterIcon_order").attr("data-index"),
|
675 |
+
f = SFSI("#sfsi_youtubeIcon_order").attr("data-index"),
|
676 |
+
d = SFSI("#sfsi_pinterestIcon_order").attr("data-index"),
|
677 |
+
I = SFSI("#sfsi_instagramIcon_order").attr("data-index"),
|
678 |
+
F = SFSI("#sfsi_linkedinIcon_order").attr("data-index"),
|
679 |
+
tgi = SFSI("#sfsi_telegramIcon_order").attr("data-index"),
|
680 |
+
vki = SFSI("#sfsi_vkIcon_order").attr("data-index"),
|
681 |
+
oki = SFSI("#sfsi_okIcon_order").attr("data-index"),
|
682 |
+
wbi = SFSI("#sfsi_weiboIcon_order").attr("data-index"),
|
683 |
+
wci = SFSI("#sfsi_wechatIcon_order").attr("data-index"),
|
684 |
+
|
685 |
+
h = new Array();
|
686 |
+
|
687 |
+
SFSI(".custom_iconOrder").each(function () {
|
688 |
+
h.push({
|
689 |
+
order: SFSI(this).attr("data-index"),
|
690 |
+
ele: SFSI(this).attr("element-id")
|
691 |
+
});
|
692 |
+
});
|
693 |
+
|
694 |
+
var v = 1 == SFSI("input[name='sfsi_rss_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_rss_MouseOverText']").val(),
|
695 |
+
g = 1 == SFSI("input[name='sfsi_email_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_email_MouseOverText']").val(),
|
696 |
+
k = 1 == SFSI("input[name='sfsi_twitter_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_twitter_MouseOverText']").val(),
|
697 |
+
y = 1 == SFSI("input[name='sfsi_facebook_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_facebook_MouseOverText']").val(),
|
698 |
+
w = 1 == SFSI("input[name='sfsi_linkedIn_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_linkedIn_MouseOverText']").val(),
|
699 |
+
x = 1 == SFSI("input[name='sfsi_youtube_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_youtube_MouseOverText']").val(),
|
700 |
+
C = 1 == SFSI("input[name='sfsi_pinterest_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_pinterest_MouseOverText']").val(),
|
701 |
+
D = 1 == SFSI("input[name='sfsi_instagram_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_instagram_MouseOverText']").val(),
|
702 |
+
tg = 1 == SFSI("input[name='sfsi_telegram_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_telegram_MouseOverText']").val(),
|
703 |
+
vk = 1 == SFSI("input[name='sfsi_vk_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_vk_MouseOverText']").val(),
|
704 |
+
ok = 1 == SFSI("input[name='sfsi_ok_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_ok_MouseOverText']").val(),
|
705 |
+
wb = 1 == SFSI("input[name='sfsi_weibo_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_weibo_MouseOverText']").val(),
|
706 |
+
wc = 1 == SFSI("input[name='sfsi_wechat_MouseOverText']").prop("disabled") ? "" : SFSI("input[name='sfsi_wechat_MouseOverText']").val(),
|
707 |
+
|
708 |
+
O = {};
|
709 |
+
SFSI("input[name='sfsi_custom_MouseOverTexts[]']").each(function () {
|
710 |
+
O[SFSI(this).attr("file-id")] = this.value;
|
711 |
+
});
|
712 |
+
|
713 |
+
var sfsi_custom_social_hide = SFSI("input[name='sfsi_custom_social_hide']").val();
|
714 |
+
|
715 |
+
var T = {
|
716 |
+
action: "updateSrcn5",
|
717 |
+
sfsi_icons_size: i,
|
718 |
+
sfsi_icons_Alignment: n,
|
719 |
+
sfsi_icons_perRow: e,
|
720 |
+
sfsi_icons_spacing: t,
|
721 |
+
sfsi_icons_ClickPageOpen: o,
|
722 |
+
sfsi_icons_suppress_errors: se,
|
723 |
+
sfsi_icons_stick: c,
|
724 |
+
sfsi_rss_MouseOverText: v,
|
725 |
+
sfsi_email_MouseOverText: g,
|
726 |
+
sfsi_twitter_MouseOverText: k,
|
727 |
+
sfsi_facebook_MouseOverText: y,
|
728 |
+
sfsi_youtube_MouseOverText: x,
|
729 |
+
sfsi_linkedIn_MouseOverText: w,
|
730 |
+
sfsi_pinterest_MouseOverText: C,
|
731 |
+
sfsi_instagram_MouseOverText: D,
|
732 |
+
sfsi_telegram_MouseOverText: tg,
|
733 |
+
sfsi_vk_MouseOverText: vk,
|
734 |
+
sfsi_ok_MouseOverText: ok,
|
735 |
+
sfsi_weibo_MouseOverText: wb,
|
736 |
+
sfsi_wechat_MouseOverText: wc,
|
737 |
+
sfsi_custom_MouseOverTexts: O,
|
738 |
+
sfsi_rssIcon_order: p,
|
739 |
+
sfsi_emailIcon_order: _,
|
740 |
+
sfsi_facebookIcon_order: S,
|
741 |
+
sfsi_twitterIcon_order: u,
|
742 |
+
sfsi_youtubeIcon_order: f,
|
743 |
+
sfsi_pinterestIcon_order: d,
|
744 |
+
sfsi_instagramIcon_order: I,
|
745 |
+
sfsi_linkedinIcon_order: F,
|
746 |
+
sfsi_telegramIcon_order: tgi,
|
747 |
+
sfsi_vkIcon_order: vki,
|
748 |
+
sfsi_okIcon_order: oki,
|
749 |
+
sfsi_weiboIcon_order: wbi,
|
750 |
+
sfsi_wechatIcon_order: wci,
|
751 |
+
|
752 |
+
sfsi_custom_orders: h,
|
753 |
+
sfsi_custom_social_hide: sfsi_custom_social_hide,
|
754 |
+
nonce: nonce
|
755 |
+
};
|
756 |
+
console.log(T);
|
757 |
+
SFSI.ajax({
|
758 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
759 |
+
type: "post",
|
760 |
+
data: T,
|
761 |
+
dataType: "json",
|
762 |
+
async: !0,
|
763 |
+
success: function (s) {
|
764 |
+
if (s == "wrong_nonce") {
|
765 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 5);
|
766 |
+
global_error = 1;
|
767 |
+
afterLoad();
|
768 |
+
} else {
|
769 |
+
"success" == s ? (showErrorSuc("success", "Saved !", 5), sfsicollapse("#sfsi_save5")) : (global_error = 1,
|
770 |
+
showErrorSuc("error", "Unkown error , please try again", 5)), afterLoad();
|
771 |
+
}
|
772 |
+
}
|
773 |
+
});
|
774 |
+
}
|
775 |
+
|
776 |
+
function sfsi_update_step6() {
|
777 |
+
var nonce = SFSI("#sfsi_save9").attr("data-nonce2");
|
778 |
+
beForeLoad();
|
779 |
+
var s = SFSI("input[name='sfsi_show_Onposts']:checked").val(),
|
780 |
+
i = SFSI("input[name='sfsi_textBefor_icons']").val(),
|
781 |
+
e = SFSI("#sfsi_icons_alignment").val(),
|
782 |
+
t = SFSI("#sfsi_icons_DisplayCounts").val(),
|
783 |
+
rsub = SFSI("input[name='sfsi_rectsub']:checked").val(),
|
784 |
+
rfb = SFSI("input[name='sfsi_rectfb']:checked").val(),
|
785 |
+
rpin = SFSI("input[name='sfsi_rectpinit']:checked").val(),
|
786 |
+
rshr = SFSI("input[name='sfsi_rectshr']:checked").val(),
|
787 |
+
rtwr = SFSI("input[name='sfsi_recttwtr']:checked").val(),
|
788 |
+
rfbshare = SFSI("input[name='sfsi_rectfbshare']:checked").val(),
|
789 |
+
a = SFSI("input[name='sfsi_display_button_type']:checked").val();
|
790 |
+
countshare = SFSI("input[name='sfsi_share_count']:checked").val();
|
791 |
+
endpost = SFSI("input[name='sfsi_responsive_icons_end_post']:checked").val();
|
792 |
+
|
793 |
+
var responsive_icons = {
|
794 |
+
"default_icons": {},
|
795 |
+
"settings": {}
|
796 |
+
};
|
797 |
+
SFSI('.sfsi_responsive_default_icon_container input[type="checkbox"]').each(function (index, obj) {
|
798 |
+
var data_obj = {};
|
799 |
+
data_obj.active = ('checked' == SFSI(obj).attr('checked')) ? 'yes' : 'no';
|
800 |
+
var iconname = SFSI(obj).attr('data-icon');
|
801 |
+
var next_section = SFSI(obj).parent().parent();
|
802 |
+
data_obj.text = next_section.find('input[name="sfsi_responsive_' + iconname + '_input"]').val();
|
803 |
+
data_obj.url = next_section.find('input[name="sfsi_responsive_' + iconname + '_url_input"]').val();
|
804 |
+
responsive_icons.default_icons[iconname] = data_obj;
|
805 |
+
});
|
806 |
+
SFSI('.sfsi_responsive_custom_icon_container input[type="checkbox"]').each(function (index, obj) {
|
807 |
+
if (SFSI(obj).attr('id') != "sfsi_responsive_custom_new_display") {
|
808 |
+
var data_obj = {};
|
809 |
+
data_obj.active = 'checked' == SFSI(obj).attr('checked') ? 'yes' : 'no';
|
810 |
+
var icon_index = SFSI(obj).attr('data-custom-index');
|
811 |
+
var next_section = SFSI(obj).parent().parent();
|
812 |
+
data_obj['added'] = SFSI('input[name="sfsi_responsive_custom_' + index + '_added"]').val();
|
813 |
+
data_obj.icon = next_section.find('img').attr('src');
|
814 |
+
data_obj["bg-color"] = next_section.find('.sfsi_bg-color-picker').val();
|
815 |
+
|
816 |
+
data_obj.text = next_section.find('input[name="sfsi_responsive_custom_' + icon_index + '_input"]').val();
|
817 |
+
data_obj.url = next_section.find('input[name="sfsi_responsive_custom_' + icon_index + '_url_input"]').val();
|
818 |
+
responsive_icons.custom_icons[index] = data_obj;
|
819 |
+
}
|
820 |
+
});
|
821 |
+
responsive_icons.settings.icon_size = SFSI('select[name="sfsi_responsive_icons_settings_icon_size"]').val();
|
822 |
+
responsive_icons.settings.icon_width_type = SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val();
|
823 |
+
responsive_icons.settings.icon_width_size = SFSI('input[name="sfsi_responsive_icons_sttings_icon_width_size"]').val();
|
824 |
+
responsive_icons.settings.edge_type = SFSI('select[name="sfsi_responsive_icons_settings_edge_type"]').val();
|
825 |
+
responsive_icons.settings.edge_radius = SFSI('select[name="sfsi_responsive_icons_settings_edge_radius"]').val();
|
826 |
+
responsive_icons.settings.style = SFSI('select[name="sfsi_responsive_icons_settings_style"]').val();
|
827 |
+
responsive_icons.settings.margin = SFSI('input[name="sfsi_responsive_icons_settings_margin"]').val();
|
828 |
+
responsive_icons.settings.text_align = SFSI('select[name="sfsi_responsive_icons_settings_text_align"]').val();
|
829 |
+
responsive_icons.settings.show_count = SFSI('input[name="sfsi_responsive_icon_show_count"]:checked').val();
|
830 |
+
responsive_icons.settings.counter_color = SFSI('input[name="sfsi_responsive_counter_color"]').val();
|
831 |
+
responsive_icons.settings.counter_bg_color = SFSI('input[name="sfsi_responsive_counter_bg_color"]').val();
|
832 |
+
responsive_icons.settings.share_count_text = SFSI('input[name="sfsi_responsive_counter_share_count_text"]').val();
|
833 |
+
responsive_icons.settings.show_count = countshare;
|
834 |
+
n = {
|
835 |
+
action: "updateSrcn6",
|
836 |
+
sfsi_show_Onposts: s,
|
837 |
+
sfsi_icons_DisplayCounts: t,
|
838 |
+
sfsi_icons_alignment: e,
|
839 |
+
sfsi_textBefor_icons: i,
|
840 |
+
sfsi_rectsub: rsub,
|
841 |
+
sfsi_rectfb: rfb,
|
842 |
+
sfsi_rectpinit: rpin,
|
843 |
+
sfsi_rectshr: rshr,
|
844 |
+
sfsi_recttwtr: rtwr,
|
845 |
+
sfsi_rectfbshare: rfbshare,
|
846 |
+
sfsi_responsive_icons: responsive_icons,
|
847 |
+
sfsi_display_button_type: a,
|
848 |
+
sfsi_responsive_icons_end_post:endpost,
|
849 |
+
sfsi_share_count: countshare,
|
850 |
+
nonce: nonce
|
851 |
+
};
|
852 |
+
SFSI.ajax({
|
853 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
854 |
+
type: "post",
|
855 |
+
data: n,
|
856 |
+
dataType: "json",
|
857 |
+
async: !0,
|
858 |
+
success: function (s) {
|
859 |
+
if (s == "wrong_nonce") {
|
860 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 6);
|
861 |
+
global_error = 1;
|
862 |
+
afterLoad();
|
863 |
+
} else {
|
864 |
+
"success" == s ? (showErrorSuc("success", "Saved !", 6), sfsicollapse("#sfsi_save6")) : (global_error = 1,
|
865 |
+
showErrorSuc("error", "Unkown error , please try again", 6)), afterLoad();
|
866 |
+
}
|
867 |
+
}
|
868 |
+
});
|
869 |
+
}
|
870 |
+
|
871 |
+
function sfsi_update_step7() {
|
872 |
+
var nonce = SFSI("#sfsi_save7").attr("data-nonce");
|
873 |
+
var s = sfsi_validationStep7();
|
874 |
+
if (!s) return global_error = 1, !1;
|
875 |
+
beForeLoad();
|
876 |
+
var i = SFSI("input[name='sfsi_popup_text']").val(),
|
877 |
+
e = SFSI("#sfsi_popup_font option:selected").val(),
|
878 |
+
t = SFSI("#sfsi_popup_fontStyle option:selected").val(),
|
879 |
+
color = SFSI("input[name='sfsi_popup_fontColor']").val(),
|
880 |
+
n = SFSI("input[name='sfsi_popup_fontSize']").val(),
|
881 |
+
o = SFSI("input[name='sfsi_popup_background_color']").val(),
|
882 |
+
a = SFSI("input[name='sfsi_popup_border_color']").val(),
|
883 |
+
r = SFSI("input[name='sfsi_popup_border_thickness']").val(),
|
884 |
+
c = SFSI("input[name='sfsi_popup_border_shadow']:checked").val(),
|
885 |
+
p = SFSI("input[name='sfsi_Show_popupOn']:checked").val(),
|
886 |
+
_ = [];
|
887 |
+
SFSI("#sfsi_Show_popupOn_PageIDs :selected").each(function (s, i) {
|
888 |
+
_[s] = SFSI(i).val();
|
889 |
+
});
|
890 |
+
var l = SFSI("input[name='sfsi_Shown_pop']:checked").val(),
|
891 |
+
S = SFSI("input[name='sfsi_Shown_popupOnceTime']").val(),
|
892 |
+
u = SFSI("#sfsi_Shown_popuplimitPerUserTime").val(),
|
893 |
+
f = {
|
894 |
+
action: "updateSrcn7",
|
895 |
+
sfsi_popup_text: i,
|
896 |
+
sfsi_popup_font: e,
|
897 |
+
sfsi_popup_fontColor: color,
|
898 |
+
/*sfsi_popup_fontStyle: t,*/
|
899 |
+
sfsi_popup_fontSize: n,
|
900 |
+
sfsi_popup_background_color: o,
|
901 |
+
sfsi_popup_border_color: a,
|
902 |
+
sfsi_popup_border_thickness: r,
|
903 |
+
sfsi_popup_border_shadow: c,
|
904 |
+
sfsi_Show_popupOn: p,
|
905 |
+
sfsi_Show_popupOn_PageIDs: _,
|
906 |
+
sfsi_Shown_pop: l,
|
907 |
+
sfsi_Shown_popupOnceTime: S,
|
908 |
+
sfsi_Shown_popuplimitPerUserTime: u,
|
909 |
+
nonce: nonce
|
910 |
+
};
|
911 |
+
SFSI.ajax({
|
912 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
913 |
+
type: "post",
|
914 |
+
data: f,
|
915 |
+
dataType: "json",
|
916 |
+
async: !0,
|
917 |
+
success: function (s) {
|
918 |
+
if (s == "wrong_nonce") {
|
919 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 7);
|
920 |
+
afterLoad();
|
921 |
+
} else {
|
922 |
+
"success" == s ? (showErrorSuc("success", "Saved !", 7), sfsicollapse("#sfsi_save7")) : showErrorSuc("error", "Unkown error , please try again", 7),
|
923 |
+
afterLoad();
|
924 |
+
}
|
925 |
+
}
|
926 |
+
});
|
927 |
+
}
|
928 |
+
|
929 |
+
function sfsi_update_step8() {
|
930 |
+
var nonce = SFSI("#sfsi_save8").attr("data-nonce");
|
931 |
+
beForeLoad();
|
932 |
+
var ie = SFSI("input[name='sfsi_form_adjustment']:checked").val(),
|
933 |
+
je = SFSI("input[name='sfsi_form_height']").val(),
|
934 |
+
ke = SFSI("input[name='sfsi_form_width']").val(),
|
935 |
+
le = SFSI("input[name='sfsi_form_border']:checked").val(),
|
936 |
+
me = SFSI("input[name='sfsi_form_border_thickness']").val(),
|
937 |
+
ne = SFSI("input[name='sfsi_form_border_color']").val(),
|
938 |
+
oe = SFSI("input[name='sfsi_form_background']").val(),
|
939 |
+
|
940 |
+
ae = SFSI("input[name='sfsi_form_heading_text']").val(),
|
941 |
+
be = SFSI("#sfsi_form_heading_font option:selected").val(),
|
942 |
+
ce = SFSI("#sfsi_form_heading_fontstyle option:selected").val(),
|
943 |
+
de = SFSI("input[name='sfsi_form_heading_fontcolor']").val(),
|
944 |
+
ee = SFSI("input[name='sfsi_form_heading_fontsize']").val(),
|
945 |
+
fe = SFSI("#sfsi_form_heading_fontalign option:selected").val(),
|
946 |
+
|
947 |
+
ue = SFSI("input[name='sfsi_form_field_text']").val(),
|
948 |
+
ve = SFSI("#sfsi_form_field_font option:selected").val(),
|
949 |
+
we = SFSI("#sfsi_form_field_fontstyle option:selected").val(),
|
950 |
+
xe = SFSI("input[name='sfsi_form_field_fontcolor']").val(),
|
951 |
+
ye = SFSI("input[name='sfsi_form_field_fontsize']").val(),
|
952 |
+
ze = SFSI("#sfsi_form_field_fontalign option:selected").val(),
|
953 |
+
|
954 |
+
i = SFSI("input[name='sfsi_form_button_text']").val(),
|
955 |
+
j = SFSI("#sfsi_form_button_font option:selected").val(),
|
956 |
+
k = SFSI("#sfsi_form_button_fontstyle option:selected").val(),
|
957 |
+
l = SFSI("input[name='sfsi_form_button_fontcolor']").val(),
|
958 |
+
m = SFSI("input[name='sfsi_form_button_fontsize']").val(),
|
959 |
+
n = SFSI("#sfsi_form_button_fontalign option:selected").val(),
|
960 |
+
o = SFSI("input[name='sfsi_form_button_background']").val();
|
961 |
+
|
962 |
+
var f = {
|
963 |
+
action: "updateSrcn8",
|
964 |
+
sfsi_form_adjustment: ie,
|
965 |
+
sfsi_form_height: je,
|
966 |
+
sfsi_form_width: ke,
|
967 |
+
sfsi_form_border: le,
|
968 |
+
sfsi_form_border_thickness: me,
|
969 |
+
sfsi_form_border_color: ne,
|
970 |
+
sfsi_form_background: oe,
|
971 |
+
|
972 |
+
sfsi_form_heading_text: ae,
|
973 |
+
sfsi_form_heading_font: be,
|
974 |
+
sfsi_form_heading_fontstyle: ce,
|
975 |
+
sfsi_form_heading_fontcolor: de,
|
976 |
+
sfsi_form_heading_fontsize: ee,
|
977 |
+
sfsi_form_heading_fontalign: fe,
|
978 |
+
|
979 |
+
sfsi_form_field_text: ue,
|
980 |
+
sfsi_form_field_font: ve,
|
981 |
+
sfsi_form_field_fontstyle: we,
|
982 |
+
sfsi_form_field_fontcolor: xe,
|
983 |
+
sfsi_form_field_fontsize: ye,
|
984 |
+
sfsi_form_field_fontalign: ze,
|
985 |
+
|
986 |
+
sfsi_form_button_text: i,
|
987 |
+
sfsi_form_button_font: j,
|
988 |
+
sfsi_form_button_fontstyle: k,
|
989 |
+
sfsi_form_button_fontcolor: l,
|
990 |
+
sfsi_form_button_fontsize: m,
|
991 |
+
sfsi_form_button_fontalign: n,
|
992 |
+
sfsi_form_button_background: o,
|
993 |
+
|
994 |
+
nonce: nonce
|
995 |
+
};
|
996 |
+
SFSI.ajax({
|
997 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
998 |
+
type: "post",
|
999 |
+
data: f,
|
1000 |
+
dataType: "json",
|
1001 |
+
async: !0,
|
1002 |
+
success: function (s) {
|
1003 |
+
if (s == "wrong_nonce") {
|
1004 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 7);
|
1005 |
+
afterLoad();
|
1006 |
+
} else {
|
1007 |
+
"success" == s ? (showErrorSuc("success", "Saved !", 8), sfsicollapse("#sfsi_save8"), create_suscriber_form()) : showErrorSuc("error", "Unkown error , please try again", 8),
|
1008 |
+
afterLoad();
|
1009 |
+
}
|
1010 |
+
}
|
1011 |
+
});
|
1012 |
+
}
|
1013 |
+
|
1014 |
+
// Queestion 3
|
1015 |
+
function sfsi_update_step9() {
|
1016 |
+
sfsi_update_step6();
|
1017 |
+
var nonce = SFSI("#sfsi_save9").attr("data-nonce");
|
1018 |
+
beForeLoad();
|
1019 |
+
|
1020 |
+
var i_float = SFSI("input[name='sfsi_icons_float']:checked").val(),
|
1021 |
+
i_floatP = SFSI("input[name='sfsi_icons_floatPosition']:checked").val(),
|
1022 |
+
i_floatMt = SFSI("input[name='sfsi_icons_floatMargin_top']").val(),
|
1023 |
+
i_floatMb = SFSI("input[name='sfsi_icons_floatMargin_bottom']").val(),
|
1024 |
+
i_floatMl = SFSI("input[name='sfsi_icons_floatMargin_left']").val(),
|
1025 |
+
i_floatMr = SFSI("input[name='sfsi_icons_floatMargin_right']").val(),
|
1026 |
+
i_disableFloat = SFSI("input[name='sfsi_disable_floaticons']:checked").val(),
|
1027 |
+
|
1028 |
+
show_via_widget = SFSI("input[name='sfsi_show_via_widget']").val(),
|
1029 |
+
show_via__shortcode = SFSI("input[name='sfsi_show_via_shortcode']:checked").length==0?"no":"yes",
|
1030 |
+
sfsi_show_via_afterposts = SFSI("input[name='sfsi_show_via_afterposts']").val();
|
1031 |
+
|
1032 |
+
var f = {
|
1033 |
+
|
1034 |
+
action: "updateSrcn9",
|
1035 |
+
|
1036 |
+
sfsi_icons_float: i_float,
|
1037 |
+
sfsi_icons_floatPosition: i_floatP,
|
1038 |
+
sfsi_icons_floatMargin_top: i_floatMt,
|
1039 |
+
sfsi_icons_floatMargin_bottom: i_floatMb,
|
1040 |
+
sfsi_icons_floatMargin_left: i_floatMl,
|
1041 |
+
sfsi_icons_floatMargin_right: i_floatMr,
|
1042 |
+
sfsi_disable_floaticons: i_disableFloat,
|
1043 |
+
|
1044 |
+
sfsi_show_via_widget: show_via_widget,
|
1045 |
+
sfsi_show_via_shortcode: show_via__shortcode,
|
1046 |
+
sfsi_show_via_afterposts: sfsi_show_via_afterposts,
|
1047 |
+
nonce: nonce
|
1048 |
+
};
|
1049 |
+
SFSI.ajax({
|
1050 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
1051 |
+
type: "post",
|
1052 |
+
data: f,
|
1053 |
+
dataType: "json",
|
1054 |
+
async: !0,
|
1055 |
+
success: function (s) {
|
1056 |
+
if (s == "wrong_nonce") {
|
1057 |
+
showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 9);
|
1058 |
+
afterLoad();
|
1059 |
+
} else {
|
1060 |
+
"success" == s ? (showErrorSuc("success", "Saved !", 9), sfsicollapse("#sfsi_save9")) : showErrorSuc("error", "Unkown error , please try again", 9),
|
1061 |
+
afterLoad();
|
1062 |
+
}
|
1063 |
+
}
|
1064 |
+
});
|
1065 |
+
}
|
1066 |
+
|
1067 |
+
function sfsi_validationStep2() {
|
1068 |
+
//var class_name= SFSI(element).hasAttr('sfsi_validate');
|
1069 |
+
SFSI('input').removeClass('inputError'); // remove previous error
|
1070 |
+
if (sfsi_validator(SFSI('input[name="sfsi_rss_display"]'), 'checked')) {
|
1071 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_rss_url"]'), 'url')) {
|
1072 |
+
showErrorSuc("error", "Error : Invalid Rss url ", 2);
|
1073 |
+
SFSI('input[name="sfsi_rss_url"]').addClass('inputError');
|
1074 |
+
|
1075 |
+
return false;
|
1076 |
+
}
|
1077 |
+
}
|
1078 |
+
/* validate facebook */
|
1079 |
+
if (sfsi_validator(SFSI('input[name="sfsi_facebookPage_option"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_facebookPage_option"]'), 'checked')) {
|
1080 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_facebookPage_url"]'), 'blank')) {
|
1081 |
+
showErrorSuc("error", "Error : Invalid Facebook page url ", 2);
|
1082 |
+
SFSI('input[name="sfsi_facebookPage_url"]').addClass('inputError');
|
1083 |
+
|
1084 |
+
return false;
|
1085 |
+
}
|
1086 |
+
}
|
1087 |
+
/* validate twitter user name */
|
1088 |
+
if (sfsi_validator(SFSI('input[name="sfsi_twitter_followme"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_twitter_followme"]'), 'checked')) {
|
1089 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_twitter_followUserName"]'), 'blank')) {
|
1090 |
+
showErrorSuc("error", "Error : Invalid Twitter UserName ", 2);
|
1091 |
+
SFSI('input[name="sfsi_twitter_followUserName"]').addClass('inputError');
|
1092 |
+
return false;
|
1093 |
+
}
|
1094 |
+
}
|
1095 |
+
/* validate twitter about page */
|
1096 |
+
if (sfsi_validator(SFSI('input[name="sfsi_twitter_aboutPage"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_twitter_aboutPage"]'), 'checked')) {
|
1097 |
+
if (!sfsi_validator(SFSI('#sfsi_twitter_aboutPageText'), 'blank')) {
|
1098 |
+
showErrorSuc("error", "Error : Tweet about my page is blank ", 2);
|
1099 |
+
SFSI('#sfsi_twitter_aboutPageText').addClass('inputError');
|
1100 |
+
return false;
|
1101 |
+
}
|
1102 |
+
}
|
1103 |
+
/* twitter validation */
|
1104 |
+
if (sfsi_validator(SFSI('input[name="sfsi_twitter_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_twitter_page"]'), 'checked')) {
|
1105 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_twitter_pageURL"]'), 'blank')) {
|
1106 |
+
showErrorSuc("error", "Error : Invalid twitter page Url ", 2);
|
1107 |
+
SFSI('input[name="sfsi_twitter_pageURL"]').addClass('inputError');
|
1108 |
+
return false;
|
1109 |
+
}
|
1110 |
+
}
|
1111 |
+
|
1112 |
+
/* youtube validation */
|
1113 |
+
if (sfsi_validator(SFSI('input[name="sfsi_youtube_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_youtube_page"]'), 'checked')) {
|
1114 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_youtube_pageUrl"]'), 'blank')) {
|
1115 |
+
showErrorSuc("error", "Error : Invalid youtube Url ", 2);
|
1116 |
+
SFSI('input[name="sfsi_youtube_pageUrl"]').addClass('inputError');
|
1117 |
+
return false;
|
1118 |
+
}
|
1119 |
+
}
|
1120 |
+
/* youtube validation */
|
1121 |
+
if (sfsi_validator(SFSI('input[name="sfsi_youtube_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_youtube_follow"]'), 'checked')) {
|
1122 |
+
cls = SFSI("input[name='sfsi_youtubeusernameorid']:checked").val();
|
1123 |
+
if (cls == 'name' && !sfsi_validator(SFSI('input[name="sfsi_ytube_user"]'), 'blank')) {
|
1124 |
+
showErrorSuc("error", "Error : Invalid youtube user name", 2);
|
1125 |
+
SFSI('input[name="sfsi_ytube_user"]').addClass('inputError');
|
1126 |
+
return false;
|
1127 |
+
}
|
1128 |
+
|
1129 |
+
if (cls == 'id' && !sfsi_validator(SFSI('input[name="sfsi_ytube_chnlid"]'), 'blank')) {
|
1130 |
+
showErrorSuc("error", "Error : Invalid youtube Channel ID ", 2);
|
1131 |
+
SFSI('input[name="sfsi_ytube_user"]').addClass('inputError');
|
1132 |
+
return false;
|
1133 |
+
}
|
1134 |
+
}
|
1135 |
+
/* pinterest validation */
|
1136 |
+
if (sfsi_validator(SFSI('input[name="sfsi_pinterest_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_pinterest_page"]'), 'checked')) {
|
1137 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_pinterest_pageUrl"]'), 'blank')) {
|
1138 |
+
showErrorSuc("error", "Error : Invalid pinterest page url ", 2);
|
1139 |
+
SFSI('input[name="sfsi_pinterest_pageUrl"]').addClass('inputError');
|
1140 |
+
return false;
|
1141 |
+
}
|
1142 |
+
}
|
1143 |
+
/* instagram validation */
|
1144 |
+
if (sfsi_validator(SFSI('input[name="sfsi_instagram_display"]'), 'checked')) {
|
1145 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_instagram_pageUrl"]'), 'blank')) {
|
1146 |
+
showErrorSuc("error", "Error : Invalid Instagram url ", 2);
|
1147 |
+
SFSI('input[name="sfsi_instagram_pageUrl"]').addClass('inputError');
|
1148 |
+
return false;
|
1149 |
+
}
|
1150 |
+
}
|
1151 |
+
/* telegram validation */
|
1152 |
+
if (sfsi_validator(SFSI('input[name="sfsi_telegram_display"]'), 'checked')) {
|
1153 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_telegram_username"]'), 'blank')) {
|
1154 |
+
showErrorSuc("error", "Error : Invalid telegram username ", 2);
|
1155 |
+
SFSI('input[name="sfsi_telegram_username"]').addClass('inputError');
|
1156 |
+
return false;
|
1157 |
+
}
|
1158 |
+
}
|
1159 |
+
/* telegram validation */
|
1160 |
+
if (sfsi_validator(SFSI('input[name="sfsi_telegram_display"]'), 'checked')) {
|
1161 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_telegram_message"]'), 'blank')) {
|
1162 |
+
showErrorSuc("error", "Error : Invalid Message ", 2);
|
1163 |
+
SFSI('input[name="sfsi_telegram_message"]').addClass('inputError');
|
1164 |
+
return false;
|
1165 |
+
}
|
1166 |
+
}
|
1167 |
+
/* vk validation */
|
1168 |
+
if (sfsi_validator(SFSI('input[name="sfsi_vk_display"]'), 'checked')) {
|
1169 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_vk_pageURL"]'), 'blank')) {
|
1170 |
+
showErrorSuc("error", "Error : Invalid vk url ", 2);
|
1171 |
+
SFSI('input[name="sfsi_vk_pageURL"]').addClass('inputError');
|
1172 |
+
return false;
|
1173 |
+
}
|
1174 |
+
}
|
1175 |
+
/* ok validation */
|
1176 |
+
if (sfsi_validator(SFSI('input[name="sfsi_ok_display"]'), 'checked')) {
|
1177 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_ok_pageURL"]'), 'blank')) {
|
1178 |
+
showErrorSuc("error", "Error : Invalid ok url ", 2);
|
1179 |
+
SFSI('input[name="sfsi_ok_pageURL"]').addClass('inputError');
|
1180 |
+
return false;
|
1181 |
+
}
|
1182 |
+
}
|
1183 |
+
/* weibo validation */
|
1184 |
+
if (sfsi_validator(SFSI('input[name="sfsi_weibo_display"]'), 'checked')) {
|
1185 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_weibo_pageURL"]'), 'blank')) {
|
1186 |
+
showErrorSuc("error", "Error : Invalid weibo url ", 2);
|
1187 |
+
SFSI('input[name="sfsi_weibo_pageURL"]').addClass('inputError');
|
1188 |
+
return false;
|
1189 |
+
}
|
1190 |
+
}
|
1191 |
+
/* LinkedIn validation */
|
1192 |
+
if (sfsi_validator(SFSI('input[name="sfsi_linkedin_page"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_linkedin_page"]'), 'checked')) {
|
1193 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_linkedin_pageURL"]'), 'blank')) {
|
1194 |
+
showErrorSuc("error", "Error : Invalid LinkedIn page url ", 2);
|
1195 |
+
SFSI('input[name="sfsi_linkedin_pageURL"]').addClass('inputError');
|
1196 |
+
return false;
|
1197 |
+
}
|
1198 |
+
}
|
1199 |
+
if (sfsi_validator(SFSI('input[name="sfsi_linkedin_recommendBusines"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_linkedin_recommendBusines"]'), 'checked')) {
|
1200 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_linkedin_recommendProductId"]'), 'blank') || !sfsi_validator(SFSI('input[name="sfsi_linkedin_recommendCompany"]'), 'blank')) {
|
1201 |
+
showErrorSuc("error", "Error : Please Enter Product Id and Company for LinkedIn Recommendation ", 2);
|
1202 |
+
SFSI('input[name="sfsi_linkedin_recommendProductId"]').addClass('inputError');
|
1203 |
+
SFSI('input[name="sfsi_linkedin_recommendCompany"]').addClass('inputError');
|
1204 |
+
return false;
|
1205 |
+
}
|
1206 |
+
}
|
1207 |
+
/* validate custom links */
|
1208 |
+
var er = 0;
|
1209 |
+
SFSI("input[name='sfsi_CustomIcon_links[]']").each(function () {
|
1210 |
+
|
1211 |
+
//if(!sfsi_validator(SFSI(this),'blank') || !sfsi_validator(SFSI(SFSI(this)),'url') )
|
1212 |
+
if (!sfsi_validator(SFSI(this), 'blank')) {
|
1213 |
+
showErrorSuc("error", "Error : Please Enter a valid Custom link ", 2);
|
1214 |
+
SFSI(this).addClass('inputError');
|
1215 |
+
er = 1;
|
1216 |
+
}
|
1217 |
+
});
|
1218 |
+
if (!er) return true;
|
1219 |
+
else return false;
|
1220 |
+
}
|
1221 |
+
|
1222 |
+
function sfsi_validationStep3() {
|
1223 |
+
SFSI('input').removeClass('inputError'); // remove previous error
|
1224 |
+
/* validate shuffle effect */
|
1225 |
+
if (sfsi_validator(SFSI('input[name="sfsi_shuffle_icons"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_shuffle_icons"]'), 'checked')) {
|
1226 |
+
if ((!sfsi_validator(SFSI('input[name="sfsi_shuffle_Firstload"]'), 'activte') || !sfsi_validator(SFSI('input[name="sfsi_shuffle_Firstload"]'), 'checked')) && (!sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'activte') || !sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'checked'))) {
|
1227 |
+
showErrorSuc("error", "Error : Please Chose a Shuffle option ", 3);
|
1228 |
+
SFSI('input[name="sfsi_shuffle_Firstload"]').addClass('inputError');
|
1229 |
+
SFSI('input[name="sfsi_shuffle_interval"]').addClass('inputError');
|
1230 |
+
return false;
|
1231 |
+
}
|
1232 |
+
}
|
1233 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_shuffle_icons"]'), 'checked') && (sfsi_validator(SFSI('input[name="sfsi_shuffle_Firstload"]'), 'checked') || sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'checked'))) {
|
1234 |
+
showErrorSuc("error", "Error : Please check \"Shuffle them automatically\" option also ", 3);
|
1235 |
+
SFSI('input[name="sfsi_shuffle_Firstload"]').addClass('inputError');
|
1236 |
+
SFSI('input[name="sfsi_shuffle_interval"]').addClass('inputError');
|
1237 |
+
return false;
|
1238 |
+
}
|
1239 |
+
|
1240 |
+
/* validate twitter user name */
|
1241 |
+
if (sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_shuffle_interval"]'), 'checked')) {
|
1242 |
+
|
1243 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_shuffle_intervalTime"]'), 'blank') || !sfsi_validator(SFSI('input[name="sfsi_shuffle_intervalTime"]'), 'int')) {
|
1244 |
+
showErrorSuc("error", "Error : Invalid shuffle time interval", 3);
|
1245 |
+
SFSI('input[name="sfsi_shuffle_intervalTime"]').addClass('inputError');
|
1246 |
+
return false;
|
1247 |
+
}
|
1248 |
+
}
|
1249 |
+
return true;
|
1250 |
+
}
|
1251 |
+
|
1252 |
+
function sfsi_validationStep4() {
|
1253 |
+
//var class_name= SFSI(element).hasAttr('sfsi_validate');
|
1254 |
+
/* validate email */
|
1255 |
+
if (sfsi_validator(SFSI('input[name="sfsi_email_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_email_countsDisplay"]'), 'checked')) {
|
1256 |
+
if (SFSI('input[name="sfsi_email_countsFrom"]:checked').val() == 'manual') {
|
1257 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_email_manualCounts"]'), 'blank')) {
|
1258 |
+
showErrorSuc("error", "Error : Please Enter manual counts for Email icon ", 4);
|
1259 |
+
SFSI('input[name="sfsi_email_manualCounts"]').addClass('inputError');
|
1260 |
+
return false;
|
1261 |
+
}
|
1262 |
+
}
|
1263 |
+
}
|
1264 |
+
/* validate RSS count */
|
1265 |
+
if (sfsi_validator(SFSI('input[name="sfsi_rss_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_rss_countsDisplay"]'), 'checked')) {
|
1266 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_rss_manualCounts"]'), 'blank')) {
|
1267 |
+
showErrorSuc("error", "Error : Please Enter manual counts for Rss icon ", 4);
|
1268 |
+
SFSI('input[name="sfsi_rss_countsDisplay"]').addClass('inputError');
|
1269 |
+
return false;
|
1270 |
+
}
|
1271 |
+
}
|
1272 |
+
/* validate facebook */
|
1273 |
+
if (sfsi_validator(SFSI('input[name="sfsi_facebook_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_facebook_countsDisplay"]'), 'checked')) {
|
1274 |
+
/*if(SFSI('input[name="sfsi_facebook_countsFrom"]:checked').val()=='likes' )
|
1275 |
+
{
|
1276 |
+
if(!sfsi_validator(SFSI('input[name="sfsi_facebook_PageLink"]'),'blank'))
|
1277 |
+
{ showErrorSuc("error","Error : Please Enter facebook page Url ",4);
|
1278 |
+
SFSI('input[name="sfsi_facebook_PageLink"]').addClass('inputError');
|
1279 |
+
return false;
|
1280 |
+
}
|
1281 |
+
} */
|
1282 |
+
if (SFSI('input[name="sfsi_facebook_countsFrom"]:checked').val() == 'manual') {
|
1283 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_facebook_manualCounts"]'), 'blank') && !sfsi_validator(SFSI('input[name="sfsi_facebook_manualCounts"]'), 'url')) {
|
1284 |
+
showErrorSuc("error", "Error : Please Enter a valid facebook manual counts ", 4);
|
1285 |
+
SFSI('input[name="sfsi_facebook_manualCounts"]').addClass('inputError');
|
1286 |
+
return false;
|
1287 |
+
}
|
1288 |
+
}
|
1289 |
+
}
|
1290 |
+
|
1291 |
+
/* validate twitter */
|
1292 |
+
if (sfsi_validator(SFSI('input[name="sfsi_twitter_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_twitter_countsDisplay"]'), 'checked')) {
|
1293 |
+
if (SFSI('input[name="sfsi_twitter_countsFrom"]:checked').val() == 'source') {
|
1294 |
+
if (!sfsi_validator(SFSI('input[name="tw_consumer_key"]'), 'blank')) {
|
1295 |
+
showErrorSuc("error", "Error : Please Enter a valid consumer key", 4);
|
1296 |
+
SFSI('input[name="tw_consumer_key"]').addClass('inputError');
|
1297 |
+
return false;
|
1298 |
+
}
|
1299 |
+
if (!sfsi_validator(SFSI('input[name="tw_consumer_secret"]'), 'blank')) {
|
1300 |
+
showErrorSuc("error", "Error : Please Enter a valid consume secret ", 4);
|
1301 |
+
SFSI('input[name="tw_consumer_secret"]').addClass('inputError');
|
1302 |
+
return false;
|
1303 |
+
}
|
1304 |
+
if (!sfsi_validator(SFSI('input[name="tw_oauth_access_token"]'), 'blank')) {
|
1305 |
+
showErrorSuc("error", "Error : Please Enter a valid oauth access token", 4);
|
1306 |
+
SFSI('input[name="tw_oauth_access_token"]').addClass('inputError');
|
1307 |
+
return false;
|
1308 |
+
}
|
1309 |
+
if (!sfsi_validator(SFSI('input[name="tw_oauth_access_token_secret"]'), 'blank')) {
|
1310 |
+
showErrorSuc("error", "Error : Please Enter a oAuth access token secret", 4);
|
1311 |
+
SFSI('input[name="tw_oauth_access_token_secret"]').addClass('inputError');
|
1312 |
+
return false;
|
1313 |
+
}
|
1314 |
+
}
|
1315 |
+
if (SFSI('input[name="sfsi_linkedIn_countsFrom"]:checked').val() == 'manual') {
|
1316 |
+
|
1317 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_twitter_manualCounts"]'), 'blank')) {
|
1318 |
+
showErrorSuc("error", "Error : Please Enter Twitter manual counts ", 4);
|
1319 |
+
SFSI('input[name="sfsi_twitter_manualCounts"]').addClass('inputError');
|
1320 |
+
return false;
|
1321 |
+
}
|
1322 |
+
}
|
1323 |
+
}
|
1324 |
+
/* validate LinkedIn */
|
1325 |
+
if (sfsi_validator(SFSI('input[name="sfsi_linkedIn_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_linkedIn_countsDisplay"]'), 'checked')) {
|
1326 |
+
if (SFSI('input[name="sfsi_linkedIn_countsFrom"]:checked').val() == 'follower') {
|
1327 |
+
if (!sfsi_validator(SFSI('input[name="ln_company"]'), 'blank')) {
|
1328 |
+
showErrorSuc("error", "Error : Please Enter a valid company name", 4);
|
1329 |
+
SFSI('input[name="ln_company"]').addClass('inputError');
|
1330 |
+
return false;
|
1331 |
+
}
|
1332 |
+
if (!sfsi_validator(SFSI('input[name="ln_api_key"]'), 'blank')) {
|
1333 |
+
showErrorSuc("error", "Error : Please Enter a valid API key ", 4);
|
1334 |
+
SFSI('input[name="ln_api_key"]').addClass('inputError');
|
1335 |
+
return false;
|
1336 |
+
}
|
1337 |
+
if (!sfsi_validator(SFSI('input[name="ln_secret_key"]'), 'blank')) {
|
1338 |
+
showErrorSuc("error", "Error : Please Enter a valid secret ", 4);
|
1339 |
+
SFSI('input[name="ln_secret_key"]').addClass('inputError');
|
1340 |
+
return false;
|
1341 |
+
}
|
1342 |
+
if (!sfsi_validator(SFSI('input[name="ln_oAuth_user_token"]'), 'blank')) {
|
1343 |
+
showErrorSuc("error", "Error : Please Enter a oAuth Access Token", 4);
|
1344 |
+
SFSI('input[name="ln_oAuth_user_token"]').addClass('inputError');
|
1345 |
+
return false;
|
1346 |
+
}
|
1347 |
+
}
|
1348 |
+
if (SFSI('input[name="sfsi_linkedIn_countsFrom"]:checked').val() == 'manual') {
|
1349 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_linkedIn_manualCounts"]'), 'blank')) {
|
1350 |
+
showErrorSuc("error", "Error : Please Enter LinkedIn manual counts ", 4);
|
1351 |
+
SFSI('input[name="sfsi_linkedIn_manualCounts"]').addClass('inputError');
|
1352 |
+
return false;
|
1353 |
+
}
|
1354 |
+
}
|
1355 |
+
}
|
1356 |
+
/* validate youtube */
|
1357 |
+
if (sfsi_validator(SFSI('input[name="sfsi_youtube_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_youtube_countsDisplay"]'), 'checked')) {
|
1358 |
+
if (SFSI('input[name="sfsi_youtube_countsFrom"]:checked').val() == 'subscriber') {
|
1359 |
+
if (
|
1360 |
+
!sfsi_validator(SFSI('input[name="sfsi_youtube_user"]'), 'blank') &&
|
1361 |
+
!sfsi_validator(SFSI('input[name="sfsi_youtube_channelId"]'), 'blank')
|
1362 |
+
) {
|
1363 |
+
showErrorSuc("error", "Error : Please Enter a youtube user name or channel id", 4);
|
1364 |
+
SFSI('input[name="sfsi_youtube_user"]').addClass('inputError');
|
1365 |
+
SFSI('input[name="sfsi_youtube_channelId"]').addClass('inputError');
|
1366 |
+
return false;
|
1367 |
+
}
|
1368 |
+
}
|
1369 |
+
if (SFSI('input[name="sfsi_youtube_countsFrom"]:checked').val() == 'manual') {
|
1370 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_youtube_manualCounts"]'), 'blank')) {
|
1371 |
+
showErrorSuc("error", "Error : Please Enter youtube manual counts ", 4);
|
1372 |
+
SFSI('input[name="sfsi_youtube_manualCounts"]').addClass('inputError');
|
1373 |
+
return false;
|
1374 |
+
}
|
1375 |
+
}
|
1376 |
+
}
|
1377 |
+
/* validate pinterest */
|
1378 |
+
if (sfsi_validator(SFSI('input[name="sfsi_pinterest_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_pinterest_countsDisplay"]'), 'checked')) {
|
1379 |
+
if (SFSI('input[name="sfsi_pinterest_countsFrom"]:checked').val() == 'manual') {
|
1380 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_pinterest_manualCounts"]'), 'blank')) {
|
1381 |
+
showErrorSuc("error", "Error : Please Enter Pinterest manual counts ", 4);
|
1382 |
+
SFSI('input[name="sfsi_pinterest_manualCounts"]').addClass('inputError');
|
1383 |
+
return false;
|
1384 |
+
}
|
1385 |
+
}
|
1386 |
+
}
|
1387 |
+
/* validate instagram */
|
1388 |
+
if (sfsi_validator(SFSI('input[name="sfsi_instagram_countsDisplay"]'), 'activte') && sfsi_validator(SFSI('input[name="sfsi_instagram_countsDisplay"]'), 'checked')) {
|
1389 |
+
if (SFSI('input[name="sfsi_instagram_countsFrom"]:checked').val() == 'manual') {
|
1390 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_instagram_manualCounts"]'), 'blank')) {
|
1391 |
+
showErrorSuc("error", "Error : Please Enter Instagram manual counts ", 4);
|
1392 |
+
SFSI('input[name="sfsi_instagram_manualCounts"]').addClass('inputError');
|
1393 |
+
return false;
|
1394 |
+
}
|
1395 |
+
}
|
1396 |
+
if (SFSI('input[name="sfsi_instagram_countsFrom"]:checked').val() == 'followers') {
|
1397 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_instagram_User"]'), 'blank')) {
|
1398 |
+
showErrorSuc("error", "Error : Please Enter a instagram user name", 4);
|
1399 |
+
SFSI('input[name="sfsi_instagram_User"]').addClass('inputError');
|
1400 |
+
return false;
|
1401 |
+
}
|
1402 |
+
}
|
1403 |
+
}
|
1404 |
+
return true;
|
1405 |
+
}
|
1406 |
+
|
1407 |
+
function sfsi_validationStep5() {
|
1408 |
+
//var class_name= SFSI(element).hasAttr('sfsi_validate');
|
1409 |
+
/* validate size */
|
1410 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_icons_size"]'), 'int')) {
|
1411 |
+
showErrorSuc("error", "Error : Please enter a numeric value only ", 5);
|
1412 |
+
SFSI('input[name="sfsi_icons_size"]').addClass('inputError');
|
1413 |
+
return false;
|
1414 |
+
}
|
1415 |
+
if (parseInt(SFSI('input[name="sfsi_icons_size"]').val()) > 100) {
|
1416 |
+
showErrorSuc("error", "Error : Icons Size allow 100px maximum ", 5);
|
1417 |
+
SFSI('input[name="sfsi_icons_size"]').addClass('inputError');
|
1418 |
+
return false;
|
1419 |
+
}
|
1420 |
+
if (parseInt(SFSI('input[name="sfsi_icons_size"]').val()) <= 0) {
|
1421 |
+
showErrorSuc("error", "Error : Icons Size should be more than 0 ", 5);
|
1422 |
+
SFSI('input[name="sfsi_icons_size"]').addClass('inputError');
|
1423 |
+
return false;
|
1424 |
+
}
|
1425 |
+
/* validate spacing */
|
1426 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_icons_spacing"]'), 'int')) {
|
1427 |
+
showErrorSuc("error", "Error : Please enter a numeric value only ", 5);
|
1428 |
+
SFSI('input[name="sfsi_icons_spacing"]').addClass('inputError');
|
1429 |
+
return false;
|
1430 |
+
}
|
1431 |
+
if (parseInt(SFSI('input[name="sfsi_icons_spacing"]').val()) < 0) {
|
1432 |
+
showErrorSuc("error", "Error : Icons Spacing should be 0 or more", 5);
|
1433 |
+
SFSI('input[name="sfsi_icons_spacing"]').addClass('inputError');
|
1434 |
+
return false;
|
1435 |
+
}
|
1436 |
+
/* icons per row spacing */
|
1437 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_icons_perRow"]'), 'int')) {
|
1438 |
+
showErrorSuc("error", "Error : Please enter a numeric value only ", 5);
|
1439 |
+
SFSI('input[name="sfsi_icons_perRow"]').addClass('inputError');
|
1440 |
+
return false;
|
1441 |
+
}
|
1442 |
+
if (parseInt(SFSI('input[name="sfsi_icons_perRow"]').val()) <= 0) {
|
1443 |
+
showErrorSuc("error", "Error : Icons Per row should be more than 0", 5);
|
1444 |
+
SFSI('input[name="sfsi_icons_perRow"]').addClass('inputError');
|
1445 |
+
return false;
|
1446 |
+
}
|
1447 |
+
/* validate icons effects */
|
1448 |
+
// if(SFSI('input[name="sfsi_icons_float"]:checked').val()=="yes" && SFSI('input[name="sfsi_icons_stick"]:checked').val()=="yes")
|
1449 |
+
// {
|
1450 |
+
// showErrorSuc("error","Error : Only one allow from Sticking & floating ",5);
|
1451 |
+
// SFSI('input[name="sfsi_icons_float"][value="no"]').prop("checked", true);
|
1452 |
+
// return false;
|
1453 |
+
// }
|
1454 |
+
return true;
|
1455 |
+
}
|
1456 |
+
|
1457 |
+
function sfsi_validationStep7() {
|
1458 |
+
//var class_name= SFSI(element).hasAttr('sfsi_validate');
|
1459 |
+
/* validate border thikness */
|
1460 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_popup_border_thickness"]'), 'int')) {
|
1461 |
+
showErrorSuc("error", "Error : Please enter a numeric value only ", 7);
|
1462 |
+
SFSI('input[name="sfsi_popup_border_thickness"]').addClass('inputError');
|
1463 |
+
return false;
|
1464 |
+
}
|
1465 |
+
/* validate fotn size */
|
1466 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_popup_fontSize"]'), 'int')) {
|
1467 |
+
showErrorSuc("error", "Error : Please enter a numeric value only ", 7);
|
1468 |
+
SFSI('input[name="sfsi_popup_fontSize"]').addClass('inputError');
|
1469 |
+
return false;
|
1470 |
+
}
|
1471 |
+
/* validate pop up shown */
|
1472 |
+
if (SFSI('input[name="sfsi_Shown_pop"]:checked').val() == 'once') {
|
1473 |
+
|
1474 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_Shown_popupOnceTime"]'), 'blank') && !sfsi_validator(SFSI('input[name="sfsi_Shown_popupOnceTime"]'), 'url')) {
|
1475 |
+
showErrorSuc("error", "Error : Please Enter a valid pop up shown time ", 7);
|
1476 |
+
SFSI('input[name="sfsi_Shown_popupOnceTime"]').addClass('inputError');
|
1477 |
+
return false;
|
1478 |
+
}
|
1479 |
+
}
|
1480 |
+
/* validate page ids */
|
1481 |
+
if (SFSI('input[name="sfsi_Show_popupOn"]:checked').val() == 'selectedpage') {
|
1482 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_Show_popupOn"]'), 'blank')) {
|
1483 |
+
showErrorSuc("error", "Error : Please Enter page ids with comma ", 7);
|
1484 |
+
SFSI('input[name="sfsi_Show_popupOn"]').addClass('inputError');
|
1485 |
+
return false;
|
1486 |
+
}
|
1487 |
+
}
|
1488 |
+
/* validate spacing */
|
1489 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_icons_spacing"]'), 'int')) {
|
1490 |
+
showErrorSuc("error", "Error : Please enter a numeric value only ", 7);
|
1491 |
+
SFSI('input[name="sfsi_icons_spacing"]').addClass('inputError');
|
1492 |
+
return false;
|
1493 |
+
}
|
1494 |
+
/* icons per row spacing */
|
1495 |
+
if (!sfsi_validator(SFSI('input[name="sfsi_icons_perRow"]'), 'int')) {
|
1496 |
+
showErrorSuc("error", "Error : Please enter a numeric value only ", 7);
|
1497 |
+
SFSI('input[name="sfsi_icons_perRow"]').addClass('inputError');
|
1498 |
+
return false;
|
1499 |
+
}
|
1500 |
+
return true;
|
1501 |
+
}
|
1502 |
+
|
1503 |
+
function sfsi_validator(element, valType) {
|
1504 |
+
var Vurl = new RegExp("^(http|https|ftp)\://([a-zA-Z0-9\.\-]+(\:[a-zA-Z0-9\.&%\$\-]+)*@)*((25[0-5]|2[0-4][0-9]|[0-1]{1}[0-9]{2}|[1-9]{1}[0-9]{1}|[1-9])\.(25[0-5]|2[0-4][0-9]|[0-1]{1}[0-9]{2}|[1-9]{1}[0-9]{1}|[1-9]|0)\.(25[0-5]|2[0-4][0-9]|[0-1]{1}[0-9]{2}|[1-9]{1}[0-9]{1}|[1-9]|0)\.(25[0-5]|2[0-4][0-9]|[0-1]{1}[0-9]{2}|[1-9]{1}[0-9]{1}|[0-9])|([a-zA-Z0-9\-]+\.)*[a-zA-Z0-9\-]+\.(com|edu|gov|int|mil|net|org|biz|arpa|info|name|pro|aero|coop|museum|[a-zA-Z]{2}))(\:[0-9]+)*(/($|[a-zA-Z0-9\.\,\@\?\'\\\+&%\$#\=~_\-]+))*$");
|
1505 |
+
//var Vurl = /http:\/\/[A-Za-z0-9\.-]{3,}\.[A-Za-z]{3}/;
|
1506 |
+
|
1507 |
+
switch (valType) {
|
1508 |
+
case "blank":
|
1509 |
+
if (!element.val().trim()) return false;
|
1510 |
+
else return true;
|
1511 |
+
break;
|
1512 |
+
case "url":
|
1513 |
+
if (!Vurl.test(element.val().trim())) return false;
|
1514 |
+
else return true;
|
1515 |
+
break;
|
1516 |
+
case "checked":
|
1517 |
+
if (!element.attr('checked') === true) return false;
|
1518 |
+
else return true;
|
1519 |
+
break;
|
1520 |
+
case "activte":
|
1521 |
+
if (!element.attr('disabled')) return true;
|
1522 |
+
else return false;
|
1523 |
+
break;
|
1524 |
+
case "int":
|
1525 |
+
if (!isNaN(element.val())) return true;
|
1526 |
+
else return false;
|
1527 |
+
break;
|
1528 |
+
|
1529 |
+
}
|
1530 |
+
}
|
1531 |
+
|
1532 |
+
function afterIconSuccess(s, nonce) {
|
1533 |
+
if (s.res = "success") {
|
1534 |
+
var i = s.key + 1,
|
1535 |
+
e = s.element,
|
1536 |
+
t = e + 1;
|
1537 |
+
SFSI("#total_cusotm_icons").val(s.element);
|
1538 |
+
SFSI(".upload-overlay").hide("slow");
|
1539 |
+
SFSI(".uperror").html("");
|
1540 |
+
showErrorSuc("success", "Custom Icon updated successfully", 1);
|
1541 |
+
d = new Date();
|
1542 |
+
|
1543 |
+
var ele = SFSI(".notice_custom_icons_premium");
|
1544 |
+
|
1545 |
+
SFSI("li.custom:last-child").removeClass("bdr_btm_non");
|
1546 |
+
SFSI("li.custom:last-child").children("span.custom-img").children("img").attr("src", s.img_path + "?" + d.getTime());
|
1547 |
+
SFSI("input[name=sfsiICON_" + s.key + "]").removeAttr("ele-type");
|
1548 |
+
SFSI("input[name=sfsiICON_" + s.key + "]").removeAttr("isnew");
|
1549 |
+
icons_name = SFSI("li.custom:last-child").find("input.styled").attr("name");
|
1550 |
+
var n = icons_name.split("_");
|
1551 |
+
s.key = s.key, s.img_path += "?" + d.getTime(), 5 > e && SFSI(".icn_listing").append('<li id="c' + i + '" class="custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style=" 0px 0px;"></span><input name="sfsiICON_' + i + '" type="checkbox" value="yes" class="styled" style="display:none;" element-type="cusotm-icon" isNew="yes" /></div> <span class="custom-img"><img src="' + SFSI("#plugin_url").val() + 'images/custom.png" id="CImg_' + i + '" alt="error" /> </span> <span class="custom custom-txt">Custom' + t + ' </span> <div class="right_info"> <p><span>It depends:</span> Upload a custom icon if you have other accounts/websites you want to link to.</p><div class="inputWrapper"></div></li>'),
|
1552 |
+
SFSI(".custom_section").show(),
|
1553 |
+
SFSI('<div class="row sfsiICON_' + s.key + ' cm_lnk"> <h2 class="custom"> <span class="customstep2-img"> <img src="' + s.img_path + "?" + d.getTime() + '" style="border-radius:48%" alt="error" /> </span> <span class="sfsiCtxt">Custom ' + e + '</span> </h2> <div class="inr_cont "><p>Where do you want this icon to link to?</p> <p class="radio_section fb_url custom_section sfsiICON_' + s.key + '" ><label>Link :</label><input file-id="' + s.key + '" name="sfsi_CustomIcon_links[]" type="text" value="" placeholder="http://" class="add" /></p></div></div>').insertBefore('.notice_custom_icons_premium');
|
1554 |
+
//SFSI(".custom-links").append(' <div class="row sfsiICON_' + s.key + ' cm_lnk"> <h2 class="custom"> <span class="customstep2-img"> <img src="' + s.img_path + "?" + d.getTime() + '" style="border-radius:48%" /> </span> <span class="sfsiCtxt">Custom ' + e + '</span> </h2> <div class="inr_cont "><p>Where do you want this icon to link to?</p> <p class="radio_section fb_url custom_section sfsiICON_' + s.key + '" ><label>Link :</label><input file-id="' + s.key + '" name="sfsi_CustomIcon_links[]" type="text" value="" placeholder="http://" class="add" /></p></div></div>');
|
1555 |
+
SFSI(".notice_custom_icons_premium").show();
|
1556 |
+
SFSI("#c" + s.key).append('<input type="hidden" name="nonce" value="' + nonce + '">');
|
1557 |
+
var o = SFSI("div.custom_m").find("div.mouseover_field").length;
|
1558 |
+
SFSI("div.custom_m").append(0 == o % 2 ? '<div class="clear"> </div> <div class="mouseover_field custom_section sfsiICON_' + s.key + '"><label>Custom ' + e + ':</label><input name="sfsi_custom_MouseOverTexts[]" value="" type="text" file-id="' + s.key + '" /></div>' : '<div class="cHover " ><div class="mouseover_field custom_section sfsiICON_' + s.key + '"><label>Custom ' + e + ':</label><input name="sfsi_custom_MouseOverTexts[]" value="" type="text" file-id="' + s.key + '" /></div>'),
|
1559 |
+
SFSI("ul.share_icon_order").append('<li class="custom_iconOrder sfsiICON_' + s.key + '" data-index="" element-id="' + s.key + '" id=""><a href="#" title="Custom Icon" ><img src="' + s.img_path + '" alt="Linked In" class="sfcm"/></a></li>'),
|
1560 |
+
SFSI("ul.sfsi_sample_icons").append('<li class="sfsiICON_' + s.key + '" element-id="' + s.key + '" ><div><img src="' + s.img_path + '" alt="Linked In" class="sfcm"/><span class="sfsi_Cdisplay">12k</span></div></li>'),
|
1561 |
+
sfsi_update_index(), update_Sec5Iconorder(), sfsi_update_step1(), sfsi_update_step2(),
|
1562 |
+
sfsi_update_step5(), SFSI(".upload-overlay").css("pointer-events", "auto"), sfsi_showPreviewCounts(),
|
1563 |
+
afterLoad();
|
1564 |
+
}
|
1565 |
+
}
|
1566 |
+
|
1567 |
+
function beforeIconSubmit(s) {
|
1568 |
+
if (SFSI(".uperror").html("Uploading....."), window.File && window.FileReader && window.FileList && window.Blob) {
|
1569 |
+
SFSI(s).val() || SFSI(".uperror").html("File is empty");
|
1570 |
+
var i = s.files[0].size,
|
1571 |
+
e = s.files[0].type;
|
1572 |
+
switch (e) {
|
1573 |
+
case "image/png":
|
1574 |
+
case "image/gif":
|
1575 |
+
case "image/jpeg":
|
1576 |
+
case "image/pjpeg":
|
1577 |
+
break;
|
1578 |
+
|
1579 |
+
default:
|
1580 |
+
return SFSI(".uperror").html("Unsupported file"), !1;
|
1581 |
+
}
|
1582 |
+
return i > 1048576 ? (SFSI(".uperror").html("Image should be less than 1 MB"), !1) : !0;
|
1583 |
+
}
|
1584 |
+
return !0;
|
1585 |
+
}
|
1586 |
+
|
1587 |
+
function bytesToSize(s) {
|
1588 |
+
var i = ["Bytes", "KB", "MB", "GB", "TB"];
|
1589 |
+
if (0 == s) return "0 Bytes";
|
1590 |
+
var e = parseInt(Math.floor(Math.log(s) / Math.log(1024)));
|
1591 |
+
return Math.round(s / Math.pow(1024, e), 2) + " " + i[e];
|
1592 |
+
}
|
1593 |
+
|
1594 |
+
function showErrorSuc(s, i, e) {
|
1595 |
+
if ("error" == s) var t = "errorMsg";
|
1596 |
+
else var t = "sucMsg";
|
1597 |
+
return SFSI(".tab" + e + ">." + t).html(i), SFSI(".tab" + e + ">." + t).show(),
|
1598 |
+
SFSI(".tab" + e + ">." + t).effect("highlight", {}, 5e3), setTimeout(function () {
|
1599 |
+
SFSI("." + t).slideUp("slow");
|
1600 |
+
}, 5e3), !1;
|
1601 |
+
}
|
1602 |
+
|
1603 |
+
function beForeLoad() {
|
1604 |
+
SFSI(".loader-img").show(), SFSI(".save_button >a").html("Saving..."), SFSI(".save_button >a").css("pointer-events", "none");
|
1605 |
+
}
|
1606 |
+
|
1607 |
+
function afterLoad() {
|
1608 |
+
SFSI("input").removeClass("inputError"), SFSI(".save_button >a").html("Save"), SFSI(".tab10>div.save_button >a").html("Save All Settings"),
|
1609 |
+
SFSI(".save_button >a").css("pointer-events", "auto"), SFSI(".save_button >a").removeAttr("onclick"),
|
1610 |
+
SFSI(".loader-img").hide();
|
1611 |
+
}
|
1612 |
+
|
1613 |
+
function sfsi_make_popBox() {
|
1614 |
+
var s = 0;
|
1615 |
+
SFSI(".sfsi_sample_icons >li").each(function () {
|
1616 |
+
"none" != SFSI(this).css("display") && (s = 1);
|
1617 |
+
}),
|
1618 |
+
0 == s ? SFSI(".sfsi_Popinner").hide() : SFSI(".sfsi_Popinner").show(),
|
1619 |
+
"" != SFSI('input[name="sfsi_popup_text"]').val() ? (SFSI(".sfsi_Popinner >h2").html(SFSI('input[name="sfsi_popup_text"]').val()),
|
1620 |
+
SFSI(".sfsi_Popinner >h2").show()) : SFSI(".sfsi_Popinner >h2").hide(), SFSI(".sfsi_Popinner").css({
|
1621 |
+
"border-color": SFSI('input[name="sfsi_popup_border_color"]').val(),
|
1622 |
+
"border-width": SFSI('input[name="sfsi_popup_border_thickness"]').val(),
|
1623 |
+
"border-style": "solid"
|
1624 |
+
}),
|
1625 |
+
SFSI(".sfsi_Popinner").css("background-color", SFSI('input[name="sfsi_popup_background_color"]').val()),
|
1626 |
+
SFSI(".sfsi_Popinner h2").css("font-family", SFSI("#sfsi_popup_font").val()), SFSI(".sfsi_Popinner h2").css("font-style", SFSI("#sfsi_popup_fontStyle").val()),
|
1627 |
+
SFSI(".sfsi_Popinner >h2").css("font-size", parseInt(SFSI('input[name="sfsi_popup_fontSize"]').val())),
|
1628 |
+
SFSI(".sfsi_Popinner >h2").css("color", SFSI('input[name="sfsi_popup_fontColor"]').val() + " !important"),
|
1629 |
+
"yes" == SFSI('input[name="sfsi_popup_border_shadow"]:checked').val() ? SFSI(".sfsi_Popinner").css("box-shadow", "12px 30px 18px #CCCCCC") : SFSI(".sfsi_Popinner").css("box-shadow", "none");
|
1630 |
+
}
|
1631 |
+
|
1632 |
+
function sfsi_stick_widget(s) {
|
1633 |
+
0 == initTop.length && (SFSI(".sfsi_widget").each(function (s) {
|
1634 |
+
initTop[s] = SFSI(this).position().top;
|
1635 |
+
}), console.log(initTop));
|
1636 |
+
var i = SFSI(window).scrollTop(),
|
1637 |
+
e = [],
|
1638 |
+
t = [];
|
1639 |
+
SFSI(".sfsi_widget").each(function (s) {
|
1640 |
+
e[s] = SFSI(this).position().top, t[s] = SFSI(this);
|
1641 |
+
});
|
1642 |
+
var n = !1;
|
1643 |
+
for (var o in e) {
|
1644 |
+
var a = parseInt(o) + 1;
|
1645 |
+
e[o] < i && e[a] > i && a < e.length ? (SFSI(t[o]).css({
|
1646 |
+
position: "fixed",
|
1647 |
+
top: s
|
1648 |
+
}), SFSI(t[a]).css({
|
1649 |
+
position: "",
|
1650 |
+
top: initTop[a]
|
1651 |
+
}), n = !0) : SFSI(t[o]).css({
|
1652 |
+
position: "",
|
1653 |
+
top: initTop[o]
|
1654 |
+
});
|
1655 |
+
}
|
1656 |
+
if (!n) {
|
1657 |
+
var r = e.length - 1,
|
1658 |
+
c = -1;
|
1659 |
+
e.length > 1 && (c = e.length - 2), initTop[r] < i ? (SFSI(t[r]).css({
|
1660 |
+
position: "fixed",
|
1661 |
+
top: s
|
1662 |
+
}), c >= 0 && SFSI(t[c]).css({
|
1663 |
+
position: "",
|
1664 |
+
top: initTop[c]
|
1665 |
+
})) : (SFSI(t[r]).css({
|
1666 |
+
position: "",
|
1667 |
+
top: initTop[r]
|
1668 |
+
}), c >= 0 && e[c] < i);
|
1669 |
+
}
|
1670 |
+
}
|
1671 |
+
|
1672 |
+
function sfsi_setCookie(s, i, e) {
|
1673 |
+
var t = new Date();
|
1674 |
+
t.setTime(t.getTime() + 1e3 * 60 * 60 * 24 * e);
|
1675 |
+
var n = "expires=" + t.toGMTString();
|
1676 |
+
document.cookie = s + "=" + i + "; " + n;
|
1677 |
+
}
|
1678 |
+
|
1679 |
+
function sfsfi_getCookie(s) {
|
1680 |
+
for (var i = s + "=", e = document.cookie.split(";"), t = 0; t < e.length; t++) {
|
1681 |
+
var n = e[t].trim();
|
1682 |
+
if (0 == n.indexOf(i)) return n.substring(i.length, n.length);
|
1683 |
+
}
|
1684 |
+
return "";
|
1685 |
+
}
|
1686 |
+
|
1687 |
+
function sfsi_hideFooter() {}
|
1688 |
+
|
1689 |
+
window.onerror = function () {},
|
1690 |
+
SFSI = jQuery,
|
1691 |
+
SFSI(window).on('load', function () {
|
1692 |
+
SFSI("#sfpageLoad").fadeOut(2e3);
|
1693 |
+
});
|
1694 |
+
|
1695 |
+
//changes done {Monad}
|
1696 |
+
function selectText(containerid) {
|
1697 |
+
if (document.selection) {
|
1698 |
+
var range = document.body.createTextRange();
|
1699 |
+
range.moveToElementText(document.getElementById(containerid));
|
1700 |
+
range.select();
|
1701 |
+
} else if (window.getSelection()) {
|
1702 |
+
var range = document.createRange();
|
1703 |
+
range.selectNode(document.getElementById(containerid));
|
1704 |
+
window.getSelection().removeAllRanges();
|
1705 |
+
window.getSelection().addRange(range);
|
1706 |
+
}
|
1707 |
+
}
|
1708 |
+
|
1709 |
+
function create_suscriber_form() {
|
1710 |
+
//Popbox customization
|
1711 |
+
"no" == SFSI('input[name="sfsi_form_adjustment"]:checked').val() ? SFSI(".sfsi_subscribe_Popinner").css({
|
1712 |
+
"width": parseInt(SFSI('input[name="sfsi_form_width"]').val()),
|
1713 |
+
"height": parseInt(SFSI('input[name="sfsi_form_height"]').val())
|
1714 |
+
}) : SFSI(".sfsi_subscribe_Popinner").css({
|
1715 |
+
"width": '',
|
1716 |
+
"height": ''
|
1717 |
+
});
|
1718 |
+
|
1719 |
+
"yes" == SFSI('input[name="sfsi_form_adjustment"]:checked').val() ? SFSI(".sfsi_html > .sfsi_subscribe_Popinner").css({
|
1720 |
+
"width": "100%"
|
1721 |
+
}) : '';
|
1722 |
+
|
1723 |
+
"yes" == SFSI('input[name="sfsi_form_border"]:checked').val() ? SFSI(".sfsi_subscribe_Popinner").css({
|
1724 |
+
"border": SFSI('input[name="sfsi_form_border_thickness"]').val() + "px solid " + SFSI('input[name="sfsi_form_border_color"]').val()
|
1725 |
+
}) : SFSI(".sfsi_subscribe_Popinner").css("border", "none");
|
1726 |
+
|
1727 |
+
SFSI('input[name="sfsi_form_background"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").css("background-color", SFSI('input[name="sfsi_form_background"]').val())) : '';
|
1728 |
+
|
1729 |
+
//Heading customization
|
1730 |
+
SFSI('input[name="sfsi_form_heading_text"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").html(SFSI('input[name="sfsi_form_heading_text"]').val())) : SFSI(".sfsi_subscribe_Popinner > form > h5").html('');
|
1731 |
+
|
1732 |
+
SFSI('#sfsi_form_heading_font').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-family", SFSI("#sfsi_form_heading_font").val())) : '';
|
1733 |
+
|
1734 |
+
if (SFSI('#sfsi_form_heading_fontstyle').val() != 'bold') {
|
1735 |
+
SFSI('#sfsi_form_heading_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-style", SFSI("#sfsi_form_heading_fontstyle").val())) : '';
|
1736 |
+
SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-weight", '');
|
1737 |
+
} else {
|
1738 |
+
SFSI('#sfsi_form_heading_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-weight", "bold")) : '';
|
1739 |
+
SFSI(".sfsi_subscribe_Popinner > form > h5").css("font-style", '');
|
1740 |
+
}
|
1741 |
+
|
1742 |
+
SFSI('input[name="sfsi_form_heading_fontcolor"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("color", SFSI('input[name="sfsi_form_heading_fontcolor"]').val())) : '';
|
1743 |
+
|
1744 |
+
SFSI('input[name="sfsi_form_heading_fontsize"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css({
|
1745 |
+
"font-size": parseInt(SFSI('input[name="sfsi_form_heading_fontsize"]').val())
|
1746 |
+
})) : '';
|
1747 |
+
|
1748 |
+
SFSI('#sfsi_form_heading_fontalign').val() != "" ? (SFSI(".sfsi_subscribe_Popinner > form > h5").css("text-align", SFSI("#sfsi_form_heading_fontalign").val())) : '';
|
1749 |
+
|
1750 |
+
//Field customization
|
1751 |
+
SFSI('input[name="sfsi_form_field_text"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').attr("placeholder", SFSI('input[name="sfsi_form_field_text"]').val())) : SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').attr("placeholder", '');
|
1752 |
+
|
1753 |
+
SFSI('input[name="sfsi_form_field_text"]').val() != "" ? (SFSI(".sfsi_left_container > .sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').val(SFSI('input[name="sfsi_form_field_text"]').val())) : SFSI(".sfsi_left_container > .sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').val('');
|
1754 |
+
|
1755 |
+
SFSI('input[name="sfsi_form_field_text"]').val() != "" ? (SFSI(".like_pop_box > .sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').val(SFSI('input[name="sfsi_form_field_text"]').val())) : SFSI(".like_pop_box > .sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').val('');
|
1756 |
+
|
1757 |
+
SFSI('#sfsi_form_field_font').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-family", SFSI("#sfsi_form_field_font").val())) : '';
|
1758 |
+
|
1759 |
+
if (SFSI('#sfsi_form_field_fontstyle').val() != "bold") {
|
1760 |
+
SFSI('#sfsi_form_field_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-style", SFSI("#sfsi_form_field_fontstyle").val())) : '';
|
1761 |
+
SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-weight", '');
|
1762 |
+
} else {
|
1763 |
+
SFSI('#sfsi_form_field_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-weight", 'bold')) : '';
|
1764 |
+
SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-style", '');
|
1765 |
+
}
|
1766 |
+
|
1767 |
+
SFSI('input[name="sfsi_form_field_fontcolor"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("color", SFSI('input[name="sfsi_form_field_fontcolor"]').val())) : '';
|
1768 |
+
|
1769 |
+
SFSI('input[name="sfsi_form_field_fontsize"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css({
|
1770 |
+
"font-size": parseInt(SFSI('input[name="sfsi_form_field_fontsize"]').val())
|
1771 |
+
})) : '';
|
1772 |
+
|
1773 |
+
SFSI('#sfsi_form_field_fontalign').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("text-align", SFSI("#sfsi_form_field_fontalign").val())) : '';
|
1774 |
+
|
1775 |
+
//Button customization
|
1776 |
+
SFSI('input[name="sfsi_form_button_text"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').attr("value", SFSI('input[name="sfsi_form_button_text"]').val())) : '';
|
1777 |
+
|
1778 |
+
SFSI('#sfsi_form_button_font').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-family", SFSI("#sfsi_form_button_font").val())) : '';
|
1779 |
+
|
1780 |
+
if (SFSI('#sfsi_form_button_fontstyle').val() != "bold") {
|
1781 |
+
SFSI('#sfsi_form_button_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-style", SFSI("#sfsi_form_button_fontstyle").val())) : '';
|
1782 |
+
SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-weight", '');
|
1783 |
+
} else {
|
1784 |
+
SFSI('#sfsi_form_button_fontstyle').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-weight", 'bold')) : '';
|
1785 |
+
SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("font-style", '');
|
1786 |
+
}
|
1787 |
+
|
1788 |
+
SFSI('input[name="sfsi_form_button_fontcolor"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("color", SFSI('input[name="sfsi_form_button_fontcolor"]').val())) : '';
|
1789 |
+
|
1790 |
+
SFSI('input[name="sfsi_form_button_fontsize"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css({
|
1791 |
+
"font-size": parseInt(SFSI('input[name="sfsi_form_button_fontsize"]').val())
|
1792 |
+
})) : '';
|
1793 |
+
|
1794 |
+
SFSI('#sfsi_form_button_fontalign').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("text-align", SFSI("#sfsi_form_button_fontalign").val())) : '';
|
1795 |
+
|
1796 |
+
SFSI('input[name="sfsi_form_button_background"]').val() != "" ? (SFSI(".sfsi_subscribe_Popinner").find('input[name="subscribe"]').css("background-color", SFSI('input[name="sfsi_form_button_background"]').val())) : '';
|
1797 |
+
|
1798 |
+
var innerHTML = SFSI(".sfsi_html > .sfsi_subscribe_Popinner").html();
|
1799 |
+
var styleCss = SFSI(".sfsi_html > .sfsi_subscribe_Popinner").attr("style");
|
1800 |
+
innerHTML = '<div style="' + styleCss + '">' + innerHTML + '</div>';
|
1801 |
+
SFSI(".sfsi_subscription_html > xmp").html(innerHTML);
|
1802 |
+
|
1803 |
+
/*var data = {
|
1804 |
+
action:"getForm",
|
1805 |
+
heading: SFSI('input[name="sfsi_form_heading_text"]').val(),
|
1806 |
+
placeholder:SFSI('input[name="sfsi_form_field_text"]').val(),
|
1807 |
+
button:SFSI('input[name="sfsi_form_button_text"]').val()
|
1808 |
+
};
|
1809 |
+
SFSI.ajax({
|
1810 |
+
url:sfsi_icon_ajax_object.ajax_url,
|
1811 |
+
type:"post",
|
1812 |
+
data:data,
|
1813 |
+
success:function(s) {
|
1814 |
+
SFSI(".sfsi_subscription_html").html(s);
|
1815 |
+
}
|
1816 |
+
});*/
|
1817 |
+
}
|
1818 |
+
|
1819 |
+
var global_error = 0;
|
1820 |
+
if (typeof SFSI != 'undefined') {
|
1821 |
+
|
1822 |
+
function sfsi_dismiss_notice(btnClass, ajaxAction) {
|
1823 |
+
|
1824 |
+
var btnClass = "." + btnClass;
|
1825 |
+
|
1826 |
+
SFSI(document).on("click", btnClass, function () {
|
1827 |
+
|
1828 |
+
SFSI.ajax({
|
1829 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
1830 |
+
type: "post",
|
1831 |
+
data: {
|
1832 |
+
action: ajaxAction
|
1833 |
+
},
|
1834 |
+
success: function (e) {
|
1835 |
+
if (false != e) {
|
1836 |
+
SFSI(btnClass).parent().remove();
|
1837 |
+
}
|
1838 |
+
}
|
1839 |
+
});
|
1840 |
+
});
|
1841 |
+
}
|
1842 |
+
}
|
1843 |
+
|
1844 |
+
SFSI(document).ready(function (s) {
|
1845 |
+
|
1846 |
+
var arrDismiss = [
|
1847 |
+
|
1848 |
+
{
|
1849 |
+
"btnClass": "sfsi-notice-dismiss",
|
1850 |
+
"action": "sfsi_dismiss_lang_notice"
|
1851 |
+
},
|
1852 |
+
|
1853 |
+
{
|
1854 |
+
"btnClass": "sfsi-AddThis-notice-dismiss",
|
1855 |
+
"action": "sfsi_dismiss_addThis_icon_notice"
|
1856 |
+
},
|
1857 |
+
|
1858 |
+
{
|
1859 |
+
"btnClass": "sfsi_error_reporting_notice-dismiss",
|
1860 |
+
"action": "sfsi_dismiss_error_reporting_notice"
|
1861 |
+
}
|
1862 |
+
];
|
1863 |
+
|
1864 |
+
SFSI.each(arrDismiss, function (key, valueObj) {
|
1865 |
+
sfsi_dismiss_notice(valueObj.btnClass, valueObj.action);
|
1866 |
+
});
|
1867 |
+
|
1868 |
+
//changes done {Monad}
|
1869 |
+
SFSI(".tab_3_icns").on("click", ".cstomskins_upload", function () {
|
1870 |
+
SFSI(".cstmskins-overlay").show("slow", function () {
|
1871 |
+
e = 0;
|
1872 |
+
});
|
1873 |
+
});
|
1874 |
+
/*SFSI("#custmskin_clspop").live("click", function() {*/
|
1875 |
+
SFSI(document).on("click", '#custmskin_clspop', function () {
|
1876 |
+
SFSI_done();
|
1877 |
+
SFSI(".cstmskins-overlay").hide("slow");
|
1878 |
+
});
|
1879 |
+
|
1880 |
+
create_suscriber_form();
|
1881 |
+
SFSI('input[name="sfsi_form_heading_text"], input[name="sfsi_form_border_thickness"], input[name="sfsi_form_height"], input[name="sfsi_form_width"], input[name="sfsi_form_heading_fontsize"], input[name="sfsi_form_field_text"], input[name="sfsi_form_field_fontsize"], input[name="sfsi_form_button_text"], input[name="sfsi_form_button_fontsize"]').on("keyup", create_suscriber_form);
|
1882 |
+
|
1883 |
+
SFSI('input[name="sfsi_form_border_color"], input[name="sfsi_form_background"] ,input[name="sfsi_form_heading_fontcolor"], input[name="sfsi_form_field_fontcolor"] ,input[name="sfsi_form_button_fontcolor"],input[name="sfsi_form_button_background"]').on("focus", create_suscriber_form);
|
1884 |
+
|
1885 |
+
SFSI("#sfsi_form_heading_font, #sfsi_form_heading_fontstyle, #sfsi_form_heading_fontalign, #sfsi_form_field_font, #sfsi_form_field_fontstyle, #sfsi_form_field_fontalign, #sfsi_form_button_font, #sfsi_form_button_fontstyle, #sfsi_form_button_fontalign").on("change", create_suscriber_form);
|
1886 |
+
|
1887 |
+
/*SFSI(".radio").live("click", function() {*/
|
1888 |
+
SFSI(document).on("click", '.radio', function () {
|
1889 |
+
|
1890 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
1891 |
+
|
1892 |
+
var inputName = s.attr("name");
|
1893 |
+
var inputChecked = s.attr("checked");
|
1894 |
+
|
1895 |
+
switch (inputName) {
|
1896 |
+
case 'sfsi_form_adjustment':
|
1897 |
+
if (s.val() == 'no')
|
1898 |
+
s.parents(".row_tab").next(".row_tab").show("fast");
|
1899 |
+
else
|
1900 |
+
s.parents(".row_tab").next(".row_tab").hide("fast");
|
1901 |
+
create_suscriber_form()
|
1902 |
+
break;
|
1903 |
+
case 'sfsi_form_border':
|
1904 |
+
if (s.val() == 'yes')
|
1905 |
+
s.parents(".row_tab").next(".row_tab").show("fast");
|
1906 |
+
else
|
1907 |
+
s.parents(".row_tab").next(".row_tab").hide("fast");
|
1908 |
+
create_suscriber_form()
|
1909 |
+
break;
|
1910 |
+
case 'sfsi_icons_suppress_errors':
|
1911 |
+
|
1912 |
+
SFSI('input[name="sfsi_icons_suppress_errors"]').removeAttr('checked');
|
1913 |
+
|
1914 |
+
if (s.val() == 'yes')
|
1915 |
+
SFSI('input[name="sfsi_icons_suppress_errors"][value="yes"]').attr('checked', 'true');
|
1916 |
+
else
|
1917 |
+
SFSI('input[name="sfsi_icons_suppress_errors"][value="no"]').attr('checked', 'true');
|
1918 |
+
break;
|
1919 |
+
|
1920 |
+
default:
|
1921 |
+
case 'sfsi_responsive_icons_end_post':
|
1922 |
+
if("yes" == s.val()){
|
1923 |
+
jQuery('.sfsi_responsive_icon_option_li.sfsi_responsive_show').show();
|
1924 |
+
}else{
|
1925 |
+
jQuery('.sfsi_responsive_icon_option_li.sfsi_responsive_show').hide();
|
1926 |
+
}
|
1927 |
+
}
|
1928 |
+
});
|
1929 |
+
|
1930 |
+
SFSI('#sfsi_form_border_color').wpColorPicker({
|
1931 |
+
defaultColor: false,
|
1932 |
+
change: function (event, ui) {
|
1933 |
+
create_suscriber_form()
|
1934 |
+
},
|
1935 |
+
clear: function () {
|
1936 |
+
create_suscriber_form()
|
1937 |
+
},
|
1938 |
+
hide: true,
|
1939 |
+
palettes: true
|
1940 |
+
}),
|
1941 |
+
SFSI('#sfsi_form_background').wpColorPicker({
|
1942 |
+
defaultColor: false,
|
1943 |
+
change: function (event, ui) {
|
1944 |
+
create_suscriber_form()
|
1945 |
+
},
|
1946 |
+
clear: function () {
|
1947 |
+
create_suscriber_form()
|
1948 |
+
},
|
1949 |
+
hide: true,
|
1950 |
+
palettes: true
|
1951 |
+
}),
|
1952 |
+
SFSI('#sfsi_form_heading_fontcolor').wpColorPicker({
|
1953 |
+
defaultColor: false,
|
1954 |
+
change: function (event, ui) {
|
1955 |
+
create_suscriber_form()
|
1956 |
+
},
|
1957 |
+
clear: function () {
|
1958 |
+
create_suscriber_form()
|
1959 |
+
},
|
1960 |
+
hide: true,
|
1961 |
+
palettes: true
|
1962 |
+
}),
|
1963 |
+
SFSI('#sfsi_form_button_fontcolor').wpColorPicker({
|
1964 |
+
defaultColor: false,
|
1965 |
+
change: function (event, ui) {
|
1966 |
+
create_suscriber_form()
|
1967 |
+
},
|
1968 |
+
clear: function () {
|
1969 |
+
create_suscriber_form()
|
1970 |
+
},
|
1971 |
+
hide: true,
|
1972 |
+
palettes: true
|
1973 |
+
}),
|
1974 |
+
SFSI('#sfsi_form_button_background').wpColorPicker({
|
1975 |
+
defaultColor: false,
|
1976 |
+
change: function (event, ui) {
|
1977 |
+
create_suscriber_form()
|
1978 |
+
},
|
1979 |
+
clear: function () {
|
1980 |
+
create_suscriber_form()
|
1981 |
+
},
|
1982 |
+
hide: true,
|
1983 |
+
palettes: true
|
1984 |
+
});
|
1985 |
+
//changes done {Monad}
|
1986 |
+
|
1987 |
+
function i() {
|
1988 |
+
SFSI(".uperror").html(""), afterLoad();
|
1989 |
+
var s = SFSI('input[name="' + SFSI("#upload_id").val() + '"]');
|
1990 |
+
s.removeAttr("checked");
|
1991 |
+
var i = SFSI(s).parent().find("span:first");
|
1992 |
+
return SFSI(i).css("background-position", "0px 0px"), SFSI(".upload-overlay").hide("slow"),
|
1993 |
+
!1;
|
1994 |
+
}
|
1995 |
+
SFSI("#accordion").accordion({
|
1996 |
+
collapsible: !0,
|
1997 |
+
active: !1,
|
1998 |
+
heightStyle: "content",
|
1999 |
+
event: "click",
|
2000 |
+
beforeActivate: function (s, i) {
|
2001 |
+
if (i.newHeader[0]) var e = i.newHeader,
|
2002 |
+
t = e.next(".ui-accordion-content");
|
2003 |
+
else var e = i.oldHeader,
|
2004 |
+
t = e.next(".ui-accordion-content");
|
2005 |
+
var n = "true" == e.attr("aria-selected");
|
2006 |
+
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
2007 |
+
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
2008 |
+
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() : t.slideDown(), !1;
|
2009 |
+
}
|
2010 |
+
}),
|
2011 |
+
SFSI("#accordion1").accordion({
|
2012 |
+
collapsible: !0,
|
2013 |
+
active: !1,
|
2014 |
+
heightStyle: "content",
|
2015 |
+
event: "click",
|
2016 |
+
beforeActivate: function (s, i) {
|
2017 |
+
if (i.newHeader[0]) var e = i.newHeader,
|
2018 |
+
t = e.next(".ui-accordion-content");
|
2019 |
+
else var e = i.oldHeader,
|
2020 |
+
t = e.next(".ui-accordion-content");
|
2021 |
+
var n = "true" == e.attr("aria-selected");
|
2022 |
+
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
2023 |
+
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
2024 |
+
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() : t.slideDown(), !1;
|
2025 |
+
}
|
2026 |
+
}),
|
2027 |
+
|
2028 |
+
SFSI("#accordion2").accordion({
|
2029 |
+
collapsible: !0,
|
2030 |
+
active: !1,
|
2031 |
+
heightStyle: "content",
|
2032 |
+
event: "click",
|
2033 |
+
beforeActivate: function (s, i) {
|
2034 |
+
if (i.newHeader[0]) var e = i.newHeader,
|
2035 |
+
t = e.next(".ui-accordion-content");
|
2036 |
+
else var e = i.oldHeader,
|
2037 |
+
t = e.next(".ui-accordion-content");
|
2038 |
+
var n = "true" == e.attr("aria-selected");
|
2039 |
+
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
2040 |
+
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
2041 |
+
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() : t.slideDown(), !1;
|
2042 |
+
}
|
2043 |
+
}),
|
2044 |
+
SFSI(".closeSec").on("click", function () {
|
2045 |
+
var s = !0,
|
2046 |
+
i = SFSI(this).closest("div.ui-accordion-content").prev("h3.ui-accordion-header").first(),
|
2047 |
+
e = SFSI(this).closest("div.ui-accordion-content").first();
|
2048 |
+
i.toggleClass("ui-corner-all", s).toggleClass("accordion-header-active ui-state-active ui-corner-top", !s).attr("aria-selected", (!s).toString()),
|
2049 |
+
i.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", s).toggleClass("ui-icon-triangle-1-s", !s),
|
2050 |
+
e.toggleClass("accordion-content-active", !s), s ? e.slideUp() : e.slideDown();
|
2051 |
+
}),
|
2052 |
+
SFSI(document).click(function (s) {
|
2053 |
+
var i = SFSI(".sfsi_FrntInner_chg"),
|
2054 |
+
e = SFSI(".sfsi_wDiv"),
|
2055 |
+
t = SFSI("#at15s");
|
2056 |
+
i.is(s.target) || 0 !== i.has(s.target).length || e.is(s.target) || 0 !== e.has(s.target).length || t.is(s.target) || 0 !== t.has(s.target).length || i.fadeOut();
|
2057 |
+
}),
|
2058 |
+
SFSI('#sfsi_popup_background_color').wpColorPicker({
|
2059 |
+
defaultColor: false,
|
2060 |
+
change: function (event, ui) {
|
2061 |
+
sfsi_make_popBox()
|
2062 |
+
},
|
2063 |
+
clear: function () {
|
2064 |
+
sfsi_make_popBox()
|
2065 |
+
},
|
2066 |
+
hide: true,
|
2067 |
+
palettes: true
|
2068 |
+
}),
|
2069 |
+
SFSI('#sfsi_popup_border_color').wpColorPicker({
|
2070 |
+
defaultColor: false,
|
2071 |
+
change: function (event, ui) {
|
2072 |
+
sfsi_make_popBox()
|
2073 |
+
},
|
2074 |
+
clear: function () {
|
2075 |
+
sfsi_make_popBox()
|
2076 |
+
},
|
2077 |
+
hide: true,
|
2078 |
+
palettes: true
|
2079 |
+
}),
|
2080 |
+
SFSI('#sfsi_popup_fontColor').wpColorPicker({
|
2081 |
+
defaultColor: false,
|
2082 |
+
change: function (event, ui) {
|
2083 |
+
sfsi_make_popBox()
|
2084 |
+
},
|
2085 |
+
clear: function () {
|
2086 |
+
sfsi_make_popBox()
|
2087 |
+
},
|
2088 |
+
hide: true,
|
2089 |
+
palettes: true
|
2090 |
+
}),
|
2091 |
+
SFSI("div#sfsiid_linkedin").find(".icon4").find("a").find("img").mouseover(function () {
|
2092 |
+
SFSI(this).attr("src", sfsi_icon_ajax_object.plugin_url + "images/visit_icons/linkedIn_hover.svg");
|
2093 |
+
}),
|
2094 |
+
SFSI("div#sfsiid_linkedin").find(".icon4").find("a").find("img").mouseleave(function () {
|
2095 |
+
SFSI(this).attr("src", sfsi_icon_ajax_object.plugin_url + "images/visit_icons/linkedIn.svg");
|
2096 |
+
}),
|
2097 |
+
SFSI("div#sfsiid_youtube").find(".icon1").find("a").find("img").mouseover(function () {
|
2098 |
+
SFSI(this).attr("src", sfsi_icon_ajax_object.plugin_url + "images/visit_icons/youtube_hover.svg");
|
2099 |
+
}),
|
2100 |
+
SFSI("div#sfsiid_youtube").find(".icon1").find("a").find("img").mouseleave(function () {
|
2101 |
+
SFSI(this).attr("src", sfsi_icon_ajax_object.plugin_url + "images/visit_icons/youtube.svg");
|
2102 |
+
}),
|
2103 |
+
SFSI("div#sfsiid_facebook").find(".icon1").find("a").find("img").mouseover(function () {
|
2104 |
+
SFSI(this).css("opacity", "0.9");
|
2105 |
+
}),
|
2106 |
+
SFSI("div#sfsiid_facebook").find(".icon1").find("a").find("img").mouseleave(function () {
|
2107 |
+
SFSI(this).css("opacity", "1");
|
2108 |
+
}),
|
2109 |
+
SFSI("div#sfsiid_twitter").find(".cstmicon1").find("a").find("img").mouseover(function () {
|
2110 |
+
SFSI(this).css("opacity", "0.9");
|
2111 |
+
}),
|
2112 |
+
SFSI("div#sfsiid_twitter").find(".cstmicon1").find("a").find("img").mouseleave(function () {
|
2113 |
+
SFSI(this).css("opacity", "1");
|
2114 |
+
}),
|
2115 |
+
SFSI("#sfsi_save1").on("click", function () {
|
2116 |
+
// console.log('save1',sfsi_update_step1());
|
2117 |
+
sfsi_update_step1() && sfsicollapse(this);
|
2118 |
+
}),
|
2119 |
+
SFSI("#sfsi_save2").on("click", function () {
|
2120 |
+
sfsi_update_step2() && sfsicollapse(this);
|
2121 |
+
}),
|
2122 |
+
SFSI("#sfsi_save3").on("click", function () {
|
2123 |
+
sfsi_update_step3() && sfsicollapse(this);
|
2124 |
+
}),
|
2125 |
+
SFSI("#sfsi_save4").on("click", function () {
|
2126 |
+
sfsi_update_step4() && sfsicollapse(this);
|
2127 |
+
}),
|
2128 |
+
SFSI("#sfsi_save5").on("click", function () {
|
2129 |
+
sfsi_update_step5() && sfsicollapse(this);
|
2130 |
+
}),
|
2131 |
+
SFSI("#sfsi_save6").on("click", function () {
|
2132 |
+
sfsi_update_step6() && sfsicollapse(this);
|
2133 |
+
}),
|
2134 |
+
SFSI("#sfsi_save7").on("click", function () {
|
2135 |
+
sfsi_update_step7() && sfsicollapse(this);
|
2136 |
+
}),
|
2137 |
+
SFSI("#sfsi_save8").on("click", function () {
|
2138 |
+
sfsi_update_step8() && sfsicollapse(this);
|
2139 |
+
}),
|
2140 |
+
SFSI("#sfsi_save9").on("click", function () {
|
2141 |
+
sfsi_update_step9() && sfsicollapse(this);
|
2142 |
+
}),
|
2143 |
+
SFSI("#save_all_settings").on("click", function () {
|
2144 |
+
return SFSI("#save_all_settings").text("Saving.."), SFSI(".save_button >a").css("pointer-events", "none"),
|
2145 |
+
sfsi_update_step1(), sfsi_update_step8(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Which icons do you want to show on your site?" tab.', 8),
|
2146 |
+
global_error = 0, !1) : (sfsi_update_step2(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "What do you want the icons to do?" tab.', 8),
|
2147 |
+
global_error = 0, !1) : (sfsi_update_step3(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "What design & animation do you want to give your icons?" tab.', 8),
|
2148 |
+
global_error = 0, !1) : (sfsi_update_step4(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Do you want to display "counts" next to your icons?" tab.', 8),
|
2149 |
+
global_error = 0, !1) : (sfsi_update_step5(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Any other wishes for your main icons?" tab.', 8),
|
2150 |
+
global_error = 0, !1) : (sfsi_update_step6(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Do you want to display icons at the end of every post?" tab.', 8),
|
2151 |
+
global_error = 0, !1) : (sfsi_update_step7(), 1 == global_error ? (showErrorSuc("error", 'Some Selection error in "Do you want to display a pop-up, asking people to subscribe?" tab.', 8),
|
2152 |
+
/*global_error = 0, !1) :void (0 == global_error && showErrorSuc("success", 'Saved! Now go to the <a href="widgets.php">widget</a> area and place the widget into your sidebar (if not done already)', 8))))))));*/
|
2153 |
+
global_error = 0, !1) : void(0 == global_error && showErrorSuc("success", '', 8))))))));
|
2154 |
+
}),
|
2155 |
+
/*SFSI(".fileUPInput").live("change", function() {*/
|
2156 |
+
SFSI(document).on("change", '.fileUPInput', function () {
|
2157 |
+
beForeLoad(), beforeIconSubmit(this) && (SFSI(".upload-overlay").css("pointer-events", "none"),
|
2158 |
+
SFSI("#customIconFrm").ajaxForm({
|
2159 |
+
dataType: "json",
|
2160 |
+
success: afterIconSuccess,
|
2161 |
+
resetForm: !0
|
2162 |
+
}).submit());
|
2163 |
+
}),
|
2164 |
+
SFSI(".pop-up").on("click", function () {
|
2165 |
+
("fbex-s2" == SFSI(this).attr("data-id") || "linkex-s2" == SFSI(this).attr("data-id")) && (SFSI("." + SFSI(this).attr("data-id")).hide(),
|
2166 |
+
SFSI("." + SFSI(this).attr("data-id")).css("opacity", "1"), SFSI("." + SFSI(this).attr("data-id")).css("z-index", "1000")),
|
2167 |
+
SFSI("." + SFSI(this).attr("data-id")).show("slow");
|
2168 |
+
}),
|
2169 |
+
/*SFSI("#close_popup").live("click", function() {*/
|
2170 |
+
SFSI(document).on("click", '#close_popup', function () {
|
2171 |
+
SFSI(".read-overlay").hide("slow");
|
2172 |
+
});
|
2173 |
+
|
2174 |
+
var e = 0;
|
2175 |
+
SFSI(".icn_listing").on("click", ".checkbox", function () {
|
2176 |
+
if (1 == e) return !1;
|
2177 |
+
"yes" == SFSI(this).attr("dynamic_ele") && (s = SFSI(this).parent().find("input:checkbox:first"),
|
2178 |
+
s.is(":checked") ? SFSI(s).attr("checked", !1) : SFSI(s).attr("checked", !0)), s = SFSI(this).parent().find("input:checkbox:first"),
|
2179 |
+
"yes" == SFSI(s).attr("isNew") && ("0px 0px" == SFSI(this).css("background-position") ? (SFSI(s).attr("checked", !0),
|
2180 |
+
SFSI(this).css("background-position", "0px -36px")) : (SFSI(s).removeAttr("checked", !0),
|
2181 |
+
SFSI(this).css("background-position", "0px 0px")));
|
2182 |
+
var s = SFSI(this).parent().find("input:checkbox:first");
|
2183 |
+
if (s.is(":checked") && "cusotm-icon" == s.attr("element-type")) SFSI(".fileUPInput").attr("name", "custom_icons[]"),
|
2184 |
+
SFSI(".upload-overlay").show("slow", function () {
|
2185 |
+
e = 0;
|
2186 |
+
}), SFSI("#upload_id").val(s.attr("name"));
|
2187 |
+
else if (!s.is(":checked") && "cusotm-icon" == s.attr("element-type")) return s.attr("ele-type") ? (SFSI(this).attr("checked", !0),
|
2188 |
+
SFSI(this).css("background-position", "0px -36px"), e = 0, !1) : confirm("Are you sure want to delete this Icon..?? ") ? "suc" == sfsi_delete_CusIcon(this, s) ? (s.attr("checked", !1),
|
2189 |
+
SFSI(this).css("background-position", "0px 0px"), e = 0, !1) : (e = 0, !1) : (s.attr("checked", !0),
|
2190 |
+
SFSI(this).css("background-position", "0px -36px"), e = 0, !1);
|
2191 |
+
}),
|
2192 |
+
SFSI(".icn_listing").on("click", ".checkbox", function () {
|
2193 |
+
checked = SFSI(this).parent().find("input:checkbox:first"), "sfsi_email_display" != checked.attr("name") || checked.is(":checked") || SFSI(".demail-1").show("slow");
|
2194 |
+
}),
|
2195 |
+
SFSI("#deac_email2").on("click", function () {
|
2196 |
+
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").show("slow");
|
2197 |
+
}),
|
2198 |
+
SFSI("#deac_email3").on("click", function () {
|
2199 |
+
SFSI(".demail-2").hide("slow"), SFSI(".demail-3").show("slow");
|
2200 |
+
}),
|
2201 |
+
SFSI(".hideemailpop").on("click", function () {
|
2202 |
+
SFSI('input[name="sfsi_email_display"]').attr("checked", !0), SFSI('input[name="sfsi_email_display"]').parent().find("span:first").css("background-position", "0px -36px"),
|
2203 |
+
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"), SFSI(".demail-3").hide("slow");
|
2204 |
+
}),
|
2205 |
+
SFSI(".hidePop").on("click", function () {
|
2206 |
+
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"), SFSI(".demail-3").hide("slow");
|
2207 |
+
}),
|
2208 |
+
SFSI(".activate_footer").on("click", function () {
|
2209 |
+
var nonce = SFSI(this).attr("data-nonce");
|
2210 |
+
SFSI(this).text("activating....");
|
2211 |
+
var s = {
|
2212 |
+
action: "activateFooter",
|
2213 |
+
nonce: nonce
|
2214 |
+
};
|
2215 |
+
SFSI.ajax({
|
2216 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
2217 |
+
type: "post",
|
2218 |
+
data: s,
|
2219 |
+
dataType: "json",
|
2220 |
+
success: function (s) {
|
2221 |
+
if (s.res == "wrong_nonce") {
|
2222 |
+
SFSI(".activate_footer").css("font-size", "18px");
|
2223 |
+
SFSI(".activate_footer").text("Unauthorised Request, Try again after refreshing page");
|
2224 |
+
} else {
|
2225 |
+
"success" == s.res && (SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"),
|
2226 |
+
SFSI(".demail-3").hide("slow"), SFSI(".activate_footer").text("Ok, activate link"));
|
2227 |
+
}
|
2228 |
+
}
|
2229 |
+
});
|
2230 |
+
}),
|
2231 |
+
SFSI(".sfsi_removeFooter").on("click", function () {
|
2232 |
+
var nonce = SFSI(this).attr("data-nonce");
|
2233 |
+
SFSI(this).text("working....");
|
2234 |
+
var s = {
|
2235 |
+
action: "removeFooter",
|
2236 |
+
nonce: nonce
|
2237 |
+
};
|
2238 |
+
SFSI.ajax({
|
2239 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
2240 |
+
type: "post",
|
2241 |
+
data: s,
|
2242 |
+
dataType: "json",
|
2243 |
+
success: function (s) {
|
2244 |
+
if (s.res == "wrong_nonce") {
|
2245 |
+
SFSI(".sfsi_removeFooter").text("Unauthorised Request, Try again after refreshing page");
|
2246 |
+
} else {
|
2247 |
+
"success" == s.res && (SFSI(".sfsi_removeFooter").fadeOut("slow"), SFSI(".sfsi_footerLnk").fadeOut("slow"));
|
2248 |
+
}
|
2249 |
+
}
|
2250 |
+
});
|
2251 |
+
}),
|
2252 |
+
/*SFSI(".radio").live("click", function() {*/
|
2253 |
+
SFSI(document).on("click", '.radio', function () {
|
2254 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
2255 |
+
"sfsi_display_counts" == s.attr("name") && sfsi_show_counts();
|
2256 |
+
}),
|
2257 |
+
SFSI("#close_Uploadpopup").on("click", i), /*SFSI(".radio").live("click", function() {*/ SFSI(document).on("click", '.radio', function () {
|
2258 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
2259 |
+
"sfsi_show_Onposts" == s.attr("name") && sfsi_show_OnpostsDisplay();
|
2260 |
+
}),
|
2261 |
+
sfsi_show_OnpostsDisplay(), sfsi_depened_sections(), sfsi_show_counts(), sfsi_showPreviewCounts(),
|
2262 |
+
SFSI(".share_icon_order").sortable({
|
2263 |
+
update: function () {
|
2264 |
+
SFSI(".share_icon_order li").each(function () {
|
2265 |
+
SFSI(this).attr("data-index", SFSI(this).index() + 1);
|
2266 |
+
});
|
2267 |
+
},
|
2268 |
+
revert: !0
|
2269 |
+
}),
|
2270 |
+
|
2271 |
+
//*------------------------------- Sharing text & pcitures checkbox for showing section in Page, Post STARTS -------------------------------------//
|
2272 |
+
|
2273 |
+
SFSI(document).on("click", '.checkbox', function () {
|
2274 |
+
|
2275 |
+
var s = SFSI(this).parent().find("input:checkbox:first");
|
2276 |
+
var backgroundPos = jQuery(this).css('background-position').split(" ");
|
2277 |
+
var xPos = backgroundPos[0],
|
2278 |
+
yPos = backgroundPos[1];
|
2279 |
+
|
2280 |
+
var inputName = s.attr('name');
|
2281 |
+
var inputChecked = s.attr("checked");
|
2282 |
+
|
2283 |
+
switch (inputName) {
|
2284 |
+
|
2285 |
+
case "sfsi_custom_social_hide":
|
2286 |
+
|
2287 |
+
var val = (yPos == "0px") ? "no" : "yes";
|
2288 |
+
SFSI('input[name="sfsi_custom_social_hide"]').val(val);
|
2289 |
+
|
2290 |
+
break;
|
2291 |
+
|
2292 |
+
case "sfsi_show_via_widget":
|
2293 |
+
case "sfsi_show_via_widget":
|
2294 |
+
case "sfsi_show_via_afterposts":
|
2295 |
+
case "sfsi_custom_social_hide":
|
2296 |
+
|
2297 |
+
var val = (yPos == "0px") ? "no" : "yes";
|
2298 |
+
SFSI('input[name="' + s.attr('name') + '"]').val(val);
|
2299 |
+
|
2300 |
+
break;
|
2301 |
+
|
2302 |
+
case 'sfsi_mouseOver':
|
2303 |
+
|
2304 |
+
var elem = SFSI('input[name="' + inputName + '"]');
|
2305 |
+
|
2306 |
+
var togglelem = SFSI('.mouse-over-effects');
|
2307 |
+
|
2308 |
+
if (inputChecked) {
|
2309 |
+
togglelem.removeClass('hide').addClass('show');
|
2310 |
+
} else {
|
2311 |
+
togglelem.removeClass('show').addClass('hide');
|
2312 |
+
}
|
2313 |
+
|
2314 |
+
break;
|
2315 |
+
case 'sfsi_responsive_facebook_display':
|
2316 |
+
if(inputChecked){
|
2317 |
+
SFSI('.sfsi_responsive_icon_facebook_container').parents('a').show();
|
2318 |
+
var icon= inputName.replace('sfsi_responsive_','').replace('_display','');
|
2319 |
+
if(SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val()!=="Fully responsive"){
|
2320 |
+
window.sfsi_fittext_shouldDisplay=true;
|
2321 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2322 |
+
if(jQuery(a_container).css('display')!=="none"){
|
2323 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2324 |
+
}
|
2325 |
+
})
|
2326 |
+
}
|
2327 |
+
}else{
|
2328 |
+
|
2329 |
+
SFSI('.sfsi_responsive_icon_facebook_container').parents('a').hide();
|
2330 |
+
if(SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val()!=="Fully responsive"){
|
2331 |
+
window.sfsi_fittext_shouldDisplay=true;
|
2332 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2333 |
+
if(jQuery(a_container).css('display')!=="none"){
|
2334 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2335 |
+
}
|
2336 |
+
})
|
2337 |
+
}
|
2338 |
+
}
|
2339 |
+
break;
|
2340 |
+
case 'sfsi_responsive_Twitter_display':
|
2341 |
+
if(inputChecked){
|
2342 |
+
SFSI('.sfsi_responsive_icon_twitter_container').parents('a').show();
|
2343 |
+
var icon= inputName.replace('sfsi_responsive_','').replace('_display','');
|
2344 |
+
if(SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val()!=="Fully responsive"){
|
2345 |
+
window.sfsi_fittext_shouldDisplay=true;
|
2346 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2347 |
+
if(jQuery(a_container).css('display')!=="none"){
|
2348 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2349 |
+
}
|
2350 |
+
})
|
2351 |
+
}
|
2352 |
+
}else{
|
2353 |
+
SFSI('.sfsi_responsive_icon_twitter_container').parents('a').hide();
|
2354 |
+
if(SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val()!=="Fully responsive"){
|
2355 |
+
window.sfsi_fittext_shouldDisplay=true;
|
2356 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2357 |
+
if(jQuery(a_container).css('display')!=="none"){
|
2358 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2359 |
+
}
|
2360 |
+
})
|
2361 |
+
}
|
2362 |
+
}
|
2363 |
+
break;
|
2364 |
+
case 'sfsi_responsive_Follow_display':
|
2365 |
+
if(inputChecked){
|
2366 |
+
SFSI('.sfsi_responsive_icon_follow_container').parents('a').show();
|
2367 |
+
var icon= inputName.replace('sfsi_responsive_','').replace('_display','');
|
2368 |
+
}else{
|
2369 |
+
SFSI('.sfsi_responsive_icon_follow_container').parents('a').hide();
|
2370 |
+
}
|
2371 |
+
window.sfsi_fittext_shouldDisplay=true;
|
2372 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function(index,a_container){
|
2373 |
+
if(jQuery(a_container).css('display')!=="none"){
|
2374 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2375 |
+
}
|
2376 |
+
})
|
2377 |
+
break;
|
2378 |
+
}
|
2379 |
+
|
2380 |
+
});
|
2381 |
+
|
2382 |
+
//*------------------------------- Sharing text & pcitures checkbox for showing section in Page, Post CLOSES -------------------------------------//
|
2383 |
+
|
2384 |
+
SFSI(document).on("click", '.radio', function () {
|
2385 |
+
|
2386 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
2387 |
+
|
2388 |
+
switch (s.attr("name")) {
|
2389 |
+
|
2390 |
+
case 'sfsi_mouseOver_effect_type':
|
2391 |
+
|
2392 |
+
var _val = s.val();
|
2393 |
+
var _name = s.attr("name");
|
2394 |
+
|
2395 |
+
if ('same_icons' == _val) {
|
2396 |
+
SFSI('.same_icons_effects').removeClass('hide').addClass('show');
|
2397 |
+
SFSI('.other_icons_effects_options').removeClass('show').addClass('hide');
|
2398 |
+
} else if ('other_icons' == _val) {
|
2399 |
+
SFSI('.same_icons_effects').removeClass('show').addClass('hide');
|
2400 |
+
SFSI('.other_icons_effects_options').removeClass('hide').addClass('show');
|
2401 |
+
}
|
2402 |
+
|
2403 |
+
break;
|
2404 |
+
}
|
2405 |
+
|
2406 |
+
});
|
2407 |
+
|
2408 |
+
SFSI(document).on("click", '.radio', function () {
|
2409 |
+
|
2410 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
2411 |
+
"sfsi_email_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_email_countsDisplay"]').prop("checked", !0),
|
2412 |
+
SFSI('input[name="sfsi_email_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2413 |
+
"manual" == SFSI("input[name='sfsi_email_countsFrom']:checked").val() ? SFSI("input[name='sfsi_email_manualCounts']").slideDown() : SFSI("input[name='sfsi_email_manualCounts']").slideUp()),
|
2414 |
+
|
2415 |
+
"sfsi_facebook_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_facebook_countsDisplay"]').prop("checked", !0),
|
2416 |
+
SFSI('input[name="sfsi_facebook_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2417 |
+
"mypage" == SFSI("input[name='sfsi_facebook_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_facebook_mypageCounts']").slideDown(), SFSI(".sfsi_fbpgidwpr").slideDown()) : (SFSI("input[name='sfsi_facebook_mypageCounts']").slideUp(), SFSI(".sfsi_fbpgidwpr").slideUp()),
|
2418 |
+
|
2419 |
+
"manual" == SFSI("input[name='sfsi_facebook_countsFrom']:checked").val() ? SFSI("input[name='sfsi_facebook_manualCounts']").slideDown() : SFSI("input[name='sfsi_facebook_manualCounts']").slideUp()),
|
2420 |
+
|
2421 |
+
"sfsi_facebook_countsFrom" == s.attr("name") && (("mypage" == SFSI("input[name='sfsi_facebook_countsFrom']:checked").val() || "likes" == SFSI("input[name='sfsi_facebook_countsFrom']:checked").val()) ? (SFSI(".sfsi_facebook_pagedeasc").slideDown()) : (SFSI(".sfsi_facebook_pagedeasc").slideUp())),
|
2422 |
+
|
2423 |
+
"sfsi_twitter_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_twitter_countsDisplay"]').prop("checked", !0),
|
2424 |
+
SFSI('input[name="sfsi_twitter_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2425 |
+
"manual" == SFSI("input[name='sfsi_twitter_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_twitter_manualCounts']").slideDown(),
|
2426 |
+
SFSI(".tw_follow_options").slideUp()) : (SFSI("input[name='sfsi_twitter_manualCounts']").slideUp(),
|
2427 |
+
SFSI(".tw_follow_options").slideDown())),
|
2428 |
+
|
2429 |
+
|
2430 |
+
"sfsi_linkedIn_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_linkedIn_countsDisplay"]').prop("checked", !0),
|
2431 |
+
SFSI('input[name="sfsi_linkedIn_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2432 |
+
"manual" == SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_linkedIn_manualCounts']").slideDown(),
|
2433 |
+
SFSI(".linkedIn_options").slideUp()) : (SFSI("input[name='sfsi_linkedIn_manualCounts']").slideUp(),
|
2434 |
+
SFSI(".linkedIn_options").slideDown())),
|
2435 |
+
|
2436 |
+
"sfsi_youtube_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_youtube_countsDisplay"]').prop("checked", !0),
|
2437 |
+
SFSI('input[name="sfsi_youtube_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2438 |
+
"manual" == SFSI("input[name='sfsi_youtube_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_youtube_manualCounts']").slideDown(),
|
2439 |
+
SFSI(".youtube_options").slideUp()) : (SFSI("input[name='sfsi_youtube_manualCounts']").slideUp(),
|
2440 |
+
SFSI(".youtube_options").slideDown())), "sfsi_pinterest_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_pinterest_countsDisplay"]').prop("checked", !0),
|
2441 |
+
SFSI('input[name="sfsi_pinterest_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2442 |
+
"manual" == SFSI("input[name='sfsi_pinterest_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_pinterest_manualCounts']").slideDown(),
|
2443 |
+
SFSI(".pin_options").slideUp()) : SFSI("input[name='sfsi_pinterest_manualCounts']").slideUp()),
|
2444 |
+
|
2445 |
+
"sfsi_instagram_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_instagram_countsDisplay"]').prop("checked", !0),
|
2446 |
+
SFSI('input[name="sfsi_instagram_countsDisplay"]').parent().find("span.checkbox").attr("style", "0px -36px;"),
|
2447 |
+
"manual" == SFSI("input[name='sfsi_instagram_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_instagram_manualCounts']").slideDown(),
|
2448 |
+
SFSI(".instagram_userLi").slideUp()) : (SFSI("input[name='sfsi_instagram_manualCounts']").slideUp(),
|
2449 |
+
SFSI(".instagram_userLi").slideDown()));
|
2450 |
+
|
2451 |
+
}),
|
2452 |
+
|
2453 |
+
sfsi_make_popBox(),
|
2454 |
+
|
2455 |
+
SFSI('input[name="sfsi_popup_text"] ,input[name="sfsi_popup_background_color"],input[name="sfsi_popup_border_color"],input[name="sfsi_popup_border_thickness"],input[name="sfsi_popup_fontSize"],input[name="sfsi_popup_fontColor"]').on("keyup", sfsi_make_popBox),
|
2456 |
+
SFSI('input[name="sfsi_popup_text"] ,input[name="sfsi_popup_background_color"],input[name="sfsi_popup_border_color"],input[name="sfsi_popup_border_thickness"],input[name="sfsi_popup_fontSize"],input[name="sfsi_popup_fontColor"]').on("focus", sfsi_make_popBox),
|
2457 |
+
|
2458 |
+
SFSI("#sfsi_popup_font ,#sfsi_popup_fontStyle").on("change", sfsi_make_popBox),
|
2459 |
+
|
2460 |
+
/*SFSI(".radio").live("click", function(){*/
|
2461 |
+
SFSI(document).on("click", '.radio', function () {
|
2462 |
+
|
2463 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
2464 |
+
|
2465 |
+
if ("sfsi_icons_floatPosition" == s.attr("name")) {
|
2466 |
+
SFSI('input[name="sfsi_icons_floatPosition"]').removeAttr("checked");
|
2467 |
+
s.attr("checked", true);
|
2468 |
+
}
|
2469 |
+
|
2470 |
+
if ("sfsi_disable_floaticons" == s.attr("name")) {
|
2471 |
+
SFSI('input[name="sfsi_disable_floaticons"]').removeAttr("checked");
|
2472 |
+
s.attr("checked", true);
|
2473 |
+
}
|
2474 |
+
|
2475 |
+
"sfsi_popup_border_shadow" == s.attr("name") && sfsi_make_popBox();
|
2476 |
+
}), /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent) ? SFSI("img.sfsi_wicon").on("click", function (s) {
|
2477 |
+
s.stopPropagation();
|
2478 |
+
var i = SFSI("#sfsi_floater_sec").val();
|
2479 |
+
SFSI("div.sfsi_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_wicons").find(".inerCnt").find("div.sfsi_tool_tip_2").hide(),
|
2480 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_tool_tip_2").css("z-index", "0"),
|
2481 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_wicons").find(".inerCnt").find("div.sfsi_tool_tip_2").hide()),
|
2482 |
+
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
2483 |
+
"z-index": "999"
|
2484 |
+
}), SFSI(this).attr("data-effect") && "fade_in" == SFSI(this).attr("data-effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2485 |
+
opacity: 1,
|
2486 |
+
"z-index": 10
|
2487 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("data-effect") && "scale" == SFSI(this).attr("data-effect") && (SFSI(this).parent().addClass("scale"),
|
2488 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2489 |
+
opacity: 1,
|
2490 |
+
"z-index": 10
|
2491 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("data-effect") && "combo" == SFSI(this).attr("data-effect") && (SFSI(this).parent().addClass("scale"),
|
2492 |
+
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2493 |
+
opacity: 1,
|
2494 |
+
"z-index": 10
|
2495 |
+
})), ("top-left" == i || "top-right" == i) && SFSI(this).parent().parent().parent().parent("#sfsi_floater").length > 0 && "sfsi_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").addClass("sfsi_plc_btm"),
|
2496 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
2497 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2498 |
+
opacity: 1,
|
2499 |
+
"z-index": 10
|
2500 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").show()) : (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
2501 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").removeClass("sfsi_plc_btm"),
|
2502 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2503 |
+
opacity: 1,
|
2504 |
+
"z-index": 1e3
|
2505 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").show());
|
2506 |
+
}) : SFSI("img.sfsi_wicon").on("mouseenter", function () {
|
2507 |
+
var s = SFSI("#sfsi_floater_sec").val();
|
2508 |
+
SFSI("div.sfsi_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_wicons").find(".inerCnt").find("div.sfsi_tool_tip_2").hide(),
|
2509 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_tool_tip_2").css("z-index", "0"),
|
2510 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_wicons").find(".inerCnt").find("div.sfsi_tool_tip_2").hide()),
|
2511 |
+
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
2512 |
+
"z-index": "999"
|
2513 |
+
}), SFSI(this).attr("data-effect") && "fade_in" == SFSI(this).attr("data-effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2514 |
+
opacity: 1,
|
2515 |
+
"z-index": 10
|
2516 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("data-effect") && "scale" == SFSI(this).attr("data-effect") && (SFSI(this).parent().addClass("scale"),
|
2517 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2518 |
+
opacity: 1,
|
2519 |
+
"z-index": 10
|
2520 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("data-effect") && "combo" == SFSI(this).attr("data-effect") && (SFSI(this).parent().addClass("scale"),
|
2521 |
+
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2522 |
+
opacity: 1,
|
2523 |
+
"z-index": 10
|
2524 |
+
})), ("top-left" == s || "top-right" == s) && SFSI(this).parent().parent().parent().parent("#sfsi_floater").length > 0 && "sfsi_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").addClass("sfsi_plc_btm"),
|
2525 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
2526 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2527 |
+
opacity: 1,
|
2528 |
+
"z-index": 10
|
2529 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").show()) : (SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
2530 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").removeClass("sfsi_plc_btm"),
|
2531 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").css({
|
2532 |
+
opacity: 1,
|
2533 |
+
"z-index": 10
|
2534 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_tool_tip_2").show());
|
2535 |
+
}), SFSI("div.sfsi_wicons").on("mouseleave", function () {
|
2536 |
+
SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && "fade_in" == SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && SFSI(this).children("div.inerCnt").find("a.sficn").css("opacity", "0.6"),
|
2537 |
+
SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && "scale" == SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && SFSI(this).children("div.inerCnt").find("a.sficn").removeClass("scale"),
|
2538 |
+
SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && "combo" == SFSI(this).children("div.inerCnt").children("a.sficn").attr("data-effect") && (SFSI(this).children("div.inerCnt").find("a.sficn").css("opacity", "0.6"),
|
2539 |
+
SFSI(this).children("div.inerCnt").find("a.sficn").removeClass("scale")), SFSI(this).children(".inerCnt").find("div.sfsi_tool_tip_2").hide();
|
2540 |
+
}), SFSI("body").on("click", function () {
|
2541 |
+
SFSI(".inerCnt").find("div.sfsi_tool_tip_2").hide();
|
2542 |
+
}), SFSI(".adminTooltip >a").on("hover", function () {
|
2543 |
+
SFSI(this).offset().top, SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").css("opacity", "1"),
|
2544 |
+
SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").show();
|
2545 |
+
}), SFSI(".adminTooltip").on("mouseleave", function () {
|
2546 |
+
"none" != SFSI(".gpls_tool_bdr").css("display") && 0 != SFSI(".gpls_tool_bdr").css("opacity") ? SFSI(".pop_up_box ").on("click", function () {
|
2547 |
+
SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").css("opacity", "0"), SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").hide();
|
2548 |
+
}) : (SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").css("opacity", "0"),
|
2549 |
+
SFSI(this).parent("div").find("div.sfsi_tool_tip_2_inr").hide());
|
2550 |
+
}), SFSI(".expand-area").on("click", function () {
|
2551 |
+
"Read more" == SFSI(this).text() ? (SFSI(this).siblings("p").children("label").fadeIn("slow"),
|
2552 |
+
SFSI(this).text("Collapse")) : (SFSI(this).siblings("p").children("label").fadeOut("slow"),
|
2553 |
+
SFSI(this).text("Read more"));
|
2554 |
+
}), /*SFSI(".radio").live("click", function() {*/ SFSI(document).on("click", '.radio', function () {
|
2555 |
+
|
2556 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
2557 |
+
|
2558 |
+
"sfsi_icons_float" == s.attr("name") && "yes" == s.val() && (SFSI(".float_options").slideDown("slow"),
|
2559 |
+
|
2560 |
+
SFSI('input[name="sfsi_icons_stick"][value="no"]').attr("checked", !0), SFSI('input[name="sfsi_icons_stick"][value="yes"]').removeAttr("checked"),
|
2561 |
+
SFSI('input[name="sfsi_icons_stick"][value="no"]').parent().find("span").attr("style", "0px -41px;"),
|
2562 |
+
SFSI('input[name="sfsi_icons_stick"][value="yes"]').parent().find("span").attr("style", "0px -0px;")),
|
2563 |
+
|
2564 |
+
//("sfsi_icons_stick" == s.attr("name") && "yes" == s.val() || "sfsi_icons_float" == s.attr("name") && "no" == s.val()) && (SFSI(".float_options").slideUp("slow"),
|
2565 |
+
("sfsi_icons_stick" == s.attr("name") && "yes" == s.val()) && (SFSI(".float_options").slideUp("slow"),
|
2566 |
+
|
2567 |
+
SFSI('input[name="sfsi_icons_float"][value="no"]').prop("checked", !0), SFSI('input[name="sfsi_icons_float"][value="yes"]').prop("checked", !1),
|
2568 |
+
SFSI('input[name="sfsi_icons_float"][value="no"]').parent().find("span.radio").attr("style", "0px -41px;"),
|
2569 |
+
SFSI('input[name="sfsi_icons_float"][value="yes"]').parent().find("span.radio").attr("style", "0px -0px;"));
|
2570 |
+
|
2571 |
+
}),
|
2572 |
+
|
2573 |
+
SFSI(".sfsi_wDiv").length > 0 && setTimeout(function () {
|
2574 |
+
var s = parseInt(SFSI(".sfsi_wDiv").height()) + 0 + "px";
|
2575 |
+
SFSI(".sfsi_holders").each(function () {
|
2576 |
+
SFSI(this).css("height", s);
|
2577 |
+
});
|
2578 |
+
}, 200),
|
2579 |
+
/*SFSI(".checkbox").live("click", function() {*/
|
2580 |
+
SFSI(document).on("click", '.checkbox', function () {
|
2581 |
+
var s = SFSI(this).parent().find("input:checkbox:first");
|
2582 |
+
("sfsi_shuffle_Firstload" == s.attr("name") && "checked" == s.attr("checked") || "sfsi_shuffle_interval" == s.attr("name") && "checked" == s.attr("checked")) && (SFSI('input[name="sfsi_shuffle_icons"]').parent().find("span").css("background-position", "0px -36px"),
|
2583 |
+
SFSI('input[name="sfsi_shuffle_icons"]').attr("checked", "checked")), "sfsi_shuffle_icons" == s.attr("name") && "checked" != s.attr("checked") && (SFSI('input[name="sfsi_shuffle_Firstload"]').removeAttr("checked"),
|
2584 |
+
SFSI('input[name="sfsi_shuffle_Firstload"]').parent().find("span").css("background-position", "0px 0px"),
|
2585 |
+
SFSI('input[name="sfsi_shuffle_interval"]').removeAttr("checked"), SFSI('input[name="sfsi_shuffle_interval"]').parent().find("span").css("background-position", "0px 0px"));
|
2586 |
+
});
|
2587 |
+
|
2588 |
+
SFSI("body").on("click", "#sfsi_getMeFullAccess", function () {
|
2589 |
+
var email = SFSI(this).parents("form").find("input[type='email']").val();
|
2590 |
+
var feedid = SFSI(this).parents("form").find("input[name='feed_id']").val();
|
2591 |
+
var error = false;
|
2592 |
+
var regEx = /^\w+([-+.']\w+)*@\w+([-.]\w+)*\.\w+([-.]\w+)*$/;
|
2593 |
+
|
2594 |
+
if (email === '') {
|
2595 |
+
error = true;
|
2596 |
+
}
|
2597 |
+
|
2598 |
+
if (!regEx.test(email)) {
|
2599 |
+
error = true;
|
2600 |
+
}
|
2601 |
+
|
2602 |
+
if (!error) {
|
2603 |
+
console.log("feedid",feedid);
|
2604 |
+
if (feedid=="" || undefined==feedid){
|
2605 |
+
var nonce = SFSI(this).attr('data-nonce-fetch-feed-id');
|
2606 |
+
e = {
|
2607 |
+
action: "sfsi_get_feed_id",
|
2608 |
+
nonce: nonce,
|
2609 |
+
};
|
2610 |
+
SFSI.ajax({
|
2611 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
2612 |
+
type: "post",
|
2613 |
+
data: e,
|
2614 |
+
dataType: "json",
|
2615 |
+
async: !0,
|
2616 |
+
success: function (s) {
|
2617 |
+
if (s.res == "wrong_nonce") {
|
2618 |
+
alert("Error: Unauthorised Request, Try again after refreshing page.");
|
2619 |
+
} else {
|
2620 |
+
if("success" == s.res){
|
2621 |
+
var feedid = s.feed_id;
|
2622 |
+
if(feedid=="" || null == feedid){
|
2623 |
+
alert("Error: Claiming didn't work. Please try again later.")
|
2624 |
+
}else{
|
2625 |
+
jQuery('#calimingOptimizationForm input[name="feed_id"]').val(feedid);
|
2626 |
+
console.log("feedid",feedid,SFSI("#calimingOptimizationForm input[name='feed_id']"),SFSI('#calimingOptimizationForm input[name="feedid"]').val());
|
2627 |
+
SFSI('#calimingOptimizationForm').submit();
|
2628 |
+
}
|
2629 |
+
}else{
|
2630 |
+
if("failed"==s.res){
|
2631 |
+
alert("Error: "+s.message+".");
|
2632 |
+
|
2633 |
+
}else{
|
2634 |
+
alert("Error: Please try again.");
|
2635 |
+
}
|
2636 |
+
}
|
2637 |
+
}
|
2638 |
+
}
|
2639 |
+
});
|
2640 |
+
}else{
|
2641 |
+
SFSI(this).parents("form").submit();
|
2642 |
+
}
|
2643 |
+
} else {
|
2644 |
+
alert("Error: Please provide your email address.");
|
2645 |
+
}
|
2646 |
+
});
|
2647 |
+
|
2648 |
+
SFSI('form#calimingOptimizationForm').on('keypress', function (e) {
|
2649 |
+
var keyCode = e.keyCode || e.which;
|
2650 |
+
if (keyCode === 13) {
|
2651 |
+
e.preventDefault();
|
2652 |
+
return false;
|
2653 |
+
}
|
2654 |
+
});
|
2655 |
+
|
2656 |
+
/*SFSI(".checkbox").live("click", function()
|
2657 |
+
{
|
2658 |
+
var s = SFSI(this).parent().find("input:checkbox:first");
|
2659 |
+
"float_on_page" == s.attr("name") && "yes" == s.val() && (
|
2660 |
+
SFSI('input[name="sfsi_icons_stick"][value="no"]').attr("checked", !0), SFSI('input[name="sfsi_icons_stick"][value="yes"]').removeAttr("checked"),
|
2661 |
+
SFSI('input[name="sfsi_icons_stick"][value="no"]').parent().find("span").attr("style", "0px -41px;"),
|
2662 |
+
SFSI('input[name="sfsi_icons_stick"][value="yes"]').parent().find("span").attr("style", "0px -0px;"));
|
2663 |
+
});
|
2664 |
+
SFSI(".radio").live("click", function()
|
2665 |
+
{
|
2666 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
2667 |
+
var a = SFSI(".cstmfltonpgstck");
|
2668 |
+
("sfsi_icons_stick" == s.attr("name") && "yes" == s.val()) && (
|
2669 |
+
SFSI('input[name="float_on_page"][value="no"]').prop("checked", !0), SFSI('input[name="float_on_page"][value="yes"]').prop("checked", !1),
|
2670 |
+
SFSI('input[name="float_on_page"][value="no"]').parent().find("span.checkbox").attr("style", "0px -41px;"),
|
2671 |
+
SFSI('input[name="float_on_page"][value="yes"]').parent().find("span.checkbox").attr("style", "0px -0px;"),
|
2672 |
+
jQuery(a).children(".checkbox").css("background-position", "0px 0px" ), toggleflotpage(a));
|
2673 |
+
});*/
|
2674 |
+
window.sfsi_initialization_checkbox_count = 0;
|
2675 |
+
window.sfsi_initialization_checkbox = setInterval(function () {
|
2676 |
+
// console.log(jQuery('.radio_section.tb_4_ck>span.checkbox').length,jQuery('.radio_section.tb_4_ck>input.styled').length);
|
2677 |
+
if (jQuery('.radio_section.tb_4_ck>span.checkbox').length < jQuery('.radio_section.tb_4_ck>input.styled').length) {
|
2678 |
+
window.sfsi_initialization_checkbox_count++;
|
2679 |
+
// console.log('not initialized',window.sfsi_initialization_checkbox_count);
|
2680 |
+
if (window.sfsi_initialization_checkbox_count > 12) {
|
2681 |
+
// alert('Some script from diffrent plugin is interfearing with "Ultimate Social Icons" js files and checkbox couldn\'t be initialized. ');
|
2682 |
+
// window.clearInterval(window.sfsi_initialization_checkbox);
|
2683 |
+
}
|
2684 |
+
} else {
|
2685 |
+
// console.log('all initialized',window.sfsi_initialization_checkbox_count);
|
2686 |
+
window.clearInterval(window.sfsi_initialization_checkbox);
|
2687 |
+
}
|
2688 |
+
}, 1000);
|
2689 |
+
sfsi_responsive_icon_intraction_handler();
|
2690 |
+
|
2691 |
+
});
|
2692 |
+
|
2693 |
+
//for utube channel name and id
|
2694 |
+
function showhideutube(ref) {
|
2695 |
+
var chnlslctn = SFSI(ref).children("input").val();
|
2696 |
+
if (chnlslctn == "name") {
|
2697 |
+
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideDown();
|
2698 |
+
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideUp();
|
2699 |
+
} else {
|
2700 |
+
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideDown();
|
2701 |
+
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideUp();
|
2702 |
+
}
|
2703 |
+
}
|
2704 |
+
|
2705 |
+
function checkforinfoslction(ref) {
|
2706 |
+
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
2707 |
+
|
2708 |
+
var rightInfoClass = jQuery(ref).next().attr('class');
|
2709 |
+
|
2710 |
+
var rightInfoPElem = jQuery(ref).next("." + rightInfoClass).children("p").first();
|
2711 |
+
|
2712 |
+
var elemName = 'label';
|
2713 |
+
|
2714 |
+
if (pos == "0px 0px") {
|
2715 |
+
rightInfoPElem.children(elemName).hide();
|
2716 |
+
} else {
|
2717 |
+
rightInfoPElem.children(elemName).show();
|
2718 |
+
}
|
2719 |
+
}
|
2720 |
+
|
2721 |
+
function checkforinfoslction_checkbox(ref) {
|
2722 |
+
|
2723 |
+
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
2724 |
+
|
2725 |
+
var elem = jQuery(ref).parent().children('.sfsi_right_info').find('.kckslctn');
|
2726 |
+
|
2727 |
+
if (pos == "0px 0px") {
|
2728 |
+
elem.hide();
|
2729 |
+
} else {
|
2730 |
+
elem.show();
|
2731 |
+
}
|
2732 |
+
}
|
2733 |
+
|
2734 |
+
function sfsi_toggleflotpage_que3(ref) {
|
2735 |
+
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
2736 |
+
if (pos == "0px 0px") {
|
2737 |
+
jQuery(ref).next(".sfsi_right_info").hide();
|
2738 |
+
|
2739 |
+
} else {
|
2740 |
+
jQuery(ref).next(".sfsi_right_info").show();
|
2741 |
+
}
|
2742 |
+
}
|
2743 |
+
|
2744 |
+
var initTop = new Array();
|
2745 |
+
|
2746 |
+
SFSI('.sfsi_navigate_to_question7').on("click", function () {
|
2747 |
+
|
2748 |
+
var elem = SFSI('#ui-id-6');
|
2749 |
+
|
2750 |
+
if (elem.hasClass('accordion-content-active')) {
|
2751 |
+
|
2752 |
+
// Cloase tab of Question 3
|
2753 |
+
elem.find('.sfsiColbtn').trigger('click');
|
2754 |
+
|
2755 |
+
// Open tab of Question 7
|
2756 |
+
if (!SFSI('#ui-id-14').hasClass('accordion-content-active')) {
|
2757 |
+
SFSI('#ui-id-13').trigger('click');
|
2758 |
+
}
|
2759 |
+
|
2760 |
+
var pos = SFSI("#ui-id-13").offset();
|
2761 |
+
var scrollToPos = pos.top - SFSI(window).height() * 0.99 + 30;
|
2762 |
+
SFSI('html,body').animate({
|
2763 |
+
scrollTop: scrollToPos
|
2764 |
+
}, 500);
|
2765 |
+
}
|
2766 |
+
});
|
2767 |
+
|
2768 |
+
SFSI("body").on("click", ".sfsi_tokenGenerateButton a", function () {
|
2769 |
+
var clienId = SFSI("input[name='sfsi_instagram_clientid']").val();
|
2770 |
+
var redirectUrl = SFSI("input[name='sfsi_instagram_appurl']").val();
|
2771 |
+
|
2772 |
+
var scope = "basic";
|
2773 |
+
var instaUrl = "https://www.instagram.com/oauth/authorize/?client_id=<id>&redirect_uri=<url>&response_type=token&scope=" + scope;
|
2774 |
+
|
2775 |
+
if (clienId !== '' && redirectUrl !== '') {
|
2776 |
+
instaUrl = instaUrl.replace('<id>', clienId);
|
2777 |
+
instaUrl = instaUrl.replace('<url>', redirectUrl);
|
2778 |
+
|
2779 |
+
window.open(instaUrl, '_blank');
|
2780 |
+
} else {
|
2781 |
+
alert("Please enter client id and redirect url first");
|
2782 |
+
}
|
2783 |
+
|
2784 |
+
});
|
2785 |
+
SFSI(document).ready(function () {
|
2786 |
+
|
2787 |
+
SFSI('#sfsi_jivo_offline_chat .tab-link').click(function () {
|
2788 |
+
var cur = SFSI(this);
|
2789 |
+
if (!cur.hasClass('active')) {
|
2790 |
+
var target = cur.find('a').attr('href');
|
2791 |
+
cur.parent().children().removeClass('active');
|
2792 |
+
cur.addClass('active');
|
2793 |
+
SFSI('#sfsi_jivo_offline_chat .tabs').children().hide();
|
2794 |
+
SFSI(target).show();
|
2795 |
+
}
|
2796 |
+
});
|
2797 |
+
SFSI('#sfsi_jivo_offline_chat #sfsi_sales form').submit(function (event) {
|
2798 |
+
event & event.preventDefault();
|
2799 |
+
// console.log(event);
|
2800 |
+
var target = SFSI(this).parents('.tab-content');
|
2801 |
+
var message = SFSI(this).find('textarea[name="question"]').val();
|
2802 |
+
var email = SFSI(this).find('input[name="email"]').val();
|
2803 |
+
var re = /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/;
|
2804 |
+
var nonce = SFSI(this).find('input[name="nonce"]').val();
|
2805 |
+
|
2806 |
+
if ("" === email || false === re.test(String(email).toLowerCase())) {
|
2807 |
+
// console.log(SFSI(this).find('input[name="email"]'));
|
2808 |
+
SFSI(this).find('input[name="email"]').css('background-color', 'red');
|
2809 |
+
SFSI(this).find('input[name="email"]').on('keyup', function () {
|
2810 |
+
var re = /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/;
|
2811 |
+
var email = SFSI(this).val();
|
2812 |
+
// console.log(email,re.test(String(email).toLowerCase()) );
|
2813 |
+
if ("" !== email && true === re.test(String(email).toLowerCase())) {
|
2814 |
+
SFSI(this).css('background-color', '#fff');
|
2815 |
+
}
|
2816 |
+
})
|
2817 |
+
return false;
|
2818 |
+
|
2819 |
+
}
|
2820 |
+
SFSI.ajax({
|
2821 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
2822 |
+
type: "post",
|
2823 |
+
data: {
|
2824 |
+
action: "sfsiOfflineChatMessage",
|
2825 |
+
message: message,
|
2826 |
+
email: email,
|
2827 |
+
'nonce': nonce
|
2828 |
+
}
|
2829 |
+
}).done(function () {
|
2830 |
+
target.find('.before_message_sent').hide();
|
2831 |
+
target.find('.after_message_sent').show();
|
2832 |
+
});
|
2833 |
+
})
|
2834 |
+
});
|
2835 |
+
|
2836 |
+
function sfsi_close_offline_chat(e) {
|
2837 |
+
e && e.preventDefault();
|
2838 |
+
|
2839 |
+
SFSI('#sfsi_jivo_offline_chat').hide();
|
2840 |
+
SFSI('#sfsi_dummy_chat_icon').show();
|
2841 |
+
}
|
2842 |
+
|
2843 |
+
function sfsi_open_quick_checkout(e) {
|
2844 |
+
e && e.preventDefault();
|
2845 |
+
// console.log(jQuery('.sfsi_quick-pay-box'));
|
2846 |
+
jQuery('.sfsi_quick-pay-box').show();
|
2847 |
+
}
|
2848 |
+
|
2849 |
+
function sfsi_close_quickpay(e) {
|
2850 |
+
e && e.preventDefault();
|
2851 |
+
jQuery('.sfsi_quickpay-overlay').hide();
|
2852 |
+
}
|
2853 |
+
|
2854 |
+
function sfsi_quickpay_container_click(event) {
|
2855 |
+
if (jQuery(event.target).hasClass('sellcodes-quick-purchase')) {
|
2856 |
+
jQuery(jQuery(event.target).find('p.sc-button img')[0]).click();
|
2857 |
+
}
|
2858 |
+
}
|
2859 |
+
|
2860 |
+
|
2861 |
+
|
2862 |
+
// <------------------------* Responsive icon *----------------------->
|
2863 |
+
|
2864 |
+
function sfsi_responsive_icon_intraction_handler() {
|
2865 |
+
window.sfsi_fittext_shouldDisplay = true;
|
2866 |
+
SFSI('select[name="sfsi_responsive_icons_settings_edge_type"]').on('change', function () {
|
2867 |
+
$target_div = (SFSI(this).parent());
|
2868 |
+
if (SFSI(this).val() === "Round") {
|
2869 |
+
console.log('Round', 'Round', SFSI(this).val());
|
2870 |
+
|
2871 |
+
$target_div.parent().children().css('display', 'inline-block');
|
2872 |
+
$target_div.parent().next().css("display","inline-block");
|
2873 |
+
var radius = jQuery('select[name="sfsi_responsive_icons_settings_edge_radius"]').val() + 'px'
|
2874 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('border-radius', radius);
|
2875 |
+
|
2876 |
+
} else {
|
2877 |
+
console.log('sharp', 'sharp', SFSI(this).val(), $target_div.parent().children(), $target_div.parent().children().hide());
|
2878 |
+
|
2879 |
+
$target_div.parent().children().hide();
|
2880 |
+
$target_div.show();
|
2881 |
+
$target_div.parent().next().hide();
|
2882 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('border-radius', 'unset');
|
2883 |
+
|
2884 |
+
}
|
2885 |
+
});
|
2886 |
+
SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').on('change', function () {
|
2887 |
+
$target_div = (SFSI(this).parent());
|
2888 |
+
if (SFSI(this).val() === "Fixed icon width") {
|
2889 |
+
$target_div.parent().children().css('display', 'inline-block');
|
2890 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').css('width', 'auto').css('display', 'flex');
|
2891 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a').css('flex-basis', 'unset');
|
2892 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').css('width', jQuery('input[name="sfsi_responsive_icons_sttings_icon_width_size"]').val());
|
2893 |
+
|
2894 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container_box_fully_container').removeClass('sfsi_icons_container_box_fully_container').addClass('sfsi_icons_container_box_fixed_container');
|
2895 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container_box_fixed_container').removeClass('sfsi_icons_container_box_fully_container').addClass('sfsi_icons_container_box_fixed_container');
|
2896 |
+
window.sfsi_fittext_shouldDisplay = true;
|
2897 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2898 |
+
if (jQuery(a_container).css('display') !== "none") {
|
2899 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2900 |
+
}
|
2901 |
+
})
|
2902 |
+
} else {
|
2903 |
+
$target_div.parent().children().hide();
|
2904 |
+
$target_div.show();
|
2905 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').css('width', '100%').css('display', 'flex');
|
2906 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a').css('flex-basis', '100%');
|
2907 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').css('width', '100%');
|
2908 |
+
|
2909 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container_box_fixed_container').removeClass('sfsi_icons_container_box_fixed_container').addClass('sfsi_icons_container_box_fully_container');
|
2910 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container_box_fully_container').removeClass('sfsi_icons_container_box_fixed_container').addClass('sfsi_icons_container_box_fully_container');
|
2911 |
+
window.sfsi_fittext_shouldDisplay = true;
|
2912 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2913 |
+
if (jQuery(a_container).css('display') !== "none") {
|
2914 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2915 |
+
}
|
2916 |
+
})
|
2917 |
+
}
|
2918 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').removeClass('sfsi_fixed_count_container').removeClass('sfsi_responsive_count_container').addClass('sfsi_' + (jQuery(this).val() == "Fully responsive" ? 'responsive' : 'fixed') + '_count_container')
|
2919 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container>a').removeClass('sfsi_responsive_fluid').removeClass('sfsi_responsive_fixed_width').addClass('sfsi_responsive_' + (jQuery(this).val() == "Fully responsive" ? 'fluid' : 'fixed_width'))
|
2920 |
+
sfsi_resize_icons_container();
|
2921 |
+
|
2922 |
+
})
|
2923 |
+
jQuery(document).on('keyup', 'input[name="sfsi_responsive_icons_sttings_icon_width_size"]', function () {
|
2924 |
+
if (SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val() === "Fixed icon width") {
|
2925 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').css('width', jQuery(this).val() + 'px');
|
2926 |
+
window.sfsi_fittext_shouldDisplay = true;
|
2927 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2928 |
+
if (jQuery(a_container).css('display') !== "none") {
|
2929 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2930 |
+
}
|
2931 |
+
})
|
2932 |
+
}
|
2933 |
+
sfsi_resize_icons_container();
|
2934 |
+
});
|
2935 |
+
jQuery(document).on('change', 'input[name="sfsi_responsive_icons_sttings_icon_width_size"]', function () {
|
2936 |
+
if (SFSI('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val() === "Fixed icon width") {
|
2937 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').css('width', jQuery(this).val() + 'px');
|
2938 |
+
}
|
2939 |
+
});
|
2940 |
+
jQuery(document).on('keyup', 'input[name="sfsi_responsive_icons_settings_margin"]', function () {
|
2941 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('margin-right', jQuery(this).val() + 'px');
|
2942 |
+
});
|
2943 |
+
jQuery(document).on('change', 'input[name="sfsi_responsive_icons_settings_margin"]', function () {
|
2944 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('margin-right', jQuery(this).val() + 'px');
|
2945 |
+
// jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').css('width',(jQuery('.sfsi_responsive_icons').width()-(jQuery('.sfsi_responsive_icons_count').width()+jQuery(this).val()))+'px');
|
2946 |
+
|
2947 |
+
});
|
2948 |
+
jQuery(document).on('change', 'select[name="sfsi_responsive_icons_settings_text_align"]', function () {
|
2949 |
+
if (jQuery(this).val() === "Centered") {
|
2950 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a').css('text-align', 'center');
|
2951 |
+
} else {
|
2952 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container a').css('text-align', 'left');
|
2953 |
+
}
|
2954 |
+
});
|
2955 |
+
jQuery('.sfsi_responsive_default_icon_container input.sfsi_responsive_input').on('keyup', function () {
|
2956 |
+
jQuery(this).parent().find('.sfsi_responsive_icon_item_container').find('span').text(jQuery(this).val());
|
2957 |
+
var iconName = jQuery(this).attr('name');
|
2958 |
+
var icon = iconName.replace('sfsi_responsive_', '').replace('_input', '');
|
2959 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_' + (icon.toLowerCase()) + '_container span').text(jQuery(this).val());
|
2960 |
+
window.sfsi_fittext_shouldDisplay = true;
|
2961 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2962 |
+
if (jQuery(a_container).css('display') !== "none") {
|
2963 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2964 |
+
}
|
2965 |
+
})
|
2966 |
+
sfsi_resize_icons_container();
|
2967 |
+
})
|
2968 |
+
jQuery('.sfsi_responsive_custom_icon_container input.sfsi_responsive_input').on('keyup', function () {
|
2969 |
+
jQuery(this).parent().find('.sfsi_responsive_icon_item_container').find('span').text(jQuery(this).val());
|
2970 |
+
var iconName = jQuery(this).attr('name');
|
2971 |
+
var icon = iconName.replace('sfsi_responsive_custom_', '').replace('_input', '');
|
2972 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_' + icon + '_container span').text(jQuery(this).val())
|
2973 |
+
window.sfsi_fittext_shouldDisplay = true;
|
2974 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
2975 |
+
if (jQuery(a_container).css('display') !== "none") {
|
2976 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
2977 |
+
}
|
2978 |
+
})
|
2979 |
+
sfsi_resize_icons_container();
|
2980 |
+
|
2981 |
+
})
|
2982 |
+
|
2983 |
+
jQuery('.sfsi_responsive_default_url_toggler').click(function (event) {
|
2984 |
+
|
2985 |
+
event.preventDefault();
|
2986 |
+
sfsi_responsive_open_url(event);
|
2987 |
+
});
|
2988 |
+
jQuery('.sfsi_responsive_default_url_toggler').click(function (event) {
|
2989 |
+
event.preventDefault();
|
2990 |
+
sfsi_responsive_open_url(event);
|
2991 |
+
})
|
2992 |
+
jQuery('.sfsi_responsive_custom_url_hide, .sfsi_responsive_default_url_hide').click(function (event) {
|
2993 |
+
event.preventDefault();
|
2994 |
+
/* console.log(event,jQuery(event.target)); */
|
2995 |
+
jQuery(event.target).parent().parent().find('.sfsi_responsive_custom_url_hide').hide();
|
2996 |
+
jQuery(event.target).parent().parent().find('.sfsi_responsive_url_input').hide();
|
2997 |
+
jQuery(event.target).parent().parent().find('.sfsi_responsive_default_url_hide').hide();
|
2998 |
+
jQuery(event.target).parent().parent().find('.sfsi_responsive_default_url_toggler').show();
|
2999 |
+
});
|
3000 |
+
jQuery('select[name="sfsi_responsive_icons_settings_icon_size"]').change(function (event) {
|
3001 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').removeClass('sfsi_small_button').removeClass('sfsi_medium_button').removeClass('sfsi_large_button').addClass('sfsi_' + (jQuery(this).val().toLowerCase()) + '_button');
|
3002 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').removeClass('sfsi_small_button_container').removeClass('sfsi_medium_button_container').removeClass('sfsi_large_button_container').addClass('sfsi_' + (jQuery(this).val().toLowerCase()) + '_button_container')
|
3003 |
+
})
|
3004 |
+
jQuery(document).on('change', 'select[name="sfsi_responsive_icons_settings_edge_radius"]', function (event) {
|
3005 |
+
var radius = jQuery(this).val() + 'px'
|
3006 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container,.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('border-radius', radius);
|
3007 |
+
|
3008 |
+
});
|
3009 |
+
jQuery(document).on('change', 'select[name="sfsi_responsive_icons_settings_style"]', function (event) {
|
3010 |
+
if ('Flat' === jQuery(this).val()) {
|
3011 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').removeClass('sfsi_responsive_icon_gradient');
|
3012 |
+
} else {
|
3013 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').addClass('sfsi_responsive_icon_gradient');
|
3014 |
+
}
|
3015 |
+
});
|
3016 |
+
jQuery(document).on('mouseenter', '.sfsi_responsive_icon_preview .sfsi_icons_container a', function () {
|
3017 |
+
jQuery(this).css('opacity', 0.8);
|
3018 |
+
})
|
3019 |
+
jQuery(document).on('mouseleave', '.sfsi_responsive_icon_preview .sfsi_icons_container a', function () {
|
3020 |
+
jQuery(this).css('opacity', 1);
|
3021 |
+
})
|
3022 |
+
window.sfsi_fittext_shouldDisplay = true;
|
3023 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
3024 |
+
if (jQuery(a_container).css('display') !== "none") {
|
3025 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
3026 |
+
}
|
3027 |
+
})
|
3028 |
+
sfsi_resize_icons_container();
|
3029 |
+
jQuery('.ui-accordion-header.ui-state-default.ui-accordion-icons').click(function (data) {
|
3030 |
+
window.sfsi_fittext_shouldDisplay = true;
|
3031 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
3032 |
+
if (jQuery(a_container).css('display') !== "none") {
|
3033 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
3034 |
+
}
|
3035 |
+
})
|
3036 |
+
sfsi_resize_icons_container();
|
3037 |
+
});
|
3038 |
+
jQuery('select[name="sfsi_responsive_icons_settings_text_align"]').change(function (event) {
|
3039 |
+
var data = jQuery(event.target).val();
|
3040 |
+
if (data == "Centered") {
|
3041 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').removeClass('sfsi_left-align_icon').addClass('sfsi_centered_icon');
|
3042 |
+
} else {
|
3043 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container').removeClass('sfsi_centered_icon').addClass('sfsi_left-align_icon');
|
3044 |
+
}
|
3045 |
+
});
|
3046 |
+
jQuery('a.sfsi_responsive_custom_delete_btn').click(function (event) {
|
3047 |
+
event.preventDefault();
|
3048 |
+
var icon_num = jQuery(this).attr('data-id');
|
3049 |
+
//reset the current block;
|
3050 |
+
// var last_block = jQuery('.sfsi_responsive_custom_icon_4_container').clone();
|
3051 |
+
var cur_block = jQuery('.sfsi_responsive_custom_icon_' + icon_num + '_container');
|
3052 |
+
cur_block.find('.sfsi_responsive_custom_delete_btn').hide();
|
3053 |
+
cur_block.find('input[name="sfsi_responsive_custom_' + icon_num + '_added"]').val('no');
|
3054 |
+
cur_block.find('.sfsi_responsive_custom_' + icon_num + '_added').attr('value', 'no');
|
3055 |
+
cur_block.find('.radio_section.tb_4_ck .checkbox').click();
|
3056 |
+
cur_block.hide();
|
3057 |
+
|
3058 |
+
|
3059 |
+
if (icon_num > 0) {
|
3060 |
+
var prev_block = jQuery('.sfsi_responsive_custom_icon_' + (icon_num - 1) + '_container');
|
3061 |
+
prev_block.find('.sfsi_responsive_custom_delete_btn').show();
|
3062 |
+
}
|
3063 |
+
// jQuery('.sfsi_responsive_custom_icon_container').each(function(index,custom_icon){
|
3064 |
+
// var target= jQuery(custom_icon);
|
3065 |
+
// target.find('.sfsi_responsive_custom_delete_btn');
|
3066 |
+
// var custom_id = target.find('.sfsi_responsive_custom_delete_btn').attr('data-id');
|
3067 |
+
// if(custom_id>icon_num){
|
3068 |
+
// target.removeClass('sfsi_responsive_custom_icon_'+custom_id+'_container').addClass('sfsi_responsive_custom_icon_'+(custom_id-1)+'_container');
|
3069 |
+
// target.find('input[name="sfsi_responsive_custom_'+custom_id+'_added"]').attr('name',"sfsi_responsive_custom_"+(custom_id-1)+"_added");
|
3070 |
+
// target.find('#sfsi_responsive_'+custom_id+'_display').removeClass('sfsi_responsive_custom_'+custom_id+'_display').addClass('sfsi_responsive_custom_'+(custom_id-1)+'_display').attr('id','sfsi_responsive_'+(custom_id-1)+'_display').attr('name','sfsi_responsive_custom_'+(custom_id-1)+'_display').attr('data-custom-index',(custom_id-1));
|
3071 |
+
// target.find('.sfsi_responsive_icon_item_container').removeClass('sfsi_responsive_icon_custom_'+custom_id+'_container').addClass('sfsi_responsive_icon_custom_'+(custom_id-1)+'_container');
|
3072 |
+
// target.find('.sfsi_responsive_input').attr('name','sfsi_responsive_custom_'+(custom_id-1)+'_input');
|
3073 |
+
// target.find('.sfsi_responsive_url_input').attr('name','sfsi_responsive_custom_'+(custom_id-1)+'_url_input');
|
3074 |
+
// target.find('.sfsi_bg-color-picker').attr('name','sfsi_responsive_icon_'+(custom_id-1)+'_bg_color');
|
3075 |
+
// target.find('.sfsi_logo_upload sfsi_logo_custom_'+custom_id+'_upload').removeClass('sfsi_logo_upload sfsi_logo_custom_'+custom_id+'_upload').addClass('sfsi_logo_upload sfsi_logo_custom_'+(custom_id-1)+'_upload');
|
3076 |
+
// target.find('input[type="sfsi_responsive_icons_custom_'+custom_id+'_icon"]').attr('name','input[type="sfsi_responsive_icons_custom_'+(custom_id-1)+'_icon"]');
|
3077 |
+
// target.find('.sfsi_responsive_custom_delete_btn').attr('data-id',''+(custom_id-1));
|
3078 |
+
// }
|
3079 |
+
// });
|
3080 |
+
// // sfsi_backend_section_beforeafter_set_fixed_width();
|
3081 |
+
// // jQuery(window).on('resize',sfsi_backend_section_beforeafter_set_fixed_width);
|
3082 |
+
// var new_block=jQuery('.sfsi_responsive_custom_icon_container').clone();
|
3083 |
+
// jQuery('.sfsi_responsive_custom_icon_container').remove();
|
3084 |
+
// jQuery('.sfsi_responsive_default_icon_container').parent().append(last_block).append();
|
3085 |
+
// jQuery('.sfsi_responsive_default_icon_container').parent().append(new_block);
|
3086 |
+
// return false;
|
3087 |
+
})
|
3088 |
+
}
|
3089 |
+
|
3090 |
+
function sfsi_responsive_icon_counter_tgl(hide, show, ref = null) {
|
3091 |
+
if (null !== hide && '' !== hide) {
|
3092 |
+
jQuery('.' + hide).hide();
|
3093 |
+
}
|
3094 |
+
if (null !== show && '' !== show) {
|
3095 |
+
jQuery('.' + show).show();
|
3096 |
+
}
|
3097 |
+
}
|
3098 |
+
|
3099 |
+
function sfsi_responsive_toggle_count() {
|
3100 |
+
var data = jQuery('input[name="sfsi_share_count"]:checked').val();
|
3101 |
+
var data2 = jQuery('input[name="sfsi_display_counts"]:checked').val();
|
3102 |
+
/* console.log('toggleer ',data,data2); */
|
3103 |
+
if (data2 == "yes" && 'yes' == data) {
|
3104 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('display', 'inline-block');
|
3105 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').removeClass('sfsi_responsive_without_counter_icons').addClass('sfsi_responsive_with_counter_icons');
|
3106 |
+
sfsi_resize_icons_container();
|
3107 |
+
} else {
|
3108 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').css('display', 'none');
|
3109 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').removeClass('sfsi_responsive_with_counter_icons').addClass('sfsi_responsive_without_counter_icons');
|
3110 |
+
sfsi_resize_icons_container();
|
3111 |
+
}
|
3112 |
+
}
|
3113 |
+
|
3114 |
+
function sfsi_responsive_open_url(event) {
|
3115 |
+
jQuery(event.target).parent().find('.sfsi_responsive_custom_url_hide').show();
|
3116 |
+
jQuery(event.target).parent().find('.sfsi_responsive_default_url_hide').show();
|
3117 |
+
jQuery(event.target).parent().find('.sfsi_responsive_url_input').show();
|
3118 |
+
jQuery(event.target).hide();
|
3119 |
+
}
|
3120 |
+
|
3121 |
+
function sfsi_responsive_icon_hide_responsive_options() {
|
3122 |
+
jQuery('.sfsi_PostsSettings_section').show();
|
3123 |
+
jQuery('.sfsi_choose_post_types_section').show();
|
3124 |
+
jQuery('.sfsi_not_responsive').show();
|
3125 |
+
// jQuery('.sfsi_icn_listing8.sfsi_closerli').hide();
|
3126 |
+
}
|
3127 |
+
|
3128 |
+
function sfsi_responsive_icon_show_responsive_options() {
|
3129 |
+
jQuery('.sfsi_PostsSettings_section').hide();
|
3130 |
+
// jQuery('.sfsi_PostsSettings_section').show();
|
3131 |
+
jQuery('.sfsi_choose_post_types_section').hide();
|
3132 |
+
jQuery('.sfsi_not_responsive').hide();
|
3133 |
+
window.sfsi_fittext_shouldDisplay = true;
|
3134 |
+
jQuery('.sfsi_responsive_icon_preview a').each(function (index, a_container) {
|
3135 |
+
if (jQuery(a_container).css('display') !== "none") {
|
3136 |
+
sfsi_fitText(jQuery(a_container).find('.sfsi_responsive_icon_item_container'));
|
3137 |
+
}
|
3138 |
+
})
|
3139 |
+
sfsi_resize_icons_container();
|
3140 |
+
}
|
3141 |
+
|
3142 |
+
function sfsi_scroll_to_div(option_id, scroll_selector) {
|
3143 |
+
jQuery('#' + option_id + '.ui-accordion-header[aria-selected="false"]').click() //opened the option
|
3144 |
+
//scroll to it.
|
3145 |
+
if (scroll_selector && scroll_selector !== '') {
|
3146 |
+
scroll_selector = scroll_selector;
|
3147 |
+
} else {
|
3148 |
+
scroll_selector = '#' + option_id + '.ui-accordion-header';
|
3149 |
+
}
|
3150 |
+
jQuery('html, body').stop().animate({
|
3151 |
+
scrollTop: jQuery(scroll_selector).offset().top
|
3152 |
+
}, 1000);
|
3153 |
+
}
|
3154 |
+
|
3155 |
+
function sfsi_fitText(container) {
|
3156 |
+
/* console.log(container,container.parent().parent(),container.parent().parent().hasClass('sfsi_icons_container_box_fixed_container')); */
|
3157 |
+
if (container.parent().parent().hasClass('sfsi_icons_container_box_fixed_container')) {
|
3158 |
+
/* console.log(window.sfsi_fittext_shouldDisplay); */
|
3159 |
+
if (window.sfsi_fittext_shouldDisplay === true) {
|
3160 |
+
if (jQuery('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val() == "Fully responsive") {
|
3161 |
+
var all_icon_width = jQuery('.sfsi_responsive_icons .sfsi_icons_container').width();
|
3162 |
+
var total_active_icons = jQuery('.sfsi_responsive_icons .sfsi_icons_container a').filter(function (i, icon) {
|
3163 |
+
return jQuery(icon).css('display') && (jQuery(icon).css('display').toLowerCase() !== "none");
|
3164 |
+
}).length;
|
3165 |
+
|
3166 |
+
var distance_between_icon = jQuery('input[name="sfsi_responsive_icons_settings_margin"]').val()
|
3167 |
+
var container_width = ((all_icon_width - distance_between_icon) / total_active_icons) - 5;
|
3168 |
+
container_width = (container_width - distance_between_icon);
|
3169 |
+
} else {
|
3170 |
+
var container_width = container.width();
|
3171 |
+
}
|
3172 |
+
// var container_img_width = container.find('img').width();
|
3173 |
+
var container_img_width = 70;
|
3174 |
+
// var span=container.find('span').clone();
|
3175 |
+
var span = container.find('span');
|
3176 |
+
// var span_original_width = container.find('span').width();
|
3177 |
+
var span_original_width = container_width - (container_img_width)
|
3178 |
+
span
|
3179 |
+
// .css('display','inline-block')
|
3180 |
+
.css('white-space', 'nowrap')
|
3181 |
+
// .css('width','auto')
|
3182 |
+
;
|
3183 |
+
var span_flatted_width = span.width();
|
3184 |
+
if (span_flatted_width == 0) {
|
3185 |
+
span_flatted_width = span_original_width;
|
3186 |
+
}
|
3187 |
+
span
|
3188 |
+
// .css('display','inline-block')
|
3189 |
+
.css('white-space', 'unset')
|
3190 |
+
// .css('width','auto')
|
3191 |
+
;
|
3192 |
+
var shouldDisplay = ((undefined === window.sfsi_fittext_shouldDisplay) ? true : window.sfsi_fittext_shouldDisplay = true);
|
3193 |
+
var fontSize = parseInt(span.css('font-size'));
|
3194 |
+
|
3195 |
+
if (6 > fontSize) {
|
3196 |
+
fontSize = 20;
|
3197 |
+
}
|
3198 |
+
|
3199 |
+
var computed_fontSize = (Math.floor((fontSize * span_original_width) / span_flatted_width));
|
3200 |
+
|
3201 |
+
if (computed_fontSize < 8) {
|
3202 |
+
shouldDisplay = false;
|
3203 |
+
window.sfsi_fittext_shouldDisplay = false;
|
3204 |
+
computed_fontSize = 20;
|
3205 |
+
}
|
3206 |
+
span.css('font-size', Math.min(computed_fontSize, 20));
|
3207 |
+
span
|
3208 |
+
// .css('display','inline-block')
|
3209 |
+
.css('white-space', 'nowrap')
|
3210 |
+
// .css('width','auto')
|
3211 |
+
;
|
3212 |
+
if (shouldDisplay) {
|
3213 |
+
span.show();
|
3214 |
+
} else {
|
3215 |
+
span.hide();
|
3216 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icon_item_container span').hide();
|
3217 |
+
}
|
3218 |
+
}
|
3219 |
+
} else {
|
3220 |
+
var span = container.find('span');
|
3221 |
+
/* console.log(span); */
|
3222 |
+
span.css('font-size', 'initial');
|
3223 |
+
span.show();
|
3224 |
+
}
|
3225 |
+
|
3226 |
+
}
|
3227 |
+
|
3228 |
+
function sfsi_fixedWidth_fitText(container) {
|
3229 |
+
return;
|
3230 |
+
/* console.log(sfsi_fittext_shouldDisplay); */
|
3231 |
+
if (window.sfsi_fittext_shouldDisplay === true) {
|
3232 |
+
if (jQuery('select[name="sfsi_responsive_icons_settings_icon_width_type"]').val() == "Fixed icon width") {
|
3233 |
+
var all_icon_width = jQuery('.sfsi_responsive_icons .sfsi_icons_container').width();
|
3234 |
+
var total_active_icons = jQuery('.sfsi_responsive_icons .sfsi_icons_container a').filter(function (i, icon) {
|
3235 |
+
return jQuery(icon).css('display') && (jQuery(icon).css('display').toLowerCase() !== "none");
|
3236 |
+
}).length;
|
3237 |
+
var distance_between_icon = jQuery('input[name="sfsi_responsive_icons_settings_margin"]').val()
|
3238 |
+
var container_width = ((all_icon_width - distance_between_icon) / total_active_icons) - 5;
|
3239 |
+
container_width = (container_width - distance_between_icon);
|
3240 |
+
} else {
|
3241 |
+
var container_width = container.width();
|
3242 |
+
}
|
3243 |
+
// var container_img_width = container.find('img').width();
|
3244 |
+
var container_img_width = 70;
|
3245 |
+
// var span=container.find('span').clone();
|
3246 |
+
var span = container.find('span');
|
3247 |
+
// var span_original_width = container.find('span').width();
|
3248 |
+
var span_original_width = container_width - (container_img_width)
|
3249 |
+
span
|
3250 |
+
// .css('display','inline-block')
|
3251 |
+
.css('white-space', 'nowrap')
|
3252 |
+
// .css('width','auto')
|
3253 |
+
;
|
3254 |
+
var span_flatted_width = span.width();
|
3255 |
+
if (span_flatted_width == 0) {
|
3256 |
+
span_flatted_width = span_original_width;
|
3257 |
+
}
|
3258 |
+
span
|
3259 |
+
// .css('display','inline-block')
|
3260 |
+
.css('white-space', 'unset')
|
3261 |
+
// .css('width','auto')
|
3262 |
+
;
|
3263 |
+
var shouldDisplay = undefined === window.sfsi_fittext_shouldDisplay ? true : window.sfsi_fittext_shouldDisplay = true;;
|
3264 |
+
var fontSize = parseInt(span.css('font-size'));
|
3265 |
+
|
3266 |
+
if (6 > fontSize) {
|
3267 |
+
fontSize = 15;
|
3268 |
+
}
|
3269 |
+
|
3270 |
+
var computed_fontSize = (Math.floor((fontSize * span_original_width) / span_flatted_width));
|
3271 |
+
|
3272 |
+
if (computed_fontSize < 8) {
|
3273 |
+
shouldDisplay = false;
|
3274 |
+
window.sfsi_fittext_shouldDisplay = false;
|
3275 |
+
computed_fontSize = 15;
|
3276 |
+
}
|
3277 |
+
span.css('font-size', Math.min(computed_fontSize, 15));
|
3278 |
+
span
|
3279 |
+
// .css('display','inline-block')
|
3280 |
+
.css('white-space', 'nowrap')
|
3281 |
+
// .css('width','auto')
|
3282 |
+
;
|
3283 |
+
// var heightOfResIcons = jQuery('.sfsi_responsive_icon_item_container').height();
|
3284 |
+
|
3285 |
+
// if(heightOfResIcons < 17){
|
3286 |
+
// span.show();
|
3287 |
+
// }else{
|
3288 |
+
// span.hide();
|
3289 |
+
// }
|
3290 |
+
|
3291 |
+
if (shouldDisplay) {
|
3292 |
+
span.show();
|
3293 |
+
} else {
|
3294 |
+
span.hide();
|
3295 |
+
}
|
3296 |
+
}
|
3297 |
+
}
|
3298 |
+
|
3299 |
+
function sfsi_resize_icons_container() {
|
3300 |
+
// resize icon container based on the size of count
|
3301 |
+
sfsi_cloned_icon_list = jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').clone();
|
3302 |
+
sfsi_cloned_icon_list.removeClass('.sfsi_responsive_icon_preview .sfsi_responsive_with_counter_icons').addClass('sfsi_responsive_cloned_list');
|
3303 |
+
sfsi_cloned_icon_list.css('width', '100%');
|
3304 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').parent().append(sfsi_cloned_icon_list);
|
3305 |
+
|
3306 |
+
// sfsi_cloned_icon_list.css({
|
3307 |
+
// position: "absolute",
|
3308 |
+
// left: "-10000px"
|
3309 |
+
// }).appendTo("body");
|
3310 |
+
actual_width = sfsi_cloned_icon_list.width();
|
3311 |
+
count_width = jQuery('.sfsi_responsive_icon_preview .sfsi_responsive_icons_count').width();
|
3312 |
+
jQuery('.sfsi_responsive_cloned_list').remove();
|
3313 |
+
sfsi_inline_style = jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').attr('style');
|
3314 |
+
// remove_width
|
3315 |
+
sfsi_inline_style = sfsi_inline_style.replace(/width:auto($|!important|)(;|$)/g, '').replace(/width:\s*(-|)\d*\s*(px|%)\s*($|!important|)(;|$)/g, '');
|
3316 |
+
if (!(jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').hasClass('sfsi_responsive_without_counter_icons') && jQuery('.sfsi_icons_container').hasClass('sfsi_icons_container_box_fixed_container'))) {
|
3317 |
+
sfsi_inline_style += "width:" + (actual_width - count_width - 1) + 'px!important;'
|
3318 |
+
} else {
|
3319 |
+
sfsi_inline_style += "width:auto!important;";
|
3320 |
+
}
|
3321 |
+
jQuery('.sfsi_responsive_icon_preview .sfsi_icons_container').attr('style', sfsi_inline_style);
|
3322 |
+
|
3323 |
+
}
|
3324 |
+
|
3325 |
+
function sfsi_togglbtmsection(show, hide, ref) {
|
3326 |
+
console.log(show,hide);
|
3327 |
+
jQuery(ref).parent("ul").children("li.clckbltglcls").each(function (index, element) {
|
3328 |
+
jQuery(this).children(".radio").css("background-position", "0px 0px");
|
3329 |
+
jQuery(this).children(".styled").attr("checked", "false");
|
3330 |
+
});
|
3331 |
+
jQuery(ref).children(".radio").css("background-position", "0px -41px");
|
3332 |
+
jQuery(ref).children(".styled").attr("checked", "true");
|
3333 |
+
console.log(show,hide);
|
3334 |
+
|
3335 |
+
jQuery("." + show).show();
|
3336 |
+
jQuery("." + show).children(".radiodisplaysection").show();
|
3337 |
+
jQuery("." + hide).hide();
|
3338 |
+
jQuery("." + hide).children(".radiodisplaysection").hide();
|
3339 |
+
}
|
3340 |
+
jQuery(document).ready(function(){
|
3341 |
+
var sfsi_functions_loaded = new CustomEvent('sfsi_functions_loaded',{detail:{"abc":"def"}});
|
3342 |
+
window.dispatchEvent(sfsi_functions_loaded);
|
3343 |
+
});
|
libs/controllers/sfsi_socialhelper.php
CHANGED
@@ -330,8 +330,12 @@ class sfsi_SocialHelper
|
|
330 |
/* get instragram followers */
|
331 |
public function sfsi_get_instagramFollowers($user_name)
|
332 |
{
|
333 |
-
$
|
334 |
-
|
|
|
|
|
|
|
|
|
335 |
/*if date is empty (for decrease request count)*/
|
336 |
if(empty($sfsi_instagram_sf_count["date_instagram"]))
|
337 |
{
|
@@ -437,7 +441,8 @@ class sfsi_SocialHelper
|
|
437 |
),
|
438 |
date_create(
|
439 |
date("Y-m-d")
|
440 |
-
|
|
|
441 |
}
|
442 |
if((isset($diff) && $diff->format("%a") >= 1)||$sfsi_instagram_sf_count["sfsi_sf_count"]=="")
|
443 |
{
|
330 |
/* get instragram followers */
|
331 |
public function sfsi_get_instagramFollowers($user_name)
|
332 |
{
|
333 |
+
$sfsi_instagram_sf_count_option = get_option('sfsi_instagram_sf_count',false);
|
334 |
+
if(is_array($sfsi_instagram_sf_count_option)){
|
335 |
+
$sfsi_instagram_sf_count = unserialize($sfsi_instagram_sf_count_option);
|
336 |
+
}else{
|
337 |
+
$sfsi_instagram_sf_count = $sfsi_instagram_sf_count_option;
|
338 |
+
}
|
339 |
/*if date is empty (for decrease request count)*/
|
340 |
if(empty($sfsi_instagram_sf_count["date_instagram"]))
|
341 |
{
|
441 |
),
|
442 |
date_create(
|
443 |
date("Y-m-d")
|
444 |
+
)
|
445 |
+
);
|
446 |
}
|
447 |
if((isset($diff) && $diff->format("%a") >= 1)||$sfsi_instagram_sf_count["sfsi_sf_count"]=="")
|
448 |
{
|
libs/sfsi_install_uninstall.php
CHANGED
@@ -39,7 +39,7 @@ function sfsi_update_plugin()
|
|
39 |
update_option("sfsi_custom_icons", "yes");
|
40 |
}
|
41 |
//Install version
|
42 |
-
update_option("sfsi_pluginVersion", "2.
|
43 |
|
44 |
if (!get_option('sfsi_serverphpVersionnotification')) {
|
45 |
add_option("sfsi_serverphpVersionnotification", "yes");
|
@@ -83,10 +83,16 @@ function sfsi_update_plugin()
|
|
83 |
);
|
84 |
add_option('sfsi_instagram_sf_count', serialize($sfsi_instagram_sf_count));
|
85 |
} else {
|
86 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
87 |
$sfsi_instagram_sf_count["date_sf"] = isset($sfsi_instagram_sf_count["date"]) ? $sfsi_instagram_sf_count["date"] : '';
|
88 |
$sfsi_instagram_sf_count["date_instagram"] = isset($sfsi_instagram_sf_count["date"]) ? $sfsi_instagram_sf_count["date"] : '';
|
89 |
-
update_option('sfsi_instagram_sf_count', $sfsi_instagram_sf_count);
|
90 |
}
|
91 |
|
92 |
$option4 = unserialize(get_option('sfsi_section4_options', false));
|
39 |
update_option("sfsi_custom_icons", "yes");
|
40 |
}
|
41 |
//Install version
|
42 |
+
update_option("sfsi_pluginVersion", "2.42");
|
43 |
|
44 |
if (!get_option('sfsi_serverphpVersionnotification')) {
|
45 |
add_option("sfsi_serverphpVersionnotification", "yes");
|
83 |
);
|
84 |
add_option('sfsi_instagram_sf_count', serialize($sfsi_instagram_sf_count));
|
85 |
} else {
|
86 |
+
|
87 |
+
$sfsi_instagram_sf_count_option = get_option('sfsi_instagram_sf_count', false);
|
88 |
+
if(!is_array($sfsi_instagram_sf_count_option)){
|
89 |
+
$sfsi_instagram_sf_count = unserialize($sfsi_instagram_sf_count_option);
|
90 |
+
}else{
|
91 |
+
$sfsi_instagram_sf_count = $sfsi_instagram_sf_count_option;
|
92 |
+
}
|
93 |
$sfsi_instagram_sf_count["date_sf"] = isset($sfsi_instagram_sf_count["date"]) ? $sfsi_instagram_sf_count["date"] : '';
|
94 |
$sfsi_instagram_sf_count["date_instagram"] = isset($sfsi_instagram_sf_count["date"]) ? $sfsi_instagram_sf_count["date"] : '';
|
95 |
+
update_option('sfsi_instagram_sf_count', serialize($sfsi_instagram_sf_count));
|
96 |
}
|
97 |
|
98 |
$option4 = unserialize(get_option('sfsi_section4_options', false));
|
readme.txt
CHANGED
@@ -1,871 +1,876 @@
|
|
1 |
-
=== Social Media Share Buttons & Social Sharing Icons ===
|
2 |
-
Contributors: socialdude, socialtech
|
3 |
-
Tags: social media, share, buttons, social widget, icons, share icons, share buttons, sharing icons, sharing buttons, social share, sharing, social sharing
|
4 |
-
Requires at least: 3.5
|
5 |
-
Tested up to: 5.2.2
|
6 |
-
Stable tag: 2.4.
|
7 |
-
License: GPLv2
|
8 |
-
License URI: http://www.gnu.org/licenses/gpl-2.0.html
|
9 |
-
|
10 |
-
Share buttons and share icons plugin for social media sharing on Facebook, Twitter, Instagram, Whatsapp, Pinterest etc.
|
11 |
-
|
12 |
-
== Description ==
|
13 |
-
|
14 |
-
Social media plugin which let's you add share icons for RSS, Email, Facebook, Twitter, LinkedIn, Pinterest, Instagram, Youtube, 'Share' (covering 200+ other social media platforms) and upload custom share icons of your choice.
|
15 |
-
|
16 |
-
This free plugin has a lot to offer. Even more can be found in the Premium Plugin, please watch this short video:
|
17 |
-
|
18 |
-
[vimeo https://vimeo.com/269140798]
|
19 |
-
|
20 |
-
See [all features of the Premium plugin](https://www.ultimatelysocial.com/usm-premium/).
|
21 |
-
|
22 |
-
The free social media plugin includes the following features:
|
23 |
-
|
24 |
-
- Pick from 16 different designs for your social media share icons
|
25 |
-
- Give several actions to one social media share icon (e.g. your facebook share icon can lead visitors to your Facebook page, and also give visitors the opportunity to like your page)
|
26 |
-
- Decide to give your social media icons an animation (e.g. automatic shuffling, mouse-over effects) to make your visitors aware of the share icons, increasing the chance that they follow/share your blog
|
27 |
-
- Make your social media icons 'float' or 'sticky'
|
28 |
-
- Allow visitors to subscribe to your blog by Email
|
29 |
-
- Add 'counts' to your social media buttons
|
30 |
-
- Decide to display a pop-up (on all or only on selected pages) asking people to follow/share you via your social media icons
|
31 |
-
- Decide to display sharing-buttons and social media icons at the end of every post
|
32 |
-
- Select from many other customization features for your socialmedia icons!
|
33 |
-
|
34 |
-
For GDPR compliance, please have a look at our [Social Media GDPR Compliance page](https://ultimatelysocial.com/gdpr/).
|
35 |
-
|
36 |
-
The social media plugin is very easy to use as it takes you through all the steps:
|
37 |
-
|
38 |
-
- Step 1: Choose which social media icons you want to display
|
39 |
-
- Step 2: Define what actions your social media icons should perform
|
40 |
-
- Step 3: Pick design & animation options for your social media icons
|
41 |
-
- Step 4: Add counts to your social media icons (optional)
|
42 |
-
- Step 5: Select from various other social share options, e.g. make your social media icons 'float'
|
43 |
-
- Step 6: Add sharing/linking icons next to each blog post (optional)
|
44 |
-
- Step 7: Add a customized pop-up asking people to follow or share (optional)
|
45 |
-
- Step 8: Add a subscription form on your site (optional)
|
46 |
-
|
47 |
-
In case of issues or questions please ask in the [Support forum](https://wordpress.org/support/plugin/ultimate-social-media-icons).
|
48 |
-
|
49 |
-
We hope you enjoy the free social media plugin!
|
50 |
-
|
51 |
-
= New Premium Plugin =
|
52 |
-
|
53 |
-
We released a Premium Plugin with many more exciting features:
|
54 |
-
|
55 |
-
- **Many more social networks** supported, including Snapchat share buttons, Whatsapp share buttons, Yummly share buttons, Phone button, Yelp share buttons, Soundcloud share buttons, Skype share buttons Flickr share buttons, Blogger share buttons, Reddit share buttons, Vimeo share buttons, Tumblr share buttons, Xing share buttons, Vkontakte share buttons (VK), Telegram share buttons, Amazon share buttons, Goodreads share buttons, Angies list share buttons, Steam share buttons, Twitch share buttons, Spotify share buttons, Odnoklassniki share buttons (OK), Buffer share buttons, Weibo share buttons, Pocket share buttons, Meneame share buttons, Frype share buttons, LiveJournal share buttons, Patreon share buttons, Dloky share buttons, Discord share buttons, Github share buttons, Wordpress buttons, Etsy share buttons, Better Business Bureau share buttons, Digg share buttons, Delicious share buttons, Print share buttons, and many other share buttons!
|
56 |
-
- **More design styles** to make your social share icons look really cool & matching the design of your website
|
57 |
-
- **Themed design styles**, e.g. if you have a website about cats you can pick from social media logos which look like cats etc.
|
58 |
-
- **Better social sharing and following features**, e.g. you can define the Tweet-texts better (e.g. pull the post titles into your Tweets automatically), let people follow you on Facebook directly without leaving your site etc.
|
59 |
-
- **Place the social icons on specific pages**, i.e. you can define on which pages the icons to the social media sites should not show
|
60 |
-
- **Position the social icons by anchor and margins**, i.e. you can define the margins where your share icons should be displayed (from top/bottom/left/right), and then have them floating, or stick, still visible when user scrolls down or not etc.
|
61 |
-
- **Optimized for mobile** - you can define separate selections for your social network icons for mobile
|
62 |
-
- **More functions for email icon**, such as Share (by email), Contact you, Link to a certain page etc.
|
63 |
-
- **Social media counters optimized** to encourage more social media sharing from your visitors
|
64 |
-
- **More pop up options** which contain your social media buttons, e.g. define a limit to how often the pop-up is shown to the same user, show pop-up only when people try to leave your website etc.
|
65 |
-
- **Friendly support** in case you're stuck
|
66 |
-
- **Many more settings and options** for your social media network icons
|
67 |
-
|
68 |
-
Have a look at the [Premium Plugin features](https://www.ultimatelysocial.com/usm-premium/)
|
69 |
-
|
70 |
-
|
71 |
-
== Installation ==
|
72 |
-
Extract the zip file and drop the contents into the wp-content/plugins/ directory of your WordPress installation. Then activate the plugin from the plugins page.
|
73 |
-
|
74 |
-
Then go to plugin settings page and follow the instructions. After you're done, go to the Widget area (Appearance >> Widget) and place the widget on your sidebar to display your social sharing icons on your blog.
|
75 |
-
|
76 |
-
Note: This plugin requires CURL to be activated/installed on your server (which should be the standard case), and a PHP version of 5.4 or above. If you don't have it, please contact your hosting provider or server admin.
|
77 |
-
|
78 |
-
== Frequently Asked Questions ==
|
79 |
-
= Please also check the more comprehensive FAQ on http://ultimatelysocial.com/faq =
|
80 |
-
|
81 |
-
.
|
82 |
-
|
83 |
-
= I face fundamental issues (the plugin doesn't load etc.) =
|
84 |
-
|
85 |
-
Please ensure that:
|
86 |
-
|
87 |
-
- You're using the latest version of the plugin(s)
|
88 |
-
- Your site is running on PHP 5.4 or above
|
89 |
-
- You have CURL activated (should be activated by default)
|
90 |
-
|
91 |
-
If you're not familiar with those please contact your hosting company or server admin.
|
92 |
-
|
93 |
-
Please check if you have browser extensions activated which may conflict with the plugin. Known culprits include:
|
94 |
-
|
95 |
-
- Open SEO Stats (Formerly: PageRank Status) in Chrome
|
96 |
-
- Adblock Plus in Chrome
|
97 |
-
- Vine in Chrome
|
98 |
-
|
99 |
-
Either de-activate those extensions or try it in a different browser.
|
100 |
-
|
101 |
-
If the plugin setting's area looks 'funny' after an upgrade then please clear your cache with String+F5 (PC) or Command+R (Mac).
|
102 |
-
|
103 |
-
If you get the error message “Are you sure you want to do this? / Please try again” when uploading the socialsharing plugin: Some servers may have a low limits with respect to permitted upload times. Please set the values in the “php.ini” file to:
|
104 |
-
|
105 |
-
max_execution_time 90
|
106 |
-
post_max_size 48M
|
107 |
-
|
108 |
-
If you don’t know how to do it, please contact your server support / hosting company for that. Tell them you need it for a social sharing plugin on WordPress which may take longer to upload.
|
109 |
-
|
110 |
-
If your issue is still not fixed after you’ve followed the steps above, we can provide support as part of our share to social Premium Plugin: https://www.ultimatelysocial.com/usm-premium/.
|
111 |
-
|
112 |
-
= I get error messages 'Error : 7', 'Error : 56', 'Error : 6' etc. =
|
113 |
-
|
114 |
-
Those point to a CURL-issue on your site. Please contact your server admin or your hosting company to resolve it.
|
115 |
-
|
116 |
-
The plugin requires CURL for the social share counts and other features.
|
117 |
-
|
118 |
-
= Social share icons don't show =
|
119 |
-
|
120 |
-
Please ensure you actually placed the social share buttons either as social widget (in your widget area) or as floating icons under question 5). The Premium Plugin makes placing the social icons especially easy and also allows you to place sticky social share icons on your site, define the placement of the social share icons by margins and many other options, see https://www.ultimatelysocial.com/usm-premium/.
|
121 |
-
|
122 |
-
If only some social share icons show, but not all, then please clear your cache, and check if you may have conflicting browser extensions (e.g. 'Disconnect'-app in Chrome). Also Ad-Blockers are known culprits, please switch them off temporarily to see if that is the reason.
|
123 |
-
|
124 |
-
If the social share icons still don't show then there's an issue with your template. Please contact the creator of your template for that.
|
125 |
-
|
126 |
-
If you are referring to specific social share icons not showing in the plugin itself (e.g. you're looking for a Whatsapp share icon, but it doesnt exist) please note that our Premium Plugin has many more social media share icons, see https://www.ultimatelysocial.com/usm-premium/
|
127 |
-
|
128 |
-
= Twitter social share counts are not displaying (anymore) =
|
129 |
-
|
130 |
-
Unfortunately, Twitter stopped providing any social share count. God knows why.
|
131 |
-
|
132 |
-
= Changes don't get saved / Deleted plugin but the social share icons still show =
|
133 |
-
|
134 |
-
Most likely you have the WP Cache plugin installed. Please de-activate and then re-activate it, then the social share icons should display again.
|
135 |
-
|
136 |
-
= Links when clicking on the social share icons don't work =
|
137 |
-
|
138 |
-
Please ensure you've entered the 'http://' at the beginning of the url (for *all* social networks). If the social share icons are not clickable at all there is most likely an issue with your template. This is especially the case if you've given your social share buttons several features, which should show a pop-up (tooltip) when you move over the social share icons.
|
139 |
-
|
140 |
-
= I cannot upload custom social share icons =
|
141 |
-
|
142 |
-
Most likely that's because you've set 'allow_url_fopen' to 'off'. Please turn it to 'on' (or ask your server admin to do so, he'll know what to do. Tell them you need it to upload custom share icons for a social media buttons plugin).
|
143 |
-
|
144 |
-
= My Youtube social share icon (direct follow) doesn't work =
|
145 |
-
|
146 |
-
Please ensure that you've selected the radio button 'Username' when you enter a youtube username, or 'Channel ID' when you entered a channel ID.
|
147 |
-
|
148 |
-
= Aligning the social share icons (centered, left- or right-aligned) doesn't work =
|
149 |
-
|
150 |
-
The alignment options under question 5 align the social share icons with respect to each other, not where they appear on the page. Our new Premium Plugin is the best social sharing plugin on the market, allowing you to define also many other social share icon alignments (e.g. within a widget, within shortcode etc.).
|
151 |
-
|
152 |
-
= Clicking on the RSS icon returns funny codes =
|
153 |
-
|
154 |
-
That's normal. RSS users will know what to do with it (i.e. copy & paste the url into their RSS readers).
|
155 |
-
|
156 |
-
= Facebook 'like'-count isn't correct =
|
157 |
-
|
158 |
-
When you 'like' something on your blog via facebook it likes the site you're currently on (e.g. your blog) and not your Facebook page.
|
159 |
-
|
160 |
-
The new Premium Plugin also allows to show the number of your Facebook page likes, see https://www.ultimatelysocial.com/usm-premium/.
|
161 |
-
|
162 |
-
= Sharing doesn't take the right text or picture =
|
163 |
-
|
164 |
-
We use the share codes from Facebook etc. and therefore don't have any influence over which text & pic Facebook decides to share.
|
165 |
-
|
166 |
-
Note that you can define an image as 'Featured Image' which tells Facebook etc. to share that one. You'll find this 'Featured Image' section in your blog's admin area where you can edit your blog post.
|
167 |
-
|
168 |
-
You can crosscheck which image Facebook will take by entering your url on https://developers.facebook.com/tools/debug/og/object/.
|
169 |
-
|
170 |
-
UPDATE: we made significant enhancements to the premium plugin, it now allows you to define the sharing pics and texts for your social share icons.
|
171 |
-
|
172 |
-
= The pop-up shows although I only gave my social share icon one function =
|
173 |
-
|
174 |
-
The pop-up only disappears if you've given your social share icons only a 'visit us'-function, otherwise (e.g. if you gave it 'Like' (on facebook) or 'Tweet' functions) a pop-up is still needed because the social share buttons for those are coming directly from the social media sites (e.g. Facebook, Twitter) and we don't have any influence over their design.
|
175 |
-
|
176 |
-
= I selected to display the social share icons after every post but they don't show =
|
177 |
-
|
178 |
-
The social share icons usually do show, however not on your blog page, but on your single posts pages. The Premium plugin (https://www.ultimatelysocial.com/usm-premium/) also allows to display the social share icons on your homepage.
|
179 |
-
|
180 |
-
= Plugin decreases my site's loading speed =
|
181 |
-
|
182 |
-
The plugin is one of the most optimized social media plugin in terms of impact on a site's loading speed (optimized code, compressed pictures etc.).
|
183 |
-
|
184 |
-
If you still experience loading speed issues, please note that:
|
185 |
-
|
186 |
-
- The more sharing- and invite- features you place on your site, the more external codes you load (i.e. from the social media sites; we just use their share code), therefore impacting loading speed. So to prevent this, give your social share icons only 'Visit us'-functionality rather than sharing-functionalities.
|
187 |
-
|
188 |
-
- We've programmed it so that the code for the social media icons is the one which loads lasts on your site, i.e. after all the other content has already been loaded. This means: even if there is a decrease in loading speed, it does not impact a user's experience because he sees your site as quickly as before, only the social media icons take a bit longer to load.
|
189 |
-
|
190 |
-
There might be also other issues on your site which cause a high loading speed (e.g. conflicts with our plugins or template issues). Please ask your template creator about that.
|
191 |
-
|
192 |
-
Also, if you've uploaded social media sharing icons not provided by the plugin itself (i.e. custom share icons) please ensure they are compressed as well.
|
193 |
-
|
194 |
-
= After moving from demo-server to live-server the follow/subscribe-link doesn't work anymore =
|
195 |
-
|
196 |
-
Please delete and install the plugin again.
|
197 |
-
|
198 |
-
If you already placed the code for a subscription form on your site, remove it again and take the new one from the new plugin installation.
|
199 |
-
|
200 |
-
= There are other issues when I activate the plugin or place the social share icons =
|
201 |
-
|
202 |
-
Please check the following:
|
203 |
-
|
204 |
-
The plugin requires that CURL is installed & activated on your server (which should be the standard case). If you don't have it, please contact your hosting provider.
|
205 |
-
|
206 |
-
Please ensure that you don't have any browser extension activated which may conflict with the plugin, esp. those which block certain content. Known culprits include the 'Disconnect' extension in Chrome or the 'Privacy Badger' extension in Firefox.
|
207 |
-
|
208 |
-
If issues persist most likely your theme has issues which makes it incompatible with our plugin. Please contact your template creator for that. As part of the Premium Plugin (https://www.ultimatelysocial.com/usm-premium/) we fix also theme issues, and provide support to ensure that your social media share buttons appear on your site (exactly where you want them).
|
209 |
-
|
210 |
-
= How can I see how many people decided to share or like my post? =
|
211 |
-
|
212 |
-
You can see this by activating the social share 'counts' on the front end (under question 4 in the USM plugin, question 5 in the USM+ plugin).
|
213 |
-
|
214 |
-
We cannot provide you this data in other ways as it's coming directly from the social media sites. One exception: if you like to know when people start to follow you by email, then you can get email alerts. For that, please claim your feed (see question above).
|
215 |
-
|
216 |
-
= How can I change the 'Please follow & like us :)'? =
|
217 |
-
|
218 |
-
You can change it in the Widget-area where you dropped the widget (with the social share icons) on the sidebar. Please click on it (on the sidebar), it will open the menu where you can change the text.
|
219 |
-
|
220 |
-
If you don't want to show any text, just enter a space (' ').
|
221 |
-
|
222 |
-
= Can I use a shortcode to place the social share icons? =
|
223 |
-
|
224 |
-
Yes, use [DISPLAY_ULTIMATE_SOCIAL_ICONS] to show the social share icons. You can place it into any editor.
|
225 |
-
|
226 |
-
Alternatively, you can place the following into your codes to show the share icons: <?php echo do_shortcode('[DISPLAY_ULTIMATE_SOCIAL_ICONS]'); ?>
|
227 |
-
|
228 |
-
In some cases there might be issues to display social media sharing buttons which you uploaded as custom share icons. In this case, we provide support as part of our premium plugin: https://www.ultimatelysocial.com/usm-premium/
|
229 |
-
|
230 |
-
= Can I get more options for the social share icons next to posts? =
|
231 |
-
|
232 |
-
Please use this plugin for that: https://www.ultimatelysocial.com/usm-premium/
|
233 |
-
|
234 |
-
= Can I also give the email-icon a 'mailto:' functionality? =
|
235 |
-
|
236 |
-
Yes, that is possible in our new social share plugin, the Premium Plugin: https://www.ultimatelysocial.com/usm-premium/
|
237 |
-
|
238 |
-
= Can I also display the social share icons vertically? =
|
239 |
-
|
240 |
-
Yes, that is possible in our new social sharing plugin, the Premium Plugin: https://www.ultimatelysocial.com/usm-premium/.
|
241 |
-
|
242 |
-
= How can I change the text on the 'visit us'-buttons? =
|
243 |
-
|
244 |
-
Use this plugin: https://www.ultimatelysocial.com/usm-premium/
|
245 |
-
|
246 |
-
= Can I deactivate the social share icons on mobile? =
|
247 |
-
|
248 |
-
Yes, you can disable the share icons under question 5. In our new Premium Plugin you can define different settings for mobile, see https://www.ultimatelysocial.com/usm-premium/. The best way to share social media! :)
|
249 |
-
|
250 |
-
= How can I use two instances of the plugin on my site? =
|
251 |
-
|
252 |
-
You cannot use the same plugin twice, however you can install both the USM as well as the Premiuem plugin (https://www.ultimatelysocial.com/usm-premium/). We've developed the code so that there are no conflicts and you can place the share icons in one way with one plugin, and select other share icons with the other plugin and place them differently.
|
253 |
-
|
254 |
-
|
255 |
-
== Screenshots ==
|
256 |
-
|
257 |
-
1. After installing the plugin, you'll see this overview. You'll be taken through the easy-to-understand steps to configure your plugin
|
258 |
-
|
259 |
-
2. As a first step you select which share icons you want to display on your website
|
260 |
-
|
261 |
-
3. Then you'll define what the share icons should do (they can perform several actions, e.g. lead users to your facebook page, or allow them to share your content on their facebook page)
|
262 |
-
|
263 |
-
4. You can pick from a wide range of share icon designs
|
264 |
-
|
265 |
-
5. Here you can animate your social share icons (automatic shuffling, mouse-over effects etc.), to make visitors of your site aware that they can share, follow & like your site
|
266 |
-
|
267 |
-
6. You can choose to display counts next to your social share icons (e.g. number of Twitter-followers)
|
268 |
-
|
269 |
-
7. There are many more options to choose from
|
270 |
-
|
271 |
-
8. You can also add social share icons at the end of every post
|
272 |
-
|
273 |
-
9. ...or even display a pop-up (designed to your liking) which asks users to like & share your site
|
274 |
-
|
275 |
-
|
276 |
-
== Changelog ==
|
277 |
-
|
278 |
-
|
279 |
-
*
|
280 |
-
*
|
281 |
-
|
282 |
-
= 2.4.
|
283 |
-
*
|
284 |
-
*
|
285 |
-
*
|
286 |
-
|
287 |
-
|
288 |
-
|
289 |
-
*
|
290 |
-
*
|
291 |
-
*
|
292 |
-
|
293 |
-
|
294 |
-
|
295 |
-
*
|
296 |
-
*
|
297 |
-
*
|
298 |
-
|
299 |
-
= 2.3.
|
300 |
-
*
|
301 |
-
|
302 |
-
|
303 |
-
|
304 |
-
|
305 |
-
|
306 |
-
|
307 |
-
|
308 |
-
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
315 |
-
|
316 |
-
|
317 |
-
|
318 |
-
|
319 |
-
|
320 |
-
|
321 |
-
|
322 |
-
|
323 |
-
|
324 |
-
* Solved:
|
325 |
-
|
326 |
-
|
327 |
-
|
328 |
-
* Solved:
|
329 |
-
|
330 |
-
|
331 |
-
|
332 |
-
|
333 |
-
|
334 |
-
|
335 |
-
|
336 |
-
|
337 |
-
|
338 |
-
|
339 |
-
*
|
340 |
-
* Solved: Icons
|
341 |
-
|
342 |
-
|
343 |
-
|
344 |
-
*
|
345 |
-
* Solved:
|
346 |
-
* Solved:
|
347 |
-
* Solved:
|
348 |
-
|
349 |
-
|
350 |
-
*
|
351 |
-
|
352 |
-
|
353 |
-
|
354 |
-
|
355 |
-
*
|
356 |
-
|
357 |
-
= 2.2.
|
358 |
-
* Solved:
|
359 |
-
* Solved:
|
360 |
-
* Solved:
|
361 |
-
|
362 |
-
= 2.2.
|
363 |
-
* Solved:
|
364 |
-
* Solved:
|
365 |
-
|
366 |
-
|
367 |
-
|
368 |
-
* Solved:
|
369 |
-
*
|
370 |
-
|
371 |
-
= 2.2.
|
372 |
-
|
373 |
-
|
374 |
-
|
375 |
-
|
376 |
-
|
377 |
-
|
378 |
-
|
379 |
-
|
380 |
-
|
381 |
-
|
382 |
-
|
383 |
-
|
384 |
-
|
385 |
-
|
386 |
-
|
387 |
-
|
388 |
-
|
389 |
-
* Solved:
|
390 |
-
|
391 |
-
|
392 |
-
|
393 |
-
* Solved:
|
394 |
-
|
395 |
-
|
396 |
-
|
397 |
-
|
398 |
-
* Solved:
|
399 |
-
|
400 |
-
|
401 |
-
|
402 |
-
|
403 |
-
* Solved:
|
404 |
-
|
405 |
-
|
406 |
-
|
407 |
-
|
408 |
-
|
409 |
-
|
410 |
-
|
411 |
-
* Solved:
|
412 |
-
* Solved:
|
413 |
-
|
414 |
-
= 2.0
|
415 |
-
*
|
416 |
-
*
|
417 |
-
*
|
418 |
-
|
419 |
-
= 2.0.
|
420 |
-
*
|
421 |
-
*
|
422 |
-
|
423 |
-
|
424 |
-
|
425 |
-
*
|
426 |
-
|
427 |
-
|
428 |
-
|
429 |
-
*
|
430 |
-
|
431 |
-
|
432 |
-
|
433 |
-
|
434 |
-
|
435 |
-
|
436 |
-
|
437 |
-
|
438 |
-
|
439 |
-
|
440 |
-
|
441 |
-
|
442 |
-
|
443 |
-
|
444 |
-
|
445 |
-
|
446 |
-
|
447 |
-
|
448 |
-
|
449 |
-
|
450 |
-
|
451 |
-
|
452 |
-
|
453 |
-
|
454 |
-
|
455 |
-
|
456 |
-
|
457 |
-
|
458 |
-
|
459 |
-
|
460 |
-
|
461 |
-
|
462 |
-
|
463 |
-
|
464 |
-
|
465 |
-
|
466 |
-
|
467 |
-
|
468 |
-
*
|
469 |
-
*
|
470 |
-
|
471 |
-
= 1.9.
|
472 |
-
*
|
473 |
-
|
474 |
-
|
475 |
-
|
476 |
-
|
477 |
-
|
478 |
-
|
479 |
-
|
480 |
-
|
481 |
-
|
482 |
-
|
483 |
-
|
484 |
-
|
485 |
-
|
486 |
-
|
487 |
-
|
488 |
-
|
489 |
-
|
490 |
-
|
491 |
-
|
492 |
-
|
493 |
-
|
494 |
-
|
495 |
-
|
496 |
-
|
497 |
-
|
498 |
-
|
499 |
-
|
500 |
-
|
501 |
-
|
502 |
-
|
503 |
-
|
504 |
-
|
505 |
-
|
506 |
-
|
507 |
-
|
508 |
-
|
509 |
-
|
510 |
-
|
511 |
-
|
512 |
-
|
513 |
-
|
514 |
-
|
515 |
-
|
516 |
-
|
517 |
-
*
|
518 |
-
|
519 |
-
= 1.7.
|
520 |
-
*
|
521 |
-
|
522 |
-
|
523 |
-
|
524 |
-
|
525 |
-
|
526 |
-
|
527 |
-
|
528 |
-
|
529 |
-
|
530 |
-
|
531 |
-
*
|
532 |
-
*
|
533 |
-
|
534 |
-
|
535 |
-
*
|
536 |
-
|
537 |
-
|
538 |
-
*
|
539 |
-
|
540 |
-
|
541 |
-
|
542 |
-
|
543 |
-
|
544 |
-
|
545 |
-
|
546 |
-
|
547 |
-
|
548 |
-
|
549 |
-
|
550 |
-
|
551 |
-
|
552 |
-
|
553 |
-
|
554 |
-
|
555 |
-
|
556 |
-
|
557 |
-
|
558 |
-
|
559 |
-
|
560 |
-
|
561 |
-
|
562 |
-
|
563 |
-
|
564 |
-
|
565 |
-
|
566 |
-
|
567 |
-
|
568 |
-
|
569 |
-
|
570 |
-
*
|
571 |
-
|
572 |
-
|
573 |
-
|
574 |
-
|
575 |
-
|
576 |
-
|
577 |
-
|
578 |
-
|
579 |
-
|
580 |
-
|
581 |
-
*
|
582 |
-
*
|
583 |
-
|
584 |
-
|
585 |
-
|
586 |
-
*
|
587 |
-
|
588 |
-
|
589 |
-
|
590 |
-
|
591 |
-
|
592 |
-
|
593 |
-
|
594 |
-
|
595 |
-
|
596 |
-
|
597 |
-
|
598 |
-
|
599 |
-
|
600 |
-
|
601 |
-
|
602 |
-
|
603 |
-
|
604 |
-
|
605 |
-
|
606 |
-
|
607 |
-
*
|
608 |
-
|
609 |
-
|
610 |
-
|
611 |
-
|
612 |
-
|
613 |
-
|
614 |
-
|
615 |
-
|
616 |
-
|
617 |
-
|
618 |
-
*
|
619 |
-
*
|
620 |
-
|
621 |
-
|
622 |
-
|
623 |
-
|
624 |
-
* jQuery issues
|
625 |
-
*
|
626 |
-
*
|
627 |
-
|
628 |
-
|
629 |
-
*
|
630 |
-
|
631 |
-
|
632 |
-
*
|
633 |
-
|
634 |
-
|
635 |
-
|
636 |
-
|
637 |
-
*
|
638 |
-
|
639 |
-
|
640 |
-
*
|
641 |
-
|
642 |
-
|
643 |
-
*
|
644 |
-
|
645 |
-
|
646 |
-
|
647 |
-
|
648 |
-
|
649 |
-
|
650 |
-
|
651 |
-
|
652 |
-
|
653 |
-
|
654 |
-
*
|
655 |
-
|
656 |
-
|
657 |
-
|
658 |
-
*
|
659 |
-
*
|
660 |
-
*
|
661 |
-
|
662 |
-
|
663 |
-
*
|
664 |
-
*
|
665 |
-
|
666 |
-
|
667 |
-
*
|
668 |
-
*
|
669 |
-
*
|
670 |
-
|
671 |
-
= 1.2.
|
672 |
-
*
|
673 |
-
|
674 |
-
|
675 |
-
|
676 |
-
|
677 |
-
|
678 |
-
|
679 |
-
|
680 |
-
|
681 |
-
|
682 |
-
|
683 |
-
*
|
684 |
-
|
685 |
-
= 1.2.
|
686 |
-
*
|
687 |
-
*
|
688 |
-
*
|
689 |
-
|
690 |
-
|
691 |
-
|
692 |
-
|
693 |
-
*
|
694 |
-
*
|
695 |
-
*
|
696 |
-
|
697 |
-
|
698 |
-
*
|
699 |
-
|
700 |
-
|
701 |
-
*
|
702 |
-
*
|
703 |
-
*
|
704 |
-
|
705 |
-
|
706 |
-
|
707 |
-
|
708 |
-
*
|
709 |
-
*
|
710 |
-
|
711 |
-
|
712 |
-
|
713 |
-
*
|
714 |
-
*
|
715 |
-
|
716 |
-
|
717 |
-
*
|
718 |
-
*
|
719 |
-
*
|
720 |
-
|
721 |
-
|
722 |
-
*
|
723 |
-
*
|
724 |
-
*
|
725 |
-
|
726 |
-
|
727 |
-
*
|
728 |
-
*
|
729 |
-
*
|
730 |
-
*
|
731 |
-
|
732 |
-
|
733 |
-
*
|
734 |
-
*
|
735 |
-
*
|
736 |
-
|
737 |
-
|
738 |
-
*
|
739 |
-
*
|
740 |
-
*
|
741 |
-
*
|
742 |
-
*
|
743 |
-
*
|
744 |
-
*
|
745 |
-
*
|
746 |
-
*
|
747 |
-
*
|
748 |
-
*
|
749 |
-
*
|
750 |
-
*
|
751 |
-
*
|
752 |
-
*
|
753 |
-
|
754 |
-
|
755 |
-
*
|
756 |
-
*
|
757 |
-
*
|
758 |
-
|
759 |
-
|
760 |
-
|
761 |
-
*
|
762 |
-
* Conflicts with
|
763 |
-
*
|
764 |
-
|
765 |
-
|
766 |
-
*
|
767 |
-
|
768 |
-
|
769 |
-
*
|
770 |
-
|
771 |
-
|
772 |
-
|
773 |
-
|
774 |
-
*
|
775 |
-
|
776 |
-
|
777 |
-
*
|
778 |
-
*
|
779 |
-
|
780 |
-
|
781 |
-
*
|
782 |
-
*
|
783 |
-
*
|
784 |
-
|
785 |
-
|
786 |
-
*
|
787 |
-
*
|
788 |
-
*
|
789 |
-
*
|
790 |
-
*
|
791 |
-
*
|
792 |
-
* Some
|
793 |
-
|
794 |
-
|
795 |
-
*
|
796 |
-
|
797 |
-
|
798 |
-
|
799 |
-
|
800 |
-
*
|
801 |
-
|
802 |
-
|
803 |
-
*
|
804 |
-
*
|
805 |
-
|
806 |
-
|
807 |
-
*
|
808 |
-
*
|
809 |
-
* If
|
810 |
-
|
811 |
-
= 1.1.1.
|
812 |
-
*
|
813 |
-
|
814 |
-
|
815 |
-
|
816 |
-
|
817 |
-
|
818 |
-
|
819 |
-
|
820 |
-
*
|
821 |
-
|
822 |
-
|
823 |
-
|
824 |
-
*
|
825 |
-
*
|
826 |
-
|
827 |
-
|
828 |
-
*
|
829 |
-
|
830 |
-
|
831 |
-
*
|
832 |
-
*
|
833 |
-
|
834 |
-
|
835 |
-
|
836 |
-
*
|
837 |
-
*
|
838 |
-
|
839 |
-
|
840 |
-
|
841 |
-
|
842 |
-
*
|
843 |
-
*
|
844 |
-
*
|
845 |
-
|
846 |
-
|
847 |
-
|
848 |
-
*
|
849 |
-
*
|
850 |
-
*
|
851 |
-
|
852 |
-
= 1.1.0.
|
853 |
-
*
|
854 |
-
*
|
855 |
-
*
|
856 |
-
|
857 |
-
= 1.1.0.
|
858 |
-
*
|
859 |
-
|
860 |
-
|
861 |
-
|
862 |
-
|
863 |
-
*
|
864 |
-
|
865 |
-
= 1.
|
866 |
-
*
|
867 |
-
|
868 |
-
|
869 |
-
|
870 |
-
=
|
|
|
|
|
|
|
|
|
|
|
871 |
Please upgrade
|
1 |
+
=== Social Media Share Buttons & Social Sharing Icons ===
|
2 |
+
Contributors: socialdude, socialtech
|
3 |
+
Tags: social media, share, buttons, social widget, icons, share icons, share buttons, sharing icons, sharing buttons, social share, sharing, social sharing
|
4 |
+
Requires at least: 3.5
|
5 |
+
Tested up to: 5.2.2
|
6 |
+
Stable tag: 2.4.2
|
7 |
+
License: GPLv2
|
8 |
+
License URI: http://www.gnu.org/licenses/gpl-2.0.html
|
9 |
+
|
10 |
+
Share buttons and share icons plugin for social media sharing on Facebook, Twitter, Instagram, Whatsapp, Pinterest etc.
|
11 |
+
|
12 |
+
== Description ==
|
13 |
+
|
14 |
+
Social media plugin which let's you add share icons for RSS, Email, Facebook, Twitter, LinkedIn, Pinterest, Instagram, Youtube, 'Share' (covering 200+ other social media platforms) and upload custom share icons of your choice.
|
15 |
+
|
16 |
+
This free plugin has a lot to offer. Even more can be found in the Premium Plugin, please watch this short video:
|
17 |
+
|
18 |
+
[vimeo https://vimeo.com/269140798]
|
19 |
+
|
20 |
+
See [all features of the Premium plugin](https://www.ultimatelysocial.com/usm-premium/).
|
21 |
+
|
22 |
+
The free social media plugin includes the following features:
|
23 |
+
|
24 |
+
- Pick from 16 different designs for your social media share icons
|
25 |
+
- Give several actions to one social media share icon (e.g. your facebook share icon can lead visitors to your Facebook page, and also give visitors the opportunity to like your page)
|
26 |
+
- Decide to give your social media icons an animation (e.g. automatic shuffling, mouse-over effects) to make your visitors aware of the share icons, increasing the chance that they follow/share your blog
|
27 |
+
- Make your social media icons 'float' or 'sticky'
|
28 |
+
- Allow visitors to subscribe to your blog by Email
|
29 |
+
- Add 'counts' to your social media buttons
|
30 |
+
- Decide to display a pop-up (on all or only on selected pages) asking people to follow/share you via your social media icons
|
31 |
+
- Decide to display sharing-buttons and social media icons at the end of every post
|
32 |
+
- Select from many other customization features for your socialmedia icons!
|
33 |
+
|
34 |
+
For GDPR compliance, please have a look at our [Social Media GDPR Compliance page](https://ultimatelysocial.com/gdpr/).
|
35 |
+
|
36 |
+
The social media plugin is very easy to use as it takes you through all the steps:
|
37 |
+
|
38 |
+
- Step 1: Choose which social media icons you want to display
|
39 |
+
- Step 2: Define what actions your social media icons should perform
|
40 |
+
- Step 3: Pick design & animation options for your social media icons
|
41 |
+
- Step 4: Add counts to your social media icons (optional)
|
42 |
+
- Step 5: Select from various other social share options, e.g. make your social media icons 'float'
|
43 |
+
- Step 6: Add sharing/linking icons next to each blog post (optional)
|
44 |
+
- Step 7: Add a customized pop-up asking people to follow or share (optional)
|
45 |
+
- Step 8: Add a subscription form on your site (optional)
|
46 |
+
|
47 |
+
In case of issues or questions please ask in the [Support forum](https://wordpress.org/support/plugin/ultimate-social-media-icons).
|
48 |
+
|
49 |
+
We hope you enjoy the free social media plugin!
|
50 |
+
|
51 |
+
= New Premium Plugin =
|
52 |
+
|
53 |
+
We released a Premium Plugin with many more exciting features:
|
54 |
+
|
55 |
+
- **Many more social networks** supported, including Snapchat share buttons, Whatsapp share buttons, Yummly share buttons, Phone button, Yelp share buttons, Soundcloud share buttons, Skype share buttons Flickr share buttons, Blogger share buttons, Reddit share buttons, Vimeo share buttons, Tumblr share buttons, Xing share buttons, Vkontakte share buttons (VK), Telegram share buttons, Amazon share buttons, Goodreads share buttons, Angies list share buttons, Steam share buttons, Twitch share buttons, Spotify share buttons, Odnoklassniki share buttons (OK), Buffer share buttons, Weibo share buttons, Pocket share buttons, Meneame share buttons, Frype share buttons, LiveJournal share buttons, Patreon share buttons, Dloky share buttons, Discord share buttons, Github share buttons, Wordpress buttons, Etsy share buttons, Better Business Bureau share buttons, Digg share buttons, Delicious share buttons, Print share buttons, and many other share buttons!
|
56 |
+
- **More design styles** to make your social share icons look really cool & matching the design of your website
|
57 |
+
- **Themed design styles**, e.g. if you have a website about cats you can pick from social media logos which look like cats etc.
|
58 |
+
- **Better social sharing and following features**, e.g. you can define the Tweet-texts better (e.g. pull the post titles into your Tweets automatically), let people follow you on Facebook directly without leaving your site etc.
|
59 |
+
- **Place the social icons on specific pages**, i.e. you can define on which pages the icons to the social media sites should not show
|
60 |
+
- **Position the social icons by anchor and margins**, i.e. you can define the margins where your share icons should be displayed (from top/bottom/left/right), and then have them floating, or stick, still visible when user scrolls down or not etc.
|
61 |
+
- **Optimized for mobile** - you can define separate selections for your social network icons for mobile
|
62 |
+
- **More functions for email icon**, such as Share (by email), Contact you, Link to a certain page etc.
|
63 |
+
- **Social media counters optimized** to encourage more social media sharing from your visitors
|
64 |
+
- **More pop up options** which contain your social media buttons, e.g. define a limit to how often the pop-up is shown to the same user, show pop-up only when people try to leave your website etc.
|
65 |
+
- **Friendly support** in case you're stuck
|
66 |
+
- **Many more settings and options** for your social media network icons
|
67 |
+
|
68 |
+
Have a look at the [Premium Plugin features](https://www.ultimatelysocial.com/usm-premium/)
|
69 |
+
|
70 |
+
|
71 |
+
== Installation ==
|
72 |
+
Extract the zip file and drop the contents into the wp-content/plugins/ directory of your WordPress installation. Then activate the plugin from the plugins page.
|
73 |
+
|
74 |
+
Then go to plugin settings page and follow the instructions. After you're done, go to the Widget area (Appearance >> Widget) and place the widget on your sidebar to display your social sharing icons on your blog.
|
75 |
+
|
76 |
+
Note: This plugin requires CURL to be activated/installed on your server (which should be the standard case), and a PHP version of 5.4 or above. If you don't have it, please contact your hosting provider or server admin.
|
77 |
+
|
78 |
+
== Frequently Asked Questions ==
|
79 |
+
= Please also check the more comprehensive FAQ on http://ultimatelysocial.com/faq =
|
80 |
+
|
81 |
+
.
|
82 |
+
|
83 |
+
= I face fundamental issues (the plugin doesn't load etc.) =
|
84 |
+
|
85 |
+
Please ensure that:
|
86 |
+
|
87 |
+
- You're using the latest version of the plugin(s)
|
88 |
+
- Your site is running on PHP 5.4 or above
|
89 |
+
- You have CURL activated (should be activated by default)
|
90 |
+
|
91 |
+
If you're not familiar with those please contact your hosting company or server admin.
|
92 |
+
|
93 |
+
Please check if you have browser extensions activated which may conflict with the plugin. Known culprits include:
|
94 |
+
|
95 |
+
- Open SEO Stats (Formerly: PageRank Status) in Chrome
|
96 |
+
- Adblock Plus in Chrome
|
97 |
+
- Vine in Chrome
|
98 |
+
|
99 |
+
Either de-activate those extensions or try it in a different browser.
|
100 |
+
|
101 |
+
If the plugin setting's area looks 'funny' after an upgrade then please clear your cache with String+F5 (PC) or Command+R (Mac).
|
102 |
+
|
103 |
+
If you get the error message “Are you sure you want to do this? / Please try again” when uploading the socialsharing plugin: Some servers may have a low limits with respect to permitted upload times. Please set the values in the “php.ini” file to:
|
104 |
+
|
105 |
+
max_execution_time 90
|
106 |
+
post_max_size 48M
|
107 |
+
|
108 |
+
If you don’t know how to do it, please contact your server support / hosting company for that. Tell them you need it for a social sharing plugin on WordPress which may take longer to upload.
|
109 |
+
|
110 |
+
If your issue is still not fixed after you’ve followed the steps above, we can provide support as part of our share to social Premium Plugin: https://www.ultimatelysocial.com/usm-premium/.
|
111 |
+
|
112 |
+
= I get error messages 'Error : 7', 'Error : 56', 'Error : 6' etc. =
|
113 |
+
|
114 |
+
Those point to a CURL-issue on your site. Please contact your server admin or your hosting company to resolve it.
|
115 |
+
|
116 |
+
The plugin requires CURL for the social share counts and other features.
|
117 |
+
|
118 |
+
= Social share icons don't show =
|
119 |
+
|
120 |
+
Please ensure you actually placed the social share buttons either as social widget (in your widget area) or as floating icons under question 5). The Premium Plugin makes placing the social icons especially easy and also allows you to place sticky social share icons on your site, define the placement of the social share icons by margins and many other options, see https://www.ultimatelysocial.com/usm-premium/.
|
121 |
+
|
122 |
+
If only some social share icons show, but not all, then please clear your cache, and check if you may have conflicting browser extensions (e.g. 'Disconnect'-app in Chrome). Also Ad-Blockers are known culprits, please switch them off temporarily to see if that is the reason.
|
123 |
+
|
124 |
+
If the social share icons still don't show then there's an issue with your template. Please contact the creator of your template for that.
|
125 |
+
|
126 |
+
If you are referring to specific social share icons not showing in the plugin itself (e.g. you're looking for a Whatsapp share icon, but it doesnt exist) please note that our Premium Plugin has many more social media share icons, see https://www.ultimatelysocial.com/usm-premium/
|
127 |
+
|
128 |
+
= Twitter social share counts are not displaying (anymore) =
|
129 |
+
|
130 |
+
Unfortunately, Twitter stopped providing any social share count. God knows why.
|
131 |
+
|
132 |
+
= Changes don't get saved / Deleted plugin but the social share icons still show =
|
133 |
+
|
134 |
+
Most likely you have the WP Cache plugin installed. Please de-activate and then re-activate it, then the social share icons should display again.
|
135 |
+
|
136 |
+
= Links when clicking on the social share icons don't work =
|
137 |
+
|
138 |
+
Please ensure you've entered the 'http://' at the beginning of the url (for *all* social networks). If the social share icons are not clickable at all there is most likely an issue with your template. This is especially the case if you've given your social share buttons several features, which should show a pop-up (tooltip) when you move over the social share icons.
|
139 |
+
|
140 |
+
= I cannot upload custom social share icons =
|
141 |
+
|
142 |
+
Most likely that's because you've set 'allow_url_fopen' to 'off'. Please turn it to 'on' (or ask your server admin to do so, he'll know what to do. Tell them you need it to upload custom share icons for a social media buttons plugin).
|
143 |
+
|
144 |
+
= My Youtube social share icon (direct follow) doesn't work =
|
145 |
+
|
146 |
+
Please ensure that you've selected the radio button 'Username' when you enter a youtube username, or 'Channel ID' when you entered a channel ID.
|
147 |
+
|
148 |
+
= Aligning the social share icons (centered, left- or right-aligned) doesn't work =
|
149 |
+
|
150 |
+
The alignment options under question 5 align the social share icons with respect to each other, not where they appear on the page. Our new Premium Plugin is the best social sharing plugin on the market, allowing you to define also many other social share icon alignments (e.g. within a widget, within shortcode etc.).
|
151 |
+
|
152 |
+
= Clicking on the RSS icon returns funny codes =
|
153 |
+
|
154 |
+
That's normal. RSS users will know what to do with it (i.e. copy & paste the url into their RSS readers).
|
155 |
+
|
156 |
+
= Facebook 'like'-count isn't correct =
|
157 |
+
|
158 |
+
When you 'like' something on your blog via facebook it likes the site you're currently on (e.g. your blog) and not your Facebook page.
|
159 |
+
|
160 |
+
The new Premium Plugin also allows to show the number of your Facebook page likes, see https://www.ultimatelysocial.com/usm-premium/.
|
161 |
+
|
162 |
+
= Sharing doesn't take the right text or picture =
|
163 |
+
|
164 |
+
We use the share codes from Facebook etc. and therefore don't have any influence over which text & pic Facebook decides to share.
|
165 |
+
|
166 |
+
Note that you can define an image as 'Featured Image' which tells Facebook etc. to share that one. You'll find this 'Featured Image' section in your blog's admin area where you can edit your blog post.
|
167 |
+
|
168 |
+
You can crosscheck which image Facebook will take by entering your url on https://developers.facebook.com/tools/debug/og/object/.
|
169 |
+
|
170 |
+
UPDATE: we made significant enhancements to the premium plugin, it now allows you to define the sharing pics and texts for your social share icons.
|
171 |
+
|
172 |
+
= The pop-up shows although I only gave my social share icon one function =
|
173 |
+
|
174 |
+
The pop-up only disappears if you've given your social share icons only a 'visit us'-function, otherwise (e.g. if you gave it 'Like' (on facebook) or 'Tweet' functions) a pop-up is still needed because the social share buttons for those are coming directly from the social media sites (e.g. Facebook, Twitter) and we don't have any influence over their design.
|
175 |
+
|
176 |
+
= I selected to display the social share icons after every post but they don't show =
|
177 |
+
|
178 |
+
The social share icons usually do show, however not on your blog page, but on your single posts pages. The Premium plugin (https://www.ultimatelysocial.com/usm-premium/) also allows to display the social share icons on your homepage.
|
179 |
+
|
180 |
+
= Plugin decreases my site's loading speed =
|
181 |
+
|
182 |
+
The plugin is one of the most optimized social media plugin in terms of impact on a site's loading speed (optimized code, compressed pictures etc.).
|
183 |
+
|
184 |
+
If you still experience loading speed issues, please note that:
|
185 |
+
|
186 |
+
- The more sharing- and invite- features you place on your site, the more external codes you load (i.e. from the social media sites; we just use their share code), therefore impacting loading speed. So to prevent this, give your social share icons only 'Visit us'-functionality rather than sharing-functionalities.
|
187 |
+
|
188 |
+
- We've programmed it so that the code for the social media icons is the one which loads lasts on your site, i.e. after all the other content has already been loaded. This means: even if there is a decrease in loading speed, it does not impact a user's experience because he sees your site as quickly as before, only the social media icons take a bit longer to load.
|
189 |
+
|
190 |
+
There might be also other issues on your site which cause a high loading speed (e.g. conflicts with our plugins or template issues). Please ask your template creator about that.
|
191 |
+
|
192 |
+
Also, if you've uploaded social media sharing icons not provided by the plugin itself (i.e. custom share icons) please ensure they are compressed as well.
|
193 |
+
|
194 |
+
= After moving from demo-server to live-server the follow/subscribe-link doesn't work anymore =
|
195 |
+
|
196 |
+
Please delete and install the plugin again.
|
197 |
+
|
198 |
+
If you already placed the code for a subscription form on your site, remove it again and take the new one from the new plugin installation.
|
199 |
+
|
200 |
+
= There are other issues when I activate the plugin or place the social share icons =
|
201 |
+
|
202 |
+
Please check the following:
|
203 |
+
|
204 |
+
The plugin requires that CURL is installed & activated on your server (which should be the standard case). If you don't have it, please contact your hosting provider.
|
205 |
+
|
206 |
+
Please ensure that you don't have any browser extension activated which may conflict with the plugin, esp. those which block certain content. Known culprits include the 'Disconnect' extension in Chrome or the 'Privacy Badger' extension in Firefox.
|
207 |
+
|
208 |
+
If issues persist most likely your theme has issues which makes it incompatible with our plugin. Please contact your template creator for that. As part of the Premium Plugin (https://www.ultimatelysocial.com/usm-premium/) we fix also theme issues, and provide support to ensure that your social media share buttons appear on your site (exactly where you want them).
|
209 |
+
|
210 |
+
= How can I see how many people decided to share or like my post? =
|
211 |
+
|
212 |
+
You can see this by activating the social share 'counts' on the front end (under question 4 in the USM plugin, question 5 in the USM+ plugin).
|
213 |
+
|
214 |
+
We cannot provide you this data in other ways as it's coming directly from the social media sites. One exception: if you like to know when people start to follow you by email, then you can get email alerts. For that, please claim your feed (see question above).
|
215 |
+
|
216 |
+
= How can I change the 'Please follow & like us :)'? =
|
217 |
+
|
218 |
+
You can change it in the Widget-area where you dropped the widget (with the social share icons) on the sidebar. Please click on it (on the sidebar), it will open the menu where you can change the text.
|
219 |
+
|
220 |
+
If you don't want to show any text, just enter a space (' ').
|
221 |
+
|
222 |
+
= Can I use a shortcode to place the social share icons? =
|
223 |
+
|
224 |
+
Yes, use [DISPLAY_ULTIMATE_SOCIAL_ICONS] to show the social share icons. You can place it into any editor.
|
225 |
+
|
226 |
+
Alternatively, you can place the following into your codes to show the share icons: <?php echo do_shortcode('[DISPLAY_ULTIMATE_SOCIAL_ICONS]'); ?>
|
227 |
+
|
228 |
+
In some cases there might be issues to display social media sharing buttons which you uploaded as custom share icons. In this case, we provide support as part of our premium plugin: https://www.ultimatelysocial.com/usm-premium/
|
229 |
+
|
230 |
+
= Can I get more options for the social share icons next to posts? =
|
231 |
+
|
232 |
+
Please use this plugin for that: https://www.ultimatelysocial.com/usm-premium/
|
233 |
+
|
234 |
+
= Can I also give the email-icon a 'mailto:' functionality? =
|
235 |
+
|
236 |
+
Yes, that is possible in our new social share plugin, the Premium Plugin: https://www.ultimatelysocial.com/usm-premium/
|
237 |
+
|
238 |
+
= Can I also display the social share icons vertically? =
|
239 |
+
|
240 |
+
Yes, that is possible in our new social sharing plugin, the Premium Plugin: https://www.ultimatelysocial.com/usm-premium/.
|
241 |
+
|
242 |
+
= How can I change the text on the 'visit us'-buttons? =
|
243 |
+
|
244 |
+
Use this plugin: https://www.ultimatelysocial.com/usm-premium/
|
245 |
+
|
246 |
+
= Can I deactivate the social share icons on mobile? =
|
247 |
+
|
248 |
+
Yes, you can disable the share icons under question 5. In our new Premium Plugin you can define different settings for mobile, see https://www.ultimatelysocial.com/usm-premium/. The best way to share social media! :)
|
249 |
+
|
250 |
+
= How can I use two instances of the plugin on my site? =
|
251 |
+
|
252 |
+
You cannot use the same plugin twice, however you can install both the USM as well as the Premiuem plugin (https://www.ultimatelysocial.com/usm-premium/). We've developed the code so that there are no conflicts and you can place the share icons in one way with one plugin, and select other share icons with the other plugin and place them differently.
|
253 |
+
|
254 |
+
|
255 |
+
== Screenshots ==
|
256 |
+
|
257 |
+
1. After installing the plugin, you'll see this overview. You'll be taken through the easy-to-understand steps to configure your plugin
|
258 |
+
|
259 |
+
2. As a first step you select which share icons you want to display on your website
|
260 |
+
|
261 |
+
3. Then you'll define what the share icons should do (they can perform several actions, e.g. lead users to your facebook page, or allow them to share your content on their facebook page)
|
262 |
+
|
263 |
+
4. You can pick from a wide range of share icon designs
|
264 |
+
|
265 |
+
5. Here you can animate your social share icons (automatic shuffling, mouse-over effects etc.), to make visitors of your site aware that they can share, follow & like your site
|
266 |
+
|
267 |
+
6. You can choose to display counts next to your social share icons (e.g. number of Twitter-followers)
|
268 |
+
|
269 |
+
7. There are many more options to choose from
|
270 |
+
|
271 |
+
8. You can also add social share icons at the end of every post
|
272 |
+
|
273 |
+
9. ...or even display a pop-up (designed to your liking) which asks users to like & share your site
|
274 |
+
|
275 |
+
|
276 |
+
== Changelog ==
|
277 |
+
|
278 |
+
= 2.4.2 =
|
279 |
+
* Solved the unserialize problem.
|
280 |
+
* Design changes and typo corrections in the settings page.
|
281 |
+
|
282 |
+
= 2.4.1 =
|
283 |
+
* Feedback system updated.
|
284 |
+
* Design changes in settings page.
|
285 |
+
* Moved below post options to Q3.
|
286 |
+
|
287 |
+
= 2.4.0 =
|
288 |
+
* Instagram generate token removed the deplicated scopes.
|
289 |
+
* Removed some PHP update Notices.
|
290 |
+
* Updated feed claiming apis.
|
291 |
+
* Updated Mouseover text removed.
|
292 |
+
|
293 |
+
= 2.3.9 =
|
294 |
+
* Corrected the jQuery admin area problem
|
295 |
+
* Solved the jQuery error for shortcode
|
296 |
+
* Solved feed claiming
|
297 |
+
* Option name in Q3 changed
|
298 |
+
|
299 |
+
= 2.3.8 =
|
300 |
+
* Fixed the text in theme banner.
|
301 |
+
* Fixed follow icon and subscription box when Curl is disabled.
|
302 |
+
* Fixed cURL errors.
|
303 |
+
|
304 |
+
= 2.3.7 =
|
305 |
+
* solved: Wrong link on icons when curl not installed.
|
306 |
+
|
307 |
+
= 2.3.6 =
|
308 |
+
* Solved: Updated Text changes.
|
309 |
+
|
310 |
+
= 2.3.5 =
|
311 |
+
* Solved: Updated Text changes.
|
312 |
+
|
313 |
+
= 2.3.4 =
|
314 |
+
* Solved: Updated Text changes.
|
315 |
+
* Solved: Updated link for email.
|
316 |
+
|
317 |
+
= 2.3.3 =
|
318 |
+
* Solved: Updated the email link and subscription action.
|
319 |
+
|
320 |
+
= 2.3.2 =
|
321 |
+
* Solved: Updated feedback system.
|
322 |
+
|
323 |
+
= 2.3.1 =
|
324 |
+
* Solved: Updated feedback system.
|
325 |
+
|
326 |
+
= 2.3.0 =
|
327 |
+
* Solved: Errors on the footer in dashboard corected.
|
328 |
+
* Solved: Updated logic for inclusion of external js.
|
329 |
+
* Solved: Some grametical errors.
|
330 |
+
* Solved: Updated feedback system.
|
331 |
+
|
332 |
+
= 2.2.9 =
|
333 |
+
* Solved: After post icons shown.
|
334 |
+
|
335 |
+
= 2.2.8 =
|
336 |
+
* Solved: Header already sent error on some servers.
|
337 |
+
|
338 |
+
= 2.2.7 =
|
339 |
+
* Solved: Updated feedback system to next version.
|
340 |
+
* Solved: Responsive Icons UI updated.
|
341 |
+
|
342 |
+
= 2.2.6 =
|
343 |
+
|
344 |
+
* New Feature: Responsive icons in free plugin.
|
345 |
+
* Solved: Icons not rendering on woocomerce product page.
|
346 |
+
* Solved: Twitter url changed to share from intent for better reliablity.
|
347 |
+
* Solved: Lots of little adjustments to improve the UI and functionality.
|
348 |
+
* Solved: Removed Google Plus.
|
349 |
+
* Solved: Stop loading unused external library code for faster load.
|
350 |
+
* Solved: Removed curl notice while activation.
|
351 |
+
* Solved: Fixed broken arrays and missing indexes.
|
352 |
+
* Solved: Updated feedback system to next version.
|
353 |
+
|
354 |
+
= 2.2.5 =
|
355 |
+
* Integrated feedback system
|
356 |
+
|
357 |
+
= 2.2.4 =
|
358 |
+
* Solved: Unserialized error corrected.
|
359 |
+
* Solved: All curl calls to wp_remote.
|
360 |
+
* Solved: Notices in front end solved.
|
361 |
+
|
362 |
+
= 2.2.3 =
|
363 |
+
* Solved: Footer Error solved.
|
364 |
+
* Solved: Removed most of the html errors.
|
365 |
+
* Solved: Less anoying sidebar.
|
366 |
+
|
367 |
+
= 2.2.2 =
|
368 |
+
* Solved: More icons upadated
|
369 |
+
* Solved: Icon backgrounds updated
|
370 |
+
|
371 |
+
= 2.2.1 =
|
372 |
+
* Solved: woocomerce conflict resolved
|
373 |
+
* Solved: alert in case on conflict.
|
374 |
+
* new Feature: More icons for free plugin
|
375 |
+
|
376 |
+
= 2.2.0 =
|
377 |
+
* Solved: Critical Security Patch.
|
378 |
+
|
379 |
+
= 2.1.9 =
|
380 |
+
* Solved: Security Patch.
|
381 |
+
|
382 |
+
= 2.1.8 =
|
383 |
+
* Solved: security update.
|
384 |
+
|
385 |
+
= 2.1.7 =
|
386 |
+
* Solved: save button not working.
|
387 |
+
|
388 |
+
= 2.1.6 =
|
389 |
+
* Solved: compatablity issue with older versions.
|
390 |
+
|
391 |
+
= 2.1.5 =
|
392 |
+
* Solved: google plus is deprecated
|
393 |
+
* Solved: Sf count not shown
|
394 |
+
* Solved: Sf subscribe form opens blank page.
|
395 |
+
* solved: decreased the manual intervestions of upgradation to premium.
|
396 |
+
|
397 |
+
= 2.1.4 =
|
398 |
+
* Solved: Changed theme check url to match bloginfo url.
|
399 |
+
|
400 |
+
= 2.1.3 =
|
401 |
+
* Solved: Email validation for Offline chat.
|
402 |
+
* Solved: Premium notification breaking the dashboard structure.
|
403 |
+
* Solved: changed option for linkedin count
|
404 |
+
* Solved: ajax_object conflict with themes.
|
405 |
+
* Solved: new keyword check from page title, page keywords and page description.
|
406 |
+
|
407 |
+
= 2.1.2 =
|
408 |
+
* Solved: Text optimized
|
409 |
+
|
410 |
+
= 2.1.1 =
|
411 |
+
* Solved: design changes for chat.
|
412 |
+
* Solved: unexpected charactor "[" error for php version 5.3.
|
413 |
+
|
414 |
+
= 2.1.0 =
|
415 |
+
* New Feature: Chat for site admin on our settings page.
|
416 |
+
* Solved: removed deprecated jQuery functions.
|
417 |
+
* Solved: Rectangle icon alignemnt problem on some themes solved.
|
418 |
+
|
419 |
+
= 2.0.9 =
|
420 |
+
* Banner for animation section in Question 4 added
|
421 |
+
* Different icon for mouseover section pointing in premium in Question 4 added
|
422 |
+
* Removed theme icon banner if no match
|
423 |
+
|
424 |
+
= 2.0.8 =
|
425 |
+
* Solved: Notification bar cannot be seen anymore
|
426 |
+
* Solved: cleared the float elements after notice.
|
427 |
+
|
428 |
+
= 2.0.7 =
|
429 |
+
* Round green follow button doesn't show - fixed
|
430 |
+
* Footer optimized
|
431 |
+
|
432 |
+
= 2.0.6 =
|
433 |
+
* Fixed bug that sometimes banner didn't disappear
|
434 |
+
* Links in review message updated
|
435 |
+
|
436 |
+
= 2.0.5 =
|
437 |
+
* Issue with click on icons on mobile fixed
|
438 |
+
|
439 |
+
= 2.0.4 =
|
440 |
+
* Corrected missing ? in shortcode
|
441 |
+
|
442 |
+
= 2.0.3 =
|
443 |
+
* Optimized texts
|
444 |
+
|
445 |
+
= 2.0.2 =
|
446 |
+
* Addthis removed due to GDPR
|
447 |
+
* New option to switch debugging mode on/off
|
448 |
+
|
449 |
+
= 2.0.1 =
|
450 |
+
* Issue of window.onscroll function overriding and breaking other plugins/themes fixed
|
451 |
+
|
452 |
+
= 2.0.0 =
|
453 |
+
* New question 3 to facilitate placement of icons
|
454 |
+
|
455 |
+
= 1.9.7 =
|
456 |
+
* Stopped setting cookies for pop-up selection "if user moved to end of page" as not needed in this case (relevant for GDPR compliance)
|
457 |
+
|
458 |
+
= 1.9.6 =
|
459 |
+
* Usage instructions updated
|
460 |
+
|
461 |
+
= 1.9.5 =
|
462 |
+
* Facebook like count fixed (previously only fixed for likes of user's website, not likes of Facebook page)
|
463 |
+
|
464 |
+
= 1.9.4 =
|
465 |
+
* Youtube count and direct follow issues fixed
|
466 |
+
|
467 |
+
= 1.9.3 =
|
468 |
+
* Facebook like count issue fixed
|
469 |
+
* Youtube saving issue when clicked on "Save all settings" - fixed now
|
470 |
+
|
471 |
+
= 1.9.2 =
|
472 |
+
* Instagram followers count issue fixed
|
473 |
+
* Twitter count issue fixed
|
474 |
+
* Facebook share count issue fixed
|
475 |
+
|
476 |
+
= 1.9.1 =
|
477 |
+
* Errors with "non-numeric value" fixed
|
478 |
+
|
479 |
+
= 1.8.9 =
|
480 |
+
* Error log files removed
|
481 |
+
|
482 |
+
= 1.8.7 =
|
483 |
+
* Updated description texts
|
484 |
+
|
485 |
+
= 1.8.6 =
|
486 |
+
* Made different placement options more visible
|
487 |
+
|
488 |
+
= 1.8.5 =
|
489 |
+
* Text changes
|
490 |
+
|
491 |
+
= 1.8.4 =
|
492 |
+
* Added referring opportunity
|
493 |
+
|
494 |
+
= 1.8.3 =
|
495 |
+
* Saving of links for custom icons sometimes didn't work. Fixed now.
|
496 |
+
|
497 |
+
= 1.8.2 =
|
498 |
+
* Links updated
|
499 |
+
|
500 |
+
= 1.8.1 =
|
501 |
+
* Themed icon notifications optimized
|
502 |
+
|
503 |
+
= 1.8.0 =
|
504 |
+
* CSS & JAVASCRIPT files are added in footer instead of header
|
505 |
+
|
506 |
+
= 1.7.9 =
|
507 |
+
* Banners added
|
508 |
+
* Spelling mistakes corrected
|
509 |
+
|
510 |
+
= 1.7.8 =
|
511 |
+
* Added more themed icon banners
|
512 |
+
|
513 |
+
= 1.7.6 =
|
514 |
+
* Comment to selecting of specific text and picture per page/post added
|
515 |
+
|
516 |
+
= 1.7.5 =
|
517 |
+
* Link to more premium icons added
|
518 |
+
|
519 |
+
= 1.7.4 =
|
520 |
+
* Better error messages in case of Curl errors
|
521 |
+
* Optimized review bar
|
522 |
+
* Code not remaining on site after de-installation
|
523 |
+
|
524 |
+
= 1.7.2 =
|
525 |
+
* More individualized offer for themed icons
|
526 |
+
|
527 |
+
= 1.7.1 =
|
528 |
+
* Claiming process optimized
|
529 |
+
|
530 |
+
= 1.6.9 =
|
531 |
+
* Counts for social buttons optimized and Instagram counter bug fixed
|
532 |
+
* Link to more social sharing buttons added
|
533 |
+
|
534 |
+
= 1.6.8 =
|
535 |
+
* Issue fixed that sometimes incorrect error-messages showed on front-end
|
536 |
+
* Credit link updated
|
537 |
+
* More icons added for pro-version
|
538 |
+
* SpecificFeeds adjusted for paid option
|
539 |
+
* De-installation will now clear database entirely
|
540 |
+
* Upgrade to pro-link renamed
|
541 |
+
|
542 |
+
= 1.6.6 =
|
543 |
+
* New option for tailor-made icons
|
544 |
+
|
545 |
+
= 1.6.5 =
|
546 |
+
* Activation/deactivation links optimized
|
547 |
+
|
548 |
+
= 1.6.4 =
|
549 |
+
* Links to additional features optimized
|
550 |
+
|
551 |
+
= 1.6.3 =
|
552 |
+
* Notification issues corrected
|
553 |
+
|
554 |
+
= 1.6.1 =
|
555 |
+
* Dismissal of notification lead to plugin setting's page previously, this is corrected now
|
556 |
+
|
557 |
+
= 1.5.8 =
|
558 |
+
* Educational comments added
|
559 |
+
|
560 |
+
= 1.5.7 =
|
561 |
+
* Conflicts with other plugins resolved
|
562 |
+
|
563 |
+
= 1.5.6 =
|
564 |
+
* Instructions for trouble shooting optimized
|
565 |
+
|
566 |
+
= 1.5.5 =
|
567 |
+
* Facebook icon leading to empty pages (in specific cases) fixed
|
568 |
+
|
569 |
+
= 1.5.4 =
|
570 |
+
* Twitter sharing text issues with forwarded slashes fixed
|
571 |
+
* Links to review sites adjusted following Wordpress changes in review section
|
572 |
+
|
573 |
+
= 1.5.3 =
|
574 |
+
* Missing counts for email follow option fixed (when there are no subscribers yet)
|
575 |
+
* Extra explanation text added
|
576 |
+
|
577 |
+
= 1.5.2 =
|
578 |
+
* Corner case vulnerability fixed
|
579 |
+
|
580 |
+
= 1.5.1 =
|
581 |
+
* Claiming process simplified
|
582 |
+
* Mouse-over for custom icons sometimes showed wrong text, corrected now
|
583 |
+
|
584 |
+
= 1.4.8 =
|
585 |
+
* Size of custom icons corrected
|
586 |
+
* Cute G+ icon too small before, corrected now
|
587 |
+
* Better description how to get G+ API key added
|
588 |
+
* Unsupported "live" function in jquery fixed
|
589 |
+
|
590 |
+
= 1.4.7 =
|
591 |
+
* Icons sometimes on top of each other - fixed
|
592 |
+
|
593 |
+
= 1.4.5 =
|
594 |
+
* E-Notice errors fixed
|
595 |
+
* Facebook share button added for before/after posts
|
596 |
+
|
597 |
+
= 1.4.4 =
|
598 |
+
* Errors fixed with color code sanitizing function
|
599 |
+
|
600 |
+
= 1.4.3 =
|
601 |
+
* Removed the js files from plugin and using the ones provided by WP now
|
602 |
+
|
603 |
+
= 1.4.2 =
|
604 |
+
* POST calls optimized (sanitize, escape, validate)
|
605 |
+
|
606 |
+
= 1.4.1 =
|
607 |
+
* Removed feedback option
|
608 |
+
* Tags changed
|
609 |
+
|
610 |
+
= 1.3.9 =
|
611 |
+
* Added Pinterest button for rectangle icons after/before posts
|
612 |
+
* If user has given an icon several functions, the tooltip appears as before, however if user clicks on the main icon then it will now also perform an action, i.e. the 'visit us'-function
|
613 |
+
|
614 |
+
= 1.3.8 =
|
615 |
+
* Review request changed
|
616 |
+
|
617 |
+
= 1.3.7 =
|
618 |
+
* Claiming links corrected
|
619 |
+
* Icons don't have any mouseover-effects (e.g. fade in) by default anymore
|
620 |
+
|
621 |
+
= 1.3.6 =
|
622 |
+
* Overkill declaration in the CSS fixed
|
623 |
+
* Custom icons can now have mailto:-functionality
|
624 |
+
* jQuery UI issues fixed
|
625 |
+
* Rectangle G+ icon now shown as last one as it takes more space (looks better)
|
626 |
+
* Comment added that partner plugin https://wordpress.org/plugins/ultimate-social-media-plus/ now allows buttons in various languages
|
627 |
+
|
628 |
+
= 1.3.5 =
|
629 |
+
* jQuery issues/conflicts fixed
|
630 |
+
* Placing icons on blog homepage had issues with counts, fixed now
|
631 |
+
* Script issues fixed
|
632 |
+
* Text added on plugin setting's page for easier understanding
|
633 |
+
* Issue that dashboard sometimes doesn't load fixed
|
634 |
+
* Instagram thin-icon issue fixed (misspelled, therefore didn't show)
|
635 |
+
|
636 |
+
= 1.3.4 =
|
637 |
+
* Facebook changed their API - please upgrade if you want Facebook sharing on mobile to work properly on your site!
|
638 |
+
|
639 |
+
= 1.3.3 =
|
640 |
+
* Feed claiming optimized
|
641 |
+
* New 'Visit us'-icon for Twitter added which matches the new Twitter-design
|
642 |
+
* PNG-file error for Houzz icon corrected
|
643 |
+
* Incorrect G+ icon replaced
|
644 |
+
* Error message for sites where subscription form doesn't work added
|
645 |
+
* Extra comments added how to claim a feed and several other texts optimized
|
646 |
+
|
647 |
+
= 1.3.2 =
|
648 |
+
* Feed claiming optimized
|
649 |
+
|
650 |
+
= 1.3.1 =
|
651 |
+
* Shortpixel link fixed
|
652 |
+
|
653 |
+
= 1.3.0 =
|
654 |
+
* Feed claiming bug fixed
|
655 |
+
|
656 |
+
= 1.2.9 =
|
657 |
+
* New G+ button updated
|
658 |
+
* Quicker claiming of feed possible
|
659 |
+
* Comments to share-button added
|
660 |
+
* Credit to shortpixel added
|
661 |
+
|
662 |
+
= 1.2.8 =
|
663 |
+
* New feature: Users can now decide where exactly the floating icons will display
|
664 |
+
* Internal links corrected
|
665 |
+
* Fixed: Targets only labels within the social icons div.
|
666 |
+
* Subscriber counts fixed
|
667 |
+
* Apostrophe issues fixed
|
668 |
+
* Conflicts with Yoast SEO plugin resolved
|
669 |
+
* PHP errors fixed
|
670 |
+
|
671 |
+
= 1.2.7 =
|
672 |
+
* Count issues fixed - please upgrade!
|
673 |
+
* Style constructor updated to PHP 5
|
674 |
+
* Text adjustments in admin area
|
675 |
+
|
676 |
+
= 1.2.6 =
|
677 |
+
* (Minor) compatibility issues with Wordpress 4.3. fixed
|
678 |
+
|
679 |
+
= 1.2.5 =
|
680 |
+
* Updating process fixed
|
681 |
+
|
682 |
+
= 1.2.4 =
|
683 |
+
* New question 8 added: you can now also add a subscription form to your site
|
684 |
+
|
685 |
+
= 1.2.3 =
|
686 |
+
* More explanations added how to fix if counts don't work
|
687 |
+
* Icon files are compressed now for faster loading - thank you ShortPixel.com!
|
688 |
+
* A typo in the code threw an error message in certain cases, this is fixed now
|
689 |
+
|
690 |
+
= 1.2.2 =
|
691 |
+
* jQuery issues fixed
|
692 |
+
* Vulnerability issues fixed
|
693 |
+
* Twitter-button didn't get displayed in full sometimes, this is fixed now
|
694 |
+
* CSS issues (occurred on some templates) fixed
|
695 |
+
* Facebook updated API (so counts didn't get displayed correctly anymore), we updated the plugin accordingly
|
696 |
+
|
697 |
+
= 1.2.1 =
|
698 |
+
* Template-specific issues fixed
|
699 |
+
* Layout in admin-area optimized
|
700 |
+
* Sometimes title didn't get rendered correctly, this is fixed now
|
701 |
+
* Youtube API changes also updated in plugin
|
702 |
+
* Outdated (and vulnerable) JS library updated
|
703 |
+
* New options for placing icons after every post (under question 6)
|
704 |
+
|
705 |
+
= 1.2.0 =
|
706 |
+
* Links with '@' in the url (e.g. as in Flickr-links) now get recognized as well
|
707 |
+
* Alignment issues of icons in tooltip fixed
|
708 |
+
* Layout optimizations in plugin area
|
709 |
+
* Users can now select to have the number of likes of their facebook page displayed as counts of the facebook icon on their blogs
|
710 |
+
* Typos in admin area corrected
|
711 |
+
|
712 |
+
= 1.1.1.12 =
|
713 |
+
* Vulnerabilities (AJAX) fixed
|
714 |
+
* OG-issues (caused in conjunction with other plugins) fixed
|
715 |
+
|
716 |
+
= 1.1.1.11 =
|
717 |
+
* Conflicts with Yoast SEO plugin sorted
|
718 |
+
* Performance optimized
|
719 |
+
* Facebook sharing text issues fixed
|
720 |
+
* Sometimes facebook share count didn't increase despite liking it, this should be fixed now (to be observed)
|
721 |
+
* When sharing from a Facebook business page it returned errors, this should be fixed now (to be observed)
|
722 |
+
* Share-box only displayed partly sometimes, fixed now
|
723 |
+
* Template CSS conflicts solved in the plugin
|
724 |
+
* Adding of unwanted spans fixed
|
725 |
+
|
726 |
+
= 1.1.1.10 =
|
727 |
+
* OG-issues fixed
|
728 |
+
* Text which gets shared sometimes didn't contain spaces, fixed now
|
729 |
+
* Plugin name in php file shortened
|
730 |
+
* More explanation texts added in admin area
|
731 |
+
* Facebook share window sometimes only got displayed partially, fixed now
|
732 |
+
* Other facebook share issues fixed
|
733 |
+
* Template CSS issues causing icons to be displayed not in one straight horizontal line fixed
|
734 |
+
* In some cases facebook counts didn't increase if liked, this should be fixed now
|
735 |
+
* Tested for up to Wordpress version 4.2.1.
|
736 |
+
|
737 |
+
= 1.1.1.9 =
|
738 |
+
* Issues with custom icon upload & custom icon removal fixed
|
739 |
+
* Box asking for review didn't disappear in some cases, fixed now
|
740 |
+
* Some design issues with some CSS for icons after every post, fixed now
|
741 |
+
* Changes in text / guide in plugin
|
742 |
+
* Conflicts with YOAST SEO plugin sorted
|
743 |
+
* Conflicts with ADD MEDIA button and ADD LINK sorted
|
744 |
+
* In some cases activating the icons after every post the content disappeared, this is fixed now
|
745 |
+
* New option to center icons after posts
|
746 |
+
* In some cases if no widget was placed it said 'Kindly go to settings page and check the option 'show them via widget'' got displayed on the blog, this is fixed now
|
747 |
+
* G+ window disappeared sometimes after moving over it, fixed now
|
748 |
+
* LinkedIn icon disappeared after moving over it a few times, fixed now
|
749 |
+
* Several other CSS issues fixed
|
750 |
+
* Sometimes tooltips didn't appear, fixed now
|
751 |
+
* When plugin is activated some toggle functionality stopped working, fixed now
|
752 |
+
* Click on icons after posts now shares the post, not the blog page
|
753 |
+
* Several little design enhancements
|
754 |
+
* When user selected that icons should show floating in the bottom right they floated in the center right, fixed now
|
755 |
+
* Issues with Youtube direct follow fixed
|
756 |
+
* Number of Instagram followers not always got pulled correctly, fixed now
|
757 |
+
* When site loaded the widget sometimes overlapped with others, fixed now
|
758 |
+
|
759 |
+
= 1.1.1.8 =
|
760 |
+
* Plugin's menu button now has less aggressive colors
|
761 |
+
* Sometimes sharing via facebook returned error messages, this is fixed now
|
762 |
+
* Conflicts with WooTheme Whitelight resolved
|
763 |
+
* Occasional problems with https-sites previously, now compatibile
|
764 |
+
|
765 |
+
= 1.1.1.7 =
|
766 |
+
* The 'counts' were not always correct, fixed now
|
767 |
+
* Conflicts with page editor resolved
|
768 |
+
* Last plugin update fixed Youtube points, however the 'channel' was as default, set back to 'username'
|
769 |
+
* Mouseover-text for social icons now correct
|
770 |
+
* Some layout adjustment in the admin area (menu-button will also be adjusted in next release)
|
771 |
+
* Setting order of icons sometimes didnt work properly when custom icons got uploaded, this is fixed now
|
772 |
+
|
773 |
+
= 1.1.1.6 =
|
774 |
+
* jQuery updated, now most conflicts with other plugins should be resolved
|
775 |
+
|
776 |
+
= 1.1.1.5 =
|
777 |
+
* Conflicts with several plugins sorted
|
778 |
+
* Icons can now be disabled on mobile
|
779 |
+
* Renaming of 'Youtube Channel' to 'Username' to avoid confusion
|
780 |
+
* On some templates there were alignment issues of the icons, this is fixed
|
781 |
+
* Menu button sub-menu removed (wasn't really necessary)
|
782 |
+
* Lightbox in admin area for custom icon upload shortened (was too large)
|
783 |
+
* Tags for all icons defined (for SEO purposes)
|
784 |
+
|
785 |
+
= 1.1.1.4 =
|
786 |
+
* If given only a 'visit us'-function for the Twitter-icon, the is no tooltip anymore (like for the other icons)
|
787 |
+
* Sharing sometimes pulled an incorrect image, fixed now
|
788 |
+
* Pop-up now also has an 'x' in the top right corner for people to close
|
789 |
+
* Sometimes icons overlapped, this is fixed now
|
790 |
+
* Several issues fixed when users put shortcode into the header
|
791 |
+
* Sometimes our request to ask users for feedback got displayed too early, this is fixed now
|
792 |
+
* Some youtube accounts don't have a username, but only a channel. To allow users to directly to subscribe to your youtube channel the plugin required a User ID, now a channel is possible too
|
793 |
+
* Several conflicts with other plugins resolved
|
794 |
+
* Some CSS issues fixed
|
795 |
+
* Steps 1., 2., 3. in the guide how to upload a custom icon were sometimes missing, this is fixed now
|
796 |
+
* Title removed now when using shortcodes
|
797 |
+
* Some error messages in developer tools not showing up anymore
|
798 |
+
|
799 |
+
= 1.1.1.3 =
|
800 |
+
* Several CSS issues fixed
|
801 |
+
|
802 |
+
= 1.1.1.2 =
|
803 |
+
* Shortcode now available too, so that you can place the icons wherever you want: Insert [DISPLAY_ULTIMATE_SOCIAL_ICONS]
|
804 |
+
* 'Visit us'-option now also available for Twitter-users
|
805 |
+
* Description added for people helping to find their LinkedIn-ID
|
806 |
+
* Description added for people helping to generate their API-keys for Twitter, LInkedIn and G+ to display their counts automatically
|
807 |
+
* Design of pop-up for upload of custom icons changed, to better explain required steps
|
808 |
+
* 'Icons per row' didn't work properly in specific cases, fixed now
|
809 |
+
* If user displayed counts for the icons, and picked the option 'floating' and 'bottom', the counts were sometimes not displayed because they moved too far down. This is fixed now.
|
810 |
+
|
811 |
+
= 1.1.1.1 =
|
812 |
+
* Previously custom icons got deleted if plugin was upgraded. This is fixed *from now on*. If you previously uploaded a custom icon, please do so (once) more. Sorry for the inconvenience.
|
813 |
+
* Question #5 The 'Sticking & Floating' -> 'Where shall they float?' was storing the right value but showing the 'Top - Left' always
|
814 |
+
* If the floating icons on the frontend had 'counts' enabled for them, the counts for the last row of the icons were being cut-off on the screen if the 'Bottom - Left' OR 'Bottom - Right' was chosen as the display position
|
815 |
+
|
816 |
+
= 1.1.1.0 =
|
817 |
+
* Following user suggestions we made it easier to remove the credit link (if previously activated by user - otherwise it doesn't display)
|
818 |
+
|
819 |
+
= 1.1.0.9 =
|
820 |
+
* Some servers don't display svg-images due to security issues, so we switched back to png
|
821 |
+
* Removed the comment line which may be me causes the syntax error at the time of installation
|
822 |
+
|
823 |
+
= 1.1.0.8 =
|
824 |
+
* In specific cases some share-icons were missing, this is fixed now
|
825 |
+
* Plugin sent error messages if user had developer mode active, this won't happen anymore
|
826 |
+
|
827 |
+
= 1.1.0.7 =
|
828 |
+
* 'Visit us' icons sometimes didn't get displayed in the backend, this is fixed now
|
829 |
+
* Also the design of the 'Visit us'-icons on the front end has been improved
|
830 |
+
* If the email-delivery option is used, emails now get sent out much faster (central server gets pinged)
|
831 |
+
* Pop-up in some cases didn't get shown on inner pages, fixed now
|
832 |
+
* Some responsive adjustments for mobile
|
833 |
+
* Custom icons had some resizing issues, fixed now
|
834 |
+
|
835 |
+
= 1.1.0.6 =
|
836 |
+
* If 'Do you want to display icons at end of every post' is clicked there were some issues on mobile view, this is fixed now
|
837 |
+
* 'Visit us'-icons in the tooltips were no vector-icons, which made them look fuzzy in some browsers, this is fixed now
|
838 |
+
|
839 |
+
= 1.1.0.5 =
|
840 |
+
* On certain pages sometimes the youtube icon didnt show, this is fixed now
|
841 |
+
* Custom uploaded icons got a black background, this is fixed now
|
842 |
+
* In the admin panel the plugin conflicted (in rare cases) with other plugins, this is fixed
|
843 |
+
* Pop-ups sometimes didn't disappear automatically, fixed now
|
844 |
+
* The tooltip for floating icons now gets displayed so that it is always visible
|
845 |
+
|
846 |
+
= 1.1.0.4 =
|
847 |
+
* Several changes done to optimize display on mobile & tablets
|
848 |
+
* Issues with widget fixed (in rare cases the separating lines between widgets didnt get displayed correctly)
|
849 |
+
* Deletion of headline for widget works now
|
850 |
+
* Slight alignment issues of share- and like buttons at the end of blog posts corrected
|
851 |
+
|
852 |
+
= 1.1.0.3 =
|
853 |
+
* Tooltip from share-option sometimes appeared some other strange places on the site, this is fixed now
|
854 |
+
* Extra checks added if user enters nonsense in the admin area
|
855 |
+
* Links to our review site added (please please give 5 stars)
|
856 |
+
|
857 |
+
= 1.1.0.2 =
|
858 |
+
* In specific cases there were Javascript loading errors, that's fixed now
|
859 |
+
* Moving from the icons to the tooltips made the tooltips disappear sometimes, now they are 'stickier'
|
860 |
+
* In specific cases the facebook-icon was displayed very small in the tooltip, fixed now
|
861 |
+
|
862 |
+
= 1.1.0.1 =
|
863 |
+
* Corrected that when only the 'visit us' function is selected, no tooltip is displayed
|
864 |
+
|
865 |
+
= 1.1 =
|
866 |
+
* Email-icon didn't get displayed for all design sets (on the website), this is fixed now
|
867 |
+
* Alignments of buttons in tooltips optimized
|
868 |
+
* Updated readme.txt
|
869 |
+
|
870 |
+
= 1.0 =
|
871 |
+
* First release
|
872 |
+
|
873 |
+
== Upgrade Notice ==
|
874 |
+
|
875 |
+
= 2.4.2 =
|
876 |
Please upgrade
|
ultimate_social_media_icons.php
CHANGED
@@ -6,7 +6,7 @@ Description: Easy to use and 100% FREE social media plugin which adds social med
|
|
6 |
|
7 |
Author: UltimatelySocial
|
8 |
Author URI: http://ultimatelysocial.com
|
9 |
-
Version: 2.4.
|
10 |
License: GPLv2 or later
|
11 |
*/
|
12 |
require_once 'analyst/main.php';
|
@@ -88,7 +88,7 @@ register_deactivation_hook(__FILE__, 'sfsi_deactivate_plugin');
|
|
88 |
|
89 |
register_uninstall_hook(__FILE__, 'sfsi_Unistall_plugin');
|
90 |
|
91 |
-
if (!get_option('sfsi_pluginVersion') || get_option('sfsi_pluginVersion') < 2.
|
92 |
|
93 |
add_action("init", "sfsi_update_plugin");
|
94 |
}
|
6 |
|
7 |
Author: UltimatelySocial
|
8 |
Author URI: http://ultimatelysocial.com
|
9 |
+
Version: 2.4.2
|
10 |
License: GPLv2 or later
|
11 |
*/
|
12 |
require_once 'analyst/main.php';
|
88 |
|
89 |
register_uninstall_hook(__FILE__, 'sfsi_Unistall_plugin');
|
90 |
|
91 |
+
if (!get_option('sfsi_pluginVersion') || get_option('sfsi_pluginVersion') < 2.42) {
|
92 |
|
93 |
add_action("init", "sfsi_update_plugin");
|
94 |
}
|
views/sfsi_option_view6.php
CHANGED
@@ -1,525 +1,525 @@
|
|
1 |
-
<?php
|
2 |
-
/* unserialize all saved option for section 6 options */
|
3 |
-
|
4 |
-
$option6 = unserialize(get_option('sfsi_section6_options', false));
|
5 |
-
|
6 |
-
/**
|
7 |
-
|
8 |
-
* Sanitize, escape and validate values
|
9 |
-
|
10 |
-
*/
|
11 |
-
|
12 |
-
$option6['sfsi_show_Onposts'] = (isset($option6['sfsi_show_Onposts'])) ? sanitize_text_field($option6['sfsi_show_Onposts']) : 'no';
|
13 |
-
|
14 |
-
$option6['sfsi_show_Onbottom'] = (isset($option6['sfsi_show_Onbottom'])) ? sanitize_text_field($option6['sfsi_show_Onbottom']) : '';
|
15 |
-
|
16 |
-
$option6['sfsi_icons_postPositon'] = (isset($option6['sfsi_icons_postPositon'])) ? sanitize_text_field($option6['sfsi_icons_postPositon']) : '';
|
17 |
-
|
18 |
-
$option6['sfsi_icons_alignment'] = (isset($option6['sfsi_icons_alignment'])) ? sanitize_text_field($option6['sfsi_icons_alignment']) : '';
|
19 |
-
|
20 |
-
$option6['sfsi_rss_countsDisplay'] = (isset($option6['sfsi_rss_countsDisplay'])) ? sanitize_text_field($option6['sfsi_rss_countsDisplay']) : '';
|
21 |
-
|
22 |
-
$option6['sfsi_textBefor_icons'] = (isset($option6['sfsi_textBefor_icons'])) ? sanitize_text_field($option6['sfsi_textBefor_icons']) : '';
|
23 |
-
|
24 |
-
$option6['sfsi_icons_DisplayCounts'] = (isset($option6['sfsi_icons_DisplayCounts'])) ? sanitize_text_field($option6['sfsi_icons_DisplayCounts']) : '';
|
25 |
-
|
26 |
-
$option6['sfsi_rectsub'] = (isset($option6['sfsi_rectsub'])) ? sanitize_text_field($option6['sfsi_rectsub']) : '';
|
27 |
-
|
28 |
-
$option6['sfsi_rectfb'] = (isset($option6['sfsi_rectfb'])) ? sanitize_text_field($option6['sfsi_rectfb']) : '';
|
29 |
-
|
30 |
-
$option6['sfsi_rectshr'] = (isset($option6['sfsi_rectshr'])) ? sanitize_text_field($option6['sfsi_rectshr']) : '';
|
31 |
-
|
32 |
-
$option6['sfsi_recttwtr'] = (isset($option6['sfsi_recttwtr'])) ? sanitize_text_field($option6['sfsi_recttwtr']) : '';
|
33 |
-
|
34 |
-
$option6['sfsi_rectpinit'] = (isset($option6['sfsi_rectpinit'])) ? sanitize_text_field($option6['sfsi_rectpinit']) : '';
|
35 |
-
|
36 |
-
$option6['sfsi_rectfbshare'] = (isset($option6['sfsi_rectfbshare'])) ? sanitize_text_field($option6['sfsi_rectfbshare']) : '';
|
37 |
-
|
38 |
-
$option6['sfsi_display_button_type'] = (isset($option6['sfsi_display_button_type']))
|
39 |
-
? sanitize_text_field($option6['sfsi_display_button_type'])
|
40 |
-
: '';
|
41 |
-
$option6['sfsi_show_premium_placement_box'] = (isset($option6['sfsi_show_premium_placement_box']))
|
42 |
-
? sanitize_text_field($option6['sfsi_show_premium_placement_box'])
|
43 |
-
: 'yes';
|
44 |
-
$option6['sfsi_responsive_icons_end_post'] = (isset($option6['sfsi_responsive_icons_end_post']))
|
45 |
-
? sanitize_text_field($option6['sfsi_responsive_icons_end_post'])
|
46 |
-
: 'no';
|
47 |
-
$option6['sfsi_share_count'] = (isset($option6['sfsi_share_count']))
|
48 |
-
? sanitize_text_field($option6['sfsi_share_count'])
|
49 |
-
: 'no';
|
50 |
-
|
51 |
-
$sfsi_responsive_icons_default = array(
|
52 |
-
"default_icons" => array(
|
53 |
-
"facebook" => array("active" => "yes", "text" => "Share on Facebook", "url" => ""),
|
54 |
-
"Twitter" => array("active" => "yes", "text" => "Tweet", "url" => ""),
|
55 |
-
"Follow" => array("active" => "yes", "text" => "Follow us", "url" => ""),
|
56 |
-
),
|
57 |
-
"custom_icons" => array(),
|
58 |
-
"settings" => array(
|
59 |
-
"icon_size" => "Medium",
|
60 |
-
"icon_width_type" => "Fully responsive",
|
61 |
-
"icon_width_size" => 240,
|
62 |
-
"edge_type" => "Round",
|
63 |
-
"edge_radius" => 5,
|
64 |
-
"style" => "Gradient",
|
65 |
-
"margin" => 10,
|
66 |
-
"text_align" => "Centered",
|
67 |
-
"show_count" => "no",
|
68 |
-
"counter_color" => "#aaaaaa",
|
69 |
-
"counter_bg_color" => "#fff",
|
70 |
-
"share_count_text" => "SHARES"
|
71 |
-
)
|
72 |
-
);
|
73 |
-
$sfsi_responsive_icons = (isset($option6["sfsi_responsive_icons"]) ? $option6["sfsi_responsive_icons"] : $sfsi_responsive_icons_default);
|
74 |
-
if (!isset($option6['sfsi_rectsub'])) {
|
75 |
-
$option6['sfsi_rectsub'] = 'no';
|
76 |
-
}
|
77 |
-
|
78 |
-
if (!isset($option6['sfsi_rectfb'])) {
|
79 |
-
$option6['sfsi_rectfb'] = 'yes';
|
80 |
-
}
|
81 |
-
|
82 |
-
if (!isset($option6['sfsi_recttwtr'])) {
|
83 |
-
$option6['sfsi_recttwtr'] = 'no';
|
84 |
-
}
|
85 |
-
|
86 |
-
if (!isset($option6['sfsi_rectpinit'])) {
|
87 |
-
$option6['sfsi_rectpinit'] = 'no';
|
88 |
-
}
|
89 |
-
|
90 |
-
if (!isset($option6['sfsi_rectfbshare'])) {
|
91 |
-
$option6['sfsi_rectfbshare'] = 'no';
|
92 |
-
}
|
93 |
-
?>
|
94 |
-
<!-- Section 6 "Do you want to display icons at the end of every post?" main div Start -->
|
95 |
-
<div>
|
96 |
-
<p class="clear" style="margin-top:0 !important">Here you have two options:</p>
|
97 |
-
|
98 |
-
<div class="tab6">
|
99 |
-
<ul class="sfsi_icn_listing8">
|
100 |
-
|
101 |
-
<li class="sfsibeforeafterpostselector">
|
102 |
-
<div class="radio_section tb_4_ck"></div>
|
103 |
-
<div class="sfsi_right_info">
|
104 |
-
<ul class="sfsi_tab_3_icns sfsi_shwthmbfraftr" style="margin:0">
|
105 |
-
<li onclick="sfsi_togglbtmsection('sfsi_toggleonlystndrshrng, .sfsi_responsive_hide', 'sfsi_toggleonlyrspvshrng, .sfsi_responsive_show', this);" class="clckbltglcls sfsi_border_left_0">
|
106 |
-
<input name="sfsi_display_button_type" <?php echo ($option6['sfsi_display_button_type'] == 'standard_buttons') ? 'checked="true"' : ''; ?> type="radio" value="standard_buttons" class="styled" />
|
107 |
-
<label class="labelhdng4">
|
108 |
-
Original icons
|
109 |
-
</label>
|
110 |
-
</li>
|
111 |
-
<li onclick="sfsi_togglbtmsection('sfsi_toggleonlyrspvshrng, .sfsi_responsive_show', 'sfsi_toggleonlystndrshrng, .sfsi_responsive_hide', this);" class="clckbltglcls sfsi_border_left_0">
|
112 |
-
<input name="sfsi_display_button_type" <?php echo ($option6['sfsi_display_button_type'] == 'responsive_button') ? 'checked="true"' : ''; ?> type="radio" value="responsive_button" class="styled" />
|
113 |
-
<label class="labelhdng4">
|
114 |
-
Responsive icons
|
115 |
-
</label>
|
116 |
-
</li>
|
117 |
-
<li class="clckbltglcls sfsi_border_left_0 sfsi_disable_radio" style="width: 43% !important">
|
118 |
-
<input type="radio" class="styled" />
|
119 |
-
<label class="labelhdng4">
|
120 |
-
Display the icons I selected above
|
121 |
-
</label>
|
122 |
-
</li>
|
123 |
-
<p class="clear">Greyed-out options are available only in the <a class="pop-up" data-id="sfsi_quickpay-overlay" onclick="sfsi_open_quick_checkout(event)" class="sfisi_font_bold" style="border-bottom: 1px solid #12a252;color: #12a252 !important;cursor:pointer;" target="_blank">Premium Plugin</a></p>
|
124 |
-
|
125 |
-
<?php if ($option6['sfsi_display_button_type'] == 'standard_buttons') : $display = "display:block";
|
126 |
-
else : $display = "display:none";
|
127 |
-
endif; ?>
|
128 |
-
<li class="sfsi_toggleonlystndrshrng
|
129 |
-
<div class="radiodisplaysection" style="<?php echo $display; ?>">
|
130 |
-
|
131 |
-
|
132 |
-
|
133 |
-
<!-- icons example section -->
|
134 |
-
<div class="social_icon_like1 cstmdsplyulwpr sfsi_center">
|
135 |
-
|
136 |
-
<ul>
|
137 |
-
<li>
|
138 |
-
<div class="radio_section tb_4_ck"><input name="sfsi_rectsub" <?php echo ($option6['sfsi_rectsub'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_rectsub" type="checkbox" value="yes" class="styled" />
|
139 |
-
</div>
|
140 |
-
|
141 |
-
<a href="#" title="Subscribe Follow" class="cstmdsplsub">
|
142 |
-
<img src="<?php echo SFSI_PLUGURL; ?>images/follow_subscribe.png" alt="Subscribe Follow" />
|
143 |
-
</a>
|
144 |
-
</li>
|
145 |
-
<li>
|
146 |
-
<div class="radio_section tb_4_ck"><input name="sfsi_rectfb" <?php echo ($option6['sfsi_rectfb'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_rectfb" type="checkbox" value="yes" class="styled" /></div>
|
147 |
-
|
148 |
-
<a href="#" title="Facebook Like">
|
149 |
-
<img src="<?php echo SFSI_PLUGURL; ?>images/like.jpg" alt="Facebook Like" />
|
150 |
-
</a>
|
151 |
-
</li>
|
152 |
-
<li>
|
153 |
-
<div class="radio_section tb_4_ck"><input name="sfsi_rectfbshare" <?php echo ($option6['sfsi_rectfbshare'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_rectfbshare" type="checkbox" value="yes" class="styled" />
|
154 |
-
</div>
|
155 |
-
<a href="#" title="Facebook Share">
|
156 |
-
<img src="<?php echo SFSI_PLUGURL; ?>images/fbshare.png" alt="Facebook Share" />
|
157 |
-
</a>
|
158 |
-
</li>
|
159 |
-
|
160 |
-
<li>
|
161 |
-
|
162 |
-
<div class="radio_section tb_4_ck"><input name="sfsi_recttwtr" <?php echo ($option6['sfsi_recttwtr'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_recttwtr" type="checkbox" value="yes" class="styled" />
|
163 |
-
</div>
|
164 |
-
|
165 |
-
<a href="#" title="twitter" class="cstmdspltwtr">
|
166 |
-
|
167 |
-
<img src="<?php echo SFSI_PLUGURL; ?>images/twiiter.png" alt="Twitter like" />
|
168 |
-
</a>
|
169 |
-
|
170 |
-
</li>
|
171 |
-
|
172 |
-
<li>
|
173 |
-
|
174 |
-
<div class="radio_section tb_4_ck"><input name="sfsi_rectpinit" <?php echo ($option6['sfsi_rectpinit'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_rectpinit" type="checkbox" value="yes" class="styled" />
|
175 |
-
</div>
|
176 |
-
|
177 |
-
<a href="#" title="Pin It">
|
178 |
-
<img src="<?php echo SFSI_PLUGURL; ?>images/pinit.png" alt="Pin It" />
|
179 |
-
</a>
|
180 |
-
</li>
|
181 |
-
</ul>
|
182 |
-
</div><!-- icons position section -->
|
183 |
-
|
184 |
-
<p class="clear">Those are usually all you need: </p>
|
185 |
-
|
186 |
-
<ul class="usually">
|
187 |
-
<li>1. The follow-icon ensures that your visitors subscribe to your newsletter</li>
|
188 |
-
<li>2. Facebook is No.1 in «liking», so it’s a must have</li>
|
189 |
-
<li>3. The Tweet-button allows quick tweeting of your article</li>
|
190 |
-
<li></li>
|
191 |
-
<li></li>
|
192 |
-
</ul>
|
193 |
-
<?php if ($option6['sfsi_show_premium_placement_box'] == 'yes') { ?>
|
194 |
-
<p class="sfsi_prem_plu_desc ">
|
195 |
-
<b>New: </b>We also added a Linkedin share-icon in the Premium Plugin. <a class="pop-up" data-id="sfsi_quickpay-overlay" onclick="sfsi_open_quick_checkout(event)" class="sfisi_font_bold" style="border-bottom: 1px solid #12a252;color: #12a252 !important;cursor:pointer;" target="_blank">Go premium now</a><a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usm_settings_page&utm_campaign=linkedin_icon&utm_medium=banner" class="sfsi_font_inherit" style="color: #12a252 !important" target="_blank"> or
|
196 |
-
learn more</a>
|
197 |
-
</p>
|
198 |
-
<?php } ?>
|
199 |
-
<div class="options">
|
200 |
-
<label class="heading-label" style="width:auto!important;margin-top: 11px;margin-right: 11px;">
|
201 |
-
<b>So: do you want to display those at the end of every post?</b>
|
202 |
-
</label>
|
203 |
-
<ul style="display:flex">
|
204 |
-
<li style="min-width: 200px">
|
205 |
-
<input name="sfsi_show_Onposts" <?php echo ($option6['sfsi_show_Onposts'] == 'yes') ? 'checked="true"' : ''; ?> type="radio" value="yes" class="styled" />
|
206 |
-
<label class="labelhdng4" style="width: auto;">
|
207 |
-
Yes
|
208 |
-
</label>
|
209 |
-
</li>
|
210 |
-
<li>
|
211 |
-
<input name="sfsi_show_Onposts" <?php echo ($option6['sfsi_show_Onposts'] == 'no') ? 'checked="true"' : ''; ?> type="radio" value="no" class="styled" />
|
212 |
-
<label class="labelhdng4" style="width: auto;">
|
213 |
-
No
|
214 |
-
</label>
|
215 |
-
</li>
|
216 |
-
|
217 |
-
</div>
|
218 |
-
<div class="row PostsSettings_section">
|
219 |
-
|
220 |
-
<h4>Options:</h4>
|
221 |
-
|
222 |
-
<div class="options">
|
223 |
-
|
224 |
-
<label class="first">Text to appear before the sharing icons:</label><input name="sfsi_textBefor_icons" type="text" value="<?php echo ($option6['sfsi_textBefor_icons'] != '') ? $option6['sfsi_textBefor_icons'] : ''; ?>" />
|
225 |
-
|
226 |
-
</div>
|
227 |
-
|
228 |
-
<!-- by developer - 28-05-2019 -->
|
229 |
-
|
230 |
-
<div class="options">
|
231 |
-
<p><b>New:</b> In the Premium Plugin you can choose to display the text before
|
232 |
-
the sharing icons in a font of your choice. You can also define the<b> font
|
233 |
-
size, type</b>, and the <b>margins below/above the icons</b>. <a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=more_placement_options&utm_medium=banner" target="_blank" style="color:#00a0d2 !important; text-decoration: none !important;">Check
|
234 |
-
it out.</a></p>
|
235 |
-
</div>
|
236 |
-
|
237 |
-
<!-- end -->
|
238 |
-
<div class="options">
|
239 |
-
<label>Alignment of share icons: </label>
|
240 |
-
<div class="field"><select name="sfsi_icons_alignment" id="sfsi_icons_alignment" class="styled">
|
241 |
-
<option value="left" <?php echo ($option6['sfsi_icons_alignment'] == 'left') ? 'selected="selected"' : ''; ?>>
|
242 |
-
Left</option>
|
243 |
-
<!--<option value="center" <?php //echo ($option6['sfsi_icons_alignment']=='center') ? 'selected="selected"' : '' ;
|
244 |
-
?>>Center</option>-->
|
245 |
-
<option value="right" <?php echo ($option6['sfsi_icons_alignment'] == 'right') ? 'selected="selected"' : ''; ?>>
|
246 |
-
Right</option>
|
247 |
-
</select>
|
248 |
-
</div>
|
249 |
-
</div>
|
250 |
-
<div class="options">
|
251 |
-
|
252 |
-
<label>Do you want to display the counts?</label>
|
253 |
-
<div class="field"><select name="sfsi_icons_DisplayCounts" id="sfsi_icons_DisplayCounts" class="styled">
|
254 |
-
<option value="yes" <?php echo ($option6['sfsi_icons_DisplayCounts'] == 'yes') ? 'selected="true"' : ''; ?>>
|
255 |
-
YES</option>
|
256 |
-
<option value="no" <?php echo ($option6['sfsi_icons_DisplayCounts'] == 'no') ? 'selected="true"' : ''; ?>>
|
257 |
-
NO</option>
|
258 |
-
</select>
|
259 |
-
</div>
|
260 |
-
</div>
|
261 |
-
|
262 |
-
</div>
|
263 |
-
<!-- by developer - 28-5-2019 -->
|
264 |
-
|
265 |
-
<div class="sfsi_new_prmium_follw">
|
266 |
-
<p><b>New:</b> In our Premium Plugin you have many more placement options, e.g.
|
267 |
-
place the icons you selected under question 1, place them also on your homepage
|
268 |
-
(instead of only post’s pages), place them before posts (instead of only after
|
269 |
-
posts) etc. <a style="cursor:pointer" class="pop-up" data-id="sfsi_quickpay-overlay" onclick="sfsi_open_quick_checkout(event)" class="sfisi_font_bold" target="_blank">See all features</a>
|
270 |
-
<!-- <a href="https://www.ultimatelysocial.com/usm-premium/?https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=more_placement_options&utm_medium=banner" class="sfsi_font_inherit" target="_blank"> or learn more.</a> -->
|
271 |
-
</p>
|
272 |
-
</div>
|
273 |
-
</div>
|
274 |
-
</li>
|
275 |
-
<?php if ($option6['sfsi_display_button_type'] == 'responsive_button') : $display = "display:block";
|
276 |
-
else : $display = "display:none";
|
277 |
-
endif; ?>
|
278 |
-
<li class="sfsi_toggleonlyrspvshrng" style="<?php echo $display; ?>">
|
279 |
-
<label style="width: 80%;width:calc( 100% - 102px );font-family: helveticaregular;font-size: 18px;color: #5c6267;margin: 10px 0px;">These
|
280 |
-
are responsive & independent from the icons you selected elsewhere in the plugin.
|
281 |
-
Preview:</label>
|
282 |
-
<div style="width: 80%; margin-left:5px; width:calc( 100% - 102px );">
|
283 |
-
<div class="sfsi_responsive_icon_preview" style="width:calc( 100% - 50px )">
|
284 |
-
|
285 |
-
<?php echo sfsi_social_responsive_buttons(null, $option6, true); ?>
|
286 |
-
</div> <!-- end sfsi_responsive_icon_preview -->
|
287 |
-
</div>
|
288 |
-
<ul>
|
289 |
-
<li class="sfsi_responsive_default_icon_container sfsi_border_left_0 " style="margin: 10px 0px">
|
290 |
-
<label class="heading-label select-icons">
|
291 |
-
Select Icons
|
292 |
-
</label>
|
293 |
-
</li>
|
294 |
-
<?php foreach ($sfsi_responsive_icons['default_icons'] as $icon => $icon_config) :
|
295 |
-
?>
|
296 |
-
<li class="sfsi_responsive_default_icon_container sfsi_vertical_center sfsi_border_left_0">
|
297 |
-
<div class="radio_section tb_4_ck">
|
298 |
-
<input name="sfsi_responsive_<?php echo $icon; ?>_display" <?php echo ($icon_config['active'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_responsive_<?php echo $icon; ?>_display" type="checkbox" value="yes" class="styled" data-icon="<?php echo $icon; ?>" />
|
299 |
-
</div>
|
300 |
-
<span class="sfsi_icon_container">
|
301 |
-
<div class="sfsi_responsive_icon_item_container sfsi_responsive_icon_<?php echo strtolower($icon); ?>_container" style="word-break:break-all;padding-left:0">
|
302 |
-
<div style="display: inline-block;height: 40px;width: 40px;text-align: center;vertical-align: middle!important;float: left;">
|
303 |
-
<img style="float:none" src="<?php echo SFSI_PLUGURL; ?>images/responsive-icon/<?php echo $icon; ?><?php echo 'Follow' === $icon ? '.png' : '.svg'; ?>">
|
304 |
-
</div>
|
305 |
-
<span> <?php echo $icon_config["text"]; ?> </span>
|
306 |
-
</div>
|
307 |
-
</span>
|
308 |
-
<input type="text" class="sfsi_responsive_input" name="sfsi_responsive_<?php echo $icon ?>_input" value="<?php echo $icon_config["text"]; ?>" />
|
309 |
-
<a href="#" class="sfsi_responsive_default_url_toggler" style="text-decoration: none;">Define URL*</a>
|
310 |
-
<input style="display:none" class="sfsi_responsive_url_input" type="text" placeholder="Enter url" name="sfsi_responsive_<?php echo $icon ?>_url_input" value="<?php echo $icon_config["url"]; ?>" />
|
311 |
-
<a href="#" class="sfsi_responsive_default_url_hide" style="display:none"><span class="sfsi_cancel_text">Cancel</span><span class="sfsi_cancel_icon">×</span></a>
|
312 |
-
</li>
|
313 |
-
|
314 |
-
<?php endforeach; ?>
|
315 |
-
</ul>
|
316 |
-
|
317 |
-
<p style="font-size:16px !important;padding-top: 0px;">
|
318 |
-
<span>* All icons have «sharing» feature enabled by default. If you want to give them a
|
319 |
-
different function (e.g link to your Facebook page) then please click on «Define
|
320 |
-
url» next to the icon.</span>
|
321 |
-
</p>
|
322 |
-
<?php if ($option6['sfsi_show_premium_placement_box'] == 'yes') { ?>
|
323 |
-
<div class="sfsi_new_prmium_follw" style="width: 91%;">
|
324 |
-
<p style="font-size:20px !important">
|
325 |
-
<b>New: </b>In the Premium Plugin, we also added: Pinterest, Linkedin, WhatsApp, VK,
|
326 |
-
OK, Telegram, Weibo, WeChat, Xing and the option to add custom icons. There are more
|
327 |
-
important options to add custom icons. There are more placement options too, e.g.
|
328 |
-
place the responsive icons before/after posts/pages, show them only on
|
329 |
-
desktop/mobile, insert them manually (via shortcode).<a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=responsive_icons&utm_medium=banner" class="sfsi_font_inherit" target="_blank"> See all features</a>
|
330 |
-
</p>
|
331 |
-
</div>
|
332 |
-
<?php } ?>
|
333 |
-
|
334 |
-
<div class="options">
|
335 |
-
<label class="heading-label" style="width:auto!important;margin-top: 11px;margin-right: 11px;">
|
336 |
-
<b>So: do you want to display those at the end of every post?</b>
|
337 |
-
</label>
|
338 |
-
<ul style="display:flex">
|
339 |
-
<li style="min-width: 200px">
|
340 |
-
<input name="sfsi_responsive_icons_end_post" <?php echo ($option6['sfsi_responsive_icons_end_post'] == 'yes') ? 'checked="true"' : ''; ?> type="radio" value="yes" class="styled" />
|
341 |
-
<label class="labelhdng4" style="width: auto;">
|
342 |
-
Yes
|
343 |
-
</label>
|
344 |
-
</li>
|
345 |
-
<li>
|
346 |
-
<input name="sfsi_responsive_icons_end_post" <?php echo ($option6['sfsi_responsive_icons_end_post'] == 'no') ? 'checked="true"' : ''; ?> type="radio" value="no" class="styled" />
|
347 |
-
<label class="labelhdng4" style="width: auto;">
|
348 |
-
No
|
349 |
-
</label>
|
350 |
-
</li>
|
351 |
-
</div>
|
352 |
-
</li>
|
353 |
-
|
354 |
-
<!-- sfsi_responsive_icons_end_post -->
|
355 |
-
<li class="sfsi_responsive_icon_option_li sfsi_responsive_show " style="<?php echo ($option6['sfsi_responsive_icons_end_post'] == 'yes') ? 'display:block' : 'display:none' ?>">
|
356 |
-
<label class="options heading-label" style="margin: 0px 0px 12px 0px;">
|
357 |
-
Design options
|
358 |
-
</label>
|
359 |
-
<div class="options sfsi_margin_top_0 ">
|
360 |
-
<label class="first">
|
361 |
-
Icons size:
|
362 |
-
</label>
|
363 |
-
<div class="field">
|
364 |
-
<div style="display:inline-block">
|
365 |
-
<select name="sfsi_responsive_icons_settings_icon_size" class="styled">
|
366 |
-
<option value="Small" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_size"]) && $sfsi_responsive_icons["settings"]["icon_size"] === "Small") ? 'selected="selected"' : ""; ?>>
|
367 |
-
Small
|
368 |
-
</option>
|
369 |
-
<option value="Medium" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_size"]) && $sfsi_responsive_icons["settings"]["icon_size"] === "Medium") ? 'selected="selected"' : ""; ?>>
|
370 |
-
Medium
|
371 |
-
</option>
|
372 |
-
<option value="Large" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_size"]) && $sfsi_responsive_icons["settings"]["icon_size"] === "Large") ? 'selected="selected"' : ""; ?>>
|
373 |
-
Large
|
374 |
-
</option>
|
375 |
-
</select>
|
376 |
-
</div>
|
377 |
-
</div>
|
378 |
-
</div>
|
379 |
-
|
380 |
-
<div class="options sfsi_margin_top_0 ">
|
381 |
-
<label class="first">
|
382 |
-
Icons width:
|
383 |
-
</label>
|
384 |
-
<div class="field">
|
385 |
-
<div style="display:inline-block">
|
386 |
-
<select name="sfsi_responsive_icons_settings_icon_width_type" class="styled">
|
387 |
-
<option value="Fixed icon width" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_width_type"]) && $sfsi_responsive_icons["settings"]["icon_width_type"] === "Fixed icon width") ? 'selected="selected"' : ""; ?>>
|
388 |
-
Fixed icon width
|
389 |
-
</option>
|
390 |
-
<option value="Fully responsive" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_width_type"]) && $sfsi_responsive_icons["settings"]["icon_width_type"] === "Fully responsive") ? 'selected="selected"' : ""; ?>>
|
391 |
-
Fully responsive
|
392 |
-
</option>
|
393 |
-
</select>
|
394 |
-
</div>
|
395 |
-
<div class="sfsi_responsive_icons_icon_width sfsi_inputSec" style='display:<?php echo (isset($sfsi_responsive_icons["settings"]["icon_width_type"]) && $sfsi_responsive_icons["settings"]["icon_width_type"] == 'Fully responsive') ? 'none' : 'inline-block'; ?>'>
|
396 |
-
<span style="width:auto!important">of</span>
|
397 |
-
<input type="number" value="<?php echo isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_width_size"]) ? $sfsi_responsive_icons["settings"]["icon_width_size"] : 140; ?>" name="sfsi_responsive_icons_sttings_icon_width_size" style="float:none" />
|
398 |
-
</select>
|
399 |
-
<span class="sfsi_span_after_input">pixels</span>
|
400 |
-
</div>
|
401 |
-
</div>
|
402 |
-
</div>
|
403 |
-
<div class="options sfsi_inputSec textBefor_icons_fontcolor sfsi_margin_top_0">
|
404 |
-
<label class="first">
|
405 |
-
Edges:
|
406 |
-
</label>
|
407 |
-
<div class="field">
|
408 |
-
<div style="display:inline-block">
|
409 |
-
<select name="sfsi_responsive_icons_settings_edge_type" class="styled">
|
410 |
-
<option value="Round" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] === "Round") ? 'selected="selected"' : ""; ?>>
|
411 |
-
Round
|
412 |
-
</option>
|
413 |
-
<option value="Sharp" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] === "Sharp") ? 'selected="selected"' : ""; ?>>
|
414 |
-
Sharp
|
415 |
-
</option>
|
416 |
-
</select>
|
417 |
-
</div>
|
418 |
-
<span style="width:auto!important;font-size: 17px;color: #5A6570; <?php echo (isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] == 'Sharp') ? 'display:none' : ''; ?>">with
|
419 |
-
border radius</span>
|
420 |
-
</div>
|
421 |
-
<div class="field-sfsi_responsive_icons_settings_edge_radius" style="position:absolute;margin-left: 6px;<?php echo (isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] == 'Sharp') ? 'display:none' : 'display:inline-block'; ?>">
|
422 |
-
<select name="sfsi_responsive_icons_settings_edge_radius" id="sfsi_icons_alignment" class="styled">
|
423 |
-
<?php for ($i = 1; $i <= 20; $i++) : ?>
|
424 |
-
<option value="<?php echo $i; ?>" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["edge_radius"]) && $sfsi_responsive_icons["settings"]["edge_radius"] == $i) ? 'selected="selected"' : ''; ?>>
|
425 |
-
<?php echo $i; ?>
|
426 |
-
</option>
|
427 |
-
<?php endfor; ?>
|
428 |
-
</select>
|
429 |
-
</div>
|
430 |
-
<!-- <span style=" <?php echo (isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] == 'Sharp') ? 'display:none' : ''; ?>">pixels</span> -->
|
431 |
-
|
432 |
-
</div>
|
433 |
-
|
434 |
-
<div class="options sfsi_margin_top_0">
|
435 |
-
<label class="first">
|
436 |
-
Style:
|
437 |
-
</label>
|
438 |
-
<div class="field">
|
439 |
-
<div style="display:inline-block">
|
440 |
-
<select name="sfsi_responsive_icons_settings_style" class="styled">
|
441 |
-
<option value="Flat" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["style"]) && $sfsi_responsive_icons["settings"]["style"] === "Flat") ? 'selected="selected"' : ""; ?>>
|
442 |
-
Flat
|
443 |
-
</option>
|
444 |
-
<option value="Gradient" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["style"]) && $sfsi_responsive_icons["settings"]["style"] === "Gradient") ? 'selected="selected"' : ""; ?>>
|
445 |
-
Gradient
|
446 |
-
</option>
|
447 |
-
</select>
|
448 |
-
</div>
|
449 |
-
</div>
|
450 |
-
</div>
|
451 |
-
|
452 |
-
<div class="options sfsi_margin_top_0 sfsi_inputSec">
|
453 |
-
<label class="first">
|
454 |
-
Margin between icons:
|
455 |
-
</label>
|
456 |
-
<div class="field">
|
457 |
-
<input type="number" value="<?php echo isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["margin"]) ? $sfsi_responsive_icons["settings"]["margin"] : 0; ?>" name="sfsi_responsive_icons_settings_margin" style="float:none" />
|
458 |
-
<span class="span_after_input">pixels</span>
|
459 |
-
</div>
|
460 |
-
</div>
|
461 |
-
|
462 |
-
<div class="options sfsi_margin_top_0">
|
463 |
-
<label class="first">
|
464 |
-
Text on icons:
|
465 |
-
</label>
|
466 |
-
<div class="field">
|
467 |
-
<div style="display:inline-block">
|
468 |
-
<select name="sfsi_responsive_icons_settings_text_align" class="styled">
|
469 |
-
<option value="Left aligned" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["text_align"]) && $sfsi_responsive_icons["settings"]["text_align"] === "Left aligned") ? 'selected="selected"' : ""; ?>>
|
470 |
-
Left aligned
|
471 |
-
</option>
|
472 |
-
<option value="Centered" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["text_align"]) && $sfsi_responsive_icons["settings"]["text_align"] === "Centered") ? 'selected="selected"' : ""; ?>>
|
473 |
-
Centered
|
474 |
-
</option>
|
475 |
-
</select>
|
476 |
-
</div>
|
477 |
-
</div>
|
478 |
-
</div>
|
479 |
-
</li>
|
480 |
-
<li class="sfsi_responsive_icon_option_li sfsi_responsive_show" style="<?php echo $display; ?>">
|
481 |
-
<label class=" options heading-label">
|
482 |
-
Share count
|
483 |
-
</label>
|
484 |
-
<div class="options sfsi_margin_top_0">
|
485 |
-
<label style="width:auto!important;font-size: 16px;">
|
486 |
-
Show the total share count on the left of your icons. It will only be visible if the
|
487 |
-
individual counts are set up under <a href="#" style="text-decoration: none;font-size: 16px;" onclick="event.preventDefault();sfsi_scroll_to_div(\'ui-id-9\')">question 5</a>.
|
488 |
-
</label>
|
489 |
-
|
490 |
-
</div>
|
491 |
-
<ul class="sfsi_tab_3_icns sfsi_shwthmbfraftr ">
|
492 |
-
<li class="clckbltglcls sfsi_border_left_0" onclick="sfsi_responsive_icon_counter_tgl(null ,'sfsi_premium_responsive_icon_share_count', this);sfsi_responsive_toggle_count();">
|
493 |
-
<input name="sfsi_share_count" <?php echo ($option6['sfsi_share_count'] == 'yes') ? 'checked="true"' : ''; ?> type="radio" value="yes" class="styled" />
|
494 |
-
<label class="labelhdng4">
|
495 |
-
Yes
|
496 |
-
</label>
|
497 |
-
</li>
|
498 |
-
<li class="clckbltglcls sfsi_border_left_0" onclick="sfsi_responsive_icon_counter_tgl('sfsi_responsive_icon_share_count', null, this);sfsi_responsive_toggle_count();">
|
499 |
-
<input name="sfsi_share_count" <?php echo ($option6['sfsi_share_count'] == 'no') ? 'checked="true"' : ''; ?> type="radio" value="no" class="styled" />
|
500 |
-
<label class="labelhdng4">
|
501 |
-
No
|
502 |
-
</label>
|
503 |
-
</li>
|
504 |
-
</ul>
|
505 |
-
</li>
|
506 |
-
</ul>
|
507 |
-
</div>
|
508 |
-
</li>
|
509 |
-
</ul>
|
510 |
-
|
511 |
-
|
512 |
-
|
513 |
-
<a class="sfsiColbtn closeSec" href="javascript:;">
|
514 |
-
Collapse area
|
515 |
-
</a>
|
516 |
-
<label class="closeSec"></label>
|
517 |
-
|
518 |
-
<!-- ERROR AND SUCCESS MESSAGE AREA-->
|
519 |
-
<p class="red_txt errorMsg" style="display:none"> </p>
|
520 |
-
<p class="green_txt sucMsg" style="display:none"> </p>
|
521 |
-
<div class="clear"></div>
|
522 |
-
|
523 |
-
</div>
|
524 |
-
</div>
|
525 |
<!-- END Section 6 "Do you want to display icons at the end of every post?" -->
|
1 |
+
<?php
|
2 |
+
/* unserialize all saved option for section 6 options */
|
3 |
+
|
4 |
+
$option6 = unserialize(get_option('sfsi_section6_options', false));
|
5 |
+
|
6 |
+
/**
|
7 |
+
|
8 |
+
* Sanitize, escape and validate values
|
9 |
+
|
10 |
+
*/
|
11 |
+
|
12 |
+
$option6['sfsi_show_Onposts'] = (isset($option6['sfsi_show_Onposts'])) ? sanitize_text_field($option6['sfsi_show_Onposts']) : 'no';
|
13 |
+
|
14 |
+
$option6['sfsi_show_Onbottom'] = (isset($option6['sfsi_show_Onbottom'])) ? sanitize_text_field($option6['sfsi_show_Onbottom']) : '';
|
15 |
+
|
16 |
+
$option6['sfsi_icons_postPositon'] = (isset($option6['sfsi_icons_postPositon'])) ? sanitize_text_field($option6['sfsi_icons_postPositon']) : '';
|
17 |
+
|
18 |
+
$option6['sfsi_icons_alignment'] = (isset($option6['sfsi_icons_alignment'])) ? sanitize_text_field($option6['sfsi_icons_alignment']) : '';
|
19 |
+
|
20 |
+
$option6['sfsi_rss_countsDisplay'] = (isset($option6['sfsi_rss_countsDisplay'])) ? sanitize_text_field($option6['sfsi_rss_countsDisplay']) : '';
|
21 |
+
|
22 |
+
$option6['sfsi_textBefor_icons'] = (isset($option6['sfsi_textBefor_icons'])) ? sanitize_text_field($option6['sfsi_textBefor_icons']) : '';
|
23 |
+
|
24 |
+
$option6['sfsi_icons_DisplayCounts'] = (isset($option6['sfsi_icons_DisplayCounts'])) ? sanitize_text_field($option6['sfsi_icons_DisplayCounts']) : '';
|
25 |
+
|
26 |
+
$option6['sfsi_rectsub'] = (isset($option6['sfsi_rectsub'])) ? sanitize_text_field($option6['sfsi_rectsub']) : '';
|
27 |
+
|
28 |
+
$option6['sfsi_rectfb'] = (isset($option6['sfsi_rectfb'])) ? sanitize_text_field($option6['sfsi_rectfb']) : '';
|
29 |
+
|
30 |
+
$option6['sfsi_rectshr'] = (isset($option6['sfsi_rectshr'])) ? sanitize_text_field($option6['sfsi_rectshr']) : '';
|
31 |
+
|
32 |
+
$option6['sfsi_recttwtr'] = (isset($option6['sfsi_recttwtr'])) ? sanitize_text_field($option6['sfsi_recttwtr']) : '';
|
33 |
+
|
34 |
+
$option6['sfsi_rectpinit'] = (isset($option6['sfsi_rectpinit'])) ? sanitize_text_field($option6['sfsi_rectpinit']) : '';
|
35 |
+
|
36 |
+
$option6['sfsi_rectfbshare'] = (isset($option6['sfsi_rectfbshare'])) ? sanitize_text_field($option6['sfsi_rectfbshare']) : '';
|
37 |
+
|
38 |
+
$option6['sfsi_display_button_type'] = (isset($option6['sfsi_display_button_type']))
|
39 |
+
? sanitize_text_field($option6['sfsi_display_button_type'])
|
40 |
+
: '';
|
41 |
+
$option6['sfsi_show_premium_placement_box'] = (isset($option6['sfsi_show_premium_placement_box']))
|
42 |
+
? sanitize_text_field($option6['sfsi_show_premium_placement_box'])
|
43 |
+
: 'yes';
|
44 |
+
$option6['sfsi_responsive_icons_end_post'] = (isset($option6['sfsi_responsive_icons_end_post']))
|
45 |
+
? sanitize_text_field($option6['sfsi_responsive_icons_end_post'])
|
46 |
+
: 'no';
|
47 |
+
$option6['sfsi_share_count'] = (isset($option6['sfsi_share_count']))
|
48 |
+
? sanitize_text_field($option6['sfsi_share_count'])
|
49 |
+
: 'no';
|
50 |
+
|
51 |
+
$sfsi_responsive_icons_default = array(
|
52 |
+
"default_icons" => array(
|
53 |
+
"facebook" => array("active" => "yes", "text" => "Share on Facebook", "url" => ""),
|
54 |
+
"Twitter" => array("active" => "yes", "text" => "Tweet", "url" => ""),
|
55 |
+
"Follow" => array("active" => "yes", "text" => "Follow us", "url" => ""),
|
56 |
+
),
|
57 |
+
"custom_icons" => array(),
|
58 |
+
"settings" => array(
|
59 |
+
"icon_size" => "Medium",
|
60 |
+
"icon_width_type" => "Fully responsive",
|
61 |
+
"icon_width_size" => 240,
|
62 |
+
"edge_type" => "Round",
|
63 |
+
"edge_radius" => 5,
|
64 |
+
"style" => "Gradient",
|
65 |
+
"margin" => 10,
|
66 |
+
"text_align" => "Centered",
|
67 |
+
"show_count" => "no",
|
68 |
+
"counter_color" => "#aaaaaa",
|
69 |
+
"counter_bg_color" => "#fff",
|
70 |
+
"share_count_text" => "SHARES"
|
71 |
+
)
|
72 |
+
);
|
73 |
+
$sfsi_responsive_icons = (isset($option6["sfsi_responsive_icons"]) ? $option6["sfsi_responsive_icons"] : $sfsi_responsive_icons_default);
|
74 |
+
if (!isset($option6['sfsi_rectsub'])) {
|
75 |
+
$option6['sfsi_rectsub'] = 'no';
|
76 |
+
}
|
77 |
+
|
78 |
+
if (!isset($option6['sfsi_rectfb'])) {
|
79 |
+
$option6['sfsi_rectfb'] = 'yes';
|
80 |
+
}
|
81 |
+
|
82 |
+
if (!isset($option6['sfsi_recttwtr'])) {
|
83 |
+
$option6['sfsi_recttwtr'] = 'no';
|
84 |
+
}
|
85 |
+
|
86 |
+
if (!isset($option6['sfsi_rectpinit'])) {
|
87 |
+
$option6['sfsi_rectpinit'] = 'no';
|
88 |
+
}
|
89 |
+
|
90 |
+
if (!isset($option6['sfsi_rectfbshare'])) {
|
91 |
+
$option6['sfsi_rectfbshare'] = 'no';
|
92 |
+
}
|
93 |
+
?>
|
94 |
+
<!-- Section 6 "Do you want to display icons at the end of every post?" main div Start -->
|
95 |
+
<div>
|
96 |
+
<p class="clear" style="margin-top:0 !important">Here you have two options:</p>
|
97 |
+
|
98 |
+
<div class="tab6">
|
99 |
+
<ul class="sfsi_icn_listing8">
|
100 |
+
|
101 |
+
<li class="sfsibeforeafterpostselector">
|
102 |
+
<div class="radio_section tb_4_ck"></div>
|
103 |
+
<div class="sfsi_right_info">
|
104 |
+
<ul class="sfsi_tab_3_icns sfsi_shwthmbfraftr" style="margin:0">
|
105 |
+
<li onclick="sfsi_togglbtmsection('sfsi_toggleonlystndrshrng, .sfsi_responsive_hide', 'sfsi_toggleonlyrspvshrng, .sfsi_responsive_show', this);" class="clckbltglcls sfsi_border_left_0">
|
106 |
+
<input name="sfsi_display_button_type" <?php echo ($option6['sfsi_display_button_type'] == 'standard_buttons') ? 'checked="true"' : ''; ?> type="radio" value="standard_buttons" class="styled" />
|
107 |
+
<label class="labelhdng4">
|
108 |
+
Original icons
|
109 |
+
</label>
|
110 |
+
</li>
|
111 |
+
<li onclick="sfsi_togglbtmsection('sfsi_toggleonlyrspvshrng, .sfsi_responsive_show', 'sfsi_toggleonlystndrshrng, .sfsi_responsive_hide', this);" class="clckbltglcls sfsi_border_left_0">
|
112 |
+
<input name="sfsi_display_button_type" <?php echo ($option6['sfsi_display_button_type'] == 'responsive_button') ? 'checked="true"' : ''; ?> type="radio" value="responsive_button" class="styled" />
|
113 |
+
<label class="labelhdng4">
|
114 |
+
Responsive icons
|
115 |
+
</label>
|
116 |
+
</li>
|
117 |
+
<li class="clckbltglcls sfsi_border_left_0 sfsi_disable_radio" style="width: 43% !important">
|
118 |
+
<input type="radio" class="styled" />
|
119 |
+
<label class="labelhdng4">
|
120 |
+
Display the icons I selected above
|
121 |
+
</label>
|
122 |
+
</li>
|
123 |
+
<p class="clear sfsi_border_left_0" style="margin-left: 40px;width: 80%;width:calc( 100% - 102px );font-family: helveticaregular;font-size: 18px;color: #5c6267;margin: 10px 27px;margin-bottom: 18px;">Greyed-out options are available only in the <a class="pop-up" data-id="sfsi_quickpay-overlay" onclick="sfsi_open_quick_checkout(event)" class="sfisi_font_bold" style="border-bottom: 1px solid #12a252;color: #12a252 !important;cursor:pointer;" target="_blank">Premium Plugin</a></p>
|
124 |
+
|
125 |
+
<?php if ($option6['sfsi_display_button_type'] == 'standard_buttons') : $display = "display:block";
|
126 |
+
else : $display = "display:none";
|
127 |
+
endif; ?>
|
128 |
+
<li class="sfsi_toggleonlystndrshrng" style="<?php echo $display; ?>">
|
129 |
+
<div class="radiodisplaysection" style="<?php echo $display; ?>">
|
130 |
+
|
131 |
+
|
132 |
+
|
133 |
+
<!-- icons example section -->
|
134 |
+
<div class="social_icon_like1 cstmdsplyulwpr sfsi_center">
|
135 |
+
|
136 |
+
<ul>
|
137 |
+
<li>
|
138 |
+
<div class="radio_section tb_4_ck"><input name="sfsi_rectsub" <?php echo ($option6['sfsi_rectsub'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_rectsub" type="checkbox" value="yes" class="styled" />
|
139 |
+
</div>
|
140 |
+
|
141 |
+
<a href="#" title="Subscribe Follow" class="cstmdsplsub">
|
142 |
+
<img src="<?php echo SFSI_PLUGURL; ?>images/follow_subscribe.png" alt="Subscribe Follow" />
|
143 |
+
</a>
|
144 |
+
</li>
|
145 |
+
<li>
|
146 |
+
<div class="radio_section tb_4_ck"><input name="sfsi_rectfb" <?php echo ($option6['sfsi_rectfb'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_rectfb" type="checkbox" value="yes" class="styled" /></div>
|
147 |
+
|
148 |
+
<a href="#" title="Facebook Like">
|
149 |
+
<img src="<?php echo SFSI_PLUGURL; ?>images/like.jpg" alt="Facebook Like" />
|
150 |
+
</a>
|
151 |
+
</li>
|
152 |
+
<li>
|
153 |
+
<div class="radio_section tb_4_ck"><input name="sfsi_rectfbshare" <?php echo ($option6['sfsi_rectfbshare'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_rectfbshare" type="checkbox" value="yes" class="styled" />
|
154 |
+
</div>
|
155 |
+
<a href="#" title="Facebook Share">
|
156 |
+
<img src="<?php echo SFSI_PLUGURL; ?>images/fbshare.png" alt="Facebook Share" />
|
157 |
+
</a>
|
158 |
+
</li>
|
159 |
+
|
160 |
+
<li>
|
161 |
+
|
162 |
+
<div class="radio_section tb_4_ck"><input name="sfsi_recttwtr" <?php echo ($option6['sfsi_recttwtr'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_recttwtr" type="checkbox" value="yes" class="styled" />
|
163 |
+
</div>
|
164 |
+
|
165 |
+
<a href="#" title="twitter" class="cstmdspltwtr">
|
166 |
+
|
167 |
+
<img src="<?php echo SFSI_PLUGURL; ?>images/twiiter.png" alt="Twitter like" />
|
168 |
+
</a>
|
169 |
+
|
170 |
+
</li>
|
171 |
+
|
172 |
+
<li>
|
173 |
+
|
174 |
+
<div class="radio_section tb_4_ck"><input name="sfsi_rectpinit" <?php echo ($option6['sfsi_rectpinit'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_rectpinit" type="checkbox" value="yes" class="styled" />
|
175 |
+
</div>
|
176 |
+
|
177 |
+
<a href="#" title="Pin It">
|
178 |
+
<img src="<?php echo SFSI_PLUGURL; ?>images/pinit.png" alt="Pin It" />
|
179 |
+
</a>
|
180 |
+
</li>
|
181 |
+
</ul>
|
182 |
+
</div><!-- icons position section -->
|
183 |
+
|
184 |
+
<p class="clear">Those are usually all you need: </p>
|
185 |
+
|
186 |
+
<ul class="usually">
|
187 |
+
<li>1. The follow-icon ensures that your visitors subscribe to your newsletter</li>
|
188 |
+
<li>2. Facebook is No.1 in «liking», so it’s a must have</li>
|
189 |
+
<li>3. The Tweet-button allows quick tweeting of your article</li>
|
190 |
+
<li></li>
|
191 |
+
<li></li>
|
192 |
+
</ul>
|
193 |
+
<?php if ($option6['sfsi_show_premium_placement_box'] == 'yes') { ?>
|
194 |
+
<p class="sfsi_prem_plu_desc ">
|
195 |
+
<b>New: </b>We also added a Linkedin share-icon in the Premium Plugin. <a class="pop-up" data-id="sfsi_quickpay-overlay" onclick="sfsi_open_quick_checkout(event)" class="sfisi_font_bold" style="border-bottom: 1px solid #12a252;color: #12a252 !important;cursor:pointer;" target="_blank">Go premium now</a><a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usm_settings_page&utm_campaign=linkedin_icon&utm_medium=banner" class="sfsi_font_inherit" style="color: #12a252 !important" target="_blank"> or
|
196 |
+
learn more</a>
|
197 |
+
</p>
|
198 |
+
<?php } ?>
|
199 |
+
<div class="options">
|
200 |
+
<label class="heading-label" style="width:auto!important;margin-top: 11px;margin-right: 11px;">
|
201 |
+
<b>So: do you want to display those at the end of every post?</b>
|
202 |
+
</label>
|
203 |
+
<ul style="display:flex">
|
204 |
+
<li style="min-width: 200px">
|
205 |
+
<input name="sfsi_show_Onposts" <?php echo ($option6['sfsi_show_Onposts'] == 'yes') ? 'checked="true"' : ''; ?> type="radio" value="yes" class="styled" />
|
206 |
+
<label class="labelhdng4" style="width: auto;">
|
207 |
+
Yes
|
208 |
+
</label>
|
209 |
+
</li>
|
210 |
+
<li>
|
211 |
+
<input name="sfsi_show_Onposts" <?php echo ($option6['sfsi_show_Onposts'] == 'no') ? 'checked="true"' : ''; ?> type="radio" value="no" class="styled" />
|
212 |
+
<label class="labelhdng4" style="width: auto;">
|
213 |
+
No
|
214 |
+
</label>
|
215 |
+
</li>
|
216 |
+
|
217 |
+
</div>
|
218 |
+
<div class="row PostsSettings_section">
|
219 |
+
|
220 |
+
<h4>Options:</h4>
|
221 |
+
|
222 |
+
<div class="options">
|
223 |
+
|
224 |
+
<label class="first">Text to appear before the sharing icons:</label><input name="sfsi_textBefor_icons" type="text" value="<?php echo ($option6['sfsi_textBefor_icons'] != '') ? $option6['sfsi_textBefor_icons'] : ''; ?>" />
|
225 |
+
|
226 |
+
</div>
|
227 |
+
|
228 |
+
<!-- by developer - 28-05-2019 -->
|
229 |
+
|
230 |
+
<div class="options">
|
231 |
+
<p><b>New:</b> In the Premium Plugin you can choose to display the text before
|
232 |
+
the sharing icons in a font of your choice. You can also define the<b> font
|
233 |
+
size, type</b>, and the <b>margins below/above the icons</b>. <a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=more_placement_options&utm_medium=banner" target="_blank" style="color:#00a0d2 !important; text-decoration: none !important;">Check
|
234 |
+
it out.</a></p>
|
235 |
+
</div>
|
236 |
+
|
237 |
+
<!-- end -->
|
238 |
+
<div class="options">
|
239 |
+
<label>Alignment of share icons: </label>
|
240 |
+
<div class="field"><select name="sfsi_icons_alignment" id="sfsi_icons_alignment" class="styled">
|
241 |
+
<option value="left" <?php echo ($option6['sfsi_icons_alignment'] == 'left') ? 'selected="selected"' : ''; ?>>
|
242 |
+
Left</option>
|
243 |
+
<!--<option value="center" <?php //echo ($option6['sfsi_icons_alignment']=='center') ? 'selected="selected"' : '' ;
|
244 |
+
?>>Center</option>-->
|
245 |
+
<option value="right" <?php echo ($option6['sfsi_icons_alignment'] == 'right') ? 'selected="selected"' : ''; ?>>
|
246 |
+
Right</option>
|
247 |
+
</select>
|
248 |
+
</div>
|
249 |
+
</div>
|
250 |
+
<div class="options">
|
251 |
+
|
252 |
+
<label>Do you want to display the counts?</label>
|
253 |
+
<div class="field"><select name="sfsi_icons_DisplayCounts" id="sfsi_icons_DisplayCounts" class="styled">
|
254 |
+
<option value="yes" <?php echo ($option6['sfsi_icons_DisplayCounts'] == 'yes') ? 'selected="true"' : ''; ?>>
|
255 |
+
YES</option>
|
256 |
+
<option value="no" <?php echo ($option6['sfsi_icons_DisplayCounts'] == 'no') ? 'selected="true"' : ''; ?>>
|
257 |
+
NO</option>
|
258 |
+
</select>
|
259 |
+
</div>
|
260 |
+
</div>
|
261 |
+
|
262 |
+
</div>
|
263 |
+
<!-- by developer - 28-5-2019 -->
|
264 |
+
|
265 |
+
<div class="sfsi_new_prmium_follw">
|
266 |
+
<p><b>New:</b> In our Premium Plugin you have many more placement options, e.g.
|
267 |
+
place the icons you selected under question 1, place them also on your homepage
|
268 |
+
(instead of only post’s pages), place them before posts (instead of only after
|
269 |
+
posts) etc. <a style="cursor:pointer" class="pop-up" data-id="sfsi_quickpay-overlay" onclick="sfsi_open_quick_checkout(event)" class="sfisi_font_bold" target="_blank">See all features</a>
|
270 |
+
<!-- <a href="https://www.ultimatelysocial.com/usm-premium/?https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=more_placement_options&utm_medium=banner" class="sfsi_font_inherit" target="_blank"> or learn more.</a> -->
|
271 |
+
</p>
|
272 |
+
</div>
|
273 |
+
</div>
|
274 |
+
</li>
|
275 |
+
<?php if ($option6['sfsi_display_button_type'] == 'responsive_button') : $display = "display:block";
|
276 |
+
else : $display = "display:none";
|
277 |
+
endif; ?>
|
278 |
+
<li class="sfsi_toggleonlyrspvshrng" style="<?php echo $display; ?>">
|
279 |
+
<label style="width: 80%;width:calc( 100% - 102px );font-family: helveticaregular;font-size: 18px;color: #5c6267;margin: 10px 0px;">These
|
280 |
+
are responsive & independent from the icons you selected elsewhere in the plugin.
|
281 |
+
Preview:</label>
|
282 |
+
<div style="width: 80%; margin-left:5px; width:calc( 100% - 102px );">
|
283 |
+
<div class="sfsi_responsive_icon_preview" style="width:calc( 100% - 50px )">
|
284 |
+
|
285 |
+
<?php echo sfsi_social_responsive_buttons(null, $option6, true); ?>
|
286 |
+
</div> <!-- end sfsi_responsive_icon_preview -->
|
287 |
+
</div>
|
288 |
+
<ul>
|
289 |
+
<li class="sfsi_responsive_default_icon_container sfsi_border_left_0 " style="margin: 10px 0px">
|
290 |
+
<label class="heading-label select-icons">
|
291 |
+
Select Icons
|
292 |
+
</label>
|
293 |
+
</li>
|
294 |
+
<?php foreach ($sfsi_responsive_icons['default_icons'] as $icon => $icon_config) :
|
295 |
+
?>
|
296 |
+
<li class="sfsi_responsive_default_icon_container sfsi_vertical_center sfsi_border_left_0">
|
297 |
+
<div class="radio_section tb_4_ck">
|
298 |
+
<input name="sfsi_responsive_<?php echo $icon; ?>_display" <?php echo ($icon_config['active'] == 'yes') ? 'checked="true"' : ''; ?> id="sfsi_responsive_<?php echo $icon; ?>_display" type="checkbox" value="yes" class="styled" data-icon="<?php echo $icon; ?>" />
|
299 |
+
</div>
|
300 |
+
<span class="sfsi_icon_container">
|
301 |
+
<div class="sfsi_responsive_icon_item_container sfsi_responsive_icon_<?php echo strtolower($icon); ?>_container" style="word-break:break-all;padding-left:0">
|
302 |
+
<div style="display: inline-block;height: 40px;width: 40px;text-align: center;vertical-align: middle!important;float: left;">
|
303 |
+
<img style="float:none" src="<?php echo SFSI_PLUGURL; ?>images/responsive-icon/<?php echo $icon; ?><?php echo 'Follow' === $icon ? '.png' : '.svg'; ?>">
|
304 |
+
</div>
|
305 |
+
<span> <?php echo $icon_config["text"]; ?> </span>
|
306 |
+
</div>
|
307 |
+
</span>
|
308 |
+
<input type="text" class="sfsi_responsive_input" name="sfsi_responsive_<?php echo $icon ?>_input" value="<?php echo $icon_config["text"]; ?>" />
|
309 |
+
<a href="#" class="sfsi_responsive_default_url_toggler" style="text-decoration: none;">Define URL*</a>
|
310 |
+
<input style="display:none" class="sfsi_responsive_url_input" type="text" placeholder="Enter url" name="sfsi_responsive_<?php echo $icon ?>_url_input" value="<?php echo $icon_config["url"]; ?>" />
|
311 |
+
<a href="#" class="sfsi_responsive_default_url_hide" style="display:none"><span class="sfsi_cancel_text">Cancel</span><span class="sfsi_cancel_icon">×</span></a>
|
312 |
+
</li>
|
313 |
+
|
314 |
+
<?php endforeach; ?>
|
315 |
+
</ul>
|
316 |
+
|
317 |
+
<p style="font-size:16px !important;padding-top: 0px;">
|
318 |
+
<span>* All icons have «sharing» feature enabled by default. If you want to give them a
|
319 |
+
different function (e.g link to your Facebook page) then please click on «Define
|
320 |
+
url» next to the icon.</span>
|
321 |
+
</p>
|
322 |
+
<?php if ($option6['sfsi_show_premium_placement_box'] == 'yes') { ?>
|
323 |
+
<div class="sfsi_new_prmium_follw" style="width: 91%;">
|
324 |
+
<p style="font-size:20px !important">
|
325 |
+
<b>New: </b>In the Premium Plugin, we also added: Pinterest, Linkedin, WhatsApp, VK,
|
326 |
+
OK, Telegram, Weibo, WeChat, Xing and the option to add custom icons. There are more
|
327 |
+
important options to add custom icons. There are more placement options too, e.g.
|
328 |
+
place the responsive icons before/after posts/pages, show them only on
|
329 |
+
desktop/mobile, insert them manually (via shortcode).<a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=responsive_icons&utm_medium=banner" class="sfsi_font_inherit" target="_blank"> See all features</a>
|
330 |
+
</p>
|
331 |
+
</div>
|
332 |
+
<?php } ?>
|
333 |
+
|
334 |
+
<div class="options">
|
335 |
+
<label class="heading-label" style="width:auto!important;margin-top: 11px;margin-right: 11px;">
|
336 |
+
<b>So: do you want to display those at the end of every post?</b>
|
337 |
+
</label>
|
338 |
+
<ul style="display:flex">
|
339 |
+
<li style="min-width: 200px">
|
340 |
+
<input name="sfsi_responsive_icons_end_post" <?php echo ($option6['sfsi_responsive_icons_end_post'] == 'yes') ? 'checked="true"' : ''; ?> type="radio" value="yes" class="styled" />
|
341 |
+
<label class="labelhdng4" style="width: auto;">
|
342 |
+
Yes
|
343 |
+
</label>
|
344 |
+
</li>
|
345 |
+
<li>
|
346 |
+
<input name="sfsi_responsive_icons_end_post" <?php echo ($option6['sfsi_responsive_icons_end_post'] == 'no') ? 'checked="true"' : ''; ?> type="radio" value="no" class="styled" />
|
347 |
+
<label class="labelhdng4" style="width: auto;">
|
348 |
+
No
|
349 |
+
</label>
|
350 |
+
</li>
|
351 |
+
</div>
|
352 |
+
</li>
|
353 |
+
|
354 |
+
<!-- sfsi_responsive_icons_end_post -->
|
355 |
+
<li class="sfsi_responsive_icon_option_li sfsi_responsive_show " style="<?php echo ($option6['sfsi_responsive_icons_end_post'] == 'yes') ? 'display:block' : 'display:none' ?>">
|
356 |
+
<label class="options heading-label" style="margin: 0px 0px 12px 0px;">
|
357 |
+
Design options
|
358 |
+
</label>
|
359 |
+
<div class="options sfsi_margin_top_0 ">
|
360 |
+
<label class="first">
|
361 |
+
Icons size:
|
362 |
+
</label>
|
363 |
+
<div class="field">
|
364 |
+
<div style="display:inline-block">
|
365 |
+
<select name="sfsi_responsive_icons_settings_icon_size" class="styled">
|
366 |
+
<option value="Small" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_size"]) && $sfsi_responsive_icons["settings"]["icon_size"] === "Small") ? 'selected="selected"' : ""; ?>>
|
367 |
+
Small
|
368 |
+
</option>
|
369 |
+
<option value="Medium" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_size"]) && $sfsi_responsive_icons["settings"]["icon_size"] === "Medium") ? 'selected="selected"' : ""; ?>>
|
370 |
+
Medium
|
371 |
+
</option>
|
372 |
+
<option value="Large" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_size"]) && $sfsi_responsive_icons["settings"]["icon_size"] === "Large") ? 'selected="selected"' : ""; ?>>
|
373 |
+
Large
|
374 |
+
</option>
|
375 |
+
</select>
|
376 |
+
</div>
|
377 |
+
</div>
|
378 |
+
</div>
|
379 |
+
|
380 |
+
<div class="options sfsi_margin_top_0 ">
|
381 |
+
<label class="first">
|
382 |
+
Icons width:
|
383 |
+
</label>
|
384 |
+
<div class="field">
|
385 |
+
<div style="display:inline-block">
|
386 |
+
<select name="sfsi_responsive_icons_settings_icon_width_type" class="styled">
|
387 |
+
<option value="Fixed icon width" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_width_type"]) && $sfsi_responsive_icons["settings"]["icon_width_type"] === "Fixed icon width") ? 'selected="selected"' : ""; ?>>
|
388 |
+
Fixed icon width
|
389 |
+
</option>
|
390 |
+
<option value="Fully responsive" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_width_type"]) && $sfsi_responsive_icons["settings"]["icon_width_type"] === "Fully responsive") ? 'selected="selected"' : ""; ?>>
|
391 |
+
Fully responsive
|
392 |
+
</option>
|
393 |
+
</select>
|
394 |
+
</div>
|
395 |
+
<div class="sfsi_responsive_icons_icon_width sfsi_inputSec" style='display:<?php echo (isset($sfsi_responsive_icons["settings"]["icon_width_type"]) && $sfsi_responsive_icons["settings"]["icon_width_type"] == 'Fully responsive') ? 'none' : 'inline-block'; ?>'>
|
396 |
+
<span style="width:auto!important">of</span>
|
397 |
+
<input type="number" value="<?php echo isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["icon_width_size"]) ? $sfsi_responsive_icons["settings"]["icon_width_size"] : 140; ?>" name="sfsi_responsive_icons_sttings_icon_width_size" style="float:none" />
|
398 |
+
</select>
|
399 |
+
<span class="sfsi_span_after_input">pixels</span>
|
400 |
+
</div>
|
401 |
+
</div>
|
402 |
+
</div>
|
403 |
+
<div class="options sfsi_inputSec textBefor_icons_fontcolor sfsi_margin_top_0">
|
404 |
+
<label class="first">
|
405 |
+
Edges:
|
406 |
+
</label>
|
407 |
+
<div class="field">
|
408 |
+
<div style="display:inline-block">
|
409 |
+
<select name="sfsi_responsive_icons_settings_edge_type" class="styled">
|
410 |
+
<option value="Round" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] === "Round") ? 'selected="selected"' : ""; ?>>
|
411 |
+
Round
|
412 |
+
</option>
|
413 |
+
<option value="Sharp" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] === "Sharp") ? 'selected="selected"' : ""; ?>>
|
414 |
+
Sharp
|
415 |
+
</option>
|
416 |
+
</select>
|
417 |
+
</div>
|
418 |
+
<span style="width:auto!important;font-size: 17px;color: #5A6570; <?php echo (isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] == 'Sharp') ? 'display:none' : ''; ?>">with
|
419 |
+
border radius</span>
|
420 |
+
</div>
|
421 |
+
<div class="field-sfsi_responsive_icons_settings_edge_radius" style="position:absolute;margin-left: 6px;<?php echo (isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] == 'Sharp') ? 'display:none' : 'display:inline-block'; ?>">
|
422 |
+
<select name="sfsi_responsive_icons_settings_edge_radius" id="sfsi_icons_alignment" class="styled">
|
423 |
+
<?php for ($i = 1; $i <= 20; $i++) : ?>
|
424 |
+
<option value="<?php echo $i; ?>" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["edge_radius"]) && $sfsi_responsive_icons["settings"]["edge_radius"] == $i) ? 'selected="selected"' : ''; ?>>
|
425 |
+
<?php echo $i; ?>
|
426 |
+
</option>
|
427 |
+
<?php endfor; ?>
|
428 |
+
</select>
|
429 |
+
</div>
|
430 |
+
<!-- <span style=" <?php echo (isset($sfsi_responsive_icons["settings"]["edge_type"]) && $sfsi_responsive_icons["settings"]["edge_type"] == 'Sharp') ? 'display:none' : ''; ?>">pixels</span> -->
|
431 |
+
|
432 |
+
</div>
|
433 |
+
|
434 |
+
<div class="options sfsi_margin_top_0">
|
435 |
+
<label class="first">
|
436 |
+
Style:
|
437 |
+
</label>
|
438 |
+
<div class="field">
|
439 |
+
<div style="display:inline-block">
|
440 |
+
<select name="sfsi_responsive_icons_settings_style" class="styled">
|
441 |
+
<option value="Flat" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["style"]) && $sfsi_responsive_icons["settings"]["style"] === "Flat") ? 'selected="selected"' : ""; ?>>
|
442 |
+
Flat
|
443 |
+
</option>
|
444 |
+
<option value="Gradient" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["style"]) && $sfsi_responsive_icons["settings"]["style"] === "Gradient") ? 'selected="selected"' : ""; ?>>
|
445 |
+
Gradient
|
446 |
+
</option>
|
447 |
+
</select>
|
448 |
+
</div>
|
449 |
+
</div>
|
450 |
+
</div>
|
451 |
+
|
452 |
+
<div class="options sfsi_margin_top_0 sfsi_inputSec">
|
453 |
+
<label class="first">
|
454 |
+
Margin between icons:
|
455 |
+
</label>
|
456 |
+
<div class="field">
|
457 |
+
<input type="number" value="<?php echo isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["margin"]) ? $sfsi_responsive_icons["settings"]["margin"] : 0; ?>" name="sfsi_responsive_icons_settings_margin" style="float:none" />
|
458 |
+
<span class="span_after_input">pixels</span>
|
459 |
+
</div>
|
460 |
+
</div>
|
461 |
+
|
462 |
+
<div class="options sfsi_margin_top_0">
|
463 |
+
<label class="first">
|
464 |
+
Text on icons:
|
465 |
+
</label>
|
466 |
+
<div class="field">
|
467 |
+
<div style="display:inline-block">
|
468 |
+
<select name="sfsi_responsive_icons_settings_text_align" class="styled">
|
469 |
+
<option value="Left aligned" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["text_align"]) && $sfsi_responsive_icons["settings"]["text_align"] === "Left aligned") ? 'selected="selected"' : ""; ?>>
|
470 |
+
Left aligned
|
471 |
+
</option>
|
472 |
+
<option value="Centered" <?php echo (isset($sfsi_responsive_icons["settings"]) && isset($sfsi_responsive_icons["settings"]["text_align"]) && $sfsi_responsive_icons["settings"]["text_align"] === "Centered") ? 'selected="selected"' : ""; ?>>
|
473 |
+
Centered
|
474 |
+
</option>
|
475 |
+
</select>
|
476 |
+
</div>
|
477 |
+
</div>
|
478 |
+
</div>
|
479 |
+
</li>
|
480 |
+
<li class="sfsi_responsive_icon_option_li sfsi_responsive_show" style="<?php echo $display; ?>">
|
481 |
+
<label class=" options heading-label">
|
482 |
+
Share count
|
483 |
+
</label>
|
484 |
+
<div class="options sfsi_margin_top_0">
|
485 |
+
<label style="width:auto!important;font-size: 16px;">
|
486 |
+
Show the total share count on the left of your icons. It will only be visible if the
|
487 |
+
individual counts are set up under <a href="#" style="text-decoration: none;font-size: 16px;" onclick="event.preventDefault();sfsi_scroll_to_div(\'ui-id-9\')">question 5</a>.
|
488 |
+
</label>
|
489 |
+
|
490 |
+
</div>
|
491 |
+
<ul class="sfsi_tab_3_icns sfsi_shwthmbfraftr ">
|
492 |
+
<li class="clckbltglcls sfsi_border_left_0" onclick="sfsi_responsive_icon_counter_tgl(null ,'sfsi_premium_responsive_icon_share_count', this);sfsi_responsive_toggle_count();">
|
493 |
+
<input name="sfsi_share_count" <?php echo ($option6['sfsi_share_count'] == 'yes') ? 'checked="true"' : ''; ?> type="radio" value="yes" class="styled" />
|
494 |
+
<label class="labelhdng4">
|
495 |
+
Yes
|
496 |
+
</label>
|
497 |
+
</li>
|
498 |
+
<li class="clckbltglcls sfsi_border_left_0" onclick="sfsi_responsive_icon_counter_tgl('sfsi_responsive_icon_share_count', null, this);sfsi_responsive_toggle_count();">
|
499 |
+
<input name="sfsi_share_count" <?php echo ($option6['sfsi_share_count'] == 'no') ? 'checked="true"' : ''; ?> type="radio" value="no" class="styled" />
|
500 |
+
<label class="labelhdng4">
|
501 |
+
No
|
502 |
+
</label>
|
503 |
+
</li>
|
504 |
+
</ul>
|
505 |
+
</li>
|
506 |
+
</ul>
|
507 |
+
</div>
|
508 |
+
</li>
|
509 |
+
</ul>
|
510 |
+
|
511 |
+
|
512 |
+
|
513 |
+
<a class="sfsiColbtn closeSec" href="javascript:;">
|
514 |
+
Collapse area
|
515 |
+
</a>
|
516 |
+
<label class="closeSec"></label>
|
517 |
+
|
518 |
+
<!-- ERROR AND SUCCESS MESSAGE AREA-->
|
519 |
+
<p class="red_txt errorMsg" style="display:none"> </p>
|
520 |
+
<p class="green_txt sucMsg" style="display:none"> </p>
|
521 |
+
<div class="clear"></div>
|
522 |
+
|
523 |
+
</div>
|
524 |
+
</div>
|
525 |
<!-- END Section 6 "Do you want to display icons at the end of every post?" -->
|
views/sfsi_options_view.php
CHANGED
@@ -1,245 +1,245 @@
|
|
1 |
-
<!-- Loader Image section -->
|
2 |
-
<div id="sfpageLoad">
|
3 |
-
|
4 |
-
</div>
|
5 |
-
<!-- END Loader Image section -->
|
6 |
-
|
7 |
-
<!-- javascript error loader -->
|
8 |
-
<div class="error" id="sfsi_onload_errors" style="margin-left: 60px;display: none;">
|
9 |
-
<p>We found errors in your javascript which may cause the plugin to not work properly. Please fix the error:</p>
|
10 |
-
<p id="sfsi_jerrors"></p>
|
11 |
-
</div> <!-- END javascript error loader -->
|
12 |
-
|
13 |
-
<!-- START Admin view for plugin-->
|
14 |
-
<div class="wapper sfsi_mainContainer">
|
15 |
-
|
16 |
-
<!-- Get notification bar-->
|
17 |
-
<?php if (get_option("show_new_notification") == "yes") { ?>
|
18 |
-
<script type="text/javascript">
|
19 |
-
jQuery(document).ready(function(e) {
|
20 |
-
jQuery(".sfsi_show_notification").click(function() {
|
21 |
-
SFSI.ajax({
|
22 |
-
url: sfsi_icon_ajax_object.ajax_url,
|
23 |
-
type: "post",
|
24 |
-
data: {
|
25 |
-
action: "notification_read",
|
26 |
-
nonce: "<?php echo wp_create_nonce('notification_read'); ?>"
|
27 |
-
},
|
28 |
-
success: function(msg) {
|
29 |
-
if (jQuery.trim(msg) == 'success') {
|
30 |
-
jQuery(".sfsi_show_notification").hide("fast");
|
31 |
-
}
|
32 |
-
}
|
33 |
-
});
|
34 |
-
});
|
35 |
-
});
|
36 |
-
</script>
|
37 |
-
<style type="text/css">
|
38 |
-
.sfsi_show_notification {
|
39 |
-
float: left;
|
40 |
-
margin-bottom: 45px;
|
41 |
-
padding: 12px 13px;
|
42 |
-
width: 98%;
|
43 |
-
background-image: url(<?php echo SFSI_PLUGURL; ?>images/notification-close.png);
|
44 |
-
background-position: right 20px center;
|
45 |
-
background-repeat: no-repeat;
|
46 |
-
cursor: pointer;
|
47 |
-
text-align: center;
|
48 |
-
}
|
49 |
-
</style>
|
50 |
-
<!-- <div class="sfsi_show_notification" style="background-color: #38B54A; color: #fff; font-size: 18px;">
|
51 |
-
New: You can now also show a subscription form on your site, increasing sign-ups! (Question 8)
|
52 |
-
<p>
|
53 |
-
(If question 8 gets displayed in a funny way then please reload the page by pressing Control+F5(PC) or Command+R(Mac))
|
54 |
-
</p>
|
55 |
-
</div> -->
|
56 |
-
<?php } ?>
|
57 |
-
<!-- Get notification bar-->
|
58 |
-
|
59 |
-
<div class="sfsi_notificationBannner"></div>
|
60 |
-
<!-- Get new_notification bar-->
|
61 |
-
<script type="text/javascript">
|
62 |
-
jQuery(document).ready(function() {
|
63 |
-
|
64 |
-
jQuery("#floating").click(function() {
|
65 |
-
jQuery("#ui-id-9").trigger("click");
|
66 |
-
jQuery('html, body').animate({
|
67 |
-
scrollTop: jQuery("#ui-id-9").offset().top - jQuery("#ui-id-9").height()
|
68 |
-
}, 2000);
|
69 |
-
});
|
70 |
-
|
71 |
-
jQuery("#afterposts").click(function() {
|
72 |
-
if ("none" == jQuery("#ui-id-12").css('display')) {
|
73 |
-
jQuery("#ui-id-11").trigger("click");
|
74 |
-
}
|
75 |
-
jQuery('html, body').animate({
|
76 |
-
scrollTop: jQuery("#ui-id-11").offset().top - jQuery("#ui-id-11").height()
|
77 |
-
}, 2000);
|
78 |
-
});
|
79 |
-
|
80 |
-
});
|
81 |
-
</script>
|
82 |
-
|
83 |
-
<!-- Top content area of plugin -->
|
84 |
-
<div class="main_contant">
|
85 |
-
|
86 |
-
<h1>Welcome to the Ultimate Social Icons and Share Plugin!</h1>
|
87 |
-
|
88 |
-
<div class="welcometext">
|
89 |
-
|
90 |
-
<p>Simply answer the questions below (at least the first 3) - that`s it! Start by clicking on them</p>
|
91 |
-
|
92 |
-
<p><a style="text-decoration: none;" href="javascript:void(0)"><?php _e('New:'); ?> </a><?php _e('Our new Premium Plugin allows many more placement options, better sharing features (e.g. define which text & images will get shared), optimization for mobile, <a class="sfsi_unbold_link" target="_blank" href="https://www.ultimatelysocial.com/extra-icon-style/">more icon design styles</a>, <a class="sfsi_unbold_link" target="_blank" href="https://www.ultimatelysocial.com/animated-social-media-icons/">animated icons</a>, <a class="sfsi_unbold_link" target="_blank" href="https://www.ultimatelysocial.com/themed-icons-search/">themed icons</a>, and <a class="sfsi_unbold_link" href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmplus_settings_page&utm_campaign=notification_banner&utm_medium=banner" target="_blank">much more</a>.'); ?>
|
93 |
-
<a class="pop-up" href="#" data-id="sfsi_quickpay-overlay" onclick="sfsi_open_quick_checkout(event)">
|
94 |
-
<?php _e('Go premium now'); ?>
|
95 |
-
</a>
|
96 |
-
</p>
|
97 |
-
<p><?php _e('Please'); ?> <a target="_blank" style="text-decoration: underline;" href="https://goo.gl/auxJ9C#no-topic-0"><?php _e('give us feedback,'); ?></a><?php _e(' and tell us how we can make the plugin better. Thank you!.'); ?></p>
|
98 |
-
|
99 |
-
</div>
|
100 |
-
<!-- <div class="welcometext">
|
101 |
-
|
102 |
-
<p>Simple answer the questions below (at least the first 3) by clicking on them - that's it! </p>
|
103 |
-
|
104 |
-
<p>If you want more features like <a target="_blank" href="https://www.ultimatelysocial.com/all-platforms/">more platform icons</a>, <a target="_blank" href="https://www.ultimatelysocial.com/themed-icons-search/">themed icons</a>, <a target="_blank" href="https://www.ultimatelysocial.com/animated-social-media-icons/">animated icons</a>, more design options, better sharing features, mobile optimization, faster loading, full support and <a target="_blank" href="https://www.ultimatelysocial.com/usm-premium/">much more</a>, then please check out our <a target="_blank" href="https://www.ultimatelysocial.com/checkout?edd_action=add_to_cart&download_id=150&edd_options[price_id]=2">Premium Plugin</a>. Pricing is really fair (24.98 USD).</p>
|
105 |
-
<p>For questions and suggestions please raise a ticket in the <a target="_blank" href="https://goo.gl/auxJ9C#no-topic-0">Support Forum.</a></p>
|
106 |
-
|
107 |
-
</div> -->
|
108 |
-
|
109 |
-
<div class="supportforum">
|
110 |
-
<div class="support-container">
|
111 |
-
<div class="have-questions">
|
112 |
-
<img src="<?php echo SFSI_PLUGURL ?>images/question.png" alt="error">
|
113 |
-
<p class="have-quest">Have questions?</p>
|
114 |
-
<!-- <p class="ask-question">Ask them in the...</p> -->
|
115 |
-
</div>
|
116 |
-
<div class="support-forum-green-div">
|
117 |
-
<a target="_blank" href="#" onclick="event.preventDefault();sfsi_open_chat(event)" class="support-forum-green-bg">
|
118 |
-
<p class="support-forum">Chat with us!</p>
|
119 |
-
</a>
|
120 |
-
</div>
|
121 |
-
<!-- <div class="respond-text">
|
122 |
-
<p>We'll try to respond ASAP!</p>
|
123 |
-
</div> -->
|
124 |
-
</div>
|
125 |
-
</div>
|
126 |
-
</div> <!-- END Top content area of plugin -->
|
127 |
-
|
128 |
-
<!-- step 1 end here -->
|
129 |
-
<div id="accordion">
|
130 |
-
|
131 |
-
<h3><span>1</span>Which icons do you want to show on your site? </h3>
|
132 |
-
<!-- step 1 end here -->
|
133 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view1.php'); ?>
|
134 |
-
<!-- step 1 end here -->
|
135 |
-
|
136 |
-
<!-- step 2 start here -->
|
137 |
-
<h3><span>2</span>What do you want the icons to do? </h3>
|
138 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view2.php'); ?>
|
139 |
-
<!-- step 2 END here -->
|
140 |
-
|
141 |
-
<!-- step 3 start here -->
|
142 |
-
<h3><span>3</span>Where shall they be displayed? </h3>
|
143 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_question3.php'); ?>
|
144 |
-
<!-- step 3 end here -->
|
145 |
-
|
146 |
-
|
147 |
-
</div>
|
148 |
-
|
149 |
-
<h2 class="optional">Optional</h2>
|
150 |
-
|
151 |
-
<div id="accordion1">
|
152 |
-
|
153 |
-
<!-- step 4 start here -->
|
154 |
-
<h3><span>4</span>What design & animation do you want to give your icons?</h3>
|
155 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view3.php'); ?>
|
156 |
-
<!-- step 4 END here -->
|
157 |
-
|
158 |
-
<!-- step 5 Start here -->
|
159 |
-
<h3><span>5</span>Do you want to display "counts" next to your icons?</h3>
|
160 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view4.php'); ?>
|
161 |
-
<!-- step 5 END here -->
|
162 |
-
|
163 |
-
<!-- step 6 Start here -->
|
164 |
-
<h3><span>6</span>Any other wishes for your main icons?</h3>
|
165 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view5.php'); ?>
|
166 |
-
<!-- step 6 END here -->
|
167 |
-
|
168 |
-
<!-- step 7 Start here -->
|
169 |
-
<h3><span>7</span>Do you want to display a pop-up, asking people to subscribe?</h3>
|
170 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view7.php'); ?>
|
171 |
-
<!-- step 7 END here -->
|
172 |
-
|
173 |
-
<!-- step 8 Start here -->
|
174 |
-
<h3><span>8</span>Do you want to show a subscription form (<b>increases sign ups</b>)?</h3>
|
175 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view8.php'); ?>
|
176 |
-
<!-- step 8 END here -->
|
177 |
-
|
178 |
-
</div>
|
179 |
-
|
180 |
-
<div class="tab10">
|
181 |
-
<div class="save_button">
|
182 |
-
<img src="<?php echo SFSI_PLUGURL; ?>images/ajax-loader.gif" class="loader-img" alt="error" />
|
183 |
-
<a href="javascript:;" id="save_all_settings" title="Save All Settings">Save All Settings</a>
|
184 |
-
</div>
|
185 |
-
<p class="red_txt errorMsg" style="display:none"> </p>
|
186 |
-
<p class="green_txt sucMsg" style="display:none"> </p>
|
187 |
-
|
188 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_affiliate_banner.php'); ?><?php include(SFSI_DOCROOT . '/views/sfsi_section_for_premium.php'); ?>
|
189 |
-
|
190 |
-
<!--<p class="bldtxtmsg">Need top-notch Wordpress development work at a competitive price? Visit us at <a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=footer_credit&utm_medium=banner">ultimatelysocial.com</a></p>-->
|
191 |
-
</div>
|
192 |
-
<!-- all pops of plugin under sfsi_pop_content.php file -->
|
193 |
-
<?php include(SFSI_DOCROOT . '/views/sfsi_pop_content.php'); ?>
|
194 |
-
</div> <!-- START Admin view for plugin-->
|
195 |
-
<?php if (in_array(get_site_url(), array('http://www.managingio.com', 'http://blog-latest.socialshare.com'))) : ?>
|
196 |
-
<div style="text-align:center">
|
197 |
-
<input type="text" name="domain" id="sfsi_domain_input" style="width:40%;min-height: :40px;text-align:center;margin:0 auto" placeholder="Enter Domian to check its theme" />
|
198 |
-
<input type="text" name="sfsi_domain_input_nonce" value="<?php echo wp_create_nonce('bannerOption'); ?>">
|
199 |
-
<div class="save_button">
|
200 |
-
<img src="<?php echo SFSI_PLUGURL; ?>images/ajax-loader.gif" class="loader-img" alt="error" />
|
201 |
-
<a href="javascript:;" id="sfsi_check_theme_of_domain_btn" title="Check">Check the Theme</a>
|
202 |
-
</div>
|
203 |
-
<script type="text/javascript">
|
204 |
-
jQuery(document).ready(function($) {
|
205 |
-
$('#sfsi_check_theme_of_domain_btn').click(function() {
|
206 |
-
jQuery.ajax({
|
207 |
-
url: "<?php echo admin_url('admin-ajax.php'); ?>",
|
208 |
-
type: "post",
|
209 |
-
data: {
|
210 |
-
'action': 'bannerOption',
|
211 |
-
'domain': $('#sfsi_domain_input').val(),
|
212 |
-
'nonce': $('#sfsi_domain_input_nonce').val(),
|
213 |
-
},
|
214 |
-
success: function(s) {
|
215 |
-
var sfsi_container = $("html,body");
|
216 |
-
var sfsi_scrollTo = $('.sfsi_notificationBannner');
|
217 |
-
$('.sfsi_notificationBannner').attr('tabindex', $('.sfsi_notificationBannner').attr('tabindex') || -1);
|
218 |
-
jQuery(".sfsi_notificationBannner").html(s).focus();
|
219 |
-
sfsi_container.animate({
|
220 |
-
scrollTop: (sfsi_scrollTo.offset().top - sfsi_container.offset().top + sfsi_container.scrollTop()),
|
221 |
-
scrollLeft: 0
|
222 |
-
}, 300);
|
223 |
-
|
224 |
-
}
|
225 |
-
});
|
226 |
-
});
|
227 |
-
})
|
228 |
-
</script>
|
229 |
-
<?php endif; ?>
|
230 |
-
<script type="text/javascript">
|
231 |
-
var e = {
|
232 |
-
action: "bannerOption",
|
233 |
-
'nonce': '<?php echo wp_create_nonce('bannerOption'); ?>',
|
234 |
-
|
235 |
-
};
|
236 |
-
jQuery.ajax({
|
237 |
-
url: "<?php echo admin_url('admin-ajax.php'); ?>",
|
238 |
-
type: "post",
|
239 |
-
data: e,
|
240 |
-
success: function(s) {
|
241 |
-
jQuery(".sfsi_notificationBannner").html(s);
|
242 |
-
}
|
243 |
-
});
|
244 |
-
</script>
|
245 |
<?php include(SFSI_DOCROOT . '/views/sfsi_chat_on_admin_pannel.php'); ?>
|
1 |
+
<!-- Loader Image section -->
|
2 |
+
<div id="sfpageLoad">
|
3 |
+
|
4 |
+
</div>
|
5 |
+
<!-- END Loader Image section -->
|
6 |
+
|
7 |
+
<!-- javascript error loader -->
|
8 |
+
<div class="error" id="sfsi_onload_errors" style="margin-left: 60px;display: none;">
|
9 |
+
<p>We found errors in your javascript which may cause the plugin to not work properly. Please fix the error:</p>
|
10 |
+
<p id="sfsi_jerrors"></p>
|
11 |
+
</div> <!-- END javascript error loader -->
|
12 |
+
|
13 |
+
<!-- START Admin view for plugin-->
|
14 |
+
<div class="wapper sfsi_mainContainer">
|
15 |
+
|
16 |
+
<!-- Get notification bar-->
|
17 |
+
<?php if (get_option("show_new_notification") == "yes") { ?>
|
18 |
+
<script type="text/javascript">
|
19 |
+
jQuery(document).ready(function(e) {
|
20 |
+
jQuery(".sfsi_show_notification").click(function() {
|
21 |
+
SFSI.ajax({
|
22 |
+
url: sfsi_icon_ajax_object.ajax_url,
|
23 |
+
type: "post",
|
24 |
+
data: {
|
25 |
+
action: "notification_read",
|
26 |
+
nonce: "<?php echo wp_create_nonce('notification_read'); ?>"
|
27 |
+
},
|
28 |
+
success: function(msg) {
|
29 |
+
if (jQuery.trim(msg) == 'success') {
|
30 |
+
jQuery(".sfsi_show_notification").hide("fast");
|
31 |
+
}
|
32 |
+
}
|
33 |
+
});
|
34 |
+
});
|
35 |
+
});
|
36 |
+
</script>
|
37 |
+
<style type="text/css">
|
38 |
+
.sfsi_show_notification {
|
39 |
+
float: left;
|
40 |
+
margin-bottom: 45px;
|
41 |
+
padding: 12px 13px;
|
42 |
+
width: 98%;
|
43 |
+
background-image: url(<?php echo SFSI_PLUGURL; ?>images/notification-close.png);
|
44 |
+
background-position: right 20px center;
|
45 |
+
background-repeat: no-repeat;
|
46 |
+
cursor: pointer;
|
47 |
+
text-align: center;
|
48 |
+
}
|
49 |
+
</style>
|
50 |
+
<!-- <div class="sfsi_show_notification" style="background-color: #38B54A; color: #fff; font-size: 18px;">
|
51 |
+
New: You can now also show a subscription form on your site, increasing sign-ups! (Question 8)
|
52 |
+
<p>
|
53 |
+
(If question 8 gets displayed in a funny way then please reload the page by pressing Control+F5(PC) or Command+R(Mac))
|
54 |
+
</p>
|
55 |
+
</div> -->
|
56 |
+
<?php } ?>
|
57 |
+
<!-- Get notification bar-->
|
58 |
+
|
59 |
+
<div class="sfsi_notificationBannner"></div>
|
60 |
+
<!-- Get new_notification bar-->
|
61 |
+
<script type="text/javascript">
|
62 |
+
jQuery(document).ready(function() {
|
63 |
+
|
64 |
+
jQuery("#floating").click(function() {
|
65 |
+
jQuery("#ui-id-9").trigger("click");
|
66 |
+
jQuery('html, body').animate({
|
67 |
+
scrollTop: jQuery("#ui-id-9").offset().top - jQuery("#ui-id-9").height()
|
68 |
+
}, 2000);
|
69 |
+
});
|
70 |
+
|
71 |
+
jQuery("#afterposts").click(function() {
|
72 |
+
if ("none" == jQuery("#ui-id-12").css('display')) {
|
73 |
+
jQuery("#ui-id-11").trigger("click");
|
74 |
+
}
|
75 |
+
jQuery('html, body').animate({
|
76 |
+
scrollTop: jQuery("#ui-id-11").offset().top - jQuery("#ui-id-11").height()
|
77 |
+
}, 2000);
|
78 |
+
});
|
79 |
+
|
80 |
+
});
|
81 |
+
</script>
|
82 |
+
|
83 |
+
<!-- Top content area of plugin -->
|
84 |
+
<div class="main_contant">
|
85 |
+
|
86 |
+
<h1>Welcome to the Ultimate Social Icons and Share Plugin!</h1>
|
87 |
+
|
88 |
+
<div class="welcometext">
|
89 |
+
|
90 |
+
<p>Simply answer the questions below (at least the first 3) - that`s it! Start by clicking on them</p>
|
91 |
+
|
92 |
+
<p><a style="text-decoration: none;" href="javascript:void(0)"><?php _e('New:'); ?> </a><?php _e('Our new Premium Plugin allows many more placement options, better sharing features (e.g. define which text & images will get shared), optimization for mobile, <a class="sfsi_unbold_link" target="_blank" href="https://www.ultimatelysocial.com/extra-icon-style/">more icon design styles</a>, <a class="sfsi_unbold_link" target="_blank" href="https://www.ultimatelysocial.com/animated-social-media-icons/">animated icons</a>, <a class="sfsi_unbold_link" target="_blank" href="https://www.ultimatelysocial.com/themed-icons-search/">themed icons</a>, and <a class="sfsi_unbold_link" href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmplus_settings_page&utm_campaign=notification_banner&utm_medium=banner" target="_blank">much more</a>.'); ?>
|
93 |
+
<a class="pop-up" href="#" data-id="sfsi_quickpay-overlay" onclick="sfsi_open_quick_checkout(event)">
|
94 |
+
<?php _e('Go premium now'); ?>
|
95 |
+
</a>
|
96 |
+
</p>
|
97 |
+
<p><?php _e('Please'); ?> <a target="_blank" style="text-decoration: underline;" href="https://goo.gl/auxJ9C#no-topic-0"><?php _e('give us feedback,'); ?></a><?php _e(' and tell us how we can make the plugin better. Thank you!.'); ?></p>
|
98 |
+
|
99 |
+
</div>
|
100 |
+
<!-- <div class="welcometext">
|
101 |
+
|
102 |
+
<p>Simple answer the questions below (at least the first 3) by clicking on them - that's it! </p>
|
103 |
+
|
104 |
+
<p>If you want more features like <a target="_blank" href="https://www.ultimatelysocial.com/all-platforms/">more platform icons</a>, <a target="_blank" href="https://www.ultimatelysocial.com/themed-icons-search/">themed icons</a>, <a target="_blank" href="https://www.ultimatelysocial.com/animated-social-media-icons/">animated icons</a>, more design options, better sharing features, mobile optimization, faster loading, full support and <a target="_blank" href="https://www.ultimatelysocial.com/usm-premium/">much more</a>, then please check out our <a target="_blank" href="https://www.ultimatelysocial.com/checkout?edd_action=add_to_cart&download_id=150&edd_options[price_id]=2">Premium Plugin</a>. Pricing is really fair (24.98 USD).</p>
|
105 |
+
<p>For questions and suggestions please raise a ticket in the <a target="_blank" href="https://goo.gl/auxJ9C#no-topic-0">Support Forum.</a></p>
|
106 |
+
|
107 |
+
</div> -->
|
108 |
+
|
109 |
+
<div class="supportforum">
|
110 |
+
<div class="support-container">
|
111 |
+
<div class="have-questions">
|
112 |
+
<img src="<?php echo SFSI_PLUGURL ?>images/question.png" alt="error">
|
113 |
+
<p class="have-quest">Have questions?</p>
|
114 |
+
<!-- <p class="ask-question">Ask them in the...</p> -->
|
115 |
+
</div>
|
116 |
+
<div class="support-forum-green-div">
|
117 |
+
<a target="_blank" href="#" onclick="event.preventDefault();sfsi_open_chat(event)" class="support-forum-green-bg">
|
118 |
+
<p class="support-forum">Chat with us!</p>
|
119 |
+
</a>
|
120 |
+
</div>
|
121 |
+
<!-- <div class="respond-text">
|
122 |
+
<p>We'll try to respond ASAP!</p>
|
123 |
+
</div> -->
|
124 |
+
</div>
|
125 |
+
</div>
|
126 |
+
</div> <!-- END Top content area of plugin -->
|
127 |
+
|
128 |
+
<!-- step 1 end here -->
|
129 |
+
<div id="accordion">
|
130 |
+
|
131 |
+
<h3><span>1</span>Which icons do you want to show on your site? </h3>
|
132 |
+
<!-- step 1 end here -->
|
133 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view1.php'); ?>
|
134 |
+
<!-- step 1 end here -->
|
135 |
+
|
136 |
+
<!-- step 2 start here -->
|
137 |
+
<h3><span>2</span>What do you want the icons to do? </h3>
|
138 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view2.php'); ?>
|
139 |
+
<!-- step 2 END here -->
|
140 |
+
|
141 |
+
<!-- step 3 start here -->
|
142 |
+
<h3><span>3</span>Where shall they be displayed? </h3>
|
143 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_question3.php'); ?>
|
144 |
+
<!-- step 3 end here -->
|
145 |
+
|
146 |
+
|
147 |
+
</div>
|
148 |
+
|
149 |
+
<h2 class="optional">Optional</h2>
|
150 |
+
|
151 |
+
<div id="accordion1">
|
152 |
+
|
153 |
+
<!-- step 4 start here -->
|
154 |
+
<h3><span>4</span>What design & animation do you want to give your icons?</h3>
|
155 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view3.php'); ?>
|
156 |
+
<!-- step 4 END here -->
|
157 |
+
|
158 |
+
<!-- step 5 Start here -->
|
159 |
+
<h3><span>5</span>Do you want to display "counts" next to your icons?</h3>
|
160 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view4.php'); ?>
|
161 |
+
<!-- step 5 END here -->
|
162 |
+
|
163 |
+
<!-- step 6 Start here -->
|
164 |
+
<h3><span>6</span>Any other wishes for your main icons?</h3>
|
165 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view5.php'); ?>
|
166 |
+
<!-- step 6 END here -->
|
167 |
+
|
168 |
+
<!-- step 7 Start here -->
|
169 |
+
<h3><span>7</span>Do you want to display a pop-up, asking people to subscribe?</h3>
|
170 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view7.php'); ?>
|
171 |
+
<!-- step 7 END here -->
|
172 |
+
|
173 |
+
<!-- step 8 Start here -->
|
174 |
+
<h3><span>8</span>Do you want to show a subscription form (<b>increases sign ups</b>)?</h3>
|
175 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_option_view8.php'); ?>
|
176 |
+
<!-- step 8 END here -->
|
177 |
+
|
178 |
+
</div>
|
179 |
+
|
180 |
+
<div class="tab10">
|
181 |
+
<div class="save_button">
|
182 |
+
<img src="<?php echo SFSI_PLUGURL; ?>images/ajax-loader.gif" class="loader-img" alt="error" />
|
183 |
+
<a href="javascript:;" id="save_all_settings" title="Save All Settings">Save All Settings</a>
|
184 |
+
</div>
|
185 |
+
<p class="red_txt errorMsg" style="display:none"> </p>
|
186 |
+
<p class="green_txt sucMsg" style="display:none"> </p>
|
187 |
+
|
188 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_affiliate_banner.php'); ?><?php include(SFSI_DOCROOT . '/views/sfsi_section_for_premium.php'); ?>
|
189 |
+
|
190 |
+
<!--<p class="bldtxtmsg">Need top-notch Wordpress development work at a competitive price? Visit us at <a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=footer_credit&utm_medium=banner">ultimatelysocial.com</a></p>-->
|
191 |
+
</div>
|
192 |
+
<!-- all pops of plugin under sfsi_pop_content.php file -->
|
193 |
+
<?php include(SFSI_DOCROOT . '/views/sfsi_pop_content.php'); ?>
|
194 |
+
</div> <!-- START Admin view for plugin-->
|
195 |
+
<?php if (in_array(get_site_url(), array('http://www.managingio.com', 'http://blog-latest.socialshare.com'))) : ?>
|
196 |
+
<div style="text-align:center">
|
197 |
+
<input type="text" name="domain" id="sfsi_domain_input" style="width:40%;min-height: :40px;text-align:center;margin:0 auto" placeholder="Enter Domian to check its theme" />
|
198 |
+
<input type="text" name="sfsi_domain_input_nonce" value="<?php echo wp_create_nonce('bannerOption'); ?>">
|
199 |
+
<div class="save_button">
|
200 |
+
<img src="<?php echo SFSI_PLUGURL; ?>images/ajax-loader.gif" class="loader-img" alt="error" />
|
201 |
+
<a href="javascript:;" id="sfsi_check_theme_of_domain_btn" title="Check">Check the Theme</a>
|
202 |
+
</div>
|
203 |
+
<script type="text/javascript">
|
204 |
+
jQuery(document).ready(function($) {
|
205 |
+
$('#sfsi_check_theme_of_domain_btn').click(function() {
|
206 |
+
jQuery.ajax({
|
207 |
+
url: "<?php echo admin_url('admin-ajax.php'); ?>",
|
208 |
+
type: "post",
|
209 |
+
data: {
|
210 |
+
'action': 'bannerOption',
|
211 |
+
'domain': $('#sfsi_domain_input').val(),
|
212 |
+
'nonce': $('#sfsi_domain_input_nonce').val(),
|
213 |
+
},
|
214 |
+
success: function(s) {
|
215 |
+
var sfsi_container = $("html,body");
|
216 |
+
var sfsi_scrollTo = $('.sfsi_notificationBannner');
|
217 |
+
$('.sfsi_notificationBannner').attr('tabindex', $('.sfsi_notificationBannner').attr('tabindex') || -1);
|
218 |
+
jQuery(".sfsi_notificationBannner").html(s).focus();
|
219 |
+
sfsi_container.animate({
|
220 |
+
scrollTop: (sfsi_scrollTo.offset().top - sfsi_container.offset().top + sfsi_container.scrollTop()),
|
221 |
+
scrollLeft: 0
|
222 |
+
}, 300);
|
223 |
+
|
224 |
+
}
|
225 |
+
});
|
226 |
+
});
|
227 |
+
})
|
228 |
+
</script>
|
229 |
+
<?php endif; ?>
|
230 |
+
<script type="text/javascript">
|
231 |
+
var e = {
|
232 |
+
action: "bannerOption",
|
233 |
+
'nonce': '<?php echo wp_create_nonce('bannerOption'); ?>',
|
234 |
+
|
235 |
+
};
|
236 |
+
jQuery.ajax({
|
237 |
+
url: "<?php echo admin_url('admin-ajax.php'); ?>",
|
238 |
+
type: "post",
|
239 |
+
data: e,
|
240 |
+
success: function(s) {
|
241 |
+
jQuery(".sfsi_notificationBannner").html(s);
|
242 |
+
}
|
243 |
+
});
|
244 |
+
</script>
|
245 |
<?php include(SFSI_DOCROOT . '/views/sfsi_chat_on_admin_pannel.php'); ?>
|
views/sfsi_question3.php
CHANGED
@@ -1,142 +1,143 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
$option9 = unserialize(get_option('sfsi_section9_options', false));
|
4 |
-
|
5 |
-
?>
|
6 |
-
|
7 |
-
<div class="tab9">
|
8 |
-
|
9 |
-
|
10 |
-
|
11 |
-
<ul class="sfsi_icn_listing8">
|
12 |
-
|
13 |
-
|
14 |
-
|
15 |
-
|
16 |
-
|
17 |
-
|
18 |
-
|
19 |
-
|
20 |
-
|
21 |
-
|
22 |
-
|
23 |
-
|
24 |
-
|
25 |
-
|
26 |
-
|
27 |
-
|
28 |
-
|
29 |
-
|
30 |
-
|
31 |
-
|
32 |
-
|
33 |
-
|
34 |
-
|
35 |
-
|
36 |
-
|
37 |
-
|
38 |
-
|
39 |
-
|
40 |
-
|
41 |
-
|
42 |
-
|
43 |
-
|
44 |
-
|
45 |
-
|
46 |
-
|
47 |
-
|
48 |
-
|
49 |
-
|
50 |
-
|
51 |
-
|
52 |
-
|
53 |
-
|
54 |
-
|
55 |
-
|
56 |
-
|
57 |
-
|
58 |
-
|
59 |
-
|
60 |
-
|
61 |
-
|
62 |
-
|
63 |
-
|
64 |
-
|
65 |
-
|
66 |
-
|
67 |
-
|
68 |
-
|
69 |
-
|
70 |
-
|
71 |
-
|
72 |
-
|
73 |
-
|
74 |
-
|
75 |
-
|
76 |
-
|
77 |
-
|
78 |
-
|
79 |
-
|
80 |
-
|
81 |
-
|
82 |
-
|
83 |
-
|
84 |
-
|
85 |
-
|
86 |
-
|
87 |
-
|
88 |
-
|
89 |
-
|
90 |
-
|
91 |
-
|
92 |
-
|
93 |
-
|
94 |
-
|
95 |
-
|
96 |
-
|
97 |
-
|
98 |
-
|
99 |
-
|
100 |
-
|
101 |
-
|
102 |
-
|
103 |
-
|
104 |
-
|
105 |
-
|
106 |
-
|
107 |
-
|
108 |
-
|
109 |
-
|
110 |
-
|
111 |
-
|
112 |
-
|
113 |
-
|
114 |
-
|
115 |
-
|
116 |
-
|
117 |
-
|
118 |
-
|
119 |
-
|
120 |
-
|
121 |
-
|
122 |
-
|
123 |
-
|
124 |
-
|
125 |
-
|
126 |
-
|
127 |
-
|
128 |
-
|
129 |
-
|
130 |
-
|
131 |
-
|
132 |
-
|
133 |
-
|
134 |
-
|
135 |
-
|
136 |
-
|
137 |
-
|
138 |
-
|
139 |
-
|
140 |
-
|
141 |
-
|
|
|
142 |
?>
|
1 |
+
<?php
|
2 |
+
|
3 |
+
$option9 = unserialize(get_option('sfsi_section9_options', false));
|
4 |
+
|
5 |
+
?>
|
6 |
+
|
7 |
+
<div class="tab9">
|
8 |
+
|
9 |
+
|
10 |
+
|
11 |
+
<ul class="sfsi_icn_listing8">
|
12 |
+
|
13 |
+
|
14 |
+
|
15 |
+
|
16 |
+
<p class="clear">Please select one or multiple placement options: </p>
|
17 |
+
|
18 |
+
<!--********************** Define the location on the page **************************************-->
|
19 |
+
|
20 |
+
<?php @include(SFSI_DOCROOT . '/views/subviews/que3/sfsi_que3_place_via_float.php'); ?>
|
21 |
+
|
22 |
+
|
23 |
+
<!--********************** Show them via a widget section **************************************-->
|
24 |
+
|
25 |
+
<?php @include(SFSI_DOCROOT . '/views/subviews/que3/sfsi_que3_place_via_widget.php'); ?>
|
26 |
+
|
27 |
+
|
28 |
+
<!--********************** Place via shortcode *******************************************-->
|
29 |
+
|
30 |
+
|
31 |
+
|
32 |
+
<?php @include(SFSI_DOCROOT . '/views/subviews/que3/sfsi_que3_place_via_shortcode.php'); ?>
|
33 |
+
|
34 |
+
|
35 |
+
|
36 |
+
|
37 |
+
|
38 |
+
<!--********************** Show them after post****************************************-->
|
39 |
+
|
40 |
+
|
41 |
+
|
42 |
+
<?php @include(SFSI_DOCROOT . '/views/subviews/que3/sfsi_que3_place_via_after_posts.php'); ?>
|
43 |
+
|
44 |
+
<!--********************** Show pinterest over image hover post****************************************-->
|
45 |
+
|
46 |
+
<li class="sfsi_show_via_onhover disabled_checkbox">
|
47 |
+
|
48 |
+
|
49 |
+
|
50 |
+
<div class="radio_section tb_4_ck">
|
51 |
+
|
52 |
+
<span class="checkbox" style="background-position:0px 0px!important;width:31px"></span>
|
53 |
+
|
54 |
+
<input name="" type="checkbox" disable value="" class="hide" style="display:none;" /></div>
|
55 |
+
|
56 |
+
|
57 |
+
|
58 |
+
<div class="sfsi_right_info">
|
59 |
+
|
60 |
+
|
61 |
+
|
62 |
+
<p style="display:block">
|
63 |
+
|
64 |
+
<span class="sfsi_toglepstpgspn" style="display:inline-block;float:left;">Show a Pinterest icon over images on mouse-over </span>- <span><a href="https://www.ultimatelysocial.com/usm-premium/?utm_source=usmi_settings_page&utm_campaign=pinterest_icon_mouse_over&utm_medium=link" target="_blank" style="font-weight:800">Premium feature</a></span>
|
65 |
+
|
66 |
+
</p>
|
67 |
+
|
68 |
+
|
69 |
+
|
70 |
+
</div>
|
71 |
+
|
72 |
+
</li>
|
73 |
+
|
74 |
+
</ul>
|
75 |
+
|
76 |
+
|
77 |
+
|
78 |
+
|
79 |
+
|
80 |
+
<p class="sfsi_premium_feature_note">
|
81 |
+
|
82 |
+
In the Premium Plugin you can also <b>exclude icons</b> from showing on certain pages. <a target="_blank" href="https://www.ultimatelysocial.com/usm-premium/"><b>See all features</b></a>
|
83 |
+
|
84 |
+
</p>
|
85 |
+
|
86 |
+
<?php sfsi_ask_for_help(9); ?>
|
87 |
+
|
88 |
+
|
89 |
+
|
90 |
+
<!-- SAVE BUTTON SECTION -->
|
91 |
+
|
92 |
+
<div class="save_button">
|
93 |
+
|
94 |
+
<img src="<?php echo SFSI_PLUGURL ?>images/ajax-loader.gif" class="loader-img" alt='loader' />
|
95 |
+
|
96 |
+
<?php $nonce2 = wp_create_nonce("update_step6"); ?>
|
97 |
+
|
98 |
+
<?php $nonce = wp_create_nonce("update_step9"); ?>
|
99 |
+
|
100 |
+
<a href="javascript:;" id="sfsi_save9" title="Save" data-nonce="<?php echo $nonce?>" data-nonce2="<?php echo $nonce2?>">Save</a>
|
101 |
+
|
102 |
+
</div>
|
103 |
+
|
104 |
+
<!-- END SAVE BUTTON SECTION -->
|
105 |
+
|
106 |
+
|
107 |
+
|
108 |
+
<a class="sfsiColbtn closeSec" href="javascript:;">Collapse area
|
109 |
+
|
110 |
+
</a>
|
111 |
+
|
112 |
+
<label class="closeSec"></label>
|
113 |
+
|
114 |
+
|
115 |
+
|
116 |
+
<!-- ERROR AND SUCCESS MESSAGE AREA-->
|
117 |
+
|
118 |
+
<p class="red_txt errorMsg" style="display:none"> </p>
|
119 |
+
|
120 |
+
<p class="green_txt sucMsg" style="display:none"> </p>
|
121 |
+
|
122 |
+
<div class="clear"></div>
|
123 |
+
|
124 |
+
|
125 |
+
|
126 |
+
</div>
|
127 |
+
|
128 |
+
<?php
|
129 |
+
|
130 |
+
function sfsi_premium_isSeletcted($givenVal, $value)
|
131 |
+
|
132 |
+
{
|
133 |
+
|
134 |
+
if ($givenVal == $value)
|
135 |
+
|
136 |
+
return 'selected="true"';
|
137 |
+
|
138 |
+
else
|
139 |
+
|
140 |
+
return '';
|
141 |
+
}
|
142 |
+
|
143 |
?>
|
views/subviews/que3/sfsi_que3_place_via_after_posts.php
CHANGED
@@ -1,60 +1,60 @@
|
|
1 |
-
|
2 |
-
|
3 |
-
<?php
|
4 |
-
|
5 |
-
$sfsi_show_via_afterposts = "no";
|
6 |
-
|
7 |
-
if(isset($option9['sfsi_show_via_afterposts']) && !empty($option9['sfsi_show_via_afterposts'])){
|
8 |
-
|
9 |
-
$sfsi_show_via_afterposts = $option9['sfsi_show_via_afterposts'];
|
10 |
-
|
11 |
-
}
|
12 |
-
|
13 |
-
$label_style = 'style="display:none;"';
|
14 |
-
|
15 |
-
$checked = "";
|
16 |
-
|
17 |
-
if($sfsi_show_via_afterposts =='yes'){
|
18 |
-
|
19 |
-
$label_style = 'style="display:block;"';
|
20 |
-
|
21 |
-
$checked = 'checked="true"';
|
22 |
-
|
23 |
-
}
|
24 |
-
|
25 |
-
?>
|
26 |
-
|
27 |
-
<li class="sfsi_show_via_afterposts">
|
28 |
-
|
29 |
-
|
30 |
-
|
31 |
-
<div class="radio_section tb_4_ck" onclick="checkforinfoslction_checkbox(this);"><input name="sfsi_show_via_afterposts" <?php echo $checked; ?> type="checkbox" value="<?php echo $sfsi_show_via_afterposts; ?>" class="styled" /></div>
|
32 |
-
|
33 |
-
|
34 |
-
|
35 |
-
<div class="sfsi_right_info">
|
36 |
-
|
37 |
-
|
38 |
-
|
39 |
-
<p>
|
40 |
-
|
41 |
-
<span class="sfsi_toglepstpgspn">Show icons after posts</span>
|
42 |
-
|
43 |
-
</p>
|
44 |
-
|
45 |
-
<div class="kckslctn" <?php echo $label_style; ?>>
|
46 |
-
|
47 |
-
|
48 |
-
<?php include(SFSI_DOCROOT.'/views/sfsi_option_view6.php'); ?>
|
49 |
-
|
50 |
-
|
51 |
-
|
52 |
-
</div>
|
53 |
-
|
54 |
-
|
55 |
-
|
56 |
-
|
57 |
-
|
58 |
-
</div>
|
59 |
-
|
60 |
</li>
|
1 |
+
|
2 |
+
|
3 |
+
<?php
|
4 |
+
|
5 |
+
$sfsi_show_via_afterposts = "no";
|
6 |
+
|
7 |
+
if(isset($option9['sfsi_show_via_afterposts']) && !empty($option9['sfsi_show_via_afterposts'])){
|
8 |
+
|
9 |
+
$sfsi_show_via_afterposts = $option9['sfsi_show_via_afterposts'];
|
10 |
+
|
11 |
+
}
|
12 |
+
|
13 |
+
$label_style = 'style="display:none;"';
|
14 |
+
|
15 |
+
$checked = "";
|
16 |
+
|
17 |
+
if($sfsi_show_via_afterposts =='yes'){
|
18 |
+
|
19 |
+
$label_style = 'style="display:block;"';
|
20 |
+
|
21 |
+
$checked = 'checked="true"';
|
22 |
+
|
23 |
+
}
|
24 |
+
|
25 |
+
?>
|
26 |
+
|
27 |
+
<li class="sfsi_show_via_afterposts">
|
28 |
+
|
29 |
+
|
30 |
+
|
31 |
+
<div class="radio_section tb_4_ck" onclick="checkforinfoslction_checkbox(this);"><input name="sfsi_show_via_afterposts" <?php echo $checked; ?> type="checkbox" value="<?php echo $sfsi_show_via_afterposts; ?>" class="styled" /></div>
|
32 |
+
|
33 |
+
|
34 |
+
|
35 |
+
<div class="sfsi_right_info">
|
36 |
+
|
37 |
+
|
38 |
+
|
39 |
+
<p>
|
40 |
+
|
41 |
+
<span class="sfsi_toglepstpgspn">Show icons after posts</span>
|
42 |
+
|
43 |
+
</p>
|
44 |
+
|
45 |
+
<div class="kckslctn" <?php echo $label_style; ?>>
|
46 |
+
|
47 |
+
|
48 |
+
<?php include(SFSI_DOCROOT.'/views/sfsi_option_view6.php'); ?>
|
49 |
+
|
50 |
+
|
51 |
+
|
52 |
+
</div>
|
53 |
+
|
54 |
+
|
55 |
+
|
56 |
+
|
57 |
+
|
58 |
+
</div>
|
59 |
+
|
60 |
</li>
|
views/subviews/que3/sfsi_que3_place_via_float.php
CHANGED
@@ -1,263 +1,263 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
$option9['sfsi_icons_float'] = (isset($option9['sfsi_icons_float'])) ? sanitize_text_field($option9['sfsi_icons_float']): 'no';
|
4 |
-
|
5 |
-
$option9['sfsi_icons_floatPosition'] = (isset($option9['sfsi_icons_floatPosition'])) ? sanitize_text_field($option9['sfsi_icons_floatPosition']) :'center-right';
|
6 |
-
|
7 |
-
$option9['sfsi_icons_floatMargin_top'] = (isset($option9['sfsi_icons_floatMargin_top'])) ? intval($option9['sfsi_icons_floatMargin_top']) : '';
|
8 |
-
|
9 |
-
$option9['sfsi_icons_floatMargin_bottom'] = (isset($option9['sfsi_icons_floatMargin_bottom'])) ? intval($option9['sfsi_icons_floatMargin_bottom']) : '';
|
10 |
-
|
11 |
-
$option9['sfsi_icons_floatMargin_left'] = (isset($option9['sfsi_icons_floatMargin_left'])) ? intval($option9['sfsi_icons_floatMargin_left']) : '';
|
12 |
-
|
13 |
-
$option9['sfsi_icons_floatMargin_right'] = (isset($option9['sfsi_icons_floatMargin_right'])) ? intval($option9['sfsi_icons_floatMargin_right']) : '';
|
14 |
-
|
15 |
-
$option9['sfsi_disable_floaticons'] = (isset($option9['sfsi_disable_floaticons'])) ? sanitize_text_field($option9['sfsi_disable_floaticons']): 'no';
|
16 |
-
|
17 |
-
$style = ($option9['sfsi_icons_float'] == "yes") ? 'display: block;' : "display: none;";
|
18 |
-
|
19 |
-
?>
|
20 |
-
|
21 |
-
<li class="sfsiLocationli">
|
22 |
-
|
23 |
-
<div class="radio_section tb_4_ck cstmfltonpgstck" onclick="sfsi_toggleflotpage_que3(this);">
|
24 |
-
|
25 |
-
<input name="sfsi_icons_float" <?php echo ($option9['sfsi_icons_float']=='yes') ? 'checked="true"' : '' ;?> type="checkbox" value="yes" class="styled" />
|
26 |
-
|
27 |
-
<p><span class="sfsi_toglepstpgspn">Floating over your website's pages</span></p>
|
28 |
-
</div>
|
29 |
-
|
30 |
-
<div class="sfsi_right_info" <?php echo 'style="'.$style.'"';?>>
|
31 |
-
<p><span style="margin-left: 31px;">Define the location:</span></p>
|
32 |
-
|
33 |
-
<div class="sfsi_tab_3_icns">
|
34 |
-
|
35 |
-
|
36 |
-
|
37 |
-
<ul class="sfsi_tab_3_icns flthmonpg">
|
38 |
-
|
39 |
-
|
40 |
-
|
41 |
-
<div class="sfsi_position_divider">
|
42 |
-
|
43 |
-
<li>
|
44 |
-
|
45 |
-
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='top-left') ? 'checked="true"' : '' ;?> type="radio" value="top-left" class="styled" />
|
46 |
-
|
47 |
-
<span class="sfsi_flicnsoptn3 sfsioptntl">Top left</span>
|
48 |
-
|
49 |
-
<label><img src="<?php echo SFSI_PLUGURL;?>images/top_left.png" alt='error'/></label>
|
50 |
-
|
51 |
-
</li>
|
52 |
-
|
53 |
-
|
54 |
-
|
55 |
-
<li>
|
56 |
-
|
57 |
-
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='center-top') ? 'checked="true"' : '' ;?> type="radio" value="center-top" class="styled" />
|
58 |
-
|
59 |
-
|
60 |
-
|
61 |
-
<span class="sfsi_flicnsoptn3 sfsioptncl">Center top</span>
|
62 |
-
|
63 |
-
<label class="sfsi_float_position_icon_label"><img src="<?php echo SFSI_PLUGURL;?>images/float_position_icon.png" alt='error'/></label>
|
64 |
-
|
65 |
-
</li>
|
66 |
-
|
67 |
-
|
68 |
-
|
69 |
-
<li>
|
70 |
-
|
71 |
-
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='top-right') ? 'checked="true"' : '' ;?> type="radio" value="top-right" class="styled" />
|
72 |
-
|
73 |
-
<span class="sfsi_flicnsoptn3 sfsioptntr">Top right</span>
|
74 |
-
|
75 |
-
<label><img src="<?php echo SFSI_PLUGURL;?>images/top_right.png" alt='error' /></label>
|
76 |
-
|
77 |
-
</li>
|
78 |
-
|
79 |
-
</div>
|
80 |
-
|
81 |
-
<div class="sfsi_position_divider">
|
82 |
-
|
83 |
-
<li>
|
84 |
-
|
85 |
-
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='center-left') ? 'checked="true"' : '' ;?> type="radio" value="center-left" class="styled" />
|
86 |
-
|
87 |
-
|
88 |
-
|
89 |
-
<span class="sfsi_flicnsoptn3 sfsioptncl">Center left</span>
|
90 |
-
|
91 |
-
<label><img src="<?php echo SFSI_PLUGURL;?>images/center_left.png" alt='error'/></label>
|
92 |
-
|
93 |
-
</li>
|
94 |
-
|
95 |
-
<li></li>
|
96 |
-
|
97 |
-
|
98 |
-
|
99 |
-
<li>
|
100 |
-
|
101 |
-
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='center-right') ? 'checked="true"' : '' ;?> type="radio" value="center-right" class="styled" />
|
102 |
-
|
103 |
-
|
104 |
-
|
105 |
-
<span class="sfsi_flicnsoptn3 sfsioptncr">Center right</span>
|
106 |
-
|
107 |
-
<label><img src="<?php echo SFSI_PLUGURL;?>images/center_right.png" alt='error'/></label>
|
108 |
-
|
109 |
-
</li>
|
110 |
-
|
111 |
-
|
112 |
-
|
113 |
-
</div>
|
114 |
-
|
115 |
-
<div class="sfsi_position_divider">
|
116 |
-
|
117 |
-
<li>
|
118 |
-
|
119 |
-
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='bottom-left') ? 'checked="true"' : '' ;?> type="radio" value="bottom-left" class="styled" />
|
120 |
-
|
121 |
-
<span class="sfsi_flicnsoptn3 sfsioptnbl">Bottom left</span>
|
122 |
-
|
123 |
-
<label><img src="<?php echo SFSI_PLUGURL;?>images/bottom_left.png" alt='error'alt='error'/></label>
|
124 |
-
|
125 |
-
</li>
|
126 |
-
|
127 |
-
|
128 |
-
|
129 |
-
<li>
|
130 |
-
|
131 |
-
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='center-bottom') ? 'checked="true"' : '' ;?> type="radio" value="center-bottom" class="styled" />
|
132 |
-
|
133 |
-
|
134 |
-
|
135 |
-
<span class="sfsi_flicnsoptn3 sfsioptncr">Center bottom</span>
|
136 |
-
|
137 |
-
<label class="sfsi_float_position_icon_label sfsi_center_botttom"><img class="sfsi_img_center_bottom" src="<?php echo SFSI_PLUGURL;?>images/float_position_icon.png" alt='error'/></label>
|
138 |
-
|
139 |
-
</li>
|
140 |
-
|
141 |
-
<li>
|
142 |
-
|
143 |
-
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='bottom-right') ? 'checked="true"' : '' ;?> type="radio" value="bottom-right" class="styled" />
|
144 |
-
|
145 |
-
|
146 |
-
|
147 |
-
<span class="sfsi_flicnsoptn3 sfsioptnbr">Bottom right</span>
|
148 |
-
|
149 |
-
<label><img src="<?php echo SFSI_PLUGURL;?>images/bottom_right.png" alt='error'/></label>
|
150 |
-
|
151 |
-
</li>
|
152 |
-
|
153 |
-
</div>
|
154 |
-
|
155 |
-
</ul>
|
156 |
-
|
157 |
-
|
158 |
-
|
159 |
-
<div style="width: 88%; float: left; margin:25px 0 0 25px">
|
160 |
-
|
161 |
-
|
162 |
-
|
163 |
-
<h4>Margin From: </h4>
|
164 |
-
|
165 |
-
<ul class="sfsi_floaticon_margin_sec">
|
166 |
-
|
167 |
-
|
168 |
-
|
169 |
-
<li>
|
170 |
-
|
171 |
-
<label>Top:</label>
|
172 |
-
|
173 |
-
<input name="sfsi_icons_floatMargin_top" type="text" value="<?php echo ($option9['sfsi_icons_floatMargin_top']!='') ? $option9['sfsi_icons_floatMargin_top'] : '' ;?>" />
|
174 |
-
|
175 |
-
<ins>Pixels</ins>
|
176 |
-
|
177 |
-
</li>
|
178 |
-
|
179 |
-
|
180 |
-
|
181 |
-
<li>
|
182 |
-
|
183 |
-
<label>Bottom:</label>
|
184 |
-
|
185 |
-
<input name="sfsi_icons_floatMargin_bottom" type="text" value="<?php echo ($option9['sfsi_icons_floatMargin_bottom'] != '') ? $option9['sfsi_icons_floatMargin_bottom'] : '' ;?>" />
|
186 |
-
|
187 |
-
<ins>Pixels</ins>
|
188 |
-
|
189 |
-
</li>
|
190 |
-
|
191 |
-
|
192 |
-
|
193 |
-
<li>
|
194 |
-
|
195 |
-
<label>Left:</label>
|
196 |
-
|
197 |
-
<input name="sfsi_icons_floatMargin_left" type="text" value="<?php echo ($option9['sfsi_icons_floatMargin_left']!='') ? $option9['sfsi_icons_floatMargin_left'] : '' ;?>" />
|
198 |
-
|
199 |
-
<ins>Pixels</ins>
|
200 |
-
|
201 |
-
</li>
|
202 |
-
|
203 |
-
|
204 |
-
|
205 |
-
<li>
|
206 |
-
|
207 |
-
<label>Right:</label>
|
208 |
-
|
209 |
-
<input name="sfsi_icons_floatMargin_right" type="text" value="<?php echo ($option9['sfsi_icons_floatMargin_right']!='') ? $option9['sfsi_icons_floatMargin_right'] : '' ;?>" />
|
210 |
-
|
211 |
-
<ins>Pixels</ins>
|
212 |
-
|
213 |
-
</li>
|
214 |
-
|
215 |
-
</ul>
|
216 |
-
|
217 |
-
</div>
|
218 |
-
|
219 |
-
|
220 |
-
|
221 |
-
<div style="width: 88%; float: left; margin:25px 0 0 7px">
|
222 |
-
|
223 |
-
<p style="line-height: 34px;">
|
224 |
-
|
225 |
-
The icons will be floating on your page. If you want them <b>"sticky"</b>, please check out the <a target="_blank" href="https://www.ultimatelysocial.com/usm-premium/"><b>Premium Plugin</b></a>. Also in the Premium Plugin you can show the icons <b>vertically</b>, and give them <b>different settings for mobile.</b>
|
226 |
-
|
227 |
-
</p>
|
228 |
-
|
229 |
-
</div>
|
230 |
-
|
231 |
-
<div class="sfsi_disable_floatingicons_mobile">
|
232 |
-
|
233 |
-
|
234 |
-
|
235 |
-
<h4>Want to disable the floating icons on mobile?</h4>
|
236 |
-
|
237 |
-
<ul class="sfsi_make_icons sfsi_plus_mobile_float">
|
238 |
-
|
239 |
-
<li>
|
240 |
-
|
241 |
-
<input name="sfsi_disable_floaticons" <?php echo ( $option9['sfsi_disable_floaticons']=='yes') ? 'checked="true"' : '' ;?> type="radio" value="yes" class="styled" />
|
242 |
-
|
243 |
-
<span class="sfsi_flicnsoptn3">Yes</span>
|
244 |
-
|
245 |
-
</li>
|
246 |
-
|
247 |
-
<li>
|
248 |
-
|
249 |
-
<input name="sfsi_disable_floaticons" <?php echo ( $option9['sfsi_disable_floaticons']=='no') ? 'checked="true"' : '' ;?> type="radio" value="no" class="styled"/>
|
250 |
-
|
251 |
-
<span class="sfsi_flicnsoptn3">No</span>
|
252 |
-
|
253 |
-
</li>
|
254 |
-
|
255 |
-
</ul>
|
256 |
-
|
257 |
-
</div>
|
258 |
-
|
259 |
-
</div>
|
260 |
-
|
261 |
-
</div>
|
262 |
-
|
263 |
</li>
|
1 |
+
<?php
|
2 |
+
|
3 |
+
$option9['sfsi_icons_float'] = (isset($option9['sfsi_icons_float'])) ? sanitize_text_field($option9['sfsi_icons_float']): 'no';
|
4 |
+
|
5 |
+
$option9['sfsi_icons_floatPosition'] = (isset($option9['sfsi_icons_floatPosition'])) ? sanitize_text_field($option9['sfsi_icons_floatPosition']) :'center-right';
|
6 |
+
|
7 |
+
$option9['sfsi_icons_floatMargin_top'] = (isset($option9['sfsi_icons_floatMargin_top'])) ? intval($option9['sfsi_icons_floatMargin_top']) : '';
|
8 |
+
|
9 |
+
$option9['sfsi_icons_floatMargin_bottom'] = (isset($option9['sfsi_icons_floatMargin_bottom'])) ? intval($option9['sfsi_icons_floatMargin_bottom']) : '';
|
10 |
+
|
11 |
+
$option9['sfsi_icons_floatMargin_left'] = (isset($option9['sfsi_icons_floatMargin_left'])) ? intval($option9['sfsi_icons_floatMargin_left']) : '';
|
12 |
+
|
13 |
+
$option9['sfsi_icons_floatMargin_right'] = (isset($option9['sfsi_icons_floatMargin_right'])) ? intval($option9['sfsi_icons_floatMargin_right']) : '';
|
14 |
+
|
15 |
+
$option9['sfsi_disable_floaticons'] = (isset($option9['sfsi_disable_floaticons'])) ? sanitize_text_field($option9['sfsi_disable_floaticons']): 'no';
|
16 |
+
|
17 |
+
$style = ($option9['sfsi_icons_float'] == "yes") ? 'display: block;' : "display: none;";
|
18 |
+
|
19 |
+
?>
|
20 |
+
|
21 |
+
<li class="sfsiLocationli">
|
22 |
+
|
23 |
+
<div class="radio_section tb_4_ck cstmfltonpgstck" onclick="sfsi_toggleflotpage_que3(this);">
|
24 |
+
|
25 |
+
<input name="sfsi_icons_float" <?php echo ($option9['sfsi_icons_float']=='yes') ? 'checked="true"' : '' ;?> type="checkbox" value="yes" class="styled" />
|
26 |
+
|
27 |
+
<p><span class="sfsi_toglepstpgspn">Floating over your website's pages</span></p>
|
28 |
+
</div>
|
29 |
+
|
30 |
+
<div class="sfsi_right_info" <?php echo 'style="'.$style.'"';?>>
|
31 |
+
<p><span style="margin-left: 31px;">Define the location:</span></p>
|
32 |
+
|
33 |
+
<div class="sfsi_tab_3_icns">
|
34 |
+
|
35 |
+
|
36 |
+
|
37 |
+
<ul class="sfsi_tab_3_icns flthmonpg">
|
38 |
+
|
39 |
+
|
40 |
+
|
41 |
+
<div class="sfsi_position_divider">
|
42 |
+
|
43 |
+
<li>
|
44 |
+
|
45 |
+
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='top-left') ? 'checked="true"' : '' ;?> type="radio" value="top-left" class="styled" />
|
46 |
+
|
47 |
+
<span class="sfsi_flicnsoptn3 sfsioptntl">Top left</span>
|
48 |
+
|
49 |
+
<label><img src="<?php echo SFSI_PLUGURL;?>images/top_left.png" alt='error'/></label>
|
50 |
+
|
51 |
+
</li>
|
52 |
+
|
53 |
+
|
54 |
+
|
55 |
+
<li>
|
56 |
+
|
57 |
+
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='center-top') ? 'checked="true"' : '' ;?> type="radio" value="center-top" class="styled" />
|
58 |
+
|
59 |
+
|
60 |
+
|
61 |
+
<span class="sfsi_flicnsoptn3 sfsioptncl">Center top</span>
|
62 |
+
|
63 |
+
<label class="sfsi_float_position_icon_label"><img src="<?php echo SFSI_PLUGURL;?>images/float_position_icon.png" alt='error'/></label>
|
64 |
+
|
65 |
+
</li>
|
66 |
+
|
67 |
+
|
68 |
+
|
69 |
+
<li>
|
70 |
+
|
71 |
+
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='top-right') ? 'checked="true"' : '' ;?> type="radio" value="top-right" class="styled" />
|
72 |
+
|
73 |
+
<span class="sfsi_flicnsoptn3 sfsioptntr">Top right</span>
|
74 |
+
|
75 |
+
<label><img src="<?php echo SFSI_PLUGURL;?>images/top_right.png" alt='error' /></label>
|
76 |
+
|
77 |
+
</li>
|
78 |
+
|
79 |
+
</div>
|
80 |
+
|
81 |
+
<div class="sfsi_position_divider">
|
82 |
+
|
83 |
+
<li>
|
84 |
+
|
85 |
+
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='center-left') ? 'checked="true"' : '' ;?> type="radio" value="center-left" class="styled" />
|
86 |
+
|
87 |
+
|
88 |
+
|
89 |
+
<span class="sfsi_flicnsoptn3 sfsioptncl">Center left</span>
|
90 |
+
|
91 |
+
<label><img src="<?php echo SFSI_PLUGURL;?>images/center_left.png" alt='error'/></label>
|
92 |
+
|
93 |
+
</li>
|
94 |
+
|
95 |
+
<li></li>
|
96 |
+
|
97 |
+
|
98 |
+
|
99 |
+
<li>
|
100 |
+
|
101 |
+
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='center-right') ? 'checked="true"' : '' ;?> type="radio" value="center-right" class="styled" />
|
102 |
+
|
103 |
+
|
104 |
+
|
105 |
+
<span class="sfsi_flicnsoptn3 sfsioptncr">Center right</span>
|
106 |
+
|
107 |
+
<label><img src="<?php echo SFSI_PLUGURL;?>images/center_right.png" alt='error'/></label>
|
108 |
+
|
109 |
+
</li>
|
110 |
+
|
111 |
+
|
112 |
+
|
113 |
+
</div>
|
114 |
+
|
115 |
+
<div class="sfsi_position_divider">
|
116 |
+
|
117 |
+
<li>
|
118 |
+
|
119 |
+
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='bottom-left') ? 'checked="true"' : '' ;?> type="radio" value="bottom-left" class="styled" />
|
120 |
+
|
121 |
+
<span class="sfsi_flicnsoptn3 sfsioptnbl">Bottom left</span>
|
122 |
+
|
123 |
+
<label><img src="<?php echo SFSI_PLUGURL;?>images/bottom_left.png" alt='error'alt='error'/></label>
|
124 |
+
|
125 |
+
</li>
|
126 |
+
|
127 |
+
|
128 |
+
|
129 |
+
<li>
|
130 |
+
|
131 |
+
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='center-bottom') ? 'checked="true"' : '' ;?> type="radio" value="center-bottom" class="styled" />
|
132 |
+
|
133 |
+
|
134 |
+
|
135 |
+
<span class="sfsi_flicnsoptn3 sfsioptncr">Center bottom</span>
|
136 |
+
|
137 |
+
<label class="sfsi_float_position_icon_label sfsi_center_botttom"><img class="sfsi_img_center_bottom" src="<?php echo SFSI_PLUGURL;?>images/float_position_icon.png" alt='error'/></label>
|
138 |
+
|
139 |
+
</li>
|
140 |
+
|
141 |
+
<li>
|
142 |
+
|
143 |
+
<input name="sfsi_icons_floatPosition" <?php echo ( $option9['sfsi_icons_floatPosition']=='bottom-right') ? 'checked="true"' : '' ;?> type="radio" value="bottom-right" class="styled" />
|
144 |
+
|
145 |
+
|
146 |
+
|
147 |
+
<span class="sfsi_flicnsoptn3 sfsioptnbr">Bottom right</span>
|
148 |
+
|
149 |
+
<label><img src="<?php echo SFSI_PLUGURL;?>images/bottom_right.png" alt='error'/></label>
|
150 |
+
|
151 |
+
</li>
|
152 |
+
|
153 |
+
</div>
|
154 |
+
|
155 |
+
</ul>
|
156 |
+
|
157 |
+
|
158 |
+
|
159 |
+
<div style="width: 88%; float: left; margin:25px 0 0 25px">
|
160 |
+
|
161 |
+
|
162 |
+
|
163 |
+
<h4>Margin From: </h4>
|
164 |
+
|
165 |
+
<ul class="sfsi_floaticon_margin_sec">
|
166 |
+
|
167 |
+
|
168 |
+
|
169 |
+
<li>
|
170 |
+
|
171 |
+
<label>Top:</label>
|
172 |
+
|
173 |
+
<input name="sfsi_icons_floatMargin_top" type="text" value="<?php echo ($option9['sfsi_icons_floatMargin_top']!='') ? $option9['sfsi_icons_floatMargin_top'] : '' ;?>" />
|
174 |
+
|
175 |
+
<ins>Pixels</ins>
|
176 |
+
|
177 |
+
</li>
|
178 |
+
|
179 |
+
|
180 |
+
|
181 |
+
<li>
|
182 |
+
|
183 |
+
<label>Bottom:</label>
|
184 |
+
|
185 |
+
<input name="sfsi_icons_floatMargin_bottom" type="text" value="<?php echo ($option9['sfsi_icons_floatMargin_bottom'] != '') ? $option9['sfsi_icons_floatMargin_bottom'] : '' ;?>" />
|
186 |
+
|
187 |
+
<ins>Pixels</ins>
|
188 |
+
|
189 |
+
</li>
|
190 |
+
|
191 |
+
|
192 |
+
|
193 |
+
<li>
|
194 |
+
|
195 |
+
<label>Left:</label>
|
196 |
+
|
197 |
+
<input name="sfsi_icons_floatMargin_left" type="text" value="<?php echo ($option9['sfsi_icons_floatMargin_left']!='') ? $option9['sfsi_icons_floatMargin_left'] : '' ;?>" />
|
198 |
+
|
199 |
+
<ins>Pixels</ins>
|
200 |
+
|
201 |
+
</li>
|
202 |
+
|
203 |
+
|
204 |
+
|
205 |
+
<li>
|
206 |
+
|
207 |
+
<label>Right:</label>
|
208 |
+
|
209 |
+
<input name="sfsi_icons_floatMargin_right" type="text" value="<?php echo ($option9['sfsi_icons_floatMargin_right']!='') ? $option9['sfsi_icons_floatMargin_right'] : '' ;?>" />
|
210 |
+
|
211 |
+
<ins>Pixels</ins>
|
212 |
+
|
213 |
+
</li>
|
214 |
+
|
215 |
+
</ul>
|
216 |
+
|
217 |
+
</div>
|
218 |
+
|
219 |
+
|
220 |
+
|
221 |
+
<div style="width: 88%; float: left; margin:25px 0 0 7px">
|
222 |
+
|
223 |
+
<p style="line-height: 34px;">
|
224 |
+
|
225 |
+
The icons will be floating on your page. If you want them <b>"sticky"</b>, please check out the <a target="_blank" href="https://www.ultimatelysocial.com/usm-premium/"><b>Premium Plugin</b></a>. Also in the Premium Plugin you can show the icons <b>vertically</b>, and give them <b>different settings for mobile.</b>
|
226 |
+
|
227 |
+
</p>
|
228 |
+
|
229 |
+
</div>
|
230 |
+
|
231 |
+
<div class="sfsi_disable_floatingicons_mobile">
|
232 |
+
|
233 |
+
|
234 |
+
|
235 |
+
<h4>Want to disable the floating icons on mobile?</h4>
|
236 |
+
|
237 |
+
<ul class="sfsi_make_icons sfsi_plus_mobile_float">
|
238 |
+
|
239 |
+
<li>
|
240 |
+
|
241 |
+
<input name="sfsi_disable_floaticons" <?php echo ( $option9['sfsi_disable_floaticons']=='yes') ? 'checked="true"' : '' ;?> type="radio" value="yes" class="styled" />
|
242 |
+
|
243 |
+
<span class="sfsi_flicnsoptn3">Yes</span>
|
244 |
+
|
245 |
+
</li>
|
246 |
+
|
247 |
+
<li>
|
248 |
+
|
249 |
+
<input name="sfsi_disable_floaticons" <?php echo ( $option9['sfsi_disable_floaticons']=='no') ? 'checked="true"' : '' ;?> type="radio" value="no" class="styled"/>
|
250 |
+
|
251 |
+
<span class="sfsi_flicnsoptn3">No</span>
|
252 |
+
|
253 |
+
</li>
|
254 |
+
|
255 |
+
</ul>
|
256 |
+
|
257 |
+
</div>
|
258 |
+
|
259 |
+
</div>
|
260 |
+
|
261 |
+
</div>
|
262 |
+
|
263 |
</li>
|