Version Description
- NEW Add FAQ schema to Toggle / Accordion widgets with Elementor (PRO)
- NEW Dropdown for meta title / meta description to quickly add dynamic variables!
- NEW UI for adding/editing/managing target keywords
- NEW Paginated XML sitemaps for taxonomies and videos
- NEW Import term metadata from CSV file using our import tool (PRO)
- NEW Custom user capabilities for Redirections post type (edit_redirection, edit_redirections, edit_others_redirections, publish_redirections, read_redirection, read_private_redirections, delete_redirection, delete_others_redirections)
- NEW Remove noindex item from Admin Bar in backend and frontend option from SEO, Advanced page, Appearance tab
- NEW Change expiration date of the user consent cookie option from SEO, Analytics page, Cookie bar / GDPR tab
- NEW Add servesCuisine for LocalBusiness automatic schema
- NEW Delete all redirects / 404 in one click (SEO, Tools, Redirections)
- NEW Add a backdrop for user consent message (SEO, Analytics, Cookie bar / GDPR tab)
- NEW 'seopress_adminbar_noindex' hook to filter the noindex alert from WP admin bar (https://www.seopress.org/support/hooks/filter-noindex-alert-html-from-admin-bar/)
- NEW 'seopress_cookies_expiration_days' hook to filter the expiration date of the user consent cookie (https://www.seopress.org/support/hooks/filter-the-expiration-date-of-the-user-consent-cookie/)
- NEW 'seopress_sitemaps_max_terms_per_sitemap' hook to filter max terms per paginated sitemap (https://www.seopress.org/support/hooks/filter-max-terms-per-paginated-sitemap/)
- NEW 'seopress_sitemaps_max_videos_per_sitemap' hook to filter max videos per paginated sitemap (https://www.seopress.org/support/hooks/filter-max-videos-per-paginated-sitemap/)
- NEW 'seopress_sitemaps_index_video_query' hook to filter video index sitemap query (https://www.seopress.org/support/hooks/filter-video-index-sitemap-query/)
- NEW 'seopress_sitemaps_index_post_types_query' hook to filter post types query in XML sitemap (https://www.seopress.org/support/hooks/filter-custom-post-type-index-xml-sitemap-query/)
- NEW 'seopress_metadata_query_terms_args' hook to filter term query from export metadata tool (https://www.seopress.org/support/hooks/filter-the-arguments-of-the-metadata-terms-export-query/)
- INFO Improve Local Business compatibility with Elementor, Beaver builder...
- INFO Add a link to Advanced global meta robots page on noindex alert from admin bar
- INFO Improve White Label
- INFO Improve UI for automatic schemas
- INFO Remove SEOPress logo from 404 email alert
- INFO Improve notice in admin bar about global noindex / nofollow and add support for Taxonomies
- INFO Add a link to the publisher logo notice
- INFO Improved detection of social media metadata in source code for content analysis
- INFO Add Alpha option to color-picker on backgrounds for Cookie bar (SEO, Analytics, Cookie bar / GDPR tab)
- INFO Improved Performances for XML sitemaps
- INFO Refactoring hundreds lines of code
- FIX Trailing slash for rel/prev meta tag
- FIX Trailing slash for XML sitemaps
- FIX Published/modified date in automatic schemas for non-english date format
- FIX Closing notification "Your site is not visible to Search Engines!"
- FIX Conflict with Elementor
- FIX Remove AM/PM from Local Business Widget
- FIX FAQ questions counter from schema metabox
- FIX Price range LocalBusiness property with custom fields for automatic schema
- FIX Remove BuddyPress groups from Titles and settings if BuddyBoss or BuddyPress is not activated
- FIX WooCommerce XML sitemaps product attributes
- FIX Quotes with target keywords
Download this release
Release Info
Developer | rainbowgeek |
Plugin | SEOPress |
Version | 4.1 |
Comparing to | |
See all releases |
Code changes from version 4.0.3 to 4.1
- assets/css/seopress-admin-bar.css +4 -1
- assets/css/seopress-admin-bar.min.css +1 -1
- assets/css/seopress.css +125 -12
- assets/css/seopress.min.css +1 -1
- assets/css/tagify.min.css +1 -1
- assets/js/seopress-block-editor.min.js +1 -1
- assets/js/seopress-cookies-ajax.js +4 -2
- assets/js/seopress-cookies-ajax.min.js +1 -1
- assets/js/seopress-counters.js +7 -0
- assets/js/seopress-counters.min.js +1 -1
- assets/js/seopress-dashboard.js +2 -1
- assets/js/seopress-dashboard.min.js +1 -1
- assets/js/seopress-migrate.js +4 -2
- assets/js/seopress-migrate.min.js +1 -1
- assets/js/seopress-tabs2.js +49 -1
- assets/js/seopress-tabs2.min.js +1 -1
- assets/js/seopress-tabs7.min.js +1 -1
- assets/js/tagify.min.js +3 -2
- assets/js/wp-color-picker-alpha.min.js +11 -0
- contributors.txt +1 -0
- inc/admin/admin-dyn-variables-helper.php +67 -0
- inc/admin/admin-metaboxes-content-analysis-form.php +5 -4
- inc/admin/admin-metaboxes-form.php +9 -4
- inc/admin/admin-metaboxes-get-content-analysis.php +38 -8
- inc/admin/admin-metaboxes.php +506 -500
- inc/admin/admin-notifications-center.php +30 -18
- inc/admin/admin-term-metaboxes.php +1 -0
- inc/admin/admin.php +282 -77
- inc/admin/adminbar.php +36 -10
- inc/admin/ajax.php +281 -106
- inc/admin/page-builders/elementor/assets/css/text-letter-counter.css +3 -1
- inc/admin/page-builders/elementor/assets/js/google-suggestions.js +6 -4
- inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php +1 -1
- inc/functions/options-google-analytics.php +98 -9
- inc/functions/options-import-export.php +58 -29
- inc/functions/options-titles-metas.php +3 -0
- inc/functions/options.php +20 -0
- inc/functions/sitemap/template-xml-sitemaps-single-term.php +44 -36
- inc/functions/sitemap/template-xml-sitemaps.php +182 -42
- languages/wp-seopress.pot +1503 -1251
- readme.txt +60 -8
- seopress.php +15 -3
assets/css/seopress-admin-bar.css
CHANGED
@@ -32,6 +32,9 @@
|
|
32 |
float: right;
|
33 |
margin-left: 6px;
|
34 |
}
|
|
|
|
|
|
|
35 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex .ab-icon::before {
|
36 |
color: #eee;
|
37 |
vertical-align: middle;
|
@@ -71,5 +74,5 @@
|
|
71 |
}
|
72 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .off::before,
|
73 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .off::before {
|
74 |
-
color: #
|
75 |
}
|
32 |
float: right;
|
33 |
margin-left: 6px;
|
34 |
}
|
35 |
+
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level > a {
|
36 |
+
display: inline-block;
|
37 |
+
}
|
38 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex .ab-icon::before {
|
39 |
color: #eee;
|
40 |
vertical-align: middle;
|
74 |
}
|
75 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .off::before,
|
76 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .off::before {
|
77 |
+
color: #46b450;
|
78 |
}
|
assets/css/seopress-admin-bar.min.css
CHANGED
@@ -1 +1 @@
|
|
1 |
-
#adminmenu div.wp-menu-image.dashicons-admin-seopress::before,#seopress-header #seopress-admin h1::before{content:"\e800";font-family:seopress}#seopress-header #seopress-admin h1::before,.seopress-page-list .seopress-feature h3,.seopress-styles .seopress-option h1{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased}@font-face{font-family:seopress;src:url(../fonts/seopress.eot?8v0bs0);src:url(../fonts/seopress.eot?8v0bs0#iefix) format('embedded-opentype'),url(../fonts/seopress.ttf?8v0bs0) format('truetype'),url(../fonts/seopress.woff?8v0bs0) format('woff'),url(../fonts/seopress.svg?8v0bs0#seopress) format('svg');font-weight:400;font-style:normal}[class*=" icon-seopress"],[class^=icon-seopress-]{font-family:seopress!important}.icon-seopress-seopress:before{content:"\e800";font:normal 14px/1 seopress;line-height:1.5rem}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex{background:red;color:#fff;padding:0 8px;float:right;margin-left:6px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex .ab-icon::before{color:#eee;vertical-align:middle}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots{display:block;background:#23292d}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots a{height:inherit;padding-bottom:5px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-seo{font-weight:700;border-bottom:1px solid currentColor;width:100%;display:block;margin-bottom:5px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex{display:block}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .ab-icon,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .ab-icon{float:none;vertical-align:middle}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .on::before,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .on::before{color:red}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .off::before,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .off::before{color:#
|
1 |
+
#adminmenu div.wp-menu-image.dashicons-admin-seopress::before,#seopress-header #seopress-admin h1::before{content:"\e800";font-family:seopress}#seopress-header #seopress-admin h1::before,.seopress-page-list .seopress-feature h3,.seopress-styles .seopress-option h1{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased}@font-face{font-family:seopress;src:url(../fonts/seopress.eot?8v0bs0);src:url(../fonts/seopress.eot?8v0bs0#iefix) format('embedded-opentype'),url(../fonts/seopress.ttf?8v0bs0) format('truetype'),url(../fonts/seopress.woff?8v0bs0) format('woff'),url(../fonts/seopress.svg?8v0bs0#seopress) format('svg');font-weight:400;font-style:normal}[class*=" icon-seopress"],[class^=icon-seopress-]{font-family:seopress!important}.icon-seopress-seopress:before{content:"\e800";font:normal 14px/1 seopress;line-height:1.5rem}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex{background:red;color:#fff;padding:0 8px;float:right;margin-left:6px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level>a{display:inline-block}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex .ab-icon::before{color:#eee;vertical-align:middle}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots{display:block;background:#23292d}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots a{height:inherit;padding-bottom:5px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-seo{font-weight:700;border-bottom:1px solid currentColor;width:100%;display:block;margin-bottom:5px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex{display:block}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .ab-icon,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .ab-icon{float:none;vertical-align:middle}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .on::before,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .on::before{color:red}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .off::before,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .off::before{color:#46b450}
|
assets/css/seopress.css
CHANGED
@@ -45,6 +45,9 @@
|
|
45 |
float: right;
|
46 |
margin-left: 6px;
|
47 |
}
|
|
|
|
|
|
|
48 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex .ab-icon::before {
|
49 |
color: #eee;
|
50 |
vertical-align: middle;
|
@@ -85,7 +88,7 @@
|
|
85 |
}
|
86 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .off::before,
|
87 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .off::before {
|
88 |
-
color: #
|
89 |
}
|
90 |
|
91 |
.sp-tooltip {
|
@@ -343,6 +346,13 @@
|
|
343 |
right: -10px;
|
344 |
}
|
345 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
346 |
#seopress_content_analysis .gr-analysis-title button {
|
347 |
background: #fff;
|
348 |
border: 0;
|
@@ -1893,11 +1903,16 @@ body.seopress-styles {
|
|
1893 |
min-width: inherit;
|
1894 |
}
|
1895 |
|
|
|
|
|
|
|
|
|
1896 |
.seopress-option .wp-picker-container .wp-picker-clear {
|
1897 |
box-shadow: none;
|
1898 |
text-transform: none;
|
1899 |
border-radius: 0;
|
1900 |
background: none;
|
|
|
1901 |
}
|
1902 |
|
1903 |
.seopress-option .wp-picker-container .wp-picker-clear:hover {
|
@@ -2168,7 +2183,11 @@ body.seopress-styles {
|
|
2168 |
margin: 0 0 1em 0;
|
2169 |
}
|
2170 |
|
2171 |
-
#seopress_cpt .tag-title
|
|
|
|
|
|
|
|
|
2172 |
cursor: pointer;
|
2173 |
font-weight: 500;
|
2174 |
border-radius: 4px;
|
@@ -2220,7 +2239,107 @@ body.seopress-styles {
|
|
2220 |
margin-bottom: 10px;
|
2221 |
}
|
2222 |
|
2223 |
-
#seopress_cpt .tag-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2224 |
padding: 4px 8px;
|
2225 |
position: relative;
|
2226 |
top: 5px;
|
@@ -2237,20 +2356,14 @@ body.seopress-styles {
|
|
2237 |
|
2238 |
#seopress_pro_cpt .tag-title:active,#seopress_pro_cpt .tag-title:focus,#seopress_pro_cpt .tag-title:hover,
|
2239 |
#seopress_cpt .tag-title:active,#seopress_cpt .tag-title:focus,#seopress_cpt .tag-title:hover,
|
2240 |
-
.seopress-
|
|
|
2241 |
background: #232323;
|
2242 |
color: #fff;
|
2243 |
user-select: none;
|
2244 |
}
|
2245 |
|
2246 |
-
|
2247 |
-
padding: 0;
|
2248 |
-
height: 16px;
|
2249 |
-
width: 16px;
|
2250 |
-
font-size: 16px;
|
2251 |
-
margin-right: 5px;
|
2252 |
-
vertical-align: middle;
|
2253 |
-
}
|
2254 |
|
2255 |
.seopress-button {
|
2256 |
text-transform: uppercase;
|
45 |
float: right;
|
46 |
margin-left: 6px;
|
47 |
}
|
48 |
+
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level > a {
|
49 |
+
display: inline-block;
|
50 |
+
}
|
51 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex .ab-icon::before {
|
52 |
color: #eee;
|
53 |
vertical-align: middle;
|
88 |
}
|
89 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .off::before,
|
90 |
#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .off::before {
|
91 |
+
color: #46b450;
|
92 |
}
|
93 |
|
94 |
.sp-tooltip {
|
346 |
right: -10px;
|
347 |
}
|
348 |
|
349 |
+
#seopress_cpt .description,
|
350 |
+
#seopress_content_analysis .description,
|
351 |
+
.seopress-tab .description {
|
352 |
+
display: block;
|
353 |
+
font-style: italic;
|
354 |
+
}
|
355 |
+
|
356 |
#seopress_content_analysis .gr-analysis-title button {
|
357 |
background: #fff;
|
358 |
border: 0;
|
1903 |
min-width: inherit;
|
1904 |
}
|
1905 |
|
1906 |
+
.seopress-option .wp-picker-container .wp-picker-default {
|
1907 |
+
margin:0;
|
1908 |
+
}
|
1909 |
+
|
1910 |
.seopress-option .wp-picker-container .wp-picker-clear {
|
1911 |
box-shadow: none;
|
1912 |
text-transform: none;
|
1913 |
border-radius: 0;
|
1914 |
background: none;
|
1915 |
+
margin: 0;
|
1916 |
}
|
1917 |
|
1918 |
.seopress-option .wp-picker-container .wp-picker-clear:hover {
|
2183 |
margin: 0 0 1em 0;
|
2184 |
}
|
2185 |
|
2186 |
+
#seopress_cpt .tag-title,
|
2187 |
+
.seopress-button,
|
2188 |
+
.seopress-option .tag-title,
|
2189 |
+
#seopress_pro_cpt .tag-title,
|
2190 |
+
#seopress_cpt .seopress-tag-dropdown {
|
2191 |
cursor: pointer;
|
2192 |
font-weight: 500;
|
2193 |
border-radius: 4px;
|
2239 |
margin-bottom: 10px;
|
2240 |
}
|
2241 |
|
2242 |
+
#seopress_cpt .sp-wrap-tag-variables-list, #seopress_pro_cpt .sp-wrap-tag-variables-list {
|
2243 |
+
position: relative;
|
2244 |
+
float: left;
|
2245 |
+
display: none;
|
2246 |
+
}
|
2247 |
+
|
2248 |
+
#seopress_cpt .sp-tag-variables-list, #seopress_pro_cpt .sp-tag-variables-list {
|
2249 |
+
background: #fff;
|
2250 |
+
position: absolute;
|
2251 |
+
left: -42px;
|
2252 |
+
width: 300px;
|
2253 |
+
border-radius: 4px;
|
2254 |
+
z-index: 100;
|
2255 |
+
top: 20px;
|
2256 |
+
color: #6b7c93;
|
2257 |
+
box-shadow: 0 0 0 0.5px rgba(50,50,93,.17), 0 2px 5px 0 rgba(50,50,93,.12), 0 3px 9px 0 rgba(50,50,93,.08), 0 1px 1.5px 0 rgba(0,0,0,.08), 0 1px 2px 0 rgba(0,0,0,.08);
|
2258 |
+
height: 300px;
|
2259 |
+
z-index: 100;
|
2260 |
+
overflow: auto;
|
2261 |
+
}
|
2262 |
+
|
2263 |
+
#seopress_cpt #seopress_titles_title_meta {
|
2264 |
+
margin-bottom: 0.2rem;
|
2265 |
+
}
|
2266 |
+
|
2267 |
+
#seopress_cpt .sp-wrap-tag-variables-list.open, #seopress_pro_cpt .sp-wrap-tag-variables-list.open {
|
2268 |
+
display: block;
|
2269 |
+
}
|
2270 |
+
|
2271 |
+
#seopress_cpt .seopress-tag-single-all.tag-title .dashicons,
|
2272 |
+
#seopress_cpt .seopress-tag-single-all.seopress-tag-dropdown .dashicons,
|
2273 |
+
#seopress_pro_cpt .seopress-tag-single-all.tag-title .dashicons {
|
2274 |
+
margin: 0;
|
2275 |
+
transition: all 150ms linear;
|
2276 |
+
}
|
2277 |
+
|
2278 |
+
#seopress_cpt .seopress-tag-single-all.open .dashicons, #seopress_pro_cpt .seopress-tag-single-all.open .dashicons {
|
2279 |
+
transform: rotateX(180deg);
|
2280 |
+
}
|
2281 |
+
|
2282 |
+
#seopress_cpt .sp-tag-variables-list li, #seopress_pro_cpt .sp-tag-variables-list li {
|
2283 |
+
padding: 8px 12px;
|
2284 |
+
cursor: pointer;
|
2285 |
+
margin: 0;
|
2286 |
+
border-bottom: 1px solid #f0f0f0;
|
2287 |
+
}
|
2288 |
+
|
2289 |
+
#seopress_cpt .sp-tag-variables-list li span, #seopress_pro_cpt .sp-tag-variables-list li span {
|
2290 |
+
display: block;
|
2291 |
+
font-weight: bold;
|
2292 |
+
font-size: 12px;
|
2293 |
+
margin-bottom: 2px;
|
2294 |
+
}
|
2295 |
+
|
2296 |
+
#seopress_cpt .sp-tag-variables-list li:hover, #seopress_pro_cpt .sp-tag-variables-list li:hover {
|
2297 |
+
background: #0385ba;
|
2298 |
+
color: #fff;
|
2299 |
+
}
|
2300 |
+
|
2301 |
+
#seopress_cpt .sp-tag-variables-list li::after, #seopress_pro_cpt .sp-tag-variables-list li::after {
|
2302 |
+
content: attr(data-value);
|
2303 |
+
display: inline-block;
|
2304 |
+
background: #e9ecef;
|
2305 |
+
padding: 1px 5px;
|
2306 |
+
color: #333;
|
2307 |
+
font-family: Menlo, Monaco, Andale Mono, Courier New, monospace;
|
2308 |
+
border-radius: 3px;
|
2309 |
+
font-size: 11px;
|
2310 |
+
}
|
2311 |
+
|
2312 |
+
#seopress_cpt .tag-title .dashicons,
|
2313 |
+
.seopress-option .tag-title .dashicons,
|
2314 |
+
#seopress_pro_cpt .tag-title .dashicons,
|
2315 |
+
#seopress_cpt .seopress-tag-dropdown .dashicons {
|
2316 |
+
padding: 0;
|
2317 |
+
height: 16px;
|
2318 |
+
width: 16px;
|
2319 |
+
font-size: 16px;
|
2320 |
+
margin-right: 5px;
|
2321 |
+
vertical-align: middle;
|
2322 |
+
}
|
2323 |
+
|
2324 |
+
.seopress-overlay-tag-dropdown {
|
2325 |
+
position: absolute;
|
2326 |
+
display: none;
|
2327 |
+
|
2328 |
+
top: 0;
|
2329 |
+
left: 0;
|
2330 |
+
width: 100%;
|
2331 |
+
height: 100%;
|
2332 |
+
z-index: 50;
|
2333 |
+
}
|
2334 |
+
|
2335 |
+
.seopress-overlay-tag-dropdown.active{
|
2336 |
+
display: block;
|
2337 |
+
}
|
2338 |
+
|
2339 |
+
#seopress_cpt .tag-title,
|
2340 |
+
.seopress-option .tag-title,
|
2341 |
+
#seopress_pro_cpt .tag-title,
|
2342 |
+
#seopress_cpt .seopress-tag-dropdown {
|
2343 |
padding: 4px 8px;
|
2344 |
position: relative;
|
2345 |
top: 5px;
|
2356 |
|
2357 |
#seopress_pro_cpt .tag-title:active,#seopress_pro_cpt .tag-title:focus,#seopress_pro_cpt .tag-title:hover,
|
2358 |
#seopress_cpt .tag-title:active,#seopress_cpt .tag-title:focus,#seopress_cpt .tag-title:hover,
|
2359 |
+
.seopress-tag-dropdown:active, .seopress-tag-dropdown:focus, .seopress-tag-dropdown:hover,
|
2360 |
+
#seopress_cpt .seopress-tag-dropdown .tag-title:active,#seopress_cpt-option .seopress-tag-dropdown .tag-title:focus,#seopress_cpt-option .seopress-tag-dropdown .tag-title:hover {
|
2361 |
background: #232323;
|
2362 |
color: #fff;
|
2363 |
user-select: none;
|
2364 |
}
|
2365 |
|
2366 |
+
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2367 |
|
2368 |
.seopress-button {
|
2369 |
text-transform: uppercase;
|
assets/css/seopress.min.css
CHANGED
@@ -1 +1 @@
|
|
1 |
-
#adminmenu div.wp-menu-image.dashicons-admin-seopress::before,#seopress-header #seopress-admin h1::before{content:"\e800";font-family:seopress!important;font-weight:700;font-size:12px;line-height:20px}#seopress-header #seopress-admin h1::before,.seopress-page-list .seopress-feature h3,.seopress-styles .seopress-option h1{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased}@font-face{font-family:seopress;src:url(../fonts/seopress.eot?81521271);src:url(../fonts/seopress.eot?81521271#iefix) format('embedded-opentype'),url(../fonts/seopress.woff?81521271) format('woff2'),url(../fonts/seopress.woff?81521271) format('woff'),url(../fonts/seopress.ttf?81521271) format('truetype'),url(../fonts/seopress.svg?81521271#seopress) format('svg');font-weight:400;font-style:normal}[class*=" icon-seopress"],[class^=icon-seopress-]{font-family:seopress!important;font-size:14px!important;line-height:24px!important}#tab_seopress_titles_archives .form-table th:empty,#tab_seopress_titles_single .form-table th:empty,#tab_seopress_titles_tax .form-table th:empty{display:none}.icon-seopress-seopress:before{content:"\e800"}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex{background:red;color:#fff;padding:0 8px;float:right;margin-left:6px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex .ab-icon::before{color:#eee;vertical-align:middle}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots{display:block;background:#23292d}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots a{height:inherit;padding-bottom:5px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-seo{font-weight:700;border-bottom:1px solid currentColor;width:100%;display:block;margin-bottom:5px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex{display:block}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .ab-icon,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .ab-icon{float:none;vertical-align:middle}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .on::before,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .on::before{color:red}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .off::before,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .off::before{color:#00b9eb}.sp-tooltip{position:relative;margin-left:5px;display:inline-block;cursor:help;vertical-align:bottom;text-align:left;background:0 0;border:none;padding:0}.sp-tooltip .dashicons{color:#666}.sp-tooltip .sp-tooltiptext{visibility:hidden;position:absolute;z-index:999999999;width:300px;right:-303px;padding:20px;top:25px;font-weight:400;box-shadow:0 3px 30px rgba(25,30,35,.1);border:1px solid #e2e4e7;background:#fff;word-break:break-word;text-transform:none}.sp-tooltip .sp-tooltiptext::before{border:8px solid #e2e4e7;top:-8px}.sp-tooltip .sp-tooltiptext::after{border:8px solid #fff;top:-6px}.sp-tooltip .sp-tooltiptext::after,.sp-tooltip .sp-tooltiptext::before{border-bottom-style:solid;border-left-color:transparent;border-right-color:transparent;border-top:none;margin-left:-10px;content:"";position:absolute;height:0;width:0;line-height:0;left:30px}.sp-tooltip:active .sp-tooltiptext,.sp-tooltip:focus .sp-tooltiptext,.sp-tooltip:hover .sp-tooltiptext{visibility:visible}.sp-tooltip .sp-tooltip-headings{font-size:18px;font-weight:600;margin-bottom:20px;display:block}.sp-tooltip .sp-tooltip-desc{margin-bottom:20px;display:block;border-bottom:1px solid #e2e4e7;padding-bottom:20px;font-size:13px}.sp-tooltip .sp-tooltip-code{font-family:Menlo,Monaco,Andale Mono,Courier New,monospace;display:block;word-break:break-all;color:#1a7a06;font-size:11px}.analysis-score .sp-tooltip{vertical-align:middle;font-size:.75em}#seopress_content_analysis a{color:#0073aa}#seopress_content_analysis .wrap-seopress-analysis{display:inline-block;width:100%}#seopress_content_analysis .col-left{width:calc(50% - 30px);float:left;margin-right:30px}#seopress_content_analysis .col-right{float:right;width:50%}#seopress_content_analysis #seopress_suggestions{display:inline-block;width:100%;margin:0;height:auto;padding:20px 0}#seopress_content_analysis #seopress_suggestions li{list-style:none;margin:5px;display:inline-block}#seopress_content_analysis .analysis-score{clear:both;border-top:1px solid #e2e4e7;display:flex;justify-content:space-between;align-items:center}.column-seopress_score .analysis-score{display:flex;align-content:center}#seopress_content_analysis .analysis-score p,.column-seopress_score .analysis-score p{font-weight:700;font-size:1.2em}#seopress_content_analysis .analysis-score svg,.column-seopress_score .analysis-score svg{display:inline-block;height:30px;width:30px;margin:0;border-radius:100%;position:relative;font-weight:600;shape-rendering:geometricprecision;font-size:.5rem;vertical-align:middle;margin-right:15px}.column-seopress_score .analysis-score p,.column-seopress_score .analysis-score svg{margin:0}@keyframes loadingPulse{0%{stroke:#adc5d2}50%{stroke:#00a0d2}100%{stroke:#adc5d2}}#seopress_content_analysis .analysis-score .loading #bar{stroke-dashoffset:0!important;stroke:#adc5d2!important;animation:loadingPulse 3s infinite ease-in-out}#seopress_content_analysis .analysis-score .good #bar,.column-seopress_score .analysis-score #bar.good{stroke:#46b450}#seopress_content_analysis .analysis-score .notgood #bar,.column-seopress_score .analysis-score #bar.notgood{stroke-dashoffset:565;stroke:#ffb900}#seopress_content_analysis .analysis-score svg circle,.column-seopress_score .analysis-score svg circle{stroke-dashoffset:0;transition:stroke-dashoffset 1s linear;stroke:#ccc;stroke-width:2em}#seopress_content_analysis .gr-analysis{clear:both}#seopress_content_analysis .gr-analysis-title{border-top:1px solid #e2e4e7;position:relative}#seopress_content_analysis .gr-analysis-title .impact,#seopress_cpt .impact{position:absolute;left:10px;top:calc(50% - 5px);width:10px;height:10px;border-radius:50px;padding:0;margin:0;border:1px solid #fff}#seopress_content_analysis .gr-analysis .impact.good{background:#46b450;box-shadow:0 0 5px #46b450}#seopress_content_analysis .gr-analysis .impact.low{background:#ffde24;box-shadow:0 0 5px #ffde24}#seopress_content_analysis .gr-analysis .impact.medium{background:#e39f48;box-shadow:0 0 5px #e39f48}#seopress_content_analysis .gr-analysis .impact.high,#seopress_cpt .impact.high{background:#e25950;box-shadow:0 0 5px #e25950}#seopress_content_analysis .gr-analysis-content .impact.high{background:#e25950;box-shadow:none;color:#fff;padding:2px 4px;margin-left:5px;border-radius:4px;font-weight:700}#seopress_cpt .impact.high{position:relative;top:calc(50% - 18px);display:inline-block;left:inherit;right:-10px}#seopress_content_analysis .gr-analysis-title button{background:#fff;border:0;cursor:pointer;display:block;margin:0;position:relative;text-align:left;width:100%;padding:15px 30px;align-items:center;transition:all .3s linear}#seopress_content_analysis .gr-analysis-title button:hover{background:#f3f4f5}#seopress_content_analysis .gr-analysis-title button:focus{color:#191e23;border:none;box-shadow:none;outline-offset:-2px;outline:1px dotted #555d66}#seopress_content_analysis .gr-analysis-title button .sp-arrow::after{content:"\f343";font-family:Dashicons;position:absolute;right:10px;top:calc(50% - 7px)}#seopress_content_analysis .gr-analysis-title button.open .sp-arrow::after{content:"\f347"}#seopress_content_analysis .gr-analysis-content{padding:0 1rem .5rem 1rem;display:none;width:100%;border-top:1px solid #e2e4e7;box-sizing:border-box}table.wp-list-table .manage_column.column-seopress_canonical,table.wp-list-table .manage_column.column-seopress_desc,table.wp-list-table .manage_column.column-seopress_insights,table.wp-list-table .manage_column.column-seopress_noindex,table.wp-list-table .manage_column.column-seopress_redirect_enable,table.wp-list-table .manage_column.column-seopress_redirect_url,table.wp-list-table .manage_column.column-seopress_title,table.wp-list-table .manage_column.column-seopress_tkw{width:7%!important}#seopress_content_analysis h3{margin:0;font-size:1em}#seopress_content_analysis h4{border-bottom:1px solid #e2e4e7;padding-bottom:.5rem;text-transform:uppercase;font-size:.85em;position:-webkit-sticky;position:sticky;top:0;background:#fff}#seopress_content_analysis .wrap-analysis-img ul{display:flex;flex-wrap:wrap}#seopress_content_analysis .wrap-analysis-img ul li{padding:0;text-align:left;cursor:default}#seopress_content_analysis .wrap-analysis-img h4{border-bottom:1px solid #ddd;padding-bottom:10px}#seopress_content_analysis .wrap-analysis-img ul li img{max-width:150px;max-height:150px;object-fit:cover;border:1px solid #f3f4f5;cursor:default;padding:1px}#seopress_cpt .notice{padding:10px 14px}#seopress-analysis-tabs .dashicons,#seopress_cpt .dashicons{vertical-align:middle}#seopress-analysis-tabs{clear:both}#seopress_cpt .inside{margin:0;padding:0}#seopress_cpt .ui-tabs .ui-tabs-nav{display:inline-block;min-height:26px;position:relative;width:100%;z-index:10;margin:0;border-radius:0;padding:0;background:#f3f4f5;border:none}#seopress_cpt .ui-helper-clearfix:after{content:none}.seopress_page_seopress-titles #seopress-tabs .form-table td,.seopress_page_seopress-titles #seopress_content_analysis .form-table td{padding:0}#seopress_cpt .ui-tabs .ui-tabs-panel{background:#fff;border-radius:0;display:inline-block;padding:1em 1.4em;width:100%;box-sizing:border-box}#seopress_content_analysis .dashicons-info,#seopress_cpt .ui-tabs .ui-tabs-panel .dashicons-info,#seopress_pro_cpt .dashicons-info{font-size:16px;vertical-align:middle;height:16px;width:16px}#seopress_cpt .ui-tabs .ui-tabs-nav li,#seopress_cpt .ui-tabs-anchor{cursor:pointer!important}#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-tabs-active{position:relative;z-index:60;cursor:pointer;border-radius:0;border-bottom:3px solid #0085ba}#seopress_content_analysis label,#seopress_cpt #tabs-1 label,#seopress_cpt #tabs-2 label[for=seopress_robots_breadcrumbs_meta],#seopress_cpt #tabs-2 label[for=seopress_robots_canonical_meta],#seopress_cpt #tabs-2 label[for=seopress_robots_primary_cat_meta],#seopress_cpt #tabs-3 label,#seopress_cpt #tabs-4 label,#seopress_cpt #tabs-5 label,#seopress_cpt #tabs-6 label,#seopress_cpt .subsection-title{display:block;margin:20px 0 5px;font-weight:700}#seopress_cpt .wp-color-result{margin:0}#seopress_content_analysis input[type=text],#seopress_cpt #tabs-1 input,#seopress_cpt #tabs-2 input[type=text],#seopress_cpt #tabs-3 input[type=text],#seopress_cpt #tabs-3 textarea,#seopress_cpt #tabs-4 input[type=text],#seopress_cpt #tabs-5 input[type=text],#seopress_cpt #tabs-6 input[type=text],#seopress_cpt #tabs-6 textarea{width:100%;display:inline-block}#seopress_cpt #tabs-1 input{width:100%}#seopress_cpt #tabs-6 input[type=number]{width:30%;min-width:200px}#seopress_cpt #tabs-6 #wrap-videos .video:first-child .remove-video{display:none}#seopress_cpt select{width:300px}#seopress_cpt #tabs-4 select{width:250px;display:inline}#seopress_cpt #tabs-4 #seopress_redirections_value_meta{width:calc(100% - 258px);float:right}#seopress_cpt #tabs-6{padding:0}#seopress_cpt #tabs-6 #wrap-videos .video .accordion-section-content,#seopress_cpt #tabs-6>p{padding:0 1.4em}#seopress_cpt #tabs-6 #wrap-videos .video .accordion-section-content{padding:0 1.4em 1em}#seopress_cpt #tabs-6 #wrap-videos .video{border-top:1px solid #eee}#seopress_cpt #tabs-6 #wrap-videos .video .accordion-section-title{border-left:none;border-right:none;font-size:1em;padding:1em 1.4em}#seopress_cpt #tabs-6 #wrap-videos .video:last-child .accordion-section-content,#seopress_cpt #tabs-6 #wrap-videos .video:last-child .accordion-section-title{border-bottom:1px solid #eee}#seopress_cpt #tabs-6 #wrap-videos .video .inside{padding:0}#seopress_cpt #tabs-4 #seopress_redirections_enabled,#seopress_cpt #tabs-5 #seopress_news_disabled,#seopress_cpt #tabs-5 #seopress_news_standout,#seopress_cpt #tabs-6 #seopress_video_disabled,#seopress_cpt #tabs-6 .family-friendly label,#seopress_cpt #tabs-6 .internal_video label{font-weight:400}#seopress_cpt #tabs-6 #wrap-videos .video:nth-child(odd){background:#fdfdfd}#seopress_content_analysis .advise,#seopress_cpt .advise,#seopress_pro_cpt .advise,.seopress-option .advise{margin:5px;display:block;color:red;font-style:italic}#seopress_cpt #tabs-6 #wrap-videos .video .advise{color:#555}#seopress_content_analysis .mandatory,#seopress_cpt .mandatory{color:#c00}#seopress_cpt .box-left{float:left;width:49%;margin-right:1%}#seopress_cpt .box-right{float:left;width:49%;margin-left:1%}#seopress_cpt #tabs-3 .box-left{width:44%}#seopress_cpt #tabs-3 .box-right{width:54%}@media only screen and (max-width:1200px){#seopress_cpt .box-left,#seopress_cpt .box-right{float:none;width:100%;margin:0}}@media only screen and (max-width:1500px){#seopress_cpt #tabs-3 .box-left,#seopress_cpt #tabs-3 .box-right{float:none;width:100%;margin:0}}#edittag #seopress_cpt #tabs-3 .box-left,#edittag #seopress_cpt #tabs-3 .box-right{float:none;width:100%;margin:0}#seopress-tabs .seopress_media_upload,#seopress_pro_cpt .seopress_media_upload{margin-top:.5rem}#seopress_cpt .google-snippet-preview{font-family:arial,sans-serif;word-break:break-all}#seopress_cpt .google-snippet-preview.mobile-preview .wrap-snippet{margin:0 0 10px 0;box-shadow:0 1px 6px rgba(32,33,36,.28);border-radius:8px;padding:12px 16px}#seopress_cpt .google-snippet-preview>p{word-break:normal}#seopress_cpt .google-snippet-preview .snippet-title,#seopress_cpt .google-snippet-preview .snippet-title-custom,#seopress_cpt .google-snippet-preview .snippet-title-default{color:#1a0dab;font-size:18px;font-weight:400;line-height:21.6px}#seopress_cpt .google-snippet-preview.mobile-preview .snippet-title,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-title-custom,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-title-default{font-size:16px;line-height:20px;margin-bottom:12px}#seopress_cpt .google-snippet-preview .snippet-permalink{color:#006621;font-size:14px;font-style:normal;font-weight:400;line-height:16px;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}#seopress_cpt .google-snippet-preview .wrap-snippet .wrap-m-icon-permalink,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-permalink{display:none}#seopress_cpt .google-snippet-preview.mobile-preview .wrap-m-icon-permalink{overflow:hidden;text-overflow:ellipsis;white-space:nowrap;margin-bottom:12px;display:flex}#seopress_cpt .google-snippet-preview.mobile-preview .wrap-m-icon-permalink .snippet-permalink{display:block;color:#3c4043;font-size:12px}#seopress_cpt .google-snippet-preview.mobile-preview .snippet-favicon{margin-right:12px;vertical-align:middle}#seopress_cpt .google-snippet-preview.mobile-preview .snippet-favicon img{width:16px;height:16px;max-width:inherit}#seopress_cpt .google-snippet-preview.mobile-preview .wrap-snippet .snippet-permalink:first-child{color:#3c4043;white-space:nowrap;font-size:12px;display:block}#seopress_cpt .google-snippet-preview .snippet-description,#seopress_cpt .google-snippet-preview .snippet-description-custom,#seopress_cpt .google-snippet-preview .snippet-description-default{color:#545454;font-size:14px;font-weight:400;line-height:18.2px;display:inline}#seopress_cpt .google-snippet-preview.mobile-preview .snippet-description,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-description-custom,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-description-default{color:#3c4043;font-size:14px;line-height:20px}#seopress_cpt .google-snippet-preview .snippet-date{color:grey;display:inline}#seopress_cpt .facebook-snippet-box{color:#4b4f56;font-size:14px;width:524px}#seopress_cpt .facebook-snippet-box .notice,#seopress_cpt .twitter-snippet-box .notice{padding:10px 14px;margin:0 0 10px 0;box-sizing:border-box;width:100%}#seopress_cpt .facebook-snippet-box .notice span,#seopress_cpt .twitter-snippet-box .notice span{font-weight:700}#seopress_cpt .snippet-meta{display:flex;overflow:hidden;max-height:12px}#seopress_cpt .fb-by,#seopress_cpt .snippet-fb-site-name,#seopress_cpt .snippet-fb-url{color:#606770;font-size:12px;white-space:normal;line-height:11px;text-transform:uppercase;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis}#seopress_cpt .fb-sep{padding-left:5px;padding-right:5px;color:#606770;line-height:11px;font-size:12px}#seopress_cpt .facebook-snippet-box .facebook-snippet-text{border:1px solid #dadde1;background-color:#f2f3f5;padding:10px 12px}#seopress_cpt .facebook-snippet-box .title-desc{max-height:46px;overflow:hidden}#seopress_cpt .facebook-snippet-box .snippet-fb-title,#seopress_cpt .facebook-snippet-box .snippet-fb-title-custom,#seopress_cpt .facebook-snippet-box .snippet-fb-title-default{font-size:16px;line-height:20px;margin:3px 0 0;padding-top:2px;color:#1d2129;font-weight:700;overflow:hidden;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis;white-space:normal;word-break:break-word;max-height:22px}#seopress_cpt .facebook-snippet-box .snippet-fb-description,#seopress_cpt .facebook-snippet-box .snippet-fb-description-custom,#seopress_cpt .facebook-snippet-box .snippet-fb-description-default{color:#606770;font-size:14px;line-height:20px;word-break:break-word;font-family:Helvetica,Arial,sans-serif;max-height:80px;overflow:hidden;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis;white-space:normal;width:100%}#seopress_cpt .facebook-snippet-box img{display:block;height:274px;width:524px;object-fit:cover;background-color:#edeff0;text-align:center;border-bottom:none}#seopress_cpt .twitter-snippet-box{color:#4b4f56;font-size:14px;width:436px}#seopress_cpt .snippet-twitter-url{color:#8899a6;font-size:14px;white-space:normal;line-height:11px;text-transform:uppercase;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis}#seopress_cpt .twitter-snippet-box .twitter-snippet-text{border:1px solid #dadde1;background-color:#fff;padding:10px 12px;border-radius:0 0 10px 10px}#seopress_cpt .twitter-snippet-box .title-desc{max-height:46px;overflow:hidden}#seopress_cpt .twitter-snippet-box .snippet-twitter-img,#seopress_cpt .twitter-snippet-box .snippet-twitter-img-custom,#seopress_cpt .twitter-snippet-box .snippet-twitter-img-default{border-radius:10px 10px 0 0;overflow:hidden}#seopress_cpt .twitter-snippet-box .snippet-twitter-title,#seopress_cpt .twitter-snippet-box .snippet-twitter-title-custom,#seopress_cpt .twitter-snippet-box .snippet-twitter-title-default{font-size:1em;line-height:20px;margin-bottom:5px;max-height:1.3em;color:#000;font-weight:700;overflow:hidden;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis;white-space:normal;word-break:break-word}#seopress_cpt .twitter-snippet-box .snippet-twitter-description,#seopress_cpt .twitter-snippet-box .snippet-twitter-description-custom,#seopress_cpt .twitter-snippet-box .snippet-twitter-description-default{color:#000;font-size:14px;line-height:20px;word-break:break-word;font-family:Helvetica,Arial,sans-serif;max-height:80px;overflow:hidden;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis;white-space:normal;width:100%}#seopress_cpt .twitter-snippet-box img{display:block;height:200px;width:436px;object-fit:cover;background-color:#edeff0;text-align:center;border-bottom:none}#seopress_cpt .wrap-seopress-counters,#seopress_pro_cpt .wrap-seopress-counters,.seopress-setup .wrap-seopress-counters,.seopress-styles .wrap-seopress-counters{text-align:right;background:#e9ecef;padding:2px 5px;display:flex;font-size:12px;justify-content:flex-end;border-radius:0 0 .25rem .25rem}#seopress_cpt .sp-progress,#seopress_pro_cpt .sp-progress,.seopress-setup .sp-progress,.seopress-styles .sp-progress{display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem .25rem 0 0}#seopress_cpt .sp-progress-bar,#seopress_pro_cpt .sp-progress-bar,.seopress-setup .sp-progress-bar,.seopress-styles .sp-progress-bar{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#0085ba;transition:width .6s ease}#seopress_cpt #seopress_titles_desc_counters,#seopress_cpt #seopress_titles_title_counters,#seopress_pro_cpt #seopress_rich_snippets_articles_counters,#seopress_pro_cpt #seopress_rich_snippets_courses_counters{display:inline;margin-right:5px}#seopress_cpt #seopress_titles_desc_counters_val,#seopress_cpt #seopress_titles_title_counters_val,#seopress_pro_cpt #seopress_rich_snippets_articles_counters_val,#seopress_pro_cpt #seopress_rich_snippets_courses_counters_val{display:inline;font-weight:700}#term-seopress #seopress_cpt{width:95%}.fixed .column-seopress_ps,.fixed .column-seopress_score,.fixed .column-seopress_w3c,.fixed .column-seopress_words{width:6%}.fixed .column-seopress_nofollow,.fixed .column-seopress_noindex{width:8%}@media only screen and (max-width:1200px){.fixed .column-seopress_nofollow,.fixed .column-seopress_noindex,.fixed .column-seopress_ps,.fixed .column-seopress_score,.fixed .column-seopress_w3c,.fixed .column-seopress_words{width:10%}}#seopress_cpt .ui-tabs{position:relative;padding:0;border:none;font-family:inherit;font-size:inherit;display:inline-block;width:100%}#seopress_cpt .ui-tabs .ui-tabs-nav li{list-style:none;display:inline-block;position:relative;top:2px;padding:0 5px;white-space:nowrap;margin:0;border:none;background:0 0}#seopress_cpt .ui-tabs .ui-tabs-nav li a{display:inline-block;padding:5px 10px}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-nav li a,#seopress_cpt .ui-tabs-vertical .ui-tabs-nav li a{display:block}#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:2px;padding-bottom:1px}#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-state-disabled a,#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-tabs-active a,#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-tabs-loading a{color:#191e23;font-weight:700}#seopress_cpt .ui-tabs .ui-tabs-nav li a,#seopress_cpt .ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a{cursor:pointer;color:#191e23;text-decoration:none;height:40px;line-height:40px}#seopress_cpt .ui-tabs-vertical{width:55em}#seopress_cpt .ui-tabs-vertical .ui-tabs-nav{padding:.2em .1em .2em .2em;float:left;width:12em}#seopress_cpt .ui-tabs-vertical .ui-tabs-nav li{clear:left;width:100%;border-bottom-width:1px!important;border-right-width:0!important;margin:0 -1px .2em 0}#seopress_cpt .ui-tabs-vertical .ui-tabs-nav li.ui-tabs-active{padding-bottom:0;padding-right:.1em;border-right-width:1px}#seopress_cpt .ui-tabs-vertical .ui-tabs-panel{padding:1em;float:right;width:40em}#seopress_cpt .ui-tabs .ui-tabs-nav li a .dashicons{margin-right:2px}#tab-panel-seopress_titles_help_tab li span{font-weight:700;margin-right:10px}#seopress_content_analysis .dashicons-no-alt,#seopress_content_analysis .dashicons-yes,#seopress_pro_cpt .dashicons-no-alt,#seopress_pro_cpt .dashicons-yes{color:#fff;background:#12bd10;border-radius:50px;margin-right:10px}#seopress_content_analysis .dashicons-no-alt,#seopress_pro_cpt .dashicons-no-alt{background:#e25950}body.seopress-styles{background:#f8fafd}#seopress-admin-tabs.ui-tabs{position:relative;padding:.2em;border:none;font-family:inherit;font-size:inherit}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:0;margin:-1px .2em 0 0;padding:0;white-space:nowrap;border:none;background:0 0}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li a{float:left;padding:.38em 1em .75rem;outline:0;border-bottom:2px solid #fff}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:-1px}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li.ui-state-disabled a,#seopress-admin-tabs.ui-tabs .ui-tabs-nav li.ui-tabs-active a,#seopress-admin-tabs.ui-tabs .ui-tabs-nav li.ui-tabs-loading a{cursor:text;border-bottom:2px solid #23282d;color:#23282d}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li a,#seopress-admin-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a{cursor:pointer;color:#0073aa;text-decoration:none}#seopress-admin-tabs.ui-tabs-vertical{width:55em}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-nav{padding:.2em .1em .2em .2em;float:left;width:12em}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-nav li{clear:left;width:100%;border-bottom-width:1px!important;border-right-width:0!important;margin:0 -1px .2em 0}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-nav li.ui-tabs-active{padding-bottom:0;padding-right:.1em;border-right-width:1px}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-panel{padding:1em;float:right;width:40em}.seopress-styles .seopress-option{margin:10px auto 0;max-width:90%;padding:1rem;background:#fff;box-shadow:0 15px 35px rgba(50,50,93,.1),0 5px 15px rgba(0,0,0,.1);border-radius:4px}.seopress-styles .seopress-option h1{font-size:16px;font-weight:700;color:#3297d3;text-transform:uppercase;z-index:100;border-bottom:1px solid #eee;padding-bottom:20px}.seopress-styles .seopress-option h1 .dashicons,.seopress-styles .seopress-option h2 .dashicons{margin:0 10px;font-size:40px;width:40px;height:40px;vertical-align:middle}.seopress-styles .seopress-option .link-archive{font-size:14px}.seopress-styles .seopress-option .link-archive .dashicons{font-size:18px;width:20px;height:20px;margin:inherit}.seopress-styles .seopress-option h1>.dashicons{font-size:30px;width:30px;height:30px;background:#c4f0ff;border-radius:6px;padding:10px;margin-left:10px;color:#0085ba}.seopress-styles .seopress-option .metabox-holder h2 .dashicons{font-size:16px}.seopress-option h1 .feature-state .dashicons{font-size:16px;width:16px;height:16px;vertical-align:middle;margin:0 10px 0 0}#seopress-admin-tabs.wrap{display:block;box-shadow:0 7px 14px 0 rgba(60,66,87,.12),0 3px 6px 0 rgba(0,0,0,.12);width:64rem;max-width:100%;margin:0 auto}@media only screen and (max-width:1024px){#seopress-admin-tabs.wrap{width:100%}}.seopress-styles .seopress-option .submit{background:#fff;text-align:center;border-top:1px solid #f1f1f1;padding-top:20px;padding-bottom:20px;margin:0}.seopress-styles .seopress-option #seopress-aio-migrate,.seopress-styles .seopress-option #seopress-rk-migrate,.seopress-styles .seopress-option #seopress-seo-framework-migrate,.seopress-styles .seopress-option #seopress-squirrly-migrate,.seopress-styles .seopress-option #seopress-yoast-migrate,.seopress-styles .seopress-option #submit{color:#fff;text-decoration:none;border:none;border-radius:4px;padding-right:20px;padding-left:20px;line-height:34px;text-transform:uppercase;min-height:34px;transition:all .3s linear;text-shadow:none;box-shadow:0 7px 14px rgba(50,50,93,.1),0 3px 6px rgba(0,0,0,.1);margin-right:15px;background:#6a7c94;position:relative;height:auto;z-index:10}.seopress-styles .seopress-option #seopress-aio-migrate:hover,.seopress-styles .seopress-option #seopress-rk-migrate:hover,.seopress-styles .seopress-option #seopress-seo-framework-migrate:hover,.seopress-styles .seopress-option #seopress-squirrly-migrate:hover,.seopress-styles .seopress-option #seopress-yoast-migrate:hover,.seopress-styles .seopress-option #submit:hover{text-decoration:none;color:#fff;background:#232323}.seopress-styles #wpcontent{padding-left:0}.seopress-styles pre{color:#42b72a;background:#f5f6f7;font-family:Menlo,Monaco,Andale Mono,Courier New,monospace;padding:7px}.seopress-styles #seopress-navbar{padding:10px .5rem;height:60px;margin:0 auto;width:64rem;box-sizing:border-box;position:relative;max-width:100%}#seopress-header{margin:0 auto;position:relative;width:90%;padding:1rem}#seopress-header #seopress-admin h1{line-height:40px;margin:0;display:inline-block;height:40px;width:40px;background-size:100%;background-repeat:no-repeat}#seopress-header #seopress-admin h1::before{font-size:14px;line-height:40px;position:absolute;border-radius:6px;font-weight:400;color:#fff;width:40px;height:40px;text-align:center;background:#3a4afb;background:-moz-linear-gradient(45deg,#3a4afb 0,#47bea5 100%);background:-webkit-linear-gradient(45deg,#3a4afb 0,#47bea5 100%);background:linear-gradient(45deg,#3a4afb 0,#47bea5 100%)}#seopress-header #seopress-admin h1:hover{cursor:pointer}#seopress-header #seopress-admin h1>a{text-decoration:none;color:inherit}#seopress-header #seopress-admin .seopress-quick-access{background:#fff;box-shadow:0 50px 100px rgba(50,50,93,.1),0 15px 35px rgba(50,50,93,.2),0 5px 15px rgba(0,0,0,.1);border-radius:4px;overflow:hidden;position:absolute;font-size:17px;line-height:40px;white-space:nowrap;transform:rotate3d(1,1,0,-15deg);transform-origin:100% 0;opacity:0;will-change:transform,opacity;transition-property:transform,opacity;transition-duration:.25s;z-index:300;padding:0;display:inline-block;width:100%;top:52px;visibility:hidden;cursor:auto;left:-.5rem}#seopress-header #seopress-admin h1:hover .seopress-quick-access{transform:none;opacity:1;pointer-events:auto;visibility:visible}#seopress-header #seopress-admin .seopress-quick-access>ul{margin:0;box-sizing:border-box;display:grid;grid-gap:0 10px;grid-template-columns:repeat(2,1fr);padding:20px}@media only screen and (max-width:1024px){#seopress-header #seopress-admin .seopress-quick-access>ul{grid-template-columns:repeat(1,1fr)}}#seopress-header #seopress-admin h1 .seopress-quick-access li{line-height:40px;margin:0;display:inline-block;height:40px;background-size:100%;background-repeat:no-repeat}#seopress-header #seopress-admin h1 .seopress-quick-access li .dashicons{vertical-align:middle;background:#b7e1f3;border-radius:50%;padding:5px;margin-right:15px}#seopress-header #seopress-admin h1 .seopress-quick-access li a{text-decoration:none;font-size:15px;line-height:30px;text-transform:uppercase;display:block;width:100%;transition:all .3s linear;color:#3297d3}#seopress-header #seopress-admin h1 .seopress-quick-access li a:hover{color:#647a88}#seopress-header #seopress-admin h1 .seopress-info-version{position:relative;left:50px;top:0;font-size:14px;width:100px;display:block}#seopress-header #seopress-admin .wpc-info-version{font-size:14px;left:310px;position:absolute;text-indent:0;top:85px}#seopress-header #seopress-notice{float:right;line-height:40px}#seopress-header #seopress-notice p{font-size:16px}#seopress-header #seopress-notice .dashicons{color:#6f8096;text-decoration:none;line-height:40px}#seopress-header #seopress-notice div.small{font-size:13px;display:inline}#seopress-footer-credits{font-style:italic}#seopress-footer-credits .wporg-ratings{display:inline}#seopress-footer-credits .wporg-ratings a{text-decoration:none}.seopress-option .seopress-settings{float:left;max-width:750px;width:100%}.seopress-option #seopress-edd-license-btn,.seopress-option #seopress-refresh{float:left}.wp-admin-ui_page_seopress-import-export .postbox{margin-right:20px}.seopress-option #side-sortables .accordion-section-content{padding:0}.seopress-option .seopress-settings label{margin:0 0 0 10px}.wrap-seopress-tab-content{position:relative;display:block;width:100%;max-width:64rem;margin:0 auto;box-sizing:border-box}#seopress-admin-tabs .seopress-tab{padding:1.5rem;visibility:hidden;overflow:hidden;opacity:0;transition:all .2s ease;transform:translateX(-15px);position:absolute;top:0;box-sizing:border-box}#seopress-admin-tabs .seopress-tab.active{visibility:visible;overflow:inherit;opacity:1;transform:translateX(0);display:inherit;position:relative}#seopress-tabs .seopress-tab{padding:0 1.5rem;width:calc(100% - 230px);display:none}@media only screen and (max-width:1024px){#seopress-tabs .seopress-tab{width:100%}}#seopress-tabs .seopress-tab.active{display:inline-block;border-left:1px solid #eee}@media only screen and (max-width:782px){#seopress-tabs .seopress-tab.active{width:100%;padding:0;border-left:none;border-top:1px solid #eee}}.seopress-option input[type=password],.seopress-option input[type=text],.seopress-option textarea{min-width:485px}@media only screen and (max-width:1024px){.seopress-option input[type=password],.seopress-option input[type=text],.seopress-option textarea{min-width:inherit;width:100%}}#seopress_htaccess_file{width:100%}.seopress-option textarea{min-height:100px}.seopress-option #side-sortables .highlight{border:1px dashed #ccc;display:block;width:382px;height:40px;background:0 0}.seopress-option #side-sortables .accordion-section{margin-bottom:9px;width:382px}.seopress-option #side-sortables .accordion-section h3{cursor:move;border:1px solid #e5e5e5;background:#fafafa}.seopress-option #side-sortables .accordion-section .inside{padding:10px 10px 24px;border-width:0 1px 1px;border-style:solid;box-shadow:0 1px 1px rgba(0,0,0,.04);border-color:#e5e5e5;display:inline-block;width:calc(100% - 22px);height:100%}.seopress-option #side-sortables .accordion-section .inside ul{padding-left:10px;margin-bottom:0;padding-top:2px;padding-bottom:2px}.seopress-option #side-sortables .accordion-section .inside ul li{border-left:2px solid #ccc;padding-left:10px;margin-bottom:10px}.seopress-option #side-sortables .accordion-section .inside ul li:first-child{border-bottom:1px dotted #e5e5e5;border-left:0;padding-bottom:10px;font-weight:700;margin-left:-15px;margin-bottom:10px}.seopress-notice #message{margin:5px 10px 2px 0}#seopress-notice a{position:relative;text-decoration:none;margin:0 0 0 .3rem}#seopress-notice a .tooltip{white-space:pre;z-index:200;padding:2px 5px;font-weight:500;font-size:12px;color:#aab7c4;background:#fff;box-shadow:0 1px 2px 0 rgba(49,49,93,.1),0 0 1px 0 rgba(0,0,0,.1);border-radius:2px;position:absolute;opacity:0;top:30px;transition:opacity .2s ease;visibility:hidden;line-height:20px;left:-100%;overflow:hidden}#seopress-notice a:hover .tooltip{opacity:1;visibility:visible}.seopress-page-list{margin:1.5rem auto}.seopress-option .dashicons,.seopress-page-list .dashicons{vertical-align:middle;margin-right:5px;color:#6f8096}#seopress-admin-tabs .ui-tabs-nav,#seopress-notifications-center,.seopress-get-started,.seopress-page-list .seopress-feature,.seopress-useful-tools{margin:0 auto 20px;max-width:64rem;padding:2rem;width:100%;border-radius:0 0 4px 4px;box-sizing:border-box}.seopress-get-started{margin-top:20px;background:#fff url(../img/bg-hero-support.svg) no-repeat 95% 50%/contain;position:relative;box-sizing:border-box;box-shadow:0 7px 14px 0 rgba(60,66,87,.12),0 3px 6px 0 rgba(0,0,0,.12)}.seopress-get-started .inside{max-width:calc(100% - 380px)}@media only screen and (max-width:782px){.seopress-get-started{background:#fff}.seopress-get-started .inside{max-width:100%}}.seopress-get-started .preheader{text-transform:uppercase;font-size:.8rem;font-weight:600}.seopress-get-started h2{font-size:1.85em;margin:15px 0 0 0;font-weight:400}.seopress-get-started p{margin-bottom:20px}.seopress-get-started a .dashicons{vertical-align:middle;text-decoration:none;color:#6a7c94}.seopress-get-started a.button-primary .dashicons{color:#fff}.seopress-get-started a.btn-link .dashicons{margin-right:5px}.seopress-get-started a.btn-link{margin:0 0 0 10px}#seopress-notifications-center,.seopress-useful-tools{background:#fff;padding:0}.seopress-page-list .seopress-feature{padding:0;position:relative;overflow:hidden;transition-duration:.15s;display:flex;margin:0;background:#fff;box-shadow:0 7px 14px 0 rgba(60,66,87,.12),0 3px 6px 0 rgba(0,0,0,.12);flex-wrap:wrap;border-radius:4px;width:100%;height:100%}.seopress-page-list .seopress-feature p{color:#6b7c93;font-size:14px;margin-bottom:30px}#seopress-notifications-center{margin-top:0}#seopress-admin-tabs .ui-tabs-nav{display:flex;padding-top:1rem;padding-bottom:0}.seopress-page-list .seopress-feature .img-tool{height:50px;width:50px;background:#c4f0ff;position:relative;border-radius:6px}.seopress-page-list .seopress-feature .img-tool .dashicons{color:#217ab7;font-size:30px;text-align:left;vertical-align:middle;width:100%;height:100%;position:absolute;top:calc(50% - 15px);left:calc(50% - 15px);margin:0}.seopress-page-list .seopress-feature .inner{margin:0;display:inline-block;padding:1.5rem;width:100%;height:100%;box-sizing:border-box}.seopress-page-list .seopress-feature h3{margin:1rem 0 0 0;font-size:16px;font-weight:700;color:#3297d3;text-transform:uppercase}.seopress-page-list .seopress-feature h3 .dashicons{font-size:16px;margin-left:5px;vertical-align:middle}#seopress-content .seopress-page-list .seopress-feature a,#seopress-notifications-center .seopress-alert .button-primary,.seopress-get-started .button-primary,.seopress-option .seopress-feature a,.seopress-useful-tools .widget .button-primary{color:#fff;text-decoration:none;border:none;border-radius:4px;padding-right:20px;padding-left:20px;line-height:34px;text-transform:uppercase;min-height:34px;transition:all .3s linear;text-shadow:none;box-shadow:0 7px 14px rgba(50,50,93,.1),0 3px 6px rgba(0,0,0,.1);background:#6a7c94;position:relative;height:auto;display:flex;flex-wrap:wrap}#seopress-content .seopress-page-list .seopress-feature a.button-secondary{padding-left:30px}#seopress-content .seopress-page-list .seopress-feature a.button-secondary::before,#seopress-notifications-center .seopress-alert .button-primary::after{content:"\f111";font-family:Dashicons;position:absolute;left:10px;top:1px;-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;font-size:16px}#seopress-content .seopress-page-list .wrap-btn{display:inline-flex;margin-bottom:2rem;flex-direction:column}#seopress-content .seopress-page-list .seopress-feature a.view-redirects,#seopress-notifications-center .seopress-alert .button-primary,.seopress-get-started .button,.seopress-option .button{color:#6a7c94;background:#fff;font-weight:500;transition:all .3s linear;text-shadow:none;text-transform:uppercase;padding-right:20px;padding-left:20px;line-height:34px;min-height:34px;margin:10px 0;border-radius:4px;box-shadow:transparent 0 0 0 0,transparent 0 0 0 0,rgba(0,0,0,.12) 0 1px 1px 0,rgba(60,66,87,.16) 0 0 0 1px,transparent 0 0 0 0,transparent 0 0 0 0,rgba(60,66,87,.12) 0 2px 5px 0;vertical-align:baseline;display:inline-flex;align-items:center;border:none;margin-right:.5rem;cursor:pointer}.seopress-get-started .button{color:#fff;background:#6259e6;box-shadow:none}.seopress-option .wp-picker-container button{box-shadow:none;border:1px solid #0071a1;border-radius:3px;background:#f3f5f6;text-transform:none}.seopress-option .wp-picker-container input[type=text].wp-color-picker{min-width:inherit}.seopress-option .wp-picker-container .wp-picker-clear{box-shadow:none;text-transform:none;border-radius:0;background:0 0}.seopress-option .wp-picker-container .wp-picker-clear:hover{background:0 0;text-decoration:currentColor;color:inherit}.seopress-option .button .dashicons{font-size:16px;align-items:center;display:flex}#seopress-content .seopress-page-list .seopress-feature a.view-redirects{padding-left:30px}#seopress-notifications-center .seopress-alert .button-primary::after{content:"\f344";left:inherit;right:10px}#seopress-content .seopress-page-list .seopress-feature a.view-redirects::before{content:"\f177"}#seopress-content .seopress-page-list .seopress-feature a:hover,#seopress-notifications-center .seopress-alert .button-primary:hover,.seopress-get-started .button-primary:hover,.seopress-option .button:hover,.seopress-option .seopress-feature a:hover,.seopress-useful-tools .widget .button-primary:hover{text-decoration:none;color:#fff;background:#232323}.seopress-get-started .button .dashicons{transition:all .3s linear}.seopress-get-started .button:hover .dashicons{color:#fff}#seopress-content .seopress-page-list .seopress-feature .seopress-doc:focus,#seopress-content .seopress-page-list .seopress-feature a:focus,#seopress-content .seopress-page-list .seopress-feature a:focus.button-secondary,#seopress-content a:focus,#seopress-notifications-center .seopress-alert .button-primary:focus,.seopress-option #seopress-tabs .seopress-doc:focus,.seopress-option .seopress-feature a:focus,.seopress-styles .seopress-option #seopress-aio-migrate:focus,.seopress-styles .seopress-option #seopress-yoast-migrate:focus,.seopress-styles .seopress-option #submit:focus,.seopress-useful-tools .widget .button-primary:focus{box-shadow:0 1px 0 #0073aa,0 0 2px 1px #33b3db;background:#008ec2;border-color:#006799;color:#fff}#seopress-admin-tabs .nav-tab-wrapper a.nav-tab-active:focus{color:inherit}#seopress-notifications-center .seopress-alert .button-primary{margin:5px 0;padding-right:30px}#seopress-notifications-center h2,.seopress-useful-tools h2{margin:5px 0 15px 5px;display:inline-block;width:100%}#seopress-notifications-center .dashicons,.seopress-useful-tools .dashicons{margin-right:10px}#seopress-notifications-center .seopress-alert{padding:1.5rem 2rem 1.2rem 1rem;border-bottom:1px solid #e6ebf1;width:calc(100% - 3rem);flex:1 1 auto;position:relative;transition:all 150ms ease;align-items:center;display:flex;justify-content:space-between}#seopress-notifications-center .seopress-alert:last-child{margin-bottom:0;border-bottom:none}#seopress-notifications-center .seopress-alert:hover{cursor:default}#seopress-notifications-center .dashicons{display:flex;align-self:normal;width:48px;height:48px;color:#d7dade;font-size:48px;padding:0 1rem}#seopress-notifications-center .seopress-alert p{margin:0}#seopress-notifications-center .notice-left{flex:1}#seopress-notifications-center .notice-left>p:first-child{color:#1a1f36;font-weight:500}#seopress-notifications-center .notice-right{padding:1rem 0 0 0;display:flex}#seopress-notifications-center .seopress-alert.impact::after{content:"";width:10px;height:10px;border-radius:50px;position:absolute;right:1rem;top:1rem}#seopress-notifications-center .seopress-alert.impact.low::after{background:#ffde24}#seopress-notifications-center .seopress-alert.impact.medium::after{background:#e39f48}#seopress-notifications-center .seopress-alert.impact.high::after{background:#e25950}#seopress-notifications-center .seopress-alert.impact.info::after{background:#0085ba}#seopress-notifications-center .seopress-alert.dashicons{color:#6f8096}#seopress-notifications-center .dashicons.remove-notice,.seopress-get-started .remove-notice{position:absolute;right:0;color:#6b7c93;font-size:20px;height:30px;width:30px;vertical-align:middle;top:1.2rem;line-height:30px;padding:5px;transition:all .3s linear;margin:0;display:block}.seopress-get-started .remove-notice{top:10px;right:10px}#seopress-notifications-center .dashicons.remove-notice:hover,.seopress-get-started .remove-notice:hover{color:#1a1f36;cursor:pointer}#seopress-content .seopress-page-list .seopress-feature .seopress-doc,.seopress-option #seopress-tabs .seopress-doc{background:0 0;padding:0;text-decoration:none;color:inherit;box-shadow:none;position:absolute;right:.5rem;top:1rem}#seopress-content .seopress-page-list .seopress-feature .seopress-doc:active,#seopress-content .seopress-page-list .seopress-feature .seopress-doc:focus,#seopress-content .seopress-page-list .seopress-feature .seopress-doc:hover,.seopress-option #seopress-tabs .seopress-doc:active,.seopress-option #seopress-tabs .seopress-doc:focus,.seopress-option #seopress-tabs .seopress-doc:hover{color:#747474;background:0 0;box-shadow:none;border:none}#seopress-content .seopress-page-list .seopress-feature .seopress-doc:hover .dashicons{color:#232323}.seopress-option .seopress-table{background:#fff;border:1px solid #ccc}.seopress-option .seopress-table th{padding:15px 10px;vertical-align:middle}.wp-admin-ui_page_seopress-roles .seopress-option .seopress-table th{min-width:200px}.seopress-option .seopress-table .seopress-settings-section{background:#f1f1f1}.seopress-option .seopress-table .seopress-table-head .seopress-feature{border-bottom:1px solid #ccc;font-weight:700;background:#f1f1f1}#seopress-content .feature-state,.seopress-option .feature-state{font-style:italic;font-size:10px;display:inline-block;background:rgba(0,140,135,.1);padding:2px 10px;border-radius:25px;color:#444;font-weight:400;text-transform:none;-moz-osx-font-smoothing:initial;-webkit-font-smoothing:initial}@media only screen and (max-width:782px){#seopress-content .feature-state,.seopress-option .feature-state{display:none}}.seopress-option .seopress_wrap_single_cpt .feature-state,.seopress-option .seopress_wrap_tax .feature-state{padding:2px 12px;margin:0 0 .5rem .5rem}.seopress-option #tab_seopress_titles_archives h2,.seopress-option #tab_seopress_titles_single h2,.seopress-option #tab_seopress_titles_tax h2{margin:2em 0 1em 0;border-top:1px solid #eee;padding:1em 0 0 0}.seopress-option #tab_seopress_titles_archives h2:first-child,.seopress-option #tab_seopress_titles_single h2:first-child,.seopress-option #tab_seopress_titles_tax h2:first-child{border-top:none;margin:0 0 1em 0}#seopress_cpt .tag-title,#seopress_pro_cpt .tag-title,.seopress-button,.seopress-option .tag-title{cursor:pointer;font-weight:500;border-radius:4px;transition:all .3s linear}#seopress-content .feature-state-on,#seopress-content .feature-state.feature-state-on,.seopress-option .feature-state-on,.seopress-option .feature-state.feature-state-on{display:inline-block}#seopress-content .feature-state-off,.seopress-option .feature-state-off{display:none}.seopress-option .postbox .inside li{list-style:square inside;padding-left:5px}#tab_seopress_page_speed .inside li{list-style:none;padding-left:0;word-break:break-word}.seopress-option .log{margin:0;text-transform:uppercase;display:inline-block;vertical-align:middle;padding:5px;color:#13bf11;font-style:italic}.seopress-option input[type=text].seopress-admin-menu-input{min-width:inherit;width:100%}.seopress_page_seopress-import-export .postbox{width:calc(100% - 20px)}#seopress_cpt .wrap-tags,#seopress_pro_cpt .wrap-tags,.seopress-option .wrap-tags{position:relative;display:inline-block;width:100%;margin-bottom:10px}#seopress_cpt .tag-title,#seopress_pro_cpt .tag-title,.seopress-option .tag-title{padding:4px 8px;position:relative;top:5px;left:0;font-size:11px;float:left;margin-right:5px;user-select:none;margin-bottom:5px;background:#fff;color:#6b7c93;box-shadow:0 0 0 .5px rgba(50,50,93,.17),0 2px 5px 0 rgba(50,50,93,.12),0 3px 9px 0 rgba(50,50,93,.08),0 1px 1.5px 0 rgba(0,0,0,.08),0 1px 2px 0 rgba(0,0,0,.08)}#seopress_cpt .tag-title:active,#seopress_cpt .tag-title:focus,#seopress_cpt .tag-title:hover,#seopress_pro_cpt .tag-title:active,#seopress_pro_cpt .tag-title:focus,#seopress_pro_cpt .tag-title:hover,.seopress-option .tag-title:active,.seopress-option .tag-title:focus,.seopress-option .tag-title:hover{background:#232323;color:#fff;user-select:none}#seopress_cpt .tag-title .dashicons,#seopress_pro_cpt .tag-title .dashicons,.seopress-option .tag-title .dashicons{padding:0;height:16px;width:16px;font-size:16px;margin-right:5px;vertical-align:middle}.seopress-button{text-transform:uppercase;background:#fff;border-color:#c8d7e1;border-style:solid;border-width:1px 1px 2px;color:#2e4453;display:inline-block;margin:0;outline:0;overflow:hidden;text-overflow:ellipsis;text-decoration:none;vertical-align:top;box-sizing:border-box;font-size:14px;line-height:20px;padding:6px 8px 6px;-webkit-appearance:none;-moz-appearance:none;appearance:none}.seopress-button:hover{border-color:#a8bece;color:#00a0d2}.seopress-button .dashicons{vertical-align:middle}#seopress-content #tab_seopress_seo_tools.seopress-useful-tools .widget{border-right:1px solid #e6ebf1;margin:0;padding:0 20px;width:calc(50% - 2px);box-sizing:border-box;display:inline-block;vertical-align:top}#seopress-content #tab_seopress_seo_tools.seopress-useful-tools .widget:first-child{width:100%;display:block;clear:both;border-right:none;border-bottom:1px solid #e6ebf1;padding-bottom:20px;margin-bottom:20px}#seopress-content #tab_seopress_seo_tools.seopress-useful-tools .widget:last-child{border-right:none}#seopress-content .seopress-useful-tools .widget-reverse ul{background:#fff}#seopress-content .seopress-useful-tools .widget-reverse li{padding:10px;margin:0;border-bottom:1px solid #e6ebf1}#seopress-content .seopress-useful-tools .widget-reverse li:hover{background:#f5f7fa}#seopress-content .seopress-useful-tools .widget-title{text-transform:uppercase;margin:0 0 10px;font-size:13px;padding:10px 0;color:#24b47e}#seopress-content .seopress-reverse label,#seopress-content .seopress-useful-tools .widget-whois ul li span{font-weight:700}#seopress-content #seopress-reverse-url{width:100%;margin:10px 0}#seopress-content .widget-reverse p{margin:0}.post-type-seopress_backlinks .wp-list-table .column-seopress_backlinks_url{width:35%}.post-type-seopress_backlinks .wp-list-table .column-seopress_backlinks_anchor_text{width:20%}.seopress-styles #screen-meta{margin:0;position:relative;background-color:#fff;border-bottom:0 solid #f2f2f2;border-top:none;-webkit-box-shadow:0 0 0 1px rgba(136,152,170,.1),0 15px 35px 0 rgba(49,49,93,.1),0 5px 15px 0 rgba(0,0,0,.08);box-shadow:0 0 0 1px rgba(136,152,170,.1),0 15px 35px 0 rgba(49,49,93,.1),0 5px 15px 0 rgba(0,0,0,.08);top:0}.seopress-styles #contextual-help-link-wrap,.seopress-styles #screen-options-link-wrap{float:right;height:28px;margin:0 0 0 6px;border:1px solid #f2f2f2;border-top:none;background:#fff;-webkit-box-shadow:0 0 0 1px rgba(136,152,170,.1),0 15px 35px 0 rgba(49,49,93,.1),0 5px 15px 0 rgba(0,0,0,.08);box-shadow:0 0 0 1px rgba(136,152,170,.1),0 15px 35px 0 rgba(49,49,93,.1),0 5px 15px 0 rgba(0,0,0,.08)}.seopress-styles #screen-meta-links .show-settings{box-shadow:none}.seopress-styles #screen-meta-links .screen-meta-toggle{position:relative;top:0;z-index:2000}.seopress-styles #contextual-help-back{background:#f8fafd}.seopress-styles .contextual-help-tabs .active{border-left:2px solid #3297d3;background:#f8fafd}#seopress-content input.toggle,#seopress_cpt input.toggle,.seopress-option input.toggle{max-height:0;max-width:0;opacity:0;position:relative}.seopress-feature input.toggle{display:block}.wrap-toggle-preview{position:relative}.wrap-toggle-preview p{font-weight:700;margin:0 0 1rem 0}#seopress_cpt input.toggle,.seopress_wrap_single_cpt input.toggle,.seopress_wrap_tax input.toggle{margin:0;border:none;min-width:0}#seopress_content_analysis span.label,#seopress_cpt span.label{outline:0;color:#fff;box-shadow:none;background:#555d66;padding:2px 4px;border-radius:4px;font-weight:700}#seopress_add_to_insights{margin-left:1rem}#seopress_add_to_insights_status{display:inline-block;font-weight:700;margin:0 0 0 1rem;vertical-align:middle;padding:.3rem;font-style:italic}#seopress-content input.toggle+label,#seopress_cpt #tabs-1 input.toggle+label,.seopress-option input.toggle+label{display:inline-block;position:relative;box-shadow:inset 0 0 0 1px #d5d5d5;text-indent:-5000px;height:20px;width:40px;border-radius:15px}#seopress_cpt #tabs-1 input.toggle+label{margin:0}.wrap-toggle-checkboxes input.toggle+label{float:left;margin-right:10px}#seopress-content input.toggle+label:before,#seopress_cpt input.toggle+label:before,.seopress-option input.toggle+label:before{content:"";position:absolute;display:block;height:20px;width:30px;top:0;left:0;border-radius:15px;background:rgba(19,191,17,0);-moz-transition:.25s ease-in-out;-webkit-transition:.25s ease-in-out;transition:.25s ease-in-out}#seopress-content input.toggle+label:after,#seopress_cpt input.toggle+label:after,.seopress-option input.toggle+label:after{content:"";position:absolute;display:block;height:20px;width:20px;top:0;left:0;border-radius:15px;background:#fff;box-shadow:inset 0 0 0 1px rgba(0,0,0,.2),0 2px 4px rgba(0,0,0,.2);-moz-transition:.25s ease-in-out;-webkit-transition:.25s ease-in-out;transition:.25s ease-in-out}#seopress_cpt input.toggle+label,#seopress_cpt input.toggle+label:before,.seopress_wrap_single_cpt input.toggle+label,.seopress_wrap_single_cpt input.toggle+label:before,.seopress_wrap_tax input.toggle+label,.seopress_wrap_tax input.toggle+label:before{width:40px;height:20px}#seopress_cpt input.toggle+label:after,.seopress_wrap_single_cpt input.toggle+label:after,.seopress_wrap_tax input.toggle+label:after{width:20px;height:20px}#seopress-content input.toggle[data-toggle="1"]+label:before,#seopress_cpt input.toggle[data-toggle="1"]+label:before,.seopress-option input.toggle[data-toggle="1"]+label:before{width:40px;background:#3197d3}#seopress_cpt input.toggle[data-toggle="1"]+label:before,.seopress_wrap_single_cpt input.toggle[data-toggle="1"]+label:before,.seopress_wrap_tax input.toggle[data-toggle="1"]+label:before{width:40px;background:#3197d3}#seopress-content input.toggle[data-toggle="1"]+label:after,#seopress_cpt input.toggle[data-toggle="1"]+label:after,.seopress-option input.toggle[data-toggle="1"]+label:after{left:20px;box-shadow:inset 0 0 0 1px #3197d3,0 2px 4px rgba(0,0,0,.2)}#seopress_cpt input.toggle[data-toggle="1"]+label:after,.seopress_wrap_single_cpt input.toggle[data-toggle="1"]+label:after,.seopress_wrap_tax input.toggle[data-toggle="1"]+label:after{box-shadow:inset 0 0 0 1px #3197d3,0 2px 4px rgba(0,0,0,.2)}#seopress-content .seopress-page-list{position:relative;display:grid;max-width:64rem;grid-gap:20px 20px;grid-template-columns:repeat(3,1fr)}@media only screen and (max-width:782px){#seopress-content .seopress-page-list{grid-template-columns:repeat(1,1fr)}}#seopress-notice-save{position:fixed;color:#fff;padding:15px 40px;font-size:.9rem;text-transform:uppercase;text-align:center;border-radius:0;background:rgba(74,184,102,.9);bottom:0;right:0;z-index:500;width:100%;font-weight:700}#seopress-notice-save .dashicons{color:#fff}.seopress-styles .wrap{margin:20px 0 0 0;display:flex;position:relative}.seopress-insights.seopress-styles .wrap,.toplevel_page_seopress-option.seopress-styles .wrap{display:inherit;position:inherit;margin:inherit}@media only screen and (max-width:782px){.seopress-styles .wrap{display:inherit;position:inherit;margin:inherit}}.seopress_page_seopress-pro-page #wpcontent{background:#f4f7fa}.seopress-option .wrap div.nav-tab-wrapper{margin:0 0 0 -26px;padding:0 0 0 10px;line-height:inherit;width:230px;z-index:95;font-weight:400;display:block;border-bottom:none}@media only screen and (max-width:782px){.seopress-option .wrap div.nav-tab-wrapper{width:100%;margin:0;padding:0}}#seopress-admin-tabs.wrap div.nav-tab-wrapper{margin:20px auto 0;max-width:64rem;width:100%;border-bottom:1px solid #e6ebf1;padding:0;line-height:inherit;position:-webkit-sticky;position:sticky;background:#f5f7fa;z-index:100;top:31px;border-radius:4px 4px 0 0;font-weight:400;overflow:hidden;display:flex;align-items:center;justify-content:space-between;box-sizing:border-box}@media only screen and (max-width:600px){#seopress-admin-tabs.wrap div.nav-tab-wrapper{top:0;display:block}}@media only screen and (max-width:1024px){#seopress-admin-tabs.wrap div.nav-tab-wrapper{display:block}}#seopress-admin-tabs #tab_seopress_notifications.seopress-tab{background:0 0;padding:0;border-radius:0}.seopress-option .nav-tab{border:0 solid #ccc;background:0 0;opacity:.5;padding:6px 30px 6px 10px;transition:opacity .3s linear;color:#191e23;margin:0;float:none;display:inline-block;width:100%;text-align:left;font-weight:400;box-sizing:border-box;white-space:normal}#seopress-admin-tabs .nav-tab{border:0 solid #ccc;background:0 0;opacity:.5;padding:14px 20px;transition:opacity .3s linear;color:#191e23;margin:0;box-shadow:inset -1px 0 #e3e8ee;float:none;display:inline-block;text-align:center;font-weight:400}#seopress-admin-tabs .nav-tab{width:100%}#seopress-admin-tabs .nav-tab-active,#seopress-admin-tabs .nav-tab-active:hover,.seopress-option .about-wrap h2 .nav-tab-active,.seopress-option .nav-tab-active,.seopress-option .nav-tab-active:hover{background-color:#fff}#seopress-admin-tabs .nav-tab-active,#seopress-admin-tabs .nav-tab-active:focus,#seopress-admin-tabs .nav-tab-active:focus:active,#seopress-admin-tabs .nav-tab-active:hover,#seopress-admin-tabs .nav-tab:focus,.nav-tab-active:focus,.seopress-option .nav-tab-active,.seopress-option .nav-tab-active:focus:active,.seopress-option .nav-tab-active:hover,.seopress-option .nav-tab:focus{opacity:1;outline:0;font-weight:600;position:relative;color:#191e23;border-left:3px solid #0085ba;background:rgba(0,133,186,.1)}#seopress-admin-tabs .nav-tab-active,#seopress-admin-tabs .nav-tab-active:focus,#seopress-admin-tabs .nav-tab-active:focus:active,#seopress-admin-tabs .nav-tab-active:hover,#seopress-admin-tabs .nav-tab:focus{border-bottom:3px solid #3197d3;border-left:none;background:#fff}#seopress-admin-tabs .nav-tab:hover,.seopress-option .nav-tab:hover{opacity:1}#seopress-admin-tabs .nav-tab:focus,.seopress-option .nav-tab:focus{outline:0;box-shadow:none}.seopress-option .section-tool{border:none;box-shadow:none;background:0 0;position:relative}.seopress-option .section-tool::after{content:'';background:#dedede;height:1px;width:100%;display:block}.seopress-option .sp-section-header{border-bottom:1px solid #eee;margin:0 0 1rem 0;width:100%;display:flex;position:relative;align-items:center;padding-bottom:.5rem}.seopress-option .sp-section-header::after{position:absolute;content:'';background:#0085ba;height:2px;width:40px;bottom:0;left:0}.seopress-option .sp-section-header h2{font-size:1.5em}.seopress-option .sp-section-header>.dashicons{color:#0085ba;padding:10px;border-radius:6px;margin-right:10px;background:#c4f0ff}.seopress-option .sp-section-header .wrap-toggle-checkboxes{display:flex}.seopress-styles .wrap .notice{margin:5px 0 15px 15px}#seopress-tabs.wrap .notice{margin:1rem 0}.seopress-BlankState a.button-primary,.seopress-BlankState button.button-primary,.seopress-message a.button-primary,.seopress-message button.button-primary{background:#6259e6;border-color:#6259e6;box-shadow:transparent 0 0 0 0,transparent 0 0 0 0,rgba(0,0,0,.12) 0 1px 1px 0,rgba(60,66,87,.16) 0 0 0 1px,transparent 0 0 0 0,transparent 0 0 0 0,rgba(60,66,87,.12) 0 2px 5px 0;color:#fff;display:inline-block}.seopress-BlankState a.button-primary:active,.seopress-BlankState a.button-primary:focus,.seopress-BlankState a.button-primary:hover,.seopress-BlankState button.button-primary:active,.seopress-BlankState button.button-primary:focus,.seopress-BlankState button.button-primary:hover,.seopress-message a.button-primary:active,.seopress-message a.button-primary:focus,.seopress-message a.button-primary:hover,.seopress-message button.button-primary:active,.seopress-message button.button-primary:focus,.seopress-message button.button-primary:hover{background:#6259e6;border-color:#6259e6;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #6259e6}.post-type-seopress_404 .seopress-BlankState-message::before,.post-type-seopress_schemas .seopress-BlankState-message::before{font-family:Dashicons;speak:none;font-weight:400;font-variant:normal;text-transform:none;line-height:1;margin:0;text-indent:0;position:absolute;top:0;left:0;width:100%;height:100%;text-align:center;content:"\f103"}.post-type-seopress_schemas .seopress-BlankState-message::before{content:"\f495"}.seopress-BlankState{text-align:center;padding:5em 0 0}.seopress-BlankState .seopress-BlankState-message{color:#aaa;margin:0 auto 1.5em;line-height:1.5em;font-size:1.2em;max-width:500px}.seopress-BlankState .seopress-BlankState-message::before{color:#ddd;text-shadow:0 -1px 1px rgba(0,0,0,.2),0 1px 0 rgba(255,255,255,.8);font-size:8em;display:block;position:relative!important;top:auto;left:auto;line-height:1em;margin:0 0 .1875em}.seopress-BlankState .seopress-BlankState-cta{font-size:1.2em;padding:.75em 1.5em;margin:0 .25em;height:auto;display:inline-block!important}.seopress-BlankState{max-width:764px;text-align:center;margin:auto}.seopress-BlankState .seopress-BlankState-message{color:#444;font-size:1.5em;margin:0 auto 1em}.seopress-BlankState .seopress-BlankState-message::before{font-size:120px}.seopress-BlankState .seopress-BlankState-buttons{margin-bottom:4em}#seopress_content_analysis .up,#seopress_content_analysis .up .dashicons{color:#4ab866}#seopress_content_analysis .down,#seopress_content_analysis .down .dashicons{color:#d94f4f}#seopress_content_analysis .up .dashicons{transform:rotateZ(45deg)}#seopress_content_analysis .stable .dashicons{transform:rotateZ(90deg)}#seopress_content_analysis .down .dashicons{transform:rotateZ(135deg)}#seopress_content_analysis .wrap-insights-post{clear:both;border-top:1px solid #e2e4e7;display:flex;align-items:center}#seopress_content_analysis .wrap-insights-post .widget-insights-title{margin:0 1rem}#seopress_content_analysis .wrap-insights-post span{font-weight:700;margin:0 .2rem 0 0}#seopress_content_analysis .wrap-insights-post .sp-tooltip *{font-weight:400}#seopress_content_analysis .wrap-insights-post .sp-tooltip-headings{font-weight:700}
|
1 |
+
#adminmenu div.wp-menu-image.dashicons-admin-seopress::before,#seopress-header #seopress-admin h1::before{content:"\e800";font-family:seopress!important;font-weight:700;font-size:12px;line-height:20px}#seopress-header #seopress-admin h1::before,.seopress-page-list .seopress-feature h3,.seopress-styles .seopress-option h1{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased}@font-face{font-family:seopress;src:url(../fonts/seopress.eot?81521271);src:url(../fonts/seopress.eot?81521271#iefix) format('embedded-opentype'),url(../fonts/seopress.woff?81521271) format('woff2'),url(../fonts/seopress.woff?81521271) format('woff'),url(../fonts/seopress.ttf?81521271) format('truetype'),url(../fonts/seopress.svg?81521271#seopress) format('svg');font-weight:400;font-style:normal}[class*=" icon-seopress"],[class^=icon-seopress-]{font-family:seopress!important;font-size:14px!important;line-height:24px!important}#tab_seopress_titles_archives .form-table th:empty,#tab_seopress_titles_single .form-table th:empty,#tab_seopress_titles_tax .form-table th:empty{display:none}.icon-seopress-seopress:before{content:"\e800"}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex{background:red;color:#fff;padding:0 8px;float:right;margin-left:6px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level>a{display:inline-block}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_top_level .wrap-seopress-noindex .ab-icon::before{color:#eee;vertical-align:middle}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots{display:block;background:#23292d}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots a{height:inherit;padding-bottom:5px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-seo{font-weight:700;border-bottom:1px solid currentColor;width:100%;display:block;margin-bottom:5px}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex{display:block}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .ab-icon,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .ab-icon{float:none;vertical-align:middle}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .on::before,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .on::before{color:red}#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-nofollow .off::before,#wpadminbar #wp-toolbar #wp-admin-bar-seopress_custom_sub_menu_meta_robots .wrap-seopress-cpt-noindex .off::before{color:#46b450}.sp-tooltip{position:relative;margin-left:5px;display:inline-block;cursor:help;vertical-align:bottom;text-align:left;background:0 0;border:none;padding:0}.sp-tooltip .dashicons{color:#666}.sp-tooltip .sp-tooltiptext{visibility:hidden;position:absolute;z-index:999999999;width:300px;right:-303px;padding:20px;top:25px;font-weight:400;box-shadow:0 3px 30px rgba(25,30,35,.1);border:1px solid #e2e4e7;background:#fff;word-break:break-word;text-transform:none}.sp-tooltip .sp-tooltiptext::before{border:8px solid #e2e4e7;top:-8px}.sp-tooltip .sp-tooltiptext::after{border:8px solid #fff;top:-6px}.sp-tooltip .sp-tooltiptext::after,.sp-tooltip .sp-tooltiptext::before{border-bottom-style:solid;border-left-color:transparent;border-right-color:transparent;border-top:none;margin-left:-10px;content:"";position:absolute;height:0;width:0;line-height:0;left:30px}.sp-tooltip:active .sp-tooltiptext,.sp-tooltip:focus .sp-tooltiptext,.sp-tooltip:hover .sp-tooltiptext{visibility:visible}.sp-tooltip .sp-tooltip-headings{font-size:18px;font-weight:600;margin-bottom:20px;display:block}.sp-tooltip .sp-tooltip-desc{margin-bottom:20px;display:block;border-bottom:1px solid #e2e4e7;padding-bottom:20px;font-size:13px}.sp-tooltip .sp-tooltip-code{font-family:Menlo,Monaco,Andale Mono,Courier New,monospace;display:block;word-break:break-all;color:#1a7a06;font-size:11px}.analysis-score .sp-tooltip{vertical-align:middle;font-size:.75em}#seopress_content_analysis a{color:#0073aa}#seopress_content_analysis .wrap-seopress-analysis{display:inline-block;width:100%}#seopress_content_analysis .col-left{width:calc(50% - 30px);float:left;margin-right:30px}#seopress_content_analysis .col-right{float:right;width:50%}#seopress_content_analysis #seopress_suggestions{display:inline-block;width:100%;margin:0;height:auto;padding:20px 0}#seopress_content_analysis #seopress_suggestions li{list-style:none;margin:5px;display:inline-block}#seopress_content_analysis .analysis-score{clear:both;border-top:1px solid #e2e4e7;display:flex;justify-content:space-between;align-items:center}.column-seopress_score .analysis-score{display:flex;align-content:center}#seopress_content_analysis .analysis-score p,.column-seopress_score .analysis-score p{font-weight:700;font-size:1.2em}#seopress_content_analysis .analysis-score svg,.column-seopress_score .analysis-score svg{display:inline-block;height:30px;width:30px;margin:0;border-radius:100%;position:relative;font-weight:600;shape-rendering:geometricprecision;font-size:.5rem;vertical-align:middle;margin-right:15px}.column-seopress_score .analysis-score p,.column-seopress_score .analysis-score svg{margin:0}@keyframes loadingPulse{0%{stroke:#adc5d2}50%{stroke:#00a0d2}100%{stroke:#adc5d2}}#seopress_content_analysis .analysis-score .loading #bar{stroke-dashoffset:0!important;stroke:#adc5d2!important;animation:loadingPulse 3s infinite ease-in-out}#seopress_content_analysis .analysis-score .good #bar,.column-seopress_score .analysis-score #bar.good{stroke:#46b450}#seopress_content_analysis .analysis-score .notgood #bar,.column-seopress_score .analysis-score #bar.notgood{stroke-dashoffset:565;stroke:#ffb900}#seopress_content_analysis .analysis-score svg circle,.column-seopress_score .analysis-score svg circle{stroke-dashoffset:0;transition:stroke-dashoffset 1s linear;stroke:#ccc;stroke-width:2em}#seopress_content_analysis .gr-analysis{clear:both}#seopress_content_analysis .gr-analysis-title{border-top:1px solid #e2e4e7;position:relative}#seopress_content_analysis .gr-analysis-title .impact,#seopress_cpt .impact{position:absolute;left:10px;top:calc(50% - 5px);width:10px;height:10px;border-radius:50px;padding:0;margin:0;border:1px solid #fff}#seopress_content_analysis .gr-analysis .impact.good{background:#46b450;box-shadow:0 0 5px #46b450}#seopress_content_analysis .gr-analysis .impact.low{background:#ffde24;box-shadow:0 0 5px #ffde24}#seopress_content_analysis .gr-analysis .impact.medium{background:#e39f48;box-shadow:0 0 5px #e39f48}#seopress_content_analysis .gr-analysis .impact.high,#seopress_cpt .impact.high{background:#e25950;box-shadow:0 0 5px #e25950}#seopress_content_analysis .gr-analysis-content .impact.high{background:#e25950;box-shadow:none;color:#fff;padding:2px 4px;margin-left:5px;border-radius:4px;font-weight:700}#seopress_cpt .impact.high{position:relative;top:calc(50% - 18px);display:inline-block;left:inherit;right:-10px}#seopress_content_analysis .description,#seopress_cpt .description,.seopress-tab .description{display:block;font-style:italic}#seopress_content_analysis .gr-analysis-title button{background:#fff;border:0;cursor:pointer;display:block;margin:0;position:relative;text-align:left;width:100%;padding:15px 30px;align-items:center;transition:all .3s linear}#seopress_content_analysis .gr-analysis-title button:hover{background:#f3f4f5}#seopress_content_analysis .gr-analysis-title button:focus{color:#191e23;border:none;box-shadow:none;outline-offset:-2px;outline:1px dotted #555d66}#seopress_content_analysis .gr-analysis-title button .sp-arrow::after{content:"\f343";font-family:Dashicons;position:absolute;right:10px;top:calc(50% - 7px)}#seopress_content_analysis .gr-analysis-title button.open .sp-arrow::after{content:"\f347"}#seopress_content_analysis .gr-analysis-content{padding:0 1rem .5rem 1rem;display:none;width:100%;border-top:1px solid #e2e4e7;box-sizing:border-box}table.wp-list-table .manage_column.column-seopress_canonical,table.wp-list-table .manage_column.column-seopress_desc,table.wp-list-table .manage_column.column-seopress_insights,table.wp-list-table .manage_column.column-seopress_noindex,table.wp-list-table .manage_column.column-seopress_redirect_enable,table.wp-list-table .manage_column.column-seopress_redirect_url,table.wp-list-table .manage_column.column-seopress_title,table.wp-list-table .manage_column.column-seopress_tkw{width:7%!important}#seopress_content_analysis h3{margin:0;font-size:1em}#seopress_content_analysis h4{border-bottom:1px solid #e2e4e7;padding-bottom:.5rem;text-transform:uppercase;font-size:.85em;position:-webkit-sticky;position:sticky;top:0;background:#fff}#seopress_content_analysis .wrap-analysis-img ul{display:flex;flex-wrap:wrap}#seopress_content_analysis .wrap-analysis-img ul li{padding:0;text-align:left;cursor:default}#seopress_content_analysis .wrap-analysis-img h4{border-bottom:1px solid #ddd;padding-bottom:10px}#seopress_content_analysis .wrap-analysis-img ul li img{max-width:150px;max-height:150px;object-fit:cover;border:1px solid #f3f4f5;cursor:default;padding:1px}#seopress_cpt .notice{padding:10px 14px}#seopress-analysis-tabs .dashicons,#seopress_cpt .dashicons{vertical-align:middle}#seopress-analysis-tabs{clear:both}#seopress_cpt .inside{margin:0;padding:0}#seopress_cpt .ui-tabs .ui-tabs-nav{display:inline-block;min-height:26px;position:relative;width:100%;z-index:10;margin:0;border-radius:0;padding:0;background:#f3f4f5;border:none}#seopress_cpt .ui-helper-clearfix:after{content:none}.seopress_page_seopress-titles #seopress-tabs .form-table td,.seopress_page_seopress-titles #seopress_content_analysis .form-table td{padding:0}#seopress_cpt .ui-tabs .ui-tabs-panel{background:#fff;border-radius:0;display:inline-block;padding:1em 1.4em;width:100%;box-sizing:border-box}#seopress_content_analysis .dashicons-info,#seopress_cpt .ui-tabs .ui-tabs-panel .dashicons-info,#seopress_pro_cpt .dashicons-info{font-size:16px;vertical-align:middle;height:16px;width:16px}#seopress_cpt .ui-tabs .ui-tabs-nav li,#seopress_cpt .ui-tabs-anchor{cursor:pointer!important}#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-tabs-active{position:relative;z-index:60;cursor:pointer;border-radius:0;border-bottom:3px solid #0085ba}#seopress_content_analysis label,#seopress_cpt #tabs-1 label,#seopress_cpt #tabs-2 label[for=seopress_robots_breadcrumbs_meta],#seopress_cpt #tabs-2 label[for=seopress_robots_canonical_meta],#seopress_cpt #tabs-2 label[for=seopress_robots_primary_cat_meta],#seopress_cpt #tabs-3 label,#seopress_cpt #tabs-4 label,#seopress_cpt #tabs-5 label,#seopress_cpt #tabs-6 label,#seopress_cpt .subsection-title{display:block;margin:20px 0 5px;font-weight:700}#seopress_cpt .wp-color-result{margin:0}#seopress_content_analysis input[type=text],#seopress_cpt #tabs-1 input,#seopress_cpt #tabs-2 input[type=text],#seopress_cpt #tabs-3 input[type=text],#seopress_cpt #tabs-3 textarea,#seopress_cpt #tabs-4 input[type=text],#seopress_cpt #tabs-5 input[type=text],#seopress_cpt #tabs-6 input[type=text],#seopress_cpt #tabs-6 textarea{width:100%;display:inline-block}#seopress_cpt #tabs-1 input{width:100%}#seopress_cpt #tabs-6 input[type=number]{width:30%;min-width:200px}#seopress_cpt #tabs-6 #wrap-videos .video:first-child .remove-video{display:none}#seopress_cpt select{width:300px}#seopress_cpt #tabs-4 select{width:250px;display:inline}#seopress_cpt #tabs-4 #seopress_redirections_value_meta{width:calc(100% - 258px);float:right}#seopress_cpt #tabs-6{padding:0}#seopress_cpt #tabs-6 #wrap-videos .video .accordion-section-content,#seopress_cpt #tabs-6>p{padding:0 1.4em}#seopress_cpt #tabs-6 #wrap-videos .video .accordion-section-content{padding:0 1.4em 1em}#seopress_cpt #tabs-6 #wrap-videos .video{border-top:1px solid #eee}#seopress_cpt #tabs-6 #wrap-videos .video .accordion-section-title{border-left:none;border-right:none;font-size:1em;padding:1em 1.4em}#seopress_cpt #tabs-6 #wrap-videos .video:last-child .accordion-section-content,#seopress_cpt #tabs-6 #wrap-videos .video:last-child .accordion-section-title{border-bottom:1px solid #eee}#seopress_cpt #tabs-6 #wrap-videos .video .inside{padding:0}#seopress_cpt #tabs-4 #seopress_redirections_enabled,#seopress_cpt #tabs-5 #seopress_news_disabled,#seopress_cpt #tabs-5 #seopress_news_standout,#seopress_cpt #tabs-6 #seopress_video_disabled,#seopress_cpt #tabs-6 .family-friendly label,#seopress_cpt #tabs-6 .internal_video label{font-weight:400}#seopress_cpt #tabs-6 #wrap-videos .video:nth-child(odd){background:#fdfdfd}#seopress_content_analysis .advise,#seopress_cpt .advise,#seopress_pro_cpt .advise,.seopress-option .advise{margin:5px;display:block;color:red;font-style:italic}#seopress_cpt #tabs-6 #wrap-videos .video .advise{color:#555}#seopress_content_analysis .mandatory,#seopress_cpt .mandatory{color:#c00}#seopress_cpt .box-left{float:left;width:49%;margin-right:1%}#seopress_cpt .box-right{float:left;width:49%;margin-left:1%}#seopress_cpt #tabs-3 .box-left{width:44%}#seopress_cpt #tabs-3 .box-right{width:54%}@media only screen and (max-width:1200px){#seopress_cpt .box-left,#seopress_cpt .box-right{float:none;width:100%;margin:0}}@media only screen and (max-width:1500px){#seopress_cpt #tabs-3 .box-left,#seopress_cpt #tabs-3 .box-right{float:none;width:100%;margin:0}}#edittag #seopress_cpt #tabs-3 .box-left,#edittag #seopress_cpt #tabs-3 .box-right{float:none;width:100%;margin:0}#seopress-tabs .seopress_media_upload,#seopress_pro_cpt .seopress_media_upload{margin-top:.5rem}#seopress_cpt .google-snippet-preview{font-family:arial,sans-serif;word-break:break-all}#seopress_cpt .google-snippet-preview.mobile-preview .wrap-snippet{margin:0 0 10px 0;box-shadow:0 1px 6px rgba(32,33,36,.28);border-radius:8px;padding:12px 16px}#seopress_cpt .google-snippet-preview>p{word-break:normal}#seopress_cpt .google-snippet-preview .snippet-title,#seopress_cpt .google-snippet-preview .snippet-title-custom,#seopress_cpt .google-snippet-preview .snippet-title-default{color:#1a0dab;font-size:18px;font-weight:400;line-height:21.6px}#seopress_cpt .google-snippet-preview.mobile-preview .snippet-title,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-title-custom,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-title-default{font-size:16px;line-height:20px;margin-bottom:12px}#seopress_cpt .google-snippet-preview .snippet-permalink{color:#006621;font-size:14px;font-style:normal;font-weight:400;line-height:16px;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}#seopress_cpt .google-snippet-preview .wrap-snippet .wrap-m-icon-permalink,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-permalink{display:none}#seopress_cpt .google-snippet-preview.mobile-preview .wrap-m-icon-permalink{overflow:hidden;text-overflow:ellipsis;white-space:nowrap;margin-bottom:12px;display:flex}#seopress_cpt .google-snippet-preview.mobile-preview .wrap-m-icon-permalink .snippet-permalink{display:block;color:#3c4043;font-size:12px}#seopress_cpt .google-snippet-preview.mobile-preview .snippet-favicon{margin-right:12px;vertical-align:middle}#seopress_cpt .google-snippet-preview.mobile-preview .snippet-favicon img{width:16px;height:16px;max-width:inherit}#seopress_cpt .google-snippet-preview.mobile-preview .wrap-snippet .snippet-permalink:first-child{color:#3c4043;white-space:nowrap;font-size:12px;display:block}#seopress_cpt .google-snippet-preview .snippet-description,#seopress_cpt .google-snippet-preview .snippet-description-custom,#seopress_cpt .google-snippet-preview .snippet-description-default{color:#545454;font-size:14px;font-weight:400;line-height:18.2px;display:inline}#seopress_cpt .google-snippet-preview.mobile-preview .snippet-description,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-description-custom,#seopress_cpt .google-snippet-preview.mobile-preview .snippet-description-default{color:#3c4043;font-size:14px;line-height:20px}#seopress_cpt .google-snippet-preview .snippet-date{color:grey;display:inline}#seopress_cpt .facebook-snippet-box{color:#4b4f56;font-size:14px;width:524px}#seopress_cpt .facebook-snippet-box .notice,#seopress_cpt .twitter-snippet-box .notice{padding:10px 14px;margin:0 0 10px 0;box-sizing:border-box;width:100%}#seopress_cpt .facebook-snippet-box .notice span,#seopress_cpt .twitter-snippet-box .notice span{font-weight:700}#seopress_cpt .snippet-meta{display:flex;overflow:hidden;max-height:12px}#seopress_cpt .fb-by,#seopress_cpt .snippet-fb-site-name,#seopress_cpt .snippet-fb-url{color:#606770;font-size:12px;white-space:normal;line-height:11px;text-transform:uppercase;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis}#seopress_cpt .fb-sep{padding-left:5px;padding-right:5px;color:#606770;line-height:11px;font-size:12px}#seopress_cpt .facebook-snippet-box .facebook-snippet-text{border:1px solid #dadde1;background-color:#f2f3f5;padding:10px 12px}#seopress_cpt .facebook-snippet-box .title-desc{max-height:46px;overflow:hidden}#seopress_cpt .facebook-snippet-box .snippet-fb-title,#seopress_cpt .facebook-snippet-box .snippet-fb-title-custom,#seopress_cpt .facebook-snippet-box .snippet-fb-title-default{font-size:16px;line-height:20px;margin:3px 0 0;padding-top:2px;color:#1d2129;font-weight:700;overflow:hidden;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis;white-space:normal;word-break:break-word;max-height:22px}#seopress_cpt .facebook-snippet-box .snippet-fb-description,#seopress_cpt .facebook-snippet-box .snippet-fb-description-custom,#seopress_cpt .facebook-snippet-box .snippet-fb-description-default{color:#606770;font-size:14px;line-height:20px;word-break:break-word;font-family:Helvetica,Arial,sans-serif;max-height:80px;overflow:hidden;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis;white-space:normal;width:100%}#seopress_cpt .facebook-snippet-box img{display:block;height:274px;width:524px;object-fit:cover;background-color:#edeff0;text-align:center;border-bottom:none}#seopress_cpt .twitter-snippet-box{color:#4b4f56;font-size:14px;width:436px}#seopress_cpt .snippet-twitter-url{color:#8899a6;font-size:14px;white-space:normal;line-height:11px;text-transform:uppercase;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis}#seopress_cpt .twitter-snippet-box .twitter-snippet-text{border:1px solid #dadde1;background-color:#fff;padding:10px 12px;border-radius:0 0 10px 10px}#seopress_cpt .twitter-snippet-box .title-desc{max-height:46px;overflow:hidden}#seopress_cpt .twitter-snippet-box .snippet-twitter-img,#seopress_cpt .twitter-snippet-box .snippet-twitter-img-custom,#seopress_cpt .twitter-snippet-box .snippet-twitter-img-default{border-radius:10px 10px 0 0;overflow:hidden}#seopress_cpt .twitter-snippet-box .snippet-twitter-title,#seopress_cpt .twitter-snippet-box .snippet-twitter-title-custom,#seopress_cpt .twitter-snippet-box .snippet-twitter-title-default{font-size:1em;line-height:20px;margin-bottom:5px;max-height:1.3em;color:#000;font-weight:700;overflow:hidden;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis;white-space:normal;word-break:break-word}#seopress_cpt .twitter-snippet-box .snippet-twitter-description,#seopress_cpt .twitter-snippet-box .snippet-twitter-description-custom,#seopress_cpt .twitter-snippet-box .snippet-twitter-description-default{color:#000;font-size:14px;line-height:20px;word-break:break-word;font-family:Helvetica,Arial,sans-serif;max-height:80px;overflow:hidden;-webkit-box-orient:vertical;display:-webkit-box;text-overflow:ellipsis;white-space:normal;width:100%}#seopress_cpt .twitter-snippet-box img{display:block;height:200px;width:436px;object-fit:cover;background-color:#edeff0;text-align:center;border-bottom:none}#seopress_cpt .wrap-seopress-counters,#seopress_pro_cpt .wrap-seopress-counters,.seopress-setup .wrap-seopress-counters,.seopress-styles .wrap-seopress-counters{text-align:right;background:#e9ecef;padding:2px 5px;display:flex;font-size:12px;justify-content:flex-end;border-radius:0 0 .25rem .25rem}#seopress_cpt .sp-progress,#seopress_pro_cpt .sp-progress,.seopress-setup .sp-progress,.seopress-styles .sp-progress{display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem .25rem 0 0}#seopress_cpt .sp-progress-bar,#seopress_pro_cpt .sp-progress-bar,.seopress-setup .sp-progress-bar,.seopress-styles .sp-progress-bar{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#0085ba;transition:width .6s ease}#seopress_cpt #seopress_titles_desc_counters,#seopress_cpt #seopress_titles_title_counters,#seopress_pro_cpt #seopress_rich_snippets_articles_counters,#seopress_pro_cpt #seopress_rich_snippets_courses_counters{display:inline;margin-right:5px}#seopress_cpt #seopress_titles_desc_counters_val,#seopress_cpt #seopress_titles_title_counters_val,#seopress_pro_cpt #seopress_rich_snippets_articles_counters_val,#seopress_pro_cpt #seopress_rich_snippets_courses_counters_val{display:inline;font-weight:700}#term-seopress #seopress_cpt{width:95%}.fixed .column-seopress_ps,.fixed .column-seopress_score,.fixed .column-seopress_w3c,.fixed .column-seopress_words{width:6%}.fixed .column-seopress_nofollow,.fixed .column-seopress_noindex{width:8%}@media only screen and (max-width:1200px){.fixed .column-seopress_nofollow,.fixed .column-seopress_noindex,.fixed .column-seopress_ps,.fixed .column-seopress_score,.fixed .column-seopress_w3c,.fixed .column-seopress_words{width:10%}}#seopress_cpt .ui-tabs{position:relative;padding:0;border:none;font-family:inherit;font-size:inherit;display:inline-block;width:100%}#seopress_cpt .ui-tabs .ui-tabs-nav li{list-style:none;display:inline-block;position:relative;top:2px;padding:0 5px;white-space:nowrap;margin:0;border:none;background:0 0}#seopress_cpt .ui-tabs .ui-tabs-nav li a{display:inline-block;padding:5px 10px}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-nav li a,#seopress_cpt .ui-tabs-vertical .ui-tabs-nav li a{display:block}#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:2px;padding-bottom:1px}#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-state-disabled a,#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-tabs-active a,#seopress_cpt .ui-tabs .ui-tabs-nav li.ui-tabs-loading a{color:#191e23;font-weight:700}#seopress_cpt .ui-tabs .ui-tabs-nav li a,#seopress_cpt .ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a{cursor:pointer;color:#191e23;text-decoration:none;height:40px;line-height:40px}#seopress_cpt .ui-tabs-vertical{width:55em}#seopress_cpt .ui-tabs-vertical .ui-tabs-nav{padding:.2em .1em .2em .2em;float:left;width:12em}#seopress_cpt .ui-tabs-vertical .ui-tabs-nav li{clear:left;width:100%;border-bottom-width:1px!important;border-right-width:0!important;margin:0 -1px .2em 0}#seopress_cpt .ui-tabs-vertical .ui-tabs-nav li.ui-tabs-active{padding-bottom:0;padding-right:.1em;border-right-width:1px}#seopress_cpt .ui-tabs-vertical .ui-tabs-panel{padding:1em;float:right;width:40em}#seopress_cpt .ui-tabs .ui-tabs-nav li a .dashicons{margin-right:2px}#tab-panel-seopress_titles_help_tab li span{font-weight:700;margin-right:10px}#seopress_content_analysis .dashicons-no-alt,#seopress_content_analysis .dashicons-yes,#seopress_pro_cpt .dashicons-no-alt,#seopress_pro_cpt .dashicons-yes{color:#fff;background:#12bd10;border-radius:50px;margin-right:10px}#seopress_content_analysis .dashicons-no-alt,#seopress_pro_cpt .dashicons-no-alt{background:#e25950}body.seopress-styles{background:#f8fafd}#seopress-admin-tabs.ui-tabs{position:relative;padding:.2em;border:none;font-family:inherit;font-size:inherit}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:0;margin:-1px .2em 0 0;padding:0;white-space:nowrap;border:none;background:0 0}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li a{float:left;padding:.38em 1em .75rem;outline:0;border-bottom:2px solid #fff}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:-1px}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li.ui-state-disabled a,#seopress-admin-tabs.ui-tabs .ui-tabs-nav li.ui-tabs-active a,#seopress-admin-tabs.ui-tabs .ui-tabs-nav li.ui-tabs-loading a{cursor:text;border-bottom:2px solid #23282d;color:#23282d}#seopress-admin-tabs.ui-tabs .ui-tabs-nav li a,#seopress-admin-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a{cursor:pointer;color:#0073aa;text-decoration:none}#seopress-admin-tabs.ui-tabs-vertical{width:55em}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-nav{padding:.2em .1em .2em .2em;float:left;width:12em}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-nav li{clear:left;width:100%;border-bottom-width:1px!important;border-right-width:0!important;margin:0 -1px .2em 0}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-nav li.ui-tabs-active{padding-bottom:0;padding-right:.1em;border-right-width:1px}#seopress-admin-tabs.ui-tabs-vertical .ui-tabs-panel{padding:1em;float:right;width:40em}.seopress-styles .seopress-option{margin:10px auto 0;max-width:90%;padding:1rem;background:#fff;box-shadow:0 15px 35px rgba(50,50,93,.1),0 5px 15px rgba(0,0,0,.1);border-radius:4px}.seopress-styles .seopress-option h1{font-size:16px;font-weight:700;color:#3297d3;text-transform:uppercase;z-index:100;border-bottom:1px solid RGB(238,238,238);padding-bottom:20px}.seopress-styles .seopress-option h1 .dashicons,.seopress-styles .seopress-option h2 .dashicons{margin:0 10px;font-size:40px;width:40px;height:40px;vertical-align:middle}.seopress-styles .seopress-option .link-archive{font-size:14px}.seopress-styles .seopress-option .link-archive .dashicons{font-size:18px;width:20px;height:20px;margin:inherit}.seopress-styles .seopress-option h1>.dashicons{font-size:30px;width:30px;height:30px;background:#c4f0ff;border-radius:6px;padding:10px;margin-left:10px;color:#0085ba}.seopress-styles .seopress-option .metabox-holder h2 .dashicons{font-size:16px}.seopress-option h1 .feature-state .dashicons{font-size:16px;width:16px;height:16px;vertical-align:middle;margin:0 10px 0 0}#seopress-admin-tabs.wrap{display:block;box-shadow:0 7px 14px 0 rgba(60,66,87,.12),0 3px 6px 0 rgba(0,0,0,.12);width:64rem;max-width:100%;margin:0 auto}@media only screen and (max-width:1024px){#seopress-admin-tabs.wrap{width:100%}}.seopress-styles .seopress-option .submit{background:#fff;text-align:center;border-top:1px solid #f1f1f1;padding-top:20px;padding-bottom:20px;margin:0}.seopress-styles .seopress-option #seopress-aio-migrate,.seopress-styles .seopress-option #seopress-rk-migrate,.seopress-styles .seopress-option #seopress-seo-framework-migrate,.seopress-styles .seopress-option #seopress-squirrly-migrate,.seopress-styles .seopress-option #seopress-yoast-migrate,.seopress-styles .seopress-option #submit{color:#fff;text-decoration:none;border:none;border-radius:4px;padding-right:20px;padding-left:20px;line-height:34px;text-transform:uppercase;min-height:34px;transition:all .3s linear;text-shadow:none;box-shadow:0 7px 14px rgba(50,50,93,.1),0 3px 6px rgba(0,0,0,.1);margin-right:15px;background:RGB(106,124,148);position:relative;height:auto;z-index:10}.seopress-styles .seopress-option #seopress-aio-migrate:hover,.seopress-styles .seopress-option #seopress-rk-migrate:hover,.seopress-styles .seopress-option #seopress-seo-framework-migrate:hover,.seopress-styles .seopress-option #seopress-squirrly-migrate:hover,.seopress-styles .seopress-option #seopress-yoast-migrate:hover,.seopress-styles .seopress-option #submit:hover{text-decoration:none;color:#fff;background:#232323}.seopress-styles #wpcontent{padding-left:0}.seopress-styles pre{color:#42b72a;background:#f5f6f7;font-family:Menlo,Monaco,Andale Mono,Courier New,monospace;padding:7px}.seopress-styles #seopress-navbar{padding:10px .5rem;height:60px;margin:0 auto;width:64rem;box-sizing:border-box;position:relative;max-width:100%}#seopress-header{margin:0 auto;position:relative;width:90%;padding:1rem}#seopress-header #seopress-admin h1{line-height:40px;margin:0;display:inline-block;height:40px;width:40px;background-size:100%;background-repeat:no-repeat}#seopress-header #seopress-admin h1::before{font-size:14px;line-height:40px;position:absolute;border-radius:6px;font-weight:400;color:#fff;width:40px;height:40px;text-align:center;background:#3a4afb;background:-moz-linear-gradient(45deg,rgba(58,74,251,1) 0,rgba(71,190,165,1) 100%);background:-webkit-linear-gradient(45deg,rgba(58,74,251,1) 0,rgba(71,190,165,1) 100%);background:linear-gradient(45deg,rgba(58,74,251,1) 0,rgba(71,190,165,1) 100%)}#seopress-header #seopress-admin h1:hover{cursor:pointer}#seopress-header #seopress-admin h1>a{text-decoration:none;color:inherit}#seopress-header #seopress-admin .seopress-quick-access{background:#fff;box-shadow:0 50px 100px rgba(50,50,93,.1),0 15px 35px rgba(50,50,93,.2),0 5px 15px rgba(0,0,0,.1);border-radius:4px;overflow:hidden;position:absolute;font-size:17px;line-height:40px;white-space:nowrap;transform:rotate3d(1,1,0,-15deg);transform-origin:100% 0;opacity:0;will-change:transform,opacity;transition-property:transform,opacity;transition-duration:.25s;z-index:300;padding:0;display:inline-block;width:100%;top:52px;visibility:hidden;cursor:auto;left:-.5rem}#seopress-header #seopress-admin h1:hover .seopress-quick-access{transform:none;opacity:1;pointer-events:auto;visibility:visible}#seopress-header #seopress-admin .seopress-quick-access>ul{margin:0;box-sizing:border-box;display:grid;grid-gap:0 10px;grid-template-columns:repeat(2,1fr);padding:20px}@media only screen and (max-width:1024px){#seopress-header #seopress-admin .seopress-quick-access>ul{grid-template-columns:repeat(1,1fr)}}#seopress-header #seopress-admin h1 .seopress-quick-access li{line-height:40px;margin:0;display:inline-block;height:40px;background-size:100%;background-repeat:no-repeat}#seopress-header #seopress-admin h1 .seopress-quick-access li .dashicons{vertical-align:middle;background:#b7e1f3;border-radius:50%;padding:5px;margin-right:15px}#seopress-header #seopress-admin h1 .seopress-quick-access li a{text-decoration:none;font-size:15px;line-height:30px;text-transform:uppercase;display:block;width:100%;transition:all .3s linear;color:#3297d3}#seopress-header #seopress-admin h1 .seopress-quick-access li a:hover{color:#647a88}#seopress-header #seopress-admin h1 .seopress-info-version{position:relative;left:50px;top:0;font-size:14px;width:100px;display:block}#seopress-header #seopress-admin .wpc-info-version{font-size:14px;left:310px;position:absolute;text-indent:0;top:85px}#seopress-header #seopress-notice{float:right;line-height:40px}#seopress-header #seopress-notice p{font-size:16px}#seopress-header #seopress-notice .dashicons{color:#6f8096;text-decoration:none;line-height:40px}#seopress-header #seopress-notice div.small{font-size:13px;display:inline}#seopress-footer-credits{font-style:italic}#seopress-footer-credits .wporg-ratings{display:inline}#seopress-footer-credits .wporg-ratings a{text-decoration:none}.seopress-option .seopress-settings{float:left;max-width:750px;width:100%}.seopress-option #seopress-edd-license-btn,.seopress-option #seopress-refresh{float:left}.wp-admin-ui_page_seopress-import-export .postbox{margin-right:20px}.seopress-option #side-sortables .accordion-section-content{padding:0}.seopress-option .seopress-settings label{margin:0 0 0 10px}.wrap-seopress-tab-content{position:relative;display:block;width:100%;max-width:64rem;margin:0 auto;box-sizing:border-box}#seopress-admin-tabs .seopress-tab{padding:1.5rem;visibility:hidden;overflow:hidden;opacity:0;transition:all .2s ease;transform:translateX(-15px);position:absolute;top:0;box-sizing:border-box}#seopress-admin-tabs .seopress-tab.active{visibility:visible;overflow:inherit;opacity:1;transform:translateX(0);display:inherit;position:relative}#seopress-tabs .seopress-tab{padding:0 1.5rem;width:calc(100% - 230px);display:none}@media only screen and (max-width:1024px){#seopress-tabs .seopress-tab{width:100%}}#seopress-tabs .seopress-tab.active{display:inline-block;border-left:1px solid RGB(238,238,238)}@media only screen and (max-width:782px){#seopress-tabs .seopress-tab.active{width:100%;padding:0;border-left:none;border-top:1px solid RGB(238,238,238)}}.seopress-option input[type=password],.seopress-option input[type=text],.seopress-option textarea{min-width:485px}@media only screen and (max-width:1024px){.seopress-option input[type=password],.seopress-option input[type=text],.seopress-option textarea{min-width:inherit;width:100%}}#seopress_htaccess_file{width:100%}.seopress-option textarea{min-height:100px}.seopress-option #side-sortables .highlight{border:1px dashed #ccc;display:block;width:382px;height:40px;background:0 0}.seopress-option #side-sortables .accordion-section{margin-bottom:9px;width:382px}.seopress-option #side-sortables .accordion-section h3{cursor:move;border:1px solid #e5e5e5;background:#fafafa}.seopress-option #side-sortables .accordion-section .inside{padding:10px 10px 24px;border-width:0 1px 1px;border-style:solid;box-shadow:0 1px 1px rgba(0,0,0,.04);border-color:#e5e5e5;display:inline-block;width:calc(100% - 22px);height:100%}.seopress-option #side-sortables .accordion-section .inside ul{padding-left:10px;margin-bottom:0;padding-top:2px;padding-bottom:2px}.seopress-option #side-sortables .accordion-section .inside ul li{border-left:2px solid #ccc;padding-left:10px;margin-bottom:10px}.seopress-option #side-sortables .accordion-section .inside ul li:first-child{border-bottom:1px dotted #e5e5e5;border-left:0;padding-bottom:10px;font-weight:700;margin-left:-15px;margin-bottom:10px}.seopress-notice #message{margin:5px 10px 2px 0}#seopress-notice a{position:relative;text-decoration:none;margin:0 0 0 .3rem}#seopress-notice a .tooltip{white-space:pre;z-index:200;padding:2px 5px;font-weight:500;font-size:12px;color:#aab7c4;background:#fff;box-shadow:0 1px 2px 0 rgba(49,49,93,.1),0 0 1px 0 rgba(0,0,0,.1);border-radius:2px;position:absolute;opacity:0;top:30px;transition:opacity .2s ease;visibility:hidden;line-height:20px;left:-100%;overflow:hidden}#seopress-notice a:hover .tooltip{opacity:1;visibility:visible}.seopress-page-list{margin:1.5rem auto}.seopress-option .dashicons,.seopress-page-list .dashicons{vertical-align:middle;margin-right:5px;color:#6f8096}#seopress-admin-tabs .ui-tabs-nav,#seopress-notifications-center,.seopress-get-started,.seopress-page-list .seopress-feature,.seopress-useful-tools{margin:0 auto 20px;max-width:64rem;padding:2rem;width:100%;border-radius:0 0 4px 4px;box-sizing:border-box}.seopress-get-started{margin-top:20px;background:#fff url(../img/bg-hero-support.svg) no-repeat 95% 50%/contain;position:relative;box-sizing:border-box;box-shadow:0 7px 14px 0 rgba(60,66,87,.12),0 3px 6px 0 rgba(0,0,0,.12)}.seopress-get-started .inside{max-width:calc(100% - 380px)}@media only screen and (max-width:782px){.seopress-get-started{background:#fff}.seopress-get-started .inside{max-width:100%}}.seopress-get-started .preheader{text-transform:uppercase;font-size:.8rem;font-weight:600}.seopress-get-started h2{font-size:1.85em;margin:15px 0 0 0;font-weight:400}.seopress-get-started p{margin-bottom:20px}.seopress-get-started a .dashicons{vertical-align:middle;text-decoration:none;color:#6a7c94}.seopress-get-started a.button-primary .dashicons{color:#fff}.seopress-get-started a.btn-link .dashicons{margin-right:5px}.seopress-get-started a.btn-link{margin:0 0 0 10px}#seopress-notifications-center,.seopress-useful-tools{background:#fff;padding:0}.seopress-page-list .seopress-feature{padding:0;position:relative;overflow:hidden;transition-duration:.15s;display:flex;margin:0;background:#fff;box-shadow:0 7px 14px 0 rgba(60,66,87,.12),0 3px 6px 0 rgba(0,0,0,.12);flex-wrap:wrap;border-radius:4px;width:100%;height:100%}.seopress-page-list .seopress-feature p{color:#6b7c93;font-size:14px;margin-bottom:30px}#seopress-notifications-center{margin-top:0}#seopress-admin-tabs .ui-tabs-nav{display:flex;padding-top:1rem;padding-bottom:0}.seopress-page-list .seopress-feature .img-tool{height:50px;width:50px;background:#c4f0ff;position:relative;border-radius:6px}.seopress-page-list .seopress-feature .img-tool .dashicons{color:#217ab7;font-size:30px;text-align:left;vertical-align:middle;width:100%;height:100%;position:absolute;top:calc(50% - 15px);left:calc(50% - 15px);margin:0}.seopress-page-list .seopress-feature .inner{margin:0;display:inline-block;padding:1.5rem;width:100%;height:100%;box-sizing:border-box}.seopress-page-list .seopress-feature h3{margin:1rem 0 0 0;font-size:16px;font-weight:700;color:#3297d3;text-transform:uppercase}.seopress-page-list .seopress-feature h3 .dashicons{font-size:16px;margin-left:5px;vertical-align:middle}#seopress-content .seopress-page-list .seopress-feature a,#seopress-notifications-center .seopress-alert .button-primary,.seopress-get-started .button-primary,.seopress-option .seopress-feature a,.seopress-useful-tools .widget .button-primary{color:#fff;text-decoration:none;border:none;border-radius:4px;padding-right:20px;padding-left:20px;line-height:34px;text-transform:uppercase;min-height:34px;transition:all .3s linear;text-shadow:none;box-shadow:0 7px 14px rgba(50,50,93,.1),0 3px 6px rgba(0,0,0,.1);background:#6a7c94;position:relative;height:auto;display:flex;flex-wrap:wrap}#seopress-content .seopress-page-list .seopress-feature a.button-secondary{padding-left:30px}#seopress-content .seopress-page-list .seopress-feature a.button-secondary::before,#seopress-notifications-center .seopress-alert .button-primary::after{content:"\f111";font-family:Dashicons;position:absolute;left:10px;top:1px;-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;font-size:16px}#seopress-content .seopress-page-list .wrap-btn{display:inline-flex;margin-bottom:2rem;flex-direction:column}#seopress-content .seopress-page-list .seopress-feature a.view-redirects,#seopress-notifications-center .seopress-alert .button-primary,.seopress-get-started .button,.seopress-option .button{color:#6a7c94;background:#fff;font-weight:500;transition:all .3s linear;text-shadow:none;text-transform:uppercase;padding-right:20px;padding-left:20px;line-height:34px;min-height:34px;margin:10px 0;border-radius:4px;box-shadow:transparent 0 0 0 0,transparent 0 0 0 0,rgba(0,0,0,.12) 0 1px 1px 0,rgba(60,66,87,.16) 0 0 0 1px,transparent 0 0 0 0,transparent 0 0 0 0,rgba(60,66,87,.12) 0 2px 5px 0;vertical-align:baseline;display:inline-flex;align-items:center;border:none;margin-right:.5rem;cursor:pointer}.seopress-get-started .button{color:#fff;background:#6259e6;box-shadow:none}.seopress-option .wp-picker-container button{box-shadow:none;border:1px solid #0071a1;border-radius:3px;background:#f3f5f6;text-transform:none}.seopress-option .wp-picker-container input[type=text].wp-color-picker{min-width:inherit}.seopress-option .wp-picker-container .wp-picker-default{margin:0}.seopress-option .wp-picker-container .wp-picker-clear{box-shadow:none;text-transform:none;border-radius:0;background:0 0;margin:0}.seopress-option .wp-picker-container .wp-picker-clear:hover{background:0 0;text-decoration:currentColor;color:inherit}.seopress-option .button .dashicons{font-size:16px;align-items:center;display:flex}#seopress-content .seopress-page-list .seopress-feature a.view-redirects{padding-left:30px}#seopress-notifications-center .seopress-alert .button-primary::after{content:"\f344";left:inherit;right:10px}#seopress-content .seopress-page-list .seopress-feature a.view-redirects::before{content:"\f177"}#seopress-content .seopress-page-list .seopress-feature a:hover,#seopress-notifications-center .seopress-alert .button-primary:hover,.seopress-get-started .button-primary:hover,.seopress-option .button:hover,.seopress-option .seopress-feature a:hover,.seopress-useful-tools .widget .button-primary:hover{text-decoration:none;color:#fff;background:#232323}.seopress-get-started .button .dashicons{transition:all .3s linear}.seopress-get-started .button:hover .dashicons{color:#fff}#seopress-content .seopress-page-list .seopress-feature .seopress-doc:focus,#seopress-content .seopress-page-list .seopress-feature a:focus,#seopress-content .seopress-page-list .seopress-feature a:focus.button-secondary,#seopress-content a:focus,#seopress-notifications-center .seopress-alert .button-primary:focus,.seopress-option #seopress-tabs .seopress-doc:focus,.seopress-option .seopress-feature a:focus,.seopress-styles .seopress-option #seopress-aio-migrate:focus,.seopress-styles .seopress-option #seopress-yoast-migrate:focus,.seopress-styles .seopress-option #submit:focus,.seopress-useful-tools .widget .button-primary:focus{box-shadow:0 1px 0 #0073aa,0 0 2px 1px #33b3db;background:#008ec2;border-color:#006799;color:#fff}#seopress-admin-tabs .nav-tab-wrapper a.nav-tab-active:focus{color:inherit}#seopress-notifications-center .seopress-alert .button-primary{margin:5px 0;padding-right:30px}#seopress-notifications-center h2,.seopress-useful-tools h2{margin:5px 0 15px 5px;display:inline-block;width:100%}#seopress-notifications-center .dashicons,.seopress-useful-tools .dashicons{margin-right:10px}#seopress-notifications-center .seopress-alert{padding:1.5rem 2rem 1.2rem 1rem;border-bottom:1px solid #e6ebf1;width:calc(100% - 3rem);flex:1 1 auto;position:relative;transition:all 150ms ease;align-items:center;display:flex;justify-content:space-between}#seopress-notifications-center .seopress-alert:last-child{margin-bottom:0;border-bottom:none}#seopress-notifications-center .seopress-alert:hover{cursor:default}#seopress-notifications-center .dashicons{display:flex;align-self:normal;width:48px;height:48px;color:#d7dade;font-size:48px;padding:0 1rem}#seopress-notifications-center .seopress-alert p{margin:0}#seopress-notifications-center .notice-left{flex:1}#seopress-notifications-center .notice-left>p:first-child{color:#1a1f36;font-weight:500}#seopress-notifications-center .notice-right{padding:1rem 0 0 0;display:flex}#seopress-notifications-center .seopress-alert.impact::after{content:"";width:10px;height:10px;border-radius:50px;position:absolute;right:1rem;top:1rem}#seopress-notifications-center .seopress-alert.impact.low::after{background:#ffde24}#seopress-notifications-center .seopress-alert.impact.medium::after{background:#e39f48}#seopress-notifications-center .seopress-alert.impact.high::after{background:#e25950}#seopress-notifications-center .seopress-alert.impact.info::after{background:#0085ba}#seopress-notifications-center .seopress-alert.dashicons{color:#6f8096}#seopress-notifications-center .dashicons.remove-notice,.seopress-get-started .remove-notice{position:absolute;right:0;color:#6b7c93;font-size:20px;height:30px;width:30px;vertical-align:middle;top:1.2rem;line-height:30px;padding:5px;transition:all .3s linear;margin:0;display:block}.seopress-get-started .remove-notice{top:10px;right:10px}#seopress-notifications-center .dashicons.remove-notice:hover,.seopress-get-started .remove-notice:hover{color:#1a1f36;cursor:pointer}#seopress-content .seopress-page-list .seopress-feature .seopress-doc,.seopress-option #seopress-tabs .seopress-doc{background:0 0;padding:0;text-decoration:none;color:inherit;box-shadow:none;position:absolute;right:.5rem;top:1rem}#seopress-content .seopress-page-list .seopress-feature .seopress-doc:active,#seopress-content .seopress-page-list .seopress-feature .seopress-doc:focus,#seopress-content .seopress-page-list .seopress-feature .seopress-doc:hover,.seopress-option #seopress-tabs .seopress-doc:active,.seopress-option #seopress-tabs .seopress-doc:focus,.seopress-option #seopress-tabs .seopress-doc:hover{color:#747474;background:0 0;box-shadow:none;border:none}#seopress-content .seopress-page-list .seopress-feature .seopress-doc:hover .dashicons{color:#232323}.seopress-option .seopress-table{background:#fff;border:1px solid #ccc}.seopress-option .seopress-table th{padding:15px 10px;vertical-align:middle}.wp-admin-ui_page_seopress-roles .seopress-option .seopress-table th{min-width:200px}.seopress-option .seopress-table .seopress-settings-section{background:#f1f1f1}.seopress-option .seopress-table .seopress-table-head .seopress-feature{border-bottom:1px solid #ccc;font-weight:700;background:#f1f1f1}#seopress-content .feature-state,.seopress-option .feature-state{font-style:italic;font-size:10px;display:inline-block;background:rgba(0,140,135,.1);padding:2px 10px;border-radius:25px;color:#444;font-weight:400;text-transform:none;-moz-osx-font-smoothing:initial;-webkit-font-smoothing:initial}@media only screen and (max-width:782px){#seopress-content .feature-state,.seopress-option .feature-state{display:none}}.seopress-option .seopress_wrap_single_cpt .feature-state,.seopress-option .seopress_wrap_tax .feature-state{padding:2px 12px;margin:0 0 .5rem .5rem}.seopress-option #tab_seopress_titles_archives h2,.seopress-option #tab_seopress_titles_single h2,.seopress-option #tab_seopress_titles_tax h2{margin:2em 0 1em 0;border-top:1px solid #eee;padding:1em 0 0 0}.seopress-option #tab_seopress_titles_archives h2:first-child,.seopress-option #tab_seopress_titles_single h2:first-child,.seopress-option #tab_seopress_titles_tax h2:first-child{border-top:none;margin:0 0 1em 0}#seopress_cpt .seopress-tag-dropdown,#seopress_cpt .tag-title,#seopress_pro_cpt .tag-title,.seopress-button,.seopress-option .tag-title{cursor:pointer;font-weight:500;border-radius:4px;transition:all .3s linear}#seopress-content .feature-state-on,#seopress-content .feature-state.feature-state-on,.seopress-option .feature-state-on,.seopress-option .feature-state.feature-state-on{display:inline-block}#seopress-content .feature-state-off,.seopress-option .feature-state-off{display:none}.seopress-option .postbox .inside li{list-style:square inside;padding-left:5px}#tab_seopress_page_speed .inside li{list-style:none;padding-left:0;word-break:break-word}.seopress-option .log{margin:0;text-transform:uppercase;display:inline-block;vertical-align:middle;padding:5px;color:rgba(19,191,17,1);font-style:italic}.seopress-option input[type=text].seopress-admin-menu-input{min-width:inherit;width:100%}.seopress_page_seopress-import-export .postbox{width:calc(100% - 20px)}#seopress_cpt .wrap-tags,#seopress_pro_cpt .wrap-tags,.seopress-option .wrap-tags{position:relative;display:inline-block;width:100%;margin-bottom:10px}#seopress_cpt .sp-wrap-tag-variables-list,#seopress_pro_cpt .sp-wrap-tag-variables-list{position:relative;float:left;display:none}#seopress_cpt .sp-tag-variables-list,#seopress_pro_cpt .sp-tag-variables-list{background:#fff;position:absolute;left:-42px;width:300px;border-radius:4px;z-index:100;top:20px;color:#6b7c93;box-shadow:0 0 0 .5px rgba(50,50,93,.17),0 2px 5px 0 rgba(50,50,93,.12),0 3px 9px 0 rgba(50,50,93,.08),0 1px 1.5px 0 rgba(0,0,0,.08),0 1px 2px 0 rgba(0,0,0,.08);height:300px;z-index:100;overflow:auto}#seopress_cpt #seopress_titles_title_meta{margin-bottom:.2rem}#seopress_cpt .sp-wrap-tag-variables-list.open,#seopress_pro_cpt .sp-wrap-tag-variables-list.open{display:block}#seopress_cpt .seopress-tag-single-all.seopress-tag-dropdown .dashicons,#seopress_cpt .seopress-tag-single-all.tag-title .dashicons,#seopress_pro_cpt .seopress-tag-single-all.tag-title .dashicons{margin:0;transition:all 150ms linear}#seopress_cpt .seopress-tag-single-all.open .dashicons,#seopress_pro_cpt .seopress-tag-single-all.open .dashicons{transform:rotateX(180deg)}#seopress_cpt .sp-tag-variables-list li,#seopress_pro_cpt .sp-tag-variables-list li{padding:8px 12px;cursor:pointer;margin:0;border-bottom:1px solid #f0f0f0}#seopress_cpt .sp-tag-variables-list li span,#seopress_pro_cpt .sp-tag-variables-list li span{display:block;font-weight:700;font-size:12px;margin-bottom:2px}#seopress_cpt .sp-tag-variables-list li:hover,#seopress_pro_cpt .sp-tag-variables-list li:hover{background:#0385ba;color:#fff}#seopress_cpt .sp-tag-variables-list li::after,#seopress_pro_cpt .sp-tag-variables-list li::after{content:attr(data-value);display:inline-block;background:#e9ecef;padding:1px 5px;color:#333;font-family:Menlo,Monaco,Andale Mono,Courier New,monospace;border-radius:3px;font-size:11px}#seopress_cpt .seopress-tag-dropdown .dashicons,#seopress_cpt .tag-title .dashicons,#seopress_pro_cpt .tag-title .dashicons,.seopress-option .tag-title .dashicons{padding:0;height:16px;width:16px;font-size:16px;margin-right:5px;vertical-align:middle}.seopress-overlay-tag-dropdown{position:absolute;display:none;top:0;left:0;width:100%;height:100%;z-index:50}.seopress-overlay-tag-dropdown.active{display:block}#seopress_cpt .seopress-tag-dropdown,#seopress_cpt .tag-title,#seopress_pro_cpt .tag-title,.seopress-option .tag-title{padding:4px 8px;position:relative;top:5px;left:0;font-size:11px;float:left;margin-right:5px;user-select:none;margin-bottom:5px;background:#fff;color:#6b7c93;box-shadow:0 0 0 .5px rgba(50,50,93,.17),0 2px 5px 0 rgba(50,50,93,.12),0 3px 9px 0 rgba(50,50,93,.08),0 1px 1.5px 0 rgba(0,0,0,.08),0 1px 2px 0 rgba(0,0,0,.08)}#seopress_cpt .seopress-tag-dropdown .tag-title:active,#seopress_cpt .tag-title:active,#seopress_cpt .tag-title:focus,#seopress_cpt .tag-title:hover,#seopress_cpt-option .seopress-tag-dropdown .tag-title:focus,#seopress_cpt-option .seopress-tag-dropdown .tag-title:hover,#seopress_pro_cpt .tag-title:active,#seopress_pro_cpt .tag-title:focus,#seopress_pro_cpt .tag-title:hover,.seopress-tag-dropdown:active,.seopress-tag-dropdown:focus,.seopress-tag-dropdown:hover{background:#232323;color:#fff;user-select:none}.seopress-button{text-transform:uppercase;background:#fff;border-color:#c8d7e1;border-style:solid;border-width:1px 1px 2px;color:#2e4453;display:inline-block;margin:0;outline:0;overflow:hidden;text-overflow:ellipsis;text-decoration:none;vertical-align:top;box-sizing:border-box;font-size:14px;line-height:20px;padding:6px 8px 6px;-webkit-appearance:none;-moz-appearance:none;appearance:none}.seopress-button:hover{border-color:#a8bece;color:#00a0d2}.seopress-button .dashicons{vertical-align:middle}#seopress-content #tab_seopress_seo_tools.seopress-useful-tools .widget{border-right:1px solid #e6ebf1;margin:0;padding:0 20px;width:calc(50% - 2px);box-sizing:border-box;display:inline-block;vertical-align:top}#seopress-content #tab_seopress_seo_tools.seopress-useful-tools .widget:first-child{width:100%;display:block;clear:both;border-right:none;border-bottom:1px solid #e6ebf1;padding-bottom:20px;margin-bottom:20px}#seopress-content #tab_seopress_seo_tools.seopress-useful-tools .widget:last-child{border-right:none}#seopress-content .seopress-useful-tools .widget-reverse ul{background:#fff}#seopress-content .seopress-useful-tools .widget-reverse li{padding:10px;margin:0;border-bottom:1px solid #e6ebf1}#seopress-content .seopress-useful-tools .widget-reverse li:hover{background:#f5f7fa}#seopress-content .seopress-useful-tools .widget-title{text-transform:uppercase;margin:0 0 10px;font-size:13px;padding:10px 0;color:#24b47e}#seopress-content .seopress-reverse label,#seopress-content .seopress-useful-tools .widget-whois ul li span{font-weight:700}#seopress-content #seopress-reverse-url{width:100%;margin:10px 0}#seopress-content .widget-reverse p{margin:0}.post-type-seopress_backlinks .wp-list-table .column-seopress_backlinks_url{width:35%}.post-type-seopress_backlinks .wp-list-table .column-seopress_backlinks_anchor_text{width:20%}.seopress-styles #screen-meta{margin:0;position:relative;background-color:#fff;border-bottom:0 solid #f2f2f2;border-top:none;-webkit-box-shadow:0 0 0 1px rgba(136,152,170,.1),0 15px 35px 0 rgba(49,49,93,.1),0 5px 15px 0 rgba(0,0,0,.08);box-shadow:0 0 0 1px rgba(136,152,170,.1),0 15px 35px 0 rgba(49,49,93,.1),0 5px 15px 0 rgba(0,0,0,.08);top:0}.seopress-styles #contextual-help-link-wrap,.seopress-styles #screen-options-link-wrap{float:right;height:28px;margin:0 0 0 6px;border:1px solid #f2f2f2;border-top:none;background:#fff;-webkit-box-shadow:0 0 0 1px rgba(136,152,170,.1),0 15px 35px 0 rgba(49,49,93,.1),0 5px 15px 0 rgba(0,0,0,.08);box-shadow:0 0 0 1px rgba(136,152,170,.1),0 15px 35px 0 rgba(49,49,93,.1),0 5px 15px 0 rgba(0,0,0,.08)}.seopress-styles #screen-meta-links .show-settings{box-shadow:none}.seopress-styles #screen-meta-links .screen-meta-toggle{position:relative;top:0;z-index:2000}.seopress-styles #contextual-help-back{background:#f8fafd}.seopress-styles .contextual-help-tabs .active{border-left:2px solid #3297d3;background:#f8fafd}#seopress-content input.toggle,#seopress_cpt input.toggle,.seopress-option input.toggle{max-height:0;max-width:0;opacity:0;position:relative}.seopress-feature input.toggle{display:block}.wrap-toggle-preview{position:relative}.wrap-toggle-preview p{font-weight:700;margin:0 0 1rem 0}#seopress_cpt input.toggle,.seopress_wrap_single_cpt input.toggle,.seopress_wrap_tax input.toggle{margin:0;border:none;min-width:0}#seopress_content_analysis span.label,#seopress_cpt span.label{outline:0;color:#fff;box-shadow:none;background:#555d66;padding:2px 4px;border-radius:4px;font-weight:700}#seopress_add_to_insights{margin-left:1rem}#seopress_add_to_insights_status{display:inline-block;font-weight:700;margin:0 0 0 1rem;vertical-align:middle;padding:.3rem;font-style:italic}#seopress-content input.toggle+label,#seopress_cpt #tabs-1 input.toggle+label,.seopress-option input.toggle+label{display:inline-block;position:relative;box-shadow:inset 0 0 0 1px #d5d5d5;text-indent:-5000px;height:20px;width:40px;border-radius:15px}#seopress_cpt #tabs-1 input.toggle+label{margin:0}.wrap-toggle-checkboxes input.toggle+label{float:left;margin-right:10px}#seopress-content input.toggle+label:before,#seopress_cpt input.toggle+label:before,.seopress-option input.toggle+label:before{content:"";position:absolute;display:block;height:20px;width:30px;top:0;left:0;border-radius:15px;background:rgba(19,191,17,0);-moz-transition:.25s ease-in-out;-webkit-transition:.25s ease-in-out;transition:.25s ease-in-out}#seopress-content input.toggle+label:after,#seopress_cpt input.toggle+label:after,.seopress-option input.toggle+label:after{content:"";position:absolute;display:block;height:20px;width:20px;top:0;left:0;border-radius:15px;background:#fff;box-shadow:inset 0 0 0 1px rgba(0,0,0,.2),0 2px 4px rgba(0,0,0,.2);-moz-transition:.25s ease-in-out;-webkit-transition:.25s ease-in-out;transition:.25s ease-in-out}#seopress_cpt input.toggle+label,#seopress_cpt input.toggle+label:before,.seopress_wrap_single_cpt input.toggle+label,.seopress_wrap_single_cpt input.toggle+label:before,.seopress_wrap_tax input.toggle+label,.seopress_wrap_tax input.toggle+label:before{width:40px;height:20px}#seopress_cpt input.toggle+label:after,.seopress_wrap_single_cpt input.toggle+label:after,.seopress_wrap_tax input.toggle+label:after{width:20px;height:20px}#seopress-content input.toggle[data-toggle="1"]+label:before,#seopress_cpt input.toggle[data-toggle="1"]+label:before,.seopress-option input.toggle[data-toggle="1"]+label:before{width:40px;background:#3197d3}#seopress_cpt input.toggle[data-toggle="1"]+label:before,.seopress_wrap_single_cpt input.toggle[data-toggle="1"]+label:before,.seopress_wrap_tax input.toggle[data-toggle="1"]+label:before{width:40px;background:#3197d3}#seopress-content input.toggle[data-toggle="1"]+label:after,#seopress_cpt input.toggle[data-toggle="1"]+label:after,.seopress-option input.toggle[data-toggle="1"]+label:after{left:20px;box-shadow:inset 0 0 0 1px #3197d3,0 2px 4px rgba(0,0,0,.2)}#seopress_cpt input.toggle[data-toggle="1"]+label:after,.seopress_wrap_single_cpt input.toggle[data-toggle="1"]+label:after,.seopress_wrap_tax input.toggle[data-toggle="1"]+label:after{box-shadow:inset 0 0 0 1px #3197d3,0 2px 4px rgba(0,0,0,.2)}#seopress-content .seopress-page-list{position:relative;display:grid;max-width:64rem;grid-gap:20px 20px;grid-template-columns:repeat(3,1fr)}@media only screen and (max-width:782px){#seopress-content .seopress-page-list{grid-template-columns:repeat(1,1fr)}}#seopress-notice-save{position:fixed;color:#fff;padding:15px 40px;font-size:.9rem;text-transform:uppercase;text-align:center;border-radius:0;background:rgba(74,184,102,.9);bottom:0;right:0;z-index:500;width:100%;font-weight:700}#seopress-notice-save .dashicons{color:#fff}.seopress-styles .wrap{margin:20px 0 0 0;display:flex;position:relative}.seopress-insights.seopress-styles .wrap,.toplevel_page_seopress-option.seopress-styles .wrap{display:inherit;position:inherit;margin:inherit}@media only screen and (max-width:782px){.seopress-styles .wrap{display:inherit;position:inherit;margin:inherit}}.seopress_page_seopress-pro-page #wpcontent{background:#f4f7fa}.seopress-option .wrap div.nav-tab-wrapper{margin:0 0 0 -26px;padding:0 0 0 10px;line-height:inherit;width:230px;z-index:95;font-weight:400;display:block;border-bottom:none}@media only screen and (max-width:782px){.seopress-option .wrap div.nav-tab-wrapper{width:100%;margin:0;padding:0}}#seopress-admin-tabs.wrap div.nav-tab-wrapper{margin:20px auto 0;max-width:64rem;width:100%;border-bottom:1px solid #e6ebf1;padding:0;line-height:inherit;position:-webkit-sticky;position:sticky;background:#f5f7fa;z-index:100;top:31px;border-radius:4px 4px 0 0;font-weight:400;overflow:hidden;display:flex;align-items:center;justify-content:space-between;box-sizing:border-box}@media only screen and (max-width:600px){#seopress-admin-tabs.wrap div.nav-tab-wrapper{top:0;display:block}}@media only screen and (max-width:1024px){#seopress-admin-tabs.wrap div.nav-tab-wrapper{display:block}}#seopress-admin-tabs #tab_seopress_notifications.seopress-tab{background:0 0;padding:0;border-radius:0}.seopress-option .nav-tab{border:0 solid #ccc;background:0 0;opacity:.5;padding:6px 30px 6px 10px;transition:opacity .3s linear;color:#191e23;margin:0;float:none;display:inline-block;width:100%;text-align:left;font-weight:400;box-sizing:border-box;white-space:normal}#seopress-admin-tabs .nav-tab{border:0 solid #ccc;background:0 0;opacity:.5;padding:14px 20px;transition:opacity .3s linear;color:#191e23;margin:0;box-shadow:inset -1px 0 #e3e8ee;float:none;display:inline-block;text-align:center;font-weight:400}#seopress-admin-tabs .nav-tab{width:100%}#seopress-admin-tabs .nav-tab-active,#seopress-admin-tabs .nav-tab-active:hover,.seopress-option .about-wrap h2 .nav-tab-active,.seopress-option .nav-tab-active,.seopress-option .nav-tab-active:hover{background-color:#fff}#seopress-admin-tabs .nav-tab-active,#seopress-admin-tabs .nav-tab-active:focus,#seopress-admin-tabs .nav-tab-active:focus:active,#seopress-admin-tabs .nav-tab-active:hover,#seopress-admin-tabs .nav-tab:focus,.nav-tab-active:focus,.seopress-option .nav-tab-active,.seopress-option .nav-tab-active:focus:active,.seopress-option .nav-tab-active:hover,.seopress-option .nav-tab:focus{opacity:1;outline:0;font-weight:600;position:relative;color:#191e23;border-left:3px solid #0085ba;background:rgba(0,133,186,.1)}#seopress-admin-tabs .nav-tab-active,#seopress-admin-tabs .nav-tab-active:focus,#seopress-admin-tabs .nav-tab-active:focus:active,#seopress-admin-tabs .nav-tab-active:hover,#seopress-admin-tabs .nav-tab:focus{border-bottom:3px solid #3197d3;border-left:none;background:#fff}#seopress-admin-tabs .nav-tab:hover,.seopress-option .nav-tab:hover{opacity:1}#seopress-admin-tabs .nav-tab:focus,.seopress-option .nav-tab:focus{outline:0;box-shadow:none}.seopress-option .section-tool{border:none;box-shadow:none;background:0 0;position:relative}.seopress-option .section-tool::after{content:'';background:#dedede;height:1px;width:100%;display:block}.seopress-option .sp-section-header{border-bottom:1px solid #eee;margin:0 0 1rem 0;width:100%;display:flex;position:relative;align-items:center;padding-bottom:.5rem}.seopress-option .sp-section-header::after{position:absolute;content:'';background:#0085ba;height:2px;width:40px;bottom:0;left:0}.seopress-option .sp-section-header h2{font-size:1.5em}.seopress-option .sp-section-header>.dashicons{color:#0085ba;padding:10px;border-radius:6px;margin-right:10px;background:#c4f0ff}.seopress-option .sp-section-header .wrap-toggle-checkboxes{display:flex}.seopress-styles .wrap .notice{margin:5px 0 15px 15px}#seopress-tabs.wrap .notice{margin:1rem 0}.seopress-BlankState a.button-primary,.seopress-BlankState button.button-primary,.seopress-message a.button-primary,.seopress-message button.button-primary{background:#6259e6;border-color:#6259e6;box-shadow:transparent 0 0 0 0,transparent 0 0 0 0,rgba(0,0,0,.12) 0 1px 1px 0,rgba(60,66,87,.16) 0 0 0 1px,transparent 0 0 0 0,transparent 0 0 0 0,rgba(60,66,87,.12) 0 2px 5px 0;color:#fff;display:inline-block}.seopress-BlankState a.button-primary:active,.seopress-BlankState a.button-primary:focus,.seopress-BlankState a.button-primary:hover,.seopress-BlankState button.button-primary:active,.seopress-BlankState button.button-primary:focus,.seopress-BlankState button.button-primary:hover,.seopress-message a.button-primary:active,.seopress-message a.button-primary:focus,.seopress-message a.button-primary:hover,.seopress-message button.button-primary:active,.seopress-message button.button-primary:focus,.seopress-message button.button-primary:hover{background:#6259e6;border-color:#6259e6;box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 0 #6259e6}.post-type-seopress_404 .seopress-BlankState-message::before,.post-type-seopress_schemas .seopress-BlankState-message::before{font-family:Dashicons;speak:none;font-weight:400;font-variant:normal;text-transform:none;line-height:1;margin:0;text-indent:0;position:absolute;top:0;left:0;width:100%;height:100%;text-align:center;content:"\f103"}.post-type-seopress_schemas .seopress-BlankState-message::before{content:"\f495"}.seopress-BlankState{text-align:center;padding:5em 0 0}.seopress-BlankState .seopress-BlankState-message{color:#aaa;margin:0 auto 1.5em;line-height:1.5em;font-size:1.2em;max-width:500px}.seopress-BlankState .seopress-BlankState-message::before{color:#ddd;text-shadow:0 -1px 1px rgba(0,0,0,.2),0 1px 0 rgba(255,255,255,.8);font-size:8em;display:block;position:relative!important;top:auto;left:auto;line-height:1em;margin:0 0 .1875em}.seopress-BlankState .seopress-BlankState-cta{font-size:1.2em;padding:.75em 1.5em;margin:0 .25em;height:auto;display:inline-block!important}.seopress-BlankState{max-width:764px;text-align:center;margin:auto}.seopress-BlankState .seopress-BlankState-message{color:#444;font-size:1.5em;margin:0 auto 1em}.seopress-BlankState .seopress-BlankState-message::before{font-size:120px}.seopress-BlankState .seopress-BlankState-buttons{margin-bottom:4em}#seopress_content_analysis .up,#seopress_content_analysis .up .dashicons{color:#4ab866}#seopress_content_analysis .down,#seopress_content_analysis .down .dashicons{color:#d94f4f}#seopress_content_analysis .up .dashicons{transform:rotateZ(45deg)}#seopress_content_analysis .stable .dashicons{transform:rotateZ(90deg)}#seopress_content_analysis .down .dashicons{transform:rotateZ(135deg)}#seopress_content_analysis .wrap-insights-post{clear:both;border-top:1px solid #e2e4e7;display:flex;align-items:center}#seopress_content_analysis .wrap-insights-post .widget-insights-title{margin:0 1rem}#seopress_content_analysis .wrap-insights-post span{font-weight:700;margin:0 .2rem 0 0}#seopress_content_analysis .wrap-insights-post .sp-tooltip *{font-weight:400}#seopress_content_analysis .wrap-insights-post .sp-tooltip-headings{font-weight:700}
|
assets/css/tagify.min.css
CHANGED
@@ -1 +1 @@
|
|
1 |
-
:root{--tagify-dd-color-primary:rgb(53,149,246);--tagify-dd-bg-color:white}.tagify{--tags-border-color:#DDD;--tag-bg:#E5E5E5;--tag-hover:#D3E2E2;--tag-text-color:black;--tag-text-color--edit:black;--tag-pad:0.3em 0.5em;--tag-inset-shadow-size:1.1em;--tag-invalid-color:#D39494;--tag-invalid-bg:rgba(211, 148, 148, 0.5);--tag-remove-bg:rgba(211, 148, 148, 0.3);--tag-remove-btn-bg:none;--tag-remove-btn-bg--hover:#c77777;--tag--min-width:1ch;--tag--max-width:auto;--tag-hide-transition
|
1 |
+
:root{--tagify-dd-color-primary:rgb(53,149,246);--tagify-dd-bg-color:white}.tagify{--tags-border-color:#DDD;--tags-hover-border-color:#CCC;--tags-focus-border-color:#3595f6;--tag-bg:#E5E5E5;--tag-hover:#D3E2E2;--tag-text-color:black;--tag-text-color--edit:black;--tag-pad:0.3em 0.5em;--tag-inset-shadow-size:1.1em;--tag-invalid-color:#D39494;--tag-invalid-bg:rgba(211, 148, 148, 0.5);--tag-remove-bg:rgba(211, 148, 148, 0.3);--tag-remove-btn-color:black;--tag-remove-btn-bg:none;--tag-remove-btn-bg--hover:#c77777;--input-color:inherit;--tag--min-width:1ch;--tag--max-width:auto;--tag-hide-transition:0.3s;--placeholder-color:rgba(0, 0, 0, 0.4);--placeholder-color-focus:rgba(0, 0, 0, 0.25);--loader-size:.8em;display:flex;align-items:flex-start;flex-wrap:wrap;border:1px solid #ddd;border:1px solid var(--tags-border-color);padding:0;line-height:1.1;cursor:text;outline:0;position:relative;box-sizing:border-box;transition:.1s}@keyframes tags--bump{30%{transform:scale(1.2)}}@keyframes rotateLoader{to{transform:rotate(1turn)}}.tagify:hover{border-color:#ccc;border-color:var(--tags-hover-border-color)}.tagify.tagify--focus{transition:0s;border-color:#3595f6;border-color:var(--tags-focus-border-color)}.tagify[readonly]:not(.tagify--mix){cursor:default}.tagify[readonly]:not(.tagify--mix)>.tagify__input{visibility:hidden;width:0;margin:5px 0}.tagify[readonly]:not(.tagify--mix) .tagify__tag>div{padding:.3em .5em;padding:var(--tag-pad)}.tagify[readonly]:not(.tagify--mix) .tagify__tag>div::before{background:linear-gradient(45deg,var(--tag-bg) 25%,transparent 25%,transparent 50%,var(--tag-bg) 50%,var(--tag-bg) 75%,transparent 75%,transparent) 0/5px 5px;box-shadow:none;filter:brightness(.95)}.tagify[readonly] .tagify__tag__removeBtn{display:none}.tagify--loading .tagify__input::before{content:none}.tagify--loading .tagify__input::after{content:'';vertical-align:middle;opacity:1;width:.7em;height:.7em;width:var(--loader-size);height:var(--loader-size);border:3px solid;border-color:#eee #bbb #888 transparent;border-radius:50%;animation:rotateLoader .4s infinite linear;margin:-2px 0 -2px .5em}.tagify--loading .tagify__input:empty::after{margin-left:0}.tagify+input,.tagify+textarea{display:none!important}.tagify__tag{display:inline-flex;align-items:center;margin:5px 0 5px 5px;position:relative;z-index:1;outline:0;cursor:default;transition:.13s ease-out}.tagify__tag>div{vertical-align:top;box-sizing:border-box;max-width:100%;padding:.3em .5em;padding:var(--tag-pad,.3em .5em);color:#000;color:var(--tag-text-color,#000);line-height:inherit;border-radius:3px;white-space:nowrap;transition:.13s ease-out}.tagify__tag>div>*{white-space:pre-wrap;overflow:hidden;text-overflow:ellipsis;display:inline-block;vertical-align:top;min-width:1ch;max-width:auto;min-width:var(--tag--min-width,1ch);max-width:var(--tag--max-width,auto);transition:.8s ease,.1s color}.tagify__tag>div>[contenteditable]{outline:0;user-select:text;cursor:text;margin:-2px;padding:2px;max-width:350px}.tagify__tag>div::before{content:'';position:absolute;border-radius:inherit;left:0;top:0;right:0;bottom:0;z-index:-1;pointer-events:none;transition:120ms ease;animation:tags--bump .3s ease-out 1;box-shadow:0 0 0 1.1em #e5e5e5 inset;box-shadow:0 0 0 var(--tag-inset-shadow-size,1.1em) var(--tag-bg,#e5e5e5) inset}.tagify__tag:hover:not([readonly]) div::before{top:-2px;right:-2px;bottom:-2px;left:-2px;box-shadow:0 0 0 1.1em #d3e2e2 inset;box-shadow:0 0 0 var(--tag-inset-shadow-size,1.1em) var(--tag-hover,#d3e2e2) inset}.tagify__tag--loading{pointer-events:none}.tagify__tag--loading .tagify__tag__removeBtn{display:none}.tagify__tag--loading::after{--loader-size:.4em;content:'';vertical-align:middle;opacity:1;width:.7em;height:.7em;width:var(--loader-size);height:var(--loader-size);border:3px solid;border-color:#eee #bbb #888 transparent;border-radius:50%;animation:rotateLoader .4s infinite linear;margin:0 .5em 0 -.1em}.tagify__tag--flash div::before{animation:none}.tagify__tag--hide{width:0!important;padding-left:0;padding-right:0;margin-left:0;margin-right:0;opacity:0;transform:scale(0);transition:.3s;transition:var(--tag-hide-transition,.3s);pointer-events:none}.tagify__tag--hide>div>*{white-space:nowrap}.tagify__tag.tagify--noAnim>div::before{animation:none}.tagify__tag.tagify--notAllowed:not(.tagify__tag--editable) div>span{opacity:.5}.tagify__tag.tagify--notAllowed:not(.tagify__tag--editable) div::before{box-shadow:0 0 0 1.1em rgba(211,148,148,.5) inset!important;box-shadow:0 0 0 var(--tag-inset-shadow-size,1.1em) var(--tag-invalid-bg,rgba(211,148,148,.5)) inset!important;transition:.2s}.tagify__tag[readonly] .tagify__tag__removeBtn{display:none}.tagify__tag[readonly]>div::before{background:linear-gradient(45deg,var(--tag-bg) 25%,transparent 25%,transparent 50%,var(--tag-bg) 50%,var(--tag-bg) 75%,transparent 75%,transparent) 0/5px 5px;box-shadow:none;filter:brightness(.95)}.tagify__tag--editable>div{color:#000;color:var(--tag-text-color--edit,#000)}.tagify__tag--editable>div::before{box-shadow:0 0 0 2px #d3e2e2 inset!important;box-shadow:0 0 0 2px var(--tag-hover,#d3e2e2) inset!important}.tagify__tag--editable>.tagify__tag__removeBtn{pointer-events:none}.tagify__tag--editable>.tagify__tag__removeBtn::after{opacity:0;transform:translateX(100%) translateX(5px)}.tagify__tag--editable.tagify--invalid>div::before{box-shadow:0 0 0 2px #d39494 inset!important;box-shadow:0 0 0 2px var(--tag-invalid-color,#d39494) inset!important}.tagify__tag__removeBtn{order:5;display:inline-flex;align-items:center;justify-content:center;border-radius:50px;cursor:pointer;font:14px/1 Arial;background:0 0;background:var(--tag-remove-btn-bg,none);color:#000;color:var(--tag-remove-btn-color,#000);width:14px;height:14px;margin-right:4.66667px;margin-left:-4.66667px;overflow:hidden;transition:.2s ease-out}.tagify__tag__removeBtn::after{content:"\00D7";transition:.3s,color 0s}.tagify__tag__removeBtn:hover{color:#fff;background:#c77777;background:var(--tag-remove-btn-bg--hover,#c77777)}.tagify__tag__removeBtn:hover+div>span{opacity:.5}.tagify__tag__removeBtn:hover+div::before{box-shadow:0 0 0 1.1em rgba(211,148,148,.3) inset!important;box-shadow:0 0 0 var(--tag-inset-shadow-size,1.1em) var(--tag-remove-bg,rgba(211,148,148,.3)) inset!important;transition:box-shadow .2s}.tagify:not(.tagify--mix) .tagify__input br{display:none}.tagify:not(.tagify--mix) .tagify__input *{display:inline;white-space:nowrap}.tagify__input{flex-grow:1;display:inline-block;min-width:110px;margin:5px;padding:.3em .5em;padding:var(--tag-pad,.3em .5em);line-height:inherit;position:relative;white-space:pre-wrap;color:inherit;color:var(--input-color,inherit);box-sizing:inherit}.tagify__input:empty::before{transition:.2s ease-out;opacity:1;transform:none;display:inline-block;width:auto}.tagify--mix .tagify__input:empty::before{display:inline-block}.tagify__input:focus{outline:0}.tagify__input:focus::before{transition:.2s ease-out;opacity:0;transform:translatex(6px)}@media all and (-ms-high-contrast:none),(-ms-high-contrast:active){.tagify__input:focus::before{display:none}}@supports (-ms-ime-align:auto){.tagify__input:focus::before{display:none}}.tagify__input:focus:empty::before{transition:.2s ease-out;opacity:1;transform:none;color:rgba(0,0,0,.25);color:var(--placeholder-color-focus)}@-moz-document url-prefix(){.tagify__input:focus:empty::after{display:none}}.tagify__input::before{content:attr(data-placeholder);height:1em;line-height:1em;margin:auto 0;z-index:1;color:rgba(0,0,0,.4);color:var(--placeholder-color);white-space:nowrap;pointer-events:none;opacity:0;position:absolute}.tagify--mix .tagify__input::before{display:none;position:static;line-height:inherit}.tagify__input::after{content:attr(data-suggest);display:inline-block;white-space:pre;color:#000;opacity:.3;pointer-events:none;max-width:100px}.tagify__input .tagify__tag{margin:0}.tagify__input .tagify__tag>div{padding-top:0;padding-bottom:0}.tagify--mix{display:block}.tagify--mix .tagify__input{padding:5px;margin:0;width:100%;height:100%;line-height:1.5}.tagify--mix .tagify__input::before{height:auto}.tagify--mix .tagify__input::after{content:none}.tagify--select::after{content:'>';opacity:.5;position:absolute;top:50%;right:0;bottom:0;font:16px monospace;line-height:8px;height:8px;pointer-events:none;transform:translate(-150%,-50%) scaleX(1.2) rotate(90deg);transition:.2s ease-in-out}.tagify--select[aria-expanded=true]::after{transform:translate(-150%,-50%) rotate(270deg) scaleY(1.2)}.tagify--select .tagify__tag{position:absolute;top:0;right:1.8em;bottom:0}.tagify--select .tagify__tag div{display:none}.tagify--select .tagify__input{width:100%}.tagify--invalid{--tags-border-color:#D39494}.tagify__dropdown{position:absolute;z-index:9999;transform:translateY(1px);overflow:hidden}.tagify__dropdown[placement=top]{margin-top:0;transform:translateY(-100%)}.tagify__dropdown[placement=top] .tagify__dropdown__wrapper{border-top-width:1px;border-bottom-width:0}.tagify__dropdown[position=text]{box-shadow:0 0 0 3px rgba(var(--tagify-dd-color-primary),.1);font-size:.9em}.tagify__dropdown[position=text] .tagify__dropdown__wrapper{border-width:1px}.tagify__dropdown__wrapper{max-height:300px;overflow:hidden;background:#fff;background:var(--tagify-dd-bg-color);border:1px solid #3595f6;border-color:var(--tagify-dd-color-primary);border-top-width:0;box-shadow:0 2px 4px -2px rgba(0,0,0,.2);transition:.25s cubic-bezier(0,1,.5,1)}.tagify__dropdown__wrapper:hover{overflow:auto}.tagify__dropdown--initial .tagify__dropdown__wrapper{max-height:20px;transform:translateY(-1em)}.tagify__dropdown--initial[placement=top] .tagify__dropdown__wrapper{transform:translateY(2em)}.tagify__dropdown__item{box-sizing:inherit;padding:.3em .5em;margin:1px;cursor:pointer;border-radius:2px;position:relative;outline:0}.tagify__dropdown__item--active{background:#3595f6;background:var(--tagify-dd-color-primary);color:#fff}.tagify__dropdown__item:active{filter:brightness(105%)}
|
assets/js/seopress-block-editor.min.js
CHANGED
@@ -1 +1 @@
|
|
1 |
-
jQuery(document).ready(
|
1 |
+
jQuery(document).ready(function(e){const{subscribe:t,select:s}=wp.data;let a=!1;t(()=>{var t=wp.data.select("core/editor").isAutosavingPost(),s=wp.data.select("core/edit-post").isSavingMetaBoxes();!s||t||a||e.ajax({method:"GET",url:seopressAjaxRealPreview.seopress_real_preview,data:{action:"seopress_do_real_preview",post_id:e("#seopress-tabs").attr("data_id"),tax_name:e("#seopress-tabs").attr("data_tax"),origin:e("#seopress-tabs").attr("data_origin"),post_type:e("#seopress_launch_analysis").attr("data_post_type"),seopress_analysis_target_kw:e("#seopress_analysis_target_kw_meta").val(),_ajax_nonce:seopressAjaxRealPreview.seopress_nonce},beforeSend:function(){e(".analysis-score p span").fadeIn().text(seopressAjaxRealPreview.i18n.progress),e(".analysis-score p").addClass("loading")},success:function(t){void 0===t.data.og_title?og_title="":og_title=t.data.og_title.values,void 0===t.data.og_desc?og_desc="":og_desc=t.data.og_desc.values,void 0===t.data.og_img?og_img="":og_img=t.data.og_img.values,void 0===t.data.og_url?og_url="":og_url=t.data.og_url.host,void 0===t.data.og_site_name?og_site_name="":og_site_name=t.data.og_site_name.values,void 0===t.data.tw_title?tw_title="":tw_title=t.data.tw_title.values,void 0===t.data.tw_desc?tw_desc="":tw_desc=t.data.tw_desc.values,void 0===t.data.tw_img?tw_img="":tw_img=t.data.tw_img.values,void 0===t.data.meta_robots?meta_robots="":meta_robots=t.data.meta_robots[0];var s={og_title:og_title,og_desc:og_desc,og_img:og_img,og_url:og_url,og_site_name:og_site_name,tw_title:tw_title,tw_desc:tw_desc,tw_img:tw_img};for(var a in s)s.length&&(a=s[a].length>1?s[a].slice(-1)[0]:s[a][0]);meta_robots=meta_robots.toString(),e("#sp-advanced-alert").empty();var i=new RegExp("noindex");i.test(meta_robots)&&e("#sp-advanced-alert").append('<span class="impact high" aria-hidden="true"></span>'),e("#seopress_cpt .google-snippet-preview .snippet-title").html(t.data.title),e("#seopress_cpt .google-snippet-preview .snippet-title-default").html(t.data.title),e("#seopress_titles_title_meta").attr("placeholder",t.data.title),e("#seopress_cpt .google-snippet-preview .snippet-description").html(t.data.meta_desc),e("#seopress_cpt .google-snippet-preview .snippet-description-default").html(t.data.meta_desc),e("#seopress_titles_desc_meta").attr("placeholder",t.data.meta_desc),s.og_title&&(e("#seopress_cpt #seopress_social_fb_title_meta").attr("placeholder",s.og_title[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-title").html(s.og_title[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-title-default").html(s.og_title[0])),s.og_desc&&(e("#seopress_cpt #seopress_social_fb_desc_meta").attr("placeholder",s.og_desc[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-description").html(s.og_desc[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-description-default").html(s.og_desc[0])),s.og_img&&(e("#seopress_cpt #seopress_social_fb_img_meta").attr("placeholder",s.og_img[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-img img").attr("src",s.og_img[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-img-default img").attr("src",s.og_img[0])),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-url").html(s.og_url),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-site-name").html(s.og_site_name),s.tw_title&&(e("#seopress_cpt #seopress_social_twitter_title_meta").attr("placeholder",s.tw_title[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-title").html(s.tw_title[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-title-default").html(s.tw_title[0])),s.tw_desc&&(e("#seopress_cpt #seopress_social_twitter_desc_meta").attr("placeholder",s.tw_desc[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-description").html(s.tw_desc[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-description-default").html(s.tw_desc[0])),s.tw_img&&(e("#seopress_cpt #seopress_social_twitter_img_meta").attr("placeholder",s.tw_img[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-img img").attr("src",s.tw_img[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-img-default img").attr("src",s.tw_img[0])),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-url").html(s.og_url),e("#seopress_cpt #seopress_robots_canonical_meta").attr("placeholder",t.data.canonical),e("#seopress-analysis-tabs").load(" #seopress-analysis-tabs-1","",sp_ca_toggle),e(".analysis-score p").removeClass("loading")}}),a=!!s})});
|
assets/js/seopress-cookies-ajax.js
CHANGED
@@ -5,6 +5,7 @@ jQuery(document).ready(function($) {
|
|
5 |
}
|
6 |
$('#seopress-user-consent-accept').on('click', function() {
|
7 |
$('.seopress-user-consent').remove();
|
|
|
8 |
$.ajax({
|
9 |
method : 'GET',
|
10 |
url : seopressAjaxGAUserConsent.seopress_cookies_user_consent,
|
@@ -21,12 +22,13 @@ jQuery(document).ready(function($) {
|
|
21 |
$('body').prepend(data.data.body_js);
|
22 |
$('body').append(data.data.footer_js);
|
23 |
}
|
24 |
-
Cookies.set('seopress-user-consent-accept', '1', { expires:
|
25 |
},
|
26 |
});
|
27 |
});
|
28 |
$('#seopress-user-consent-close').on('click', function() {
|
29 |
$('.seopress-user-consent').remove();
|
30 |
-
|
|
|
31 |
});
|
32 |
});
|
5 |
}
|
6 |
$('#seopress-user-consent-accept').on('click', function() {
|
7 |
$('.seopress-user-consent').remove();
|
8 |
+
$('.seopress-user-consent-backdrop').remove();
|
9 |
$.ajax({
|
10 |
method : 'GET',
|
11 |
url : seopressAjaxGAUserConsent.seopress_cookies_user_consent,
|
22 |
$('body').prepend(data.data.body_js);
|
23 |
$('body').append(data.data.footer_js);
|
24 |
}
|
25 |
+
Cookies.set('seopress-user-consent-accept', '1', { expires: Number(seopressAjaxGAUserConsent.seopress_cookies_expiration_days) });
|
26 |
},
|
27 |
});
|
28 |
});
|
29 |
$('#seopress-user-consent-close').on('click', function() {
|
30 |
$('.seopress-user-consent').remove();
|
31 |
+
$('.seopress-user-consent-backdrop').remove();
|
32 |
+
Cookies.set('seopress-user-consent-close', '1', { expires: Number(seopressAjaxGAUserConsent.seopress_cookies_expiration_days) });
|
33 |
});
|
34 |
});
|
assets/js/seopress-cookies-ajax.min.js
CHANGED
@@ -1 +1 @@
|
|
1 |
-
jQuery(document).ready(function(e){null==Cookies.get("seopress-user-consent-close")&&null==Cookies.get("seopress-user-consent-accept")&&e(".seopress-user-consent").removeClass("seopress-user-consent-hide"),e("#seopress-user-consent-accept").on("click",function(){e(".seopress-user-consent").remove(),e.ajax({method:"GET",url:seopressAjaxGAUserConsent.seopress_cookies_user_consent,data:{action:"seopress_cookies_user_consent",_ajax_nonce:seopressAjaxGAUserConsent.seopress_nonce},success:function(s){s.data&&(e("head").append(s.data.gtag_js),e("head").append(s.data.matomo_js),e("head").append(s.data.custom),e("head").append(s.data.head_js),e("body").prepend(s.data.body_js),e("body").append(s.data.footer_js)),Cookies.set("seopress-user-consent-accept","1",{expires:
|
1 |
+
jQuery(document).ready(function(e){null==Cookies.get("seopress-user-consent-close")&&null==Cookies.get("seopress-user-consent-accept")&&e(".seopress-user-consent").removeClass("seopress-user-consent-hide"),e("#seopress-user-consent-accept").on("click",function(){e(".seopress-user-consent").remove(),e(".seopress-user-consent-backdrop").remove(),e.ajax({method:"GET",url:seopressAjaxGAUserConsent.seopress_cookies_user_consent,data:{action:"seopress_cookies_user_consent",_ajax_nonce:seopressAjaxGAUserConsent.seopress_nonce},success:function(s){s.data&&(e("head").append(s.data.gtag_js),e("head").append(s.data.matomo_js),e("head").append(s.data.custom),e("head").append(s.data.head_js),e("body").prepend(s.data.body_js),e("body").append(s.data.footer_js)),Cookies.set("seopress-user-consent-accept","1",{expires:Number(seopressAjaxGAUserConsent.seopress_cookies_expiration_days)})}})}),e("#seopress-user-consent-close").on("click",function(){e(".seopress-user-consent").remove(),e(".seopress-user-consent-backdrop").remove(),Cookies.set("seopress-user-consent-close","1",{expires:Number(seopressAjaxGAUserConsent.seopress_cookies_expiration_days)})})});
|
assets/js/seopress-counters.js
CHANGED
@@ -323,6 +323,13 @@ function sp_ca_toggle() {
|
|
323 |
}
|
324 |
|
325 |
jQuery(document).ready(function(e) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
326 |
//default state
|
327 |
if (jQuery('#toggle-preview').attr('data-toggle') == '1') {
|
328 |
jQuery("#seopress_cpt .google-snippet-preview").addClass("mobile-preview");
|
323 |
}
|
324 |
|
325 |
jQuery(document).ready(function(e) {
|
326 |
+
//Tagify
|
327 |
+
var input = document.querySelector('input[id=seopress_analysis_target_kw_meta]');
|
328 |
+
|
329 |
+
new Tagify(input, {
|
330 |
+
originalInputValueFormat: valuesArr => valuesArr.map(item => item.value).join(',')
|
331 |
+
})
|
332 |
+
|
333 |
//default state
|
334 |
if (jQuery('#toggle-preview').attr('data-toggle') == '1') {
|
335 |
jQuery("#seopress_cpt .google-snippet-preview").addClass("mobile-preview");
|
assets/js/seopress-counters.min.js
CHANGED
@@ -1 +1 @@
|
|
1 |
-
function sp_titles_counters(){var meta_title_val=jQuery("#seopress_titles_title_meta").val(),meta_title_placeholder=jQuery("#seopress_titles_title_meta").attr("placeholder");if(jQuery("#seopress_titles_title_counters").after('<div id="seopress_titles_title_counters_val">/ 60</div>'),meta_title_val.length>0?(jQuery("#seopress_titles_title_counters").text(meta_title_val.length),jQuery("#seopress_titles_title_pixel").text(pixelTitle(meta_title_val))):meta_title_placeholder.length&&(jQuery("#seopress_titles_title_counters").text(meta_title_placeholder.length),jQuery("#seopress_titles_title_pixel").text(pixelTitle(meta_title_placeholder))),meta_title_val.length>60?jQuery("#seopress_titles_title_counters").css("color","red"):meta_title_placeholder.length>60&&jQuery("#seopress_titles_title_counters").css("color","red"),pixelTitle(meta_title_val)>568?jQuery("#seopress_titles_title_pixel").css("color","red"):pixelTitle(meta_title_placeholder)>568&&jQuery("#seopress_titles_title_pixel").css("color","red"),meta_title_val.length)var progress=Math.round(pixelTitle(meta_title_val)/568*100);else var progress=Math.round(pixelTitle(meta_title_placeholder)/568*100);progress>=100&&(progress=100),jQuery("#seopress_titles_title_counters_progress").attr("aria-valuenow",progress),jQuery("#seopress_titles_title_counters_progress").text(progress+"%"),jQuery("#seopress_titles_title_counters_progress").css("width",progress+"%"),jQuery("#seopress_titles_title_meta, #seopress-tag-single-title, #seopress-tag-single-site-title, #seopress-tag-single-sep").on("keyup paste change click",(function(e){var meta_title_val=jQuery("#seopress_titles_title_meta").val(),meta_title_placeholder=jQuery("#seopress_titles_title_meta").attr("placeholder");if(jQuery("#seopress_titles_title_counters").css("color","inherit"),jQuery("#seopress_titles_title_pixel").css("color","inherit"),meta_title_val.length>60&&jQuery("#seopress_titles_title_counters").css("color","red"),pixelTitle(meta_title_val)>568&&jQuery("#seopress_titles_title_pixel").css("color","red"),0==meta_title_val.length&&(meta_title_placeholder.length>60&&jQuery("#seopress_titles_title_counters").css("color","red"),pixelTitle(meta_title_placeholder)>568&&jQuery("#seopress_titles_title_pixel").css("color","red")),meta_title_val.length>0?(jQuery("#seopress_titles_title_counters").text(meta_title_val.length),jQuery("#seopress_titles_title_pixel").text(pixelTitle(meta_title_val))):meta_title_placeholder.length&&(jQuery("#seopress_titles_title_counters").text(meta_title_placeholder.length),jQuery("#seopress_titles_title_pixel").text(pixelTitle(meta_title_placeholder))),meta_title_val.length>0?(jQuery(".snippet-title-custom").text(e.target.value),jQuery(".snippet-title").css("display","none"),jQuery(".snippet-title-custom").css("display","block"),jQuery(".snippet-title-default").css("display","none")):0==meta_title_val.length&&(jQuery(".snippet-title-default").css("display","block"),jQuery(".snippet-title-custom").css("display","none"),jQuery(".snippet-title").css("display","none")),meta_title_val.length)var progress=Math.round(pixelTitle(meta_title_val)/568*100);else var progress=Math.round(pixelTitle(meta_title_placeholder)/568*100);progress>=100&&(progress=100),jQuery("#seopress_titles_title_counters_progress").attr("aria-valuenow",progress),jQuery("#seopress_titles_title_counters_progress").text(progress+"%"),jQuery("#seopress_titles_title_counters_progress").css("width",progress+"%")}))}function sp_meta_desc_counters(){var meta_desc_val=jQuery("#seopress_titles_desc_meta").val(),meta_desc_placeholder=jQuery("#seopress_titles_desc_meta").attr("placeholder");if(jQuery("#seopress_titles_desc_counters").after('<div id="seopress_titles_desc_counters_val">/ 160</div>'),meta_desc_val.length>0?(jQuery("#seopress_titles_desc_counters").text(meta_desc_val.length),jQuery("#seopress_titles_desc_pixel").text(pixelDesc(meta_desc_val))):meta_desc_placeholder.length&&(jQuery("#seopress_titles_desc_counters").text(meta_desc_placeholder.length),jQuery("#seopress_titles_desc_pixel").text(pixelDesc(meta_desc_placeholder))),meta_desc_val.length>160?jQuery("#seopress_titles_desc_counters").css("color","red"):meta_desc_placeholder.length>160&&jQuery("#seopress_titles_desc_counters").css("color","red"),pixelDesc(meta_desc_val)>940?jQuery("#seopress_titles_desc_pixel").css("color","red"):pixelDesc(meta_desc_placeholder)>940&&jQuery("#seopress_titles_desc_pixel").css("color","red"),meta_desc_val.length)var progress=Math.round(pixelDesc(meta_desc_val)/940*100);else var progress=Math.round(pixelDesc(meta_desc_placeholder)/940*100);progress>=100&&(progress=100),jQuery("#seopress_titles_desc_counters_progress").attr("aria-valuenow",progress),jQuery("#seopress_titles_desc_counters_progress").text(progress+"%"),jQuery("#seopress_titles_desc_counters_progress").css("width",progress+"%"),jQuery("#seopress_titles_desc_meta, #seopress-tag-single-excerpt").on("keyup paste change click",(function(e){var meta_desc_val=jQuery("#seopress_titles_desc_meta").val(),meta_desc_placeholder=jQuery("#seopress_titles_desc_meta").attr("placeholder");if(jQuery("#seopress_titles_desc_counters").css("color","inherit"),jQuery("#seopress_titles_desc_pixel").css("color","inherit"),meta_desc_val.length>160&&jQuery("#seopress_titles_desc_counters").css("color","red"),pixelDesc(meta_desc_val)>940&&jQuery("#seopress_titles_desc_pixel").css("color","red"),0==meta_desc_val.length&&(meta_desc_placeholder.length>160&&jQuery("#seopress_titles_desc_counters").css("color","red"),pixelDesc(meta_desc_placeholder)>940&&jQuery("#seopress_titles_desc_pixel").css("color","red")),meta_desc_val.length>0?(jQuery("#seopress_titles_desc_counters").text(meta_desc_val.length),jQuery("#seopress_titles_desc_pixel").text(pixelDesc(meta_desc_val))):meta_desc_placeholder.length&&(jQuery("#seopress_titles_desc_counters").text(meta_desc_placeholder.length),jQuery("#seopress_titles_desc_pixel").text(pixelDesc(meta_desc_placeholder))),meta_desc_val.length>0?(jQuery(".snippet-description-custom").text(e.target.value),jQuery(".snippet-description").css("display","none"),jQuery(".snippet-description-custom").css("display","inline"),jQuery(".snippet-description-default").css("display","none")):0==meta_desc_val.length&&(jQuery(".snippet-description-default").css("display","inline"),jQuery(".snippet-description-custom").css("display","none"),jQuery(".snippet-description").css("display","none")),meta_desc_val.length)var progress=Math.round(pixelDesc(meta_desc_val)/940*100);else var progress=Math.round(pixelDesc(meta_desc_placeholder)/940*100);progress>=100&&(progress=100),jQuery("#seopress_titles_desc_counters_progress").attr("aria-valuenow",progress),jQuery("#seopress_titles_desc_counters_progress").text(progress+"%"),jQuery("#seopress_titles_desc_counters_progress").css("width",progress+"%")})),jQuery("#excerpt, .editor-post-excerpt textarea").keyup((function(e){var meta_desc_val=jQuery("#seopress_titles_desc_meta").val(),meta_desc_placeholder=jQuery("#seopress_titles_desc_meta").attr("placeholder");if(0==meta_desc_val.length&&0==jQuery(".snippet-description-custom").val().length&&(jQuery(".snippet-description-custom").text(e.target.value),jQuery(".snippet-description").css("display","none"),jQuery(".snippet-description-custom").css("display","inline"),jQuery(".snippet-description-default").css("display","none")),meta_desc_val.length)var progress=meta_desc_val.length;else var progress=meta_desc_placeholder.length;progress>=100&&(progress=100),jQuery("#seopress_titles_desc_counters_progress").attr("aria-valuenow",progress),jQuery("#seopress_titles_desc_counters_progress").text(progress+"%"),jQuery("#seopress_titles_desc_counters_progress").css("width",progress+"%")}))}function pixelTitle(e){return inputText=e,font="18px Arial",canvas=document.createElement("canvas"),context=canvas.getContext("2d"),context.font=font,width=context.measureText(inputText).width,formattedWidth=Math.ceil(width),formattedWidth}function pixelDesc(e){return inputText=e,font="14px Arial",canvas=document.createElement("canvas"),context=canvas.getContext("2d"),context.font=font,width=context.measureText(inputText).width,formattedWidth=Math.ceil(width),formattedWidth}function sp_is_valid_url(string){var res;return null!==string.match(/(http(s)?:\/\/.)?(www\.)?[-a-zA-Z0-9@:%._\+~#=]{2,256}\.[a-z]{2,6}\b([-a-zA-Z0-9@:%_\+.~#?&//=]*)/g)}function sp_social_img(social_slug){var meta_img_val;if(jQuery(".snippet-"+social_slug+"-img-alert").css("display","none"),""==(meta_img_val=jQuery("#seopress_social_"+social_slug+"_img_meta").val()))var meta_img_val=jQuery("#seopress_social_"+social_slug+"_img_meta").attr("placeholder");!0===sp_is_valid_url(meta_img_val)?(meta_img_val.length>0?(jQuery(".snippet-"+social_slug+"-img-custom img").attr("src",meta_img_val),jQuery(".snippet-"+social_slug+"-img").css("display","none"),jQuery(".snippet-"+social_slug+"-img-custom").css("display","block"),jQuery(".snippet-"+social_slug+"-img-default").css("display","none")):0==meta_img_val.length&&(jQuery(".snippet-"+social_slug+"-img-default").css("display","block"),jQuery(".snippet-"+social_slug+"-img-custom").css("display","none"),jQuery(".snippet-"+social_slug+"-img").css("display","none")),meta_img_val.length>0&&jQuery.get(meta_img_val).done((function(){var meta_img_filetype=meta_img_val.split(/\#|\?/)[0].split(".").pop().trim(),types;if(-1==["jpg","jpeg","gif","png"].indexOf(meta_img_filetype))jQuery(".snippet-"+social_slug+"-img-alert.alert1").css("display","block");else{var tmp_img=new Image;tmp_img.src=meta_img_val,jQuery(tmp_img).one("load",(function(){pic_real_width=parseInt(tmp_img.width),pic_real_height=parseInt(tmp_img.height),"fb"==social_slug?(min_width=200,min_height=200):(min_width=144,min_height=144),(pic_real_width<min_width||pic_real_height<min_height)&&jQuery(".snippet-"+social_slug+"-img-alert.alert2").css("display","block"),ratio_img=(pic_real_width/pic_real_height).toFixed(2),jQuery(".snippet-"+social_slug+"-img-alert.alert4").css("display","block"),jQuery(".snippet-"+social_slug+"-img-alert.alert4 span").text(ratio_img)}))}})).fail((function(){jQuery(".snippet-"+social_slug+"-img-alert.alert3").css("display","block")}))):jQuery(".snippet-"+social_slug+"-img-alert.alert5").css("display","block")}function sp_social(){jQuery("#seopress_social_fb_title_meta, #seopress-tag-single-title, #seopress-tag-single-site-title, #seopress-tag-single-sep").on("keyup paste change click",(function(e){var meta_fb_title_val=jQuery("#seopress_social_fb_title_meta").val();meta_fb_title_val.length>0?(jQuery(".snippet-fb-title-custom").text(e.target.value),jQuery(".snippet-fb-title").css("display","none"),jQuery(".snippet-fb-title-custom").css("display","block"),jQuery(".snippet-fb-title-default").css("display","none")):0==meta_fb_title_val.length&&(jQuery(".snippet-fb-title-default").css("display","block"),jQuery(".snippet-fb-title-custom").css("display","none"),jQuery(".snippet-fb-title").css("display","none"))})),jQuery("#seopress_social_fb_desc_meta").on("keyup paste change click",(function(e){var meta_fb_desc_val=jQuery("#seopress_social_fb_desc_meta").val();meta_fb_desc_val.length>0?(jQuery(".snippet-fb-description-custom").text(e.target.value),jQuery(".snippet-fb-description").css("display","none"),jQuery(".snippet-fb-description-custom").css("display","block"),jQuery(".snippet-fb-description-default").css("display","none")):0==meta_fb_desc_val.length&&(jQuery(".snippet-fb-description-default").css("display","block"),jQuery(".snippet-fb-description-custom").css("display","none"),jQuery(".snippet-fb-description").css("display","none"))})),sp_social_img("fb"),jQuery("#seopress_social_fb_img_meta").on("keyup paste change click",(function(){sp_social_img("fb")})),jQuery("#seopress_social_twitter_title_meta").on("keyup paste change click",(function(e){var meta_fb_title_val=jQuery("#seopress_social_twitter_title_meta").val();meta_fb_title_val.length>0?(jQuery(".snippet-twitter-title-custom").text(e.target.value),jQuery(".snippet-twitter-title").css("display","none"),jQuery(".snippet-twitter-title-custom").css("display","block"),jQuery(".snippet-twitter-title-default").css("display","none")):0==meta_fb_title_val.length&&(jQuery(".snippet-twitter-title-default").css("display","block"),jQuery(".snippet-twitter-title-custom").css("display","none"),jQuery(".snippet-twitter-title").css("display","none"))})),jQuery("#seopress_social_twitter_desc_meta").on("keyup paste change click",(function(e){var meta_fb_desc_val=jQuery("#seopress_social_twitter_desc_meta").val();meta_fb_desc_val.length>0?(jQuery(".snippet-twitter-description-custom").text(e.target.value),jQuery(".snippet-twitter-description").css("display","none"),jQuery(".snippet-twitter-description-custom").css("display","block"),jQuery(".snippet-twitter-description-default").css("display","none")):0==meta_fb_desc_val.length&&(jQuery(".snippet-twitter-description-default").css("display","block"),jQuery(".snippet-twitter-description-custom").css("display","none"),jQuery(".snippet-twitter-description").css("display","none"))})),sp_social_img("twitter"),jQuery("#seopress_social_twitter_img_meta").on("keyup paste change click",(function(){sp_social_img("twitter")}))}function sp_ca_toggle(){var stop=!1;jQuery(".gr-analysis-title .btn-toggle").on("click",(function(e){stop&&(event.stopImmediatePropagation(),event.preventDefault(),stop=!1),jQuery(this).toggleClass("open"),jQuery(this).parent().parent().next(".gr-analysis-content").toggle()})),jQuery("#expand-all").on("click",(function(e){e.preventDefault(),jQuery(".gr-analysis-content").show()})),jQuery("#close-all").on("click",(function(e){e.preventDefault(),jQuery(".gr-analysis-content").hide()}))}jQuery(document).ready((function(e){function s(){e.ajax({method:"GET",url:seopressAjaxRealPreview.seopress_real_preview,data:{action:"seopress_do_real_preview",post_id:e("#seopress-tabs").attr("data_id"),tax_name:e("#seopress-tabs").attr("data_tax"),origin:e("#seopress-tabs").attr("data_origin"),post_type:e("#seopress_launch_analysis").attr("data_post_type"),seopress_analysis_target_kw:e("#seopress_analysis_target_kw_meta").val(),_ajax_nonce:seopressAjaxRealPreview.seopress_nonce},beforeSend:function(){e(".analysis-score p span").fadeIn().text(seopressAjaxRealPreview.i18n.progress),e(".analysis-score p").addClass("loading")},success:function(s){void 0===s.data.og_title?og_title="":og_title=s.data.og_title.values,void 0===s.data.og_desc?og_desc="":og_desc=s.data.og_desc.values,void 0===s.data.og_img?og_img="":og_img=s.data.og_img.values,void 0===s.data.og_url?og_url="":og_url=s.data.og_url.host,void 0===s.data.og_site_name?og_site_name="":og_site_name=s.data.og_site_name.values,void 0===s.data.tw_title?tw_title="":tw_title=s.data.tw_title.values,void 0===s.data.tw_desc?tw_desc="":tw_desc=s.data.tw_desc.values,void 0===s.data.tw_img?tw_img="":tw_img=s.data.tw_img.values,void 0===s.data.meta_robots?meta_robots="":meta_robots=s.data.meta_robots[0];var data_arr={og_title:og_title,og_desc:og_desc,og_img:og_img,og_url:og_url,og_site_name:og_site_name,tw_title:tw_title,tw_desc:tw_desc,tw_img:tw_img},if_noindex;for(var key in data_arr)data_arr.length&&(key=data_arr[key].length>1?data_arr[key].slice(-1)[0]:data_arr[key][0]);meta_robots=meta_robots.toString(),e("#sp-advanced-alert").empty(),new RegExp("noindex").test(meta_robots)&&e("#sp-advanced-alert").append('<span class="impact high" aria-hidden="true"></span>'),e("#seopress_cpt .google-snippet-preview .snippet-title").html(s.data.title),e("#seopress_cpt .google-snippet-preview .snippet-title-default").html(s.data.title),e("#seopress_titles_title_meta").attr("placeholder",s.data.title),e("#seopress_cpt .google-snippet-preview .snippet-description").html(s.data.meta_desc),e("#seopress_cpt .google-snippet-preview .snippet-description-default").html(s.data.meta_desc),e("#seopress_titles_desc_meta").attr("placeholder",s.data.meta_desc),data_arr.og_title&&(e("#seopress_cpt #seopress_social_fb_title_meta").attr("placeholder",data_arr.og_title[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-title").html(data_arr.og_title[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-title-default").html(data_arr.og_title[0])),data_arr.og_desc&&(e("#seopress_cpt #seopress_social_fb_desc_meta").attr("placeholder",data_arr.og_desc[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-description").html(data_arr.og_desc[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-description-default").html(data_arr.og_desc[0])),data_arr.og_img&&(e("#seopress_cpt #seopress_social_fb_img_meta").attr("placeholder",data_arr.og_img[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-img img").attr("src",data_arr.og_img[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-img-default img").attr("src",data_arr.og_img[0])),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-url").html(data_arr.og_url),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-site-name").html(data_arr.og_site_name),data_arr.tw_title&&(e("#seopress_cpt #seopress_social_twitter_title_meta").attr("placeholder",data_arr.tw_title[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-title").html(data_arr.tw_title[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-title-default").html(data_arr.tw_title[0])),data_arr.tw_desc&&(e("#seopress_cpt #seopress_social_twitter_desc_meta").attr("placeholder",data_arr.tw_desc[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-description").html(data_arr.tw_desc[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-description-default").html(data_arr.tw_desc[0])),data_arr.tw_img&&(e("#seopress_cpt #seopress_social_twitter_img_meta").attr("placeholder",data_arr.tw_img[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-img img").attr("src",data_arr.tw_img[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-img-default img").attr("src",data_arr.tw_img[0])),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-url").html(data_arr.og_url),e("#seopress_cpt #seopress_robots_canonical_meta").attr("placeholder",s.data.canonical),e("#seopress-analysis-tabs").load(" #seopress-analysis-tabs-1","",sp_ca_toggle),e(".analysis-score p").removeClass("loading"),e(" #seopress_titles_title_counters_val").remove(),e(" #seopress_titles_desc_counters_val").remove(),sp_titles_counters(),sp_meta_desc_counters(),sp_social()}})}"1"==jQuery("#toggle-preview").attr("data-toggle")?jQuery("#seopress_cpt .google-snippet-preview").addClass("mobile-preview"):jQuery("#seopress_cpt .google-snippet-preview").removeClass("mobile-preview"),jQuery("#toggle-preview").on("click",(function(){jQuery("#toggle-preview").attr("data-toggle","1"==jQuery("#toggle-preview").attr("data-toggle")?"0":"1"),jQuery("#seopress_cpt .google-snippet-preview").toggleClass("mobile-preview")})),s(),e("#seopress_launch_analysis").on("click",(function(){s()})),sp_ca_toggle()}));
|
1 |
+
function sp_titles_counters(){var e=jQuery("#seopress_titles_title_meta").val(),t=jQuery("#seopress_titles_title_meta").attr("placeholder");if(jQuery("#seopress_titles_title_counters").after('<div id="seopress_titles_title_counters_val">/ 60</div>'),e.length>0?(jQuery("#seopress_titles_title_counters").text(e.length),jQuery("#seopress_titles_title_pixel").text(pixelTitle(e))):t.length&&(jQuery("#seopress_titles_title_counters").text(t.length),jQuery("#seopress_titles_title_pixel").text(pixelTitle(t))),e.length>60?jQuery("#seopress_titles_title_counters").css("color","red"):t.length>60&&jQuery("#seopress_titles_title_counters").css("color","red"),pixelTitle(e)>568?jQuery("#seopress_titles_title_pixel").css("color","red"):pixelTitle(t)>568&&jQuery("#seopress_titles_title_pixel").css("color","red"),e.length)var s=Math.round(pixelTitle(e)/568*100);else s=Math.round(pixelTitle(t)/568*100);s>=100&&(s=100),jQuery("#seopress_titles_title_counters_progress").attr("aria-valuenow",s),jQuery("#seopress_titles_title_counters_progress").text(s+"%"),jQuery("#seopress_titles_title_counters_progress").css("width",s+"%"),jQuery("#seopress_titles_title_meta, #seopress-tag-single-title, #seopress-tag-single-site-title, #seopress-tag-single-sep").on("keyup paste change click",function(e){var t=jQuery("#seopress_titles_title_meta").val(),s=jQuery("#seopress_titles_title_meta").attr("placeholder");if(jQuery("#seopress_titles_title_counters").css("color","inherit"),jQuery("#seopress_titles_title_pixel").css("color","inherit"),t.length>60&&jQuery("#seopress_titles_title_counters").css("color","red"),pixelTitle(t)>568&&jQuery("#seopress_titles_title_pixel").css("color","red"),0==t.length&&(s.length>60&&jQuery("#seopress_titles_title_counters").css("color","red"),pixelTitle(s)>568&&jQuery("#seopress_titles_title_pixel").css("color","red")),t.length>0?(jQuery("#seopress_titles_title_counters").text(t.length),jQuery("#seopress_titles_title_pixel").text(pixelTitle(t))):s.length&&(jQuery("#seopress_titles_title_counters").text(s.length),jQuery("#seopress_titles_title_pixel").text(pixelTitle(s))),t.length>0?(jQuery(".snippet-title-custom").text(e.target.value),jQuery(".snippet-title").css("display","none"),jQuery(".snippet-title-custom").css("display","block"),jQuery(".snippet-title-default").css("display","none")):0==t.length&&(jQuery(".snippet-title-default").css("display","block"),jQuery(".snippet-title-custom").css("display","none"),jQuery(".snippet-title").css("display","none")),t.length)var i=Math.round(pixelTitle(t)/568*100);else i=Math.round(pixelTitle(s)/568*100);i>=100&&(i=100),jQuery("#seopress_titles_title_counters_progress").attr("aria-valuenow",i),jQuery("#seopress_titles_title_counters_progress").text(i+"%"),jQuery("#seopress_titles_title_counters_progress").css("width",i+"%")})}function sp_meta_desc_counters(){var e=jQuery("#seopress_titles_desc_meta").val(),t=jQuery("#seopress_titles_desc_meta").attr("placeholder");if(jQuery("#seopress_titles_desc_counters").after('<div id="seopress_titles_desc_counters_val">/ 160</div>'),e.length>0?(jQuery("#seopress_titles_desc_counters").text(e.length),jQuery("#seopress_titles_desc_pixel").text(pixelDesc(e))):t.length&&(jQuery("#seopress_titles_desc_counters").text(t.length),jQuery("#seopress_titles_desc_pixel").text(pixelDesc(t))),e.length>160?jQuery("#seopress_titles_desc_counters").css("color","red"):t.length>160&&jQuery("#seopress_titles_desc_counters").css("color","red"),pixelDesc(e)>940?jQuery("#seopress_titles_desc_pixel").css("color","red"):pixelDesc(t)>940&&jQuery("#seopress_titles_desc_pixel").css("color","red"),e.length)var s=Math.round(pixelDesc(e)/940*100);else s=Math.round(pixelDesc(t)/940*100);s>=100&&(s=100),jQuery("#seopress_titles_desc_counters_progress").attr("aria-valuenow",s),jQuery("#seopress_titles_desc_counters_progress").text(s+"%"),jQuery("#seopress_titles_desc_counters_progress").css("width",s+"%"),jQuery("#seopress_titles_desc_meta, #seopress-tag-single-excerpt").on("keyup paste change click",function(e){var t=jQuery("#seopress_titles_desc_meta").val(),s=jQuery("#seopress_titles_desc_meta").attr("placeholder");if(jQuery("#seopress_titles_desc_counters").css("color","inherit"),jQuery("#seopress_titles_desc_pixel").css("color","inherit"),t.length>160&&jQuery("#seopress_titles_desc_counters").css("color","red"),pixelDesc(t)>940&&jQuery("#seopress_titles_desc_pixel").css("color","red"),0==t.length&&(s.length>160&&jQuery("#seopress_titles_desc_counters").css("color","red"),pixelDesc(s)>940&&jQuery("#seopress_titles_desc_pixel").css("color","red")),t.length>0?(jQuery("#seopress_titles_desc_counters").text(t.length),jQuery("#seopress_titles_desc_pixel").text(pixelDesc(t))):s.length&&(jQuery("#seopress_titles_desc_counters").text(s.length),jQuery("#seopress_titles_desc_pixel").text(pixelDesc(s))),t.length>0?(jQuery(".snippet-description-custom").text(e.target.value),jQuery(".snippet-description").css("display","none"),jQuery(".snippet-description-custom").css("display","inline"),jQuery(".snippet-description-default").css("display","none")):0==t.length&&(jQuery(".snippet-description-default").css("display","inline"),jQuery(".snippet-description-custom").css("display","none"),jQuery(".snippet-description").css("display","none")),t.length)var i=Math.round(pixelDesc(t)/940*100);else i=Math.round(pixelDesc(s)/940*100);i>=100&&(i=100),jQuery("#seopress_titles_desc_counters_progress").attr("aria-valuenow",i),jQuery("#seopress_titles_desc_counters_progress").text(i+"%"),jQuery("#seopress_titles_desc_counters_progress").css("width",i+"%")}),jQuery("#excerpt, .editor-post-excerpt textarea").keyup(function(e){var t=jQuery("#seopress_titles_desc_meta").val(),s=jQuery("#seopress_titles_desc_meta").attr("placeholder");if(0==t.length&&0==jQuery(".snippet-description-custom").val().length&&(jQuery(".snippet-description-custom").text(e.target.value),jQuery(".snippet-description").css("display","none"),jQuery(".snippet-description-custom").css("display","inline"),jQuery(".snippet-description-default").css("display","none")),t.length)var i=t.length;else i=s.length;i>=100&&(i=100),jQuery("#seopress_titles_desc_counters_progress").attr("aria-valuenow",i),jQuery("#seopress_titles_desc_counters_progress").text(i+"%"),jQuery("#seopress_titles_desc_counters_progress").css("width",i+"%")})}function pixelTitle(e){return inputText=e,font="18px Arial",canvas=document.createElement("canvas"),context=canvas.getContext("2d"),context.font=font,width=context.measureText(inputText).width,formattedWidth=Math.ceil(width),formattedWidth}function pixelDesc(e){return inputText=e,font="14px Arial",canvas=document.createElement("canvas"),context=canvas.getContext("2d"),context.font=font,width=context.measureText(inputText).width,formattedWidth=Math.ceil(width),formattedWidth}function sp_is_valid_url(e){var t=e.match(/(http(s)?:\/\/.)?(www\.)?[-a-zA-Z0-9@:%._\+~#=]{2,256}\.[a-z]{2,6}\b([-a-zA-Z0-9@:%_\+.~#?&//=]*)/g);return null!==t}function sp_social_img(e){jQuery(".snippet-"+e+"-img-alert").css("display","none");var t=jQuery("#seopress_social_"+e+"_img_meta").val();if(""==t)t=jQuery("#seopress_social_"+e+"_img_meta").attr("placeholder");!0===sp_is_valid_url(t)?(t.length>0?(jQuery(".snippet-"+e+"-img-custom img").attr("src",t),jQuery(".snippet-"+e+"-img").css("display","none"),jQuery(".snippet-"+e+"-img-custom").css("display","block"),jQuery(".snippet-"+e+"-img-default").css("display","none")):0==t.length&&(jQuery(".snippet-"+e+"-img-default").css("display","block"),jQuery(".snippet-"+e+"-img-custom").css("display","none"),jQuery(".snippet-"+e+"-img").css("display","none")),t.length>0&&jQuery.get(t).done(function(){var s=t.split(/\#|\?/)[0].split(".").pop().trim(),i=["jpg","jpeg","gif","png"];if(-1==i.indexOf(s))jQuery(".snippet-"+e+"-img-alert.alert1").css("display","block");else{var r=new Image;r.src=t,jQuery(r).one("load",function(){pic_real_width=parseInt(r.width),pic_real_height=parseInt(r.height),"fb"==e?(min_width=200,min_height=200):(min_width=144,min_height=144),(pic_real_width<min_width||pic_real_height<min_height)&&jQuery(".snippet-"+e+"-img-alert.alert2").css("display","block"),ratio_img=(pic_real_width/pic_real_height).toFixed(2),jQuery(".snippet-"+e+"-img-alert.alert4").css("display","block"),jQuery(".snippet-"+e+"-img-alert.alert4 span").text(ratio_img)})}}).fail(function(){jQuery(".snippet-"+e+"-img-alert.alert3").css("display","block")})):jQuery(".snippet-"+e+"-img-alert.alert5").css("display","block")}function sp_social(){jQuery("#seopress_social_fb_title_meta, #seopress-tag-single-title, #seopress-tag-single-site-title, #seopress-tag-single-sep").on("keyup paste change click",function(e){var t=jQuery("#seopress_social_fb_title_meta").val();t.length>0?(jQuery(".snippet-fb-title-custom").text(e.target.value),jQuery(".snippet-fb-title").css("display","none"),jQuery(".snippet-fb-title-custom").css("display","block"),jQuery(".snippet-fb-title-default").css("display","none")):0==t.length&&(jQuery(".snippet-fb-title-default").css("display","block"),jQuery(".snippet-fb-title-custom").css("display","none"),jQuery(".snippet-fb-title").css("display","none"))}),jQuery("#seopress_social_fb_desc_meta").on("keyup paste change click",function(e){var t=jQuery("#seopress_social_fb_desc_meta").val();t.length>0?(jQuery(".snippet-fb-description-custom").text(e.target.value),jQuery(".snippet-fb-description").css("display","none"),jQuery(".snippet-fb-description-custom").css("display","block"),jQuery(".snippet-fb-description-default").css("display","none")):0==t.length&&(jQuery(".snippet-fb-description-default").css("display","block"),jQuery(".snippet-fb-description-custom").css("display","none"),jQuery(".snippet-fb-description").css("display","none"))}),sp_social_img("fb"),jQuery("#seopress_social_fb_img_meta").on("keyup paste change click",function(){sp_social_img("fb")}),jQuery("#seopress_social_twitter_title_meta").on("keyup paste change click",function(e){var t=jQuery("#seopress_social_twitter_title_meta").val();t.length>0?(jQuery(".snippet-twitter-title-custom").text(e.target.value),jQuery(".snippet-twitter-title").css("display","none"),jQuery(".snippet-twitter-title-custom").css("display","block"),jQuery(".snippet-twitter-title-default").css("display","none")):0==t.length&&(jQuery(".snippet-twitter-title-default").css("display","block"),jQuery(".snippet-twitter-title-custom").css("display","none"),jQuery(".snippet-twitter-title").css("display","none"))}),jQuery("#seopress_social_twitter_desc_meta").on("keyup paste change click",function(e){var t=jQuery("#seopress_social_twitter_desc_meta").val();t.length>0?(jQuery(".snippet-twitter-description-custom").text(e.target.value),jQuery(".snippet-twitter-description").css("display","none"),jQuery(".snippet-twitter-description-custom").css("display","block"),jQuery(".snippet-twitter-description-default").css("display","none")):0==t.length&&(jQuery(".snippet-twitter-description-default").css("display","block"),jQuery(".snippet-twitter-description-custom").css("display","none"),jQuery(".snippet-twitter-description").css("display","none"))}),sp_social_img("twitter"),jQuery("#seopress_social_twitter_img_meta").on("keyup paste change click",function(){sp_social_img("twitter")})}function sp_ca_toggle(){var e=!1;jQuery(".gr-analysis-title .btn-toggle").on("click",function(t){e&&(event.stopImmediatePropagation(),event.preventDefault(),e=!1),jQuery(this).toggleClass("open"),jQuery(this).parent().parent().next(".gr-analysis-content").toggle()}),jQuery("#expand-all").on("click",function(e){e.preventDefault(),jQuery(".gr-analysis-content").show()}),jQuery("#close-all").on("click",function(e){e.preventDefault(),jQuery(".gr-analysis-content").hide()})}jQuery(document).ready(function(e){function t(){e.ajax({method:"GET",url:seopressAjaxRealPreview.seopress_real_preview,data:{action:"seopress_do_real_preview",post_id:e("#seopress-tabs").attr("data_id"),tax_name:e("#seopress-tabs").attr("data_tax"),origin:e("#seopress-tabs").attr("data_origin"),post_type:e("#seopress_launch_analysis").attr("data_post_type"),seopress_analysis_target_kw:e("#seopress_analysis_target_kw_meta").val(),_ajax_nonce:seopressAjaxRealPreview.seopress_nonce},beforeSend:function(){e(".analysis-score p span").fadeIn().text(seopressAjaxRealPreview.i18n.progress),e(".analysis-score p").addClass("loading")},success:function(t){void 0===t.data.og_title?og_title="":og_title=t.data.og_title.values,void 0===t.data.og_desc?og_desc="":og_desc=t.data.og_desc.values,void 0===t.data.og_img?og_img="":og_img=t.data.og_img.values,void 0===t.data.og_url?og_url="":og_url=t.data.og_url.host,void 0===t.data.og_site_name?og_site_name="":og_site_name=t.data.og_site_name.values,void 0===t.data.tw_title?tw_title="":tw_title=t.data.tw_title.values,void 0===t.data.tw_desc?tw_desc="":tw_desc=t.data.tw_desc.values,void 0===t.data.tw_img?tw_img="":tw_img=t.data.tw_img.values,void 0===t.data.meta_robots?meta_robots="":meta_robots=t.data.meta_robots[0];var s={og_title:og_title,og_desc:og_desc,og_img:og_img,og_url:og_url,og_site_name:og_site_name,tw_title:tw_title,tw_desc:tw_desc,tw_img:tw_img};for(var i in s)s.length&&(i=s[i].length>1?s[i].slice(-1)[0]:s[i][0]);meta_robots=meta_robots.toString(),e("#sp-advanced-alert").empty();var r=new RegExp("noindex");r.test(meta_robots)&&e("#sp-advanced-alert").append('<span class="impact high" aria-hidden="true"></span>'),e("#seopress_cpt .google-snippet-preview .snippet-title").html(t.data.title),e("#seopress_cpt .google-snippet-preview .snippet-title-default").html(t.data.title),e("#seopress_titles_title_meta").attr("placeholder",t.data.title),e("#seopress_cpt .google-snippet-preview .snippet-description").html(t.data.meta_desc),e("#seopress_cpt .google-snippet-preview .snippet-description-default").html(t.data.meta_desc),e("#seopress_titles_desc_meta").attr("placeholder",t.data.meta_desc),s.og_title&&(e("#seopress_cpt #seopress_social_fb_title_meta").attr("placeholder",s.og_title[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-title").html(s.og_title[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-title-default").html(s.og_title[0])),s.og_desc&&(e("#seopress_cpt #seopress_social_fb_desc_meta").attr("placeholder",s.og_desc[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-description").html(s.og_desc[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-description-default").html(s.og_desc[0])),s.og_img&&(e("#seopress_cpt #seopress_social_fb_img_meta").attr("placeholder",s.og_img[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-img img").attr("src",s.og_img[0]),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-img-default img").attr("src",s.og_img[0])),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-url").html(s.og_url),e("#seopress_cpt .facebook-snippet-preview .snippet-fb-site-name").html(s.og_site_name),s.tw_title&&(e("#seopress_cpt #seopress_social_twitter_title_meta").attr("placeholder",s.tw_title[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-title").html(s.tw_title[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-title-default").html(s.tw_title[0])),s.tw_desc&&(e("#seopress_cpt #seopress_social_twitter_desc_meta").attr("placeholder",s.tw_desc[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-description").html(s.tw_desc[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-description-default").html(s.tw_desc[0])),s.tw_img&&(e("#seopress_cpt #seopress_social_twitter_img_meta").attr("placeholder",s.tw_img[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-img img").attr("src",s.tw_img[0]),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-img-default img").attr("src",s.tw_img[0])),e("#seopress_cpt .twitter-snippet-preview .snippet-twitter-url").html(s.og_url),e("#seopress_cpt #seopress_robots_canonical_meta").attr("placeholder",t.data.canonical),e("#seopress-analysis-tabs").load(" #seopress-analysis-tabs-1","",sp_ca_toggle),e(".analysis-score p").removeClass("loading"),e(" #seopress_titles_title_counters_val").remove(),e(" #seopress_titles_desc_counters_val").remove(),sp_titles_counters(),sp_meta_desc_counters(),sp_social()}})}var s=document.querySelector("input[id=seopress_analysis_target_kw_meta]");new Tagify(s,{originalInputValueFormat:e=>e.map(e=>e.value).join(",")}),"1"==jQuery("#toggle-preview").attr("data-toggle")?jQuery("#seopress_cpt .google-snippet-preview").addClass("mobile-preview"):jQuery("#seopress_cpt .google-snippet-preview").removeClass("mobile-preview"),jQuery("#toggle-preview").on("click",function(){jQuery("#toggle-preview").attr("data-toggle","1"==jQuery("#toggle-preview").attr("data-toggle")?"0":"1"),jQuery("#seopress_cpt .google-snippet-preview").toggleClass("mobile-preview")}),t(),e("#seopress_launch_analysis").on("click",function(){t()}),sp_ca_toggle()});
|
assets/js/seopress-dashboard.js
CHANGED
@@ -20,7 +20,8 @@ jQuery(document).ready(function($) {
|
|
20 |
"notice-enfold",
|
21 |
"notice-themes",
|
22 |
"notice-page-builders",
|
23 |
-
"notice-go-pro"
|
|
|
24 |
]
|
25 |
notices.forEach(function (item) {
|
26 |
$('#'+item).on('click', function() {
|
20 |
"notice-enfold",
|
21 |
"notice-themes",
|
22 |
"notice-page-builders",
|
23 |
+
"notice-go-pro",
|
24 |
+
"notice-noindex"
|
25 |
]
|
26 |
notices.forEach(function (item) {
|
27 |
$('#'+item).on('click', function() {
|
assets/js/seopress-dashboard.min.js
CHANGED
@@ -1 +1 @@
|
|
1 |
-
jQuery(document).ready(function(e){e.trim(e("#seopress-notifications-center").html())||e("#seopress-notifications-center").remove();const t=["notice-get-started","notice-wizard","notice-insights-wizard","notice-tagdiv","notice-divide-comments","notice-review","notice-trailingslash","notice-posts-number","notice-rss-use-excerpt","notice-search-console","notice-google-business","notice-ssl","notice-title-tag","notice-enfold","notice-themes","notice-page-builders","notice-go-pro"];t.forEach(function(t){e("#"+t).on("click",function(){e("#"+t).attr("data-notice","1"==e("#"+t).attr("data-notice")?"0":"1"),e.ajax({method:"POST",url:seopressAjaxHideNotices.seopress_hide_notices,data:{action:"seopress_hide_notices",notice:t,notice_value:e("#"+t).attr("data-notice"),_ajax_nonce:seopressAjaxHideNotices.seopress_nonce},success:function(s){e("#seopress-notice-save").css("display","block"),e("#seopress-notice-save .html").html("Notice successfully removed"),e("#"+t+"-alert").fadeOut(),e("#seopress-notice-save").delay(3500).fadeOut()}})})});const s=["titles","xml-sitemap","social","google-analytics","advanced","local-business","woocommerce","edd","dublin-core","rich-snippets","breadcrumbs","robots","news","404","bot","rewrite","white-label"];s.forEach(function(t){e("#toggle-"+t).on("click",function(){e("#toggle-"+t).attr("data-toggle","1"==e("#toggle-"+t).attr("data-toggle")?"0":"1"),e.ajax({method:"POST",url:seopressAjaxToggleFeatures.seopress_toggle_features,data:{action:"seopress_toggle_features",feature:"toggle-"+t,feature_value:e("#toggle-"+t).attr("data-toggle"),_ajax_nonce:seopressAjaxToggleFeatures.seopress_nonce},success:function(s){e("#seopress-notice-save").css("display","block"),e("#seopress-notice-save .html").html(t+" "+seopressAjaxToggleFeatures.i18n),e("#"+t+"-state").toggleClass("feature-state-on"),e("#"+t+"-state-default").toggleClass("feature-state-off"),e("#seopress-notice-save").delay(3500).fadeOut()}})})})});
|
1 |
+
jQuery(document).ready(function(e){e.trim(e("#seopress-notifications-center").html())||e("#seopress-notifications-center").remove();const t=["notice-get-started","notice-wizard","notice-insights-wizard","notice-tagdiv","notice-divide-comments","notice-review","notice-trailingslash","notice-posts-number","notice-rss-use-excerpt","notice-search-console","notice-google-business","notice-ssl","notice-title-tag","notice-enfold","notice-themes","notice-page-builders","notice-go-pro","notice-noindex"];t.forEach(function(t){e("#"+t).on("click",function(){e("#"+t).attr("data-notice","1"==e("#"+t).attr("data-notice")?"0":"1"),e.ajax({method:"POST",url:seopressAjaxHideNotices.seopress_hide_notices,data:{action:"seopress_hide_notices",notice:t,notice_value:e("#"+t).attr("data-notice"),_ajax_nonce:seopressAjaxHideNotices.seopress_nonce},success:function(s){e("#seopress-notice-save").css("display","block"),e("#seopress-notice-save .html").html("Notice successfully removed"),e("#"+t+"-alert").fadeOut(),e("#seopress-notice-save").delay(3500).fadeOut()}})})});const s=["titles","xml-sitemap","social","google-analytics","advanced","local-business","woocommerce","edd","dublin-core","rich-snippets","breadcrumbs","robots","news","404","bot","rewrite","white-label"];s.forEach(function(t){e("#toggle-"+t).on("click",function(){e("#toggle-"+t).attr("data-toggle","1"==e("#toggle-"+t).attr("data-toggle")?"0":"1"),e.ajax({method:"POST",url:seopressAjaxToggleFeatures.seopress_toggle_features,data:{action:"seopress_toggle_features",feature:"toggle-"+t,feature_value:e("#toggle-"+t).attr("data-toggle"),_ajax_nonce:seopressAjaxToggleFeatures.seopress_nonce},success:function(s){e("#seopress-notice-save").css("display","block"),e("#seopress-notice-save .html").html(t+" "+seopressAjaxToggleFeatures.i18n),e("#"+t+"-state").toggleClass("feature-state-on"),e("#"+t+"-state-default").toggleClass("feature-state-off"),e("#seopress-notice-save").delay(3500).fadeOut()}})})})});
|
assets/js/seopress-migrate.js
CHANGED
@@ -84,7 +84,7 @@ jQuery(document).ready(function($) {
|
|
84 |
self.process_offset( 0, self, url, action, _ajax_nonce, id );
|
85 |
});
|
86 |
|
87 |
-
process_offset = function( offset, self, url, action, _ajax_nonce, id ) {
|
88 |
|
89 |
i18n = seopressAjaxMigrate.i18n.migration;
|
90 |
if (id =='metadata') {
|
@@ -96,6 +96,8 @@ jQuery(document).ready(function($) {
|
|
96 |
data : {
|
97 |
action: action,
|
98 |
offset: offset,
|
|
|
|
|
99 |
_ajax_nonce: _ajax_nonce,
|
100 |
},
|
101 |
success : function( data ) {
|
@@ -108,7 +110,7 @@ jQuery(document).ready(function($) {
|
|
108 |
$(location).attr('href',data.data.url);
|
109 |
}
|
110 |
} else {
|
111 |
-
self.process_offset( parseInt( data.data.offset ), self, url, action, _ajax_nonce, id );
|
112 |
}
|
113 |
},
|
114 |
});
|
84 |
self.process_offset( 0, self, url, action, _ajax_nonce, id );
|
85 |
});
|
86 |
|
87 |
+
process_offset = function( offset, self, url, action, _ajax_nonce, id, post_export, term_export ) {
|
88 |
|
89 |
i18n = seopressAjaxMigrate.i18n.migration;
|
90 |
if (id =='metadata') {
|
96 |
data : {
|
97 |
action: action,
|
98 |
offset: offset,
|
99 |
+
post_export : post_export,
|
100 |
+
term_export : term_export,
|
101 |
_ajax_nonce: _ajax_nonce,
|
102 |
},
|
103 |
success : function( data ) {
|
110 |
$(location).attr('href',data.data.url);
|
111 |
}
|
112 |
} else {
|
113 |
+
self.process_offset( parseInt( data.data.offset ), self, url, action, _ajax_nonce, id, data.data.post_export, data.data.term_export );
|
114 |
}
|
115 |
},
|
116 |
});
|
assets/js/seopress-migrate.min.js
CHANGED
@@ -1 +1 @@
|
|
1 |
-
jQuery(document).ready(function(e){e("#select-wizard-redirects, #select-wizard-import").change(function(s){s.preventDefault();var r=e(this).val();"none"==r?e("#select-wizard-redirects option, #select-wizard-import option").each(function(){var s=e(this).val();e("#"+s).hide()}):(e("#select-wizard-redirects option:selected, #select-wizard-import option:selected").each(function(){var s=e(this).val();e("#"+s).show()}),e("#select-wizard-redirects option:not(:selected), #select-wizard-import option:not(:selected)").each(function(){var s=e(this).val();e("#"+s).hide()}))}).trigger("change");const s=["yoast","aio","seo-framework","rk","squirrly","seo-ultimate","wp-meta-seo","premium-seo-pack","wpseo","metadata"];s.forEach(function(s){e("#seopress-"+s+"-migrate").on("click",function(e){switch(e.preventDefault(),id=s,e.target.id){case"seopress-yoast-migrate":url=seopressAjaxMigrate.seopress_yoast_migrate.seopress_yoast_migration,action="seopress_yoast_migration",_ajax_nonce=seopressAjaxMigrate.seopress_yoast_migrate.seopress_nonce;break;case"seopress-aio-migrate":url=seopressAjaxMigrate.seopress_aio_migrate.seopress_aio_migration,action="seopress_aio_migration",_ajax_nonce=seopressAjaxMigrate.seopress_aio_migrate.seopress_nonce;break;case"seopress-seo-framework-migrate":url=seopressAjaxMigrate.seopress_seo_framework_migrate.seopress_seo_framework_migration,action="seopress_seo_framework_migration",_ajax_nonce=seopressAjaxMigrate.seopress_seo_framework_migrate.seopress_nonce;break;case"seopress-rk-migrate":url=seopressAjaxMigrate.seopress_rk_migrate.seopress_rk_migration,action="seopress_rk_migration",_ajax_nonce=seopressAjaxMigrate.seopress_rk_migrate.seopress_nonce;break;case"seopress-squirrly-migrate":url=seopressAjaxMigrate.seopress_squirrly_migrate.seopress_squirrly_migration,action="seopress_squirrly_migration",_ajax_nonce=seopressAjaxMigrate.seopress_squirrly_migrate.seopress_nonce;break;case"seopress-seo-ultimate-migrate":url=seopressAjaxMigrate.seopress_seo_ultimate_migrate.seopress_seo_ultimate_migration,action="seopress_seo_ultimate_migration",_ajax_nonce=seopressAjaxMigrate.seopress_seo_ultimate_migrate.seopress_nonce;break;case"seopress-wp-meta-seo-migrate":url=seopressAjaxMigrate.seopress_wp_meta_seo_migrate.seopress_wp_meta_seo_migration,action="seopress_wp_meta_seo_migration",_ajax_nonce=seopressAjaxMigrate.seopress_wp_meta_seo_migrate.seopress_nonce;break;case"seopress-premium-seo-pack-migrate":url=seopressAjaxMigrate.seopress_premium_seo_pack_migrate.seopress_premium_seo_pack_migration,action="seopress_premium_seo_pack_migration",_ajax_nonce=seopressAjaxMigrate.seopress_premium_seo_pack_migrate.seopress_nonce;break;case"seopress-wpseo-migrate":url=seopressAjaxMigrate.seopress_wpseo_migrate.seopress_wpseo_migration,action="seopress_wpseo_migration",_ajax_nonce=seopressAjaxMigrate.seopress_wpseo_migrate.seopress_nonce;break;case"seopress-metadata-migrate":url=seopressAjaxMigrate.seopress_metadata_csv.seopress_metadata_export,action="seopress_metadata_export",_ajax_nonce=seopressAjaxMigrate.seopress_metadata_csv.seopress_nonce}self.process_offset(0,self,url,action,_ajax_nonce,id)}),process_offset=function(s,r,a,o,t,i){i18n=seopressAjaxMigrate.i18n.migration,"metadata"==i&&(i18n=seopressAjaxMigrate.i18n.export),e.ajax({method:"POST",url:a,data:{action:o,offset:s,_ajax_nonce:t},success:function(s){"done"==s.data.offset?(e("#seopress-"+i+"-migrate").removeAttr("disabled"),e(".spinner").css("visibility","hidden"),e("#"+i+"-migration-tool .log").html(i18n),""!=s.data.url&&e(location).attr("href",s.data.url)):r.process_offset(parseInt(s.data.offset),r,a,o,t,i)}})},e("#seopress-"+s+"-migrate").on("click",function(){e(this).attr("disabled","disabled"),e("#"+s+"-migration-tool .spinner").css("visibility","visible"),e("#"+s+"-migration-tool .spinner").css("float","none"),e("#"+s+"-migration-tool .log").html("")})})});
|
1 |
+
jQuery(document).ready(function(e){e("#select-wizard-redirects, #select-wizard-import").change(function(s){s.preventDefault();var r=e(this).val();"none"==r?e("#select-wizard-redirects option, #select-wizard-import option").each(function(){var s=e(this).val();e("#"+s).hide()}):(e("#select-wizard-redirects option:selected, #select-wizard-import option:selected").each(function(){var s=e(this).val();e("#"+s).show()}),e("#select-wizard-redirects option:not(:selected), #select-wizard-import option:not(:selected)").each(function(){var s=e(this).val();e("#"+s).hide()}))}).trigger("change");const s=["yoast","aio","seo-framework","rk","squirrly","seo-ultimate","wp-meta-seo","premium-seo-pack","wpseo","metadata"];s.forEach(function(s){e("#seopress-"+s+"-migrate").on("click",function(e){switch(e.preventDefault(),id=s,e.target.id){case"seopress-yoast-migrate":url=seopressAjaxMigrate.seopress_yoast_migrate.seopress_yoast_migration,action="seopress_yoast_migration",_ajax_nonce=seopressAjaxMigrate.seopress_yoast_migrate.seopress_nonce;break;case"seopress-aio-migrate":url=seopressAjaxMigrate.seopress_aio_migrate.seopress_aio_migration,action="seopress_aio_migration",_ajax_nonce=seopressAjaxMigrate.seopress_aio_migrate.seopress_nonce;break;case"seopress-seo-framework-migrate":url=seopressAjaxMigrate.seopress_seo_framework_migrate.seopress_seo_framework_migration,action="seopress_seo_framework_migration",_ajax_nonce=seopressAjaxMigrate.seopress_seo_framework_migrate.seopress_nonce;break;case"seopress-rk-migrate":url=seopressAjaxMigrate.seopress_rk_migrate.seopress_rk_migration,action="seopress_rk_migration",_ajax_nonce=seopressAjaxMigrate.seopress_rk_migrate.seopress_nonce;break;case"seopress-squirrly-migrate":url=seopressAjaxMigrate.seopress_squirrly_migrate.seopress_squirrly_migration,action="seopress_squirrly_migration",_ajax_nonce=seopressAjaxMigrate.seopress_squirrly_migrate.seopress_nonce;break;case"seopress-seo-ultimate-migrate":url=seopressAjaxMigrate.seopress_seo_ultimate_migrate.seopress_seo_ultimate_migration,action="seopress_seo_ultimate_migration",_ajax_nonce=seopressAjaxMigrate.seopress_seo_ultimate_migrate.seopress_nonce;break;case"seopress-wp-meta-seo-migrate":url=seopressAjaxMigrate.seopress_wp_meta_seo_migrate.seopress_wp_meta_seo_migration,action="seopress_wp_meta_seo_migration",_ajax_nonce=seopressAjaxMigrate.seopress_wp_meta_seo_migrate.seopress_nonce;break;case"seopress-premium-seo-pack-migrate":url=seopressAjaxMigrate.seopress_premium_seo_pack_migrate.seopress_premium_seo_pack_migration,action="seopress_premium_seo_pack_migration",_ajax_nonce=seopressAjaxMigrate.seopress_premium_seo_pack_migrate.seopress_nonce;break;case"seopress-wpseo-migrate":url=seopressAjaxMigrate.seopress_wpseo_migrate.seopress_wpseo_migration,action="seopress_wpseo_migration",_ajax_nonce=seopressAjaxMigrate.seopress_wpseo_migrate.seopress_nonce;break;case"seopress-metadata-migrate":url=seopressAjaxMigrate.seopress_metadata_csv.seopress_metadata_export,action="seopress_metadata_export",_ajax_nonce=seopressAjaxMigrate.seopress_metadata_csv.seopress_nonce}self.process_offset(0,self,url,action,_ajax_nonce,id)}),process_offset=function(s,r,a,o,t,i,_,p){i18n=seopressAjaxMigrate.i18n.migration,"metadata"==i&&(i18n=seopressAjaxMigrate.i18n.export),e.ajax({method:"POST",url:a,data:{action:o,offset:s,post_export:_,term_export:p,_ajax_nonce:t},success:function(s){"done"==s.data.offset?(e("#seopress-"+i+"-migrate").removeAttr("disabled"),e(".spinner").css("visibility","hidden"),e("#"+i+"-migration-tool .log").html(i18n),""!=s.data.url&&e(location).attr("href",s.data.url)):r.process_offset(parseInt(s.data.offset),r,a,o,t,i,s.data.post_export,s.data.term_export)}})},e("#seopress-"+s+"-migrate").on("click",function(){e(this).attr("disabled","disabled"),e("#"+s+"-migration-tool .spinner").css("visibility","visible"),e("#"+s+"-migration-tool .spinner").css("float","none"),e("#"+s+"-migration-tool .log").html("")})})});
|
assets/js/seopress-tabs2.js
CHANGED
@@ -1,7 +1,10 @@
|
|
1 |
-
|
|
|
|
|
2 |
$("#seopress-tabs .hidden").removeClass('hidden');
|
3 |
$("#seopress-tabs").tabs();
|
4 |
|
|
|
5 |
function sp_get_field_length(e) {
|
6 |
if (e.val().length > 0) {
|
7 |
meta = e.val() + ' ';
|
@@ -23,4 +26,49 @@ jQuery(document).ready(function($) {
|
|
23 |
$('#seopress-tag-single-sep').click(function() {
|
24 |
$("#seopress_titles_title_meta").val(sp_get_field_length($("#seopress_titles_title_meta")) + $('#seopress-tag-single-sep').attr('data-tag'));
|
25 |
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
26 |
});
|
1 |
+
document.addEventListener('DOMContentLoaded', function(){
|
2 |
+
const $ = jQuery
|
3 |
+
|
4 |
$("#seopress-tabs .hidden").removeClass('hidden');
|
5 |
$("#seopress-tabs").tabs();
|
6 |
|
7 |
+
|
8 |
function sp_get_field_length(e) {
|
9 |
if (e.val().length > 0) {
|
10 |
meta = e.val() + ' ';
|
26 |
$('#seopress-tag-single-sep').click(function() {
|
27 |
$("#seopress_titles_title_meta").val(sp_get_field_length($("#seopress_titles_title_meta")) + $('#seopress-tag-single-sep').attr('data-tag'));
|
28 |
});
|
29 |
+
|
30 |
+
|
31 |
+
|
32 |
+
let alreadyBind = false
|
33 |
+
|
34 |
+
//All variables
|
35 |
+
$('.seopress-tag-dropdown').each(function(item){
|
36 |
+
|
37 |
+
const _self = $(this)
|
38 |
+
$(this).on("click", function() {
|
39 |
+
|
40 |
+
$(this).next('.sp-wrap-tag-variables-list').toggleClass('open');
|
41 |
+
|
42 |
+
$(this).next('.sp-wrap-tag-variables-list').find('li').on("click", function(e) {
|
43 |
+
|
44 |
+
if(_self.hasClass("tag-title")){
|
45 |
+
$("#seopress_titles_title_meta").val(sp_get_field_length($("#seopress_titles_title_meta")) + $(this).attr('data-value'));
|
46 |
+
$("#seopress_titles_title_meta").trigger('paste')
|
47 |
+
}
|
48 |
+
if(_self.hasClass("tag-description")){
|
49 |
+
$("#seopress_titles_desc_meta").val(sp_get_field_length($("#seopress_titles_desc_meta")) + $(this).attr('data-value'));
|
50 |
+
$("#seopress_titles_desc_meta").trigger('paste')
|
51 |
+
}
|
52 |
+
e.stopImmediatePropagation();
|
53 |
+
});
|
54 |
+
|
55 |
+
|
56 |
+
function closeItem (e){
|
57 |
+
|
58 |
+
if($(e.target).hasClass("dashicons") || $(e.target).hasClass("seopress-tag-single-all")){
|
59 |
+
return
|
60 |
+
}
|
61 |
+
|
62 |
+
alreadyBind = false
|
63 |
+
$(document).off("click", closeItem)
|
64 |
+
$('.sp-wrap-tag-variables-list').removeClass('open')
|
65 |
+
}
|
66 |
+
|
67 |
+
if(!alreadyBind){
|
68 |
+
alreadyBind = true
|
69 |
+
$(document).on("click", closeItem)
|
70 |
+
}
|
71 |
+
|
72 |
+
});
|
73 |
+
})
|
74 |
});
|
assets/js/seopress-tabs2.min.js
CHANGED
@@ -1 +1 @@
|
|
1 |
-
|
1 |
+
document.addEventListener("DOMContentLoaded",function(){function t(t){return t.val().length>0?meta=t.val()+" ":meta=t.val(),meta}const e=jQuery;e("#seopress-tabs .hidden").removeClass("hidden"),e("#seopress-tabs").tabs(),e("#seopress-tag-single-title").click(function(){e("#seopress_titles_title_meta").val(t(e("#seopress_titles_title_meta"))+e("#seopress-tag-single-title").attr("data-tag"))}),e("#seopress-tag-single-site-title").click(function(){e("#seopress_titles_title_meta").val(t(e("#seopress_titles_title_meta"))+e("#seopress-tag-single-site-title").attr("data-tag"))}),e("#seopress-tag-single-excerpt").click(function(){e("#seopress_titles_desc_meta").val(t(e("#seopress_titles_desc_meta"))+e("#seopress-tag-single-excerpt").attr("data-tag"))}),e("#seopress-tag-single-sep").click(function(){e("#seopress_titles_title_meta").val(t(e("#seopress_titles_title_meta"))+e("#seopress-tag-single-sep").attr("data-tag"))});let s=!1;e(".seopress-tag-dropdown").each(function(a){const i=e(this);e(this).on("click",function(){function a(t){e(t.target).hasClass("dashicons")||e(t.target).hasClass("seopress-tag-single-all")||(s=!1,e(document).off("click",a),e(".sp-wrap-tag-variables-list").removeClass("open"))}e(this).next(".sp-wrap-tag-variables-list").toggleClass("open"),e(this).next(".sp-wrap-tag-variables-list").find("li").on("click",function(s){i.hasClass("tag-title")&&(e("#seopress_titles_title_meta").val(t(e("#seopress_titles_title_meta"))+e(this).attr("data-value")),e("#seopress_titles_title_meta").trigger("paste")),i.hasClass("tag-description")&&(e("#seopress_titles_desc_meta").val(t(e("#seopress_titles_desc_meta"))+e(this).attr("data-value")),e("#seopress_titles_desc_meta").trigger("paste")),s.stopImmediatePropagation()}),s||(s=!0,e(document).on("click",a))})})});
|
assets/js/seopress-tabs7.min.js
CHANGED
@@ -1 +1 @@
|
|
1 |
-
jQuery(document).ready(function(s){var e=window.location.hash.split("$");if("undefined"!=typeof sessionStorage){var
|
1 |
+
jQuery(document).ready(function(s){var e=window.location.hash,a=e.split("$");if("undefined"!=typeof sessionStorage){var t=sessionStorage.getItem("seopress_admin_tab");"1"==a[1]?(s("#tab_seopress_notifications-tab").addClass("nav-tab-active"),s("#tab_seopress_notifications").addClass("active")):"2"==a[1]?(s("#tab_seopress_seo_tools-tab").addClass("nav-tab-active"),s("#tab_seopress_seo_tools").addClass("active")):"3"==a[1]?(s("#tab_seopress_links-tab").addClass("nav-tab-active"),s("#tab_seopress_links_tools").addClass("active")):t?(s("#seopress-admin-tabs").find(".nav-tab.nav-tab-active").removeClass("nav-tab-active"),s("#seopress-admin-tabs").find(".seopress-tab.active").removeClass("active"),s("#"+t.split("#tab=")+"-tab").addClass("nav-tab-active"),s("#"+t.split("#tab=")).addClass("active")):(s("#tab_seopress_notifications-tab").addClass("nav-tab-active"),s("#tab_seopress_notifications").addClass("active"))}s("#seopress-admin-tabs").find("a.nav-tab").click(function(e){e.preventDefault();var t=s(this).attr("href").split("#tab=")[1];s("#seopress-admin-tabs").find(".nav-tab.nav-tab-active").removeClass("nav-tab-active"),s("#"+t+"-tab").addClass("nav-tab-active"),1==a[1]?sessionStorage.setItem("seopress_admin_tab","tab_seopress_notifications"):2==a[1]?sessionStorage.setItem("seopress_admin_tab","tab_seopress_seo_tools"):3==a[1]?sessionStorage.setItem("seopress_admin_tab","tab_seopress_links_tools"):sessionStorage.setItem("seopress_admin_tab",t),s("#seopress-admin-tabs").find(".seopress-tab.active").removeClass("active"),s("#"+t).addClass("active")}),s("#seopress-reverse-submit").on("click",function(){s.ajax({method:"GET",url:seopressAjaxReverse.seopress_request_reverse,data:{action:"seopress_request_reverse",_ajax_nonce:seopressAjaxReverse.seopress_nonce},success:function(s){window.location.reload(!0)}})}),s("#seopress-reverse-submit").on("click",function(){s(this).attr("disabled","disabled"),s("#spinner-reverse.spinner").css("visibility","visible"),s("#spinner-reverse.spinner").css("float","none")})});
|
assets/js/tagify.min.js
CHANGED
@@ -1,7 +1,8 @@
|
|
1 |
/**
|
2 |
-
* Tagify (
|
3 |
* By Yair Even-Or
|
4 |
* Don't sell this code. (c)
|
5 |
* https://github.com/yairEO/tagify
|
6 |
*/
|
7 |
-
!function(t,e){"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?module.exports=e():t.Tagify=e()}(this,function(){"use strict";function u(t){return function(t){if(Array.isArray(t)){for(var e=0,i=new Array(t.length);e<t.length;e++)i[e]=t[e];return i}}(t)||function(t){if(Symbol.iterator in Object(t)||"[object Arguments]"===Object.prototype.toString.call(t))return Array.from(t)}(t)||function(){throw new TypeError("Invalid attempt to spread non-iterable instance")}()}function s(e,t){var i=Object.keys(e);if(Object.getOwnPropertySymbols){var s=Object.getOwnPropertySymbols(e);t&&(s=s.filter(function(t){return Object.getOwnPropertyDescriptor(e,t).enumerable})),i.push.apply(i,s)}return i}function g(e){for(var t=1;t<arguments.length;t++){var i=null!=arguments[t]?arguments[t]:{};t%2?s(i,!0).forEach(function(t){n(e,t,i[t])}):Object.getOwnPropertyDescriptors?Object.defineProperties(e,Object.getOwnPropertyDescriptors(i)):s(i).forEach(function(t){Object.defineProperty(e,t,Object.getOwnPropertyDescriptor(i,t))})}return e}function n(t,e,i){return e in t?Object.defineProperty(t,e,{value:i,enumerable:!0,configurable:!0,writable:!0}):t[e]=i,t}function t(t,e){if(!t)return console.warn("Tagify: ","invalid input element ",t),this;this.applySettings(t,e||{}),this.state={editing:{},actions:{},dropdown:{}},this.value=[],this.listeners={},this.DOM={},this.extend(this,new this.EventDispatcher(this)),this.build(t),this.getCSSVars(),this.loadOriginalValues(),this.events.customBinding.call(this),this.events.binding.call(this),t.autofocus&&this.DOM.input.focus()}return t.prototype={isIE:window.document.documentMode,TEXTS:{empty:"empty",exceed:"number of tags exceeded",pattern:"pattern mismatch",duplicate:"already exists",notAllowed:"not allowed"},DEFAULTS:{delimiters:",",pattern:null,maxTags:1/0,callbacks:{},addTagOnBlur:!0,duplicates:!1,whitelist:[],blacklist:[],enforceWhitelist:!1,keepInvalidTags:!1,mixTagsAllowedAfter:/,|\.|\:|\s/,mixTagsInterpolator:["[[","]]"],backspace:!0,skipInvalid:!1,editTags:2,transformTag:function(){},autoComplete:{enabled:!0,rightKey:!1},dropdown:{classname:"",enabled:2,maxItems:10,searchKeys:[],fuzzySearch:!0,highlightFirst:!1,closeOnSelect:!0,position:"all"}},templates:{wrapper:function(t,e){return'<tags class="tagify '.concat(e.mode?"tagify--"+e.mode:""," ").concat(t.className,'"\n ').concat(e.readonly?'readonly aria-readonly="true"':'aria-haspopup="listbox" aria-expanded="false"','\n role="tagslist"\n tabIndex="-1">\n <span contenteditable data-placeholder="').concat(e.placeholder||"​",'" aria-placeholder="').concat(e.placeholder||"",'"\n class="tagify__input"\n role="textbox"\n aria-controls="dropdown"\n aria-autocomplete="both"\n aria-multiline="').concat("mix"==e.mode,'"></span>\n </tags>')},tag:function(t,e){return"<tag title='".concat(e.title||t,"'\n contenteditable='false'\n spellcheck='false'\n tabIndex=\"-1\"\n class='tagify__tag ").concat(e.class?e.class:"","'\n ").concat(this.getAttributes(e),">\n <x title='' class='tagify__tag__removeBtn' role='button' aria-label='remove tag'></x>\n <div>\n <span class='tagify__tag-text'>").concat(t,"</span>\n </div>\n </tag>")},dropdownItem:function(t){var e=this.settings.dropdown.mapValueTo,i=((e?"function"==typeof e?e(t):t[e]:t.value)||t.value||t).replace(/`|'/g,"'");return"<div ".concat(this.getAttributes(t),"\n class='tagify__dropdown__item ").concat(t.class?t.class:"",'\'\n tabindex="0"\n role="option"\n aria-labelledby="dropdown-label">').concat(i,"</div>")}},customEventsList:["add","remove","invalid","input","click","keydown","focus","blur","edit:input","edit:updated","edit:start","edit:keydown","dropdown:show","dropdown:hide","dropdown:select"],applySettings:function(i,t){var s=this;if(this.DEFAULTS.templates=this.templates,this.settings=this.extend({},this.DEFAULTS,t),this.settings.readonly=i.hasAttribute("readonly"),this.settings.placeholder=i.getAttribute("placeholder")||this.settings.placeholder||"",this.isIE&&(this.settings.autoComplete=!1),["whitelist","blacklist"].forEach(function(t){var e=i.getAttribute("data-"+t);e&&(e=e.split(s.settings.delimiters))instanceof Array&&(s.settings[t]=e)}),"autoComplete"in t&&!this.isObject(t.autoComplete)&&(this.settings.autoComplete=this.DEFAULTS.autoComplete,this.settings.autoComplete.enabled=t.autoComplete),i.pattern)try{this.settings.pattern=new RegExp(i.pattern)}catch(t){}if(this.settings.delimiters)try{this.settings.delimiters=new RegExp(this.settings.delimiters,"g")}catch(t){}"select"==this.settings.mode&&(this.settings.dropdown.enabled=0),"mix"==this.settings.mode&&(this.settings.autoComplete.rightKey=!0)},getAttributes:function(t){if("[object Object]"!=Object.prototype.toString.call(t))return"";var e,i,s=Object.keys(t),n="";for(i=s.length;i--;)"class"!=(e=s[i])&&t.hasOwnProperty(e)&&t[e]&&(n+=" "+e+(t[e]?'="'.concat(t[e],'"'):""));return n},parseHTML:function(t){return(new DOMParser).parseFromString(t.trim(),"text/html").body.firstElementChild},escapeHTML:function(t){var e=document.createTextNode(t),i=document.createElement("p");return i.appendChild(e),i.innerHTML},getCaretGlobalPosition:function(){var t=document.getSelection();if(t.rangeCount){var e,i,s=t.getRangeAt(0),n=s.startContainer,a=s.startOffset;if(0<a)return(i=document.createRange()).setStart(n,a-1),i.setEnd(n,a),{left:(e=i.getBoundingClientRect()).right,top:e.top,bottom:e.bottom}}return{left:-9999,top:-9999}},getCSSVars:function(){var t,e,i,s=getComputedStyle(this.DOM.scope,null);this.CSSVars={tagHideTransition:(t=function(t){if(!t)return{};var e=(t=t.trim().split(" ")[0]).split(/\d+/g).filter(function(t){return t}).pop().trim();return{value:+t.split(e).filter(function(t){return t})[0].trim(),unit:e}}((i="tag-hide-transition",s.getPropertyValue("--"+i))),e=t.value,"s"==t.unit?1e3*e:e)}},build:function(t){var e=this.DOM,i=this.settings.templates.wrapper(t,this.settings);e.originalInput=t,e.scope=this.parseHTML(i),e.input=e.scope.querySelector("[contenteditable]"),t.parentNode.insertBefore(e.scope,t),0<=this.settings.dropdown.enabled&&this.dropdown.init.call(this)},destroy:function(){this.DOM.scope.parentNode.removeChild(this.DOM.scope),this.dropdown.hide.call(this,!0)},loadOriginalValues:function(t){if(t=t||this.DOM.originalInput.value)if(this.removeAllTags(),"mix"==this.settings.mode)this.parseMixTags(t.trim());else{try{"string"!=typeof JSON.parse(t)&&(t=JSON.parse(t))}catch(t){}this.addTags(t).forEach(function(t){return t&&t.classList.add("tagify--noAnim")})}},isObject:function(t){var e=Object.prototype.toString.call(t).split(" ")[1].slice(0,-1);return t===Object(t)&&"Array"!=e&&"Function"!=e&&"RegExp"!=e&&"HTMLUnknownElement"!=e},extend:function(t,e,i){var s=this;function n(t,e){for(var i in e)e.hasOwnProperty(i)&&(s.isObject(e[i])?s.isObject(t[i])?n(t[i],e[i]):t[i]=Object.assign({},e[i]):t[i]=e[i])}return t instanceof Object||(t={}),n(t,e),i&&n(t,i),t},cloneEvent:function(t){var e={};for(var i in t)e[i]=t[i];return e},EventDispatcher:function(s){var n=document.createTextNode("");function i(e,t,i){i&&t.split(/\s+/g).forEach(function(t){return n[e+"EventListener"].call(n,t,i)})}this.off=function(t,e){return i("remove",t,e),this},this.on=function(t,e){return e&&"function"==typeof e&&i("add",t,e),this},this.trigger=function(t,e){var i;if(t)if(s.settings.isJQueryPlugin)"remove"==t&&(t="removeTag"),jQuery(s.DOM.originalInput).triggerHandler(t,[e]);else{try{i=new CustomEvent(t,{detail:this.extend({},e,{tagify:this})})}catch(t){console.warn(t)}n.dispatchEvent(i)}}},loading:function(t){return this.DOM.scope.classList[t?"add":"remove"]("tagify--loading"),this},toggleFocusClass:function(t){this.DOM.scope.classList.toggle("tagify--focus",!!t)},events:{customBinding:function(){var e=this;this.customEventsList.forEach(function(t){e.on(t,e.settings.callbacks[t])})},binding:function(t){var e,i=!(0<arguments.length&&void 0!==t)||t,s=this.events.callbacks,n=i?"addEventListener":"removeEventListener";if(!this.state.mainEvents||!i)for(var a in(this.state.mainEvents=i)&&!this.listeners.main&&(this.DOM.input.addEventListener(this.isIE?"keydown":"input",s[this.isIE?"onInputIE":"onInput"].bind(this)),this.settings.isJQueryPlugin&&jQuery(this.DOM.originalInput).on("tagify.removeAllTags",this.removeAllTags.bind(this))),e=this.listeners.main=this.listeners.main||{focus:["input",s.onFocusBlur.bind(this)],blur:["input",s.onFocusBlur.bind(this)],keydown:["input",s.onKeydown.bind(this)],click:["scope",s.onClickScope.bind(this)],dblclick:["scope",s.onDoubleClickScope.bind(this)]}){if("blur"==a&&!i)return;this.DOM[e[a][0]][n](a,e[a][1])}},callbacks:{onFocusBlur:function(t){var e=t.target?t.target.textContent.trim():"",i=this.settings,s=t.type;if(!(t.relatedTarget&&t.relatedTarget.classList.contains("tagify__tag")&&this.DOM.scope.contains(t.relatedTarget))){if("blur"==s&&t.relatedTarget===this.DOM.scope)return this.dropdown.hide.call(this),void this.DOM.input.focus();if(!this.state.actions.selectOption||!i.dropdown.enabled&&i.dropdown.closeOnSelect)if(this.state.hasFocus="focus"==s&&+new Date,this.toggleFocusClass(this.state.hasFocus),this.setRangeAtStartEnd(!1),"mix"!=i.mode){if("focus"==s)return this.trigger("focus",{relatedTarget:t.relatedTarget}),void(0===i.dropdown.enabled&&"select"!=i.mode&&this.dropdown.show.call(this));"blur"==s&&(this.trigger("blur",{relatedTarget:t.relatedTarget}),this.loading(!1),e&&!this.state.actions.selectOption&&i.addTagOnBlur&&this.addTags(e,!0)),this.DOM.input.removeAttribute("style"),this.dropdown.hide.call(this)}else"blur"==t.type&&this.dropdown.hide.call(this)}},onKeydown:function(t){var e,i=this,s=t.target.textContent.trim();if(this.trigger("keydown",{originalEvent:this.cloneEvent(t)}),"mix"==this.settings.mode){switch(t.key){case"Left":case"ArrowLeft":this.state.actions.ArrowLeft=!0;break;case"Delete":case"Backspace":var n=document.getSelection();!!navigator.userAgent.match(/firefox/i)&&n&&0==n.anchorOffset&&this.removeTag(n.anchorNode.previousSibling);var a=[];e=this.DOM.input.children,setTimeout(function(){[].forEach.call(e,function(t){return a.push(t.getAttribute("value"))}),i.value=i.value.filter(function(t){return-1!=a.indexOf(t.value)})})}return!0}switch(t.key){case"Backspace":""!=s&&8203!=s.charCodeAt(0)||(!0===this.settings.backspace?this.removeTag():"edit"==this.settings.backspace&&setTimeout(this.editTag.bind(this),0));break;case"Esc":case"Escape":if(this.state.dropdown.visible)return;t.target.blur();break;case"Down":case"ArrowDown":this.state.dropdown.visible||this.dropdown.show.call(this);break;case"ArrowRight":var o=this.state.inputSuggestion||this.state.ddItemData;if(o&&this.settings.autoComplete.rightKey)return void this.addTags([o],!0);break;case"Tab":if(!s)return!0;case"Enter":t.preventDefault(),setTimeout(function(){i.state.actions.selectOption||i.addTags(s,!0)})}},onInput:function(t){var e="mix"==this.settings.mode?this.DOM.input.textContent:this.input.normalize.call(this),i=e.length>=this.settings.dropdown.enabled,s={value:e,inputElm:this.DOM.input};if("mix"==this.settings.mode)return this.events.callbacks.onMixTagsInput.call(this,t);e?this.input.value!=e&&(s.isValid=this.validateTag(e),this.trigger("input",s),this.input.set.call(this,e,!1),-1!=e.search(this.settings.delimiters)?this.addTags(e)&&this.input.set.call(this):0<=this.settings.dropdown.enabled&&this.dropdown[i?"show":"hide"].call(this,e)):this.input.set.call(this,"")},onMixTagsInput:function(){var t,e,i,s,n,a=this,o=this.settings;if(this.hasMaxTags())return!0;window.getSelection&&0<(t=window.getSelection()).rangeCount&&((e=t.getRangeAt(0).cloneRange()).collapse(!0),e.setStart(window.getSelection().focusNode,0),(s=(i=e.toString().split(o.mixTagsAllowedAfter))[i.length-1].match(o.pattern))&&(this.state.actions.ArrowLeft=!1,this.state.tag={prefix:s[0],value:s.input.split(s[0])[1]},n=this.state.tag.value.length>=o.dropdown.enabled)),this.update(),setTimeout(function(){a.trigger("input",a.extend({},a.state.tag,{textContent:a.DOM.input.textContent})),a.state.tag&&a.dropdown[n?"show":"hide"].call(a,a.state.tag.value)},10)},onInputIE:function(t){var e=this;setTimeout(function(){e.events.callbacks.onInput.call(e,t)})},onClickScope:function(t){var e,i=t.target.closest(".tagify__tag"),s=this.settings,n=new Date-this.state.hasFocus;if(t.target!=this.DOM.scope){if(!t.target.classList.contains("tagify__tag__removeBtn"))return i?(e=this.getNodeIndex(i),this.trigger("click",{tag:i,index:e,data:this.value[e],originalEvent:this.cloneEvent(t)}),void(1==this.settings.editTags&&this.events.callbacks.onDoubleClickScope.call(this,t))):void(t.target==this.DOM.input&&500<n?this.state.dropdown.visible?this.dropdown.hide.call(this):0===s.dropdown.enabled&&"mix"!=s.mode&&this.dropdown.show.call(this):"select"==s.mode&&(this.state.dropdown.visible||this.dropdown.show.call(this)));this.removeTag(t.target.parentNode)}else this.DOM.input.focus()},onEditTagInput:function(t,e){var i=t.closest("tag"),s=this.getNodeIndex(i),n=this.input.normalize.call(this,t),a=n.toLowerCase()==t.originalValue.toLowerCase()||this.validateTag(n);i.classList.toggle("tagify--invalid",!0!==a),i.isValid=a,n.length>=this.settings.dropdown.enabled&&(this.state.editing.value=n,this.dropdown.show.call(this,n)),this.trigger("edit:input",{tag:i,index:s,data:this.extend({},this.value[s],{newValue:n}),originalEvent:this.cloneEvent(e)})},onEditTagBlur:function(t){if(this.state.hasFocus||this.toggleFocusClass(),this.DOM.scope.contains(t)){var e=t.closest(".tagify__tag"),i=this.getNodeIndex(e),s=this.input.normalize.call(this,t),n=s||t.originalValue,a=n!=t.originalValue,o=e.isValid,r=g({},this.value[i],{value:n});s?a?(this.settings.transformTag.call(this,r),void 0!==(o=this.validateTag(r.value))&&!0!==o||this.onEditTagDone(e,r)):this.onEditTagDone(e):this.removeTag(e)}},onEditTagkeydown:function(t){switch(this.trigger("edit:keydown",{originalEvent:this.cloneEvent(t)}),t.key){case"Esc":case"Escape":t.target.textContent=t.target.originalValue;case"Enter":case"Tab":t.preventDefault(),t.target.blur()}},onDoubleClickScope:function(t){var e,i,s=t.target.closest("tag"),n=this.settings;s&&(e=s.classList.contains("tagify__tag--editable"),i=s.hasAttribute("readonly"),"select"==n.mode||n.readonly||e||i||!this.settings.editTags||this.editTag(s),this.toggleFocusClass(!0))}}},editTag:function(t){var e=this,i=0<arguments.length&&void 0!==t?t:this.getLastTag(),s=i.querySelector(".tagify__tag-text"),n=this.getNodeIndex(i),a=this.value[n],o=this.events.callbacks,r=this;if(s){if(!("editable"in a)||a.editable)return i.classList.add("tagify__tag--editable"),s.originalValue=s.textContent,s.setAttribute("contenteditable",!0),s.addEventListener("blur",function(){setTimeout(o.onEditTagBlur.bind(r),0,s)}),s.addEventListener("input",o.onEditTagInput.bind(this,s)),s.addEventListener("keydown",function(t){return o.onEditTagkeydown.call(e,t)}),s.focus(),this.setRangeAtStartEnd(!1,s),this.state.editing={scope:i,input:i.querySelector("[contenteditable]")},this.trigger("edit:start",{tag:i,index:n,data:a}),this}else console.warn("Cannot find element in Tag template: ",".tagify__tag-text")},onEditTagDone:function(t,e){var i={tag:t,index:this.getNodeIndex(t),data:e};this.trigger("edit:beforeUpdate",i),this.replaceTag(t,e),this.trigger("edit:updated",i)},replaceTag:function(t,e){var i=this,s=t.querySelector(".tagify__tag-text"),n=s.cloneNode(!0),a=this.getNodeIndex(t);this.state.editing.locked||(this.state.editing={locked:!0},setTimeout(function(){return delete i.state.editing.locked},500),n.removeAttribute("contenteditable"),t.classList.remove("tagify__tag--editable"),s.parentNode.replaceChild(n,s),e&&(n.innerHTML=e.value,n.title=e.value,this.value[a]=e,this.update()))},setRangeAtStartEnd:function(e,i){i=(i=i||this.DOM.input).lastChild||i;var s=document.getSelection();s.rangeCount&&["Start","End"].forEach(function(t){return s.getRangeAt(0)["set"+t](i,e?0:i.length)})},input:{value:"",set:function(t,e){var i=0<arguments.length&&void 0!==t?t:"",s=!(1<arguments.length&&void 0!==e)||e,n=this.settings.dropdown.closeOnSelect;this.input.value=i,s&&(this.DOM.input.innerHTML=i),!i&&n&&setTimeout(this.dropdown.hide.bind(this),20),this.input.autocomplete.suggest.call(this),this.input.validate.call(this)},validate:function(){var t=!this.input.value||this.validateTag(this.input.value);"select"==this.settings.mode?this.DOM.scope.classList.toggle("tagify--invalid",!0!==t):this.DOM.input.classList.toggle("tagify__input--invalid",!0!==t)},normalize:function(t){var e=t||this.DOM.input,i=[];e.childNodes.forEach(function(t){return 3==t.nodeType&&i.push(t.nodeValue)}),i=i.join("\n");try{i=i.replace(/(?:\r\n|\r|\n)/g,this.settings.delimiters.source.charAt(0))}catch(t){}return i=i.replace(/\s/g," ").replace(/^\s+/,"")},autocomplete:{suggest:function(t){if(this.settings.autoComplete.enabled){"string"==typeof(t=t||{})&&(t={value:t});var e=t.value||"",i=e.substr(0,this.input.value.length).toLowerCase(),s=e.substring(this.input.value.length);e&&this.input.value&&i==this.input.value.toLowerCase()?(this.DOM.input.setAttribute("data-suggest",s),this.state.inputSuggestion=t):(this.DOM.input.removeAttribute("data-suggest"),delete this.state.inputSuggestion)}},set:function(t){var e=this.DOM.input.getAttribute("data-suggest"),i=t||(e?this.input.value+e:null);return!!i&&("mix"==this.settings.mode?this.replaceTextWithNode(document.createTextNode(this.state.tag.prefix+i)):(this.input.set.call(this,i),this.setRangeAtStartEnd()),this.input.autocomplete.suggest.call(this),this.dropdown.hide.call(this),!0)}}},getNodeIndex:function(t){var e=0;if(t)for(;t=t.previousElementSibling;)e++;return e},getTagElms:function(){return this.DOM.scope.querySelectorAll(".tagify__tag")},getLastTag:function(){var t=this.DOM.scope.querySelectorAll("tag:not(.tagify--hide):not([readonly])");return t[t.length-1]},isTagDuplicate:function(e){var i=this;return"select"!=this.settings.mode&&this.value.some(function(t){return i.isObject(e)?JSON.stringify(t).toLowerCase()===JSON.stringify(e).toLowerCase():e.trim().toLowerCase()===t.value.toLowerCase()})},getTagIndexByValue:function(i){var s=[];return this.getTagElms().forEach(function(t,e){t.textContent.trim().toLowerCase()==i.toLowerCase()&&s.push(e)}),s},getTagElmByValue:function(t){var e=this.getTagIndexByValue(t)[0];return this.getTagElms()[e]},markTagByValue:function(t,e){return!!(e=e||this.getTagElmByValue(t))&&(e.classList.add("tagify--mark"),e)},isTagBlacklisted:function(e){return e=e.toLowerCase().trim(),this.settings.blacklist.filter(function(t){return e==t.toLowerCase()}).length},isTagWhitelisted:function(e){return this.settings.whitelist.some(function(t){return"string"==typeof e?e.trim().toLowerCase()===(t.value||t).toLowerCase():JSON.stringify(t).toLowerCase()===JSON.stringify(e).toLowerCase()})},validateTag:function(t){var e=t.trim(),i=this.settings,s=!0;return e?i.pattern&&!i.pattern.test(e)?s=this.TEXTS.pattern:!i.duplicates&&this.isTagDuplicate(e)?s=this.TEXTS.duplicate:(this.isTagBlacklisted(e)||i.enforceWhitelist&&!this.isTagWhitelisted(e))&&(s=this.TEXTS.notAllowed):s=this.TEXTS.empty,s},hasMaxTags:function(){return this.value.length>=this.settings.maxTags&&this.TEXTS.exceed},normalizeTags:function(t){function i(t){return t.split(a).filter(function(t){return t}).map(function(t){return{value:t.trim()}})}var e,s=this.settings,n=s.whitelist,a=s.delimiters,o=s.mode,r=!!n&&n[0]instanceof Object,l=t instanceof Array,d=l&&t[0]instanceof Object&&"value"in t[0],c=[];if(d)return t=(e=[]).concat.apply(e,u(t.map(function(e){return i(e.value).map(function(t){return g({},e,{},t)})})));if("number"==typeof t&&(t=t.toString()),"string"==typeof t){if(!t.trim())return[];t=i(t)}else if(l){var h;t=(h=[]).concat.apply(h,u(t.map(function(t){return i(t)})))}return r&&(t.forEach(function(e){var t=n.filter(function(t){return t.value.toLowerCase()==e.value.toLowerCase()});t[0]?c.push(t[0]):"mix"!=o&&c.push(e)}),t=c),t},parseMixTags:function(t){var o=this,e=this.settings,r=e.mixTagsInterpolator,l=e.duplicates,d=e.transformTag,c=e.enforceWhitelist;return t=t.split(r[0]).map(function(t,e){var i,s,n=t.split(r[1]),a=n[0];try{i=JSON.parse(a)}catch(t){i=o.normalizeTags(a)[0]}if(!(1<n.length)||c&&!o.isTagWhitelisted(i.value)||!l&&o.isTagDuplicate(i)){if(t)return e?r[0]+t:t}else d.call(o,i),s=o.createTagElem(i),n[0]=s.outerHTML,o.value.push(i);return n.join("")}).join(""),this.DOM.input.innerHTML=t,this.DOM.input.appendChild(document.createTextNode("")),this.update(),t},replaceTextWithNode:function(t,e){if(this.state.tag||e){e=e||this.state.tag.prefix+this.state.tag.value;var i,s,n=window.getSelection(),a=n.anchorNode;return a.splitText(n.anchorOffset),i=a.nodeValue.lastIndexOf(e),(s=a.splitText(i)).nodeValue=s.nodeValue.replace(e,""),a.parentNode.insertBefore(t,s),this.DOM.input.normalize(),s}},selectTag:function(t,e){return this.input.set.call(this,e.value,!0),setTimeout(this.setRangeAtStartEnd.bind(this)),this.getLastTag()?this.replaceTag(this.getLastTag(),e):this.appendTag(t),this.value[0]=e,this.trigger("add",{tag:t,data:e}),this.update(),[t]},addEmptyTag:function(){var t={value:""},e=this.createTagElem(t);this.appendTag(e),this.value.push(t),this.update(),this.editTag(e)},addTags:function(t,e,i){var s,n=this,a=2<arguments.length&&void 0!==i?i:this.settings.skipInvalid,o=[],r=this.settings;return t&&0!=t.length?(t=this.normalizeTags(t),this.state.editing.scope?this.onEditTagDone(this.state.editing.scope,t[0]):"mix"==r.mode?(r.transformTag.call(this,t[0]),s=this.createTagElem(t[0]),this.replaceTextWithNode(s)||this.DOM.input.appendChild(s),this.DOM.input.appendChild(document.createTextNode("")),t[0].prefix=t[0].prefix||this.state.tag?this.state.tag.prefix:(r.pattern.source||r.pattern)[0],this.value.push(t[0]),this.update(),this.state.tag=null,this.trigger("add",this.extend({},{tag:s},{data:t[0]})),this.DOM.input.appendChild(document.createTextNode("")),s):("select"==r.mode&&(e=!1),this.DOM.input.removeAttribute("style"),t.forEach(function(t){var e,i,s={};if(t=Object.assign({},t),r.transformTag.call(n,t),!0!==(e=n.hasMaxTags()||n.validateTag(t.value))){if(a)return;s["aria-invalid"]=!0,s.class=(t.class||"")+" tagify--notAllowed",s.title=e,n.markTagByValue(t.value)}if(s.role="tag",t.readonly&&(s["aria-readonly"]=!0),i=n.createTagElem(n.extend({},t,s)),o.push(i),"select"==r.mode)return n.selectTag(i,t);n.appendTag(i),!0===e?(n.value.push(t),n.update(),n.trigger("add",{tag:i,index:n.value.length-1,data:t})):(n.trigger("invalid",{data:t,index:n.value.length,tag:i,message:e}),r.keepInvalidTags||setTimeout(function(){return n.removeTag(i,!0)},1e3)),n.dropdown.position.call(n)}),t.length&&e&&this.input.set.call(this),this.dropdown.refilter.call(this),o)):("select"==r.mode&&this.removeAllTags(),o)},appendTag:function(t){var e=this.DOM.scope.lastElementChild;e===this.DOM.input?this.DOM.scope.insertBefore(t,e):this.DOM.scope.appendChild(t)},minify:function(t){return t?t.replace(/\>[\r\n ]+\</g,"><").replace(/(<.*?>)|\s+/g,function(t,e){return e||" "}):""},createTagElem:function(t){var e=this.escapeHTML(t.value),i=this.settings.templates.tag.call(this,e,t);return this.settings.readonly&&(t.readonly=!0),i=this.minify(i),this.parseHTML(i)},removeTag:function(t,e,i){if(t=t||this.getLastTag(),i=i||this.CSSVars.tagHideTransition,"string"==typeof t&&(t=this.getTagElmByValue(t)),t instanceof HTMLElement){var s,n=this,a=this.getNodeIndex(t);"select"==this.settings.mode&&(i=0,this.input.set.call(this)),t.classList.contains("tagify--notAllowed")&&(e=!0),i&&10<i?(t.style.width=parseFloat(window.getComputedStyle(t).width)+"px",document.body.clientTop,t.classList.add("tagify--hide"),setTimeout(o,i)):o()}function o(){t.parentNode&&(t.parentNode.removeChild(t),e?n.settings.keepInvalidTags&&n.trigger("remove",{tag:t,index:a}):(s=n.value.splice(a,1)[0],n.update(),n.trigger("remove",{tag:t,index:a,data:s}),n.dropdown.refilter.call(n),n.dropdown.position.call(n)))}},removeAllTags:function(){this.value=[],this.update(),Array.prototype.slice.call(this.getTagElms()).forEach(function(t){return t.parentNode.removeChild(t)}),this.dropdown.position.call(this),"select"==this.settings.mode&&this.input.set.call(this)},preUpdate:function(){this.DOM.scope.classList.toggle("tagify--hasMaxTags",this.value.length>=this.settings.maxTags),this.DOM.scope.classList.toggle("tagify--noTags",!this.value.length)},update:function(){this.preUpdate(),this.DOM.originalInput.value="mix"==this.settings.mode?this.getMixedTagsAsString():this.value.length?JSON.stringify(this.value):""},getMixedTagsAsString:function(){var e=this,i="",s=0,n=this.settings.mixTagsInterpolator;return this.DOM.input.childNodes.forEach(function(t){1==t.nodeType&&t.classList.contains("tagify__tag")?i+=n[0]+JSON.stringify(e.value[s++])+n[1]:i+=t.textContent}),i},getNodeHeight:function(t){var e,i=t.cloneNode(!0);return i.style.cssText="position:fixed; top:-9999px; opacity:0",document.body.appendChild(i),e=i.clientHeight,i.parentNode.removeChild(i),e},dropdown:{init:function(){this.DOM.dropdown=this.dropdown.build.call(this),this.DOM.dropdown.content=this.DOM.dropdown.querySelector(".tagify__dropdown__wrapper")},build:function(){var t=this.settings.dropdown,e=t.position,i=t.classname,s="".concat("manual"==e?"":"tagify__dropdown tagify__dropdown--".concat(e)," ").concat(i).trim();return this.parseHTML('<div class="'.concat(s,'" role="listbox" aria-labelledby="dropdown">\n <div class="tagify__dropdown__wrapper"></div>\n </div>'))},show:function(t){var e,i,s,n,a=this,o=this.settings,r="manual"==o.dropdown.position;if(o.whitelist&&o.whitelist.length&&!1!==o.dropdown.enable){if(this.suggestedListItems=this.dropdown.filterListItems.call(this,t),!this.suggestedListItems.length)return this.input.autocomplete.suggest.call(this),void this.dropdown.hide.call(this);s=(i=this.suggestedListItems[0]).value||i,o.autoComplete&&0==s.indexOf(t)&&this.input.autocomplete.suggest.call(this,i),e=this.dropdown.createListHTML.call(this,this.suggestedListItems),this.DOM.dropdown.content.innerHTML=this.minify(e),(o.enforceWhitelist&&!r||o.dropdown.highlightFirst)&&this.dropdown.highlightOption.call(this,this.DOM.dropdown.content.children[0]),this.DOM.scope.setAttribute("aria-expanded",!0),this.trigger("dropdown:show",this.DOM.dropdown),this.state.dropdown.visible=t||!0,this.dropdown.position.call(this),document.body.contains(this.DOM.dropdown)||(r||(this.events.binding.call(this,!1),n=this.getNodeHeight(this.DOM.dropdown),this.DOM.dropdown.classList.add("tagify__dropdown--initial"),this.dropdown.position.call(this,n),document.body.appendChild(this.DOM.dropdown),setTimeout(function(){return a.DOM.dropdown.classList.remove("tagify__dropdown--initial")})),setTimeout(this.dropdown.events.binding.bind(this)))}},hide:function(t){var e=this.DOM,i=e.scope,s=e.dropdown,n="manual"==this.settings.dropdown.position&&!t;s&&document.body.contains(s)&&!n&&(window.removeEventListener("resize",this.dropdown.position),this.dropdown.events.binding.call(this,!1),setTimeout(this.events.binding.bind(this),250),i.setAttribute("aria-expanded",!1),s.parentNode.removeChild(s),this.state.dropdown.visible=!1,this.state.ddItemData=null,this.state.ddItemElm=null,this.trigger("dropdown:hide",s))},refilter:function(){this.suggestedListItems=this.dropdown.filterListItems.call(this,"");var t=this.dropdown.createListHTML.call(this,this.suggestedListItems);this.DOM.dropdown.content.innerHTML=this.minify(t)},position:function(t){var e,i,s,n,a,o,r=this.DOM.dropdown;this.state.dropdown.visible&&(o="text"==this.settings.dropdown.position?(n=(i=this.getCaretGlobalPosition()).bottom,s=i.top,a=i.left,"auto"):(s=(i=this.DOM.scope.getBoundingClientRect()).top,n=i.bottom-1,a=i.left,i.width+"px"),s=Math.floor(s),n=Math.ceil(n),e=document.documentElement.clientHeight-n<(t||r.clientHeight),r.style.cssText="left:"+(a+window.pageXOffset)+"px; width:"+o+";"+(e?"bottom:"+(document.documentElement.clientHeight-s-window.pageYOffset-2)+"px;":"top: "+(n+window.pageYOffset)+"px"),r.setAttribute("placement",e?"top":"bottom"))},events:{binding:function(t){var e=!(0<arguments.length&&void 0!==t)||t,i=this.dropdown.events.callbacks,s=this.listeners.dropdown=this.listeners.dropdown||{position:this.dropdown.position.bind(this),onKeyDown:i.onKeyDown.bind(this),onMouseOver:i.onMouseOver.bind(this),onMouseLeave:i.onMouseLeave.bind(this),onClick:i.onClick.bind(this)},n=e?"addEventListener":"removeEventListener";"manual"!=this.settings.dropdown.position&&(window[n]("resize",s.position),window[n]("keydown",s.onKeyDown)),this.DOM.dropdown[n]("mouseover",s.onMouseOver),this.DOM.dropdown[n]("mouseleave",s.onMouseLeave),this.DOM.dropdown[n]("mousedown",s.onClick),this.DOM[this.listeners.main.click[0]][n]("click",this.listeners.main.click[1])},callbacks:{onKeyDown:function(t){var e=this.DOM.dropdown.querySelector("[class$='--active']"),i=e;switch(t.key){case"ArrowDown":case"ArrowUp":case"Down":case"Up":var s;t.preventDefault(),i=(i=i&&i[("ArrowUp"==t.key||"Up"==t.key?"previous":"next")+"ElementSibling"])||(s=this.DOM.dropdown.content.children)["ArrowUp"==t.key||"Up"==t.key?s.length-1:0],this.dropdown.highlightOption.call(this,i,!0);break;case"Escape":case"Esc":this.dropdown.hide.call(this);break;case"ArrowRight":if(this.state.actions.ArrowLeft)return;case"Tab":if(t.preventDefault(),"mix"!=this.settings.mode&&!this.settings.autoComplete.rightKey){try{var n=i?i.textContent:this.suggestedListItems[0].value;this.input.autocomplete.set.call(this,n)}catch(t){}return!1}case"Enter":t.preventDefault(),this.dropdown.selectOption.call(this,e);break;case"Backspace":if("mix"==this.settings.mode||this.state.editing.scope)return;var a=this.input.value.trim();""!=a&&8203!=a.charCodeAt(0)||(!0===this.settings.backspace?this.removeTag():"edit"==this.settings.backspace&&setTimeout(this.editTag.bind(this),0))}},onMouseOver:function(t){var e=t.target.closest(".tagify__dropdown__item");e&&this.dropdown.highlightOption.call(this,e)},onMouseLeave:function(){this.dropdown.highlightOption.call(this)},onClick:function(t){if(0==t.button&&t.target!=this.DOM.dropdown){var e=t.target.closest(".tagify__dropdown__item");this.dropdown.selectOption.call(this,e)}}}},highlightOption:function(t,e){var i,s="tagify__dropdown__item--active";if(this.state.ddItemElm&&(this.state.ddItemElm.classList.remove(s),this.state.ddItemElm.removeAttribute("aria-selected")),!t)return this.state.ddItemData=null,this.state.ddItemElm=null,void this.input.autocomplete.suggest.call(this);i=this.suggestedListItems[this.getNodeIndex(t)],this.state.ddItemData=i,(this.state.ddItemElm=t).classList.add(s),t.setAttribute("aria-selected",!0),e&&(t.parentNode.scrollTop=t.clientHeight+t.offsetTop-t.parentNode.clientHeight),this.settings.autoComplete&&(this.input.autocomplete.suggest.call(this,i),"manual"!=this.settings.dropdown.position&&this.dropdown.position.call(this))},selectOption:function(t){var e=this;if(t){this.state.actions.selectOption=!0,setTimeout(function(){return e.state.actions.selectOption=!1},50);var i=this.settings.dropdown.closeOnSelect,s=this.suggestedListItems[this.getNodeIndex(t)]||this.input.value;this.trigger("dropdown:select",s),this.addTags([s],!0),setTimeout(function(){e.DOM.input.focus(),e.toggleFocusClass(!0)}),i&&this.dropdown.hide.call(this)}},filterListItems:function(t){var i,e,s,n,a=this,o=this.settings,r=[],l=o.whitelist,d=o.dropdown.maxItems||1/0,c=o.dropdown.searchKeys.concat(["searchBy","value"]),h=0;if(!t)return(o.duplicates?l:l.filter(function(t){return!a.isTagDuplicate(t.value||t)})).slice(0,d);for(;h<l.length&&(i=l[h]instanceof Object?l[h]:{value:l[h]},s=c.reduce(function(t,e){return t+" "+(i[e]||"")},"").toLowerCase().indexOf(t.toLowerCase()),e=o.dropdown.fuzzySearch?0<=s:0==s,n=!o.duplicates&&this.isTagDuplicate(i.value),e&&!n&&d--&&r.push(i),0!=d);h++);return r},createListHTML:function(t){var e=this.settings.templates.dropdownItem.bind(this);return this.minify(t.map(e).join(""))}}},t});
|
|
1 |
/**
|
2 |
+
* Tagify (v3.20.3) - tags input component
|
3 |
* By Yair Even-Or
|
4 |
* Don't sell this code. (c)
|
5 |
* https://github.com/yairEO/tagify
|
6 |
*/
|
7 |
+
|
8 |
+
!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):(t="undefined"!=typeof globalThis?globalThis:t||self).Tagify=e()}(this,(function(){"use strict";function t(e){return(t="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t})(e)}function e(t,e,i){return e in t?Object.defineProperty(t,e,{value:i,enumerable:!0,configurable:!0,writable:!0}):t[e]=i,t}function i(t,e){var i=Object.keys(t);if(Object.getOwnPropertySymbols){var s=Object.getOwnPropertySymbols(t);e&&(s=s.filter((function(e){return Object.getOwnPropertyDescriptor(t,e).enumerable}))),i.push.apply(i,s)}return i}function s(t){for(var s=1;s<arguments.length;s++){var n=null!=arguments[s]?arguments[s]:{};s%2?i(Object(n),!0).forEach((function(i){e(t,i,n[i])})):Object.getOwnPropertyDescriptors?Object.defineProperties(t,Object.getOwnPropertyDescriptors(n)):i(Object(n)).forEach((function(e){Object.defineProperty(t,e,Object.getOwnPropertyDescriptor(n,e))}))}return t}function n(t){return function(t){if(Array.isArray(t))return a(t)}(t)||function(t){if("undefined"!=typeof Symbol&&Symbol.iterator in Object(t))return Array.from(t)}(t)||function(t,e){if(!t)return;if("string"==typeof t)return a(t,e);var i=Object.prototype.toString.call(t).slice(8,-1);"Object"===i&&t.constructor&&(i=t.constructor.name);if("Map"===i||"Set"===i)return Array.from(t);if("Arguments"===i||/^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(i))return a(t,e)}(t)||function(){throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.")}()}function a(t,e){(null==e||e>t.length)&&(e=t.length);for(var i=0,s=new Array(e);i<e;i++)s[i]=t[i];return s}var o=function(t,e,i){return i?t==e:(""+t).toLowerCase()==(""+e).toLowerCase()};function r(t){var e=Object.prototype.toString.call(t).split(" ")[1].slice(0,-1);return t===Object(t)&&"Array"!=e&&"Function"!=e&&"RegExp"!=e&&"HTMLUnknownElement"!=e}function l(t){var e=document.createElement("div");return t.replace(/\&#?[0-9a-z]+;/gi,(function(t){return e.innerHTML=t,e.innerText}))}function d(t){return t.replace(/&/g,"&").replace(/</g,"<").replace(/>/g,">").replace(/"/g,""").replace(/`|'/g,"'")}function c(t,e,i){function s(t,e){for(var i in e)e.hasOwnProperty(i)&&(r(e[i])?r(t[i])?s(t[i],e[i]):t[i]=Object.assign({},e[i]):t[i]=e[i])}return t instanceof Object||(t={}),s(t,e),i&&s(t,i),t}function h(t){return String.prototype.normalize?"string"==typeof t?t.normalize("NFD").replace(/[\u0300-\u036f]/g,""):void 0:t}var g={init:function(){this.DOM.dropdown=this.parseTemplate("dropdown",[this.settings]),this.DOM.dropdown.content=this.DOM.dropdown.querySelector("."+this.settings.classNames.dropdownWrapper)},show:function(t){var e,i,s,n=this,a=this.settings,l=window.getSelection(),d="mix"==a.mode&&!a.enforceWhitelist,c=!a.whitelist||!a.whitelist.length,h="manual"==a.dropdown.position;if(t=void 0===t?this.state.inputText:t,(!c||d||a.templates.dropdownItemNoMatch)&&!1!==a.dropdown.enable&&!this.state.isLoading){if(clearTimeout(this.dropdownHide__bindEventsTimeout),this.suggestedListItems=this.dropdown.filterListItems.call(this,t),t&&!this.suggestedListItems.length&&(this.trigger("dropdown:noMatch",t),a.templates.dropdownItemNoMatch&&(s=a.templates.dropdownItemNoMatch.call(this,{value:t}))),!s){if(this.suggestedListItems.length)t&&d&&!this.state.editing.scope&&!o(this.suggestedListItems[0].value,t)&&this.suggestedListItems.unshift({value:t});else{if(!t||!d||this.state.editing.scope)return this.input.autocomplete.suggest.call(this),void this.dropdown.hide.call(this);this.suggestedListItems=[{value:t}]}i=""+(r(e=this.suggestedListItems[0])?e.value:e),a.autoComplete&&i&&0==i.indexOf(t)&&this.input.autocomplete.suggest.call(this,e)}this.dropdown.fill.call(this,s),a.dropdown.highlightFirst&&this.dropdown.highlightOption.call(this,this.DOM.dropdown.content.children[0]),this.state.dropdown.visible||setTimeout(this.dropdown.events.binding.bind(this)),this.state.dropdown.visible=t||!0,this.state.dropdown.query=t,this.state.selection={anchorOffset:l.anchorOffset,anchorNode:l.anchorNode},h||setTimeout((function(){n.dropdown.position.call(n),n.dropdown.render.call(n)})),setTimeout((function(){n.trigger("dropdown:show",n.DOM.dropdown)}))}},hide:function(t){var e=this,i=this.DOM,s=i.scope,n=i.dropdown,a="manual"==this.settings.dropdown.position&&!t;if(n&&document.body.contains(n)&&!a)return window.removeEventListener("resize",this.dropdown.position),this.dropdown.events.binding.call(this,!1),s.setAttribute("aria-expanded",!1),n.parentNode.removeChild(n),setTimeout((function(){e.state.dropdown.visible=!1}),100),this.state.dropdown.query=this.state.ddItemData=this.state.ddItemElm=this.state.selection=null,this.state.tag&&this.state.tag.value.length&&(this.state.flaggedTags[this.state.tag.baseOffset]=this.state.tag),this.trigger("dropdown:hide",n),this},render:function(){var t,e,i,s=this,n=(t=this.DOM.dropdown,(i=t.cloneNode(!0)).style.cssText="position:fixed; top:-9999px; opacity:0",document.body.appendChild(i),e=i.clientHeight,i.parentNode.removeChild(i),e),a=this.settings;return this.DOM.scope.setAttribute("aria-expanded",!0),document.body.contains(this.DOM.dropdown)||(this.DOM.dropdown.classList.add(a.classNames.dropdownInital),this.dropdown.position.call(this,n),a.dropdown.appendTarget.appendChild(this.DOM.dropdown),setTimeout((function(){return s.DOM.dropdown.classList.remove(a.classNames.dropdownInital)}))),this},fill:function(t){var e;t="string"==typeof t?t:this.dropdown.createListHTML.call(this,t||this.suggestedListItems),this.DOM.dropdown.content.innerHTML=(e=t)?e.replace(/\>[\r\n ]+\</g,"><").replace(/(<.*?>)|\s+/g,(function(t,e){return e||" "})):""},refilter:function(t){t=t||this.state.dropdown.query||"",this.suggestedListItems=this.dropdown.filterListItems.call(this,t),this.suggestedListItems.length?this.dropdown.fill.call(this):this.dropdown.hide.call(this),this.trigger("dropdown:updated",this.DOM.dropdown)},position:function(t){if("manual"!=this.settings.dropdown.position){var e,i,s,n,a,o,r,l=this.DOM.dropdown,d=document.documentElement.clientHeight,c=Math.max(document.documentElement.clientWidth||0,window.innerWidth||0)>480?this.settings.dropdown.position:"all",h=this.DOM["input"==c?"input":"scope"];t=t||l.clientHeight,this.state.dropdown.visible&&("text"==c?(n=(i=this.getCaretGlobalPosition()).bottom,s=i.top,a=i.left,o="auto"):(r=function(t){for(var e=0,i=0;t;)e+=t.offsetLeft||0,i+=t.offsetTop||0,t=t.parentNode;return{left:e,top:i}}(this.settings.dropdown.appendTarget),s=(i=h.getBoundingClientRect()).top+2-r.top,n=i.bottom-1-r.top,a=i.left-r.left,o=i.width+"px"),s=Math.floor(s),n=Math.ceil(n),e=d-i.bottom<t,l.style.cssText="left:"+(a+window.pageXOffset)+"px; width:"+o+";"+(e?"top: "+(s+window.pageYOffset)+"px":"top: "+(n+window.pageYOffset)+"px"),l.setAttribute("placement",e?"top":"bottom"),l.setAttribute("position",c))}},events:{binding:function(){var t=!(arguments.length>0&&void 0!==arguments[0])||arguments[0],e=this.dropdown.events.callbacks,i=this.listeners.dropdown=this.listeners.dropdown||{position:this.dropdown.position.bind(this),onKeyDown:e.onKeyDown.bind(this),onMouseOver:e.onMouseOver.bind(this),onMouseLeave:e.onMouseLeave.bind(this),onClick:e.onClick.bind(this),onScroll:e.onScroll.bind(this)},s=t?"addEventListener":"removeEventListener";"manual"!=this.settings.dropdown.position&&(window[s]("resize",i.position),window[s]("keydown",i.onKeyDown)),this.DOM.dropdown[s]("mouseover",i.onMouseOver),this.DOM.dropdown[s]("mouseleave",i.onMouseLeave),this.DOM.dropdown[s]("mousedown",i.onClick),this.DOM.dropdown.content[s]("scroll",i.onScroll)},callbacks:{onKeyDown:function(t){var e=this.DOM.dropdown.querySelector("[class$='--active']"),i=e;switch(t.key){case"ArrowDown":case"ArrowUp":case"Down":case"Up":var s;t.preventDefault(),i&&(i=i[("ArrowUp"==t.key||"Up"==t.key?"previous":"next")+"ElementSibling"]),i||(i=(s=this.DOM.dropdown.content.children)["ArrowUp"==t.key||"Up"==t.key?s.length-1:0]),this.dropdown.highlightOption.call(this,i,!0);break;case"Escape":case"Esc":this.dropdown.hide.call(this);break;case"ArrowRight":if(this.state.actions.ArrowLeft)return;case"Tab":if("mix"!=this.settings.mode&&i&&!this.settings.autoComplete.rightKey&&!this.state.editing){t.preventDefault();var n=i.getAttribute("tagifySuggestionIdx"),a=n?this.suggestedListItems[+n]:"";return this.input.autocomplete.set.call(this,a.value||a),!1}return!0;case"Enter":t.preventDefault(),this.dropdown.selectOption.call(this,e);break;case"Backspace":if("mix"==this.settings.mode||this.state.editing.scope)return;var o=this.state.inputText.trim();""!=o&&8203!=o.charCodeAt(0)||(!0===this.settings.backspace?this.removeTags():"edit"==this.settings.backspace&&setTimeout(this.editTag.bind(this),0))}},onMouseOver:function(t){var e=t.target.closest("."+this.settings.classNames.dropdownItem);e&&this.dropdown.highlightOption.call(this,e)},onMouseLeave:function(t){this.dropdown.highlightOption.call(this)},onClick:function(t){var e=this;if(0==t.button&&t.target!=this.DOM.dropdown){var i=t.target.closest("."+this.settings.classNames.dropdownItem);this.state.actions.selectOption=!0,setTimeout((function(){return e.state.actions.selectOption=!1}),50),this.settings.hooks.suggestionClick(t,{tagify:this,suggestionElm:i}).then((function(){i&&e.dropdown.selectOption.call(e,i)})).catch((function(t){return t}))}},onScroll:function(t){var e=t.target,i=e.scrollTop/(e.scrollHeight-e.parentNode.clientHeight)*100;this.trigger("dropdown:scroll",{percentage:Math.round(i)})}}},highlightOption:function(t,e){var i,s=this.settings.classNames.dropdownItemActive;if(this.state.ddItemElm&&(this.state.ddItemElm.classList.remove(s),this.state.ddItemElm.removeAttribute("aria-selected")),!t)return this.state.ddItemData=null,this.state.ddItemElm=null,void this.input.autocomplete.suggest.call(this);i=this.suggestedListItems[this.getNodeIndex(t)],this.state.ddItemData=i,this.state.ddItemElm=t,t.classList.add(s),t.setAttribute("aria-selected",!0),e&&(t.parentNode.scrollTop=t.clientHeight+t.offsetTop-t.parentNode.clientHeight),this.settings.autoComplete&&(this.input.autocomplete.suggest.call(this,i),this.dropdown.position.call(this))},selectOption:function(t){var e=this,i=this.settings.dropdown,n=i.clearOnSelect,a=i.closeOnSelect;if(!t)return this.addTags(this.state.inputText,!0),void(a&&this.dropdown.hide.call(this));var o=t.getAttribute("tagifySuggestionIdx"),r=(o?this.suggestedListItems[+o]:"")||this.state.inputText;if(this.trigger("dropdown:select",{data:r,elm:t}),this.state.editing?this.onEditTagDone(this.state.editing.scope,s(s(s({},this.state.editing.scope.__tagifyTagData),{},{value:r.value},r instanceof Object?r:{}),{},{__isValid:!0})):this.addTags([r],n),setTimeout((function(){e.DOM.input.focus(),e.toggleFocusClass(!0)})),a)return this.dropdown.hide.call(this);this.dropdown.refilter.call(this)},selectAll:function(){return this.suggestedListItems.length=0,this.dropdown.hide.call(this),this.addTags(this.dropdown.filterListItems.call(this,""),!0),this},filterListItems:function(t){var e,i,s,n,a,o=this,l=this.settings,d=l.dropdown,c=[],g=l.whitelist,u=d.maxItems||1/0,p=d.searchKeys,f=0;if(!t||!p.length)return(l.duplicates?g:g.filter((function(t){return!o.isTagDuplicate(r(t)?t.value:t)}))).slice(0,u);function m(t,e){return e.toLowerCase().split(" ").every((function(e){return t.includes(e.toLowerCase())}))}for(a=d.caseSensitive?""+t:(""+t).toLowerCase();f<g.length&&(e=g[f]instanceof Object?g[f]:{value:g[f]},d.fuzzySearch?(s=p.reduce((function(t,i){return t+" "+(e[i]||"")}),"").toLowerCase(),d.accentedSearch&&(s=h(s),a=h(a)),i=m(s,a)):i=p.some((function(t){var i=""+(e[t]||"");return d.accentedSearch&&(i=h(i),a=h(a)),d.caseSensitive||(i=i.toLowerCase()),0==i.indexOf(a)})),n=!l.duplicates&&this.isTagDuplicate(r(e)?e.value:e),i&&!n&&u--&&c.push(e),0!=u);f++);return c},createListHTML:function(t){var e=this;return t.map((function(t,i){"string"!=typeof t&&"number"!=typeof t||(t={value:t});var s=e.settings.dropdown.mapValueTo,n=s?"function"==typeof s?s(t):t[s]:t.value,a=c({},t,{value:n&&"string"==typeof n?d(n):n,tagifySuggestionIdx:i});return e.settings.templates.dropdownItem.call(e,a)})).join("")}},u={delimiters:",",pattern:null,tagTextProp:"value",maxTags:1/0,callbacks:{},addTagOnBlur:!0,duplicates:!1,whitelist:[],blacklist:[],enforceWhitelist:!1,keepInvalidTags:!1,mixTagsAllowedAfter:/,|\.|\:|\s/,mixTagsInterpolator:["[[","]]"],backspace:!0,skipInvalid:!1,editTags:{clicks:2,keepInvalid:!0},transformTag:function(){},trim:!0,mixMode:{insertAfterTag:" "},autoComplete:{enabled:!0,rightKey:!1},classNames:{namespace:"tagify",input:"tagify__input",focus:"tagify--focus",tag:"tagify__tag",tagNoAnimation:"tagify--noAnim",tagInvalid:"tagify--invalid",tagNotAllowed:"tagify--notAllowed",inputInvalid:"tagify__input--invalid",tagX:"tagify__tag__removeBtn",tagText:"tagify__tag-text",dropdown:"tagify__dropdown",dropdownWrapper:"tagify__dropdown__wrapper",dropdownItem:"tagify__dropdown__item",dropdownItemActive:"tagify__dropdown__item--active",dropdownInital:"tagify__dropdown--initial",scopeLoading:"tagify--loading",tagLoading:"tagify__tag--loading",tagEditing:"tagify__tag--editable",tagFlash:"tagify__tag--flash",tagHide:"tagify__tag--hide",hasMaxTags:"tagify--hasMaxTags",hasNoTags:"tagify--noTags",empty:"tagify--empty"},dropdown:{classname:"",enabled:2,maxItems:10,searchKeys:["value","searchBy"],fuzzySearch:!0,caseSensitive:!1,accentedSearch:!0,highlightFirst:!1,closeOnSelect:!0,clearOnSelect:!0,position:"all",appendTarget:null},hooks:{beforeRemoveTag:function(){return Promise.resolve()},suggestionClick:function(){return Promise.resolve()}}};var p={customBinding:function(){var t=this;this.customEventsList.forEach((function(e){t.on(e,t.settings.callbacks[e])}))},binding:function(){var t,e=!(arguments.length>0&&void 0!==arguments[0])||arguments[0],i=this.events.callbacks,s=e?"addEventListener":"removeEventListener";if(!this.state.mainEvents||!e)for(var n in this.state.mainEvents=e,e&&!this.listeners.main&&(this.DOM.input.addEventListener(this.isIE?"keydown":"input",i[this.isIE?"onInputIE":"onInput"].bind(this)),this.settings.isJQueryPlugin&&jQuery(this.DOM.originalInput).on("tagify.removeAllTags",this.removeAllTags.bind(this))),t=this.listeners.main=this.listeners.main||{focus:["input",i.onFocusBlur.bind(this)],blur:["input",i.onFocusBlur.bind(this)],keydown:["input",i.onKeydown.bind(this)],click:["scope",i.onClickScope.bind(this)],dblclick:["scope",i.onDoubleClickScope.bind(this)],paste:["input",i.onPaste.bind(this)]})("blur"!=n||e)&&this.DOM[t[n][0]][s](n,t[n][1])},callbacks:{onFocusBlur:function(t){var e=t.target?this.trim(t.target.textContent):"",i=this.settings,s=t.type,n=i.dropdown.enabled>=0,a={relatedTarget:t.relatedTarget},o=this.state.actions.selectOption&&(n||!i.dropdown.closeOnSelect),r=this.state.actions.addNew&&n,l=window.getSelection();if("blur"==s){if(t.relatedTarget===this.DOM.scope)return this.dropdown.hide.call(this),void this.DOM.input.focus();this.postUpdate(),this.triggerChangeEvent()}if(!o&&!r)if(this.state.hasFocus="focus"==s&&+new Date,this.toggleFocusClass(this.state.hasFocus),"mix"!=i.mode){if("focus"==s)return this.trigger("focus",a),void(0===i.dropdown.enabled&&this.dropdown.show.call(this));"blur"==s&&(this.trigger("blur",a),this.loading(!1),("select"==this.settings.mode?!this.value.length||this.value[0].value!=e:e&&!this.state.actions.selectOption&&i.addTagOnBlur)&&this.addTags(e,!0)),this.DOM.input.removeAttribute("style"),this.dropdown.hide.call(this)}else"focus"==s?this.trigger("focus",a):"blur"==t.type&&(this.trigger("blur",a),this.loading(!1),this.dropdown.hide.call(this),this.state.dropdown.visible=void 0,this.state.selection={anchorOffset:l.anchorOffset,anchorNode:l.anchorNode},l.getRangeAt&&l.rangeCount&&(this.state.selection.range=l.getRangeAt(0)))},onKeydown:function(t){var e=this,i=this.trim(t.target.textContent);if(this.trigger("keydown",{originalEvent:this.cloneEvent(t)}),"mix"==this.settings.mode){switch(t.key){case"Left":case"ArrowLeft":this.state.actions.ArrowLeft=!0;break;case"Delete":case"Backspace":if(this.state.editing)return;var s,n=document.getSelection(),a="Delete"==t.key&&n.anchorOffset==(n.anchorNode.length||0),o=1==n.anchorNode.nodeType||!n.anchorOffset&&n.anchorNode.previousElementSibling,r=l(this.DOM.input.innerHTML),d=this.getTagElms();if("BR"==n.anchorNode.nodeName)return;if((a||o)&&1==n.anchorNode.nodeType?s=0==n.anchorOffset?a?d[0]:null:d[n.anchorOffset-1]:a?s=n.anchorNode.nextElementSibling:o&&(s=o),3==n.anchorNode.nodeType&&!n.anchorNode.nodeValue&&n.anchorNode.previousElementSibling&&t.preventDefault(),(o||a)&&!this.settings.backspace)return void t.preventDefault();if("Range"!=n.type&&s&&s.hasAttribute("readonly"))return void this.placeCaretAfterNode(function(t,e){for(e=e||"previous";t=t[e+"Sibling"];)if(3==t.nodeType)return t}(s));this.isFirefox&&1==n.anchorNode.nodeType&&0!=n.anchorOffset&&(this.removeTags(),this.placeCaretAfterNode(this.setRangeAtStartEnd())),setTimeout((function(){var t=document.getSelection(),i=l(e.DOM.input.innerHTML),s=t.anchorNode.previousElementSibling;if(i.length>=r.length&&s&&!s.hasAttribute("readonly")&&(e.removeTags(s),e.fixFirefoxLastTagNoCaret(),2==e.DOM.input.children.length&&"BR"==e.DOM.input.children[1].tagName))return e.DOM.input.innerHTML="",e.value.length=0,!0;e.value=[].map.call(d,(function(t,i){var s=e.tagData(t);if(t.parentNode||s.readonly)return s;e.trigger("remove",{tag:t,index:i,data:s})})).filter((function(t){return t}))}),50)}return!0}switch(t.key){case"Backspace":this.state.dropdown.visible&&"manual"!=this.settings.dropdown.position||""!=i&&8203!=i.charCodeAt(0)||(!0===this.settings.backspace?this.removeTags():"edit"==this.settings.backspace&&setTimeout(this.editTag.bind(this),0));break;case"Esc":case"Escape":if(this.state.dropdown.visible)return;t.target.blur();break;case"Down":case"ArrowDown":this.state.dropdown.visible||this.dropdown.show.call(this);break;case"ArrowRight":var c=this.state.inputSuggestion||this.state.ddItemData;if(c&&this.settings.autoComplete.rightKey)return void this.addTags([c],!0);break;case"Tab":if(i&&t.preventDefault(),!i||"select"==this.settings.mode)return!0;case"Enter":if(this.state.dropdown.visible||229==t.keyCode)return;t.preventDefault(),setTimeout((function(){e.state.actions.selectOption||e.addTags(i,!0)}))}},onInput:function(t){if("mix"==this.settings.mode)return this.events.callbacks.onMixTagsInput.call(this,t);var e=this.input.normalize.call(this),i=e.length>=this.settings.dropdown.enabled,s={value:e,inputElm:this.DOM.input};s.isValid=this.validateTag({value:e}),this.trigger("input",s),this.state.inputText!=e&&(this.input.set.call(this,e,!1),-1!=e.search(this.settings.delimiters)?this.addTags(e)&&this.input.set.call(this):this.settings.dropdown.enabled>=0&&this.dropdown[i?"show":"hide"].call(this,e))},onMixTagsInput:function(t){var e,i,s,n,a,o,r,l,d=this,h=this.settings,g=this.value.length,u=this.getTagElms(),p=document.createDocumentFragment(),f=window.getSelection().getRangeAt(0),m=[].map.call(u,(function(t){return d.tagData(t).value}));if(this.value.slice().forEach((function(t){t.readonly&&!m.includes(t.value)&&p.appendChild(d.createTagElem(t))})),p.childNodes.length&&(f.insertNode(p),this.setRangeAtStartEnd(!1,p.lastChild)),u.length!=g)return this.value=[].map.call(this.getTagElms(),(function(t){return d.tagData(t)})),void this.update({withoutChangeEvent:!0});if(this.hasMaxTags())return!0;if(window.getSelection&&(o=window.getSelection()).rangeCount>0&&3==o.anchorNode.nodeType){if((f=o.getRangeAt(0).cloneRange()).collapse(!0),f.setStart(o.focusNode,0),s=(e=f.toString().slice(0,f.endOffset)).split(h.pattern).length-1,(i=e.match(h.pattern))&&(n=e.slice(e.lastIndexOf(i[i.length-1]))),n){if(this.state.actions.ArrowLeft=!1,this.state.tag={prefix:n.match(h.pattern)[0],value:n.replace(h.pattern,"")},this.state.tag.baseOffset=o.baseOffset-this.state.tag.value.length,l=this.state.tag.value.match(h.delimiters))return this.state.tag.value=this.state.tag.value.replace(h.delimiters,""),this.state.tag.delimiters=l[0],this.addTags(this.state.tag.value,h.dropdown.clearOnSelect),void this.dropdown.hide.call(this);a=this.state.tag.value.length>=h.dropdown.enabled;try{r=(r=this.state.flaggedTags[this.state.tag.baseOffset]).prefix==this.state.tag.prefix&&r.value[0]==this.state.tag.value[0],this.state.flaggedTags[this.state.tag.baseOffset]&&!this.state.tag.value&&delete this.state.flaggedTags[this.state.tag.baseOffset]}catch(t){}(r||s<this.state.mixMode.matchedPatternCount)&&(a=!1)}else this.state.flaggedTags={};this.state.mixMode.matchedPatternCount=s}setTimeout((function(){d.update({withoutChangeEvent:!0}),d.trigger("input",c({},d.state.tag,{textContent:d.DOM.input.textContent})),d.state.tag&&d.dropdown[a?"show":"hide"].call(d,d.state.tag.value)}),10)},onInputIE:function(t){var e=this;setTimeout((function(){e.events.callbacks.onInput.call(e,t)}))},onClickScope:function(t){var e=this.settings,i=t.target.closest("."+e.classNames.tag),s=+new Date-this.state.hasFocus;if(t.target!=this.DOM.scope){if(!t.target.classList.contains(e.classNames.tagX))return i?(this.trigger("click",{tag:i,index:this.getNodeIndex(i),data:this.tagData(i),originalEvent:this.cloneEvent(t)}),void(1!==e.editTags&&1!==e.editTags.clicks||this.events.callbacks.onDoubleClickScope.call(this,t))):void(t.target==this.DOM.input&&("mix"==e.mode&&this.fixFirefoxLastTagNoCaret(),s>500)?this.state.dropdown.visible?this.dropdown.hide.call(this):0===e.dropdown.enabled&&"mix"!=e.mode&&this.dropdown.show.call(this):"select"==e.mode&&!this.state.dropdown.visible&&this.dropdown.show.call(this));this.removeTags(t.target.parentNode)}else this.state.hasFocus||this.DOM.input.focus()},onPaste:function(t){var e;t.preventDefault(),this.settings.readonly||(e=(t.clipboardData||window.clipboardData).getData("Text"),this.injectAtCaret(e,window.getSelection().getRangeAt(0)),"mix"!=this.settings.mode&&this.addTags(this.DOM.input.textContent,!0))},onEditTagInput:function(t,i){var s=t.closest("."+this.settings.classNames.tag),n=this.getNodeIndex(s),a=this.tagData(s),o=this.input.normalize.call(this,t),r=s.innerHTML!=s.__tagifyTagData.__originalHTML,l=this.validateTag(e({},this.settings.tagTextProp,o));r||!0!==t.originalIsValid||(l=!0),s.classList.toggle(this.settings.classNames.tagInvalid,!0!==l),a.__isValid=l,s.title=!0===l?a.title||a.value:l,o.length>=this.settings.dropdown.enabled&&(this.state.editing.value=o,this.dropdown.show.call(this,o)),this.trigger("edit:input",{tag:s,index:n,data:c({},this.value[n],{newValue:o}),originalEvent:this.cloneEvent(i)})},onEditTagFocus:function(t){this.state.editing={scope:t,input:t.querySelector("[contenteditable]")}},onEditTagBlur:function(t){if(this.state.hasFocus||this.toggleFocusClass(),this.DOM.scope.contains(t)){var i=this.settings,s=t.closest("."+i.classNames.tag),n=this.input.normalize.call(this,t),a=this.tagData(s).__originalData,o=c({},a,e({},i.tagTextProp,n)),r=s.innerHTML!=s.__tagifyTagData.__originalHTML,l=this.validateTag(e({},i.tagTextProp,n));if(!n)return this.removeTags(s),void this.onEditTagDone(null,o);if(r){if(i.transformTag.call(this,o),!0!==(l=this.validateTag(e({},i.tagTextProp,o[i.tagTextProp])))){if(this.trigger("invalid",{data:o,tag:s,message:l}),i.editTags.keepInvalid)return;o=a}else if(o=this.getWhitelistItem(n)||o.__preInvalidData||o,!0!==(l=this.validateTag(o))){if(this.trigger("invalid",{data:o,tag:s,message:l}),s.classList.toggle(i.classNames.tagInvalid,!0),i.editTags.keepInvalid)return;o=a}this.onEditTagDone(s,o)}else this.onEditTagDone(s,a)}},onEditTagkeydown:function(t,e){switch(this.trigger("edit:keydown",{originalEvent:this.cloneEvent(t)}),t.key){case"Esc":case"Escape":e.innerHTML=e.__tagifyTagData.__originalHTML;case"Enter":case"Tab":t.preventDefault(),t.target.blur()}},onDoubleClickScope:function(t){var e,i,s=t.target.closest("."+this.settings.classNames.tag),n=this.settings;s&&(e=s.classList.contains(this.settings.classNames.tagEditing),i=s.hasAttribute("readonly"),"select"==n.mode||n.readonly||e||i||!this.settings.editTags||this.editTag(s),this.toggleFocusClass(!0),this.trigger("dblclick",{tag:s,index:this.getNodeIndex(s),data:this.tagData(s)}))}}};function f(e,i){return e?e.previousElementSibling&&e.previousElementSibling.classList.contains("tagify")?(console.warn("Tagify: ","input element is already Tagified",e),this):(c(this,function(e){var i=document.createTextNode("");function s(t,e,s){s&&e.split(/\s+/g).forEach((function(e){return i[t+"EventListener"].call(i,e,s)}))}return{off:function(t,e){return s("remove",t,e),this},on:function(t,e){return e&&"function"==typeof e&&s("add",t,e),this},trigger:function(s,n){var a;if(s)if(e.settings.isJQueryPlugin)"remove"==s&&(s="removeTag"),jQuery(e.DOM.originalInput).triggerHandler(s,[n]);else{try{var o=c({},"object"===t(n)?n:{value:n});if(o.tagify=this,n instanceof Object)for(var r in n)n[r]instanceof HTMLElement&&(o[r]=n[r]);a=new CustomEvent(s,{detail:o})}catch(t){console.warn(t)}i.dispatchEvent(a)}}}}(this)),this.isFirefox="undefined"!=typeof InstallTrigger,this.isIE=window.document.documentMode,this.applySettings(e,i||{}),this.state={inputText:"",editing:!1,actions:{},mixMode:{},dropdown:{},flaggedTags:{}},this.value=[],this.listeners={},this.DOM={},this.build(e),this.getCSSVars(),this.loadOriginalValues(),this.events.customBinding.call(this),this.events.binding.call(this),void(e.autofocus&&this.DOM.input.focus())):(console.warn("Tagify: ","input element not found",e),this)}return f.prototype={dropdown:g,TEXTS:{empty:"empty",exceed:"number of tags exceeded",pattern:"pattern mismatch",duplicate:"already exists",notAllowed:"not allowed"},DEFAULTS:u,customEventsList:["change","add","remove","invalid","input","click","keydown","focus","blur","edit:input","edit:updated","edit:start","edit:keydown","dropdown:show","dropdown:hide","dropdown:select","dropdown:updated","dropdown:noMatch"],trim:function(t){return this.settings.trim?t.trim():t},parseHTML:function(t){return(new DOMParser).parseFromString(t.trim(),"text/html").body.firstElementChild},templates:{wrapper:function(t,e){return'<tags class="'.concat(e.classNames.namespace," ").concat(e.mode?"".concat(e.classNames.namespace,"--").concat(e.mode):""," ").concat(t.className,'"\n ').concat(e.readonly?"readonly":"","\n ").concat(e.required?"required":"",'\n tabIndex="-1">\n <span ').concat(e.readonly&&"mix"==e.mode?"":"contenteditable",' data-placeholder="').concat(e.placeholder||"​",'" aria-placeholder="').concat(e.placeholder||"",'"\n class="').concat(e.classNames.input,'"\n role="textbox"\n aria-autocomplete="both"\n aria-multiline="').concat("mix"==e.mode,'"></span>\n </tags>')},tag:function(t){return'<tag title="'.concat(t.title||t.value,"\"\n contenteditable='false'\n spellcheck='false'\n tabIndex=\"-1\"\n class=\"").concat(this.settings.classNames.tag," ").concat(t.class?t.class:"",'"\n ').concat(this.getAttributes(t),">\n <x title='' class=\"").concat(this.settings.classNames.tagX,"\" role='button' aria-label='remove tag'></x>\n <div>\n <span class=\"").concat(this.settings.classNames.tagText,'">').concat(t[this.settings.tagTextProp]||t.value,"</span>\n </div>\n </tag>")},dropdown:function(t){var e=t.dropdown,i="manual"==e.position,s="".concat(t.classNames.dropdown);return'<div class="'.concat(i?"":s," ").concat(e.classname,'" role="listbox" aria-labelledby="dropdown">\n <div class="').concat(t.classNames.dropdownWrapper,'"></div>\n </div>')},dropdownItem:function(t){return"<div ".concat(this.getAttributes(t),"\n class='").concat(this.settings.classNames.dropdownItem," ").concat(t.class?t.class:"",'\'\n tabindex="0"\n role="option">').concat(t.value,"</div>")},dropdownItemNoMatch:null},parseTemplate:function(t,e){return t=this.settings.templates[t]||t,this.parseHTML(t.apply(this,e))},applySettings:function(t,e){this.DEFAULTS.templates=this.templates;var i=this.settings=c({},this.DEFAULTS,e);if(i.readonly=t.hasAttribute("readonly"),i.placeholder=t.getAttribute("placeholder")||i.placeholder||"",i.required=t.hasAttribute("required"),this.isIE&&(i.autoComplete=!1),["whitelist","blacklist"].forEach((function(e){var s=t.getAttribute("data-"+e);s&&(s=s.split(i.delimiters))instanceof Array&&(i[e]=s)})),"autoComplete"in e&&!r(e.autoComplete)&&(i.autoComplete=this.DEFAULTS.autoComplete,i.autoComplete.enabled=e.autoComplete),"mix"==i.mode&&(i.autoComplete.rightKey=!0,i.delimiters=e.delimiters||null),t.pattern)try{i.pattern=new RegExp(t.pattern)}catch(t){}if(this.settings.delimiters)try{i.delimiters=new RegExp(this.settings.delimiters,"g")}catch(t){}"select"==i.mode&&(i.dropdown.enabled=0),i.dropdown.appendTarget=e.dropdown&&e.dropdown.appendTarget?e.dropdown.appendTarget:document.body},getAttributes:function(t){if("[object Object]"!=Object.prototype.toString.call(t))return"";var e,i,s=Object.keys(t),n="";for(i=s.length;i--;)"class"!=(e=s[i])&&t.hasOwnProperty(e)&&void 0!==t[e]&&(n+=" "+e+(void 0!==t[e]?'="'.concat(t[e],'"'):""));return n},getCaretGlobalPosition:function(){var t=document.getSelection();if(t.rangeCount){var e,i,s=t.getRangeAt(0),n=s.startContainer,a=s.startOffset;if(a>0)return(i=document.createRange()).setStart(n,a-1),i.setEnd(n,a),{left:(e=i.getBoundingClientRect()).right,top:e.top,bottom:e.bottom};if(n.getBoundingClientRect)return n.getBoundingClientRect()}return{left:-9999,top:-9999}},getCSSVars:function(){var t,e=getComputedStyle(this.DOM.scope,null);this.CSSVars={tagHideTransition:function(t){var e=t.value;return"s"==t.unit?1e3*e:e}(function(t){if(!t)return{};var e=(t=t.trim().split(" ")[0]).split(/\d+/g).filter((function(t){return t})).pop().trim();return{value:+t.split(e).filter((function(t){return t}))[0].trim(),unit:e}}((t="tag-hide-transition",e.getPropertyValue("--"+t))))}},build:function(t){var e=this.DOM;this.settings.mixMode.integrated?(e.originalInput=null,e.scope=t,e.input=t):(e.originalInput=t,e.scope=this.parseTemplate("wrapper",[t,this.settings]),e.input=e.scope.querySelector("."+this.settings.classNames.input),t.parentNode.insertBefore(e.scope,t)),this.settings.dropdown.enabled>=0&&this.dropdown.init.call(this)},destroy:function(){this.DOM.scope.parentNode.removeChild(this.DOM.scope),this.dropdown.hide.call(this,!0),clearTimeout(this.dropdownHide__bindEventsTimeout)},loadOriginalValues:function(t){var e,i=this.settings;if(t=t||(i.mixMode.integrated?this.DOM.input.textContent:this.DOM.originalInput.value))if(this.removeAllTags(),"mix"==i.mode)this.parseMixTags(t.trim()),(e=this.DOM.input.lastChild)&&"BR"==e.tagName||this.DOM.input.insertAdjacentHTML("beforeend","<br>");else{try{JSON.parse(t)instanceof Array&&(t=JSON.parse(t))}catch(t){}this.addTags(t).forEach((function(t){return t&&t.classList.add(i.classNames.tagNoAnimation)}))}else this.postUpdate();this.state.lastOriginalValueReported=i.mixMode.integrated?"":this.DOM.originalInput.value,this.state.loadedOriginalValues=!0},cloneEvent:function(t){var e={};for(var i in t)e[i]=t[i];return e},loading:function(t){return this.state.isLoading=t,this.DOM.scope.classList[t?"add":"remove"](this.settings.classNames.scopeLoading),this},tagLoading:function(t,e){return t&&t.classList[e?"add":"remove"](this.settings.classNames.tagLoading),this},toggleFocusClass:function(t){this.DOM.scope.classList.toggle(this.settings.classNames.focus,!!t)},triggerChangeEvent:function(){if(!this.settings.mixMode.integrated){var t=this.DOM.originalInput,e=this.state.lastOriginalValueReported!==t.value,i=new CustomEvent("change",{bubbles:!0});e&&(this.state.lastOriginalValueReported=t.value,i.simulated=!0,t._valueTracker&&t._valueTracker.setValue(Math.random()),t.dispatchEvent(i),this.trigger("change",this.state.lastOriginalValueReported),t.value=this.state.lastOriginalValueReported)}},events:p,fixFirefoxLastTagNoCaret:function(){},placeCaretAfterNode:function(t){if(t){var e=t.nextSibling,i=window.getSelection(),s=i.getRangeAt(0);i.rangeCount&&(s.setStartBefore(e||t),s.setEndBefore(e||t),i.removeAllRanges(),i.addRange(s))}},insertAfterTag:function(t,e){if(e=e||this.settings.mixMode.insertAfterTag,t&&e)return e="string"==typeof e?document.createTextNode(e):e,t.appendChild(e),t.parentNode.insertBefore(e,t.nextSibling),e},editTag:function(t,e){var i=this;t=t||this.getLastTag(),e=e||{},this.dropdown.hide.call(this);var s=this.settings;function n(){return t.querySelector("."+s.classNames.tagText)}var a=n(),o=this.getNodeIndex(t),r=this.tagData(t),l=this.events.callbacks,d=this,h=!0;if(a){if(!(r instanceof Object&&"editable"in r)||r.editable)return a.setAttribute("contenteditable",!0),t.classList.add(s.classNames.tagEditing),this.tagData(t,{__originalData:c({},r),__originalHTML:t.innerHTML}),a.addEventListener("focus",l.onEditTagFocus.bind(this,t)),a.addEventListener("blur",(function(){setTimeout((function(){return l.onEditTagBlur.call(d,n())}))})),a.addEventListener("input",l.onEditTagInput.bind(this,a)),a.addEventListener("keydown",(function(e){return l.onEditTagkeydown.call(i,e,t)})),a.focus(),this.setRangeAtStartEnd(!1,a),e.skipValidation||(h=this.editTagToggleValidity(t,r.value)),a.originalIsValid=h,this.trigger("edit:start",{tag:t,index:o,data:r,isValid:h}),this}else console.warn("Cannot find element in Tag template: .",s.classNames.tagText)},editTagToggleValidity:function(t,e){var i,s=t.__tagifyTagData;if(s)return i=!(!s.__isValid||1==s.__isValid),t.classList.toggle(this.settings.classNames.tagInvalid,i),s.__isValid;console.warn("tag has no data: ",t,s)},onEditTagDone:function(t,e){this.state.editing=!1,e=e||{};var i={tag:t=t||this.state.editing.scope,index:this.getNodeIndex(t),data:e};this.trigger("edit:beforeUpdate",i),delete e.__originalData,delete e.__originalHTML,t&&(this.editTagToggleValidity(t),this.replaceTag(t,e)),this.trigger("edit:updated",i),this.dropdown.hide.call(this),this.settings.keepInvalidTags&&this.reCheckInvalidTags()},replaceTag:function(t,e){e&&e.value||(e=t.__tagifyTagData),e.__isValid&&1!=e.__isValid&&c(e,this.getInvalidTagAttrs(e,e.__isValid));var i=this.createTagElem(e);t.parentNode.replaceChild(i,t),this.updateValueByDOMTags()},updateValueByDOMTags:function(){var t=this;this.value.length=0,[].forEach.call(this.getTagElms(),(function(e){e.classList.contains(t.settings.classNames.tagNotAllowed)||t.value.push(t.tagData(e))})),this.update()},setRangeAtStartEnd:function(t,e){t="number"==typeof t?t:!!t,e=(e=e||this.DOM.input).lastChild||e;var i=document.getSelection();try{i.rangeCount>=1&&["Start","End"].forEach((function(s){return i.getRangeAt(0)["set"+s](e,t||e.length)}))}catch(t){console.warn("Tagify: ",t)}},injectAtCaret:function(t,e){if(e=e||this.state.selection.range)return"string"==typeof t&&(t=document.createTextNode(t)),e.deleteContents(),e.insertNode(t),this.setRangeAtStartEnd(!1,t),this.updateValueByDOMTags(),this.update(),this},input:{set:function(){var t=arguments.length>0&&void 0!==arguments[0]?arguments[0]:"",e=!(arguments.length>1&&void 0!==arguments[1])||arguments[1],i=this.settings.dropdown.closeOnSelect;this.state.inputText=t,e&&(this.DOM.input.innerHTML=t),!t&&i&&this.dropdown.hide.bind(this),this.input.autocomplete.suggest.call(this),this.input.validate.call(this)},validate:function(){var t=!this.state.inputText||!0===this.validateTag({value:this.state.inputText});return this.DOM.input.classList.toggle(this.settings.classNames.inputInvalid,!t),t},normalize:function(t){var e=t||this.DOM.input,i=[];e.childNodes.forEach((function(t){return 3==t.nodeType&&i.push(t.nodeValue)})),i=i.join("\n");try{i=i.replace(/(?:\r\n|\r|\n)/g,this.settings.delimiters.source.charAt(0))}catch(t){}return i=i.replace(/\s/g," "),this.settings.trim&&(i=i.replace(/^\s+/,"")),i},autocomplete:{suggest:function(t){if(this.settings.autoComplete.enabled){"string"==typeof(t=t||{})&&(t={value:t});var e=t.value?""+t.value:"",i=e.substr(0,this.state.inputText.length).toLowerCase(),s=e.substring(this.state.inputText.length);e&&this.state.inputText&&i==this.state.inputText.toLowerCase()?(this.DOM.input.setAttribute("data-suggest",s),this.state.inputSuggestion=t):(this.DOM.input.removeAttribute("data-suggest"),delete this.state.inputSuggestion)}},set:function(t){var e=this.DOM.input.getAttribute("data-suggest"),i=t||(e?this.state.inputText+e:null);return!!i&&("mix"==this.settings.mode?this.replaceTextWithNode(document.createTextNode(this.state.tag.prefix+i)):(this.input.set.call(this,i),this.setRangeAtStartEnd()),this.input.autocomplete.suggest.call(this),this.dropdown.hide.call(this),!0)}}},getTagIdx:function(t){return this.value.findIndex((function(e){return JSON.stringify(e)==JSON.stringify(t)}))},getNodeIndex:function(t){var e=0;if(t)for(;t=t.previousElementSibling;)e++;return e},getTagElms:function(){for(var t=arguments.length,e=new Array(t),i=0;i<t;i++)e[i]=arguments[i];var s=["."+this.settings.classNames.tag].concat(e).join(".");return[].slice.call(this.DOM.scope.querySelectorAll(s))},getLastTag:function(){var t=this.DOM.scope.querySelectorAll(".".concat(this.settings.classNames.tag,":not(.").concat(this.settings.classNames.tagHide,"):not([readonly])"));return t[t.length-1]},tagData:function(t,e){return t?(e&&(t.__tagifyTagData=c({},t.__tagifyTagData||{},e)),t.__tagifyTagData):(console.warn("tag elment doesn't exist",t,e),e)},isTagDuplicate:function(t,e){var i=this,s=this.settings;return"select"!=s.mode&&this.value.reduce((function(n,a){return o(i.trim(""+t),a.value,e||s.dropdown.caseSensitive)?n+1:n}),0)},getTagIndexByValue:function(t){var e=this,i=[];return this.getTagElms().forEach((function(s,n){o(e.trim(s.textContent),t,e.settings.dropdown.caseSensitive)&&i.push(n)})),i},getTagElmByValue:function(t){var e=this.getTagIndexByValue(t)[0];return this.getTagElms()[e]},flashTag:function(t){var e=this;t&&(t.classList.add(this.settings.classNames.tagFlash),setTimeout((function(){t.classList.remove(e.settings.classNames.tagFlash)}),100))},isTagBlacklisted:function(t){return t=this.trim(t.toLowerCase()),this.settings.blacklist.filter((function(e){return(""+e).toLowerCase()==t})).length},isTagWhitelisted:function(t){return!!this.getWhitelistItem(t)},getWhitelistItem:function(t,e,i){e=e||"value";var s,n=this.settings,a=(i=i||n.whitelist,n.dropdown.caseSensitive);return i.some((function(i){var n="string"==typeof i?i:i[e];if(o(n,t,a))return s="string"==typeof i?{value:i}:i,!0})),s||"value"!=e||"value"==n.tagTextProp||(s=this.getWhitelistItem(t,n.tagTextProp,i)),s},validateTag:function(t){var e=this.settings,i="value"in t?"value":e.tagTextProp,s=this.trim(t[i]+"");return(t[i]+"").trim()?e.pattern&&e.pattern instanceof RegExp&&!e.pattern.test(s)?this.TEXTS.pattern:!e.duplicates&&this.isTagDuplicate(s,this.state.editing)?this.TEXTS.duplicate:!(this.isTagBlacklisted(s)||e.enforceWhitelist&&!this.isTagWhitelisted(s))||this.TEXTS.notAllowed:this.TEXTS.empty},getInvalidTagAttrs:function(t,e){return{"aria-invalid":!0,class:"".concat(t.class||""," ").concat(this.settings.classNames.tagNotAllowed).trim(),title:e}},hasMaxTags:function(){return this.value.length>=this.settings.maxTags&&this.TEXTS.exceed},setReadonly:function(t){var e=this.settings;document.activeElement.blur(),e.readonly=t,this.DOM.scope[(t?"set":"remove")+"Attribute"]("readonly",!0),"mix"==e.mode&&(this.DOM.input.contentEditable=!t)},normalizeTags:function(t){var i=this,s=this.settings,a=s.whitelist,o=s.delimiters,r=s.mode,l=s.tagTextProp,d=[],c=!!a&&a[0]instanceof Object,h=t instanceof Array,g=function(t){return(t+"").split(o).filter((function(t){return t})).map((function(t){return e({},l,i.trim(t))}))};if("number"==typeof t&&(t=t.toString()),"string"==typeof t){if(!t.trim())return[];t=g(t)}else if(h){var u;t=(u=[]).concat.apply(u,n(t.map((function(t){return t.value?t:g(t)}))))}return c&&(t.forEach((function(t){var e=d.map((function(t){return t.value})),s=i.dropdown.filterListItems.call(i,t[l]).filter((function(t){return!e.includes(t.value)})),n=i.getWhitelistItem(t[l],null,s);n&&n instanceof Object?d.push(n):"mix"!=r&&(null==t.value&&(t.value=t[l]),d.push(t))})),d.length&&(t=d)),t},parseMixTags:function(t){var e=this,i=this.settings,s=i.mixTagsInterpolator,n=i.duplicates,a=i.transformTag,o=i.enforceWhitelist,r=i.maxTags,l=i.tagTextProp,d=[];return t=t.split(s[0]).map((function(t,i){var c,h,g,u=t.split(s[1]),p=u[0],f=d.length==r;try{if(p==+p)throw Error;h=JSON.parse(p)}catch(t){h=e.normalizeTags(p)[0]}if(f||!(u.length>1)||o&&!e.isTagWhitelisted(h.value)||!n&&e.isTagDuplicate(h.value)){if(t)return i?s[0]+t:t}else a.call(e,h),h[c=h[l]?l:"value"]=e.trim(h[c]),g=e.createTagElem(h),d.push(h),g.classList.add(e.settings.classNames.tagNoAnimation),u[0]=g.outerHTML,e.value.push(h);return u.join("")})).join(""),this.DOM.input.innerHTML=t,this.DOM.input.appendChild(document.createTextNode("")),this.DOM.input.normalize(),this.getTagElms().forEach((function(t,i){return e.tagData(t,d[i])})),this.update({withoutChangeEvent:!0}),t},replaceTextWithNode:function(t,e){if(this.state.tag||e){e=e||this.state.tag.prefix+this.state.tag.value;var i,s,n=window.getSelection(),a=n.anchorNode,o=this.state.tag.delimiters?this.state.tag.delimiters.length:0;return a.splitText(n.anchorOffset-o),i=a.nodeValue.lastIndexOf(e),s=a.splitText(i),t&&a.parentNode.replaceChild(t,s),!0}},selectTag:function(t,e){if(!this.settings.enforceWhitelist||this.isTagWhitelisted(e.value))return this.input.set.call(this,e.value,!0),this.state.actions.selectOption&&setTimeout(this.setRangeAtStartEnd.bind(this)),this.getLastTag()?this.replaceTag(this.getLastTag(),e):this.appendTag(t),this.value[0]=e,this.trigger("add",{tag:t,data:e}),this.update(),[t]},addEmptyTag:function(t){var e=c({value:""},t||{}),i=this.createTagElem(e);this.tagData(i,e),this.appendTag(i),this.editTag(i,{skipValidation:!0})},addTags:function(t,e){var i=this,s=arguments.length>2&&void 0!==arguments[2]?arguments[2]:this.settings.skipInvalid,n=[],a=this.settings;return t&&0!=t.length?(t=this.normalizeTags(t),"mix"==a.mode?this.addMixTags(t):("select"==a.mode&&(e=!1),this.DOM.input.removeAttribute("style"),t.forEach((function(t){var e,o={},r=Object.assign({},t,{value:t.value+""});if((t=Object.assign({},r)).__isValid=i.hasMaxTags()||i.validateTag(t),a.transformTag.call(i,t),!0!==t.__isValid){if(s)return;c(o,i.getInvalidTagAttrs(t,t.__isValid),{__preInvalidData:r}),t.__isValid==i.TEXTS.duplicate&&i.flashTag(i.getTagElmByValue(t.value))}if(t.readonly&&(o["aria-readonly"]=!0),e=i.createTagElem(c({},t,o)),n.push(e),"select"==a.mode)return i.selectTag(e,t);i.appendTag(e),t.__isValid&&!0===t.__isValid?(i.value.push(t),i.update(),i.trigger("add",{tag:e,index:i.value.length-1,data:t})):(i.trigger("invalid",{data:t,index:i.value.length,tag:e,message:t.__isValid}),a.keepInvalidTags||setTimeout((function(){return i.removeTags(e,!0)}),1e3)),i.dropdown.position.call(i)})),t.length&&e&&this.input.set.call(this),this.dropdown.refilter.call(this),n)):("select"==a.mode&&this.removeAllTags(),n)},addMixTags:function(t){var e,i=this,s=this.settings,n=this.state.tag.delimiters;return s.transformTag.call(this,t[0]),t[0].prefix=t[0].prefix||this.state.tag?this.state.tag.prefix:(s.pattern.source||s.pattern)[0],e=this.createTagElem(t[0]),this.replaceTextWithNode(e)||this.DOM.input.appendChild(e),setTimeout((function(){return e.classList.add(i.settings.classNames.tagNoAnimation)}),300),this.value.push(t[0]),this.update(),!n&&setTimeout((function(){var t=i.insertAfterTag(e)||e;i.placeCaretAfterNode(t)}),this.isFirefox?100:0),this.state.tag=null,this.trigger("add",c({},{tag:e},{data:t[0]})),e},appendTag:function(t){var e=this.DOM.scope.lastElementChild;e===this.DOM.input?this.DOM.scope.insertBefore(t,e):this.DOM.scope.appendChild(t)},createTagElem:function(t){var e,i=c({},t,{value:d(t.value+"")});return this.settings.readonly&&(t.readonly=!0),function(t){for(var e,i=document.createNodeIterator(t,NodeFilter.SHOW_TEXT);e=i.nextNode();)e.textContent.trim()||e.parentNode.removeChild(e)}(e=this.parseTemplate("tag",[i])),this.tagData(e,t),e},reCheckInvalidTags:function(){var t=this,e=this.settings,i=".".concat(e.classNames.tag,".").concat(e.classNames.tagNotAllowed),s=this.DOM.scope.querySelectorAll(i);[].forEach.call(s,(function(e){var i=t.tagData(e),s=e.getAttribute("title")==t.TEXTS.duplicate,n=!0===t.validateTag(i);s&&n&&(i=i.__preInvalidData?i.__preInvalidData:{value:i.value},t.replaceTag(e,i))}))},removeTags:function(t,e,i){var s,n=this;t=t&&t instanceof HTMLElement?[t]:t instanceof Array?t:t?[t]:[this.getLastTag()],s=t.reduce((function(t,e){return e&&"string"==typeof e&&(e=n.getTagElmByValue(e)),e&&t.push({node:e,idx:n.getTagIdx(n.tagData(e)),data:n.tagData(e,{__removed:!0})}),t}),[]),i="number"==typeof i?i:this.CSSVars.tagHideTransition,"select"==this.settings.mode&&(i=0,this.input.set.call(this)),1==s.length&&s[0].node.classList.contains(this.settings.classNames.tagNotAllowed)&&(e=!0),s.length&&this.settings.hooks.beforeRemoveTag(s,{tagify:this}).then((function(){function t(t){t.node.parentNode&&(t.node.parentNode.removeChild(t.node),e?this.settings.keepInvalidTags&&this.trigger("remove",{tag:t.node,index:t.idx}):(this.trigger("remove",{tag:t.node,index:t.idx,data:t.data}),this.dropdown.refilter.call(this),this.dropdown.position.call(this),this.DOM.input.normalize(),this.settings.keepInvalidTags&&this.reCheckInvalidTags()))}i&&i>10&&1==s.length?function(e){e.node.style.width=parseFloat(window.getComputedStyle(e.node).width)+"px",document.body.clientTop,e.node.classList.add(this.settings.classNames.tagHide),setTimeout(t.bind(this),i,e)}.call(n,s[0]):s.forEach(t.bind(n)),e||(s.forEach((function(t){var e=Object.assign({},t.data);delete e.__removed;var i=n.getTagIdx(e);i>-1&&n.value.splice(i,1)})),n.update())})).catch((function(t){}))},removeAllTags:function(){this.value=[],"mix"==this.settings.mode?this.DOM.input.innerHTML="":Array.prototype.slice.call(this.getTagElms()).forEach((function(t){return t.parentNode.removeChild(t)})),this.dropdown.position.call(this),"select"==this.settings.mode&&this.input.set.call(this),this.update()},postUpdate:function(){var t=this.settings.classNames,e="mix"==this.settings.mode?this.settings.mixMode.integrated?this.DOM.input.textContent:this.DOM.originalInput.value:this.value.length;this.DOM.scope.classList.toggle(t.hasMaxTags,this.value.length>=this.settings.maxTags),this.DOM.scope.classList.toggle(t.hasNoTags,!this.value.length),this.DOM.scope.classList.toggle(t.empty,!e)},update:function(t){var e,i,s=this.DOM.originalInput,n=(t||{}).withoutChangeEvent,a=(e=this.value,i=["__isValid","__removed"],e.map((function(t){var e={};for(var s in t)i.indexOf(s)<0&&(e[s]=t[s]);return e})));this.settings.mixMode.integrated||(s.value="mix"==this.settings.mode?this.getMixedTagsAsString(a):a.length?this.settings.originalInputValueFormat?this.settings.originalInputValueFormat(a):JSON.stringify(a):""),this.postUpdate(),!n&&this.state.loadedOriginalValues&&this.triggerChangeEvent()},getMixedTagsAsString:function(){var t="",e=this,i=this.settings.mixTagsInterpolator;return function s(n){n.childNodes.forEach((function(n){if(1==n.nodeType){if(n.classList.contains(e.settings.classNames.tag)&&e.tagData(n)){if(e.tagData(n).__removed)return;return void(t+=i[0]+JSON.stringify(n.__tagifyTagData)+i[1])}"BR"!=n.tagName||n.parentNode!=e.DOM.input&&1!=n.parentNode.childNodes.length?"DIV"!=n.tagName&&"P"!=n.tagName||(t+="\r\n",s(n)):t+="\r\n"}else t+=n.textContent}))}(this.DOM.input),t}},f.prototype.removeTag=f.prototype.removeTags,f}));
|
assets/js/wp-color-picker-alpha.min.js
ADDED
@@ -0,0 +1,11 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**!
|
2 |
+
* wp-color-picker-alpha
|
3 |
+
*
|
4 |
+
* Overwrite Automattic Iris for enabled Alpha Channel in wpColorPicker
|
5 |
+
* Only run in input and is defined data alpha in true
|
6 |
+
*
|
7 |
+
* Version: 2.1.4
|
8 |
+
* https://github.com/kallookoo/wp-color-picker-alpha
|
9 |
+
* Licensed under the GPLv2 license or later.
|
10 |
+
*/
|
11 |
+
!function(t){if(!t.wp.wpColorPicker.prototype._hasAlpha){var o="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAIAAAHnlligAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAHJJREFUeNpi+P///4EDBxiAGMgCCCAGFB5AADGCRBgYDh48CCRZIJS9vT2QBAggFBkmBiSAogxFBiCAoHogAKIKAlBUYTELAiAmEtABEECk20G6BOmuIl0CIMBQ/IEMkO0myiSSraaaBhZcbkUOs0HuBwDplz5uFJ3Z4gAAAABJRU5ErkJggg==",r='<div class="wp-picker-holder" />',e='<div class="wp-picker-container" />',a='<input type="button" class="button button-small" />',i=void 0!==wpColorPickerL10n.current;if(i)var n='<a tabindex="0" class="wp-color-result" />';else{n='<button type="button" class="button wp-color-result" aria-expanded="false"><span class="wp-color-result-text"></span></button>';var l="<label></label>",s='<span class="screen-reader-text"></span>'}Color.fn.toString=function(){if(this._alpha<1)return this.toCSS("rgba",this._alpha).replace(/\s+/g,"");var t=parseInt(this._color,10).toString(16);return this.error?"":(t.length<6&&(t=("00000"+t).substr(-6)),"#"+t)},t.widget("wp.wpColorPicker",t.wp.wpColorPicker,{_hasAlpha:!0,_create:function(){if(t.support.iris){var p=this,c=p.element;if(t.extend(p.options,c.data()),"hue"===p.options.type)return p._createHueOnly();p.close=t.proxy(p.close,p),p.initialValue=c.val(),c.addClass("wp-color-picker"),i?(c.hide().wrap(e),p.wrap=c.parent(),p.toggler=t(n).insertBefore(c).css({backgroundColor:p.initialValue}).attr("title",wpColorPickerL10n.pick).attr("data-current",wpColorPickerL10n.current),p.pickerContainer=t(r).insertAfter(c),p.button=t(a).addClass("hidden")):(c.parent("label").length||(c.wrap(l),p.wrappingLabelText=t(s).insertBefore(c).text(wpColorPickerL10n.defaultLabel)),p.wrappingLabel=c.parent(),p.wrappingLabel.wrap(e),p.wrap=p.wrappingLabel.parent(),p.toggler=t(n).insertBefore(p.wrappingLabel).css({backgroundColor:p.initialValue}),p.toggler.find(".wp-color-result-text").text(wpColorPickerL10n.pick),p.pickerContainer=t(r).insertAfter(p.wrappingLabel),p.button=t(a)),p.options.defaultColor?(p.button.addClass("wp-picker-default").val(wpColorPickerL10n.defaultString),i||p.button.attr("aria-label",wpColorPickerL10n.defaultAriaLabel)):(p.button.addClass("wp-picker-clear").val(wpColorPickerL10n.clear),i||p.button.attr("aria-label",wpColorPickerL10n.clearAriaLabel)),i?c.wrap('<span class="wp-picker-input-wrap" />').after(p.button):(p.wrappingLabel.wrap('<span class="wp-picker-input-wrap hidden" />').after(p.button),p.inputWrapper=c.closest(".wp-picker-input-wrap")),c.iris({target:p.pickerContainer,hide:p.options.hide,width:p.options.width,mode:p.options.mode,palettes:p.options.palettes,change:function(r,e){p.options.alpha?(p.toggler.css({"background-image":"url("+o+")"}),i?p.toggler.html('<span class="color-alpha" />'):(p.toggler.css({position:"relative"}),0==p.toggler.find("span.color-alpha").length&&p.toggler.append('<span class="color-alpha" />')),p.toggler.find("span.color-alpha").css({width:"30px",height:"100%",position:"absolute",top:0,left:0,"border-top-left-radius":"2px","border-bottom-left-radius":"2px",background:e.color.toString()})):p.toggler.css({backgroundColor:e.color.toString()}),t.isFunction(p.options.change)&&p.options.change.call(this,r,e)}}),c.val(p.initialValue),p._addListeners(),p.options.hide||p.toggler.click()}},_addListeners:function(){var o=this;o.wrap.on("click.wpcolorpicker",function(t){t.stopPropagation()}),o.toggler.click(function(){o.toggler.hasClass("wp-picker-open")?o.close():o.open()}),o.element.on("change",function(r){(""===t(this).val()||o.element.hasClass("iris-error"))&&(o.options.alpha?(i&&o.toggler.removeAttr("style"),o.toggler.find("span.color-alpha").css("backgroundColor","")):o.toggler.css("backgroundColor",""),t.isFunction(o.options.clear)&&o.options.clear.call(this,r))}),o.button.on("click",function(r){t(this).hasClass("wp-picker-clear")?(o.element.val(""),o.options.alpha?(i&&o.toggler.removeAttr("style"),o.toggler.find("span.color-alpha").css("backgroundColor","")):o.toggler.css("backgroundColor",""),t.isFunction(o.options.clear)&&o.options.clear.call(this,r),o.element.trigger("change")):t(this).hasClass("wp-picker-default")&&o.element.val(o.options.defaultColor).change()})}}),t.widget("a8c.iris",t.a8c.iris,{_create:function(){if(this._super(),this.options.alpha=this.element.data("alpha")||!1,this.element.is(":input")||(this.options.alpha=!1),void 0!==this.options.alpha&&this.options.alpha){var o=this,r=o.element,e=t('<div class="iris-strip iris-slider iris-alpha-slider"><div class="iris-slider-offset iris-slider-offset-alpha"></div></div>').appendTo(o.picker.find(".iris-picker-inner")),a={aContainer:e,aSlider:e.find(".iris-slider-offset-alpha")};void 0!==r.data("custom-width")?o.options.customWidth=parseInt(r.data("custom-width"))||0:o.options.customWidth=100,o.options.defaultWidth=r.width(),(o._color._alpha<1||-1!=o._color.toString().indexOf("rgb"))&&r.width(parseInt(o.options.defaultWidth+o.options.customWidth)),t.each(a,function(t,r){o.controls[t]=r}),o.controls.square.css({"margin-right":"0"});var i=o.picker.width()-o.controls.square.width()-20,n=i/6,l=i/2-n;t.each(["aContainer","strip"],function(t,r){o.controls[r].width(l).css({"margin-left":n+"px"})}),o._initControls(),o._change()}},_initControls:function(){if(this._super(),this.options.alpha){var t=this;t.controls.aSlider.slider({orientation:"vertical",min:0,max:100,step:1,value:parseInt(100*t._color._alpha),slide:function(o,r){t._color._alpha=parseFloat(r.value/100),t._change.apply(t,arguments)}})}},_change:function(){this._super();var t=this,r=t.element;if(this.options.alpha){var e=t.controls,a=parseInt(100*t._color._alpha),i=t._color.toRgb(),n=["rgb("+i.r+","+i.g+","+i.b+") 0%","rgba("+i.r+","+i.g+","+i.b+", 0) 100%"],l=t.options.defaultWidth,s=t.options.customWidth,p=t.picker.closest(".wp-picker-container").find(".wp-color-result");e.aContainer.css({background:"linear-gradient(to bottom, "+n.join(", ")+"), url("+o+")"}),p.hasClass("wp-picker-open")&&(e.aSlider.slider("value",a),t._color._alpha<1?(e.strip.attr("style",e.strip.attr("style").replace(/rgba\(([0-9]+,)(\s+)?([0-9]+,)(\s+)?([0-9]+)(,(\s+)?[0-9\.]+)\)/g,"rgb($1$3$5)")),r.width(parseInt(l+s))):r.width(l))}(r.data("reset-alpha")||!1)&&t.picker.find(".iris-palette-container").on("click.palette",".iris-palette",function(){t._color._alpha=1,t.active="external",t._change()}),r.trigger("change")},_addInputListeners:function(t){var o=this,r=function(r){var e=new Color(t.val()),a=t.val();t.removeClass("iris-error"),e.error?""!==a&&t.addClass("iris-error"):e.toString()!==o._color.toString()&&("keyup"===r.type&&a.match(/^[0-9a-fA-F]{3}$/)||o._setOption("color",e.toString()))};t.on("change",r).on("keyup",o._debounce(r,100)),o.options.hide&&t.on("focus",function(){o.show()})}})}}(jQuery),jQuery(document).ready(function(t){t(".color-picker").wpColorPicker()});
|
contributors.txt
CHANGED
@@ -2,6 +2,7 @@ Great people who contributed to this plugin :
|
|
2 |
|
3 |
Developers:
|
4 |
- Benjamin Denis: contact@seopress.org / @wp_seopress
|
|
|
5 |
- Julio Potier: @juliobox
|
6 |
- Mickael Gris: @mgris
|
7 |
|
2 |
|
3 |
Developers:
|
4 |
- Benjamin Denis: contact@seopress.org / @wp_seopress
|
5 |
+
- Thomas Deneulin: @gmulti
|
6 |
- Julio Potier: @juliobox
|
7 |
- Mickael Gris: @mgris
|
8 |
|
inc/admin/admin-dyn-variables-helper.php
ADDED
@@ -0,0 +1,67 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
function seopress_get_dyn_variables() {
|
3 |
+
return [
|
4 |
+
'%%sep%%' => 'Separator',
|
5 |
+
'%%sitetitle%%' => __('Site Title','wp-seopress'),
|
6 |
+
'%%tagline%%' => __('Tagline','wp-seopress'),
|
7 |
+
'%%post_title%%' => __('Post Title','wp-seopress'),
|
8 |
+
'%%post_excerpt%%' => __('Post excerpt','wp-seopress'),
|
9 |
+
'%%post_content%%' => __('Post content / product description','wp-seopress'),
|
10 |
+
'%%post_thumbnail_url%%' => __('Post thumbnail URL','wp-seopress'),
|
11 |
+
'%%post_url%%' => __('Post URL','wp-seopress'),
|
12 |
+
'%%post_date%%' => __('Post date','wp-seopress'),
|
13 |
+
'%%post_modified_date%%' => __('Post modified date','wp-seopress'),
|
14 |
+
'%%post_author%%' => __('Post author','wp-seopress'),
|
15 |
+
'%%post_category%%' => __('Post category','wp-seopress'),
|
16 |
+
'%%post_tag%%' => __('Post tag','wp-seopress'),
|
17 |
+
'%%_category_title%%' => __('Category title','wp-seopress'),
|
18 |
+
'%%_category_description%%' => __('Category description','wp-seopress'),
|
19 |
+
'%%tag_title%%' => __('Tag title','wp-seopress'),
|
20 |
+
'%%tag_description%%' => __('Tag description','wp-seopress'),
|
21 |
+
'%%term_title%%' => __('Term title','wp-seopress'),
|
22 |
+
'%%term_description%%' => __('Term description','wp-seopress'),
|
23 |
+
'%%search_keywords%%' => __('Search keywords','wp-seopress'),
|
24 |
+
'%%current_pagination%%' => __('Current number page','wp-seopress'),
|
25 |
+
'%%page%%' => __('Page number with context','wp-seopress'),
|
26 |
+
'%%cpt_plural%%' => __('Plural Post Type Archive name','wp-seopress'),
|
27 |
+
'%%archive_title%%' => __('Archive title','wp-seopress'),
|
28 |
+
'%%archive_date%%' => __('Archive date','wp-seopress'),
|
29 |
+
'%%archive_date_day%%' => __('Day Archive date','wp-seopress'),
|
30 |
+
'%%archive_date_month%%' => __('Month Archive title','wp-seopress'),
|
31 |
+
'%%archive_date_year%%' => __('Year Archive title','wp-seopress'),
|
32 |
+
'%%_cf_your_custom_field_name%%' => __('Custom fields from post, page or post type','wp-seopress'),
|
33 |
+
'%%_ct_your_custom_taxonomy_slug%%' => __('Custom term taxonomy from post, page or post type','wp-seopress'),
|
34 |
+
'%%wc_single_cat%%' => __('Single product category','wp-seopress'),
|
35 |
+
'%%wc_single_tag%%' => __('Single product tag','wp-seopress'),
|
36 |
+
'%%wc_single_short_desc%%' => __('Single product short description','wp-seopress'),
|
37 |
+
'%%wc_single_price%%' => __('Single product price','wp-seopress'),
|
38 |
+
'%%wc_single_price_exc_tax%%' => __('Single product price taxes excluded','wp-seopress'),
|
39 |
+
'%%wc_sku%%' => __('Single SKU product','wp-seopress'),
|
40 |
+
'%%currentday%%' => __('Current day','wp-seopress'),
|
41 |
+
'%%currentmonth%%' => __('Current month','wp-seopress'),
|
42 |
+
'%%currentmonth_short%%' => __('Current month in 3 letters','wp-seopress'),
|
43 |
+
'%%currentyear%%' => __('Current year','wp-seopress'),
|
44 |
+
'%%currentdate%%' => __('Current date','wp-seopress'),
|
45 |
+
'%%currenttime%%' => __('Current time','wp-seopress'),
|
46 |
+
'%%author_bio%%' => __('Author biography','wp-seopress'),
|
47 |
+
'%%currentmonth_num%%' => __('Current month in digital format','wp-seopress'),
|
48 |
+
];
|
49 |
+
}
|
50 |
+
|
51 |
+
/**
|
52 |
+
*
|
53 |
+
* @param string $classes
|
54 |
+
* @return string
|
55 |
+
*/
|
56 |
+
function seopress_render_dyn_variables($classes) {
|
57 |
+
$html = sprintf('<span class="seopress-tag-single-all seopress-tag-dropdown %s"><span class="dashicons dashicons-arrow-down-alt2"></span></span>', $classes);
|
58 |
+
if (!empty(seopress_get_dyn_variables())) {
|
59 |
+
$html .= '<div class="sp-wrap-tag-variables-list"><ul class="sp-tag-variables-list">';
|
60 |
+
foreach(seopress_get_dyn_variables() as $key => $value) {
|
61 |
+
$html .= '<li data-value='.$key.'><span>'.$value.'</span></li>';
|
62 |
+
}
|
63 |
+
$html .= '</ul></div>';
|
64 |
+
}
|
65 |
+
|
66 |
+
return $html;
|
67 |
+
}
|
inc/admin/admin-metaboxes-content-analysis-form.php
CHANGED
@@ -51,12 +51,13 @@ if ( is_plugin_active( 'wp-seopress-pro/seopress-pro.php' ) ) {
|
|
51 |
echo "<script>
|
52 |
function seopress_google_suggest(data){
|
53 |
var raw_suggestions = String(data);
|
54 |
-
|
55 |
var suggestions_array = raw_suggestions.split(',');
|
56 |
|
57 |
var i;
|
58 |
-
for (i = 0; i <
|
59 |
-
|
|
|
|
|
60 |
}
|
61 |
|
62 |
jQuery('.sp-suggest-btn').click(function(e) {
|
@@ -79,7 +80,7 @@ if ( is_plugin_active( 'wp-seopress-pro/seopress-pro.php' ) ) {
|
|
79 |
|
80 |
if (kws) {
|
81 |
var script = document.createElement('script');
|
82 |
-
script.src = 'https://www.google.com/complete/search?client=firefox&hl=".$locale."&q='+kws+'&gl=".$country_code."&callback=seopress_google_suggest';
|
83 |
document.body.appendChild(script);
|
84 |
}
|
85 |
});
|
51 |
echo "<script>
|
52 |
function seopress_google_suggest(data){
|
53 |
var raw_suggestions = String(data);
|
|
|
54 |
var suggestions_array = raw_suggestions.split(',');
|
55 |
|
56 |
var i;
|
57 |
+
for (i = 0; i < suggestions_array.length; i++) {
|
58 |
+
if (suggestions_array[i] != null && suggestions_array[i] != undefined && suggestions_array[i] !='' && suggestions_array[i] !='[object Object]') {
|
59 |
+
document.getElementById('seopress_suggestions').innerHTML += '<li><a href=\"#\" class=\"sp-suggest-btn button button-small\">'+suggestions_array[i]+'</a></li>';
|
60 |
+
}
|
61 |
}
|
62 |
|
63 |
jQuery('.sp-suggest-btn').click(function(e) {
|
80 |
|
81 |
if (kws) {
|
82 |
var script = document.createElement('script');
|
83 |
+
script.src = 'https://www.google.com/complete/search?client=firefox&format=rich&hl=".$locale."&q='+kws+'&gl=".$country_code."&callback=seopress_google_suggest';
|
84 |
document.body.appendChild(script);
|
85 |
}
|
86 |
});
|
inc/admin/admin-metaboxes-form.php
CHANGED
@@ -44,6 +44,7 @@ function seopress_redirections_value($seopress_redirections_value) {
|
|
44 |
}
|
45 |
}
|
46 |
|
|
|
47 |
if ( $pagenow =='term.php' || $pagenow =='edit-tags.php') {
|
48 |
echo '
|
49 |
<tr id="term-seopress" class="form-field">
|
@@ -53,6 +54,7 @@ if ( $pagenow =='term.php' || $pagenow =='edit-tags.php') {
|
|
53 |
<div class="inside">';
|
54 |
}
|
55 |
|
|
|
56 |
echo '<div id="seopress-tabs" data_id="'.$current_id.'" data_origin="'.$origin.'" data_tax="'.$data_tax.'">';
|
57 |
|
58 |
if ("seopress_404" != $typenow) {
|
@@ -126,9 +128,11 @@ echo '<div id="seopress-tabs" data_id="'.$current_id.'" data_origin="'.$origin.'
|
|
126 |
echo '<span id="seopress-tag-single-title" data-tag="%%post_title%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Post Title','wp-seopress').'</span>';
|
127 |
}
|
128 |
echo '<span id="seopress-tag-single-site-title" data-tag="%%sitetitle%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Site Title','wp-seopress').'</span>
|
129 |
-
|
130 |
-
|
131 |
-
|
|
|
|
|
132 |
|
133 |
<p style="margin-bottom:0">
|
134 |
<label for="seopress_titles_desc_meta">'
|
@@ -152,6 +156,7 @@ echo '<div id="seopress-tabs" data_id="'.$current_id.'" data_origin="'.$origin.'
|
|
152 |
} else {
|
153 |
echo '<span id="seopress-tag-single-excerpt" data-tag="%%post_excerpt%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Post Excerpt','wp-seopress').'</span>';
|
154 |
}
|
|
|
155 |
echo '</div></div>';
|
156 |
|
157 |
$toggle_preview = 1;
|
@@ -271,7 +276,7 @@ echo '<div id="seopress-tabs" data_id="'.$current_id.'" data_origin="'.$origin.'
|
|
271 |
if (($typenow =='post' || $typenow =='product') && ($pagenow == 'post.php' || $pagenow == 'post-new.php')) {
|
272 |
echo '<p>
|
273 |
<label for="seopress_robots_primary_cat_meta">'. __( 'Select a primary category', 'wp-seopress' ) .'</label>
|
274 |
-
<span class="description">'.__('Set the category that gets used in the %category% permalink if you have multiple categories.','wp-seopress').'</p>
|
275 |
<select name="seopress_robots_primary_cat">';
|
276 |
|
277 |
$cats = get_categories();
|
44 |
}
|
45 |
}
|
46 |
|
47 |
+
|
48 |
if ( $pagenow =='term.php' || $pagenow =='edit-tags.php') {
|
49 |
echo '
|
50 |
<tr id="term-seopress" class="form-field">
|
54 |
<div class="inside">';
|
55 |
}
|
56 |
|
57 |
+
|
58 |
echo '<div id="seopress-tabs" data_id="'.$current_id.'" data_origin="'.$origin.'" data_tax="'.$data_tax.'">';
|
59 |
|
60 |
if ("seopress_404" != $typenow) {
|
128 |
echo '<span id="seopress-tag-single-title" data-tag="%%post_title%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Post Title','wp-seopress').'</span>';
|
129 |
}
|
130 |
echo '<span id="seopress-tag-single-site-title" data-tag="%%sitetitle%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Site Title','wp-seopress').'</span>
|
131 |
+
<span id="seopress-tag-single-sep" data-tag="%%sep%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Separator','wp-seopress').'</span>';
|
132 |
+
|
133 |
+
echo seopress_render_dyn_variables("tag-title");
|
134 |
+
|
135 |
+
echo '</div>
|
136 |
|
137 |
<p style="margin-bottom:0">
|
138 |
<label for="seopress_titles_desc_meta">'
|
156 |
} else {
|
157 |
echo '<span id="seopress-tag-single-excerpt" data-tag="%%post_excerpt%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Post Excerpt','wp-seopress').'</span>';
|
158 |
}
|
159 |
+
echo seopress_render_dyn_variables("tag-description");
|
160 |
echo '</div></div>';
|
161 |
|
162 |
$toggle_preview = 1;
|
276 |
if (($typenow =='post' || $typenow =='product') && ($pagenow == 'post.php' || $pagenow == 'post-new.php')) {
|
277 |
echo '<p>
|
278 |
<label for="seopress_robots_primary_cat_meta">'. __( 'Select a primary category', 'wp-seopress' ) .'</label>
|
279 |
+
<span class="description">'.__('Set the category that gets used in the %category% permalink and in our breadcrumbs if you have multiple categories.','wp-seopress').'</p>
|
280 |
<select name="seopress_robots_primary_cat">';
|
281 |
|
282 |
$cats = get_categories();
|
inc/admin/admin-metaboxes-get-content-analysis.php
CHANGED
@@ -99,7 +99,7 @@ if( strtotime( $post->post_modified ) < strtotime('-365 days') ) {
|
|
99 |
} else {
|
100 |
$desc = '<p><span class="dashicons dashicons-yes"></span>'.__('The last modified date of this article is less than 1 year. Cool!','wp-seopress').'</p>';
|
101 |
}
|
102 |
-
$desc .= '<p>'.__('Search engines love fresh content. Regularly update your articles without having to rewrite your content entirely and give them a boost in search rankings.
|
103 |
$analyzes['old_post']['desc'] = $desc;
|
104 |
|
105 |
//Word counters
|
@@ -337,6 +337,9 @@ if (!empty($seopress_analysis_data['og_title']['count'])) {
|
|
337 |
$analyzes['social']['impact'] = 'high';
|
338 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d og:title in your content.','wp-seopress'), $count).'</p>';
|
339 |
$desc .= '<p>'.__('You should not use more than one og:title in your post content to avoid conflicts when sharing on social networks. Facebook will take the last og:title tag from your source code. Below, the list:','wp-seopress').'</p>';
|
|
|
|
|
|
|
340 |
} else {
|
341 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found an Open Graph Title tag in your source code.','wp-seopress').'</p>';
|
342 |
}
|
@@ -360,12 +363,15 @@ if (!empty($seopress_analysis_data['og_desc']['count'])) {
|
|
360 |
|
361 |
$count = $seopress_analysis_data['og_desc']['count'];
|
362 |
|
363 |
-
$all_og_desc = $seopress_analysis_data['og_desc']['values'];
|
364 |
|
365 |
if ($count > 1) {
|
366 |
$analyzes['social']['impact'] = 'high';
|
367 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d og:description in your content.','wp-seopress'), $count).'</p>';
|
368 |
$desc .= '<p>'.__('You should not use more than one og:description in your post content to avoid conflicts when sharing on social networks. Facebook will take the last og:description tag from your source code. Below, the list:','wp-seopress').'</p>';
|
|
|
|
|
|
|
369 |
} else {
|
370 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found an Open Graph Description tag in your source code.','wp-seopress').'</p>';
|
371 |
}
|
@@ -389,12 +395,18 @@ if (!empty($seopress_analysis_data['og_img']['count'])) {
|
|
389 |
|
390 |
$count = $seopress_analysis_data['og_img']['count'];
|
391 |
|
392 |
-
$all_og_img = $seopress_analysis_data['og_img']['values'];
|
393 |
|
394 |
-
if ($count > 0) {
|
395 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.sprintf(esc_html__('We found %d og:image in your content.','wp-seopress'), $count).'</p>';
|
396 |
}
|
397 |
|
|
|
|
|
|
|
|
|
|
|
|
|
398 |
if (!empty($all_og_img)) {
|
399 |
$desc .= '<ul>';
|
400 |
foreach($all_og_img as $og_img) {
|
@@ -420,6 +432,9 @@ if (!empty($seopress_analysis_data['og_url']['count'])) {
|
|
420 |
$analyzes['social']['impact'] = 'high';
|
421 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d og:url in your content.','wp-seopress'), $count).'</p>';
|
422 |
$desc .= '<p>'.__('You should not use more than one og:url in your post content to avoid conflicts when sharing on social networks. Facebook will take the last og:url tag from your source code. Below, the list:','wp-seopress').'</p>';
|
|
|
|
|
|
|
423 |
} else {
|
424 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found an Open Graph URL tag in your source code.','wp-seopress').'</p>';
|
425 |
}
|
@@ -449,6 +464,9 @@ if (!empty($seopress_analysis_data['og_site_name']['count'])) {
|
|
449 |
$analyzes['social']['impact'] = 'high';
|
450 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d og:site_name in your content.','wp-seopress'), $count).'</p>';
|
451 |
$desc .= '<p>'.__('You should not use more than one og:site_name in your post content to avoid conflicts when sharing on social networks. Facebook will take the last og:site_name tag from your source code. Below, the list:','wp-seopress').'</p>';
|
|
|
|
|
|
|
452 |
} else {
|
453 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found an Open Graph Site Name tag in your source code.','wp-seopress').'</p>';
|
454 |
}
|
@@ -478,8 +496,11 @@ if (!empty($seopress_analysis_data['tw_title']['count'])) {
|
|
478 |
$analyzes['social']['impact'] = 'high';
|
479 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d twitter:title in your content.','wp-seopress'), $count).'</p>';
|
480 |
$desc .= '<p>'.__('You should not use more than one twitter:title in your post content to avoid conflicts when sharing on social networks. Twitter will take the last twitter:title tag from your source code. Below, the list:','wp-seopress').'</p>';
|
|
|
|
|
|
|
481 |
} else {
|
482 |
-
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found a Twitter Title
|
483 |
}
|
484 |
|
485 |
if (!empty($all_tw_title)) {
|
@@ -501,12 +522,15 @@ if (!empty($seopress_analysis_data['tw_desc']['count'])) {
|
|
501 |
|
502 |
$count = $seopress_analysis_data['tw_desc']['count'];
|
503 |
|
504 |
-
$all_tw_desc = $seopress_analysis_data['tw_desc']['values'];
|
505 |
|
506 |
if ($count > 1) {
|
507 |
$analyzes['social']['impact'] = 'high';
|
508 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d twitter:description in your content.','wp-seopress'), $count).'</p>';
|
509 |
$desc .= '<p>'.__('You should not use more than one twitter:description in your post content to avoid conflicts when sharing on social networks. Twitter will take the last twitter:description tag from your source code. Below, the list:','wp-seopress').'</p>';
|
|
|
|
|
|
|
510 |
} else {
|
511 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found a Twitter Description tag in your source code.','wp-seopress').'</p>';
|
512 |
}
|
@@ -530,12 +554,18 @@ if (!empty($seopress_analysis_data['tw_img']['count'])) {
|
|
530 |
|
531 |
$count = $seopress_analysis_data['tw_img']['count'];
|
532 |
|
533 |
-
$all_tw_img = $seopress_analysis_data['tw_img']['values'];
|
534 |
|
535 |
-
if ($count > 0) {
|
536 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.sprintf(esc_html__('We found %d twitter:image in your content.','wp-seopress'), $count).'</p>';
|
537 |
}
|
538 |
|
|
|
|
|
|
|
|
|
|
|
|
|
539 |
if (!empty($all_tw_img)) {
|
540 |
$desc .= '<ul>';
|
541 |
foreach($all_tw_img as $tw_img) {
|
99 |
} else {
|
100 |
$desc = '<p><span class="dashicons dashicons-yes"></span>'.__('The last modified date of this article is less than 1 year. Cool!','wp-seopress').'</p>';
|
101 |
}
|
102 |
+
$desc .= '<p>'.__('Search engines love fresh content. Regularly update your articles without having to rewrite your content entirely and give them a boost in search rankings. We takes care of the technical part.','wp-seopress').'</p>';
|
103 |
$analyzes['old_post']['desc'] = $desc;
|
104 |
|
105 |
//Word counters
|
337 |
$analyzes['social']['impact'] = 'high';
|
338 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d og:title in your content.','wp-seopress'), $count).'</p>';
|
339 |
$desc .= '<p>'.__('You should not use more than one og:title in your post content to avoid conflicts when sharing on social networks. Facebook will take the last og:title tag from your source code. Below, the list:','wp-seopress').'</p>';
|
340 |
+
} elseif(empty($all_og_title[0])) { //If og:title empty
|
341 |
+
$analyzes['social']['impact'] = 'high';
|
342 |
+
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.__('Your Open Graph Title tag is empty!','wp-seopress').'</p>';
|
343 |
} else {
|
344 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found an Open Graph Title tag in your source code.','wp-seopress').'</p>';
|
345 |
}
|
363 |
|
364 |
$count = $seopress_analysis_data['og_desc']['count'];
|
365 |
|
366 |
+
$all_og_desc = isset($seopress_analysis_data['og_desc']['values']) ? $seopress_analysis_data['og_desc']['values'] : [];
|
367 |
|
368 |
if ($count > 1) {
|
369 |
$analyzes['social']['impact'] = 'high';
|
370 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d og:description in your content.','wp-seopress'), $count).'</p>';
|
371 |
$desc .= '<p>'.__('You should not use more than one og:description in your post content to avoid conflicts when sharing on social networks. Facebook will take the last og:description tag from your source code. Below, the list:','wp-seopress').'</p>';
|
372 |
+
} elseif(empty($all_og_desc[0])) { //If og:description empty
|
373 |
+
$analyzes['social']['impact'] = 'high';
|
374 |
+
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.__('Your Open Graph Description tag is empty!','wp-seopress').'</p>';
|
375 |
} else {
|
376 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found an Open Graph Description tag in your source code.','wp-seopress').'</p>';
|
377 |
}
|
395 |
|
396 |
$count = $seopress_analysis_data['og_img']['count'];
|
397 |
|
398 |
+
$all_og_img = isset($seopress_analysis_data['og_img']['values']) ? $seopress_analysis_data['og_img']['values'] : [];
|
399 |
|
400 |
+
if ($count > 0 && !empty($all_og_img[0])) {
|
401 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.sprintf(esc_html__('We found %d og:image in your content.','wp-seopress'), $count).'</p>';
|
402 |
}
|
403 |
|
404 |
+
//If og:image empty
|
405 |
+
if ($count > 0 && empty($all_og_img[0])) {
|
406 |
+
$analyzes['social']['impact'] = 'high';
|
407 |
+
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.__('Your Open Graph Image tag is empty!','wp-seopress').'</p>';
|
408 |
+
}
|
409 |
+
|
410 |
if (!empty($all_og_img)) {
|
411 |
$desc .= '<ul>';
|
412 |
foreach($all_og_img as $og_img) {
|
432 |
$analyzes['social']['impact'] = 'high';
|
433 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d og:url in your content.','wp-seopress'), $count).'</p>';
|
434 |
$desc .= '<p>'.__('You should not use more than one og:url in your post content to avoid conflicts when sharing on social networks. Facebook will take the last og:url tag from your source code. Below, the list:','wp-seopress').'</p>';
|
435 |
+
} elseif(empty($all_og_url[0])) { //If og:url empty
|
436 |
+
$analyzes['social']['impact'] = 'high';
|
437 |
+
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.__('Your Open Graph URL tag is empty!','wp-seopress').'</p>';
|
438 |
} else {
|
439 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found an Open Graph URL tag in your source code.','wp-seopress').'</p>';
|
440 |
}
|
464 |
$analyzes['social']['impact'] = 'high';
|
465 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d og:site_name in your content.','wp-seopress'), $count).'</p>';
|
466 |
$desc .= '<p>'.__('You should not use more than one og:site_name in your post content to avoid conflicts when sharing on social networks. Facebook will take the last og:site_name tag from your source code. Below, the list:','wp-seopress').'</p>';
|
467 |
+
} elseif(empty($all_og_site_name[0])) { //If og:site_name empty
|
468 |
+
$analyzes['social']['impact'] = 'high';
|
469 |
+
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.__('Your Open Graph Site Name tag is empty!','wp-seopress').'</p>';
|
470 |
} else {
|
471 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found an Open Graph Site Name tag in your source code.','wp-seopress').'</p>';
|
472 |
}
|
496 |
$analyzes['social']['impact'] = 'high';
|
497 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d twitter:title in your content.','wp-seopress'), $count).'</p>';
|
498 |
$desc .= '<p>'.__('You should not use more than one twitter:title in your post content to avoid conflicts when sharing on social networks. Twitter will take the last twitter:title tag from your source code. Below, the list:','wp-seopress').'</p>';
|
499 |
+
} elseif(empty($all_tw_title[0])) { //If twitter:title empty
|
500 |
+
$analyzes['social']['impact'] = 'high';
|
501 |
+
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.__('Your Twitter Title tag is empty!','wp-seopress').'</p>';
|
502 |
} else {
|
503 |
+
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found a Twitter Title tag in your source code.','wp-seopress').'</p>';
|
504 |
}
|
505 |
|
506 |
if (!empty($all_tw_title)) {
|
522 |
|
523 |
$count = $seopress_analysis_data['tw_desc']['count'];
|
524 |
|
525 |
+
$all_tw_desc = isset($seopress_analysis_data['tw_desc']['values']) ? $seopress_analysis_data['tw_desc']['values'] : [];
|
526 |
|
527 |
if ($count > 1) {
|
528 |
$analyzes['social']['impact'] = 'high';
|
529 |
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.sprintf(esc_html__('We found %d twitter:description in your content.','wp-seopress'), $count).'</p>';
|
530 |
$desc .= '<p>'.__('You should not use more than one twitter:description in your post content to avoid conflicts when sharing on social networks. Twitter will take the last twitter:description tag from your source code. Below, the list:','wp-seopress').'</p>';
|
531 |
+
} elseif(empty($all_tw_desc[0])) { //If twitter:description empty
|
532 |
+
$analyzes['social']['impact'] = 'high';
|
533 |
+
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.__('Your Twitter Description tag is empty!','wp-seopress').'</p>';
|
534 |
} else {
|
535 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.__('We found a Twitter Description tag in your source code.','wp-seopress').'</p>';
|
536 |
}
|
554 |
|
555 |
$count = $seopress_analysis_data['tw_img']['count'];
|
556 |
|
557 |
+
$all_tw_img = isset($seopress_analysis_data['tw_img']['values']) ? $seopress_analysis_data['tw_img']['values'] : [];
|
558 |
|
559 |
+
if ($count > 0 && !empty($all_tw_img[0])) {
|
560 |
$desc .= '<p><span class="dashicons dashicons-yes"></span>'.sprintf(esc_html__('We found %d twitter:image in your content.','wp-seopress'), $count).'</p>';
|
561 |
}
|
562 |
|
563 |
+
//If twitter:image:src empty
|
564 |
+
if ($count > 0 && empty($all_tw_img[0])) {
|
565 |
+
$analyzes['social']['impact'] = 'high';
|
566 |
+
$desc .= '<p><span class="dashicons dashicons-no-alt"></span>'.__('Your Twitter Image tag is empty!','wp-seopress').'</p>';
|
567 |
+
}
|
568 |
+
|
569 |
if (!empty($all_tw_img)) {
|
570 |
$desc .= '<ul>';
|
571 |
foreach($all_tw_img as $tw_img) {
|
inc/admin/admin-metaboxes.php
CHANGED
@@ -6,546 +6,552 @@ defined( 'ABSPATH' ) or die( 'Please don’t call the plugin directly. Thank
|
|
6 |
//Restrict SEO metaboxes to user roles
|
7 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
8 |
function seopress_advanced_security_metaboxe_role_hook_option() {
|
9 |
-
|
10 |
-
|
11 |
-
|
12 |
-
|
13 |
-
|
14 |
-
|
15 |
-
|
16 |
-
|
17 |
}
|
18 |
|
19 |
function seopress_advanced_security_metaboxe_ca_role_hook_option() {
|
20 |
-
|
21 |
-
|
22 |
-
|
23 |
-
|
24 |
-
|
25 |
-
|
26 |
-
|
27 |
-
|
28 |
}
|
29 |
|
30 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
31 |
//Check global settings
|
32 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
33 |
if (!function_exists('seopress_titles_single_cpt_noindex_option')) {
|
34 |
-
|
35 |
-
|
36 |
-
|
37 |
-
|
38 |
-
|
39 |
-
|
40 |
-
|
41 |
-
|
42 |
-
|
43 |
-
|
44 |
-
|
45 |
-
|
46 |
-
|
47 |
}
|
48 |
|
49 |
if (!function_exists('seopress_titles_noindex_option')) {
|
50 |
-
|
51 |
-
|
52 |
-
|
53 |
-
|
54 |
-
|
55 |
-
|
56 |
-
|
57 |
-
|
58 |
-
|
59 |
-
|
60 |
}
|
61 |
|
62 |
if (!function_exists('seopress_titles_single_cpt_nofollow_option')) {
|
63 |
-
|
64 |
-
|
65 |
-
|
66 |
-
|
67 |
-
|
68 |
-
|
69 |
-
|
70 |
-
|
71 |
-
|
72 |
-
|
73 |
-
|
74 |
-
|
75 |
-
|
76 |
}
|
77 |
|
78 |
if (!function_exists('seopress_titles_nofollow_option')) {
|
79 |
-
|
80 |
-
|
81 |
-
|
82 |
-
|
83 |
-
|
84 |
-
|
85 |
-
|
86 |
-
|
87 |
-
|
88 |
-
|
89 |
}
|
90 |
|
91 |
if (!function_exists('seopress_titles_noodp_option')) {
|
92 |
-
|
93 |
-
|
94 |
-
|
95 |
-
|
96 |
-
|
97 |
-
|
98 |
-
|
99 |
-
|
100 |
-
|
101 |
-
|
102 |
}
|
103 |
|
104 |
if (!function_exists('seopress_titles_noarchive_option')) {
|
105 |
-
|
106 |
-
|
107 |
-
|
108 |
-
|
109 |
-
|
110 |
-
|
111 |
-
|
112 |
-
|
113 |
-
|
114 |
-
|
115 |
}
|
116 |
|
117 |
if (!function_exists('seopress_titles_nosnippet_option')) {
|
118 |
-
|
119 |
-
|
120 |
-
|
121 |
-
|
122 |
-
|
123 |
-
|
124 |
-
|
125 |
-
|
126 |
-
|
127 |
-
|
128 |
}
|
129 |
|
130 |
if (!function_exists('seopress_titles_noimageindex_option')) {
|
131 |
-
|
132 |
-
|
133 |
-
|
134 |
-
|
135 |
-
|
136 |
-
|
137 |
-
|
138 |
-
|
139 |
-
|
140 |
-
|
141 |
}
|
142 |
|
143 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
144 |
//Display metabox in Custom Post Type
|
145 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
146 |
function seopress_display_seo_metaboxe() {
|
147 |
-
|
148 |
-
|
149 |
-
|
150 |
-
|
151 |
-
|
152 |
-
|
153 |
-
|
154 |
-
|
155 |
-
|
156 |
-
|
157 |
-
|
158 |
-
|
159 |
-
|
160 |
-
|
161 |
-
|
162 |
-
|
163 |
-
|
164 |
-
|
165 |
-
|
166 |
-
|
167 |
-
|
168 |
-
|
169 |
-
|
170 |
-
|
171 |
-
|
172 |
-
|
173 |
-
|
174 |
-
|
175 |
-
|
176 |
-
|
177 |
-
|
178 |
-
|
179 |
-
|
180 |
-
|
181 |
-
|
182 |
-
|
183 |
-
|
184 |
-
|
185 |
-
|
186 |
-
|
187 |
-
|
188 |
-
|
189 |
-
|
190 |
-
|
191 |
-
|
192 |
-
|
193 |
-
|
194 |
-
|
195 |
-
|
196 |
-
|
197 |
-
|
198 |
-
|
199 |
-
|
200 |
-
|
201 |
-
|
202 |
-
|
203 |
-
|
204 |
-
|
205 |
-
|
206 |
-
|
207 |
-
|
208 |
-
|
209 |
-
|
210 |
-
|
211 |
-
|
212 |
-
|
213 |
-
|
214 |
-
|
215 |
-
|
216 |
-
|
217 |
-
|
218 |
-
|
219 |
-
|
220 |
-
|
221 |
-
|
222 |
-
|
223 |
-
|
224 |
-
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
-
|
230 |
-
|
231 |
-
|
232 |
-
|
233 |
-
|
234 |
-
|
235 |
-
|
236 |
-
|
237 |
-
|
238 |
-
|
239 |
-
|
240 |
-
|
241 |
-
|
242 |
-
|
243 |
-
|
244 |
-
|
245 |
-
|
246 |
-
|
247 |
-
|
248 |
-
|
249 |
-
|
250 |
-
|
251 |
-
|
252 |
-
|
253 |
-
|
254 |
-
|
255 |
-
|
256 |
-
|
257 |
-
|
258 |
-
|
259 |
-
|
260 |
-
|
261 |
-
|
262 |
-
|
263 |
-
|
264 |
-
|
265 |
-
|
266 |
-
|
267 |
-
|
268 |
-
|
269 |
-
|
270 |
-
|
271 |
-
|
272 |
-
|
273 |
-
|
274 |
-
|
275 |
-
|
276 |
-
|
277 |
-
|
278 |
-
|
279 |
-
|
280 |
-
|
281 |
-
|
282 |
-
|
283 |
-
|
284 |
-
|
285 |
-
|
286 |
-
|
287 |
-
|
288 |
-
|
289 |
-
|
290 |
-
|
291 |
-
|
292 |
-
|
293 |
-
|
294 |
-
|
295 |
-
|
296 |
-
|
297 |
-
|
298 |
-
|
299 |
-
|
300 |
-
|
301 |
-
|
302 |
-
|
303 |
-
|
304 |
-
|
305 |
-
|
306 |
-
|
307 |
-
|
308 |
-
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
315 |
-
|
316 |
-
|
317 |
-
|
318 |
-
|
319 |
-
|
320 |
-
|
321 |
-
|
322 |
-
|
323 |
-
|
324 |
-
|
325 |
-
|
326 |
-
|
327 |
-
|
328 |
-
|
329 |
-
|
330 |
-
|
331 |
-
|
332 |
-
|
333 |
-
|
334 |
-
|
335 |
-
|
336 |
-
|
337 |
-
|
338 |
-
|
339 |
-
|
340 |
-
|
341 |
-
|
342 |
-
|
343 |
-
|
344 |
-
|
345 |
-
|
346 |
-
|
347 |
-
|
348 |
-
|
349 |
-
|
350 |
-
|
351 |
-
|
352 |
-
|
353 |
-
|
354 |
-
|
355 |
-
|
356 |
-
|
357 |
-
|
358 |
-
|
359 |
-
|
360 |
-
|
361 |
-
|
362 |
-
|
363 |
-
|
364 |
-
|
365 |
-
|
366 |
-
|
367 |
-
|
368 |
-
|
369 |
-
|
370 |
-
|
371 |
-
|
372 |
-
|
373 |
-
|
374 |
-
|
375 |
-
|
376 |
-
|
377 |
-
|
378 |
-
|
379 |
-
|
380 |
-
|
381 |
-
|
382 |
-
|
383 |
-
|
384 |
-
|
385 |
-
|
386 |
-
|
387 |
-
|
388 |
-
|
389 |
-
|
390 |
-
|
391 |
-
|
392 |
-
|
393 |
-
|
394 |
-
|
395 |
-
|
396 |
-
|
397 |
-
|
398 |
-
|
399 |
-
|
400 |
-
|
401 |
-
|
402 |
-
|
403 |
-
|
404 |
-
|
405 |
-
|
406 |
-
|
407 |
-
|
408 |
-
|
409 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
410 |
}
|
411 |
|
412 |
function seopress_display_ca_metaboxe() {
|
413 |
-
|
414 |
-
|
415 |
-
|
416 |
-
|
417 |
-
|
418 |
-
|
419 |
-
|
420 |
-
|
421 |
-
|
422 |
-
|
423 |
-
|
424 |
-
|
425 |
-
|
426 |
-
|
427 |
-
|
428 |
-
|
429 |
-
|
430 |
-
|
431 |
-
|
432 |
-
|
433 |
-
|
434 |
-
|
435 |
-
|
436 |
-
|
437 |
-
|
438 |
-
|
439 |
-
|
440 |
-
|
441 |
-
|
442 |
-
|
443 |
-
|
444 |
-
|
445 |
-
|
446 |
-
|
447 |
-
|
448 |
-
|
449 |
-
|
450 |
-
|
451 |
-
|
452 |
-
|
453 |
-
|
454 |
-
|
455 |
-
|
456 |
-
|
457 |
-
|
458 |
-
|
459 |
-
|
460 |
-
|
461 |
-
|
462 |
-
|
463 |
-
|
464 |
-
|
465 |
-
|
466 |
-
|
467 |
-
|
468 |
-
|
469 |
-
|
470 |
-
|
471 |
-
|
472 |
-
|
473 |
-
|
474 |
-
|
475 |
-
|
476 |
-
|
477 |
-
|
478 |
-
|
479 |
-
|
480 |
-
|
481 |
-
|
482 |
-
|
483 |
-
|
484 |
-
|
485 |
-
|
486 |
-
|
487 |
-
|
488 |
-
|
489 |
-
|
490 |
-
|
491 |
-
|
492 |
-
|
493 |
-
|
494 |
-
|
495 |
-
|
496 |
-
|
497 |
-
|
498 |
-
|
499 |
-
|
500 |
-
|
501 |
-
|
502 |
-
|
503 |
-
|
504 |
-
|
505 |
-
|
506 |
-
|
507 |
-
|
508 |
-
|
509 |
-
|
510 |
-
|
511 |
-
|
512 |
-
|
513 |
-
|
514 |
-
|
515 |
}
|
516 |
|
517 |
if (is_user_logged_in()) {
|
518 |
-
|
519 |
-
|
520 |
-
|
521 |
-
|
522 |
-
|
523 |
-
|
524 |
-
|
525 |
-
|
526 |
-
|
527 |
-
|
528 |
-
|
529 |
-
|
530 |
-
|
531 |
-
|
532 |
-
|
533 |
-
|
534 |
-
|
535 |
-
|
536 |
-
|
537 |
-
|
538 |
-
|
539 |
-
|
540 |
-
|
541 |
-
|
542 |
-
|
543 |
-
|
544 |
-
|
545 |
-
|
546 |
-
|
547 |
-
|
548 |
-
|
549 |
-
|
550 |
-
|
551 |
}
|
6 |
//Restrict SEO metaboxes to user roles
|
7 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
8 |
function seopress_advanced_security_metaboxe_role_hook_option() {
|
9 |
+
$seopress_advanced_security_metaboxe_role_hook_option = get_option("seopress_advanced_option_name");
|
10 |
+
if ( ! empty ( $seopress_advanced_security_metaboxe_role_hook_option ) ) {
|
11 |
+
foreach ($seopress_advanced_security_metaboxe_role_hook_option as $key => $seopress_advanced_security_metaboxe_role_hook_value)
|
12 |
+
$options[$key] = $seopress_advanced_security_metaboxe_role_hook_value;
|
13 |
+
if (isset($seopress_advanced_security_metaboxe_role_hook_option['seopress_advanced_security_metaboxe_role'])) {
|
14 |
+
return $seopress_advanced_security_metaboxe_role_hook_option['seopress_advanced_security_metaboxe_role'];
|
15 |
+
}
|
16 |
+
}
|
17 |
}
|
18 |
|
19 |
function seopress_advanced_security_metaboxe_ca_role_hook_option() {
|
20 |
+
$seopress_advanced_security_metaboxe_ca_role_hook_option = get_option("seopress_advanced_option_name");
|
21 |
+
if ( ! empty ( $seopress_advanced_security_metaboxe_ca_role_hook_option ) ) {
|
22 |
+
foreach ($seopress_advanced_security_metaboxe_ca_role_hook_option as $key => $seopress_advanced_security_metaboxe_ca_role_hook_value)
|
23 |
+
$options[$key] = $seopress_advanced_security_metaboxe_ca_role_hook_value;
|
24 |
+
if (isset($seopress_advanced_security_metaboxe_ca_role_hook_option['seopress_advanced_security_metaboxe_ca_role'])) {
|
25 |
+
return $seopress_advanced_security_metaboxe_ca_role_hook_option['seopress_advanced_security_metaboxe_ca_role'];
|
26 |
+
}
|
27 |
+
}
|
28 |
}
|
29 |
|
30 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
31 |
//Check global settings
|
32 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
33 |
if (!function_exists('seopress_titles_single_cpt_noindex_option')) {
|
34 |
+
function seopress_titles_single_cpt_noindex_option() {
|
35 |
+
global $post;
|
36 |
+
$seopress_get_current_cpt = get_post_type($post);
|
37 |
+
|
38 |
+
$seopress_titles_single_cpt_noindex_option = get_option("seopress_titles_option_name");
|
39 |
+
if ( ! empty ( $seopress_titles_single_cpt_noindex_option ) ) {
|
40 |
+
foreach ($seopress_titles_single_cpt_noindex_option as $key => $seopress_titles_single_cpt_noindex_value)
|
41 |
+
$options[$key] = $seopress_titles_single_cpt_noindex_value;
|
42 |
+
if (isset($seopress_titles_single_cpt_noindex_option['seopress_titles_single_titles'][$seopress_get_current_cpt]['noindex'])) {
|
43 |
+
return $seopress_titles_single_cpt_noindex_option['seopress_titles_single_titles'][$seopress_get_current_cpt]['noindex'];
|
44 |
+
}
|
45 |
+
}
|
46 |
+
}
|
47 |
}
|
48 |
|
49 |
if (!function_exists('seopress_titles_noindex_option')) {
|
50 |
+
function seopress_titles_noindex_option() {
|
51 |
+
$seopress_titles_noindex_option = get_option("seopress_titles_option_name");
|
52 |
+
if ( ! empty ( $seopress_titles_noindex_option ) ) {
|
53 |
+
foreach ($seopress_titles_noindex_option as $key => $seopress_titles_noindex_value)
|
54 |
+
$options[$key] = $seopress_titles_noindex_value;
|
55 |
+
if (isset($seopress_titles_noindex_option['seopress_titles_noindex'])) {
|
56 |
+
return $seopress_titles_noindex_option['seopress_titles_noindex'];
|
57 |
+
}
|
58 |
+
}
|
59 |
+
}
|
60 |
}
|
61 |
|
62 |
if (!function_exists('seopress_titles_single_cpt_nofollow_option')) {
|
63 |
+
function seopress_titles_single_cpt_nofollow_option() {
|
64 |
+
global $post;
|
65 |
+
$seopress_get_current_cpt = get_post_type($post);
|
66 |
+
|
67 |
+
$seopress_titles_single_cpt_nofollow_option = get_option("seopress_titles_option_name");
|
68 |
+
if ( ! empty ( $seopress_titles_single_cpt_nofollow_option ) ) {
|
69 |
+
foreach ($seopress_titles_single_cpt_nofollow_option as $key => $seopress_titles_single_cpt_nofollow_value)
|
70 |
+
$options[$key] = $seopress_titles_single_cpt_nofollow_value;
|
71 |
+
if (isset($seopress_titles_single_cpt_nofollow_option['seopress_titles_single_titles'][$seopress_get_current_cpt]['nofollow'])) {
|
72 |
+
return $seopress_titles_single_cpt_nofollow_option['seopress_titles_single_titles'][$seopress_get_current_cpt]['nofollow'];
|
73 |
+
}
|
74 |
+
}
|
75 |
+
}
|
76 |
}
|
77 |
|
78 |
if (!function_exists('seopress_titles_nofollow_option')) {
|
79 |
+
function seopress_titles_nofollow_option() {
|
80 |
+
$seopress_titles_nofollow_option = get_option("seopress_titles_option_name");
|
81 |
+
if ( ! empty ( $seopress_titles_nofollow_option ) ) {
|
82 |
+
foreach ($seopress_titles_nofollow_option as $key => $seopress_titles_nofollow_value)
|
83 |
+
$options[$key] = $seopress_titles_nofollow_value;
|
84 |
+
if (isset($seopress_titles_nofollow_option['seopress_titles_nofollow'])) {
|
85 |
+
return $seopress_titles_nofollow_option['seopress_titles_nofollow'];
|
86 |
+
}
|
87 |
+
}
|
88 |
+
}
|
89 |
}
|
90 |
|
91 |
if (!function_exists('seopress_titles_noodp_option')) {
|
92 |
+
function seopress_titles_noodp_option() {
|
93 |
+
$seopress_titles_noodp_option = get_option("seopress_titles_option_name");
|
94 |
+
if ( ! empty ( $seopress_titles_noodp_option ) ) {
|
95 |
+
foreach ($seopress_titles_noodp_option as $key => $seopress_titles_noodp_value)
|
96 |
+
$options[$key] = $seopress_titles_noodp_value;
|
97 |
+
if (isset($seopress_titles_noodp_option['seopress_titles_noodp'])) {
|
98 |
+
return $seopress_titles_noodp_option['seopress_titles_noodp'];
|
99 |
+
}
|
100 |
+
}
|
101 |
+
}
|
102 |
}
|
103 |
|
104 |
if (!function_exists('seopress_titles_noarchive_option')) {
|
105 |
+
function seopress_titles_noarchive_option() {
|
106 |
+
$seopress_titles_noarchive_option = get_option("seopress_titles_option_name");
|
107 |
+
if ( ! empty ( $seopress_titles_noarchive_option ) ) {
|
108 |
+
foreach ($seopress_titles_noarchive_option as $key => $seopress_titles_noarchive_value)
|
109 |
+
$options[$key] = $seopress_titles_noarchive_value;
|
110 |
+
if (isset($seopress_titles_noarchive_option['seopress_titles_noarchive'])) {
|
111 |
+
return $seopress_titles_noarchive_option['seopress_titles_noarchive'];
|
112 |
+
}
|
113 |
+
}
|
114 |
+
}
|
115 |
}
|
116 |
|
117 |
if (!function_exists('seopress_titles_nosnippet_option')) {
|
118 |
+
function seopress_titles_nosnippet_option() {
|
119 |
+
$seopress_titles_nosnippet_option = get_option("seopress_titles_option_name");
|
120 |
+
if ( ! empty ( $seopress_titles_nosnippet_option ) ) {
|
121 |
+
foreach ($seopress_titles_nosnippet_option as $key => $seopress_titles_nosnippet_value)
|
122 |
+
$options[$key] = $seopress_titles_nosnippet_value;
|
123 |
+
if (isset($seopress_titles_nosnippet_option['seopress_titles_nosnippet'])) {
|
124 |
+
return $seopress_titles_nosnippet_option['seopress_titles_nosnippet'];
|
125 |
+
}
|
126 |
+
}
|
127 |
+
}
|
128 |
}
|
129 |
|
130 |
if (!function_exists('seopress_titles_noimageindex_option')) {
|
131 |
+
function seopress_titles_noimageindex_option() {
|
132 |
+
$seopress_titles_noimageindex_option = get_option("seopress_titles_option_name");
|
133 |
+
if ( ! empty ( $seopress_titles_noimageindex_option ) ) {
|
134 |
+
foreach ($seopress_titles_noimageindex_option as $key => $seopress_titles_noimageindex_value)
|
135 |
+
$options[$key] = $seopress_titles_noimageindex_value;
|
136 |
+
if (isset($seopress_titles_noimageindex_option['seopress_titles_noimageindex'])) {
|
137 |
+
return $seopress_titles_noimageindex_option['seopress_titles_noimageindex'];
|
138 |
+
}
|
139 |
+
}
|
140 |
+
}
|
141 |
}
|
142 |
|
143 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
144 |
//Display metabox in Custom Post Type
|
145 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
146 |
function seopress_display_seo_metaboxe() {
|
147 |
+
add_action('add_meta_boxes','seopress_init_metabox');
|
148 |
+
function seopress_init_metabox(){
|
149 |
+
if (function_exists('seopress_advanced_appearance_metaboxe_position_option')) {
|
150 |
+
$seopress_advanced_appearance_metaboxe_position_option = seopress_advanced_appearance_metaboxe_position_option();
|
151 |
+
} else {
|
152 |
+
$seopress_advanced_appearance_metaboxe_position_option = 'default';
|
153 |
+
}
|
154 |
+
|
155 |
+
if (function_exists('seopress_get_post_types')) {
|
156 |
+
|
157 |
+
$seopress_get_post_types = seopress_get_post_types();
|
158 |
+
|
159 |
+
$seopress_get_post_types = apply_filters('seopress_metaboxe_seo', $seopress_get_post_types);
|
160 |
+
|
161 |
+
if (!empty($seopress_get_post_types)) {
|
162 |
+
foreach ($seopress_get_post_types as $key => $value) {
|
163 |
+
add_meta_box('seopress_cpt', __('SEO','wp-seopress'), 'seopress_cpt', $key, 'normal', $seopress_advanced_appearance_metaboxe_position_option);
|
164 |
+
}
|
165 |
+
}
|
166 |
+
add_meta_box('seopress_cpt', __('SEO','wp-seopress'), 'seopress_cpt', 'seopress_404', 'normal', $seopress_advanced_appearance_metaboxe_position_option);
|
167 |
+
}
|
168 |
+
}
|
169 |
+
|
170 |
+
function seopress_cpt( $post ){
|
171 |
+
global $typenow;
|
172 |
+
$prefix = defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG ? '' : '.min';
|
173 |
+
wp_nonce_field( plugin_basename( __FILE__ ), 'seopress_cpt_nonce' );
|
174 |
+
|
175 |
+
//init
|
176 |
+
$disabled = array();
|
177 |
+
|
178 |
+
wp_enqueue_script( 'seopress-cpt-tabs-js', plugins_url( 'assets/js/seopress-tabs2' . $prefix . '.js', dirname( dirname( __FILE__ ) ) ), [ 'jquery-ui-tabs' ], SEOPRESS_VERSION );
|
179 |
+
|
180 |
+
if ("seopress_404" != $typenow) {
|
181 |
+
wp_enqueue_script('jquery-ui-accordion');
|
182 |
+
|
183 |
+
//Tagify
|
184 |
+
wp_enqueue_script( 'seopress-tagify-js', plugins_url( 'assets/js/tagify.min.js', dirname( dirname( __FILE__ ) ) ), [ 'jquery' ], SEOPRESS_VERSION, true );
|
185 |
+
wp_register_style('seopress-tagify', plugins_url('assets/css/tagify.min.css', dirname( dirname( __FILE__ ) ) ), [], SEOPRESS_PRO_VERSION);
|
186 |
+
wp_enqueue_style('seopress-tagify');
|
187 |
+
|
188 |
+
//Register Google Snippet Preview / Content Analysis JS
|
189 |
+
wp_enqueue_script( 'seopress-cpt-counters-js', plugins_url( 'assets/js/seopress-counters' . $prefix . '.js', dirname( dirname( __FILE__ ) ) ), [ 'jquery', 'jquery-ui-tabs', 'jquery-ui-accordion' ], SEOPRESS_VERSION, true );
|
190 |
+
|
191 |
+
//If Gutenberg ON
|
192 |
+
if ( function_exists( 'get_current_screen' ) ) {
|
193 |
+
$get_current_screen = get_current_screen();
|
194 |
+
if ( isset( $get_current_screen->is_block_editor ) ) {
|
195 |
+
if ( $get_current_screen->is_block_editor ) {
|
196 |
+
wp_enqueue_script( 'seopress-block-editor-js', plugins_url( 'assets/js/seopress-block-editor' . $prefix . '.js', dirname( dirname( __FILE__ ) ) ), [ 'jquery' ], SEOPRESS_VERSION, true );
|
197 |
+
}
|
198 |
+
}
|
199 |
+
}
|
200 |
+
|
201 |
+
wp_enqueue_script( 'seopress-cpt-video-sitemap-js', plugins_url( 'assets/js/seopress-sitemap-video' . $prefix . '.js', dirname(dirname( __FILE__ ))), [ 'jquery', 'jquery-ui-accordion' ], SEOPRESS_VERSION );
|
202 |
+
|
203 |
+
$seopress_real_preview = array(
|
204 |
+
'seopress_nonce' => wp_create_nonce('seopress_real_preview_nonce'),
|
205 |
+
'seopress_real_preview' => admin_url('admin-ajax.php'),
|
206 |
+
'i18n' => [ 'progress' => __( 'Analysis in progress...', 'wp-seopress' ) ]
|
207 |
+
);
|
208 |
+
wp_localize_script( 'seopress-cpt-counters-js', 'seopressAjaxRealPreview', $seopress_real_preview );
|
209 |
+
|
210 |
+
wp_enqueue_script( 'seopress-media-uploader-js', plugins_url('assets/js/seopress-media-uploader' . $prefix . '.js', dirname( dirname( __FILE__ ) ) ), [ 'jquery' ], SEOPRESS_VERSION, false );
|
211 |
+
wp_enqueue_media();
|
212 |
+
}
|
213 |
+
|
214 |
+
$seopress_titles_title = get_post_meta($post->ID,'_seopress_titles_title',true);
|
215 |
+
$seopress_titles_desc = get_post_meta($post->ID,'_seopress_titles_desc',true);
|
216 |
+
|
217 |
+
$disabled['robots_index'] ='';
|
218 |
+
if (seopress_titles_single_cpt_noindex_option() || seopress_titles_noindex_option() || post_password_required($post->ID) ===true) {
|
219 |
+
$seopress_robots_index = 'yes';
|
220 |
+
$disabled['robots_index'] = 'disabled';
|
221 |
+
} else {
|
222 |
+
$seopress_robots_index = get_post_meta($post->ID,'_seopress_robots_index',true);
|
223 |
+
|
224 |
+
}
|
225 |
+
|
226 |
+
$disabled['robots_follow'] ='';
|
227 |
+
if (seopress_titles_single_cpt_nofollow_option() || seopress_titles_nofollow_option()) {
|
228 |
+
$seopress_robots_follow = 'yes';
|
229 |
+
$disabled['robots_follow'] = 'disabled';
|
230 |
+
} else {
|
231 |
+
$seopress_robots_follow = get_post_meta($post->ID,'_seopress_robots_follow',true);
|
232 |
+
}
|
233 |
+
|
234 |
+
$disabled['robots_odp'] ='';
|
235 |
+
if (seopress_titles_noodp_option()) {
|
236 |
+
$seopress_robots_odp = 'yes';
|
237 |
+
$disabled['robots_odp'] = 'disabled';
|
238 |
+
} else {
|
239 |
+
$seopress_robots_odp = get_post_meta($post->ID,'_seopress_robots_odp',true);
|
240 |
+
}
|
241 |
+
|
242 |
+
$disabled['archive'] ='';
|
243 |
+
if (seopress_titles_noarchive_option()) {
|
244 |
+
$seopress_robots_archive = 'yes';
|
245 |
+
$disabled['archive'] = 'disabled';
|
246 |
+
} else {
|
247 |
+
$seopress_robots_archive = get_post_meta($post->ID,'_seopress_robots_archive',true);
|
248 |
+
}
|
249 |
+
|
250 |
+
$disabled['snippet'] ='';
|
251 |
+
if (seopress_titles_nosnippet_option()) {
|
252 |
+
$seopress_robots_snippet = 'yes';
|
253 |
+
$disabled['snippet'] = 'disabled';
|
254 |
+
} else {
|
255 |
+
$seopress_robots_snippet = get_post_meta($post->ID,'_seopress_robots_snippet',true);
|
256 |
+
}
|
257 |
+
|
258 |
+
$disabled['imageindex'] ='';
|
259 |
+
if (seopress_titles_noimageindex_option()) {
|
260 |
+
$seopress_robots_imageindex = 'yes';
|
261 |
+
$disabled['imageindex'] = 'disabled';
|
262 |
+
} else {
|
263 |
+
$seopress_robots_imageindex = get_post_meta($post->ID,'_seopress_robots_imageindex',true);
|
264 |
+
}
|
265 |
+
|
266 |
+
$seopress_robots_canonical = get_post_meta($post->ID,'_seopress_robots_canonical',true);
|
267 |
+
$seopress_robots_primary_cat = get_post_meta($post->ID,'_seopress_robots_primary_cat',true);
|
268 |
+
if (is_plugin_active('wp-seopress-pro/seopress-pro.php')) {
|
269 |
+
$seopress_robots_breadcrumbs = get_post_meta($post->ID,'_seopress_robots_breadcrumbs',true);
|
270 |
+
}
|
271 |
+
$seopress_social_fb_title = get_post_meta($post->ID,'_seopress_social_fb_title',true);
|
272 |
+
$seopress_social_fb_desc = get_post_meta($post->ID,'_seopress_social_fb_desc',true);
|
273 |
+
$seopress_social_fb_img = get_post_meta($post->ID,'_seopress_social_fb_img',true);
|
274 |
+
$seopress_social_twitter_title = get_post_meta($post->ID,'_seopress_social_twitter_title',true);
|
275 |
+
$seopress_social_twitter_desc = get_post_meta($post->ID,'_seopress_social_twitter_desc',true);
|
276 |
+
$seopress_social_twitter_img = get_post_meta($post->ID,'_seopress_social_twitter_img',true);
|
277 |
+
$seopress_redirections_enabled = get_post_meta($post->ID,'_seopress_redirections_enabled',true);
|
278 |
+
$seopress_redirections_type = get_post_meta($post->ID,'_seopress_redirections_type',true);
|
279 |
+
$seopress_redirections_value = get_post_meta($post->ID,'_seopress_redirections_value',true);
|
280 |
+
$seopress_redirections_param = get_post_meta($post->ID,'_seopress_redirections_param',true);
|
281 |
+
if (is_plugin_active('wp-seopress-pro/seopress-pro.php')) {
|
282 |
+
$seopress_news_disabled = get_post_meta($post->ID,'_seopress_news_disabled',true);
|
283 |
+
$seopress_video_disabled = get_post_meta($post->ID,'_seopress_video_disabled',true);
|
284 |
+
$seopress_video = get_post_meta($post->ID,'_seopress_video');
|
285 |
+
}
|
286 |
+
|
287 |
+
require_once ( dirname( __FILE__ ) . '/admin-dyn-variables-helper.php'); //Dynamic variables
|
288 |
+
require_once ( dirname( __FILE__ ) . '/admin-metaboxes-form.php'); //Metaboxe HTML
|
289 |
+
}
|
290 |
+
|
291 |
+
add_action('save_post','seopress_save_metabox', 10, 2);
|
292 |
+
function seopress_save_metabox($post_id, $post){
|
293 |
+
//Nonce
|
294 |
+
if ( !isset( $_POST['seopress_cpt_nonce'] ) || !wp_verify_nonce( $_POST['seopress_cpt_nonce'], plugin_basename( __FILE__ ) ) )
|
295 |
+
return $post_id;
|
296 |
+
|
297 |
+
//Post type object
|
298 |
+
$post_type = get_post_type_object( $post->post_type );
|
299 |
+
|
300 |
+
//Check permission
|
301 |
+
if ( !current_user_can( $post_type->cap->edit_post, $post_id ) )
|
302 |
+
return $post_id;
|
303 |
+
|
304 |
+
if ( 'attachment' !== get_post_type($post_id)) {
|
305 |
+
$seo_tabs = array();
|
306 |
+
$seo_tabs = json_decode(stripslashes(htmlspecialchars_decode($_POST['seo_tabs'])));
|
307 |
+
|
308 |
+
if (in_array('title-tab', $seo_tabs)) {
|
309 |
+
if(isset($_POST['seopress_titles_title'])){
|
310 |
+
update_post_meta($post_id, '_seopress_titles_title', esc_html($_POST['seopress_titles_title']));
|
311 |
+
}
|
312 |
+
if(isset($_POST['seopress_titles_desc'])){
|
313 |
+
update_post_meta($post_id, '_seopress_titles_desc', esc_html($_POST['seopress_titles_desc']));
|
314 |
+
}
|
315 |
+
}
|
316 |
+
if (in_array('advanced-tab', $seo_tabs)) {
|
317 |
+
if( isset( $_POST[ 'seopress_robots_index' ] ) ) {
|
318 |
+
update_post_meta( $post_id, '_seopress_robots_index', 'yes' );
|
319 |
+
} else {
|
320 |
+
delete_post_meta( $post_id, '_seopress_robots_index', '' );
|
321 |
+
}
|
322 |
+
if( isset( $_POST[ 'seopress_robots_follow' ] ) ) {
|
323 |
+
update_post_meta( $post_id, '_seopress_robots_follow', 'yes' );
|
324 |
+
} else {
|
325 |
+
delete_post_meta( $post_id, '_seopress_robots_follow', '' );
|
326 |
+
}
|
327 |
+
if( isset( $_POST[ 'seopress_robots_odp' ] ) ) {
|
328 |
+
update_post_meta( $post_id, '_seopress_robots_odp', 'yes' );
|
329 |
+
} else {
|
330 |
+
delete_post_meta( $post_id, '_seopress_robots_odp', '' );
|
331 |
+
}
|
332 |
+
if( isset( $_POST[ 'seopress_robots_imageindex' ] ) ) {
|
333 |
+
update_post_meta( $post_id, '_seopress_robots_imageindex', 'yes' );
|
334 |
+
} else {
|
335 |
+
delete_post_meta( $post_id, '_seopress_robots_imageindex', '' );
|
336 |
+
}
|
337 |
+
if( isset( $_POST[ 'seopress_robots_archive' ] ) ) {
|
338 |
+
update_post_meta( $post_id, '_seopress_robots_archive', 'yes' );
|
339 |
+
} else {
|
340 |
+
delete_post_meta( $post_id, '_seopress_robots_archive', '' );
|
341 |
+
}
|
342 |
+
if( isset( $_POST[ 'seopress_robots_snippet' ] ) ) {
|
343 |
+
update_post_meta( $post_id, '_seopress_robots_snippet', 'yes' );
|
344 |
+
} else {
|
345 |
+
delete_post_meta( $post_id, '_seopress_robots_snippet', '' );
|
346 |
+
}
|
347 |
+
if(isset($_POST['seopress_robots_canonical'])){
|
348 |
+
update_post_meta($post_id, '_seopress_robots_canonical', esc_html($_POST['seopress_robots_canonical']));
|
349 |
+
}
|
350 |
+
if(isset($_POST['seopress_robots_primary_cat'])){
|
351 |
+
update_post_meta($post_id, '_seopress_robots_primary_cat', esc_html($_POST['seopress_robots_primary_cat']));
|
352 |
+
}
|
353 |
+
if (is_plugin_active('wp-seopress-pro/seopress-pro.php')) {
|
354 |
+
if(isset($_POST['seopress_robots_breadcrumbs'])){
|
355 |
+
update_post_meta($post_id, '_seopress_robots_breadcrumbs', esc_html($_POST['seopress_robots_breadcrumbs']));
|
356 |
+
}
|
357 |
+
}
|
358 |
+
}
|
359 |
+
if (in_array('social-tab', $seo_tabs)) {
|
360 |
+
if(isset($_POST['seopress_social_fb_title'])){
|
361 |
+
update_post_meta($post_id, '_seopress_social_fb_title', esc_html($_POST['seopress_social_fb_title']));
|
362 |
+
}
|
363 |
+
if(isset($_POST['seopress_social_fb_desc'])){
|
364 |
+
update_post_meta($post_id, '_seopress_social_fb_desc', esc_html($_POST['seopress_social_fb_desc']));
|
365 |
+
}
|
366 |
+
if(isset($_POST['seopress_social_fb_img'])){
|
367 |
+
update_post_meta($post_id, '_seopress_social_fb_img', esc_html($_POST['seopress_social_fb_img']));
|
368 |
+
}
|
369 |
+
if(isset($_POST['seopress_social_twitter_title'])){
|
370 |
+
update_post_meta($post_id, '_seopress_social_twitter_title', esc_html($_POST['seopress_social_twitter_title']));
|
371 |
+
}
|
372 |
+
if(isset($_POST['seopress_social_twitter_desc'])){
|
373 |
+
update_post_meta($post_id, '_seopress_social_twitter_desc', esc_html($_POST['seopress_social_twitter_desc']));
|
374 |
+
}
|
375 |
+
if(isset($_POST['seopress_social_twitter_img'])){
|
376 |
+
update_post_meta($post_id, '_seopress_social_twitter_img', esc_html($_POST['seopress_social_twitter_img']));
|
377 |
+
}
|
378 |
+
}
|
379 |
+
if (in_array('redirect-tab', $seo_tabs)) {
|
380 |
+
if(isset($_POST['seopress_redirections_type'])){
|
381 |
+
update_post_meta($post_id, '_seopress_redirections_type', $_POST['seopress_redirections_type']);
|
382 |
+
}
|
383 |
+
if(isset($_POST['seopress_redirections_value'])){
|
384 |
+
update_post_meta($post_id, '_seopress_redirections_value', esc_html($_POST['seopress_redirections_value']));
|
385 |
+
}
|
386 |
+
if(isset($_POST['seopress_redirections_param'])){
|
387 |
+
update_post_meta($post_id, '_seopress_redirections_param', esc_html($_POST['seopress_redirections_param']));
|
388 |
+
}
|
389 |
+
if( isset( $_POST[ 'seopress_redirections_enabled' ] ) ) {
|
390 |
+
update_post_meta( $post_id, '_seopress_redirections_enabled', 'yes' );
|
391 |
+
} else {
|
392 |
+
delete_post_meta( $post_id, '_seopress_redirections_enabled', '' );
|
393 |
+
}
|
394 |
+
}
|
395 |
+
if (is_plugin_active('wp-seopress-pro/seopress-pro.php')) {
|
396 |
+
if (in_array('news-tab', $seo_tabs)) {
|
397 |
+
if( isset( $_POST[ 'seopress_news_disabled' ] ) ) {
|
398 |
+
update_post_meta( $post_id, '_seopress_news_disabled', 'yes' );
|
399 |
+
} else {
|
400 |
+
delete_post_meta( $post_id, '_seopress_news_disabled', '' );
|
401 |
+
}
|
402 |
+
}
|
403 |
+
if (in_array('video-tab', $seo_tabs)) {
|
404 |
+
if( isset( $_POST[ 'seopress_video_disabled' ] ) ) {
|
405 |
+
update_post_meta( $post_id, '_seopress_video_disabled', 'yes' );
|
406 |
+
} else {
|
407 |
+
delete_post_meta( $post_id, '_seopress_video_disabled', '' );
|
408 |
+
}
|
409 |
+
if(isset($_POST['seopress_video'])){
|
410 |
+
update_post_meta($post_id, '_seopress_video', $_POST['seopress_video']);
|
411 |
+
}
|
412 |
+
}
|
413 |
+
}
|
414 |
+
}
|
415 |
+
}
|
416 |
}
|
417 |
|
418 |
function seopress_display_ca_metaboxe() {
|
419 |
+
add_action('add_meta_boxes','seopress_init_ca_metabox');
|
420 |
+
function seopress_init_ca_metabox(){
|
421 |
+
if (function_exists('seopress_advanced_appearance_metaboxe_position_option')) {
|
422 |
+
$seopress_advanced_appearance_metaboxe_position_option = seopress_advanced_appearance_metaboxe_position_option();
|
423 |
+
} else {
|
424 |
+
$seopress_advanced_appearance_metaboxe_position_option = 'default';
|
425 |
+
}
|
426 |
+
if (function_exists('seopress_get_post_types')) {
|
427 |
+
|
428 |
+
$seopress_get_post_types = seopress_get_post_types();
|
429 |
+
|
430 |
+
$seopress_get_post_types = apply_filters('seopress_metaboxe_content_analysis', $seopress_get_post_types);
|
431 |
+
|
432 |
+
if (!empty($seopress_get_post_types)) {
|
433 |
+
foreach ($seopress_get_post_types as $key => $value) {
|
434 |
+
add_meta_box('seopress_content_analysis', __('Content analysis','wp-seopress'), 'seopress_content_analysis', $key, 'normal', $seopress_advanced_appearance_metaboxe_position_option);
|
435 |
+
}
|
436 |
+
}
|
437 |
+
}
|
438 |
+
}
|
439 |
+
|
440 |
+
function seopress_content_analysis($post) {
|
441 |
+
$prefix = defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG ? '' : '.min';
|
442 |
+
wp_nonce_field( plugin_basename( __FILE__ ), 'seopress_content_analysis_nonce' );
|
443 |
+
|
444 |
+
wp_enqueue_script( 'seopress-cpt-counters-js', plugins_url( 'assets/js/seopress-counters' . $prefix . '.js', dirname(dirname( __FILE__ ))), array( 'jquery', 'jquery-ui-tabs', 'jquery-ui-accordion' ), SEOPRESS_VERSION );
|
445 |
+
$seopress_real_preview = array(
|
446 |
+
'seopress_nonce' => wp_create_nonce('seopress_real_preview_nonce'),
|
447 |
+
'seopress_real_preview' => admin_url('admin-ajax.php'),
|
448 |
+
'i18n' => array('progress' => __('Analysis in progress...','wp-seopress'))
|
449 |
+
);
|
450 |
+
wp_localize_script( 'seopress-cpt-counters-js', 'seopressAjaxRealPreview', $seopress_real_preview );
|
451 |
+
|
452 |
+
$seopress_analysis_target_kw = get_post_meta($post->ID,'_seopress_analysis_target_kw',true);
|
453 |
+
$seopress_analysis_data = get_post_meta($post->ID,'_seopress_analysis_data', true);
|
454 |
+
$seopress_titles_title = get_post_meta($post->ID,'_seopress_titles_title',true);
|
455 |
+
$seopress_titles_desc = get_post_meta($post->ID,'_seopress_titles_desc',true);
|
456 |
+
|
457 |
+
if (seopress_titles_single_cpt_noindex_option() || seopress_titles_noindex_option() || post_password_required($post->ID) ===true) {
|
458 |
+
$seopress_robots_index = 'yes';
|
459 |
+
} else {
|
460 |
+
$seopress_robots_index = get_post_meta($post->ID,'_seopress_robots_index',true);
|
461 |
+
}
|
462 |
+
|
463 |
+
if (seopress_titles_single_cpt_nofollow_option() || seopress_titles_nofollow_option()) {
|
464 |
+
$seopress_robots_follow = 'yes';
|
465 |
+
} else {
|
466 |
+
$seopress_robots_follow = get_post_meta($post->ID,'_seopress_robots_follow',true);
|
467 |
+
}
|
468 |
+
|
469 |
+
if (seopress_titles_noodp_option()) {
|
470 |
+
$seopress_robots_odp = 'yes';
|
471 |
+
} else {
|
472 |
+
$seopress_robots_odp = get_post_meta($post->ID,'_seopress_robots_odp',true);
|
473 |
+
}
|
474 |
+
|
475 |
+
if (seopress_titles_noarchive_option()) {
|
476 |
+
$seopress_robots_archive = 'yes';
|
477 |
+
} else {
|
478 |
+
$seopress_robots_archive = get_post_meta($post->ID,'_seopress_robots_archive',true);
|
479 |
+
}
|
480 |
+
|
481 |
+
if (seopress_titles_nosnippet_option()) {
|
482 |
+
$seopress_robots_snippet = 'yes';
|
483 |
+
} else {
|
484 |
+
$seopress_robots_snippet = get_post_meta($post->ID,'_seopress_robots_snippet',true);
|
485 |
+
}
|
486 |
+
|
487 |
+
if (seopress_titles_noimageindex_option()) {
|
488 |
+
$seopress_robots_imageindex = 'yes';
|
489 |
+
} else {
|
490 |
+
$seopress_robots_imageindex = get_post_meta($post->ID,'_seopress_robots_imageindex',true);
|
491 |
+
}
|
492 |
+
|
493 |
+
require_once ( dirname( __FILE__ ) . '/admin-metaboxes-content-analysis-form.php'); //Metaboxe HTML
|
494 |
+
}
|
495 |
+
|
496 |
+
add_action('save_post','seopress_save_ca_metabox', 10, 2);
|
497 |
+
function seopress_save_ca_metabox($post_id, $post){
|
498 |
+
//Nonce
|
499 |
+
if ( !isset( $_POST['seopress_content_analysis_nonce'] ) || !wp_verify_nonce( $_POST['seopress_content_analysis_nonce'], plugin_basename( __FILE__ ) ) )
|
500 |
+
return $post_id;
|
501 |
+
|
502 |
+
//Post type object
|
503 |
+
$post_type = get_post_type_object( $post->post_type );
|
504 |
+
|
505 |
+
//Check permission
|
506 |
+
if ( !current_user_can( $post_type->cap->edit_post, $post_id ) )
|
507 |
+
return $post_id;
|
508 |
+
|
509 |
+
if ( 'attachment' !== get_post_type($post_id)) {
|
510 |
+
if(isset($_POST['seopress_analysis_target_kw'])){
|
511 |
+
update_post_meta($post_id, '_seopress_analysis_target_kw', esc_html($_POST['seopress_analysis_target_kw']));
|
512 |
+
}
|
513 |
+
}
|
514 |
+
}
|
515 |
+
|
516 |
+
//Save metabox values in elementor
|
517 |
+
add_action('save_post', 'seopress_update_elementor_fields', 999, 2);
|
518 |
+
function seopress_update_elementor_fields( $post_id, $post ) {
|
519 |
+
do_action( 'seopress/page-builders/elementor/save_meta', $post_id );
|
520 |
+
}
|
521 |
}
|
522 |
|
523 |
if (is_user_logged_in()) {
|
524 |
+
if(is_super_admin()) {
|
525 |
+
echo seopress_display_seo_metaboxe();
|
526 |
+
echo seopress_display_ca_metaboxe();
|
527 |
+
} else {
|
528 |
+
global $wp_roles;
|
529 |
+
|
530 |
+
//Get current user role
|
531 |
+
if(isset(wp_get_current_user()->roles[0])) {
|
532 |
+
$seopress_user_role = wp_get_current_user()->roles[0];
|
533 |
+
|
534 |
+
//If current user role matchs values from Security settings then apply -- SEO Metaboxe
|
535 |
+
if (function_exists('seopress_advanced_security_metaboxe_role_hook_option') && seopress_advanced_security_metaboxe_role_hook_option() !='') {
|
536 |
+
if( array_key_exists( $seopress_user_role, seopress_advanced_security_metaboxe_role_hook_option())) {
|
537 |
+
//do nothing
|
538 |
+
} else {
|
539 |
+
echo seopress_display_seo_metaboxe();
|
540 |
+
}
|
541 |
+
} else {
|
542 |
+
echo seopress_display_seo_metaboxe();
|
543 |
+
}
|
544 |
+
|
545 |
+
//If current user role matchs values from Security settings then apply -- SEO Content Analysis
|
546 |
+
if (function_exists('seopress_advanced_security_metaboxe_ca_role_hook_option') && seopress_advanced_security_metaboxe_ca_role_hook_option() !='') {
|
547 |
+
if( array_key_exists( $seopress_user_role, seopress_advanced_security_metaboxe_ca_role_hook_option())) {
|
548 |
+
//do nothing
|
549 |
+
} else {
|
550 |
+
echo seopress_display_ca_metaboxe();
|
551 |
+
}
|
552 |
+
} else {
|
553 |
+
echo seopress_display_ca_metaboxe();
|
554 |
+
}
|
555 |
+
}
|
556 |
+
}
|
557 |
}
|
inc/admin/admin-notifications-center.php
CHANGED
@@ -490,23 +490,35 @@
|
|
490 |
}
|
491 |
}
|
492 |
}
|
493 |
-
|
494 |
-
$
|
495 |
-
|
496 |
-
|
497 |
-
|
498 |
-
|
499 |
-
|
500 |
-
|
501 |
-
|
502 |
-
|
503 |
-
|
504 |
-
|
505 |
-
|
506 |
-
|
507 |
-
|
508 |
-
|
509 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
510 |
}
|
511 |
if (get_option('blogname') =='') {
|
512 |
$args = [
|
@@ -878,7 +890,7 @@
|
|
878 |
<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://www.seopress.org/blog/" target="_blank"><?php _e('Our blog: SEO news, how-to, tips and tricks...','wp-seopress'); ?></a><span class="dashicons dashicons-external"></span></li>
|
879 |
<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://www.google.com/webmasters/tools/disavow-links-main" target="_blank"><?php _e('Upload a list of links to disavow to Google','wp-seopress'); ?></a><span class="dashicons dashicons-external"></span></li>
|
880 |
<?php if ( !is_plugin_active( 'imageseo/imageseo.php' )) {
|
881 |
-
echo '<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://
|
882 |
} ?>
|
883 |
<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://www.dareboost.com/en/home" target="_blank"><?php _e('Dareboost: Test, analyze and optimize your website','wp-seopress'); ?></a><span class="dashicons dashicons-external"></span></li>
|
884 |
<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://ga-dev-tools.appspot.com/campaign-url-builder/" target="_blank"><?php _e('Google Campaign URL Builder tool','wp-seopress'); ?></a><span class="dashicons dashicons-external"></span></li>
|
490 |
}
|
491 |
}
|
492 |
}
|
493 |
+
function seopress_get_hidden_notices_noindex_option() {
|
494 |
+
$seopress_get_hidden_notices_noindex_option = get_option("seopress_notices");
|
495 |
+
if ( ! empty ( $seopress_get_hidden_notices_noindex_option ) ) {
|
496 |
+
foreach ($seopress_get_hidden_notices_noindex_option as $key => $seopress_get_hidden_notices_noindex_value)
|
497 |
+
$options[$key] = $seopress_get_hidden_notices_noindex_value;
|
498 |
+
if (isset($seopress_get_hidden_notices_noindex_option['notice-noindex'])) {
|
499 |
+
return $seopress_get_hidden_notices_noindex_option['notice-noindex'];
|
500 |
+
}
|
501 |
+
}
|
502 |
+
}
|
503 |
+
if(seopress_get_hidden_notices_noindex_option() !='1') {
|
504 |
+
if (seopress_titles_noindex_option()=='1' || get_option('blog_public') !='1') {
|
505 |
+
$args = [
|
506 |
+
'id' => 'notice-noindex',
|
507 |
+
'title' => __('Your site is not visible to Search Engines!','wp-seopress'),
|
508 |
+
'desc' => __('You have activated the blocking of the indexing of your site. If your site is under development, this is probably normal. Otherwise, check your settings. Delete this notification using the cross on the right if you are not concerned.','wp-seopress'),
|
509 |
+
'impact' => [
|
510 |
+
'high' => __('High impact','wp-seopress')
|
511 |
+
],
|
512 |
+
'link' => [
|
513 |
+
'en' => admin_url( 'options-reading.php' ),
|
514 |
+
'title' => __('Fix this!','wp-seopress'),
|
515 |
+
'external' => false
|
516 |
+
],
|
517 |
+
'icon' => 'dashicons-warning',
|
518 |
+
'deleteable' => true
|
519 |
+
];
|
520 |
+
seopress_notification($args);
|
521 |
+
}
|
522 |
}
|
523 |
if (get_option('blogname') =='') {
|
524 |
$args = [
|
890 |
<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://www.seopress.org/blog/" target="_blank"><?php _e('Our blog: SEO news, how-to, tips and tricks...','wp-seopress'); ?></a><span class="dashicons dashicons-external"></span></li>
|
891 |
<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://www.google.com/webmasters/tools/disavow-links-main" target="_blank"><?php _e('Upload a list of links to disavow to Google','wp-seopress'); ?></a><span class="dashicons dashicons-external"></span></li>
|
892 |
<?php if ( !is_plugin_active( 'imageseo/imageseo.php' )) {
|
893 |
+
echo '<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://www.seopress.org/go/image-seo" target="_blank">'.__('Image SEO plugin to optimize your image ALT texts and names for Search Engines.','wp-seopress').'</a><span class="dashicons dashicons-external"></span></li>';
|
894 |
} ?>
|
895 |
<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://www.dareboost.com/en/home" target="_blank"><?php _e('Dareboost: Test, analyze and optimize your website','wp-seopress'); ?></a><span class="dashicons dashicons-external"></span></li>
|
896 |
<li><span class="dashicons dashicons-arrow-right-alt2"></span><a href="https://ga-dev-tools.appspot.com/campaign-url-builder/" target="_blank"><?php _e('Google Campaign URL Builder tool','wp-seopress'); ?></a><span class="dashicons dashicons-external"></span></li>
|
inc/admin/admin-term-metaboxes.php
CHANGED
@@ -275,6 +275,7 @@ function seopress_display_seo_term_metaboxe() {
|
|
275 |
$seopress_redirections_type = get_term_meta($term->term_id,'_seopress_redirections_type',true);
|
276 |
$seopress_redirections_value = get_term_meta($term->term_id,'_seopress_redirections_value',true);
|
277 |
|
|
|
278 |
require_once ( dirname( __FILE__ ) . '/admin-metaboxes-form.php'); //Metaboxe HTML
|
279 |
}
|
280 |
|
275 |
$seopress_redirections_type = get_term_meta($term->term_id,'_seopress_redirections_type',true);
|
276 |
$seopress_redirections_value = get_term_meta($term->term_id,'_seopress_redirections_value',true);
|
277 |
|
278 |
+
require_once ( dirname( __FILE__ ) . '/admin-dyn-variables-helper.php'); //Dynamic variables
|
279 |
require_once ( dirname( __FILE__ ) . '/admin-metaboxes-form.php'); //Metaboxe HTML
|
280 |
}
|
281 |
|
inc/admin/admin.php
CHANGED
@@ -118,7 +118,9 @@ class seopress_options
|
|
118 |
$seopress_titles_options['seopress_titles_archives_date_noindex'] = '1';
|
119 |
|
120 |
//BuddyPress Groups
|
121 |
-
|
|
|
|
|
122 |
|
123 |
//Search
|
124 |
$seopress_titles_options['seopress_titles_archives_search_title'] = '%%search_keywords%% %%sep%% %%sitetitle%%';
|
@@ -736,14 +738,66 @@ class seopress_options
|
|
736 |
<div class="postbox section-tool">
|
737 |
<div class="inside">
|
738 |
<h3><span><?php _e( 'Import data from a CSV', 'wp-seopress' ); ?></span></h3>
|
739 |
-
<p><?php _e( '
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
740 |
<a class="button" href="<?php echo admin_url( 'admin.php?page=seopress_csv_importer' ); ?>"><?php _e('Run the importer','wp-seopress'); ?></a>
|
741 |
</div><!-- .inside -->
|
742 |
</div><!-- .postbox -->
|
743 |
<div id="metadata-migration-tool" class="postbox section-tool">
|
744 |
<div class="inside">
|
745 |
<h3><span><?php _e( 'Export metadata to a CSV', 'wp-seopress' ); ?></span></h3>
|
746 |
-
<p><?php _e( 'Export your
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
747 |
<form method="post">
|
748 |
<p><input type="hidden" name="seopress_action" value="export_csv_metadata" /></p>
|
749 |
<p>
|
@@ -1143,6 +1197,20 @@ class seopress_options
|
|
1143 |
</form>
|
1144 |
</div><!-- .inside -->
|
1145 |
</div><!-- .postbox -->
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1146 |
<?php } else { ?>
|
1147 |
<p><?php _e('Redirections feature is disabled. Please activate it from the PRO page.','wp-seopress'); ?></p>
|
1148 |
<a href="<?php echo admin_url( 'admin.php?page=seopress-pro-page' ); ?>"><?php _e('Activate Redirections','wp-seopress'); ?></a>
|
@@ -1167,7 +1235,7 @@ class seopress_options
|
|
1167 |
<div class="postbox section-tool">
|
1168 |
<div class="inside">
|
1169 |
<h3><span><?php _e( 'Reset All Settings', 'wp-seopress' ); ?></span></h3>
|
1170 |
-
<p style="color:red"><span class="dashicons dashicons-info"></span> <?php _e( '<strong>WARNING:</strong> Delete all options related to
|
1171 |
<form method="post" enctype="multipart/form-data">
|
1172 |
<p>
|
1173 |
<input type="hidden" name="seopress_action" value="reset_settings" />
|
@@ -1323,29 +1391,31 @@ class seopress_options
|
|
1323 |
'seopress_setting_section_titles_single' // Section
|
1324 |
);
|
1325 |
|
1326 |
-
|
1327 |
-
|
1328 |
-
|
1329 |
-
|
1330 |
-
|
1331 |
-
|
1332 |
-
|
|
|
1333 |
|
1334 |
-
|
1335 |
-
|
1336 |
-
|
1337 |
-
|
1338 |
-
|
1339 |
-
|
1340 |
-
|
1341 |
|
1342 |
-
|
1343 |
-
|
1344 |
-
|
1345 |
-
|
1346 |
-
|
1347 |
-
|
1348 |
-
|
|
|
1349 |
|
1350 |
//Archives SECTION=========================================================================
|
1351 |
add_settings_section(
|
@@ -2036,6 +2106,14 @@ class seopress_options
|
|
2036 |
'seopress_setting_section_google_analytics_gdpr' // Section
|
2037 |
);
|
2038 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2039 |
add_settings_field(
|
2040 |
'seopress_google_analytics_cb_pos', // ID
|
2041 |
__("Cookie bar position","wp-seopress"), // Title
|
@@ -2043,6 +2121,30 @@ class seopress_options
|
|
2043 |
'seopress-settings-admin-google-analytics-gdpr', // Page
|
2044 |
'seopress_setting_section_google_analytics_gdpr' // Section
|
2045 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2046 |
|
2047 |
add_settings_field(
|
2048 |
'seopress_google_analytics_cb_bg', // ID
|
@@ -2614,15 +2716,23 @@ class seopress_options
|
|
2614 |
|
2615 |
add_settings_field(
|
2616 |
'seopress_advanced_appearance_adminbar', // ID
|
2617 |
-
__("
|
2618 |
array( $this, 'seopress_advanced_appearance_adminbar_callback' ), // Callback
|
2619 |
'seopress-settings-admin-advanced-appearance', // Page
|
2620 |
'seopress_setting_section_advanced_appearance' // Section
|
2621 |
);
|
2622 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2623 |
add_settings_field(
|
2624 |
'seopress_advanced_appearance_metabox_position', // ID
|
2625 |
-
__("Move
|
2626 |
array( $this, 'seopress_advanced_appearance_metaboxe_position_callback' ), // Callback
|
2627 |
'seopress-settings-admin-advanced-appearance', // Page
|
2628 |
'seopress_setting_section_advanced_appearance' // Section
|
@@ -2863,7 +2973,21 @@ class seopress_options
|
|
2863 |
'seopress_google_analytics_cross_domain',
|
2864 |
'seopress_google_analytics_matomo_id',
|
2865 |
'seopress_google_analytics_matomo_site_id',
|
2866 |
-
'seopress_google_analytics_matomo_cross_domain_sites'
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2867 |
];
|
2868 |
|
2869 |
$seopress_sanitize_site_verification = [
|
@@ -3066,7 +3190,7 @@ class seopress_options
|
|
3066 |
}
|
3067 |
|
3068 |
public function print_section_info_google_analytics_custom_dimensions() {
|
3069 |
-
print __('<p>Configure your Google Analytics custom dimensions. <br>Custom dimensions and custom metrics
|
3070 |
|
3071 |
echo '<p>'.__('Custom dimensions also work with <strong>Matomo</strong> tracking code.','wp-seopress').'</p>';
|
3072 |
|
@@ -3090,7 +3214,7 @@ class seopress_options
|
|
3090 |
}
|
3091 |
|
3092 |
public function print_section_info_advanced_appearance() {
|
3093 |
-
print __('<p>Customize
|
3094 |
}
|
3095 |
|
3096 |
public function print_section_info_advanced_security() {
|
@@ -3328,55 +3452,58 @@ class seopress_options
|
|
3328 |
//BuddyPress Groups
|
3329 |
public function seopress_titles_bp_groups_title_callback()
|
3330 |
{
|
3331 |
-
|
3332 |
-
|
3333 |
-
|
3334 |
-
|
|
|
3335 |
|
3336 |
-
|
3337 |
|
3338 |
-
|
3339 |
-
|
3340 |
-
|
3341 |
-
|
3342 |
|
3343 |
-
|
3344 |
-
|
3345 |
-
|
3346 |
-
|
3347 |
-
|
3348 |
}
|
3349 |
|
3350 |
public function seopress_titles_bp_groups_desc_callback()
|
3351 |
{
|
3352 |
-
|
3353 |
-
|
3354 |
-
|
3355 |
-
|
|
|
3356 |
|
3357 |
-
|
3358 |
-
|
3359 |
-
|
3360 |
-
|
3361 |
-
|
3362 |
-
|
3363 |
}
|
3364 |
|
3365 |
public function seopress_titles_bp_groups_noindex_callback()
|
3366 |
{
|
3367 |
-
|
3368 |
-
|
3369 |
-
|
3370 |
-
|
3371 |
-
|
3372 |
-
|
3373 |
-
|
3374 |
-
|
3375 |
-
|
3376 |
-
|
3377 |
-
|
3378 |
-
|
3379 |
-
|
|
|
3380 |
}
|
3381 |
}
|
3382 |
|
@@ -3897,6 +4024,8 @@ class seopress_options
|
|
3897 |
echo '<label for="seopress_titles_noindex">'. __( 'noindex', 'wp-seopress' ) .'</label>';
|
3898 |
|
3899 |
echo '<p class="description">'.__('Do not display all pages of the site in Google search results and do not display "Cached" links in search results.','wp-seopress').'</p>';
|
|
|
|
|
3900 |
|
3901 |
if (isset($this->options['seopress_titles_noindex'])) {
|
3902 |
esc_attr( $this->options['seopress_titles_noindex']);
|
@@ -4383,7 +4512,7 @@ class seopress_options
|
|
4383 |
$check = isset($this->options['seopress_social_knowledge_name']) ? $this->options['seopress_social_knowledge_name'] : NULL;
|
4384 |
|
4385 |
printf(
|
4386 |
-
'<input type="text" name="seopress_social_option_name[seopress_social_knowledge_name]" placeholder="'.esc_html__('eg:
|
4387 |
esc_html( $check )
|
4388 |
);
|
4389 |
}
|
@@ -4927,6 +5056,23 @@ class seopress_options
|
|
4927 |
);
|
4928 |
}
|
4929 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4930 |
public function seopress_google_analytics_cb_pos_callback()
|
4931 |
{
|
4932 |
$options = get_option( 'seopress_google_analytics_option_name' );
|
@@ -4937,6 +5083,9 @@ class seopress_options
|
|
4937 |
echo ' <option ';
|
4938 |
if ('bottom' == $selected) echo 'selected="selected"';
|
4939 |
echo ' value="bottom">'. __("Bottom (default)","wp-seopress") .'</option>';
|
|
|
|
|
|
|
4940 |
echo ' <option ';
|
4941 |
if ('top' == $selected) echo 'selected="selected"';
|
4942 |
echo ' value="top">'. __("Top","wp-seopress") .'</option>';
|
@@ -4947,12 +5096,51 @@ class seopress_options
|
|
4947 |
}
|
4948 |
}
|
4949 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4950 |
public function seopress_google_analytics_cb_bg_callback()
|
4951 |
{
|
4952 |
$check = isset($this->options['seopress_google_analytics_cb_bg']) ? $this->options['seopress_google_analytics_cb_bg'] : NULL;
|
4953 |
|
4954 |
printf(
|
4955 |
-
'<input type="text" data-default-color="#F1F1F1" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_bg]" aria-label="'.__('Change the color of the cookie bar background','wp-seopress').'" value="%s" class="seopress_admin_color_picker"/>',
|
4956 |
esc_html( $check )
|
4957 |
);
|
4958 |
}
|
@@ -4982,7 +5170,7 @@ class seopress_options
|
|
4982 |
$check = isset($this->options['seopress_google_analytics_cb_btn_bg']) ? $this->options['seopress_google_analytics_cb_btn_bg'] : NULL;
|
4983 |
|
4984 |
printf(
|
4985 |
-
'<input type="text" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_btn_bg]" aria-label="'.__('Change the color of the cookie bar button background','wp-seopress').'" value="%s" class="seopress_admin_color_picker"/>',
|
4986 |
esc_html( $check )
|
4987 |
);
|
4988 |
}
|
@@ -4992,7 +5180,7 @@ class seopress_options
|
|
4992 |
$check = isset($this->options['seopress_google_analytics_cb_btn_bg_hov']) ? $this->options['seopress_google_analytics_cb_btn_bg_hov'] : NULL;
|
4993 |
|
4994 |
printf(
|
4995 |
-
'<input type="text" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_btn_bg_hov]" aria-label="'.__('Change the color of the cookie bar button hover background','wp-seopress').'" value="%s" class="seopress_admin_color_picker"/>',
|
4996 |
esc_html( $check )
|
4997 |
);
|
4998 |
}
|
@@ -5022,7 +5210,7 @@ class seopress_options
|
|
5022 |
$check = isset($this->options['seopress_google_analytics_cb_btn_sec_bg']) ? $this->options['seopress_google_analytics_cb_btn_sec_bg'] : NULL;
|
5023 |
|
5024 |
printf(
|
5025 |
-
'<input type="text" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_btn_sec_bg]" aria-label="'.__('Change the color of the cookie bar secondary button background','wp-seopress').'" value="%s" class="seopress_admin_color_picker"/>',
|
5026 |
esc_html( $check )
|
5027 |
);
|
5028 |
}
|
@@ -5042,7 +5230,7 @@ class seopress_options
|
|
5042 |
$check = isset($this->options['seopress_google_analytics_cb_btn_sec_bg_hov']) ? $this->options['seopress_google_analytics_cb_btn_sec_bg_hov'] : NULL;
|
5043 |
|
5044 |
printf(
|
5045 |
-
'<input type="text" data-default-color="#222222" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_btn_sec_bg_hov]" aria-label="'.__('Change the color of the cookie bar secondary button','wp-seopress').'" value="%s" class="seopress_admin_color_picker"/>',
|
5046 |
esc_html( $check )
|
5047 |
);
|
5048 |
}
|
@@ -6003,13 +6191,30 @@ class seopress_options
|
|
6003 |
if ('1' == $check) echo 'checked="yes"';
|
6004 |
echo ' value="1"/>';
|
6005 |
|
6006 |
-
echo '<label for="seopress_advanced_appearance_adminbar">'. __( 'Remove
|
6007 |
|
6008 |
if (isset($this->options['seopress_advanced_appearance_adminbar'])) {
|
6009 |
esc_attr( $this->options['seopress_advanced_appearance_adminbar']);
|
6010 |
}
|
6011 |
}
|
6012 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6013 |
public function seopress_advanced_appearance_metaboxe_position_callback()
|
6014 |
{
|
6015 |
$options = get_option( 'seopress_advanced_option_name' );
|
@@ -6065,7 +6270,7 @@ class seopress_options
|
|
6065 |
if ('1' == $check) echo 'checked="yes"';
|
6066 |
echo ' value="1"/>';
|
6067 |
|
6068 |
-
echo '<label for="seopress_advanced_appearance_notifications">'. __( 'Hide Notifications Center in
|
6069 |
|
6070 |
if (isset($this->options['seopress_advanced_appearance_notifications'])) {
|
6071 |
esc_attr( $this->options['seopress_advanced_appearance_notifications']);
|
@@ -6082,7 +6287,7 @@ class seopress_options
|
|
6082 |
if ('1' == $check) echo 'checked="yes"';
|
6083 |
echo ' value="1"/>';
|
6084 |
|
6085 |
-
echo '<label for="seopress_advanced_appearance_seo_tools">'. __( 'Hide SEO tools in
|
6086 |
|
6087 |
if (isset($this->options['seopress_advanced_appearance_seo_tools'])) {
|
6088 |
esc_attr( $this->options['seopress_advanced_appearance_seo_tools']);
|
@@ -6099,7 +6304,7 @@ class seopress_options
|
|
6099 |
if ('1' == $check) echo 'checked="yes"';
|
6100 |
echo ' value="1"/>';
|
6101 |
|
6102 |
-
echo '<label for="seopress_advanced_appearance_useful_links">'. __( 'Hide Useful Links in
|
6103 |
|
6104 |
if (isset($this->options['seopress_advanced_appearance_useful_links'])) {
|
6105 |
esc_attr( $this->options['seopress_advanced_appearance_useful_links']);
|
118 |
$seopress_titles_options['seopress_titles_archives_date_noindex'] = '1';
|
119 |
|
120 |
//BuddyPress Groups
|
121 |
+
if ( is_plugin_active( 'buddypress/bp-loader.php' ) || is_plugin_active( 'buddyboss-platform/bp-loader.php' )) {
|
122 |
+
$seopress_titles_options['seopress_titles_bp_groups_title'] = '%%post_title%% %%sep%% %%sitetitle%%';
|
123 |
+
}
|
124 |
|
125 |
//Search
|
126 |
$seopress_titles_options['seopress_titles_archives_search_title'] = '%%search_keywords%% %%sep%% %%sitetitle%%';
|
738 |
<div class="postbox section-tool">
|
739 |
<div class="inside">
|
740 |
<h3><span><?php _e( 'Import data from a CSV', 'wp-seopress' ); ?></span></h3>
|
741 |
+
<p><?php _e( 'Upload a CSV file to quickly import post (post, page, single post type) and term metadata:', 'wp-seopress' ); ?></p>
|
742 |
+
<ul>
|
743 |
+
<li>
|
744 |
+
<?php _e('Meta title','wp-seopress'); ?>
|
745 |
+
</li>
|
746 |
+
<li>
|
747 |
+
<?php _e('Meta description','wp-seopress'); ?>
|
748 |
+
</li>
|
749 |
+
<li>
|
750 |
+
<?php _e('Meta robots (noindex, nofollow...)','wp-seopress'); ?>
|
751 |
+
</li>
|
752 |
+
<li>
|
753 |
+
<?php _e('Facebook Open Graph tags (title, description, image)','wp-seopress'); ?>
|
754 |
+
</li>
|
755 |
+
<li>
|
756 |
+
<?php _e('Twitter cards tags (title, description, image)','wp-seopress'); ?>
|
757 |
+
</li>
|
758 |
+
<li>
|
759 |
+
<?php _e('Redirection (enable, type, URL)','wp-seopress'); ?>
|
760 |
+
</li>
|
761 |
+
<li>
|
762 |
+
<?php _e('Canonical URL','wp-seopress'); ?>
|
763 |
+
</li>
|
764 |
+
<li>
|
765 |
+
<?php _e('Target keywords','wp-seopress'); ?>
|
766 |
+
</li>
|
767 |
+
</ul>
|
768 |
<a class="button" href="<?php echo admin_url( 'admin.php?page=seopress_csv_importer' ); ?>"><?php _e('Run the importer','wp-seopress'); ?></a>
|
769 |
</div><!-- .inside -->
|
770 |
</div><!-- .postbox -->
|
771 |
<div id="metadata-migration-tool" class="postbox section-tool">
|
772 |
<div class="inside">
|
773 |
<h3><span><?php _e( 'Export metadata to a CSV', 'wp-seopress' ); ?></span></h3>
|
774 |
+
<p><?php _e( 'Export your post (post, page, single post type) and term metadata for this site as a .csv file.', 'wp-seopress' ); ?></p>
|
775 |
+
<ul>
|
776 |
+
<li>
|
777 |
+
<?php _e('Meta title','wp-seopress'); ?>
|
778 |
+
</li>
|
779 |
+
<li>
|
780 |
+
<?php _e('Meta description','wp-seopress'); ?>
|
781 |
+
</li>
|
782 |
+
<li>
|
783 |
+
<?php _e('Meta robots (noindex, nofollow...)','wp-seopress'); ?>
|
784 |
+
</li>
|
785 |
+
<li>
|
786 |
+
<?php _e('Facebook Open Graph tags (title, description, image)','wp-seopress'); ?>
|
787 |
+
</li>
|
788 |
+
<li>
|
789 |
+
<?php _e('Twitter cards tags (title, description, image)','wp-seopress'); ?>
|
790 |
+
</li>
|
791 |
+
<li>
|
792 |
+
<?php _e('Redirection (enable, type, URL)','wp-seopress'); ?>
|
793 |
+
</li>
|
794 |
+
<li>
|
795 |
+
<?php _e('Canonical URL','wp-seopress'); ?>
|
796 |
+
</li>
|
797 |
+
<li>
|
798 |
+
<?php _e('Target keywords','wp-seopress'); ?>
|
799 |
+
</li>
|
800 |
+
</ul>
|
801 |
<form method="post">
|
802 |
<p><input type="hidden" name="seopress_action" value="export_csv_metadata" /></p>
|
803 |
<p>
|
1197 |
</form>
|
1198 |
</div><!-- .inside -->
|
1199 |
</div><!-- .postbox -->
|
1200 |
+
<div id="section-clean-redirects" class="postbox section-tool">
|
1201 |
+
<div class="inside">
|
1202 |
+
<h3><span><?php _e( 'Clean all your redirects and 404 errors', 'wp-seopress' ); ?></span></h3>
|
1203 |
+
<p><?php _e( 'Delete all your 301, 302, 307, 404, 410 and 451 entries.', 'wp-seopress' ); ?></p>
|
1204 |
+
<p style="color:red"><span class="dashicons dashicons-info"></span> <?php _e( '<strong>WARNING:</strong> Backup your database before deletion. Safety FIRST!', 'wp-seopress' ); ?></p>
|
1205 |
+
<form method="post">
|
1206 |
+
<p><input type="hidden" name="seopress_action" value="clean_all" /></p>
|
1207 |
+
<p>
|
1208 |
+
<?php wp_nonce_field( 'seopress_clean_all_nonce', 'seopress_clean_all_nonce' ); ?>
|
1209 |
+
<?php submit_button( __( 'Delete', 'wp-seopress' ), 'secondary', 'submit', false ); ?>
|
1210 |
+
</p>
|
1211 |
+
</form>
|
1212 |
+
</div><!-- .inside -->
|
1213 |
+
</div><!-- .postbox -->
|
1214 |
<?php } else { ?>
|
1215 |
<p><?php _e('Redirections feature is disabled. Please activate it from the PRO page.','wp-seopress'); ?></p>
|
1216 |
<a href="<?php echo admin_url( 'admin.php?page=seopress-pro-page' ); ?>"><?php _e('Activate Redirections','wp-seopress'); ?></a>
|
1235 |
<div class="postbox section-tool">
|
1236 |
<div class="inside">
|
1237 |
<h3><span><?php _e( 'Reset All Settings', 'wp-seopress' ); ?></span></h3>
|
1238 |
+
<p style="color:red"><span class="dashicons dashicons-info"></span> <?php _e( '<strong>WARNING:</strong> Delete all options related to this plugin in your database AND set settings to their default values.', 'wp-seopress' ); ?></p>
|
1239 |
<form method="post" enctype="multipart/form-data">
|
1240 |
<p>
|
1241 |
<input type="hidden" name="seopress_action" value="reset_settings" />
|
1391 |
'seopress_setting_section_titles_single' // Section
|
1392 |
);
|
1393 |
|
1394 |
+
if ( is_plugin_active( 'buddypress/bp-loader.php' ) || is_plugin_active( 'buddyboss-platform/bp-loader.php' )) {
|
1395 |
+
add_settings_field(
|
1396 |
+
'seopress_titles_bp_groups_title', // ID
|
1397 |
+
'',
|
1398 |
+
array( $this, 'seopress_titles_bp_groups_title_callback' ), // Callback
|
1399 |
+
'seopress-settings-admin-titles-single', // Page
|
1400 |
+
'seopress_setting_section_titles_single' // Section
|
1401 |
+
);
|
1402 |
|
1403 |
+
add_settings_field(
|
1404 |
+
'seopress_titles_bp_groups_desc', // ID
|
1405 |
+
'',
|
1406 |
+
array( $this, 'seopress_titles_bp_groups_desc_callback' ), // Callback
|
1407 |
+
'seopress-settings-admin-titles-single', // Page
|
1408 |
+
'seopress_setting_section_titles_single' // Section
|
1409 |
+
);
|
1410 |
|
1411 |
+
add_settings_field(
|
1412 |
+
'seopress_titles_bp_groups_noindex', // ID
|
1413 |
+
'',
|
1414 |
+
array( $this, 'seopress_titles_bp_groups_noindex_callback' ), // Callback
|
1415 |
+
'seopress-settings-admin-titles-single', // Page
|
1416 |
+
'seopress_setting_section_titles_single' // Section
|
1417 |
+
);
|
1418 |
+
}
|
1419 |
|
1420 |
//Archives SECTION=========================================================================
|
1421 |
add_settings_section(
|
2106 |
'seopress_setting_section_google_analytics_gdpr' // Section
|
2107 |
);
|
2108 |
|
2109 |
+
add_settings_field(
|
2110 |
+
'seopress_google_analytics_cb_exp_date', // ID
|
2111 |
+
__("User consent cookie expiration date","wp-seopress"), // Title
|
2112 |
+
array( $this, 'seopress_google_analytics_cb_exp_date_callback' ), // Callback
|
2113 |
+
'seopress-settings-admin-google-analytics-gdpr', // Page
|
2114 |
+
'seopress_setting_section_google_analytics_gdpr' // Section
|
2115 |
+
);
|
2116 |
+
|
2117 |
add_settings_field(
|
2118 |
'seopress_google_analytics_cb_pos', // ID
|
2119 |
__("Cookie bar position","wp-seopress"), // Title
|
2121 |
'seopress-settings-admin-google-analytics-gdpr', // Page
|
2122 |
'seopress_setting_section_google_analytics_gdpr' // Section
|
2123 |
);
|
2124 |
+
|
2125 |
+
add_settings_field(
|
2126 |
+
'seopress_google_analytics_cb_width', // ID
|
2127 |
+
__("Cookie bar width","wp-seopress"), // Title
|
2128 |
+
array( $this, 'seopress_google_analytics_cb_width_callback' ), // Callback
|
2129 |
+
'seopress-settings-admin-google-analytics-gdpr', // Page
|
2130 |
+
'seopress_setting_section_google_analytics_gdpr' // Section
|
2131 |
+
);
|
2132 |
+
|
2133 |
+
add_settings_field(
|
2134 |
+
'seopress_google_analytics_cb_backdrop', // ID
|
2135 |
+
__("Enable backdrop","wp-seopress"), // Title
|
2136 |
+
array( $this, 'seopress_google_analytics_cb_backdrop_callback' ), // Callback
|
2137 |
+
'seopress-settings-admin-google-analytics-gdpr', // Page
|
2138 |
+
'seopress_setting_section_google_analytics_gdpr' // Section
|
2139 |
+
);
|
2140 |
+
|
2141 |
+
add_settings_field(
|
2142 |
+
'seopress_google_analytics_cb_backdrop_bg', // ID
|
2143 |
+
__("Backdrop background color","wp-seopress"), // Title
|
2144 |
+
array( $this, 'seopress_google_analytics_cb_backdrop_bg_callback' ), // Callback
|
2145 |
+
'seopress-settings-admin-google-analytics-gdpr', // Page
|
2146 |
+
'seopress_setting_section_google_analytics_gdpr' // Section
|
2147 |
+
);
|
2148 |
|
2149 |
add_settings_field(
|
2150 |
'seopress_google_analytics_cb_bg', // ID
|
2716 |
|
2717 |
add_settings_field(
|
2718 |
'seopress_advanced_appearance_adminbar', // ID
|
2719 |
+
__("SEO in admin bar","wp-seopress"), // Title
|
2720 |
array( $this, 'seopress_advanced_appearance_adminbar_callback' ), // Callback
|
2721 |
'seopress-settings-admin-advanced-appearance', // Page
|
2722 |
'seopress_setting_section_advanced_appearance' // Section
|
2723 |
);
|
2724 |
|
2725 |
+
add_settings_field(
|
2726 |
+
'seopress_advanced_appearance_adminbar_noindex', // ID
|
2727 |
+
__("Noindex in admin bar","wp-seopress"), // Title
|
2728 |
+
array( $this, 'seopress_advanced_appearance_adminbar_noindex_callback' ), // Callback
|
2729 |
+
'seopress-settings-admin-advanced-appearance', // Page
|
2730 |
+
'seopress_setting_section_advanced_appearance' // Section
|
2731 |
+
);
|
2732 |
+
|
2733 |
add_settings_field(
|
2734 |
'seopress_advanced_appearance_metabox_position', // ID
|
2735 |
+
__("Move SEO metabox's position","wp-seopress"), // Title
|
2736 |
array( $this, 'seopress_advanced_appearance_metaboxe_position_callback' ), // Callback
|
2737 |
'seopress-settings-admin-advanced-appearance', // Page
|
2738 |
'seopress_setting_section_advanced_appearance' // Section
|
2973 |
'seopress_google_analytics_cross_domain',
|
2974 |
'seopress_google_analytics_matomo_id',
|
2975 |
'seopress_google_analytics_matomo_site_id',
|
2976 |
+
'seopress_google_analytics_matomo_cross_domain_sites',
|
2977 |
+
'seopress_google_analytics_cb_backdrop_bg',
|
2978 |
+
'seopress_google_analytics_cb_exp_date',
|
2979 |
+
'seopress_google_analytics_cb_bg',
|
2980 |
+
'seopress_google_analytics_cb_txt_col',
|
2981 |
+
'seopress_google_analytics_cb_lk_col',
|
2982 |
+
'seopress_google_analytics_cb_btn_bg',
|
2983 |
+
'seopress_google_analytics_cb_btn_col',
|
2984 |
+
'seopress_google_analytics_cb_btn_bg_hov',
|
2985 |
+
'seopress_google_analytics_cb_btn_col_hov',
|
2986 |
+
'seopress_google_analytics_cb_btn_sec_bg',
|
2987 |
+
'seopress_google_analytics_cb_btn_sec_col',
|
2988 |
+
'seopress_google_analytics_cb_btn_sec_bg_hov',
|
2989 |
+
'seopress_google_analytics_cb_btn_sec_col_hov',
|
2990 |
+
'seopress_google_analytics_cb_width',
|
2991 |
];
|
2992 |
|
2993 |
$seopress_sanitize_site_verification = [
|
3190 |
}
|
3191 |
|
3192 |
public function print_section_info_google_analytics_custom_dimensions() {
|
3193 |
+
print __('<p>Configure your Google Analytics custom dimensions. <br>Custom dimensions and custom metrics are like the default dimensions and metrics in your Analytics account, except you create them yourself.<br> Use them to collect and analyze data that Analytics doesn\'t automatically track.<br> Please note that you also have to setup your custom dimensions in your Google Analytics account. More info by clicking on the help icon.', 'wp-seopress');
|
3194 |
|
3195 |
echo '<p>'.__('Custom dimensions also work with <strong>Matomo</strong> tracking code.','wp-seopress').'</p>';
|
3196 |
|
3214 |
}
|
3215 |
|
3216 |
public function print_section_info_advanced_appearance() {
|
3217 |
+
print __('<p>Customize the plugin to fit your needs.</p>', 'wp-seopress');
|
3218 |
}
|
3219 |
|
3220 |
public function print_section_info_advanced_security() {
|
3452 |
//BuddyPress Groups
|
3453 |
public function seopress_titles_bp_groups_title_callback()
|
3454 |
{
|
3455 |
+
if ( is_plugin_active( 'buddypress/bp-loader.php' ) || is_plugin_active( 'buddyboss-platform/bp-loader.php' )) {
|
3456 |
+
echo '<h2>'.__('BuddyPress groups','wp-seopress').'</h2>';
|
3457 |
+
|
3458 |
+
_e('Title template','wp-seopress');
|
3459 |
+
echo "<br/>";
|
3460 |
|
3461 |
+
$check = isset($this->options['seopress_titles_bp_groups_title']) ? $this->options['seopress_titles_bp_groups_title'] : NULL;
|
3462 |
|
3463 |
+
printf(
|
3464 |
+
'<input id="seopress_titles_bp_groups_title" type="text" name="seopress_titles_option_name[seopress_titles_bp_groups_title]" value="%s"/>',
|
3465 |
+
esc_html( $check )
|
3466 |
+
);
|
3467 |
|
3468 |
+
echo '<div class="wrap-tags"><span id="seopress-tag-post-title-bd-groups" data-tag="%%post_title%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Post Title','wp-seopress').'</span>';
|
3469 |
+
echo '<span id="seopress-tag-sep-bd-groups" data-tag="%%sep%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Separator','wp-seopress').'</span>';
|
3470 |
+
echo '<span id="seopress-tag-site-title-bd-groups" data-tag="%%sitetitle%%" class="tag-title"><span class="dashicons dashicons-plus"></span>'.__('Site Title','wp-seopress').'</span>';
|
3471 |
+
echo '<span id="seopress-quick-help" class="tag-title more-tags"><span class="dashicons dashicons-menu"></span>'.__('More tags','wp-seopress').'</span></div>';
|
3472 |
+
}
|
3473 |
}
|
3474 |
|
3475 |
public function seopress_titles_bp_groups_desc_callback()
|
3476 |
{
|
3477 |
+
if ( is_plugin_active( 'buddypress/bp-loader.php' ) || is_plugin_active( 'buddyboss-platform/bp-loader.php' )) {
|
3478 |
+
_e('Meta description template','wp-seopress');
|
3479 |
+
echo "<br/>";
|
3480 |
+
|
3481 |
+
$check = isset($this->options['seopress_titles_bp_groups_desc']) ? $this->options['seopress_titles_bp_groups_desc'] : NULL;
|
3482 |
|
3483 |
+
printf(
|
3484 |
+
'<textarea name="seopress_titles_option_name[seopress_titles_bp_groups_desc]">%s</textarea>',
|
3485 |
+
esc_html( $check )
|
3486 |
+
|
3487 |
+
);
|
3488 |
+
}
|
3489 |
}
|
3490 |
|
3491 |
public function seopress_titles_bp_groups_noindex_callback()
|
3492 |
{
|
3493 |
+
if ( is_plugin_active( 'buddypress/bp-loader.php' ) || is_plugin_active( 'buddyboss-platform/bp-loader.php' )) {
|
3494 |
+
$options = get_option( 'seopress_titles_option_name' );
|
3495 |
+
|
3496 |
+
$check = isset($options['seopress_titles_bp_groups_noindex']);
|
3497 |
+
|
3498 |
+
echo '<input id="seopress_titles_bp_groups_noindex" name="seopress_titles_option_name[seopress_titles_bp_groups_noindex]" type="checkbox"';
|
3499 |
+
if ('1' == $check) echo 'checked="yes"';
|
3500 |
+
echo ' value="1"/>';
|
3501 |
+
|
3502 |
+
echo '<label for="seopress_titles_bp_groups_noindex">'. __( 'Do not display BuddyPress groups in search engine results <strong>(noindex)</strong>', 'wp-seopress' ) .'</label>';
|
3503 |
+
|
3504 |
+
if (isset($this->options['seopress_titles_bp_groups_noindex'])) {
|
3505 |
+
esc_attr( $this->options['seopress_titles_bp_groups_noindex']);
|
3506 |
+
}
|
3507 |
}
|
3508 |
}
|
3509 |
|
4024 |
echo '<label for="seopress_titles_noindex">'. __( 'noindex', 'wp-seopress' ) .'</label>';
|
4025 |
|
4026 |
echo '<p class="description">'.__('Do not display all pages of the site in Google search results and do not display "Cached" links in search results.','wp-seopress').'</p>';
|
4027 |
+
|
4028 |
+
echo '<p class="description">'. sprintf(__('Check also the <strong>"Search engine visibility"</strong> setting from the <a href="%s">WordPress Reading page</a>.','wp-seopress'),admin_url('options-reading.php')) .'</p>';
|
4029 |
|
4030 |
if (isset($this->options['seopress_titles_noindex'])) {
|
4031 |
esc_attr( $this->options['seopress_titles_noindex']);
|
4512 |
$check = isset($this->options['seopress_social_knowledge_name']) ? $this->options['seopress_social_knowledge_name'] : NULL;
|
4513 |
|
4514 |
printf(
|
4515 |
+
'<input type="text" name="seopress_social_option_name[seopress_social_knowledge_name]" placeholder="'.esc_html__('eg: Miremont','wp-seopress').'" aria-label="'.__('Your name/organization','wp-seopress').'" value="%s"/>',
|
4516 |
esc_html( $check )
|
4517 |
);
|
4518 |
}
|
5056 |
);
|
5057 |
}
|
5058 |
|
5059 |
+
public function seopress_google_analytics_cb_exp_date_callback()
|
5060 |
+
{
|
5061 |
+
$options = get_option( 'seopress_google_analytics_option_name' );
|
5062 |
+
|
5063 |
+
$check = isset($options['seopress_google_analytics_cb_exp_date']);
|
5064 |
+
|
5065 |
+
echo '<input type="number" min="1" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_exp_date]"';
|
5066 |
+
if ('1' == $check) echo 'value="'.esc_attr($options['seopress_google_analytics_cb_exp_date']).'"';
|
5067 |
+
echo ' value="30"/>';
|
5068 |
+
|
5069 |
+
if (isset($this->options['seopress_google_analytics_cb_exp_date'])) {
|
5070 |
+
esc_html( $this->options['seopress_google_analytics_cb_exp_date']);
|
5071 |
+
}
|
5072 |
+
|
5073 |
+
echo '<p class="description">'.__('Default: 30 days before the cookie expiration.','wp-seopress').'</p>';
|
5074 |
+
}
|
5075 |
+
|
5076 |
public function seopress_google_analytics_cb_pos_callback()
|
5077 |
{
|
5078 |
$options = get_option( 'seopress_google_analytics_option_name' );
|
5083 |
echo ' <option ';
|
5084 |
if ('bottom' == $selected) echo 'selected="selected"';
|
5085 |
echo ' value="bottom">'. __("Bottom (default)","wp-seopress") .'</option>';
|
5086 |
+
echo ' <option ';
|
5087 |
+
if ('center' == $selected) echo 'selected="selected"';
|
5088 |
+
echo ' value="center">'. __("Middle","wp-seopress") .'</option>';
|
5089 |
echo ' <option ';
|
5090 |
if ('top' == $selected) echo 'selected="selected"';
|
5091 |
echo ' value="top">'. __("Top","wp-seopress") .'</option>';
|
5096 |
}
|
5097 |
}
|
5098 |
|
5099 |
+
public function seopress_google_analytics_cb_width_callback()
|
5100 |
+
{
|
5101 |
+
$check = isset($this->options['seopress_google_analytics_cb_width']) ? $this->options['seopress_google_analytics_cb_width'] : NULL;
|
5102 |
+
|
5103 |
+
printf(
|
5104 |
+
'<input type="text" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_width]" aria-label="'.__('Change the cookie bar width','wp-seopress').'" value="%s"/>',
|
5105 |
+
esc_html( $check )
|
5106 |
+
);
|
5107 |
+
|
5108 |
+
echo '<p class="description">'.__('Default unit is Pixels. Add % just after your custom value to use percentages (eg: 80%).','wp-seopress').'</p>';
|
5109 |
+
}
|
5110 |
+
|
5111 |
+
public function seopress_google_analytics_cb_backdrop_callback()
|
5112 |
+
{
|
5113 |
+
$options = get_option( 'seopress_google_analytics_option_name' );
|
5114 |
+
|
5115 |
+
$check = isset($options['seopress_google_analytics_cb_backdrop']);
|
5116 |
+
|
5117 |
+
echo '<input id="seopress_google_analytics_cb_backdrop" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_backdrop]" type="checkbox"';
|
5118 |
+
if ('1' == $check) echo 'checked="yes"';
|
5119 |
+
echo ' value="1"/>';
|
5120 |
+
|
5121 |
+
echo '<label for="seopress_google_analytics_cb_backdrop">'. __( 'Display a backdrop with the cookie bar', 'wp-seopress' ) .'</label>';
|
5122 |
+
|
5123 |
+
if (isset($this->options['seopress_google_analytics_cb_backdrop'])) {
|
5124 |
+
esc_attr( $this->options['seopress_google_analytics_cb_backdrop']);
|
5125 |
+
}
|
5126 |
+
}
|
5127 |
+
|
5128 |
+
public function seopress_google_analytics_cb_backdrop_bg_callback()
|
5129 |
+
{
|
5130 |
+
$check = isset($this->options['seopress_google_analytics_cb_backdrop_bg']) ? $this->options['seopress_google_analytics_cb_backdrop_bg'] : NULL;
|
5131 |
+
|
5132 |
+
printf(
|
5133 |
+
'<input type="text" data-default-color="rgba(255,255,255,0.8)" data-alpha="true" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_backdrop_bg]" aria-label="'.__('Change the background color of the backdrop','wp-seopress').'" value="%s" class="seopress_admin_color_picker color-picker"/>',
|
5134 |
+
esc_html( $check )
|
5135 |
+
);
|
5136 |
+
}
|
5137 |
+
|
5138 |
public function seopress_google_analytics_cb_bg_callback()
|
5139 |
{
|
5140 |
$check = isset($this->options['seopress_google_analytics_cb_bg']) ? $this->options['seopress_google_analytics_cb_bg'] : NULL;
|
5141 |
|
5142 |
printf(
|
5143 |
+
'<input type="text" data-alpha="true" data-default-color="#F1F1F1" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_bg]" aria-label="'.__('Change the color of the cookie bar background','wp-seopress').'" value="%s" class="seopress_admin_color_picker color-picker"/>',
|
5144 |
esc_html( $check )
|
5145 |
);
|
5146 |
}
|
5170 |
$check = isset($this->options['seopress_google_analytics_cb_btn_bg']) ? $this->options['seopress_google_analytics_cb_btn_bg'] : NULL;
|
5171 |
|
5172 |
printf(
|
5173 |
+
'<input type="text" data-alpha="true" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_btn_bg]" aria-label="'.__('Change the color of the cookie bar button background','wp-seopress').'" value="%s" class="seopress_admin_color_picker color-picker"/>',
|
5174 |
esc_html( $check )
|
5175 |
);
|
5176 |
}
|
5180 |
$check = isset($this->options['seopress_google_analytics_cb_btn_bg_hov']) ? $this->options['seopress_google_analytics_cb_btn_bg_hov'] : NULL;
|
5181 |
|
5182 |
printf(
|
5183 |
+
'<input type="text" data-alpha="true" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_btn_bg_hov]" aria-label="'.__('Change the color of the cookie bar button hover background','wp-seopress').'" value="%s" class="seopress_admin_color_picker color-picker"/>',
|
5184 |
esc_html( $check )
|
5185 |
);
|
5186 |
}
|
5210 |
$check = isset($this->options['seopress_google_analytics_cb_btn_sec_bg']) ? $this->options['seopress_google_analytics_cb_btn_sec_bg'] : NULL;
|
5211 |
|
5212 |
printf(
|
5213 |
+
'<input type="text" data-alpha="true" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_btn_sec_bg]" aria-label="'.__('Change the color of the cookie bar secondary button background','wp-seopress').'" value="%s" class="seopress_admin_color_picker color-picker"/>',
|
5214 |
esc_html( $check )
|
5215 |
);
|
5216 |
}
|
5230 |
$check = isset($this->options['seopress_google_analytics_cb_btn_sec_bg_hov']) ? $this->options['seopress_google_analytics_cb_btn_sec_bg_hov'] : NULL;
|
5231 |
|
5232 |
printf(
|
5233 |
+
'<input type="text" data-alpha="true" data-default-color="#222222" name="seopress_google_analytics_option_name[seopress_google_analytics_cb_btn_sec_bg_hov]" aria-label="'.__('Change the color of the cookie bar secondary button','wp-seopress').'" value="%s" class="seopress_admin_color_picker color-picker"/>',
|
5234 |
esc_html( $check )
|
5235 |
);
|
5236 |
}
|
6191 |
if ('1' == $check) echo 'checked="yes"';
|
6192 |
echo ' value="1"/>';
|
6193 |
|
6194 |
+
echo '<label for="seopress_advanced_appearance_adminbar">'. __( 'Remove SEO from Admin Bar in backend and frontend', 'wp-seopress' ) .'</label>';
|
6195 |
|
6196 |
if (isset($this->options['seopress_advanced_appearance_adminbar'])) {
|
6197 |
esc_attr( $this->options['seopress_advanced_appearance_adminbar']);
|
6198 |
}
|
6199 |
}
|
6200 |
|
6201 |
+
public function seopress_advanced_appearance_adminbar_noindex_callback()
|
6202 |
+
{
|
6203 |
+
$options = get_option( 'seopress_advanced_option_name' );
|
6204 |
+
|
6205 |
+
$check = isset($options['seopress_advanced_appearance_adminbar_noindex']);
|
6206 |
+
|
6207 |
+
echo '<input id="seopress_advanced_appearance_adminbar_noindex" name="seopress_advanced_option_name[seopress_advanced_appearance_adminbar_noindex]" type="checkbox"';
|
6208 |
+
if ('1' == $check) echo 'checked="yes"';
|
6209 |
+
echo ' value="1"/>';
|
6210 |
+
|
6211 |
+
echo '<label for="seopress_advanced_appearance_adminbar_noindex">'. __( 'Remove noindex item from Admin Bar in backend and frontend', 'wp-seopress' ) .'</label>';
|
6212 |
+
|
6213 |
+
if (isset($this->options['seopress_advanced_appearance_adminbar_noindex'])) {
|
6214 |
+
esc_attr( $this->options['seopress_advanced_appearance_adminbar_noindex']);
|
6215 |
+
}
|
6216 |
+
}
|
6217 |
+
|
6218 |
public function seopress_advanced_appearance_metaboxe_position_callback()
|
6219 |
{
|
6220 |
$options = get_option( 'seopress_advanced_option_name' );
|
6270 |
if ('1' == $check) echo 'checked="yes"';
|
6271 |
echo ' value="1"/>';
|
6272 |
|
6273 |
+
echo '<label for="seopress_advanced_appearance_notifications">'. __( 'Hide Notifications Center in SEO Dashboard page', 'wp-seopress' ) .'</label>';
|
6274 |
|
6275 |
if (isset($this->options['seopress_advanced_appearance_notifications'])) {
|
6276 |
esc_attr( $this->options['seopress_advanced_appearance_notifications']);
|
6287 |
if ('1' == $check) echo 'checked="yes"';
|
6288 |
echo ' value="1"/>';
|
6289 |
|
6290 |
+
echo '<label for="seopress_advanced_appearance_seo_tools">'. __( 'Hide SEO tools in SEO Dashboard page', 'wp-seopress' ) .'</label>';
|
6291 |
|
6292 |
if (isset($this->options['seopress_advanced_appearance_seo_tools'])) {
|
6293 |
esc_attr( $this->options['seopress_advanced_appearance_seo_tools']);
|
6304 |
if ('1' == $check) echo 'checked="yes"';
|
6305 |
echo ' value="1"/>';
|
6306 |
|
6307 |
+
echo '<label for="seopress_advanced_appearance_useful_links">'. __( 'Hide Useful Links in SEO dashboard page', 'wp-seopress' ) .'</label>';
|
6308 |
|
6309 |
if (isset($this->options['seopress_advanced_appearance_useful_links'])) {
|
6310 |
esc_attr( $this->options['seopress_advanced_appearance_useful_links']);
|
inc/admin/adminbar.php
CHANGED
@@ -21,6 +21,18 @@ if (!function_exists('seopress_global_noindex_option')) {
|
|
21 |
}
|
22 |
}
|
23 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24 |
/**
|
25 |
* Admin bar customization
|
26 |
*/
|
@@ -32,18 +44,23 @@ function seopress_admin_bar_links() {
|
|
32 |
$title = '<span class="ab-icon icon-seopress-seopress"></span> '.__( 'SEO', 'wp-seopress' );
|
33 |
$title = apply_filters('seopress_adminbar_icon',$title);
|
34 |
|
35 |
-
|
36 |
-
|
37 |
-
|
38 |
-
|
39 |
-
|
|
|
|
|
|
|
|
|
|
|
40 |
}
|
41 |
|
42 |
// Adds a new top level admin bar link and a submenu to it
|
43 |
$wp_admin_bar->add_menu( array(
|
44 |
'parent' => false,
|
45 |
'id' => 'seopress_custom_top_level',
|
46 |
-
'title' => $title,
|
47 |
'href' => admin_url( 'admin.php?page=seopress-option' ),
|
48 |
));
|
49 |
|
@@ -53,10 +70,19 @@ function seopress_admin_bar_links() {
|
|
53 |
|
54 |
$options = get_option( 'seopress_titles_option_name' );
|
55 |
|
56 |
-
|
57 |
-
|
58 |
-
|
59 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
60 |
$robots .= '<span class="wrap-seopress-cpt-noindex">';
|
61 |
|
62 |
if ($noindex === true) {
|
21 |
}
|
22 |
}
|
23 |
|
24 |
+
//Noindex alert?
|
25 |
+
function seopress_advanced_appearance_adminbar_noindex_option() {
|
26 |
+
$seopress_advanced_appearance_adminbar_noindex_option = get_option("seopress_advanced_option_name");
|
27 |
+
if ( ! empty ( $seopress_advanced_appearance_adminbar_noindex_option ) ) {
|
28 |
+
foreach ($seopress_advanced_appearance_adminbar_noindex_option as $key => $seopress_advanced_appearance_adminbar_noindex_value)
|
29 |
+
$options[$key] = $seopress_advanced_appearance_adminbar_noindex_value;
|
30 |
+
if (isset($seopress_advanced_appearance_adminbar_noindex_option['seopress_advanced_appearance_adminbar_noindex'])) {
|
31 |
+
return $seopress_advanced_appearance_adminbar_noindex_option['seopress_advanced_appearance_adminbar_noindex'];
|
32 |
+
}
|
33 |
+
}
|
34 |
+
}
|
35 |
+
|
36 |
/**
|
37 |
* Admin bar customization
|
38 |
*/
|
44 |
$title = '<span class="ab-icon icon-seopress-seopress"></span> '.__( 'SEO', 'wp-seopress' );
|
45 |
$title = apply_filters('seopress_adminbar_icon',$title);
|
46 |
|
47 |
+
$noindex = '';
|
48 |
+
if (seopress_advanced_appearance_adminbar_noindex_option() !='1') {
|
49 |
+
|
50 |
+
if (seopress_global_noindex_option()=='1' || get_option('blog_public') !='1') {
|
51 |
+
$noindex .= '<a class="wrap-seopress-noindex" href="'.admin_url( 'admin.php?page=seopress-titles#tab=tab_seopress_titles_advanced' ).'">';
|
52 |
+
$noindex .= '<span class="ab-icon dashicons dashicons-hidden"></span>';
|
53 |
+
$noindex .= __('noindex is on!', 'wp-seopress');
|
54 |
+
$noindex .= '</a>';
|
55 |
+
}
|
56 |
+
$noindex = apply_filters('seopress_adminbar_noindex',$noindex);
|
57 |
}
|
58 |
|
59 |
// Adds a new top level admin bar link and a submenu to it
|
60 |
$wp_admin_bar->add_menu( array(
|
61 |
'parent' => false,
|
62 |
'id' => 'seopress_custom_top_level',
|
63 |
+
'title' => $title.$noindex,
|
64 |
'href' => admin_url( 'admin.php?page=seopress-option' ),
|
65 |
));
|
66 |
|
70 |
|
71 |
$options = get_option( 'seopress_titles_option_name' );
|
72 |
|
73 |
+
if (get_current_screen()->taxonomy) {
|
74 |
+
$noindex = isset($options['seopress_titles_single_titles'][get_current_screen()->taxonomy]['noindex']);
|
75 |
+
$nofollow = isset($options['seopress_titles_single_titles'][get_current_screen()->taxonomy]['nofollow']);
|
76 |
+
} else {
|
77 |
+
$noindex = isset($options['seopress_titles_single_titles'][get_current_screen()->post_type]['noindex']);
|
78 |
+
$nofollow = isset($options['seopress_titles_single_titles'][get_current_screen()->post_type]['nofollow']);
|
79 |
+
}
|
80 |
+
|
81 |
+
if (get_current_screen()->taxonomy) {
|
82 |
+
$robots .= '<span class="wrap-seopress-cpt-seo">'.sprintf(__('SEO for "%s"','wp-seopress'), get_current_screen()->taxonomy).'</span>';
|
83 |
+
} else {
|
84 |
+
$robots .= '<span class="wrap-seopress-cpt-seo">'.sprintf(__('SEO for "%s"','wp-seopress'), get_current_screen()->post_type).'</span>';
|
85 |
+
}
|
86 |
$robots .= '<span class="wrap-seopress-cpt-noindex">';
|
87 |
|
88 |
if ($noindex === true) {
|
inc/admin/ajax.php
CHANGED
@@ -134,13 +134,14 @@ function seopress_do_real_preview() {
|
|
134 |
//Get Target Keywords
|
135 |
if(isset($_GET['seopress_analysis_target_kw']) && !empty($_GET['seopress_analysis_target_kw'])) {
|
136 |
$data['target_kws'] = strtolower(stripslashes_deep($_GET['seopress_analysis_target_kw']));
|
137 |
-
$seopress_analysis_target_kw = array_filter(explode(',', strtolower(
|
138 |
-
|
139 |
//Manage keywords with special characters
|
140 |
foreach ($seopress_analysis_target_kw as $key => $kw) {
|
141 |
-
$kw = str_replace("-", " ", $kw)
|
142 |
$seopress_analysis_target_kw[] = htmlspecialchars_decode($kw,ENT_QUOTES);
|
143 |
}
|
|
|
144 |
//Remove duplicates
|
145 |
$seopress_analysis_target_kw = array_unique($seopress_analysis_target_kw);
|
146 |
}
|
@@ -1573,19 +1574,57 @@ function seopress_metadata_export() {
|
|
1573 |
|
1574 |
if ( current_user_can( seopress_capability( 'manage_options', 'migration' ) ) && is_admin() ) {
|
1575 |
|
1576 |
-
if ( isset( $_POST['offset'])
|
1577 |
$offset = absint($_POST['offset']);
|
1578 |
}
|
1579 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1580 |
$seopress_get_post_types = [];
|
1581 |
foreach (seopress_get_post_types() as $seopress_cpt_key => $seopress_cpt_value) {
|
1582 |
$seopress_get_post_types[] = $seopress_cpt_key;
|
1583 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
1584 |
|
1585 |
global $wpdb;
|
1586 |
global $post;
|
1587 |
|
1588 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1589 |
|
1590 |
$increment = 200;
|
1591 |
|
@@ -1616,137 +1655,273 @@ function seopress_metadata_export() {
|
|
1616 |
$settings["redirect_url"] = [];
|
1617 |
$settings["target_kw"] = [];
|
1618 |
|
1619 |
-
|
1620 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1621 |
|
1622 |
-
|
|
|
|
|
|
|
1623 |
|
1624 |
-
|
1625 |
-
'nonce' => wp_create_nonce( 'seopress_csv_batch_export_nonce' ),
|
1626 |
-
'page' => 'seopress-import-export',
|
1627 |
-
'seopress_action' => 'seopress_download_batch_export',
|
1628 |
-
) );
|
1629 |
|
1630 |
-
|
1631 |
|
1632 |
-
|
1633 |
-
|
1634 |
-
|
1635 |
-
|
1636 |
-
|
1637 |
-
|
1638 |
-
|
1639 |
-
|
1640 |
-
|
1641 |
-
|
1642 |
-
|
1643 |
-
$meta_query = get_posts( $args );
|
1644 |
|
1645 |
-
|
1646 |
-
// The Loop
|
1647 |
-
foreach ($meta_query as $post) {
|
1648 |
-
array_push($settings["id"], $post->ID);
|
1649 |
|
1650 |
-
|
1651 |
|
1652 |
-
|
1653 |
|
1654 |
-
|
1655 |
|
1656 |
-
|
1657 |
|
1658 |
-
|
1659 |
|
1660 |
-
|
1661 |
|
1662 |
-
|
1663 |
|
1664 |
-
|
1665 |
|
1666 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1667 |
|
1668 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1669 |
|
1670 |
-
|
|
|
|
|
|
|
1671 |
|
1672 |
-
|
1673 |
|
1674 |
-
|
1675 |
|
1676 |
-
|
1677 |
|
1678 |
-
|
1679 |
|
1680 |
-
|
1681 |
|
1682 |
-
|
1683 |
|
1684 |
-
|
1685 |
-
|
1686 |
-
|
1687 |
-
|
1688 |
-
|
1689 |
-
|
1690 |
-
|
1691 |
-
|
1692 |
-
|
1693 |
-
|
1694 |
-
$settings["
|
1695 |
-
|
1696 |
-
$settings["
|
1697 |
-
|
1698 |
-
$settings["
|
1699 |
-
|
1700 |
-
$settings["
|
1701 |
-
|
1702 |
-
$settings["
|
1703 |
-
$settings["tw_img"],
|
1704 |
-
$settings["noindex"],
|
1705 |
-
$settings["nofollow"],
|
1706 |
-
$settings["noodp"],
|
1707 |
-
$settings["noimageindex"],
|
1708 |
-
$settings["noarchive"],
|
1709 |
-
$settings["nosnippet"],
|
1710 |
-
$settings["canonical_url"],
|
1711 |
-
$settings["redirect_active"],
|
1712 |
-
$settings["redirect_type"],
|
1713 |
-
$settings["redirect_url"],
|
1714 |
-
$settings["target_kw"]
|
1715 |
-
);
|
1716 |
-
|
1717 |
-
//Clean arrays
|
1718 |
-
$settings["id"] = [];
|
1719 |
-
$settings["post_title"] = [];
|
1720 |
-
$settings["url"] = [];
|
1721 |
-
$settings["meta_title"] = [];
|
1722 |
-
$settings["meta_desc"] = [];
|
1723 |
-
$settings["fb_title"] = [];
|
1724 |
-
$settings["fb_desc"] = [];
|
1725 |
-
$settings["fb_img"] = [];
|
1726 |
-
$settings["tw_title"] = [];
|
1727 |
-
$settings["tw_desc"] = [];
|
1728 |
-
$settings["tw_img"] = [];
|
1729 |
-
$settings["noindex"] = [];
|
1730 |
-
$settings["nofollow"] = [];
|
1731 |
-
$settings["noodp"] = [];
|
1732 |
-
$settings["noimageindex"] = [];
|
1733 |
-
$settings["noarchive"] = [];
|
1734 |
-
$settings["nosnippet"] = [];
|
1735 |
-
$settings["canonical_url"] = [];
|
1736 |
-
$settings["redirect_active"] = [];
|
1737 |
-
$settings["redirect_type"] = [];
|
1738 |
-
$settings["redirect_url"] = [];
|
1739 |
-
$settings["target_kw"] = [];
|
1740 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1741 |
}
|
|
|
|
|
|
|
1742 |
}
|
1743 |
-
|
1744 |
-
|
|
|
1745 |
}
|
1746 |
|
1747 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1748 |
$data['offset'] = $offset;
|
1749 |
$data['url'] = $download_url;
|
|
|
|
|
1750 |
wp_send_json_success($data);
|
1751 |
|
1752 |
die();
|
134 |
//Get Target Keywords
|
135 |
if(isset($_GET['seopress_analysis_target_kw']) && !empty($_GET['seopress_analysis_target_kw'])) {
|
136 |
$data['target_kws'] = strtolower(stripslashes_deep($_GET['seopress_analysis_target_kw']));
|
137 |
+
$seopress_analysis_target_kw = array_filter(explode(',', strtolower(get_post_meta($seopress_get_the_id,'_seopress_analysis_target_kw',true))));
|
138 |
+
|
139 |
//Manage keywords with special characters
|
140 |
foreach ($seopress_analysis_target_kw as $key => $kw) {
|
141 |
+
$kw = str_replace("-", " ", $kw);//remove dashes
|
142 |
$seopress_analysis_target_kw[] = htmlspecialchars_decode($kw,ENT_QUOTES);
|
143 |
}
|
144 |
+
|
145 |
//Remove duplicates
|
146 |
$seopress_analysis_target_kw = array_unique($seopress_analysis_target_kw);
|
147 |
}
|
1574 |
|
1575 |
if ( current_user_can( seopress_capability( 'manage_options', 'migration' ) ) && is_admin() ) {
|
1576 |
|
1577 |
+
if ( isset( $_POST['offset'] ) ) {
|
1578 |
$offset = absint($_POST['offset']);
|
1579 |
}
|
1580 |
|
1581 |
+
$post_export = '';
|
1582 |
+
if ( isset( $_POST['post_export'] ) ) {
|
1583 |
+
$post_export = esc_attr($_POST['post_export']);
|
1584 |
+
}
|
1585 |
+
|
1586 |
+
$term_export = '';
|
1587 |
+
if ( isset( $_POST['term_export'] ) ) {
|
1588 |
+
$term_export = esc_attr($_POST['term_export']);
|
1589 |
+
}
|
1590 |
+
|
1591 |
+
//Get post types
|
1592 |
$seopress_get_post_types = [];
|
1593 |
foreach (seopress_get_post_types() as $seopress_cpt_key => $seopress_cpt_value) {
|
1594 |
$seopress_get_post_types[] = $seopress_cpt_key;
|
1595 |
}
|
1596 |
+
|
1597 |
+
//Get taxonomies
|
1598 |
+
$seopress_get_taxonomies = [];
|
1599 |
+
foreach (seopress_get_taxonomies() as $seopress_tax_key => $seopress_tax_value) {
|
1600 |
+
$seopress_get_taxonomies[] = $seopress_tax_key;
|
1601 |
+
}
|
1602 |
|
1603 |
global $wpdb;
|
1604 |
global $post;
|
1605 |
|
1606 |
+
//Count posts
|
1607 |
+
$i = 1;
|
1608 |
+
$sql = '(';
|
1609 |
+
$count = count($seopress_get_post_types);
|
1610 |
+
foreach($seopress_get_post_types as $cpt) {
|
1611 |
+
$sql .= '(post_type = "' . $cpt . '")';
|
1612 |
+
|
1613 |
+
if ($i < $count) {
|
1614 |
+
$sql .= ' OR ';
|
1615 |
+
}
|
1616 |
+
|
1617 |
+
$i++;
|
1618 |
+
}
|
1619 |
+
$sql .=')';
|
1620 |
+
|
1621 |
+
$total_count_posts = (int)$wpdb->get_var( "SELECT count(*)
|
1622 |
+
FROM {$wpdb->posts}
|
1623 |
+
WHERE $sql
|
1624 |
+
AND (post_status = 'publish' OR post_status = 'pending' OR post_status = 'draft' OR post_status = 'auto-draft' OR post_status = 'future' OR post_status = 'private' OR post_status = 'inherit' OR post_status = 'trash') " );
|
1625 |
+
|
1626 |
+
//Count terms
|
1627 |
+
$total_count_terms = (int)$wpdb->get_var( "SELECT count(*) FROM {$wpdb->terms}" );
|
1628 |
|
1629 |
$increment = 200;
|
1630 |
|
1655 |
$settings["redirect_url"] = [];
|
1656 |
$settings["target_kw"] = [];
|
1657 |
|
1658 |
+
//Posts
|
1659 |
+
if ($post_export !='done') {
|
1660 |
+
if ($offset > $total_count_posts) {
|
1661 |
+
wp_reset_query();
|
1662 |
+
//Reset offset once Posts export is done
|
1663 |
+
$offset = 0;
|
1664 |
+
update_option('seopress_metadata_csv', $csv);
|
1665 |
+
$post_export = 'done';
|
1666 |
+
} else {
|
1667 |
+
$args = array(
|
1668 |
+
'post_type' => $seopress_get_post_types,
|
1669 |
+
'posts_per_page' => $increment,
|
1670 |
+
'offset' => $offset,
|
1671 |
+
'post_status' => 'any',
|
1672 |
+
'order' => 'DESC',
|
1673 |
+
'orderby' => 'date',
|
1674 |
+
);
|
1675 |
+
$args = apply_filters( 'seopress_metadata_query_args', $args, $seopress_get_post_types, $increment, $offset );
|
1676 |
+
$meta_query = get_posts( $args );
|
1677 |
|
1678 |
+
if ($meta_query) {
|
1679 |
+
// The Loop
|
1680 |
+
foreach ($meta_query as $post) {
|
1681 |
+
array_push($settings["id"], $post->ID);
|
1682 |
|
1683 |
+
array_push($settings["post_title"], $post->post_title);
|
|
|
|
|
|
|
|
|
1684 |
|
1685 |
+
array_push($settings["url"], get_permalink($post));
|
1686 |
|
1687 |
+
array_push($settings["meta_title"], get_post_meta( $post->ID, '_seopress_titles_title', true ));
|
1688 |
+
|
1689 |
+
array_push($settings["meta_desc"], get_post_meta( $post->ID, '_seopress_titles_desc', true ));
|
1690 |
+
|
1691 |
+
array_push($settings["fb_title"], get_post_meta( $post->ID, '_seopress_social_fb_title', true ));
|
1692 |
+
|
1693 |
+
array_push($settings["fb_desc"], get_post_meta( $post->ID, '_seopress_social_fb_desc', true ));
|
1694 |
+
|
1695 |
+
array_push($settings["fb_img"], get_post_meta( $post->ID, '_seopress_social_fb_img', true ));
|
1696 |
+
|
1697 |
+
array_push($settings["tw_title"], get_post_meta( $post->ID, '_seopress_social_twitter_title', true ));
|
|
|
1698 |
|
1699 |
+
array_push($settings["tw_desc"], get_post_meta( $post->ID, '_seopress_social_twitter_desc', true ));
|
|
|
|
|
|
|
1700 |
|
1701 |
+
array_push($settings["tw_img"], get_post_meta( $post->ID, '_seopress_social_twitter_img', true ));
|
1702 |
|
1703 |
+
array_push($settings["noindex"], get_post_meta( $post->ID, '_seopress_robots_index', true ));
|
1704 |
|
1705 |
+
array_push($settings["nofollow"], get_post_meta( $post->ID, '_seopress_robots_follow', true ));
|
1706 |
|
1707 |
+
array_push($settings["noodp"], get_post_meta( $post->ID, '_seopress_robots_odp', true ));
|
1708 |
|
1709 |
+
array_push($settings["noimageindex"], get_post_meta( $post->ID, '_seopress_robots_imageindex', true ));
|
1710 |
|
1711 |
+
array_push($settings["noarchive"], get_post_meta( $post->ID, '_seopress_robots_archive', true ));
|
1712 |
|
1713 |
+
array_push($settings["nosnippet"], get_post_meta( $post->ID, '_seopress_robots_snippet', true ));
|
1714 |
|
1715 |
+
array_push($settings["canonical_url"], get_post_meta( $post->ID, '_seopress_robots_canonical', true ));
|
1716 |
|
1717 |
+
array_push($settings["redirect_active"], get_post_meta( $post->ID, '_seopress_redirections_enabled', true ));
|
1718 |
+
|
1719 |
+
array_push($settings["redirect_type"], get_post_meta( $post->ID, '_seopress_redirections_type', true ));
|
1720 |
+
|
1721 |
+
array_push($settings["redirect_url"], get_post_meta( $post->ID, '_seopress_redirections_value', true ));
|
1722 |
+
|
1723 |
+
array_push($settings["target_kw"], get_post_meta( $post->ID, '_seopress_analysis_target_kw', true ));
|
1724 |
+
|
1725 |
+
$csv[] = array_merge(
|
1726 |
+
$settings["id"],
|
1727 |
+
$settings["post_title"],
|
1728 |
+
$settings["url"],
|
1729 |
+
$settings["meta_title"],
|
1730 |
+
$settings["meta_desc"],
|
1731 |
+
$settings["fb_title"],
|
1732 |
+
$settings["fb_desc"],
|
1733 |
+
$settings["fb_img"],
|
1734 |
+
$settings["tw_title"],
|
1735 |
+
$settings["tw_desc"],
|
1736 |
+
$settings["tw_img"],
|
1737 |
+
$settings["noindex"],
|
1738 |
+
$settings["nofollow"],
|
1739 |
+
$settings["noodp"],
|
1740 |
+
$settings["noimageindex"],
|
1741 |
+
$settings["noarchive"],
|
1742 |
+
$settings["nosnippet"],
|
1743 |
+
$settings["canonical_url"],
|
1744 |
+
$settings["redirect_active"],
|
1745 |
+
$settings["redirect_type"],
|
1746 |
+
$settings["redirect_url"],
|
1747 |
+
$settings["target_kw"]
|
1748 |
+
);
|
1749 |
+
|
1750 |
+
//Clean arrays
|
1751 |
+
$settings["id"] = [];
|
1752 |
+
$settings["post_title"] = [];
|
1753 |
+
$settings["url"] = [];
|
1754 |
+
$settings["meta_title"] = [];
|
1755 |
+
$settings["meta_desc"] = [];
|
1756 |
+
$settings["fb_title"] = [];
|
1757 |
+
$settings["fb_desc"] = [];
|
1758 |
+
$settings["fb_img"] = [];
|
1759 |
+
$settings["tw_title"] = [];
|
1760 |
+
$settings["tw_desc"] = [];
|
1761 |
+
$settings["tw_img"] = [];
|
1762 |
+
$settings["noindex"] = [];
|
1763 |
+
$settings["nofollow"] = [];
|
1764 |
+
$settings["noodp"] = [];
|
1765 |
+
$settings["noimageindex"] = [];
|
1766 |
+
$settings["noarchive"] = [];
|
1767 |
+
$settings["nosnippet"] = [];
|
1768 |
+
$settings["canonical_url"] = [];
|
1769 |
+
$settings["redirect_active"] = [];
|
1770 |
+
$settings["redirect_type"] = [];
|
1771 |
+
$settings["redirect_url"] = [];
|
1772 |
+
$settings["target_kw"] = [];
|
1773 |
|
1774 |
+
}
|
1775 |
+
}
|
1776 |
+
$offset += $increment;
|
1777 |
+
update_option('seopress_metadata_csv', $csv);
|
1778 |
+
}
|
1779 |
+
} elseif ($term_export !='done') {
|
1780 |
+
//Terms
|
1781 |
+
if ($offset > $total_count_terms) {
|
1782 |
+
update_option('seopress_metadata_csv', $csv);
|
1783 |
+
$post_export = 'done';
|
1784 |
+
$term_export = 'done';
|
1785 |
+
} else {
|
1786 |
+
$args = [
|
1787 |
+
'taxonomy' => $seopress_get_taxonomies,
|
1788 |
+
'number' => $increment,
|
1789 |
+
'offset' => $offset,
|
1790 |
+
'order' => 'DESC',
|
1791 |
+
'orderby' => 'date',
|
1792 |
+
'hide_empty' => false,
|
1793 |
+
];
|
1794 |
+
|
1795 |
+
$args = apply_filters( 'seopress_metadata_query_terms_args', $args, $seopress_get_taxonomies, $increment, $offset );
|
1796 |
+
|
1797 |
+
$meta_query = get_terms( $args );
|
1798 |
|
1799 |
+
if ($meta_query) {
|
1800 |
+
// The Loop
|
1801 |
+
foreach ($meta_query as $term) {
|
1802 |
+
array_push($settings["id"], $term->term_id);
|
1803 |
|
1804 |
+
array_push($settings["post_title"], $term->name);
|
1805 |
|
1806 |
+
array_push($settings["url"], get_term_link($term));
|
1807 |
|
1808 |
+
array_push($settings["meta_title"], get_term_meta( $term->term_id, '_seopress_titles_title', true ));
|
1809 |
|
1810 |
+
array_push($settings["meta_desc"], get_term_meta( $term->term_id, '_seopress_titles_desc', true ));
|
1811 |
|
1812 |
+
array_push($settings["fb_title"], get_term_meta( $term->term_id, '_seopress_social_fb_title', true ));
|
1813 |
|
1814 |
+
array_push($settings["fb_desc"], get_term_meta( $term->term_id, '_seopress_social_fb_desc', true ));
|
1815 |
|
1816 |
+
array_push($settings["fb_img"], get_term_meta( $term->term_id, '_seopress_social_fb_img', true ));
|
1817 |
+
|
1818 |
+
array_push($settings["tw_title"], get_term_meta( $term->term_id, '_seopress_social_twitter_title', true ));
|
1819 |
+
|
1820 |
+
array_push($settings["tw_desc"], get_term_meta( $term->term_id, '_seopress_social_twitter_desc', true ));
|
1821 |
+
|
1822 |
+
array_push($settings["tw_img"], get_term_meta( $term->term_id, '_seopress_social_twitter_img', true ));
|
1823 |
+
|
1824 |
+
array_push($settings["noindex"], get_term_meta( $term->term_id, '_seopress_robots_index', true ));
|
1825 |
+
|
1826 |
+
array_push($settings["nofollow"], get_term_meta( $term->term_id, '_seopress_robots_follow', true ));
|
1827 |
+
|
1828 |
+
array_push($settings["noodp"], get_term_meta( $term->term_id, '_seopress_robots_odp', true ));
|
1829 |
+
|
1830 |
+
array_push($settings["noimageindex"], get_term_meta( $term->term_id, '_seopress_robots_imageindex', true ));
|
1831 |
+
|
1832 |
+
array_push($settings["noarchive"], get_term_meta( $term->term_id, '_seopress_robots_archive', true ));
|
1833 |
+
|
1834 |
+
array_push($settings["nosnippet"], get_term_meta( $term->term_id, '_seopress_robots_snippet', true ));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1835 |
|
1836 |
+
array_push($settings["canonical_url"], get_term_meta( $term->term_id, '_seopress_robots_canonical', true ));
|
1837 |
+
|
1838 |
+
array_push($settings["redirect_active"], get_term_meta( $term->term_id, '_seopress_redirections_enabled', true ));
|
1839 |
+
|
1840 |
+
array_push($settings["redirect_type"], get_term_meta( $term->term_id, '_seopress_redirections_type', true ));
|
1841 |
+
|
1842 |
+
array_push($settings["redirect_url"], get_term_meta( $term->term_id, '_seopress_redirections_value', true ));
|
1843 |
+
|
1844 |
+
array_push($settings["target_kw"], get_term_meta( $term->term_id, '_seopress_analysis_target_kw', true ));
|
1845 |
+
|
1846 |
+
$csv[] = array_merge(
|
1847 |
+
$settings["id"],
|
1848 |
+
$settings["post_title"],
|
1849 |
+
$settings["url"],
|
1850 |
+
$settings["meta_title"],
|
1851 |
+
$settings["meta_desc"],
|
1852 |
+
$settings["fb_title"],
|
1853 |
+
$settings["fb_desc"],
|
1854 |
+
$settings["fb_img"],
|
1855 |
+
$settings["tw_title"],
|
1856 |
+
$settings["tw_desc"],
|
1857 |
+
$settings["tw_img"],
|
1858 |
+
$settings["noindex"],
|
1859 |
+
$settings["nofollow"],
|
1860 |
+
$settings["noodp"],
|
1861 |
+
$settings["noimageindex"],
|
1862 |
+
$settings["noarchive"],
|
1863 |
+
$settings["nosnippet"],
|
1864 |
+
$settings["canonical_url"],
|
1865 |
+
$settings["redirect_active"],
|
1866 |
+
$settings["redirect_type"],
|
1867 |
+
$settings["redirect_url"],
|
1868 |
+
$settings["target_kw"]
|
1869 |
+
);
|
1870 |
+
|
1871 |
+
//Clean arrays
|
1872 |
+
$settings["id"] = [];
|
1873 |
+
$settings["post_title"] = [];
|
1874 |
+
$settings["url"] = [];
|
1875 |
+
$settings["meta_title"] = [];
|
1876 |
+
$settings["meta_desc"] = [];
|
1877 |
+
$settings["fb_title"] = [];
|
1878 |
+
$settings["fb_desc"] = [];
|
1879 |
+
$settings["fb_img"] = [];
|
1880 |
+
$settings["tw_title"] = [];
|
1881 |
+
$settings["tw_desc"] = [];
|
1882 |
+
$settings["tw_img"] = [];
|
1883 |
+
$settings["noindex"] = [];
|
1884 |
+
$settings["nofollow"] = [];
|
1885 |
+
$settings["noodp"] = [];
|
1886 |
+
$settings["noimageindex"] = [];
|
1887 |
+
$settings["noarchive"] = [];
|
1888 |
+
$settings["nosnippet"] = [];
|
1889 |
+
$settings["canonical_url"] = [];
|
1890 |
+
$settings["redirect_active"] = [];
|
1891 |
+
$settings["redirect_type"] = [];
|
1892 |
+
$settings["redirect_url"] = [];
|
1893 |
+
$settings["target_kw"] = [];
|
1894 |
+
|
1895 |
+
}
|
1896 |
}
|
1897 |
+
$offset += $increment;
|
1898 |
+
$post_export = 'done';
|
1899 |
+
update_option('seopress_metadata_csv', $csv);
|
1900 |
}
|
1901 |
+
} else {
|
1902 |
+
$post_export = 'done';
|
1903 |
+
$term_export = 'done';
|
1904 |
}
|
1905 |
|
1906 |
+
//Create download URL
|
1907 |
+
if ($post_export =='done' && $term_export =='done') {
|
1908 |
+
$args = array_merge( $_POST, array(
|
1909 |
+
'nonce' => wp_create_nonce( 'seopress_csv_batch_export_nonce' ),
|
1910 |
+
'page' => 'seopress-import-export',
|
1911 |
+
'seopress_action' => 'seopress_download_batch_export',
|
1912 |
+
) );
|
1913 |
+
|
1914 |
+
$download_url = add_query_arg( $args, admin_url('admin.php') );
|
1915 |
+
|
1916 |
+
$offset = 'done';
|
1917 |
+
}
|
1918 |
+
|
1919 |
+
//Return data to JSON
|
1920 |
+
$data = [];
|
1921 |
$data['offset'] = $offset;
|
1922 |
$data['url'] = $download_url;
|
1923 |
+
$data['post_export'] = $post_export;
|
1924 |
+
$data['term_export'] = $term_export;
|
1925 |
wp_send_json_success($data);
|
1926 |
|
1927 |
die();
|
inc/admin/page-builders/elementor/assets/css/text-letter-counter.css
CHANGED
@@ -49,7 +49,9 @@
|
|
49 |
margin-bottom: 10px;
|
50 |
}
|
51 |
|
52 |
-
.seopress-text-letter-counter .tag-title,
|
|
|
|
|
53 |
padding: 4px 8px;
|
54 |
position: relative;
|
55 |
top: 5px;
|
49 |
margin-bottom: 10px;
|
50 |
}
|
51 |
|
52 |
+
.seopress-text-letter-counter .tag-title,
|
53 |
+
.seopress-option .tag-title,
|
54 |
+
.seopress-option .seopress-tag-dropdown {
|
55 |
padding: 4px 8px;
|
56 |
position: relative;
|
57 |
top: 5px;
|
inc/admin/page-builders/elementor/assets/js/google-suggestions.js
CHANGED
@@ -16,8 +16,10 @@ function seopress_google_suggest(data){
|
|
16 |
var suggestions_array = raw_suggestions.split(',');
|
17 |
|
18 |
var i;
|
19 |
-
for (i = 0; i <
|
20 |
-
|
|
|
|
|
21 |
}
|
22 |
}
|
23 |
|
@@ -35,7 +37,7 @@ const getSuggestions = function(data) {
|
|
35 |
}
|
36 |
}
|
37 |
|
38 |
-
var
|
39 |
onReady: function () {
|
40 |
console.log(this);
|
41 |
console.log(elementor);
|
@@ -52,4 +54,4 @@ var googleSuggestiosnView = elementor.modules.controls.BaseData.extend({
|
|
52 |
}
|
53 |
});
|
54 |
|
55 |
-
elementor.addControlView('seopress-google-suggestions',
|
16 |
var suggestions_array = raw_suggestions.split(',');
|
17 |
|
18 |
var i;
|
19 |
+
for (i = 0; i < suggestions_array.length; i++) {
|
20 |
+
if (suggestions_array[i] != null && suggestions_array[i] != undefined && suggestions_array[i] !='' && suggestions_array[i] !='[object Object]') {
|
21 |
+
document.getElementById('seopress_suggestions').innerHTML += '<li><a href=\"#\" class=\"sp-suggest-btn button button-small\">'+suggestions_array[i]+'</a></li>';
|
22 |
+
}
|
23 |
}
|
24 |
}
|
25 |
|
37 |
}
|
38 |
}
|
39 |
|
40 |
+
var googleSuggestionsView = elementor.modules.controls.BaseData.extend({
|
41 |
onReady: function () {
|
42 |
console.log(this);
|
43 |
console.log(elementor);
|
54 |
}
|
55 |
});
|
56 |
|
57 |
+
elementor.addControlView('seopress-google-suggestions', googleSuggestionsView);
|
inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php
CHANGED
@@ -275,7 +275,7 @@ class Document_Settings_Section {
|
|
275 |
'_seopress_robots_primary_cat',
|
276 |
[
|
277 |
'label' => __( 'Select a primary category', 'wp-seopress' ),
|
278 |
-
'description' => __('Set the category that gets used in the %category% permalink if you have multiple categories.','wp-seopress'),
|
279 |
'type' => \Elementor\Controls_Manager::SELECT,
|
280 |
'label_block' => true,
|
281 |
'separator' => 'none',
|
275 |
'_seopress_robots_primary_cat',
|
276 |
[
|
277 |
'label' => __( 'Select a primary category', 'wp-seopress' ),
|
278 |
+
'description' => __('Set the category that gets used in the %category% permalink and in our breadcrumbs if you have multiple categories.','wp-seopress'),
|
279 |
'type' => \Elementor\Controls_Manager::SELECT,
|
280 |
'label_block' => true,
|
281 |
'separator' => 'none',
|
inc/functions/options-google-analytics.php
CHANGED
@@ -160,6 +160,39 @@ if (seopress_google_analytics_disable_option() =='1' && ( (empty($_COOKIE["seopr
|
|
160 |
}
|
161 |
}
|
162 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
163 |
function seopress_cookies_user_consent_html() {
|
164 |
if (seopress_google_analytics_opt_out_msg_option() !='') {
|
165 |
$msg = seopress_google_analytics_opt_out_msg_option();
|
@@ -188,19 +221,45 @@ if (seopress_google_analytics_disable_option() =='1' && ( (empty($_COOKIE["seopr
|
|
188 |
$close_btn = __('X','wp-seopress');
|
189 |
}
|
190 |
|
191 |
-
$user_msg = '<div class="seopress-user-consent seopress-user-consent-hide" tabindex="10"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
192 |
|
193 |
-
$user_msg = apply_filters('seopress_rgpd_full_message', $user_msg, $msg, $consent_btn, $close_btn);
|
194 |
|
195 |
-
echo $user_msg;
|
196 |
}
|
197 |
|
198 |
function seopress_cookies_user_consent_styles(){
|
199 |
-
$styles = '<style>.seopress-user-consent {position: fixed;z-index: 8000;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
200 |
|
201 |
//Position
|
202 |
if (seopress_google_analytics_cb_pos_option() ==='top') {
|
203 |
$styles .= 'top:0;';
|
|
|
|
|
204 |
} else {
|
205 |
$styles .= 'bottom:0;';
|
206 |
}
|
@@ -212,14 +271,14 @@ if (seopress_google_analytics_disable_option() =='1' && ( (empty($_COOKIE["seopr
|
|
212 |
$styles .= 'background:#F1F1F1;';
|
213 |
}
|
214 |
|
215 |
-
$styles .='}.seopress-user-consent p {margin: 0;font-size: 0.8em;justify-content:
|
216 |
|
217 |
//Text color
|
218 |
if (seopress_google_analytics_cb_txt_col_option() !='') {
|
219 |
$styles .= 'color:'.seopress_google_analytics_cb_txt_col_option().';';
|
220 |
}
|
221 |
|
222 |
-
$styles .='}.seopress-user-consent button {vertical-align: middle;margin: 0
|
223 |
|
224 |
//Btn background color
|
225 |
if (seopress_google_analytics_cb_btn_bg_option() !='') {
|
@@ -243,8 +302,8 @@ if (seopress_google_analytics_disable_option() =='1' && ( (empty($_COOKIE["seopr
|
|
243 |
$styles .= 'color:'.seopress_google_analytics_cb_btn_col_hov_option().';';
|
244 |
}
|
245 |
|
246 |
-
$styles .='}#seopress-user-consent-close{margin: 0
|
247 |
-
|
248 |
//Background secondary button
|
249 |
if (seopress_google_analytics_cb_btn_sec_bg_option() !='') {
|
250 |
$styles .= 'background:'.seopress_google_analytics_cb_btn_sec_bg_option().';';
|
@@ -284,8 +343,38 @@ if (seopress_google_analytics_disable_option() =='1' && ( (empty($_COOKIE["seopr
|
|
284 |
$styles .= '}';
|
285 |
}
|
286 |
|
287 |
-
$styles .='.seopress-user-consent-hide{display:none;}
|
288 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
289 |
$styles = apply_filters('seopress_rgpd_full_message_styles', $styles);
|
290 |
|
291 |
echo $styles;
|
160 |
}
|
161 |
}
|
162 |
|
163 |
+
function seopress_google_analytics_cb_width_option() {
|
164 |
+
$seopress_google_analytics_cb_width_option = get_option("seopress_google_analytics_option_name");
|
165 |
+
if ( ! empty ( $seopress_google_analytics_cb_width_option ) ) {
|
166 |
+
foreach ($seopress_google_analytics_cb_width_option as $key => $seopress_google_analytics_cb_width_value)
|
167 |
+
$options[$key] = $seopress_google_analytics_cb_width_value;
|
168 |
+
if (isset($seopress_google_analytics_cb_width_option['seopress_google_analytics_cb_width'])) {
|
169 |
+
return $seopress_google_analytics_cb_width_option['seopress_google_analytics_cb_width'];
|
170 |
+
}
|
171 |
+
}
|
172 |
+
}
|
173 |
+
|
174 |
+
function seopress_google_analytics_cb_backdrop_option() {
|
175 |
+
$seopress_google_analytics_cb_backdrop_option = get_option("seopress_google_analytics_option_name");
|
176 |
+
if ( ! empty ( $seopress_google_analytics_cb_backdrop_option ) ) {
|
177 |
+
foreach ($seopress_google_analytics_cb_backdrop_option as $key => $seopress_google_analytics_cb_backdrop_value)
|
178 |
+
$options[$key] = $seopress_google_analytics_cb_backdrop_value;
|
179 |
+
if (isset($seopress_google_analytics_cb_backdrop_option['seopress_google_analytics_cb_backdrop'])) {
|
180 |
+
return $seopress_google_analytics_cb_backdrop_option['seopress_google_analytics_cb_backdrop'];
|
181 |
+
}
|
182 |
+
}
|
183 |
+
}
|
184 |
+
|
185 |
+
function seopress_google_analytics_cb_backdrop_bg_option() {
|
186 |
+
$seopress_google_analytics_cb_backdrop_bg_option = get_option("seopress_google_analytics_option_name");
|
187 |
+
if ( ! empty ( $seopress_google_analytics_cb_backdrop_bg_option ) ) {
|
188 |
+
foreach ($seopress_google_analytics_cb_backdrop_bg_option as $key => $seopress_google_analytics_cb_backdrop_bg_value)
|
189 |
+
$options[$key] = $seopress_google_analytics_cb_backdrop_bg_value;
|
190 |
+
if (isset($seopress_google_analytics_cb_backdrop_bg_option['seopress_google_analytics_cb_backdrop_bg'])) {
|
191 |
+
return $seopress_google_analytics_cb_backdrop_bg_option['seopress_google_analytics_cb_backdrop_bg'];
|
192 |
+
}
|
193 |
+
}
|
194 |
+
}
|
195 |
+
|
196 |
function seopress_cookies_user_consent_html() {
|
197 |
if (seopress_google_analytics_opt_out_msg_option() !='') {
|
198 |
$msg = seopress_google_analytics_opt_out_msg_option();
|
221 |
$close_btn = __('X','wp-seopress');
|
222 |
}
|
223 |
|
224 |
+
$user_msg = '<div class="seopress-user-consent seopress-user-consent-hide" tabindex="10">
|
225 |
+
<p>'.$msg.'</p>
|
226 |
+
<p>
|
227 |
+
<button id="seopress-user-consent-accept" type="button" tabindex="11">'.$consent_btn.'</button>
|
228 |
+
<button type="button" id="seopress-user-consent-close" tabindex="12">'.$close_btn.'</button>
|
229 |
+
</p>
|
230 |
+
</div>';
|
231 |
+
|
232 |
+
$backdrop = '<div class="seopress-user-consent-backdrop"></div>';
|
233 |
|
234 |
+
$user_msg = apply_filters('seopress_rgpd_full_message', $user_msg, $msg, $consent_btn, $close_btn, $backdrop);
|
235 |
|
236 |
+
echo $user_msg.$backdrop;
|
237 |
}
|
238 |
|
239 |
function seopress_cookies_user_consent_styles(){
|
240 |
+
$styles = '<style>.seopress-user-consent {left: 50%;transform: translate(-50%, -50%);position: fixed;z-index: 8000;padding: 30px;text-align: center;display: flex;justify-content: center;border: 1px solid #CCC;box-shadow: 0 0 10px rgb(204 204 204 / 0.5);border-radius: 5px;flex-wrap: wrap;max-width:100%;';
|
241 |
+
|
242 |
+
//Width
|
243 |
+
if (seopress_google_analytics_cb_width_option() !='') {
|
244 |
+
$width = seopress_google_analytics_cb_width_option();
|
245 |
+
$needle = '%';
|
246 |
+
|
247 |
+
if ( strpos( $width, $needle ) !== false ) {
|
248 |
+
$unit = '';
|
249 |
+
} else {
|
250 |
+
$unit = 'px';
|
251 |
+
}
|
252 |
+
|
253 |
+
$styles .= 'width: '.$width.$unit.';';
|
254 |
+
} else {
|
255 |
+
$styles .= 'width:100%;';
|
256 |
+
}
|
257 |
|
258 |
//Position
|
259 |
if (seopress_google_analytics_cb_pos_option() ==='top') {
|
260 |
$styles .= 'top:0;';
|
261 |
+
} elseif(seopress_google_analytics_cb_pos_option() ==='center') {
|
262 |
+
$styles .= 'top:45%;';
|
263 |
} else {
|
264 |
$styles .= 'bottom:0;';
|
265 |
}
|
271 |
$styles .= 'background:#F1F1F1;';
|
272 |
}
|
273 |
|
274 |
+
$styles .='}.seopress-user-consent p {margin: 0;font-size: 0.8em;justify-content: space-around;display: flex;flex-wrap: wrap;width: 100%;';
|
275 |
|
276 |
//Text color
|
277 |
if (seopress_google_analytics_cb_txt_col_option() !='') {
|
278 |
$styles .= 'color:'.seopress_google_analytics_cb_txt_col_option().';';
|
279 |
}
|
280 |
|
281 |
+
$styles .='}.seopress-user-consent p:first-child {margin-bottom:20px} .seopress-user-consent button {vertical-align: middle;margin: 0;width: 50%;font-size: 14px;';
|
282 |
|
283 |
//Btn background color
|
284 |
if (seopress_google_analytics_cb_btn_bg_option() !='') {
|
302 |
$styles .= 'color:'.seopress_google_analytics_cb_btn_col_hov_option().';';
|
303 |
}
|
304 |
|
305 |
+
$styles .='}#seopress-user-consent-close{margin: 0;position: relative;font-weight: bold;border: 1px solid #ccc;';
|
306 |
+
|
307 |
//Background secondary button
|
308 |
if (seopress_google_analytics_cb_btn_sec_bg_option() !='') {
|
309 |
$styles .= 'background:'.seopress_google_analytics_cb_btn_sec_bg_option().';';
|
343 |
$styles .= '}';
|
344 |
}
|
345 |
|
346 |
+
$styles .='.seopress-user-consent-hide{display:none;}';
|
347 |
|
348 |
+
if (seopress_google_analytics_cb_backdrop_option() !='') {
|
349 |
+
|
350 |
+
$bg_backdrop = 'rgba(0,0,0,.65)';
|
351 |
+
if (seopress_google_analytics_cb_backdrop_bg_option() !='') {
|
352 |
+
$bg_backdrop = seopress_google_analytics_cb_backdrop_bg_option();
|
353 |
+
}
|
354 |
+
|
355 |
+
$styles .='.seopress-user-consent-backdrop{-webkit-box-align: center;
|
356 |
+
-webkit-align-items: center;
|
357 |
+
-ms-flex-align: center;
|
358 |
+
align-items: center;
|
359 |
+
background: '.$bg_backdrop.';
|
360 |
+
bottom: 0;
|
361 |
+
-webkit-box-orient: vertical;
|
362 |
+
-webkit-box-direction: normal;
|
363 |
+
-webkit-flex-direction: column;
|
364 |
+
-ms-flex-direction: column;
|
365 |
+
flex-direction: column;
|
366 |
+
left: 0;
|
367 |
+
-webkit-overflow-scrolling: touch;
|
368 |
+
overflow-y: auto;
|
369 |
+
position: fixed;
|
370 |
+
right: 0;
|
371 |
+
-webkit-tap-highlight-color: transparent;
|
372 |
+
top: 0;
|
373 |
+
z-index: 100;}';
|
374 |
+
}
|
375 |
+
|
376 |
+
$styles .='</style>';
|
377 |
+
|
378 |
$styles = apply_filters('seopress_rgpd_full_message_styles', $styles);
|
379 |
|
380 |
echo $styles;
|
inc/functions/options-import-export.php
CHANGED
@@ -282,17 +282,17 @@ function seopress_export_redirections_settings() {
|
|
282 |
//Init
|
283 |
$redirects_html = '';
|
284 |
|
285 |
-
$args =
|
286 |
'post_type' => 'seopress_404',
|
287 |
'posts_per_page' => '-1',
|
288 |
-
'meta_query' =>
|
289 |
-
|
290 |
'key' => '_seopress_redirections_type',
|
291 |
-
'value' =>
|
292 |
'compare' => 'IN',
|
293 |
-
|
294 |
-
|
295 |
-
|
296 |
$seopress_redirects_query = new WP_Query( $args );
|
297 |
|
298 |
if ( $seopress_redirects_query->have_posts() ) {
|
@@ -339,21 +339,21 @@ function seopress_export_redirections_htaccess_settings() {
|
|
339 |
//Init
|
340 |
$redirects_html = '';
|
341 |
|
342 |
-
$args =
|
343 |
'post_type' => 'seopress_404',
|
344 |
'posts_per_page' => '-1',
|
345 |
-
'meta_query' =>
|
346 |
-
|
347 |
'key' => '_seopress_redirections_type',
|
348 |
-
'value' =>
|
349 |
'compare' => 'IN',
|
350 |
-
|
351 |
-
|
352 |
'key' => '_seopress_redirections_enabled',
|
353 |
'value' => 'yes',
|
354 |
-
|
355 |
-
|
356 |
-
|
357 |
$seopress_redirects_query = new WP_Query( $args );
|
358 |
|
359 |
if ( $seopress_redirects_query->have_posts() ) {
|
@@ -559,6 +559,35 @@ function seopress_clean_404() {
|
|
559 |
}
|
560 |
add_action( 'admin_init', 'seopress_clean_404' );
|
561 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
562 |
//Reset SEOPress Notices Settings
|
563 |
function seopress_reset_notices_settings() {
|
564 |
if( empty( $_POST['seopress_action'] ) || 'reset_notices_settings' != $_POST['seopress_action'] ) {
|
@@ -612,22 +641,22 @@ function seopress_bot_links_export_settings() {
|
|
612 |
if( ! current_user_can( seopress_capability( 'manage_options', 'export_settings' ) ) ) {
|
613 |
return;
|
614 |
}
|
615 |
-
$args =
|
616 |
'post_type' => 'seopress_bot',
|
617 |
'posts_per_page' => 1000,
|
618 |
'post_status' => 'publish',
|
619 |
'order' => 'DESC',
|
620 |
'orderby' => 'date',
|
621 |
-
|
622 |
$the_query = new WP_Query( $args );
|
623 |
|
624 |
-
$settings["URL"] =
|
625 |
-
$settings["Source"] =
|
626 |
-
$settings["Source_Url"] =
|
627 |
-
$settings["Status"] =
|
628 |
-
$settings["Type"] =
|
629 |
|
630 |
-
$csv_fields =
|
631 |
$csv_fields[] = 'URL';
|
632 |
$csv_fields[] = 'Source';
|
633 |
$csv_fields[] = 'Source URL';
|
@@ -665,11 +694,11 @@ function seopress_bot_links_export_settings() {
|
|
665 |
fputcsv( $output_handle, array_merge($settings["URL"], $settings["Source"], $settings["Source_Url"], $settings["Status"], $settings["Type"]));
|
666 |
|
667 |
//Clean arrays
|
668 |
-
$settings["URL"] =
|
669 |
-
$settings["Source"] =
|
670 |
-
$settings["Source_Url"] =
|
671 |
-
$settings["Status"] =
|
672 |
-
$settings["Type"] =
|
673 |
|
674 |
}
|
675 |
wp_reset_postdata();
|
282 |
//Init
|
283 |
$redirects_html = '';
|
284 |
|
285 |
+
$args = [
|
286 |
'post_type' => 'seopress_404',
|
287 |
'posts_per_page' => '-1',
|
288 |
+
'meta_query' => [
|
289 |
+
[
|
290 |
'key' => '_seopress_redirections_type',
|
291 |
+
'value' => ['301','302','307','410','451'],
|
292 |
'compare' => 'IN',
|
293 |
+
],
|
294 |
+
],
|
295 |
+
];
|
296 |
$seopress_redirects_query = new WP_Query( $args );
|
297 |
|
298 |
if ( $seopress_redirects_query->have_posts() ) {
|
339 |
//Init
|
340 |
$redirects_html = '';
|
341 |
|
342 |
+
$args = [
|
343 |
'post_type' => 'seopress_404',
|
344 |
'posts_per_page' => '-1',
|
345 |
+
'meta_query' => [
|
346 |
+
[
|
347 |
'key' => '_seopress_redirections_type',
|
348 |
+
'value' => ['301','302','307','410','451'],
|
349 |
'compare' => 'IN',
|
350 |
+
],
|
351 |
+
[
|
352 |
'key' => '_seopress_redirections_enabled',
|
353 |
'value' => 'yes',
|
354 |
+
],
|
355 |
+
],
|
356 |
+
];
|
357 |
$seopress_redirects_query = new WP_Query( $args );
|
358 |
|
359 |
if ( $seopress_redirects_query->have_posts() ) {
|
559 |
}
|
560 |
add_action( 'admin_init', 'seopress_clean_404' );
|
561 |
|
562 |
+
//Clean all (redirects / 404 errors)
|
563 |
+
function seopress_clean_all() {
|
564 |
+
if( empty( $_POST['seopress_action'] ) || 'clean_all' != $_POST['seopress_action'] ) {
|
565 |
+
return;
|
566 |
+
}
|
567 |
+
if( ! wp_verify_nonce( $_POST['seopress_clean_all_nonce'], 'seopress_clean_all_nonce' ) ) {
|
568 |
+
return;
|
569 |
+
}
|
570 |
+
if( ! current_user_can( seopress_capability( 'manage_options', '404' ) ) ) {
|
571 |
+
return;
|
572 |
+
}
|
573 |
+
|
574 |
+
global $wpdb;
|
575 |
+
|
576 |
+
//SQL query
|
577 |
+
$sql = 'DELETE `posts`, `pm`
|
578 |
+
FROM `' . $wpdb->prefix . 'posts` AS `posts`
|
579 |
+
LEFT JOIN `' . $wpdb->prefix . 'postmeta` AS `pm` ON `pm`.`post_id` = `posts`.`ID`
|
580 |
+
WHERE `posts`.`post_type` = \'seopress_404\'';
|
581 |
+
|
582 |
+
$sql = $wpdb->prepare($sql);
|
583 |
+
|
584 |
+
$wpdb->query($sql);
|
585 |
+
|
586 |
+
wp_safe_redirect( admin_url( 'edit.php?post_type=seopress_404' ) );
|
587 |
+
exit;
|
588 |
+
}
|
589 |
+
add_action( 'admin_init', 'seopress_clean_all' );
|
590 |
+
|
591 |
//Reset SEOPress Notices Settings
|
592 |
function seopress_reset_notices_settings() {
|
593 |
if( empty( $_POST['seopress_action'] ) || 'reset_notices_settings' != $_POST['seopress_action'] ) {
|
641 |
if( ! current_user_can( seopress_capability( 'manage_options', 'export_settings' ) ) ) {
|
642 |
return;
|
643 |
}
|
644 |
+
$args = [
|
645 |
'post_type' => 'seopress_bot',
|
646 |
'posts_per_page' => 1000,
|
647 |
'post_status' => 'publish',
|
648 |
'order' => 'DESC',
|
649 |
'orderby' => 'date',
|
650 |
+
];
|
651 |
$the_query = new WP_Query( $args );
|
652 |
|
653 |
+
$settings["URL"] = [];
|
654 |
+
$settings["Source"] = [];
|
655 |
+
$settings["Source_Url"] = [];
|
656 |
+
$settings["Status"] = [];
|
657 |
+
$settings["Type"] = [];
|
658 |
|
659 |
+
$csv_fields = [];
|
660 |
$csv_fields[] = 'URL';
|
661 |
$csv_fields[] = 'Source';
|
662 |
$csv_fields[] = 'Source URL';
|
694 |
fputcsv( $output_handle, array_merge($settings["URL"], $settings["Source"], $settings["Source_Url"], $settings["Status"], $settings["Type"]));
|
695 |
|
696 |
//Clean arrays
|
697 |
+
$settings["URL"] = [];
|
698 |
+
$settings["Source"] = [];
|
699 |
+
$settings["Source_Url"] = [];
|
700 |
+
$settings["Status"] = [];
|
701 |
+
$settings["Type"] = [];
|
702 |
|
703 |
}
|
704 |
wp_reset_postdata();
|
inc/functions/options-titles-metas.php
CHANGED
@@ -1386,6 +1386,9 @@ if (seopress_titles_nositelinkssearchbox_option()) {
|
|
1386 |
}
|
1387 |
|
1388 |
//link rel prev/next
|
|
|
|
|
|
|
1389 |
if (seopress_titles_paged_rel_option()) {
|
1390 |
function seopress_titles_paged_rel_hook() {
|
1391 |
global $paged;
|
1386 |
}
|
1387 |
|
1388 |
//link rel prev/next
|
1389 |
+
if(seopress_advanced_advanced_trailingslash_option()){
|
1390 |
+
add_filter( 'get_pagenum_link', 'user_trailingslashit' );
|
1391 |
+
}
|
1392 |
if (seopress_titles_paged_rel_option()) {
|
1393 |
function seopress_titles_paged_rel_hook() {
|
1394 |
global $paged;
|
inc/functions/options.php
CHANGED
@@ -246,6 +246,18 @@ if (seopress_get_toggle_option('google-analytics') =='1') {
|
|
246 |
}
|
247 |
}
|
248 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
249 |
|
250 |
//User Consent JS
|
251 |
function seopress_google_analytics_cookies_js() {
|
@@ -255,9 +267,17 @@ if (seopress_get_toggle_option('google-analytics') =='1') {
|
|
255 |
|
256 |
wp_enqueue_script( 'seopress-cookies-ajax', plugins_url( 'assets/js/seopress-cookies-ajax' . $prefix . '.js', dirname( dirname( __FILE__ ) ) ), [ 'jquery', 'seopress-cookies' ], SEOPRESS_VERSION, true );
|
257 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
258 |
$seopress_cookies_user_consent = [
|
259 |
'seopress_nonce' => wp_create_nonce('seopress_cookies_user_consent_nonce'),
|
260 |
'seopress_cookies_user_consent' => admin_url('admin-ajax.php'),
|
|
|
261 |
];
|
262 |
wp_localize_script( 'seopress-cookies-ajax', 'seopressAjaxGAUserConsent', $seopress_cookies_user_consent );
|
263 |
}
|
246 |
}
|
247 |
}
|
248 |
}
|
249 |
+
|
250 |
+
//Cookie expiration date
|
251 |
+
function seopress_google_analytics_cb_exp_date_option() {
|
252 |
+
$seopress_google_analytics_cb_exp_date_option = get_option("seopress_google_analytics_option_name");
|
253 |
+
if ( ! empty ( $seopress_google_analytics_cb_exp_date_option ) ) {
|
254 |
+
foreach ($seopress_google_analytics_cb_exp_date_option as $key => $seopress_google_analytics_cb_exp_date_value)
|
255 |
+
$options[$key] = $seopress_google_analytics_cb_exp_date_value;
|
256 |
+
if (isset($seopress_google_analytics_cb_exp_date_option['seopress_google_analytics_cb_exp_date'])) {
|
257 |
+
return $seopress_google_analytics_cb_exp_date_option['seopress_google_analytics_cb_exp_date'];
|
258 |
+
}
|
259 |
+
}
|
260 |
+
}
|
261 |
|
262 |
//User Consent JS
|
263 |
function seopress_google_analytics_cookies_js() {
|
267 |
|
268 |
wp_enqueue_script( 'seopress-cookies-ajax', plugins_url( 'assets/js/seopress-cookies-ajax' . $prefix . '.js', dirname( dirname( __FILE__ ) ) ), [ 'jquery', 'seopress-cookies' ], SEOPRESS_VERSION, true );
|
269 |
|
270 |
+
$days = 30;
|
271 |
+
|
272 |
+
if (seopress_google_analytics_cb_exp_date_option()) {
|
273 |
+
$days = seopress_google_analytics_cb_exp_date_option();
|
274 |
+
}
|
275 |
+
$days = apply_filters('seopress_cookies_expiration_days', $days);
|
276 |
+
|
277 |
$seopress_cookies_user_consent = [
|
278 |
'seopress_nonce' => wp_create_nonce('seopress_cookies_user_consent_nonce'),
|
279 |
'seopress_cookies_user_consent' => admin_url('admin-ajax.php'),
|
280 |
+
'seopress_cookies_expiration_days' => $days,
|
281 |
];
|
282 |
wp_localize_script( 'seopress-cookies-ajax', 'seopressAjaxGAUserConsent', $seopress_cookies_user_consent );
|
283 |
}
|
inc/functions/sitemap/template-xml-sitemaps-single-term.php
CHANGED
@@ -26,6 +26,20 @@ function seopress_xml_sitemap_single_term() {
|
|
26 |
$path = get_query_var( 'seopress_cpt');
|
27 |
}
|
28 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
29 |
$home_url = home_url().'/';
|
30 |
|
31 |
if (function_exists('pll_home_url')) {
|
@@ -36,48 +50,42 @@ function seopress_xml_sitemap_single_term() {
|
|
36 |
$seopress_sitemaps .='<?xml-stylesheet type="text/xsl" href="'.$home_url.'sitemaps_xsl.xsl"?>';
|
37 |
$seopress_sitemaps .= "\n";
|
38 |
$seopress_sitemaps .= apply_filters('seopress_sitemaps_urlset', '<urlset xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://www.sitemaps.org/schemas/sitemap/0.9 http://www.sitemaps.org/schemas/sitemap/0.9/sitemap.xsd" xmlns="http://www.sitemaps.org/schemas/sitemap/0.9">' );
|
|
|
39 |
$args = [
|
40 |
'taxonomy' => $path,
|
41 |
-
'
|
42 |
-
'
|
43 |
-
'
|
44 |
-
|
45 |
-
[
|
46 |
-
'key' => '_seopress_robots_index',
|
47 |
-
'value' => '',
|
48 |
-
'compare' => 'NOT EXISTS'
|
49 |
-
],
|
50 |
-
[
|
51 |
-
'key' => '_seopress_robots_index',
|
52 |
-
'value' => 'yes',
|
53 |
-
'compare' => '!='
|
54 |
-
]
|
55 |
-
],
|
56 |
-
'fields' => 'ids',
|
57 |
'lang' => ''
|
58 |
];
|
59 |
|
60 |
$args = apply_filters('seopress_sitemaps_single_term_query', $args, $path);
|
61 |
-
|
62 |
-
|
63 |
-
|
64 |
-
|
65 |
-
|
66 |
-
|
67 |
-
|
68 |
-
|
69 |
-
|
70 |
-
|
71 |
-
|
72 |
-
|
73 |
-
|
74 |
-
|
75 |
-
|
76 |
-
|
77 |
-
|
78 |
-
|
79 |
-
|
80 |
-
|
|
|
|
|
|
|
|
|
|
|
81 |
}
|
82 |
$seopress_sitemaps .= '</urlset>';
|
83 |
$seopress_sitemaps .= "\n";
|
26 |
$path = get_query_var( 'seopress_cpt');
|
27 |
}
|
28 |
|
29 |
+
$offset = basename(parse_url($_SERVER['REQUEST_URI'], PHP_URL_PATH), ".xml");
|
30 |
+
$offset = preg_match_all('/\d+/', $offset, $matches);
|
31 |
+
$offset = end($matches[0]);
|
32 |
+
|
33 |
+
//Max posts per paginated sitemap
|
34 |
+
$max = 1000;
|
35 |
+
$max = apply_filters('seopress_sitemaps_max_terms_per_sitemap', $max);
|
36 |
+
|
37 |
+
if (isset($offset) && absint($offset) && $offset !='' && $offset !=0) {
|
38 |
+
$offset = (($offset-1)*$max);
|
39 |
+
} else {
|
40 |
+
$offset = 0;
|
41 |
+
}
|
42 |
+
|
43 |
$home_url = home_url().'/';
|
44 |
|
45 |
if (function_exists('pll_home_url')) {
|
50 |
$seopress_sitemaps .='<?xml-stylesheet type="text/xsl" href="'.$home_url.'sitemaps_xsl.xsl"?>';
|
51 |
$seopress_sitemaps .= "\n";
|
52 |
$seopress_sitemaps .= apply_filters('seopress_sitemaps_urlset', '<urlset xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://www.sitemaps.org/schemas/sitemap/0.9 http://www.sitemaps.org/schemas/sitemap/0.9/sitemap.xsd" xmlns="http://www.sitemaps.org/schemas/sitemap/0.9">' );
|
53 |
+
|
54 |
$args = [
|
55 |
'taxonomy' => $path,
|
56 |
+
'offset' => $offset,
|
57 |
+
'hide_empty' => false,
|
58 |
+
'number' => 1000,
|
59 |
+
'fields' => 'ids',
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
60 |
'lang' => ''
|
61 |
];
|
62 |
|
63 |
$args = apply_filters('seopress_sitemaps_single_term_query', $args, $path);
|
64 |
+
|
65 |
+
$termslist = new WP_Term_Query( $args );
|
66 |
+
|
67 |
+
foreach ( $termslist->terms as $term ) {
|
68 |
+
|
69 |
+
if (!get_term_meta( $term, '_seopress_robots_index', true)) {
|
70 |
+
$seopress_sitemaps_url = '';
|
71 |
+
// array with all the information needed for a sitemap url
|
72 |
+
$seopress_url = [
|
73 |
+
'loc' => htmlspecialchars(urldecode(esc_url(get_term_link($term)))),
|
74 |
+
'mod' => '',
|
75 |
+
'images' => []
|
76 |
+
];
|
77 |
+
|
78 |
+
$seopress_sitemaps_url .= "\n";
|
79 |
+
$seopress_sitemaps_url .= '<url>';
|
80 |
+
$seopress_sitemaps_url .= "\n";
|
81 |
+
$seopress_sitemaps_url .= '<loc>';
|
82 |
+
$seopress_sitemaps_url .= $seopress_url['loc'];
|
83 |
+
$seopress_sitemaps_url .= '</loc>';
|
84 |
+
$seopress_sitemaps_url .= "\n";
|
85 |
+
$seopress_sitemaps_url .= '</url>';
|
86 |
+
|
87 |
+
$seopress_sitemaps .= apply_filters('seopress_sitemaps_url', $seopress_sitemaps_url, $seopress_url);
|
88 |
+
}
|
89 |
}
|
90 |
$seopress_sitemaps .= '</urlset>';
|
91 |
$seopress_sitemaps .= "\n";
|
inc/functions/sitemap/template-xml-sitemaps.php
CHANGED
@@ -47,21 +47,38 @@ function seopress_xml_sitemap_index() {
|
|
47 |
foreach (seopress_xml_sitemap_post_types_list_option() as $cpt_key => $cpt_value) {
|
48 |
foreach ($cpt_value as $_cpt_key => $_cpt_value) {
|
49 |
if($_cpt_value =='1') {
|
50 |
-
|
51 |
-
|
52 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
53 |
|
54 |
//Max posts per paginated sitemap
|
55 |
$max = 1000;
|
56 |
$max = apply_filters('seopress_sitemaps_max_posts_per_sitemap', $max);
|
57 |
-
|
58 |
-
$
|
59 |
-
|
60 |
-
$published_posts = $count_posts->publish;
|
61 |
-
}
|
62 |
-
|
63 |
-
if ($published_posts >= $max) {
|
64 |
-
$max_loop = $published_posts / $max;
|
65 |
} else {
|
66 |
$max_loop = 1;
|
67 |
}
|
@@ -91,7 +108,7 @@ function seopress_xml_sitemap_index() {
|
|
91 |
$seopress_sitemaps .= "\n";
|
92 |
|
93 |
//Remove lastmod column in index sitemap for lage sitemap
|
94 |
-
$display_lastmod = apply_filters( 'seopress_sitemaps_index_lastmod',
|
95 |
|
96 |
if ($display_lastmod == true) {
|
97 |
$args = [
|
@@ -145,31 +162,68 @@ function seopress_xml_sitemap_index() {
|
|
145 |
foreach (seopress_xml_sitemap_taxonomies_list_option() as $tax_key => $tax_value) {
|
146 |
foreach ($tax_value as $_tax_key => $_tax_value) {
|
147 |
if($_tax_value =='1') {
|
148 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
149 |
}
|
150 |
}
|
151 |
}
|
152 |
-
foreach ($seopress_xml_terms_list as $term_value) {
|
153 |
-
$args = [
|
154 |
-
'taxonomy' => $term_value,
|
155 |
-
'hide_empty' => false,
|
156 |
-
'lang' => ''
|
157 |
-
];
|
158 |
-
$args = apply_filters('seopress_sitemaps_index_tax_query', $args, $term_value);
|
159 |
-
|
160 |
-
$terms = get_terms($args);
|
161 |
-
|
162 |
-
if (!empty($terms)) {
|
163 |
-
$seopress_sitemaps .= "\n";
|
164 |
-
$seopress_sitemaps .= '<sitemap>';
|
165 |
-
$seopress_sitemaps .= "\n";
|
166 |
-
$seopress_sitemaps .= '<loc>';
|
167 |
-
$seopress_sitemaps .= $home_url.'sitemaps/'.$term_value.'-sitemap.xml';
|
168 |
-
$seopress_sitemaps .= '</loc>';
|
169 |
-
$seopress_sitemaps .= "\n";
|
170 |
-
$seopress_sitemaps .= '</sitemap>';
|
171 |
-
}
|
172 |
-
}
|
173 |
}
|
174 |
|
175 |
//Google News
|
@@ -236,14 +290,100 @@ function seopress_xml_sitemap_index() {
|
|
236 |
|
237 |
//Video sitemap
|
238 |
if (function_exists("seopress_xml_sitemap_video_enable_option") && seopress_xml_sitemap_video_enable_option() !='') {
|
239 |
-
|
240 |
-
|
241 |
-
|
242 |
-
|
243 |
-
|
244 |
-
|
245 |
-
|
246 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
247 |
}
|
248 |
|
249 |
//Author sitemap
|
47 |
foreach (seopress_xml_sitemap_post_types_list_option() as $cpt_key => $cpt_value) {
|
48 |
foreach ($cpt_value as $_cpt_key => $_cpt_value) {
|
49 |
if($_cpt_value =='1') {
|
50 |
+
$args = [
|
51 |
+
'posts_per_page' => -1,
|
52 |
+
'post_type' => $cpt_key,
|
53 |
+
'post_status' => 'publish',
|
54 |
+
'meta_query' => [
|
55 |
+
'relation' => 'OR',
|
56 |
+
[
|
57 |
+
'key' => '_seopress_robots_index',
|
58 |
+
'value' => '',
|
59 |
+
'compare' => 'NOT EXISTS'
|
60 |
+
],
|
61 |
+
[
|
62 |
+
'key' => '_seopress_robots_index',
|
63 |
+
'value' => 'yes',
|
64 |
+
'compare' => '!='
|
65 |
+
]
|
66 |
+
],
|
67 |
+
'fields' => 'ids',
|
68 |
+
'lang' => '',
|
69 |
+
'has_password' => false
|
70 |
+
];
|
71 |
+
|
72 |
+
$args = apply_filters('seopress_sitemaps_index_post_types_query', $args, $cpt_key);
|
73 |
+
|
74 |
+
$count_posts = count(get_posts( $args ));
|
75 |
|
76 |
//Max posts per paginated sitemap
|
77 |
$max = 1000;
|
78 |
$max = apply_filters('seopress_sitemaps_max_posts_per_sitemap', $max);
|
79 |
+
|
80 |
+
if ($count_posts >= $max) {
|
81 |
+
$max_loop = $count_posts / $max;
|
|
|
|
|
|
|
|
|
|
|
82 |
} else {
|
83 |
$max_loop = 1;
|
84 |
}
|
108 |
$seopress_sitemaps .= "\n";
|
109 |
|
110 |
//Remove lastmod column in index sitemap for lage sitemap
|
111 |
+
$display_lastmod = apply_filters( 'seopress_sitemaps_index_lastmod', false );
|
112 |
|
113 |
if ($display_lastmod == true) {
|
114 |
$args = [
|
162 |
foreach (seopress_xml_sitemap_taxonomies_list_option() as $tax_key => $tax_value) {
|
163 |
foreach ($tax_value as $_tax_key => $_tax_value) {
|
164 |
if($_tax_value =='1') {
|
165 |
+
$args = [
|
166 |
+
'taxonomy' => $tax_key,
|
167 |
+
'hide_empty' => false,
|
168 |
+
'lang' => '',
|
169 |
+
'fields' => 'ids',
|
170 |
+
'meta_query' => [
|
171 |
+
'relation' => 'OR',
|
172 |
+
[
|
173 |
+
'key' => '_seopress_robots_index',
|
174 |
+
'value' => '',
|
175 |
+
'compare' => 'NOT EXISTS'
|
176 |
+
],
|
177 |
+
[
|
178 |
+
'key' => '_seopress_robots_index',
|
179 |
+
'value' => 'yes',
|
180 |
+
'compare' => '!='
|
181 |
+
]
|
182 |
+
],
|
183 |
+
];
|
184 |
+
|
185 |
+
$args = apply_filters('seopress_sitemaps_index_tax_query', $args, $tax_key);
|
186 |
+
|
187 |
+
$count_terms = wp_count_terms($tax_key, $args);
|
188 |
+
|
189 |
+
//Max terms per paginated sitemap
|
190 |
+
$max = 1000;
|
191 |
+
$max = apply_filters('seopress_sitemaps_max_terms_per_sitemap', $max);
|
192 |
+
|
193 |
+
if ($count_terms >= $max) {
|
194 |
+
$max_loop = $count_terms / $max;
|
195 |
+
} else {
|
196 |
+
$max_loop = 1;
|
197 |
+
}
|
198 |
+
|
199 |
+
$paged ='';
|
200 |
+
$i = '';
|
201 |
+
for ($i=0; $i < $max_loop ; $i++) {
|
202 |
+
|
203 |
+
if (isset($offset) && absint($offset) && $offset !='' && $offset !=0) {
|
204 |
+
$offset = ((($i)*$max));
|
205 |
+
} else {
|
206 |
+
$offset = 0;
|
207 |
+
}
|
208 |
+
|
209 |
+
if ($i >= 1 && $i <= $max_loop) {
|
210 |
+
$paged = $i+1;
|
211 |
+
} else {
|
212 |
+
$paged = 1;
|
213 |
+
}
|
214 |
+
|
215 |
+
$seopress_sitemaps .= "\n";
|
216 |
+
$seopress_sitemaps .= '<sitemap>';
|
217 |
+
$seopress_sitemaps .= "\n";
|
218 |
+
$seopress_sitemaps .= '<loc>';
|
219 |
+
$seopress_sitemaps .= $home_url.'sitemaps/'.$tax_key.'-sitemap'.$paged.'.xml';
|
220 |
+
$seopress_sitemaps .= '</loc>';
|
221 |
+
$seopress_sitemaps .= "\n";
|
222 |
+
$seopress_sitemaps .= '</sitemap>';
|
223 |
+
}
|
224 |
}
|
225 |
}
|
226 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
227 |
}
|
228 |
|
229 |
//Google News
|
290 |
|
291 |
//Video sitemap
|
292 |
if (function_exists("seopress_xml_sitemap_video_enable_option") && seopress_xml_sitemap_video_enable_option() !='') {
|
293 |
+
if (seopress_xml_sitemap_post_types_list_option() !='') {
|
294 |
+
$cpt = [];
|
295 |
+
foreach (seopress_xml_sitemap_post_types_list_option() as $cpt_key => $cpt_value) {
|
296 |
+
foreach ($cpt_value as $_cpt_key => $_cpt_value) {
|
297 |
+
if($_cpt_value =='1') {
|
298 |
+
$cpt[] = $cpt_key;
|
299 |
+
}
|
300 |
+
}
|
301 |
+
}
|
302 |
+
}
|
303 |
+
|
304 |
+
$args = [
|
305 |
+
'post_type' => $cpt,
|
306 |
+
'post_status' => 'publish',
|
307 |
+
'ignore_sticky_posts' => true,
|
308 |
+
'posts_per_page' => -1,
|
309 |
+
'meta_query' => [
|
310 |
+
'relation' => 'AND',
|
311 |
+
[
|
312 |
+
'relation' => 'OR',
|
313 |
+
[
|
314 |
+
'key' => '_seopress_robots_index',
|
315 |
+
'value' => '',
|
316 |
+
'compare' => 'NOT EXISTS'
|
317 |
+
],
|
318 |
+
[
|
319 |
+
'key' => '_seopress_robots_index',
|
320 |
+
'value' => 'yes',
|
321 |
+
'compare' => '!='
|
322 |
+
],
|
323 |
+
],
|
324 |
+
[
|
325 |
+
'relation' => 'OR',
|
326 |
+
[
|
327 |
+
'key' => '_seopress_video_disabled',
|
328 |
+
'value' => '',
|
329 |
+
'compare' => 'NOT EXISTS'
|
330 |
+
],
|
331 |
+
[
|
332 |
+
'key' => '_seopress_video_disabled',
|
333 |
+
'value' => 'yes',
|
334 |
+
'compare' => '!='
|
335 |
+
],
|
336 |
+
],
|
337 |
+
[
|
338 |
+
'key' => '_seopress_video',
|
339 |
+
'compare' => 'EXISTS'
|
340 |
+
]
|
341 |
+
],
|
342 |
+
'lang' => '',
|
343 |
+
'has_password' => false,
|
344 |
+
'fields' => 'ids',
|
345 |
+
];
|
346 |
+
|
347 |
+
$args = apply_filters('seopress_sitemaps_index_video_query', $args, $cpt_key);
|
348 |
+
|
349 |
+
$count_posts = count(get_posts( $args ));
|
350 |
+
|
351 |
+
|
352 |
+
//Max posts per paginated sitemap
|
353 |
+
$max = 1000;
|
354 |
+
$max = apply_filters('seopress_sitemaps_max_videos_per_sitemap', $max);
|
355 |
+
|
356 |
+
if ($count_posts >= $max) {
|
357 |
+
$max_loop = $count_posts / $max;
|
358 |
+
} else {
|
359 |
+
$max_loop = 1;
|
360 |
+
}
|
361 |
+
|
362 |
+
$paged ='';
|
363 |
+
$i = '';
|
364 |
+
for ($i=0; $i < $max_loop ; $i++) {
|
365 |
+
|
366 |
+
if (isset($offset) && absint($offset) && $offset !='' && $offset !=0) {
|
367 |
+
$offset = ((($i)*$max));
|
368 |
+
} else {
|
369 |
+
$offset = 0;
|
370 |
+
}
|
371 |
+
|
372 |
+
if ($i >= 1 && $i <= $max_loop) {
|
373 |
+
$paged = $i+1;
|
374 |
+
} else {
|
375 |
+
$paged = 1;
|
376 |
+
}
|
377 |
+
|
378 |
+
$seopress_sitemaps .= "\n";
|
379 |
+
$seopress_sitemaps .= '<sitemap>';
|
380 |
+
$seopress_sitemaps .= "\n";
|
381 |
+
$seopress_sitemaps .= '<loc>';
|
382 |
+
$seopress_sitemaps .= $home_url.'sitemaps/video'.$paged.'.xml';
|
383 |
+
$seopress_sitemaps .= '</loc>';
|
384 |
+
$seopress_sitemaps .= "\n";
|
385 |
+
$seopress_sitemaps .= '</sitemap>';
|
386 |
+
}
|
387 |
}
|
388 |
|
389 |
//Author sitemap
|
languages/wp-seopress.pot
CHANGED
@@ -3,7 +3,7 @@ msgid ""
|
|
3 |
msgstr ""
|
4 |
"Project-Id-Version: SEOPress\n"
|
5 |
"Report-Msgid-Bugs-To: http://wordpress.org/tag/wp-cloudy\n"
|
6 |
-
"POT-Creation-Date: 2020-
|
7 |
"PO-Revision-Date: 2019-08-22 12:52+0200\n"
|
8 |
"Last-Translator: \n"
|
9 |
"Language-Team: Benjamin DENIS <contact@seopress.org>\n"
|
@@ -18,6 +18,188 @@ msgstr ""
|
|
18 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
"X-Poedit-SearchPath-0: .\n"
|
20 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
21 |
#: inc/admin/admin-features-list.php:15
|
22 |
msgid "Titles & metas"
|
23 |
msgstr ""
|
@@ -48,7 +230,7 @@ msgstr ""
|
|
48 |
#: inc/admin/admin-features-list.php:233 inc/admin/admin-features-list.php:252
|
49 |
#: inc/admin/admin-features-list.php:271 inc/admin/admin-features-list.php:290
|
50 |
#: inc/admin/admin-features-list.php:338 inc/admin/admin-features-list.php:356
|
51 |
-
#: inc/admin/admin.php:
|
52 |
msgid "Read our guide"
|
53 |
msgstr ""
|
54 |
|
@@ -56,7 +238,7 @@ msgstr ""
|
|
56 |
msgid "Guide to manage your titles and meta descriptions - new window"
|
57 |
msgstr ""
|
58 |
|
59 |
-
#: inc/admin/admin-features-list.php:31 inc/admin/admin.php:
|
60 |
msgid "XML / Image / Video / HTML Sitemap"
|
61 |
msgstr ""
|
62 |
|
@@ -69,7 +251,7 @@ msgid "Guide to enable your XML Sitemaps - new window"
|
|
69 |
msgstr ""
|
70 |
|
71 |
#: inc/admin/admin-features-list.php:47 inc/admin/admin-header.php:57
|
72 |
-
#: inc/admin/admin.php:
|
73 |
msgid "Social Networks"
|
74 |
msgstr ""
|
75 |
|
@@ -82,7 +264,7 @@ msgid "Guide to enable Google Knowledge Graph - new window"
|
|
82 |
msgstr ""
|
83 |
|
84 |
#: inc/admin/admin-features-list.php:63 inc/admin/admin-header.php:63
|
85 |
-
#: inc/admin/admin.php:
|
86 |
msgid "Analytics"
|
87 |
msgstr ""
|
88 |
|
@@ -95,8 +277,8 @@ msgid "Guide to getting started with Google Analytics - new window"
|
|
95 |
msgstr ""
|
96 |
|
97 |
#: inc/admin/admin-features-list.php:79 inc/admin/admin-header.php:69
|
98 |
-
#: inc/admin/admin-metaboxes-form.php:
|
99 |
-
#: inc/admin/admin.php:
|
100 |
msgid "Advanced"
|
101 |
msgstr ""
|
102 |
|
@@ -105,8 +287,8 @@ msgid "Advanced SEO options for advanced users!"
|
|
105 |
msgstr ""
|
106 |
|
107 |
#: inc/admin/admin-features-list.php:90 inc/admin/admin-header.php:25
|
108 |
-
#: inc/admin/admin-header.php:77 inc/admin/adminbar.php:
|
109 |
-
#: inc/functions/options-advanced-admin.php:
|
110 |
msgid "Insights"
|
111 |
msgstr ""
|
112 |
|
@@ -220,7 +402,7 @@ msgstr ""
|
|
220 |
msgid "Guide to create your xml news sitemap - new window"
|
221 |
msgstr ""
|
222 |
|
223 |
-
#: inc/admin/admin-features-list.php:241 inc/admin/adminbar.php:
|
224 |
msgid "Schemas"
|
225 |
msgstr ""
|
226 |
|
@@ -229,7 +411,7 @@ msgid "Create / manage your schemas"
|
|
229 |
msgstr ""
|
230 |
|
231 |
#: inc/admin/admin-features-list.php:260 inc/admin/admin-header.php:142
|
232 |
-
#: inc/admin/admin.php:
|
233 |
msgid "Redirections"
|
234 |
msgstr ""
|
235 |
|
@@ -290,7 +472,7 @@ msgid "Configure default WordPress RSS."
|
|
290 |
msgstr ""
|
291 |
|
292 |
#: inc/admin/admin-features-list.php:330 inc/admin/admin-header.php:187
|
293 |
-
#: inc/admin/admin.php:
|
294 |
msgid "Tools"
|
295 |
msgstr ""
|
296 |
|
@@ -303,7 +485,7 @@ msgid "Guide to Export/Import/Reset settings - new window"
|
|
303 |
msgstr ""
|
304 |
|
305 |
#: inc/admin/admin-features-list.php:348 inc/admin/admin-header.php:180
|
306 |
-
#: inc/admin/admin-notifications-center.php:
|
307 |
msgid "License"
|
308 |
msgstr ""
|
309 |
|
@@ -355,8 +537,8 @@ msgstr ""
|
|
355 |
msgid "SEOPress"
|
356 |
msgstr ""
|
357 |
|
358 |
-
#: inc/admin/admin-header.php:31 inc/admin/admin-notifications-center.php:
|
359 |
-
#: inc/admin/adminbar.php:
|
360 |
msgid "PRO"
|
361 |
msgstr ""
|
362 |
|
@@ -364,13 +546,13 @@ msgstr ""
|
|
364 |
msgid "FREE"
|
365 |
msgstr ""
|
366 |
|
367 |
-
#: inc/admin/admin-header.php:45 inc/admin/admin.php:
|
368 |
-
#: inc/admin/adminbar.php:
|
369 |
msgid "Titles & Metas"
|
370 |
msgstr ""
|
371 |
|
372 |
-
#: inc/admin/admin-header.php:51 inc/admin/admin.php:
|
373 |
-
#: inc/admin/adminbar.php:
|
374 |
msgid "XML / HTML Sitemap"
|
375 |
msgstr ""
|
376 |
|
@@ -390,11 +572,11 @@ msgstr ""
|
|
390 |
msgid "Send feedback"
|
391 |
msgstr ""
|
392 |
|
393 |
-
#: inc/admin/admin-header.php:219 seopress.php:
|
394 |
msgid "Join our Facebook Community group"
|
395 |
msgstr ""
|
396 |
|
397 |
-
#: inc/admin/admin-header.php:223 seopress.php:
|
398 |
msgid "Follow us on Twitter"
|
399 |
msgstr ""
|
400 |
|
@@ -428,13 +610,14 @@ msgstr ""
|
|
428 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:12
|
429 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:13
|
430 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:15
|
431 |
-
#: inc/admin/
|
432 |
-
#: inc/
|
|
|
433 |
msgid "Target keywords"
|
434 |
msgstr ""
|
435 |
|
436 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:13
|
437 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
438 |
msgid ""
|
439 |
"Separate target keywords with commas. Do not use spaces after the commas, "
|
440 |
"unless you want to include them"
|
@@ -449,6 +632,7 @@ msgid "Analyze my content"
|
|
449 |
msgstr ""
|
450 |
|
451 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:20
|
|
|
452 |
msgid "Refresh analysis"
|
453 |
msgstr ""
|
454 |
|
@@ -457,6 +641,7 @@ msgid "Track with Insights"
|
|
457 |
msgstr ""
|
458 |
|
459 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:29
|
|
|
460 |
msgid ""
|
461 |
"To get the most accurate analysis, save your post first. We analyze all of "
|
462 |
"your source code as a search engine would."
|
@@ -464,71 +649,78 @@ msgstr ""
|
|
464 |
|
465 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:34
|
466 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:35
|
|
|
|
|
|
|
467 |
msgid "Google suggestions"
|
468 |
msgstr ""
|
469 |
|
470 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:35
|
|
|
471 |
msgid ""
|
472 |
"Enter a keyword, or a phrase, to find the top 10 Google suggestions "
|
473 |
"instantly. This is useful if you want to work with the long tail technique."
|
474 |
msgstr ""
|
475 |
|
476 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:37
|
|
|
477 |
msgid "Get suggestions from Google"
|
478 |
msgstr ""
|
479 |
|
480 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:39
|
|
|
481 |
msgid "Get suggestions!"
|
482 |
msgstr ""
|
483 |
|
484 |
-
#: inc/admin/admin-metaboxes-form.php:
|
485 |
-
#: inc/admin/admin-metaboxes.php:166 inc/admin/admin.php:
|
486 |
-
#: inc/admin/adminbar.php:
|
487 |
msgid "SEO"
|
488 |
msgstr ""
|
489 |
|
490 |
-
#: inc/admin/admin-metaboxes-form.php:
|
491 |
msgid "Titles settings"
|
492 |
msgstr ""
|
493 |
|
494 |
-
#: inc/admin/admin-metaboxes-form.php:
|
495 |
msgid "Social"
|
496 |
msgstr ""
|
497 |
|
498 |
-
#: inc/admin/admin-metaboxes-form.php:
|
499 |
msgid "Redirection"
|
500 |
msgstr ""
|
501 |
|
502 |
-
#: inc/admin/admin-metaboxes-form.php:
|
503 |
msgid "Google News"
|
504 |
msgstr ""
|
505 |
|
506 |
-
#: inc/admin/admin-metaboxes-form.php:
|
507 |
msgid "Video Sitemap"
|
508 |
msgstr ""
|
509 |
|
510 |
-
#: inc/admin/admin-metaboxes-form.php:
|
511 |
msgid ""
|
512 |
"This is your <strong>Shop page</strong>. Go to <strong>SEO > Titles & Metas "
|
513 |
"> Archives > Products</strong> "
|
514 |
msgstr ""
|
515 |
|
516 |
-
#: inc/admin/admin-metaboxes-form.php:
|
517 |
msgid "to edit your title and meta description"
|
518 |
msgstr ""
|
519 |
|
520 |
-
#: inc/admin/admin-metaboxes-form.php:
|
521 |
-
#: inc/admin/admin-metaboxes-form.php:
|
522 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
523 |
msgid "Title"
|
524 |
msgstr ""
|
525 |
|
526 |
-
#: inc/admin/admin-metaboxes-form.php:
|
527 |
#: inc/admin/admin-metaboxes-get-content-analysis.php:37
|
|
|
528 |
msgid "Meta title"
|
529 |
msgstr ""
|
530 |
|
531 |
-
#: inc/admin/admin-metaboxes-form.php:
|
532 |
msgid ""
|
533 |
"Titles are critical to give users a quick insight into the content of a "
|
534 |
"result and why it’s relevant to their query. It's often the primary piece of "
|
@@ -536,60 +728,52 @@ msgid ""
|
|
536 |
"use high-quality titles on your web pages."
|
537 |
msgstr ""
|
538 |
|
539 |
-
#: inc/admin/admin-metaboxes-form.php:
|
540 |
msgid "Enter your title"
|
541 |
msgstr ""
|
542 |
|
543 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
544 |
msgid " / 568 pixels - "
|
545 |
msgstr ""
|
546 |
|
547 |
-
#: inc/admin/admin-metaboxes-form.php:
|
548 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
549 |
msgid " (maximum recommended limit)"
|
550 |
msgstr ""
|
551 |
|
552 |
-
#: inc/admin/admin-metaboxes-form.php:
|
553 |
msgid "Term Title"
|
554 |
msgstr ""
|
555 |
|
556 |
-
#: inc/admin/admin-metaboxes-form.php:
|
557 |
-
#: inc/admin/admin.php:
|
558 |
-
|
559 |
-
|
560 |
-
|
561 |
-
#: inc/admin/
|
562 |
-
#: inc/admin/admin.php:3123 inc/admin/admin.php:3229 inc/admin/admin.php:3345
|
563 |
-
#: inc/admin/admin.php:3474 inc/admin/admin.php:3597 inc/admin/admin.php:3675
|
564 |
-
#: inc/admin/admin.php:3746 inc/admin/admin.php:3816 inc/admin/admin.php:3866
|
565 |
-
msgid "Site Title"
|
566 |
-
msgstr ""
|
567 |
-
|
568 |
-
#: inc/admin/admin-metaboxes-form.php:130 inc/admin/admin-wizard.php:508
|
569 |
-
#: inc/admin/admin.php:1287 inc/admin/admin.php:3110 inc/admin/admin.php:3124
|
570 |
-
#: inc/admin/admin.php:3227 inc/admin/admin.php:3344 inc/admin/admin.php:3472
|
571 |
-
#: inc/admin/admin.php:3595 inc/admin/admin.php:3674 inc/admin/admin.php:3745
|
572 |
-
#: inc/admin/admin.php:3815 inc/admin/admin.php:3867
|
573 |
msgid "Separator"
|
574 |
msgstr ""
|
575 |
|
576 |
-
#: inc/admin/admin-metaboxes-form.php:
|
577 |
-
#: inc/admin/admin-metaboxes-form.php:
|
578 |
-
#: inc/admin/admin-metaboxes-form.php:
|
579 |
#: inc/admin/admin-metaboxes-get-content-analysis.php:42
|
580 |
#: inc/admin/admin-wizard.php:303 inc/admin/admin-wizard.php:323
|
581 |
#: inc/admin/admin-wizard.php:340 inc/admin/admin-wizard.php:359
|
582 |
#: inc/admin/admin-wizard.php:378 inc/admin/admin-wizard.php:396
|
583 |
#: inc/admin/admin-wizard.php:413 inc/admin/admin-wizard.php:429
|
584 |
-
#: inc/admin/admin-wizard.php:448 inc/admin/admin.php:
|
585 |
-
#: inc/admin/admin.php:
|
586 |
-
#: inc/admin/admin.php:
|
587 |
-
#: inc/admin/admin.php:
|
588 |
-
#: inc/admin/admin.php:
|
|
|
589 |
msgid "Meta description"
|
590 |
msgstr ""
|
591 |
|
592 |
-
#: inc/admin/admin-metaboxes-form.php:
|
593 |
msgid ""
|
594 |
"A meta description tag should generally inform and interest users with a "
|
595 |
"short, relevant summary of what a particular page is about. <br>They are "
|
@@ -599,31 +783,34 @@ msgid ""
|
|
599 |
"device width."
|
600 |
msgstr ""
|
601 |
|
602 |
-
#: inc/admin/admin-metaboxes-form.php:
|
603 |
msgid "Enter your meta description"
|
604 |
msgstr ""
|
605 |
|
606 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
607 |
msgid " / 940 pixels - "
|
608 |
msgstr ""
|
609 |
|
610 |
-
#: inc/admin/admin-metaboxes-form.php:
|
611 |
msgid "Category / term description"
|
612 |
msgstr ""
|
613 |
|
614 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
615 |
msgid "Post Excerpt"
|
616 |
msgstr ""
|
617 |
|
618 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
619 |
msgid "Google Snippet Preview"
|
620 |
msgstr ""
|
621 |
|
622 |
-
#: inc/admin/admin-metaboxes-form.php:
|
623 |
msgid "Snippet Preview"
|
624 |
msgstr ""
|
625 |
|
626 |
-
#: inc/admin/admin-metaboxes-form.php:
|
627 |
msgid ""
|
628 |
"The Google preview is a simulation. <br>There is no reliable preview because "
|
629 |
"it depends on the screen resolution, the device used, the expression sought, "
|
@@ -632,130 +819,132 @@ msgid ""
|
|
632 |
"what the crawlers will see."
|
633 |
msgstr ""
|
634 |
|
635 |
-
#: inc/admin/admin-metaboxes-form.php:
|
636 |
msgid ""
|
637 |
"This is what your page will look like in Google search results. You have to "
|
638 |
"publish your post to get the Google Snippet Preview."
|
639 |
msgstr ""
|
640 |
|
641 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
642 |
msgid "Mobile Preview"
|
643 |
msgstr ""
|
644 |
|
645 |
-
#: inc/admin/admin-metaboxes-form.php:
|
646 |
msgid ""
|
647 |
"Do not display this page in search engine results / XML - HTML sitemaps "
|
648 |
"<strong>(noindex)</strong>"
|
649 |
msgstr ""
|
650 |
|
651 |
-
#: inc/admin/admin-metaboxes-form.php:
|
652 |
msgid "\"noindex\" robots meta tag"
|
653 |
msgstr ""
|
654 |
|
655 |
-
#: inc/admin/admin-metaboxes-form.php:
|
656 |
msgid ""
|
657 |
"By checking this option, you will add a meta robots tag with the value "
|
658 |
"\"noindex\". <br>Search engines will not index this URL in the search "
|
659 |
"results."
|
660 |
msgstr ""
|
661 |
|
662 |
-
#: inc/admin/admin-metaboxes-form.php:
|
663 |
msgid "Do not follow links for this page <strong>(nofollow)</strong>"
|
664 |
msgstr ""
|
665 |
|
666 |
-
#: inc/admin/admin-metaboxes-form.php:
|
667 |
msgid "\"nofollow\" robots meta tag"
|
668 |
msgstr ""
|
669 |
|
670 |
-
#: inc/admin/admin-metaboxes-form.php:
|
671 |
msgid ""
|
672 |
"By checking this option, you will add a meta robots tag with the value "
|
673 |
"\"nofollow\". <br>Search engines will not follow links from this URL."
|
674 |
msgstr ""
|
675 |
|
676 |
-
#: inc/admin/admin-metaboxes-form.php:
|
677 |
msgid ""
|
678 |
"Do not use Open Directory project metadata for titles or excerpts for this "
|
679 |
"page <strong>(noodp)</strong>"
|
680 |
msgstr ""
|
681 |
|
682 |
-
#: inc/admin/admin-metaboxes-form.php:
|
683 |
msgid "\"noodp\" robots meta tag"
|
684 |
msgstr ""
|
685 |
|
686 |
-
#: inc/admin/admin-metaboxes-form.php:
|
687 |
msgid ""
|
688 |
"By checking this option, you will add a meta robots tag with the value "
|
689 |
"\"noodp\". <br>Note that Google and Yahoo have stopped considering this tag "
|
690 |
"since the closing of DMOZ directory."
|
691 |
msgstr ""
|
692 |
|
693 |
-
#: inc/admin/admin-metaboxes-form.php:
|
694 |
msgid "Do not index images for this page <strong>(noimageindex)</strong>"
|
695 |
msgstr ""
|
696 |
|
697 |
-
#: inc/admin/admin-metaboxes-form.php:
|
698 |
msgid "\"noimageindex\" robots meta tag"
|
699 |
msgstr ""
|
700 |
|
701 |
-
#: inc/admin/admin-metaboxes-form.php:
|
702 |
msgid ""
|
703 |
"By checking this option, you will add a meta robots tag with the value "
|
704 |
"\"noimageindex\". <br> Note that your images can always be indexed if they "
|
705 |
"are linked from other pages."
|
706 |
msgstr ""
|
707 |
|
708 |
-
#: inc/admin/admin-metaboxes-form.php:
|
709 |
msgid ""
|
710 |
"Do not display a \"Cached\" link in the Google search results "
|
711 |
"<strong>(noarchive)</strong>"
|
712 |
msgstr ""
|
713 |
|
714 |
-
#: inc/admin/admin-metaboxes-form.php:
|
715 |
msgid "\"noarchive\" robots meta tag"
|
716 |
msgstr ""
|
717 |
|
718 |
-
#: inc/admin/admin-metaboxes-form.php:
|
719 |
msgid ""
|
720 |
"By checking this option, you will add a meta robots tag with the value "
|
721 |
"\"noarchive\"."
|
722 |
msgstr ""
|
723 |
|
724 |
-
#: inc/admin/admin-metaboxes-form.php:
|
725 |
msgid ""
|
726 |
"Do not display a description in search results for this page "
|
727 |
"<strong>(nosnippet)</strong>"
|
728 |
msgstr ""
|
729 |
|
730 |
-
#: inc/admin/admin-metaboxes-form.php:
|
731 |
msgid "\"nosnippet\" robots meta tag"
|
732 |
msgstr ""
|
733 |
|
734 |
-
#: inc/admin/admin-metaboxes-form.php:
|
735 |
msgid ""
|
736 |
"By checking this option, you will add a meta robots tag with the value "
|
737 |
"\"nosnippet\"."
|
738 |
msgstr ""
|
739 |
|
740 |
-
#: inc/admin/admin-metaboxes-form.php:
|
741 |
msgid ""
|
742 |
"You cannot uncheck a parameter? This is normal, and it‘s most likely defined "
|
743 |
"in the global settings of the extension."
|
744 |
msgstr ""
|
745 |
|
746 |
-
#: inc/admin/admin-metaboxes-form.php:
|
747 |
-
#: inc/admin/admin-metaboxes-form.php:
|
748 |
-
#: inc/admin/admin-metaboxes-form.php:
|
749 |
#: inc/admin/admin-wizard.php:344 inc/admin/admin-wizard.php:363
|
750 |
#: inc/admin/admin-wizard.php:382 inc/admin/admin-wizard.php:432
|
751 |
-
#: inc/admin/admin-wizard.php:452 inc/admin/admin.php:
|
752 |
-
#: inc/admin/admin.php:
|
753 |
-
#: inc/admin/admin.php:
|
754 |
-
#: inc/admin/
|
|
|
755 |
msgid "Canonical URL"
|
756 |
msgstr ""
|
757 |
|
758 |
-
#: inc/admin/admin-metaboxes-form.php:
|
759 |
msgid ""
|
760 |
"A canonical URL is the URL of the page that Google thinks is most "
|
761 |
"representative from a set of duplicate pages on your site. <br>For example, "
|
@@ -767,454 +956,466 @@ msgid ""
|
|
767 |
"\t\t\t\t\t\t\tThe canonical can be in a different domain than a duplicate."
|
768 |
msgstr ""
|
769 |
|
770 |
-
#: inc/admin/admin-metaboxes-form.php:
|
771 |
msgid "Default value: "
|
772 |
msgstr ""
|
773 |
|
774 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
775 |
msgid "Select a primary category"
|
776 |
msgstr ""
|
777 |
|
778 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
779 |
msgid ""
|
780 |
-
"Set the category that gets used in the %category% permalink
|
781 |
-
"multiple categories."
|
782 |
msgstr ""
|
783 |
|
784 |
-
#: inc/admin/admin-metaboxes-form.php:
|
785 |
-
#: inc/admin/admin.php:
|
|
|
786 |
msgid "None (will disable this feature)"
|
787 |
msgstr ""
|
788 |
|
789 |
-
#: inc/admin/admin-metaboxes-form.php:
|
790 |
-
#: inc/admin/admin-metaboxes-form.php:
|
791 |
msgid "Custom breadcrumbs"
|
792 |
msgstr ""
|
793 |
|
794 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
795 |
msgid "Enter a custom value, useful if your title is too long"
|
796 |
msgstr ""
|
797 |
|
798 |
-
#: inc/admin/admin-metaboxes-form.php:
|
799 |
#, php-format
|
800 |
msgid "Current breadcrumbs: %s"
|
801 |
msgstr ""
|
802 |
|
803 |
-
#: inc/admin/admin-metaboxes-form.php:
|
804 |
msgid "Ask Facebook to update its cache"
|
805 |
msgstr ""
|
806 |
|
807 |
-
#: inc/admin/admin-metaboxes-form.php:
|
808 |
msgid ""
|
809 |
"<span class=\"label\">Did you know?</span> LinkedIn, Instagram and Pinterest "
|
810 |
"use the same social metadata as Facebook. Twitter does the same if no "
|
811 |
"Twitter cards tags are defined below."
|
812 |
msgstr ""
|
813 |
|
814 |
-
#: inc/admin/admin-metaboxes-form.php:
|
815 |
-
#: inc/admin/admin-metaboxes-form.php:
|
816 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
817 |
msgid "Facebook Title"
|
818 |
msgstr ""
|
819 |
|
820 |
-
#: inc/admin/admin-metaboxes-form.php:
|
821 |
msgid "Enter your Facebook title"
|
822 |
msgstr ""
|
823 |
|
824 |
-
#: inc/admin/admin-metaboxes-form.php:
|
825 |
-
#: inc/admin/admin-metaboxes-form.php:
|
826 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
827 |
msgid "Facebook description"
|
828 |
msgstr ""
|
829 |
|
830 |
-
#: inc/admin/admin-metaboxes-form.php:
|
831 |
msgid "Enter your Facebook description"
|
832 |
msgstr ""
|
833 |
|
834 |
-
#: inc/admin/admin-metaboxes-form.php:
|
835 |
-
#: inc/admin/admin-metaboxes-form.php:
|
836 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
837 |
msgid "Facebook Thumbnail"
|
838 |
msgstr ""
|
839 |
|
840 |
-
#: inc/admin/admin-metaboxes-form.php:
|
841 |
-
#: inc/admin/admin-metaboxes-form.php:
|
842 |
-
#: inc/admin/admin.php:
|
843 |
msgid "Select your default thumbnail"
|
844 |
msgstr ""
|
845 |
|
846 |
-
#: inc/admin/admin-metaboxes-form.php:
|
847 |
msgid ""
|
848 |
"Minimum size: 200x200px, ideal ratio 1.91:1, 8Mb max. (eg: 1640x856px or "
|
849 |
"3280x1712px for retina screens)"
|
850 |
msgstr ""
|
851 |
|
852 |
-
#: inc/admin/admin-metaboxes-form.php:
|
853 |
-
#: inc/admin/admin-metaboxes-form.php:
|
854 |
-
#: inc/admin/admin-metaboxes-form.php:
|
855 |
-
#: inc/admin/admin.php:
|
856 |
msgid "Upload an Image"
|
857 |
msgstr ""
|
858 |
|
859 |
-
#: inc/admin/admin-metaboxes-form.php:
|
860 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
861 |
-
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:40
|
862 |
msgid "Facebook Preview"
|
863 |
msgstr ""
|
864 |
|
865 |
-
#: inc/admin/admin-metaboxes-form.php:
|
866 |
msgid ""
|
867 |
"This is what your post will look like in Facebook. You have to publish your "
|
868 |
"post to get the Facebook Preview."
|
869 |
msgstr ""
|
870 |
|
871 |
-
#: inc/admin/admin-metaboxes-form.php:
|
872 |
msgid ""
|
873 |
"The Social Networks feature is disabled. Still seing informations from the "
|
874 |
"FB Preview? You probably have social tags added by your theme or a plugin."
|
875 |
msgstr ""
|
876 |
|
877 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
878 |
msgid "File type not supported by Facebook. Please choose another image."
|
879 |
msgstr ""
|
880 |
|
881 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
882 |
msgid ""
|
883 |
"Minimun size for Facebook is <strong>200x200px</strong>. Please choose "
|
884 |
"another image."
|
885 |
msgstr ""
|
886 |
|
887 |
-
#: inc/admin/admin-metaboxes-form.php:
|
888 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
|
|
889 |
msgid "File error. Please choose another image."
|
890 |
msgstr ""
|
891 |
|
892 |
-
#: inc/admin/admin-metaboxes-form.php:
|
893 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
|
|
894 |
msgid "Your image ratio is: "
|
895 |
msgstr ""
|
896 |
|
897 |
-
#: inc/admin/admin-metaboxes-form.php:
|
898 |
msgid "The closer to 1.91 the better."
|
899 |
msgstr ""
|
900 |
|
901 |
-
#: inc/admin/admin-metaboxes-form.php:
|
902 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
|
|
903 |
msgid "File URL is not valid."
|
904 |
msgstr ""
|
905 |
|
906 |
-
#: inc/admin/admin-metaboxes-form.php:
|
907 |
msgid "By "
|
908 |
msgstr ""
|
909 |
|
910 |
-
#: inc/admin/admin-metaboxes-form.php:
|
911 |
msgid "Preview your Twitter card using the official validator"
|
912 |
msgstr ""
|
913 |
|
914 |
-
#: inc/admin/admin-metaboxes-form.php:
|
915 |
-
#: inc/admin/admin-metaboxes-form.php:
|
916 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
917 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
918 |
msgid "Twitter Title"
|
919 |
msgstr ""
|
920 |
|
921 |
-
#: inc/admin/admin-metaboxes-form.php:
|
922 |
msgid "Enter your Twitter title"
|
923 |
msgstr ""
|
924 |
|
925 |
-
#: inc/admin/admin-metaboxes-form.php:
|
926 |
-
#: inc/admin/admin-metaboxes-form.php:
|
927 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
928 |
msgid "Twitter description"
|
929 |
msgstr ""
|
930 |
|
931 |
-
#: inc/admin/admin-metaboxes-form.php:
|
932 |
msgid "Enter your Twitter description"
|
933 |
msgstr ""
|
934 |
|
935 |
-
#: inc/admin/admin-metaboxes-form.php:
|
936 |
-
#: inc/admin/admin-metaboxes-form.php:
|
937 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
938 |
msgid "Twitter Thumbnail"
|
939 |
msgstr ""
|
940 |
|
941 |
-
#: inc/admin/admin-metaboxes-form.php:
|
942 |
msgid ""
|
943 |
"Minimum size: 144x144px (300x157px with large card enabled), ideal ratio 1:1 "
|
944 |
"(2:1 with large card), 5Mb max."
|
945 |
msgstr ""
|
946 |
|
947 |
-
#: inc/admin/admin-metaboxes-form.php:
|
948 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
949 |
-
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:59
|
950 |
msgid "Twitter Preview"
|
951 |
msgstr ""
|
952 |
|
953 |
-
#: inc/admin/admin-metaboxes-form.php:
|
954 |
msgid ""
|
955 |
"This is what your post will look like in Twitter. You have to publish your "
|
956 |
"post to get the Twitter Preview."
|
957 |
msgstr ""
|
958 |
|
959 |
-
#: inc/admin/admin-metaboxes-form.php:
|
960 |
msgid ""
|
961 |
"The Social Networks feature is disabled. Still seing informations from the "
|
962 |
"Twitter Preview? You probably have social tags added by your theme or a "
|
963 |
"plugin."
|
964 |
msgstr ""
|
965 |
|
966 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
967 |
msgid "File type not supported by Twitter. Please choose another image."
|
968 |
msgstr ""
|
969 |
|
970 |
-
#: inc/admin/admin-metaboxes-form.php:
|
|
|
971 |
msgid ""
|
972 |
"Minimun size for Twitter is <strong>144x144px</strong>. Please choose "
|
973 |
"another image."
|
974 |
msgstr ""
|
975 |
|
976 |
-
#: inc/admin/admin-metaboxes-form.php:
|
977 |
msgid "The closer to 1 the better (with large card, 2 is better)."
|
978 |
msgstr ""
|
979 |
|
980 |
-
#: inc/admin/admin-metaboxes-form.php:
|
981 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
982 |
msgid "Enable redirection?"
|
983 |
msgstr ""
|
984 |
|
985 |
-
#: inc/admin/admin-metaboxes-form.php:
|
986 |
-
#: inc/admin/admin-metaboxes-form.php:
|
987 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
988 |
msgid "URL redirection"
|
989 |
msgstr ""
|
990 |
|
991 |
-
#: inc/admin/admin-metaboxes-form.php:
|
992 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
993 |
msgid "301 Moved Permanently"
|
994 |
msgstr ""
|
995 |
|
996 |
-
#: inc/admin/admin-metaboxes-form.php:
|
997 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
998 |
msgid "302 Found / Moved Temporarily"
|
999 |
msgstr ""
|
1000 |
|
1001 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1002 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
1003 |
msgid "307 Moved Temporarily"
|
1004 |
msgstr ""
|
1005 |
|
1006 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1007 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
1008 |
msgid "410 Gone"
|
1009 |
msgstr ""
|
1010 |
|
1011 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1012 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
1013 |
msgid "451 Unavailable For Legal Reasons"
|
1014 |
msgstr ""
|
1015 |
|
1016 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1017 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
1018 |
msgid "Enter your new URL in absolute (eg: https://www.example.com/)"
|
1019 |
msgstr ""
|
1020 |
|
1021 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1022 |
msgid "Query parameters"
|
1023 |
msgstr ""
|
1024 |
|
1025 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1026 |
msgid "Exactly match all parameters"
|
1027 |
msgstr ""
|
1028 |
|
1029 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1030 |
msgid "Exclude all parameters"
|
1031 |
msgstr ""
|
1032 |
|
1033 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1034 |
msgid "Exclude all parameters and pass them to the redirection"
|
1035 |
msgstr ""
|
1036 |
|
1037 |
-
#: inc/admin/admin-metaboxes-form.php:467
|
1038 |
-
#: inc/admin/admin-metaboxes-form.php:469
|
1039 |
#: inc/admin/admin-metaboxes-form.php:472
|
1040 |
#: inc/admin/admin-metaboxes-form.php:474
|
|
|
|
|
1041 |
msgid "Test your URL"
|
1042 |
msgstr ""
|
1043 |
|
1044 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1045 |
msgid "Need help with your redirections? Read our guide."
|
1046 |
msgstr ""
|
1047 |
|
1048 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1049 |
msgid "Exclude this post from Google News Sitemap?"
|
1050 |
msgstr ""
|
1051 |
|
1052 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1053 |
msgid "Exclude this post from Video Sitemap?"
|
1054 |
msgstr ""
|
1055 |
|
1056 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1057 |
msgid ""
|
1058 |
"If your post is set to noindex, it will be automatically excluded from the "
|
1059 |
"sitemap."
|
1060 |
msgstr ""
|
1061 |
|
1062 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1063 |
msgid "Video "
|
1064 |
msgstr ""
|
1065 |
|
1066 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1067 |
msgid "Video URL (required)"
|
1068 |
msgstr ""
|
1069 |
|
1070 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1071 |
msgid "Enter your video URL"
|
1072 |
msgstr ""
|
1073 |
|
1074 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1075 |
msgid "Video URL"
|
1076 |
msgstr ""
|
1077 |
|
1078 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1079 |
msgid ""
|
1080 |
"NOT an external video (eg: video hosting on YouTube, Vimeo, Wistia...)? "
|
1081 |
"Check this if your video is hosting on this server."
|
1082 |
msgstr ""
|
1083 |
|
1084 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1085 |
msgid "Video Title (required)"
|
1086 |
msgstr ""
|
1087 |
|
1088 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1089 |
msgid "Enter your video title"
|
1090 |
msgstr ""
|
1091 |
|
1092 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1093 |
msgid "Video title"
|
1094 |
msgstr ""
|
1095 |
|
1096 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1097 |
msgid "Default: title tag, if not available, post title."
|
1098 |
msgstr ""
|
1099 |
|
1100 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1101 |
msgid "Video Description (required)"
|
1102 |
msgstr ""
|
1103 |
|
1104 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1105 |
msgid "Enter your video description"
|
1106 |
msgstr ""
|
1107 |
|
1108 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1109 |
msgid "Video description"
|
1110 |
msgstr ""
|
1111 |
|
1112 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1113 |
msgid ""
|
1114 |
"2048 characters max.; default: meta description. If not available, use the "
|
1115 |
"beginning of the post content."
|
1116 |
msgstr ""
|
1117 |
|
1118 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1119 |
msgid "Video Thumbnail (required)"
|
1120 |
msgstr ""
|
1121 |
|
1122 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1123 |
msgid "Select your video thumbnail"
|
1124 |
msgstr ""
|
1125 |
|
1126 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1127 |
msgid "Video Thumbnail"
|
1128 |
msgstr ""
|
1129 |
|
1130 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1131 |
msgid ""
|
1132 |
"Minimum size: 160x90px (1920x1080 max), JPG, PNG or GIF formats. Default: "
|
1133 |
"your post featured image."
|
1134 |
msgstr ""
|
1135 |
|
1136 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1137 |
msgid "Video Duration (recommended)"
|
1138 |
msgstr ""
|
1139 |
|
1140 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1141 |
msgid "Duration in seconds"
|
1142 |
msgstr ""
|
1143 |
|
1144 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1145 |
msgid "Video duration"
|
1146 |
msgstr ""
|
1147 |
|
1148 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1149 |
msgid ""
|
1150 |
"The duration of the video in seconds. Value must be between 0 and 28800 (8 "
|
1151 |
"hours)."
|
1152 |
msgstr ""
|
1153 |
|
1154 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1155 |
msgid "Video Rating"
|
1156 |
msgstr ""
|
1157 |
|
1158 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1159 |
msgid "Video rating"
|
1160 |
msgstr ""
|
1161 |
|
1162 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1163 |
msgid "Allowed values are float numbers in the range 0.0 to 5.0."
|
1164 |
msgstr ""
|
1165 |
|
1166 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1167 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1168 |
msgid "View count"
|
1169 |
msgstr ""
|
1170 |
|
1171 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1172 |
msgid "Number of views"
|
1173 |
msgstr ""
|
1174 |
|
1175 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1176 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1177 |
msgid "Video tags"
|
1178 |
msgstr ""
|
1179 |
|
1180 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1181 |
msgid "Enter your video tags"
|
1182 |
msgstr ""
|
1183 |
|
1184 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1185 |
msgid ""
|
1186 |
"32 tags max., separate tags with commas. Default: target keywords + post "
|
1187 |
"tags if available."
|
1188 |
msgstr ""
|
1189 |
|
1190 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1191 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1192 |
msgid "Video categories"
|
1193 |
msgstr ""
|
1194 |
|
1195 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1196 |
msgid "Enter your video categories"
|
1197 |
msgstr ""
|
1198 |
|
1199 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1200 |
msgid ""
|
1201 |
"256 characters max., usually a video will belong to a single category, "
|
1202 |
"separate categories with commas. Default: first post category if available."
|
1203 |
msgstr ""
|
1204 |
|
1205 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1206 |
msgid "NOT family friendly?"
|
1207 |
msgstr ""
|
1208 |
|
1209 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1210 |
msgid "The video will be available only to users with SafeSearch turned off."
|
1211 |
msgstr ""
|
1212 |
|
1213 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1214 |
msgid "Remove video"
|
1215 |
msgstr ""
|
1216 |
|
1217 |
-
#: inc/admin/admin-metaboxes-form.php:
|
1218 |
msgid "Add video"
|
1219 |
msgstr ""
|
1220 |
|
@@ -1286,7 +1487,7 @@ msgstr ""
|
|
1286 |
msgid ""
|
1287 |
"Search engines love fresh content. Regularly update your articles without "
|
1288 |
"having to rewrite your content entirely and give them a boost in search "
|
1289 |
-
"rankings.
|
1290 |
msgstr ""
|
1291 |
|
1292 |
#: inc/admin/admin-metaboxes-get-content-analysis.php:108
|
@@ -1463,259 +1664,291 @@ msgid ""
|
|
1463 |
"title tag from your source code. Below, the list:"
|
1464 |
msgstr ""
|
1465 |
|
1466 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
|
|
|
|
|
|
|
|
1467 |
msgid "We found an Open Graph Title tag in your source code."
|
1468 |
msgstr ""
|
1469 |
|
1470 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1471 |
msgid "Your Open Graph Title is missing!"
|
1472 |
msgstr ""
|
1473 |
|
1474 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1475 |
msgid "Open Graph Description"
|
1476 |
msgstr ""
|
1477 |
|
1478 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1479 |
#, php-format
|
1480 |
msgid "We found %d og:description in your content."
|
1481 |
msgstr ""
|
1482 |
|
1483 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1484 |
msgid ""
|
1485 |
"You should not use more than one og:description in your post content to "
|
1486 |
"avoid conflicts when sharing on social networks. Facebook will take the last "
|
1487 |
"og:description tag from your source code. Below, the list:"
|
1488 |
msgstr ""
|
1489 |
|
1490 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
|
|
|
|
|
|
|
|
1491 |
msgid "We found an Open Graph Description tag in your source code."
|
1492 |
msgstr ""
|
1493 |
|
1494 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1495 |
msgid "Your Open Graph Description is missing!"
|
1496 |
msgstr ""
|
1497 |
|
1498 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1499 |
msgid "Open Graph Image"
|
1500 |
msgstr ""
|
1501 |
|
1502 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1503 |
#, php-format
|
1504 |
msgid "We found %d og:image in your content."
|
1505 |
msgstr ""
|
1506 |
|
1507 |
#: inc/admin/admin-metaboxes-get-content-analysis.php:407
|
|
|
|
|
|
|
|
|
1508 |
msgid "Your Open Graph Image is missing!"
|
1509 |
msgstr ""
|
1510 |
|
1511 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1512 |
msgid "Open Graph URL"
|
1513 |
msgstr ""
|
1514 |
|
1515 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1516 |
#, php-format
|
1517 |
msgid "We found %d og:url in your content."
|
1518 |
msgstr ""
|
1519 |
|
1520 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1521 |
msgid ""
|
1522 |
"You should not use more than one og:url in your post content to avoid "
|
1523 |
"conflicts when sharing on social networks. Facebook will take the last og:"
|
1524 |
"url tag from your source code. Below, the list:"
|
1525 |
msgstr ""
|
1526 |
|
1527 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
|
|
|
|
|
|
|
|
1528 |
msgid "We found an Open Graph URL tag in your source code."
|
1529 |
msgstr ""
|
1530 |
|
1531 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1532 |
msgid "Your Open Graph URL is missing!"
|
1533 |
msgstr ""
|
1534 |
|
1535 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1536 |
msgid "Open Graph Site Name"
|
1537 |
msgstr ""
|
1538 |
|
1539 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1540 |
#, php-format
|
1541 |
msgid "We found %d og:site_name in your content."
|
1542 |
msgstr ""
|
1543 |
|
1544 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1545 |
msgid ""
|
1546 |
"You should not use more than one og:site_name in your post content to avoid "
|
1547 |
"conflicts when sharing on social networks. Facebook will take the last og:"
|
1548 |
"site_name tag from your source code. Below, the list:"
|
1549 |
msgstr ""
|
1550 |
|
1551 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
|
|
|
|
|
|
|
|
1552 |
msgid "We found an Open Graph Site Name tag in your source code."
|
1553 |
msgstr ""
|
1554 |
|
1555 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1556 |
msgid "Your Open Graph Site Name is missing!"
|
1557 |
msgstr ""
|
1558 |
|
1559 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1560 |
#, php-format
|
1561 |
msgid "We found %d twitter:title in your content."
|
1562 |
msgstr ""
|
1563 |
|
1564 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1565 |
msgid ""
|
1566 |
"You should not use more than one twitter:title in your post content to avoid "
|
1567 |
"conflicts when sharing on social networks. Twitter will take the last "
|
1568 |
"twitter:title tag from your source code. Below, the list:"
|
1569 |
msgstr ""
|
1570 |
|
1571 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1572 |
-
msgid "
|
1573 |
msgstr ""
|
1574 |
|
1575 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
|
|
|
|
|
|
|
|
1576 |
msgid "Your Twitter Title is missing!"
|
1577 |
msgstr ""
|
1578 |
|
1579 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1580 |
msgid "Twitter Description"
|
1581 |
msgstr ""
|
1582 |
|
1583 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1584 |
#, php-format
|
1585 |
msgid "We found %d twitter:description in your content."
|
1586 |
msgstr ""
|
1587 |
|
1588 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1589 |
msgid ""
|
1590 |
"You should not use more than one twitter:description in your post content to "
|
1591 |
"avoid conflicts when sharing on social networks. Twitter will take the last "
|
1592 |
"twitter:description tag from your source code. Below, the list:"
|
1593 |
msgstr ""
|
1594 |
|
1595 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
|
|
|
|
|
|
|
|
1596 |
msgid "We found a Twitter Description tag in your source code."
|
1597 |
msgstr ""
|
1598 |
|
1599 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1600 |
msgid "Your Twitter Description is missing!"
|
1601 |
msgstr ""
|
1602 |
|
1603 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1604 |
msgid "Twitter Image"
|
1605 |
msgstr ""
|
1606 |
|
1607 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1608 |
#, php-format
|
1609 |
msgid "We found %d twitter:image in your content."
|
1610 |
msgstr ""
|
1611 |
|
1612 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
|
|
|
|
|
|
|
|
1613 |
msgid "Your Twitter Image is missing!"
|
1614 |
msgstr ""
|
1615 |
|
1616 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1617 |
#, php-format
|
1618 |
msgid ""
|
1619 |
"We found %s meta robots in your page. There is probably something wrong with "
|
1620 |
"your theme!"
|
1621 |
msgstr ""
|
1622 |
|
1623 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1624 |
msgid "noindex is on! Search engines can't index this page."
|
1625 |
msgstr ""
|
1626 |
|
1627 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1628 |
msgid "noindex is off. Search engines will index this page."
|
1629 |
msgstr ""
|
1630 |
|
1631 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1632 |
msgid "nofollow is on! Search engines can't follow your links on this page."
|
1633 |
msgstr ""
|
1634 |
|
1635 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1636 |
msgid "nofollow is off. Search engines will follow links on this page."
|
1637 |
msgstr ""
|
1638 |
|
1639 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1640 |
msgid "noarchive is on! Search engines will not cache your page."
|
1641 |
msgstr ""
|
1642 |
|
1643 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1644 |
msgid "noarchive is off. Search engines will probably cache your page."
|
1645 |
msgstr ""
|
1646 |
|
1647 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1648 |
msgid ""
|
1649 |
"nosnippet is on! Search engines will not display a snippet of this page in "
|
1650 |
"search results."
|
1651 |
msgstr ""
|
1652 |
|
1653 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1654 |
msgid ""
|
1655 |
"nosnippet is off. Search engines will display a snippet of this page in "
|
1656 |
"search results."
|
1657 |
msgstr ""
|
1658 |
|
1659 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1660 |
msgid ""
|
1661 |
"We found no meta robots on this page. It means, your page is index,follow. "
|
1662 |
"Search engines will index it, and follow links. "
|
1663 |
msgstr ""
|
1664 |
|
1665 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1666 |
msgid ""
|
1667 |
"noimageindex is on! Google will not index your images on this page (but if "
|
1668 |
"someone makes a direct link to one of your image in this page, it will be "
|
1669 |
"indexed)."
|
1670 |
msgstr ""
|
1671 |
|
1672 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1673 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1674 |
msgid "noimageindex is off. Google will index the images on this page."
|
1675 |
msgstr ""
|
1676 |
|
1677 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1678 |
msgid ""
|
1679 |
"nositelinkssearchbox is on! Google will not display a sitelinks searchbox in "
|
1680 |
"search results."
|
1681 |
msgstr ""
|
1682 |
|
1683 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1684 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1685 |
msgid ""
|
1686 |
"nositelinkssearchbox is off. Google will probably display a sitelinks "
|
1687 |
"searchbox in search results."
|
1688 |
msgstr ""
|
1689 |
|
1690 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1691 |
msgid ""
|
1692 |
"No alternative text found for these images. Alt tags are important for both "
|
1693 |
"SEO and accessibility. Edit your images using the media library or your "
|
1694 |
"favorite page builder and fill in alternative text fields."
|
1695 |
msgstr ""
|
1696 |
|
1697 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1698 |
msgid "All alternative tags are filled in. Good work!"
|
1699 |
msgstr ""
|
1700 |
|
1701 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1702 |
msgid ""
|
1703 |
"We could not find any image in your content. Content with media is a plus "
|
1704 |
"for your SEO."
|
1705 |
msgstr ""
|
1706 |
|
1707 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1708 |
#, php-format
|
1709 |
msgid ""
|
1710 |
"We found %d links with nofollow attribute in your page. Do not overuse "
|
1711 |
"nofollow attribute in links. Below, the list:"
|
1712 |
msgstr ""
|
1713 |
|
1714 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1715 |
msgid "This page doesn't have any nofollow links."
|
1716 |
msgstr ""
|
1717 |
|
1718 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1719 |
msgid ""
|
1720 |
"Internet is built on the principle of hyperlink. It is therefore perfectly "
|
1721 |
"normal to make links between different websites. However, avoid making links "
|
@@ -1723,17 +1956,17 @@ msgid ""
|
|
1723 |
"site, add the attribute \"nofollow\" to your link."
|
1724 |
msgstr ""
|
1725 |
|
1726 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1727 |
#, php-format
|
1728 |
msgid "We found %s outbound links in your page. Below, the list:"
|
1729 |
msgstr ""
|
1730 |
|
1731 |
-
#: inc/admin/admin-metaboxes-get-content-analysis.php:
|
1732 |
msgid "This page doesn't have any outbound links."
|
1733 |
msgstr ""
|
1734 |
|
1735 |
#: inc/admin/admin-metaboxes-render-content-analysis.php:12
|
1736 |
-
#: inc/admin/admin-metaboxes.php:
|
1737 |
msgid "Content analysis"
|
1738 |
msgstr ""
|
1739 |
|
@@ -1744,12 +1977,12 @@ msgid ""
|
|
1744 |
msgstr ""
|
1745 |
|
1746 |
#: inc/admin/admin-metaboxes-render-content-analysis.php:16
|
1747 |
-
#: inc/functions/options-advanced-admin.php:
|
1748 |
msgid "Should be improved"
|
1749 |
msgstr ""
|
1750 |
|
1751 |
#: inc/admin/admin-metaboxes-render-content-analysis.php:19
|
1752 |
-
#: inc/functions/options-advanced-admin.php:
|
1753 |
msgid "Good"
|
1754 |
msgstr ""
|
1755 |
|
@@ -1761,8 +1994,10 @@ msgstr ""
|
|
1761 |
msgid "Close"
|
1762 |
msgstr ""
|
1763 |
|
1764 |
-
#: inc/admin/admin-metaboxes.php:
|
1765 |
#: inc/admin/admin-term-metaboxes.php:203
|
|
|
|
|
1766 |
msgid "Analysis in progress..."
|
1767 |
msgstr ""
|
1768 |
|
@@ -1826,13 +2061,13 @@ msgstr ""
|
|
1826 |
#: inc/admin/admin-notifications-center.php:295
|
1827 |
#: inc/admin/admin-notifications-center.php:419
|
1828 |
#: inc/admin/admin-notifications-center.php:469
|
1829 |
-
#: inc/admin/admin-notifications-center.php:
|
1830 |
-
#: inc/admin/admin-notifications-center.php:
|
1831 |
-
#: inc/admin/admin-notifications-center.php:
|
1832 |
-
#: inc/admin/admin-notifications-center.php:
|
1833 |
-
#: inc/admin/admin-notifications-center.php:
|
1834 |
-
#: inc/admin/admin-notifications-center.php:
|
1835 |
-
#: inc/admin/admin-notifications-center.php:
|
1836 |
msgid "High impact"
|
1837 |
msgstr ""
|
1838 |
|
@@ -1841,14 +2076,14 @@ msgstr ""
|
|
1841 |
#: inc/admin/admin-notifications-center.php:205
|
1842 |
#: inc/admin/admin-notifications-center.php:235
|
1843 |
#: inc/admin/admin-notifications-center.php:423
|
1844 |
-
#: inc/admin/admin-notifications-center.php:
|
1845 |
-
#: inc/admin/admin-notifications-center.php:
|
1846 |
-
#: inc/admin/admin-notifications-center.php:
|
1847 |
-
#: inc/admin/admin-notifications-center.php:
|
1848 |
-
#: inc/admin/admin-notifications-center.php:
|
1849 |
-
#: inc/admin/admin-notifications-center.php:
|
1850 |
-
#: inc/admin/admin-notifications-center.php:
|
1851 |
-
#: inc/admin/admin-notifications-center.php:
|
1852 |
msgid "Fix this!"
|
1853 |
msgstr ""
|
1854 |
|
@@ -1902,9 +2137,9 @@ msgstr ""
|
|
1902 |
#: inc/admin/admin-notifications-center.php:347
|
1903 |
#: inc/admin/admin-notifications-center.php:386
|
1904 |
#: inc/admin/admin-notifications-center.php:448
|
1905 |
-
#: inc/admin/admin-notifications-center.php:474 inc/admin/admin.php:
|
1906 |
-
#: inc/admin/admin.php:
|
1907 |
-
#: inc/admin/admin.php:
|
1908 |
msgid "Learn more"
|
1909 |
msgstr ""
|
1910 |
|
@@ -1947,9 +2182,9 @@ msgstr ""
|
|
1947 |
|
1948 |
#: inc/admin/admin-notifications-center.php:342
|
1949 |
#: inc/admin/admin-notifications-center.php:381
|
1950 |
-
#: inc/admin/admin-notifications-center.php:
|
1951 |
-
#: inc/admin/admin-notifications-center.php:
|
1952 |
-
#: inc/admin/admin-notifications-center.php:
|
1953 |
msgid "Medium impact"
|
1954 |
msgstr ""
|
1955 |
|
@@ -2004,11 +2239,11 @@ msgid ""
|
|
2004 |
"this."
|
2005 |
msgstr ""
|
2006 |
|
2007 |
-
#: inc/admin/admin-notifications-center.php:
|
2008 |
msgid "Your site is not visible to Search Engines!"
|
2009 |
msgstr ""
|
2010 |
|
2011 |
-
#: inc/admin/admin-notifications-center.php:
|
2012 |
msgid ""
|
2013 |
"You have activated the blocking of the indexing of your site. If your site "
|
2014 |
"is under development, this is probably normal. Otherwise, check your "
|
@@ -2016,24 +2251,24 @@ msgid ""
|
|
2016 |
"not concerned."
|
2017 |
msgstr ""
|
2018 |
|
2019 |
-
#: inc/admin/admin-notifications-center.php:
|
2020 |
msgid "Your site title is empty!"
|
2021 |
msgstr ""
|
2022 |
|
2023 |
-
#: inc/admin/admin-notifications-center.php:
|
2024 |
msgid ""
|
2025 |
"Your Site Title is used by WordPress, your theme and your plugins including "
|
2026 |
"SEOPress. It is an essential component in the generation of title tags, but "
|
2027 |
"not only. Enter one!"
|
2028 |
msgstr ""
|
2029 |
|
2030 |
-
#: inc/admin/admin-notifications-center.php:
|
2031 |
msgid ""
|
2032 |
"Your permalinks are not SEO Friendly! Enable pretty permalinks to fix this."
|
2033 |
msgstr ""
|
2034 |
|
2035 |
-
#: inc/admin/admin-notifications-center.php:
|
2036 |
-
#: inc/admin/admin-notifications-center.php:
|
2037 |
msgid ""
|
2038 |
"Why is this important? Showing only the summary of each article "
|
2039 |
"significantly reduces the theft of your content by third party sites. Not to "
|
@@ -2041,34 +2276,34 @@ msgid ""
|
|
2041 |
"conversions..."
|
2042 |
msgstr ""
|
2043 |
|
2044 |
-
#: inc/admin/admin-notifications-center.php:
|
2045 |
msgid "Your RSS feed shows full text!"
|
2046 |
msgstr ""
|
2047 |
|
2048 |
-
#: inc/admin/admin-notifications-center.php:
|
2049 |
msgid "You like SEOPress? Please help us by rating us 5 stars!"
|
2050 |
msgstr ""
|
2051 |
|
2052 |
-
#: inc/admin/admin-notifications-center.php:
|
2053 |
msgid ""
|
2054 |
"Support the development and improvement of the plugin by taking 15 seconds "
|
2055 |
"of your time to leave us a user review on the official WordPress plugins "
|
2056 |
"repository. Thank you!"
|
2057 |
msgstr ""
|
2058 |
|
2059 |
-
#: inc/admin/admin-notifications-center.php:
|
2060 |
msgid "Information"
|
2061 |
msgstr ""
|
2062 |
|
2063 |
-
#: inc/admin/admin-notifications-center.php:
|
2064 |
msgid "Rate us!"
|
2065 |
msgstr ""
|
2066 |
|
2067 |
-
#: inc/admin/admin-notifications-center.php:
|
2068 |
msgid "Break comments into pages is ON!"
|
2069 |
msgstr ""
|
2070 |
|
2071 |
-
#: inc/admin/admin-notifications-center.php:
|
2072 |
msgid ""
|
2073 |
"Enabling this option will create duplicate content for each article beyond x "
|
2074 |
"comments. This can have a disastrous effect by creating a large number of "
|
@@ -2076,15 +2311,15 @@ msgid ""
|
|
2076 |
"ranking in search results."
|
2077 |
msgstr ""
|
2078 |
|
2079 |
-
#: inc/admin/admin-notifications-center.php:
|
2080 |
msgid "Disable this!"
|
2081 |
msgstr ""
|
2082 |
|
2083 |
-
#: inc/admin/admin-notifications-center.php:
|
2084 |
msgid "Display more posts per page on homepage and archives"
|
2085 |
msgstr ""
|
2086 |
|
2087 |
-
#: inc/admin/admin-notifications-center.php:
|
2088 |
msgid ""
|
2089 |
"To reduce the number pages search engines have to crawl to find all your "
|
2090 |
"articles, it is recommended displaying more posts per page. This should not "
|
@@ -2092,73 +2327,73 @@ msgid ""
|
|
2092 |
"than clicking on next page links."
|
2093 |
msgstr ""
|
2094 |
|
2095 |
-
#: inc/admin/admin-notifications-center.php:
|
2096 |
msgid "You don't have an XML Sitemap!"
|
2097 |
msgstr ""
|
2098 |
|
2099 |
-
#: inc/admin/admin-notifications-center.php:
|
2100 |
msgid ""
|
2101 |
"XML Sitemaps are useful to facilitate the crawling of your content by search "
|
2102 |
"engine robots. Indirectly, this can benefit your ranking by reducing the "
|
2103 |
"crawl bugdet."
|
2104 |
msgstr ""
|
2105 |
|
2106 |
-
#: inc/admin/admin-notifications-center.php:
|
2107 |
msgid "Do you have a Google My Business page? It's free!"
|
2108 |
msgstr ""
|
2109 |
|
2110 |
-
#: inc/admin/admin-notifications-center.php:
|
2111 |
msgid ""
|
2112 |
"Local Business websites should have a My Business page to improve visibility "
|
2113 |
"in search results. Click on the cross on the right to delete this "
|
2114 |
"notification if you are not concerned."
|
2115 |
msgstr ""
|
2116 |
|
2117 |
-
#: inc/admin/admin-notifications-center.php:
|
2118 |
msgid "Create your page now!"
|
2119 |
msgstr ""
|
2120 |
|
2121 |
-
#: inc/admin/admin-notifications-center.php:
|
2122 |
msgid "Add your site to Google. It's free!"
|
2123 |
msgstr ""
|
2124 |
|
2125 |
-
#: inc/admin/admin-notifications-center.php:
|
2126 |
msgid ""
|
2127 |
"Is your brand new site online? So reference it as quickly as possible on "
|
2128 |
"Google to get your first visitors via Google Search Console. Already the "
|
2129 |
"case? Click on the cross on the right to remove this alert."
|
2130 |
msgstr ""
|
2131 |
|
2132 |
-
#: inc/admin/admin-notifications-center.php:
|
2133 |
msgid "Add your site to Search Console!"
|
2134 |
msgstr ""
|
2135 |
|
2136 |
-
#: inc/admin/admin-notifications-center.php:
|
2137 |
msgid "Structured data types is not correctly enabled"
|
2138 |
msgstr ""
|
2139 |
|
2140 |
-
#: inc/admin/admin-notifications-center.php:
|
2141 |
msgid ""
|
2142 |
"Please enable <strong>Structured Data Types metabox for your posts, pages "
|
2143 |
"and custom post types</strong> option in order to use automatic and manual "
|
2144 |
"schemas. (SEO > PRO > Structured Data Types (schema.org)"
|
2145 |
msgstr ""
|
2146 |
|
2147 |
-
#: inc/admin/admin-notifications-center.php:
|
2148 |
msgid "You have to enter your licence key to get updates and support"
|
2149 |
msgstr ""
|
2150 |
|
2151 |
-
#: inc/admin/admin-notifications-center.php:
|
2152 |
msgid ""
|
2153 |
"Please activate the SEOPress PRO license key to automatically receive "
|
2154 |
"updates to guarantee you the best user experience possible."
|
2155 |
msgstr ""
|
2156 |
|
2157 |
-
#: inc/admin/admin-notifications-center.php:
|
2158 |
msgid "Take your SEO to the next level with SEOPress PRO!"
|
2159 |
msgstr ""
|
2160 |
|
2161 |
-
#: inc/admin/admin-notifications-center.php:
|
2162 |
msgid ""
|
2163 |
"The PRO version of SEOPress allows you to easily manage your structured data "
|
2164 |
"(schemas), add a breadcrumb optimized for SEO and accessibility, improve SEO "
|
@@ -2166,61 +2401,61 @@ msgid ""
|
|
2166 |
"of your metadata and so much more."
|
2167 |
msgstr ""
|
2168 |
|
2169 |
-
#: inc/admin/admin-notifications-center.php:
|
2170 |
msgid "Upgrade now!"
|
2171 |
msgstr ""
|
2172 |
|
2173 |
-
#: inc/admin/admin-notifications-center.php:
|
2174 |
msgid "Check websites setup on your server"
|
2175 |
msgstr ""
|
2176 |
|
2177 |
-
#: inc/admin/admin-notifications-center.php:
|
2178 |
msgid "Not found"
|
2179 |
msgstr ""
|
2180 |
|
2181 |
-
#: inc/admin/admin-notifications-center.php:
|
2182 |
msgid "No scrape."
|
2183 |
msgstr ""
|
2184 |
|
2185 |
-
#: inc/admin/admin-notifications-center.php:
|
2186 |
msgid "No domain found."
|
2187 |
msgstr ""
|
2188 |
|
2189 |
-
#: inc/admin/admin-notifications-center.php:
|
2190 |
msgid "Server IP Address: "
|
2191 |
msgstr ""
|
2192 |
|
2193 |
-
#: inc/admin/admin-notifications-center.php:
|
2194 |
msgid "Last scrape: "
|
2195 |
msgstr ""
|
2196 |
|
2197 |
-
#: inc/admin/admin-notifications-center.php:
|
2198 |
msgid "Number of websites on your server: "
|
2199 |
msgstr ""
|
2200 |
|
2201 |
-
#: inc/admin/admin-notifications-center.php:
|
2202 |
msgid "Get list"
|
2203 |
msgstr ""
|
2204 |
|
2205 |
-
#: inc/admin/admin-notifications-center.php:
|
2206 |
msgid "Our blog: SEO news, how-to, tips and tricks..."
|
2207 |
msgstr ""
|
2208 |
|
2209 |
-
#: inc/admin/admin-notifications-center.php:
|
2210 |
msgid "Upload a list of links to disavow to Google"
|
2211 |
msgstr ""
|
2212 |
|
2213 |
-
#: inc/admin/admin-notifications-center.php:
|
2214 |
msgid ""
|
2215 |
"Image SEO plugin to optimize your image ALT texts and names for Search "
|
2216 |
"Engines."
|
2217 |
msgstr ""
|
2218 |
|
2219 |
-
#: inc/admin/admin-notifications-center.php:
|
2220 |
msgid "Dareboost: Test, analyze and optimize your website"
|
2221 |
msgstr ""
|
2222 |
|
2223 |
-
#: inc/admin/admin-notifications-center.php:
|
2224 |
msgid "Google Campaign URL Builder tool"
|
2225 |
msgstr ""
|
2226 |
|
@@ -2284,52 +2519,52 @@ msgstr ""
|
|
2284 |
msgid "No data to migrate? Click \"Next step\" button!"
|
2285 |
msgstr ""
|
2286 |
|
2287 |
-
#: inc/admin/admin-wizard.php:280 inc/admin/admin.php:
|
2288 |
msgid "Import posts and terms metadata from"
|
2289 |
msgstr ""
|
2290 |
|
2291 |
-
#: inc/admin/admin-wizard.php:282 inc/admin/admin.php:
|
2292 |
-
#: inc/admin/admin.php:
|
2293 |
msgid "Select an option"
|
2294 |
msgstr ""
|
2295 |
|
2296 |
-
#: inc/admin/admin-wizard.php:283 inc/admin/admin.php:
|
2297 |
msgid "Yoast SEO"
|
2298 |
msgstr ""
|
2299 |
|
2300 |
-
#: inc/admin/admin-wizard.php:284 inc/admin/admin.php:
|
2301 |
msgid "All In One SEO"
|
2302 |
msgstr ""
|
2303 |
|
2304 |
-
#: inc/admin/admin-wizard.php:285 inc/admin/admin.php:
|
2305 |
msgid "The SEO Framework"
|
2306 |
msgstr ""
|
2307 |
|
2308 |
-
#: inc/admin/admin-wizard.php:286 inc/admin/admin.php:
|
2309 |
msgid "Rank Math"
|
2310 |
msgstr ""
|
2311 |
|
2312 |
-
#: inc/admin/admin-wizard.php:287 inc/admin/admin.php:
|
2313 |
msgid "Squirrly SEO"
|
2314 |
msgstr ""
|
2315 |
|
2316 |
-
#: inc/admin/admin-wizard.php:288 inc/admin/admin.php:
|
2317 |
msgid "SEO Ultimate"
|
2318 |
msgstr ""
|
2319 |
|
2320 |
-
#: inc/admin/admin-wizard.php:289 inc/admin/admin.php:
|
2321 |
msgid "WP Meta SEO"
|
2322 |
msgstr ""
|
2323 |
|
2324 |
-
#: inc/admin/admin-wizard.php:290 inc/admin/admin.php:
|
2325 |
msgid "Premium SEO Pack"
|
2326 |
msgstr ""
|
2327 |
|
2328 |
-
#: inc/admin/admin-wizard.php:291 inc/admin/admin.php:
|
2329 |
msgid "wpSEO"
|
2330 |
msgstr ""
|
2331 |
|
2332 |
-
#: inc/admin/admin-wizard.php:299 inc/admin/admin.php:
|
2333 |
msgid "Import posts and terms metadata from Yoast"
|
2334 |
msgstr ""
|
2335 |
|
@@ -2337,10 +2572,10 @@ msgstr ""
|
|
2337 |
#: inc/admin/admin-wizard.php:337 inc/admin/admin-wizard.php:356
|
2338 |
#: inc/admin/admin-wizard.php:375 inc/admin/admin-wizard.php:393
|
2339 |
#: inc/admin/admin-wizard.php:410 inc/admin/admin-wizard.php:426
|
2340 |
-
#: inc/admin/admin-wizard.php:445 inc/admin/admin.php:
|
2341 |
-
#: inc/admin/admin.php:
|
2342 |
-
#: inc/admin/admin.php:
|
2343 |
-
#: inc/admin/admin.php:
|
2344 |
msgid "By clicking Migrate, we'll import:"
|
2345 |
msgstr ""
|
2346 |
|
@@ -2348,10 +2583,10 @@ msgstr ""
|
|
2348 |
#: inc/admin/admin-wizard.php:339 inc/admin/admin-wizard.php:358
|
2349 |
#: inc/admin/admin-wizard.php:377 inc/admin/admin-wizard.php:395
|
2350 |
#: inc/admin/admin-wizard.php:412 inc/admin/admin-wizard.php:428
|
2351 |
-
#: inc/admin/admin-wizard.php:447 inc/admin/admin.php:
|
2352 |
-
#: inc/admin/admin.php:
|
2353 |
-
#: inc/admin/admin.php:
|
2354 |
-
#: inc/admin/admin.php:
|
2355 |
msgid "Title tags"
|
2356 |
msgstr ""
|
2357 |
|
@@ -2359,37 +2594,37 @@ msgstr ""
|
|
2359 |
#: inc/admin/admin-wizard.php:341 inc/admin/admin-wizard.php:360
|
2360 |
#: inc/admin/admin-wizard.php:379 inc/admin/admin-wizard.php:397
|
2361 |
#: inc/admin/admin-wizard.php:414 inc/admin/admin-wizard.php:430
|
2362 |
-
#: inc/admin/admin-wizard.php:449 inc/admin/admin.php:
|
2363 |
-
#: inc/admin/admin.php:
|
2364 |
-
#: inc/admin/admin.php:
|
2365 |
-
#: inc/admin/admin.php:
|
2366 |
msgid "Facebook Open Graph tags (title, description and image thumbnail)"
|
2367 |
msgstr ""
|
2368 |
|
2369 |
#: inc/admin/admin-wizard.php:305 inc/admin/admin-wizard.php:342
|
2370 |
#: inc/admin/admin-wizard.php:361 inc/admin/admin-wizard.php:380
|
2371 |
#: inc/admin/admin-wizard.php:398 inc/admin/admin-wizard.php:415
|
2372 |
-
#: inc/admin/admin-wizard.php:450 inc/admin/admin.php:
|
2373 |
-
#: inc/admin/admin.php:
|
2374 |
-
#: inc/admin/admin.php:
|
2375 |
msgid "Twitter tags (title, description and image thumbnail)"
|
2376 |
msgstr ""
|
2377 |
|
2378 |
-
#: inc/admin/admin-wizard.php:306 inc/admin/admin.php:
|
2379 |
msgid "Meta Robots (noindex, nofollow...)"
|
2380 |
msgstr ""
|
2381 |
|
2382 |
#: inc/admin/admin-wizard.php:308 inc/admin/admin-wizard.php:364
|
2383 |
-
#: inc/admin/admin-wizard.php:433 inc/admin/admin.php:
|
2384 |
-
#: inc/admin/admin.php:
|
2385 |
msgid "Focus keywords"
|
2386 |
msgstr ""
|
2387 |
|
2388 |
-
#: inc/admin/admin-wizard.php:309 inc/admin/admin.php:
|
2389 |
msgid "Primary category"
|
2390 |
msgstr ""
|
2391 |
|
2392 |
-
#: inc/admin/admin-wizard.php:311 inc/admin/admin.php:
|
2393 |
msgid ""
|
2394 |
"<strong>WARNING:</strong> Migration will delete / update all SEOPress posts "
|
2395 |
"and terms metadata. Some dynamic variables will not be interpreted. We do "
|
@@ -2400,76 +2635,76 @@ msgstr ""
|
|
2400 |
#: inc/admin/admin-wizard.php:348 inc/admin/admin-wizard.php:367
|
2401 |
#: inc/admin/admin-wizard.php:385 inc/admin/admin-wizard.php:402
|
2402 |
#: inc/admin/admin-wizard.php:418 inc/admin/admin-wizard.php:436
|
2403 |
-
#: inc/admin/admin-wizard.php:457 inc/admin/admin.php:
|
2404 |
-
#: inc/admin/admin.php:
|
2405 |
-
#: inc/admin/admin.php:
|
2406 |
-
#: inc/admin/admin.php:
|
2407 |
msgid "Migrate now"
|
2408 |
msgstr ""
|
2409 |
|
2410 |
-
#: inc/admin/admin-wizard.php:319 inc/admin/admin.php:
|
2411 |
msgid "Import posts and terms metadata from All In One SEO"
|
2412 |
msgstr ""
|
2413 |
|
2414 |
-
#: inc/admin/admin-wizard.php:325 inc/admin/admin.php:
|
2415 |
msgid "Twitter image thumbnail"
|
2416 |
msgstr ""
|
2417 |
|
2418 |
#: inc/admin/admin-wizard.php:326 inc/admin/admin-wizard.php:431
|
2419 |
-
#: inc/admin/admin-wizard.php:451 inc/admin/admin.php:
|
2420 |
-
#: inc/admin/admin.php:
|
2421 |
msgid "Meta Robots (noindex, nofollow)"
|
2422 |
msgstr ""
|
2423 |
|
2424 |
-
#: inc/admin/admin-wizard.php:328 inc/admin/admin.php:
|
2425 |
msgid ""
|
2426 |
"<strong>WARNING:</strong> Migration will update/delete all SEOPress posts "
|
2427 |
"and terms metadata. Some dynamic variables will not be interpreted. We do "
|
2428 |
"NOT delete any AIO data."
|
2429 |
msgstr ""
|
2430 |
|
2431 |
-
#: inc/admin/admin-wizard.php:336 inc/admin/admin.php:
|
2432 |
msgid "Import posts and terms metadata from The SEO Framework"
|
2433 |
msgstr ""
|
2434 |
|
2435 |
-
#: inc/admin/admin-wizard.php:343 inc/admin/admin.php:
|
2436 |
msgid "Meta Robots (noindex, nofollow, noarchive)"
|
2437 |
msgstr ""
|
2438 |
|
2439 |
#: inc/admin/admin-wizard.php:345 inc/admin/admin-wizard.php:453
|
2440 |
-
#: inc/admin/admin.php:
|
2441 |
-
#: inc/functions/options-advanced-admin.php:
|
2442 |
msgid "Redirect URL"
|
2443 |
msgstr ""
|
2444 |
|
2445 |
-
#: inc/admin/admin-wizard.php:347 inc/admin/admin.php:
|
2446 |
msgid ""
|
2447 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2448 |
"and terms metadata. Some dynamic variables will not be interpreted. We do "
|
2449 |
"NOT delete any SEO Framework data."
|
2450 |
msgstr ""
|
2451 |
|
2452 |
-
#: inc/admin/admin-wizard.php:355 inc/admin/admin.php:
|
2453 |
msgid "Import posts and terms metadata from Rank Math"
|
2454 |
msgstr ""
|
2455 |
|
2456 |
-
#: inc/admin/admin-wizard.php:362 inc/admin/admin.php:
|
2457 |
msgid "Meta Robots (noindex, nofollow, noarchive, noimageindex)"
|
2458 |
msgstr ""
|
2459 |
|
2460 |
-
#: inc/admin/admin-wizard.php:366 inc/admin/admin.php:
|
2461 |
msgid ""
|
2462 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2463 |
"and terms metadata. Some dynamic variables will not be interpreted. We do "
|
2464 |
"NOT delete any Rank Math data."
|
2465 |
msgstr ""
|
2466 |
|
2467 |
-
#: inc/admin/admin-wizard.php:374 inc/admin/admin.php:
|
2468 |
msgid "Import posts metadata from Squirrly SEO"
|
2469 |
msgstr ""
|
2470 |
|
2471 |
#: inc/admin/admin-wizard.php:381 inc/admin/admin-wizard.php:399
|
2472 |
-
#: inc/admin/admin.php:
|
2473 |
msgid "Meta Robots (noindex or nofollow)"
|
2474 |
msgstr ""
|
2475 |
|
@@ -2480,48 +2715,48 @@ msgid ""
|
|
2480 |
"any Squirrly SEO data."
|
2481 |
msgstr ""
|
2482 |
|
2483 |
-
#: inc/admin/admin-wizard.php:392 inc/admin/admin.php:
|
2484 |
msgid "Import posts metadata from SEO Ultimate"
|
2485 |
msgstr ""
|
2486 |
|
2487 |
-
#: inc/admin/admin-wizard.php:401 inc/admin/admin.php:
|
2488 |
msgid ""
|
2489 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2490 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
2491 |
"any SEO Ultimate data."
|
2492 |
msgstr ""
|
2493 |
|
2494 |
-
#: inc/admin/admin-wizard.php:409 inc/admin/admin.php:
|
2495 |
msgid "Import posts and terms metadata from WP Meta SEO"
|
2496 |
msgstr ""
|
2497 |
|
2498 |
-
#: inc/admin/admin-wizard.php:417 inc/admin/admin.php:
|
2499 |
msgid ""
|
2500 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2501 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
2502 |
"any WP Meta SEO data."
|
2503 |
msgstr ""
|
2504 |
|
2505 |
-
#: inc/admin/admin-wizard.php:425 inc/admin/admin.php:
|
2506 |
msgid "Import posts and terms metadata from Premium SEO Pack"
|
2507 |
msgstr ""
|
2508 |
|
2509 |
-
#: inc/admin/admin-wizard.php:435 inc/admin/admin.php:
|
2510 |
msgid ""
|
2511 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2512 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
2513 |
"any Premium SEO Pack data."
|
2514 |
msgstr ""
|
2515 |
|
2516 |
-
#: inc/admin/admin-wizard.php:444 inc/admin/admin.php:
|
2517 |
msgid "Import posts and terms metadata from wpSEO"
|
2518 |
msgstr ""
|
2519 |
|
2520 |
-
#: inc/admin/admin-wizard.php:454 inc/admin/admin.php:
|
2521 |
msgid "Main keyword"
|
2522 |
msgstr ""
|
2523 |
|
2524 |
-
#: inc/admin/admin-wizard.php:456 inc/admin/admin.php:
|
2525 |
msgid ""
|
2526 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2527 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
@@ -2542,8 +2777,8 @@ msgstr ""
|
|
2542 |
msgid "eg: |"
|
2543 |
msgstr ""
|
2544 |
|
2545 |
-
#: inc/admin/admin-wizard.php:511 inc/admin/admin.php:
|
2546 |
-
#: inc/admin/admin.php:
|
2547 |
msgid "Site title"
|
2548 |
msgstr ""
|
2549 |
|
@@ -2551,7 +2786,7 @@ msgstr ""
|
|
2551 |
msgid "eg: My super website"
|
2552 |
msgstr ""
|
2553 |
|
2554 |
-
#: inc/admin/admin-wizard.php:514 inc/admin/admin.php:
|
2555 |
msgid "Person or organization"
|
2556 |
msgstr ""
|
2557 |
|
@@ -2559,16 +2794,16 @@ msgstr ""
|
|
2559 |
msgid "Choose a knowledge type"
|
2560 |
msgstr ""
|
2561 |
|
2562 |
-
#: inc/admin/admin-wizard.php:522 inc/admin/admin.php:
|
2563 |
msgid "Person"
|
2564 |
msgstr ""
|
2565 |
|
2566 |
-
#: inc/admin/admin-wizard.php:525 inc/admin/admin.php:
|
2567 |
msgid "Organization"
|
2568 |
msgstr ""
|
2569 |
|
2570 |
-
#: inc/admin/admin-wizard.php:529 inc/admin/admin.php:
|
2571 |
-
#: inc/admin/admin.php:
|
2572 |
msgid "Your name/organization"
|
2573 |
msgstr ""
|
2574 |
|
@@ -2576,8 +2811,8 @@ msgstr ""
|
|
2576 |
msgid "eg: My Company Name"
|
2577 |
msgstr ""
|
2578 |
|
2579 |
-
#: inc/admin/admin-wizard.php:532 inc/admin/admin.php:
|
2580 |
-
#: inc/admin/admin.php:
|
2581 |
msgid "Your photo/organization logo"
|
2582 |
msgstr ""
|
2583 |
|
@@ -2589,78 +2824,78 @@ msgstr ""
|
|
2589 |
msgid "Facebook page URL"
|
2590 |
msgstr ""
|
2591 |
|
2592 |
-
#: inc/admin/admin-wizard.php:536 inc/admin/admin.php:
|
2593 |
msgid "eg: https://facebook.com/my-page-url"
|
2594 |
msgstr ""
|
2595 |
|
2596 |
-
#: inc/admin/admin-wizard.php:538 inc/admin/admin.php:
|
2597 |
msgid "Twitter Username"
|
2598 |
msgstr ""
|
2599 |
|
2600 |
-
#: inc/admin/admin-wizard.php:539 inc/admin/admin.php:
|
2601 |
msgid "eg: @my_twitter_account"
|
2602 |
msgstr ""
|
2603 |
|
2604 |
-
#: inc/admin/admin-wizard.php:541 inc/admin/admin.php:
|
2605 |
-
#: inc/admin/admin.php:
|
2606 |
msgid "Pinterest URL"
|
2607 |
msgstr ""
|
2608 |
|
2609 |
-
#: inc/admin/admin-wizard.php:542 inc/admin/admin.php:
|
2610 |
msgid "eg: https://pinterest.com/my-page-url/"
|
2611 |
msgstr ""
|
2612 |
|
2613 |
-
#: inc/admin/admin-wizard.php:544 inc/admin/admin.php:
|
2614 |
-
#: inc/admin/admin.php:
|
2615 |
msgid "Instagram URL"
|
2616 |
msgstr ""
|
2617 |
|
2618 |
-
#: inc/admin/admin-wizard.php:545 inc/admin/admin.php:
|
2619 |
msgid "eg: https://www.instagram.com/my-page-url/"
|
2620 |
msgstr ""
|
2621 |
|
2622 |
-
#: inc/admin/admin-wizard.php:547 inc/admin/admin.php:
|
2623 |
-
#: inc/admin/admin.php:
|
2624 |
msgid "YouTube URL"
|
2625 |
msgstr ""
|
2626 |
|
2627 |
-
#: inc/admin/admin-wizard.php:548 inc/admin/admin.php:
|
2628 |
msgid "eg: https://www.youtube.com/my-channel-url"
|
2629 |
msgstr ""
|
2630 |
|
2631 |
-
#: inc/admin/admin-wizard.php:550 inc/admin/admin.php:
|
2632 |
-
#: inc/admin/admin.php:
|
2633 |
msgid "LinkedIn URL"
|
2634 |
msgstr ""
|
2635 |
|
2636 |
-
#: inc/admin/admin-wizard.php:551 inc/admin/admin.php:
|
2637 |
msgid "eg: http://linkedin.com/company/my-company-url/"
|
2638 |
msgstr ""
|
2639 |
|
2640 |
-
#: inc/admin/admin-wizard.php:553 inc/admin/admin.php:
|
2641 |
-
#: inc/admin/admin.php:
|
2642 |
msgid "MySpace URL"
|
2643 |
msgstr ""
|
2644 |
|
2645 |
-
#: inc/admin/admin-wizard.php:554 inc/admin/admin.php:
|
2646 |
msgid "eg: https://myspace.com/my-page-url"
|
2647 |
msgstr ""
|
2648 |
|
2649 |
-
#: inc/admin/admin-wizard.php:556 inc/admin/admin.php:
|
2650 |
-
#: inc/admin/admin.php:
|
2651 |
msgid "Soundcloud URL"
|
2652 |
msgstr ""
|
2653 |
|
2654 |
-
#: inc/admin/admin-wizard.php:557 inc/admin/admin.php:
|
2655 |
msgid "eg: https://soundcloud.com/my-page-url"
|
2656 |
msgstr ""
|
2657 |
|
2658 |
-
#: inc/admin/admin-wizard.php:559 inc/admin/admin.php:
|
2659 |
-
#: inc/admin/admin.php:
|
2660 |
msgid "Tumblr URL"
|
2661 |
msgstr ""
|
2662 |
|
2663 |
-
#: inc/admin/admin-wizard.php:560 inc/admin/admin.php:
|
2664 |
msgid "eg: https://your-site.tumblr.com"
|
2665 |
msgstr ""
|
2666 |
|
@@ -2711,7 +2946,7 @@ msgid ""
|
|
2711 |
"results <strong>(noindex)</strong>"
|
2712 |
msgstr ""
|
2713 |
|
2714 |
-
#: inc/admin/admin-wizard.php:780 inc/admin/admin.php:
|
2715 |
msgid ""
|
2716 |
"Do not display author archives in search engine results <strong>(noindex)</"
|
2717 |
"strong>"
|
@@ -2723,7 +2958,7 @@ msgid ""
|
|
2723 |
"content."
|
2724 |
msgstr ""
|
2725 |
|
2726 |
-
#: inc/admin/admin-wizard.php:792 inc/admin/admin.php:
|
2727 |
msgid ""
|
2728 |
"Redirect attachment pages to their file URL (https://www.example.com/my-"
|
2729 |
"image-file.jpg)"
|
@@ -2735,7 +2970,7 @@ msgid ""
|
|
2735 |
"Optimize this by redirecting the user directly to the URL of the media file."
|
2736 |
msgstr ""
|
2737 |
|
2738 |
-
#: inc/admin/admin-wizard.php:804 inc/admin/admin.php:
|
2739 |
msgid "Remove /category/ in your permalinks"
|
2740 |
msgstr ""
|
2741 |
|
@@ -2804,657 +3039,547 @@ msgstr ""
|
|
2804 |
msgid "Knowledge base"
|
2805 |
msgstr ""
|
2806 |
|
2807 |
-
#: inc/admin/admin.php:
|
2808 |
msgid "404 - Page not found"
|
2809 |
msgstr ""
|
2810 |
|
2811 |
-
#: inc/admin/admin.php:
|
2812 |
msgid "Dashboard"
|
2813 |
msgstr ""
|
2814 |
|
2815 |
-
#: inc/admin/admin.php:
|
2816 |
#, php-format
|
2817 |
msgid "%%sep%%"
|
2818 |
msgstr ""
|
2819 |
|
2820 |
-
#: inc/admin/admin.php:247
|
2821 |
-
msgid "Separator (eg: - )"
|
2822 |
-
msgstr ""
|
2823 |
-
|
2824 |
-
#: inc/admin/admin.php:248
|
2825 |
-
#, php-format
|
2826 |
-
msgid "%%sitetitle%% (alias: %%sitename%%)"
|
2827 |
-
msgstr ""
|
2828 |
-
|
2829 |
#: inc/admin/admin.php:249
|
2830 |
-
|
2831 |
-
msgid "%%tagline%% (alias %%sitedesc%%)"
|
2832 |
-
msgstr ""
|
2833 |
-
|
2834 |
-
#: inc/admin/admin.php:249 inc/admin/admin.php:3125 inc/admin/admin.php:3136
|
2835 |
-
msgid "Tagline"
|
2836 |
msgstr ""
|
2837 |
|
2838 |
#: inc/admin/admin.php:250
|
2839 |
#, php-format
|
2840 |
-
msgid "%%
|
2841 |
-
msgstr ""
|
2842 |
-
|
2843 |
-
#: inc/admin/admin.php:250
|
2844 |
-
msgid "Post Title (post, page, custom post type)"
|
2845 |
msgstr ""
|
2846 |
|
2847 |
#: inc/admin/admin.php:251
|
2848 |
#, php-format
|
2849 |
-
msgid "%%
|
2850 |
-
msgstr ""
|
2851 |
-
|
2852 |
-
#: inc/admin/admin.php:251
|
2853 |
-
msgid "Post excerpt"
|
2854 |
msgstr ""
|
2855 |
|
2856 |
#: inc/admin/admin.php:252
|
2857 |
#, php-format
|
2858 |
-
msgid "%%
|
2859 |
msgstr ""
|
2860 |
|
2861 |
#: inc/admin/admin.php:252
|
2862 |
-
msgid "Post
|
2863 |
msgstr ""
|
2864 |
|
2865 |
#: inc/admin/admin.php:253
|
2866 |
#, php-format
|
2867 |
-
msgid "%%
|
2868 |
-
msgstr ""
|
2869 |
-
|
2870 |
-
#: inc/admin/admin.php:253
|
2871 |
-
msgid "Post thumbnail URL"
|
2872 |
msgstr ""
|
2873 |
|
2874 |
#: inc/admin/admin.php:254
|
2875 |
#, php-format
|
2876 |
-
msgid "%%
|
2877 |
msgstr ""
|
2878 |
|
2879 |
#: inc/admin/admin.php:254
|
2880 |
-
msgid "Post
|
2881 |
msgstr ""
|
2882 |
|
2883 |
#: inc/admin/admin.php:255
|
2884 |
#, php-format
|
2885 |
-
msgid "%%
|
2886 |
-
msgstr ""
|
2887 |
-
|
2888 |
-
#: inc/admin/admin.php:255
|
2889 |
-
msgid "Post date"
|
2890 |
msgstr ""
|
2891 |
|
2892 |
#: inc/admin/admin.php:256
|
2893 |
#, php-format
|
2894 |
-
msgid "%%
|
2895 |
msgstr ""
|
2896 |
|
2897 |
#: inc/admin/admin.php:256
|
2898 |
-
msgid "
|
2899 |
msgstr ""
|
2900 |
|
2901 |
#: inc/admin/admin.php:257
|
2902 |
#, php-format
|
2903 |
-
msgid "%%
|
2904 |
-
msgstr ""
|
2905 |
-
|
2906 |
-
#: inc/admin/admin.php:257 inc/admin/admin.php:3673
|
2907 |
-
msgid "Post author"
|
2908 |
msgstr ""
|
2909 |
|
2910 |
#: inc/admin/admin.php:258
|
2911 |
#, php-format
|
2912 |
-
msgid "%%
|
2913 |
msgstr ""
|
2914 |
|
2915 |
#: inc/admin/admin.php:258
|
2916 |
-
msgid "
|
2917 |
msgstr ""
|
2918 |
|
2919 |
#: inc/admin/admin.php:259
|
2920 |
#, php-format
|
2921 |
-
msgid "%%
|
2922 |
-
msgstr ""
|
2923 |
-
|
2924 |
-
#: inc/admin/admin.php:259
|
2925 |
-
msgid "Post tag"
|
2926 |
msgstr ""
|
2927 |
|
2928 |
#: inc/admin/admin.php:260
|
2929 |
#, php-format
|
2930 |
-
msgid "%%
|
2931 |
-
msgstr ""
|
2932 |
-
|
2933 |
-
#: inc/admin/admin.php:260
|
2934 |
-
msgid "Category title"
|
2935 |
msgstr ""
|
2936 |
|
2937 |
#: inc/admin/admin.php:261
|
2938 |
#, php-format
|
2939 |
-
msgid "%%
|
2940 |
-
msgstr ""
|
2941 |
-
|
2942 |
-
#: inc/admin/admin.php:261
|
2943 |
-
msgid "Category description"
|
2944 |
msgstr ""
|
2945 |
|
2946 |
#: inc/admin/admin.php:262
|
2947 |
#, php-format
|
2948 |
-
msgid "%%
|
2949 |
-
msgstr ""
|
2950 |
-
|
2951 |
-
#: inc/admin/admin.php:262
|
2952 |
-
msgid "Tag title"
|
2953 |
msgstr ""
|
2954 |
|
2955 |
#: inc/admin/admin.php:263
|
2956 |
#, php-format
|
2957 |
-
msgid "%%
|
2958 |
-
msgstr ""
|
2959 |
-
|
2960 |
-
#: inc/admin/admin.php:263
|
2961 |
-
msgid "Tag description"
|
2962 |
msgstr ""
|
2963 |
|
2964 |
#: inc/admin/admin.php:264
|
2965 |
#, php-format
|
2966 |
-
msgid "%%
|
2967 |
-
msgstr ""
|
2968 |
-
|
2969 |
-
#: inc/admin/admin.php:264
|
2970 |
-
msgid "Term title"
|
2971 |
msgstr ""
|
2972 |
|
2973 |
#: inc/admin/admin.php:265
|
2974 |
#, php-format
|
2975 |
-
msgid "%%
|
2976 |
-
msgstr ""
|
2977 |
-
|
2978 |
-
#: inc/admin/admin.php:265
|
2979 |
-
msgid "Term description"
|
2980 |
msgstr ""
|
2981 |
|
2982 |
#: inc/admin/admin.php:266
|
2983 |
#, php-format
|
2984 |
-
msgid "%%
|
2985 |
-
msgstr ""
|
2986 |
-
|
2987 |
-
#: inc/admin/admin.php:266
|
2988 |
-
msgid "Search keywords"
|
2989 |
msgstr ""
|
2990 |
|
2991 |
#: inc/admin/admin.php:267
|
2992 |
#, php-format
|
2993 |
-
msgid "%%
|
2994 |
-
msgstr ""
|
2995 |
-
|
2996 |
-
#: inc/admin/admin.php:267
|
2997 |
-
msgid "Current number page"
|
2998 |
msgstr ""
|
2999 |
|
3000 |
#: inc/admin/admin.php:268
|
3001 |
#, php-format
|
3002 |
-
msgid "%%
|
3003 |
-
msgstr ""
|
3004 |
-
|
3005 |
-
#: inc/admin/admin.php:268
|
3006 |
-
msgid "Current page number with context (i.e. page 1 of 3)"
|
3007 |
msgstr ""
|
3008 |
|
3009 |
#: inc/admin/admin.php:269
|
3010 |
#, php-format
|
3011 |
-
msgid "%%
|
3012 |
-
msgstr ""
|
3013 |
-
|
3014 |
-
#: inc/admin/admin.php:269
|
3015 |
-
msgid "Plural Post Type Archive name"
|
3016 |
msgstr ""
|
3017 |
|
3018 |
#: inc/admin/admin.php:270
|
3019 |
#, php-format
|
3020 |
-
msgid "%%
|
3021 |
msgstr ""
|
3022 |
|
3023 |
#: inc/admin/admin.php:270
|
3024 |
-
msgid "
|
3025 |
msgstr ""
|
3026 |
|
3027 |
#: inc/admin/admin.php:271
|
3028 |
#, php-format
|
3029 |
-
msgid "%%
|
3030 |
-
msgstr ""
|
3031 |
-
|
3032 |
-
#: inc/admin/admin.php:271
|
3033 |
-
msgid "Date Archive"
|
3034 |
msgstr ""
|
3035 |
|
3036 |
#: inc/admin/admin.php:272
|
3037 |
#, php-format
|
3038 |
-
msgid "%%
|
3039 |
-
msgstr ""
|
3040 |
-
|
3041 |
-
#: inc/admin/admin.php:272
|
3042 |
-
msgid "Day Archive date"
|
3043 |
msgstr ""
|
3044 |
|
3045 |
#: inc/admin/admin.php:273
|
3046 |
#, php-format
|
3047 |
-
msgid "%%
|
3048 |
msgstr ""
|
3049 |
|
3050 |
#: inc/admin/admin.php:273
|
3051 |
-
msgid "
|
3052 |
msgstr ""
|
3053 |
|
3054 |
#: inc/admin/admin.php:274
|
3055 |
#, php-format
|
3056 |
-
msgid "%%
|
3057 |
msgstr ""
|
3058 |
|
3059 |
-
#: inc/admin/admin.php:
|
3060 |
-
|
|
|
3061 |
msgstr ""
|
3062 |
|
3063 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
|
|
3064 |
#, php-format
|
3065 |
msgid "%%_cf_your_custom_field_name%%"
|
3066 |
msgstr ""
|
3067 |
|
3068 |
-
#: inc/admin/admin.php:
|
3069 |
msgid ""
|
3070 |
"Custom fields from post, page or post type (replace <span style=\"color:red;"
|
3071 |
"margin:0\">your_custom_field_name</span> with your custom field name)"
|
3072 |
msgstr ""
|
3073 |
|
3074 |
-
#: inc/admin/admin.php:
|
3075 |
#, php-format
|
3076 |
msgid "%%_ct_your_custom_taxonomy_slug%%"
|
3077 |
msgstr ""
|
3078 |
|
3079 |
-
#: inc/admin/admin.php:
|
3080 |
msgid ""
|
3081 |
"Custom term taxonomy from post, page or post type (replace <span style="
|
3082 |
"\"color:red;margin:0\">your_custom_taxonomy_slug</span> with your custom "
|
3083 |
"taxonomy slug)"
|
3084 |
msgstr ""
|
3085 |
|
3086 |
-
#: inc/admin/admin.php:
|
3087 |
#, php-format
|
3088 |
msgid "%%wc_single_cat%%"
|
3089 |
msgstr ""
|
3090 |
|
3091 |
-
#: inc/admin/admin.php:
|
3092 |
-
msgid "Single product category"
|
3093 |
-
msgstr ""
|
3094 |
-
|
3095 |
-
#: inc/admin/admin.php:278
|
3096 |
#, php-format
|
3097 |
msgid "%%wc_single_tag%%"
|
3098 |
msgstr ""
|
3099 |
|
3100 |
-
#: inc/admin/admin.php:
|
3101 |
-
msgid "Single product tag"
|
3102 |
-
msgstr ""
|
3103 |
-
|
3104 |
-
#: inc/admin/admin.php:279
|
3105 |
#, php-format
|
3106 |
msgid "%%wc_single_short_desc%%"
|
3107 |
msgstr ""
|
3108 |
|
3109 |
-
#: inc/admin/admin.php:
|
3110 |
-
msgid "Single product short description"
|
3111 |
-
msgstr ""
|
3112 |
-
|
3113 |
-
#: inc/admin/admin.php:280
|
3114 |
#, php-format
|
3115 |
msgid "%%wc_single_price%%"
|
3116 |
msgstr ""
|
3117 |
|
3118 |
-
#: inc/admin/admin.php:
|
3119 |
-
msgid "Single product price"
|
3120 |
-
msgstr ""
|
3121 |
-
|
3122 |
-
#: inc/admin/admin.php:281
|
3123 |
#, php-format
|
3124 |
msgid "%%wc_single_price_exc_tax%%"
|
3125 |
msgstr ""
|
3126 |
|
3127 |
-
#: inc/admin/admin.php:
|
3128 |
-
msgid "Single product price taxes excluded"
|
3129 |
-
msgstr ""
|
3130 |
-
|
3131 |
-
#: inc/admin/admin.php:282
|
3132 |
#, php-format
|
3133 |
msgid "%%wc_sku%%"
|
3134 |
msgstr ""
|
3135 |
|
3136 |
-
#: inc/admin/admin.php:
|
3137 |
-
msgid "Single SKU product"
|
3138 |
-
msgstr ""
|
3139 |
-
|
3140 |
-
#: inc/admin/admin.php:283
|
3141 |
#, php-format
|
3142 |
msgid "%%currentday%%"
|
3143 |
msgstr ""
|
3144 |
|
3145 |
-
#: inc/admin/admin.php:
|
3146 |
-
msgid "Current day"
|
3147 |
-
msgstr ""
|
3148 |
-
|
3149 |
-
#: inc/admin/admin.php:284
|
3150 |
#, php-format
|
3151 |
msgid "%%currentmonth%%"
|
3152 |
msgstr ""
|
3153 |
|
3154 |
-
#: inc/admin/admin.php:
|
3155 |
-
msgid "Current month"
|
3156 |
-
msgstr ""
|
3157 |
-
|
3158 |
-
#: inc/admin/admin.php:285
|
3159 |
#, php-format
|
3160 |
msgid "%%currentmonth_short%%"
|
3161 |
msgstr ""
|
3162 |
|
3163 |
-
#: inc/admin/admin.php:
|
3164 |
msgid "Current month in 3 letters, eg: \"Jan\" for \"January\""
|
3165 |
msgstr ""
|
3166 |
|
3167 |
-
#: inc/admin/admin.php:
|
3168 |
#, php-format
|
3169 |
msgid "%%currentyear%%"
|
3170 |
msgstr ""
|
3171 |
|
3172 |
-
#: inc/admin/admin.php:
|
3173 |
-
msgid "Current year"
|
3174 |
-
msgstr ""
|
3175 |
-
|
3176 |
-
#: inc/admin/admin.php:287
|
3177 |
#, php-format
|
3178 |
msgid "%%currentdate%%"
|
3179 |
msgstr ""
|
3180 |
|
3181 |
-
#: inc/admin/admin.php:
|
3182 |
-
msgid "Current date"
|
3183 |
-
msgstr ""
|
3184 |
-
|
3185 |
-
#: inc/admin/admin.php:288
|
3186 |
#, php-format
|
3187 |
msgid "%%currenttime%%"
|
3188 |
msgstr ""
|
3189 |
|
3190 |
-
#: inc/admin/admin.php:
|
3191 |
-
msgid "Current time"
|
3192 |
-
msgstr ""
|
3193 |
-
|
3194 |
-
#: inc/admin/admin.php:289
|
3195 |
#, php-format
|
3196 |
msgid "%%author_bio%%"
|
3197 |
msgstr ""
|
3198 |
|
3199 |
-
#: inc/admin/admin.php:
|
3200 |
msgid "Author bio, meta desc only"
|
3201 |
msgstr ""
|
3202 |
|
3203 |
-
#: inc/admin/admin.php:
|
3204 |
#, php-format
|
3205 |
msgid "%%currentmonth_num%%"
|
3206 |
msgstr ""
|
3207 |
|
3208 |
-
#: inc/admin/admin.php:
|
3209 |
-
msgid "Current month in digital format"
|
3210 |
-
msgstr ""
|
3211 |
-
|
3212 |
-
#: inc/admin/admin.php:296
|
3213 |
msgid "Templates variables"
|
3214 |
msgstr ""
|
3215 |
|
3216 |
-
#: inc/admin/admin.php:
|
3217 |
msgid "Browse our guides"
|
3218 |
msgstr ""
|
3219 |
|
3220 |
-
#: inc/admin/admin.php:
|
3221 |
msgid "Read our FAQ"
|
3222 |
msgstr ""
|
3223 |
|
3224 |
-
#: inc/admin/admin.php:
|
3225 |
msgid "Check our website"
|
3226 |
msgstr ""
|
3227 |
|
3228 |
-
#: inc/admin/admin.php:
|
3229 |
msgid ""
|
3230 |
"Watch our video to learn how to connect your WordPress site with Google "
|
3231 |
"Analytics and get statistics right in your dashboard (PRO only)."
|
3232 |
msgstr ""
|
3233 |
|
3234 |
-
#: inc/admin/admin.php:
|
3235 |
msgid "How-to"
|
3236 |
msgstr ""
|
3237 |
|
3238 |
-
#: inc/admin/admin.php:
|
3239 |
-
#: inc/admin/admin.php:
|
3240 |
-
#: inc/admin/admin.php:
|
3241 |
-
#: inc/admin/admin.php:
|
3242 |
msgid "Click to disable this feature"
|
3243 |
msgstr ""
|
3244 |
|
3245 |
-
#: inc/admin/admin.php:
|
3246 |
-
#: inc/admin/admin.php:
|
3247 |
-
#: inc/admin/admin.php:
|
3248 |
-
#: inc/admin/admin.php:
|
3249 |
msgid "Click to enable this feature"
|
3250 |
msgstr ""
|
3251 |
|
3252 |
-
#: inc/admin/admin.php:
|
3253 |
msgid "Home"
|
3254 |
msgstr ""
|
3255 |
|
3256 |
-
#: inc/admin/admin.php:
|
3257 |
msgid "Single Post Types"
|
3258 |
msgstr ""
|
3259 |
|
3260 |
-
#: inc/admin/admin.php:
|
3261 |
msgid "Archives"
|
3262 |
msgstr ""
|
3263 |
|
3264 |
-
#: inc/admin/admin.php:
|
3265 |
msgid "Taxonomies"
|
3266 |
msgstr ""
|
3267 |
|
3268 |
-
#: inc/admin/admin.php:
|
3269 |
msgid "General"
|
3270 |
msgstr ""
|
3271 |
|
3272 |
-
#: inc/admin/admin.php:
|
3273 |
msgid "Post Types"
|
3274 |
msgstr ""
|
3275 |
|
3276 |
-
#: inc/admin/admin.php:
|
3277 |
msgid "HTML Sitemap"
|
3278 |
msgstr ""
|
3279 |
|
3280 |
-
#: inc/admin/admin.php:
|
3281 |
msgid "Knowledge Graph"
|
3282 |
msgstr ""
|
3283 |
|
3284 |
-
#: inc/admin/admin.php:
|
3285 |
msgid "Your social accounts"
|
3286 |
msgstr ""
|
3287 |
|
3288 |
-
#: inc/admin/admin.php:
|
3289 |
msgid "Facebook (Open Graph)"
|
3290 |
msgstr ""
|
3291 |
|
3292 |
-
#: inc/admin/admin.php:
|
3293 |
msgid "Twitter (Twitter card)"
|
3294 |
msgstr ""
|
3295 |
|
3296 |
-
#: inc/admin/admin.php:
|
3297 |
msgid "Tracking"
|
3298 |
msgstr ""
|
3299 |
|
3300 |
-
#: inc/admin/admin.php:
|
3301 |
msgid "Ecommerce"
|
3302 |
msgstr ""
|
3303 |
|
3304 |
-
#: inc/admin/admin.php:
|
3305 |
msgid "Events"
|
3306 |
msgstr ""
|
3307 |
|
3308 |
-
#: inc/admin/admin.php:
|
3309 |
msgid "Custom Dimensions"
|
3310 |
msgstr ""
|
3311 |
|
3312 |
-
#: inc/admin/admin.php:
|
3313 |
msgid "Stats in Dashboard"
|
3314 |
msgstr ""
|
3315 |
|
3316 |
-
#: inc/admin/admin.php:
|
3317 |
msgid "Cookie bar / GDPR"
|
3318 |
msgstr ""
|
3319 |
|
3320 |
-
#: inc/admin/admin.php:
|
3321 |
msgid "Matomo"
|
3322 |
msgstr ""
|
3323 |
|
3324 |
-
#: inc/admin/admin.php:
|
3325 |
msgid "Appearance"
|
3326 |
msgstr ""
|
3327 |
|
3328 |
-
#: inc/admin/admin.php:
|
3329 |
msgid "Security"
|
3330 |
msgstr ""
|
3331 |
|
3332 |
-
#: inc/admin/admin.php:
|
3333 |
msgid "Data"
|
3334 |
msgstr ""
|
3335 |
|
3336 |
-
#: inc/admin/admin.php:
|
3337 |
msgid "Settings"
|
3338 |
msgstr ""
|
3339 |
|
3340 |
-
#: inc/admin/admin.php:
|
3341 |
msgid "Plugins"
|
3342 |
msgstr ""
|
3343 |
|
3344 |
-
#: inc/admin/admin.php:
|
3345 |
msgid "Reset"
|
3346 |
msgstr ""
|
3347 |
|
3348 |
-
#: inc/admin/admin.php:
|
3349 |
msgid "Import data from a CSV"
|
3350 |
msgstr ""
|
3351 |
|
3352 |
-
#: inc/admin/admin.php:
|
3353 |
msgid ""
|
3354 |
-
"
|
3355 |
-
"
|
3356 |
msgstr ""
|
3357 |
|
3358 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3359 |
msgid "Run the importer"
|
3360 |
msgstr ""
|
3361 |
|
3362 |
-
#: inc/admin/admin.php:
|
3363 |
msgid "Export metadata to a CSV"
|
3364 |
msgstr ""
|
3365 |
|
3366 |
-
#: inc/admin/admin.php:
|
3367 |
-
msgid "
|
|
|
|
|
3368 |
msgstr ""
|
3369 |
|
3370 |
-
#: inc/admin/admin.php:
|
3371 |
-
#: inc/admin/admin.php:
|
3372 |
msgid "Export"
|
3373 |
msgstr ""
|
3374 |
|
3375 |
-
#: inc/admin/admin.php:
|
3376 |
msgid "Export plugin settings"
|
3377 |
msgstr ""
|
3378 |
|
3379 |
-
#: inc/admin/admin.php:
|
3380 |
msgid ""
|
3381 |
"Export the plugin settings for this site as a .json file. This allows you to "
|
3382 |
"easily import the configuration into another site."
|
3383 |
msgstr ""
|
3384 |
|
3385 |
-
#: inc/admin/admin.php:
|
3386 |
msgid "Import plugin settings"
|
3387 |
msgstr ""
|
3388 |
|
3389 |
-
#: inc/admin/admin.php:
|
3390 |
msgid ""
|
3391 |
"Import the plugin settings from a .json file. This file can be obtained by "
|
3392 |
"exporting the settings on another site using the form above."
|
3393 |
msgstr ""
|
3394 |
|
3395 |
-
#: inc/admin/admin.php:
|
3396 |
-
#: inc/admin/admin.php:
|
3397 |
msgid "Import"
|
3398 |
msgstr ""
|
3399 |
|
3400 |
-
#: inc/admin/admin.php:
|
3401 |
msgid "Import completed!"
|
3402 |
msgstr ""
|
3403 |
|
3404 |
-
#: inc/admin/admin.php:
|
3405 |
msgid ""
|
3406 |
"<strong>WARNING:</strong> Migration will update/delete all SEOPress posts "
|
3407 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
3408 |
"any Squirrly SEO data."
|
3409 |
msgstr ""
|
3410 |
|
3411 |
-
#: inc/admin/admin.php:
|
3412 |
msgid "Import your redirections"
|
3413 |
msgstr ""
|
3414 |
|
3415 |
-
#: inc/admin/admin.php:
|
3416 |
msgid "CSV file (must match the template)"
|
3417 |
msgstr ""
|
3418 |
|
3419 |
-
#: inc/admin/admin.php:
|
3420 |
msgid "Redirections plugin (JSON - WordPress Redirects)"
|
3421 |
msgstr ""
|
3422 |
|
3423 |
-
#: inc/admin/admin.php:
|
3424 |
msgid "Yoast Premium plugin (CSV)"
|
3425 |
msgstr ""
|
3426 |
|
3427 |
-
#: inc/admin/admin.php:
|
3428 |
msgid "Rank Math plugin (TXT)"
|
3429 |
msgstr ""
|
3430 |
|
3431 |
-
#: inc/admin/admin.php:
|
3432 |
msgid "Import Redirections"
|
3433 |
msgstr ""
|
3434 |
|
3435 |
-
#: inc/admin/admin.php:
|
3436 |
msgid ""
|
3437 |
"Import your own redirections from a .csv file (separator \";\"). You must "
|
3438 |
"have 6 columns in this order:"
|
3439 |
msgstr ""
|
3440 |
|
3441 |
-
#: inc/admin/admin.php:
|
3442 |
msgid "URL to match (without your domain name)"
|
3443 |
msgstr ""
|
3444 |
|
3445 |
-
#: inc/admin/admin.php:
|
3446 |
msgid "URL to redirect in absolute,"
|
3447 |
msgstr ""
|
3448 |
|
3449 |
-
#: inc/admin/admin.php:
|
3450 |
msgid "type of redirection (301, 302 or 307, 410, 451),"
|
3451 |
msgstr ""
|
3452 |
|
3453 |
-
#: inc/admin/admin.php:
|
3454 |
msgid "Yes to enable the redirect (leave it empty to disable the redirect)"
|
3455 |
msgstr ""
|
3456 |
|
3457 |
-
#: inc/admin/admin.php:
|
3458 |
msgid ""
|
3459 |
"the query parameter without the quotes (\"exact_match\" = Exact match with "
|
3460 |
"all parameters, \"without_param\" = Exclude all parameters or "
|
@@ -3462,35 +3587,35 @@ msgid ""
|
|
3462 |
"redirection),"
|
3463 |
msgstr ""
|
3464 |
|
3465 |
-
#: inc/admin/admin.php:
|
3466 |
msgid "and, the last parameter, the counter (optional)."
|
3467 |
msgstr ""
|
3468 |
|
3469 |
-
#: inc/admin/admin.php:
|
3470 |
msgid "Download a CSV example"
|
3471 |
msgstr ""
|
3472 |
|
3473 |
-
#: inc/admin/admin.php:
|
3474 |
msgid "Duplicate entries will be automatically removed during import."
|
3475 |
msgstr ""
|
3476 |
|
3477 |
-
#: inc/admin/admin.php:
|
3478 |
msgid "Select your separator:"
|
3479 |
msgstr ""
|
3480 |
|
3481 |
-
#: inc/admin/admin.php:
|
3482 |
msgid "Comma separator: \"<strong>,</strong>\""
|
3483 |
msgstr ""
|
3484 |
|
3485 |
-
#: inc/admin/admin.php:
|
3486 |
msgid "Semicolon separator: \"<strong>;</strong>\""
|
3487 |
msgstr ""
|
3488 |
|
3489 |
-
#: inc/admin/admin.php:
|
3490 |
msgid "Import Redirections from the Redirections plugin"
|
3491 |
msgstr ""
|
3492 |
|
3493 |
-
#: inc/admin/admin.php:
|
3494 |
msgid ""
|
3495 |
"Import your own redirections from a .json file generated by the Redirections "
|
3496 |
"plugin (make sure to select <strong>\"WordPress redirects\"</strong> when "
|
@@ -3499,749 +3624,786 @@ msgid ""
|
|
3499 |
"file and existing redirects."
|
3500 |
msgstr ""
|
3501 |
|
3502 |
-
#: inc/admin/admin.php:
|
3503 |
msgid "Import Redirections from Yoast Premium"
|
3504 |
msgstr ""
|
3505 |
|
3506 |
-
#: inc/admin/admin.php:
|
3507 |
msgid ""
|
3508 |
"Import your own redirections from a .csv file generated by Yoast Premium. "
|
3509 |
"Note that we don't support certain options, like regex. To avoid conflicts, "
|
3510 |
"make sure there are no duplicates between your file and existing redirects."
|
3511 |
msgstr ""
|
3512 |
|
3513 |
-
#: inc/admin/admin.php:
|
3514 |
msgid "Import Redirections from Rank Math"
|
3515 |
msgstr ""
|
3516 |
|
3517 |
-
#: inc/admin/admin.php:
|
3518 |
msgid ""
|
3519 |
"Import your own redirections from a .txt file generated by Rank Math. Note "
|
3520 |
"that we don't support certain options, like regex. To avoid conflicts, make "
|
3521 |
"sure there are no duplicates between your file and existing redirects."
|
3522 |
msgstr ""
|
3523 |
|
3524 |
-
#: inc/admin/admin.php:
|
3525 |
msgid "Export Redirections"
|
3526 |
msgstr ""
|
3527 |
|
3528 |
-
#: inc/admin/admin.php:
|
3529 |
msgid ""
|
3530 |
"Export all redirections for this site as a .csv file. This allows you to "
|
3531 |
"easily import the redirections into another site, to Excel / Google Sheets..."
|
3532 |
msgstr ""
|
3533 |
|
3534 |
-
#: inc/admin/admin.php:
|
3535 |
msgid "Export Redirections for an .htaccess file"
|
3536 |
msgstr ""
|
3537 |
|
3538 |
-
#: inc/admin/admin.php:
|
3539 |
msgid ""
|
3540 |
"Export all redirects from this site to a txt file. Then copy and paste the "
|
3541 |
"formatted URLs into your .htaccess file."
|
3542 |
msgstr ""
|
3543 |
|
3544 |
-
#: inc/admin/admin.php:
|
3545 |
msgid "Only active redirections will be exported."
|
3546 |
msgstr ""
|
3547 |
|
3548 |
-
#: inc/admin/admin.php:
|
3549 |
msgid ""
|
3550 |
"Save your .htaccess file before editing it. <strong>Safety first!</strong>"
|
3551 |
msgstr ""
|
3552 |
|
3553 |
-
#: inc/admin/admin.php:
|
3554 |
msgid "Do not forget to test every redirects!"
|
3555 |
msgstr ""
|
3556 |
|
3557 |
-
#: inc/admin/admin.php:
|
3558 |
msgid "Clean your 404"
|
3559 |
msgstr ""
|
3560 |
|
3561 |
-
#: inc/admin/admin.php:
|
3562 |
msgid "Delete all your 404 errors. We don‘t delete any redirects."
|
3563 |
msgstr ""
|
3564 |
|
3565 |
-
#: inc/admin/admin.php:
|
3566 |
#, php-format
|
3567 |
msgid ""
|
3568 |
"Make sure you have enabled 404 cleaning from SEO, PRO, <a href=\"%s"
|
3569 |
"\">404/301</a> tab to be able to delete all your 404 errors."
|
3570 |
msgstr ""
|
3571 |
|
3572 |
-
#: inc/admin/admin.php:
|
3573 |
#, php-format
|
3574 |
msgid ""
|
3575 |
"You can also use <span class=\"dashicons dashicons-external\"></span><a href="
|
3576 |
"\"%s\" target=\"_blank\">this MySQL query</a> if necessary."
|
3577 |
msgstr ""
|
3578 |
|
3579 |
-
#: inc/admin/admin.php:
|
3580 |
msgid "Delete all 404"
|
3581 |
msgstr ""
|
3582 |
|
3583 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3584 |
msgid "Redirections feature is disabled. Please activate it from the PRO page."
|
3585 |
msgstr ""
|
3586 |
|
3587 |
-
#: inc/admin/admin.php:
|
3588 |
msgid "Activate Redirections"
|
3589 |
msgstr ""
|
3590 |
|
3591 |
-
#: inc/admin/admin.php:
|
3592 |
msgid "Reset All Notices From Notifications Center"
|
3593 |
msgstr ""
|
3594 |
|
3595 |
-
#: inc/admin/admin.php:
|
3596 |
msgid ""
|
3597 |
"By clicking Reset Notices, all notices in the notifications center will be "
|
3598 |
"set to their initial status."
|
3599 |
msgstr ""
|
3600 |
|
3601 |
-
#: inc/admin/admin.php:
|
3602 |
msgid "Reset notices"
|
3603 |
msgstr ""
|
3604 |
|
3605 |
-
#: inc/admin/admin.php:
|
3606 |
msgid "Reset All Settings"
|
3607 |
msgstr ""
|
3608 |
|
3609 |
-
#: inc/admin/admin.php:
|
3610 |
msgid ""
|
3611 |
-
"<strong>WARNING:</strong> Delete all options related to
|
3612 |
"database AND set settings to their default values."
|
3613 |
msgstr ""
|
3614 |
|
3615 |
-
#: inc/admin/admin.php:
|
3616 |
msgid "Reset settings"
|
3617 |
msgstr ""
|
3618 |
|
3619 |
-
#: inc/admin/admin.php:
|
3620 |
msgid "noindex"
|
3621 |
msgstr ""
|
3622 |
|
3623 |
-
#: inc/admin/admin.php:
|
3624 |
msgid "nofollow"
|
3625 |
msgstr ""
|
3626 |
|
3627 |
-
#: inc/admin/admin.php:
|
3628 |
msgid "noodp"
|
3629 |
msgstr ""
|
3630 |
|
3631 |
-
#: inc/admin/admin.php:
|
3632 |
msgid "noimageindex"
|
3633 |
msgstr ""
|
3634 |
|
3635 |
-
#: inc/admin/admin.php:
|
3636 |
msgid "noarchive"
|
3637 |
msgstr ""
|
3638 |
|
3639 |
-
#: inc/admin/admin.php:
|
3640 |
msgid "nosnippet"
|
3641 |
msgstr ""
|
3642 |
|
3643 |
-
#: inc/admin/admin.php:
|
3644 |
msgid "nositelinkssearchbox"
|
3645 |
msgstr ""
|
3646 |
|
3647 |
-
#: inc/admin/admin.php:
|
3648 |
msgid "Indicate paginated content to Google"
|
3649 |
msgstr ""
|
3650 |
|
3651 |
-
#: inc/admin/admin.php:
|
3652 |
msgid "noindex on paged archives"
|
3653 |
msgstr ""
|
3654 |
|
3655 |
-
#: inc/admin/admin.php:
|
3656 |
msgid "Enable XML Sitemap"
|
3657 |
msgstr ""
|
3658 |
|
3659 |
-
#: inc/admin/admin.php:
|
3660 |
msgid "Enable XML Image Sitemaps"
|
3661 |
msgstr ""
|
3662 |
|
3663 |
-
#: inc/admin/admin.php:
|
3664 |
msgid "Enable XML Video Sitemaps"
|
3665 |
msgstr ""
|
3666 |
|
3667 |
-
#: inc/admin/admin.php:
|
3668 |
msgid "Enable Author Sitemap"
|
3669 |
msgstr ""
|
3670 |
|
3671 |
-
#: inc/admin/admin.php:
|
3672 |
msgid "Enable HTML Sitemap"
|
3673 |
msgstr ""
|
3674 |
|
3675 |
-
#: inc/admin/admin.php:
|
3676 |
msgid "Check to INCLUDE Post Types"
|
3677 |
msgstr ""
|
3678 |
|
3679 |
-
#: inc/admin/admin.php:
|
3680 |
msgid "Check to INCLUDE Taxonomies"
|
3681 |
msgstr ""
|
3682 |
|
3683 |
-
#: inc/admin/admin.php:
|
3684 |
msgid "Enter a post, page or custom post type ID(s) to display the sitemap"
|
3685 |
msgstr ""
|
3686 |
|
3687 |
-
#: inc/admin/admin.php:
|
3688 |
msgid "Exclude some Posts, Pages, Custom Post Types or Terms IDs"
|
3689 |
msgstr ""
|
3690 |
|
3691 |
-
#: inc/admin/admin.php:
|
3692 |
msgid "Sort order"
|
3693 |
msgstr ""
|
3694 |
|
3695 |
-
#: inc/admin/admin.php:
|
3696 |
msgid "Order posts by"
|
3697 |
msgstr ""
|
3698 |
|
3699 |
-
#: inc/admin/admin.php:
|
3700 |
msgid "Disable the display of the publication date"
|
3701 |
msgstr ""
|
3702 |
|
3703 |
-
#: inc/admin/admin.php:
|
3704 |
msgid "Organization's phone number (only for Organizations)"
|
3705 |
msgstr ""
|
3706 |
|
3707 |
-
#: inc/admin/admin.php:
|
3708 |
msgid "Contact type (only for Organizations)"
|
3709 |
msgstr ""
|
3710 |
|
3711 |
-
#: inc/admin/admin.php:
|
3712 |
msgid "Contact option (only for Organizations)"
|
3713 |
msgstr ""
|
3714 |
|
3715 |
-
#: inc/admin/admin.php:
|
3716 |
msgid "Facebook Page URL"
|
3717 |
msgstr ""
|
3718 |
|
3719 |
-
#: inc/admin/admin.php:
|
3720 |
msgid "Enable Open Graph Data"
|
3721 |
msgstr ""
|
3722 |
|
3723 |
-
#: inc/admin/admin.php:
|
3724 |
msgid "Select a default image"
|
3725 |
msgstr ""
|
3726 |
|
3727 |
-
#: inc/admin/admin.php:
|
3728 |
msgid "Apply this image to all your og:image tag"
|
3729 |
msgstr ""
|
3730 |
|
3731 |
-
#: inc/admin/admin.php:
|
3732 |
msgid "Define custom og:image tag for post type archive pages"
|
3733 |
msgstr ""
|
3734 |
|
3735 |
-
#: inc/admin/admin.php:
|
3736 |
msgid "Facebook Link Ownership ID"
|
3737 |
msgstr ""
|
3738 |
|
3739 |
-
#: inc/admin/admin.php:
|
3740 |
msgid "Facebook Admin ID"
|
3741 |
msgstr ""
|
3742 |
|
3743 |
-
#: inc/admin/admin.php:
|
3744 |
msgid "Facebook App ID"
|
3745 |
msgstr ""
|
3746 |
|
3747 |
-
#: inc/admin/admin.php:
|
3748 |
msgid "Enable Twitter Card"
|
3749 |
msgstr ""
|
3750 |
|
3751 |
-
#: inc/admin/admin.php:
|
3752 |
msgid "Use Open Graph if no Twitter Card is filled"
|
3753 |
msgstr ""
|
3754 |
|
3755 |
-
#: inc/admin/admin.php:
|
3756 |
msgid "Default Twitter Image"
|
3757 |
msgstr ""
|
3758 |
|
3759 |
-
#: inc/admin/admin.php:
|
3760 |
msgid "Image size for Twitter Summary card"
|
3761 |
msgstr ""
|
3762 |
|
3763 |
-
#: inc/admin/admin.php:
|
3764 |
msgid "Enable Google Analytics tracking"
|
3765 |
msgstr ""
|
3766 |
|
3767 |
-
#: inc/admin/admin.php:
|
3768 |
msgid "Enter your tracking ID"
|
3769 |
msgstr ""
|
3770 |
|
3771 |
-
#: inc/admin/admin.php:
|
3772 |
msgid "Exclude user roles from tracking (Google Analytics and Matomo)"
|
3773 |
msgstr ""
|
3774 |
|
3775 |
-
#: inc/admin/admin.php:
|
3776 |
msgid "Analytics tracking opt-in"
|
3777 |
msgstr ""
|
3778 |
|
3779 |
-
#: inc/admin/admin.php:
|
3780 |
msgid "Consent message for user tracking"
|
3781 |
msgstr ""
|
3782 |
|
3783 |
-
#: inc/admin/admin.php:
|
3784 |
msgid "Accept button for user tracking"
|
3785 |
msgstr ""
|
3786 |
|
3787 |
-
#: inc/admin/admin.php:
|
3788 |
msgid "Close button"
|
3789 |
msgstr ""
|
3790 |
|
3791 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
3792 |
msgid "Cookie bar position"
|
3793 |
msgstr ""
|
3794 |
|
3795 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3796 |
msgid "Cookie bar background color"
|
3797 |
msgstr ""
|
3798 |
|
3799 |
-
#: inc/admin/admin.php:
|
3800 |
msgid "Cookie bar text color"
|
3801 |
msgstr ""
|
3802 |
|
3803 |
-
#: inc/admin/admin.php:
|
3804 |
msgid "Cookie bar link color"
|
3805 |
msgstr ""
|
3806 |
|
3807 |
-
#: inc/admin/admin.php:
|
3808 |
msgid "Cookie bar button background color"
|
3809 |
msgstr ""
|
3810 |
|
3811 |
-
#: inc/admin/admin.php:
|
3812 |
msgid "Cookie bar button color"
|
3813 |
msgstr ""
|
3814 |
|
3815 |
-
#: inc/admin/admin.php:
|
3816 |
msgid "Cookie bar button hover background color"
|
3817 |
msgstr ""
|
3818 |
|
3819 |
-
#: inc/admin/admin.php:
|
3820 |
msgid "Cookie bar button hover color"
|
3821 |
msgstr ""
|
3822 |
|
3823 |
-
#: inc/admin/admin.php:
|
3824 |
msgid "Cookie bar secondary button background color"
|
3825 |
msgstr ""
|
3826 |
|
3827 |
-
#: inc/admin/admin.php:
|
3828 |
msgid "Cookie bar secondary button color"
|
3829 |
msgstr ""
|
3830 |
|
3831 |
-
#: inc/admin/admin.php:
|
3832 |
msgid "Cookie bar secondary button hover background color"
|
3833 |
msgstr ""
|
3834 |
|
3835 |
-
#: inc/admin/admin.php:
|
3836 |
msgid "Cookie bar secondary button hover color"
|
3837 |
msgstr ""
|
3838 |
|
3839 |
-
#: inc/admin/admin.php:
|
3840 |
msgid "Enable Google Optimize"
|
3841 |
msgstr ""
|
3842 |
|
3843 |
-
#: inc/admin/admin.php:
|
3844 |
msgid "Enable Google Ads"
|
3845 |
msgstr ""
|
3846 |
|
3847 |
-
#: inc/admin/admin.php:
|
3848 |
msgid "Add an additional tracking code (like Facebook Pixel, Hotjar...)"
|
3849 |
msgstr ""
|
3850 |
|
3851 |
-
#: inc/admin/admin.php:
|
3852 |
msgid "[BODY] Add an additional tracking code (like Google Tag Manager...)"
|
3853 |
msgstr ""
|
3854 |
|
3855 |
-
#: inc/admin/admin.php:
|
3856 |
msgid ""
|
3857 |
"[BODY (FOOTER)] Add an additional tracking code (like Google Tag Manager...)"
|
3858 |
msgstr ""
|
3859 |
|
3860 |
-
#: inc/admin/admin.php:
|
3861 |
msgid "Enable remarketing, demographics, and interests reporting"
|
3862 |
msgstr ""
|
3863 |
|
3864 |
-
#: inc/admin/admin.php:
|
3865 |
msgid "Enable IP Anonymization"
|
3866 |
msgstr ""
|
3867 |
|
3868 |
-
#: inc/admin/admin.php:
|
3869 |
msgid "Enhanced Link Attribution"
|
3870 |
msgstr ""
|
3871 |
|
3872 |
-
#: inc/admin/admin.php:
|
3873 |
msgid "Enable cross-domain tracking"
|
3874 |
msgstr ""
|
3875 |
|
3876 |
-
#: inc/admin/admin.php:
|
3877 |
msgid "Cross domains"
|
3878 |
msgstr ""
|
3879 |
|
3880 |
-
#: inc/admin/admin.php:
|
3881 |
msgid "Enable external links tracking"
|
3882 |
msgstr ""
|
3883 |
|
3884 |
-
#: inc/admin/admin.php:
|
3885 |
msgid "Enable downloads tracking (eg: PDF, XLSX, DOCX...)"
|
3886 |
msgstr ""
|
3887 |
|
3888 |
-
#: inc/admin/admin.php:
|
3889 |
msgid "Track downloads' clicks"
|
3890 |
msgstr ""
|
3891 |
|
3892 |
-
#: inc/admin/admin.php:
|
3893 |
msgid "Enable affiliate/outbound links tracking (eg: aff, go, out, recommends)"
|
3894 |
msgstr ""
|
3895 |
|
3896 |
-
#: inc/admin/admin.php:
|
3897 |
msgid "Track affiliate/outbound links"
|
3898 |
msgstr ""
|
3899 |
|
3900 |
-
#: inc/admin/admin.php:
|
3901 |
msgid "Track Authors"
|
3902 |
msgstr ""
|
3903 |
|
3904 |
-
#: inc/admin/admin.php:
|
3905 |
msgid "Track Categories"
|
3906 |
msgstr ""
|
3907 |
|
3908 |
-
#: inc/admin/admin.php:
|
3909 |
msgid "Track Tags"
|
3910 |
msgstr ""
|
3911 |
|
3912 |
-
#: inc/admin/admin.php:
|
3913 |
msgid "Track Post Types"
|
3914 |
msgstr ""
|
3915 |
|
3916 |
-
#: inc/admin/admin.php:
|
3917 |
msgid "Track Logged In Users"
|
3918 |
msgstr ""
|
3919 |
|
3920 |
-
#: inc/admin/admin.php:
|
3921 |
msgid "Enable Matomo tracking"
|
3922 |
msgstr ""
|
3923 |
|
3924 |
-
#: inc/admin/admin.php:
|
3925 |
msgid "Enter your site ID"
|
3926 |
msgstr ""
|
3927 |
|
3928 |
-
#: inc/admin/admin.php:
|
3929 |
msgid "Track visitors across all subdomains"
|
3930 |
msgstr ""
|
3931 |
|
3932 |
-
#: inc/admin/admin.php:
|
3933 |
msgid "Prepend the site domain"
|
3934 |
msgstr ""
|
3935 |
|
3936 |
-
#: inc/admin/admin.php:
|
3937 |
msgid "Track users with JavaScript disabled"
|
3938 |
msgstr ""
|
3939 |
|
3940 |
-
#: inc/admin/admin.php:
|
3941 |
msgid "Enables cross domain linking"
|
3942 |
msgstr ""
|
3943 |
|
3944 |
-
#: inc/admin/admin.php:
|
3945 |
msgid "Cross domain"
|
3946 |
msgstr ""
|
3947 |
|
3948 |
-
#: inc/admin/admin.php:
|
3949 |
msgid "Enable DoNotTrack detection"
|
3950 |
msgstr ""
|
3951 |
|
3952 |
-
#: inc/admin/admin.php:
|
3953 |
msgid "Disable all tracking cookies"
|
3954 |
msgstr ""
|
3955 |
|
3956 |
-
#: inc/admin/admin.php:
|
3957 |
msgid "Download & Outlink tracking"
|
3958 |
msgstr ""
|
3959 |
|
3960 |
-
#: inc/admin/admin.php:
|
3961 |
msgid "Redirect attachment pages to post parent"
|
3962 |
msgstr ""
|
3963 |
|
3964 |
-
#: inc/admin/admin.php:
|
3965 |
msgid "Redirect attachment pages to their file URL"
|
3966 |
msgstr ""
|
3967 |
|
3968 |
-
#: inc/admin/admin.php:
|
3969 |
msgid "Remove ?replytocom link to avoid duplicate content"
|
3970 |
msgstr ""
|
3971 |
|
3972 |
-
#: inc/admin/admin.php:
|
3973 |
msgid "Automatically set the image Title"
|
3974 |
msgstr ""
|
3975 |
|
3976 |
-
#: inc/admin/admin.php:
|
3977 |
msgid "Automatically set the image Alt text"
|
3978 |
msgstr ""
|
3979 |
|
3980 |
-
#: inc/admin/admin.php:
|
3981 |
msgid "Automatically set the image Alt text from target keywords"
|
3982 |
msgstr ""
|
3983 |
|
3984 |
-
#: inc/admin/admin.php:
|
3985 |
msgid "Automatically set the image Caption"
|
3986 |
msgstr ""
|
3987 |
|
3988 |
-
#: inc/admin/admin.php:
|
3989 |
msgid "Automatically set the image Description"
|
3990 |
msgstr ""
|
3991 |
|
3992 |
-
#: inc/admin/admin.php:
|
3993 |
msgid "Add WP Editor to taxonomy description textarea"
|
3994 |
msgstr ""
|
3995 |
|
3996 |
-
#: inc/admin/admin.php:
|
3997 |
msgid "Remove /category/ in URL"
|
3998 |
msgstr ""
|
3999 |
|
4000 |
-
#: inc/admin/admin.php:
|
4001 |
msgid "Disable trailing slash for metas"
|
4002 |
msgstr ""
|
4003 |
|
4004 |
-
#: inc/admin/admin.php:
|
4005 |
msgid "Remove WordPress generator meta tag"
|
4006 |
msgstr ""
|
4007 |
|
4008 |
-
#: inc/admin/admin.php:
|
4009 |
msgid "Remove hentry post class"
|
4010 |
msgstr ""
|
4011 |
|
4012 |
-
#: inc/admin/admin.php:
|
4013 |
msgid "Remove author URL"
|
4014 |
msgstr ""
|
4015 |
|
4016 |
-
#: inc/admin/admin.php:
|
4017 |
msgid "Remove website field in comment form"
|
4018 |
msgstr ""
|
4019 |
|
4020 |
-
#: inc/admin/admin.php:
|
4021 |
msgid "Remove WordPress shortlink meta tag"
|
4022 |
msgstr ""
|
4023 |
|
4024 |
-
#: inc/admin/admin.php:
|
4025 |
msgid "Remove Windows Live Writer meta tag"
|
4026 |
msgstr ""
|
4027 |
|
4028 |
-
#: inc/admin/admin.php:
|
4029 |
msgid "Remove RSD meta tag"
|
4030 |
msgstr ""
|
4031 |
|
4032 |
-
#: inc/admin/admin.php:
|
4033 |
msgid "Google site verification"
|
4034 |
msgstr ""
|
4035 |
|
4036 |
-
#: inc/admin/admin.php:
|
4037 |
msgid "Bing site verification"
|
4038 |
msgstr ""
|
4039 |
|
4040 |
-
#: inc/admin/admin.php:
|
4041 |
msgid "Pinterest site verification"
|
4042 |
msgstr ""
|
4043 |
|
4044 |
-
#: inc/admin/admin.php:
|
4045 |
msgid "Yandex site verification"
|
4046 |
msgstr ""
|
4047 |
|
4048 |
-
#: inc/admin/admin.php:
|
4049 |
-
msgid "
|
|
|
|
|
|
|
|
|
4050 |
msgstr ""
|
4051 |
|
4052 |
-
#: inc/admin/admin.php:
|
4053 |
-
msgid "Move
|
4054 |
msgstr ""
|
4055 |
|
4056 |
-
#: inc/admin/admin.php:
|
4057 |
msgid "Set default tab for Structured data metabox"
|
4058 |
msgstr ""
|
4059 |
|
4060 |
-
#: inc/admin/admin.php:
|
4061 |
msgid "Hide Notifications Center"
|
4062 |
msgstr ""
|
4063 |
|
4064 |
-
#: inc/admin/admin.php:
|
4065 |
msgid "Hide SEO tools"
|
4066 |
msgstr ""
|
4067 |
|
4068 |
-
#: inc/admin/admin.php:
|
4069 |
msgid "Hide Useful Links"
|
4070 |
msgstr ""
|
4071 |
|
4072 |
-
#: inc/admin/admin.php:
|
4073 |
msgid "Show Title tag column in post types"
|
4074 |
msgstr ""
|
4075 |
|
4076 |
-
#: inc/admin/admin.php:
|
4077 |
msgid "Show Meta description column in post types"
|
4078 |
msgstr ""
|
4079 |
|
4080 |
-
#: inc/admin/admin.php:
|
4081 |
msgid "Show Redirection Enable column in post types"
|
4082 |
msgstr ""
|
4083 |
|
4084 |
-
#: inc/admin/admin.php:
|
4085 |
msgid "Show Redirect URL column in post types"
|
4086 |
msgstr ""
|
4087 |
|
4088 |
-
#: inc/admin/admin.php:
|
4089 |
msgid "Show canonical URL column in post types"
|
4090 |
msgstr ""
|
4091 |
|
4092 |
-
#: inc/admin/admin.php:
|
4093 |
msgid "Show Target Keyword column in post types"
|
4094 |
msgstr ""
|
4095 |
|
4096 |
-
#: inc/admin/admin.php:
|
4097 |
msgid "Show noindex column in post types"
|
4098 |
msgstr ""
|
4099 |
|
4100 |
-
#: inc/admin/admin.php:
|
4101 |
msgid "Show nofollow column in post types"
|
4102 |
msgstr ""
|
4103 |
|
4104 |
-
#: inc/admin/admin.php:
|
4105 |
msgid "Show total number of words column in post types"
|
4106 |
msgstr ""
|
4107 |
|
4108 |
-
#: inc/admin/admin.php:
|
4109 |
msgid "Show W3C validator column in post types"
|
4110 |
msgstr ""
|
4111 |
|
4112 |
-
#: inc/admin/admin.php:
|
4113 |
msgid "Show Google Page Speed column in post types"
|
4114 |
msgstr ""
|
4115 |
|
4116 |
-
#: inc/admin/admin.php:
|
4117 |
msgid "Show Insights column in post types"
|
4118 |
msgstr ""
|
4119 |
|
4120 |
-
#: inc/admin/admin.php:
|
4121 |
msgid "Show content analysis score column in post types"
|
4122 |
msgstr ""
|
4123 |
|
4124 |
-
#: inc/admin/admin.php:
|
4125 |
msgid "Hide Genesis SEO Metabox"
|
4126 |
msgstr ""
|
4127 |
|
4128 |
-
#: inc/admin/admin.php:
|
4129 |
msgid "Hide Genesis SEO Settings link"
|
4130 |
msgstr ""
|
4131 |
|
4132 |
-
#: inc/admin/admin.php:
|
4133 |
msgid "Hide advice in Structured Data Types metabox"
|
4134 |
msgstr ""
|
4135 |
|
4136 |
-
#: inc/admin/admin.php:
|
4137 |
msgid "Block SEO metabox to user roles"
|
4138 |
msgstr ""
|
4139 |
|
4140 |
-
#: inc/admin/admin.php:
|
4141 |
msgid "Block Content analysis metabox to user roles"
|
4142 |
msgstr ""
|
4143 |
|
4144 |
-
#: inc/admin/admin.php:
|
4145 |
msgid "<p>Customize your title & meta description for homepage</p>"
|
4146 |
msgstr ""
|
4147 |
|
4148 |
-
#: inc/admin/admin.php:
|
4149 |
msgid "<p>Customize your titles & metas for Single Custom Post Types</p>"
|
4150 |
msgstr ""
|
4151 |
|
4152 |
-
#: inc/admin/admin.php:
|
4153 |
msgid "<p>Customize your metas for all pages</p>"
|
4154 |
msgstr ""
|
4155 |
|
4156 |
-
#: inc/admin/admin.php:
|
4157 |
msgid "<p>Customize your metas for all taxonomies archives</p>"
|
4158 |
msgstr ""
|
4159 |
|
4160 |
-
#: inc/admin/admin.php:
|
4161 |
msgid "<p>Customize your metas for all archives</p>"
|
4162 |
msgstr ""
|
4163 |
|
4164 |
-
#: inc/admin/admin.php:
|
4165 |
msgid "Change this settings"
|
4166 |
msgstr ""
|
4167 |
|
4168 |
-
#: inc/admin/admin.php:
|
4169 |
msgid ""
|
4170 |
"To view your sitemap, enable permalinks (not default one), and save settings "
|
4171 |
"to flush them."
|
4172 |
msgstr ""
|
4173 |
|
4174 |
-
#: inc/admin/admin.php:
|
4175 |
msgid ""
|
4176 |
"Your server uses NGINX. If XML Sitemaps doesn't work properly, you need to "
|
4177 |
"add this rule to your configuration:"
|
4178 |
msgstr ""
|
4179 |
|
4180 |
-
#: inc/admin/admin.php:
|
4181 |
msgid "Noindex content will not be displayed in Sitemaps."
|
4182 |
msgstr ""
|
4183 |
|
4184 |
-
#: inc/admin/admin.php:
|
4185 |
msgid ""
|
4186 |
"If you disable globally this feature (using the blue toggle from above), the "
|
4187 |
"native WordPress XML sitemaps will be re-activated."
|
4188 |
msgstr ""
|
4189 |
|
4190 |
-
#: inc/admin/admin.php:
|
4191 |
msgid "Blank sitemap?"
|
4192 |
msgstr ""
|
4193 |
|
4194 |
-
#: inc/admin/admin.php:
|
4195 |
msgid "404 error?"
|
4196 |
msgstr ""
|
4197 |
|
4198 |
-
#: inc/admin/admin.php:
|
4199 |
msgid "HTML error? Exclude XML and XSL from caching plugins!"
|
4200 |
msgstr ""
|
4201 |
|
4202 |
-
#: inc/admin/admin.php:
|
4203 |
msgid "View your sitemap"
|
4204 |
msgstr ""
|
4205 |
|
4206 |
-
#: inc/admin/admin.php:
|
4207 |
msgid "Ping Google manually"
|
4208 |
msgstr ""
|
4209 |
|
4210 |
-
#: inc/admin/admin.php:
|
4211 |
msgid "Flush permalinks"
|
4212 |
msgstr ""
|
4213 |
|
4214 |
-
#: inc/admin/admin.php:
|
4215 |
msgid "<p>Create an HTML Sitemap for your visitors and boost your SEO.</p>"
|
4216 |
msgstr ""
|
4217 |
|
4218 |
-
#: inc/admin/admin.php:
|
4219 |
msgid ""
|
4220 |
"<p>Limited to 1,000 posts per post type. You can change the order and "
|
4221 |
"sorting criteria below.</p>"
|
4222 |
msgstr ""
|
4223 |
|
4224 |
-
#: inc/admin/admin.php:
|
4225 |
msgid "Guide to enable a HTML Sitemap - new window"
|
4226 |
msgstr ""
|
4227 |
|
4228 |
-
#: inc/admin/admin.php:
|
4229 |
msgid "<p>Include/Exclude Post Types.</p>"
|
4230 |
msgstr ""
|
4231 |
|
4232 |
-
#: inc/admin/admin.php:
|
4233 |
msgid "<p>Include/Exclude Taxonomies.</p>"
|
4234 |
msgstr ""
|
4235 |
|
4236 |
-
#: inc/admin/admin.php:
|
4237 |
msgid "<p>Configure Google Knowledge Graph.</p>"
|
4238 |
msgstr ""
|
4239 |
|
4240 |
-
#: inc/admin/admin.php:
|
4241 |
msgid "Learn more on Google official website."
|
4242 |
msgstr ""
|
4243 |
|
4244 |
-
#: inc/admin/admin.php:
|
4245 |
msgid ""
|
4246 |
"<p>Link your site with your social accounts. Use markup on your website to "
|
4247 |
"add your social profile information to a Google Knowledge panel. Knowledge "
|
@@ -4251,533 +4413,540 @@ msgid ""
|
|
4251 |
"network links.</p>"
|
4252 |
msgstr ""
|
4253 |
|
4254 |
-
#: inc/admin/admin.php:
|
4255 |
msgid "<p>Manage Open Graph data.</p>"
|
4256 |
msgstr ""
|
4257 |
|
4258 |
-
#: inc/admin/admin.php:
|
4259 |
msgid "<p>We generate the <strong>og:image</strong> meta in this order:</p>"
|
4260 |
msgstr ""
|
4261 |
|
4262 |
-
#: inc/admin/admin.php:
|
4263 |
msgid "Custom OG Image from SEO metabox"
|
4264 |
msgstr ""
|
4265 |
|
4266 |
-
#: inc/admin/admin.php:
|
4267 |
msgid "Post thumbnail"
|
4268 |
msgstr ""
|
4269 |
|
4270 |
-
#: inc/admin/admin.php:
|
4271 |
msgid "First image of your post content"
|
4272 |
msgstr ""
|
4273 |
|
4274 |
-
#: inc/admin/admin.php:
|
4275 |
msgid "Global OG Image set in SEO > Social > Open Graph"
|
4276 |
msgstr ""
|
4277 |
|
4278 |
-
#: inc/admin/admin.php:
|
4279 |
msgid "<p>Manage your Twitter card.</p>"
|
4280 |
msgstr ""
|
4281 |
|
4282 |
-
#: inc/admin/admin.php:
|
4283 |
msgid ""
|
4284 |
"<p>We generate the <strong>twitter:image</strong> meta in this order:</p>"
|
4285 |
msgstr ""
|
4286 |
|
4287 |
-
#: inc/admin/admin.php:
|
4288 |
msgid "Custom Twitter image from SEO metabox"
|
4289 |
msgstr ""
|
4290 |
|
4291 |
-
#: inc/admin/admin.php:
|
4292 |
msgid "Global Twitter:image set in SEO > Social > Twitter Card"
|
4293 |
msgstr ""
|
4294 |
|
4295 |
-
#: inc/admin/admin.php:
|
4296 |
msgid ""
|
4297 |
"<p>Link your Google Analytics to your website. The tracking code will be "
|
4298 |
"automatically added to your site.</p>"
|
4299 |
msgstr ""
|
4300 |
|
4301 |
-
#: inc/admin/admin.php:
|
4302 |
msgid ""
|
4303 |
"<p>Manage user consent for GDPR and customize your cookie bar easily.</p>"
|
4304 |
msgstr ""
|
4305 |
|
4306 |
-
#: inc/admin/admin.php:
|
4307 |
msgid ""
|
4308 |
"Works with <strong>Google Analytics</strong> and <strong>Matomo</strong>."
|
4309 |
msgstr ""
|
4310 |
|
4311 |
-
#: inc/admin/admin.php:
|
4312 |
msgid "<p>Configure your Google Analytics tracking code.</p>"
|
4313 |
msgstr ""
|
4314 |
|
4315 |
-
#: inc/admin/admin.php:
|
4316 |
msgid "<p>Track events in Google Analytics.</p>"
|
4317 |
msgstr ""
|
4318 |
|
4319 |
-
#: inc/admin/admin.php:
|
4320 |
msgid ""
|
4321 |
"<p>Configure your Google Analytics custom dimensions. <br>Custom dimensions "
|
4322 |
-
"and custom metrics
|
4323 |
-
"
|
4324 |
-
"
|
4325 |
-
"
|
4326 |
-
"
|
4327 |
msgstr ""
|
4328 |
|
4329 |
-
#: inc/admin/admin.php:
|
4330 |
msgid "Custom dimensions also work with <strong>Matomo</strong> tracking code."
|
4331 |
msgstr ""
|
4332 |
|
4333 |
-
#: inc/admin/admin.php:
|
4334 |
msgid "Guide to create custom dimensions in Google Analytics - new window"
|
4335 |
msgstr ""
|
4336 |
|
4337 |
-
#: inc/admin/admin.php:
|
4338 |
msgid "<p>Use Matomo to track your users with privacy in mind.</p>"
|
4339 |
msgstr ""
|
4340 |
|
4341 |
-
#: inc/admin/admin.php:
|
4342 |
msgid ""
|
4343 |
"Your <strong>Custom Dimensions</strong> will also work with Matomo tracking "
|
4344 |
"code"
|
4345 |
msgstr ""
|
4346 |
|
4347 |
-
#: inc/admin/admin.php:
|
4348 |
msgid "<p>Advanced SEO options.</p>"
|
4349 |
msgstr ""
|
4350 |
|
4351 |
-
#: inc/admin/admin.php:
|
4352 |
-
msgid "<p>Customize
|
4353 |
msgstr ""
|
4354 |
|
4355 |
-
#: inc/admin/admin.php:
|
4356 |
msgid "<p>Manage security.</p>"
|
4357 |
msgstr ""
|
4358 |
|
4359 |
-
#: inc/admin/admin.php:
|
4360 |
msgid "Enter your separator, eg: \"-\""
|
4361 |
msgstr ""
|
4362 |
|
4363 |
-
#: inc/admin/admin.php:
|
4364 |
#, php-format
|
4365 |
msgid "Use this separator with %%sep%% in your title and meta description."
|
4366 |
msgstr ""
|
4367 |
|
4368 |
-
#: inc/admin/admin.php:
|
4369 |
msgid "My awesome website"
|
4370 |
msgstr ""
|
4371 |
|
4372 |
-
#: inc/admin/admin.php:
|
4373 |
-
#: inc/admin/admin.php:
|
4374 |
-
#: inc/admin/admin.php:
|
4375 |
-
#: inc/admin/admin.php:
|
4376 |
msgid "More tags"
|
4377 |
msgstr ""
|
4378 |
|
4379 |
-
#: inc/admin/admin.php:
|
4380 |
msgid "This is a cool website about Wookiees"
|
4381 |
msgstr ""
|
4382 |
|
4383 |
-
#: inc/admin/admin.php:
|
4384 |
msgid "Looking to edit your blog page?"
|
4385 |
msgstr ""
|
4386 |
|
4387 |
-
#: inc/admin/admin.php:
|
4388 |
-
#: inc/admin/admin.php:
|
4389 |
msgid "Click to hide any SEO metaboxes / columns for this post type"
|
4390 |
msgstr ""
|
4391 |
|
4392 |
-
#: inc/admin/admin.php:
|
4393 |
msgid "Click to display any SEO metaboxes / columns for this post type"
|
4394 |
msgstr ""
|
4395 |
|
4396 |
-
#: inc/admin/admin.php:
|
4397 |
-
#: inc/admin/admin.php:
|
4398 |
-
#: inc/admin/admin.php:
|
4399 |
msgid "Title template"
|
4400 |
msgstr ""
|
4401 |
|
4402 |
-
#: inc/admin/admin.php:
|
4403 |
-
#: inc/admin/admin.php:
|
4404 |
-
#: inc/admin/admin.php:
|
4405 |
msgid "Meta description template"
|
4406 |
msgstr ""
|
4407 |
|
4408 |
-
#: inc/admin/admin.php:
|
4409 |
msgid ""
|
4410 |
"Do not display this single post type in search engine results "
|
4411 |
"<strong>(noindex)</strong>"
|
4412 |
msgstr ""
|
4413 |
|
4414 |
-
#: inc/admin/admin.php:
|
4415 |
msgid ""
|
4416 |
"Do not follow links for this single post type <strong>(nofollow)</strong>"
|
4417 |
msgstr ""
|
4418 |
|
4419 |
-
#: inc/admin/admin.php:
|
4420 |
msgid "Display date in Google search results?"
|
4421 |
msgstr ""
|
4422 |
|
4423 |
-
#: inc/admin/admin.php:
|
4424 |
msgid "Display post thumbnail in Google Custom Search results?"
|
4425 |
msgstr ""
|
4426 |
|
4427 |
-
#: inc/admin/admin.php:
|
4428 |
msgid "BuddyPress groups"
|
4429 |
msgstr ""
|
4430 |
|
4431 |
-
#: inc/admin/admin.php:
|
4432 |
msgid ""
|
4433 |
"Do not display BuddyPress groups in search engine results <strong>(noindex)</"
|
4434 |
"strong>"
|
4435 |
msgstr ""
|
4436 |
|
4437 |
-
#: inc/admin/admin.php:
|
4438 |
-
#: inc/admin/admin.php:
|
4439 |
msgid "Click to hide any SEO metaboxes for this taxonomy"
|
4440 |
msgstr ""
|
4441 |
|
4442 |
-
#: inc/admin/admin.php:
|
4443 |
msgid "Click to display any SEO metaboxes for this taxonomy"
|
4444 |
msgstr ""
|
4445 |
|
4446 |
-
#: inc/admin/admin.php:
|
4447 |
msgid "Category Title"
|
4448 |
msgstr ""
|
4449 |
|
4450 |
-
#: inc/admin/admin.php:
|
4451 |
msgid "Tag Title"
|
4452 |
msgstr ""
|
4453 |
|
4454 |
-
#: inc/admin/admin.php:
|
4455 |
msgid "Category Description"
|
4456 |
msgstr ""
|
4457 |
|
4458 |
-
#: inc/admin/admin.php:
|
4459 |
msgid "Tag Description"
|
4460 |
msgstr ""
|
4461 |
|
4462 |
-
#: inc/admin/admin.php:
|
4463 |
msgid "Term Description"
|
4464 |
msgstr ""
|
4465 |
|
4466 |
-
#: inc/admin/admin.php:
|
4467 |
msgid ""
|
4468 |
"Do not display this taxonomy archive in search engine results "
|
4469 |
"<strong>(noindex)</strong>"
|
4470 |
msgstr ""
|
4471 |
|
4472 |
-
#: inc/admin/admin.php:
|
4473 |
msgid ""
|
4474 |
"Do not follow links for this taxonomy archive <strong>(nofollow)</strong>"
|
4475 |
msgstr ""
|
4476 |
|
4477 |
-
#: inc/admin/admin.php:
|
4478 |
msgid "See archive"
|
4479 |
msgstr ""
|
4480 |
|
4481 |
-
#: inc/admin/admin.php:
|
4482 |
msgid "Post Type Archive Name"
|
4483 |
msgstr ""
|
4484 |
|
4485 |
-
#: inc/admin/admin.php:
|
4486 |
msgid ""
|
4487 |
"Do not display this post type archive in search engine results "
|
4488 |
"<strong>(noindex)</strong>"
|
4489 |
msgstr ""
|
4490 |
|
4491 |
-
#: inc/admin/admin.php:
|
4492 |
msgid ""
|
4493 |
"Do not follow links for this post type archive <strong>(nofollow)</strong>"
|
4494 |
msgstr ""
|
4495 |
|
4496 |
-
#: inc/admin/admin.php:
|
4497 |
msgid "Author archives"
|
4498 |
msgstr ""
|
4499 |
|
4500 |
-
#: inc/admin/admin.php:
|
4501 |
msgid "Disable author archives"
|
4502 |
msgstr ""
|
4503 |
|
4504 |
-
#: inc/admin/admin.php:
|
4505 |
msgid "Date archives"
|
4506 |
msgstr ""
|
4507 |
|
4508 |
-
#: inc/admin/admin.php:
|
4509 |
msgid ""
|
4510 |
"Do not display date archives in search engine results <strong>(noindex)</"
|
4511 |
"strong>"
|
4512 |
msgstr ""
|
4513 |
|
4514 |
-
#: inc/admin/admin.php:
|
4515 |
msgid "Disable date archives"
|
4516 |
msgstr ""
|
4517 |
|
4518 |
-
#: inc/admin/admin.php:
|
4519 |
msgid "Search archives"
|
4520 |
msgstr ""
|
4521 |
|
4522 |
-
#: inc/admin/admin.php:
|
4523 |
msgid "Search Keywords"
|
4524 |
msgstr ""
|
4525 |
|
4526 |
-
#: inc/admin/admin.php:
|
4527 |
msgid ""
|
4528 |
"Do not display search archives in search engine results <strong>(noindex)</"
|
4529 |
"strong>"
|
4530 |
msgstr ""
|
4531 |
|
4532 |
-
#: inc/admin/admin.php:
|
4533 |
msgid "404 archives"
|
4534 |
msgstr ""
|
4535 |
|
4536 |
-
#: inc/admin/admin.php:
|
4537 |
msgid ""
|
4538 |
"Do not display all pages of the site in Google search results and do not "
|
4539 |
"display \"Cached\" links in search results."
|
4540 |
msgstr ""
|
4541 |
|
4542 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4543 |
msgid "Do not follow links for all pages."
|
4544 |
msgstr ""
|
4545 |
|
4546 |
-
#: inc/admin/admin.php:
|
4547 |
msgid ""
|
4548 |
"Do not use Open Directory project metadata for titles or excerpts for all "
|
4549 |
"pages."
|
4550 |
msgstr ""
|
4551 |
|
4552 |
-
#: inc/admin/admin.php:
|
4553 |
msgid "Do not index images from the entire site."
|
4554 |
msgstr ""
|
4555 |
|
4556 |
-
#: inc/admin/admin.php:
|
4557 |
msgid "Do not display a \"Cached\" link in the Google search results."
|
4558 |
msgstr ""
|
4559 |
|
4560 |
-
#: inc/admin/admin.php:
|
4561 |
msgid ""
|
4562 |
"Do not display a description in the Google search results for all pages."
|
4563 |
msgstr ""
|
4564 |
|
4565 |
-
#: inc/admin/admin.php:
|
4566 |
msgid ""
|
4567 |
"Prevents Google to display a sitelinks searchbox in search results. Enable "
|
4568 |
"this option will remove the \"Website\" schema from your source code."
|
4569 |
msgstr ""
|
4570 |
|
4571 |
-
#: inc/admin/admin.php:
|
4572 |
msgid "Add rel next/prev link in head of paginated archive pages"
|
4573 |
msgstr ""
|
4574 |
|
4575 |
-
#: inc/admin/admin.php:
|
4576 |
msgid "Add a \"noindex\" meta robots for all paginated archive pages"
|
4577 |
msgstr ""
|
4578 |
|
4579 |
-
#: inc/admin/admin.php:
|
4580 |
msgid "eg: https://example.com/category/my-category/page/2/"
|
4581 |
msgstr ""
|
4582 |
|
4583 |
-
#: inc/admin/admin.php:
|
4584 |
msgid "Guide to enable XML Sitemaps - new window"
|
4585 |
msgstr ""
|
4586 |
|
4587 |
-
#: inc/admin/admin.php:
|
4588 |
msgid ""
|
4589 |
"Enable Image Sitemaps (standard images, image galleries, featured image, "
|
4590 |
"WooCommerce product images)"
|
4591 |
msgstr ""
|
4592 |
|
4593 |
-
#: inc/admin/admin.php:
|
4594 |
msgid "Images in XML sitemaps are visible only from the source code."
|
4595 |
msgstr ""
|
4596 |
|
4597 |
-
#: inc/admin/admin.php:
|
4598 |
msgid "Guide to enable XML image sitemaps - new window"
|
4599 |
msgstr ""
|
4600 |
|
4601 |
-
#: inc/admin/admin.php:
|
4602 |
msgid "Enable Video Sitemaps"
|
4603 |
msgstr ""
|
4604 |
|
4605 |
-
#: inc/admin/admin.php:
|
4606 |
#, php-format
|
4607 |
msgid ""
|
4608 |
"Your video sitemap is empty? Read our guide to learn more about <a href=\"%s"
|
4609 |
"\" target=\"_blank\">adding videos to your sitemap.</a>"
|
4610 |
msgstr ""
|
4611 |
|
4612 |
-
#: inc/admin/admin.php:
|
4613 |
msgid "Guide to enable XML video sitemaps - new window"
|
4614 |
msgstr ""
|
4615 |
|
4616 |
-
#: inc/admin/admin.php:
|
4617 |
msgid ""
|
4618 |
"Make sure to enable author archive from SEO, titles and metas, archives tab."
|
4619 |
"</a>"
|
4620 |
msgstr ""
|
4621 |
|
4622 |
-
#: inc/admin/admin.php:
|
4623 |
msgid "Include"
|
4624 |
msgstr ""
|
4625 |
|
4626 |
-
#: inc/admin/admin.php:
|
4627 |
msgid ""
|
4628 |
"You should never include attachment post type in your sitemap. Be careful if "
|
4629 |
"you checked this."
|
4630 |
msgstr ""
|
4631 |
|
4632 |
-
#: inc/admin/admin.php:
|
4633 |
msgid "eg: 2, 28, 68"
|
4634 |
msgstr ""
|
4635 |
|
4636 |
-
#: inc/admin/admin.php:
|
4637 |
msgid "You can also use this shortcode:"
|
4638 |
msgstr ""
|
4639 |
|
4640 |
-
#: inc/admin/admin.php:
|
4641 |
msgid "eg: 13, 8, 38"
|
4642 |
msgstr ""
|
4643 |
|
4644 |
-
#: inc/admin/admin.php:
|
4645 |
msgid ""
|
4646 |
"DESC (descending order from highest to lowest values (3, 2, 1; c, b, a))"
|
4647 |
msgstr ""
|
4648 |
|
4649 |
-
#: inc/admin/admin.php:
|
4650 |
msgid "ASC (ascending order from lowest to highest values (1, 2, 3; a, b, c))"
|
4651 |
msgstr ""
|
4652 |
|
4653 |
-
#: inc/admin/admin.php:
|
4654 |
msgid "Default (date)"
|
4655 |
msgstr ""
|
4656 |
|
4657 |
-
#: inc/admin/admin.php:
|
4658 |
msgid "Modified date"
|
4659 |
msgstr ""
|
4660 |
|
4661 |
-
#: inc/admin/admin.php:
|
4662 |
msgid "Post ID"
|
4663 |
msgstr ""
|
4664 |
|
4665 |
-
#: inc/admin/admin.php:
|
4666 |
msgid "Menu order"
|
4667 |
msgstr ""
|
4668 |
|
4669 |
-
#: inc/admin/admin.php:
|
4670 |
msgid "Disable date after each post, page, post type?"
|
4671 |
msgstr ""
|
4672 |
|
4673 |
-
#: inc/admin/admin.php:
|
4674 |
-
msgid "eg:
|
4675 |
msgstr ""
|
4676 |
|
4677 |
-
#: inc/admin/admin.php:
|
4678 |
msgid "Select your logo"
|
4679 |
msgstr ""
|
4680 |
|
4681 |
-
#: inc/admin/admin.php:
|
4682 |
msgid "JPG, PNG, and GIF allowed."
|
4683 |
msgstr ""
|
4684 |
|
4685 |
-
#: inc/admin/admin.php:
|
4686 |
msgid "eg: +33123456789 (internationalized version required)"
|
4687 |
msgstr ""
|
4688 |
|
4689 |
-
#: inc/admin/admin.php:
|
4690 |
msgid "Customer support"
|
4691 |
msgstr ""
|
4692 |
|
4693 |
-
#: inc/admin/admin.php:
|
4694 |
msgid "Technical support"
|
4695 |
msgstr ""
|
4696 |
|
4697 |
-
#: inc/admin/admin.php:
|
4698 |
msgid "Billing support"
|
4699 |
msgstr ""
|
4700 |
|
4701 |
-
#: inc/admin/admin.php:
|
4702 |
msgid "Bill payment"
|
4703 |
msgstr ""
|
4704 |
|
4705 |
-
#: inc/admin/admin.php:
|
4706 |
msgid "Sales"
|
4707 |
msgstr ""
|
4708 |
|
4709 |
-
#: inc/admin/admin.php:
|
4710 |
msgid "Credit card support"
|
4711 |
msgstr ""
|
4712 |
|
4713 |
-
#: inc/admin/admin.php:
|
4714 |
msgid "Emergency"
|
4715 |
msgstr ""
|
4716 |
|
4717 |
-
#: inc/admin/admin.php:
|
4718 |
msgid "Baggage tracking"
|
4719 |
msgstr ""
|
4720 |
|
4721 |
-
#: inc/admin/admin.php:
|
4722 |
msgid "Roadside assistance"
|
4723 |
msgstr ""
|
4724 |
|
4725 |
-
#: inc/admin/admin.php:
|
4726 |
msgid "Package tracking"
|
4727 |
msgstr ""
|
4728 |
|
4729 |
-
#: inc/admin/admin.php:
|
4730 |
-
#: inc/admin/admin.php:
|
4731 |
msgid "None"
|
4732 |
msgstr ""
|
4733 |
|
4734 |
-
#: inc/admin/admin.php:
|
4735 |
msgid "Toll Free"
|
4736 |
msgstr ""
|
4737 |
|
4738 |
-
#: inc/admin/admin.php:
|
4739 |
msgid "Hearing impaired supported"
|
4740 |
msgstr ""
|
4741 |
|
4742 |
-
#: inc/admin/admin.php:
|
4743 |
msgid "Twitter Page URL"
|
4744 |
msgstr ""
|
4745 |
|
4746 |
-
#: inc/admin/admin.php:
|
4747 |
msgid "Enable OG data"
|
4748 |
msgstr ""
|
4749 |
|
4750 |
-
#: inc/admin/admin.php:
|
4751 |
msgid ""
|
4752 |
"Override every <strong>og:image</strong> tag with this default image (except "
|
4753 |
"if a custom og:image has already been set from the SEO metabox)."
|
4754 |
msgstr ""
|
4755 |
|
4756 |
-
#: inc/admin/admin.php:
|
4757 |
msgid "Please define a default OG Image from the field above"
|
4758 |
msgstr ""
|
4759 |
|
4760 |
-
#: inc/admin/admin.php:
|
4761 |
msgid "No custom post type to configure."
|
4762 |
msgstr ""
|
4763 |
|
4764 |
-
#: inc/admin/admin.php:
|
4765 |
msgid ""
|
4766 |
"One or more Facebook Page IDs that are associated with a URL in order to "
|
4767 |
"enable link editing and instant article publishing."
|
4768 |
msgstr ""
|
4769 |
|
4770 |
-
#: inc/admin/admin.php:
|
4771 |
msgid "How do I find my Facebook Page ID?"
|
4772 |
msgstr ""
|
4773 |
|
4774 |
-
#: inc/admin/admin.php:
|
4775 |
msgid ""
|
4776 |
"The ID (or comma-separated list for properties that can accept multiple IDs) "
|
4777 |
"of an app, person using the app, or Page Graph API object."
|
4778 |
msgstr ""
|
4779 |
|
4780 |
-
#: inc/admin/admin.php:
|
4781 |
msgid ""
|
4782 |
"The Facebook app ID of the site's app. In order to use Facebook Insights you "
|
4783 |
"must add the app ID to your page. Insights lets you view analytics for "
|
@@ -4787,48 +4956,48 @@ msgid ""
|
|
4787 |
"\"seopress-help dashicons dashicons-external\"></span>"
|
4788 |
msgstr ""
|
4789 |
|
4790 |
-
#: inc/admin/admin.php:
|
4791 |
msgid "How to create a Facebook App ID"
|
4792 |
msgstr ""
|
4793 |
|
4794 |
-
#: inc/admin/admin.php:
|
4795 |
msgid "Enable Twitter card"
|
4796 |
msgstr ""
|
4797 |
|
4798 |
-
#: inc/admin/admin.php:
|
4799 |
msgid "Use OG if no Twitter Cards"
|
4800 |
msgstr ""
|
4801 |
|
4802 |
-
#: inc/admin/admin.php:
|
4803 |
msgid "Default"
|
4804 |
msgstr ""
|
4805 |
|
4806 |
-
#: inc/admin/admin.php:
|
4807 |
msgid "Large"
|
4808 |
msgstr ""
|
4809 |
|
4810 |
-
#: inc/admin/admin.php:
|
4811 |
msgid "Enable Google Analytics tracking (Global Site Tag: gtag.js)"
|
4812 |
msgstr ""
|
4813 |
|
4814 |
-
#: inc/admin/admin.php:
|
4815 |
msgid "Enter your Tracking ID (UA-XXXX-XX)"
|
4816 |
msgstr ""
|
4817 |
|
4818 |
-
#: inc/admin/admin.php:
|
4819 |
msgid "Find your tracking ID"
|
4820 |
msgstr ""
|
4821 |
|
4822 |
-
#: inc/admin/admin.php:
|
4823 |
msgid "Request user's consent for analytics tracking (required by GDPR)"
|
4824 |
msgstr ""
|
4825 |
|
4826 |
-
#: inc/admin/admin.php:
|
4827 |
msgid ""
|
4828 |
"<strong>The user must click the Accept button to allow tracking.</strong>"
|
4829 |
msgstr ""
|
4830 |
|
4831 |
-
#: inc/admin/admin.php:
|
4832 |
msgid ""
|
4833 |
"User roles excluded from tracking will not see the consent message.<br> If "
|
4834 |
"you use a caching plugin, you have to exclude this JS file in your settings: "
|
@@ -4836,287 +5005,313 @@ msgid ""
|
|
4836 |
"js</strong> <br>and this cookie <strong>seopress-user-consent-accept</strong>"
|
4837 |
msgstr ""
|
4838 |
|
4839 |
-
#: inc/admin/admin.php:
|
4840 |
msgid "Hook to add custom tracking code with user consent - new window"
|
4841 |
msgstr ""
|
4842 |
|
4843 |
-
#: inc/admin/admin.php:
|
4844 |
msgid ""
|
4845 |
"Display and automatically accept the user‘s consent on page load (not fully "
|
4846 |
"GDPR)"
|
4847 |
msgstr ""
|
4848 |
|
4849 |
-
#: inc/admin/admin.php:
|
4850 |
msgid "The previous option must be checked to use this."
|
4851 |
msgstr ""
|
4852 |
|
4853 |
-
#: inc/admin/admin.php:
|
4854 |
msgid "Enter your message (HTML allowed)"
|
4855 |
msgstr ""
|
4856 |
|
4857 |
-
#: inc/admin/admin.php:
|
4858 |
msgid "This message will only appear if request user's consent is enabled."
|
4859 |
msgstr ""
|
4860 |
|
4861 |
-
#: inc/admin/admin.php:
|
4862 |
msgid "Hook to filter user consent message - new window"
|
4863 |
msgstr ""
|
4864 |
|
4865 |
-
#: inc/admin/admin.php:
|
4866 |
msgid "HTML tags allowed: strong, em, br, a href / target"
|
4867 |
msgstr ""
|
4868 |
|
4869 |
-
#: inc/admin/admin.php:
|
4870 |
msgid ""
|
4871 |
"Shortcode allowed to get the privacy page set in WordPress settings: "
|
4872 |
"[seopress_privacy_page]"
|
4873 |
msgstr ""
|
4874 |
|
4875 |
-
#: inc/admin/admin.php:
|
4876 |
msgid "Accept"
|
4877 |
msgstr ""
|
4878 |
|
4879 |
-
#: inc/admin/admin.php:
|
4880 |
msgid "Change the button value"
|
4881 |
msgstr ""
|
4882 |
|
4883 |
-
#: inc/admin/admin.php:
|
4884 |
msgid "default: X"
|
4885 |
msgstr ""
|
4886 |
|
4887 |
-
#: inc/admin/admin.php:
|
4888 |
msgid "Change the close button value"
|
4889 |
msgstr ""
|
4890 |
|
4891 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
4892 |
msgid "Bottom (default)"
|
4893 |
msgstr ""
|
4894 |
|
4895 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
4896 |
msgid "Top"
|
4897 |
msgstr ""
|
4898 |
|
4899 |
-
#: inc/admin/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4900 |
msgid "Change the color of the cookie bar background"
|
4901 |
msgstr ""
|
4902 |
|
4903 |
-
#: inc/admin/admin.php:
|
4904 |
msgid "Change the color of the cookie bar text"
|
4905 |
msgstr ""
|
4906 |
|
4907 |
-
#: inc/admin/admin.php:
|
4908 |
msgid "Change the color of the cookie bar link"
|
4909 |
msgstr ""
|
4910 |
|
4911 |
-
#: inc/admin/admin.php:
|
4912 |
msgid "Change the color of the cookie bar button background"
|
4913 |
msgstr ""
|
4914 |
|
4915 |
-
#: inc/admin/admin.php:
|
4916 |
msgid "Change the color of the cookie bar button hover background"
|
4917 |
msgstr ""
|
4918 |
|
4919 |
-
#: inc/admin/admin.php:
|
4920 |
msgid "Change the color of the cookie bar button"
|
4921 |
msgstr ""
|
4922 |
|
4923 |
-
#: inc/admin/admin.php:
|
4924 |
msgid "Change the color of the cookie bar button hover"
|
4925 |
msgstr ""
|
4926 |
|
4927 |
-
#: inc/admin/admin.php:
|
4928 |
msgid "Change the color of the cookie bar secondary button background"
|
4929 |
msgstr ""
|
4930 |
|
4931 |
-
#: inc/admin/admin.php:
|
4932 |
msgid "Change the color of the cookie bar secondary button hover background"
|
4933 |
msgstr ""
|
4934 |
|
4935 |
-
#: inc/admin/admin.php:
|
4936 |
msgid "Change the color of the cookie bar secondary button"
|
4937 |
msgstr ""
|
4938 |
|
4939 |
-
#: inc/admin/admin.php:
|
4940 |
msgid "Change the color of the cookie bar secondary button hover"
|
4941 |
msgstr ""
|
4942 |
|
4943 |
-
#: inc/admin/admin.php:
|
4944 |
msgid "Enter your Google Optimize container ID"
|
4945 |
msgstr ""
|
4946 |
|
4947 |
-
#: inc/admin/admin.php:
|
4948 |
msgid "GTM-XXXXXXX"
|
4949 |
msgstr ""
|
4950 |
|
4951 |
-
#: inc/admin/admin.php:
|
4952 |
msgid ""
|
4953 |
"Google Optimize offers A/B testing, website testing & personalization tools."
|
4954 |
msgstr ""
|
4955 |
|
4956 |
-
#: inc/admin/admin.php:
|
4957 |
msgid "Enter your Google Ads conversion ID (eg: AW-123456789)"
|
4958 |
msgstr ""
|
4959 |
|
4960 |
-
#: inc/admin/admin.php:
|
4961 |
msgid "AW-XXXXXXXXX"
|
4962 |
msgstr ""
|
4963 |
|
4964 |
-
#: inc/admin/admin.php:
|
4965 |
msgid "Paste your tracking code here like Google Tag Manager (head)"
|
4966 |
msgstr ""
|
4967 |
|
4968 |
-
#: inc/admin/admin.php:
|
4969 |
msgid "Additional tracking code field"
|
4970 |
msgstr ""
|
4971 |
|
4972 |
-
#: inc/admin/admin.php:
|
4973 |
msgid "This code will be added in the head section of your page."
|
4974 |
msgstr ""
|
4975 |
|
4976 |
-
#: inc/admin/admin.php:
|
4977 |
msgid "Paste your tracking code here like Google Tag Manager (body)"
|
4978 |
msgstr ""
|
4979 |
|
4980 |
-
#: inc/admin/admin.php:
|
4981 |
msgid "Additional tracking code field added to body"
|
4982 |
msgstr ""
|
4983 |
|
4984 |
-
#: inc/admin/admin.php:
|
4985 |
msgid "This code will be added just after the opening body tag of your page."
|
4986 |
msgstr ""
|
4987 |
|
4988 |
-
#: inc/admin/admin.php:
|
4989 |
msgid ""
|
4990 |
"You don‘t see your code? Make sure to call <strong>wp_body_open();</strong> "
|
4991 |
"just after the opening body tag in your theme."
|
4992 |
msgstr ""
|
4993 |
|
4994 |
-
#: inc/admin/admin.php:
|
4995 |
msgid "Paste your tracking code here (body footer)"
|
4996 |
msgstr ""
|
4997 |
|
4998 |
-
#: inc/admin/admin.php:
|
4999 |
msgid "Additional tracking code field added to body footer"
|
5000 |
msgstr ""
|
5001 |
|
5002 |
-
#: inc/admin/admin.php:
|
5003 |
msgid "This code will be added just after the closing body tag of your page."
|
5004 |
msgstr ""
|
5005 |
|
5006 |
-
#: inc/admin/admin.php:
|
5007 |
msgid ""
|
5008 |
"A remarketing audience is a list of cookies or mobile-advertising IDs that "
|
5009 |
"represents a group of users you want to re-engage because of their "
|
5010 |
"likelihood to convert."
|
5011 |
msgstr ""
|
5012 |
|
5013 |
-
#: inc/admin/admin.php:
|
5014 |
msgid ""
|
5015 |
"When a customer of Analytics requests IP address anonymization, Analytics "
|
5016 |
"anonymizes the address as soon as technically feasible at the earliest "
|
5017 |
"possible stage of the collection network."
|
5018 |
msgstr ""
|
5019 |
|
5020 |
-
#: inc/admin/admin.php:
|
5021 |
msgid ""
|
5022 |
"Enhanced Link Attribution improves the accuracy of your In-Page Analytics "
|
5023 |
"report by automatically differentiating between multiple links to the same "
|
5024 |
"URL on a single page by using link element IDs."
|
5025 |
msgstr ""
|
5026 |
|
5027 |
-
#: inc/admin/admin.php:
|
5028 |
msgid ""
|
5029 |
"Cross domain tracking makes it possible for Analytics to see sessions on two "
|
5030 |
"related sites (such as an ecommerce site and a separate shopping cart site) "
|
5031 |
"as a single session. This is sometimes called site linking."
|
5032 |
msgstr ""
|
5033 |
|
5034 |
-
#: inc/admin/admin.php:
|
5035 |
msgid "Enter your domains: seopress.org,sub.seopress.org,sub2.seopress.org"
|
5036 |
msgstr ""
|
5037 |
|
5038 |
-
#: inc/admin/admin.php:
|
5039 |
msgid "Enable download tracking"
|
5040 |
msgstr ""
|
5041 |
|
5042 |
-
#: inc/admin/admin.php:
|
5043 |
msgid "pdf|docx|pptx|zip"
|
5044 |
msgstr ""
|
5045 |
|
5046 |
-
#: inc/admin/admin.php:
|
5047 |
msgid "Separate each file type extensions with a pipe \"|\""
|
5048 |
msgstr ""
|
5049 |
|
5050 |
-
#: inc/admin/admin.php:
|
5051 |
msgid "Enable affiliate/outbound tracking"
|
5052 |
msgstr ""
|
5053 |
|
5054 |
-
#: inc/admin/admin.php:
|
5055 |
msgid "aff|go|out"
|
5056 |
msgstr ""
|
5057 |
|
5058 |
-
#: inc/admin/admin.php:
|
5059 |
msgid "Separate each keyword with a pipe \"|\""
|
5060 |
msgstr ""
|
5061 |
|
5062 |
-
#: inc/admin/admin.php:
|
5063 |
-
#: inc/admin/admin.php:
|
5064 |
#, php-format
|
5065 |
msgid "Custom Dimension #%d"
|
5066 |
msgstr ""
|
5067 |
|
5068 |
-
#: inc/admin/admin.php:
|
5069 |
msgid "Enable Matomo tracking (Matomo account required)"
|
5070 |
msgstr ""
|
5071 |
|
5072 |
-
#: inc/admin/admin.php:
|
5073 |
msgid "Enter \"example\" if you Matomo account URL is \"example.matomo.cloud\""
|
5074 |
msgstr ""
|
5075 |
|
5076 |
-
#: inc/admin/admin.php:
|
5077 |
msgid "Matomo Cloud URL"
|
5078 |
msgstr ""
|
5079 |
|
5080 |
-
#: inc/admin/admin.php:
|
5081 |
msgid "Enter only the <strong>host</strong> like this example.matomo.cloud"
|
5082 |
msgstr ""
|
5083 |
|
5084 |
-
#: inc/admin/admin.php:
|
5085 |
msgid "Enter your site ID here"
|
5086 |
msgstr ""
|
5087 |
|
5088 |
-
#: inc/admin/admin.php:
|
5089 |
msgid "Matomo Site ID"
|
5090 |
msgstr ""
|
5091 |
|
5092 |
-
#: inc/admin/admin.php:
|
5093 |
msgid ""
|
5094 |
"To find your site ID, go to your <strong>Matomo Cloud account, Websites, "
|
5095 |
"Manage page</strong>. Look at \"Site ID\" on the right part."
|
5096 |
msgstr ""
|
5097 |
|
5098 |
-
#: inc/admin/admin.php:
|
5099 |
msgid "Tracking one domain and its subdomains in the same website"
|
5100 |
msgstr ""
|
5101 |
|
5102 |
-
#: inc/admin/admin.php:
|
5103 |
msgid ""
|
5104 |
"If one visitor visits x.example.com and y.example.com, they will be counted "
|
5105 |
"as a unique visitor."
|
5106 |
msgstr ""
|
5107 |
|
5108 |
-
#: inc/admin/admin.php:
|
5109 |
msgid "Prepend the site domain to the page title when tracking"
|
5110 |
msgstr ""
|
5111 |
|
5112 |
-
#: inc/admin/admin.php:
|
5113 |
msgid ""
|
5114 |
"If someone visits the 'About' page on blog.example.com it will be recorded "
|
5115 |
"as 'blog / About'. This is the easiest way to get an overview of your "
|
5116 |
"traffic by sub-domain."
|
5117 |
msgstr ""
|
5118 |
|
5119 |
-
#: inc/admin/admin.php:
|
5120 |
msgid ""
|
5121 |
"By default, the visitor ID that identifies a unique visitor is stored in the "
|
5122 |
"browser's first party cookies which can only be accessed by pages on the "
|
@@ -5127,26 +5322,26 @@ msgid ""
|
|
5127 |
"Visitor ID."
|
5128 |
msgstr ""
|
5129 |
|
5130 |
-
#: inc/admin/admin.php:
|
5131 |
msgid "Enable client side DoNotTrack detection"
|
5132 |
msgstr ""
|
5133 |
|
5134 |
-
#: inc/admin/admin.php:
|
5135 |
msgid ""
|
5136 |
"Tracking requests will not be sent if visitors do not wish to be tracked."
|
5137 |
msgstr ""
|
5138 |
|
5139 |
-
#: inc/admin/admin.php:
|
5140 |
msgid ""
|
5141 |
"Disables all first party cookies. Existing Matomo cookies for this website "
|
5142 |
"will be deleted on the next page view."
|
5143 |
msgstr ""
|
5144 |
|
5145 |
-
#: inc/admin/admin.php:
|
5146 |
msgid "Enabling Download & Outlink tracking"
|
5147 |
msgstr ""
|
5148 |
|
5149 |
-
#: inc/admin/admin.php:
|
5150 |
msgid ""
|
5151 |
"By default, any file ending with one of these extensions will be considered "
|
5152 |
"a \"download\" in the Matomo interface: 7z|aac|arc|arj|apk|asf|asx|avi|bin|"
|
@@ -5157,270 +5352,274 @@ msgid ""
|
|
5157 |
"\t\ttbz|tbz2|tgz|torrent|txt|wav|wma|wmv|wpd|xls|xml|z|zip"
|
5158 |
msgstr ""
|
5159 |
|
5160 |
-
#: inc/admin/admin.php:
|
5161 |
msgid "Redirect attachment pages to post parent (or homepage if none)"
|
5162 |
msgstr ""
|
5163 |
|
5164 |
-
#: inc/admin/admin.php:
|
5165 |
msgid ""
|
5166 |
"If this option is checked, it will take precedence over the redirection of "
|
5167 |
"attachments to the post's parent."
|
5168 |
msgstr ""
|
5169 |
|
5170 |
-
#: inc/admin/admin.php:
|
5171 |
msgid "Remove ?replytocom link in source code"
|
5172 |
msgstr ""
|
5173 |
|
5174 |
-
#: inc/admin/admin.php:
|
5175 |
msgid ""
|
5176 |
"When sending an image file, automatically set the title based on the filename"
|
5177 |
msgstr ""
|
5178 |
|
5179 |
-
#: inc/admin/admin.php:
|
5180 |
msgid ""
|
5181 |
"When sending an image file, automatically set the alternative text based on "
|
5182 |
"the filename"
|
5183 |
msgstr ""
|
5184 |
|
5185 |
-
#: inc/admin/admin.php:
|
5186 |
msgid ""
|
5187 |
"We recommend Image SEO plugin to optimize your image ALT texts and names for "
|
5188 |
"Search Engines using AI and Machine Learning. Starting from just €4.99."
|
5189 |
msgstr ""
|
5190 |
|
5191 |
-
#: inc/admin/admin.php:
|
5192 |
msgid "Use the target keywords if not alternative text set for the image"
|
5193 |
msgstr ""
|
5194 |
|
5195 |
-
#: inc/admin/admin.php:
|
5196 |
msgid ""
|
5197 |
"This setting will be applied to images without any alt text on frontend "
|
5198 |
"only. This setting is retroactive. If you turn it off, alt texts that were "
|
5199 |
"previously empty will be empty again."
|
5200 |
msgstr ""
|
5201 |
|
5202 |
-
#: inc/admin/admin.php:
|
5203 |
msgid ""
|
5204 |
"When sending an image file, automatically set the caption based on the "
|
5205 |
"filename"
|
5206 |
msgstr ""
|
5207 |
|
5208 |
-
#: inc/admin/admin.php:
|
5209 |
msgid ""
|
5210 |
"When sending an image file, automatically set the description based on the "
|
5211 |
"filename"
|
5212 |
msgstr ""
|
5213 |
|
5214 |
-
#: inc/admin/admin.php:
|
5215 |
msgid "Add TINYMCE editor to term description"
|
5216 |
msgstr ""
|
5217 |
|
5218 |
-
#: inc/admin/admin.php:
|
5219 |
msgid "You have to flush your permalinks each time you change this settings"
|
5220 |
msgstr ""
|
5221 |
|
5222 |
-
#: inc/admin/admin.php:
|
5223 |
msgid ""
|
5224 |
"You must check this box if the structure of your permalinks DOES NOT contain "
|
5225 |
"a slash at the end (eg: /%postname%)"
|
5226 |
msgstr ""
|
5227 |
|
5228 |
-
#: inc/admin/admin.php:
|
5229 |
msgid "Remove WordPress meta generator in source code"
|
5230 |
msgstr ""
|
5231 |
|
5232 |
-
#: inc/admin/admin.php:
|
5233 |
msgid ""
|
5234 |
"Remove hentry post class to prevent Google from seeing this as structured "
|
5235 |
"data (schema)"
|
5236 |
msgstr ""
|
5237 |
|
5238 |
-
#: inc/admin/admin.php:
|
5239 |
msgid ""
|
5240 |
"Remove comment author URL in comments if the website is filled from profile "
|
5241 |
"page"
|
5242 |
msgstr ""
|
5243 |
|
5244 |
-
#: inc/admin/admin.php:
|
5245 |
msgid "Remove website field from comment form to reduce spam"
|
5246 |
msgstr ""
|
5247 |
|
5248 |
-
#: inc/admin/admin.php:
|
5249 |
msgid "Remove WordPress shortlink meta tag in source code (eg:"
|
5250 |
msgstr ""
|
5251 |
|
5252 |
-
#: inc/admin/admin.php:
|
5253 |
msgid "Remove Windows Live Writer meta tag in source code (eg:"
|
5254 |
msgstr ""
|
5255 |
|
5256 |
-
#: inc/admin/admin.php:
|
5257 |
msgid "Remove Really Simple Discovery meta tag in source code (eg:"
|
5258 |
msgstr ""
|
5259 |
|
5260 |
-
#: inc/admin/admin.php:
|
5261 |
msgid "Enter Google meta value site verification"
|
5262 |
msgstr ""
|
5263 |
|
5264 |
-
#: inc/admin/admin.php:
|
5265 |
msgid ""
|
5266 |
"If your site is already verified in <strong>Google Search Console</strong>, "
|
5267 |
"you can leave this field empty."
|
5268 |
msgstr ""
|
5269 |
|
5270 |
-
#: inc/admin/admin.php:
|
5271 |
msgid "Enter Bing meta value site verification"
|
5272 |
msgstr ""
|
5273 |
|
5274 |
-
#: inc/admin/admin.php:
|
5275 |
msgid ""
|
5276 |
"If your site is already verified in <strong>Bing Webmaster tools</strong>, "
|
5277 |
"you can leave this field empty."
|
5278 |
msgstr ""
|
5279 |
|
5280 |
-
#: inc/admin/admin.php:
|
5281 |
msgid "Enter Pinterest meta value site verification"
|
5282 |
msgstr ""
|
5283 |
|
5284 |
-
#: inc/admin/admin.php:
|
5285 |
msgid "Enter Yandex meta value site verification"
|
5286 |
msgstr ""
|
5287 |
|
5288 |
-
#: inc/admin/admin.php:
|
5289 |
-
msgid "Remove
|
|
|
|
|
|
|
|
|
5290 |
msgstr ""
|
5291 |
|
5292 |
-
#: inc/admin/admin.php:
|
5293 |
msgid "High priority (top)"
|
5294 |
msgstr ""
|
5295 |
|
5296 |
-
#: inc/admin/admin.php:
|
5297 |
msgid "Normal priority (default)"
|
5298 |
msgstr ""
|
5299 |
|
5300 |
-
#: inc/admin/admin.php:
|
5301 |
msgid "Low priority"
|
5302 |
msgstr ""
|
5303 |
|
5304 |
-
#: inc/admin/admin.php:
|
5305 |
msgid "Automatic tab (default)"
|
5306 |
msgstr ""
|
5307 |
|
5308 |
-
#: inc/admin/admin.php:
|
5309 |
msgid "Manual tab"
|
5310 |
msgstr ""
|
5311 |
|
5312 |
-
#: inc/admin/admin.php:
|
5313 |
-
msgid "Hide Notifications Center in
|
5314 |
msgstr ""
|
5315 |
|
5316 |
-
#: inc/admin/admin.php:
|
5317 |
-
msgid "Hide SEO tools in
|
5318 |
msgstr ""
|
5319 |
|
5320 |
-
#: inc/admin/admin.php:
|
5321 |
-
msgid "Hide Useful Links in
|
5322 |
msgstr ""
|
5323 |
|
5324 |
-
#: inc/admin/admin.php:
|
5325 |
msgid "Add title column"
|
5326 |
msgstr ""
|
5327 |
|
5328 |
-
#: inc/admin/admin.php:
|
5329 |
msgid "Add meta description column"
|
5330 |
msgstr ""
|
5331 |
|
5332 |
-
#: inc/admin/admin.php:
|
5333 |
msgid "Add redirection enable column"
|
5334 |
msgstr ""
|
5335 |
|
5336 |
-
#: inc/admin/admin.php:
|
5337 |
msgid "Add redirection URL column"
|
5338 |
msgstr ""
|
5339 |
|
5340 |
-
#: inc/admin/admin.php:
|
5341 |
msgid "Add canonical URL column"
|
5342 |
msgstr ""
|
5343 |
|
5344 |
-
#: inc/admin/admin.php:
|
5345 |
msgid "Add target keyword column"
|
5346 |
msgstr ""
|
5347 |
|
5348 |
-
#: inc/admin/admin.php:
|
5349 |
msgid "Display noindex status"
|
5350 |
msgstr ""
|
5351 |
|
5352 |
-
#: inc/admin/admin.php:
|
5353 |
msgid "Display nofollow status"
|
5354 |
msgstr ""
|
5355 |
|
5356 |
-
#: inc/admin/admin.php:
|
5357 |
msgid "Display total number of words in content"
|
5358 |
msgstr ""
|
5359 |
|
5360 |
-
#: inc/admin/admin.php:
|
5361 |
msgid "Display W3C column to check code quality"
|
5362 |
msgstr ""
|
5363 |
|
5364 |
-
#: inc/admin/admin.php:
|
5365 |
msgid "Display Page Speed column to check performances"
|
5366 |
msgstr ""
|
5367 |
|
5368 |
-
#: inc/admin/admin.php:
|
5369 |
msgid "Display SEO Insights column to check rankings"
|
5370 |
msgstr ""
|
5371 |
|
5372 |
-
#: inc/admin/admin.php:
|
5373 |
msgid ""
|
5374 |
"Display Content Analysis results column (\"Good\" or \"Should be improved\")"
|
5375 |
msgstr ""
|
5376 |
|
5377 |
-
#: inc/admin/admin.php:
|
5378 |
msgid "Remove Genesis SEO Metabox"
|
5379 |
msgstr ""
|
5380 |
|
5381 |
-
#: inc/admin/admin.php:
|
5382 |
msgid "Remove Genesis SEO link in WP Admin Menu"
|
5383 |
msgstr ""
|
5384 |
|
5385 |
-
#: inc/admin/admin.php:
|
5386 |
msgid "Remove the advice if None schema selected"
|
5387 |
msgstr ""
|
5388 |
|
5389 |
-
#: inc/admin/admin.php:
|
5390 |
msgid ""
|
5391 |
"Hook to filter structured data types metabox call by post type - new window"
|
5392 |
msgstr ""
|
5393 |
|
5394 |
-
#: inc/admin/adminbar.php:
|
5395 |
msgid "noindex is on!"
|
5396 |
msgstr ""
|
5397 |
|
5398 |
-
#: inc/admin/adminbar.php:
|
5399 |
#, php-format
|
5400 |
-
msgid "SEO for %s"
|
5401 |
msgstr ""
|
5402 |
|
5403 |
-
#: inc/admin/adminbar.php:
|
5404 |
msgid "noindex is off."
|
5405 |
msgstr ""
|
5406 |
|
5407 |
-
#: inc/admin/adminbar.php:
|
5408 |
msgid "nofollow is on!"
|
5409 |
msgstr ""
|
5410 |
|
5411 |
-
#: inc/admin/adminbar.php:
|
5412 |
msgid "nofollow is off."
|
5413 |
msgstr ""
|
5414 |
|
5415 |
-
#: inc/admin/adminbar.php:
|
5416 |
msgid "BOT"
|
5417 |
msgstr ""
|
5418 |
|
5419 |
-
#: inc/admin/adminbar.php:
|
5420 |
msgid "Broken Links"
|
5421 |
msgstr ""
|
5422 |
|
5423 |
-
#: inc/admin/adminbar.php:
|
5424 |
msgid "Configuration wizard"
|
5425 |
msgstr ""
|
5426 |
|
@@ -5430,68 +5629,101 @@ msgid ""
|
|
5430 |
"content analysis."
|
5431 |
msgstr ""
|
5432 |
|
5433 |
-
#: inc/admin/ajax.php:
|
5434 |
msgid "To get your Google snippet preview, publish your post!"
|
5435 |
msgstr ""
|
5436 |
|
5437 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5438 |
msgid "SEO Title / Description"
|
5439 |
msgstr ""
|
5440 |
|
5441 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5442 |
msgid "Meta Description"
|
5443 |
msgstr ""
|
5444 |
|
5445 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5446 |
msgid "SEO Advanced"
|
5447 |
msgstr ""
|
5448 |
|
5449 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5450 |
msgid ""
|
5451 |
"Do not display this page in search engine results / XML - HTML sitemaps "
|
5452 |
"(noindex)"
|
5453 |
msgstr ""
|
5454 |
|
5455 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5456 |
msgid "Do not follow links for this page (nofollow)"
|
5457 |
msgstr ""
|
5458 |
|
5459 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5460 |
msgid ""
|
5461 |
"Do not use Open Directory project metadata for titles or excerpts for this "
|
5462 |
"page (noodp)"
|
5463 |
msgstr ""
|
5464 |
|
5465 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5466 |
msgid "Do not index images for this page (noimageindex)"
|
5467 |
msgstr ""
|
5468 |
|
5469 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5470 |
msgid ""
|
5471 |
"Do not display a \"Cached\" link in the Google search results (noarchive)"
|
5472 |
msgstr ""
|
5473 |
|
5474 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5475 |
msgid ""
|
5476 |
"Do not display a description in search results for this page (nosnippet)"
|
5477 |
msgstr ""
|
5478 |
|
5479 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5480 |
msgid "SEO Social"
|
5481 |
msgstr ""
|
5482 |
|
5483 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5484 |
msgid "SEO Redirection"
|
5485 |
msgstr ""
|
5486 |
|
5487 |
-
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:
|
5488 |
msgid "SEO Content Analysis"
|
5489 |
msgstr ""
|
5490 |
|
5491 |
-
#: inc/admin/page-builders/elementor/inc/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5492 |
msgid "By"
|
5493 |
msgstr ""
|
5494 |
|
|
|
|
|
|
|
|
|
5495 |
#: inc/functions/options-advanced-admin.php:27
|
5496 |
msgid "Need help?"
|
5497 |
msgstr ""
|
@@ -5513,144 +5745,144 @@ msgid ""
|
|
5513 |
"is optimized for SEO (NOT Plain)."
|
5514 |
msgstr ""
|
5515 |
|
5516 |
-
#: inc/functions/options-advanced-admin.php:
|
5517 |
-
#: inc/functions/options-advanced-admin.php:
|
5518 |
msgid "Title tag"
|
5519 |
msgstr ""
|
5520 |
|
5521 |
-
#: inc/functions/options-advanced-admin.php:
|
5522 |
msgid "Meta Desc."
|
5523 |
msgstr ""
|
5524 |
|
5525 |
-
#: inc/functions/options-advanced-admin.php:
|
5526 |
msgid "Redirect?"
|
5527 |
msgstr ""
|
5528 |
|
5529 |
-
#: inc/functions/options-advanced-admin.php:
|
5530 |
-
#: inc/functions/options-advanced-admin.php:
|
5531 |
msgid "Canonical"
|
5532 |
msgstr ""
|
5533 |
|
5534 |
-
#: inc/functions/options-advanced-admin.php:
|
5535 |
msgid "Target Kw"
|
5536 |
msgstr ""
|
5537 |
|
5538 |
-
#: inc/functions/options-advanced-admin.php:
|
5539 |
msgid "Noindex?"
|
5540 |
msgstr ""
|
5541 |
|
5542 |
-
#: inc/functions/options-advanced-admin.php:
|
5543 |
msgid "Nofollow?"
|
5544 |
msgstr ""
|
5545 |
|
5546 |
-
#: inc/functions/options-advanced-admin.php:
|
5547 |
msgid "Score"
|
5548 |
msgstr ""
|
5549 |
|
5550 |
-
#: inc/functions/options-advanced-admin.php:
|
5551 |
msgid "Words"
|
5552 |
msgstr ""
|
5553 |
|
5554 |
-
#: inc/functions/options-advanced-admin.php:
|
5555 |
msgid "W3C check"
|
5556 |
msgstr ""
|
5557 |
|
5558 |
-
#: inc/functions/options-advanced-admin.php:
|
5559 |
msgid "Page Speed"
|
5560 |
msgstr ""
|
5561 |
|
5562 |
-
#: inc/functions/options-advanced-admin.php:
|
5563 |
msgid "Check code quality of this page"
|
5564 |
msgstr ""
|
5565 |
|
5566 |
-
#: inc/functions/options-advanced-admin.php:
|
5567 |
msgid "Analyze this page with Google Page Speed"
|
5568 |
msgstr ""
|
5569 |
|
5570 |
-
#: inc/functions/options-advanced-admin.php:
|
5571 |
msgid "Insights from these keywords:"
|
5572 |
msgstr ""
|
5573 |
|
5574 |
-
#: inc/functions/options-advanced-admin.php:
|
5575 |
msgid "Average position: "
|
5576 |
msgstr ""
|
5577 |
|
5578 |
-
#: inc/functions/options-advanced-admin.php:
|
5579 |
msgid "Latest position: "
|
5580 |
msgstr ""
|
5581 |
|
5582 |
-
#: inc/functions/options-advanced-admin.php:
|
5583 |
msgid "Enable noindex"
|
5584 |
msgstr ""
|
5585 |
|
5586 |
-
#: inc/functions/options-advanced-admin.php:
|
5587 |
msgid "Enable index"
|
5588 |
msgstr ""
|
5589 |
|
5590 |
-
#: inc/functions/options-advanced-admin.php:
|
5591 |
msgid "Enable nofollow"
|
5592 |
msgstr ""
|
5593 |
|
5594 |
-
#: inc/functions/options-advanced-admin.php:
|
5595 |
msgid "Enable follow"
|
5596 |
msgstr ""
|
5597 |
|
5598 |
-
#: inc/functions/options-advanced-admin.php:
|
5599 |
msgid "Enable redirection"
|
5600 |
msgstr ""
|
5601 |
|
5602 |
-
#: inc/functions/options-advanced-admin.php:
|
5603 |
msgid "Disable redirection"
|
5604 |
msgstr ""
|
5605 |
|
5606 |
-
#: inc/functions/options-advanced-admin.php:
|
5607 |
msgid "Description"
|
5608 |
msgstr ""
|
5609 |
|
5610 |
-
#: inc/functions/options-advanced-admin.php:
|
5611 |
msgid ""
|
5612 |
"The description is not prominent by default; however, some themes may show "
|
5613 |
"it."
|
5614 |
msgstr ""
|
5615 |
|
5616 |
-
#: inc/functions/options-google-analytics.php:
|
5617 |
msgid ""
|
5618 |
"By visiting our site, you agree to our privacy policy regarding cookies, "
|
5619 |
"tracking statistics, etc. <a href=\"[seopress_privacy_page]\" tabindex="
|
5620 |
"\"10\">Read more</a>"
|
5621 |
msgstr ""
|
5622 |
|
5623 |
-
#: inc/functions/options-google-analytics.php:
|
5624 |
msgid ""
|
5625 |
"By visiting our site, you agree to our privacy policy regarding cookies, "
|
5626 |
"tracking statistics, etc."
|
5627 |
msgstr ""
|
5628 |
|
5629 |
-
#: inc/functions/options-google-analytics.php:
|
5630 |
msgid "X"
|
5631 |
msgstr ""
|
5632 |
|
5633 |
-
#: inc/functions/options-google-analytics.php:
|
5634 |
#: inc/functions/options-matomo.php:205
|
5635 |
msgid "Authors"
|
5636 |
msgstr ""
|
5637 |
|
5638 |
-
#: inc/functions/options-google-analytics.php:
|
5639 |
#: inc/functions/options-matomo.php:219
|
5640 |
msgid "Categories"
|
5641 |
msgstr ""
|
5642 |
|
5643 |
-
#: inc/functions/options-google-analytics.php:
|
5644 |
#: inc/functions/options-matomo.php:239
|
5645 |
msgid "Tags"
|
5646 |
msgstr ""
|
5647 |
|
5648 |
-
#: inc/functions/options-google-analytics.php:
|
5649 |
#: inc/functions/options-matomo.php:248
|
5650 |
msgid "Post types"
|
5651 |
msgstr ""
|
5652 |
|
5653 |
-
#: inc/functions/options-google-analytics.php:
|
5654 |
#: inc/functions/options-matomo.php:257
|
5655 |
msgid "Connected users"
|
5656 |
msgstr ""
|
@@ -5712,38 +5944,58 @@ msgstr ""
|
|
5712 |
msgid "has been successfully updated!"
|
5713 |
msgstr ""
|
5714 |
|
5715 |
-
#: seopress.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5716 |
msgid "You like SEOPress? Don't forget to rate it 5 stars!"
|
5717 |
msgstr ""
|
5718 |
|
5719 |
-
#: seopress.php:
|
5720 |
msgid "Docs"
|
5721 |
msgstr ""
|
5722 |
|
5723 |
-
#: seopress.php:
|
5724 |
msgid "Configuration Wizard"
|
5725 |
msgstr ""
|
5726 |
|
5727 |
-
#: seopress.php:
|
5728 |
msgid "GO PRO!"
|
5729 |
msgstr ""
|
5730 |
|
5731 |
-
#: seopress.php:
|
5732 |
msgid "Follow us:"
|
5733 |
msgstr ""
|
5734 |
|
5735 |
-
#: seopress.php:
|
5736 |
msgid "Like our Facebook page"
|
5737 |
msgstr ""
|
5738 |
|
5739 |
-
#: seopress.php:
|
5740 |
msgid "Watch our guided tour videos to learn more about SEOPress"
|
5741 |
msgstr ""
|
5742 |
|
5743 |
-
#: seopress.php:
|
5744 |
msgid "Read our blog posts about SEO concepts, tutorials and more"
|
5745 |
msgstr ""
|
5746 |
|
5747 |
-
#: seopress.php:
|
5748 |
msgid "The off side of SEOPress"
|
5749 |
msgstr ""
|
3 |
msgstr ""
|
4 |
"Project-Id-Version: SEOPress\n"
|
5 |
"Report-Msgid-Bugs-To: http://wordpress.org/tag/wp-cloudy\n"
|
6 |
+
"POT-Creation-Date: 2020-10-29 11:45+0100\n"
|
7 |
"PO-Revision-Date: 2019-08-22 12:52+0200\n"
|
8 |
"Last-Translator: \n"
|
9 |
"Language-Team: Benjamin DENIS <contact@seopress.org>\n"
|
18 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
"X-Poedit-SearchPath-0: .\n"
|
20 |
|
21 |
+
#: inc/admin/admin-dyn-variables-helper.php:5
|
22 |
+
#: inc/admin/admin-metaboxes-form.php:130 inc/admin/admin.php:250
|
23 |
+
#: inc/admin/admin.php:3247 inc/admin/admin.php:3353 inc/admin/admin.php:3470
|
24 |
+
#: inc/admin/admin.php:3601 inc/admin/admin.php:3724 inc/admin/admin.php:3802
|
25 |
+
#: inc/admin/admin.php:3873 inc/admin/admin.php:3943 inc/admin/admin.php:3993
|
26 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-text-letter-counter-control.php:67
|
27 |
+
msgid "Site Title"
|
28 |
+
msgstr ""
|
29 |
+
|
30 |
+
#: inc/admin/admin-dyn-variables-helper.php:6 inc/admin/admin.php:251
|
31 |
+
#: inc/admin/admin.php:3249 inc/admin/admin.php:3260
|
32 |
+
msgid "Tagline"
|
33 |
+
msgstr ""
|
34 |
+
|
35 |
+
#: inc/admin/admin-dyn-variables-helper.php:7
|
36 |
+
#: inc/admin/admin-metaboxes-form.php:128 inc/admin/admin.php:3349
|
37 |
+
#: inc/admin/admin.php:3468 inc/admin/admin.php:4453
|
38 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-text-letter-counter-control.php:66
|
39 |
+
msgid "Post Title"
|
40 |
+
msgstr ""
|
41 |
+
|
42 |
+
#: inc/admin/admin-dyn-variables-helper.php:8 inc/admin/admin.php:253
|
43 |
+
msgid "Post excerpt"
|
44 |
+
msgstr ""
|
45 |
+
|
46 |
+
#: inc/admin/admin-dyn-variables-helper.php:9
|
47 |
+
msgid "Post content / product description"
|
48 |
+
msgstr ""
|
49 |
+
|
50 |
+
#: inc/admin/admin-dyn-variables-helper.php:10 inc/admin/admin.php:255
|
51 |
+
msgid "Post thumbnail URL"
|
52 |
+
msgstr ""
|
53 |
+
|
54 |
+
#: inc/admin/admin-dyn-variables-helper.php:11
|
55 |
+
msgid "Post URL"
|
56 |
+
msgstr ""
|
57 |
+
|
58 |
+
#: inc/admin/admin-dyn-variables-helper.php:12 inc/admin/admin.php:257
|
59 |
+
msgid "Post date"
|
60 |
+
msgstr ""
|
61 |
+
|
62 |
+
#: inc/admin/admin-dyn-variables-helper.php:13
|
63 |
+
msgid "Post modified date"
|
64 |
+
msgstr ""
|
65 |
+
|
66 |
+
#: inc/admin/admin-dyn-variables-helper.php:14 inc/admin/admin.php:259
|
67 |
+
#: inc/admin/admin.php:3800
|
68 |
+
msgid "Post author"
|
69 |
+
msgstr ""
|
70 |
+
|
71 |
+
#: inc/admin/admin-dyn-variables-helper.php:15 inc/admin/admin.php:260
|
72 |
+
msgid "Post category"
|
73 |
+
msgstr ""
|
74 |
+
|
75 |
+
#: inc/admin/admin-dyn-variables-helper.php:16 inc/admin/admin.php:261
|
76 |
+
msgid "Post tag"
|
77 |
+
msgstr ""
|
78 |
+
|
79 |
+
#: inc/admin/admin-dyn-variables-helper.php:17 inc/admin/admin.php:262
|
80 |
+
msgid "Category title"
|
81 |
+
msgstr ""
|
82 |
+
|
83 |
+
#: inc/admin/admin-dyn-variables-helper.php:18 inc/admin/admin.php:263
|
84 |
+
msgid "Category description"
|
85 |
+
msgstr ""
|
86 |
+
|
87 |
+
#: inc/admin/admin-dyn-variables-helper.php:19 inc/admin/admin.php:264
|
88 |
+
msgid "Tag title"
|
89 |
+
msgstr ""
|
90 |
+
|
91 |
+
#: inc/admin/admin-dyn-variables-helper.php:20 inc/admin/admin.php:265
|
92 |
+
msgid "Tag description"
|
93 |
+
msgstr ""
|
94 |
+
|
95 |
+
#: inc/admin/admin-dyn-variables-helper.php:21 inc/admin/admin.php:266
|
96 |
+
msgid "Term title"
|
97 |
+
msgstr ""
|
98 |
+
|
99 |
+
#: inc/admin/admin-dyn-variables-helper.php:22 inc/admin/admin.php:267
|
100 |
+
msgid "Term description"
|
101 |
+
msgstr ""
|
102 |
+
|
103 |
+
#: inc/admin/admin-dyn-variables-helper.php:23 inc/admin/admin.php:268
|
104 |
+
msgid "Search keywords"
|
105 |
+
msgstr ""
|
106 |
+
|
107 |
+
#: inc/admin/admin-dyn-variables-helper.php:24 inc/admin/admin.php:269
|
108 |
+
msgid "Current number page"
|
109 |
+
msgstr ""
|
110 |
+
|
111 |
+
#: inc/admin/admin-dyn-variables-helper.php:25
|
112 |
+
msgid "Page number with context"
|
113 |
+
msgstr ""
|
114 |
+
|
115 |
+
#: inc/admin/admin-dyn-variables-helper.php:26 inc/admin/admin.php:271
|
116 |
+
msgid "Plural Post Type Archive name"
|
117 |
+
msgstr ""
|
118 |
+
|
119 |
+
#: inc/admin/admin-dyn-variables-helper.php:27 inc/admin/admin.php:272
|
120 |
+
msgid "Archive title"
|
121 |
+
msgstr ""
|
122 |
+
|
123 |
+
#: inc/admin/admin-dyn-variables-helper.php:28
|
124 |
+
msgid "Archive date"
|
125 |
+
msgstr ""
|
126 |
+
|
127 |
+
#: inc/admin/admin-dyn-variables-helper.php:29 inc/admin/admin.php:274
|
128 |
+
msgid "Day Archive date"
|
129 |
+
msgstr ""
|
130 |
+
|
131 |
+
#: inc/admin/admin-dyn-variables-helper.php:30 inc/admin/admin.php:275
|
132 |
+
msgid "Month Archive title"
|
133 |
+
msgstr ""
|
134 |
+
|
135 |
+
#: inc/admin/admin-dyn-variables-helper.php:31 inc/admin/admin.php:276
|
136 |
+
msgid "Year Archive title"
|
137 |
+
msgstr ""
|
138 |
+
|
139 |
+
#: inc/admin/admin-dyn-variables-helper.php:32
|
140 |
+
msgid "Custom fields from post, page or post type"
|
141 |
+
msgstr ""
|
142 |
+
|
143 |
+
#: inc/admin/admin-dyn-variables-helper.php:33
|
144 |
+
msgid "Custom term taxonomy from post, page or post type"
|
145 |
+
msgstr ""
|
146 |
+
|
147 |
+
#: inc/admin/admin-dyn-variables-helper.php:34 inc/admin/admin.php:279
|
148 |
+
msgid "Single product category"
|
149 |
+
msgstr ""
|
150 |
+
|
151 |
+
#: inc/admin/admin-dyn-variables-helper.php:35 inc/admin/admin.php:280
|
152 |
+
msgid "Single product tag"
|
153 |
+
msgstr ""
|
154 |
+
|
155 |
+
#: inc/admin/admin-dyn-variables-helper.php:36 inc/admin/admin.php:281
|
156 |
+
msgid "Single product short description"
|
157 |
+
msgstr ""
|
158 |
+
|
159 |
+
#: inc/admin/admin-dyn-variables-helper.php:37 inc/admin/admin.php:282
|
160 |
+
msgid "Single product price"
|
161 |
+
msgstr ""
|
162 |
+
|
163 |
+
#: inc/admin/admin-dyn-variables-helper.php:38 inc/admin/admin.php:283
|
164 |
+
msgid "Single product price taxes excluded"
|
165 |
+
msgstr ""
|
166 |
+
|
167 |
+
#: inc/admin/admin-dyn-variables-helper.php:39 inc/admin/admin.php:284
|
168 |
+
msgid "Single SKU product"
|
169 |
+
msgstr ""
|
170 |
+
|
171 |
+
#: inc/admin/admin-dyn-variables-helper.php:40 inc/admin/admin.php:285
|
172 |
+
msgid "Current day"
|
173 |
+
msgstr ""
|
174 |
+
|
175 |
+
#: inc/admin/admin-dyn-variables-helper.php:41 inc/admin/admin.php:286
|
176 |
+
msgid "Current month"
|
177 |
+
msgstr ""
|
178 |
+
|
179 |
+
#: inc/admin/admin-dyn-variables-helper.php:42
|
180 |
+
msgid "Current month in 3 letters"
|
181 |
+
msgstr ""
|
182 |
+
|
183 |
+
#: inc/admin/admin-dyn-variables-helper.php:43 inc/admin/admin.php:288
|
184 |
+
msgid "Current year"
|
185 |
+
msgstr ""
|
186 |
+
|
187 |
+
#: inc/admin/admin-dyn-variables-helper.php:44 inc/admin/admin.php:289
|
188 |
+
msgid "Current date"
|
189 |
+
msgstr ""
|
190 |
+
|
191 |
+
#: inc/admin/admin-dyn-variables-helper.php:45 inc/admin/admin.php:290
|
192 |
+
msgid "Current time"
|
193 |
+
msgstr ""
|
194 |
+
|
195 |
+
#: inc/admin/admin-dyn-variables-helper.php:46
|
196 |
+
msgid "Author biography"
|
197 |
+
msgstr ""
|
198 |
+
|
199 |
+
#: inc/admin/admin-dyn-variables-helper.php:47 inc/admin/admin.php:292
|
200 |
+
msgid "Current month in digital format"
|
201 |
+
msgstr ""
|
202 |
+
|
203 |
#: inc/admin/admin-features-list.php:15
|
204 |
msgid "Titles & metas"
|
205 |
msgstr ""
|
230 |
#: inc/admin/admin-features-list.php:233 inc/admin/admin-features-list.php:252
|
231 |
#: inc/admin/admin-features-list.php:271 inc/admin/admin-features-list.php:290
|
232 |
#: inc/admin/admin-features-list.php:338 inc/admin/admin-features-list.php:356
|
233 |
+
#: inc/admin/admin.php:338 inc/admin/admin.php:344
|
234 |
msgid "Read our guide"
|
235 |
msgstr ""
|
236 |
|
238 |
msgid "Guide to manage your titles and meta descriptions - new window"
|
239 |
msgstr ""
|
240 |
|
241 |
+
#: inc/admin/admin-features-list.php:31 inc/admin/admin.php:238
|
242 |
msgid "XML / Image / Video / HTML Sitemap"
|
243 |
msgstr ""
|
244 |
|
251 |
msgstr ""
|
252 |
|
253 |
#: inc/admin/admin-features-list.php:47 inc/admin/admin-header.php:57
|
254 |
+
#: inc/admin/admin.php:239 inc/admin/adminbar.php:133
|
255 |
msgid "Social Networks"
|
256 |
msgstr ""
|
257 |
|
264 |
msgstr ""
|
265 |
|
266 |
#: inc/admin/admin-features-list.php:63 inc/admin/admin-header.php:63
|
267 |
+
#: inc/admin/admin.php:240 inc/admin/adminbar.php:139
|
268 |
msgid "Analytics"
|
269 |
msgstr ""
|
270 |
|
277 |
msgstr ""
|
278 |
|
279 |
#: inc/admin/admin-features-list.php:79 inc/admin/admin-header.php:69
|
280 |
+
#: inc/admin/admin-metaboxes-form.php:62 inc/admin/admin.php:241
|
281 |
+
#: inc/admin/admin.php:400 inc/admin/admin.php:682 inc/admin/adminbar.php:145
|
282 |
msgid "Advanced"
|
283 |
msgstr ""
|
284 |
|
287 |
msgstr ""
|
288 |
|
289 |
#: inc/admin/admin-features-list.php:90 inc/admin/admin-header.php:25
|
290 |
+
#: inc/admin/admin-header.php:77 inc/admin/adminbar.php:153
|
291 |
+
#: inc/functions/options-advanced-admin.php:435
|
292 |
msgid "Insights"
|
293 |
msgstr ""
|
294 |
|
402 |
msgid "Guide to create your xml news sitemap - new window"
|
403 |
msgstr ""
|
404 |
|
405 |
+
#: inc/admin/admin-features-list.php:241 inc/admin/adminbar.php:188
|
406 |
msgid "Schemas"
|
407 |
msgstr ""
|
408 |
|
411 |
msgstr ""
|
412 |
|
413 |
#: inc/admin/admin-features-list.php:260 inc/admin/admin-header.php:142
|
414 |
+
#: inc/admin/admin.php:721 inc/admin/adminbar.php:196
|
415 |
msgid "Redirections"
|
416 |
msgstr ""
|
417 |
|
472 |
msgstr ""
|
473 |
|
474 |
#: inc/admin/admin-features-list.php:330 inc/admin/admin-header.php:187
|
475 |
+
#: inc/admin/admin.php:242 inc/admin/adminbar.php:160
|
476 |
msgid "Tools"
|
477 |
msgstr ""
|
478 |
|
485 |
msgstr ""
|
486 |
|
487 |
#: inc/admin/admin-features-list.php:348 inc/admin/admin-header.php:180
|
488 |
+
#: inc/admin/admin-notifications-center.php:784 inc/admin/adminbar.php:175
|
489 |
msgid "License"
|
490 |
msgstr ""
|
491 |
|
537 |
msgid "SEOPress"
|
538 |
msgstr ""
|
539 |
|
540 |
+
#: inc/admin/admin-header.php:31 inc/admin/admin-notifications-center.php:813
|
541 |
+
#: inc/admin/adminbar.php:181
|
542 |
msgid "PRO"
|
543 |
msgstr ""
|
544 |
|
546 |
msgid "FREE"
|
547 |
msgstr ""
|
548 |
|
549 |
+
#: inc/admin/admin-header.php:45 inc/admin/admin.php:237
|
550 |
+
#: inc/admin/adminbar.php:121
|
551 |
msgid "Titles & Metas"
|
552 |
msgstr ""
|
553 |
|
554 |
+
#: inc/admin/admin-header.php:51 inc/admin/admin.php:238
|
555 |
+
#: inc/admin/adminbar.php:127
|
556 |
msgid "XML / HTML Sitemap"
|
557 |
msgstr ""
|
558 |
|
572 |
msgid "Send feedback"
|
573 |
msgstr ""
|
574 |
|
575 |
+
#: inc/admin/admin-header.php:219 seopress.php:1256
|
576 |
msgid "Join our Facebook Community group"
|
577 |
msgstr ""
|
578 |
|
579 |
+
#: inc/admin/admin-header.php:223 seopress.php:1281
|
580 |
msgid "Follow us on Twitter"
|
581 |
msgstr ""
|
582 |
|
610 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:12
|
611 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:13
|
612 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:15
|
613 |
+
#: inc/admin/admin.php:765 inc/admin/admin.php:798
|
614 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:551
|
615 |
+
#: inc/functions/options-advanced-admin.php:987
|
616 |
msgid "Target keywords"
|
617 |
msgstr ""
|
618 |
|
619 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:13
|
620 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:553
|
621 |
msgid ""
|
622 |
"Separate target keywords with commas. Do not use spaces after the commas, "
|
623 |
"unless you want to include them"
|
632 |
msgstr ""
|
633 |
|
634 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:20
|
635 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-content-analysis-control.php:43
|
636 |
msgid "Refresh analysis"
|
637 |
msgstr ""
|
638 |
|
641 |
msgstr ""
|
642 |
|
643 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:29
|
644 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:577
|
645 |
msgid ""
|
646 |
"To get the most accurate analysis, save your post first. We analyze all of "
|
647 |
"your source code as a search engine would."
|
649 |
|
650 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:34
|
651 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:35
|
652 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:564
|
653 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-google-suggestions-control.php:49
|
654 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-google-suggestions-control.php:50
|
655 |
msgid "Google suggestions"
|
656 |
msgstr ""
|
657 |
|
658 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:35
|
659 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-google-suggestions-control.php:50
|
660 |
msgid ""
|
661 |
"Enter a keyword, or a phrase, to find the top 10 Google suggestions "
|
662 |
"instantly. This is useful if you want to work with the long tail technique."
|
663 |
msgstr ""
|
664 |
|
665 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:37
|
666 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-google-suggestions-control.php:51
|
667 |
msgid "Get suggestions from Google"
|
668 |
msgstr ""
|
669 |
|
670 |
#: inc/admin/admin-metaboxes-content-analysis-form.php:39
|
671 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-google-suggestions-control.php:52
|
672 |
msgid "Get suggestions!"
|
673 |
msgstr ""
|
674 |
|
675 |
+
#: inc/admin/admin-metaboxes-form.php:51 inc/admin/admin-metaboxes.php:163
|
676 |
+
#: inc/admin/admin-metaboxes.php:166 inc/admin/admin.php:235
|
677 |
+
#: inc/admin/adminbar.php:44 inc/functions/options-advanced-admin.php:969
|
678 |
msgid "SEO"
|
679 |
msgstr ""
|
680 |
|
681 |
+
#: inc/admin/admin-metaboxes-form.php:61
|
682 |
msgid "Titles settings"
|
683 |
msgstr ""
|
684 |
|
685 |
+
#: inc/admin/admin-metaboxes-form.php:63
|
686 |
msgid "Social"
|
687 |
msgstr ""
|
688 |
|
689 |
+
#: inc/admin/admin-metaboxes-form.php:66
|
690 |
msgid "Redirection"
|
691 |
msgstr ""
|
692 |
|
693 |
+
#: inc/admin/admin-metaboxes-form.php:72
|
694 |
msgid "Google News"
|
695 |
msgstr ""
|
696 |
|
697 |
+
#: inc/admin/admin-metaboxes-form.php:79
|
698 |
msgid "Video Sitemap"
|
699 |
msgstr ""
|
700 |
|
701 |
+
#: inc/admin/admin-metaboxes-form.php:102
|
702 |
msgid ""
|
703 |
"This is your <strong>Shop page</strong>. Go to <strong>SEO > Titles & Metas "
|
704 |
"> Archives > Products</strong> "
|
705 |
msgstr ""
|
706 |
|
707 |
+
#: inc/admin/admin-metaboxes-form.php:102
|
708 |
msgid "to edit your title and meta description"
|
709 |
msgstr ""
|
710 |
|
711 |
+
#: inc/admin/admin-metaboxes-form.php:109
|
712 |
+
#: inc/admin/admin-metaboxes-form.php:112
|
713 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:110
|
714 |
msgid "Title"
|
715 |
msgstr ""
|
716 |
|
717 |
+
#: inc/admin/admin-metaboxes-form.php:110
|
718 |
#: inc/admin/admin-metaboxes-get-content-analysis.php:37
|
719 |
+
#: inc/admin/admin.php:744 inc/admin/admin.php:777
|
720 |
msgid "Meta title"
|
721 |
msgstr ""
|
722 |
|
723 |
+
#: inc/admin/admin-metaboxes-form.php:110
|
724 |
msgid ""
|
725 |
"Titles are critical to give users a quick insight into the content of a "
|
726 |
"result and why it’s relevant to their query. It's often the primary piece of "
|
728 |
"use high-quality titles on your web pages."
|
729 |
msgstr ""
|
730 |
|
731 |
+
#: inc/admin/admin-metaboxes-form.php:112
|
732 |
msgid "Enter your title"
|
733 |
msgstr ""
|
734 |
|
735 |
+
#: inc/admin/admin-metaboxes-form.php:119
|
736 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-text-letter-counter-control.php:55
|
737 |
msgid " / 568 pixels - "
|
738 |
msgstr ""
|
739 |
|
740 |
+
#: inc/admin/admin-metaboxes-form.php:121
|
741 |
+
#: inc/admin/admin-metaboxes-form.php:151
|
742 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-text-letter-counter-control.php:61
|
743 |
msgid " (maximum recommended limit)"
|
744 |
msgstr ""
|
745 |
|
746 |
+
#: inc/admin/admin-metaboxes-form.php:126 inc/admin/admin.php:3596
|
747 |
msgid "Term Title"
|
748 |
msgstr ""
|
749 |
|
750 |
+
#: inc/admin/admin-metaboxes-form.php:131 inc/admin/admin-wizard.php:508
|
751 |
+
#: inc/admin/admin.php:1355 inc/admin/admin.php:3234 inc/admin/admin.php:3248
|
752 |
+
#: inc/admin/admin.php:3351 inc/admin/admin.php:3469 inc/admin/admin.php:3599
|
753 |
+
#: inc/admin/admin.php:3722 inc/admin/admin.php:3801 inc/admin/admin.php:3872
|
754 |
+
#: inc/admin/admin.php:3942 inc/admin/admin.php:3994
|
755 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-text-letter-counter-control.php:68
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
756 |
msgid "Separator"
|
757 |
msgstr ""
|
758 |
|
759 |
+
#: inc/admin/admin-metaboxes-form.php:139
|
760 |
+
#: inc/admin/admin-metaboxes-form.php:140
|
761 |
+
#: inc/admin/admin-metaboxes-form.php:142
|
762 |
#: inc/admin/admin-metaboxes-get-content-analysis.php:42
|
763 |
#: inc/admin/admin-wizard.php:303 inc/admin/admin-wizard.php:323
|
764 |
#: inc/admin/admin-wizard.php:340 inc/admin/admin-wizard.php:359
|
765 |
#: inc/admin/admin-wizard.php:378 inc/admin/admin-wizard.php:396
|
766 |
#: inc/admin/admin-wizard.php:413 inc/admin/admin-wizard.php:429
|
767 |
+
#: inc/admin/admin-wizard.php:448 inc/admin/admin.php:747
|
768 |
+
#: inc/admin/admin.php:780 inc/admin/admin.php:873 inc/admin/admin.php:895
|
769 |
+
#: inc/admin/admin.php:914 inc/admin/admin.php:935 inc/admin/admin.php:956
|
770 |
+
#: inc/admin/admin.php:976 inc/admin/admin.php:995 inc/admin/admin.php:1013
|
771 |
+
#: inc/admin/admin.php:1033 inc/admin/admin.php:1371 inc/admin/admin.php:3256
|
772 |
+
#: inc/functions/options-advanced-admin.php:979
|
773 |
msgid "Meta description"
|
774 |
msgstr ""
|
775 |
|
776 |
+
#: inc/admin/admin-metaboxes-form.php:140
|
777 |
msgid ""
|
778 |
"A meta description tag should generally inform and interest users with a "
|
779 |
"short, relevant summary of what a particular page is about. <br>They are "
|
783 |
"device width."
|
784 |
msgstr ""
|
785 |
|
786 |
+
#: inc/admin/admin-metaboxes-form.php:142
|
787 |
msgid "Enter your meta description"
|
788 |
msgstr ""
|
789 |
|
790 |
+
#: inc/admin/admin-metaboxes-form.php:149
|
791 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-text-letter-counter-control.php:57
|
792 |
msgid " / 940 pixels - "
|
793 |
msgstr ""
|
794 |
|
795 |
+
#: inc/admin/admin-metaboxes-form.php:155
|
796 |
msgid "Category / term description"
|
797 |
msgstr ""
|
798 |
|
799 |
+
#: inc/admin/admin-metaboxes-form.php:157
|
800 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-text-letter-counter-control.php:70
|
801 |
msgid "Post Excerpt"
|
802 |
msgstr ""
|
803 |
|
804 |
+
#: inc/admin/admin-metaboxes-form.php:168
|
805 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:134
|
806 |
msgid "Google Snippet Preview"
|
807 |
msgstr ""
|
808 |
|
809 |
+
#: inc/admin/admin-metaboxes-form.php:169
|
810 |
msgid "Snippet Preview"
|
811 |
msgstr ""
|
812 |
|
813 |
+
#: inc/admin/admin-metaboxes-form.php:169
|
814 |
msgid ""
|
815 |
"The Google preview is a simulation. <br>There is no reliable preview because "
|
816 |
"it depends on the screen resolution, the device used, the expression sought, "
|
819 |
"what the crawlers will see."
|
820 |
msgstr ""
|
821 |
|
822 |
+
#: inc/admin/admin-metaboxes-form.php:171
|
823 |
msgid ""
|
824 |
"This is what your page will look like in Google search results. You have to "
|
825 |
"publish your post to get the Google Snippet Preview."
|
826 |
msgstr ""
|
827 |
|
828 |
+
#: inc/admin/admin-metaboxes-form.php:176
|
829 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:91
|
830 |
msgid "Mobile Preview"
|
831 |
msgstr ""
|
832 |
|
833 |
+
#: inc/admin/admin-metaboxes-form.php:223
|
834 |
msgid ""
|
835 |
"Do not display this page in search engine results / XML - HTML sitemaps "
|
836 |
"<strong>(noindex)</strong>"
|
837 |
msgstr ""
|
838 |
|
839 |
+
#: inc/admin/admin-metaboxes-form.php:224
|
840 |
msgid "\"noindex\" robots meta tag"
|
841 |
msgstr ""
|
842 |
|
843 |
+
#: inc/admin/admin-metaboxes-form.php:224
|
844 |
msgid ""
|
845 |
"By checking this option, you will add a meta robots tag with the value "
|
846 |
"\"noindex\". <br>Search engines will not index this URL in the search "
|
847 |
"results."
|
848 |
msgstr ""
|
849 |
|
850 |
+
#: inc/admin/admin-metaboxes-form.php:230
|
851 |
msgid "Do not follow links for this page <strong>(nofollow)</strong>"
|
852 |
msgstr ""
|
853 |
|
854 |
+
#: inc/admin/admin-metaboxes-form.php:231
|
855 |
msgid "\"nofollow\" robots meta tag"
|
856 |
msgstr ""
|
857 |
|
858 |
+
#: inc/admin/admin-metaboxes-form.php:231
|
859 |
msgid ""
|
860 |
"By checking this option, you will add a meta robots tag with the value "
|
861 |
"\"nofollow\". <br>Search engines will not follow links from this URL."
|
862 |
msgstr ""
|
863 |
|
864 |
+
#: inc/admin/admin-metaboxes-form.php:237
|
865 |
msgid ""
|
866 |
"Do not use Open Directory project metadata for titles or excerpts for this "
|
867 |
"page <strong>(noodp)</strong>"
|
868 |
msgstr ""
|
869 |
|
870 |
+
#: inc/admin/admin-metaboxes-form.php:238
|
871 |
msgid "\"noodp\" robots meta tag"
|
872 |
msgstr ""
|
873 |
|
874 |
+
#: inc/admin/admin-metaboxes-form.php:238
|
875 |
msgid ""
|
876 |
"By checking this option, you will add a meta robots tag with the value "
|
877 |
"\"noodp\". <br>Note that Google and Yahoo have stopped considering this tag "
|
878 |
"since the closing of DMOZ directory."
|
879 |
msgstr ""
|
880 |
|
881 |
+
#: inc/admin/admin-metaboxes-form.php:244
|
882 |
msgid "Do not index images for this page <strong>(noimageindex)</strong>"
|
883 |
msgstr ""
|
884 |
|
885 |
+
#: inc/admin/admin-metaboxes-form.php:245
|
886 |
msgid "\"noimageindex\" robots meta tag"
|
887 |
msgstr ""
|
888 |
|
889 |
+
#: inc/admin/admin-metaboxes-form.php:245
|
890 |
msgid ""
|
891 |
"By checking this option, you will add a meta robots tag with the value "
|
892 |
"\"noimageindex\". <br> Note that your images can always be indexed if they "
|
893 |
"are linked from other pages."
|
894 |
msgstr ""
|
895 |
|
896 |
+
#: inc/admin/admin-metaboxes-form.php:251
|
897 |
msgid ""
|
898 |
"Do not display a \"Cached\" link in the Google search results "
|
899 |
"<strong>(noarchive)</strong>"
|
900 |
msgstr ""
|
901 |
|
902 |
+
#: inc/admin/admin-metaboxes-form.php:252
|
903 |
msgid "\"noarchive\" robots meta tag"
|
904 |
msgstr ""
|
905 |
|
906 |
+
#: inc/admin/admin-metaboxes-form.php:252
|
907 |
msgid ""
|
908 |
"By checking this option, you will add a meta robots tag with the value "
|
909 |
"\"noarchive\"."
|
910 |
msgstr ""
|
911 |
|
912 |
+
#: inc/admin/admin-metaboxes-form.php:258
|
913 |
msgid ""
|
914 |
"Do not display a description in search results for this page "
|
915 |
"<strong>(nosnippet)</strong>"
|
916 |
msgstr ""
|
917 |
|
918 |
+
#: inc/admin/admin-metaboxes-form.php:259
|
919 |
msgid "\"nosnippet\" robots meta tag"
|
920 |
msgstr ""
|
921 |
|
922 |
+
#: inc/admin/admin-metaboxes-form.php:259
|
923 |
msgid ""
|
924 |
"By checking this option, you will add a meta robots tag with the value "
|
925 |
"\"nosnippet\"."
|
926 |
msgstr ""
|
927 |
|
928 |
+
#: inc/admin/admin-metaboxes-form.php:264
|
929 |
msgid ""
|
930 |
"You cannot uncheck a parameter? This is normal, and it‘s most likely defined "
|
931 |
"in the global settings of the extension."
|
932 |
msgstr ""
|
933 |
|
934 |
+
#: inc/admin/admin-metaboxes-form.php:267
|
935 |
+
#: inc/admin/admin-metaboxes-form.php:268
|
936 |
+
#: inc/admin/admin-metaboxes-form.php:271 inc/admin/admin-wizard.php:307
|
937 |
#: inc/admin/admin-wizard.php:344 inc/admin/admin-wizard.php:363
|
938 |
#: inc/admin/admin-wizard.php:382 inc/admin/admin-wizard.php:432
|
939 |
+
#: inc/admin/admin-wizard.php:452 inc/admin/admin.php:762
|
940 |
+
#: inc/admin/admin.php:795 inc/admin/admin.php:877 inc/admin/admin.php:918
|
941 |
+
#: inc/admin/admin.php:939 inc/admin/admin.php:960 inc/admin/admin.php:1016
|
942 |
+
#: inc/admin/admin.php:1037
|
943 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:247
|
944 |
msgid "Canonical URL"
|
945 |
msgstr ""
|
946 |
|
947 |
+
#: inc/admin/admin-metaboxes-form.php:268
|
948 |
msgid ""
|
949 |
"A canonical URL is the URL of the page that Google thinks is most "
|
950 |
"representative from a set of duplicate pages on your site. <br>For example, "
|
956 |
"\t\t\t\t\t\t\tThe canonical can be in a different domain than a duplicate."
|
957 |
msgstr ""
|
958 |
|
959 |
+
#: inc/admin/admin-metaboxes-form.php:271
|
960 |
msgid "Default value: "
|
961 |
msgstr ""
|
962 |
|
963 |
+
#: inc/admin/admin-metaboxes-form.php:278
|
964 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:277
|
965 |
msgid "Select a primary category"
|
966 |
msgstr ""
|
967 |
|
968 |
+
#: inc/admin/admin-metaboxes-form.php:279
|
969 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:278
|
970 |
msgid ""
|
971 |
+
"Set the category that gets used in the %category% permalink and in our "
|
972 |
+
"breadcrumbs if you have multiple categories."
|
973 |
msgstr ""
|
974 |
|
975 |
+
#: inc/admin/admin-metaboxes-form.php:289 inc/admin/admin-wizard.php:519
|
976 |
+
#: inc/admin/admin.php:4496
|
977 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:270
|
978 |
msgid "None (will disable this feature)"
|
979 |
msgstr ""
|
980 |
|
981 |
+
#: inc/admin/admin-metaboxes-form.php:300
|
982 |
+
#: inc/admin/admin-metaboxes-form.php:304
|
983 |
msgid "Custom breadcrumbs"
|
984 |
msgstr ""
|
985 |
|
986 |
+
#: inc/admin/admin-metaboxes-form.php:301
|
987 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:295
|
988 |
msgid "Enter a custom value, useful if your title is too long"
|
989 |
msgstr ""
|
990 |
|
991 |
+
#: inc/admin/admin-metaboxes-form.php:304
|
992 |
#, php-format
|
993 |
msgid "Current breadcrumbs: %s"
|
994 |
msgstr ""
|
995 |
|
996 |
+
#: inc/admin/admin-metaboxes-form.php:314
|
997 |
msgid "Ask Facebook to update its cache"
|
998 |
msgstr ""
|
999 |
|
1000 |
+
#: inc/admin/admin-metaboxes-form.php:315
|
1001 |
msgid ""
|
1002 |
"<span class=\"label\">Did you know?</span> LinkedIn, Instagram and Pinterest "
|
1003 |
"use the same social metadata as Facebook. Twitter does the same if no "
|
1004 |
"Twitter cards tags are defined below."
|
1005 |
msgstr ""
|
1006 |
|
1007 |
+
#: inc/admin/admin-metaboxes-form.php:317
|
1008 |
+
#: inc/admin/admin-metaboxes-form.php:318
|
1009 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:357
|
1010 |
msgid "Facebook Title"
|
1011 |
msgstr ""
|
1012 |
|
1013 |
+
#: inc/admin/admin-metaboxes-form.php:318
|
1014 |
msgid "Enter your Facebook title"
|
1015 |
msgstr ""
|
1016 |
|
1017 |
+
#: inc/admin/admin-metaboxes-form.php:321
|
1018 |
+
#: inc/admin/admin-metaboxes-form.php:322
|
1019 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:368
|
1020 |
msgid "Facebook description"
|
1021 |
msgstr ""
|
1022 |
|
1023 |
+
#: inc/admin/admin-metaboxes-form.php:322
|
1024 |
msgid "Enter your Facebook description"
|
1025 |
msgstr ""
|
1026 |
|
1027 |
+
#: inc/admin/admin-metaboxes-form.php:325
|
1028 |
+
#: inc/admin/admin-metaboxes-form.php:326
|
1029 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:379
|
1030 |
msgid "Facebook Thumbnail"
|
1031 |
msgstr ""
|
1032 |
|
1033 |
+
#: inc/admin/admin-metaboxes-form.php:326
|
1034 |
+
#: inc/admin/admin-metaboxes-form.php:389 inc/admin/admin.php:4763
|
1035 |
+
#: inc/admin/admin.php:4812 inc/admin/admin.php:4909
|
1036 |
msgid "Select your default thumbnail"
|
1037 |
msgstr ""
|
1038 |
|
1039 |
+
#: inc/admin/admin-metaboxes-form.php:327 inc/admin/admin.php:4767
|
1040 |
msgid ""
|
1041 |
"Minimum size: 200x200px, ideal ratio 1.91:1, 8Mb max. (eg: 1640x856px or "
|
1042 |
"3280x1712px for retina screens)"
|
1043 |
msgstr ""
|
1044 |
|
1045 |
+
#: inc/admin/admin-metaboxes-form.php:328
|
1046 |
+
#: inc/admin/admin-metaboxes-form.php:391
|
1047 |
+
#: inc/admin/admin-metaboxes-form.php:578 inc/admin/admin.php:4530
|
1048 |
+
#: inc/admin/admin.php:4765 inc/admin/admin.php:4814 inc/admin/admin.php:4911
|
1049 |
msgid "Upload an Image"
|
1050 |
msgstr ""
|
1051 |
|
1052 |
+
#: inc/admin/admin-metaboxes-form.php:333
|
1053 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:392
|
|
|
1054 |
msgid "Facebook Preview"
|
1055 |
msgstr ""
|
1056 |
|
1057 |
+
#: inc/admin/admin-metaboxes-form.php:335
|
1058 |
msgid ""
|
1059 |
"This is what your post will look like in Facebook. You have to publish your "
|
1060 |
"post to get the Facebook Preview."
|
1061 |
msgstr ""
|
1062 |
|
1063 |
+
#: inc/admin/admin-metaboxes-form.php:337
|
1064 |
msgid ""
|
1065 |
"The Social Networks feature is disabled. Still seing informations from the "
|
1066 |
"FB Preview? You probably have social tags added by your theme or a plugin."
|
1067 |
msgstr ""
|
1068 |
|
1069 |
+
#: inc/admin/admin-metaboxes-form.php:340
|
1070 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:42
|
1071 |
msgid "File type not supported by Facebook. Please choose another image."
|
1072 |
msgstr ""
|
1073 |
|
1074 |
+
#: inc/admin/admin-metaboxes-form.php:341
|
1075 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:43
|
1076 |
msgid ""
|
1077 |
"Minimun size for Facebook is <strong>200x200px</strong>. Please choose "
|
1078 |
"another image."
|
1079 |
msgstr ""
|
1080 |
|
1081 |
+
#: inc/admin/admin-metaboxes-form.php:342
|
1082 |
+
#: inc/admin/admin-metaboxes-form.php:405
|
1083 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:44
|
1084 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:68
|
1085 |
msgid "File error. Please choose another image."
|
1086 |
msgstr ""
|
1087 |
|
1088 |
+
#: inc/admin/admin-metaboxes-form.php:343
|
1089 |
+
#: inc/admin/admin-metaboxes-form.php:406
|
1090 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:45
|
1091 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:69
|
1092 |
msgid "Your image ratio is: "
|
1093 |
msgstr ""
|
1094 |
|
1095 |
+
#: inc/admin/admin-metaboxes-form.php:343
|
1096 |
msgid "The closer to 1.91 the better."
|
1097 |
msgstr ""
|
1098 |
|
1099 |
+
#: inc/admin/admin-metaboxes-form.php:344
|
1100 |
+
#: inc/admin/admin-metaboxes-form.php:407
|
1101 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:46
|
1102 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:70
|
1103 |
msgid "File URL is not valid."
|
1104 |
msgstr ""
|
1105 |
|
1106 |
+
#: inc/admin/admin-metaboxes-form.php:353
|
1107 |
msgid "By "
|
1108 |
msgstr ""
|
1109 |
|
1110 |
+
#: inc/admin/admin-metaboxes-form.php:378
|
1111 |
msgid "Preview your Twitter card using the official validator"
|
1112 |
msgstr ""
|
1113 |
|
1114 |
+
#: inc/admin/admin-metaboxes-form.php:380
|
1115 |
+
#: inc/admin/admin-metaboxes-form.php:381
|
1116 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:487
|
1117 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:406
|
1118 |
msgid "Twitter Title"
|
1119 |
msgstr ""
|
1120 |
|
1121 |
+
#: inc/admin/admin-metaboxes-form.php:381
|
1122 |
msgid "Enter your Twitter title"
|
1123 |
msgstr ""
|
1124 |
|
1125 |
+
#: inc/admin/admin-metaboxes-form.php:384
|
1126 |
+
#: inc/admin/admin-metaboxes-form.php:385
|
1127 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:417
|
1128 |
msgid "Twitter description"
|
1129 |
msgstr ""
|
1130 |
|
1131 |
+
#: inc/admin/admin-metaboxes-form.php:385
|
1132 |
msgid "Enter your Twitter description"
|
1133 |
msgstr ""
|
1134 |
|
1135 |
+
#: inc/admin/admin-metaboxes-form.php:388
|
1136 |
+
#: inc/admin/admin-metaboxes-form.php:391
|
1137 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:428
|
1138 |
msgid "Twitter Thumbnail"
|
1139 |
msgstr ""
|
1140 |
|
1141 |
+
#: inc/admin/admin-metaboxes-form.php:390 inc/admin/admin.php:4913
|
1142 |
msgid ""
|
1143 |
"Minimum size: 144x144px (300x157px with large card enabled), ideal ratio 1:1 "
|
1144 |
"(2:1 with large card), 5Mb max."
|
1145 |
msgstr ""
|
1146 |
|
1147 |
+
#: inc/admin/admin-metaboxes-form.php:396
|
1148 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:441
|
|
|
1149 |
msgid "Twitter Preview"
|
1150 |
msgstr ""
|
1151 |
|
1152 |
+
#: inc/admin/admin-metaboxes-form.php:398
|
1153 |
msgid ""
|
1154 |
"This is what your post will look like in Twitter. You have to publish your "
|
1155 |
"post to get the Twitter Preview."
|
1156 |
msgstr ""
|
1157 |
|
1158 |
+
#: inc/admin/admin-metaboxes-form.php:400
|
1159 |
msgid ""
|
1160 |
"The Social Networks feature is disabled. Still seing informations from the "
|
1161 |
"Twitter Preview? You probably have social tags added by your theme or a "
|
1162 |
"plugin."
|
1163 |
msgstr ""
|
1164 |
|
1165 |
+
#: inc/admin/admin-metaboxes-form.php:403
|
1166 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:66
|
1167 |
msgid "File type not supported by Twitter. Please choose another image."
|
1168 |
msgstr ""
|
1169 |
|
1170 |
+
#: inc/admin/admin-metaboxes-form.php:404
|
1171 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:67
|
1172 |
msgid ""
|
1173 |
"Minimun size for Twitter is <strong>144x144px</strong>. Please choose "
|
1174 |
"another image."
|
1175 |
msgstr ""
|
1176 |
|
1177 |
+
#: inc/admin/admin-metaboxes-form.php:406
|
1178 |
msgid "The closer to 1 the better (with large card, 2 is better)."
|
1179 |
msgstr ""
|
1180 |
|
1181 |
+
#: inc/admin/admin-metaboxes-form.php:442
|
1182 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:479
|
1183 |
msgid "Enable redirection?"
|
1184 |
msgstr ""
|
1185 |
|
1186 |
+
#: inc/admin/admin-metaboxes-form.php:446
|
1187 |
+
#: inc/admin/admin-metaboxes-form.php:454
|
1188 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:490
|
1189 |
msgid "URL redirection"
|
1190 |
msgstr ""
|
1191 |
|
1192 |
+
#: inc/admin/admin-metaboxes-form.php:448
|
1193 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:495
|
1194 |
msgid "301 Moved Permanently"
|
1195 |
msgstr ""
|
1196 |
|
1197 |
+
#: inc/admin/admin-metaboxes-form.php:449
|
1198 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:496
|
1199 |
msgid "302 Found / Moved Temporarily"
|
1200 |
msgstr ""
|
1201 |
|
1202 |
+
#: inc/admin/admin-metaboxes-form.php:450
|
1203 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:497
|
1204 |
msgid "307 Moved Temporarily"
|
1205 |
msgstr ""
|
1206 |
|
1207 |
+
#: inc/admin/admin-metaboxes-form.php:451
|
1208 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:498
|
1209 |
msgid "410 Gone"
|
1210 |
msgstr ""
|
1211 |
|
1212 |
+
#: inc/admin/admin-metaboxes-form.php:452
|
1213 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:499
|
1214 |
msgid "451 Unavailable For Legal Reasons"
|
1215 |
msgstr ""
|
1216 |
|
1217 |
+
#: inc/admin/admin-metaboxes-form.php:454
|
1218 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:508
|
1219 |
msgid "Enter your new URL in absolute (eg: https://www.example.com/)"
|
1220 |
msgstr ""
|
1221 |
|
1222 |
+
#: inc/admin/admin-metaboxes-form.php:459
|
1223 |
msgid "Query parameters"
|
1224 |
msgstr ""
|
1225 |
|
1226 |
+
#: inc/admin/admin-metaboxes-form.php:461
|
1227 |
msgid "Exactly match all parameters"
|
1228 |
msgstr ""
|
1229 |
|
1230 |
+
#: inc/admin/admin-metaboxes-form.php:462
|
1231 |
msgid "Exclude all parameters"
|
1232 |
msgstr ""
|
1233 |
|
1234 |
+
#: inc/admin/admin-metaboxes-form.php:463
|
1235 |
msgid "Exclude all parameters and pass them to the redirection"
|
1236 |
msgstr ""
|
1237 |
|
|
|
|
|
1238 |
#: inc/admin/admin-metaboxes-form.php:472
|
1239 |
#: inc/admin/admin-metaboxes-form.php:474
|
1240 |
+
#: inc/admin/admin-metaboxes-form.php:477
|
1241 |
+
#: inc/admin/admin-metaboxes-form.php:479
|
1242 |
msgid "Test your URL"
|
1243 |
msgstr ""
|
1244 |
|
1245 |
+
#: inc/admin/admin-metaboxes-form.php:491
|
1246 |
msgid "Need help with your redirections? Read our guide."
|
1247 |
msgstr ""
|
1248 |
|
1249 |
+
#: inc/admin/admin-metaboxes-form.php:505
|
1250 |
msgid "Exclude this post from Google News Sitemap?"
|
1251 |
msgstr ""
|
1252 |
|
1253 |
+
#: inc/admin/admin-metaboxes-form.php:531
|
1254 |
msgid "Exclude this post from Video Sitemap?"
|
1255 |
msgstr ""
|
1256 |
|
1257 |
+
#: inc/admin/admin-metaboxes-form.php:533
|
1258 |
msgid ""
|
1259 |
"If your post is set to noindex, it will be automatically excluded from the "
|
1260 |
"sitemap."
|
1261 |
msgstr ""
|
1262 |
|
1263 |
+
#: inc/admin/admin-metaboxes-form.php:552
|
1264 |
msgid "Video "
|
1265 |
msgstr ""
|
1266 |
|
1267 |
+
#: inc/admin/admin-metaboxes-form.php:556
|
1268 |
msgid "Video URL (required)"
|
1269 |
msgstr ""
|
1270 |
|
1271 |
+
#: inc/admin/admin-metaboxes-form.php:557
|
1272 |
msgid "Enter your video URL"
|
1273 |
msgstr ""
|
1274 |
|
1275 |
+
#: inc/admin/admin-metaboxes-form.php:557
|
1276 |
msgid "Video URL"
|
1277 |
msgstr ""
|
1278 |
|
1279 |
+
#: inc/admin/admin-metaboxes-form.php:562
|
1280 |
msgid ""
|
1281 |
"NOT an external video (eg: video hosting on YouTube, Vimeo, Wistia...)? "
|
1282 |
"Check this if your video is hosting on this server."
|
1283 |
msgstr ""
|
1284 |
|
1285 |
+
#: inc/admin/admin-metaboxes-form.php:566
|
1286 |
msgid "Video Title (required)"
|
1287 |
msgstr ""
|
1288 |
|
1289 |
+
#: inc/admin/admin-metaboxes-form.php:567
|
1290 |
msgid "Enter your video title"
|
1291 |
msgstr ""
|
1292 |
|
1293 |
+
#: inc/admin/admin-metaboxes-form.php:567
|
1294 |
msgid "Video title"
|
1295 |
msgstr ""
|
1296 |
|
1297 |
+
#: inc/admin/admin-metaboxes-form.php:568
|
1298 |
msgid "Default: title tag, if not available, post title."
|
1299 |
msgstr ""
|
1300 |
|
1301 |
+
#: inc/admin/admin-metaboxes-form.php:571
|
1302 |
msgid "Video Description (required)"
|
1303 |
msgstr ""
|
1304 |
|
1305 |
+
#: inc/admin/admin-metaboxes-form.php:572
|
1306 |
msgid "Enter your video description"
|
1307 |
msgstr ""
|
1308 |
|
1309 |
+
#: inc/admin/admin-metaboxes-form.php:572
|
1310 |
msgid "Video description"
|
1311 |
msgstr ""
|
1312 |
|
1313 |
+
#: inc/admin/admin-metaboxes-form.php:573
|
1314 |
msgid ""
|
1315 |
"2048 characters max.; default: meta description. If not available, use the "
|
1316 |
"beginning of the post content."
|
1317 |
msgstr ""
|
1318 |
|
1319 |
+
#: inc/admin/admin-metaboxes-form.php:576
|
1320 |
msgid "Video Thumbnail (required)"
|
1321 |
msgstr ""
|
1322 |
|
1323 |
+
#: inc/admin/admin-metaboxes-form.php:577
|
1324 |
msgid "Select your video thumbnail"
|
1325 |
msgstr ""
|
1326 |
|
1327 |
+
#: inc/admin/admin-metaboxes-form.php:578
|
1328 |
msgid "Video Thumbnail"
|
1329 |
msgstr ""
|
1330 |
|
1331 |
+
#: inc/admin/admin-metaboxes-form.php:579
|
1332 |
msgid ""
|
1333 |
"Minimum size: 160x90px (1920x1080 max), JPG, PNG or GIF formats. Default: "
|
1334 |
"your post featured image."
|
1335 |
msgstr ""
|
1336 |
|
1337 |
+
#: inc/admin/admin-metaboxes-form.php:582
|
1338 |
msgid "Video Duration (recommended)"
|
1339 |
msgstr ""
|
1340 |
|
1341 |
+
#: inc/admin/admin-metaboxes-form.php:583
|
1342 |
msgid "Duration in seconds"
|
1343 |
msgstr ""
|
1344 |
|
1345 |
+
#: inc/admin/admin-metaboxes-form.php:583
|
1346 |
msgid "Video duration"
|
1347 |
msgstr ""
|
1348 |
|
1349 |
+
#: inc/admin/admin-metaboxes-form.php:584
|
1350 |
msgid ""
|
1351 |
"The duration of the video in seconds. Value must be between 0 and 28800 (8 "
|
1352 |
"hours)."
|
1353 |
msgstr ""
|
1354 |
|
1355 |
+
#: inc/admin/admin-metaboxes-form.php:587
|
1356 |
msgid "Video Rating"
|
1357 |
msgstr ""
|
1358 |
|
1359 |
+
#: inc/admin/admin-metaboxes-form.php:588
|
1360 |
msgid "Video rating"
|
1361 |
msgstr ""
|
1362 |
|
1363 |
+
#: inc/admin/admin-metaboxes-form.php:589
|
1364 |
msgid "Allowed values are float numbers in the range 0.0 to 5.0."
|
1365 |
msgstr ""
|
1366 |
|
1367 |
+
#: inc/admin/admin-metaboxes-form.php:592
|
1368 |
+
#: inc/admin/admin-metaboxes-form.php:593
|
1369 |
msgid "View count"
|
1370 |
msgstr ""
|
1371 |
|
1372 |
+
#: inc/admin/admin-metaboxes-form.php:593
|
1373 |
msgid "Number of views"
|
1374 |
msgstr ""
|
1375 |
|
1376 |
+
#: inc/admin/admin-metaboxes-form.php:596
|
1377 |
+
#: inc/admin/admin-metaboxes-form.php:597
|
1378 |
msgid "Video tags"
|
1379 |
msgstr ""
|
1380 |
|
1381 |
+
#: inc/admin/admin-metaboxes-form.php:597
|
1382 |
msgid "Enter your video tags"
|
1383 |
msgstr ""
|
1384 |
|
1385 |
+
#: inc/admin/admin-metaboxes-form.php:598
|
1386 |
msgid ""
|
1387 |
"32 tags max., separate tags with commas. Default: target keywords + post "
|
1388 |
"tags if available."
|
1389 |
msgstr ""
|
1390 |
|
1391 |
+
#: inc/admin/admin-metaboxes-form.php:601
|
1392 |
+
#: inc/admin/admin-metaboxes-form.php:602
|
1393 |
msgid "Video categories"
|
1394 |
msgstr ""
|
1395 |
|
1396 |
+
#: inc/admin/admin-metaboxes-form.php:602
|
1397 |
msgid "Enter your video categories"
|
1398 |
msgstr ""
|
1399 |
|
1400 |
+
#: inc/admin/admin-metaboxes-form.php:603
|
1401 |
msgid ""
|
1402 |
"256 characters max., usually a video will belong to a single category, "
|
1403 |
"separate categories with commas. Default: first post category if available."
|
1404 |
msgstr ""
|
1405 |
|
1406 |
+
#: inc/admin/admin-metaboxes-form.php:608
|
1407 |
msgid "NOT family friendly?"
|
1408 |
msgstr ""
|
1409 |
|
1410 |
+
#: inc/admin/admin-metaboxes-form.php:610
|
1411 |
msgid "The video will be available only to users with SafeSearch turned off."
|
1412 |
msgstr ""
|
1413 |
|
1414 |
+
#: inc/admin/admin-metaboxes-form.php:612
|
1415 |
msgid "Remove video"
|
1416 |
msgstr ""
|
1417 |
|
1418 |
+
#: inc/admin/admin-metaboxes-form.php:619
|
1419 |
msgid "Add video"
|
1420 |
msgstr ""
|
1421 |
|
1487 |
msgid ""
|
1488 |
"Search engines love fresh content. Regularly update your articles without "
|
1489 |
"having to rewrite your content entirely and give them a boost in search "
|
1490 |
+
"rankings. We takes care of the technical part."
|
1491 |
msgstr ""
|
1492 |
|
1493 |
#: inc/admin/admin-metaboxes-get-content-analysis.php:108
|
1664 |
"title tag from your source code. Below, the list:"
|
1665 |
msgstr ""
|
1666 |
|
1667 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:342
|
1668 |
+
msgid "Your Open Graph Title tag is empty!"
|
1669 |
+
msgstr ""
|
1670 |
+
|
1671 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:344
|
1672 |
msgid "We found an Open Graph Title tag in your source code."
|
1673 |
msgstr ""
|
1674 |
|
1675 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:356
|
1676 |
msgid "Your Open Graph Title is missing!"
|
1677 |
msgstr ""
|
1678 |
|
1679 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:360
|
1680 |
msgid "Open Graph Description"
|
1681 |
msgstr ""
|
1682 |
|
1683 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:370
|
1684 |
#, php-format
|
1685 |
msgid "We found %d og:description in your content."
|
1686 |
msgstr ""
|
1687 |
|
1688 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:371
|
1689 |
msgid ""
|
1690 |
"You should not use more than one og:description in your post content to "
|
1691 |
"avoid conflicts when sharing on social networks. Facebook will take the last "
|
1692 |
"og:description tag from your source code. Below, the list:"
|
1693 |
msgstr ""
|
1694 |
|
1695 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:374
|
1696 |
+
msgid "Your Open Graph Description tag is empty!"
|
1697 |
+
msgstr ""
|
1698 |
+
|
1699 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:376
|
1700 |
msgid "We found an Open Graph Description tag in your source code."
|
1701 |
msgstr ""
|
1702 |
|
1703 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:388
|
1704 |
msgid "Your Open Graph Description is missing!"
|
1705 |
msgstr ""
|
1706 |
|
1707 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:392
|
1708 |
msgid "Open Graph Image"
|
1709 |
msgstr ""
|
1710 |
|
1711 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:401
|
1712 |
#, php-format
|
1713 |
msgid "We found %d og:image in your content."
|
1714 |
msgstr ""
|
1715 |
|
1716 |
#: inc/admin/admin-metaboxes-get-content-analysis.php:407
|
1717 |
+
msgid "Your Open Graph Image tag is empty!"
|
1718 |
+
msgstr ""
|
1719 |
+
|
1720 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:419
|
1721 |
msgid "Your Open Graph Image is missing!"
|
1722 |
msgstr ""
|
1723 |
|
1724 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:423
|
1725 |
msgid "Open Graph URL"
|
1726 |
msgstr ""
|
1727 |
|
1728 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:433
|
1729 |
#, php-format
|
1730 |
msgid "We found %d og:url in your content."
|
1731 |
msgstr ""
|
1732 |
|
1733 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:434
|
1734 |
msgid ""
|
1735 |
"You should not use more than one og:url in your post content to avoid "
|
1736 |
"conflicts when sharing on social networks. Facebook will take the last og:"
|
1737 |
"url tag from your source code. Below, the list:"
|
1738 |
msgstr ""
|
1739 |
|
1740 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:437
|
1741 |
+
msgid "Your Open Graph URL tag is empty!"
|
1742 |
+
msgstr ""
|
1743 |
+
|
1744 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:439
|
1745 |
msgid "We found an Open Graph URL tag in your source code."
|
1746 |
msgstr ""
|
1747 |
|
1748 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:451
|
1749 |
msgid "Your Open Graph URL is missing!"
|
1750 |
msgstr ""
|
1751 |
|
1752 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:455
|
1753 |
msgid "Open Graph Site Name"
|
1754 |
msgstr ""
|
1755 |
|
1756 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:465
|
1757 |
#, php-format
|
1758 |
msgid "We found %d og:site_name in your content."
|
1759 |
msgstr ""
|
1760 |
|
1761 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:466
|
1762 |
msgid ""
|
1763 |
"You should not use more than one og:site_name in your post content to avoid "
|
1764 |
"conflicts when sharing on social networks. Facebook will take the last og:"
|
1765 |
"site_name tag from your source code. Below, the list:"
|
1766 |
msgstr ""
|
1767 |
|
1768 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:469
|
1769 |
+
msgid "Your Open Graph Site Name tag is empty!"
|
1770 |
+
msgstr ""
|
1771 |
+
|
1772 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:471
|
1773 |
msgid "We found an Open Graph Site Name tag in your source code."
|
1774 |
msgstr ""
|
1775 |
|
1776 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:483
|
1777 |
msgid "Your Open Graph Site Name is missing!"
|
1778 |
msgstr ""
|
1779 |
|
1780 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:497
|
1781 |
#, php-format
|
1782 |
msgid "We found %d twitter:title in your content."
|
1783 |
msgstr ""
|
1784 |
|
1785 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:498
|
1786 |
msgid ""
|
1787 |
"You should not use more than one twitter:title in your post content to avoid "
|
1788 |
"conflicts when sharing on social networks. Twitter will take the last "
|
1789 |
"twitter:title tag from your source code. Below, the list:"
|
1790 |
msgstr ""
|
1791 |
|
1792 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:501
|
1793 |
+
msgid "Your Twitter Title tag is empty!"
|
1794 |
msgstr ""
|
1795 |
|
1796 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:503
|
1797 |
+
msgid "We found a Twitter Title tag in your source code."
|
1798 |
+
msgstr ""
|
1799 |
+
|
1800 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:515
|
1801 |
msgid "Your Twitter Title is missing!"
|
1802 |
msgstr ""
|
1803 |
|
1804 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:519
|
1805 |
msgid "Twitter Description"
|
1806 |
msgstr ""
|
1807 |
|
1808 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:529
|
1809 |
#, php-format
|
1810 |
msgid "We found %d twitter:description in your content."
|
1811 |
msgstr ""
|
1812 |
|
1813 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:530
|
1814 |
msgid ""
|
1815 |
"You should not use more than one twitter:description in your post content to "
|
1816 |
"avoid conflicts when sharing on social networks. Twitter will take the last "
|
1817 |
"twitter:description tag from your source code. Below, the list:"
|
1818 |
msgstr ""
|
1819 |
|
1820 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:533
|
1821 |
+
msgid "Your Twitter Description tag is empty!"
|
1822 |
+
msgstr ""
|
1823 |
+
|
1824 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:535
|
1825 |
msgid "We found a Twitter Description tag in your source code."
|
1826 |
msgstr ""
|
1827 |
|
1828 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:547
|
1829 |
msgid "Your Twitter Description is missing!"
|
1830 |
msgstr ""
|
1831 |
|
1832 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:551
|
1833 |
msgid "Twitter Image"
|
1834 |
msgstr ""
|
1835 |
|
1836 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:560
|
1837 |
#, php-format
|
1838 |
msgid "We found %d twitter:image in your content."
|
1839 |
msgstr ""
|
1840 |
|
1841 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:566
|
1842 |
+
msgid "Your Twitter Image tag is empty!"
|
1843 |
+
msgstr ""
|
1844 |
+
|
1845 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:578
|
1846 |
msgid "Your Twitter Image is missing!"
|
1847 |
msgstr ""
|
1848 |
|
1849 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:593
|
1850 |
#, php-format
|
1851 |
msgid ""
|
1852 |
"We found %s meta robots in your page. There is probably something wrong with "
|
1853 |
"your theme!"
|
1854 |
msgstr ""
|
1855 |
|
1856 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:598
|
1857 |
msgid "noindex is on! Search engines can't index this page."
|
1858 |
msgstr ""
|
1859 |
|
1860 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:600
|
1861 |
msgid "noindex is off. Search engines will index this page."
|
1862 |
msgstr ""
|
1863 |
|
1864 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:605
|
1865 |
msgid "nofollow is on! Search engines can't follow your links on this page."
|
1866 |
msgstr ""
|
1867 |
|
1868 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:607
|
1869 |
msgid "nofollow is off. Search engines will follow links on this page."
|
1870 |
msgstr ""
|
1871 |
|
1872 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:614
|
1873 |
msgid "noarchive is on! Search engines will not cache your page."
|
1874 |
msgstr ""
|
1875 |
|
1876 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:616
|
1877 |
msgid "noarchive is off. Search engines will probably cache your page."
|
1878 |
msgstr ""
|
1879 |
|
1880 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:623
|
1881 |
msgid ""
|
1882 |
"nosnippet is on! Search engines will not display a snippet of this page in "
|
1883 |
"search results."
|
1884 |
msgstr ""
|
1885 |
|
1886 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:625
|
1887 |
msgid ""
|
1888 |
"nosnippet is off. Search engines will display a snippet of this page in "
|
1889 |
"search results."
|
1890 |
msgstr ""
|
1891 |
|
1892 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:628
|
1893 |
msgid ""
|
1894 |
"We found no meta robots on this page. It means, your page is index,follow. "
|
1895 |
"Search engines will index it, and follow links. "
|
1896 |
msgstr ""
|
1897 |
|
1898 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:637
|
1899 |
msgid ""
|
1900 |
"noimageindex is on! Google will not index your images on this page (but if "
|
1901 |
"someone makes a direct link to one of your image in this page, it will be "
|
1902 |
"indexed)."
|
1903 |
msgstr ""
|
1904 |
|
1905 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:639
|
1906 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:651
|
1907 |
msgid "noimageindex is off. Google will index the images on this page."
|
1908 |
msgstr ""
|
1909 |
|
1910 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:646
|
1911 |
msgid ""
|
1912 |
"nositelinkssearchbox is on! Google will not display a sitelinks searchbox in "
|
1913 |
"search results."
|
1914 |
msgstr ""
|
1915 |
|
1916 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:648
|
1917 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:653
|
1918 |
msgid ""
|
1919 |
"nositelinkssearchbox is off. Google will probably display a sitelinks "
|
1920 |
"searchbox in search results."
|
1921 |
msgstr ""
|
1922 |
|
1923 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:666
|
1924 |
msgid ""
|
1925 |
"No alternative text found for these images. Alt tags are important for both "
|
1926 |
"SEO and accessibility. Edit your images using the media library or your "
|
1927 |
"favorite page builder and fill in alternative text fields."
|
1928 |
msgstr ""
|
1929 |
|
1930 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:677
|
1931 |
msgid "All alternative tags are filled in. Good work!"
|
1932 |
msgstr ""
|
1933 |
|
1934 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:684
|
1935 |
msgid ""
|
1936 |
"We could not find any image in your content. Content with media is a plus "
|
1937 |
"for your SEO."
|
1938 |
msgstr ""
|
1939 |
|
1940 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:691
|
1941 |
#, php-format
|
1942 |
msgid ""
|
1943 |
"We found %d links with nofollow attribute in your page. Do not overuse "
|
1944 |
"nofollow attribute in links. Below, the list:"
|
1945 |
msgstr ""
|
1946 |
|
1947 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:702
|
1948 |
msgid "This page doesn't have any nofollow links."
|
1949 |
msgstr ""
|
1950 |
|
1951 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:706
|
1952 |
msgid ""
|
1953 |
"Internet is built on the principle of hyperlink. It is therefore perfectly "
|
1954 |
"normal to make links between different websites. However, avoid making links "
|
1956 |
"site, add the attribute \"nofollow\" to your link."
|
1957 |
msgstr ""
|
1958 |
|
1959 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:710
|
1960 |
#, php-format
|
1961 |
msgid "We found %s outbound links in your page. Below, the list:"
|
1962 |
msgstr ""
|
1963 |
|
1964 |
+
#: inc/admin/admin-metaboxes-get-content-analysis.php:720
|
1965 |
msgid "This page doesn't have any outbound links."
|
1966 |
msgstr ""
|
1967 |
|
1968 |
#: inc/admin/admin-metaboxes-render-content-analysis.php:12
|
1969 |
+
#: inc/admin/admin-metaboxes.php:434
|
1970 |
msgid "Content analysis"
|
1971 |
msgstr ""
|
1972 |
|
1977 |
msgstr ""
|
1978 |
|
1979 |
#: inc/admin/admin-metaboxes-render-content-analysis.php:16
|
1980 |
+
#: inc/functions/options-advanced-admin.php:508
|
1981 |
msgid "Should be improved"
|
1982 |
msgstr ""
|
1983 |
|
1984 |
#: inc/admin/admin-metaboxes-render-content-analysis.php:19
|
1985 |
+
#: inc/functions/options-advanced-admin.php:503
|
1986 |
msgid "Good"
|
1987 |
msgstr ""
|
1988 |
|
1994 |
msgid "Close"
|
1995 |
msgstr ""
|
1996 |
|
1997 |
+
#: inc/admin/admin-metaboxes.php:206 inc/admin/admin-metaboxes.php:448
|
1998 |
#: inc/admin/admin-term-metaboxes.php:203
|
1999 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:55
|
2000 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-content-analysis-control.php:34
|
2001 |
msgid "Analysis in progress..."
|
2002 |
msgstr ""
|
2003 |
|
2061 |
#: inc/admin/admin-notifications-center.php:295
|
2062 |
#: inc/admin/admin-notifications-center.php:419
|
2063 |
#: inc/admin/admin-notifications-center.php:469
|
2064 |
+
#: inc/admin/admin-notifications-center.php:510
|
2065 |
+
#: inc/admin/admin-notifications-center.php:529
|
2066 |
+
#: inc/admin/admin-notifications-center.php:546
|
2067 |
+
#: inc/admin/admin-notifications-center.php:634
|
2068 |
+
#: inc/admin/admin-notifications-center.php:710
|
2069 |
+
#: inc/admin/admin-notifications-center.php:747
|
2070 |
+
#: inc/admin/admin-notifications-center.php:765
|
2071 |
msgid "High impact"
|
2072 |
msgstr ""
|
2073 |
|
2076 |
#: inc/admin/admin-notifications-center.php:205
|
2077 |
#: inc/admin/admin-notifications-center.php:235
|
2078 |
#: inc/admin/admin-notifications-center.php:423
|
2079 |
+
#: inc/admin/admin-notifications-center.php:514
|
2080 |
+
#: inc/admin/admin-notifications-center.php:533
|
2081 |
+
#: inc/admin/admin-notifications-center.php:550
|
2082 |
+
#: inc/admin/admin-notifications-center.php:579
|
2083 |
+
#: inc/admin/admin-notifications-center.php:668
|
2084 |
+
#: inc/admin/admin-notifications-center.php:686
|
2085 |
+
#: inc/admin/admin-notifications-center.php:769
|
2086 |
+
#: inc/admin/admin-notifications-center.php:788
|
2087 |
msgid "Fix this!"
|
2088 |
msgstr ""
|
2089 |
|
2137 |
#: inc/admin/admin-notifications-center.php:347
|
2138 |
#: inc/admin/admin-notifications-center.php:386
|
2139 |
#: inc/admin/admin-notifications-center.php:448
|
2140 |
+
#: inc/admin/admin-notifications-center.php:474 inc/admin/admin.php:5281
|
2141 |
+
#: inc/admin/admin.php:5321 inc/admin/admin.php:5348 inc/admin/admin.php:5370
|
2142 |
+
#: inc/admin/admin.php:5392 inc/admin/admin.php:5414
|
2143 |
msgid "Learn more"
|
2144 |
msgstr ""
|
2145 |
|
2182 |
|
2183 |
#: inc/admin/admin-notifications-center.php:342
|
2184 |
#: inc/admin/admin-notifications-center.php:381
|
2185 |
+
#: inc/admin/admin-notifications-center.php:575
|
2186 |
+
#: inc/admin/admin-notifications-center.php:664
|
2187 |
+
#: inc/admin/admin-notifications-center.php:682
|
2188 |
msgid "Medium impact"
|
2189 |
msgstr ""
|
2190 |
|
2239 |
"this."
|
2240 |
msgstr ""
|
2241 |
|
2242 |
+
#: inc/admin/admin-notifications-center.php:507
|
2243 |
msgid "Your site is not visible to Search Engines!"
|
2244 |
msgstr ""
|
2245 |
|
2246 |
+
#: inc/admin/admin-notifications-center.php:508
|
2247 |
msgid ""
|
2248 |
"You have activated the blocking of the indexing of your site. If your site "
|
2249 |
"is under development, this is probably normal. Otherwise, check your "
|
2251 |
"not concerned."
|
2252 |
msgstr ""
|
2253 |
|
2254 |
+
#: inc/admin/admin-notifications-center.php:526
|
2255 |
msgid "Your site title is empty!"
|
2256 |
msgstr ""
|
2257 |
|
2258 |
+
#: inc/admin/admin-notifications-center.php:527
|
2259 |
msgid ""
|
2260 |
"Your Site Title is used by WordPress, your theme and your plugins including "
|
2261 |
"SEOPress. It is an essential component in the generation of title tags, but "
|
2262 |
"not only. Enter one!"
|
2263 |
msgstr ""
|
2264 |
|
2265 |
+
#: inc/admin/admin-notifications-center.php:543 inc/admin/admin.php:3068
|
2266 |
msgid ""
|
2267 |
"Your permalinks are not SEO Friendly! Enable pretty permalinks to fix this."
|
2268 |
msgstr ""
|
2269 |
|
2270 |
+
#: inc/admin/admin-notifications-center.php:544
|
2271 |
+
#: inc/admin/admin-notifications-center.php:573
|
2272 |
msgid ""
|
2273 |
"Why is this important? Showing only the summary of each article "
|
2274 |
"significantly reduces the theft of your content by third party sites. Not to "
|
2276 |
"conversions..."
|
2277 |
msgstr ""
|
2278 |
|
2279 |
+
#: inc/admin/admin-notifications-center.php:572
|
2280 |
msgid "Your RSS feed shows full text!"
|
2281 |
msgstr ""
|
2282 |
|
2283 |
+
#: inc/admin/admin-notifications-center.php:602
|
2284 |
msgid "You like SEOPress? Please help us by rating us 5 stars!"
|
2285 |
msgstr ""
|
2286 |
|
2287 |
+
#: inc/admin/admin-notifications-center.php:603
|
2288 |
msgid ""
|
2289 |
"Support the development and improvement of the plugin by taking 15 seconds "
|
2290 |
"of your time to leave us a user review on the official WordPress plugins "
|
2291 |
"repository. Thank you!"
|
2292 |
msgstr ""
|
2293 |
|
2294 |
+
#: inc/admin/admin-notifications-center.php:605
|
2295 |
msgid "Information"
|
2296 |
msgstr ""
|
2297 |
|
2298 |
+
#: inc/admin/admin-notifications-center.php:609
|
2299 |
msgid "Rate us!"
|
2300 |
msgstr ""
|
2301 |
|
2302 |
+
#: inc/admin/admin-notifications-center.php:631
|
2303 |
msgid "Break comments into pages is ON!"
|
2304 |
msgstr ""
|
2305 |
|
2306 |
+
#: inc/admin/admin-notifications-center.php:632
|
2307 |
msgid ""
|
2308 |
"Enabling this option will create duplicate content for each article beyond x "
|
2309 |
"comments. This can have a disastrous effect by creating a large number of "
|
2311 |
"ranking in search results."
|
2312 |
msgstr ""
|
2313 |
|
2314 |
+
#: inc/admin/admin-notifications-center.php:638
|
2315 |
msgid "Disable this!"
|
2316 |
msgstr ""
|
2317 |
|
2318 |
+
#: inc/admin/admin-notifications-center.php:661
|
2319 |
msgid "Display more posts per page on homepage and archives"
|
2320 |
msgstr ""
|
2321 |
|
2322 |
+
#: inc/admin/admin-notifications-center.php:662
|
2323 |
msgid ""
|
2324 |
"To reduce the number pages search engines have to crawl to find all your "
|
2325 |
"articles, it is recommended displaying more posts per page. This should not "
|
2327 |
"than clicking on next page links."
|
2328 |
msgstr ""
|
2329 |
|
2330 |
+
#: inc/admin/admin-notifications-center.php:679
|
2331 |
msgid "You don't have an XML Sitemap!"
|
2332 |
msgstr ""
|
2333 |
|
2334 |
+
#: inc/admin/admin-notifications-center.php:680
|
2335 |
msgid ""
|
2336 |
"XML Sitemaps are useful to facilitate the crawling of your content by search "
|
2337 |
"engine robots. Indirectly, this can benefit your ranking by reducing the "
|
2338 |
"crawl bugdet."
|
2339 |
msgstr ""
|
2340 |
|
2341 |
+
#: inc/admin/admin-notifications-center.php:707
|
2342 |
msgid "Do you have a Google My Business page? It's free!"
|
2343 |
msgstr ""
|
2344 |
|
2345 |
+
#: inc/admin/admin-notifications-center.php:708
|
2346 |
msgid ""
|
2347 |
"Local Business websites should have a My Business page to improve visibility "
|
2348 |
"in search results. Click on the cross on the right to delete this "
|
2349 |
"notification if you are not concerned."
|
2350 |
msgstr ""
|
2351 |
|
2352 |
+
#: inc/admin/admin-notifications-center.php:714
|
2353 |
msgid "Create your page now!"
|
2354 |
msgstr ""
|
2355 |
|
2356 |
+
#: inc/admin/admin-notifications-center.php:744
|
2357 |
msgid "Add your site to Google. It's free!"
|
2358 |
msgstr ""
|
2359 |
|
2360 |
+
#: inc/admin/admin-notifications-center.php:745
|
2361 |
msgid ""
|
2362 |
"Is your brand new site online? So reference it as quickly as possible on "
|
2363 |
"Google to get your first visitors via Google Search Console. Already the "
|
2364 |
"case? Click on the cross on the right to remove this alert."
|
2365 |
msgstr ""
|
2366 |
|
2367 |
+
#: inc/admin/admin-notifications-center.php:751
|
2368 |
msgid "Add your site to Search Console!"
|
2369 |
msgstr ""
|
2370 |
|
2371 |
+
#: inc/admin/admin-notifications-center.php:762
|
2372 |
msgid "Structured data types is not correctly enabled"
|
2373 |
msgstr ""
|
2374 |
|
2375 |
+
#: inc/admin/admin-notifications-center.php:763
|
2376 |
msgid ""
|
2377 |
"Please enable <strong>Structured Data Types metabox for your posts, pages "
|
2378 |
"and custom post types</strong> option in order to use automatic and manual "
|
2379 |
"schemas. (SEO > PRO > Structured Data Types (schema.org)"
|
2380 |
msgstr ""
|
2381 |
|
2382 |
+
#: inc/admin/admin-notifications-center.php:781
|
2383 |
msgid "You have to enter your licence key to get updates and support"
|
2384 |
msgstr ""
|
2385 |
|
2386 |
+
#: inc/admin/admin-notifications-center.php:782
|
2387 |
msgid ""
|
2388 |
"Please activate the SEOPress PRO license key to automatically receive "
|
2389 |
"updates to guarantee you the best user experience possible."
|
2390 |
msgstr ""
|
2391 |
|
2392 |
+
#: inc/admin/admin-notifications-center.php:810
|
2393 |
msgid "Take your SEO to the next level with SEOPress PRO!"
|
2394 |
msgstr ""
|
2395 |
|
2396 |
+
#: inc/admin/admin-notifications-center.php:811
|
2397 |
msgid ""
|
2398 |
"The PRO version of SEOPress allows you to easily manage your structured data "
|
2399 |
"(schemas), add a breadcrumb optimized for SEO and accessibility, improve SEO "
|
2401 |
"of your metadata and so much more."
|
2402 |
msgstr ""
|
2403 |
|
2404 |
+
#: inc/admin/admin-notifications-center.php:818
|
2405 |
msgid "Upgrade now!"
|
2406 |
msgstr ""
|
2407 |
|
2408 |
+
#: inc/admin/admin-notifications-center.php:835
|
2409 |
msgid "Check websites setup on your server"
|
2410 |
msgstr ""
|
2411 |
|
2412 |
+
#: inc/admin/admin-notifications-center.php:844
|
2413 |
msgid "Not found"
|
2414 |
msgstr ""
|
2415 |
|
2416 |
+
#: inc/admin/admin-notifications-center.php:849
|
2417 |
msgid "No scrape."
|
2418 |
msgstr ""
|
2419 |
|
2420 |
+
#: inc/admin/admin-notifications-center.php:854
|
2421 |
msgid "No domain found."
|
2422 |
msgstr ""
|
2423 |
|
2424 |
+
#: inc/admin/admin-notifications-center.php:864
|
2425 |
msgid "Server IP Address: "
|
2426 |
msgstr ""
|
2427 |
|
2428 |
+
#: inc/admin/admin-notifications-center.php:867
|
2429 |
msgid "Last scrape: "
|
2430 |
msgstr ""
|
2431 |
|
2432 |
+
#: inc/admin/admin-notifications-center.php:868
|
2433 |
msgid "Number of websites on your server: "
|
2434 |
msgstr ""
|
2435 |
|
2436 |
+
#: inc/admin/admin-notifications-center.php:881
|
2437 |
msgid "Get list"
|
2438 |
msgstr ""
|
2439 |
|
2440 |
+
#: inc/admin/admin-notifications-center.php:890
|
2441 |
msgid "Our blog: SEO news, how-to, tips and tricks..."
|
2442 |
msgstr ""
|
2443 |
|
2444 |
+
#: inc/admin/admin-notifications-center.php:891
|
2445 |
msgid "Upload a list of links to disavow to Google"
|
2446 |
msgstr ""
|
2447 |
|
2448 |
+
#: inc/admin/admin-notifications-center.php:893
|
2449 |
msgid ""
|
2450 |
"Image SEO plugin to optimize your image ALT texts and names for Search "
|
2451 |
"Engines."
|
2452 |
msgstr ""
|
2453 |
|
2454 |
+
#: inc/admin/admin-notifications-center.php:895
|
2455 |
msgid "Dareboost: Test, analyze and optimize your website"
|
2456 |
msgstr ""
|
2457 |
|
2458 |
+
#: inc/admin/admin-notifications-center.php:896
|
2459 |
msgid "Google Campaign URL Builder tool"
|
2460 |
msgstr ""
|
2461 |
|
2519 |
msgid "No data to migrate? Click \"Next step\" button!"
|
2520 |
msgstr ""
|
2521 |
|
2522 |
+
#: inc/admin/admin-wizard.php:280 inc/admin/admin.php:851
|
2523 |
msgid "Import posts and terms metadata from"
|
2524 |
msgstr ""
|
2525 |
|
2526 |
+
#: inc/admin/admin-wizard.php:282 inc/admin/admin.php:853
|
2527 |
+
#: inc/admin/admin.php:1054
|
2528 |
msgid "Select an option"
|
2529 |
msgstr ""
|
2530 |
|
2531 |
+
#: inc/admin/admin-wizard.php:283 inc/admin/admin.php:854
|
2532 |
msgid "Yoast SEO"
|
2533 |
msgstr ""
|
2534 |
|
2535 |
+
#: inc/admin/admin-wizard.php:284 inc/admin/admin.php:855
|
2536 |
msgid "All In One SEO"
|
2537 |
msgstr ""
|
2538 |
|
2539 |
+
#: inc/admin/admin-wizard.php:285 inc/admin/admin.php:856
|
2540 |
msgid "The SEO Framework"
|
2541 |
msgstr ""
|
2542 |
|
2543 |
+
#: inc/admin/admin-wizard.php:286 inc/admin/admin.php:857
|
2544 |
msgid "Rank Math"
|
2545 |
msgstr ""
|
2546 |
|
2547 |
+
#: inc/admin/admin-wizard.php:287 inc/admin/admin.php:858
|
2548 |
msgid "Squirrly SEO"
|
2549 |
msgstr ""
|
2550 |
|
2551 |
+
#: inc/admin/admin-wizard.php:288 inc/admin/admin.php:859
|
2552 |
msgid "SEO Ultimate"
|
2553 |
msgstr ""
|
2554 |
|
2555 |
+
#: inc/admin/admin-wizard.php:289 inc/admin/admin.php:860
|
2556 |
msgid "WP Meta SEO"
|
2557 |
msgstr ""
|
2558 |
|
2559 |
+
#: inc/admin/admin-wizard.php:290 inc/admin/admin.php:861
|
2560 |
msgid "Premium SEO Pack"
|
2561 |
msgstr ""
|
2562 |
|
2563 |
+
#: inc/admin/admin-wizard.php:291 inc/admin/admin.php:862
|
2564 |
msgid "wpSEO"
|
2565 |
msgstr ""
|
2566 |
|
2567 |
+
#: inc/admin/admin-wizard.php:299 inc/admin/admin.php:869
|
2568 |
msgid "Import posts and terms metadata from Yoast"
|
2569 |
msgstr ""
|
2570 |
|
2572 |
#: inc/admin/admin-wizard.php:337 inc/admin/admin-wizard.php:356
|
2573 |
#: inc/admin/admin-wizard.php:375 inc/admin/admin-wizard.php:393
|
2574 |
#: inc/admin/admin-wizard.php:410 inc/admin/admin-wizard.php:426
|
2575 |
+
#: inc/admin/admin-wizard.php:445 inc/admin/admin.php:870
|
2576 |
+
#: inc/admin/admin.php:892 inc/admin/admin.php:911 inc/admin/admin.php:932
|
2577 |
+
#: inc/admin/admin.php:953 inc/admin/admin.php:973 inc/admin/admin.php:992
|
2578 |
+
#: inc/admin/admin.php:1010 inc/admin/admin.php:1030
|
2579 |
msgid "By clicking Migrate, we'll import:"
|
2580 |
msgstr ""
|
2581 |
|
2583 |
#: inc/admin/admin-wizard.php:339 inc/admin/admin-wizard.php:358
|
2584 |
#: inc/admin/admin-wizard.php:377 inc/admin/admin-wizard.php:395
|
2585 |
#: inc/admin/admin-wizard.php:412 inc/admin/admin-wizard.php:428
|
2586 |
+
#: inc/admin/admin-wizard.php:447 inc/admin/admin.php:872
|
2587 |
+
#: inc/admin/admin.php:894 inc/admin/admin.php:913 inc/admin/admin.php:934
|
2588 |
+
#: inc/admin/admin.php:955 inc/admin/admin.php:975 inc/admin/admin.php:994
|
2589 |
+
#: inc/admin/admin.php:1012 inc/admin/admin.php:1032
|
2590 |
msgid "Title tags"
|
2591 |
msgstr ""
|
2592 |
|
2594 |
#: inc/admin/admin-wizard.php:341 inc/admin/admin-wizard.php:360
|
2595 |
#: inc/admin/admin-wizard.php:379 inc/admin/admin-wizard.php:397
|
2596 |
#: inc/admin/admin-wizard.php:414 inc/admin/admin-wizard.php:430
|
2597 |
+
#: inc/admin/admin-wizard.php:449 inc/admin/admin.php:874
|
2598 |
+
#: inc/admin/admin.php:896 inc/admin/admin.php:915 inc/admin/admin.php:936
|
2599 |
+
#: inc/admin/admin.php:957 inc/admin/admin.php:977 inc/admin/admin.php:996
|
2600 |
+
#: inc/admin/admin.php:1014 inc/admin/admin.php:1034
|
2601 |
msgid "Facebook Open Graph tags (title, description and image thumbnail)"
|
2602 |
msgstr ""
|
2603 |
|
2604 |
#: inc/admin/admin-wizard.php:305 inc/admin/admin-wizard.php:342
|
2605 |
#: inc/admin/admin-wizard.php:361 inc/admin/admin-wizard.php:380
|
2606 |
#: inc/admin/admin-wizard.php:398 inc/admin/admin-wizard.php:415
|
2607 |
+
#: inc/admin/admin-wizard.php:450 inc/admin/admin.php:875
|
2608 |
+
#: inc/admin/admin.php:916 inc/admin/admin.php:937 inc/admin/admin.php:958
|
2609 |
+
#: inc/admin/admin.php:978 inc/admin/admin.php:997 inc/admin/admin.php:1035
|
2610 |
msgid "Twitter tags (title, description and image thumbnail)"
|
2611 |
msgstr ""
|
2612 |
|
2613 |
+
#: inc/admin/admin-wizard.php:306 inc/admin/admin.php:876
|
2614 |
msgid "Meta Robots (noindex, nofollow...)"
|
2615 |
msgstr ""
|
2616 |
|
2617 |
#: inc/admin/admin-wizard.php:308 inc/admin/admin-wizard.php:364
|
2618 |
+
#: inc/admin/admin-wizard.php:433 inc/admin/admin.php:878
|
2619 |
+
#: inc/admin/admin.php:940 inc/admin/admin.php:1017
|
2620 |
msgid "Focus keywords"
|
2621 |
msgstr ""
|
2622 |
|
2623 |
+
#: inc/admin/admin-wizard.php:309 inc/admin/admin.php:879
|
2624 |
msgid "Primary category"
|
2625 |
msgstr ""
|
2626 |
|
2627 |
+
#: inc/admin/admin-wizard.php:311 inc/admin/admin.php:881
|
2628 |
msgid ""
|
2629 |
"<strong>WARNING:</strong> Migration will delete / update all SEOPress posts "
|
2630 |
"and terms metadata. Some dynamic variables will not be interpreted. We do "
|
2635 |
#: inc/admin/admin-wizard.php:348 inc/admin/admin-wizard.php:367
|
2636 |
#: inc/admin/admin-wizard.php:385 inc/admin/admin-wizard.php:402
|
2637 |
#: inc/admin/admin-wizard.php:418 inc/admin/admin-wizard.php:436
|
2638 |
+
#: inc/admin/admin-wizard.php:457 inc/admin/admin.php:882
|
2639 |
+
#: inc/admin/admin.php:901 inc/admin/admin.php:922 inc/admin/admin.php:943
|
2640 |
+
#: inc/admin/admin.php:963 inc/admin/admin.php:982 inc/admin/admin.php:1000
|
2641 |
+
#: inc/admin/admin.php:1020 inc/admin/admin.php:1042
|
2642 |
msgid "Migrate now"
|
2643 |
msgstr ""
|
2644 |
|
2645 |
+
#: inc/admin/admin-wizard.php:319 inc/admin/admin.php:891
|
2646 |
msgid "Import posts and terms metadata from All In One SEO"
|
2647 |
msgstr ""
|
2648 |
|
2649 |
+
#: inc/admin/admin-wizard.php:325 inc/admin/admin.php:897
|
2650 |
msgid "Twitter image thumbnail"
|
2651 |
msgstr ""
|
2652 |
|
2653 |
#: inc/admin/admin-wizard.php:326 inc/admin/admin-wizard.php:431
|
2654 |
+
#: inc/admin/admin-wizard.php:451 inc/admin/admin.php:898
|
2655 |
+
#: inc/admin/admin.php:1015 inc/admin/admin.php:1036
|
2656 |
msgid "Meta Robots (noindex, nofollow)"
|
2657 |
msgstr ""
|
2658 |
|
2659 |
+
#: inc/admin/admin-wizard.php:328 inc/admin/admin.php:900
|
2660 |
msgid ""
|
2661 |
"<strong>WARNING:</strong> Migration will update/delete all SEOPress posts "
|
2662 |
"and terms metadata. Some dynamic variables will not be interpreted. We do "
|
2663 |
"NOT delete any AIO data."
|
2664 |
msgstr ""
|
2665 |
|
2666 |
+
#: inc/admin/admin-wizard.php:336 inc/admin/admin.php:910
|
2667 |
msgid "Import posts and terms metadata from The SEO Framework"
|
2668 |
msgstr ""
|
2669 |
|
2670 |
+
#: inc/admin/admin-wizard.php:343 inc/admin/admin.php:917
|
2671 |
msgid "Meta Robots (noindex, nofollow, noarchive)"
|
2672 |
msgstr ""
|
2673 |
|
2674 |
#: inc/admin/admin-wizard.php:345 inc/admin/admin-wizard.php:453
|
2675 |
+
#: inc/admin/admin.php:919 inc/admin/admin.php:1038
|
2676 |
+
#: inc/functions/options-advanced-admin.php:408
|
2677 |
msgid "Redirect URL"
|
2678 |
msgstr ""
|
2679 |
|
2680 |
+
#: inc/admin/admin-wizard.php:347 inc/admin/admin.php:921
|
2681 |
msgid ""
|
2682 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2683 |
"and terms metadata. Some dynamic variables will not be interpreted. We do "
|
2684 |
"NOT delete any SEO Framework data."
|
2685 |
msgstr ""
|
2686 |
|
2687 |
+
#: inc/admin/admin-wizard.php:355 inc/admin/admin.php:931
|
2688 |
msgid "Import posts and terms metadata from Rank Math"
|
2689 |
msgstr ""
|
2690 |
|
2691 |
+
#: inc/admin/admin-wizard.php:362 inc/admin/admin.php:938
|
2692 |
msgid "Meta Robots (noindex, nofollow, noarchive, noimageindex)"
|
2693 |
msgstr ""
|
2694 |
|
2695 |
+
#: inc/admin/admin-wizard.php:366 inc/admin/admin.php:942
|
2696 |
msgid ""
|
2697 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2698 |
"and terms metadata. Some dynamic variables will not be interpreted. We do "
|
2699 |
"NOT delete any Rank Math data."
|
2700 |
msgstr ""
|
2701 |
|
2702 |
+
#: inc/admin/admin-wizard.php:374 inc/admin/admin.php:952
|
2703 |
msgid "Import posts metadata from Squirrly SEO"
|
2704 |
msgstr ""
|
2705 |
|
2706 |
#: inc/admin/admin-wizard.php:381 inc/admin/admin-wizard.php:399
|
2707 |
+
#: inc/admin/admin.php:959 inc/admin/admin.php:979
|
2708 |
msgid "Meta Robots (noindex or nofollow)"
|
2709 |
msgstr ""
|
2710 |
|
2715 |
"any Squirrly SEO data."
|
2716 |
msgstr ""
|
2717 |
|
2718 |
+
#: inc/admin/admin-wizard.php:392 inc/admin/admin.php:972
|
2719 |
msgid "Import posts metadata from SEO Ultimate"
|
2720 |
msgstr ""
|
2721 |
|
2722 |
+
#: inc/admin/admin-wizard.php:401 inc/admin/admin.php:981
|
2723 |
msgid ""
|
2724 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2725 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
2726 |
"any SEO Ultimate data."
|
2727 |
msgstr ""
|
2728 |
|
2729 |
+
#: inc/admin/admin-wizard.php:409 inc/admin/admin.php:991
|
2730 |
msgid "Import posts and terms metadata from WP Meta SEO"
|
2731 |
msgstr ""
|
2732 |
|
2733 |
+
#: inc/admin/admin-wizard.php:417 inc/admin/admin.php:999
|
2734 |
msgid ""
|
2735 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2736 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
2737 |
"any WP Meta SEO data."
|
2738 |
msgstr ""
|
2739 |
|
2740 |
+
#: inc/admin/admin-wizard.php:425 inc/admin/admin.php:1009
|
2741 |
msgid "Import posts and terms metadata from Premium SEO Pack"
|
2742 |
msgstr ""
|
2743 |
|
2744 |
+
#: inc/admin/admin-wizard.php:435 inc/admin/admin.php:1019
|
2745 |
msgid ""
|
2746 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2747 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
2748 |
"any Premium SEO Pack data."
|
2749 |
msgstr ""
|
2750 |
|
2751 |
+
#: inc/admin/admin-wizard.php:444 inc/admin/admin.php:1029
|
2752 |
msgid "Import posts and terms metadata from wpSEO"
|
2753 |
msgstr ""
|
2754 |
|
2755 |
+
#: inc/admin/admin-wizard.php:454 inc/admin/admin.php:1039
|
2756 |
msgid "Main keyword"
|
2757 |
msgstr ""
|
2758 |
|
2759 |
+
#: inc/admin/admin-wizard.php:456 inc/admin/admin.php:1041
|
2760 |
msgid ""
|
2761 |
"<strong>WARNING:</strong> Migration will update / delete all SEOPress posts "
|
2762 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
2777 |
msgid "eg: |"
|
2778 |
msgstr ""
|
2779 |
|
2780 |
+
#: inc/admin/admin-wizard.php:511 inc/admin/admin.php:1363
|
2781 |
+
#: inc/admin/admin.php:3244
|
2782 |
msgid "Site title"
|
2783 |
msgstr ""
|
2784 |
|
2786 |
msgid "eg: My super website"
|
2787 |
msgstr ""
|
2788 |
|
2789 |
+
#: inc/admin/admin-wizard.php:514 inc/admin/admin.php:1794
|
2790 |
msgid "Person or organization"
|
2791 |
msgstr ""
|
2792 |
|
2794 |
msgid "Choose a knowledge type"
|
2795 |
msgstr ""
|
2796 |
|
2797 |
+
#: inc/admin/admin-wizard.php:522 inc/admin/admin.php:4499
|
2798 |
msgid "Person"
|
2799 |
msgstr ""
|
2800 |
|
2801 |
+
#: inc/admin/admin-wizard.php:525 inc/admin/admin.php:4502
|
2802 |
msgid "Organization"
|
2803 |
msgstr ""
|
2804 |
|
2805 |
+
#: inc/admin/admin-wizard.php:529 inc/admin/admin.php:1802
|
2806 |
+
#: inc/admin/admin.php:4515
|
2807 |
msgid "Your name/organization"
|
2808 |
msgstr ""
|
2809 |
|
2811 |
msgid "eg: My Company Name"
|
2812 |
msgstr ""
|
2813 |
|
2814 |
+
#: inc/admin/admin-wizard.php:532 inc/admin/admin.php:1810
|
2815 |
+
#: inc/admin/admin.php:4528
|
2816 |
msgid "Your photo/organization logo"
|
2817 |
msgstr ""
|
2818 |
|
2824 |
msgid "Facebook page URL"
|
2825 |
msgstr ""
|
2826 |
|
2827 |
+
#: inc/admin/admin-wizard.php:536 inc/admin/admin.php:4636
|
2828 |
msgid "eg: https://facebook.com/my-page-url"
|
2829 |
msgstr ""
|
2830 |
|
2831 |
+
#: inc/admin/admin-wizard.php:538 inc/admin/admin.php:1859
|
2832 |
msgid "Twitter Username"
|
2833 |
msgstr ""
|
2834 |
|
2835 |
+
#: inc/admin/admin-wizard.php:539 inc/admin/admin.php:4649
|
2836 |
msgid "eg: @my_twitter_account"
|
2837 |
msgstr ""
|
2838 |
|
2839 |
+
#: inc/admin/admin-wizard.php:541 inc/admin/admin.php:1867
|
2840 |
+
#: inc/admin/admin.php:4661
|
2841 |
msgid "Pinterest URL"
|
2842 |
msgstr ""
|
2843 |
|
2844 |
+
#: inc/admin/admin-wizard.php:542 inc/admin/admin.php:4661
|
2845 |
msgid "eg: https://pinterest.com/my-page-url/"
|
2846 |
msgstr ""
|
2847 |
|
2848 |
+
#: inc/admin/admin-wizard.php:544 inc/admin/admin.php:1875
|
2849 |
+
#: inc/admin/admin.php:4673
|
2850 |
msgid "Instagram URL"
|
2851 |
msgstr ""
|
2852 |
|
2853 |
+
#: inc/admin/admin-wizard.php:545 inc/admin/admin.php:4673
|
2854 |
msgid "eg: https://www.instagram.com/my-page-url/"
|
2855 |
msgstr ""
|
2856 |
|
2857 |
+
#: inc/admin/admin-wizard.php:547 inc/admin/admin.php:1883
|
2858 |
+
#: inc/admin/admin.php:4685
|
2859 |
msgid "YouTube URL"
|
2860 |
msgstr ""
|
2861 |
|
2862 |
+
#: inc/admin/admin-wizard.php:548 inc/admin/admin.php:4685
|
2863 |
msgid "eg: https://www.youtube.com/my-channel-url"
|
2864 |
msgstr ""
|
2865 |
|
2866 |
+
#: inc/admin/admin-wizard.php:550 inc/admin/admin.php:1891
|
2867 |
+
#: inc/admin/admin.php:4697
|
2868 |
msgid "LinkedIn URL"
|
2869 |
msgstr ""
|
2870 |
|
2871 |
+
#: inc/admin/admin-wizard.php:551 inc/admin/admin.php:4697
|
2872 |
msgid "eg: http://linkedin.com/company/my-company-url/"
|
2873 |
msgstr ""
|
2874 |
|
2875 |
+
#: inc/admin/admin-wizard.php:553 inc/admin/admin.php:1899
|
2876 |
+
#: inc/admin/admin.php:4709
|
2877 |
msgid "MySpace URL"
|
2878 |
msgstr ""
|
2879 |
|
2880 |
+
#: inc/admin/admin-wizard.php:554 inc/admin/admin.php:4709
|
2881 |
msgid "eg: https://myspace.com/my-page-url"
|
2882 |
msgstr ""
|
2883 |
|
2884 |
+
#: inc/admin/admin-wizard.php:556 inc/admin/admin.php:1907
|
2885 |
+
#: inc/admin/admin.php:4721
|
2886 |
msgid "Soundcloud URL"
|
2887 |
msgstr ""
|
2888 |
|
2889 |
+
#: inc/admin/admin-wizard.php:557 inc/admin/admin.php:4721
|
2890 |
msgid "eg: https://soundcloud.com/my-page-url"
|
2891 |
msgstr ""
|
2892 |
|
2893 |
+
#: inc/admin/admin-wizard.php:559 inc/admin/admin.php:1915
|
2894 |
+
#: inc/admin/admin.php:4733
|
2895 |
msgid "Tumblr URL"
|
2896 |
msgstr ""
|
2897 |
|
2898 |
+
#: inc/admin/admin-wizard.php:560 inc/admin/admin.php:4733
|
2899 |
msgid "eg: https://your-site.tumblr.com"
|
2900 |
msgstr ""
|
2901 |
|
2946 |
"results <strong>(noindex)</strong>"
|
2947 |
msgstr ""
|
2948 |
|
2949 |
+
#: inc/admin/admin-wizard.php:780 inc/admin/admin.php:3833
|
2950 |
msgid ""
|
2951 |
"Do not display author archives in search engine results <strong>(noindex)</"
|
2952 |
"strong>"
|
2958 |
"content."
|
2959 |
msgstr ""
|
2960 |
|
2961 |
+
#: inc/admin/admin-wizard.php:792 inc/admin/admin.php:5846
|
2962 |
msgid ""
|
2963 |
"Redirect attachment pages to their file URL (https://www.example.com/my-"
|
2964 |
"image-file.jpg)"
|
2970 |
"Optimize this by redirecting the user directly to the URL of the media file."
|
2971 |
msgstr ""
|
2972 |
|
2973 |
+
#: inc/admin/admin-wizard.php:804 inc/admin/admin.php:5990
|
2974 |
msgid "Remove /category/ in your permalinks"
|
2975 |
msgstr ""
|
2976 |
|
3039 |
msgid "Knowledge base"
|
3040 |
msgstr ""
|
3041 |
|
3042 |
+
#: inc/admin/admin.php:129
|
3043 |
msgid "404 - Page not found"
|
3044 |
msgstr ""
|
3045 |
|
3046 |
+
#: inc/admin/admin.php:236
|
3047 |
msgid "Dashboard"
|
3048 |
msgstr ""
|
3049 |
|
3050 |
+
#: inc/admin/admin.php:249
|
3051 |
#, php-format
|
3052 |
msgid "%%sep%%"
|
3053 |
msgstr ""
|
3054 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3055 |
#: inc/admin/admin.php:249
|
3056 |
+
msgid "Separator (eg: - )"
|
|
|
|
|
|
|
|
|
|
|
3057 |
msgstr ""
|
3058 |
|
3059 |
#: inc/admin/admin.php:250
|
3060 |
#, php-format
|
3061 |
+
msgid "%%sitetitle%% (alias: %%sitename%%)"
|
|
|
|
|
|
|
|
|
3062 |
msgstr ""
|
3063 |
|
3064 |
#: inc/admin/admin.php:251
|
3065 |
#, php-format
|
3066 |
+
msgid "%%tagline%% (alias %%sitedesc%%)"
|
|
|
|
|
|
|
|
|
3067 |
msgstr ""
|
3068 |
|
3069 |
#: inc/admin/admin.php:252
|
3070 |
#, php-format
|
3071 |
+
msgid "%%post_title%% (alias %%title%%)"
|
3072 |
msgstr ""
|
3073 |
|
3074 |
#: inc/admin/admin.php:252
|
3075 |
+
msgid "Post Title (post, page, custom post type)"
|
3076 |
msgstr ""
|
3077 |
|
3078 |
#: inc/admin/admin.php:253
|
3079 |
#, php-format
|
3080 |
+
msgid "%%post_excerpt%% (alias %%excerpt%%)"
|
|
|
|
|
|
|
|
|
3081 |
msgstr ""
|
3082 |
|
3083 |
#: inc/admin/admin.php:254
|
3084 |
#, php-format
|
3085 |
+
msgid "%%post_content%%"
|
3086 |
msgstr ""
|
3087 |
|
3088 |
#: inc/admin/admin.php:254
|
3089 |
+
msgid "Post content / product long description"
|
3090 |
msgstr ""
|
3091 |
|
3092 |
#: inc/admin/admin.php:255
|
3093 |
#, php-format
|
3094 |
+
msgid "%%post_thumbnail_url%%"
|
|
|
|
|
|
|
|
|
3095 |
msgstr ""
|
3096 |
|
3097 |
#: inc/admin/admin.php:256
|
3098 |
#, php-format
|
3099 |
+
msgid "%%post_url%%"
|
3100 |
msgstr ""
|
3101 |
|
3102 |
#: inc/admin/admin.php:256
|
3103 |
+
msgid "Post URL (permalink)"
|
3104 |
msgstr ""
|
3105 |
|
3106 |
#: inc/admin/admin.php:257
|
3107 |
#, php-format
|
3108 |
+
msgid "%%post_date%% (alias %%date%%)"
|
|
|
|
|
|
|
|
|
3109 |
msgstr ""
|
3110 |
|
3111 |
#: inc/admin/admin.php:258
|
3112 |
#, php-format
|
3113 |
+
msgid "%%post_modified_date%%"
|
3114 |
msgstr ""
|
3115 |
|
3116 |
#: inc/admin/admin.php:258
|
3117 |
+
msgid "Last modified post date"
|
3118 |
msgstr ""
|
3119 |
|
3120 |
#: inc/admin/admin.php:259
|
3121 |
#, php-format
|
3122 |
+
msgid "%%post_author%%"
|
|
|
|
|
|
|
|
|
3123 |
msgstr ""
|
3124 |
|
3125 |
#: inc/admin/admin.php:260
|
3126 |
#, php-format
|
3127 |
+
msgid "%%post_category%%"
|
|
|
|
|
|
|
|
|
3128 |
msgstr ""
|
3129 |
|
3130 |
#: inc/admin/admin.php:261
|
3131 |
#, php-format
|
3132 |
+
msgid "%%post_tag%%"
|
|
|
|
|
|
|
|
|
3133 |
msgstr ""
|
3134 |
|
3135 |
#: inc/admin/admin.php:262
|
3136 |
#, php-format
|
3137 |
+
msgid "%%_category_title%%"
|
|
|
|
|
|
|
|
|
3138 |
msgstr ""
|
3139 |
|
3140 |
#: inc/admin/admin.php:263
|
3141 |
#, php-format
|
3142 |
+
msgid "%%_category_description%%"
|
|
|
|
|
|
|
|
|
3143 |
msgstr ""
|
3144 |
|
3145 |
#: inc/admin/admin.php:264
|
3146 |
#, php-format
|
3147 |
+
msgid "%%tag_title%%"
|
|
|
|
|
|
|
|
|
3148 |
msgstr ""
|
3149 |
|
3150 |
#: inc/admin/admin.php:265
|
3151 |
#, php-format
|
3152 |
+
msgid "%%tag_description%%"
|
|
|
|
|
|
|
|
|
3153 |
msgstr ""
|
3154 |
|
3155 |
#: inc/admin/admin.php:266
|
3156 |
#, php-format
|
3157 |
+
msgid "%%term_title%%"
|
|
|
|
|
|
|
|
|
3158 |
msgstr ""
|
3159 |
|
3160 |
#: inc/admin/admin.php:267
|
3161 |
#, php-format
|
3162 |
+
msgid "%%term_description%%"
|
|
|
|
|
|
|
|
|
3163 |
msgstr ""
|
3164 |
|
3165 |
#: inc/admin/admin.php:268
|
3166 |
#, php-format
|
3167 |
+
msgid "%%search_keywords%%"
|
|
|
|
|
|
|
|
|
3168 |
msgstr ""
|
3169 |
|
3170 |
#: inc/admin/admin.php:269
|
3171 |
#, php-format
|
3172 |
+
msgid "%%current_pagination%%"
|
|
|
|
|
|
|
|
|
3173 |
msgstr ""
|
3174 |
|
3175 |
#: inc/admin/admin.php:270
|
3176 |
#, php-format
|
3177 |
+
msgid "%%page%%"
|
3178 |
msgstr ""
|
3179 |
|
3180 |
#: inc/admin/admin.php:270
|
3181 |
+
msgid "Current page number with context (i.e. page 1 of 3)"
|
3182 |
msgstr ""
|
3183 |
|
3184 |
#: inc/admin/admin.php:271
|
3185 |
#, php-format
|
3186 |
+
msgid "%%cpt_plural%%"
|
|
|
|
|
|
|
|
|
3187 |
msgstr ""
|
3188 |
|
3189 |
#: inc/admin/admin.php:272
|
3190 |
#, php-format
|
3191 |
+
msgid "%%archive_title%%"
|
|
|
|
|
|
|
|
|
3192 |
msgstr ""
|
3193 |
|
3194 |
#: inc/admin/admin.php:273
|
3195 |
#, php-format
|
3196 |
+
msgid "%%archive_date%%"
|
3197 |
msgstr ""
|
3198 |
|
3199 |
#: inc/admin/admin.php:273
|
3200 |
+
msgid "Date Archive"
|
3201 |
msgstr ""
|
3202 |
|
3203 |
#: inc/admin/admin.php:274
|
3204 |
#, php-format
|
3205 |
+
msgid "%%archive_date_day%%"
|
3206 |
msgstr ""
|
3207 |
|
3208 |
+
#: inc/admin/admin.php:275
|
3209 |
+
#, php-format
|
3210 |
+
msgid "%%archive_date_month%%"
|
3211 |
msgstr ""
|
3212 |
|
3213 |
+
#: inc/admin/admin.php:276
|
3214 |
+
#, php-format
|
3215 |
+
msgid "%%archive_date_year%%"
|
3216 |
+
msgstr ""
|
3217 |
+
|
3218 |
+
#: inc/admin/admin.php:277
|
3219 |
#, php-format
|
3220 |
msgid "%%_cf_your_custom_field_name%%"
|
3221 |
msgstr ""
|
3222 |
|
3223 |
+
#: inc/admin/admin.php:277
|
3224 |
msgid ""
|
3225 |
"Custom fields from post, page or post type (replace <span style=\"color:red;"
|
3226 |
"margin:0\">your_custom_field_name</span> with your custom field name)"
|
3227 |
msgstr ""
|
3228 |
|
3229 |
+
#: inc/admin/admin.php:278
|
3230 |
#, php-format
|
3231 |
msgid "%%_ct_your_custom_taxonomy_slug%%"
|
3232 |
msgstr ""
|
3233 |
|
3234 |
+
#: inc/admin/admin.php:278
|
3235 |
msgid ""
|
3236 |
"Custom term taxonomy from post, page or post type (replace <span style="
|
3237 |
"\"color:red;margin:0\">your_custom_taxonomy_slug</span> with your custom "
|
3238 |
"taxonomy slug)"
|
3239 |
msgstr ""
|
3240 |
|
3241 |
+
#: inc/admin/admin.php:279
|
3242 |
#, php-format
|
3243 |
msgid "%%wc_single_cat%%"
|
3244 |
msgstr ""
|
3245 |
|
3246 |
+
#: inc/admin/admin.php:280
|
|
|
|
|
|
|
|
|
3247 |
#, php-format
|
3248 |
msgid "%%wc_single_tag%%"
|
3249 |
msgstr ""
|
3250 |
|
3251 |
+
#: inc/admin/admin.php:281
|
|
|
|
|
|
|
|
|
3252 |
#, php-format
|
3253 |
msgid "%%wc_single_short_desc%%"
|
3254 |
msgstr ""
|
3255 |
|
3256 |
+
#: inc/admin/admin.php:282
|
|
|
|
|
|
|
|
|
3257 |
#, php-format
|
3258 |
msgid "%%wc_single_price%%"
|
3259 |
msgstr ""
|
3260 |
|
3261 |
+
#: inc/admin/admin.php:283
|
|
|
|
|
|
|
|
|
3262 |
#, php-format
|
3263 |
msgid "%%wc_single_price_exc_tax%%"
|
3264 |
msgstr ""
|
3265 |
|
3266 |
+
#: inc/admin/admin.php:284
|
|
|
|
|
|
|
|
|
3267 |
#, php-format
|
3268 |
msgid "%%wc_sku%%"
|
3269 |
msgstr ""
|
3270 |
|
3271 |
+
#: inc/admin/admin.php:285
|
|
|
|
|
|
|
|
|
3272 |
#, php-format
|
3273 |
msgid "%%currentday%%"
|
3274 |
msgstr ""
|
3275 |
|
3276 |
+
#: inc/admin/admin.php:286
|
|
|
|
|
|
|
|
|
3277 |
#, php-format
|
3278 |
msgid "%%currentmonth%%"
|
3279 |
msgstr ""
|
3280 |
|
3281 |
+
#: inc/admin/admin.php:287
|
|
|
|
|
|
|
|
|
3282 |
#, php-format
|
3283 |
msgid "%%currentmonth_short%%"
|
3284 |
msgstr ""
|
3285 |
|
3286 |
+
#: inc/admin/admin.php:287
|
3287 |
msgid "Current month in 3 letters, eg: \"Jan\" for \"January\""
|
3288 |
msgstr ""
|
3289 |
|
3290 |
+
#: inc/admin/admin.php:288
|
3291 |
#, php-format
|
3292 |
msgid "%%currentyear%%"
|
3293 |
msgstr ""
|
3294 |
|
3295 |
+
#: inc/admin/admin.php:289
|
|
|
|
|
|
|
|
|
3296 |
#, php-format
|
3297 |
msgid "%%currentdate%%"
|
3298 |
msgstr ""
|
3299 |
|
3300 |
+
#: inc/admin/admin.php:290
|
|
|
|
|
|
|
|
|
3301 |
#, php-format
|
3302 |
msgid "%%currenttime%%"
|
3303 |
msgstr ""
|
3304 |
|
3305 |
+
#: inc/admin/admin.php:291
|
|
|
|
|
|
|
|
|
3306 |
#, php-format
|
3307 |
msgid "%%author_bio%%"
|
3308 |
msgstr ""
|
3309 |
|
3310 |
+
#: inc/admin/admin.php:291
|
3311 |
msgid "Author bio, meta desc only"
|
3312 |
msgstr ""
|
3313 |
|
3314 |
+
#: inc/admin/admin.php:292
|
3315 |
#, php-format
|
3316 |
msgid "%%currentmonth_num%%"
|
3317 |
msgstr ""
|
3318 |
|
3319 |
+
#: inc/admin/admin.php:298
|
|
|
|
|
|
|
|
|
3320 |
msgid "Templates variables"
|
3321 |
msgstr ""
|
3322 |
|
3323 |
+
#: inc/admin/admin.php:305 inc/admin/admin.php:313
|
3324 |
msgid "Browse our guides"
|
3325 |
msgstr ""
|
3326 |
|
3327 |
+
#: inc/admin/admin.php:306 inc/admin/admin.php:314
|
3328 |
msgid "Read our FAQ"
|
3329 |
msgstr ""
|
3330 |
|
3331 |
+
#: inc/admin/admin.php:307 inc/admin/admin.php:315
|
3332 |
msgid "Check our website"
|
3333 |
msgstr ""
|
3334 |
|
3335 |
+
#: inc/admin/admin.php:326
|
3336 |
msgid ""
|
3337 |
"Watch our video to learn how to connect your WordPress site with Google "
|
3338 |
"Analytics and get statistics right in your dashboard (PRO only)."
|
3339 |
msgstr ""
|
3340 |
|
3341 |
+
#: inc/admin/admin.php:331
|
3342 |
msgid "How-to"
|
3343 |
msgstr ""
|
3344 |
|
3345 |
+
#: inc/admin/admin.php:378 inc/admin/admin.php:382 inc/admin/admin.php:445
|
3346 |
+
#: inc/admin/admin.php:449 inc/admin/admin.php:510 inc/admin/admin.php:514
|
3347 |
+
#: inc/admin/admin.php:577 inc/admin/admin.php:581 inc/admin/admin.php:664
|
3348 |
+
#: inc/admin/admin.php:668
|
3349 |
msgid "Click to disable this feature"
|
3350 |
msgstr ""
|
3351 |
|
3352 |
+
#: inc/admin/admin.php:379 inc/admin/admin.php:381 inc/admin/admin.php:446
|
3353 |
+
#: inc/admin/admin.php:448 inc/admin/admin.php:511 inc/admin/admin.php:513
|
3354 |
+
#: inc/admin/admin.php:578 inc/admin/admin.php:580 inc/admin/admin.php:665
|
3355 |
+
#: inc/admin/admin.php:667
|
3356 |
msgid "Click to enable this feature"
|
3357 |
msgstr ""
|
3358 |
|
3359 |
+
#: inc/admin/admin.php:396
|
3360 |
msgid "Home"
|
3361 |
msgstr ""
|
3362 |
|
3363 |
+
#: inc/admin/admin.php:397
|
3364 |
msgid "Single Post Types"
|
3365 |
msgstr ""
|
3366 |
|
3367 |
+
#: inc/admin/admin.php:398
|
3368 |
msgid "Archives"
|
3369 |
msgstr ""
|
3370 |
|
3371 |
+
#: inc/admin/admin.php:399 inc/admin/admin.php:465
|
3372 |
msgid "Taxonomies"
|
3373 |
msgstr ""
|
3374 |
|
3375 |
+
#: inc/admin/admin.php:463 inc/admin/admin.php:596 inc/admin/admin.php:607
|
3376 |
msgid "General"
|
3377 |
msgstr ""
|
3378 |
|
3379 |
+
#: inc/admin/admin.php:464
|
3380 |
msgid "Post Types"
|
3381 |
msgstr ""
|
3382 |
|
3383 |
+
#: inc/admin/admin.php:466
|
3384 |
msgid "HTML Sitemap"
|
3385 |
msgstr ""
|
3386 |
|
3387 |
+
#: inc/admin/admin.php:528
|
3388 |
msgid "Knowledge Graph"
|
3389 |
msgstr ""
|
3390 |
|
3391 |
+
#: inc/admin/admin.php:529
|
3392 |
msgid "Your social accounts"
|
3393 |
msgstr ""
|
3394 |
|
3395 |
+
#: inc/admin/admin.php:530
|
3396 |
msgid "Facebook (Open Graph)"
|
3397 |
msgstr ""
|
3398 |
|
3399 |
+
#: inc/admin/admin.php:531
|
3400 |
msgid "Twitter (Twitter card)"
|
3401 |
msgstr ""
|
3402 |
|
3403 |
+
#: inc/admin/admin.php:597 inc/admin/admin.php:608
|
3404 |
msgid "Tracking"
|
3405 |
msgstr ""
|
3406 |
|
3407 |
+
#: inc/admin/admin.php:598
|
3408 |
msgid "Ecommerce"
|
3409 |
msgstr ""
|
3410 |
|
3411 |
+
#: inc/admin/admin.php:599 inc/admin/admin.php:609
|
3412 |
msgid "Events"
|
3413 |
msgstr ""
|
3414 |
|
3415 |
+
#: inc/admin/admin.php:600 inc/admin/admin.php:610
|
3416 |
msgid "Custom Dimensions"
|
3417 |
msgstr ""
|
3418 |
|
3419 |
+
#: inc/admin/admin.php:601
|
3420 |
msgid "Stats in Dashboard"
|
3421 |
msgstr ""
|
3422 |
|
3423 |
+
#: inc/admin/admin.php:602 inc/admin/admin.php:611
|
3424 |
msgid "Cookie bar / GDPR"
|
3425 |
msgstr ""
|
3426 |
|
3427 |
+
#: inc/admin/admin.php:603 inc/admin/admin.php:612
|
3428 |
msgid "Matomo"
|
3429 |
msgstr ""
|
3430 |
|
3431 |
+
#: inc/admin/admin.php:683
|
3432 |
msgid "Appearance"
|
3433 |
msgstr ""
|
3434 |
|
3435 |
+
#: inc/admin/admin.php:684
|
3436 |
msgid "Security"
|
3437 |
msgstr ""
|
3438 |
|
3439 |
+
#: inc/admin/admin.php:718
|
3440 |
msgid "Data"
|
3441 |
msgstr ""
|
3442 |
|
3443 |
+
#: inc/admin/admin.php:719 seopress.php:439
|
3444 |
msgid "Settings"
|
3445 |
msgstr ""
|
3446 |
|
3447 |
+
#: inc/admin/admin.php:720
|
3448 |
msgid "Plugins"
|
3449 |
msgstr ""
|
3450 |
|
3451 |
+
#: inc/admin/admin.php:722
|
3452 |
msgid "Reset"
|
3453 |
msgstr ""
|
3454 |
|
3455 |
+
#: inc/admin/admin.php:740
|
3456 |
msgid "Import data from a CSV"
|
3457 |
msgstr ""
|
3458 |
|
3459 |
+
#: inc/admin/admin.php:741
|
3460 |
msgid ""
|
3461 |
+
"Upload a CSV file to quickly import post (post, page, single post type) and "
|
3462 |
+
"term metadata:"
|
3463 |
msgstr ""
|
3464 |
|
3465 |
+
#: inc/admin/admin.php:750 inc/admin/admin.php:783
|
3466 |
+
msgid "Meta robots (noindex, nofollow...)"
|
3467 |
+
msgstr ""
|
3468 |
+
|
3469 |
+
#: inc/admin/admin.php:753 inc/admin/admin.php:786
|
3470 |
+
msgid "Facebook Open Graph tags (title, description, image)"
|
3471 |
+
msgstr ""
|
3472 |
+
|
3473 |
+
#: inc/admin/admin.php:756 inc/admin/admin.php:789
|
3474 |
+
msgid "Twitter cards tags (title, description, image)"
|
3475 |
+
msgstr ""
|
3476 |
+
|
3477 |
+
#: inc/admin/admin.php:759 inc/admin/admin.php:792
|
3478 |
+
msgid "Redirection (enable, type, URL)"
|
3479 |
+
msgstr ""
|
3480 |
+
|
3481 |
+
#: inc/admin/admin.php:768
|
3482 |
msgid "Run the importer"
|
3483 |
msgstr ""
|
3484 |
|
3485 |
+
#: inc/admin/admin.php:773
|
3486 |
msgid "Export metadata to a CSV"
|
3487 |
msgstr ""
|
3488 |
|
3489 |
+
#: inc/admin/admin.php:774
|
3490 |
+
msgid ""
|
3491 |
+
"Export your post (post, page, single post type) and term metadata for this "
|
3492 |
+
"site as a .csv file."
|
3493 |
msgstr ""
|
3494 |
|
3495 |
+
#: inc/admin/admin.php:805 inc/admin/admin.php:823 inc/admin/admin.php:1158
|
3496 |
+
#: inc/admin/admin.php:1174
|
3497 |
msgid "Export"
|
3498 |
msgstr ""
|
3499 |
|
3500 |
+
#: inc/admin/admin.php:817
|
3501 |
msgid "Export plugin settings"
|
3502 |
msgstr ""
|
3503 |
|
3504 |
+
#: inc/admin/admin.php:818
|
3505 |
msgid ""
|
3506 |
"Export the plugin settings for this site as a .json file. This allows you to "
|
3507 |
"easily import the configuration into another site."
|
3508 |
msgstr ""
|
3509 |
|
3510 |
+
#: inc/admin/admin.php:831
|
3511 |
msgid "Import plugin settings"
|
3512 |
msgstr ""
|
3513 |
|
3514 |
+
#: inc/admin/admin.php:832
|
3515 |
msgid ""
|
3516 |
"Import the plugin settings from a .json file. This file can be obtained by "
|
3517 |
"exporting the settings on another site using the form above."
|
3518 |
msgstr ""
|
3519 |
|
3520 |
+
#: inc/admin/admin.php:840 inc/admin/admin.php:1097 inc/admin/admin.php:1113
|
3521 |
+
#: inc/admin/admin.php:1129 inc/admin/admin.php:1145
|
3522 |
msgid "Import"
|
3523 |
msgstr ""
|
3524 |
|
3525 |
+
#: inc/admin/admin.php:842
|
3526 |
msgid "Import completed!"
|
3527 |
msgstr ""
|
3528 |
|
3529 |
+
#: inc/admin/admin.php:962
|
3530 |
msgid ""
|
3531 |
"<strong>WARNING:</strong> Migration will update/delete all SEOPress posts "
|
3532 |
"metadata. Some dynamic variables will not be interpreted. We do NOT delete "
|
3533 |
"any Squirrly SEO data."
|
3534 |
msgstr ""
|
3535 |
|
3536 |
+
#: inc/admin/admin.php:1052
|
3537 |
msgid "Import your redirections"
|
3538 |
msgstr ""
|
3539 |
|
3540 |
+
#: inc/admin/admin.php:1055
|
3541 |
msgid "CSV file (must match the template)"
|
3542 |
msgstr ""
|
3543 |
|
3544 |
+
#: inc/admin/admin.php:1056
|
3545 |
msgid "Redirections plugin (JSON - WordPress Redirects)"
|
3546 |
msgstr ""
|
3547 |
|
3548 |
+
#: inc/admin/admin.php:1057
|
3549 |
msgid "Yoast Premium plugin (CSV)"
|
3550 |
msgstr ""
|
3551 |
|
3552 |
+
#: inc/admin/admin.php:1058
|
3553 |
msgid "Rank Math plugin (TXT)"
|
3554 |
msgstr ""
|
3555 |
|
3556 |
+
#: inc/admin/admin.php:1064
|
3557 |
msgid "Import Redirections"
|
3558 |
msgstr ""
|
3559 |
|
3560 |
+
#: inc/admin/admin.php:1065
|
3561 |
msgid ""
|
3562 |
"Import your own redirections from a .csv file (separator \";\"). You must "
|
3563 |
"have 6 columns in this order:"
|
3564 |
msgstr ""
|
3565 |
|
3566 |
+
#: inc/admin/admin.php:1067
|
3567 |
msgid "URL to match (without your domain name)"
|
3568 |
msgstr ""
|
3569 |
|
3570 |
+
#: inc/admin/admin.php:1068
|
3571 |
msgid "URL to redirect in absolute,"
|
3572 |
msgstr ""
|
3573 |
|
3574 |
+
#: inc/admin/admin.php:1069
|
3575 |
msgid "type of redirection (301, 302 or 307, 410, 451),"
|
3576 |
msgstr ""
|
3577 |
|
3578 |
+
#: inc/admin/admin.php:1070
|
3579 |
msgid "Yes to enable the redirect (leave it empty to disable the redirect)"
|
3580 |
msgstr ""
|
3581 |
|
3582 |
+
#: inc/admin/admin.php:1071
|
3583 |
msgid ""
|
3584 |
"the query parameter without the quotes (\"exact_match\" = Exact match with "
|
3585 |
"all parameters, \"without_param\" = Exclude all parameters or "
|
3587 |
"redirection),"
|
3588 |
msgstr ""
|
3589 |
|
3590 |
+
#: inc/admin/admin.php:1072
|
3591 |
msgid "and, the last parameter, the counter (optional)."
|
3592 |
msgstr ""
|
3593 |
|
3594 |
+
#: inc/admin/admin.php:1077
|
3595 |
msgid "Download a CSV example"
|
3596 |
msgstr ""
|
3597 |
|
3598 |
+
#: inc/admin/admin.php:1080
|
3599 |
msgid "Duplicate entries will be automatically removed during import."
|
3600 |
msgstr ""
|
3601 |
|
3602 |
+
#: inc/admin/admin.php:1081
|
3603 |
msgid "Select your separator:"
|
3604 |
msgstr ""
|
3605 |
|
3606 |
+
#: inc/admin/admin.php:1085
|
3607 |
msgid "Comma separator: \"<strong>,</strong>\""
|
3608 |
msgstr ""
|
3609 |
|
3610 |
+
#: inc/admin/admin.php:1089
|
3611 |
msgid "Semicolon separator: \"<strong>;</strong>\""
|
3612 |
msgstr ""
|
3613 |
|
3614 |
+
#: inc/admin/admin.php:1104
|
3615 |
msgid "Import Redirections from the Redirections plugin"
|
3616 |
msgstr ""
|
3617 |
|
3618 |
+
#: inc/admin/admin.php:1105
|
3619 |
msgid ""
|
3620 |
"Import your own redirections from a .json file generated by the Redirections "
|
3621 |
"plugin (make sure to select <strong>\"WordPress redirects\"</strong> when "
|
3624 |
"file and existing redirects."
|
3625 |
msgstr ""
|
3626 |
|
3627 |
+
#: inc/admin/admin.php:1120
|
3628 |
msgid "Import Redirections from Yoast Premium"
|
3629 |
msgstr ""
|
3630 |
|
3631 |
+
#: inc/admin/admin.php:1121
|
3632 |
msgid ""
|
3633 |
"Import your own redirections from a .csv file generated by Yoast Premium. "
|
3634 |
"Note that we don't support certain options, like regex. To avoid conflicts, "
|
3635 |
"make sure there are no duplicates between your file and existing redirects."
|
3636 |
msgstr ""
|
3637 |
|
3638 |
+
#: inc/admin/admin.php:1136
|
3639 |
msgid "Import Redirections from Rank Math"
|
3640 |
msgstr ""
|
3641 |
|
3642 |
+
#: inc/admin/admin.php:1137
|
3643 |
msgid ""
|
3644 |
"Import your own redirections from a .txt file generated by Rank Math. Note "
|
3645 |
"that we don't support certain options, like regex. To avoid conflicts, make "
|
3646 |
"sure there are no duplicates between your file and existing redirects."
|
3647 |
msgstr ""
|
3648 |
|
3649 |
+
#: inc/admin/admin.php:1152
|
3650 |
msgid "Export Redirections"
|
3651 |
msgstr ""
|
3652 |
|
3653 |
+
#: inc/admin/admin.php:1153
|
3654 |
msgid ""
|
3655 |
"Export all redirections for this site as a .csv file. This allows you to "
|
3656 |
"easily import the redirections into another site, to Excel / Google Sheets..."
|
3657 |
msgstr ""
|
3658 |
|
3659 |
+
#: inc/admin/admin.php:1165
|
3660 |
msgid "Export Redirections for an .htaccess file"
|
3661 |
msgstr ""
|
3662 |
|
3663 |
+
#: inc/admin/admin.php:1166
|
3664 |
msgid ""
|
3665 |
"Export all redirects from this site to a txt file. Then copy and paste the "
|
3666 |
"formatted URLs into your .htaccess file."
|
3667 |
msgstr ""
|
3668 |
|
3669 |
+
#: inc/admin/admin.php:1167
|
3670 |
msgid "Only active redirections will be exported."
|
3671 |
msgstr ""
|
3672 |
|
3673 |
+
#: inc/admin/admin.php:1168
|
3674 |
msgid ""
|
3675 |
"Save your .htaccess file before editing it. <strong>Safety first!</strong>"
|
3676 |
msgstr ""
|
3677 |
|
3678 |
+
#: inc/admin/admin.php:1169
|
3679 |
msgid "Do not forget to test every redirects!"
|
3680 |
msgstr ""
|
3681 |
|
3682 |
+
#: inc/admin/admin.php:1181
|
3683 |
msgid "Clean your 404"
|
3684 |
msgstr ""
|
3685 |
|
3686 |
+
#: inc/admin/admin.php:1182
|
3687 |
msgid "Delete all your 404 errors. We don‘t delete any redirects."
|
3688 |
msgstr ""
|
3689 |
|
3690 |
+
#: inc/admin/admin.php:1183
|
3691 |
#, php-format
|
3692 |
msgid ""
|
3693 |
"Make sure you have enabled 404 cleaning from SEO, PRO, <a href=\"%s"
|
3694 |
"\">404/301</a> tab to be able to delete all your 404 errors."
|
3695 |
msgstr ""
|
3696 |
|
3697 |
+
#: inc/admin/admin.php:1190
|
3698 |
#, php-format
|
3699 |
msgid ""
|
3700 |
"You can also use <span class=\"dashicons dashicons-external\"></span><a href="
|
3701 |
"\"%s\" target=\"_blank\">this MySQL query</a> if necessary."
|
3702 |
msgstr ""
|
3703 |
|
3704 |
+
#: inc/admin/admin.php:1195
|
3705 |
msgid "Delete all 404"
|
3706 |
msgstr ""
|
3707 |
|
3708 |
+
#: inc/admin/admin.php:1202
|
3709 |
+
msgid "Clean all your redirects and 404 errors"
|
3710 |
+
msgstr ""
|
3711 |
+
|
3712 |
+
#: inc/admin/admin.php:1203
|
3713 |
+
msgid "Delete all your 301, 302, 307, 404, 410 and 451 entries."
|
3714 |
+
msgstr ""
|
3715 |
+
|
3716 |
+
#: inc/admin/admin.php:1204
|
3717 |
+
msgid ""
|
3718 |
+
"<strong>WARNING:</strong> Backup your database before deletion. Safety FIRST!"
|
3719 |
+
msgstr ""
|
3720 |
+
|
3721 |
+
#: inc/admin/admin.php:1209
|
3722 |
+
msgid "Delete"
|
3723 |
+
msgstr ""
|
3724 |
+
|
3725 |
+
#: inc/admin/admin.php:1215
|
3726 |
msgid "Redirections feature is disabled. Please activate it from the PRO page."
|
3727 |
msgstr ""
|
3728 |
|
3729 |
+
#: inc/admin/admin.php:1216
|
3730 |
msgid "Activate Redirections"
|
3731 |
msgstr ""
|
3732 |
|
3733 |
+
#: inc/admin/admin.php:1223
|
3734 |
msgid "Reset All Notices From Notifications Center"
|
3735 |
msgstr ""
|
3736 |
|
3737 |
+
#: inc/admin/admin.php:1224
|
3738 |
msgid ""
|
3739 |
"By clicking Reset Notices, all notices in the notifications center will be "
|
3740 |
"set to their initial status."
|
3741 |
msgstr ""
|
3742 |
|
3743 |
+
#: inc/admin/admin.php:1229
|
3744 |
msgid "Reset notices"
|
3745 |
msgstr ""
|
3746 |
|
3747 |
+
#: inc/admin/admin.php:1237
|
3748 |
msgid "Reset All Settings"
|
3749 |
msgstr ""
|
3750 |
|
3751 |
+
#: inc/admin/admin.php:1238
|
3752 |
msgid ""
|
3753 |
+
"<strong>WARNING:</strong> Delete all options related to this plugin in your "
|
3754 |
"database AND set settings to their default values."
|
3755 |
msgstr ""
|
3756 |
|
3757 |
+
#: inc/admin/admin.php:1243
|
3758 |
msgid "Reset settings"
|
3759 |
msgstr ""
|
3760 |
|
3761 |
+
#: inc/admin/admin.php:1582 inc/admin/admin.php:4024
|
3762 |
msgid "noindex"
|
3763 |
msgstr ""
|
3764 |
|
3765 |
+
#: inc/admin/admin.php:1590 inc/admin/admin.php:4045
|
3766 |
msgid "nofollow"
|
3767 |
msgstr ""
|
3768 |
|
3769 |
+
#: inc/admin/admin.php:1598 inc/admin/admin.php:4064
|
3770 |
msgid "noodp"
|
3771 |
msgstr ""
|
3772 |
|
3773 |
+
#: inc/admin/admin.php:1606 inc/admin/admin.php:4083
|
3774 |
msgid "noimageindex"
|
3775 |
msgstr ""
|
3776 |
|
3777 |
+
#: inc/admin/admin.php:1614 inc/admin/admin.php:4102
|
3778 |
msgid "noarchive"
|
3779 |
msgstr ""
|
3780 |
|
3781 |
+
#: inc/admin/admin.php:1622 inc/admin/admin.php:4121
|
3782 |
msgid "nosnippet"
|
3783 |
msgstr ""
|
3784 |
|
3785 |
+
#: inc/admin/admin.php:1630 inc/admin/admin.php:4140
|
3786 |
msgid "nositelinkssearchbox"
|
3787 |
msgstr ""
|
3788 |
|
3789 |
+
#: inc/admin/admin.php:1638
|
3790 |
msgid "Indicate paginated content to Google"
|
3791 |
msgstr ""
|
3792 |
|
3793 |
+
#: inc/admin/admin.php:1646
|
3794 |
msgid "noindex on paged archives"
|
3795 |
msgstr ""
|
3796 |
|
3797 |
+
#: inc/admin/admin.php:1663 inc/admin/admin.php:4195
|
3798 |
msgid "Enable XML Sitemap"
|
3799 |
msgstr ""
|
3800 |
|
3801 |
+
#: inc/admin/admin.php:1671
|
3802 |
msgid "Enable XML Image Sitemaps"
|
3803 |
msgstr ""
|
3804 |
|
3805 |
+
#: inc/admin/admin.php:1680
|
3806 |
msgid "Enable XML Video Sitemaps"
|
3807 |
msgstr ""
|
3808 |
|
3809 |
+
#: inc/admin/admin.php:1689 inc/admin/admin.php:4276
|
3810 |
msgid "Enable Author Sitemap"
|
3811 |
msgstr ""
|
3812 |
|
3813 |
+
#: inc/admin/admin.php:1697 inc/admin/admin.php:4295
|
3814 |
msgid "Enable HTML Sitemap"
|
3815 |
msgstr ""
|
3816 |
|
3817 |
+
#: inc/admin/admin.php:1713
|
3818 |
msgid "Check to INCLUDE Post Types"
|
3819 |
msgstr ""
|
3820 |
|
3821 |
+
#: inc/admin/admin.php:1729
|
3822 |
msgid "Check to INCLUDE Taxonomies"
|
3823 |
msgstr ""
|
3824 |
|
3825 |
+
#: inc/admin/admin.php:1745 inc/admin/admin.php:4402
|
3826 |
msgid "Enter a post, page or custom post type ID(s) to display the sitemap"
|
3827 |
msgstr ""
|
3828 |
|
3829 |
+
#: inc/admin/admin.php:1753 inc/admin/admin.php:4416
|
3830 |
msgid "Exclude some Posts, Pages, Custom Post Types or Terms IDs"
|
3831 |
msgstr ""
|
3832 |
|
3833 |
+
#: inc/admin/admin.php:1761
|
3834 |
msgid "Sort order"
|
3835 |
msgstr ""
|
3836 |
|
3837 |
+
#: inc/admin/admin.php:1769
|
3838 |
msgid "Order posts by"
|
3839 |
msgstr ""
|
3840 |
|
3841 |
+
#: inc/admin/admin.php:1777
|
3842 |
msgid "Disable the display of the publication date"
|
3843 |
msgstr ""
|
3844 |
|
3845 |
+
#: inc/admin/admin.php:1818 inc/admin/admin.php:4558
|
3846 |
msgid "Organization's phone number (only for Organizations)"
|
3847 |
msgstr ""
|
3848 |
|
3849 |
+
#: inc/admin/admin.php:1826
|
3850 |
msgid "Contact type (only for Organizations)"
|
3851 |
msgstr ""
|
3852 |
|
3853 |
+
#: inc/admin/admin.php:1834
|
3854 |
msgid "Contact option (only for Organizations)"
|
3855 |
msgstr ""
|
3856 |
|
3857 |
+
#: inc/admin/admin.php:1851 inc/admin/admin.php:4636
|
3858 |
msgid "Facebook Page URL"
|
3859 |
msgstr ""
|
3860 |
|
3861 |
+
#: inc/admin/admin.php:1932
|
3862 |
msgid "Enable Open Graph Data"
|
3863 |
msgstr ""
|
3864 |
|
3865 |
+
#: inc/admin/admin.php:1940 inc/admin/admin.php:4763 inc/admin/admin.php:4812
|
3866 |
msgid "Select a default image"
|
3867 |
msgstr ""
|
3868 |
|
3869 |
+
#: inc/admin/admin.php:1948
|
3870 |
msgid "Apply this image to all your og:image tag"
|
3871 |
msgstr ""
|
3872 |
|
3873 |
+
#: inc/admin/admin.php:1956
|
3874 |
msgid "Define custom og:image tag for post type archive pages"
|
3875 |
msgstr ""
|
3876 |
|
3877 |
+
#: inc/admin/admin.php:1964
|
3878 |
msgid "Facebook Link Ownership ID"
|
3879 |
msgstr ""
|
3880 |
|
3881 |
+
#: inc/admin/admin.php:1972
|
3882 |
msgid "Facebook Admin ID"
|
3883 |
msgstr ""
|
3884 |
|
3885 |
+
#: inc/admin/admin.php:1980
|
3886 |
msgid "Facebook App ID"
|
3887 |
msgstr ""
|
3888 |
|
3889 |
+
#: inc/admin/admin.php:1997
|
3890 |
msgid "Enable Twitter Card"
|
3891 |
msgstr ""
|
3892 |
|
3893 |
+
#: inc/admin/admin.php:2005
|
3894 |
msgid "Use Open Graph if no Twitter Card is filled"
|
3895 |
msgstr ""
|
3896 |
|
3897 |
+
#: inc/admin/admin.php:2013 inc/admin/admin.php:4909
|
3898 |
msgid "Default Twitter Image"
|
3899 |
msgstr ""
|
3900 |
|
3901 |
+
#: inc/admin/admin.php:2021
|
3902 |
msgid "Image size for Twitter Summary card"
|
3903 |
msgstr ""
|
3904 |
|
3905 |
+
#: inc/admin/admin.php:2038
|
3906 |
msgid "Enable Google Analytics tracking"
|
3907 |
msgstr ""
|
3908 |
|
3909 |
+
#: inc/admin/admin.php:2046 inc/admin/admin.php:2446 inc/admin/admin.php:4962
|
3910 |
msgid "Enter your tracking ID"
|
3911 |
msgstr ""
|
3912 |
|
3913 |
+
#: inc/admin/admin.php:2054
|
3914 |
msgid "Exclude user roles from tracking (Google Analytics and Matomo)"
|
3915 |
msgstr ""
|
3916 |
|
3917 |
+
#: inc/admin/admin.php:2071
|
3918 |
msgid "Analytics tracking opt-in"
|
3919 |
msgstr ""
|
3920 |
|
3921 |
+
#: inc/admin/admin.php:2087
|
3922 |
msgid "Consent message for user tracking"
|
3923 |
msgstr ""
|
3924 |
|
3925 |
+
#: inc/admin/admin.php:2095
|
3926 |
msgid "Accept button for user tracking"
|
3927 |
msgstr ""
|
3928 |
|
3929 |
+
#: inc/admin/admin.php:2103
|
3930 |
msgid "Close button"
|
3931 |
msgstr ""
|
3932 |
|
3933 |
+
#: inc/admin/admin.php:2111
|
3934 |
+
msgid "User consent cookie expiration date"
|
3935 |
+
msgstr ""
|
3936 |
+
|
3937 |
+
#: inc/admin/admin.php:2119
|
3938 |
msgid "Cookie bar position"
|
3939 |
msgstr ""
|
3940 |
|
3941 |
+
#: inc/admin/admin.php:2127
|
3942 |
+
msgid "Cookie bar width"
|
3943 |
+
msgstr ""
|
3944 |
+
|
3945 |
+
#: inc/admin/admin.php:2135
|
3946 |
+
msgid "Enable backdrop"
|
3947 |
+
msgstr ""
|
3948 |
+
|
3949 |
+
#: inc/admin/admin.php:2143
|
3950 |
+
msgid "Backdrop background color"
|
3951 |
+
msgstr ""
|
3952 |
+
|
3953 |
+
#: inc/admin/admin.php:2151
|
3954 |
msgid "Cookie bar background color"
|
3955 |
msgstr ""
|
3956 |
|
3957 |
+
#: inc/admin/admin.php:2159
|
3958 |
msgid "Cookie bar text color"
|
3959 |
msgstr ""
|
3960 |
|
3961 |
+
#: inc/admin/admin.php:2167
|
3962 |
msgid "Cookie bar link color"
|
3963 |
msgstr ""
|
3964 |
|
3965 |
+
#: inc/admin/admin.php:2175
|
3966 |
msgid "Cookie bar button background color"
|
3967 |
msgstr ""
|
3968 |
|
3969 |
+
#: inc/admin/admin.php:2183
|
3970 |
msgid "Cookie bar button color"
|
3971 |
msgstr ""
|
3972 |
|
3973 |
+
#: inc/admin/admin.php:2191
|
3974 |
msgid "Cookie bar button hover background color"
|
3975 |
msgstr ""
|
3976 |
|
3977 |
+
#: inc/admin/admin.php:2199
|
3978 |
msgid "Cookie bar button hover color"
|
3979 |
msgstr ""
|
3980 |
|
3981 |
+
#: inc/admin/admin.php:2207
|
3982 |
msgid "Cookie bar secondary button background color"
|
3983 |
msgstr ""
|
3984 |
|
3985 |
+
#: inc/admin/admin.php:2215
|
3986 |
msgid "Cookie bar secondary button color"
|
3987 |
msgstr ""
|
3988 |
|
3989 |
+
#: inc/admin/admin.php:2223
|
3990 |
msgid "Cookie bar secondary button hover background color"
|
3991 |
msgstr ""
|
3992 |
|
3993 |
+
#: inc/admin/admin.php:2231
|
3994 |
msgid "Cookie bar secondary button hover color"
|
3995 |
msgstr ""
|
3996 |
|
3997 |
+
#: inc/admin/admin.php:2249
|
3998 |
msgid "Enable Google Optimize"
|
3999 |
msgstr ""
|
4000 |
|
4001 |
+
#: inc/admin/admin.php:2257
|
4002 |
msgid "Enable Google Ads"
|
4003 |
msgstr ""
|
4004 |
|
4005 |
+
#: inc/admin/admin.php:2265
|
4006 |
msgid "Add an additional tracking code (like Facebook Pixel, Hotjar...)"
|
4007 |
msgstr ""
|
4008 |
|
4009 |
+
#: inc/admin/admin.php:2273
|
4010 |
msgid "[BODY] Add an additional tracking code (like Google Tag Manager...)"
|
4011 |
msgstr ""
|
4012 |
|
4013 |
+
#: inc/admin/admin.php:2281
|
4014 |
msgid ""
|
4015 |
"[BODY (FOOTER)] Add an additional tracking code (like Google Tag Manager...)"
|
4016 |
msgstr ""
|
4017 |
|
4018 |
+
#: inc/admin/admin.php:2289 inc/admin/admin.php:5345
|
4019 |
msgid "Enable remarketing, demographics, and interests reporting"
|
4020 |
msgstr ""
|
4021 |
|
4022 |
+
#: inc/admin/admin.php:2297 inc/admin/admin.php:5367
|
4023 |
msgid "Enable IP Anonymization"
|
4024 |
msgstr ""
|
4025 |
|
4026 |
+
#: inc/admin/admin.php:2305 inc/admin/admin.php:5389
|
4027 |
msgid "Enhanced Link Attribution"
|
4028 |
msgstr ""
|
4029 |
|
4030 |
+
#: inc/admin/admin.php:2313 inc/admin/admin.php:5411
|
4031 |
msgid "Enable cross-domain tracking"
|
4032 |
msgstr ""
|
4033 |
|
4034 |
+
#: inc/admin/admin.php:2321 inc/admin/admin.php:5428 inc/admin/admin.php:5753
|
4035 |
msgid "Cross domains"
|
4036 |
msgstr ""
|
4037 |
|
4038 |
+
#: inc/admin/admin.php:2339 inc/admin/admin.php:5445
|
4039 |
msgid "Enable external links tracking"
|
4040 |
msgstr ""
|
4041 |
|
4042 |
+
#: inc/admin/admin.php:2347
|
4043 |
msgid "Enable downloads tracking (eg: PDF, XLSX, DOCX...)"
|
4044 |
msgstr ""
|
4045 |
|
4046 |
+
#: inc/admin/admin.php:2355 inc/admin/admin.php:5474
|
4047 |
msgid "Track downloads' clicks"
|
4048 |
msgstr ""
|
4049 |
|
4050 |
+
#: inc/admin/admin.php:2363
|
4051 |
msgid "Enable affiliate/outbound links tracking (eg: aff, go, out, recommends)"
|
4052 |
msgstr ""
|
4053 |
|
4054 |
+
#: inc/admin/admin.php:2371 inc/admin/admin.php:5505
|
4055 |
msgid "Track affiliate/outbound links"
|
4056 |
msgstr ""
|
4057 |
|
4058 |
+
#: inc/admin/admin.php:2389
|
4059 |
msgid "Track Authors"
|
4060 |
msgstr ""
|
4061 |
|
4062 |
+
#: inc/admin/admin.php:2397
|
4063 |
msgid "Track Categories"
|
4064 |
msgstr ""
|
4065 |
|
4066 |
+
#: inc/admin/admin.php:2405
|
4067 |
msgid "Track Tags"
|
4068 |
msgstr ""
|
4069 |
|
4070 |
+
#: inc/admin/admin.php:2413
|
4071 |
msgid "Track Post Types"
|
4072 |
msgstr ""
|
4073 |
|
4074 |
+
#: inc/admin/admin.php:2421
|
4075 |
msgid "Track Logged In Users"
|
4076 |
msgstr ""
|
4077 |
|
4078 |
+
#: inc/admin/admin.php:2438
|
4079 |
msgid "Enable Matomo tracking"
|
4080 |
msgstr ""
|
4081 |
|
4082 |
+
#: inc/admin/admin.php:2454
|
4083 |
msgid "Enter your site ID"
|
4084 |
msgstr ""
|
4085 |
|
4086 |
+
#: inc/admin/admin.php:2462
|
4087 |
msgid "Track visitors across all subdomains"
|
4088 |
msgstr ""
|
4089 |
|
4090 |
+
#: inc/admin/admin.php:2470
|
4091 |
msgid "Prepend the site domain"
|
4092 |
msgstr ""
|
4093 |
|
4094 |
+
#: inc/admin/admin.php:2478 inc/admin/admin.php:5722
|
4095 |
msgid "Track users with JavaScript disabled"
|
4096 |
msgstr ""
|
4097 |
|
4098 |
+
#: inc/admin/admin.php:2486 inc/admin/admin.php:5739
|
4099 |
msgid "Enables cross domain linking"
|
4100 |
msgstr ""
|
4101 |
|
4102 |
+
#: inc/admin/admin.php:2494
|
4103 |
msgid "Cross domain"
|
4104 |
msgstr ""
|
4105 |
|
4106 |
+
#: inc/admin/admin.php:2501
|
4107 |
msgid "Enable DoNotTrack detection"
|
4108 |
msgstr ""
|
4109 |
|
4110 |
+
#: inc/admin/admin.php:2509
|
4111 |
msgid "Disable all tracking cookies"
|
4112 |
msgstr ""
|
4113 |
|
4114 |
+
#: inc/admin/admin.php:2517
|
4115 |
msgid "Download & Outlink tracking"
|
4116 |
msgstr ""
|
4117 |
|
4118 |
+
#: inc/admin/admin.php:2534
|
4119 |
msgid "Redirect attachment pages to post parent"
|
4120 |
msgstr ""
|
4121 |
|
4122 |
+
#: inc/admin/admin.php:2542
|
4123 |
msgid "Redirect attachment pages to their file URL"
|
4124 |
msgstr ""
|
4125 |
|
4126 |
+
#: inc/admin/admin.php:2550
|
4127 |
msgid "Remove ?replytocom link to avoid duplicate content"
|
4128 |
msgstr ""
|
4129 |
|
4130 |
+
#: inc/admin/admin.php:2558
|
4131 |
msgid "Automatically set the image Title"
|
4132 |
msgstr ""
|
4133 |
|
4134 |
+
#: inc/admin/admin.php:2566
|
4135 |
msgid "Automatically set the image Alt text"
|
4136 |
msgstr ""
|
4137 |
|
4138 |
+
#: inc/admin/admin.php:2574
|
4139 |
msgid "Automatically set the image Alt text from target keywords"
|
4140 |
msgstr ""
|
4141 |
|
4142 |
+
#: inc/admin/admin.php:2582
|
4143 |
msgid "Automatically set the image Caption"
|
4144 |
msgstr ""
|
4145 |
|
4146 |
+
#: inc/admin/admin.php:2590
|
4147 |
msgid "Automatically set the image Description"
|
4148 |
msgstr ""
|
4149 |
|
4150 |
+
#: inc/admin/admin.php:2598
|
4151 |
msgid "Add WP Editor to taxonomy description textarea"
|
4152 |
msgstr ""
|
4153 |
|
4154 |
+
#: inc/admin/admin.php:2606
|
4155 |
msgid "Remove /category/ in URL"
|
4156 |
msgstr ""
|
4157 |
|
4158 |
+
#: inc/admin/admin.php:2614 inc/admin/admin.php:6007
|
4159 |
msgid "Disable trailing slash for metas"
|
4160 |
msgstr ""
|
4161 |
|
4162 |
+
#: inc/admin/admin.php:2622
|
4163 |
msgid "Remove WordPress generator meta tag"
|
4164 |
msgstr ""
|
4165 |
|
4166 |
+
#: inc/admin/admin.php:2630
|
4167 |
msgid "Remove hentry post class"
|
4168 |
msgstr ""
|
4169 |
|
4170 |
+
#: inc/admin/admin.php:2638
|
4171 |
msgid "Remove author URL"
|
4172 |
msgstr ""
|
4173 |
|
4174 |
+
#: inc/admin/admin.php:2646
|
4175 |
msgid "Remove website field in comment form"
|
4176 |
msgstr ""
|
4177 |
|
4178 |
+
#: inc/admin/admin.php:2654
|
4179 |
msgid "Remove WordPress shortlink meta tag"
|
4180 |
msgstr ""
|
4181 |
|
4182 |
+
#: inc/admin/admin.php:2662
|
4183 |
msgid "Remove Windows Live Writer meta tag"
|
4184 |
msgstr ""
|
4185 |
|
4186 |
+
#: inc/admin/admin.php:2670
|
4187 |
msgid "Remove RSD meta tag"
|
4188 |
msgstr ""
|
4189 |
|
4190 |
+
#: inc/admin/admin.php:2678 inc/admin/admin.php:6138
|
4191 |
msgid "Google site verification"
|
4192 |
msgstr ""
|
4193 |
|
4194 |
+
#: inc/admin/admin.php:2686 inc/admin/admin.php:6152
|
4195 |
msgid "Bing site verification"
|
4196 |
msgstr ""
|
4197 |
|
4198 |
+
#: inc/admin/admin.php:2694 inc/admin/admin.php:6165
|
4199 |
msgid "Pinterest site verification"
|
4200 |
msgstr ""
|
4201 |
|
4202 |
+
#: inc/admin/admin.php:2702 inc/admin/admin.php:6177
|
4203 |
msgid "Yandex site verification"
|
4204 |
msgstr ""
|
4205 |
|
4206 |
+
#: inc/admin/admin.php:2719
|
4207 |
+
msgid "SEO in admin bar"
|
4208 |
+
msgstr ""
|
4209 |
+
|
4210 |
+
#: inc/admin/admin.php:2727
|
4211 |
+
msgid "Noindex in admin bar"
|
4212 |
msgstr ""
|
4213 |
|
4214 |
+
#: inc/admin/admin.php:2735
|
4215 |
+
msgid "Move SEO metabox's position"
|
4216 |
msgstr ""
|
4217 |
|
4218 |
+
#: inc/admin/admin.php:2743
|
4219 |
msgid "Set default tab for Structured data metabox"
|
4220 |
msgstr ""
|
4221 |
|
4222 |
+
#: inc/admin/admin.php:2751
|
4223 |
msgid "Hide Notifications Center"
|
4224 |
msgstr ""
|
4225 |
|
4226 |
+
#: inc/admin/admin.php:2759
|
4227 |
msgid "Hide SEO tools"
|
4228 |
msgstr ""
|
4229 |
|
4230 |
+
#: inc/admin/admin.php:2767
|
4231 |
msgid "Hide Useful Links"
|
4232 |
msgstr ""
|
4233 |
|
4234 |
+
#: inc/admin/admin.php:2775
|
4235 |
msgid "Show Title tag column in post types"
|
4236 |
msgstr ""
|
4237 |
|
4238 |
+
#: inc/admin/admin.php:2783
|
4239 |
msgid "Show Meta description column in post types"
|
4240 |
msgstr ""
|
4241 |
|
4242 |
+
#: inc/admin/admin.php:2791
|
4243 |
msgid "Show Redirection Enable column in post types"
|
4244 |
msgstr ""
|
4245 |
|
4246 |
+
#: inc/admin/admin.php:2799
|
4247 |
msgid "Show Redirect URL column in post types"
|
4248 |
msgstr ""
|
4249 |
|
4250 |
+
#: inc/admin/admin.php:2807
|
4251 |
msgid "Show canonical URL column in post types"
|
4252 |
msgstr ""
|
4253 |
|
4254 |
+
#: inc/admin/admin.php:2815
|
4255 |
msgid "Show Target Keyword column in post types"
|
4256 |
msgstr ""
|
4257 |
|
4258 |
+
#: inc/admin/admin.php:2823
|
4259 |
msgid "Show noindex column in post types"
|
4260 |
msgstr ""
|
4261 |
|
4262 |
+
#: inc/admin/admin.php:2831
|
4263 |
msgid "Show nofollow column in post types"
|
4264 |
msgstr ""
|
4265 |
|
4266 |
+
#: inc/admin/admin.php:2839
|
4267 |
msgid "Show total number of words column in post types"
|
4268 |
msgstr ""
|
4269 |
|
4270 |
+
#: inc/admin/admin.php:2847
|
4271 |
msgid "Show W3C validator column in post types"
|
4272 |
msgstr ""
|
4273 |
|
4274 |
+
#: inc/admin/admin.php:2855
|
4275 |
msgid "Show Google Page Speed column in post types"
|
4276 |
msgstr ""
|
4277 |
|
4278 |
+
#: inc/admin/admin.php:2865
|
4279 |
msgid "Show Insights column in post types"
|
4280 |
msgstr ""
|
4281 |
|
4282 |
+
#: inc/admin/admin.php:2874
|
4283 |
msgid "Show content analysis score column in post types"
|
4284 |
msgstr ""
|
4285 |
|
4286 |
+
#: inc/admin/admin.php:2882
|
4287 |
msgid "Hide Genesis SEO Metabox"
|
4288 |
msgstr ""
|
4289 |
|
4290 |
+
#: inc/admin/admin.php:2890
|
4291 |
msgid "Hide Genesis SEO Settings link"
|
4292 |
msgstr ""
|
4293 |
|
4294 |
+
#: inc/admin/admin.php:2898
|
4295 |
msgid "Hide advice in Structured Data Types metabox"
|
4296 |
msgstr ""
|
4297 |
|
4298 |
+
#: inc/admin/admin.php:2915
|
4299 |
msgid "Block SEO metabox to user roles"
|
4300 |
msgstr ""
|
4301 |
|
4302 |
+
#: inc/admin/admin.php:2923
|
4303 |
msgid "Block Content analysis metabox to user roles"
|
4304 |
msgstr ""
|
4305 |
|
4306 |
+
#: inc/admin/admin.php:3037
|
4307 |
msgid "<p>Customize your title & meta description for homepage</p>"
|
4308 |
msgstr ""
|
4309 |
|
4310 |
+
#: inc/admin/admin.php:3050
|
4311 |
msgid "<p>Customize your titles & metas for Single Custom Post Types</p>"
|
4312 |
msgstr ""
|
4313 |
|
4314 |
+
#: inc/admin/admin.php:3054
|
4315 |
msgid "<p>Customize your metas for all pages</p>"
|
4316 |
msgstr ""
|
4317 |
|
4318 |
+
#: inc/admin/admin.php:3058
|
4319 |
msgid "<p>Customize your metas for all taxonomies archives</p>"
|
4320 |
msgstr ""
|
4321 |
|
4322 |
+
#: inc/admin/admin.php:3062
|
4323 |
msgid "<p>Customize your metas for all archives</p>"
|
4324 |
msgstr ""
|
4325 |
|
4326 |
+
#: inc/admin/admin.php:3069
|
4327 |
msgid "Change this settings"
|
4328 |
msgstr ""
|
4329 |
|
4330 |
+
#: inc/admin/admin.php:3072
|
4331 |
msgid ""
|
4332 |
"To view your sitemap, enable permalinks (not default one), and save settings "
|
4333 |
"to flush them."
|
4334 |
msgstr ""
|
4335 |
|
4336 |
+
#: inc/admin/admin.php:3078
|
4337 |
msgid ""
|
4338 |
"Your server uses NGINX. If XML Sitemaps doesn't work properly, you need to "
|
4339 |
"add this rule to your configuration:"
|
4340 |
msgstr ""
|
4341 |
|
4342 |
+
#: inc/admin/admin.php:3092
|
4343 |
msgid "Noindex content will not be displayed in Sitemaps."
|
4344 |
msgstr ""
|
4345 |
|
4346 |
+
#: inc/admin/admin.php:3093
|
4347 |
msgid ""
|
4348 |
"If you disable globally this feature (using the blue toggle from above), the "
|
4349 |
"native WordPress XML sitemaps will be re-activated."
|
4350 |
msgstr ""
|
4351 |
|
4352 |
+
#: inc/admin/admin.php:3105
|
4353 |
msgid "Blank sitemap?"
|
4354 |
msgstr ""
|
4355 |
|
4356 |
+
#: inc/admin/admin.php:3106
|
4357 |
msgid "404 error?"
|
4358 |
msgstr ""
|
4359 |
|
4360 |
+
#: inc/admin/admin.php:3107
|
4361 |
msgid "HTML error? Exclude XML and XSL from caching plugins!"
|
4362 |
msgstr ""
|
4363 |
|
4364 |
+
#: inc/admin/admin.php:3109
|
4365 |
msgid "View your sitemap"
|
4366 |
msgstr ""
|
4367 |
|
4368 |
+
#: inc/admin/admin.php:3111
|
4369 |
msgid "Ping Google manually"
|
4370 |
msgstr ""
|
4371 |
|
4372 |
+
#: inc/admin/admin.php:3113
|
4373 |
msgid "Flush permalinks"
|
4374 |
msgstr ""
|
4375 |
|
4376 |
+
#: inc/admin/admin.php:3118
|
4377 |
msgid "<p>Create an HTML Sitemap for your visitors and boost your SEO.</p>"
|
4378 |
msgstr ""
|
4379 |
|
4380 |
+
#: inc/admin/admin.php:3119
|
4381 |
msgid ""
|
4382 |
"<p>Limited to 1,000 posts per post type. You can change the order and "
|
4383 |
"sorting criteria below.</p>"
|
4384 |
msgstr ""
|
4385 |
|
4386 |
+
#: inc/admin/admin.php:3127 inc/admin/admin.php:4303
|
4387 |
msgid "Guide to enable a HTML Sitemap - new window"
|
4388 |
msgstr ""
|
4389 |
|
4390 |
+
#: inc/admin/admin.php:3131
|
4391 |
msgid "<p>Include/Exclude Post Types.</p>"
|
4392 |
msgstr ""
|
4393 |
|
4394 |
+
#: inc/admin/admin.php:3135
|
4395 |
msgid "<p>Include/Exclude Taxonomies.</p>"
|
4396 |
msgstr ""
|
4397 |
|
4398 |
+
#: inc/admin/admin.php:3139
|
4399 |
msgid "<p>Configure Google Knowledge Graph.</p>"
|
4400 |
msgstr ""
|
4401 |
|
4402 |
+
#: inc/admin/admin.php:3140
|
4403 |
msgid "Learn more on Google official website."
|
4404 |
msgstr ""
|
4405 |
|
4406 |
+
#: inc/admin/admin.php:3144
|
4407 |
msgid ""
|
4408 |
"<p>Link your site with your social accounts. Use markup on your website to "
|
4409 |
"add your social profile information to a Google Knowledge panel. Knowledge "
|
4413 |
"network links.</p>"
|
4414 |
msgstr ""
|
4415 |
|
4416 |
+
#: inc/admin/admin.php:3148
|
4417 |
msgid "<p>Manage Open Graph data.</p>"
|
4418 |
msgstr ""
|
4419 |
|
4420 |
+
#: inc/admin/admin.php:3150
|
4421 |
msgid "<p>We generate the <strong>og:image</strong> meta in this order:</p>"
|
4422 |
msgstr ""
|
4423 |
|
4424 |
+
#: inc/admin/admin.php:3154
|
4425 |
msgid "Custom OG Image from SEO metabox"
|
4426 |
msgstr ""
|
4427 |
|
4428 |
+
#: inc/admin/admin.php:3155 inc/admin/admin.php:3169
|
4429 |
msgid "Post thumbnail"
|
4430 |
msgstr ""
|
4431 |
|
4432 |
+
#: inc/admin/admin.php:3156 inc/admin/admin.php:3170
|
4433 |
msgid "First image of your post content"
|
4434 |
msgstr ""
|
4435 |
|
4436 |
+
#: inc/admin/admin.php:3157
|
4437 |
msgid "Global OG Image set in SEO > Social > Open Graph"
|
4438 |
msgstr ""
|
4439 |
|
4440 |
+
#: inc/admin/admin.php:3162
|
4441 |
msgid "<p>Manage your Twitter card.</p>"
|
4442 |
msgstr ""
|
4443 |
|
4444 |
+
#: inc/admin/admin.php:3164
|
4445 |
msgid ""
|
4446 |
"<p>We generate the <strong>twitter:image</strong> meta in this order:</p>"
|
4447 |
msgstr ""
|
4448 |
|
4449 |
+
#: inc/admin/admin.php:3168
|
4450 |
msgid "Custom Twitter image from SEO metabox"
|
4451 |
msgstr ""
|
4452 |
|
4453 |
+
#: inc/admin/admin.php:3171
|
4454 |
msgid "Global Twitter:image set in SEO > Social > Twitter Card"
|
4455 |
msgstr ""
|
4456 |
|
4457 |
+
#: inc/admin/admin.php:3176
|
4458 |
msgid ""
|
4459 |
"<p>Link your Google Analytics to your website. The tracking code will be "
|
4460 |
"automatically added to your site.</p>"
|
4461 |
msgstr ""
|
4462 |
|
4463 |
+
#: inc/admin/admin.php:3180
|
4464 |
msgid ""
|
4465 |
"<p>Manage user consent for GDPR and customize your cookie bar easily.</p>"
|
4466 |
msgstr ""
|
4467 |
|
4468 |
+
#: inc/admin/admin.php:3181
|
4469 |
msgid ""
|
4470 |
"Works with <strong>Google Analytics</strong> and <strong>Matomo</strong>."
|
4471 |
msgstr ""
|
4472 |
|
4473 |
+
#: inc/admin/admin.php:3185
|
4474 |
msgid "<p>Configure your Google Analytics tracking code.</p>"
|
4475 |
msgstr ""
|
4476 |
|
4477 |
+
#: inc/admin/admin.php:3189
|
4478 |
msgid "<p>Track events in Google Analytics.</p>"
|
4479 |
msgstr ""
|
4480 |
|
4481 |
+
#: inc/admin/admin.php:3193
|
4482 |
msgid ""
|
4483 |
"<p>Configure your Google Analytics custom dimensions. <br>Custom dimensions "
|
4484 |
+
"and custom metrics are like the default dimensions and metrics in your "
|
4485 |
+
"Analytics account, except you create them yourself.<br> Use them to collect "
|
4486 |
+
"and analyze data that Analytics doesn't automatically track.<br> Please note "
|
4487 |
+
"that you also have to setup your custom dimensions in your Google Analytics "
|
4488 |
+
"account. More info by clicking on the help icon."
|
4489 |
msgstr ""
|
4490 |
|
4491 |
+
#: inc/admin/admin.php:3195
|
4492 |
msgid "Custom dimensions also work with <strong>Matomo</strong> tracking code."
|
4493 |
msgstr ""
|
4494 |
|
4495 |
+
#: inc/admin/admin.php:3203
|
4496 |
msgid "Guide to create custom dimensions in Google Analytics - new window"
|
4497 |
msgstr ""
|
4498 |
|
4499 |
+
#: inc/admin/admin.php:3207
|
4500 |
msgid "<p>Use Matomo to track your users with privacy in mind.</p>"
|
4501 |
msgstr ""
|
4502 |
|
4503 |
+
#: inc/admin/admin.php:3209
|
4504 |
msgid ""
|
4505 |
"Your <strong>Custom Dimensions</strong> will also work with Matomo tracking "
|
4506 |
"code"
|
4507 |
msgstr ""
|
4508 |
|
4509 |
+
#: inc/admin/admin.php:3213
|
4510 |
msgid "<p>Advanced SEO options.</p>"
|
4511 |
msgstr ""
|
4512 |
|
4513 |
+
#: inc/admin/admin.php:3217
|
4514 |
+
msgid "<p>Customize the plugin to fit your needs.</p>"
|
4515 |
msgstr ""
|
4516 |
|
4517 |
+
#: inc/admin/admin.php:3221
|
4518 |
msgid "<p>Manage security.</p>"
|
4519 |
msgstr ""
|
4520 |
|
4521 |
+
#: inc/admin/admin.php:3234
|
4522 |
msgid "Enter your separator, eg: \"-\""
|
4523 |
msgstr ""
|
4524 |
|
4525 |
+
#: inc/admin/admin.php:3238
|
4526 |
#, php-format
|
4527 |
msgid "Use this separator with %%sep%% in your title and meta description."
|
4528 |
msgstr ""
|
4529 |
|
4530 |
+
#: inc/admin/admin.php:3244
|
4531 |
msgid "My awesome website"
|
4532 |
msgstr ""
|
4533 |
|
4534 |
+
#: inc/admin/admin.php:3250 inc/admin/admin.php:3261 inc/admin/admin.php:3355
|
4535 |
+
#: inc/admin/admin.php:3471 inc/admin/admin.php:3603 inc/admin/admin.php:3636
|
4536 |
+
#: inc/admin/admin.php:3726 inc/admin/admin.php:3803 inc/admin/admin.php:3874
|
4537 |
+
#: inc/admin/admin.php:3944 inc/admin/admin.php:3995
|
4538 |
msgid "More tags"
|
4539 |
msgstr ""
|
4540 |
|
4541 |
+
#: inc/admin/admin.php:3256
|
4542 |
msgid "This is a cool website about Wookiees"
|
4543 |
msgstr ""
|
4544 |
|
4545 |
+
#: inc/admin/admin.php:3264
|
4546 |
msgid "Looking to edit your blog page?"
|
4547 |
msgstr ""
|
4548 |
|
4549 |
+
#: inc/admin/admin.php:3289 inc/admin/admin.php:3293 inc/admin/admin.php:3295
|
4550 |
+
#: inc/admin/admin.php:3300
|
4551 |
msgid "Click to hide any SEO metaboxes / columns for this post type"
|
4552 |
msgstr ""
|
4553 |
|
4554 |
+
#: inc/admin/admin.php:3292 inc/admin/admin.php:3296 inc/admin/admin.php:3299
|
4555 |
msgid "Click to display any SEO metaboxes / columns for this post type"
|
4556 |
msgstr ""
|
4557 |
|
4558 |
+
#: inc/admin/admin.php:3324 inc/admin/admin.php:3458 inc/admin/admin.php:3569
|
4559 |
+
#: inc/admin/admin.php:3698 inc/admin/admin.php:3791 inc/admin/admin.php:3862
|
4560 |
+
#: inc/admin/admin.php:3932 inc/admin/admin.php:3985
|
4561 |
msgid "Title template"
|
4562 |
msgstr ""
|
4563 |
|
4564 |
+
#: inc/admin/admin.php:3362 inc/admin/admin.php:3478 inc/admin/admin.php:3612
|
4565 |
+
#: inc/admin/admin.php:3733 inc/admin/admin.php:3809 inc/admin/admin.php:3880
|
4566 |
+
#: inc/admin/admin.php:3950 inc/admin/admin.php:4000
|
4567 |
msgid "Meta description template"
|
4568 |
msgstr ""
|
4569 |
|
4570 |
+
#: inc/admin/admin.php:3385
|
4571 |
msgid ""
|
4572 |
"Do not display this single post type in search engine results "
|
4573 |
"<strong>(noindex)</strong>"
|
4574 |
msgstr ""
|
4575 |
|
4576 |
+
#: inc/admin/admin.php:3404
|
4577 |
msgid ""
|
4578 |
"Do not follow links for this single post type <strong>(nofollow)</strong>"
|
4579 |
msgstr ""
|
4580 |
|
4581 |
+
#: inc/admin/admin.php:3423
|
4582 |
msgid "Display date in Google search results?"
|
4583 |
msgstr ""
|
4584 |
|
4585 |
+
#: inc/admin/admin.php:3442
|
4586 |
msgid "Display post thumbnail in Google Custom Search results?"
|
4587 |
msgstr ""
|
4588 |
|
4589 |
+
#: inc/admin/admin.php:3456
|
4590 |
msgid "BuddyPress groups"
|
4591 |
msgstr ""
|
4592 |
|
4593 |
+
#: inc/admin/admin.php:3502
|
4594 |
msgid ""
|
4595 |
"Do not display BuddyPress groups in search engine results <strong>(noindex)</"
|
4596 |
"strong>"
|
4597 |
msgstr ""
|
4598 |
|
4599 |
+
#: inc/admin/admin.php:3532 inc/admin/admin.php:3536 inc/admin/admin.php:3538
|
4600 |
+
#: inc/admin/admin.php:3543
|
4601 |
msgid "Click to hide any SEO metaboxes for this taxonomy"
|
4602 |
msgstr ""
|
4603 |
|
4604 |
+
#: inc/admin/admin.php:3535 inc/admin/admin.php:3539 inc/admin/admin.php:3542
|
4605 |
msgid "Click to display any SEO metaboxes for this taxonomy"
|
4606 |
msgstr ""
|
4607 |
|
4608 |
+
#: inc/admin/admin.php:3592
|
4609 |
msgid "Category Title"
|
4610 |
msgstr ""
|
4611 |
|
4612 |
+
#: inc/admin/admin.php:3594
|
4613 |
msgid "Tag Title"
|
4614 |
msgstr ""
|
4615 |
|
4616 |
+
#: inc/admin/admin.php:3629
|
4617 |
msgid "Category Description"
|
4618 |
msgstr ""
|
4619 |
|
4620 |
+
#: inc/admin/admin.php:3631
|
4621 |
msgid "Tag Description"
|
4622 |
msgstr ""
|
4623 |
|
4624 |
+
#: inc/admin/admin.php:3633
|
4625 |
msgid "Term Description"
|
4626 |
msgstr ""
|
4627 |
|
4628 |
+
#: inc/admin/admin.php:3651
|
4629 |
msgid ""
|
4630 |
"Do not display this taxonomy archive in search engine results "
|
4631 |
"<strong>(noindex)</strong>"
|
4632 |
msgstr ""
|
4633 |
|
4634 |
+
#: inc/admin/admin.php:3670
|
4635 |
msgid ""
|
4636 |
"Do not follow links for this taxonomy archive <strong>(nofollow)</strong>"
|
4637 |
msgstr ""
|
4638 |
|
4639 |
+
#: inc/admin/admin.php:3690
|
4640 |
msgid "See archive"
|
4641 |
msgstr ""
|
4642 |
|
4643 |
+
#: inc/admin/admin.php:3720
|
4644 |
msgid "Post Type Archive Name"
|
4645 |
msgstr ""
|
4646 |
|
4647 |
+
#: inc/admin/admin.php:3756
|
4648 |
msgid ""
|
4649 |
"Do not display this post type archive in search engine results "
|
4650 |
"<strong>(noindex)</strong>"
|
4651 |
msgstr ""
|
4652 |
|
4653 |
+
#: inc/admin/admin.php:3775
|
4654 |
msgid ""
|
4655 |
"Do not follow links for this post type archive <strong>(nofollow)</strong>"
|
4656 |
msgstr ""
|
4657 |
|
4658 |
+
#: inc/admin/admin.php:3789
|
4659 |
msgid "Author archives"
|
4660 |
msgstr ""
|
4661 |
|
4662 |
+
#: inc/admin/admin.php:3851
|
4663 |
msgid "Disable author archives"
|
4664 |
msgstr ""
|
4665 |
|
4666 |
+
#: inc/admin/admin.php:3860 inc/admin/admin.php:3871
|
4667 |
msgid "Date archives"
|
4668 |
msgstr ""
|
4669 |
|
4670 |
+
#: inc/admin/admin.php:3903
|
4671 |
msgid ""
|
4672 |
"Do not display date archives in search engine results <strong>(noindex)</"
|
4673 |
"strong>"
|
4674 |
msgstr ""
|
4675 |
|
4676 |
+
#: inc/admin/admin.php:3921
|
4677 |
msgid "Disable date archives"
|
4678 |
msgstr ""
|
4679 |
|
4680 |
+
#: inc/admin/admin.php:3930
|
4681 |
msgid "Search archives"
|
4682 |
msgstr ""
|
4683 |
|
4684 |
+
#: inc/admin/admin.php:3941
|
4685 |
msgid "Search Keywords"
|
4686 |
msgstr ""
|
4687 |
|
4688 |
+
#: inc/admin/admin.php:3974
|
4689 |
msgid ""
|
4690 |
"Do not display search archives in search engine results <strong>(noindex)</"
|
4691 |
"strong>"
|
4692 |
msgstr ""
|
4693 |
|
4694 |
+
#: inc/admin/admin.php:3983
|
4695 |
msgid "404 archives"
|
4696 |
msgstr ""
|
4697 |
|
4698 |
+
#: inc/admin/admin.php:4026
|
4699 |
msgid ""
|
4700 |
"Do not display all pages of the site in Google search results and do not "
|
4701 |
"display \"Cached\" links in search results."
|
4702 |
msgstr ""
|
4703 |
|
4704 |
+
#: inc/admin/admin.php:4028
|
4705 |
+
#, php-format
|
4706 |
+
msgid ""
|
4707 |
+
"Check also the <strong>\"Search engine visibility\"</strong> setting from "
|
4708 |
+
"the <a href=\"%s\">WordPress Reading page</a>."
|
4709 |
+
msgstr ""
|
4710 |
+
|
4711 |
+
#: inc/admin/admin.php:4047
|
4712 |
msgid "Do not follow links for all pages."
|
4713 |
msgstr ""
|
4714 |
|
4715 |
+
#: inc/admin/admin.php:4066
|
4716 |
msgid ""
|
4717 |
"Do not use Open Directory project metadata for titles or excerpts for all "
|
4718 |
"pages."
|
4719 |
msgstr ""
|
4720 |
|
4721 |
+
#: inc/admin/admin.php:4085
|
4722 |
msgid "Do not index images from the entire site."
|
4723 |
msgstr ""
|
4724 |
|
4725 |
+
#: inc/admin/admin.php:4104
|
4726 |
msgid "Do not display a \"Cached\" link in the Google search results."
|
4727 |
msgstr ""
|
4728 |
|
4729 |
+
#: inc/admin/admin.php:4123
|
4730 |
msgid ""
|
4731 |
"Do not display a description in the Google search results for all pages."
|
4732 |
msgstr ""
|
4733 |
|
4734 |
+
#: inc/admin/admin.php:4142
|
4735 |
msgid ""
|
4736 |
"Prevents Google to display a sitelinks searchbox in search results. Enable "
|
4737 |
"this option will remove the \"Website\" schema from your source code."
|
4738 |
msgstr ""
|
4739 |
|
4740 |
+
#: inc/admin/admin.php:4159
|
4741 |
msgid "Add rel next/prev link in head of paginated archive pages"
|
4742 |
msgstr ""
|
4743 |
|
4744 |
+
#: inc/admin/admin.php:4176
|
4745 |
msgid "Add a \"noindex\" meta robots for all paginated archive pages"
|
4746 |
msgstr ""
|
4747 |
|
4748 |
+
#: inc/admin/admin.php:4178
|
4749 |
msgid "eg: https://example.com/category/my-category/page/2/"
|
4750 |
msgstr ""
|
4751 |
|
4752 |
+
#: inc/admin/admin.php:4203
|
4753 |
msgid "Guide to enable XML Sitemaps - new window"
|
4754 |
msgstr ""
|
4755 |
|
4756 |
+
#: inc/admin/admin.php:4220
|
4757 |
msgid ""
|
4758 |
"Enable Image Sitemaps (standard images, image galleries, featured image, "
|
4759 |
"WooCommerce product images)"
|
4760 |
msgstr ""
|
4761 |
|
4762 |
+
#: inc/admin/admin.php:4222
|
4763 |
msgid "Images in XML sitemaps are visible only from the source code."
|
4764 |
msgstr ""
|
4765 |
|
4766 |
+
#: inc/admin/admin.php:4230
|
4767 |
msgid "Guide to enable XML image sitemaps - new window"
|
4768 |
msgstr ""
|
4769 |
|
4770 |
+
#: inc/admin/admin.php:4248
|
4771 |
msgid "Enable Video Sitemaps"
|
4772 |
msgstr ""
|
4773 |
|
4774 |
+
#: inc/admin/admin.php:4256
|
4775 |
#, php-format
|
4776 |
msgid ""
|
4777 |
"Your video sitemap is empty? Read our guide to learn more about <a href=\"%s"
|
4778 |
"\" target=\"_blank\">adding videos to your sitemap.</a>"
|
4779 |
msgstr ""
|
4780 |
|
4781 |
+
#: inc/admin/admin.php:4258
|
4782 |
msgid "Guide to enable XML video sitemaps - new window"
|
4783 |
msgstr ""
|
4784 |
|
4785 |
+
#: inc/admin/admin.php:4278
|
4786 |
msgid ""
|
4787 |
"Make sure to enable author archive from SEO, titles and metas, archives tab."
|
4788 |
"</a>"
|
4789 |
msgstr ""
|
4790 |
|
4791 |
+
#: inc/admin/admin.php:4343 inc/admin/admin.php:4387
|
4792 |
msgid "Include"
|
4793 |
msgstr ""
|
4794 |
|
4795 |
+
#: inc/admin/admin.php:4346
|
4796 |
msgid ""
|
4797 |
"You should never include attachment post type in your sitemap. Be careful if "
|
4798 |
"you checked this."
|
4799 |
msgstr ""
|
4800 |
|
4801 |
+
#: inc/admin/admin.php:4402
|
4802 |
msgid "eg: 2, 28, 68"
|
4803 |
msgstr ""
|
4804 |
|
4805 |
+
#: inc/admin/admin.php:4406
|
4806 |
msgid "You can also use this shortcode:"
|
4807 |
msgstr ""
|
4808 |
|
4809 |
+
#: inc/admin/admin.php:4416
|
4810 |
msgid "eg: 13, 8, 38"
|
4811 |
msgstr ""
|
4812 |
|
4813 |
+
#: inc/admin/admin.php:4430
|
4814 |
msgid ""
|
4815 |
"DESC (descending order from highest to lowest values (3, 2, 1; c, b, a))"
|
4816 |
msgstr ""
|
4817 |
|
4818 |
+
#: inc/admin/admin.php:4433
|
4819 |
msgid "ASC (ascending order from lowest to highest values (1, 2, 3; a, b, c))"
|
4820 |
msgstr ""
|
4821 |
|
4822 |
+
#: inc/admin/admin.php:4450
|
4823 |
msgid "Default (date)"
|
4824 |
msgstr ""
|
4825 |
|
4826 |
+
#: inc/admin/admin.php:4456
|
4827 |
msgid "Modified date"
|
4828 |
msgstr ""
|
4829 |
|
4830 |
+
#: inc/admin/admin.php:4459
|
4831 |
msgid "Post ID"
|
4832 |
msgstr ""
|
4833 |
|
4834 |
+
#: inc/admin/admin.php:4462
|
4835 |
msgid "Menu order"
|
4836 |
msgstr ""
|
4837 |
|
4838 |
+
#: inc/admin/admin.php:4480
|
4839 |
msgid "Disable date after each post, page, post type?"
|
4840 |
msgstr ""
|
4841 |
|
4842 |
+
#: inc/admin/admin.php:4515
|
4843 |
+
msgid "eg: Miremont"
|
4844 |
msgstr ""
|
4845 |
|
4846 |
+
#: inc/admin/admin.php:4528
|
4847 |
msgid "Select your logo"
|
4848 |
msgstr ""
|
4849 |
|
4850 |
+
#: inc/admin/admin.php:4532
|
4851 |
msgid "JPG, PNG, and GIF allowed."
|
4852 |
msgstr ""
|
4853 |
|
4854 |
+
#: inc/admin/admin.php:4558
|
4855 |
msgid "eg: +33123456789 (internationalized version required)"
|
4856 |
msgstr ""
|
4857 |
|
4858 |
+
#: inc/admin/admin.php:4573
|
4859 |
msgid "Customer support"
|
4860 |
msgstr ""
|
4861 |
|
4862 |
+
#: inc/admin/admin.php:4576
|
4863 |
msgid "Technical support"
|
4864 |
msgstr ""
|
4865 |
|
4866 |
+
#: inc/admin/admin.php:4579
|
4867 |
msgid "Billing support"
|
4868 |
msgstr ""
|
4869 |
|
4870 |
+
#: inc/admin/admin.php:4582
|
4871 |
msgid "Bill payment"
|
4872 |
msgstr ""
|
4873 |
|
4874 |
+
#: inc/admin/admin.php:4585
|
4875 |
msgid "Sales"
|
4876 |
msgstr ""
|
4877 |
|
4878 |
+
#: inc/admin/admin.php:4588
|
4879 |
msgid "Credit card support"
|
4880 |
msgstr ""
|
4881 |
|
4882 |
+
#: inc/admin/admin.php:4591
|
4883 |
msgid "Emergency"
|
4884 |
msgstr ""
|
4885 |
|
4886 |
+
#: inc/admin/admin.php:4594
|
4887 |
msgid "Baggage tracking"
|
4888 |
msgstr ""
|
4889 |
|
4890 |
+
#: inc/admin/admin.php:4597
|
4891 |
msgid "Roadside assistance"
|
4892 |
msgstr ""
|
4893 |
|
4894 |
+
#: inc/admin/admin.php:4600
|
4895 |
msgid "Package tracking"
|
4896 |
msgstr ""
|
4897 |
|
4898 |
+
#: inc/admin/admin.php:4617 inc/admin/admin.php:5523 inc/admin/admin.php:5546
|
4899 |
+
#: inc/admin/admin.php:5569 inc/admin/admin.php:5592 inc/admin/admin.php:5615
|
4900 |
msgid "None"
|
4901 |
msgstr ""
|
4902 |
|
4903 |
+
#: inc/admin/admin.php:4620
|
4904 |
msgid "Toll Free"
|
4905 |
msgstr ""
|
4906 |
|
4907 |
+
#: inc/admin/admin.php:4623
|
4908 |
msgid "Hearing impaired supported"
|
4909 |
msgstr ""
|
4910 |
|
4911 |
+
#: inc/admin/admin.php:4649
|
4912 |
msgid "Twitter Page URL"
|
4913 |
msgstr ""
|
4914 |
|
4915 |
+
#: inc/admin/admin.php:4750
|
4916 |
msgid "Enable OG data"
|
4917 |
msgstr ""
|
4918 |
|
4919 |
+
#: inc/admin/admin.php:4784
|
4920 |
msgid ""
|
4921 |
"Override every <strong>og:image</strong> tag with this default image (except "
|
4922 |
"if a custom og:image has already been set from the SEO metabox)."
|
4923 |
msgstr ""
|
4924 |
|
4925 |
+
#: inc/admin/admin.php:4789
|
4926 |
msgid "Please define a default OG Image from the field above"
|
4927 |
msgstr ""
|
4928 |
|
4929 |
+
#: inc/admin/admin.php:4822
|
4930 |
msgid "No custom post type to configure."
|
4931 |
msgstr ""
|
4932 |
|
4933 |
+
#: inc/admin/admin.php:4834
|
4934 |
msgid ""
|
4935 |
"One or more Facebook Page IDs that are associated with a URL in order to "
|
4936 |
"enable link editing and instant article publishing."
|
4937 |
msgstr ""
|
4938 |
|
4939 |
+
#: inc/admin/admin.php:4838
|
4940 |
msgid "How do I find my Facebook Page ID?"
|
4941 |
msgstr ""
|
4942 |
|
4943 |
+
#: inc/admin/admin.php:4848
|
4944 |
msgid ""
|
4945 |
"The ID (or comma-separated list for properties that can accept multiple IDs) "
|
4946 |
"of an app, person using the app, or Page Graph API object."
|
4947 |
msgstr ""
|
4948 |
|
4949 |
+
#: inc/admin/admin.php:4860
|
4950 |
msgid ""
|
4951 |
"The Facebook app ID of the site's app. In order to use Facebook Insights you "
|
4952 |
"must add the app ID to your page. Insights lets you view analytics for "
|
4956 |
"\"seopress-help dashicons dashicons-external\"></span>"
|
4957 |
msgstr ""
|
4958 |
|
4959 |
+
#: inc/admin/admin.php:4864
|
4960 |
msgid "How to create a Facebook App ID"
|
4961 |
msgstr ""
|
4962 |
|
4963 |
+
#: inc/admin/admin.php:4877
|
4964 |
msgid "Enable Twitter card"
|
4965 |
msgstr ""
|
4966 |
|
4967 |
+
#: inc/admin/admin.php:4894
|
4968 |
msgid "Use OG if no Twitter Cards"
|
4969 |
msgstr ""
|
4970 |
|
4971 |
+
#: inc/admin/admin.php:4929 seopress.php:259
|
4972 |
msgid "Default"
|
4973 |
msgstr ""
|
4974 |
|
4975 |
+
#: inc/admin/admin.php:4932
|
4976 |
msgid "Large"
|
4977 |
msgstr ""
|
4978 |
|
4979 |
+
#: inc/admin/admin.php:4950
|
4980 |
msgid "Enable Google Analytics tracking (Global Site Tag: gtag.js)"
|
4981 |
msgstr ""
|
4982 |
|
4983 |
+
#: inc/admin/admin.php:4962
|
4984 |
msgid "Enter your Tracking ID (UA-XXXX-XX)"
|
4985 |
msgstr ""
|
4986 |
|
4987 |
+
#: inc/admin/admin.php:4966
|
4988 |
msgid "Find your tracking ID"
|
4989 |
msgstr ""
|
4990 |
|
4991 |
+
#: inc/admin/admin.php:4980
|
4992 |
msgid "Request user's consent for analytics tracking (required by GDPR)"
|
4993 |
msgstr ""
|
4994 |
|
4995 |
+
#: inc/admin/admin.php:4982
|
4996 |
msgid ""
|
4997 |
"<strong>The user must click the Accept button to allow tracking.</strong>"
|
4998 |
msgstr ""
|
4999 |
|
5000 |
+
#: inc/admin/admin.php:4984
|
5001 |
msgid ""
|
5002 |
"User roles excluded from tracking will not see the consent message.<br> If "
|
5003 |
"you use a caching plugin, you have to exclude this JS file in your settings: "
|
5005 |
"js</strong> <br>and this cookie <strong>seopress-user-consent-accept</strong>"
|
5006 |
msgstr ""
|
5007 |
|
5008 |
+
#: inc/admin/admin.php:4992
|
5009 |
msgid "Hook to add custom tracking code with user consent - new window"
|
5010 |
msgstr ""
|
5011 |
|
5012 |
+
#: inc/admin/admin.php:5009
|
5013 |
msgid ""
|
5014 |
"Display and automatically accept the user‘s consent on page load (not fully "
|
5015 |
"GDPR)"
|
5016 |
msgstr ""
|
5017 |
|
5018 |
+
#: inc/admin/admin.php:5011
|
5019 |
msgid "The previous option must be checked to use this."
|
5020 |
msgstr ""
|
5021 |
|
5022 |
+
#: inc/admin/admin.php:5024
|
5023 |
msgid "Enter your message (HTML allowed)"
|
5024 |
msgstr ""
|
5025 |
|
5026 |
+
#: inc/admin/admin.php:5024
|
5027 |
msgid "This message will only appear if request user's consent is enabled."
|
5028 |
msgstr ""
|
5029 |
|
5030 |
+
#: inc/admin/admin.php:5033
|
5031 |
msgid "Hook to filter user consent message - new window"
|
5032 |
msgstr ""
|
5033 |
|
5034 |
+
#: inc/admin/admin.php:5035
|
5035 |
msgid "HTML tags allowed: strong, em, br, a href / target"
|
5036 |
msgstr ""
|
5037 |
|
5038 |
+
#: inc/admin/admin.php:5036
|
5039 |
msgid ""
|
5040 |
"Shortcode allowed to get the privacy page set in WordPress settings: "
|
5041 |
"[seopress_privacy_page]"
|
5042 |
msgstr ""
|
5043 |
|
5044 |
+
#: inc/admin/admin.php:5044 inc/functions/options-google-analytics.php:215
|
5045 |
msgid "Accept"
|
5046 |
msgstr ""
|
5047 |
|
5048 |
+
#: inc/admin/admin.php:5044
|
5049 |
msgid "Change the button value"
|
5050 |
msgstr ""
|
5051 |
|
5052 |
+
#: inc/admin/admin.php:5054
|
5053 |
msgid "default: X"
|
5054 |
msgstr ""
|
5055 |
|
5056 |
+
#: inc/admin/admin.php:5054
|
5057 |
msgid "Change the close button value"
|
5058 |
msgstr ""
|
5059 |
|
5060 |
+
#: inc/admin/admin.php:5073
|
5061 |
+
msgid "Default: 30 days before the cookie expiration."
|
5062 |
+
msgstr ""
|
5063 |
+
|
5064 |
+
#: inc/admin/admin.php:5085
|
5065 |
msgid "Bottom (default)"
|
5066 |
msgstr ""
|
5067 |
|
5068 |
+
#: inc/admin/admin.php:5088
|
5069 |
+
msgid "Middle"
|
5070 |
+
msgstr ""
|
5071 |
+
|
5072 |
+
#: inc/admin/admin.php:5091
|
5073 |
msgid "Top"
|
5074 |
msgstr ""
|
5075 |
|
5076 |
+
#: inc/admin/admin.php:5104
|
5077 |
+
msgid "Change the cookie bar width"
|
5078 |
+
msgstr ""
|
5079 |
+
|
5080 |
+
#: inc/admin/admin.php:5108
|
5081 |
+
msgid ""
|
5082 |
+
"Default unit is Pixels. Add % just after your custom value to use "
|
5083 |
+
"percentages (eg: 80%)."
|
5084 |
+
msgstr ""
|
5085 |
+
|
5086 |
+
#: inc/admin/admin.php:5121
|
5087 |
+
msgid "Display a backdrop with the cookie bar"
|
5088 |
+
msgstr ""
|
5089 |
+
|
5090 |
+
#: inc/admin/admin.php:5133
|
5091 |
+
msgid "Change the background color of the backdrop"
|
5092 |
+
msgstr ""
|
5093 |
+
|
5094 |
+
#: inc/admin/admin.php:5143
|
5095 |
msgid "Change the color of the cookie bar background"
|
5096 |
msgstr ""
|
5097 |
|
5098 |
+
#: inc/admin/admin.php:5153
|
5099 |
msgid "Change the color of the cookie bar text"
|
5100 |
msgstr ""
|
5101 |
|
5102 |
+
#: inc/admin/admin.php:5163
|
5103 |
msgid "Change the color of the cookie bar link"
|
5104 |
msgstr ""
|
5105 |
|
5106 |
+
#: inc/admin/admin.php:5173
|
5107 |
msgid "Change the color of the cookie bar button background"
|
5108 |
msgstr ""
|
5109 |
|
5110 |
+
#: inc/admin/admin.php:5183
|
5111 |
msgid "Change the color of the cookie bar button hover background"
|
5112 |
msgstr ""
|
5113 |
|
5114 |
+
#: inc/admin/admin.php:5193
|
5115 |
msgid "Change the color of the cookie bar button"
|
5116 |
msgstr ""
|
5117 |
|
5118 |
+
#: inc/admin/admin.php:5203
|
5119 |
msgid "Change the color of the cookie bar button hover"
|
5120 |
msgstr ""
|
5121 |
|
5122 |
+
#: inc/admin/admin.php:5213
|
5123 |
msgid "Change the color of the cookie bar secondary button background"
|
5124 |
msgstr ""
|
5125 |
|
5126 |
+
#: inc/admin/admin.php:5223
|
5127 |
msgid "Change the color of the cookie bar secondary button hover background"
|
5128 |
msgstr ""
|
5129 |
|
5130 |
+
#: inc/admin/admin.php:5233
|
5131 |
msgid "Change the color of the cookie bar secondary button"
|
5132 |
msgstr ""
|
5133 |
|
5134 |
+
#: inc/admin/admin.php:5243
|
5135 |
msgid "Change the color of the cookie bar secondary button hover"
|
5136 |
msgstr ""
|
5137 |
|
5138 |
+
#: inc/admin/admin.php:5278
|
5139 |
msgid "Enter your Google Optimize container ID"
|
5140 |
msgstr ""
|
5141 |
|
5142 |
+
#: inc/admin/admin.php:5278
|
5143 |
msgid "GTM-XXXXXXX"
|
5144 |
msgstr ""
|
5145 |
|
5146 |
+
#: inc/admin/admin.php:5281
|
5147 |
msgid ""
|
5148 |
"Google Optimize offers A/B testing, website testing & personalization tools."
|
5149 |
msgstr ""
|
5150 |
|
5151 |
+
#: inc/admin/admin.php:5289
|
5152 |
msgid "Enter your Google Ads conversion ID (eg: AW-123456789)"
|
5153 |
msgstr ""
|
5154 |
|
5155 |
+
#: inc/admin/admin.php:5289
|
5156 |
msgid "AW-XXXXXXXXX"
|
5157 |
msgstr ""
|
5158 |
|
5159 |
+
#: inc/admin/admin.php:5298
|
5160 |
msgid "Paste your tracking code here like Google Tag Manager (head)"
|
5161 |
msgstr ""
|
5162 |
|
5163 |
+
#: inc/admin/admin.php:5298
|
5164 |
msgid "Additional tracking code field"
|
5165 |
msgstr ""
|
5166 |
|
5167 |
+
#: inc/admin/admin.php:5301
|
5168 |
msgid "This code will be added in the head section of your page."
|
5169 |
msgstr ""
|
5170 |
|
5171 |
+
#: inc/admin/admin.php:5309
|
5172 |
msgid "Paste your tracking code here like Google Tag Manager (body)"
|
5173 |
msgstr ""
|
5174 |
|
5175 |
+
#: inc/admin/admin.php:5309
|
5176 |
msgid "Additional tracking code field added to body"
|
5177 |
msgstr ""
|
5178 |
|
5179 |
+
#: inc/admin/admin.php:5312
|
5180 |
msgid "This code will be added just after the opening body tag of your page."
|
5181 |
msgstr ""
|
5182 |
|
5183 |
+
#: inc/admin/admin.php:5313
|
5184 |
msgid ""
|
5185 |
"You don‘t see your code? Make sure to call <strong>wp_body_open();</strong> "
|
5186 |
"just after the opening body tag in your theme."
|
5187 |
msgstr ""
|
5188 |
|
5189 |
+
#: inc/admin/admin.php:5329
|
5190 |
msgid "Paste your tracking code here (body footer)"
|
5191 |
msgstr ""
|
5192 |
|
5193 |
+
#: inc/admin/admin.php:5329
|
5194 |
msgid "Additional tracking code field added to body footer"
|
5195 |
msgstr ""
|
5196 |
|
5197 |
+
#: inc/admin/admin.php:5332
|
5198 |
msgid "This code will be added just after the closing body tag of your page."
|
5199 |
msgstr ""
|
5200 |
|
5201 |
+
#: inc/admin/admin.php:5347
|
5202 |
msgid ""
|
5203 |
"A remarketing audience is a list of cookies or mobile-advertising IDs that "
|
5204 |
"represents a group of users you want to re-engage because of their "
|
5205 |
"likelihood to convert."
|
5206 |
msgstr ""
|
5207 |
|
5208 |
+
#: inc/admin/admin.php:5369
|
5209 |
msgid ""
|
5210 |
"When a customer of Analytics requests IP address anonymization, Analytics "
|
5211 |
"anonymizes the address as soon as technically feasible at the earliest "
|
5212 |
"possible stage of the collection network."
|
5213 |
msgstr ""
|
5214 |
|
5215 |
+
#: inc/admin/admin.php:5391
|
5216 |
msgid ""
|
5217 |
"Enhanced Link Attribution improves the accuracy of your In-Page Analytics "
|
5218 |
"report by automatically differentiating between multiple links to the same "
|
5219 |
"URL on a single page by using link element IDs."
|
5220 |
msgstr ""
|
5221 |
|
5222 |
+
#: inc/admin/admin.php:5413
|
5223 |
msgid ""
|
5224 |
"Cross domain tracking makes it possible for Analytics to see sessions on two "
|
5225 |
"related sites (such as an ecommerce site and a separate shopping cart site) "
|
5226 |
"as a single session. This is sometimes called site linking."
|
5227 |
msgstr ""
|
5228 |
|
5229 |
+
#: inc/admin/admin.php:5428 inc/admin/admin.php:5753
|
5230 |
msgid "Enter your domains: seopress.org,sub.seopress.org,sub2.seopress.org"
|
5231 |
msgstr ""
|
5232 |
|
5233 |
+
#: inc/admin/admin.php:5462
|
5234 |
msgid "Enable download tracking"
|
5235 |
msgstr ""
|
5236 |
|
5237 |
+
#: inc/admin/admin.php:5474
|
5238 |
msgid "pdf|docx|pptx|zip"
|
5239 |
msgstr ""
|
5240 |
|
5241 |
+
#: inc/admin/admin.php:5478
|
5242 |
msgid "Separate each file type extensions with a pipe \"|\""
|
5243 |
msgstr ""
|
5244 |
|
5245 |
+
#: inc/admin/admin.php:5493
|
5246 |
msgid "Enable affiliate/outbound tracking"
|
5247 |
msgstr ""
|
5248 |
|
5249 |
+
#: inc/admin/admin.php:5505
|
5250 |
msgid "aff|go|out"
|
5251 |
msgstr ""
|
5252 |
|
5253 |
+
#: inc/admin/admin.php:5509
|
5254 |
msgid "Separate each keyword with a pipe \"|\""
|
5255 |
msgstr ""
|
5256 |
|
5257 |
+
#: inc/admin/admin.php:5528 inc/admin/admin.php:5551 inc/admin/admin.php:5574
|
5258 |
+
#: inc/admin/admin.php:5597 inc/admin/admin.php:5620
|
5259 |
#, php-format
|
5260 |
msgid "Custom Dimension #%d"
|
5261 |
msgstr ""
|
5262 |
|
5263 |
+
#: inc/admin/admin.php:5639
|
5264 |
msgid "Enable Matomo tracking (Matomo account required)"
|
5265 |
msgstr ""
|
5266 |
|
5267 |
+
#: inc/admin/admin.php:5651
|
5268 |
msgid "Enter \"example\" if you Matomo account URL is \"example.matomo.cloud\""
|
5269 |
msgstr ""
|
5270 |
|
5271 |
+
#: inc/admin/admin.php:5651
|
5272 |
msgid "Matomo Cloud URL"
|
5273 |
msgstr ""
|
5274 |
|
5275 |
+
#: inc/admin/admin.php:5656
|
5276 |
msgid "Enter only the <strong>host</strong> like this example.matomo.cloud"
|
5277 |
msgstr ""
|
5278 |
|
5279 |
+
#: inc/admin/admin.php:5665
|
5280 |
msgid "Enter your site ID here"
|
5281 |
msgstr ""
|
5282 |
|
5283 |
+
#: inc/admin/admin.php:5665
|
5284 |
msgid "Matomo Site ID"
|
5285 |
msgstr ""
|
5286 |
|
5287 |
+
#: inc/admin/admin.php:5670
|
5288 |
msgid ""
|
5289 |
"To find your site ID, go to your <strong>Matomo Cloud account, Websites, "
|
5290 |
"Manage page</strong>. Look at \"Site ID\" on the right part."
|
5291 |
msgstr ""
|
5292 |
|
5293 |
+
#: inc/admin/admin.php:5684
|
5294 |
msgid "Tracking one domain and its subdomains in the same website"
|
5295 |
msgstr ""
|
5296 |
|
5297 |
+
#: inc/admin/admin.php:5686
|
5298 |
msgid ""
|
5299 |
"If one visitor visits x.example.com and y.example.com, they will be counted "
|
5300 |
"as a unique visitor."
|
5301 |
msgstr ""
|
5302 |
|
5303 |
+
#: inc/admin/admin.php:5703
|
5304 |
msgid "Prepend the site domain to the page title when tracking"
|
5305 |
msgstr ""
|
5306 |
|
5307 |
+
#: inc/admin/admin.php:5705
|
5308 |
msgid ""
|
5309 |
"If someone visits the 'About' page on blog.example.com it will be recorded "
|
5310 |
"as 'blog / About'. This is the easiest way to get an overview of your "
|
5311 |
"traffic by sub-domain."
|
5312 |
msgstr ""
|
5313 |
|
5314 |
+
#: inc/admin/admin.php:5741
|
5315 |
msgid ""
|
5316 |
"By default, the visitor ID that identifies a unique visitor is stored in the "
|
5317 |
"browser's first party cookies which can only be accessed by pages on the "
|
5322 |
"Visitor ID."
|
5323 |
msgstr ""
|
5324 |
|
5325 |
+
#: inc/admin/admin.php:5770
|
5326 |
msgid "Enable client side DoNotTrack detection"
|
5327 |
msgstr ""
|
5328 |
|
5329 |
+
#: inc/admin/admin.php:5772
|
5330 |
msgid ""
|
5331 |
"Tracking requests will not be sent if visitors do not wish to be tracked."
|
5332 |
msgstr ""
|
5333 |
|
5334 |
+
#: inc/admin/admin.php:5789
|
5335 |
msgid ""
|
5336 |
"Disables all first party cookies. Existing Matomo cookies for this website "
|
5337 |
"will be deleted on the next page view."
|
5338 |
msgstr ""
|
5339 |
|
5340 |
+
#: inc/admin/admin.php:5806
|
5341 |
msgid "Enabling Download & Outlink tracking"
|
5342 |
msgstr ""
|
5343 |
|
5344 |
+
#: inc/admin/admin.php:5808
|
5345 |
msgid ""
|
5346 |
"By default, any file ending with one of these extensions will be considered "
|
5347 |
"a \"download\" in the Matomo interface: 7z|aac|arc|arj|apk|asf|asx|avi|bin|"
|
5352 |
"\t\ttbz|tbz2|tgz|torrent|txt|wav|wma|wmv|wpd|xls|xml|z|zip"
|
5353 |
msgstr ""
|
5354 |
|
5355 |
+
#: inc/admin/admin.php:5829
|
5356 |
msgid "Redirect attachment pages to post parent (or homepage if none)"
|
5357 |
msgstr ""
|
5358 |
|
5359 |
+
#: inc/admin/admin.php:5848
|
5360 |
msgid ""
|
5361 |
"If this option is checked, it will take precedence over the redirection of "
|
5362 |
"attachments to the post's parent."
|
5363 |
msgstr ""
|
5364 |
|
5365 |
+
#: inc/admin/admin.php:5865
|
5366 |
msgid "Remove ?replytocom link in source code"
|
5367 |
msgstr ""
|
5368 |
|
5369 |
+
#: inc/admin/admin.php:5882
|
5370 |
msgid ""
|
5371 |
"When sending an image file, automatically set the title based on the filename"
|
5372 |
msgstr ""
|
5373 |
|
5374 |
+
#: inc/admin/admin.php:5899
|
5375 |
msgid ""
|
5376 |
"When sending an image file, automatically set the alternative text based on "
|
5377 |
"the filename"
|
5378 |
msgstr ""
|
5379 |
|
5380 |
+
#: inc/admin/admin.php:5902
|
5381 |
msgid ""
|
5382 |
"We recommend Image SEO plugin to optimize your image ALT texts and names for "
|
5383 |
"Search Engines using AI and Machine Learning. Starting from just €4.99."
|
5384 |
msgstr ""
|
5385 |
|
5386 |
+
#: inc/admin/admin.php:5920
|
5387 |
msgid "Use the target keywords if not alternative text set for the image"
|
5388 |
msgstr ""
|
5389 |
|
5390 |
+
#: inc/admin/admin.php:5922
|
5391 |
msgid ""
|
5392 |
"This setting will be applied to images without any alt text on frontend "
|
5393 |
"only. This setting is retroactive. If you turn it off, alt texts that were "
|
5394 |
"previously empty will be empty again."
|
5395 |
msgstr ""
|
5396 |
|
5397 |
+
#: inc/admin/admin.php:5939
|
5398 |
msgid ""
|
5399 |
"When sending an image file, automatically set the caption based on the "
|
5400 |
"filename"
|
5401 |
msgstr ""
|
5402 |
|
5403 |
+
#: inc/admin/admin.php:5956
|
5404 |
msgid ""
|
5405 |
"When sending an image file, automatically set the description based on the "
|
5406 |
"filename"
|
5407 |
msgstr ""
|
5408 |
|
5409 |
+
#: inc/admin/admin.php:5973
|
5410 |
msgid "Add TINYMCE editor to term description"
|
5411 |
msgstr ""
|
5412 |
|
5413 |
+
#: inc/admin/admin.php:5990
|
5414 |
msgid "You have to flush your permalinks each time you change this settings"
|
5415 |
msgstr ""
|
5416 |
|
5417 |
+
#: inc/admin/admin.php:6007
|
5418 |
msgid ""
|
5419 |
"You must check this box if the structure of your permalinks DOES NOT contain "
|
5420 |
"a slash at the end (eg: /%postname%)"
|
5421 |
msgstr ""
|
5422 |
|
5423 |
+
#: inc/admin/admin.php:6024
|
5424 |
msgid "Remove WordPress meta generator in source code"
|
5425 |
msgstr ""
|
5426 |
|
5427 |
+
#: inc/admin/admin.php:6041
|
5428 |
msgid ""
|
5429 |
"Remove hentry post class to prevent Google from seeing this as structured "
|
5430 |
"data (schema)"
|
5431 |
msgstr ""
|
5432 |
|
5433 |
+
#: inc/admin/admin.php:6058
|
5434 |
msgid ""
|
5435 |
"Remove comment author URL in comments if the website is filled from profile "
|
5436 |
"page"
|
5437 |
msgstr ""
|
5438 |
|
5439 |
+
#: inc/admin/admin.php:6075
|
5440 |
msgid "Remove website field from comment form to reduce spam"
|
5441 |
msgstr ""
|
5442 |
|
5443 |
+
#: inc/admin/admin.php:6092
|
5444 |
msgid "Remove WordPress shortlink meta tag in source code (eg:"
|
5445 |
msgstr ""
|
5446 |
|
5447 |
+
#: inc/admin/admin.php:6109
|
5448 |
msgid "Remove Windows Live Writer meta tag in source code (eg:"
|
5449 |
msgstr ""
|
5450 |
|
5451 |
+
#: inc/admin/admin.php:6126
|
5452 |
msgid "Remove Really Simple Discovery meta tag in source code (eg:"
|
5453 |
msgstr ""
|
5454 |
|
5455 |
+
#: inc/admin/admin.php:6138
|
5456 |
msgid "Enter Google meta value site verification"
|
5457 |
msgstr ""
|
5458 |
|
5459 |
+
#: inc/admin/admin.php:6143
|
5460 |
msgid ""
|
5461 |
"If your site is already verified in <strong>Google Search Console</strong>, "
|
5462 |
"you can leave this field empty."
|
5463 |
msgstr ""
|
5464 |
|
5465 |
+
#: inc/admin/admin.php:6152
|
5466 |
msgid "Enter Bing meta value site verification"
|
5467 |
msgstr ""
|
5468 |
|
5469 |
+
#: inc/admin/admin.php:6156
|
5470 |
msgid ""
|
5471 |
"If your site is already verified in <strong>Bing Webmaster tools</strong>, "
|
5472 |
"you can leave this field empty."
|
5473 |
msgstr ""
|
5474 |
|
5475 |
+
#: inc/admin/admin.php:6165
|
5476 |
msgid "Enter Pinterest meta value site verification"
|
5477 |
msgstr ""
|
5478 |
|
5479 |
+
#: inc/admin/admin.php:6177
|
5480 |
msgid "Enter Yandex meta value site verification"
|
5481 |
msgstr ""
|
5482 |
|
5483 |
+
#: inc/admin/admin.php:6194
|
5484 |
+
msgid "Remove SEO from Admin Bar in backend and frontend"
|
5485 |
+
msgstr ""
|
5486 |
+
|
5487 |
+
#: inc/admin/admin.php:6211
|
5488 |
+
msgid "Remove noindex item from Admin Bar in backend and frontend"
|
5489 |
msgstr ""
|
5490 |
|
5491 |
+
#: inc/admin/admin.php:6227
|
5492 |
msgid "High priority (top)"
|
5493 |
msgstr ""
|
5494 |
|
5495 |
+
#: inc/admin/admin.php:6230
|
5496 |
msgid "Normal priority (default)"
|
5497 |
msgstr ""
|
5498 |
|
5499 |
+
#: inc/admin/admin.php:6233
|
5500 |
msgid "Low priority"
|
5501 |
msgstr ""
|
5502 |
|
5503 |
+
#: inc/admin/admin.php:6251
|
5504 |
msgid "Automatic tab (default)"
|
5505 |
msgstr ""
|
5506 |
|
5507 |
+
#: inc/admin/admin.php:6254
|
5508 |
msgid "Manual tab"
|
5509 |
msgstr ""
|
5510 |
|
5511 |
+
#: inc/admin/admin.php:6273
|
5512 |
+
msgid "Hide Notifications Center in SEO Dashboard page"
|
5513 |
msgstr ""
|
5514 |
|
5515 |
+
#: inc/admin/admin.php:6290
|
5516 |
+
msgid "Hide SEO tools in SEO Dashboard page"
|
5517 |
msgstr ""
|
5518 |
|
5519 |
+
#: inc/admin/admin.php:6307
|
5520 |
+
msgid "Hide Useful Links in SEO dashboard page"
|
5521 |
msgstr ""
|
5522 |
|
5523 |
+
#: inc/admin/admin.php:6324
|
5524 |
msgid "Add title column"
|
5525 |
msgstr ""
|
5526 |
|
5527 |
+
#: inc/admin/admin.php:6341
|
5528 |
msgid "Add meta description column"
|
5529 |
msgstr ""
|
5530 |
|
5531 |
+
#: inc/admin/admin.php:6358
|
5532 |
msgid "Add redirection enable column"
|
5533 |
msgstr ""
|
5534 |
|
5535 |
+
#: inc/admin/admin.php:6375
|
5536 |
msgid "Add redirection URL column"
|
5537 |
msgstr ""
|
5538 |
|
5539 |
+
#: inc/admin/admin.php:6392
|
5540 |
msgid "Add canonical URL column"
|
5541 |
msgstr ""
|
5542 |
|
5543 |
+
#: inc/admin/admin.php:6409
|
5544 |
msgid "Add target keyword column"
|
5545 |
msgstr ""
|
5546 |
|
5547 |
+
#: inc/admin/admin.php:6426
|
5548 |
msgid "Display noindex status"
|
5549 |
msgstr ""
|
5550 |
|
5551 |
+
#: inc/admin/admin.php:6443
|
5552 |
msgid "Display nofollow status"
|
5553 |
msgstr ""
|
5554 |
|
5555 |
+
#: inc/admin/admin.php:6460
|
5556 |
msgid "Display total number of words in content"
|
5557 |
msgstr ""
|
5558 |
|
5559 |
+
#: inc/admin/admin.php:6477
|
5560 |
msgid "Display W3C column to check code quality"
|
5561 |
msgstr ""
|
5562 |
|
5563 |
+
#: inc/admin/admin.php:6495
|
5564 |
msgid "Display Page Speed column to check performances"
|
5565 |
msgstr ""
|
5566 |
|
5567 |
+
#: inc/admin/admin.php:6514
|
5568 |
msgid "Display SEO Insights column to check rankings"
|
5569 |
msgstr ""
|
5570 |
|
5571 |
+
#: inc/admin/admin.php:6533
|
5572 |
msgid ""
|
5573 |
"Display Content Analysis results column (\"Good\" or \"Should be improved\")"
|
5574 |
msgstr ""
|
5575 |
|
5576 |
+
#: inc/admin/admin.php:6551
|
5577 |
msgid "Remove Genesis SEO Metabox"
|
5578 |
msgstr ""
|
5579 |
|
5580 |
+
#: inc/admin/admin.php:6568
|
5581 |
msgid "Remove Genesis SEO link in WP Admin Menu"
|
5582 |
msgstr ""
|
5583 |
|
5584 |
+
#: inc/admin/admin.php:6585
|
5585 |
msgid "Remove the advice if None schema selected"
|
5586 |
msgstr ""
|
5587 |
|
5588 |
+
#: inc/admin/admin.php:6621 inc/admin/admin.php:6654
|
5589 |
msgid ""
|
5590 |
"Hook to filter structured data types metabox call by post type - new window"
|
5591 |
msgstr ""
|
5592 |
|
5593 |
+
#: inc/admin/adminbar.php:53 inc/admin/adminbar.php:90
|
5594 |
msgid "noindex is on!"
|
5595 |
msgstr ""
|
5596 |
|
5597 |
+
#: inc/admin/adminbar.php:82 inc/admin/adminbar.php:84
|
5598 |
#, php-format
|
5599 |
+
msgid "SEO for \"%s\""
|
5600 |
msgstr ""
|
5601 |
|
5602 |
+
#: inc/admin/adminbar.php:93
|
5603 |
msgid "noindex is off."
|
5604 |
msgstr ""
|
5605 |
|
5606 |
+
#: inc/admin/adminbar.php:102
|
5607 |
msgid "nofollow is on!"
|
5608 |
msgstr ""
|
5609 |
|
5610 |
+
#: inc/admin/adminbar.php:105
|
5611 |
msgid "nofollow is off."
|
5612 |
msgstr ""
|
5613 |
|
5614 |
+
#: inc/admin/adminbar.php:168
|
5615 |
msgid "BOT"
|
5616 |
msgstr ""
|
5617 |
|
5618 |
+
#: inc/admin/adminbar.php:204
|
5619 |
msgid "Broken Links"
|
5620 |
msgstr ""
|
5621 |
|
5622 |
+
#: inc/admin/adminbar.php:212
|
5623 |
msgid "Configuration wizard"
|
5624 |
msgstr ""
|
5625 |
|
5629 |
"content analysis."
|
5630 |
msgstr ""
|
5631 |
|
5632 |
+
#: inc/admin/ajax.php:96
|
5633 |
msgid "To get your Google snippet preview, publish your post!"
|
5634 |
msgstr ""
|
5635 |
|
5636 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:94
|
5637 |
msgid "SEO Title / Description"
|
5638 |
msgstr ""
|
5639 |
|
5640 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:122
|
5641 |
msgid "Meta Description"
|
5642 |
msgstr ""
|
5643 |
|
5644 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:163
|
5645 |
msgid "SEO Advanced"
|
5646 |
msgstr ""
|
5647 |
|
5648 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:181
|
5649 |
msgid ""
|
5650 |
"Do not display this page in search engine results / XML - HTML sitemaps "
|
5651 |
"(noindex)"
|
5652 |
msgstr ""
|
5653 |
|
5654 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:192
|
5655 |
msgid "Do not follow links for this page (nofollow)"
|
5656 |
msgstr ""
|
5657 |
|
5658 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:203
|
5659 |
msgid ""
|
5660 |
"Do not use Open Directory project metadata for titles or excerpts for this "
|
5661 |
"page (noodp)"
|
5662 |
msgstr ""
|
5663 |
|
5664 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:214
|
5665 |
msgid "Do not index images for this page (noimageindex)"
|
5666 |
msgstr ""
|
5667 |
|
5668 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:225
|
5669 |
msgid ""
|
5670 |
"Do not display a \"Cached\" link in the Google search results (noarchive)"
|
5671 |
msgstr ""
|
5672 |
|
5673 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:236
|
5674 |
msgid ""
|
5675 |
"Do not display a description in search results for this page (nosnippet)"
|
5676 |
msgstr ""
|
5677 |
|
5678 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:319
|
5679 |
msgid "SEO Social"
|
5680 |
msgstr ""
|
5681 |
|
5682 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:339
|
5683 |
+
msgid ""
|
5684 |
+
"<p class=\"elementor-control-field-description\"><span class=\"dashicons "
|
5685 |
+
"dashicons-external\"></span><a href=\"https://developers.facebook.com/tools/"
|
5686 |
+
"debug/sharing/?q="
|
5687 |
+
msgstr ""
|
5688 |
+
|
5689 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:349
|
5690 |
+
msgid ""
|
5691 |
+
"<p class=\"elementor-control-field-description\"><strong>Did you know?</"
|
5692 |
+
"strong> LinkedIn, Instagram and Pinterest use the same social metadata as "
|
5693 |
+
"Facebook. Twitter does the same if no Twitter cards tags are defined below.</"
|
5694 |
+
"p>"
|
5695 |
+
msgstr ""
|
5696 |
+
|
5697 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:467
|
5698 |
msgid "SEO Redirection"
|
5699 |
msgstr ""
|
5700 |
|
5701 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:531
|
5702 |
msgid "SEO Content Analysis"
|
5703 |
msgstr ""
|
5704 |
|
5705 |
+
#: inc/admin/page-builders/elementor/inc/admin/class-document-settings-section.php:543
|
5706 |
+
msgid ""
|
5707 |
+
"<p class=\"elementor-control-field-description\">Enter a few keywords for "
|
5708 |
+
"analysis to help you write optimized content.</p><p class=\"elementor-"
|
5709 |
+
"control-field-description\"><strong>Did you know?</strong> Writing content "
|
5710 |
+
"for your users is the most important thing! If it doesn‘t feel natural, your "
|
5711 |
+
"visitors will leave your site, Google will know it and your ranking will be "
|
5712 |
+
"affected.</p>"
|
5713 |
+
msgstr ""
|
5714 |
+
|
5715 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:45
|
5716 |
+
msgid ". The closer to 1.91 the better."
|
5717 |
+
msgstr ""
|
5718 |
+
|
5719 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:54
|
5720 |
msgid "By"
|
5721 |
msgstr ""
|
5722 |
|
5723 |
+
#: inc/admin/page-builders/elementor/inc/controls/class-social-preview-control.php:69
|
5724 |
+
msgid ". The closer to 1 the better (with large card, 2 is better)."
|
5725 |
+
msgstr ""
|
5726 |
+
|
5727 |
#: inc/functions/options-advanced-admin.php:27
|
5728 |
msgid "Need help?"
|
5729 |
msgstr ""
|
5745 |
"is optimized for SEO (NOT Plain)."
|
5746 |
msgstr ""
|
5747 |
|
5748 |
+
#: inc/functions/options-advanced-admin.php:399
|
5749 |
+
#: inc/functions/options-advanced-admin.php:971
|
5750 |
msgid "Title tag"
|
5751 |
msgstr ""
|
5752 |
|
5753 |
+
#: inc/functions/options-advanced-admin.php:402
|
5754 |
msgid "Meta Desc."
|
5755 |
msgstr ""
|
5756 |
|
5757 |
+
#: inc/functions/options-advanced-admin.php:405
|
5758 |
msgid "Redirect?"
|
5759 |
msgstr ""
|
5760 |
|
5761 |
+
#: inc/functions/options-advanced-admin.php:411
|
5762 |
+
#: inc/functions/options-advanced-admin.php:995
|
5763 |
msgid "Canonical"
|
5764 |
msgstr ""
|
5765 |
|
5766 |
+
#: inc/functions/options-advanced-admin.php:414
|
5767 |
msgid "Target Kw"
|
5768 |
msgstr ""
|
5769 |
|
5770 |
+
#: inc/functions/options-advanced-admin.php:417
|
5771 |
msgid "Noindex?"
|
5772 |
msgstr ""
|
5773 |
|
5774 |
+
#: inc/functions/options-advanced-admin.php:420
|
5775 |
msgid "Nofollow?"
|
5776 |
msgstr ""
|
5777 |
|
5778 |
+
#: inc/functions/options-advanced-admin.php:423
|
5779 |
msgid "Score"
|
5780 |
msgstr ""
|
5781 |
|
5782 |
+
#: inc/functions/options-advanced-admin.php:426
|
5783 |
msgid "Words"
|
5784 |
msgstr ""
|
5785 |
|
5786 |
+
#: inc/functions/options-advanced-admin.php:429
|
5787 |
msgid "W3C check"
|
5788 |
msgstr ""
|
5789 |
|
5790 |
+
#: inc/functions/options-advanced-admin.php:432
|
5791 |
msgid "Page Speed"
|
5792 |
msgstr ""
|
5793 |
|
5794 |
+
#: inc/functions/options-advanced-admin.php:488
|
5795 |
msgid "Check code quality of this page"
|
5796 |
msgstr ""
|
5797 |
|
5798 |
+
#: inc/functions/options-advanced-admin.php:492
|
5799 |
msgid "Analyze this page with Google Page Speed"
|
5800 |
msgstr ""
|
5801 |
|
5802 |
+
#: inc/functions/options-advanced-admin.php:551
|
5803 |
msgid "Insights from these keywords:"
|
5804 |
msgstr ""
|
5805 |
|
5806 |
+
#: inc/functions/options-advanced-admin.php:557
|
5807 |
msgid "Average position: "
|
5808 |
msgstr ""
|
5809 |
|
5810 |
+
#: inc/functions/options-advanced-admin.php:583
|
5811 |
msgid "Latest position: "
|
5812 |
msgstr ""
|
5813 |
|
5814 |
+
#: inc/functions/options-advanced-admin.php:675
|
5815 |
msgid "Enable noindex"
|
5816 |
msgstr ""
|
5817 |
|
5818 |
+
#: inc/functions/options-advanced-admin.php:728
|
5819 |
msgid "Enable index"
|
5820 |
msgstr ""
|
5821 |
|
5822 |
+
#: inc/functions/options-advanced-admin.php:781
|
5823 |
msgid "Enable nofollow"
|
5824 |
msgstr ""
|
5825 |
|
5826 |
+
#: inc/functions/options-advanced-admin.php:833
|
5827 |
msgid "Enable follow"
|
5828 |
msgstr ""
|
5829 |
|
5830 |
+
#: inc/functions/options-advanced-admin.php:880
|
5831 |
msgid "Enable redirection"
|
5832 |
msgstr ""
|
5833 |
|
5834 |
+
#: inc/functions/options-advanced-admin.php:919
|
5835 |
msgid "Disable redirection"
|
5836 |
msgstr ""
|
5837 |
|
5838 |
+
#: inc/functions/options-advanced-admin.php:1099
|
5839 |
msgid "Description"
|
5840 |
msgstr ""
|
5841 |
|
5842 |
+
#: inc/functions/options-advanced-admin.php:1108
|
5843 |
msgid ""
|
5844 |
"The description is not prominent by default; however, some themes may show "
|
5845 |
"it."
|
5846 |
msgstr ""
|
5847 |
|
5848 |
+
#: inc/functions/options-google-analytics.php:200
|
5849 |
msgid ""
|
5850 |
"By visiting our site, you agree to our privacy policy regarding cookies, "
|
5851 |
"tracking statistics, etc. <a href=\"[seopress_privacy_page]\" tabindex="
|
5852 |
"\"10\">Read more</a>"
|
5853 |
msgstr ""
|
5854 |
|
5855 |
+
#: inc/functions/options-google-analytics.php:202
|
5856 |
msgid ""
|
5857 |
"By visiting our site, you agree to our privacy policy regarding cookies, "
|
5858 |
"tracking statistics, etc."
|
5859 |
msgstr ""
|
5860 |
|
5861 |
+
#: inc/functions/options-google-analytics.php:221
|
5862 |
msgid "X"
|
5863 |
msgstr ""
|
5864 |
|
5865 |
+
#: inc/functions/options-google-analytics.php:771
|
5866 |
#: inc/functions/options-matomo.php:205
|
5867 |
msgid "Authors"
|
5868 |
msgstr ""
|
5869 |
|
5870 |
+
#: inc/functions/options-google-analytics.php:790
|
5871 |
#: inc/functions/options-matomo.php:219
|
5872 |
msgid "Categories"
|
5873 |
msgstr ""
|
5874 |
|
5875 |
+
#: inc/functions/options-google-analytics.php:816
|
5876 |
#: inc/functions/options-matomo.php:239
|
5877 |
msgid "Tags"
|
5878 |
msgstr ""
|
5879 |
|
5880 |
+
#: inc/functions/options-google-analytics.php:830
|
5881 |
#: inc/functions/options-matomo.php:248
|
5882 |
msgid "Post types"
|
5883 |
msgstr ""
|
5884 |
|
5885 |
+
#: inc/functions/options-google-analytics.php:844
|
5886 |
#: inc/functions/options-matomo.php:257
|
5887 |
msgid "Connected users"
|
5888 |
msgstr ""
|
5944 |
msgid "has been successfully updated!"
|
5945 |
msgstr ""
|
5946 |
|
5947 |
+
#: seopress.php:257
|
5948 |
+
msgid "Clear"
|
5949 |
+
msgstr ""
|
5950 |
+
|
5951 |
+
#: seopress.php:258
|
5952 |
+
msgid "Clear color"
|
5953 |
+
msgstr ""
|
5954 |
+
|
5955 |
+
#: seopress.php:260
|
5956 |
+
msgid "Select default color"
|
5957 |
+
msgstr ""
|
5958 |
+
|
5959 |
+
#: seopress.php:261
|
5960 |
+
msgid "Select Color"
|
5961 |
+
msgstr ""
|
5962 |
+
|
5963 |
+
#: seopress.php:262
|
5964 |
+
msgid "Color value"
|
5965 |
+
msgstr ""
|
5966 |
+
|
5967 |
+
#: seopress.php:379
|
5968 |
msgid "You like SEOPress? Don't forget to rate it 5 stars!"
|
5969 |
msgstr ""
|
5970 |
|
5971 |
+
#: seopress.php:440
|
5972 |
msgid "Docs"
|
5973 |
msgstr ""
|
5974 |
|
5975 |
+
#: seopress.php:441
|
5976 |
msgid "Configuration Wizard"
|
5977 |
msgstr ""
|
5978 |
|
5979 |
+
#: seopress.php:443
|
5980 |
msgid "GO PRO!"
|
5981 |
msgstr ""
|
5982 |
|
5983 |
+
#: seopress.php:1243
|
5984 |
msgid "Follow us:"
|
5985 |
msgstr ""
|
5986 |
|
5987 |
+
#: seopress.php:1250
|
5988 |
msgid "Like our Facebook page"
|
5989 |
msgstr ""
|
5990 |
|
5991 |
+
#: seopress.php:1262
|
5992 |
msgid "Watch our guided tour videos to learn more about SEOPress"
|
5993 |
msgstr ""
|
5994 |
|
5995 |
+
#: seopress.php:1275
|
5996 |
msgid "Read our blog posts about SEO concepts, tutorials and more"
|
5997 |
msgstr ""
|
5998 |
|
5999 |
+
#: seopress.php:1287
|
6000 |
msgid "The off side of SEOPress"
|
6001 |
msgstr ""
|
readme.txt
CHANGED
@@ -6,7 +6,7 @@ Tags: SEO, XML sitemap, meta title, open graph, content analysis, knowledge grap
|
|
6 |
Requires at least: 4.7+
|
7 |
Tested up to: 5.5
|
8 |
Requires PHP: 5.6
|
9 |
-
Stable tag: 4.
|
10 |
License: GPLv2 or later
|
11 |
License URI: https://www.gnu.org/licenses/gpl-2.0.html
|
12 |
|
@@ -135,6 +135,16 @@ We support WooCommerce and Easy Digital Downloads for e-commerce sites.
|
|
135 |
|
136 |
<a href="https://www.seopress.org/pricing/?utm_source=w.org&utm_campaign=seopress&utm_medium=readme" target="_blank"><strong>Increase your sales now!</strong></a>
|
137 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
138 |
<h3>Developers will love SEOPress!</h3>
|
139 |
|
140 |
Hundreds of hooks are available to extend SEOPress. <a href="https://www.seopress.org/support/hooks/?utm_source=w.org&utm_campaign=seopress&utm_medium=readme" target="_blank">Browse them all here</a>!
|
@@ -288,15 +298,57 @@ You're theme is probably using a deprecated function to handle the title. <a hre
|
|
288 |
<a href="https://www.seopress.org/support/faq/" target="_blank">Read our complete FAQ on our site</a>
|
289 |
|
290 |
== Screenshots ==
|
291 |
-
1. SEOPress
|
292 |
-
2. SEOPress
|
293 |
-
3.
|
294 |
-
4. SEO metabox:
|
295 |
-
5.
|
296 |
-
6.
|
297 |
-
7.
|
|
|
298 |
|
299 |
== Changelog ==
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
300 |
= 4.0.3 =
|
301 |
* FIX Elementor CSS
|
302 |
= 4.0.2 =
|
6 |
Requires at least: 4.7+
|
7 |
Tested up to: 5.5
|
8 |
Requires PHP: 5.6
|
9 |
+
Stable tag: 4.1
|
10 |
License: GPLv2 or later
|
11 |
License URI: https://www.gnu.org/licenses/gpl-2.0.html
|
12 |
|
135 |
|
136 |
<a href="https://www.seopress.org/pricing/?utm_source=w.org&utm_campaign=seopress&utm_medium=readme" target="_blank"><strong>Increase your sales now!</strong></a>
|
137 |
|
138 |
+
<h3>Elementor + SEOPress: perfect combo!</h3>
|
139 |
+
We provide deep integration with Elementor page builder. Directly from Elementor settings, you can:
|
140 |
+
<ul>
|
141 |
+
<li>edit your SEO metadata (title, meta description, meta robots)</li>
|
142 |
+
<li>edit social meta (Facebook Open Graph and Twitter Cards</li>
|
143 |
+
<li>analyse your content to optimize it for search engines</li>
|
144 |
+
<li>apply FAQ schema on Toggle and / or Accordion Elementor widgets</li>
|
145 |
+
<li>and more!</li>
|
146 |
+
</ul>
|
147 |
+
|
148 |
<h3>Developers will love SEOPress!</h3>
|
149 |
|
150 |
Hundreds of hooks are available to extend SEOPress. <a href="https://www.seopress.org/support/hooks/?utm_source=w.org&utm_campaign=seopress&utm_medium=readme" target="_blank">Browse them all here</a>!
|
298 |
<a href="https://www.seopress.org/support/faq/" target="_blank">Read our complete FAQ on our site</a>
|
299 |
|
300 |
== Screenshots ==
|
301 |
+
1. SEOPress Elementor integration
|
302 |
+
2. SEOPress notifications center
|
303 |
+
3. SEOPress dashboard
|
304 |
+
4. SEO metabox: Titles settings
|
305 |
+
5. SEO metabox: Social tab
|
306 |
+
6. Content analysis metabox
|
307 |
+
7. SEOPress PRO
|
308 |
+
8. Installation Wizard
|
309 |
|
310 |
== Changelog ==
|
311 |
+
= 4.1 =
|
312 |
+
* NEW Add FAQ schema to Toggle / Accordion widgets with Elementor (PRO) 🎉
|
313 |
+
* NEW Dropdown for meta title / meta description to quickly add dynamic variables! 🎉
|
314 |
+
* NEW UI for adding/editing/managing target keywords 🎉
|
315 |
+
* NEW Paginated XML sitemaps for taxonomies and videos 🎉
|
316 |
+
* NEW Import term metadata from CSV file using our import tool (PRO) 🎉
|
317 |
+
* NEW Custom user capabilities for Redirections post type (edit_redirection, edit_redirections, edit_others_redirections, publish_redirections, read_redirection, read_private_redirections, delete_redirection, delete_others_redirections)
|
318 |
+
* NEW Remove noindex item from Admin Bar in backend and frontend option from SEO, Advanced page, Appearance tab
|
319 |
+
* NEW Change expiration date of the user consent cookie option from SEO, Analytics page, Cookie bar / GDPR tab
|
320 |
+
* NEW Add servesCuisine for LocalBusiness automatic schema
|
321 |
+
* NEW Delete all redirects / 404 in one click (SEO, Tools, Redirections)
|
322 |
+
* NEW Add a backdrop for user consent message (SEO, Analytics, Cookie bar / GDPR tab)
|
323 |
+
* NEW 'seopress_adminbar_noindex' hook to filter the noindex alert from WP admin bar (https://www.seopress.org/support/hooks/filter-noindex-alert-html-from-admin-bar/)
|
324 |
+
* NEW 'seopress_cookies_expiration_days' hook to filter the expiration date of the user consent cookie (https://www.seopress.org/support/hooks/filter-the-expiration-date-of-the-user-consent-cookie/)
|
325 |
+
* NEW 'seopress_sitemaps_max_terms_per_sitemap' hook to filter max terms per paginated sitemap (https://www.seopress.org/support/hooks/filter-max-terms-per-paginated-sitemap/)
|
326 |
+
* NEW 'seopress_sitemaps_max_videos_per_sitemap' hook to filter max videos per paginated sitemap (https://www.seopress.org/support/hooks/filter-max-videos-per-paginated-sitemap/)
|
327 |
+
* NEW 'seopress_sitemaps_index_video_query' hook to filter video index sitemap query (https://www.seopress.org/support/hooks/filter-video-index-sitemap-query/)
|
328 |
+
* NEW 'seopress_sitemaps_index_post_types_query' hook to filter post types query in XML sitemap (https://www.seopress.org/support/hooks/filter-custom-post-type-index-xml-sitemap-query/)
|
329 |
+
* NEW 'seopress_metadata_query_terms_args' hook to filter term query from export metadata tool (https://www.seopress.org/support/hooks/filter-the-arguments-of-the-metadata-terms-export-query/)
|
330 |
+
* INFO Improve Local Business compatibility with Elementor, Beaver builder...
|
331 |
+
* INFO Add a link to Advanced global meta robots page on noindex alert from admin bar
|
332 |
+
* INFO Improve White Label
|
333 |
+
* INFO Improve UI for automatic schemas
|
334 |
+
* INFO Remove SEOPress logo from 404 email alert
|
335 |
+
* INFO Improve notice in admin bar about global noindex / nofollow and add support for Taxonomies
|
336 |
+
* INFO Add a link to the publisher logo notice
|
337 |
+
* INFO Improved detection of social media metadata in source code for content analysis
|
338 |
+
* INFO Add Alpha option to color-picker on backgrounds for Cookie bar (SEO, Analytics, Cookie bar / GDPR tab)
|
339 |
+
* INFO Improved Performances for XML sitemaps
|
340 |
+
* INFO Refactoring hundreds lines of code
|
341 |
+
* FIX Trailing slash for rel/prev meta tag
|
342 |
+
* FIX Trailing slash for XML sitemaps
|
343 |
+
* FIX Published/modified date in automatic schemas for non-english date format
|
344 |
+
* FIX Closing notification "Your site is not visible to Search Engines!"
|
345 |
+
* FIX Conflict with Elementor
|
346 |
+
* FIX Remove AM/PM from Local Business Widget
|
347 |
+
* FIX FAQ questions counter from schema metabox
|
348 |
+
* FIX Price range LocalBusiness property with custom fields for automatic schema
|
349 |
+
* FIX Remove BuddyPress groups from Titles and settings if BuddyBoss or BuddyPress is not activated
|
350 |
+
* FIX WooCommerce XML sitemaps product attributes
|
351 |
+
* FIX Quotes with target keywords
|
352 |
= 4.0.3 =
|
353 |
* FIX Elementor CSS
|
354 |
= 4.0.2 =
|
seopress.php
CHANGED
@@ -3,7 +3,7 @@
|
|
3 |
Plugin Name: SEOPress
|
4 |
Plugin URI: https://www.seopress.org/
|
5 |
Description: One of the best SEO plugins for WordPress.
|
6 |
-
Version: 4.
|
7 |
Author: SEOPress
|
8 |
Author URI: https://www.seopress.org/
|
9 |
License: GPLv2
|
@@ -55,7 +55,7 @@ register_deactivation_hook(__FILE__, 'seopress_deactivation');
|
|
55 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
56 |
//Define
|
57 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
58 |
-
define( 'SEOPRESS_VERSION', '4.
|
59 |
define( 'SEOPRESS_AUTHOR', 'Benjamin Denis' );
|
60 |
|
61 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
@@ -251,6 +251,18 @@ function seopress_add_admin_options_scripts( $hook ) {
|
|
251 |
|
252 |
if ( 'seopress-google-analytics' === $_GET['page'] ) {
|
253 |
wp_enqueue_style( 'wp-color-picker' );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
254 |
wp_enqueue_script( 'seopress-admin-tabs-js', plugins_url( 'assets/js/seopress-tabs6' . $prefix . '.js', __FILE__ ), [ 'jquery-ui-tabs', 'wp-color-picker' ], SEOPRESS_VERSION );
|
255 |
}
|
256 |
|
@@ -772,7 +784,7 @@ if (seopress_xml_sitemap_general_enable_option() =='1' && seopress_get_toggle_op
|
|
772 |
add_rewrite_rule( '^sitemaps_xsl.xsl$', 'index.php?seopress_sitemap_xsl=1', 'top' );
|
773 |
|
774 |
//CPT / Taxonomies
|
775 |
-
$urls =
|
776 |
|
777 |
/*CPT*/
|
778 |
if (seopress_xml_sitemap_post_types_list_option() !='') {
|
3 |
Plugin Name: SEOPress
|
4 |
Plugin URI: https://www.seopress.org/
|
5 |
Description: One of the best SEO plugins for WordPress.
|
6 |
+
Version: 4.1
|
7 |
Author: SEOPress
|
8 |
Author URI: https://www.seopress.org/
|
9 |
License: GPLv2
|
55 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
56 |
//Define
|
57 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
58 |
+
define( 'SEOPRESS_VERSION', '4.1' );
|
59 |
define( 'SEOPRESS_AUTHOR', 'Benjamin Denis' );
|
60 |
|
61 |
///////////////////////////////////////////////////////////////////////////////////////////////////
|
251 |
|
252 |
if ( 'seopress-google-analytics' === $_GET['page'] ) {
|
253 |
wp_enqueue_style( 'wp-color-picker' );
|
254 |
+
|
255 |
+
wp_enqueue_script( 'wp-color-picker-alpha', plugins_url( 'assets/js/wp-color-picker-alpha.min.js', __FILE__ ), [ 'wp-color-picker' ], SEOPRESS_VERSION, true );
|
256 |
+
$color_picker_strings = [
|
257 |
+
'clear' => __( 'Clear', 'wp-seopress' ),
|
258 |
+
'clearAriaLabel' => __( 'Clear color', 'wp-seopress' ),
|
259 |
+
'defaultString' => __( 'Default', 'wp-seopress' ),
|
260 |
+
'defaultAriaLabel' => __( 'Select default color', 'wp-seopress' ),
|
261 |
+
'pick' => __( 'Select Color', 'wp-seopress' ),
|
262 |
+
'defaultLabel' => __( 'Color value', 'wp-seopress' ),
|
263 |
+
];
|
264 |
+
wp_localize_script( 'wp-color-picker-alpha', 'wpColorPickerL10n', $color_picker_strings );
|
265 |
+
|
266 |
wp_enqueue_script( 'seopress-admin-tabs-js', plugins_url( 'assets/js/seopress-tabs6' . $prefix . '.js', __FILE__ ), [ 'jquery-ui-tabs', 'wp-color-picker' ], SEOPRESS_VERSION );
|
267 |
}
|
268 |
|
784 |
add_rewrite_rule( '^sitemaps_xsl.xsl$', 'index.php?seopress_sitemap_xsl=1', 'top' );
|
785 |
|
786 |
//CPT / Taxonomies
|
787 |
+
$urls = [];
|
788 |
|
789 |
/*CPT*/
|
790 |
if (seopress_xml_sitemap_post_types_list_option() !='') {
|